diff --git a/.gitattributes b/.gitattributes
index a9dc81a83dce673d55f07c4e5a0f3437db3a0b0d..33f88b69027551ceefeccdc9bfac0d1c99c7b89a 100644
--- a/.gitattributes
+++ b/.gitattributes
@@ -333,3 +333,5 @@ tuning-competition-baseline/.venv/lib/python3.11/site-packages/nvidia/cudnn/lib/
 .venv/lib/python3.11/site-packages/sentencepiece/_sentencepiece.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
 .venv/lib/python3.11/site-packages/tiktoken/_tiktoken.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
 .venv/lib/python3.11/site-packages/cryptography/hazmat/bindings/_rust.abi3.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/pip/_vendor/chardet/__pycache__/langrussianmodel.cpython-311.pyc filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/pip/_vendor/__pycache__/typing_extensions.cpython-311.pyc filter=lfs diff=lfs merge=lfs -text
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/__pycache__/typing_extensions.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/__pycache__/typing_extensions.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..c4cf279ac7e34f8450703cb3cb978e19e1482e51
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/__pycache__/typing_extensions.cpython-311.pyc
@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:29e7cb87477c4162d4a7a5b5a446b8a0bda9b41a1d17b53e5914a80d010fd67b
+size 131577
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/chardet/__pycache__/langrussianmodel.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/chardet/__pycache__/langrussianmodel.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..4196709b1a02ea73213e1c3a7982c4b7bfe8ab41
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/chardet/__pycache__/langrussianmodel.cpython-311.pyc
@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:d33dfe3598d64cd87d0e97f91eff29005b725510660439fc64f90ef595a1b1b0
+size 108731
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__init__.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__init__.py
new file mode 100644
index 0000000000000000000000000000000000000000..73f58d7740813264d20047ffe918c82e1acc84eb
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__init__.py
@@ -0,0 +1,177 @@
+"""Rich text and beautiful formatting in the terminal."""
+
+import os
+from typing import IO, TYPE_CHECKING, Any, Callable, Optional, Union
+
+from ._extension import load_ipython_extension  # noqa: F401
+
+__all__ = ["get_console", "reconfigure", "print", "inspect", "print_json"]
+
+if TYPE_CHECKING:
+    from .console import Console
+
+# Global console used by alternative print
+_console: Optional["Console"] = None
+
+try:
+    _IMPORT_CWD = os.path.abspath(os.getcwd())
+except FileNotFoundError:
+    # Can happen if the cwd has been deleted
+    _IMPORT_CWD = ""
+
+
+def get_console() -> "Console":
+    """Get a global :class:`~rich.console.Console` instance. This function is used when Rich requires a Console,
+    and hasn't been explicitly given one.
+
+    Returns:
+        Console: A console instance.
+    """
+    global _console
+    if _console is None:
+        from .console import Console
+
+        _console = Console()
+
+    return _console
+
+
+def reconfigure(*args: Any, **kwargs: Any) -> None:
+    """Reconfigures the global console by replacing it with another.
+
+    Args:
+        *args (Any): Positional arguments for the replacement :class:`~rich.console.Console`.
+        **kwargs (Any): Keyword arguments for the replacement :class:`~rich.console.Console`.
+    """
+    from pip._vendor.rich.console import Console
+
+    new_console = Console(*args, **kwargs)
+    _console = get_console()
+    _console.__dict__ = new_console.__dict__
+
+
+def print(
+    *objects: Any,
+    sep: str = " ",
+    end: str = "\n",
+    file: Optional[IO[str]] = None,
+    flush: bool = False,
+) -> None:
+    r"""Print object(s) supplied via positional arguments.
+    This function has an identical signature to the built-in print.
+    For more advanced features, see the :class:`~rich.console.Console` class.
+
+    Args:
+        sep (str, optional): Separator between printed objects. Defaults to " ".
+        end (str, optional): Character to write at end of output. Defaults to "\\n".
+        file (IO[str], optional): File to write to, or None for stdout. Defaults to None.
+        flush (bool, optional): Has no effect as Rich always flushes output. Defaults to False.
+
+    """
+    from .console import Console
+
+    write_console = get_console() if file is None else Console(file=file)
+    return write_console.print(*objects, sep=sep, end=end)
+
+
+def print_json(
+    json: Optional[str] = None,
+    *,
+    data: Any = None,
+    indent: Union[None, int, str] = 2,
+    highlight: bool = True,
+    skip_keys: bool = False,
+    ensure_ascii: bool = False,
+    check_circular: bool = True,
+    allow_nan: bool = True,
+    default: Optional[Callable[[Any], Any]] = None,
+    sort_keys: bool = False,
+) -> None:
+    """Pretty prints JSON. Output will be valid JSON.
+
+    Args:
+        json (str): A string containing JSON.
+        data (Any): If json is not supplied, then encode this data.
+        indent (int, optional): Number of spaces to indent. Defaults to 2.
+        highlight (bool, optional): Enable highlighting of output: Defaults to True.
+        skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+        ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+        check_circular (bool, optional): Check for circular references. Defaults to True.
+        allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+        default (Callable, optional): A callable that converts values that can not be encoded
+            in to something that can be JSON encoded. Defaults to None.
+        sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+    """
+
+    get_console().print_json(
+        json,
+        data=data,
+        indent=indent,
+        highlight=highlight,
+        skip_keys=skip_keys,
+        ensure_ascii=ensure_ascii,
+        check_circular=check_circular,
+        allow_nan=allow_nan,
+        default=default,
+        sort_keys=sort_keys,
+    )
+
+
+def inspect(
+    obj: Any,
+    *,
+    console: Optional["Console"] = None,
+    title: Optional[str] = None,
+    help: bool = False,
+    methods: bool = False,
+    docs: bool = True,
+    private: bool = False,
+    dunder: bool = False,
+    sort: bool = True,
+    all: bool = False,
+    value: bool = True,
+) -> None:
+    """Inspect any Python object.
+
+    * inspect(<OBJECT>) to see summarized info.
+    * inspect(<OBJECT>, methods=True) to see methods.
+    * inspect(<OBJECT>, help=True) to see full (non-abbreviated) help.
+    * inspect(<OBJECT>, private=True) to see private attributes (single underscore).
+    * inspect(<OBJECT>, dunder=True) to see attributes beginning with double underscore.
+    * inspect(<OBJECT>, all=True) to see all attributes.
+
+    Args:
+        obj (Any): An object to inspect.
+        title (str, optional): Title to display over inspect result, or None use type. Defaults to None.
+        help (bool, optional): Show full help text rather than just first paragraph. Defaults to False.
+        methods (bool, optional): Enable inspection of callables. Defaults to False.
+        docs (bool, optional): Also render doc strings. Defaults to True.
+        private (bool, optional): Show private attributes (beginning with underscore). Defaults to False.
+        dunder (bool, optional): Show attributes starting with double underscore. Defaults to False.
+        sort (bool, optional): Sort attributes alphabetically. Defaults to True.
+        all (bool, optional): Show all attributes. Defaults to False.
+        value (bool, optional): Pretty print value. Defaults to True.
+    """
+    _console = console or get_console()
+    from pip._vendor.rich._inspect import Inspect
+
+    # Special case for inspect(inspect)
+    is_inspect = obj is inspect
+
+    _inspect = Inspect(
+        obj,
+        title=title,
+        help=is_inspect or help,
+        methods=is_inspect or methods,
+        docs=is_inspect or docs,
+        private=private,
+        dunder=dunder,
+        sort=sort,
+        all=all,
+        value=value,
+    )
+    _console.print(_inspect)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    print("Hello, **World**")
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/__main__.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/__main__.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..130d1407e3ffddd71c61a5beef2d528c4006294d
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/__main__.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..089f302510ce369f8c057e6c32fcbcd50a835a6e
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_fileno.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_fileno.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..fec3947fcd6564ce31541e5c24205832ac32eebe
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_fileno.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_inspect.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_inspect.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..c0d04e6b038fedb6af695af334e08a4aefe55a7f
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_inspect.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_log_render.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_log_render.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..48a7a488521c2d24301ea466118b580881c25461
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_log_render.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_palettes.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_palettes.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..7e2d7d8e0c517b86933ef84e1550a06368c7043f
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_palettes.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_pick.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_pick.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..97c085791d87cd7b35a5dbdbcfd678363244a823
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_pick.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_ratio.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_ratio.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..fae99497d473016682906f690454abf103a83a36
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_ratio.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_stack.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_stack.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e7e040df2f9127406959f2f9c85cf96a15aa6471
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_stack.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_windows_renderer.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_windows_renderer.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..ac24b5fa3e3c571200ba0ef2fb31013bb173ed5c
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/_windows_renderer.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/align.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/align.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..1632e6fe7ff834412609e03f208445676f98a148
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/align.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/ansi.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/ansi.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..01cd570eead9db06a4c6b6091f5c54768e7bc9e3
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/ansi.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e03657ff6cd77d6e0442e5decb538e9deb5c125d
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color_triplet.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color_triplet.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..ef039045d8f01486257719240fc63fddb66c727c
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/color_triplet.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..bc591cf0b0d4e79e80db326c16132f4370149d38
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/containers.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/containers.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..7a0e7c615e2be9279694961ac01f8c9cedfece11
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/containers.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/control.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/control.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..c01a4f5e2366673238a2edd0de194610aeea3a59
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/control.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/emoji.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/emoji.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..ba73f7e90f3ee0e7d413101cb9e8e62cd4fd4577
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/emoji.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/errors.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/errors.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e75bd0cb5b9339786004f607e6629378343447a4
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/errors.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..f527f20fc1907344c9c6007535275b3d67c9b082
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/filesize.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/filesize.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..39fa3ac22977e8baa19b3ea79b0f0894e27bd923
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/filesize.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/highlighter.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/highlighter.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..d99ebb097ca03b76cd74881e41a05d704f340a1f
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/highlighter.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/json.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/json.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..34bae43c068d9b940573e8d45eeedfc1a6c00309
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/json.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/jupyter.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/jupyter.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..fbe00caa21031d54f8b53dfcc8e6caf6a63a9e56
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/jupyter.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..569ef1835c3ab362a4f1c75e8a7192463457d1f7
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..8e4d992bae710570826d466a48950611d2e5c430
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live_render.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live_render.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..56fb63055b5b7ee80bfa174686c5fa39185d7f94
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/live_render.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/logging.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/logging.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..2fe306c5b4e4f673f7b2fc1571561304fa624297
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/logging.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/padding.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/padding.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..5690a3e0d278077ae40b1c986067216f8042500a
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/padding.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..d09cdf573f51ea860799b4f80b67b0da8b6c591a
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/progress.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/progress.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..0cf3c98976893c30b2507fe1e2a620fc4ca0e87c
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/progress.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..588e942d1fed20c0e74cce8e3e7059b0200cdacd
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/region.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/region.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..65b1de5147d9f5329e8bc2891d24701e8a21397b
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/region.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..da0411d19b17dbeb0b9b5684142c39688f680e44
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/screen.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/screen.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..35d065c3812c6a5e6d8c386cd96a762c2c374b29
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/screen.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/segment.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/segment.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..b0be0974908be78a51f137d7e3a3b731aeca68d3
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/segment.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/style.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/style.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..4174cf22f66dfca7b6257e90ab37ed143dba944e
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/style.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/syntax.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/syntax.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e1205915206c412dc41da66edbda26060a15ec25
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/syntax.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/table.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/table.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..79f08e2eadf02acf1ec33bde6dbcc598670c537b
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/table.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..baeb372b059b1b91ca8c7cf73a13d64b4e28014d
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..2a4f24489615ed25a4dd44c7639985d46171d368
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/tree.cpython-311.pyc b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/tree.cpython-311.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..0ddda7813fee12b65c9e4636e36caa356a9fd6ba
Binary files /dev/null and b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/__pycache__/tree.cpython-311.pyc differ
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_cell_widths.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_cell_widths.py
new file mode 100644
index 0000000000000000000000000000000000000000..36286df379e28ea997bea3ee1fd62cadebebbba9
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_cell_widths.py
@@ -0,0 +1,451 @@
+# Auto generated by make_terminal_widths.py
+
+CELL_WIDTHS = [
+    (0, 0, 0),
+    (1, 31, -1),
+    (127, 159, -1),
+    (768, 879, 0),
+    (1155, 1161, 0),
+    (1425, 1469, 0),
+    (1471, 1471, 0),
+    (1473, 1474, 0),
+    (1476, 1477, 0),
+    (1479, 1479, 0),
+    (1552, 1562, 0),
+    (1611, 1631, 0),
+    (1648, 1648, 0),
+    (1750, 1756, 0),
+    (1759, 1764, 0),
+    (1767, 1768, 0),
+    (1770, 1773, 0),
+    (1809, 1809, 0),
+    (1840, 1866, 0),
+    (1958, 1968, 0),
+    (2027, 2035, 0),
+    (2045, 2045, 0),
+    (2070, 2073, 0),
+    (2075, 2083, 0),
+    (2085, 2087, 0),
+    (2089, 2093, 0),
+    (2137, 2139, 0),
+    (2259, 2273, 0),
+    (2275, 2306, 0),
+    (2362, 2362, 0),
+    (2364, 2364, 0),
+    (2369, 2376, 0),
+    (2381, 2381, 0),
+    (2385, 2391, 0),
+    (2402, 2403, 0),
+    (2433, 2433, 0),
+    (2492, 2492, 0),
+    (2497, 2500, 0),
+    (2509, 2509, 0),
+    (2530, 2531, 0),
+    (2558, 2558, 0),
+    (2561, 2562, 0),
+    (2620, 2620, 0),
+    (2625, 2626, 0),
+    (2631, 2632, 0),
+    (2635, 2637, 0),
+    (2641, 2641, 0),
+    (2672, 2673, 0),
+    (2677, 2677, 0),
+    (2689, 2690, 0),
+    (2748, 2748, 0),
+    (2753, 2757, 0),
+    (2759, 2760, 0),
+    (2765, 2765, 0),
+    (2786, 2787, 0),
+    (2810, 2815, 0),
+    (2817, 2817, 0),
+    (2876, 2876, 0),
+    (2879, 2879, 0),
+    (2881, 2884, 0),
+    (2893, 2893, 0),
+    (2901, 2902, 0),
+    (2914, 2915, 0),
+    (2946, 2946, 0),
+    (3008, 3008, 0),
+    (3021, 3021, 0),
+    (3072, 3072, 0),
+    (3076, 3076, 0),
+    (3134, 3136, 0),
+    (3142, 3144, 0),
+    (3146, 3149, 0),
+    (3157, 3158, 0),
+    (3170, 3171, 0),
+    (3201, 3201, 0),
+    (3260, 3260, 0),
+    (3263, 3263, 0),
+    (3270, 3270, 0),
+    (3276, 3277, 0),
+    (3298, 3299, 0),
+    (3328, 3329, 0),
+    (3387, 3388, 0),
+    (3393, 3396, 0),
+    (3405, 3405, 0),
+    (3426, 3427, 0),
+    (3457, 3457, 0),
+    (3530, 3530, 0),
+    (3538, 3540, 0),
+    (3542, 3542, 0),
+    (3633, 3633, 0),
+    (3636, 3642, 0),
+    (3655, 3662, 0),
+    (3761, 3761, 0),
+    (3764, 3772, 0),
+    (3784, 3789, 0),
+    (3864, 3865, 0),
+    (3893, 3893, 0),
+    (3895, 3895, 0),
+    (3897, 3897, 0),
+    (3953, 3966, 0),
+    (3968, 3972, 0),
+    (3974, 3975, 0),
+    (3981, 3991, 0),
+    (3993, 4028, 0),
+    (4038, 4038, 0),
+    (4141, 4144, 0),
+    (4146, 4151, 0),
+    (4153, 4154, 0),
+    (4157, 4158, 0),
+    (4184, 4185, 0),
+    (4190, 4192, 0),
+    (4209, 4212, 0),
+    (4226, 4226, 0),
+    (4229, 4230, 0),
+    (4237, 4237, 0),
+    (4253, 4253, 0),
+    (4352, 4447, 2),
+    (4957, 4959, 0),
+    (5906, 5908, 0),
+    (5938, 5940, 0),
+    (5970, 5971, 0),
+    (6002, 6003, 0),
+    (6068, 6069, 0),
+    (6071, 6077, 0),
+    (6086, 6086, 0),
+    (6089, 6099, 0),
+    (6109, 6109, 0),
+    (6155, 6157, 0),
+    (6277, 6278, 0),
+    (6313, 6313, 0),
+    (6432, 6434, 0),
+    (6439, 6440, 0),
+    (6450, 6450, 0),
+    (6457, 6459, 0),
+    (6679, 6680, 0),
+    (6683, 6683, 0),
+    (6742, 6742, 0),
+    (6744, 6750, 0),
+    (6752, 6752, 0),
+    (6754, 6754, 0),
+    (6757, 6764, 0),
+    (6771, 6780, 0),
+    (6783, 6783, 0),
+    (6832, 6848, 0),
+    (6912, 6915, 0),
+    (6964, 6964, 0),
+    (6966, 6970, 0),
+    (6972, 6972, 0),
+    (6978, 6978, 0),
+    (7019, 7027, 0),
+    (7040, 7041, 0),
+    (7074, 7077, 0),
+    (7080, 7081, 0),
+    (7083, 7085, 0),
+    (7142, 7142, 0),
+    (7144, 7145, 0),
+    (7149, 7149, 0),
+    (7151, 7153, 0),
+    (7212, 7219, 0),
+    (7222, 7223, 0),
+    (7376, 7378, 0),
+    (7380, 7392, 0),
+    (7394, 7400, 0),
+    (7405, 7405, 0),
+    (7412, 7412, 0),
+    (7416, 7417, 0),
+    (7616, 7673, 0),
+    (7675, 7679, 0),
+    (8203, 8207, 0),
+    (8232, 8238, 0),
+    (8288, 8291, 0),
+    (8400, 8432, 0),
+    (8986, 8987, 2),
+    (9001, 9002, 2),
+    (9193, 9196, 2),
+    (9200, 9200, 2),
+    (9203, 9203, 2),
+    (9725, 9726, 2),
+    (9748, 9749, 2),
+    (9800, 9811, 2),
+    (9855, 9855, 2),
+    (9875, 9875, 2),
+    (9889, 9889, 2),
+    (9898, 9899, 2),
+    (9917, 9918, 2),
+    (9924, 9925, 2),
+    (9934, 9934, 2),
+    (9940, 9940, 2),
+    (9962, 9962, 2),
+    (9970, 9971, 2),
+    (9973, 9973, 2),
+    (9978, 9978, 2),
+    (9981, 9981, 2),
+    (9989, 9989, 2),
+    (9994, 9995, 2),
+    (10024, 10024, 2),
+    (10060, 10060, 2),
+    (10062, 10062, 2),
+    (10067, 10069, 2),
+    (10071, 10071, 2),
+    (10133, 10135, 2),
+    (10160, 10160, 2),
+    (10175, 10175, 2),
+    (11035, 11036, 2),
+    (11088, 11088, 2),
+    (11093, 11093, 2),
+    (11503, 11505, 0),
+    (11647, 11647, 0),
+    (11744, 11775, 0),
+    (11904, 11929, 2),
+    (11931, 12019, 2),
+    (12032, 12245, 2),
+    (12272, 12283, 2),
+    (12288, 12329, 2),
+    (12330, 12333, 0),
+    (12334, 12350, 2),
+    (12353, 12438, 2),
+    (12441, 12442, 0),
+    (12443, 12543, 2),
+    (12549, 12591, 2),
+    (12593, 12686, 2),
+    (12688, 12771, 2),
+    (12784, 12830, 2),
+    (12832, 12871, 2),
+    (12880, 19903, 2),
+    (19968, 42124, 2),
+    (42128, 42182, 2),
+    (42607, 42610, 0),
+    (42612, 42621, 0),
+    (42654, 42655, 0),
+    (42736, 42737, 0),
+    (43010, 43010, 0),
+    (43014, 43014, 0),
+    (43019, 43019, 0),
+    (43045, 43046, 0),
+    (43052, 43052, 0),
+    (43204, 43205, 0),
+    (43232, 43249, 0),
+    (43263, 43263, 0),
+    (43302, 43309, 0),
+    (43335, 43345, 0),
+    (43360, 43388, 2),
+    (43392, 43394, 0),
+    (43443, 43443, 0),
+    (43446, 43449, 0),
+    (43452, 43453, 0),
+    (43493, 43493, 0),
+    (43561, 43566, 0),
+    (43569, 43570, 0),
+    (43573, 43574, 0),
+    (43587, 43587, 0),
+    (43596, 43596, 0),
+    (43644, 43644, 0),
+    (43696, 43696, 0),
+    (43698, 43700, 0),
+    (43703, 43704, 0),
+    (43710, 43711, 0),
+    (43713, 43713, 0),
+    (43756, 43757, 0),
+    (43766, 43766, 0),
+    (44005, 44005, 0),
+    (44008, 44008, 0),
+    (44013, 44013, 0),
+    (44032, 55203, 2),
+    (63744, 64255, 2),
+    (64286, 64286, 0),
+    (65024, 65039, 0),
+    (65040, 65049, 2),
+    (65056, 65071, 0),
+    (65072, 65106, 2),
+    (65108, 65126, 2),
+    (65128, 65131, 2),
+    (65281, 65376, 2),
+    (65504, 65510, 2),
+    (66045, 66045, 0),
+    (66272, 66272, 0),
+    (66422, 66426, 0),
+    (68097, 68099, 0),
+    (68101, 68102, 0),
+    (68108, 68111, 0),
+    (68152, 68154, 0),
+    (68159, 68159, 0),
+    (68325, 68326, 0),
+    (68900, 68903, 0),
+    (69291, 69292, 0),
+    (69446, 69456, 0),
+    (69633, 69633, 0),
+    (69688, 69702, 0),
+    (69759, 69761, 0),
+    (69811, 69814, 0),
+    (69817, 69818, 0),
+    (69888, 69890, 0),
+    (69927, 69931, 0),
+    (69933, 69940, 0),
+    (70003, 70003, 0),
+    (70016, 70017, 0),
+    (70070, 70078, 0),
+    (70089, 70092, 0),
+    (70095, 70095, 0),
+    (70191, 70193, 0),
+    (70196, 70196, 0),
+    (70198, 70199, 0),
+    (70206, 70206, 0),
+    (70367, 70367, 0),
+    (70371, 70378, 0),
+    (70400, 70401, 0),
+    (70459, 70460, 0),
+    (70464, 70464, 0),
+    (70502, 70508, 0),
+    (70512, 70516, 0),
+    (70712, 70719, 0),
+    (70722, 70724, 0),
+    (70726, 70726, 0),
+    (70750, 70750, 0),
+    (70835, 70840, 0),
+    (70842, 70842, 0),
+    (70847, 70848, 0),
+    (70850, 70851, 0),
+    (71090, 71093, 0),
+    (71100, 71101, 0),
+    (71103, 71104, 0),
+    (71132, 71133, 0),
+    (71219, 71226, 0),
+    (71229, 71229, 0),
+    (71231, 71232, 0),
+    (71339, 71339, 0),
+    (71341, 71341, 0),
+    (71344, 71349, 0),
+    (71351, 71351, 0),
+    (71453, 71455, 0),
+    (71458, 71461, 0),
+    (71463, 71467, 0),
+    (71727, 71735, 0),
+    (71737, 71738, 0),
+    (71995, 71996, 0),
+    (71998, 71998, 0),
+    (72003, 72003, 0),
+    (72148, 72151, 0),
+    (72154, 72155, 0),
+    (72160, 72160, 0),
+    (72193, 72202, 0),
+    (72243, 72248, 0),
+    (72251, 72254, 0),
+    (72263, 72263, 0),
+    (72273, 72278, 0),
+    (72281, 72283, 0),
+    (72330, 72342, 0),
+    (72344, 72345, 0),
+    (72752, 72758, 0),
+    (72760, 72765, 0),
+    (72767, 72767, 0),
+    (72850, 72871, 0),
+    (72874, 72880, 0),
+    (72882, 72883, 0),
+    (72885, 72886, 0),
+    (73009, 73014, 0),
+    (73018, 73018, 0),
+    (73020, 73021, 0),
+    (73023, 73029, 0),
+    (73031, 73031, 0),
+    (73104, 73105, 0),
+    (73109, 73109, 0),
+    (73111, 73111, 0),
+    (73459, 73460, 0),
+    (92912, 92916, 0),
+    (92976, 92982, 0),
+    (94031, 94031, 0),
+    (94095, 94098, 0),
+    (94176, 94179, 2),
+    (94180, 94180, 0),
+    (94192, 94193, 2),
+    (94208, 100343, 2),
+    (100352, 101589, 2),
+    (101632, 101640, 2),
+    (110592, 110878, 2),
+    (110928, 110930, 2),
+    (110948, 110951, 2),
+    (110960, 111355, 2),
+    (113821, 113822, 0),
+    (119143, 119145, 0),
+    (119163, 119170, 0),
+    (119173, 119179, 0),
+    (119210, 119213, 0),
+    (119362, 119364, 0),
+    (121344, 121398, 0),
+    (121403, 121452, 0),
+    (121461, 121461, 0),
+    (121476, 121476, 0),
+    (121499, 121503, 0),
+    (121505, 121519, 0),
+    (122880, 122886, 0),
+    (122888, 122904, 0),
+    (122907, 122913, 0),
+    (122915, 122916, 0),
+    (122918, 122922, 0),
+    (123184, 123190, 0),
+    (123628, 123631, 0),
+    (125136, 125142, 0),
+    (125252, 125258, 0),
+    (126980, 126980, 2),
+    (127183, 127183, 2),
+    (127374, 127374, 2),
+    (127377, 127386, 2),
+    (127488, 127490, 2),
+    (127504, 127547, 2),
+    (127552, 127560, 2),
+    (127568, 127569, 2),
+    (127584, 127589, 2),
+    (127744, 127776, 2),
+    (127789, 127797, 2),
+    (127799, 127868, 2),
+    (127870, 127891, 2),
+    (127904, 127946, 2),
+    (127951, 127955, 2),
+    (127968, 127984, 2),
+    (127988, 127988, 2),
+    (127992, 128062, 2),
+    (128064, 128064, 2),
+    (128066, 128252, 2),
+    (128255, 128317, 2),
+    (128331, 128334, 2),
+    (128336, 128359, 2),
+    (128378, 128378, 2),
+    (128405, 128406, 2),
+    (128420, 128420, 2),
+    (128507, 128591, 2),
+    (128640, 128709, 2),
+    (128716, 128716, 2),
+    (128720, 128722, 2),
+    (128725, 128727, 2),
+    (128747, 128748, 2),
+    (128756, 128764, 2),
+    (128992, 129003, 2),
+    (129292, 129338, 2),
+    (129340, 129349, 2),
+    (129351, 129400, 2),
+    (129402, 129483, 2),
+    (129485, 129535, 2),
+    (129648, 129652, 2),
+    (129656, 129658, 2),
+    (129664, 129670, 2),
+    (129680, 129704, 2),
+    (129712, 129718, 2),
+    (129728, 129730, 2),
+    (129744, 129750, 2),
+    (131072, 196605, 2),
+    (196608, 262141, 2),
+    (917760, 917999, 0),
+]
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_codes.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_codes.py
new file mode 100644
index 0000000000000000000000000000000000000000..1f2877bb2bd520253502b1c05bb811bb0d7ef64c
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_codes.py
@@ -0,0 +1,3610 @@
+EMOJI = {
+    "1st_place_medal": "🥇",
+    "2nd_place_medal": "🥈",
+    "3rd_place_medal": "🥉",
+    "ab_button_(blood_type)": "🆎",
+    "atm_sign": "🏧",
+    "a_button_(blood_type)": "🅰",
+    "afghanistan": "🇦🇫",
+    "albania": "🇦🇱",
+    "algeria": "🇩🇿",
+    "american_samoa": "🇦🇸",
+    "andorra": "🇦🇩",
+    "angola": "🇦🇴",
+    "anguilla": "🇦🇮",
+    "antarctica": "🇦🇶",
+    "antigua_&_barbuda": "🇦🇬",
+    "aquarius": "♒",
+    "argentina": "🇦🇷",
+    "aries": "♈",
+    "armenia": "🇦🇲",
+    "aruba": "🇦🇼",
+    "ascension_island": "🇦🇨",
+    "australia": "🇦🇺",
+    "austria": "🇦🇹",
+    "azerbaijan": "🇦🇿",
+    "back_arrow": "🔙",
+    "b_button_(blood_type)": "🅱",
+    "bahamas": "🇧🇸",
+    "bahrain": "🇧🇭",
+    "bangladesh": "🇧🇩",
+    "barbados": "🇧🇧",
+    "belarus": "🇧🇾",
+    "belgium": "🇧🇪",
+    "belize": "🇧🇿",
+    "benin": "🇧🇯",
+    "bermuda": "🇧🇲",
+    "bhutan": "🇧🇹",
+    "bolivia": "🇧🇴",
+    "bosnia_&_herzegovina": "🇧🇦",
+    "botswana": "🇧🇼",
+    "bouvet_island": "🇧🇻",
+    "brazil": "🇧🇷",
+    "british_indian_ocean_territory": "🇮🇴",
+    "british_virgin_islands": "🇻🇬",
+    "brunei": "🇧🇳",
+    "bulgaria": "🇧🇬",
+    "burkina_faso": "🇧🇫",
+    "burundi": "🇧🇮",
+    "cl_button": "🆑",
+    "cool_button": "🆒",
+    "cambodia": "🇰🇭",
+    "cameroon": "🇨🇲",
+    "canada": "🇨🇦",
+    "canary_islands": "🇮🇨",
+    "cancer": "♋",
+    "cape_verde": "🇨🇻",
+    "capricorn": "♑",
+    "caribbean_netherlands": "🇧🇶",
+    "cayman_islands": "🇰🇾",
+    "central_african_republic": "🇨🇫",
+    "ceuta_&_melilla": "🇪🇦",
+    "chad": "🇹🇩",
+    "chile": "🇨🇱",
+    "china": "🇨🇳",
+    "christmas_island": "🇨🇽",
+    "christmas_tree": "🎄",
+    "clipperton_island": "🇨🇵",
+    "cocos_(keeling)_islands": "🇨🇨",
+    "colombia": "🇨🇴",
+    "comoros": "🇰🇲",
+    "congo_-_brazzaville": "🇨🇬",
+    "congo_-_kinshasa": "🇨🇩",
+    "cook_islands": "🇨🇰",
+    "costa_rica": "🇨🇷",
+    "croatia": "🇭🇷",
+    "cuba": "🇨🇺",
+    "curaçao": "🇨🇼",
+    "cyprus": "🇨🇾",
+    "czechia": "🇨🇿",
+    "côte_d’ivoire": "🇨🇮",
+    "denmark": "🇩🇰",
+    "diego_garcia": "🇩🇬",
+    "djibouti": "🇩🇯",
+    "dominica": "🇩🇲",
+    "dominican_republic": "🇩🇴",
+    "end_arrow": "🔚",
+    "ecuador": "🇪🇨",
+    "egypt": "🇪🇬",
+    "el_salvador": "🇸🇻",
+    "england": "🏴\U000e0067\U000e0062\U000e0065\U000e006e\U000e0067\U000e007f",
+    "equatorial_guinea": "🇬🇶",
+    "eritrea": "🇪🇷",
+    "estonia": "🇪🇪",
+    "ethiopia": "🇪🇹",
+    "european_union": "🇪🇺",
+    "free_button": "🆓",
+    "falkland_islands": "🇫🇰",
+    "faroe_islands": "🇫🇴",
+    "fiji": "🇫🇯",
+    "finland": "🇫🇮",
+    "france": "🇫🇷",
+    "french_guiana": "🇬🇫",
+    "french_polynesia": "🇵🇫",
+    "french_southern_territories": "🇹🇫",
+    "gabon": "🇬🇦",
+    "gambia": "🇬🇲",
+    "gemini": "♊",
+    "georgia": "🇬🇪",
+    "germany": "🇩🇪",
+    "ghana": "🇬🇭",
+    "gibraltar": "🇬🇮",
+    "greece": "🇬🇷",
+    "greenland": "🇬🇱",
+    "grenada": "🇬🇩",
+    "guadeloupe": "🇬🇵",
+    "guam": "🇬🇺",
+    "guatemala": "🇬🇹",
+    "guernsey": "🇬🇬",
+    "guinea": "🇬🇳",
+    "guinea-bissau": "🇬🇼",
+    "guyana": "🇬🇾",
+    "haiti": "🇭🇹",
+    "heard_&_mcdonald_islands": "🇭🇲",
+    "honduras": "🇭🇳",
+    "hong_kong_sar_china": "🇭🇰",
+    "hungary": "🇭🇺",
+    "id_button": "🆔",
+    "iceland": "🇮🇸",
+    "india": "🇮🇳",
+    "indonesia": "🇮🇩",
+    "iran": "🇮🇷",
+    "iraq": "🇮🇶",
+    "ireland": "🇮🇪",
+    "isle_of_man": "🇮🇲",
+    "israel": "🇮🇱",
+    "italy": "🇮🇹",
+    "jamaica": "🇯🇲",
+    "japan": "🗾",
+    "japanese_acceptable_button": "🉑",
+    "japanese_application_button": "🈸",
+    "japanese_bargain_button": "🉐",
+    "japanese_castle": "🏯",
+    "japanese_congratulations_button": "㊗",
+    "japanese_discount_button": "🈹",
+    "japanese_dolls": "🎎",
+    "japanese_free_of_charge_button": "🈚",
+    "japanese_here_button": "🈁",
+    "japanese_monthly_amount_button": "🈷",
+    "japanese_no_vacancy_button": "🈵",
+    "japanese_not_free_of_charge_button": "🈶",
+    "japanese_open_for_business_button": "🈺",
+    "japanese_passing_grade_button": "🈴",
+    "japanese_post_office": "🏣",
+    "japanese_prohibited_button": "🈲",
+    "japanese_reserved_button": "🈯",
+    "japanese_secret_button": "㊙",
+    "japanese_service_charge_button": "🈂",
+    "japanese_symbol_for_beginner": "🔰",
+    "japanese_vacancy_button": "🈳",
+    "jersey": "🇯🇪",
+    "jordan": "🇯🇴",
+    "kazakhstan": "🇰🇿",
+    "kenya": "🇰🇪",
+    "kiribati": "🇰🇮",
+    "kosovo": "🇽🇰",
+    "kuwait": "🇰🇼",
+    "kyrgyzstan": "🇰🇬",
+    "laos": "🇱🇦",
+    "latvia": "🇱🇻",
+    "lebanon": "🇱🇧",
+    "leo": "♌",
+    "lesotho": "🇱🇸",
+    "liberia": "🇱🇷",
+    "libra": "♎",
+    "libya": "🇱🇾",
+    "liechtenstein": "🇱🇮",
+    "lithuania": "🇱🇹",
+    "luxembourg": "🇱🇺",
+    "macau_sar_china": "🇲🇴",
+    "macedonia": "🇲🇰",
+    "madagascar": "🇲🇬",
+    "malawi": "🇲🇼",
+    "malaysia": "🇲🇾",
+    "maldives": "🇲🇻",
+    "mali": "🇲🇱",
+    "malta": "🇲🇹",
+    "marshall_islands": "🇲🇭",
+    "martinique": "🇲🇶",
+    "mauritania": "🇲🇷",
+    "mauritius": "🇲🇺",
+    "mayotte": "🇾🇹",
+    "mexico": "🇲🇽",
+    "micronesia": "🇫🇲",
+    "moldova": "🇲🇩",
+    "monaco": "🇲🇨",
+    "mongolia": "🇲🇳",
+    "montenegro": "🇲🇪",
+    "montserrat": "🇲🇸",
+    "morocco": "🇲🇦",
+    "mozambique": "🇲🇿",
+    "mrs._claus": "🤶",
+    "mrs._claus_dark_skin_tone": "🤶🏿",
+    "mrs._claus_light_skin_tone": "🤶🏻",
+    "mrs._claus_medium-dark_skin_tone": "🤶🏾",
+    "mrs._claus_medium-light_skin_tone": "🤶🏼",
+    "mrs._claus_medium_skin_tone": "🤶🏽",
+    "myanmar_(burma)": "🇲🇲",
+    "new_button": "🆕",
+    "ng_button": "🆖",
+    "namibia": "🇳🇦",
+    "nauru": "🇳🇷",
+    "nepal": "🇳🇵",
+    "netherlands": "🇳🇱",
+    "new_caledonia": "🇳🇨",
+    "new_zealand": "🇳🇿",
+    "nicaragua": "🇳🇮",
+    "niger": "🇳🇪",
+    "nigeria": "🇳🇬",
+    "niue": "🇳🇺",
+    "norfolk_island": "🇳🇫",
+    "north_korea": "🇰🇵",
+    "northern_mariana_islands": "🇲🇵",
+    "norway": "🇳🇴",
+    "ok_button": "🆗",
+    "ok_hand": "👌",
+    "ok_hand_dark_skin_tone": "👌🏿",
+    "ok_hand_light_skin_tone": "👌🏻",
+    "ok_hand_medium-dark_skin_tone": "👌🏾",
+    "ok_hand_medium-light_skin_tone": "👌🏼",
+    "ok_hand_medium_skin_tone": "👌🏽",
+    "on!_arrow": "🔛",
+    "o_button_(blood_type)": "🅾",
+    "oman": "🇴🇲",
+    "ophiuchus": "⛎",
+    "p_button": "🅿",
+    "pakistan": "🇵🇰",
+    "palau": "🇵🇼",
+    "palestinian_territories": "🇵🇸",
+    "panama": "🇵🇦",
+    "papua_new_guinea": "🇵🇬",
+    "paraguay": "🇵🇾",
+    "peru": "🇵🇪",
+    "philippines": "🇵🇭",
+    "pisces": "♓",
+    "pitcairn_islands": "🇵🇳",
+    "poland": "🇵🇱",
+    "portugal": "🇵🇹",
+    "puerto_rico": "🇵🇷",
+    "qatar": "🇶🇦",
+    "romania": "🇷🇴",
+    "russia": "🇷🇺",
+    "rwanda": "🇷🇼",
+    "réunion": "🇷🇪",
+    "soon_arrow": "🔜",
+    "sos_button": "🆘",
+    "sagittarius": "♐",
+    "samoa": "🇼🇸",
+    "san_marino": "🇸🇲",
+    "santa_claus": "🎅",
+    "santa_claus_dark_skin_tone": "🎅🏿",
+    "santa_claus_light_skin_tone": "🎅🏻",
+    "santa_claus_medium-dark_skin_tone": "🎅🏾",
+    "santa_claus_medium-light_skin_tone": "🎅🏼",
+    "santa_claus_medium_skin_tone": "🎅🏽",
+    "saudi_arabia": "🇸🇦",
+    "scorpio": "♏",
+    "scotland": "🏴\U000e0067\U000e0062\U000e0073\U000e0063\U000e0074\U000e007f",
+    "senegal": "🇸🇳",
+    "serbia": "🇷🇸",
+    "seychelles": "🇸🇨",
+    "sierra_leone": "🇸🇱",
+    "singapore": "🇸🇬",
+    "sint_maarten": "🇸🇽",
+    "slovakia": "🇸🇰",
+    "slovenia": "🇸🇮",
+    "solomon_islands": "🇸🇧",
+    "somalia": "🇸🇴",
+    "south_africa": "🇿🇦",
+    "south_georgia_&_south_sandwich_islands": "🇬🇸",
+    "south_korea": "🇰🇷",
+    "south_sudan": "🇸🇸",
+    "spain": "🇪🇸",
+    "sri_lanka": "🇱🇰",
+    "st._barthélemy": "🇧🇱",
+    "st._helena": "🇸🇭",
+    "st._kitts_&_nevis": "🇰🇳",
+    "st._lucia": "🇱🇨",
+    "st._martin": "🇲🇫",
+    "st._pierre_&_miquelon": "🇵🇲",
+    "st._vincent_&_grenadines": "🇻🇨",
+    "statue_of_liberty": "🗽",
+    "sudan": "🇸🇩",
+    "suriname": "🇸🇷",
+    "svalbard_&_jan_mayen": "🇸🇯",
+    "swaziland": "🇸🇿",
+    "sweden": "🇸🇪",
+    "switzerland": "🇨🇭",
+    "syria": "🇸🇾",
+    "são_tomé_&_príncipe": "🇸🇹",
+    "t-rex": "🦖",
+    "top_arrow": "🔝",
+    "taiwan": "🇹🇼",
+    "tajikistan": "🇹🇯",
+    "tanzania": "🇹🇿",
+    "taurus": "♉",
+    "thailand": "🇹🇭",
+    "timor-leste": "🇹🇱",
+    "togo": "🇹🇬",
+    "tokelau": "🇹🇰",
+    "tokyo_tower": "🗼",
+    "tonga": "🇹🇴",
+    "trinidad_&_tobago": "🇹🇹",
+    "tristan_da_cunha": "🇹🇦",
+    "tunisia": "🇹🇳",
+    "turkey": "🦃",
+    "turkmenistan": "🇹🇲",
+    "turks_&_caicos_islands": "🇹🇨",
+    "tuvalu": "🇹🇻",
+    "u.s._outlying_islands": "🇺🇲",
+    "u.s._virgin_islands": "🇻🇮",
+    "up!_button": "🆙",
+    "uganda": "🇺🇬",
+    "ukraine": "🇺🇦",
+    "united_arab_emirates": "🇦🇪",
+    "united_kingdom": "🇬🇧",
+    "united_nations": "🇺🇳",
+    "united_states": "🇺🇸",
+    "uruguay": "🇺🇾",
+    "uzbekistan": "🇺🇿",
+    "vs_button": "🆚",
+    "vanuatu": "🇻🇺",
+    "vatican_city": "🇻🇦",
+    "venezuela": "🇻🇪",
+    "vietnam": "🇻🇳",
+    "virgo": "♍",
+    "wales": "🏴\U000e0067\U000e0062\U000e0077\U000e006c\U000e0073\U000e007f",
+    "wallis_&_futuna": "🇼🇫",
+    "western_sahara": "🇪🇭",
+    "yemen": "🇾🇪",
+    "zambia": "🇿🇲",
+    "zimbabwe": "🇿🇼",
+    "abacus": "🧮",
+    "adhesive_bandage": "🩹",
+    "admission_tickets": "🎟",
+    "adult": "🧑",
+    "adult_dark_skin_tone": "🧑🏿",
+    "adult_light_skin_tone": "🧑🏻",
+    "adult_medium-dark_skin_tone": "🧑🏾",
+    "adult_medium-light_skin_tone": "🧑🏼",
+    "adult_medium_skin_tone": "🧑🏽",
+    "aerial_tramway": "🚡",
+    "airplane": "✈",
+    "airplane_arrival": "🛬",
+    "airplane_departure": "🛫",
+    "alarm_clock": "⏰",
+    "alembic": "⚗",
+    "alien": "👽",
+    "alien_monster": "👾",
+    "ambulance": "🚑",
+    "american_football": "🏈",
+    "amphora": "🏺",
+    "anchor": "⚓",
+    "anger_symbol": "💢",
+    "angry_face": "😠",
+    "angry_face_with_horns": "👿",
+    "anguished_face": "😧",
+    "ant": "🐜",
+    "antenna_bars": "📶",
+    "anxious_face_with_sweat": "😰",
+    "articulated_lorry": "🚛",
+    "artist_palette": "🎨",
+    "astonished_face": "😲",
+    "atom_symbol": "⚛",
+    "auto_rickshaw": "🛺",
+    "automobile": "🚗",
+    "avocado": "🥑",
+    "axe": "🪓",
+    "baby": "👶",
+    "baby_angel": "👼",
+    "baby_angel_dark_skin_tone": "👼🏿",
+    "baby_angel_light_skin_tone": "👼🏻",
+    "baby_angel_medium-dark_skin_tone": "👼🏾",
+    "baby_angel_medium-light_skin_tone": "👼🏼",
+    "baby_angel_medium_skin_tone": "👼🏽",
+    "baby_bottle": "🍼",
+    "baby_chick": "🐤",
+    "baby_dark_skin_tone": "👶🏿",
+    "baby_light_skin_tone": "👶🏻",
+    "baby_medium-dark_skin_tone": "👶🏾",
+    "baby_medium-light_skin_tone": "👶🏼",
+    "baby_medium_skin_tone": "👶🏽",
+    "baby_symbol": "🚼",
+    "backhand_index_pointing_down": "👇",
+    "backhand_index_pointing_down_dark_skin_tone": "👇🏿",
+    "backhand_index_pointing_down_light_skin_tone": "👇🏻",
+    "backhand_index_pointing_down_medium-dark_skin_tone": "👇🏾",
+    "backhand_index_pointing_down_medium-light_skin_tone": "👇🏼",
+    "backhand_index_pointing_down_medium_skin_tone": "👇🏽",
+    "backhand_index_pointing_left": "👈",
+    "backhand_index_pointing_left_dark_skin_tone": "👈🏿",
+    "backhand_index_pointing_left_light_skin_tone": "👈🏻",
+    "backhand_index_pointing_left_medium-dark_skin_tone": "👈🏾",
+    "backhand_index_pointing_left_medium-light_skin_tone": "👈🏼",
+    "backhand_index_pointing_left_medium_skin_tone": "👈🏽",
+    "backhand_index_pointing_right": "👉",
+    "backhand_index_pointing_right_dark_skin_tone": "👉🏿",
+    "backhand_index_pointing_right_light_skin_tone": "👉🏻",
+    "backhand_index_pointing_right_medium-dark_skin_tone": "👉🏾",
+    "backhand_index_pointing_right_medium-light_skin_tone": "👉🏼",
+    "backhand_index_pointing_right_medium_skin_tone": "👉🏽",
+    "backhand_index_pointing_up": "👆",
+    "backhand_index_pointing_up_dark_skin_tone": "👆🏿",
+    "backhand_index_pointing_up_light_skin_tone": "👆🏻",
+    "backhand_index_pointing_up_medium-dark_skin_tone": "👆🏾",
+    "backhand_index_pointing_up_medium-light_skin_tone": "👆🏼",
+    "backhand_index_pointing_up_medium_skin_tone": "👆🏽",
+    "bacon": "🥓",
+    "badger": "🦡",
+    "badminton": "🏸",
+    "bagel": "🥯",
+    "baggage_claim": "🛄",
+    "baguette_bread": "🥖",
+    "balance_scale": "⚖",
+    "bald": "🦲",
+    "bald_man": "👨\u200d🦲",
+    "bald_woman": "👩\u200d🦲",
+    "ballet_shoes": "🩰",
+    "balloon": "🎈",
+    "ballot_box_with_ballot": "🗳",
+    "ballot_box_with_check": "☑",
+    "banana": "🍌",
+    "banjo": "🪕",
+    "bank": "🏦",
+    "bar_chart": "📊",
+    "barber_pole": "💈",
+    "baseball": "⚾",
+    "basket": "🧺",
+    "basketball": "🏀",
+    "bat": "🦇",
+    "bathtub": "🛁",
+    "battery": "🔋",
+    "beach_with_umbrella": "🏖",
+    "beaming_face_with_smiling_eyes": "😁",
+    "bear_face": "🐻",
+    "bearded_person": "🧔",
+    "bearded_person_dark_skin_tone": "🧔🏿",
+    "bearded_person_light_skin_tone": "🧔🏻",
+    "bearded_person_medium-dark_skin_tone": "🧔🏾",
+    "bearded_person_medium-light_skin_tone": "🧔🏼",
+    "bearded_person_medium_skin_tone": "🧔🏽",
+    "beating_heart": "💓",
+    "bed": "🛏",
+    "beer_mug": "🍺",
+    "bell": "🔔",
+    "bell_with_slash": "🔕",
+    "bellhop_bell": "🛎",
+    "bento_box": "🍱",
+    "beverage_box": "🧃",
+    "bicycle": "🚲",
+    "bikini": "👙",
+    "billed_cap": "🧢",
+    "biohazard": "☣",
+    "bird": "🐦",
+    "birthday_cake": "🎂",
+    "black_circle": "⚫",
+    "black_flag": "🏴",
+    "black_heart": "🖤",
+    "black_large_square": "⬛",
+    "black_medium-small_square": "◾",
+    "black_medium_square": "◼",
+    "black_nib": "✒",
+    "black_small_square": "▪",
+    "black_square_button": "🔲",
+    "blond-haired_man": "👱\u200d♂️",
+    "blond-haired_man_dark_skin_tone": "👱🏿\u200d♂️",
+    "blond-haired_man_light_skin_tone": "👱🏻\u200d♂️",
+    "blond-haired_man_medium-dark_skin_tone": "👱🏾\u200d♂️",
+    "blond-haired_man_medium-light_skin_tone": "👱🏼\u200d♂️",
+    "blond-haired_man_medium_skin_tone": "👱🏽\u200d♂️",
+    "blond-haired_person": "👱",
+    "blond-haired_person_dark_skin_tone": "👱🏿",
+    "blond-haired_person_light_skin_tone": "👱🏻",
+    "blond-haired_person_medium-dark_skin_tone": "👱🏾",
+    "blond-haired_person_medium-light_skin_tone": "👱🏼",
+    "blond-haired_person_medium_skin_tone": "👱🏽",
+    "blond-haired_woman": "👱\u200d♀️",
+    "blond-haired_woman_dark_skin_tone": "👱🏿\u200d♀️",
+    "blond-haired_woman_light_skin_tone": "👱🏻\u200d♀️",
+    "blond-haired_woman_medium-dark_skin_tone": "👱🏾\u200d♀️",
+    "blond-haired_woman_medium-light_skin_tone": "👱🏼\u200d♀️",
+    "blond-haired_woman_medium_skin_tone": "👱🏽\u200d♀️",
+    "blossom": "🌼",
+    "blowfish": "🐡",
+    "blue_book": "📘",
+    "blue_circle": "🔵",
+    "blue_heart": "💙",
+    "blue_square": "🟦",
+    "boar": "🐗",
+    "bomb": "💣",
+    "bone": "🦴",
+    "bookmark": "🔖",
+    "bookmark_tabs": "📑",
+    "books": "📚",
+    "bottle_with_popping_cork": "🍾",
+    "bouquet": "💐",
+    "bow_and_arrow": "🏹",
+    "bowl_with_spoon": "🥣",
+    "bowling": "🎳",
+    "boxing_glove": "🥊",
+    "boy": "👦",
+    "boy_dark_skin_tone": "👦🏿",
+    "boy_light_skin_tone": "👦🏻",
+    "boy_medium-dark_skin_tone": "👦🏾",
+    "boy_medium-light_skin_tone": "👦🏼",
+    "boy_medium_skin_tone": "👦🏽",
+    "brain": "🧠",
+    "bread": "🍞",
+    "breast-feeding": "🤱",
+    "breast-feeding_dark_skin_tone": "🤱🏿",
+    "breast-feeding_light_skin_tone": "🤱🏻",
+    "breast-feeding_medium-dark_skin_tone": "🤱🏾",
+    "breast-feeding_medium-light_skin_tone": "🤱🏼",
+    "breast-feeding_medium_skin_tone": "🤱🏽",
+    "brick": "🧱",
+    "bride_with_veil": "👰",
+    "bride_with_veil_dark_skin_tone": "👰🏿",
+    "bride_with_veil_light_skin_tone": "👰🏻",
+    "bride_with_veil_medium-dark_skin_tone": "👰🏾",
+    "bride_with_veil_medium-light_skin_tone": "👰🏼",
+    "bride_with_veil_medium_skin_tone": "👰🏽",
+    "bridge_at_night": "🌉",
+    "briefcase": "💼",
+    "briefs": "🩲",
+    "bright_button": "🔆",
+    "broccoli": "🥦",
+    "broken_heart": "💔",
+    "broom": "🧹",
+    "brown_circle": "🟤",
+    "brown_heart": "🤎",
+    "brown_square": "🟫",
+    "bug": "🐛",
+    "building_construction": "🏗",
+    "bullet_train": "🚅",
+    "burrito": "🌯",
+    "bus": "🚌",
+    "bus_stop": "🚏",
+    "bust_in_silhouette": "👤",
+    "busts_in_silhouette": "👥",
+    "butter": "🧈",
+    "butterfly": "🦋",
+    "cactus": "🌵",
+    "calendar": "📆",
+    "call_me_hand": "🤙",
+    "call_me_hand_dark_skin_tone": "🤙🏿",
+    "call_me_hand_light_skin_tone": "🤙🏻",
+    "call_me_hand_medium-dark_skin_tone": "🤙🏾",
+    "call_me_hand_medium-light_skin_tone": "🤙🏼",
+    "call_me_hand_medium_skin_tone": "🤙🏽",
+    "camel": "🐫",
+    "camera": "📷",
+    "camera_with_flash": "📸",
+    "camping": "🏕",
+    "candle": "🕯",
+    "candy": "🍬",
+    "canned_food": "🥫",
+    "canoe": "🛶",
+    "card_file_box": "🗃",
+    "card_index": "📇",
+    "card_index_dividers": "🗂",
+    "carousel_horse": "🎠",
+    "carp_streamer": "🎏",
+    "carrot": "🥕",
+    "castle": "🏰",
+    "cat": "🐱",
+    "cat_face": "🐱",
+    "cat_face_with_tears_of_joy": "😹",
+    "cat_face_with_wry_smile": "😼",
+    "chains": "⛓",
+    "chair": "🪑",
+    "chart_decreasing": "📉",
+    "chart_increasing": "📈",
+    "chart_increasing_with_yen": "💹",
+    "cheese_wedge": "🧀",
+    "chequered_flag": "🏁",
+    "cherries": "🍒",
+    "cherry_blossom": "🌸",
+    "chess_pawn": "♟",
+    "chestnut": "🌰",
+    "chicken": "🐔",
+    "child": "🧒",
+    "child_dark_skin_tone": "🧒🏿",
+    "child_light_skin_tone": "🧒🏻",
+    "child_medium-dark_skin_tone": "🧒🏾",
+    "child_medium-light_skin_tone": "🧒🏼",
+    "child_medium_skin_tone": "🧒🏽",
+    "children_crossing": "🚸",
+    "chipmunk": "🐿",
+    "chocolate_bar": "🍫",
+    "chopsticks": "🥢",
+    "church": "⛪",
+    "cigarette": "🚬",
+    "cinema": "🎦",
+    "circled_m": "Ⓜ",
+    "circus_tent": "🎪",
+    "cityscape": "🏙",
+    "cityscape_at_dusk": "🌆",
+    "clamp": "🗜",
+    "clapper_board": "🎬",
+    "clapping_hands": "👏",
+    "clapping_hands_dark_skin_tone": "👏🏿",
+    "clapping_hands_light_skin_tone": "👏🏻",
+    "clapping_hands_medium-dark_skin_tone": "👏🏾",
+    "clapping_hands_medium-light_skin_tone": "👏🏼",
+    "clapping_hands_medium_skin_tone": "👏🏽",
+    "classical_building": "🏛",
+    "clinking_beer_mugs": "🍻",
+    "clinking_glasses": "🥂",
+    "clipboard": "📋",
+    "clockwise_vertical_arrows": "🔃",
+    "closed_book": "📕",
+    "closed_mailbox_with_lowered_flag": "📪",
+    "closed_mailbox_with_raised_flag": "📫",
+    "closed_umbrella": "🌂",
+    "cloud": "☁",
+    "cloud_with_lightning": "🌩",
+    "cloud_with_lightning_and_rain": "⛈",
+    "cloud_with_rain": "🌧",
+    "cloud_with_snow": "🌨",
+    "clown_face": "🤡",
+    "club_suit": "♣",
+    "clutch_bag": "👝",
+    "coat": "🧥",
+    "cocktail_glass": "🍸",
+    "coconut": "🥥",
+    "coffin": "⚰",
+    "cold_face": "🥶",
+    "collision": "💥",
+    "comet": "☄",
+    "compass": "🧭",
+    "computer_disk": "💽",
+    "computer_mouse": "🖱",
+    "confetti_ball": "🎊",
+    "confounded_face": "😖",
+    "confused_face": "😕",
+    "construction": "🚧",
+    "construction_worker": "👷",
+    "construction_worker_dark_skin_tone": "👷🏿",
+    "construction_worker_light_skin_tone": "👷🏻",
+    "construction_worker_medium-dark_skin_tone": "👷🏾",
+    "construction_worker_medium-light_skin_tone": "👷🏼",
+    "construction_worker_medium_skin_tone": "👷🏽",
+    "control_knobs": "🎛",
+    "convenience_store": "🏪",
+    "cooked_rice": "🍚",
+    "cookie": "🍪",
+    "cooking": "🍳",
+    "copyright": "©",
+    "couch_and_lamp": "🛋",
+    "counterclockwise_arrows_button": "🔄",
+    "couple_with_heart": "💑",
+    "couple_with_heart_man_man": "👨\u200d❤️\u200d👨",
+    "couple_with_heart_woman_man": "👩\u200d❤️\u200d👨",
+    "couple_with_heart_woman_woman": "👩\u200d❤️\u200d👩",
+    "cow": "🐮",
+    "cow_face": "🐮",
+    "cowboy_hat_face": "🤠",
+    "crab": "🦀",
+    "crayon": "🖍",
+    "credit_card": "💳",
+    "crescent_moon": "🌙",
+    "cricket": "🦗",
+    "cricket_game": "🏏",
+    "crocodile": "🐊",
+    "croissant": "🥐",
+    "cross_mark": "❌",
+    "cross_mark_button": "❎",
+    "crossed_fingers": "🤞",
+    "crossed_fingers_dark_skin_tone": "🤞🏿",
+    "crossed_fingers_light_skin_tone": "🤞🏻",
+    "crossed_fingers_medium-dark_skin_tone": "🤞🏾",
+    "crossed_fingers_medium-light_skin_tone": "🤞🏼",
+    "crossed_fingers_medium_skin_tone": "🤞🏽",
+    "crossed_flags": "🎌",
+    "crossed_swords": "⚔",
+    "crown": "👑",
+    "crying_cat_face": "😿",
+    "crying_face": "😢",
+    "crystal_ball": "🔮",
+    "cucumber": "🥒",
+    "cupcake": "🧁",
+    "cup_with_straw": "🥤",
+    "curling_stone": "🥌",
+    "curly_hair": "🦱",
+    "curly-haired_man": "👨\u200d🦱",
+    "curly-haired_woman": "👩\u200d🦱",
+    "curly_loop": "➰",
+    "currency_exchange": "💱",
+    "curry_rice": "🍛",
+    "custard": "🍮",
+    "customs": "🛃",
+    "cut_of_meat": "🥩",
+    "cyclone": "🌀",
+    "dagger": "🗡",
+    "dango": "🍡",
+    "dashing_away": "💨",
+    "deaf_person": "🧏",
+    "deciduous_tree": "🌳",
+    "deer": "🦌",
+    "delivery_truck": "🚚",
+    "department_store": "🏬",
+    "derelict_house": "🏚",
+    "desert": "🏜",
+    "desert_island": "🏝",
+    "desktop_computer": "🖥",
+    "detective": "🕵",
+    "detective_dark_skin_tone": "🕵🏿",
+    "detective_light_skin_tone": "🕵🏻",
+    "detective_medium-dark_skin_tone": "🕵🏾",
+    "detective_medium-light_skin_tone": "🕵🏼",
+    "detective_medium_skin_tone": "🕵🏽",
+    "diamond_suit": "♦",
+    "diamond_with_a_dot": "💠",
+    "dim_button": "🔅",
+    "direct_hit": "🎯",
+    "disappointed_face": "😞",
+    "diving_mask": "🤿",
+    "diya_lamp": "🪔",
+    "dizzy": "💫",
+    "dizzy_face": "😵",
+    "dna": "🧬",
+    "dog": "🐶",
+    "dog_face": "🐶",
+    "dollar_banknote": "💵",
+    "dolphin": "🐬",
+    "door": "🚪",
+    "dotted_six-pointed_star": "🔯",
+    "double_curly_loop": "➿",
+    "double_exclamation_mark": "‼",
+    "doughnut": "🍩",
+    "dove": "🕊",
+    "down-left_arrow": "↙",
+    "down-right_arrow": "↘",
+    "down_arrow": "⬇",
+    "downcast_face_with_sweat": "😓",
+    "downwards_button": "🔽",
+    "dragon": "🐉",
+    "dragon_face": "🐲",
+    "dress": "👗",
+    "drooling_face": "🤤",
+    "drop_of_blood": "🩸",
+    "droplet": "💧",
+    "drum": "🥁",
+    "duck": "🦆",
+    "dumpling": "🥟",
+    "dvd": "📀",
+    "e-mail": "📧",
+    "eagle": "🦅",
+    "ear": "👂",
+    "ear_dark_skin_tone": "👂🏿",
+    "ear_light_skin_tone": "👂🏻",
+    "ear_medium-dark_skin_tone": "👂🏾",
+    "ear_medium-light_skin_tone": "👂🏼",
+    "ear_medium_skin_tone": "👂🏽",
+    "ear_of_corn": "🌽",
+    "ear_with_hearing_aid": "🦻",
+    "egg": "🍳",
+    "eggplant": "🍆",
+    "eight-pointed_star": "✴",
+    "eight-spoked_asterisk": "✳",
+    "eight-thirty": "🕣",
+    "eight_o’clock": "🕗",
+    "eject_button": "⏏",
+    "electric_plug": "🔌",
+    "elephant": "🐘",
+    "eleven-thirty": "🕦",
+    "eleven_o’clock": "🕚",
+    "elf": "🧝",
+    "elf_dark_skin_tone": "🧝🏿",
+    "elf_light_skin_tone": "🧝🏻",
+    "elf_medium-dark_skin_tone": "🧝🏾",
+    "elf_medium-light_skin_tone": "🧝🏼",
+    "elf_medium_skin_tone": "🧝🏽",
+    "envelope": "✉",
+    "envelope_with_arrow": "📩",
+    "euro_banknote": "💶",
+    "evergreen_tree": "🌲",
+    "ewe": "🐑",
+    "exclamation_mark": "❗",
+    "exclamation_question_mark": "⁉",
+    "exploding_head": "🤯",
+    "expressionless_face": "😑",
+    "eye": "👁",
+    "eye_in_speech_bubble": "👁️\u200d🗨️",
+    "eyes": "👀",
+    "face_blowing_a_kiss": "😘",
+    "face_savoring_food": "😋",
+    "face_screaming_in_fear": "😱",
+    "face_vomiting": "🤮",
+    "face_with_hand_over_mouth": "🤭",
+    "face_with_head-bandage": "🤕",
+    "face_with_medical_mask": "😷",
+    "face_with_monocle": "🧐",
+    "face_with_open_mouth": "😮",
+    "face_with_raised_eyebrow": "🤨",
+    "face_with_rolling_eyes": "🙄",
+    "face_with_steam_from_nose": "😤",
+    "face_with_symbols_on_mouth": "🤬",
+    "face_with_tears_of_joy": "😂",
+    "face_with_thermometer": "🤒",
+    "face_with_tongue": "😛",
+    "face_without_mouth": "😶",
+    "factory": "🏭",
+    "fairy": "🧚",
+    "fairy_dark_skin_tone": "🧚🏿",
+    "fairy_light_skin_tone": "🧚🏻",
+    "fairy_medium-dark_skin_tone": "🧚🏾",
+    "fairy_medium-light_skin_tone": "🧚🏼",
+    "fairy_medium_skin_tone": "🧚🏽",
+    "falafel": "🧆",
+    "fallen_leaf": "🍂",
+    "family": "👪",
+    "family_man_boy": "👨\u200d👦",
+    "family_man_boy_boy": "👨\u200d👦\u200d👦",
+    "family_man_girl": "👨\u200d👧",
+    "family_man_girl_boy": "👨\u200d👧\u200d👦",
+    "family_man_girl_girl": "👨\u200d👧\u200d👧",
+    "family_man_man_boy": "👨\u200d👨\u200d👦",
+    "family_man_man_boy_boy": "👨\u200d👨\u200d👦\u200d👦",
+    "family_man_man_girl": "👨\u200d👨\u200d👧",
+    "family_man_man_girl_boy": "👨\u200d👨\u200d👧\u200d👦",
+    "family_man_man_girl_girl": "👨\u200d👨\u200d👧\u200d👧",
+    "family_man_woman_boy": "👨\u200d👩\u200d👦",
+    "family_man_woman_boy_boy": "👨\u200d👩\u200d👦\u200d👦",
+    "family_man_woman_girl": "👨\u200d👩\u200d👧",
+    "family_man_woman_girl_boy": "👨\u200d👩\u200d👧\u200d👦",
+    "family_man_woman_girl_girl": "👨\u200d👩\u200d👧\u200d👧",
+    "family_woman_boy": "👩\u200d👦",
+    "family_woman_boy_boy": "👩\u200d👦\u200d👦",
+    "family_woman_girl": "👩\u200d👧",
+    "family_woman_girl_boy": "👩\u200d👧\u200d👦",
+    "family_woman_girl_girl": "👩\u200d👧\u200d👧",
+    "family_woman_woman_boy": "👩\u200d👩\u200d👦",
+    "family_woman_woman_boy_boy": "👩\u200d👩\u200d👦\u200d👦",
+    "family_woman_woman_girl": "👩\u200d👩\u200d👧",
+    "family_woman_woman_girl_boy": "👩\u200d👩\u200d👧\u200d👦",
+    "family_woman_woman_girl_girl": "👩\u200d👩\u200d👧\u200d👧",
+    "fast-forward_button": "⏩",
+    "fast_down_button": "⏬",
+    "fast_reverse_button": "⏪",
+    "fast_up_button": "⏫",
+    "fax_machine": "📠",
+    "fearful_face": "😨",
+    "female_sign": "♀",
+    "ferris_wheel": "🎡",
+    "ferry": "⛴",
+    "field_hockey": "🏑",
+    "file_cabinet": "🗄",
+    "file_folder": "📁",
+    "film_frames": "🎞",
+    "film_projector": "📽",
+    "fire": "🔥",
+    "fire_extinguisher": "🧯",
+    "firecracker": "🧨",
+    "fire_engine": "🚒",
+    "fireworks": "🎆",
+    "first_quarter_moon": "🌓",
+    "first_quarter_moon_face": "🌛",
+    "fish": "🐟",
+    "fish_cake_with_swirl": "🍥",
+    "fishing_pole": "🎣",
+    "five-thirty": "🕠",
+    "five_o’clock": "🕔",
+    "flag_in_hole": "⛳",
+    "flamingo": "🦩",
+    "flashlight": "🔦",
+    "flat_shoe": "🥿",
+    "fleur-de-lis": "⚜",
+    "flexed_biceps": "💪",
+    "flexed_biceps_dark_skin_tone": "💪🏿",
+    "flexed_biceps_light_skin_tone": "💪🏻",
+    "flexed_biceps_medium-dark_skin_tone": "💪🏾",
+    "flexed_biceps_medium-light_skin_tone": "💪🏼",
+    "flexed_biceps_medium_skin_tone": "💪🏽",
+    "floppy_disk": "💾",
+    "flower_playing_cards": "🎴",
+    "flushed_face": "😳",
+    "flying_disc": "🥏",
+    "flying_saucer": "🛸",
+    "fog": "🌫",
+    "foggy": "🌁",
+    "folded_hands": "🙏",
+    "folded_hands_dark_skin_tone": "🙏🏿",
+    "folded_hands_light_skin_tone": "🙏🏻",
+    "folded_hands_medium-dark_skin_tone": "🙏🏾",
+    "folded_hands_medium-light_skin_tone": "🙏🏼",
+    "folded_hands_medium_skin_tone": "🙏🏽",
+    "foot": "🦶",
+    "footprints": "👣",
+    "fork_and_knife": "🍴",
+    "fork_and_knife_with_plate": "🍽",
+    "fortune_cookie": "🥠",
+    "fountain": "⛲",
+    "fountain_pen": "🖋",
+    "four-thirty": "🕟",
+    "four_leaf_clover": "🍀",
+    "four_o’clock": "🕓",
+    "fox_face": "🦊",
+    "framed_picture": "🖼",
+    "french_fries": "🍟",
+    "fried_shrimp": "🍤",
+    "frog_face": "🐸",
+    "front-facing_baby_chick": "🐥",
+    "frowning_face": "☹",
+    "frowning_face_with_open_mouth": "😦",
+    "fuel_pump": "⛽",
+    "full_moon": "🌕",
+    "full_moon_face": "🌝",
+    "funeral_urn": "⚱",
+    "game_die": "🎲",
+    "garlic": "🧄",
+    "gear": "⚙",
+    "gem_stone": "💎",
+    "genie": "🧞",
+    "ghost": "👻",
+    "giraffe": "🦒",
+    "girl": "👧",
+    "girl_dark_skin_tone": "👧🏿",
+    "girl_light_skin_tone": "👧🏻",
+    "girl_medium-dark_skin_tone": "👧🏾",
+    "girl_medium-light_skin_tone": "👧🏼",
+    "girl_medium_skin_tone": "👧🏽",
+    "glass_of_milk": "🥛",
+    "glasses": "👓",
+    "globe_showing_americas": "🌎",
+    "globe_showing_asia-australia": "🌏",
+    "globe_showing_europe-africa": "🌍",
+    "globe_with_meridians": "🌐",
+    "gloves": "🧤",
+    "glowing_star": "🌟",
+    "goal_net": "🥅",
+    "goat": "🐐",
+    "goblin": "👺",
+    "goggles": "🥽",
+    "gorilla": "🦍",
+    "graduation_cap": "🎓",
+    "grapes": "🍇",
+    "green_apple": "🍏",
+    "green_book": "📗",
+    "green_circle": "🟢",
+    "green_heart": "💚",
+    "green_salad": "🥗",
+    "green_square": "🟩",
+    "grimacing_face": "😬",
+    "grinning_cat_face": "😺",
+    "grinning_cat_face_with_smiling_eyes": "😸",
+    "grinning_face": "😀",
+    "grinning_face_with_big_eyes": "😃",
+    "grinning_face_with_smiling_eyes": "😄",
+    "grinning_face_with_sweat": "😅",
+    "grinning_squinting_face": "😆",
+    "growing_heart": "💗",
+    "guard": "💂",
+    "guard_dark_skin_tone": "💂🏿",
+    "guard_light_skin_tone": "💂🏻",
+    "guard_medium-dark_skin_tone": "💂🏾",
+    "guard_medium-light_skin_tone": "💂🏼",
+    "guard_medium_skin_tone": "💂🏽",
+    "guide_dog": "🦮",
+    "guitar": "🎸",
+    "hamburger": "🍔",
+    "hammer": "🔨",
+    "hammer_and_pick": "⚒",
+    "hammer_and_wrench": "🛠",
+    "hamster_face": "🐹",
+    "hand_with_fingers_splayed": "🖐",
+    "hand_with_fingers_splayed_dark_skin_tone": "🖐🏿",
+    "hand_with_fingers_splayed_light_skin_tone": "🖐🏻",
+    "hand_with_fingers_splayed_medium-dark_skin_tone": "🖐🏾",
+    "hand_with_fingers_splayed_medium-light_skin_tone": "🖐🏼",
+    "hand_with_fingers_splayed_medium_skin_tone": "🖐🏽",
+    "handbag": "👜",
+    "handshake": "🤝",
+    "hatching_chick": "🐣",
+    "headphone": "🎧",
+    "hear-no-evil_monkey": "🙉",
+    "heart_decoration": "💟",
+    "heart_suit": "♥",
+    "heart_with_arrow": "💘",
+    "heart_with_ribbon": "💝",
+    "heavy_check_mark": "✔",
+    "heavy_division_sign": "➗",
+    "heavy_dollar_sign": "💲",
+    "heavy_heart_exclamation": "❣",
+    "heavy_large_circle": "⭕",
+    "heavy_minus_sign": "➖",
+    "heavy_multiplication_x": "✖",
+    "heavy_plus_sign": "➕",
+    "hedgehog": "🦔",
+    "helicopter": "🚁",
+    "herb": "🌿",
+    "hibiscus": "🌺",
+    "high-heeled_shoe": "👠",
+    "high-speed_train": "🚄",
+    "high_voltage": "⚡",
+    "hiking_boot": "🥾",
+    "hindu_temple": "🛕",
+    "hippopotamus": "🦛",
+    "hole": "🕳",
+    "honey_pot": "🍯",
+    "honeybee": "🐝",
+    "horizontal_traffic_light": "🚥",
+    "horse": "🐴",
+    "horse_face": "🐴",
+    "horse_racing": "🏇",
+    "horse_racing_dark_skin_tone": "🏇🏿",
+    "horse_racing_light_skin_tone": "🏇🏻",
+    "horse_racing_medium-dark_skin_tone": "🏇🏾",
+    "horse_racing_medium-light_skin_tone": "🏇🏼",
+    "horse_racing_medium_skin_tone": "🏇🏽",
+    "hospital": "🏥",
+    "hot_beverage": "☕",
+    "hot_dog": "🌭",
+    "hot_face": "🥵",
+    "hot_pepper": "🌶",
+    "hot_springs": "♨",
+    "hotel": "🏨",
+    "hourglass_done": "⌛",
+    "hourglass_not_done": "⏳",
+    "house": "🏠",
+    "house_with_garden": "🏡",
+    "houses": "🏘",
+    "hugging_face": "🤗",
+    "hundred_points": "💯",
+    "hushed_face": "😯",
+    "ice": "🧊",
+    "ice_cream": "🍨",
+    "ice_hockey": "🏒",
+    "ice_skate": "⛸",
+    "inbox_tray": "📥",
+    "incoming_envelope": "📨",
+    "index_pointing_up": "☝",
+    "index_pointing_up_dark_skin_tone": "☝🏿",
+    "index_pointing_up_light_skin_tone": "☝🏻",
+    "index_pointing_up_medium-dark_skin_tone": "☝🏾",
+    "index_pointing_up_medium-light_skin_tone": "☝🏼",
+    "index_pointing_up_medium_skin_tone": "☝🏽",
+    "infinity": "♾",
+    "information": "ℹ",
+    "input_latin_letters": "🔤",
+    "input_latin_lowercase": "🔡",
+    "input_latin_uppercase": "🔠",
+    "input_numbers": "🔢",
+    "input_symbols": "🔣",
+    "jack-o-lantern": "🎃",
+    "jeans": "👖",
+    "jigsaw": "🧩",
+    "joker": "🃏",
+    "joystick": "🕹",
+    "kaaba": "🕋",
+    "kangaroo": "🦘",
+    "key": "🔑",
+    "keyboard": "⌨",
+    "keycap_#": "#️⃣",
+    "keycap_*": "*️⃣",
+    "keycap_0": "0️⃣",
+    "keycap_1": "1️⃣",
+    "keycap_10": "🔟",
+    "keycap_2": "2️⃣",
+    "keycap_3": "3️⃣",
+    "keycap_4": "4️⃣",
+    "keycap_5": "5️⃣",
+    "keycap_6": "6️⃣",
+    "keycap_7": "7️⃣",
+    "keycap_8": "8️⃣",
+    "keycap_9": "9️⃣",
+    "kick_scooter": "🛴",
+    "kimono": "👘",
+    "kiss": "💋",
+    "kiss_man_man": "👨\u200d❤️\u200d💋\u200d👨",
+    "kiss_mark": "💋",
+    "kiss_woman_man": "👩\u200d❤️\u200d💋\u200d👨",
+    "kiss_woman_woman": "👩\u200d❤️\u200d💋\u200d👩",
+    "kissing_cat_face": "😽",
+    "kissing_face": "😗",
+    "kissing_face_with_closed_eyes": "😚",
+    "kissing_face_with_smiling_eyes": "😙",
+    "kitchen_knife": "🔪",
+    "kite": "🪁",
+    "kiwi_fruit": "🥝",
+    "koala": "🐨",
+    "lab_coat": "🥼",
+    "label": "🏷",
+    "lacrosse": "🥍",
+    "lady_beetle": "🐞",
+    "laptop_computer": "💻",
+    "large_blue_diamond": "🔷",
+    "large_orange_diamond": "🔶",
+    "last_quarter_moon": "🌗",
+    "last_quarter_moon_face": "🌜",
+    "last_track_button": "⏮",
+    "latin_cross": "✝",
+    "leaf_fluttering_in_wind": "🍃",
+    "leafy_green": "🥬",
+    "ledger": "📒",
+    "left-facing_fist": "🤛",
+    "left-facing_fist_dark_skin_tone": "🤛🏿",
+    "left-facing_fist_light_skin_tone": "🤛🏻",
+    "left-facing_fist_medium-dark_skin_tone": "🤛🏾",
+    "left-facing_fist_medium-light_skin_tone": "🤛🏼",
+    "left-facing_fist_medium_skin_tone": "🤛🏽",
+    "left-right_arrow": "↔",
+    "left_arrow": "⬅",
+    "left_arrow_curving_right": "↪",
+    "left_luggage": "🛅",
+    "left_speech_bubble": "🗨",
+    "leg": "🦵",
+    "lemon": "🍋",
+    "leopard": "🐆",
+    "level_slider": "🎚",
+    "light_bulb": "💡",
+    "light_rail": "🚈",
+    "link": "🔗",
+    "linked_paperclips": "🖇",
+    "lion_face": "🦁",
+    "lipstick": "💄",
+    "litter_in_bin_sign": "🚮",
+    "lizard": "🦎",
+    "llama": "🦙",
+    "lobster": "🦞",
+    "locked": "🔒",
+    "locked_with_key": "🔐",
+    "locked_with_pen": "🔏",
+    "locomotive": "🚂",
+    "lollipop": "🍭",
+    "lotion_bottle": "🧴",
+    "loudly_crying_face": "😭",
+    "loudspeaker": "📢",
+    "love-you_gesture": "🤟",
+    "love-you_gesture_dark_skin_tone": "🤟🏿",
+    "love-you_gesture_light_skin_tone": "🤟🏻",
+    "love-you_gesture_medium-dark_skin_tone": "🤟🏾",
+    "love-you_gesture_medium-light_skin_tone": "🤟🏼",
+    "love-you_gesture_medium_skin_tone": "🤟🏽",
+    "love_hotel": "🏩",
+    "love_letter": "💌",
+    "luggage": "🧳",
+    "lying_face": "🤥",
+    "mage": "🧙",
+    "mage_dark_skin_tone": "🧙🏿",
+    "mage_light_skin_tone": "🧙🏻",
+    "mage_medium-dark_skin_tone": "🧙🏾",
+    "mage_medium-light_skin_tone": "🧙🏼",
+    "mage_medium_skin_tone": "🧙🏽",
+    "magnet": "🧲",
+    "magnifying_glass_tilted_left": "🔍",
+    "magnifying_glass_tilted_right": "🔎",
+    "mahjong_red_dragon": "🀄",
+    "male_sign": "♂",
+    "man": "👨",
+    "man_and_woman_holding_hands": "👫",
+    "man_artist": "👨\u200d🎨",
+    "man_artist_dark_skin_tone": "👨🏿\u200d🎨",
+    "man_artist_light_skin_tone": "👨🏻\u200d🎨",
+    "man_artist_medium-dark_skin_tone": "👨🏾\u200d🎨",
+    "man_artist_medium-light_skin_tone": "👨🏼\u200d🎨",
+    "man_artist_medium_skin_tone": "👨🏽\u200d🎨",
+    "man_astronaut": "👨\u200d🚀",
+    "man_astronaut_dark_skin_tone": "👨🏿\u200d🚀",
+    "man_astronaut_light_skin_tone": "👨🏻\u200d🚀",
+    "man_astronaut_medium-dark_skin_tone": "👨🏾\u200d🚀",
+    "man_astronaut_medium-light_skin_tone": "👨🏼\u200d🚀",
+    "man_astronaut_medium_skin_tone": "👨🏽\u200d🚀",
+    "man_biking": "🚴\u200d♂️",
+    "man_biking_dark_skin_tone": "🚴🏿\u200d♂️",
+    "man_biking_light_skin_tone": "🚴🏻\u200d♂️",
+    "man_biking_medium-dark_skin_tone": "🚴🏾\u200d♂️",
+    "man_biking_medium-light_skin_tone": "🚴🏼\u200d♂️",
+    "man_biking_medium_skin_tone": "🚴🏽\u200d♂️",
+    "man_bouncing_ball": "⛹️\u200d♂️",
+    "man_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♂️",
+    "man_bouncing_ball_light_skin_tone": "⛹🏻\u200d♂️",
+    "man_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♂️",
+    "man_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♂️",
+    "man_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♂️",
+    "man_bowing": "🙇\u200d♂️",
+    "man_bowing_dark_skin_tone": "🙇🏿\u200d♂️",
+    "man_bowing_light_skin_tone": "🙇🏻\u200d♂️",
+    "man_bowing_medium-dark_skin_tone": "🙇🏾\u200d♂️",
+    "man_bowing_medium-light_skin_tone": "🙇🏼\u200d♂️",
+    "man_bowing_medium_skin_tone": "🙇🏽\u200d♂️",
+    "man_cartwheeling": "🤸\u200d♂️",
+    "man_cartwheeling_dark_skin_tone": "🤸🏿\u200d♂️",
+    "man_cartwheeling_light_skin_tone": "🤸🏻\u200d♂️",
+    "man_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♂️",
+    "man_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♂️",
+    "man_cartwheeling_medium_skin_tone": "🤸🏽\u200d♂️",
+    "man_climbing": "🧗\u200d♂️",
+    "man_climbing_dark_skin_tone": "🧗🏿\u200d♂️",
+    "man_climbing_light_skin_tone": "🧗🏻\u200d♂️",
+    "man_climbing_medium-dark_skin_tone": "🧗🏾\u200d♂️",
+    "man_climbing_medium-light_skin_tone": "🧗🏼\u200d♂️",
+    "man_climbing_medium_skin_tone": "🧗🏽\u200d♂️",
+    "man_construction_worker": "👷\u200d♂️",
+    "man_construction_worker_dark_skin_tone": "👷🏿\u200d♂️",
+    "man_construction_worker_light_skin_tone": "👷🏻\u200d♂️",
+    "man_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♂️",
+    "man_construction_worker_medium-light_skin_tone": "👷🏼\u200d♂️",
+    "man_construction_worker_medium_skin_tone": "👷🏽\u200d♂️",
+    "man_cook": "👨\u200d🍳",
+    "man_cook_dark_skin_tone": "👨🏿\u200d🍳",
+    "man_cook_light_skin_tone": "👨🏻\u200d🍳",
+    "man_cook_medium-dark_skin_tone": "👨🏾\u200d🍳",
+    "man_cook_medium-light_skin_tone": "👨🏼\u200d🍳",
+    "man_cook_medium_skin_tone": "👨🏽\u200d🍳",
+    "man_dancing": "🕺",
+    "man_dancing_dark_skin_tone": "🕺🏿",
+    "man_dancing_light_skin_tone": "🕺🏻",
+    "man_dancing_medium-dark_skin_tone": "🕺🏾",
+    "man_dancing_medium-light_skin_tone": "🕺🏼",
+    "man_dancing_medium_skin_tone": "🕺🏽",
+    "man_dark_skin_tone": "👨🏿",
+    "man_detective": "🕵️\u200d♂️",
+    "man_detective_dark_skin_tone": "🕵🏿\u200d♂️",
+    "man_detective_light_skin_tone": "🕵🏻\u200d♂️",
+    "man_detective_medium-dark_skin_tone": "🕵🏾\u200d♂️",
+    "man_detective_medium-light_skin_tone": "🕵🏼\u200d♂️",
+    "man_detective_medium_skin_tone": "🕵🏽\u200d♂️",
+    "man_elf": "🧝\u200d♂️",
+    "man_elf_dark_skin_tone": "🧝🏿\u200d♂️",
+    "man_elf_light_skin_tone": "🧝🏻\u200d♂️",
+    "man_elf_medium-dark_skin_tone": "🧝🏾\u200d♂️",
+    "man_elf_medium-light_skin_tone": "🧝🏼\u200d♂️",
+    "man_elf_medium_skin_tone": "🧝🏽\u200d♂️",
+    "man_facepalming": "🤦\u200d♂️",
+    "man_facepalming_dark_skin_tone": "🤦🏿\u200d♂️",
+    "man_facepalming_light_skin_tone": "🤦🏻\u200d♂️",
+    "man_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♂️",
+    "man_facepalming_medium-light_skin_tone": "🤦🏼\u200d♂️",
+    "man_facepalming_medium_skin_tone": "🤦🏽\u200d♂️",
+    "man_factory_worker": "👨\u200d🏭",
+    "man_factory_worker_dark_skin_tone": "👨🏿\u200d🏭",
+    "man_factory_worker_light_skin_tone": "👨🏻\u200d🏭",
+    "man_factory_worker_medium-dark_skin_tone": "👨🏾\u200d🏭",
+    "man_factory_worker_medium-light_skin_tone": "👨🏼\u200d🏭",
+    "man_factory_worker_medium_skin_tone": "👨🏽\u200d🏭",
+    "man_fairy": "🧚\u200d♂️",
+    "man_fairy_dark_skin_tone": "🧚🏿\u200d♂️",
+    "man_fairy_light_skin_tone": "🧚🏻\u200d♂️",
+    "man_fairy_medium-dark_skin_tone": "🧚🏾\u200d♂️",
+    "man_fairy_medium-light_skin_tone": "🧚🏼\u200d♂️",
+    "man_fairy_medium_skin_tone": "🧚🏽\u200d♂️",
+    "man_farmer": "👨\u200d🌾",
+    "man_farmer_dark_skin_tone": "👨🏿\u200d🌾",
+    "man_farmer_light_skin_tone": "👨🏻\u200d🌾",
+    "man_farmer_medium-dark_skin_tone": "👨🏾\u200d🌾",
+    "man_farmer_medium-light_skin_tone": "👨🏼\u200d🌾",
+    "man_farmer_medium_skin_tone": "👨🏽\u200d🌾",
+    "man_firefighter": "👨\u200d🚒",
+    "man_firefighter_dark_skin_tone": "👨🏿\u200d🚒",
+    "man_firefighter_light_skin_tone": "👨🏻\u200d🚒",
+    "man_firefighter_medium-dark_skin_tone": "👨🏾\u200d🚒",
+    "man_firefighter_medium-light_skin_tone": "👨🏼\u200d🚒",
+    "man_firefighter_medium_skin_tone": "👨🏽\u200d🚒",
+    "man_frowning": "🙍\u200d♂️",
+    "man_frowning_dark_skin_tone": "🙍🏿\u200d♂️",
+    "man_frowning_light_skin_tone": "🙍🏻\u200d♂️",
+    "man_frowning_medium-dark_skin_tone": "🙍🏾\u200d♂️",
+    "man_frowning_medium-light_skin_tone": "🙍🏼\u200d♂️",
+    "man_frowning_medium_skin_tone": "🙍🏽\u200d♂️",
+    "man_genie": "🧞\u200d♂️",
+    "man_gesturing_no": "🙅\u200d♂️",
+    "man_gesturing_no_dark_skin_tone": "🙅🏿\u200d♂️",
+    "man_gesturing_no_light_skin_tone": "🙅🏻\u200d♂️",
+    "man_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♂️",
+    "man_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♂️",
+    "man_gesturing_no_medium_skin_tone": "🙅🏽\u200d♂️",
+    "man_gesturing_ok": "🙆\u200d♂️",
+    "man_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♂️",
+    "man_gesturing_ok_light_skin_tone": "🙆🏻\u200d♂️",
+    "man_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♂️",
+    "man_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♂️",
+    "man_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♂️",
+    "man_getting_haircut": "💇\u200d♂️",
+    "man_getting_haircut_dark_skin_tone": "💇🏿\u200d♂️",
+    "man_getting_haircut_light_skin_tone": "💇🏻\u200d♂️",
+    "man_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♂️",
+    "man_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♂️",
+    "man_getting_haircut_medium_skin_tone": "💇🏽\u200d♂️",
+    "man_getting_massage": "💆\u200d♂️",
+    "man_getting_massage_dark_skin_tone": "💆🏿\u200d♂️",
+    "man_getting_massage_light_skin_tone": "💆🏻\u200d♂️",
+    "man_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♂️",
+    "man_getting_massage_medium-light_skin_tone": "💆🏼\u200d♂️",
+    "man_getting_massage_medium_skin_tone": "💆🏽\u200d♂️",
+    "man_golfing": "🏌️\u200d♂️",
+    "man_golfing_dark_skin_tone": "🏌🏿\u200d♂️",
+    "man_golfing_light_skin_tone": "🏌🏻\u200d♂️",
+    "man_golfing_medium-dark_skin_tone": "🏌🏾\u200d♂️",
+    "man_golfing_medium-light_skin_tone": "🏌🏼\u200d♂️",
+    "man_golfing_medium_skin_tone": "🏌🏽\u200d♂️",
+    "man_guard": "💂\u200d♂️",
+    "man_guard_dark_skin_tone": "💂🏿\u200d♂️",
+    "man_guard_light_skin_tone": "💂🏻\u200d♂️",
+    "man_guard_medium-dark_skin_tone": "💂🏾\u200d♂️",
+    "man_guard_medium-light_skin_tone": "💂🏼\u200d♂️",
+    "man_guard_medium_skin_tone": "💂🏽\u200d♂️",
+    "man_health_worker": "👨\u200d⚕️",
+    "man_health_worker_dark_skin_tone": "👨🏿\u200d⚕️",
+    "man_health_worker_light_skin_tone": "👨🏻\u200d⚕️",
+    "man_health_worker_medium-dark_skin_tone": "👨🏾\u200d⚕️",
+    "man_health_worker_medium-light_skin_tone": "👨🏼\u200d⚕️",
+    "man_health_worker_medium_skin_tone": "👨🏽\u200d⚕️",
+    "man_in_lotus_position": "🧘\u200d♂️",
+    "man_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♂️",
+    "man_in_lotus_position_light_skin_tone": "🧘🏻\u200d♂️",
+    "man_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♂️",
+    "man_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♂️",
+    "man_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♂️",
+    "man_in_manual_wheelchair": "👨\u200d🦽",
+    "man_in_motorized_wheelchair": "👨\u200d🦼",
+    "man_in_steamy_room": "🧖\u200d♂️",
+    "man_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♂️",
+    "man_in_steamy_room_light_skin_tone": "🧖🏻\u200d♂️",
+    "man_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♂️",
+    "man_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♂️",
+    "man_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♂️",
+    "man_in_suit_levitating": "🕴",
+    "man_in_suit_levitating_dark_skin_tone": "🕴🏿",
+    "man_in_suit_levitating_light_skin_tone": "🕴🏻",
+    "man_in_suit_levitating_medium-dark_skin_tone": "🕴🏾",
+    "man_in_suit_levitating_medium-light_skin_tone": "🕴🏼",
+    "man_in_suit_levitating_medium_skin_tone": "🕴🏽",
+    "man_in_tuxedo": "🤵",
+    "man_in_tuxedo_dark_skin_tone": "🤵🏿",
+    "man_in_tuxedo_light_skin_tone": "🤵🏻",
+    "man_in_tuxedo_medium-dark_skin_tone": "🤵🏾",
+    "man_in_tuxedo_medium-light_skin_tone": "🤵🏼",
+    "man_in_tuxedo_medium_skin_tone": "🤵🏽",
+    "man_judge": "👨\u200d⚖️",
+    "man_judge_dark_skin_tone": "👨🏿\u200d⚖️",
+    "man_judge_light_skin_tone": "👨🏻\u200d⚖️",
+    "man_judge_medium-dark_skin_tone": "👨🏾\u200d⚖️",
+    "man_judge_medium-light_skin_tone": "👨🏼\u200d⚖️",
+    "man_judge_medium_skin_tone": "👨🏽\u200d⚖️",
+    "man_juggling": "🤹\u200d♂️",
+    "man_juggling_dark_skin_tone": "🤹🏿\u200d♂️",
+    "man_juggling_light_skin_tone": "🤹🏻\u200d♂️",
+    "man_juggling_medium-dark_skin_tone": "🤹🏾\u200d♂️",
+    "man_juggling_medium-light_skin_tone": "🤹🏼\u200d♂️",
+    "man_juggling_medium_skin_tone": "🤹🏽\u200d♂️",
+    "man_lifting_weights": "🏋️\u200d♂️",
+    "man_lifting_weights_dark_skin_tone": "🏋🏿\u200d♂️",
+    "man_lifting_weights_light_skin_tone": "🏋🏻\u200d♂️",
+    "man_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♂️",
+    "man_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♂️",
+    "man_lifting_weights_medium_skin_tone": "🏋🏽\u200d♂️",
+    "man_light_skin_tone": "👨🏻",
+    "man_mage": "🧙\u200d♂️",
+    "man_mage_dark_skin_tone": "🧙🏿\u200d♂️",
+    "man_mage_light_skin_tone": "🧙🏻\u200d♂️",
+    "man_mage_medium-dark_skin_tone": "🧙🏾\u200d♂️",
+    "man_mage_medium-light_skin_tone": "🧙🏼\u200d♂️",
+    "man_mage_medium_skin_tone": "🧙🏽\u200d♂️",
+    "man_mechanic": "👨\u200d🔧",
+    "man_mechanic_dark_skin_tone": "👨🏿\u200d🔧",
+    "man_mechanic_light_skin_tone": "👨🏻\u200d🔧",
+    "man_mechanic_medium-dark_skin_tone": "👨🏾\u200d🔧",
+    "man_mechanic_medium-light_skin_tone": "👨🏼\u200d🔧",
+    "man_mechanic_medium_skin_tone": "👨🏽\u200d🔧",
+    "man_medium-dark_skin_tone": "👨🏾",
+    "man_medium-light_skin_tone": "👨🏼",
+    "man_medium_skin_tone": "👨🏽",
+    "man_mountain_biking": "🚵\u200d♂️",
+    "man_mountain_biking_dark_skin_tone": "🚵🏿\u200d♂️",
+    "man_mountain_biking_light_skin_tone": "🚵🏻\u200d♂️",
+    "man_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♂️",
+    "man_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♂️",
+    "man_mountain_biking_medium_skin_tone": "🚵🏽\u200d♂️",
+    "man_office_worker": "👨\u200d💼",
+    "man_office_worker_dark_skin_tone": "👨🏿\u200d💼",
+    "man_office_worker_light_skin_tone": "👨🏻\u200d💼",
+    "man_office_worker_medium-dark_skin_tone": "👨🏾\u200d💼",
+    "man_office_worker_medium-light_skin_tone": "👨🏼\u200d💼",
+    "man_office_worker_medium_skin_tone": "👨🏽\u200d💼",
+    "man_pilot": "👨\u200d✈️",
+    "man_pilot_dark_skin_tone": "👨🏿\u200d✈️",
+    "man_pilot_light_skin_tone": "👨🏻\u200d✈️",
+    "man_pilot_medium-dark_skin_tone": "👨🏾\u200d✈️",
+    "man_pilot_medium-light_skin_tone": "👨🏼\u200d✈️",
+    "man_pilot_medium_skin_tone": "👨🏽\u200d✈️",
+    "man_playing_handball": "🤾\u200d♂️",
+    "man_playing_handball_dark_skin_tone": "🤾🏿\u200d♂️",
+    "man_playing_handball_light_skin_tone": "🤾🏻\u200d♂️",
+    "man_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♂️",
+    "man_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♂️",
+    "man_playing_handball_medium_skin_tone": "🤾🏽\u200d♂️",
+    "man_playing_water_polo": "🤽\u200d♂️",
+    "man_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♂️",
+    "man_playing_water_polo_light_skin_tone": "🤽🏻\u200d♂️",
+    "man_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♂️",
+    "man_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♂️",
+    "man_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♂️",
+    "man_police_officer": "👮\u200d♂️",
+    "man_police_officer_dark_skin_tone": "👮🏿\u200d♂️",
+    "man_police_officer_light_skin_tone": "👮🏻\u200d♂️",
+    "man_police_officer_medium-dark_skin_tone": "👮🏾\u200d♂️",
+    "man_police_officer_medium-light_skin_tone": "👮🏼\u200d♂️",
+    "man_police_officer_medium_skin_tone": "👮🏽\u200d♂️",
+    "man_pouting": "🙎\u200d♂️",
+    "man_pouting_dark_skin_tone": "🙎🏿\u200d♂️",
+    "man_pouting_light_skin_tone": "🙎🏻\u200d♂️",
+    "man_pouting_medium-dark_skin_tone": "🙎🏾\u200d♂️",
+    "man_pouting_medium-light_skin_tone": "🙎🏼\u200d♂️",
+    "man_pouting_medium_skin_tone": "🙎🏽\u200d♂️",
+    "man_raising_hand": "🙋\u200d♂️",
+    "man_raising_hand_dark_skin_tone": "🙋🏿\u200d♂️",
+    "man_raising_hand_light_skin_tone": "🙋🏻\u200d♂️",
+    "man_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♂️",
+    "man_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♂️",
+    "man_raising_hand_medium_skin_tone": "🙋🏽\u200d♂️",
+    "man_rowing_boat": "🚣\u200d♂️",
+    "man_rowing_boat_dark_skin_tone": "🚣🏿\u200d♂️",
+    "man_rowing_boat_light_skin_tone": "🚣🏻\u200d♂️",
+    "man_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♂️",
+    "man_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♂️",
+    "man_rowing_boat_medium_skin_tone": "🚣🏽\u200d♂️",
+    "man_running": "🏃\u200d♂️",
+    "man_running_dark_skin_tone": "🏃🏿\u200d♂️",
+    "man_running_light_skin_tone": "🏃🏻\u200d♂️",
+    "man_running_medium-dark_skin_tone": "🏃🏾\u200d♂️",
+    "man_running_medium-light_skin_tone": "🏃🏼\u200d♂️",
+    "man_running_medium_skin_tone": "🏃🏽\u200d♂️",
+    "man_scientist": "👨\u200d🔬",
+    "man_scientist_dark_skin_tone": "👨🏿\u200d🔬",
+    "man_scientist_light_skin_tone": "👨🏻\u200d🔬",
+    "man_scientist_medium-dark_skin_tone": "👨🏾\u200d🔬",
+    "man_scientist_medium-light_skin_tone": "👨🏼\u200d🔬",
+    "man_scientist_medium_skin_tone": "👨🏽\u200d🔬",
+    "man_shrugging": "🤷\u200d♂️",
+    "man_shrugging_dark_skin_tone": "🤷🏿\u200d♂️",
+    "man_shrugging_light_skin_tone": "🤷🏻\u200d♂️",
+    "man_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♂️",
+    "man_shrugging_medium-light_skin_tone": "🤷🏼\u200d♂️",
+    "man_shrugging_medium_skin_tone": "🤷🏽\u200d♂️",
+    "man_singer": "👨\u200d🎤",
+    "man_singer_dark_skin_tone": "👨🏿\u200d🎤",
+    "man_singer_light_skin_tone": "👨🏻\u200d🎤",
+    "man_singer_medium-dark_skin_tone": "👨🏾\u200d🎤",
+    "man_singer_medium-light_skin_tone": "👨🏼\u200d🎤",
+    "man_singer_medium_skin_tone": "👨🏽\u200d🎤",
+    "man_student": "👨\u200d🎓",
+    "man_student_dark_skin_tone": "👨🏿\u200d🎓",
+    "man_student_light_skin_tone": "👨🏻\u200d🎓",
+    "man_student_medium-dark_skin_tone": "👨🏾\u200d🎓",
+    "man_student_medium-light_skin_tone": "👨🏼\u200d🎓",
+    "man_student_medium_skin_tone": "👨🏽\u200d🎓",
+    "man_surfing": "🏄\u200d♂️",
+    "man_surfing_dark_skin_tone": "🏄🏿\u200d♂️",
+    "man_surfing_light_skin_tone": "🏄🏻\u200d♂️",
+    "man_surfing_medium-dark_skin_tone": "🏄🏾\u200d♂️",
+    "man_surfing_medium-light_skin_tone": "🏄🏼\u200d♂️",
+    "man_surfing_medium_skin_tone": "🏄🏽\u200d♂️",
+    "man_swimming": "🏊\u200d♂️",
+    "man_swimming_dark_skin_tone": "🏊🏿\u200d♂️",
+    "man_swimming_light_skin_tone": "🏊🏻\u200d♂️",
+    "man_swimming_medium-dark_skin_tone": "🏊🏾\u200d♂️",
+    "man_swimming_medium-light_skin_tone": "🏊🏼\u200d♂️",
+    "man_swimming_medium_skin_tone": "🏊🏽\u200d♂️",
+    "man_teacher": "👨\u200d🏫",
+    "man_teacher_dark_skin_tone": "👨🏿\u200d🏫",
+    "man_teacher_light_skin_tone": "👨🏻\u200d🏫",
+    "man_teacher_medium-dark_skin_tone": "👨🏾\u200d🏫",
+    "man_teacher_medium-light_skin_tone": "👨🏼\u200d🏫",
+    "man_teacher_medium_skin_tone": "👨🏽\u200d🏫",
+    "man_technologist": "👨\u200d💻",
+    "man_technologist_dark_skin_tone": "👨🏿\u200d💻",
+    "man_technologist_light_skin_tone": "👨🏻\u200d💻",
+    "man_technologist_medium-dark_skin_tone": "👨🏾\u200d💻",
+    "man_technologist_medium-light_skin_tone": "👨🏼\u200d💻",
+    "man_technologist_medium_skin_tone": "👨🏽\u200d💻",
+    "man_tipping_hand": "💁\u200d♂️",
+    "man_tipping_hand_dark_skin_tone": "💁🏿\u200d♂️",
+    "man_tipping_hand_light_skin_tone": "💁🏻\u200d♂️",
+    "man_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♂️",
+    "man_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♂️",
+    "man_tipping_hand_medium_skin_tone": "💁🏽\u200d♂️",
+    "man_vampire": "🧛\u200d♂️",
+    "man_vampire_dark_skin_tone": "🧛🏿\u200d♂️",
+    "man_vampire_light_skin_tone": "🧛🏻\u200d♂️",
+    "man_vampire_medium-dark_skin_tone": "🧛🏾\u200d♂️",
+    "man_vampire_medium-light_skin_tone": "🧛🏼\u200d♂️",
+    "man_vampire_medium_skin_tone": "🧛🏽\u200d♂️",
+    "man_walking": "🚶\u200d♂️",
+    "man_walking_dark_skin_tone": "🚶🏿\u200d♂️",
+    "man_walking_light_skin_tone": "🚶🏻\u200d♂️",
+    "man_walking_medium-dark_skin_tone": "🚶🏾\u200d♂️",
+    "man_walking_medium-light_skin_tone": "🚶🏼\u200d♂️",
+    "man_walking_medium_skin_tone": "🚶🏽\u200d♂️",
+    "man_wearing_turban": "👳\u200d♂️",
+    "man_wearing_turban_dark_skin_tone": "👳🏿\u200d♂️",
+    "man_wearing_turban_light_skin_tone": "👳🏻\u200d♂️",
+    "man_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♂️",
+    "man_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♂️",
+    "man_wearing_turban_medium_skin_tone": "👳🏽\u200d♂️",
+    "man_with_probing_cane": "👨\u200d🦯",
+    "man_with_chinese_cap": "👲",
+    "man_with_chinese_cap_dark_skin_tone": "👲🏿",
+    "man_with_chinese_cap_light_skin_tone": "👲🏻",
+    "man_with_chinese_cap_medium-dark_skin_tone": "👲🏾",
+    "man_with_chinese_cap_medium-light_skin_tone": "👲🏼",
+    "man_with_chinese_cap_medium_skin_tone": "👲🏽",
+    "man_zombie": "🧟\u200d♂️",
+    "mango": "🥭",
+    "mantelpiece_clock": "🕰",
+    "manual_wheelchair": "🦽",
+    "man’s_shoe": "👞",
+    "map_of_japan": "🗾",
+    "maple_leaf": "🍁",
+    "martial_arts_uniform": "🥋",
+    "mate": "🧉",
+    "meat_on_bone": "🍖",
+    "mechanical_arm": "🦾",
+    "mechanical_leg": "🦿",
+    "medical_symbol": "⚕",
+    "megaphone": "📣",
+    "melon": "🍈",
+    "memo": "📝",
+    "men_with_bunny_ears": "👯\u200d♂️",
+    "men_wrestling": "🤼\u200d♂️",
+    "menorah": "🕎",
+    "men’s_room": "🚹",
+    "mermaid": "🧜\u200d♀️",
+    "mermaid_dark_skin_tone": "🧜🏿\u200d♀️",
+    "mermaid_light_skin_tone": "🧜🏻\u200d♀️",
+    "mermaid_medium-dark_skin_tone": "🧜🏾\u200d♀️",
+    "mermaid_medium-light_skin_tone": "🧜🏼\u200d♀️",
+    "mermaid_medium_skin_tone": "🧜🏽\u200d♀️",
+    "merman": "🧜\u200d♂️",
+    "merman_dark_skin_tone": "🧜🏿\u200d♂️",
+    "merman_light_skin_tone": "🧜🏻\u200d♂️",
+    "merman_medium-dark_skin_tone": "🧜🏾\u200d♂️",
+    "merman_medium-light_skin_tone": "🧜🏼\u200d♂️",
+    "merman_medium_skin_tone": "🧜🏽\u200d♂️",
+    "merperson": "🧜",
+    "merperson_dark_skin_tone": "🧜🏿",
+    "merperson_light_skin_tone": "🧜🏻",
+    "merperson_medium-dark_skin_tone": "🧜🏾",
+    "merperson_medium-light_skin_tone": "🧜🏼",
+    "merperson_medium_skin_tone": "🧜🏽",
+    "metro": "🚇",
+    "microbe": "🦠",
+    "microphone": "🎤",
+    "microscope": "🔬",
+    "middle_finger": "🖕",
+    "middle_finger_dark_skin_tone": "🖕🏿",
+    "middle_finger_light_skin_tone": "🖕🏻",
+    "middle_finger_medium-dark_skin_tone": "🖕🏾",
+    "middle_finger_medium-light_skin_tone": "🖕🏼",
+    "middle_finger_medium_skin_tone": "🖕🏽",
+    "military_medal": "🎖",
+    "milky_way": "🌌",
+    "minibus": "🚐",
+    "moai": "🗿",
+    "mobile_phone": "📱",
+    "mobile_phone_off": "📴",
+    "mobile_phone_with_arrow": "📲",
+    "money-mouth_face": "🤑",
+    "money_bag": "💰",
+    "money_with_wings": "💸",
+    "monkey": "🐒",
+    "monkey_face": "🐵",
+    "monorail": "🚝",
+    "moon_cake": "🥮",
+    "moon_viewing_ceremony": "🎑",
+    "mosque": "🕌",
+    "mosquito": "🦟",
+    "motor_boat": "🛥",
+    "motor_scooter": "🛵",
+    "motorcycle": "🏍",
+    "motorized_wheelchair": "🦼",
+    "motorway": "🛣",
+    "mount_fuji": "🗻",
+    "mountain": "⛰",
+    "mountain_cableway": "🚠",
+    "mountain_railway": "🚞",
+    "mouse": "🐭",
+    "mouse_face": "🐭",
+    "mouth": "👄",
+    "movie_camera": "🎥",
+    "mushroom": "🍄",
+    "musical_keyboard": "🎹",
+    "musical_note": "🎵",
+    "musical_notes": "🎶",
+    "musical_score": "🎼",
+    "muted_speaker": "🔇",
+    "nail_polish": "💅",
+    "nail_polish_dark_skin_tone": "💅🏿",
+    "nail_polish_light_skin_tone": "💅🏻",
+    "nail_polish_medium-dark_skin_tone": "💅🏾",
+    "nail_polish_medium-light_skin_tone": "💅🏼",
+    "nail_polish_medium_skin_tone": "💅🏽",
+    "name_badge": "📛",
+    "national_park": "🏞",
+    "nauseated_face": "🤢",
+    "nazar_amulet": "🧿",
+    "necktie": "👔",
+    "nerd_face": "🤓",
+    "neutral_face": "😐",
+    "new_moon": "🌑",
+    "new_moon_face": "🌚",
+    "newspaper": "📰",
+    "next_track_button": "⏭",
+    "night_with_stars": "🌃",
+    "nine-thirty": "🕤",
+    "nine_o’clock": "🕘",
+    "no_bicycles": "🚳",
+    "no_entry": "⛔",
+    "no_littering": "🚯",
+    "no_mobile_phones": "📵",
+    "no_one_under_eighteen": "🔞",
+    "no_pedestrians": "🚷",
+    "no_smoking": "🚭",
+    "non-potable_water": "🚱",
+    "nose": "👃",
+    "nose_dark_skin_tone": "👃🏿",
+    "nose_light_skin_tone": "👃🏻",
+    "nose_medium-dark_skin_tone": "👃🏾",
+    "nose_medium-light_skin_tone": "👃🏼",
+    "nose_medium_skin_tone": "👃🏽",
+    "notebook": "📓",
+    "notebook_with_decorative_cover": "📔",
+    "nut_and_bolt": "🔩",
+    "octopus": "🐙",
+    "oden": "🍢",
+    "office_building": "🏢",
+    "ogre": "👹",
+    "oil_drum": "🛢",
+    "old_key": "🗝",
+    "old_man": "👴",
+    "old_man_dark_skin_tone": "👴🏿",
+    "old_man_light_skin_tone": "👴🏻",
+    "old_man_medium-dark_skin_tone": "👴🏾",
+    "old_man_medium-light_skin_tone": "👴🏼",
+    "old_man_medium_skin_tone": "👴🏽",
+    "old_woman": "👵",
+    "old_woman_dark_skin_tone": "👵🏿",
+    "old_woman_light_skin_tone": "👵🏻",
+    "old_woman_medium-dark_skin_tone": "👵🏾",
+    "old_woman_medium-light_skin_tone": "👵🏼",
+    "old_woman_medium_skin_tone": "👵🏽",
+    "older_adult": "🧓",
+    "older_adult_dark_skin_tone": "🧓🏿",
+    "older_adult_light_skin_tone": "🧓🏻",
+    "older_adult_medium-dark_skin_tone": "🧓🏾",
+    "older_adult_medium-light_skin_tone": "🧓🏼",
+    "older_adult_medium_skin_tone": "🧓🏽",
+    "om": "🕉",
+    "oncoming_automobile": "🚘",
+    "oncoming_bus": "🚍",
+    "oncoming_fist": "👊",
+    "oncoming_fist_dark_skin_tone": "👊🏿",
+    "oncoming_fist_light_skin_tone": "👊🏻",
+    "oncoming_fist_medium-dark_skin_tone": "👊🏾",
+    "oncoming_fist_medium-light_skin_tone": "👊🏼",
+    "oncoming_fist_medium_skin_tone": "👊🏽",
+    "oncoming_police_car": "🚔",
+    "oncoming_taxi": "🚖",
+    "one-piece_swimsuit": "🩱",
+    "one-thirty": "🕜",
+    "one_o’clock": "🕐",
+    "onion": "🧅",
+    "open_book": "📖",
+    "open_file_folder": "📂",
+    "open_hands": "👐",
+    "open_hands_dark_skin_tone": "👐🏿",
+    "open_hands_light_skin_tone": "👐🏻",
+    "open_hands_medium-dark_skin_tone": "👐🏾",
+    "open_hands_medium-light_skin_tone": "👐🏼",
+    "open_hands_medium_skin_tone": "👐🏽",
+    "open_mailbox_with_lowered_flag": "📭",
+    "open_mailbox_with_raised_flag": "📬",
+    "optical_disk": "💿",
+    "orange_book": "📙",
+    "orange_circle": "🟠",
+    "orange_heart": "🧡",
+    "orange_square": "🟧",
+    "orangutan": "🦧",
+    "orthodox_cross": "☦",
+    "otter": "🦦",
+    "outbox_tray": "📤",
+    "owl": "🦉",
+    "ox": "🐂",
+    "oyster": "🦪",
+    "package": "📦",
+    "page_facing_up": "📄",
+    "page_with_curl": "📃",
+    "pager": "📟",
+    "paintbrush": "🖌",
+    "palm_tree": "🌴",
+    "palms_up_together": "🤲",
+    "palms_up_together_dark_skin_tone": "🤲🏿",
+    "palms_up_together_light_skin_tone": "🤲🏻",
+    "palms_up_together_medium-dark_skin_tone": "🤲🏾",
+    "palms_up_together_medium-light_skin_tone": "🤲🏼",
+    "palms_up_together_medium_skin_tone": "🤲🏽",
+    "pancakes": "🥞",
+    "panda_face": "🐼",
+    "paperclip": "📎",
+    "parrot": "🦜",
+    "part_alternation_mark": "〽",
+    "party_popper": "🎉",
+    "partying_face": "🥳",
+    "passenger_ship": "🛳",
+    "passport_control": "🛂",
+    "pause_button": "⏸",
+    "paw_prints": "🐾",
+    "peace_symbol": "☮",
+    "peach": "🍑",
+    "peacock": "🦚",
+    "peanuts": "🥜",
+    "pear": "🍐",
+    "pen": "🖊",
+    "pencil": "📝",
+    "penguin": "🐧",
+    "pensive_face": "😔",
+    "people_holding_hands": "🧑\u200d🤝\u200d🧑",
+    "people_with_bunny_ears": "👯",
+    "people_wrestling": "🤼",
+    "performing_arts": "🎭",
+    "persevering_face": "😣",
+    "person_biking": "🚴",
+    "person_biking_dark_skin_tone": "🚴🏿",
+    "person_biking_light_skin_tone": "🚴🏻",
+    "person_biking_medium-dark_skin_tone": "🚴🏾",
+    "person_biking_medium-light_skin_tone": "🚴🏼",
+    "person_biking_medium_skin_tone": "🚴🏽",
+    "person_bouncing_ball": "⛹",
+    "person_bouncing_ball_dark_skin_tone": "⛹🏿",
+    "person_bouncing_ball_light_skin_tone": "⛹🏻",
+    "person_bouncing_ball_medium-dark_skin_tone": "⛹🏾",
+    "person_bouncing_ball_medium-light_skin_tone": "⛹🏼",
+    "person_bouncing_ball_medium_skin_tone": "⛹🏽",
+    "person_bowing": "🙇",
+    "person_bowing_dark_skin_tone": "🙇🏿",
+    "person_bowing_light_skin_tone": "🙇🏻",
+    "person_bowing_medium-dark_skin_tone": "🙇🏾",
+    "person_bowing_medium-light_skin_tone": "🙇🏼",
+    "person_bowing_medium_skin_tone": "🙇🏽",
+    "person_cartwheeling": "🤸",
+    "person_cartwheeling_dark_skin_tone": "🤸🏿",
+    "person_cartwheeling_light_skin_tone": "🤸🏻",
+    "person_cartwheeling_medium-dark_skin_tone": "🤸🏾",
+    "person_cartwheeling_medium-light_skin_tone": "🤸🏼",
+    "person_cartwheeling_medium_skin_tone": "🤸🏽",
+    "person_climbing": "🧗",
+    "person_climbing_dark_skin_tone": "🧗🏿",
+    "person_climbing_light_skin_tone": "🧗🏻",
+    "person_climbing_medium-dark_skin_tone": "🧗🏾",
+    "person_climbing_medium-light_skin_tone": "🧗🏼",
+    "person_climbing_medium_skin_tone": "🧗🏽",
+    "person_facepalming": "🤦",
+    "person_facepalming_dark_skin_tone": "🤦🏿",
+    "person_facepalming_light_skin_tone": "🤦🏻",
+    "person_facepalming_medium-dark_skin_tone": "🤦🏾",
+    "person_facepalming_medium-light_skin_tone": "🤦🏼",
+    "person_facepalming_medium_skin_tone": "🤦🏽",
+    "person_fencing": "🤺",
+    "person_frowning": "🙍",
+    "person_frowning_dark_skin_tone": "🙍🏿",
+    "person_frowning_light_skin_tone": "🙍🏻",
+    "person_frowning_medium-dark_skin_tone": "🙍🏾",
+    "person_frowning_medium-light_skin_tone": "🙍🏼",
+    "person_frowning_medium_skin_tone": "🙍🏽",
+    "person_gesturing_no": "🙅",
+    "person_gesturing_no_dark_skin_tone": "🙅🏿",
+    "person_gesturing_no_light_skin_tone": "🙅🏻",
+    "person_gesturing_no_medium-dark_skin_tone": "🙅🏾",
+    "person_gesturing_no_medium-light_skin_tone": "🙅🏼",
+    "person_gesturing_no_medium_skin_tone": "🙅🏽",
+    "person_gesturing_ok": "🙆",
+    "person_gesturing_ok_dark_skin_tone": "🙆🏿",
+    "person_gesturing_ok_light_skin_tone": "🙆🏻",
+    "person_gesturing_ok_medium-dark_skin_tone": "🙆🏾",
+    "person_gesturing_ok_medium-light_skin_tone": "🙆🏼",
+    "person_gesturing_ok_medium_skin_tone": "🙆🏽",
+    "person_getting_haircut": "💇",
+    "person_getting_haircut_dark_skin_tone": "💇🏿",
+    "person_getting_haircut_light_skin_tone": "💇🏻",
+    "person_getting_haircut_medium-dark_skin_tone": "💇🏾",
+    "person_getting_haircut_medium-light_skin_tone": "💇🏼",
+    "person_getting_haircut_medium_skin_tone": "💇🏽",
+    "person_getting_massage": "💆",
+    "person_getting_massage_dark_skin_tone": "💆🏿",
+    "person_getting_massage_light_skin_tone": "💆🏻",
+    "person_getting_massage_medium-dark_skin_tone": "💆🏾",
+    "person_getting_massage_medium-light_skin_tone": "💆🏼",
+    "person_getting_massage_medium_skin_tone": "💆🏽",
+    "person_golfing": "🏌",
+    "person_golfing_dark_skin_tone": "🏌🏿",
+    "person_golfing_light_skin_tone": "🏌🏻",
+    "person_golfing_medium-dark_skin_tone": "🏌🏾",
+    "person_golfing_medium-light_skin_tone": "🏌🏼",
+    "person_golfing_medium_skin_tone": "🏌🏽",
+    "person_in_bed": "🛌",
+    "person_in_bed_dark_skin_tone": "🛌🏿",
+    "person_in_bed_light_skin_tone": "🛌🏻",
+    "person_in_bed_medium-dark_skin_tone": "🛌🏾",
+    "person_in_bed_medium-light_skin_tone": "🛌🏼",
+    "person_in_bed_medium_skin_tone": "🛌🏽",
+    "person_in_lotus_position": "🧘",
+    "person_in_lotus_position_dark_skin_tone": "🧘🏿",
+    "person_in_lotus_position_light_skin_tone": "🧘🏻",
+    "person_in_lotus_position_medium-dark_skin_tone": "🧘🏾",
+    "person_in_lotus_position_medium-light_skin_tone": "🧘🏼",
+    "person_in_lotus_position_medium_skin_tone": "🧘🏽",
+    "person_in_steamy_room": "🧖",
+    "person_in_steamy_room_dark_skin_tone": "🧖🏿",
+    "person_in_steamy_room_light_skin_tone": "🧖🏻",
+    "person_in_steamy_room_medium-dark_skin_tone": "🧖🏾",
+    "person_in_steamy_room_medium-light_skin_tone": "🧖🏼",
+    "person_in_steamy_room_medium_skin_tone": "🧖🏽",
+    "person_juggling": "🤹",
+    "person_juggling_dark_skin_tone": "🤹🏿",
+    "person_juggling_light_skin_tone": "🤹🏻",
+    "person_juggling_medium-dark_skin_tone": "🤹🏾",
+    "person_juggling_medium-light_skin_tone": "🤹🏼",
+    "person_juggling_medium_skin_tone": "🤹🏽",
+    "person_kneeling": "🧎",
+    "person_lifting_weights": "🏋",
+    "person_lifting_weights_dark_skin_tone": "🏋🏿",
+    "person_lifting_weights_light_skin_tone": "🏋🏻",
+    "person_lifting_weights_medium-dark_skin_tone": "🏋🏾",
+    "person_lifting_weights_medium-light_skin_tone": "🏋🏼",
+    "person_lifting_weights_medium_skin_tone": "🏋🏽",
+    "person_mountain_biking": "🚵",
+    "person_mountain_biking_dark_skin_tone": "🚵🏿",
+    "person_mountain_biking_light_skin_tone": "🚵🏻",
+    "person_mountain_biking_medium-dark_skin_tone": "🚵🏾",
+    "person_mountain_biking_medium-light_skin_tone": "🚵🏼",
+    "person_mountain_biking_medium_skin_tone": "🚵🏽",
+    "person_playing_handball": "🤾",
+    "person_playing_handball_dark_skin_tone": "🤾🏿",
+    "person_playing_handball_light_skin_tone": "🤾🏻",
+    "person_playing_handball_medium-dark_skin_tone": "🤾🏾",
+    "person_playing_handball_medium-light_skin_tone": "🤾🏼",
+    "person_playing_handball_medium_skin_tone": "🤾🏽",
+    "person_playing_water_polo": "🤽",
+    "person_playing_water_polo_dark_skin_tone": "🤽🏿",
+    "person_playing_water_polo_light_skin_tone": "🤽🏻",
+    "person_playing_water_polo_medium-dark_skin_tone": "🤽🏾",
+    "person_playing_water_polo_medium-light_skin_tone": "🤽🏼",
+    "person_playing_water_polo_medium_skin_tone": "🤽🏽",
+    "person_pouting": "🙎",
+    "person_pouting_dark_skin_tone": "🙎🏿",
+    "person_pouting_light_skin_tone": "🙎🏻",
+    "person_pouting_medium-dark_skin_tone": "🙎🏾",
+    "person_pouting_medium-light_skin_tone": "🙎🏼",
+    "person_pouting_medium_skin_tone": "🙎🏽",
+    "person_raising_hand": "🙋",
+    "person_raising_hand_dark_skin_tone": "🙋🏿",
+    "person_raising_hand_light_skin_tone": "🙋🏻",
+    "person_raising_hand_medium-dark_skin_tone": "🙋🏾",
+    "person_raising_hand_medium-light_skin_tone": "🙋🏼",
+    "person_raising_hand_medium_skin_tone": "🙋🏽",
+    "person_rowing_boat": "🚣",
+    "person_rowing_boat_dark_skin_tone": "🚣🏿",
+    "person_rowing_boat_light_skin_tone": "🚣🏻",
+    "person_rowing_boat_medium-dark_skin_tone": "🚣🏾",
+    "person_rowing_boat_medium-light_skin_tone": "🚣🏼",
+    "person_rowing_boat_medium_skin_tone": "🚣🏽",
+    "person_running": "🏃",
+    "person_running_dark_skin_tone": "🏃🏿",
+    "person_running_light_skin_tone": "🏃🏻",
+    "person_running_medium-dark_skin_tone": "🏃🏾",
+    "person_running_medium-light_skin_tone": "🏃🏼",
+    "person_running_medium_skin_tone": "🏃🏽",
+    "person_shrugging": "🤷",
+    "person_shrugging_dark_skin_tone": "🤷🏿",
+    "person_shrugging_light_skin_tone": "🤷🏻",
+    "person_shrugging_medium-dark_skin_tone": "🤷🏾",
+    "person_shrugging_medium-light_skin_tone": "🤷🏼",
+    "person_shrugging_medium_skin_tone": "🤷🏽",
+    "person_standing": "🧍",
+    "person_surfing": "🏄",
+    "person_surfing_dark_skin_tone": "🏄🏿",
+    "person_surfing_light_skin_tone": "🏄🏻",
+    "person_surfing_medium-dark_skin_tone": "🏄🏾",
+    "person_surfing_medium-light_skin_tone": "🏄🏼",
+    "person_surfing_medium_skin_tone": "🏄🏽",
+    "person_swimming": "🏊",
+    "person_swimming_dark_skin_tone": "🏊🏿",
+    "person_swimming_light_skin_tone": "🏊🏻",
+    "person_swimming_medium-dark_skin_tone": "🏊🏾",
+    "person_swimming_medium-light_skin_tone": "🏊🏼",
+    "person_swimming_medium_skin_tone": "🏊🏽",
+    "person_taking_bath": "🛀",
+    "person_taking_bath_dark_skin_tone": "🛀🏿",
+    "person_taking_bath_light_skin_tone": "🛀🏻",
+    "person_taking_bath_medium-dark_skin_tone": "🛀🏾",
+    "person_taking_bath_medium-light_skin_tone": "🛀🏼",
+    "person_taking_bath_medium_skin_tone": "🛀🏽",
+    "person_tipping_hand": "💁",
+    "person_tipping_hand_dark_skin_tone": "💁🏿",
+    "person_tipping_hand_light_skin_tone": "💁🏻",
+    "person_tipping_hand_medium-dark_skin_tone": "💁🏾",
+    "person_tipping_hand_medium-light_skin_tone": "💁🏼",
+    "person_tipping_hand_medium_skin_tone": "💁🏽",
+    "person_walking": "🚶",
+    "person_walking_dark_skin_tone": "🚶🏿",
+    "person_walking_light_skin_tone": "🚶🏻",
+    "person_walking_medium-dark_skin_tone": "🚶🏾",
+    "person_walking_medium-light_skin_tone": "🚶🏼",
+    "person_walking_medium_skin_tone": "🚶🏽",
+    "person_wearing_turban": "👳",
+    "person_wearing_turban_dark_skin_tone": "👳🏿",
+    "person_wearing_turban_light_skin_tone": "👳🏻",
+    "person_wearing_turban_medium-dark_skin_tone": "👳🏾",
+    "person_wearing_turban_medium-light_skin_tone": "👳🏼",
+    "person_wearing_turban_medium_skin_tone": "👳🏽",
+    "petri_dish": "🧫",
+    "pick": "⛏",
+    "pie": "🥧",
+    "pig": "🐷",
+    "pig_face": "🐷",
+    "pig_nose": "🐽",
+    "pile_of_poo": "💩",
+    "pill": "💊",
+    "pinching_hand": "🤏",
+    "pine_decoration": "🎍",
+    "pineapple": "🍍",
+    "ping_pong": "🏓",
+    "pirate_flag": "🏴\u200d☠️",
+    "pistol": "🔫",
+    "pizza": "🍕",
+    "place_of_worship": "🛐",
+    "play_button": "▶",
+    "play_or_pause_button": "⏯",
+    "pleading_face": "🥺",
+    "police_car": "🚓",
+    "police_car_light": "🚨",
+    "police_officer": "👮",
+    "police_officer_dark_skin_tone": "👮🏿",
+    "police_officer_light_skin_tone": "👮🏻",
+    "police_officer_medium-dark_skin_tone": "👮🏾",
+    "police_officer_medium-light_skin_tone": "👮🏼",
+    "police_officer_medium_skin_tone": "👮🏽",
+    "poodle": "🐩",
+    "pool_8_ball": "🎱",
+    "popcorn": "🍿",
+    "post_office": "🏣",
+    "postal_horn": "📯",
+    "postbox": "📮",
+    "pot_of_food": "🍲",
+    "potable_water": "🚰",
+    "potato": "🥔",
+    "poultry_leg": "🍗",
+    "pound_banknote": "💷",
+    "pouting_cat_face": "😾",
+    "pouting_face": "😡",
+    "prayer_beads": "📿",
+    "pregnant_woman": "🤰",
+    "pregnant_woman_dark_skin_tone": "🤰🏿",
+    "pregnant_woman_light_skin_tone": "🤰🏻",
+    "pregnant_woman_medium-dark_skin_tone": "🤰🏾",
+    "pregnant_woman_medium-light_skin_tone": "🤰🏼",
+    "pregnant_woman_medium_skin_tone": "🤰🏽",
+    "pretzel": "🥨",
+    "probing_cane": "🦯",
+    "prince": "🤴",
+    "prince_dark_skin_tone": "🤴🏿",
+    "prince_light_skin_tone": "🤴🏻",
+    "prince_medium-dark_skin_tone": "🤴🏾",
+    "prince_medium-light_skin_tone": "🤴🏼",
+    "prince_medium_skin_tone": "🤴🏽",
+    "princess": "👸",
+    "princess_dark_skin_tone": "👸🏿",
+    "princess_light_skin_tone": "👸🏻",
+    "princess_medium-dark_skin_tone": "👸🏾",
+    "princess_medium-light_skin_tone": "👸🏼",
+    "princess_medium_skin_tone": "👸🏽",
+    "printer": "🖨",
+    "prohibited": "🚫",
+    "purple_circle": "🟣",
+    "purple_heart": "💜",
+    "purple_square": "🟪",
+    "purse": "👛",
+    "pushpin": "📌",
+    "question_mark": "❓",
+    "rabbit": "🐰",
+    "rabbit_face": "🐰",
+    "raccoon": "🦝",
+    "racing_car": "🏎",
+    "radio": "📻",
+    "radio_button": "🔘",
+    "radioactive": "☢",
+    "railway_car": "🚃",
+    "railway_track": "🛤",
+    "rainbow": "🌈",
+    "rainbow_flag": "🏳️\u200d🌈",
+    "raised_back_of_hand": "🤚",
+    "raised_back_of_hand_dark_skin_tone": "🤚🏿",
+    "raised_back_of_hand_light_skin_tone": "🤚🏻",
+    "raised_back_of_hand_medium-dark_skin_tone": "🤚🏾",
+    "raised_back_of_hand_medium-light_skin_tone": "🤚🏼",
+    "raised_back_of_hand_medium_skin_tone": "🤚🏽",
+    "raised_fist": "✊",
+    "raised_fist_dark_skin_tone": "✊🏿",
+    "raised_fist_light_skin_tone": "✊🏻",
+    "raised_fist_medium-dark_skin_tone": "✊🏾",
+    "raised_fist_medium-light_skin_tone": "✊🏼",
+    "raised_fist_medium_skin_tone": "✊🏽",
+    "raised_hand": "✋",
+    "raised_hand_dark_skin_tone": "✋🏿",
+    "raised_hand_light_skin_tone": "✋🏻",
+    "raised_hand_medium-dark_skin_tone": "✋🏾",
+    "raised_hand_medium-light_skin_tone": "✋🏼",
+    "raised_hand_medium_skin_tone": "✋🏽",
+    "raising_hands": "🙌",
+    "raising_hands_dark_skin_tone": "🙌🏿",
+    "raising_hands_light_skin_tone": "🙌🏻",
+    "raising_hands_medium-dark_skin_tone": "🙌🏾",
+    "raising_hands_medium-light_skin_tone": "🙌🏼",
+    "raising_hands_medium_skin_tone": "🙌🏽",
+    "ram": "🐏",
+    "rat": "🐀",
+    "razor": "🪒",
+    "ringed_planet": "🪐",
+    "receipt": "🧾",
+    "record_button": "⏺",
+    "recycling_symbol": "♻",
+    "red_apple": "🍎",
+    "red_circle": "🔴",
+    "red_envelope": "🧧",
+    "red_hair": "🦰",
+    "red-haired_man": "👨\u200d🦰",
+    "red-haired_woman": "👩\u200d🦰",
+    "red_heart": "❤",
+    "red_paper_lantern": "🏮",
+    "red_square": "🟥",
+    "red_triangle_pointed_down": "🔻",
+    "red_triangle_pointed_up": "🔺",
+    "registered": "®",
+    "relieved_face": "😌",
+    "reminder_ribbon": "🎗",
+    "repeat_button": "🔁",
+    "repeat_single_button": "🔂",
+    "rescue_worker’s_helmet": "⛑",
+    "restroom": "🚻",
+    "reverse_button": "◀",
+    "revolving_hearts": "💞",
+    "rhinoceros": "🦏",
+    "ribbon": "🎀",
+    "rice_ball": "🍙",
+    "rice_cracker": "🍘",
+    "right-facing_fist": "🤜",
+    "right-facing_fist_dark_skin_tone": "🤜🏿",
+    "right-facing_fist_light_skin_tone": "🤜🏻",
+    "right-facing_fist_medium-dark_skin_tone": "🤜🏾",
+    "right-facing_fist_medium-light_skin_tone": "🤜🏼",
+    "right-facing_fist_medium_skin_tone": "🤜🏽",
+    "right_anger_bubble": "🗯",
+    "right_arrow": "➡",
+    "right_arrow_curving_down": "⤵",
+    "right_arrow_curving_left": "↩",
+    "right_arrow_curving_up": "⤴",
+    "ring": "💍",
+    "roasted_sweet_potato": "🍠",
+    "robot_face": "🤖",
+    "rocket": "🚀",
+    "roll_of_paper": "🧻",
+    "rolled-up_newspaper": "🗞",
+    "roller_coaster": "🎢",
+    "rolling_on_the_floor_laughing": "🤣",
+    "rooster": "🐓",
+    "rose": "🌹",
+    "rosette": "🏵",
+    "round_pushpin": "📍",
+    "rugby_football": "🏉",
+    "running_shirt": "🎽",
+    "running_shoe": "👟",
+    "sad_but_relieved_face": "😥",
+    "safety_pin": "🧷",
+    "safety_vest": "🦺",
+    "salt": "🧂",
+    "sailboat": "⛵",
+    "sake": "🍶",
+    "sandwich": "🥪",
+    "sari": "🥻",
+    "satellite": "📡",
+    "satellite_antenna": "📡",
+    "sauropod": "🦕",
+    "saxophone": "🎷",
+    "scarf": "🧣",
+    "school": "🏫",
+    "school_backpack": "🎒",
+    "scissors": "✂",
+    "scorpion": "🦂",
+    "scroll": "📜",
+    "seat": "💺",
+    "see-no-evil_monkey": "🙈",
+    "seedling": "🌱",
+    "selfie": "🤳",
+    "selfie_dark_skin_tone": "🤳🏿",
+    "selfie_light_skin_tone": "🤳🏻",
+    "selfie_medium-dark_skin_tone": "🤳🏾",
+    "selfie_medium-light_skin_tone": "🤳🏼",
+    "selfie_medium_skin_tone": "🤳🏽",
+    "service_dog": "🐕\u200d🦺",
+    "seven-thirty": "🕢",
+    "seven_o’clock": "🕖",
+    "shallow_pan_of_food": "🥘",
+    "shamrock": "☘",
+    "shark": "🦈",
+    "shaved_ice": "🍧",
+    "sheaf_of_rice": "🌾",
+    "shield": "🛡",
+    "shinto_shrine": "⛩",
+    "ship": "🚢",
+    "shooting_star": "🌠",
+    "shopping_bags": "🛍",
+    "shopping_cart": "🛒",
+    "shortcake": "🍰",
+    "shorts": "🩳",
+    "shower": "🚿",
+    "shrimp": "🦐",
+    "shuffle_tracks_button": "🔀",
+    "shushing_face": "🤫",
+    "sign_of_the_horns": "🤘",
+    "sign_of_the_horns_dark_skin_tone": "🤘🏿",
+    "sign_of_the_horns_light_skin_tone": "🤘🏻",
+    "sign_of_the_horns_medium-dark_skin_tone": "🤘🏾",
+    "sign_of_the_horns_medium-light_skin_tone": "🤘🏼",
+    "sign_of_the_horns_medium_skin_tone": "🤘🏽",
+    "six-thirty": "🕡",
+    "six_o’clock": "🕕",
+    "skateboard": "🛹",
+    "skier": "⛷",
+    "skis": "🎿",
+    "skull": "💀",
+    "skull_and_crossbones": "☠",
+    "skunk": "🦨",
+    "sled": "🛷",
+    "sleeping_face": "😴",
+    "sleepy_face": "😪",
+    "slightly_frowning_face": "🙁",
+    "slightly_smiling_face": "🙂",
+    "slot_machine": "🎰",
+    "sloth": "🦥",
+    "small_airplane": "🛩",
+    "small_blue_diamond": "🔹",
+    "small_orange_diamond": "🔸",
+    "smiling_cat_face_with_heart-eyes": "😻",
+    "smiling_face": "☺",
+    "smiling_face_with_halo": "😇",
+    "smiling_face_with_3_hearts": "🥰",
+    "smiling_face_with_heart-eyes": "😍",
+    "smiling_face_with_horns": "😈",
+    "smiling_face_with_smiling_eyes": "😊",
+    "smiling_face_with_sunglasses": "😎",
+    "smirking_face": "😏",
+    "snail": "🐌",
+    "snake": "🐍",
+    "sneezing_face": "🤧",
+    "snow-capped_mountain": "🏔",
+    "snowboarder": "🏂",
+    "snowboarder_dark_skin_tone": "🏂🏿",
+    "snowboarder_light_skin_tone": "🏂🏻",
+    "snowboarder_medium-dark_skin_tone": "🏂🏾",
+    "snowboarder_medium-light_skin_tone": "🏂🏼",
+    "snowboarder_medium_skin_tone": "🏂🏽",
+    "snowflake": "❄",
+    "snowman": "☃",
+    "snowman_without_snow": "⛄",
+    "soap": "🧼",
+    "soccer_ball": "⚽",
+    "socks": "🧦",
+    "softball": "🥎",
+    "soft_ice_cream": "🍦",
+    "spade_suit": "♠",
+    "spaghetti": "🍝",
+    "sparkle": "❇",
+    "sparkler": "🎇",
+    "sparkles": "✨",
+    "sparkling_heart": "💖",
+    "speak-no-evil_monkey": "🙊",
+    "speaker_high_volume": "🔊",
+    "speaker_low_volume": "🔈",
+    "speaker_medium_volume": "🔉",
+    "speaking_head": "🗣",
+    "speech_balloon": "💬",
+    "speedboat": "🚤",
+    "spider": "🕷",
+    "spider_web": "🕸",
+    "spiral_calendar": "🗓",
+    "spiral_notepad": "🗒",
+    "spiral_shell": "🐚",
+    "spoon": "🥄",
+    "sponge": "🧽",
+    "sport_utility_vehicle": "🚙",
+    "sports_medal": "🏅",
+    "spouting_whale": "🐳",
+    "squid": "🦑",
+    "squinting_face_with_tongue": "😝",
+    "stadium": "🏟",
+    "star-struck": "🤩",
+    "star_and_crescent": "☪",
+    "star_of_david": "✡",
+    "station": "🚉",
+    "steaming_bowl": "🍜",
+    "stethoscope": "🩺",
+    "stop_button": "⏹",
+    "stop_sign": "🛑",
+    "stopwatch": "⏱",
+    "straight_ruler": "📏",
+    "strawberry": "🍓",
+    "studio_microphone": "🎙",
+    "stuffed_flatbread": "🥙",
+    "sun": "☀",
+    "sun_behind_cloud": "⛅",
+    "sun_behind_large_cloud": "🌥",
+    "sun_behind_rain_cloud": "🌦",
+    "sun_behind_small_cloud": "🌤",
+    "sun_with_face": "🌞",
+    "sunflower": "🌻",
+    "sunglasses": "😎",
+    "sunrise": "🌅",
+    "sunrise_over_mountains": "🌄",
+    "sunset": "🌇",
+    "superhero": "🦸",
+    "supervillain": "🦹",
+    "sushi": "🍣",
+    "suspension_railway": "🚟",
+    "swan": "🦢",
+    "sweat_droplets": "💦",
+    "synagogue": "🕍",
+    "syringe": "💉",
+    "t-shirt": "👕",
+    "taco": "🌮",
+    "takeout_box": "🥡",
+    "tanabata_tree": "🎋",
+    "tangerine": "🍊",
+    "taxi": "🚕",
+    "teacup_without_handle": "🍵",
+    "tear-off_calendar": "📆",
+    "teddy_bear": "🧸",
+    "telephone": "☎",
+    "telephone_receiver": "📞",
+    "telescope": "🔭",
+    "television": "📺",
+    "ten-thirty": "🕥",
+    "ten_o’clock": "🕙",
+    "tennis": "🎾",
+    "tent": "⛺",
+    "test_tube": "🧪",
+    "thermometer": "🌡",
+    "thinking_face": "🤔",
+    "thought_balloon": "💭",
+    "thread": "🧵",
+    "three-thirty": "🕞",
+    "three_o’clock": "🕒",
+    "thumbs_down": "👎",
+    "thumbs_down_dark_skin_tone": "👎🏿",
+    "thumbs_down_light_skin_tone": "👎🏻",
+    "thumbs_down_medium-dark_skin_tone": "👎🏾",
+    "thumbs_down_medium-light_skin_tone": "👎🏼",
+    "thumbs_down_medium_skin_tone": "👎🏽",
+    "thumbs_up": "👍",
+    "thumbs_up_dark_skin_tone": "👍🏿",
+    "thumbs_up_light_skin_tone": "👍🏻",
+    "thumbs_up_medium-dark_skin_tone": "👍🏾",
+    "thumbs_up_medium-light_skin_tone": "👍🏼",
+    "thumbs_up_medium_skin_tone": "👍🏽",
+    "ticket": "🎫",
+    "tiger": "🐯",
+    "tiger_face": "🐯",
+    "timer_clock": "⏲",
+    "tired_face": "😫",
+    "toolbox": "🧰",
+    "toilet": "🚽",
+    "tomato": "🍅",
+    "tongue": "👅",
+    "tooth": "🦷",
+    "top_hat": "🎩",
+    "tornado": "🌪",
+    "trackball": "🖲",
+    "tractor": "🚜",
+    "trade_mark": "™",
+    "train": "🚋",
+    "tram": "🚊",
+    "tram_car": "🚋",
+    "triangular_flag": "🚩",
+    "triangular_ruler": "📐",
+    "trident_emblem": "🔱",
+    "trolleybus": "🚎",
+    "trophy": "🏆",
+    "tropical_drink": "🍹",
+    "tropical_fish": "🐠",
+    "trumpet": "🎺",
+    "tulip": "🌷",
+    "tumbler_glass": "🥃",
+    "turtle": "🐢",
+    "twelve-thirty": "🕧",
+    "twelve_o’clock": "🕛",
+    "two-hump_camel": "🐫",
+    "two-thirty": "🕝",
+    "two_hearts": "💕",
+    "two_men_holding_hands": "👬",
+    "two_o’clock": "🕑",
+    "two_women_holding_hands": "👭",
+    "umbrella": "☂",
+    "umbrella_on_ground": "⛱",
+    "umbrella_with_rain_drops": "☔",
+    "unamused_face": "😒",
+    "unicorn_face": "🦄",
+    "unlocked": "🔓",
+    "up-down_arrow": "↕",
+    "up-left_arrow": "↖",
+    "up-right_arrow": "↗",
+    "up_arrow": "⬆",
+    "upside-down_face": "🙃",
+    "upwards_button": "🔼",
+    "vampire": "🧛",
+    "vampire_dark_skin_tone": "🧛🏿",
+    "vampire_light_skin_tone": "🧛🏻",
+    "vampire_medium-dark_skin_tone": "🧛🏾",
+    "vampire_medium-light_skin_tone": "🧛🏼",
+    "vampire_medium_skin_tone": "🧛🏽",
+    "vertical_traffic_light": "🚦",
+    "vibration_mode": "📳",
+    "victory_hand": "✌",
+    "victory_hand_dark_skin_tone": "✌🏿",
+    "victory_hand_light_skin_tone": "✌🏻",
+    "victory_hand_medium-dark_skin_tone": "✌🏾",
+    "victory_hand_medium-light_skin_tone": "✌🏼",
+    "victory_hand_medium_skin_tone": "✌🏽",
+    "video_camera": "📹",
+    "video_game": "🎮",
+    "videocassette": "📼",
+    "violin": "🎻",
+    "volcano": "🌋",
+    "volleyball": "🏐",
+    "vulcan_salute": "🖖",
+    "vulcan_salute_dark_skin_tone": "🖖🏿",
+    "vulcan_salute_light_skin_tone": "🖖🏻",
+    "vulcan_salute_medium-dark_skin_tone": "🖖🏾",
+    "vulcan_salute_medium-light_skin_tone": "🖖🏼",
+    "vulcan_salute_medium_skin_tone": "🖖🏽",
+    "waffle": "🧇",
+    "waning_crescent_moon": "🌘",
+    "waning_gibbous_moon": "🌖",
+    "warning": "⚠",
+    "wastebasket": "🗑",
+    "watch": "⌚",
+    "water_buffalo": "🐃",
+    "water_closet": "🚾",
+    "water_wave": "🌊",
+    "watermelon": "🍉",
+    "waving_hand": "👋",
+    "waving_hand_dark_skin_tone": "👋🏿",
+    "waving_hand_light_skin_tone": "👋🏻",
+    "waving_hand_medium-dark_skin_tone": "👋🏾",
+    "waving_hand_medium-light_skin_tone": "👋🏼",
+    "waving_hand_medium_skin_tone": "👋🏽",
+    "wavy_dash": "〰",
+    "waxing_crescent_moon": "🌒",
+    "waxing_gibbous_moon": "🌔",
+    "weary_cat_face": "🙀",
+    "weary_face": "😩",
+    "wedding": "💒",
+    "whale": "🐳",
+    "wheel_of_dharma": "☸",
+    "wheelchair_symbol": "♿",
+    "white_circle": "⚪",
+    "white_exclamation_mark": "❕",
+    "white_flag": "🏳",
+    "white_flower": "💮",
+    "white_hair": "🦳",
+    "white-haired_man": "👨\u200d🦳",
+    "white-haired_woman": "👩\u200d🦳",
+    "white_heart": "🤍",
+    "white_heavy_check_mark": "✅",
+    "white_large_square": "⬜",
+    "white_medium-small_square": "◽",
+    "white_medium_square": "◻",
+    "white_medium_star": "⭐",
+    "white_question_mark": "❔",
+    "white_small_square": "▫",
+    "white_square_button": "🔳",
+    "wilted_flower": "🥀",
+    "wind_chime": "🎐",
+    "wind_face": "🌬",
+    "wine_glass": "🍷",
+    "winking_face": "😉",
+    "winking_face_with_tongue": "😜",
+    "wolf_face": "🐺",
+    "woman": "👩",
+    "woman_artist": "👩\u200d🎨",
+    "woman_artist_dark_skin_tone": "👩🏿\u200d🎨",
+    "woman_artist_light_skin_tone": "👩🏻\u200d🎨",
+    "woman_artist_medium-dark_skin_tone": "👩🏾\u200d🎨",
+    "woman_artist_medium-light_skin_tone": "👩🏼\u200d🎨",
+    "woman_artist_medium_skin_tone": "👩🏽\u200d🎨",
+    "woman_astronaut": "👩\u200d🚀",
+    "woman_astronaut_dark_skin_tone": "👩🏿\u200d🚀",
+    "woman_astronaut_light_skin_tone": "👩🏻\u200d🚀",
+    "woman_astronaut_medium-dark_skin_tone": "👩🏾\u200d🚀",
+    "woman_astronaut_medium-light_skin_tone": "👩🏼\u200d🚀",
+    "woman_astronaut_medium_skin_tone": "👩🏽\u200d🚀",
+    "woman_biking": "🚴\u200d♀️",
+    "woman_biking_dark_skin_tone": "🚴🏿\u200d♀️",
+    "woman_biking_light_skin_tone": "🚴🏻\u200d♀️",
+    "woman_biking_medium-dark_skin_tone": "🚴🏾\u200d♀️",
+    "woman_biking_medium-light_skin_tone": "🚴🏼\u200d♀️",
+    "woman_biking_medium_skin_tone": "🚴🏽\u200d♀️",
+    "woman_bouncing_ball": "⛹️\u200d♀️",
+    "woman_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♀️",
+    "woman_bouncing_ball_light_skin_tone": "⛹🏻\u200d♀️",
+    "woman_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♀️",
+    "woman_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♀️",
+    "woman_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♀️",
+    "woman_bowing": "🙇\u200d♀️",
+    "woman_bowing_dark_skin_tone": "🙇🏿\u200d♀️",
+    "woman_bowing_light_skin_tone": "🙇🏻\u200d♀️",
+    "woman_bowing_medium-dark_skin_tone": "🙇🏾\u200d♀️",
+    "woman_bowing_medium-light_skin_tone": "🙇🏼\u200d♀️",
+    "woman_bowing_medium_skin_tone": "🙇🏽\u200d♀️",
+    "woman_cartwheeling": "🤸\u200d♀️",
+    "woman_cartwheeling_dark_skin_tone": "🤸🏿\u200d♀️",
+    "woman_cartwheeling_light_skin_tone": "🤸🏻\u200d♀️",
+    "woman_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♀️",
+    "woman_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♀️",
+    "woman_cartwheeling_medium_skin_tone": "🤸🏽\u200d♀️",
+    "woman_climbing": "🧗\u200d♀️",
+    "woman_climbing_dark_skin_tone": "🧗🏿\u200d♀️",
+    "woman_climbing_light_skin_tone": "🧗🏻\u200d♀️",
+    "woman_climbing_medium-dark_skin_tone": "🧗🏾\u200d♀️",
+    "woman_climbing_medium-light_skin_tone": "🧗🏼\u200d♀️",
+    "woman_climbing_medium_skin_tone": "🧗🏽\u200d♀️",
+    "woman_construction_worker": "👷\u200d♀️",
+    "woman_construction_worker_dark_skin_tone": "👷🏿\u200d♀️",
+    "woman_construction_worker_light_skin_tone": "👷🏻\u200d♀️",
+    "woman_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♀️",
+    "woman_construction_worker_medium-light_skin_tone": "👷🏼\u200d♀️",
+    "woman_construction_worker_medium_skin_tone": "👷🏽\u200d♀️",
+    "woman_cook": "👩\u200d🍳",
+    "woman_cook_dark_skin_tone": "👩🏿\u200d🍳",
+    "woman_cook_light_skin_tone": "👩🏻\u200d🍳",
+    "woman_cook_medium-dark_skin_tone": "👩🏾\u200d🍳",
+    "woman_cook_medium-light_skin_tone": "👩🏼\u200d🍳",
+    "woman_cook_medium_skin_tone": "👩🏽\u200d🍳",
+    "woman_dancing": "💃",
+    "woman_dancing_dark_skin_tone": "💃🏿",
+    "woman_dancing_light_skin_tone": "💃🏻",
+    "woman_dancing_medium-dark_skin_tone": "💃🏾",
+    "woman_dancing_medium-light_skin_tone": "💃🏼",
+    "woman_dancing_medium_skin_tone": "💃🏽",
+    "woman_dark_skin_tone": "👩🏿",
+    "woman_detective": "🕵️\u200d♀️",
+    "woman_detective_dark_skin_tone": "🕵🏿\u200d♀️",
+    "woman_detective_light_skin_tone": "🕵🏻\u200d♀️",
+    "woman_detective_medium-dark_skin_tone": "🕵🏾\u200d♀️",
+    "woman_detective_medium-light_skin_tone": "🕵🏼\u200d♀️",
+    "woman_detective_medium_skin_tone": "🕵🏽\u200d♀️",
+    "woman_elf": "🧝\u200d♀️",
+    "woman_elf_dark_skin_tone": "🧝🏿\u200d♀️",
+    "woman_elf_light_skin_tone": "🧝🏻\u200d♀️",
+    "woman_elf_medium-dark_skin_tone": "🧝🏾\u200d♀️",
+    "woman_elf_medium-light_skin_tone": "🧝🏼\u200d♀️",
+    "woman_elf_medium_skin_tone": "🧝🏽\u200d♀️",
+    "woman_facepalming": "🤦\u200d♀️",
+    "woman_facepalming_dark_skin_tone": "🤦🏿\u200d♀️",
+    "woman_facepalming_light_skin_tone": "🤦🏻\u200d♀️",
+    "woman_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♀️",
+    "woman_facepalming_medium-light_skin_tone": "🤦🏼\u200d♀️",
+    "woman_facepalming_medium_skin_tone": "🤦🏽\u200d♀️",
+    "woman_factory_worker": "👩\u200d🏭",
+    "woman_factory_worker_dark_skin_tone": "👩🏿\u200d🏭",
+    "woman_factory_worker_light_skin_tone": "👩🏻\u200d🏭",
+    "woman_factory_worker_medium-dark_skin_tone": "👩🏾\u200d🏭",
+    "woman_factory_worker_medium-light_skin_tone": "👩🏼\u200d🏭",
+    "woman_factory_worker_medium_skin_tone": "👩🏽\u200d🏭",
+    "woman_fairy": "🧚\u200d♀️",
+    "woman_fairy_dark_skin_tone": "🧚🏿\u200d♀️",
+    "woman_fairy_light_skin_tone": "🧚🏻\u200d♀️",
+    "woman_fairy_medium-dark_skin_tone": "🧚🏾\u200d♀️",
+    "woman_fairy_medium-light_skin_tone": "🧚🏼\u200d♀️",
+    "woman_fairy_medium_skin_tone": "🧚🏽\u200d♀️",
+    "woman_farmer": "👩\u200d🌾",
+    "woman_farmer_dark_skin_tone": "👩🏿\u200d🌾",
+    "woman_farmer_light_skin_tone": "👩🏻\u200d🌾",
+    "woman_farmer_medium-dark_skin_tone": "👩🏾\u200d🌾",
+    "woman_farmer_medium-light_skin_tone": "👩🏼\u200d🌾",
+    "woman_farmer_medium_skin_tone": "👩🏽\u200d🌾",
+    "woman_firefighter": "👩\u200d🚒",
+    "woman_firefighter_dark_skin_tone": "👩🏿\u200d🚒",
+    "woman_firefighter_light_skin_tone": "👩🏻\u200d🚒",
+    "woman_firefighter_medium-dark_skin_tone": "👩🏾\u200d🚒",
+    "woman_firefighter_medium-light_skin_tone": "👩🏼\u200d🚒",
+    "woman_firefighter_medium_skin_tone": "👩🏽\u200d🚒",
+    "woman_frowning": "🙍\u200d♀️",
+    "woman_frowning_dark_skin_tone": "🙍🏿\u200d♀️",
+    "woman_frowning_light_skin_tone": "🙍🏻\u200d♀️",
+    "woman_frowning_medium-dark_skin_tone": "🙍🏾\u200d♀️",
+    "woman_frowning_medium-light_skin_tone": "🙍🏼\u200d♀️",
+    "woman_frowning_medium_skin_tone": "🙍🏽\u200d♀️",
+    "woman_genie": "🧞\u200d♀️",
+    "woman_gesturing_no": "🙅\u200d♀️",
+    "woman_gesturing_no_dark_skin_tone": "🙅🏿\u200d♀️",
+    "woman_gesturing_no_light_skin_tone": "🙅🏻\u200d♀️",
+    "woman_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♀️",
+    "woman_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♀️",
+    "woman_gesturing_no_medium_skin_tone": "🙅🏽\u200d♀️",
+    "woman_gesturing_ok": "🙆\u200d♀️",
+    "woman_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♀️",
+    "woman_gesturing_ok_light_skin_tone": "🙆🏻\u200d♀️",
+    "woman_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♀️",
+    "woman_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♀️",
+    "woman_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♀️",
+    "woman_getting_haircut": "💇\u200d♀️",
+    "woman_getting_haircut_dark_skin_tone": "💇🏿\u200d♀️",
+    "woman_getting_haircut_light_skin_tone": "💇🏻\u200d♀️",
+    "woman_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♀️",
+    "woman_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♀️",
+    "woman_getting_haircut_medium_skin_tone": "💇🏽\u200d♀️",
+    "woman_getting_massage": "💆\u200d♀️",
+    "woman_getting_massage_dark_skin_tone": "💆🏿\u200d♀️",
+    "woman_getting_massage_light_skin_tone": "💆🏻\u200d♀️",
+    "woman_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♀️",
+    "woman_getting_massage_medium-light_skin_tone": "💆🏼\u200d♀️",
+    "woman_getting_massage_medium_skin_tone": "💆🏽\u200d♀️",
+    "woman_golfing": "🏌️\u200d♀️",
+    "woman_golfing_dark_skin_tone": "🏌🏿\u200d♀️",
+    "woman_golfing_light_skin_tone": "🏌🏻\u200d♀️",
+    "woman_golfing_medium-dark_skin_tone": "🏌🏾\u200d♀️",
+    "woman_golfing_medium-light_skin_tone": "🏌🏼\u200d♀️",
+    "woman_golfing_medium_skin_tone": "🏌🏽\u200d♀️",
+    "woman_guard": "💂\u200d♀️",
+    "woman_guard_dark_skin_tone": "💂🏿\u200d♀️",
+    "woman_guard_light_skin_tone": "💂🏻\u200d♀️",
+    "woman_guard_medium-dark_skin_tone": "💂🏾\u200d♀️",
+    "woman_guard_medium-light_skin_tone": "💂🏼\u200d♀️",
+    "woman_guard_medium_skin_tone": "💂🏽\u200d♀️",
+    "woman_health_worker": "👩\u200d⚕️",
+    "woman_health_worker_dark_skin_tone": "👩🏿\u200d⚕️",
+    "woman_health_worker_light_skin_tone": "👩🏻\u200d⚕️",
+    "woman_health_worker_medium-dark_skin_tone": "👩🏾\u200d⚕️",
+    "woman_health_worker_medium-light_skin_tone": "👩🏼\u200d⚕️",
+    "woman_health_worker_medium_skin_tone": "👩🏽\u200d⚕️",
+    "woman_in_lotus_position": "🧘\u200d♀️",
+    "woman_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♀️",
+    "woman_in_lotus_position_light_skin_tone": "🧘🏻\u200d♀️",
+    "woman_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♀️",
+    "woman_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♀️",
+    "woman_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♀️",
+    "woman_in_manual_wheelchair": "👩\u200d🦽",
+    "woman_in_motorized_wheelchair": "👩\u200d🦼",
+    "woman_in_steamy_room": "🧖\u200d♀️",
+    "woman_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♀️",
+    "woman_in_steamy_room_light_skin_tone": "🧖🏻\u200d♀️",
+    "woman_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♀️",
+    "woman_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♀️",
+    "woman_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♀️",
+    "woman_judge": "👩\u200d⚖️",
+    "woman_judge_dark_skin_tone": "👩🏿\u200d⚖️",
+    "woman_judge_light_skin_tone": "👩🏻\u200d⚖️",
+    "woman_judge_medium-dark_skin_tone": "👩🏾\u200d⚖️",
+    "woman_judge_medium-light_skin_tone": "👩🏼\u200d⚖️",
+    "woman_judge_medium_skin_tone": "👩🏽\u200d⚖️",
+    "woman_juggling": "🤹\u200d♀️",
+    "woman_juggling_dark_skin_tone": "🤹🏿\u200d♀️",
+    "woman_juggling_light_skin_tone": "🤹🏻\u200d♀️",
+    "woman_juggling_medium-dark_skin_tone": "🤹🏾\u200d♀️",
+    "woman_juggling_medium-light_skin_tone": "🤹🏼\u200d♀️",
+    "woman_juggling_medium_skin_tone": "🤹🏽\u200d♀️",
+    "woman_lifting_weights": "🏋️\u200d♀️",
+    "woman_lifting_weights_dark_skin_tone": "🏋🏿\u200d♀️",
+    "woman_lifting_weights_light_skin_tone": "🏋🏻\u200d♀️",
+    "woman_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♀️",
+    "woman_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♀️",
+    "woman_lifting_weights_medium_skin_tone": "🏋🏽\u200d♀️",
+    "woman_light_skin_tone": "👩🏻",
+    "woman_mage": "🧙\u200d♀️",
+    "woman_mage_dark_skin_tone": "🧙🏿\u200d♀️",
+    "woman_mage_light_skin_tone": "🧙🏻\u200d♀️",
+    "woman_mage_medium-dark_skin_tone": "🧙🏾\u200d♀️",
+    "woman_mage_medium-light_skin_tone": "🧙🏼\u200d♀️",
+    "woman_mage_medium_skin_tone": "🧙🏽\u200d♀️",
+    "woman_mechanic": "👩\u200d🔧",
+    "woman_mechanic_dark_skin_tone": "👩🏿\u200d🔧",
+    "woman_mechanic_light_skin_tone": "👩🏻\u200d🔧",
+    "woman_mechanic_medium-dark_skin_tone": "👩🏾\u200d🔧",
+    "woman_mechanic_medium-light_skin_tone": "👩🏼\u200d🔧",
+    "woman_mechanic_medium_skin_tone": "👩🏽\u200d🔧",
+    "woman_medium-dark_skin_tone": "👩🏾",
+    "woman_medium-light_skin_tone": "👩🏼",
+    "woman_medium_skin_tone": "👩🏽",
+    "woman_mountain_biking": "🚵\u200d♀️",
+    "woman_mountain_biking_dark_skin_tone": "🚵🏿\u200d♀️",
+    "woman_mountain_biking_light_skin_tone": "🚵🏻\u200d♀️",
+    "woman_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♀️",
+    "woman_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♀️",
+    "woman_mountain_biking_medium_skin_tone": "🚵🏽\u200d♀️",
+    "woman_office_worker": "👩\u200d💼",
+    "woman_office_worker_dark_skin_tone": "👩🏿\u200d💼",
+    "woman_office_worker_light_skin_tone": "👩🏻\u200d💼",
+    "woman_office_worker_medium-dark_skin_tone": "👩🏾\u200d💼",
+    "woman_office_worker_medium-light_skin_tone": "👩🏼\u200d💼",
+    "woman_office_worker_medium_skin_tone": "👩🏽\u200d💼",
+    "woman_pilot": "👩\u200d✈️",
+    "woman_pilot_dark_skin_tone": "👩🏿\u200d✈️",
+    "woman_pilot_light_skin_tone": "👩🏻\u200d✈️",
+    "woman_pilot_medium-dark_skin_tone": "👩🏾\u200d✈️",
+    "woman_pilot_medium-light_skin_tone": "👩🏼\u200d✈️",
+    "woman_pilot_medium_skin_tone": "👩🏽\u200d✈️",
+    "woman_playing_handball": "🤾\u200d♀️",
+    "woman_playing_handball_dark_skin_tone": "🤾🏿\u200d♀️",
+    "woman_playing_handball_light_skin_tone": "🤾🏻\u200d♀️",
+    "woman_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♀️",
+    "woman_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♀️",
+    "woman_playing_handball_medium_skin_tone": "🤾🏽\u200d♀️",
+    "woman_playing_water_polo": "🤽\u200d♀️",
+    "woman_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♀️",
+    "woman_playing_water_polo_light_skin_tone": "🤽🏻\u200d♀️",
+    "woman_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♀️",
+    "woman_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♀️",
+    "woman_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♀️",
+    "woman_police_officer": "👮\u200d♀️",
+    "woman_police_officer_dark_skin_tone": "👮🏿\u200d♀️",
+    "woman_police_officer_light_skin_tone": "👮🏻\u200d♀️",
+    "woman_police_officer_medium-dark_skin_tone": "👮🏾\u200d♀️",
+    "woman_police_officer_medium-light_skin_tone": "👮🏼\u200d♀️",
+    "woman_police_officer_medium_skin_tone": "👮🏽\u200d♀️",
+    "woman_pouting": "🙎\u200d♀️",
+    "woman_pouting_dark_skin_tone": "🙎🏿\u200d♀️",
+    "woman_pouting_light_skin_tone": "🙎🏻\u200d♀️",
+    "woman_pouting_medium-dark_skin_tone": "🙎🏾\u200d♀️",
+    "woman_pouting_medium-light_skin_tone": "🙎🏼\u200d♀️",
+    "woman_pouting_medium_skin_tone": "🙎🏽\u200d♀️",
+    "woman_raising_hand": "🙋\u200d♀️",
+    "woman_raising_hand_dark_skin_tone": "🙋🏿\u200d♀️",
+    "woman_raising_hand_light_skin_tone": "🙋🏻\u200d♀️",
+    "woman_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♀️",
+    "woman_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♀️",
+    "woman_raising_hand_medium_skin_tone": "🙋🏽\u200d♀️",
+    "woman_rowing_boat": "🚣\u200d♀️",
+    "woman_rowing_boat_dark_skin_tone": "🚣🏿\u200d♀️",
+    "woman_rowing_boat_light_skin_tone": "🚣🏻\u200d♀️",
+    "woman_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♀️",
+    "woman_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♀️",
+    "woman_rowing_boat_medium_skin_tone": "🚣🏽\u200d♀️",
+    "woman_running": "🏃\u200d♀️",
+    "woman_running_dark_skin_tone": "🏃🏿\u200d♀️",
+    "woman_running_light_skin_tone": "🏃🏻\u200d♀️",
+    "woman_running_medium-dark_skin_tone": "🏃🏾\u200d♀️",
+    "woman_running_medium-light_skin_tone": "🏃🏼\u200d♀️",
+    "woman_running_medium_skin_tone": "🏃🏽\u200d♀️",
+    "woman_scientist": "👩\u200d🔬",
+    "woman_scientist_dark_skin_tone": "👩🏿\u200d🔬",
+    "woman_scientist_light_skin_tone": "👩🏻\u200d🔬",
+    "woman_scientist_medium-dark_skin_tone": "👩🏾\u200d🔬",
+    "woman_scientist_medium-light_skin_tone": "👩🏼\u200d🔬",
+    "woman_scientist_medium_skin_tone": "👩🏽\u200d🔬",
+    "woman_shrugging": "🤷\u200d♀️",
+    "woman_shrugging_dark_skin_tone": "🤷🏿\u200d♀️",
+    "woman_shrugging_light_skin_tone": "🤷🏻\u200d♀️",
+    "woman_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♀️",
+    "woman_shrugging_medium-light_skin_tone": "🤷🏼\u200d♀️",
+    "woman_shrugging_medium_skin_tone": "🤷🏽\u200d♀️",
+    "woman_singer": "👩\u200d🎤",
+    "woman_singer_dark_skin_tone": "👩🏿\u200d🎤",
+    "woman_singer_light_skin_tone": "👩🏻\u200d🎤",
+    "woman_singer_medium-dark_skin_tone": "👩🏾\u200d🎤",
+    "woman_singer_medium-light_skin_tone": "👩🏼\u200d🎤",
+    "woman_singer_medium_skin_tone": "👩🏽\u200d🎤",
+    "woman_student": "👩\u200d🎓",
+    "woman_student_dark_skin_tone": "👩🏿\u200d🎓",
+    "woman_student_light_skin_tone": "👩🏻\u200d🎓",
+    "woman_student_medium-dark_skin_tone": "👩🏾\u200d🎓",
+    "woman_student_medium-light_skin_tone": "👩🏼\u200d🎓",
+    "woman_student_medium_skin_tone": "👩🏽\u200d🎓",
+    "woman_surfing": "🏄\u200d♀️",
+    "woman_surfing_dark_skin_tone": "🏄🏿\u200d♀️",
+    "woman_surfing_light_skin_tone": "🏄🏻\u200d♀️",
+    "woman_surfing_medium-dark_skin_tone": "🏄🏾\u200d♀️",
+    "woman_surfing_medium-light_skin_tone": "🏄🏼\u200d♀️",
+    "woman_surfing_medium_skin_tone": "🏄🏽\u200d♀️",
+    "woman_swimming": "🏊\u200d♀️",
+    "woman_swimming_dark_skin_tone": "🏊🏿\u200d♀️",
+    "woman_swimming_light_skin_tone": "🏊🏻\u200d♀️",
+    "woman_swimming_medium-dark_skin_tone": "🏊🏾\u200d♀️",
+    "woman_swimming_medium-light_skin_tone": "🏊🏼\u200d♀️",
+    "woman_swimming_medium_skin_tone": "🏊🏽\u200d♀️",
+    "woman_teacher": "👩\u200d🏫",
+    "woman_teacher_dark_skin_tone": "👩🏿\u200d🏫",
+    "woman_teacher_light_skin_tone": "👩🏻\u200d🏫",
+    "woman_teacher_medium-dark_skin_tone": "👩🏾\u200d🏫",
+    "woman_teacher_medium-light_skin_tone": "👩🏼\u200d🏫",
+    "woman_teacher_medium_skin_tone": "👩🏽\u200d🏫",
+    "woman_technologist": "👩\u200d💻",
+    "woman_technologist_dark_skin_tone": "👩🏿\u200d💻",
+    "woman_technologist_light_skin_tone": "👩🏻\u200d💻",
+    "woman_technologist_medium-dark_skin_tone": "👩🏾\u200d💻",
+    "woman_technologist_medium-light_skin_tone": "👩🏼\u200d💻",
+    "woman_technologist_medium_skin_tone": "👩🏽\u200d💻",
+    "woman_tipping_hand": "💁\u200d♀️",
+    "woman_tipping_hand_dark_skin_tone": "💁🏿\u200d♀️",
+    "woman_tipping_hand_light_skin_tone": "💁🏻\u200d♀️",
+    "woman_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♀️",
+    "woman_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♀️",
+    "woman_tipping_hand_medium_skin_tone": "💁🏽\u200d♀️",
+    "woman_vampire": "🧛\u200d♀️",
+    "woman_vampire_dark_skin_tone": "🧛🏿\u200d♀️",
+    "woman_vampire_light_skin_tone": "🧛🏻\u200d♀️",
+    "woman_vampire_medium-dark_skin_tone": "🧛🏾\u200d♀️",
+    "woman_vampire_medium-light_skin_tone": "🧛🏼\u200d♀️",
+    "woman_vampire_medium_skin_tone": "🧛🏽\u200d♀️",
+    "woman_walking": "🚶\u200d♀️",
+    "woman_walking_dark_skin_tone": "🚶🏿\u200d♀️",
+    "woman_walking_light_skin_tone": "🚶🏻\u200d♀️",
+    "woman_walking_medium-dark_skin_tone": "🚶🏾\u200d♀️",
+    "woman_walking_medium-light_skin_tone": "🚶🏼\u200d♀️",
+    "woman_walking_medium_skin_tone": "🚶🏽\u200d♀️",
+    "woman_wearing_turban": "👳\u200d♀️",
+    "woman_wearing_turban_dark_skin_tone": "👳🏿\u200d♀️",
+    "woman_wearing_turban_light_skin_tone": "👳🏻\u200d♀️",
+    "woman_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♀️",
+    "woman_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♀️",
+    "woman_wearing_turban_medium_skin_tone": "👳🏽\u200d♀️",
+    "woman_with_headscarf": "🧕",
+    "woman_with_headscarf_dark_skin_tone": "🧕🏿",
+    "woman_with_headscarf_light_skin_tone": "🧕🏻",
+    "woman_with_headscarf_medium-dark_skin_tone": "🧕🏾",
+    "woman_with_headscarf_medium-light_skin_tone": "🧕🏼",
+    "woman_with_headscarf_medium_skin_tone": "🧕🏽",
+    "woman_with_probing_cane": "👩\u200d🦯",
+    "woman_zombie": "🧟\u200d♀️",
+    "woman’s_boot": "👢",
+    "woman’s_clothes": "👚",
+    "woman’s_hat": "👒",
+    "woman’s_sandal": "👡",
+    "women_with_bunny_ears": "👯\u200d♀️",
+    "women_wrestling": "🤼\u200d♀️",
+    "women’s_room": "🚺",
+    "woozy_face": "🥴",
+    "world_map": "🗺",
+    "worried_face": "😟",
+    "wrapped_gift": "🎁",
+    "wrench": "🔧",
+    "writing_hand": "✍",
+    "writing_hand_dark_skin_tone": "✍🏿",
+    "writing_hand_light_skin_tone": "✍🏻",
+    "writing_hand_medium-dark_skin_tone": "✍🏾",
+    "writing_hand_medium-light_skin_tone": "✍🏼",
+    "writing_hand_medium_skin_tone": "✍🏽",
+    "yarn": "🧶",
+    "yawning_face": "🥱",
+    "yellow_circle": "🟡",
+    "yellow_heart": "💛",
+    "yellow_square": "🟨",
+    "yen_banknote": "💴",
+    "yo-yo": "🪀",
+    "yin_yang": "☯",
+    "zany_face": "🤪",
+    "zebra": "🦓",
+    "zipper-mouth_face": "🤐",
+    "zombie": "🧟",
+    "zzz": "💤",
+    "åland_islands": "🇦🇽",
+    "keycap_asterisk": "*⃣",
+    "keycap_digit_eight": "8⃣",
+    "keycap_digit_five": "5⃣",
+    "keycap_digit_four": "4⃣",
+    "keycap_digit_nine": "9⃣",
+    "keycap_digit_one": "1⃣",
+    "keycap_digit_seven": "7⃣",
+    "keycap_digit_six": "6⃣",
+    "keycap_digit_three": "3⃣",
+    "keycap_digit_two": "2⃣",
+    "keycap_digit_zero": "0⃣",
+    "keycap_number_sign": "#⃣",
+    "light_skin_tone": "🏻",
+    "medium_light_skin_tone": "🏼",
+    "medium_skin_tone": "🏽",
+    "medium_dark_skin_tone": "🏾",
+    "dark_skin_tone": "🏿",
+    "regional_indicator_symbol_letter_a": "🇦",
+    "regional_indicator_symbol_letter_b": "🇧",
+    "regional_indicator_symbol_letter_c": "🇨",
+    "regional_indicator_symbol_letter_d": "🇩",
+    "regional_indicator_symbol_letter_e": "🇪",
+    "regional_indicator_symbol_letter_f": "🇫",
+    "regional_indicator_symbol_letter_g": "🇬",
+    "regional_indicator_symbol_letter_h": "🇭",
+    "regional_indicator_symbol_letter_i": "🇮",
+    "regional_indicator_symbol_letter_j": "🇯",
+    "regional_indicator_symbol_letter_k": "🇰",
+    "regional_indicator_symbol_letter_l": "🇱",
+    "regional_indicator_symbol_letter_m": "🇲",
+    "regional_indicator_symbol_letter_n": "🇳",
+    "regional_indicator_symbol_letter_o": "🇴",
+    "regional_indicator_symbol_letter_p": "🇵",
+    "regional_indicator_symbol_letter_q": "🇶",
+    "regional_indicator_symbol_letter_r": "🇷",
+    "regional_indicator_symbol_letter_s": "🇸",
+    "regional_indicator_symbol_letter_t": "🇹",
+    "regional_indicator_symbol_letter_u": "🇺",
+    "regional_indicator_symbol_letter_v": "🇻",
+    "regional_indicator_symbol_letter_w": "🇼",
+    "regional_indicator_symbol_letter_x": "🇽",
+    "regional_indicator_symbol_letter_y": "🇾",
+    "regional_indicator_symbol_letter_z": "🇿",
+    "airplane_arriving": "🛬",
+    "space_invader": "👾",
+    "football": "🏈",
+    "anger": "💢",
+    "angry": "😠",
+    "anguished": "😧",
+    "signal_strength": "📶",
+    "arrows_counterclockwise": "🔄",
+    "arrow_heading_down": "⤵",
+    "arrow_heading_up": "⤴",
+    "art": "🎨",
+    "astonished": "😲",
+    "athletic_shoe": "👟",
+    "atm": "🏧",
+    "car": "🚗",
+    "red_car": "🚗",
+    "angel": "👼",
+    "back": "🔙",
+    "badminton_racquet_and_shuttlecock": "🏸",
+    "dollar": "💵",
+    "euro": "💶",
+    "pound": "💷",
+    "yen": "💴",
+    "barber": "💈",
+    "bath": "🛀",
+    "bear": "🐻",
+    "heartbeat": "💓",
+    "beer": "🍺",
+    "no_bell": "🔕",
+    "bento": "🍱",
+    "bike": "🚲",
+    "bicyclist": "🚴",
+    "8ball": "🎱",
+    "biohazard_sign": "☣",
+    "birthday": "🎂",
+    "black_circle_for_record": "⏺",
+    "clubs": "♣",
+    "diamonds": "♦",
+    "arrow_double_down": "⏬",
+    "hearts": "♥",
+    "rewind": "⏪",
+    "black_left__pointing_double_triangle_with_vertical_bar": "⏮",
+    "arrow_backward": "◀",
+    "black_medium_small_square": "◾",
+    "question": "❓",
+    "fast_forward": "⏩",
+    "black_right__pointing_double_triangle_with_vertical_bar": "⏭",
+    "arrow_forward": "▶",
+    "black_right__pointing_triangle_with_double_vertical_bar": "⏯",
+    "arrow_right": "➡",
+    "spades": "♠",
+    "black_square_for_stop": "⏹",
+    "sunny": "☀",
+    "phone": "☎",
+    "recycle": "♻",
+    "arrow_double_up": "⏫",
+    "busstop": "🚏",
+    "date": "📅",
+    "flags": "🎏",
+    "cat2": "🐈",
+    "joy_cat": "😹",
+    "smirk_cat": "😼",
+    "chart_with_downwards_trend": "📉",
+    "chart_with_upwards_trend": "📈",
+    "chart": "💹",
+    "mega": "📣",
+    "checkered_flag": "🏁",
+    "accept": "🉑",
+    "ideograph_advantage": "🉐",
+    "congratulations": "㊗",
+    "secret": "㊙",
+    "m": "Ⓜ",
+    "city_sunset": "🌆",
+    "clapper": "🎬",
+    "clap": "👏",
+    "beers": "🍻",
+    "clock830": "🕣",
+    "clock8": "🕗",
+    "clock1130": "🕦",
+    "clock11": "🕚",
+    "clock530": "🕠",
+    "clock5": "🕔",
+    "clock430": "🕟",
+    "clock4": "🕓",
+    "clock930": "🕤",
+    "clock9": "🕘",
+    "clock130": "🕜",
+    "clock1": "🕐",
+    "clock730": "🕢",
+    "clock7": "🕖",
+    "clock630": "🕡",
+    "clock6": "🕕",
+    "clock1030": "🕥",
+    "clock10": "🕙",
+    "clock330": "🕞",
+    "clock3": "🕒",
+    "clock1230": "🕧",
+    "clock12": "🕛",
+    "clock230": "🕝",
+    "clock2": "🕑",
+    "arrows_clockwise": "🔃",
+    "repeat": "🔁",
+    "repeat_one": "🔂",
+    "closed_lock_with_key": "🔐",
+    "mailbox_closed": "📪",
+    "mailbox": "📫",
+    "cloud_with_tornado": "🌪",
+    "cocktail": "🍸",
+    "boom": "💥",
+    "compression": "🗜",
+    "confounded": "😖",
+    "confused": "😕",
+    "rice": "🍚",
+    "cow2": "🐄",
+    "cricket_bat_and_ball": "🏏",
+    "x": "❌",
+    "cry": "😢",
+    "curry": "🍛",
+    "dagger_knife": "🗡",
+    "dancer": "💃",
+    "dark_sunglasses": "🕶",
+    "dash": "💨",
+    "truck": "🚚",
+    "derelict_house_building": "🏚",
+    "diamond_shape_with_a_dot_inside": "💠",
+    "dart": "🎯",
+    "disappointed_relieved": "😥",
+    "disappointed": "😞",
+    "do_not_litter": "🚯",
+    "dog2": "🐕",
+    "flipper": "🐬",
+    "loop": "➿",
+    "bangbang": "‼",
+    "double_vertical_bar": "⏸",
+    "dove_of_peace": "🕊",
+    "small_red_triangle_down": "🔻",
+    "arrow_down_small": "🔽",
+    "arrow_down": "⬇",
+    "dromedary_camel": "🐪",
+    "e__mail": "📧",
+    "corn": "🌽",
+    "ear_of_rice": "🌾",
+    "earth_americas": "🌎",
+    "earth_asia": "🌏",
+    "earth_africa": "🌍",
+    "eight_pointed_black_star": "✴",
+    "eight_spoked_asterisk": "✳",
+    "eject_symbol": "⏏",
+    "bulb": "💡",
+    "emoji_modifier_fitzpatrick_type__1__2": "🏻",
+    "emoji_modifier_fitzpatrick_type__3": "🏼",
+    "emoji_modifier_fitzpatrick_type__4": "🏽",
+    "emoji_modifier_fitzpatrick_type__5": "🏾",
+    "emoji_modifier_fitzpatrick_type__6": "🏿",
+    "end": "🔚",
+    "email": "✉",
+    "european_castle": "🏰",
+    "european_post_office": "🏤",
+    "interrobang": "⁉",
+    "expressionless": "😑",
+    "eyeglasses": "👓",
+    "massage": "💆",
+    "yum": "😋",
+    "scream": "😱",
+    "kissing_heart": "😘",
+    "sweat": "😓",
+    "face_with_head__bandage": "🤕",
+    "triumph": "😤",
+    "mask": "😷",
+    "no_good": "🙅",
+    "ok_woman": "🙆",
+    "open_mouth": "😮",
+    "cold_sweat": "😰",
+    "stuck_out_tongue": "😛",
+    "stuck_out_tongue_closed_eyes": "😝",
+    "stuck_out_tongue_winking_eye": "😜",
+    "joy": "😂",
+    "no_mouth": "😶",
+    "santa": "🎅",
+    "fax": "📠",
+    "fearful": "😨",
+    "field_hockey_stick_and_ball": "🏑",
+    "first_quarter_moon_with_face": "🌛",
+    "fish_cake": "🍥",
+    "fishing_pole_and_fish": "🎣",
+    "facepunch": "👊",
+    "punch": "👊",
+    "flag_for_afghanistan": "🇦🇫",
+    "flag_for_albania": "🇦🇱",
+    "flag_for_algeria": "🇩🇿",
+    "flag_for_american_samoa": "🇦🇸",
+    "flag_for_andorra": "🇦🇩",
+    "flag_for_angola": "🇦🇴",
+    "flag_for_anguilla": "🇦🇮",
+    "flag_for_antarctica": "🇦🇶",
+    "flag_for_antigua_&_barbuda": "🇦🇬",
+    "flag_for_argentina": "🇦🇷",
+    "flag_for_armenia": "🇦🇲",
+    "flag_for_aruba": "🇦🇼",
+    "flag_for_ascension_island": "🇦🇨",
+    "flag_for_australia": "🇦🇺",
+    "flag_for_austria": "🇦🇹",
+    "flag_for_azerbaijan": "🇦🇿",
+    "flag_for_bahamas": "🇧🇸",
+    "flag_for_bahrain": "🇧🇭",
+    "flag_for_bangladesh": "🇧🇩",
+    "flag_for_barbados": "🇧🇧",
+    "flag_for_belarus": "🇧🇾",
+    "flag_for_belgium": "🇧🇪",
+    "flag_for_belize": "🇧🇿",
+    "flag_for_benin": "🇧🇯",
+    "flag_for_bermuda": "🇧🇲",
+    "flag_for_bhutan": "🇧🇹",
+    "flag_for_bolivia": "🇧🇴",
+    "flag_for_bosnia_&_herzegovina": "🇧🇦",
+    "flag_for_botswana": "🇧🇼",
+    "flag_for_bouvet_island": "🇧🇻",
+    "flag_for_brazil": "🇧🇷",
+    "flag_for_british_indian_ocean_territory": "🇮🇴",
+    "flag_for_british_virgin_islands": "🇻🇬",
+    "flag_for_brunei": "🇧🇳",
+    "flag_for_bulgaria": "🇧🇬",
+    "flag_for_burkina_faso": "🇧🇫",
+    "flag_for_burundi": "🇧🇮",
+    "flag_for_cambodia": "🇰🇭",
+    "flag_for_cameroon": "🇨🇲",
+    "flag_for_canada": "🇨🇦",
+    "flag_for_canary_islands": "🇮🇨",
+    "flag_for_cape_verde": "🇨🇻",
+    "flag_for_caribbean_netherlands": "🇧🇶",
+    "flag_for_cayman_islands": "🇰🇾",
+    "flag_for_central_african_republic": "🇨🇫",
+    "flag_for_ceuta_&_melilla": "🇪🇦",
+    "flag_for_chad": "🇹🇩",
+    "flag_for_chile": "🇨🇱",
+    "flag_for_china": "🇨🇳",
+    "flag_for_christmas_island": "🇨🇽",
+    "flag_for_clipperton_island": "🇨🇵",
+    "flag_for_cocos__islands": "🇨🇨",
+    "flag_for_colombia": "🇨🇴",
+    "flag_for_comoros": "🇰🇲",
+    "flag_for_congo____brazzaville": "🇨🇬",
+    "flag_for_congo____kinshasa": "🇨🇩",
+    "flag_for_cook_islands": "🇨🇰",
+    "flag_for_costa_rica": "🇨🇷",
+    "flag_for_croatia": "🇭🇷",
+    "flag_for_cuba": "🇨🇺",
+    "flag_for_curaçao": "🇨🇼",
+    "flag_for_cyprus": "🇨🇾",
+    "flag_for_czech_republic": "🇨🇿",
+    "flag_for_côte_d’ivoire": "🇨🇮",
+    "flag_for_denmark": "🇩🇰",
+    "flag_for_diego_garcia": "🇩🇬",
+    "flag_for_djibouti": "🇩🇯",
+    "flag_for_dominica": "🇩🇲",
+    "flag_for_dominican_republic": "🇩🇴",
+    "flag_for_ecuador": "🇪🇨",
+    "flag_for_egypt": "🇪🇬",
+    "flag_for_el_salvador": "🇸🇻",
+    "flag_for_equatorial_guinea": "🇬🇶",
+    "flag_for_eritrea": "🇪🇷",
+    "flag_for_estonia": "🇪🇪",
+    "flag_for_ethiopia": "🇪🇹",
+    "flag_for_european_union": "🇪🇺",
+    "flag_for_falkland_islands": "🇫🇰",
+    "flag_for_faroe_islands": "🇫🇴",
+    "flag_for_fiji": "🇫🇯",
+    "flag_for_finland": "🇫🇮",
+    "flag_for_france": "🇫🇷",
+    "flag_for_french_guiana": "🇬🇫",
+    "flag_for_french_polynesia": "🇵🇫",
+    "flag_for_french_southern_territories": "🇹🇫",
+    "flag_for_gabon": "🇬🇦",
+    "flag_for_gambia": "🇬🇲",
+    "flag_for_georgia": "🇬🇪",
+    "flag_for_germany": "🇩🇪",
+    "flag_for_ghana": "🇬🇭",
+    "flag_for_gibraltar": "🇬🇮",
+    "flag_for_greece": "🇬🇷",
+    "flag_for_greenland": "🇬🇱",
+    "flag_for_grenada": "🇬🇩",
+    "flag_for_guadeloupe": "🇬🇵",
+    "flag_for_guam": "🇬🇺",
+    "flag_for_guatemala": "🇬🇹",
+    "flag_for_guernsey": "🇬🇬",
+    "flag_for_guinea": "🇬🇳",
+    "flag_for_guinea__bissau": "🇬🇼",
+    "flag_for_guyana": "🇬🇾",
+    "flag_for_haiti": "🇭🇹",
+    "flag_for_heard_&_mcdonald_islands": "🇭🇲",
+    "flag_for_honduras": "🇭🇳",
+    "flag_for_hong_kong": "🇭🇰",
+    "flag_for_hungary": "🇭🇺",
+    "flag_for_iceland": "🇮🇸",
+    "flag_for_india": "🇮🇳",
+    "flag_for_indonesia": "🇮🇩",
+    "flag_for_iran": "🇮🇷",
+    "flag_for_iraq": "🇮🇶",
+    "flag_for_ireland": "🇮🇪",
+    "flag_for_isle_of_man": "🇮🇲",
+    "flag_for_israel": "🇮🇱",
+    "flag_for_italy": "🇮🇹",
+    "flag_for_jamaica": "🇯🇲",
+    "flag_for_japan": "🇯🇵",
+    "flag_for_jersey": "🇯🇪",
+    "flag_for_jordan": "🇯🇴",
+    "flag_for_kazakhstan": "🇰🇿",
+    "flag_for_kenya": "🇰🇪",
+    "flag_for_kiribati": "🇰🇮",
+    "flag_for_kosovo": "🇽🇰",
+    "flag_for_kuwait": "🇰🇼",
+    "flag_for_kyrgyzstan": "🇰🇬",
+    "flag_for_laos": "🇱🇦",
+    "flag_for_latvia": "🇱🇻",
+    "flag_for_lebanon": "🇱🇧",
+    "flag_for_lesotho": "🇱🇸",
+    "flag_for_liberia": "🇱🇷",
+    "flag_for_libya": "🇱🇾",
+    "flag_for_liechtenstein": "🇱🇮",
+    "flag_for_lithuania": "🇱🇹",
+    "flag_for_luxembourg": "🇱🇺",
+    "flag_for_macau": "🇲🇴",
+    "flag_for_macedonia": "🇲🇰",
+    "flag_for_madagascar": "🇲🇬",
+    "flag_for_malawi": "🇲🇼",
+    "flag_for_malaysia": "🇲🇾",
+    "flag_for_maldives": "🇲🇻",
+    "flag_for_mali": "🇲🇱",
+    "flag_for_malta": "🇲🇹",
+    "flag_for_marshall_islands": "🇲🇭",
+    "flag_for_martinique": "🇲🇶",
+    "flag_for_mauritania": "🇲🇷",
+    "flag_for_mauritius": "🇲🇺",
+    "flag_for_mayotte": "🇾🇹",
+    "flag_for_mexico": "🇲🇽",
+    "flag_for_micronesia": "🇫🇲",
+    "flag_for_moldova": "🇲🇩",
+    "flag_for_monaco": "🇲🇨",
+    "flag_for_mongolia": "🇲🇳",
+    "flag_for_montenegro": "🇲🇪",
+    "flag_for_montserrat": "🇲🇸",
+    "flag_for_morocco": "🇲🇦",
+    "flag_for_mozambique": "🇲🇿",
+    "flag_for_myanmar": "🇲🇲",
+    "flag_for_namibia": "🇳🇦",
+    "flag_for_nauru": "🇳🇷",
+    "flag_for_nepal": "🇳🇵",
+    "flag_for_netherlands": "🇳🇱",
+    "flag_for_new_caledonia": "🇳🇨",
+    "flag_for_new_zealand": "🇳🇿",
+    "flag_for_nicaragua": "🇳🇮",
+    "flag_for_niger": "🇳🇪",
+    "flag_for_nigeria": "🇳🇬",
+    "flag_for_niue": "🇳🇺",
+    "flag_for_norfolk_island": "🇳🇫",
+    "flag_for_north_korea": "🇰🇵",
+    "flag_for_northern_mariana_islands": "🇲🇵",
+    "flag_for_norway": "🇳🇴",
+    "flag_for_oman": "🇴🇲",
+    "flag_for_pakistan": "🇵🇰",
+    "flag_for_palau": "🇵🇼",
+    "flag_for_palestinian_territories": "🇵🇸",
+    "flag_for_panama": "🇵🇦",
+    "flag_for_papua_new_guinea": "🇵🇬",
+    "flag_for_paraguay": "🇵🇾",
+    "flag_for_peru": "🇵🇪",
+    "flag_for_philippines": "🇵🇭",
+    "flag_for_pitcairn_islands": "🇵🇳",
+    "flag_for_poland": "🇵🇱",
+    "flag_for_portugal": "🇵🇹",
+    "flag_for_puerto_rico": "🇵🇷",
+    "flag_for_qatar": "🇶🇦",
+    "flag_for_romania": "🇷🇴",
+    "flag_for_russia": "🇷🇺",
+    "flag_for_rwanda": "🇷🇼",
+    "flag_for_réunion": "🇷🇪",
+    "flag_for_samoa": "🇼🇸",
+    "flag_for_san_marino": "🇸🇲",
+    "flag_for_saudi_arabia": "🇸🇦",
+    "flag_for_senegal": "🇸🇳",
+    "flag_for_serbia": "🇷🇸",
+    "flag_for_seychelles": "🇸🇨",
+    "flag_for_sierra_leone": "🇸🇱",
+    "flag_for_singapore": "🇸🇬",
+    "flag_for_sint_maarten": "🇸🇽",
+    "flag_for_slovakia": "🇸🇰",
+    "flag_for_slovenia": "🇸🇮",
+    "flag_for_solomon_islands": "🇸🇧",
+    "flag_for_somalia": "🇸🇴",
+    "flag_for_south_africa": "🇿🇦",
+    "flag_for_south_georgia_&_south_sandwich_islands": "🇬🇸",
+    "flag_for_south_korea": "🇰🇷",
+    "flag_for_south_sudan": "🇸🇸",
+    "flag_for_spain": "🇪🇸",
+    "flag_for_sri_lanka": "🇱🇰",
+    "flag_for_st._barthélemy": "🇧🇱",
+    "flag_for_st._helena": "🇸🇭",
+    "flag_for_st._kitts_&_nevis": "🇰🇳",
+    "flag_for_st._lucia": "🇱🇨",
+    "flag_for_st._martin": "🇲🇫",
+    "flag_for_st._pierre_&_miquelon": "🇵🇲",
+    "flag_for_st._vincent_&_grenadines": "🇻🇨",
+    "flag_for_sudan": "🇸🇩",
+    "flag_for_suriname": "🇸🇷",
+    "flag_for_svalbard_&_jan_mayen": "🇸🇯",
+    "flag_for_swaziland": "🇸🇿",
+    "flag_for_sweden": "🇸🇪",
+    "flag_for_switzerland": "🇨🇭",
+    "flag_for_syria": "🇸🇾",
+    "flag_for_são_tomé_&_príncipe": "🇸🇹",
+    "flag_for_taiwan": "🇹🇼",
+    "flag_for_tajikistan": "🇹🇯",
+    "flag_for_tanzania": "🇹🇿",
+    "flag_for_thailand": "🇹🇭",
+    "flag_for_timor__leste": "🇹🇱",
+    "flag_for_togo": "🇹🇬",
+    "flag_for_tokelau": "🇹🇰",
+    "flag_for_tonga": "🇹🇴",
+    "flag_for_trinidad_&_tobago": "🇹🇹",
+    "flag_for_tristan_da_cunha": "🇹🇦",
+    "flag_for_tunisia": "🇹🇳",
+    "flag_for_turkey": "🇹🇷",
+    "flag_for_turkmenistan": "🇹🇲",
+    "flag_for_turks_&_caicos_islands": "🇹🇨",
+    "flag_for_tuvalu": "🇹🇻",
+    "flag_for_u.s._outlying_islands": "🇺🇲",
+    "flag_for_u.s._virgin_islands": "🇻🇮",
+    "flag_for_uganda": "🇺🇬",
+    "flag_for_ukraine": "🇺🇦",
+    "flag_for_united_arab_emirates": "🇦🇪",
+    "flag_for_united_kingdom": "🇬🇧",
+    "flag_for_united_states": "🇺🇸",
+    "flag_for_uruguay": "🇺🇾",
+    "flag_for_uzbekistan": "🇺🇿",
+    "flag_for_vanuatu": "🇻🇺",
+    "flag_for_vatican_city": "🇻🇦",
+    "flag_for_venezuela": "🇻🇪",
+    "flag_for_vietnam": "🇻🇳",
+    "flag_for_wallis_&_futuna": "🇼🇫",
+    "flag_for_western_sahara": "🇪🇭",
+    "flag_for_yemen": "🇾🇪",
+    "flag_for_zambia": "🇿🇲",
+    "flag_for_zimbabwe": "🇿🇼",
+    "flag_for_åland_islands": "🇦🇽",
+    "golf": "⛳",
+    "fleur__de__lis": "⚜",
+    "muscle": "💪",
+    "flushed": "😳",
+    "frame_with_picture": "🖼",
+    "fries": "🍟",
+    "frog": "🐸",
+    "hatched_chick": "🐥",
+    "frowning": "😦",
+    "fuelpump": "⛽",
+    "full_moon_with_face": "🌝",
+    "gem": "💎",
+    "star2": "🌟",
+    "golfer": "🏌",
+    "mortar_board": "🎓",
+    "grimacing": "😬",
+    "smile_cat": "😸",
+    "grinning": "😀",
+    "grin": "😁",
+    "heartpulse": "💗",
+    "guardsman": "💂",
+    "haircut": "💇",
+    "hamster": "🐹",
+    "raising_hand": "🙋",
+    "headphones": "🎧",
+    "hear_no_evil": "🙉",
+    "cupid": "💘",
+    "gift_heart": "💝",
+    "heart": "❤",
+    "exclamation": "❗",
+    "heavy_exclamation_mark": "❗",
+    "heavy_heart_exclamation_mark_ornament": "❣",
+    "o": "⭕",
+    "helm_symbol": "⎈",
+    "helmet_with_white_cross": "⛑",
+    "high_heel": "👠",
+    "bullettrain_side": "🚄",
+    "bullettrain_front": "🚅",
+    "high_brightness": "🔆",
+    "zap": "⚡",
+    "hocho": "🔪",
+    "knife": "🔪",
+    "bee": "🐝",
+    "traffic_light": "🚥",
+    "racehorse": "🐎",
+    "coffee": "☕",
+    "hotsprings": "♨",
+    "hourglass": "⌛",
+    "hourglass_flowing_sand": "⏳",
+    "house_buildings": "🏘",
+    "100": "💯",
+    "hushed": "😯",
+    "ice_hockey_stick_and_puck": "🏒",
+    "imp": "👿",
+    "information_desk_person": "💁",
+    "information_source": "ℹ",
+    "capital_abcd": "🔠",
+    "abc": "🔤",
+    "abcd": "🔡",
+    "1234": "🔢",
+    "symbols": "🔣",
+    "izakaya_lantern": "🏮",
+    "lantern": "🏮",
+    "jack_o_lantern": "🎃",
+    "dolls": "🎎",
+    "japanese_goblin": "👺",
+    "japanese_ogre": "👹",
+    "beginner": "🔰",
+    "zero": "0️⃣",
+    "one": "1️⃣",
+    "ten": "🔟",
+    "two": "2️⃣",
+    "three": "3️⃣",
+    "four": "4️⃣",
+    "five": "5️⃣",
+    "six": "6️⃣",
+    "seven": "7️⃣",
+    "eight": "8️⃣",
+    "nine": "9️⃣",
+    "couplekiss": "💏",
+    "kissing_cat": "😽",
+    "kissing": "😗",
+    "kissing_closed_eyes": "😚",
+    "kissing_smiling_eyes": "😙",
+    "beetle": "🐞",
+    "large_blue_circle": "🔵",
+    "last_quarter_moon_with_face": "🌜",
+    "leaves": "🍃",
+    "mag": "🔍",
+    "left_right_arrow": "↔",
+    "leftwards_arrow_with_hook": "↩",
+    "arrow_left": "⬅",
+    "lock": "🔒",
+    "lock_with_ink_pen": "🔏",
+    "sob": "😭",
+    "low_brightness": "🔅",
+    "lower_left_ballpoint_pen": "🖊",
+    "lower_left_crayon": "🖍",
+    "lower_left_fountain_pen": "🖋",
+    "lower_left_paintbrush": "🖌",
+    "mahjong": "🀄",
+    "couple": "👫",
+    "man_in_business_suit_levitating": "🕴",
+    "man_with_gua_pi_mao": "👲",
+    "man_with_turban": "👳",
+    "mans_shoe": "👞",
+    "shoe": "👞",
+    "menorah_with_nine_branches": "🕎",
+    "mens": "🚹",
+    "minidisc": "💽",
+    "iphone": "📱",
+    "calling": "📲",
+    "money__mouth_face": "🤑",
+    "moneybag": "💰",
+    "rice_scene": "🎑",
+    "mountain_bicyclist": "🚵",
+    "mouse2": "🐁",
+    "lips": "👄",
+    "moyai": "🗿",
+    "notes": "🎶",
+    "nail_care": "💅",
+    "ab": "🆎",
+    "negative_squared_cross_mark": "❎",
+    "a": "🅰",
+    "b": "🅱",
+    "o2": "🅾",
+    "parking": "🅿",
+    "new_moon_with_face": "🌚",
+    "no_entry_sign": "🚫",
+    "underage": "🔞",
+    "non__potable_water": "🚱",
+    "arrow_upper_right": "↗",
+    "arrow_upper_left": "↖",
+    "office": "🏢",
+    "older_man": "👴",
+    "older_woman": "👵",
+    "om_symbol": "🕉",
+    "on": "🔛",
+    "book": "📖",
+    "unlock": "🔓",
+    "mailbox_with_no_mail": "📭",
+    "mailbox_with_mail": "📬",
+    "cd": "💿",
+    "tada": "🎉",
+    "feet": "🐾",
+    "walking": "🚶",
+    "pencil2": "✏",
+    "pensive": "😔",
+    "persevere": "😣",
+    "bow": "🙇",
+    "raised_hands": "🙌",
+    "person_with_ball": "⛹",
+    "person_with_blond_hair": "👱",
+    "pray": "🙏",
+    "person_with_pouting_face": "🙎",
+    "computer": "💻",
+    "pig2": "🐖",
+    "hankey": "💩",
+    "poop": "💩",
+    "shit": "💩",
+    "bamboo": "🎍",
+    "gun": "🔫",
+    "black_joker": "🃏",
+    "rotating_light": "🚨",
+    "cop": "👮",
+    "stew": "🍲",
+    "pouch": "👝",
+    "pouting_cat": "😾",
+    "rage": "😡",
+    "put_litter_in_its_place": "🚮",
+    "rabbit2": "🐇",
+    "racing_motorcycle": "🏍",
+    "radioactive_sign": "☢",
+    "fist": "✊",
+    "hand": "✋",
+    "raised_hand_with_fingers_splayed": "🖐",
+    "raised_hand_with_part_between_middle_and_ring_fingers": "🖖",
+    "blue_car": "🚙",
+    "apple": "🍎",
+    "relieved": "😌",
+    "reversed_hand_with_middle_finger_extended": "🖕",
+    "mag_right": "🔎",
+    "arrow_right_hook": "↪",
+    "sweet_potato": "🍠",
+    "robot": "🤖",
+    "rolled__up_newspaper": "🗞",
+    "rowboat": "🚣",
+    "runner": "🏃",
+    "running": "🏃",
+    "running_shirt_with_sash": "🎽",
+    "boat": "⛵",
+    "scales": "⚖",
+    "school_satchel": "🎒",
+    "scorpius": "♏",
+    "see_no_evil": "🙈",
+    "sheep": "🐑",
+    "stars": "🌠",
+    "cake": "🍰",
+    "six_pointed_star": "🔯",
+    "ski": "🎿",
+    "sleeping_accommodation": "🛌",
+    "sleeping": "😴",
+    "sleepy": "😪",
+    "sleuth_or_spy": "🕵",
+    "heart_eyes_cat": "😻",
+    "smiley_cat": "😺",
+    "innocent": "😇",
+    "heart_eyes": "😍",
+    "smiling_imp": "😈",
+    "smiley": "😃",
+    "sweat_smile": "😅",
+    "smile": "😄",
+    "laughing": "😆",
+    "satisfied": "😆",
+    "blush": "😊",
+    "smirk": "😏",
+    "smoking": "🚬",
+    "snow_capped_mountain": "🏔",
+    "soccer": "⚽",
+    "icecream": "🍦",
+    "soon": "🔜",
+    "arrow_lower_right": "↘",
+    "arrow_lower_left": "↙",
+    "speak_no_evil": "🙊",
+    "speaker": "🔈",
+    "mute": "🔇",
+    "sound": "🔉",
+    "loud_sound": "🔊",
+    "speaking_head_in_silhouette": "🗣",
+    "spiral_calendar_pad": "🗓",
+    "spiral_note_pad": "🗒",
+    "shell": "🐚",
+    "sweat_drops": "💦",
+    "u5272": "🈹",
+    "u5408": "🈴",
+    "u55b6": "🈺",
+    "u6307": "🈯",
+    "u6708": "🈷",
+    "u6709": "🈶",
+    "u6e80": "🈵",
+    "u7121": "🈚",
+    "u7533": "🈸",
+    "u7981": "🈲",
+    "u7a7a": "🈳",
+    "cl": "🆑",
+    "cool": "🆒",
+    "free": "🆓",
+    "id": "🆔",
+    "koko": "🈁",
+    "sa": "🈂",
+    "new": "🆕",
+    "ng": "🆖",
+    "ok": "🆗",
+    "sos": "🆘",
+    "up": "🆙",
+    "vs": "🆚",
+    "steam_locomotive": "🚂",
+    "ramen": "🍜",
+    "partly_sunny": "⛅",
+    "city_sunrise": "🌇",
+    "surfer": "🏄",
+    "swimmer": "🏊",
+    "shirt": "👕",
+    "tshirt": "👕",
+    "table_tennis_paddle_and_ball": "🏓",
+    "tea": "🍵",
+    "tv": "📺",
+    "three_button_mouse": "🖱",
+    "+1": "👍",
+    "thumbsup": "👍",
+    "__1": "👎",
+    "-1": "👎",
+    "thumbsdown": "👎",
+    "thunder_cloud_and_rain": "⛈",
+    "tiger2": "🐅",
+    "tophat": "🎩",
+    "top": "🔝",
+    "tm": "™",
+    "train2": "🚆",
+    "triangular_flag_on_post": "🚩",
+    "trident": "🔱",
+    "twisted_rightwards_arrows": "🔀",
+    "unamused": "😒",
+    "small_red_triangle": "🔺",
+    "arrow_up_small": "🔼",
+    "arrow_up_down": "↕",
+    "upside__down_face": "🙃",
+    "arrow_up": "⬆",
+    "v": "✌",
+    "vhs": "📼",
+    "wc": "🚾",
+    "ocean": "🌊",
+    "waving_black_flag": "🏴",
+    "wave": "👋",
+    "waving_white_flag": "🏳",
+    "moon": "🌔",
+    "scream_cat": "🙀",
+    "weary": "😩",
+    "weight_lifter": "🏋",
+    "whale2": "🐋",
+    "wheelchair": "♿",
+    "point_down": "👇",
+    "grey_exclamation": "❕",
+    "white_frowning_face": "☹",
+    "white_check_mark": "✅",
+    "point_left": "👈",
+    "white_medium_small_square": "◽",
+    "star": "⭐",
+    "grey_question": "❔",
+    "point_right": "👉",
+    "relaxed": "☺",
+    "white_sun_behind_cloud": "🌥",
+    "white_sun_behind_cloud_with_rain": "🌦",
+    "white_sun_with_small_cloud": "🌤",
+    "point_up_2": "👆",
+    "point_up": "☝",
+    "wind_blowing_face": "🌬",
+    "wink": "😉",
+    "wolf": "🐺",
+    "dancers": "👯",
+    "boot": "👢",
+    "womans_clothes": "👚",
+    "womans_hat": "👒",
+    "sandal": "👡",
+    "womens": "🚺",
+    "worried": "😟",
+    "gift": "🎁",
+    "zipper__mouth_face": "🤐",
+    "regional_indicator_a": "🇦",
+    "regional_indicator_b": "🇧",
+    "regional_indicator_c": "🇨",
+    "regional_indicator_d": "🇩",
+    "regional_indicator_e": "🇪",
+    "regional_indicator_f": "🇫",
+    "regional_indicator_g": "🇬",
+    "regional_indicator_h": "🇭",
+    "regional_indicator_i": "🇮",
+    "regional_indicator_j": "🇯",
+    "regional_indicator_k": "🇰",
+    "regional_indicator_l": "🇱",
+    "regional_indicator_m": "🇲",
+    "regional_indicator_n": "🇳",
+    "regional_indicator_o": "🇴",
+    "regional_indicator_p": "🇵",
+    "regional_indicator_q": "🇶",
+    "regional_indicator_r": "🇷",
+    "regional_indicator_s": "🇸",
+    "regional_indicator_t": "🇹",
+    "regional_indicator_u": "🇺",
+    "regional_indicator_v": "🇻",
+    "regional_indicator_w": "🇼",
+    "regional_indicator_x": "🇽",
+    "regional_indicator_y": "🇾",
+    "regional_indicator_z": "🇿",
+}
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_replace.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_replace.py
new file mode 100644
index 0000000000000000000000000000000000000000..bb2cafa18011e7115773055338291c366f173d6f
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_emoji_replace.py
@@ -0,0 +1,32 @@
+from typing import Callable, Match, Optional
+import re
+
+from ._emoji_codes import EMOJI
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EmojiSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def _emoji_replace(
+    text: str,
+    default_variant: Optional[str] = None,
+    _emoji_sub: _EmojiSubMethod = re.compile(r"(:(\S*?)(?:(?:\-)(emoji|text))?:)").sub,
+) -> str:
+    """Replace emoji code in text."""
+    get_emoji = EMOJI.__getitem__
+    variants = {"text": "\uFE0E", "emoji": "\uFE0F"}
+    get_variant = variants.get
+    default_variant_code = variants.get(default_variant, "") if default_variant else ""
+
+    def do_replace(match: Match[str]) -> str:
+        emoji_code, emoji_name, variant = match.groups()
+        try:
+            return get_emoji(emoji_name.lower()) + get_variant(
+                variant, default_variant_code
+            )
+        except KeyError:
+            return emoji_code
+
+    return _emoji_sub(do_replace, text)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_palettes.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_palettes.py
new file mode 100644
index 0000000000000000000000000000000000000000..3c748d33e45bfcdc690ceee490cbb50b516cd2b3
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_palettes.py
@@ -0,0 +1,309 @@
+from .palette import Palette
+
+
+# Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column)
+WINDOWS_PALETTE = Palette(
+    [
+        (12, 12, 12),
+        (197, 15, 31),
+        (19, 161, 14),
+        (193, 156, 0),
+        (0, 55, 218),
+        (136, 23, 152),
+        (58, 150, 221),
+        (204, 204, 204),
+        (118, 118, 118),
+        (231, 72, 86),
+        (22, 198, 12),
+        (249, 241, 165),
+        (59, 120, 255),
+        (180, 0, 158),
+        (97, 214, 214),
+        (242, 242, 242),
+    ]
+)
+
+# # The standard ansi colors (including bright variants)
+STANDARD_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (170, 0, 0),
+        (0, 170, 0),
+        (170, 85, 0),
+        (0, 0, 170),
+        (170, 0, 170),
+        (0, 170, 170),
+        (170, 170, 170),
+        (85, 85, 85),
+        (255, 85, 85),
+        (85, 255, 85),
+        (255, 255, 85),
+        (85, 85, 255),
+        (255, 85, 255),
+        (85, 255, 255),
+        (255, 255, 255),
+    ]
+)
+
+
+# The 256 color palette
+EIGHT_BIT_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (128, 0, 0),
+        (0, 128, 0),
+        (128, 128, 0),
+        (0, 0, 128),
+        (128, 0, 128),
+        (0, 128, 128),
+        (192, 192, 192),
+        (128, 128, 128),
+        (255, 0, 0),
+        (0, 255, 0),
+        (255, 255, 0),
+        (0, 0, 255),
+        (255, 0, 255),
+        (0, 255, 255),
+        (255, 255, 255),
+        (0, 0, 0),
+        (0, 0, 95),
+        (0, 0, 135),
+        (0, 0, 175),
+        (0, 0, 215),
+        (0, 0, 255),
+        (0, 95, 0),
+        (0, 95, 95),
+        (0, 95, 135),
+        (0, 95, 175),
+        (0, 95, 215),
+        (0, 95, 255),
+        (0, 135, 0),
+        (0, 135, 95),
+        (0, 135, 135),
+        (0, 135, 175),
+        (0, 135, 215),
+        (0, 135, 255),
+        (0, 175, 0),
+        (0, 175, 95),
+        (0, 175, 135),
+        (0, 175, 175),
+        (0, 175, 215),
+        (0, 175, 255),
+        (0, 215, 0),
+        (0, 215, 95),
+        (0, 215, 135),
+        (0, 215, 175),
+        (0, 215, 215),
+        (0, 215, 255),
+        (0, 255, 0),
+        (0, 255, 95),
+        (0, 255, 135),
+        (0, 255, 175),
+        (0, 255, 215),
+        (0, 255, 255),
+        (95, 0, 0),
+        (95, 0, 95),
+        (95, 0, 135),
+        (95, 0, 175),
+        (95, 0, 215),
+        (95, 0, 255),
+        (95, 95, 0),
+        (95, 95, 95),
+        (95, 95, 135),
+        (95, 95, 175),
+        (95, 95, 215),
+        (95, 95, 255),
+        (95, 135, 0),
+        (95, 135, 95),
+        (95, 135, 135),
+        (95, 135, 175),
+        (95, 135, 215),
+        (95, 135, 255),
+        (95, 175, 0),
+        (95, 175, 95),
+        (95, 175, 135),
+        (95, 175, 175),
+        (95, 175, 215),
+        (95, 175, 255),
+        (95, 215, 0),
+        (95, 215, 95),
+        (95, 215, 135),
+        (95, 215, 175),
+        (95, 215, 215),
+        (95, 215, 255),
+        (95, 255, 0),
+        (95, 255, 95),
+        (95, 255, 135),
+        (95, 255, 175),
+        (95, 255, 215),
+        (95, 255, 255),
+        (135, 0, 0),
+        (135, 0, 95),
+        (135, 0, 135),
+        (135, 0, 175),
+        (135, 0, 215),
+        (135, 0, 255),
+        (135, 95, 0),
+        (135, 95, 95),
+        (135, 95, 135),
+        (135, 95, 175),
+        (135, 95, 215),
+        (135, 95, 255),
+        (135, 135, 0),
+        (135, 135, 95),
+        (135, 135, 135),
+        (135, 135, 175),
+        (135, 135, 215),
+        (135, 135, 255),
+        (135, 175, 0),
+        (135, 175, 95),
+        (135, 175, 135),
+        (135, 175, 175),
+        (135, 175, 215),
+        (135, 175, 255),
+        (135, 215, 0),
+        (135, 215, 95),
+        (135, 215, 135),
+        (135, 215, 175),
+        (135, 215, 215),
+        (135, 215, 255),
+        (135, 255, 0),
+        (135, 255, 95),
+        (135, 255, 135),
+        (135, 255, 175),
+        (135, 255, 215),
+        (135, 255, 255),
+        (175, 0, 0),
+        (175, 0, 95),
+        (175, 0, 135),
+        (175, 0, 175),
+        (175, 0, 215),
+        (175, 0, 255),
+        (175, 95, 0),
+        (175, 95, 95),
+        (175, 95, 135),
+        (175, 95, 175),
+        (175, 95, 215),
+        (175, 95, 255),
+        (175, 135, 0),
+        (175, 135, 95),
+        (175, 135, 135),
+        (175, 135, 175),
+        (175, 135, 215),
+        (175, 135, 255),
+        (175, 175, 0),
+        (175, 175, 95),
+        (175, 175, 135),
+        (175, 175, 175),
+        (175, 175, 215),
+        (175, 175, 255),
+        (175, 215, 0),
+        (175, 215, 95),
+        (175, 215, 135),
+        (175, 215, 175),
+        (175, 215, 215),
+        (175, 215, 255),
+        (175, 255, 0),
+        (175, 255, 95),
+        (175, 255, 135),
+        (175, 255, 175),
+        (175, 255, 215),
+        (175, 255, 255),
+        (215, 0, 0),
+        (215, 0, 95),
+        (215, 0, 135),
+        (215, 0, 175),
+        (215, 0, 215),
+        (215, 0, 255),
+        (215, 95, 0),
+        (215, 95, 95),
+        (215, 95, 135),
+        (215, 95, 175),
+        (215, 95, 215),
+        (215, 95, 255),
+        (215, 135, 0),
+        (215, 135, 95),
+        (215, 135, 135),
+        (215, 135, 175),
+        (215, 135, 215),
+        (215, 135, 255),
+        (215, 175, 0),
+        (215, 175, 95),
+        (215, 175, 135),
+        (215, 175, 175),
+        (215, 175, 215),
+        (215, 175, 255),
+        (215, 215, 0),
+        (215, 215, 95),
+        (215, 215, 135),
+        (215, 215, 175),
+        (215, 215, 215),
+        (215, 215, 255),
+        (215, 255, 0),
+        (215, 255, 95),
+        (215, 255, 135),
+        (215, 255, 175),
+        (215, 255, 215),
+        (215, 255, 255),
+        (255, 0, 0),
+        (255, 0, 95),
+        (255, 0, 135),
+        (255, 0, 175),
+        (255, 0, 215),
+        (255, 0, 255),
+        (255, 95, 0),
+        (255, 95, 95),
+        (255, 95, 135),
+        (255, 95, 175),
+        (255, 95, 215),
+        (255, 95, 255),
+        (255, 135, 0),
+        (255, 135, 95),
+        (255, 135, 135),
+        (255, 135, 175),
+        (255, 135, 215),
+        (255, 135, 255),
+        (255, 175, 0),
+        (255, 175, 95),
+        (255, 175, 135),
+        (255, 175, 175),
+        (255, 175, 215),
+        (255, 175, 255),
+        (255, 215, 0),
+        (255, 215, 95),
+        (255, 215, 135),
+        (255, 215, 175),
+        (255, 215, 215),
+        (255, 215, 255),
+        (255, 255, 0),
+        (255, 255, 95),
+        (255, 255, 135),
+        (255, 255, 175),
+        (255, 255, 215),
+        (255, 255, 255),
+        (8, 8, 8),
+        (18, 18, 18),
+        (28, 28, 28),
+        (38, 38, 38),
+        (48, 48, 48),
+        (58, 58, 58),
+        (68, 68, 68),
+        (78, 78, 78),
+        (88, 88, 88),
+        (98, 98, 98),
+        (108, 108, 108),
+        (118, 118, 118),
+        (128, 128, 128),
+        (138, 138, 138),
+        (148, 148, 148),
+        (158, 158, 158),
+        (168, 168, 168),
+        (178, 178, 178),
+        (188, 188, 188),
+        (198, 198, 198),
+        (208, 208, 208),
+        (218, 218, 218),
+        (228, 228, 228),
+        (238, 238, 238),
+    ]
+)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_ratio.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_ratio.py
new file mode 100644
index 0000000000000000000000000000000000000000..e8a3a674e0070159b956c29c5092b0f72abc969d
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_ratio.py
@@ -0,0 +1,160 @@
+import sys
+from fractions import Fraction
+from math import ceil
+from typing import cast, List, Optional, Sequence
+
+if sys.version_info >= (3, 8):
+    from typing import Protocol
+else:
+    from pip._vendor.typing_extensions import Protocol  # pragma: no cover
+
+
+class Edge(Protocol):
+    """Any object that defines an edge (such as Layout)."""
+
+    size: Optional[int] = None
+    ratio: int = 1
+    minimum_size: int = 1
+
+
+def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]:
+    """Divide total space to satisfy size, ratio, and minimum_size, constraints.
+
+    The returned list of integers should add up to total in most cases, unless it is
+    impossible to satisfy all the constraints. For instance, if there are two edges
+    with a minimum size of 20 each and `total` is 30 then the returned list will be
+    greater than total. In practice, this would mean that a Layout object would
+    clip the rows that would overflow the screen height.
+
+    Args:
+        total (int): Total number of characters.
+        edges (List[Edge]): Edges within total space.
+
+    Returns:
+        List[int]: Number of characters for each edge.
+    """
+    # Size of edge or None for yet to be determined
+    sizes = [(edge.size or None) for edge in edges]
+
+    _Fraction = Fraction
+
+    # While any edges haven't been calculated
+    while None in sizes:
+        # Get flexible edges and index to map these back on to sizes list
+        flexible_edges = [
+            (index, edge)
+            for index, (size, edge) in enumerate(zip(sizes, edges))
+            if size is None
+        ]
+        # Remaining space in total
+        remaining = total - sum(size or 0 for size in sizes)
+        if remaining <= 0:
+            # No room for flexible edges
+            return [
+                ((edge.minimum_size or 1) if size is None else size)
+                for size, edge in zip(sizes, edges)
+            ]
+        # Calculate number of characters in a ratio portion
+        portion = _Fraction(
+            remaining, sum((edge.ratio or 1) for _, edge in flexible_edges)
+        )
+
+        # If any edges will be less than their minimum, replace size with the minimum
+        for index, edge in flexible_edges:
+            if portion * edge.ratio <= edge.minimum_size:
+                sizes[index] = edge.minimum_size
+                # New fixed size will invalidate calculations, so we need to repeat the process
+                break
+        else:
+            # Distribute flexible space and compensate for rounding error
+            # Since edge sizes can only be integers we need to add the remainder
+            # to the following line
+            remainder = _Fraction(0)
+            for index, edge in flexible_edges:
+                size, remainder = divmod(portion * edge.ratio + remainder, 1)
+                sizes[index] = size
+            break
+    # Sizes now contains integers only
+    return cast(List[int], sizes)
+
+
+def ratio_reduce(
+    total: int, ratios: List[int], maximums: List[int], values: List[int]
+) -> List[int]:
+    """Divide an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        maximums (List[int]): List of maximums values for each slot.
+        values (List[int]): List of values
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)]
+    total_ratio = sum(ratios)
+    if not total_ratio:
+        return values[:]
+    total_remaining = total
+    result: List[int] = []
+    append = result.append
+    for ratio, maximum, value in zip(ratios, maximums, values):
+        if ratio and total_ratio > 0:
+            distributed = min(maximum, round(ratio * total_remaining / total_ratio))
+            append(value - distributed)
+            total_remaining -= distributed
+            total_ratio -= ratio
+        else:
+            append(value)
+    return result
+
+
+def ratio_distribute(
+    total: int, ratios: List[int], minimums: Optional[List[int]] = None
+) -> List[int]:
+    """Distribute an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        minimums (List[int]): List of minimum values for each slot.
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    if minimums:
+        ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)]
+    total_ratio = sum(ratios)
+    assert total_ratio > 0, "Sum of ratios must be > 0"
+
+    total_remaining = total
+    distributed_total: List[int] = []
+    append = distributed_total.append
+    if minimums is None:
+        _minimums = [0] * len(ratios)
+    else:
+        _minimums = minimums
+    for ratio, minimum in zip(ratios, _minimums):
+        if total_ratio > 0:
+            distributed = max(minimum, ceil(ratio * total_remaining / total_ratio))
+        else:
+            distributed = total_remaining
+        append(distributed)
+        total_ratio -= ratio
+        total_remaining -= distributed
+    return distributed_total
+
+
+if __name__ == "__main__":
+    from dataclasses import dataclass
+
+    @dataclass
+    class E:
+
+        size: Optional[int] = None
+        ratio: int = 1
+        minimum_size: int = 1
+
+    resolved = ratio_resolve(110, [E(None, 1, 1), E(None, 1, 1), E(None, 1, 1)])
+    print(sum(resolved))
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_spinners.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_spinners.py
new file mode 100644
index 0000000000000000000000000000000000000000..d0bb1fe751677f0ee83fc6bb876ed72443fdcde7
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_spinners.py
@@ -0,0 +1,482 @@
+"""
+Spinners are from:
+* cli-spinners:
+    MIT License
+    Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+    Permission is hereby granted, free of charge, to any person obtaining a copy
+    of this software and associated documentation files (the "Software"), to deal
+    in the Software without restriction, including without limitation the rights to
+    use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+    the Software, and to permit persons to whom the Software is furnished to do so,
+    subject to the following conditions:
+    The above copyright notice and this permission notice shall be included
+    in all copies or substantial portions of the Software.
+    THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+    INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
+    PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
+    FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+    ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS
+    IN THE SOFTWARE.
+"""
+
+SPINNERS = {
+    "dots": {
+        "interval": 80,
+        "frames": "⠋⠙⠹⠸⠼⠴⠦⠧⠇⠏",
+    },
+    "dots2": {"interval": 80, "frames": "⣾⣽⣻⢿⡿⣟⣯⣷"},
+    "dots3": {
+        "interval": 80,
+        "frames": "⠋⠙⠚⠞⠖⠦⠴⠲⠳⠓",
+    },
+    "dots4": {
+        "interval": 80,
+        "frames": "⠄⠆⠇⠋⠙⠸⠰⠠⠰⠸⠙⠋⠇⠆",
+    },
+    "dots5": {
+        "interval": 80,
+        "frames": "⠋⠙⠚⠒⠂⠂⠒⠲⠴⠦⠖⠒⠐⠐⠒⠓⠋",
+    },
+    "dots6": {
+        "interval": 80,
+        "frames": "⠁⠉⠙⠚⠒⠂⠂⠒⠲⠴⠤⠄⠄⠤⠴⠲⠒⠂⠂⠒⠚⠙⠉⠁",
+    },
+    "dots7": {
+        "interval": 80,
+        "frames": "⠈⠉⠋⠓⠒⠐⠐⠒⠖⠦⠤⠠⠠⠤⠦⠖⠒⠐⠐⠒⠓⠋⠉⠈",
+    },
+    "dots8": {
+        "interval": 80,
+        "frames": "⠁⠁⠉⠙⠚⠒⠂⠂⠒⠲⠴⠤⠄⠄⠤⠠⠠⠤⠦⠖⠒⠐⠐⠒⠓⠋⠉⠈⠈",
+    },
+    "dots9": {"interval": 80, "frames": "⢹⢺⢼⣸⣇⡧⡗⡏"},
+    "dots10": {"interval": 80, "frames": "⢄⢂⢁⡁⡈⡐⡠"},
+    "dots11": {"interval": 100, "frames": "⠁⠂⠄⡀⢀⠠⠐⠈"},
+    "dots12": {
+        "interval": 80,
+        "frames": [
+            "⢀⠀",
+            "⡀⠀",
+            "⠄⠀",
+            "⢂⠀",
+            "⡂⠀",
+            "⠅⠀",
+            "⢃⠀",
+            "⡃⠀",
+            "⠍⠀",
+            "⢋⠀",
+            "⡋⠀",
+            "⠍⠁",
+            "⢋⠁",
+            "⡋⠁",
+            "⠍⠉",
+            "⠋⠉",
+            "⠋⠉",
+            "⠉⠙",
+            "⠉⠙",
+            "⠉⠩",
+            "⠈⢙",
+            "⠈⡙",
+            "⢈⠩",
+            "⡀⢙",
+            "⠄⡙",
+            "⢂⠩",
+            "⡂⢘",
+            "⠅⡘",
+            "⢃⠨",
+            "⡃⢐",
+            "⠍⡐",
+            "⢋⠠",
+            "⡋⢀",
+            "⠍⡁",
+            "⢋⠁",
+            "⡋⠁",
+            "⠍⠉",
+            "⠋⠉",
+            "⠋⠉",
+            "⠉⠙",
+            "⠉⠙",
+            "⠉⠩",
+            "⠈⢙",
+            "⠈⡙",
+            "⠈⠩",
+            "⠀⢙",
+            "⠀⡙",
+            "⠀⠩",
+            "⠀⢘",
+            "⠀⡘",
+            "⠀⠨",
+            "⠀⢐",
+            "⠀⡐",
+            "⠀⠠",
+            "⠀⢀",
+            "⠀⡀",
+        ],
+    },
+    "dots8Bit": {
+        "interval": 80,
+        "frames": "⠀⠁⠂⠃⠄⠅⠆⠇⡀⡁⡂⡃⡄⡅⡆⡇⠈⠉⠊⠋⠌⠍⠎⠏⡈⡉⡊⡋⡌⡍⡎⡏⠐⠑⠒⠓⠔⠕⠖⠗⡐⡑⡒⡓⡔⡕⡖⡗⠘⠙⠚⠛⠜⠝⠞⠟⡘⡙"
+        "⡚⡛⡜⡝⡞⡟⠠⠡⠢⠣⠤⠥⠦⠧⡠⡡⡢⡣⡤⡥⡦⡧⠨⠩⠪⠫⠬⠭⠮⠯⡨⡩⡪⡫⡬⡭⡮⡯⠰⠱⠲⠳⠴⠵⠶⠷⡰⡱⡲⡳⡴⡵⡶⡷⠸⠹⠺⠻"
+        "⠼⠽⠾⠿⡸⡹⡺⡻⡼⡽⡾⡿⢀⢁⢂⢃⢄⢅⢆⢇⣀⣁⣂⣃⣄⣅⣆⣇⢈⢉⢊⢋⢌⢍⢎⢏⣈⣉⣊⣋⣌⣍⣎⣏⢐⢑⢒⢓⢔⢕⢖⢗⣐⣑⣒⣓⣔⣕"
+        "⣖⣗⢘⢙⢚⢛⢜⢝⢞⢟⣘⣙⣚⣛⣜⣝⣞⣟⢠⢡⢢⢣⢤⢥⢦⢧⣠⣡⣢⣣⣤⣥⣦⣧⢨⢩⢪⢫⢬⢭⢮⢯⣨⣩⣪⣫⣬⣭⣮⣯⢰⢱⢲⢳⢴⢵⢶⢷"
+        "⣰⣱⣲⣳⣴⣵⣶⣷⢸⢹⢺⢻⢼⢽⢾⢿⣸⣹⣺⣻⣼⣽⣾⣿",
+    },
+    "line": {"interval": 130, "frames": ["-", "\\", "|", "/"]},
+    "line2": {"interval": 100, "frames": "⠂-–—–-"},
+    "pipe": {"interval": 100, "frames": "┤┘┴└├┌┬┐"},
+    "simpleDots": {"interval": 400, "frames": [".  ", ".. ", "...", "   "]},
+    "simpleDotsScrolling": {
+        "interval": 200,
+        "frames": [".  ", ".. ", "...", " ..", "  .", "   "],
+    },
+    "star": {"interval": 70, "frames": "✶✸✹✺✹✷"},
+    "star2": {"interval": 80, "frames": "+x*"},
+    "flip": {
+        "interval": 70,
+        "frames": "___-``'´-___",
+    },
+    "hamburger": {"interval": 100, "frames": "☱☲☴"},
+    "growVertical": {
+        "interval": 120,
+        "frames": "▁▃▄▅▆▇▆▅▄▃",
+    },
+    "growHorizontal": {
+        "interval": 120,
+        "frames": "▏▎▍▌▋▊▉▊▋▌▍▎",
+    },
+    "balloon": {"interval": 140, "frames": " .oO@* "},
+    "balloon2": {"interval": 120, "frames": ".oO°Oo."},
+    "noise": {"interval": 100, "frames": "▓▒░"},
+    "bounce": {"interval": 120, "frames": "⠁⠂⠄⠂"},
+    "boxBounce": {"interval": 120, "frames": "▖▘▝▗"},
+    "boxBounce2": {"interval": 100, "frames": "▌▀▐▄"},
+    "triangle": {"interval": 50, "frames": "◢◣◤◥"},
+    "arc": {"interval": 100, "frames": "◜◠◝◞◡◟"},
+    "circle": {"interval": 120, "frames": "◡⊙◠"},
+    "squareCorners": {"interval": 180, "frames": "◰◳◲◱"},
+    "circleQuarters": {"interval": 120, "frames": "◴◷◶◵"},
+    "circleHalves": {"interval": 50, "frames": "◐◓◑◒"},
+    "squish": {"interval": 100, "frames": "╫╪"},
+    "toggle": {"interval": 250, "frames": "⊶⊷"},
+    "toggle2": {"interval": 80, "frames": "▫▪"},
+    "toggle3": {"interval": 120, "frames": "□■"},
+    "toggle4": {"interval": 100, "frames": "■□▪▫"},
+    "toggle5": {"interval": 100, "frames": "▮▯"},
+    "toggle6": {"interval": 300, "frames": "ဝ၀"},
+    "toggle7": {"interval": 80, "frames": "⦾⦿"},
+    "toggle8": {"interval": 100, "frames": "◍◌"},
+    "toggle9": {"interval": 100, "frames": "◉◎"},
+    "toggle10": {"interval": 100, "frames": "㊂㊀㊁"},
+    "toggle11": {"interval": 50, "frames": "⧇⧆"},
+    "toggle12": {"interval": 120, "frames": "☗☖"},
+    "toggle13": {"interval": 80, "frames": "=*-"},
+    "arrow": {"interval": 100, "frames": "←↖↑↗→↘↓↙"},
+    "arrow2": {
+        "interval": 80,
+        "frames": ["⬆️ ", "↗️ ", "➡️ ", "↘️ ", "⬇️ ", "↙️ ", "⬅️ ", "↖️ "],
+    },
+    "arrow3": {
+        "interval": 120,
+        "frames": ["▹▹▹▹▹", "▸▹▹▹▹", "▹▸▹▹▹", "▹▹▸▹▹", "▹▹▹▸▹", "▹▹▹▹▸"],
+    },
+    "bouncingBar": {
+        "interval": 80,
+        "frames": [
+            "[    ]",
+            "[=   ]",
+            "[==  ]",
+            "[=== ]",
+            "[ ===]",
+            "[  ==]",
+            "[   =]",
+            "[    ]",
+            "[   =]",
+            "[  ==]",
+            "[ ===]",
+            "[====]",
+            "[=== ]",
+            "[==  ]",
+            "[=   ]",
+        ],
+    },
+    "bouncingBall": {
+        "interval": 80,
+        "frames": [
+            "( ●    )",
+            "(  ●   )",
+            "(   ●  )",
+            "(    ● )",
+            "(     ●)",
+            "(    ● )",
+            "(   ●  )",
+            "(  ●   )",
+            "( ●    )",
+            "(●     )",
+        ],
+    },
+    "smiley": {"interval": 200, "frames": ["😄 ", "😝 "]},
+    "monkey": {"interval": 300, "frames": ["🙈 ", "🙈 ", "🙉 ", "🙊 "]},
+    "hearts": {"interval": 100, "frames": ["💛 ", "💙 ", "💜 ", "💚 ", "❤️ "]},
+    "clock": {
+        "interval": 100,
+        "frames": [
+            "🕛 ",
+            "🕐 ",
+            "🕑 ",
+            "🕒 ",
+            "🕓 ",
+            "🕔 ",
+            "🕕 ",
+            "🕖 ",
+            "🕗 ",
+            "🕘 ",
+            "🕙 ",
+            "🕚 ",
+        ],
+    },
+    "earth": {"interval": 180, "frames": ["🌍 ", "🌎 ", "🌏 "]},
+    "material": {
+        "interval": 17,
+        "frames": [
+            "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "███████▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "████████▁▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "██████████▁▁▁▁▁▁▁▁▁▁",
+            "███████████▁▁▁▁▁▁▁▁▁",
+            "█████████████▁▁▁▁▁▁▁",
+            "██████████████▁▁▁▁▁▁",
+            "██████████████▁▁▁▁▁▁",
+            "▁██████████████▁▁▁▁▁",
+            "▁██████████████▁▁▁▁▁",
+            "▁██████████████▁▁▁▁▁",
+            "▁▁██████████████▁▁▁▁",
+            "▁▁▁██████████████▁▁▁",
+            "▁▁▁▁█████████████▁▁▁",
+            "▁▁▁▁██████████████▁▁",
+            "▁▁▁▁██████████████▁▁",
+            "▁▁▁▁▁██████████████▁",
+            "▁▁▁▁▁██████████████▁",
+            "▁▁▁▁▁██████████████▁",
+            "▁▁▁▁▁▁██████████████",
+            "▁▁▁▁▁▁██████████████",
+            "▁▁▁▁▁▁▁█████████████",
+            "▁▁▁▁▁▁▁█████████████",
+            "▁▁▁▁▁▁▁▁████████████",
+            "▁▁▁▁▁▁▁▁████████████",
+            "▁▁▁▁▁▁▁▁▁███████████",
+            "▁▁▁▁▁▁▁▁▁███████████",
+            "▁▁▁▁▁▁▁▁▁▁██████████",
+            "▁▁▁▁▁▁▁▁▁▁██████████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁████████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁███████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁██████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████",
+            "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████",
+            "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███",
+            "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███",
+            "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁███",
+            "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁██",
+            "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "██████▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "████████▁▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "█████████▁▁▁▁▁▁▁▁▁▁▁",
+            "███████████▁▁▁▁▁▁▁▁▁",
+            "████████████▁▁▁▁▁▁▁▁",
+            "████████████▁▁▁▁▁▁▁▁",
+            "██████████████▁▁▁▁▁▁",
+            "██████████████▁▁▁▁▁▁",
+            "▁██████████████▁▁▁▁▁",
+            "▁██████████████▁▁▁▁▁",
+            "▁▁▁█████████████▁▁▁▁",
+            "▁▁▁▁▁████████████▁▁▁",
+            "▁▁▁▁▁████████████▁▁▁",
+            "▁▁▁▁▁▁███████████▁▁▁",
+            "▁▁▁▁▁▁▁▁█████████▁▁▁",
+            "▁▁▁▁▁▁▁▁█████████▁▁▁",
+            "▁▁▁▁▁▁▁▁▁█████████▁▁",
+            "▁▁▁▁▁▁▁▁▁█████████▁▁",
+            "▁▁▁▁▁▁▁▁▁▁█████████▁",
+            "▁▁▁▁▁▁▁▁▁▁▁████████▁",
+            "▁▁▁▁▁▁▁▁▁▁▁████████▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁███████▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁███████▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁███████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁███████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+            "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁",
+        ],
+    },
+    "moon": {
+        "interval": 80,
+        "frames": ["🌑 ", "🌒 ", "🌓 ", "🌔 ", "🌕 ", "🌖 ", "🌗 ", "🌘 "],
+    },
+    "runner": {"interval": 140, "frames": ["🚶 ", "🏃 "]},
+    "pong": {
+        "interval": 80,
+        "frames": [
+            "▐⠂       ▌",
+            "▐⠈       ▌",
+            "▐ ⠂      ▌",
+            "▐ ⠠      ▌",
+            "▐  ⡀     ▌",
+            "▐  ⠠     ▌",
+            "▐   ⠂    ▌",
+            "▐   ⠈    ▌",
+            "▐    ⠂   ▌",
+            "▐    ⠠   ▌",
+            "▐     ⡀  ▌",
+            "▐     ⠠  ▌",
+            "▐      ⠂ ▌",
+            "▐      ⠈ ▌",
+            "▐       ⠂▌",
+            "▐       ⠠▌",
+            "▐       ⡀▌",
+            "▐      ⠠ ▌",
+            "▐      ⠂ ▌",
+            "▐     ⠈  ▌",
+            "▐     ⠂  ▌",
+            "▐    ⠠   ▌",
+            "▐    ⡀   ▌",
+            "▐   ⠠    ▌",
+            "▐   ⠂    ▌",
+            "▐  ⠈     ▌",
+            "▐  ⠂     ▌",
+            "▐ ⠠      ▌",
+            "▐ ⡀      ▌",
+            "▐⠠       ▌",
+        ],
+    },
+    "shark": {
+        "interval": 120,
+        "frames": [
+            "▐|\\____________▌",
+            "▐_|\\___________▌",
+            "▐__|\\__________▌",
+            "▐___|\\_________▌",
+            "▐____|\\________▌",
+            "▐_____|\\_______▌",
+            "▐______|\\______▌",
+            "▐_______|\\_____▌",
+            "▐________|\\____▌",
+            "▐_________|\\___▌",
+            "▐__________|\\__▌",
+            "▐___________|\\_▌",
+            "▐____________|\\▌",
+            "▐____________/|▌",
+            "▐___________/|_▌",
+            "▐__________/|__▌",
+            "▐_________/|___▌",
+            "▐________/|____▌",
+            "▐_______/|_____▌",
+            "▐______/|______▌",
+            "▐_____/|_______▌",
+            "▐____/|________▌",
+            "▐___/|_________▌",
+            "▐__/|__________▌",
+            "▐_/|___________▌",
+            "▐/|____________▌",
+        ],
+    },
+    "dqpb": {"interval": 100, "frames": "dqpb"},
+    "weather": {
+        "interval": 100,
+        "frames": [
+            "☀️ ",
+            "☀️ ",
+            "☀️ ",
+            "🌤 ",
+            "⛅️ ",
+            "🌥 ",
+            "☁️ ",
+            "🌧 ",
+            "🌨 ",
+            "🌧 ",
+            "🌨 ",
+            "🌧 ",
+            "🌨 ",
+            "⛈ ",
+            "🌨 ",
+            "🌧 ",
+            "🌨 ",
+            "☁️ ",
+            "🌥 ",
+            "⛅️ ",
+            "🌤 ",
+            "☀️ ",
+            "☀️ ",
+        ],
+    },
+    "christmas": {"interval": 400, "frames": "🌲🎄"},
+    "grenade": {
+        "interval": 80,
+        "frames": [
+            "،   ",
+            "′   ",
+            " ´ ",
+            " ‾ ",
+            "  ⸌",
+            "  ⸊",
+            "  |",
+            "  ⁎",
+            "  ⁕",
+            " ෴ ",
+            "  ⁓",
+            "   ",
+            "   ",
+            "   ",
+        ],
+    },
+    "point": {"interval": 125, "frames": ["∙∙∙", "●∙∙", "∙●∙", "∙∙●", "∙∙∙"]},
+    "layer": {"interval": 150, "frames": "-=≡"},
+    "betaWave": {
+        "interval": 80,
+        "frames": [
+            "ρββββββ",
+            "βρβββββ",
+            "ββρββββ",
+            "βββρβββ",
+            "ββββρββ",
+            "βββββρβ",
+            "ββββββρ",
+        ],
+    },
+    "aesthetic": {
+        "interval": 80,
+        "frames": [
+            "▰▱▱▱▱▱▱",
+            "▰▰▱▱▱▱▱",
+            "▰▰▰▱▱▱▱",
+            "▰▰▰▰▱▱▱",
+            "▰▰▰▰▰▱▱",
+            "▰▰▰▰▰▰▱",
+            "▰▰▰▰▰▰▰",
+            "▰▱▱▱▱▱▱",
+        ],
+    },
+}
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_stack.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_stack.py
new file mode 100644
index 0000000000000000000000000000000000000000..194564e761ddae165b39ef6598877e2e3820af0a
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_stack.py
@@ -0,0 +1,16 @@
+from typing import List, TypeVar
+
+T = TypeVar("T")
+
+
+class Stack(List[T]):
+    """A small shim over builtin list."""
+
+    @property
+    def top(self) -> T:
+        """Get top of stack."""
+        return self[-1]
+
+    def push(self, item: T) -> None:
+        """Push an item on to the stack (append in stack nomenclature)."""
+        self.append(item)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_windows_renderer.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_windows_renderer.py
new file mode 100644
index 0000000000000000000000000000000000000000..5ece05649e7268a75c82de6ced552619ffc093ab
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_windows_renderer.py
@@ -0,0 +1,56 @@
+from typing import Iterable, Sequence, Tuple, cast
+
+from pip._vendor.rich._win32_console import LegacyWindowsTerm, WindowsCoordinates
+from pip._vendor.rich.segment import ControlCode, ControlType, Segment
+
+
+def legacy_windows_render(buffer: Iterable[Segment], term: LegacyWindowsTerm) -> None:
+    """Makes appropriate Windows Console API calls based on the segments in the buffer.
+
+    Args:
+        buffer (Iterable[Segment]): Iterable of Segments to convert to Win32 API calls.
+        term (LegacyWindowsTerm): Used to call the Windows Console API.
+    """
+    for text, style, control in buffer:
+        if not control:
+            if style:
+                term.write_styled(text, style)
+            else:
+                term.write_text(text)
+        else:
+            control_codes: Sequence[ControlCode] = control
+            for control_code in control_codes:
+                control_type = control_code[0]
+                if control_type == ControlType.CURSOR_MOVE_TO:
+                    _, x, y = cast(Tuple[ControlType, int, int], control_code)
+                    term.move_cursor_to(WindowsCoordinates(row=y - 1, col=x - 1))
+                elif control_type == ControlType.CARRIAGE_RETURN:
+                    term.write_text("\r")
+                elif control_type == ControlType.HOME:
+                    term.move_cursor_to(WindowsCoordinates(0, 0))
+                elif control_type == ControlType.CURSOR_UP:
+                    term.move_cursor_up()
+                elif control_type == ControlType.CURSOR_DOWN:
+                    term.move_cursor_down()
+                elif control_type == ControlType.CURSOR_FORWARD:
+                    term.move_cursor_forward()
+                elif control_type == ControlType.CURSOR_BACKWARD:
+                    term.move_cursor_backward()
+                elif control_type == ControlType.CURSOR_MOVE_TO_COLUMN:
+                    _, column = cast(Tuple[ControlType, int], control_code)
+                    term.move_cursor_to_column(column - 1)
+                elif control_type == ControlType.HIDE_CURSOR:
+                    term.hide_cursor()
+                elif control_type == ControlType.SHOW_CURSOR:
+                    term.show_cursor()
+                elif control_type == ControlType.ERASE_IN_LINE:
+                    _, mode = cast(Tuple[ControlType, int], control_code)
+                    if mode == 0:
+                        term.erase_end_of_line()
+                    elif mode == 1:
+                        term.erase_start_of_line()
+                    elif mode == 2:
+                        term.erase_line()
+                elif control_type == ControlType.SET_WINDOW_TITLE:
+                    _, title = cast(Tuple[ControlType, str], control_code)
+                    term.set_title(title)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_wrap.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_wrap.py
new file mode 100644
index 0000000000000000000000000000000000000000..c45f193f74ad7385c84f3b935663198415cfaa4b
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/_wrap.py
@@ -0,0 +1,56 @@
+import re
+from typing import Iterable, List, Tuple
+
+from ._loop import loop_last
+from .cells import cell_len, chop_cells
+
+re_word = re.compile(r"\s*\S+\s*")
+
+
+def words(text: str) -> Iterable[Tuple[int, int, str]]:
+    position = 0
+    word_match = re_word.match(text, position)
+    while word_match is not None:
+        start, end = word_match.span()
+        word = word_match.group(0)
+        yield start, end, word
+        word_match = re_word.match(text, end)
+
+
+def divide_line(text: str, width: int, fold: bool = True) -> List[int]:
+    divides: List[int] = []
+    append = divides.append
+    line_position = 0
+    _cell_len = cell_len
+    for start, _end, word in words(text):
+        word_length = _cell_len(word.rstrip())
+        if line_position + word_length > width:
+            if word_length > width:
+                if fold:
+                    chopped_words = chop_cells(word, max_size=width, position=0)
+                    for last, line in loop_last(chopped_words):
+                        if start:
+                            append(start)
+
+                        if last:
+                            line_position = _cell_len(line)
+                        else:
+                            start += len(line)
+                else:
+                    if start:
+                        append(start)
+                    line_position = _cell_len(word)
+            elif line_position and start:
+                append(start)
+                line_position = _cell_len(word)
+        else:
+            line_position += _cell_len(word)
+    return divides
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console(width=10)
+    console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345")
+    print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10, position=2))
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/ansi.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/ansi.py
new file mode 100644
index 0000000000000000000000000000000000000000..66365e6536080bd9372d2a7a58b8ffa3447fec34
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/ansi.py
@@ -0,0 +1,240 @@
+import re
+import sys
+from contextlib import suppress
+from typing import Iterable, NamedTuple, Optional
+
+from .color import Color
+from .style import Style
+from .text import Text
+
+re_ansi = re.compile(
+    r"""
+(?:\x1b\](.*?)\x1b\\)|
+(?:\x1b([(@-Z\\-_]|\[[0-?]*[ -/]*[@-~]))
+""",
+    re.VERBOSE,
+)
+
+
+class _AnsiToken(NamedTuple):
+    """Result of ansi tokenized string."""
+
+    plain: str = ""
+    sgr: Optional[str] = ""
+    osc: Optional[str] = ""
+
+
+def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]:
+    """Tokenize a string in to plain text and ANSI codes.
+
+    Args:
+        ansi_text (str): A String containing ANSI codes.
+
+    Yields:
+        AnsiToken: A named tuple of (plain, sgr, osc)
+    """
+
+    position = 0
+    sgr: Optional[str]
+    osc: Optional[str]
+    for match in re_ansi.finditer(ansi_text):
+        start, end = match.span(0)
+        osc, sgr = match.groups()
+        if start > position:
+            yield _AnsiToken(ansi_text[position:start])
+        if sgr:
+            if sgr == "(":
+                position = end + 1
+                continue
+            if sgr.endswith("m"):
+                yield _AnsiToken("", sgr[1:-1], osc)
+        else:
+            yield _AnsiToken("", sgr, osc)
+        position = end
+    if position < len(ansi_text):
+        yield _AnsiToken(ansi_text[position:])
+
+
+SGR_STYLE_MAP = {
+    1: "bold",
+    2: "dim",
+    3: "italic",
+    4: "underline",
+    5: "blink",
+    6: "blink2",
+    7: "reverse",
+    8: "conceal",
+    9: "strike",
+    21: "underline2",
+    22: "not dim not bold",
+    23: "not italic",
+    24: "not underline",
+    25: "not blink",
+    26: "not blink2",
+    27: "not reverse",
+    28: "not conceal",
+    29: "not strike",
+    30: "color(0)",
+    31: "color(1)",
+    32: "color(2)",
+    33: "color(3)",
+    34: "color(4)",
+    35: "color(5)",
+    36: "color(6)",
+    37: "color(7)",
+    39: "default",
+    40: "on color(0)",
+    41: "on color(1)",
+    42: "on color(2)",
+    43: "on color(3)",
+    44: "on color(4)",
+    45: "on color(5)",
+    46: "on color(6)",
+    47: "on color(7)",
+    49: "on default",
+    51: "frame",
+    52: "encircle",
+    53: "overline",
+    54: "not frame not encircle",
+    55: "not overline",
+    90: "color(8)",
+    91: "color(9)",
+    92: "color(10)",
+    93: "color(11)",
+    94: "color(12)",
+    95: "color(13)",
+    96: "color(14)",
+    97: "color(15)",
+    100: "on color(8)",
+    101: "on color(9)",
+    102: "on color(10)",
+    103: "on color(11)",
+    104: "on color(12)",
+    105: "on color(13)",
+    106: "on color(14)",
+    107: "on color(15)",
+}
+
+
+class AnsiDecoder:
+    """Translate ANSI code in to styled Text."""
+
+    def __init__(self) -> None:
+        self.style = Style.null()
+
+    def decode(self, terminal_text: str) -> Iterable[Text]:
+        """Decode ANSI codes in an iterable of lines.
+
+        Args:
+            lines (Iterable[str]): An iterable of lines of terminal output.
+
+        Yields:
+            Text: Marked up Text.
+        """
+        for line in terminal_text.splitlines():
+            yield self.decode_line(line)
+
+    def decode_line(self, line: str) -> Text:
+        """Decode a line containing ansi codes.
+
+        Args:
+            line (str): A line of terminal output.
+
+        Returns:
+            Text: A Text instance marked up according to ansi codes.
+        """
+        from_ansi = Color.from_ansi
+        from_rgb = Color.from_rgb
+        _Style = Style
+        text = Text()
+        append = text.append
+        line = line.rsplit("\r", 1)[-1]
+        for plain_text, sgr, osc in _ansi_tokenize(line):
+            if plain_text:
+                append(plain_text, self.style or None)
+            elif osc is not None:
+                if osc.startswith("8;"):
+                    _params, semicolon, link = osc[2:].partition(";")
+                    if semicolon:
+                        self.style = self.style.update_link(link or None)
+            elif sgr is not None:
+                # Translate in to semi-colon separated codes
+                # Ignore invalid codes, because we want to be lenient
+                codes = [
+                    min(255, int(_code) if _code else 0)
+                    for _code in sgr.split(";")
+                    if _code.isdigit() or _code == ""
+                ]
+                iter_codes = iter(codes)
+                for code in iter_codes:
+                    if code == 0:
+                        # reset
+                        self.style = _Style.null()
+                    elif code in SGR_STYLE_MAP:
+                        # styles
+                        self.style += _Style.parse(SGR_STYLE_MAP[code])
+                    elif code == 38:
+                        #  Foreground
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    )
+                                )
+                    elif code == 48:
+                        # Background
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    None, from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    None,
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    ),
+                                )
+
+        return text
+
+
+if sys.platform != "win32" and __name__ == "__main__":  # pragma: no cover
+    import io
+    import os
+    import pty
+    import sys
+
+    decoder = AnsiDecoder()
+
+    stdout = io.BytesIO()
+
+    def read(fd: int) -> bytes:
+        data = os.read(fd, 1024)
+        stdout.write(data)
+        return data
+
+    pty.spawn(sys.argv[1:], read)
+
+    from .console import Console
+
+    console = Console(record=True)
+
+    stdout_result = stdout.getvalue().decode("utf-8")
+    print(stdout_result)
+
+    for line in decoder.decode(stdout_result):
+        console.print(line)
+
+    console.save_html("stdout.html")
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color.py
new file mode 100644
index 0000000000000000000000000000000000000000..dfe455937c86b5b7cc83f5506ae0f7010bece1b1
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color.py
@@ -0,0 +1,622 @@
+import platform
+import re
+from colorsys import rgb_to_hls
+from enum import IntEnum
+from functools import lru_cache
+from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple
+
+from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE
+from .color_triplet import ColorTriplet
+from .repr import Result, rich_repr
+from .terminal_theme import DEFAULT_TERMINAL_THEME
+
+if TYPE_CHECKING:  # pragma: no cover
+    from .terminal_theme import TerminalTheme
+    from .text import Text
+
+
+WINDOWS = platform.system() == "Windows"
+
+
+class ColorSystem(IntEnum):
+    """One of the 3 color system supported by terminals."""
+
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorSystem.{self.name}"
+
+    def __str__(self) -> str:
+        return repr(self)
+
+
+class ColorType(IntEnum):
+    """Type of color stored in Color class."""
+
+    DEFAULT = 0
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorType.{self.name}"
+
+
+ANSI_COLOR_NAMES = {
+    "black": 0,
+    "red": 1,
+    "green": 2,
+    "yellow": 3,
+    "blue": 4,
+    "magenta": 5,
+    "cyan": 6,
+    "white": 7,
+    "bright_black": 8,
+    "bright_red": 9,
+    "bright_green": 10,
+    "bright_yellow": 11,
+    "bright_blue": 12,
+    "bright_magenta": 13,
+    "bright_cyan": 14,
+    "bright_white": 15,
+    "grey0": 16,
+    "gray0": 16,
+    "navy_blue": 17,
+    "dark_blue": 18,
+    "blue3": 20,
+    "blue1": 21,
+    "dark_green": 22,
+    "deep_sky_blue4": 25,
+    "dodger_blue3": 26,
+    "dodger_blue2": 27,
+    "green4": 28,
+    "spring_green4": 29,
+    "turquoise4": 30,
+    "deep_sky_blue3": 32,
+    "dodger_blue1": 33,
+    "green3": 40,
+    "spring_green3": 41,
+    "dark_cyan": 36,
+    "light_sea_green": 37,
+    "deep_sky_blue2": 38,
+    "deep_sky_blue1": 39,
+    "spring_green2": 47,
+    "cyan3": 43,
+    "dark_turquoise": 44,
+    "turquoise2": 45,
+    "green1": 46,
+    "spring_green1": 48,
+    "medium_spring_green": 49,
+    "cyan2": 50,
+    "cyan1": 51,
+    "dark_red": 88,
+    "deep_pink4": 125,
+    "purple4": 55,
+    "purple3": 56,
+    "blue_violet": 57,
+    "orange4": 94,
+    "grey37": 59,
+    "gray37": 59,
+    "medium_purple4": 60,
+    "slate_blue3": 62,
+    "royal_blue1": 63,
+    "chartreuse4": 64,
+    "dark_sea_green4": 71,
+    "pale_turquoise4": 66,
+    "steel_blue": 67,
+    "steel_blue3": 68,
+    "cornflower_blue": 69,
+    "chartreuse3": 76,
+    "cadet_blue": 73,
+    "sky_blue3": 74,
+    "steel_blue1": 81,
+    "pale_green3": 114,
+    "sea_green3": 78,
+    "aquamarine3": 79,
+    "medium_turquoise": 80,
+    "chartreuse2": 112,
+    "sea_green2": 83,
+    "sea_green1": 85,
+    "aquamarine1": 122,
+    "dark_slate_gray2": 87,
+    "dark_magenta": 91,
+    "dark_violet": 128,
+    "purple": 129,
+    "light_pink4": 95,
+    "plum4": 96,
+    "medium_purple3": 98,
+    "slate_blue1": 99,
+    "yellow4": 106,
+    "wheat4": 101,
+    "grey53": 102,
+    "gray53": 102,
+    "light_slate_grey": 103,
+    "light_slate_gray": 103,
+    "medium_purple": 104,
+    "light_slate_blue": 105,
+    "dark_olive_green3": 149,
+    "dark_sea_green": 108,
+    "light_sky_blue3": 110,
+    "sky_blue2": 111,
+    "dark_sea_green3": 150,
+    "dark_slate_gray3": 116,
+    "sky_blue1": 117,
+    "chartreuse1": 118,
+    "light_green": 120,
+    "pale_green1": 156,
+    "dark_slate_gray1": 123,
+    "red3": 160,
+    "medium_violet_red": 126,
+    "magenta3": 164,
+    "dark_orange3": 166,
+    "indian_red": 167,
+    "hot_pink3": 168,
+    "medium_orchid3": 133,
+    "medium_orchid": 134,
+    "medium_purple2": 140,
+    "dark_goldenrod": 136,
+    "light_salmon3": 173,
+    "rosy_brown": 138,
+    "grey63": 139,
+    "gray63": 139,
+    "medium_purple1": 141,
+    "gold3": 178,
+    "dark_khaki": 143,
+    "navajo_white3": 144,
+    "grey69": 145,
+    "gray69": 145,
+    "light_steel_blue3": 146,
+    "light_steel_blue": 147,
+    "yellow3": 184,
+    "dark_sea_green2": 157,
+    "light_cyan3": 152,
+    "light_sky_blue1": 153,
+    "green_yellow": 154,
+    "dark_olive_green2": 155,
+    "dark_sea_green1": 193,
+    "pale_turquoise1": 159,
+    "deep_pink3": 162,
+    "magenta2": 200,
+    "hot_pink2": 169,
+    "orchid": 170,
+    "medium_orchid1": 207,
+    "orange3": 172,
+    "light_pink3": 174,
+    "pink3": 175,
+    "plum3": 176,
+    "violet": 177,
+    "light_goldenrod3": 179,
+    "tan": 180,
+    "misty_rose3": 181,
+    "thistle3": 182,
+    "plum2": 183,
+    "khaki3": 185,
+    "light_goldenrod2": 222,
+    "light_yellow3": 187,
+    "grey84": 188,
+    "gray84": 188,
+    "light_steel_blue1": 189,
+    "yellow2": 190,
+    "dark_olive_green1": 192,
+    "honeydew2": 194,
+    "light_cyan1": 195,
+    "red1": 196,
+    "deep_pink2": 197,
+    "deep_pink1": 199,
+    "magenta1": 201,
+    "orange_red1": 202,
+    "indian_red1": 204,
+    "hot_pink": 206,
+    "dark_orange": 208,
+    "salmon1": 209,
+    "light_coral": 210,
+    "pale_violet_red1": 211,
+    "orchid2": 212,
+    "orchid1": 213,
+    "orange1": 214,
+    "sandy_brown": 215,
+    "light_salmon1": 216,
+    "light_pink1": 217,
+    "pink1": 218,
+    "plum1": 219,
+    "gold1": 220,
+    "navajo_white1": 223,
+    "misty_rose1": 224,
+    "thistle1": 225,
+    "yellow1": 226,
+    "light_goldenrod1": 227,
+    "khaki1": 228,
+    "wheat1": 229,
+    "cornsilk1": 230,
+    "grey100": 231,
+    "gray100": 231,
+    "grey3": 232,
+    "gray3": 232,
+    "grey7": 233,
+    "gray7": 233,
+    "grey11": 234,
+    "gray11": 234,
+    "grey15": 235,
+    "gray15": 235,
+    "grey19": 236,
+    "gray19": 236,
+    "grey23": 237,
+    "gray23": 237,
+    "grey27": 238,
+    "gray27": 238,
+    "grey30": 239,
+    "gray30": 239,
+    "grey35": 240,
+    "gray35": 240,
+    "grey39": 241,
+    "gray39": 241,
+    "grey42": 242,
+    "gray42": 242,
+    "grey46": 243,
+    "gray46": 243,
+    "grey50": 244,
+    "gray50": 244,
+    "grey54": 245,
+    "gray54": 245,
+    "grey58": 246,
+    "gray58": 246,
+    "grey62": 247,
+    "gray62": 247,
+    "grey66": 248,
+    "gray66": 248,
+    "grey70": 249,
+    "gray70": 249,
+    "grey74": 250,
+    "gray74": 250,
+    "grey78": 251,
+    "gray78": 251,
+    "grey82": 252,
+    "gray82": 252,
+    "grey85": 253,
+    "gray85": 253,
+    "grey89": 254,
+    "gray89": 254,
+    "grey93": 255,
+    "gray93": 255,
+}
+
+
+class ColorParseError(Exception):
+    """The color could not be parsed."""
+
+
+RE_COLOR = re.compile(
+    r"""^
+\#([0-9a-f]{6})$|
+color\(([0-9]{1,3})\)$|
+rgb\(([\d\s,]+)\)$
+""",
+    re.VERBOSE,
+)
+
+
+@rich_repr
+class Color(NamedTuple):
+    """Terminal color definition."""
+
+    name: str
+    """The name of the color (typically the input to Color.parse)."""
+    type: ColorType
+    """The type of the color."""
+    number: Optional[int] = None
+    """The color number, if a standard color, or None."""
+    triplet: Optional[ColorTriplet] = None
+    """A triplet of color components, if an RGB color."""
+
+    def __rich__(self) -> "Text":
+        """Displays the actual color if Rich printed."""
+        from .style import Style
+        from .text import Text
+
+        return Text.assemble(
+            f"<color {self.name!r} ({self.type.name.lower()})",
+            ("⬤", Style(color=self)),
+            " >",
+        )
+
+    def __rich_repr__(self) -> Result:
+        yield self.name
+        yield self.type
+        yield "number", self.number, None
+        yield "triplet", self.triplet, None
+
+    @property
+    def system(self) -> ColorSystem:
+        """Get the native color system for this color."""
+        if self.type == ColorType.DEFAULT:
+            return ColorSystem.STANDARD
+        return ColorSystem(int(self.type))
+
+    @property
+    def is_system_defined(self) -> bool:
+        """Check if the color is ultimately defined by the system."""
+        return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR)
+
+    @property
+    def is_default(self) -> bool:
+        """Check if the color is a default color."""
+        return self.type == ColorType.DEFAULT
+
+    def get_truecolor(
+        self, theme: Optional["TerminalTheme"] = None, foreground: bool = True
+    ) -> ColorTriplet:
+        """Get an equivalent color triplet for this color.
+
+        Args:
+            theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None.
+            foreground (bool, optional): True for a foreground color, or False for background. Defaults to True.
+
+        Returns:
+            ColorTriplet: A color triplet containing RGB components.
+        """
+
+        if theme is None:
+            theme = DEFAULT_TERMINAL_THEME
+        if self.type == ColorType.TRUECOLOR:
+            assert self.triplet is not None
+            return self.triplet
+        elif self.type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return EIGHT_BIT_PALETTE[self.number]
+        elif self.type == ColorType.STANDARD:
+            assert self.number is not None
+            return theme.ansi_colors[self.number]
+        elif self.type == ColorType.WINDOWS:
+            assert self.number is not None
+            return WINDOWS_PALETTE[self.number]
+        else:  # self.type == ColorType.DEFAULT:
+            assert self.number is None
+            return theme.foreground_color if foreground else theme.background_color
+
+    @classmethod
+    def from_ansi(cls, number: int) -> "Color":
+        """Create a Color number from it's 8-bit ansi number.
+
+        Args:
+            number (int): A number between 0-255 inclusive.
+
+        Returns:
+            Color: A new Color instance.
+        """
+        return cls(
+            name=f"color({number})",
+            type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+            number=number,
+        )
+
+    @classmethod
+    def from_triplet(cls, triplet: "ColorTriplet") -> "Color":
+        """Create a truecolor RGB color from a triplet of values.
+
+        Args:
+            triplet (ColorTriplet): A color triplet containing red, green and blue components.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet)
+
+    @classmethod
+    def from_rgb(cls, red: float, green: float, blue: float) -> "Color":
+        """Create a truecolor from three color components in the range(0->255).
+
+        Args:
+            red (float): Red component in range 0-255.
+            green (float): Green component in range 0-255.
+            blue (float): Blue component in range 0-255.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue)))
+
+    @classmethod
+    def default(cls) -> "Color":
+        """Get a Color instance representing the default color.
+
+        Returns:
+            Color: Default color.
+        """
+        return cls(name="default", type=ColorType.DEFAULT)
+
+    @classmethod
+    @lru_cache(maxsize=1024)
+    def parse(cls, color: str) -> "Color":
+        """Parse a color definition."""
+        original_color = color
+        color = color.lower().strip()
+
+        if color == "default":
+            return cls(color, type=ColorType.DEFAULT)
+
+        color_number = ANSI_COLOR_NAMES.get(color)
+        if color_number is not None:
+            return cls(
+                color,
+                type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT),
+                number=color_number,
+            )
+
+        color_match = RE_COLOR.match(color)
+        if color_match is None:
+            raise ColorParseError(f"{original_color!r} is not a valid color")
+
+        color_24, color_8, color_rgb = color_match.groups()
+        if color_24:
+            triplet = ColorTriplet(
+                int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16)
+            )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+        elif color_8:
+            number = int(color_8)
+            if number > 255:
+                raise ColorParseError(f"color number must be <= 255 in {color!r}")
+            return cls(
+                color,
+                type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+                number=number,
+            )
+
+        else:  #  color_rgb:
+            components = color_rgb.split(",")
+            if len(components) != 3:
+                raise ColorParseError(
+                    f"expected three components in {original_color!r}"
+                )
+            red, green, blue = components
+            triplet = ColorTriplet(int(red), int(green), int(blue))
+            if not all(component <= 255 for component in triplet):
+                raise ColorParseError(
+                    f"color components must be <= 255 in {original_color!r}"
+                )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+    @lru_cache(maxsize=1024)
+    def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]:
+        """Get the ANSI escape codes for this color."""
+        _type = self.type
+        if _type == ColorType.DEFAULT:
+            return ("39" if foreground else "49",)
+
+        elif _type == ColorType.WINDOWS:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.STANDARD:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return ("38" if foreground else "48", "5", str(self.number))
+
+        else:  # self.standard == ColorStandard.TRUECOLOR:
+            assert self.triplet is not None
+            red, green, blue = self.triplet
+            return ("38" if foreground else "48", "2", str(red), str(green), str(blue))
+
+    @lru_cache(maxsize=1024)
+    def downgrade(self, system: ColorSystem) -> "Color":
+        """Downgrade a color system to a system with fewer colors."""
+
+        if self.type in (ColorType.DEFAULT, system):
+            return self
+        # Convert to 8-bit color from truecolor color
+        if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR:
+            assert self.triplet is not None
+            _h, l, s = rgb_to_hls(*self.triplet.normalized)
+            # If saturation is under 15% assume it is grayscale
+            if s < 0.15:
+                gray = round(l * 25.0)
+                if gray == 0:
+                    color_number = 16
+                elif gray == 25:
+                    color_number = 231
+                else:
+                    color_number = 231 + gray
+                return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+            red, green, blue = self.triplet
+            six_red = red / 95 if red < 95 else 1 + (red - 95) / 40
+            six_green = green / 95 if green < 95 else 1 + (green - 95) / 40
+            six_blue = blue / 95 if blue < 95 else 1 + (blue - 95) / 40
+
+            color_number = (
+                16 + 36 * round(six_red) + 6 * round(six_green) + round(six_blue)
+            )
+            return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+        # Convert to standard from truecolor or 8-bit
+        elif system == ColorSystem.STANDARD:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = STANDARD_PALETTE.match(triplet)
+            return Color(self.name, ColorType.STANDARD, number=color_number)
+
+        elif system == ColorSystem.WINDOWS:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                if self.number < 16:
+                    return Color(self.name, ColorType.WINDOWS, number=self.number)
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = WINDOWS_PALETTE.match(triplet)
+            return Color(self.name, ColorType.WINDOWS, number=color_number)
+
+        return self
+
+
+def parse_rgb_hex(hex_color: str) -> ColorTriplet:
+    """Parse six hex characters in to RGB triplet."""
+    assert len(hex_color) == 6, "must be 6 characters"
+    color = ColorTriplet(
+        int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16)
+    )
+    return color
+
+
+def blend_rgb(
+    color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5
+) -> ColorTriplet:
+    """Blend one RGB color in to another."""
+    r1, g1, b1 = color1
+    r2, g2, b2 = color2
+    new_color = ColorTriplet(
+        int(r1 + (r2 - r1) * cross_fade),
+        int(g1 + (g2 - g1) * cross_fade),
+        int(b1 + (b2 - b1) * cross_fade),
+    )
+    return new_color
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console()
+
+    table = Table(show_footer=False, show_edge=True)
+    table.add_column("Color", width=10, overflow="ellipsis")
+    table.add_column("Number", justify="right", style="yellow")
+    table.add_column("Name", style="green")
+    table.add_column("Hex", style="blue")
+    table.add_column("RGB", style="magenta")
+
+    colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items())
+    for color_number, name in colors:
+        if "grey" in name:
+            continue
+        color_cell = Text(" " * 10, style=f"on {name}")
+        if color_number < 16:
+            table.add_row(color_cell, f"{color_number}", Text(f'"{name}"'))
+        else:
+            color = EIGHT_BIT_PALETTE[color_number]  # type: ignore[has-type]
+            table.add_row(
+                color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb
+            )
+
+    console.print(table)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color_triplet.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color_triplet.py
new file mode 100644
index 0000000000000000000000000000000000000000..02cab328251af9bfa809981aaa44933c407e2cd7
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/color_triplet.py
@@ -0,0 +1,38 @@
+from typing import NamedTuple, Tuple
+
+
+class ColorTriplet(NamedTuple):
+    """The red, green, and blue components of a color."""
+
+    red: int
+    """Red component in 0 to 255 range."""
+    green: int
+    """Green component in 0 to 255 range."""
+    blue: int
+    """Blue component in 0 to 255 range."""
+
+    @property
+    def hex(self) -> str:
+        """get the color triplet in CSS style."""
+        red, green, blue = self
+        return f"#{red:02x}{green:02x}{blue:02x}"
+
+    @property
+    def rgb(self) -> str:
+        """The color in RGB format.
+
+        Returns:
+            str: An rgb color, e.g. ``"rgb(100,23,255)"``.
+        """
+        red, green, blue = self
+        return f"rgb({red},{green},{blue})"
+
+    @property
+    def normalized(self) -> Tuple[float, float, float]:
+        """Convert components into floats between 0 and 1.
+
+        Returns:
+            Tuple[float, float, float]: A tuple of three normalized colour components.
+        """
+        red, green, blue = self
+        return red / 255.0, green / 255.0, blue / 255.0
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/console.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/console.py
new file mode 100644
index 0000000000000000000000000000000000000000..e559cbb43c18392606d1212cfbde76339719a6a0
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/console.py
@@ -0,0 +1,2633 @@
+import inspect
+import os
+import platform
+import sys
+import threading
+import zlib
+from abc import ABC, abstractmethod
+from dataclasses import dataclass, field
+from datetime import datetime
+from functools import wraps
+from getpass import getpass
+from html import escape
+from inspect import isclass
+from itertools import islice
+from math import ceil
+from time import monotonic
+from types import FrameType, ModuleType, TracebackType
+from typing import (
+    IO,
+    TYPE_CHECKING,
+    Any,
+    Callable,
+    Dict,
+    Iterable,
+    List,
+    Mapping,
+    NamedTuple,
+    Optional,
+    TextIO,
+    Tuple,
+    Type,
+    Union,
+    cast,
+)
+
+from pip._vendor.rich._null_file import NULL_FILE
+
+if sys.version_info >= (3, 8):
+    from typing import Literal, Protocol, runtime_checkable
+else:
+    from pip._vendor.typing_extensions import (
+        Literal,
+        Protocol,
+        runtime_checkable,
+    )  # pragma: no cover
+
+from . import errors, themes
+from ._emoji_replace import _emoji_replace
+from ._export_format import CONSOLE_HTML_FORMAT, CONSOLE_SVG_FORMAT
+from ._fileno import get_fileno
+from ._log_render import FormatTimeCallable, LogRender
+from .align import Align, AlignMethod
+from .color import ColorSystem, blend_rgb
+from .control import Control
+from .emoji import EmojiVariant
+from .highlighter import NullHighlighter, ReprHighlighter
+from .markup import render as render_markup
+from .measure import Measurement, measure_renderables
+from .pager import Pager, SystemPager
+from .pretty import Pretty, is_expandable
+from .protocol import rich_cast
+from .region import Region
+from .scope import render_scope
+from .screen import Screen
+from .segment import Segment
+from .style import Style, StyleType
+from .styled import Styled
+from .terminal_theme import DEFAULT_TERMINAL_THEME, SVG_EXPORT_THEME, TerminalTheme
+from .text import Text, TextType
+from .theme import Theme, ThemeStack
+
+if TYPE_CHECKING:
+    from ._windows import WindowsConsoleFeatures
+    from .live import Live
+    from .status import Status
+
+JUPYTER_DEFAULT_COLUMNS = 115
+JUPYTER_DEFAULT_LINES = 100
+WINDOWS = platform.system() == "Windows"
+
+HighlighterType = Callable[[Union[str, "Text"]], "Text"]
+JustifyMethod = Literal["default", "left", "center", "right", "full"]
+OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"]
+
+
+class NoChange:
+    pass
+
+
+NO_CHANGE = NoChange()
+
+try:
+    _STDIN_FILENO = sys.__stdin__.fileno()
+except Exception:
+    _STDIN_FILENO = 0
+try:
+    _STDOUT_FILENO = sys.__stdout__.fileno()
+except Exception:
+    _STDOUT_FILENO = 1
+try:
+    _STDERR_FILENO = sys.__stderr__.fileno()
+except Exception:
+    _STDERR_FILENO = 2
+
+_STD_STREAMS = (_STDIN_FILENO, _STDOUT_FILENO, _STDERR_FILENO)
+_STD_STREAMS_OUTPUT = (_STDOUT_FILENO, _STDERR_FILENO)
+
+
+_TERM_COLORS = {
+    "kitty": ColorSystem.EIGHT_BIT,
+    "256color": ColorSystem.EIGHT_BIT,
+    "16color": ColorSystem.STANDARD,
+}
+
+
+class ConsoleDimensions(NamedTuple):
+    """Size of the terminal."""
+
+    width: int
+    """The width of the console in 'cells'."""
+    height: int
+    """The height of the console in lines."""
+
+
+@dataclass
+class ConsoleOptions:
+    """Options for __rich_console__ method."""
+
+    size: ConsoleDimensions
+    """Size of console."""
+    legacy_windows: bool
+    """legacy_windows: flag for legacy windows."""
+    min_width: int
+    """Minimum width of renderable."""
+    max_width: int
+    """Maximum width of renderable."""
+    is_terminal: bool
+    """True if the target is a terminal, otherwise False."""
+    encoding: str
+    """Encoding of terminal."""
+    max_height: int
+    """Height of container (starts as terminal)"""
+    justify: Optional[JustifyMethod] = None
+    """Justify value override for renderable."""
+    overflow: Optional[OverflowMethod] = None
+    """Overflow value override for renderable."""
+    no_wrap: Optional[bool] = False
+    """Disable wrapping for text."""
+    highlight: Optional[bool] = None
+    """Highlight override for render_str."""
+    markup: Optional[bool] = None
+    """Enable markup when rendering strings."""
+    height: Optional[int] = None
+
+    @property
+    def ascii_only(self) -> bool:
+        """Check if renderables should use ascii only."""
+        return not self.encoding.startswith("utf")
+
+    def copy(self) -> "ConsoleOptions":
+        """Return a copy of the options.
+
+        Returns:
+            ConsoleOptions: a copy of self.
+        """
+        options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions)
+        options.__dict__ = self.__dict__.copy()
+        return options
+
+    def update(
+        self,
+        *,
+        width: Union[int, NoChange] = NO_CHANGE,
+        min_width: Union[int, NoChange] = NO_CHANGE,
+        max_width: Union[int, NoChange] = NO_CHANGE,
+        justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE,
+        overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE,
+        no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE,
+        highlight: Union[Optional[bool], NoChange] = NO_CHANGE,
+        markup: Union[Optional[bool], NoChange] = NO_CHANGE,
+        height: Union[Optional[int], NoChange] = NO_CHANGE,
+    ) -> "ConsoleOptions":
+        """Update values, return a copy."""
+        options = self.copy()
+        if not isinstance(width, NoChange):
+            options.min_width = options.max_width = max(0, width)
+        if not isinstance(min_width, NoChange):
+            options.min_width = min_width
+        if not isinstance(max_width, NoChange):
+            options.max_width = max_width
+        if not isinstance(justify, NoChange):
+            options.justify = justify
+        if not isinstance(overflow, NoChange):
+            options.overflow = overflow
+        if not isinstance(no_wrap, NoChange):
+            options.no_wrap = no_wrap
+        if not isinstance(highlight, NoChange):
+            options.highlight = highlight
+        if not isinstance(markup, NoChange):
+            options.markup = markup
+        if not isinstance(height, NoChange):
+            if height is not None:
+                options.max_height = height
+            options.height = None if height is None else max(0, height)
+        return options
+
+    def update_width(self, width: int) -> "ConsoleOptions":
+        """Update just the width, return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width)
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        return options
+
+    def update_height(self, height: int) -> "ConsoleOptions":
+        """Update the height, and return a copy.
+
+        Args:
+            height (int): New height
+
+        Returns:
+            ~ConsoleOptions: New Console options instance.
+        """
+        options = self.copy()
+        options.max_height = options.height = height
+        return options
+
+    def reset_height(self) -> "ConsoleOptions":
+        """Return a copy of the options with height set to ``None``.
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.height = None
+        return options
+
+    def update_dimensions(self, width: int, height: int) -> "ConsoleOptions":
+        """Update the width and height, and return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width).
+            height (int): New height.
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        options.height = options.max_height = height
+        return options
+
+
+@runtime_checkable
+class RichCast(Protocol):
+    """An object that may be 'cast' to a console renderable."""
+
+    def __rich__(
+        self,
+    ) -> Union["ConsoleRenderable", "RichCast", str]:  # pragma: no cover
+        ...
+
+
+@runtime_checkable
+class ConsoleRenderable(Protocol):
+    """An object that supports the console protocol."""
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":  # pragma: no cover
+        ...
+
+
+# A type that may be rendered by Console.
+RenderableType = Union[ConsoleRenderable, RichCast, str]
+
+# The result of calling a __rich_console__ method.
+RenderResult = Iterable[Union[RenderableType, Segment]]
+
+_null_highlighter = NullHighlighter()
+
+
+class CaptureError(Exception):
+    """An error in the Capture context manager."""
+
+
+class NewLine:
+    """A renderable to generate new line(s)"""
+
+    def __init__(self, count: int = 1) -> None:
+        self.count = count
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Iterable[Segment]:
+        yield Segment("\n" * self.count)
+
+
+class ScreenUpdate:
+    """Render a list of lines at a given offset."""
+
+    def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None:
+        self._lines = lines
+        self.x = x
+        self.y = y
+
+    def __rich_console__(
+        self, console: "Console", options: ConsoleOptions
+    ) -> RenderResult:
+        x = self.x
+        move_to = Control.move_to
+        for offset, line in enumerate(self._lines, self.y):
+            yield move_to(x, offset)
+            yield from line
+
+
+class Capture:
+    """Context manager to capture the result of printing to the console.
+    See :meth:`~rich.console.Console.capture` for how to use.
+
+    Args:
+        console (Console): A console instance to capture output.
+    """
+
+    def __init__(self, console: "Console") -> None:
+        self._console = console
+        self._result: Optional[str] = None
+
+    def __enter__(self) -> "Capture":
+        self._console.begin_capture()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self._result = self._console.end_capture()
+
+    def get(self) -> str:
+        """Get the result of the capture."""
+        if self._result is None:
+            raise CaptureError(
+                "Capture result is not available until context manager exits."
+            )
+        return self._result
+
+
+class ThemeContext:
+    """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage."""
+
+    def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None:
+        self.console = console
+        self.theme = theme
+        self.inherit = inherit
+
+    def __enter__(self) -> "ThemeContext":
+        self.console.push_theme(self.theme)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.console.pop_theme()
+
+
+class PagerContext:
+    """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage."""
+
+    def __init__(
+        self,
+        console: "Console",
+        pager: Optional[Pager] = None,
+        styles: bool = False,
+        links: bool = False,
+    ) -> None:
+        self._console = console
+        self.pager = SystemPager() if pager is None else pager
+        self.styles = styles
+        self.links = links
+
+    def __enter__(self) -> "PagerContext":
+        self._console._enter_buffer()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if exc_type is None:
+            with self._console._lock:
+                buffer: List[Segment] = self._console._buffer[:]
+                del self._console._buffer[:]
+                segments: Iterable[Segment] = buffer
+                if not self.styles:
+                    segments = Segment.strip_styles(segments)
+                elif not self.links:
+                    segments = Segment.strip_links(segments)
+                content = self._console._render_buffer(segments)
+            self.pager.show(content)
+        self._console._exit_buffer()
+
+
+class ScreenContext:
+    """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage."""
+
+    def __init__(
+        self, console: "Console", hide_cursor: bool, style: StyleType = ""
+    ) -> None:
+        self.console = console
+        self.hide_cursor = hide_cursor
+        self.screen = Screen(style=style)
+        self._changed = False
+
+    def update(
+        self, *renderables: RenderableType, style: Optional[StyleType] = None
+    ) -> None:
+        """Update the screen.
+
+        Args:
+            renderable (RenderableType, optional): Optional renderable to replace current renderable,
+                or None for no change. Defaults to None.
+            style: (Style, optional): Replacement style, or None for no change. Defaults to None.
+        """
+        if renderables:
+            self.screen.renderable = (
+                Group(*renderables) if len(renderables) > 1 else renderables[0]
+            )
+        if style is not None:
+            self.screen.style = style
+        self.console.print(self.screen, end="")
+
+    def __enter__(self) -> "ScreenContext":
+        self._changed = self.console.set_alt_screen(True)
+        if self._changed and self.hide_cursor:
+            self.console.show_cursor(False)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if self._changed:
+            self.console.set_alt_screen(False)
+            if self.hide_cursor:
+                self.console.show_cursor(True)
+
+
+class Group:
+    """Takes a group of renderables and returns a renderable object that renders the group.
+
+    Args:
+        renderables (Iterable[RenderableType]): An iterable of renderable objects.
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None:
+        self._renderables = renderables
+        self.fit = fit
+        self._render: Optional[List[RenderableType]] = None
+
+    @property
+    def renderables(self) -> List["RenderableType"]:
+        if self._render is None:
+            self._render = list(self._renderables)
+        return self._render
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.fit:
+            return measure_renderables(console, options, self.renderables)
+        else:
+            return Measurement(options.max_width, options.max_width)
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> RenderResult:
+        yield from self.renderables
+
+
+def group(fit: bool = True) -> Callable[..., Callable[..., Group]]:
+    """A decorator that turns an iterable of renderables in to a group.
+
+    Args:
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def decorator(
+        method: Callable[..., Iterable[RenderableType]]
+    ) -> Callable[..., Group]:
+        """Convert a method that returns an iterable of renderables in to a Group."""
+
+        @wraps(method)
+        def _replace(*args: Any, **kwargs: Any) -> Group:
+            renderables = method(*args, **kwargs)
+            return Group(*renderables, fit=fit)
+
+        return _replace
+
+    return decorator
+
+
+def _is_jupyter() -> bool:  # pragma: no cover
+    """Check if we're running in a Jupyter notebook."""
+    try:
+        get_ipython  # type: ignore[name-defined]
+    except NameError:
+        return False
+    ipython = get_ipython()  # type: ignore[name-defined]
+    shell = ipython.__class__.__name__
+    if (
+        "google.colab" in str(ipython.__class__)
+        or os.getenv("DATABRICKS_RUNTIME_VERSION")
+        or shell == "ZMQInteractiveShell"
+    ):
+        return True  # Jupyter notebook or qtconsole
+    elif shell == "TerminalInteractiveShell":
+        return False  # Terminal running IPython
+    else:
+        return False  # Other type (?)
+
+
+COLOR_SYSTEMS = {
+    "standard": ColorSystem.STANDARD,
+    "256": ColorSystem.EIGHT_BIT,
+    "truecolor": ColorSystem.TRUECOLOR,
+    "windows": ColorSystem.WINDOWS,
+}
+
+_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()}
+
+
+@dataclass
+class ConsoleThreadLocals(threading.local):
+    """Thread local values for Console context."""
+
+    theme_stack: ThemeStack
+    buffer: List[Segment] = field(default_factory=list)
+    buffer_index: int = 0
+
+
+class RenderHook(ABC):
+    """Provides hooks in to the render process."""
+
+    @abstractmethod
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Called with a list of objects to render.
+
+        This method can return a new list of renderables, or modify and return the same list.
+
+        Args:
+            renderables (List[ConsoleRenderable]): A number of renderable objects.
+
+        Returns:
+            List[ConsoleRenderable]: A replacement list of renderables.
+        """
+
+
+_windows_console_features: Optional["WindowsConsoleFeatures"] = None
+
+
+def get_windows_console_features() -> "WindowsConsoleFeatures":  # pragma: no cover
+    global _windows_console_features
+    if _windows_console_features is not None:
+        return _windows_console_features
+    from ._windows import get_windows_console_features
+
+    _windows_console_features = get_windows_console_features()
+    return _windows_console_features
+
+
+def detect_legacy_windows() -> bool:
+    """Detect legacy Windows."""
+    return WINDOWS and not get_windows_console_features().vt
+
+
+class Console:
+    """A high level console interface.
+
+    Args:
+        color_system (str, optional): The color system supported by your terminal,
+            either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect.
+        force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None.
+        force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None.
+        force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None.
+        soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False.
+        theme (Theme, optional): An optional style theme object, or ``None`` for default theme.
+        stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False.
+        file (IO, optional): A file object where the console should write to. Defaults to stdout.
+        quiet (bool, Optional): Boolean to suppress all output. Defaults to False.
+        width (int, optional): The width of the terminal. Leave as default to auto-detect width.
+        height (int, optional): The height of the terminal. Leave as default to auto-detect height.
+        style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None.
+        no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None.
+        tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8.
+        record (bool, optional): Boolean to enable recording of terminal output,
+            required to call :meth:`export_html`, :meth:`export_svg`, and :meth:`export_text`. Defaults to False.
+        markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True.
+        emoji (bool, optional): Enable emoji code. Defaults to True.
+        emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None.
+        highlight (bool, optional): Enable automatic highlighting. Defaults to True.
+        log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True.
+        log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ".
+        highlighter (HighlighterType, optional): Default highlighter.
+        legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``.
+        safe_box (bool, optional): Restrict box options that don't render on legacy Windows.
+        get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log),
+            or None for datetime.now.
+        get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic.
+    """
+
+    _environ: Mapping[str, str] = os.environ
+
+    def __init__(
+        self,
+        *,
+        color_system: Optional[
+            Literal["auto", "standard", "256", "truecolor", "windows"]
+        ] = "auto",
+        force_terminal: Optional[bool] = None,
+        force_jupyter: Optional[bool] = None,
+        force_interactive: Optional[bool] = None,
+        soft_wrap: bool = False,
+        theme: Optional[Theme] = None,
+        stderr: bool = False,
+        file: Optional[IO[str]] = None,
+        quiet: bool = False,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        style: Optional[StyleType] = None,
+        no_color: Optional[bool] = None,
+        tab_size: int = 8,
+        record: bool = False,
+        markup: bool = True,
+        emoji: bool = True,
+        emoji_variant: Optional[EmojiVariant] = None,
+        highlight: bool = True,
+        log_time: bool = True,
+        log_path: bool = True,
+        log_time_format: Union[str, FormatTimeCallable] = "[%X]",
+        highlighter: Optional["HighlighterType"] = ReprHighlighter(),
+        legacy_windows: Optional[bool] = None,
+        safe_box: bool = True,
+        get_datetime: Optional[Callable[[], datetime]] = None,
+        get_time: Optional[Callable[[], float]] = None,
+        _environ: Optional[Mapping[str, str]] = None,
+    ):
+        # Copy of os.environ allows us to replace it for testing
+        if _environ is not None:
+            self._environ = _environ
+
+        self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter
+        if self.is_jupyter:
+            if width is None:
+                jupyter_columns = self._environ.get("JUPYTER_COLUMNS")
+                if jupyter_columns is not None and jupyter_columns.isdigit():
+                    width = int(jupyter_columns)
+                else:
+                    width = JUPYTER_DEFAULT_COLUMNS
+            if height is None:
+                jupyter_lines = self._environ.get("JUPYTER_LINES")
+                if jupyter_lines is not None and jupyter_lines.isdigit():
+                    height = int(jupyter_lines)
+                else:
+                    height = JUPYTER_DEFAULT_LINES
+
+        self.tab_size = tab_size
+        self.record = record
+        self._markup = markup
+        self._emoji = emoji
+        self._emoji_variant: Optional[EmojiVariant] = emoji_variant
+        self._highlight = highlight
+        self.legacy_windows: bool = (
+            (detect_legacy_windows() and not self.is_jupyter)
+            if legacy_windows is None
+            else legacy_windows
+        )
+
+        if width is None:
+            columns = self._environ.get("COLUMNS")
+            if columns is not None and columns.isdigit():
+                width = int(columns) - self.legacy_windows
+        if height is None:
+            lines = self._environ.get("LINES")
+            if lines is not None and lines.isdigit():
+                height = int(lines)
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+
+        self._color_system: Optional[ColorSystem]
+
+        self._force_terminal = None
+        if force_terminal is not None:
+            self._force_terminal = force_terminal
+
+        self._file = file
+        self.quiet = quiet
+        self.stderr = stderr
+
+        if color_system is None:
+            self._color_system = None
+        elif color_system == "auto":
+            self._color_system = self._detect_color_system()
+        else:
+            self._color_system = COLOR_SYSTEMS[color_system]
+
+        self._lock = threading.RLock()
+        self._log_render = LogRender(
+            show_time=log_time,
+            show_path=log_path,
+            time_format=log_time_format,
+        )
+        self.highlighter: HighlighterType = highlighter or _null_highlighter
+        self.safe_box = safe_box
+        self.get_datetime = get_datetime or datetime.now
+        self.get_time = get_time or monotonic
+        self.style = style
+        self.no_color = (
+            no_color if no_color is not None else "NO_COLOR" in self._environ
+        )
+        self.is_interactive = (
+            (self.is_terminal and not self.is_dumb_terminal)
+            if force_interactive is None
+            else force_interactive
+        )
+
+        self._record_buffer_lock = threading.RLock()
+        self._thread_locals = ConsoleThreadLocals(
+            theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme)
+        )
+        self._record_buffer: List[Segment] = []
+        self._render_hooks: List[RenderHook] = []
+        self._live: Optional["Live"] = None
+        self._is_alt_screen = False
+
+    def __repr__(self) -> str:
+        return f"<console width={self.width} {self._color_system!s}>"
+
+    @property
+    def file(self) -> IO[str]:
+        """Get the file object to write to."""
+        file = self._file or (sys.stderr if self.stderr else sys.stdout)
+        file = getattr(file, "rich_proxied_file", file)
+        if file is None:
+            file = NULL_FILE
+        return file
+
+    @file.setter
+    def file(self, new_file: IO[str]) -> None:
+        """Set a new file object."""
+        self._file = new_file
+
+    @property
+    def _buffer(self) -> List[Segment]:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer
+
+    @property
+    def _buffer_index(self) -> int:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer_index
+
+    @_buffer_index.setter
+    def _buffer_index(self, value: int) -> None:
+        self._thread_locals.buffer_index = value
+
+    @property
+    def _theme_stack(self) -> ThemeStack:
+        """Get the thread local theme stack."""
+        return self._thread_locals.theme_stack
+
+    def _detect_color_system(self) -> Optional[ColorSystem]:
+        """Detect color system from env vars."""
+        if self.is_jupyter:
+            return ColorSystem.TRUECOLOR
+        if not self.is_terminal or self.is_dumb_terminal:
+            return None
+        if WINDOWS:  # pragma: no cover
+            if self.legacy_windows:  # pragma: no cover
+                return ColorSystem.WINDOWS
+            windows_console_features = get_windows_console_features()
+            return (
+                ColorSystem.TRUECOLOR
+                if windows_console_features.truecolor
+                else ColorSystem.EIGHT_BIT
+            )
+        else:
+            color_term = self._environ.get("COLORTERM", "").strip().lower()
+            if color_term in ("truecolor", "24bit"):
+                return ColorSystem.TRUECOLOR
+            term = self._environ.get("TERM", "").strip().lower()
+            _term_name, _hyphen, colors = term.rpartition("-")
+            color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD)
+            return color_system
+
+    def _enter_buffer(self) -> None:
+        """Enter in to a buffer context, and buffer all output."""
+        self._buffer_index += 1
+
+    def _exit_buffer(self) -> None:
+        """Leave buffer context, and render content if required."""
+        self._buffer_index -= 1
+        self._check_buffer()
+
+    def set_live(self, live: "Live") -> None:
+        """Set Live instance. Used by Live context manager.
+
+        Args:
+            live (Live): Live instance using this Console.
+
+        Raises:
+            errors.LiveError: If this Console has a Live context currently active.
+        """
+        with self._lock:
+            if self._live is not None:
+                raise errors.LiveError("Only one live display may be active at once")
+            self._live = live
+
+    def clear_live(self) -> None:
+        """Clear the Live instance."""
+        with self._lock:
+            self._live = None
+
+    def push_render_hook(self, hook: RenderHook) -> None:
+        """Add a new render hook to the stack.
+
+        Args:
+            hook (RenderHook): Render hook instance.
+        """
+        with self._lock:
+            self._render_hooks.append(hook)
+
+    def pop_render_hook(self) -> None:
+        """Pop the last renderhook from the stack."""
+        with self._lock:
+            self._render_hooks.pop()
+
+    def __enter__(self) -> "Console":
+        """Own context manager to enter buffer context."""
+        self._enter_buffer()
+        return self
+
+    def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
+        """Exit buffer context."""
+        self._exit_buffer()
+
+    def begin_capture(self) -> None:
+        """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output."""
+        self._enter_buffer()
+
+    def end_capture(self) -> str:
+        """End capture mode and return captured string.
+
+        Returns:
+            str: Console output.
+        """
+        render_result = self._render_buffer(self._buffer)
+        del self._buffer[:]
+        self._exit_buffer()
+        return render_result
+
+    def push_theme(self, theme: Theme, *, inherit: bool = True) -> None:
+        """Push a new theme on to the top of the stack, replacing the styles from the previous theme.
+        Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather
+        than calling this method directly.
+
+        Args:
+            theme (Theme): A theme instance.
+            inherit (bool, optional): Inherit existing styles. Defaults to True.
+        """
+        self._theme_stack.push_theme(theme, inherit=inherit)
+
+    def pop_theme(self) -> None:
+        """Remove theme from top of stack, restoring previous theme."""
+        self._theme_stack.pop_theme()
+
+    def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext:
+        """Use a different theme for the duration of the context manager.
+
+        Args:
+            theme (Theme): Theme instance to user.
+            inherit (bool, optional): Inherit existing console styles. Defaults to True.
+
+        Returns:
+            ThemeContext: [description]
+        """
+        return ThemeContext(self, theme, inherit)
+
+    @property
+    def color_system(self) -> Optional[str]:
+        """Get color system string.
+
+        Returns:
+            Optional[str]: "standard", "256" or "truecolor".
+        """
+
+        if self._color_system is not None:
+            return _COLOR_SYSTEMS_NAMES[self._color_system]
+        else:
+            return None
+
+    @property
+    def encoding(self) -> str:
+        """Get the encoding of the console file, e.g. ``"utf-8"``.
+
+        Returns:
+            str: A standard encoding string.
+        """
+        return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower()
+
+    @property
+    def is_terminal(self) -> bool:
+        """Check if the console is writing to a terminal.
+
+        Returns:
+            bool: True if the console writing to a device capable of
+            understanding terminal codes, otherwise False.
+        """
+        if self._force_terminal is not None:
+            return self._force_terminal
+
+        if hasattr(sys.stdin, "__module__") and sys.stdin.__module__.startswith(
+            "idlelib"
+        ):
+            # Return False for Idle which claims to be a tty but can't handle ansi codes
+            return False
+
+        if self.is_jupyter:
+            # return False for Jupyter, which may have FORCE_COLOR set
+            return False
+
+        # If FORCE_COLOR env var has any value at all, we assume a terminal.
+        force_color = self._environ.get("FORCE_COLOR")
+        if force_color is not None:
+            self._force_terminal = True
+            return True
+
+        isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None)
+        try:
+            return False if isatty is None else isatty()
+        except ValueError:
+            # in some situation (at the end of a pytest run for example) isatty() can raise
+            # ValueError: I/O operation on closed file
+            # return False because we aren't in a terminal anymore
+            return False
+
+    @property
+    def is_dumb_terminal(self) -> bool:
+        """Detect dumb terminal.
+
+        Returns:
+            bool: True if writing to a dumb terminal, otherwise False.
+
+        """
+        _term = self._environ.get("TERM", "")
+        is_dumb = _term.lower() in ("dumb", "unknown")
+        return self.is_terminal and is_dumb
+
+    @property
+    def options(self) -> ConsoleOptions:
+        """Get default console options."""
+        return ConsoleOptions(
+            max_height=self.size.height,
+            size=self.size,
+            legacy_windows=self.legacy_windows,
+            min_width=1,
+            max_width=self.width,
+            encoding=self.encoding,
+            is_terminal=self.is_terminal,
+        )
+
+    @property
+    def size(self) -> ConsoleDimensions:
+        """Get the size of the console.
+
+        Returns:
+            ConsoleDimensions: A named tuple containing the dimensions.
+        """
+
+        if self._width is not None and self._height is not None:
+            return ConsoleDimensions(self._width - self.legacy_windows, self._height)
+
+        if self.is_dumb_terminal:
+            return ConsoleDimensions(80, 25)
+
+        width: Optional[int] = None
+        height: Optional[int] = None
+
+        if WINDOWS:  # pragma: no cover
+            try:
+                width, height = os.get_terminal_size()
+            except (AttributeError, ValueError, OSError):  # Probably not a terminal
+                pass
+        else:
+            for file_descriptor in _STD_STREAMS:
+                try:
+                    width, height = os.get_terminal_size(file_descriptor)
+                except (AttributeError, ValueError, OSError):
+                    pass
+                else:
+                    break
+
+        columns = self._environ.get("COLUMNS")
+        if columns is not None and columns.isdigit():
+            width = int(columns)
+        lines = self._environ.get("LINES")
+        if lines is not None and lines.isdigit():
+            height = int(lines)
+
+        # get_terminal_size can report 0, 0 if run from pseudo-terminal
+        width = width or 80
+        height = height or 25
+        return ConsoleDimensions(
+            width - self.legacy_windows if self._width is None else self._width,
+            height if self._height is None else self._height,
+        )
+
+    @size.setter
+    def size(self, new_size: Tuple[int, int]) -> None:
+        """Set a new size for the terminal.
+
+        Args:
+            new_size (Tuple[int, int]): New width and height.
+        """
+        width, height = new_size
+        self._width = width
+        self._height = height
+
+    @property
+    def width(self) -> int:
+        """Get the width of the console.
+
+        Returns:
+            int: The width (in characters) of the console.
+        """
+        return self.size.width
+
+    @width.setter
+    def width(self, width: int) -> None:
+        """Set width.
+
+        Args:
+            width (int): New width.
+        """
+        self._width = width
+
+    @property
+    def height(self) -> int:
+        """Get the height of the console.
+
+        Returns:
+            int: The height (in lines) of the console.
+        """
+        return self.size.height
+
+    @height.setter
+    def height(self, height: int) -> None:
+        """Set height.
+
+        Args:
+            height (int): new height.
+        """
+        self._height = height
+
+    def bell(self) -> None:
+        """Play a 'bell' sound (if supported by the terminal)."""
+        self.control(Control.bell())
+
+    def capture(self) -> Capture:
+        """A context manager to *capture* the result of print() or log() in a string,
+        rather than writing it to the console.
+
+        Example:
+            >>> from rich.console import Console
+            >>> console = Console()
+            >>> with console.capture() as capture:
+            ...     console.print("[bold magenta]Hello World[/]")
+            >>> print(capture.get())
+
+        Returns:
+            Capture: Context manager with disables writing to the terminal.
+        """
+        capture = Capture(self)
+        return capture
+
+    def pager(
+        self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False
+    ) -> PagerContext:
+        """A context manager to display anything printed within a "pager". The pager application
+        is defined by the system and will typically support at least pressing a key to scroll.
+
+        Args:
+            pager (Pager, optional): A pager object, or None to use :class:`~rich.pager.SystemPager`. Defaults to None.
+            styles (bool, optional): Show styles in pager. Defaults to False.
+            links (bool, optional): Show links in pager. Defaults to False.
+
+        Example:
+            >>> from rich.console import Console
+            >>> from rich.__main__ import make_test_card
+            >>> console = Console()
+            >>> with console.pager():
+                    console.print(make_test_card())
+
+        Returns:
+            PagerContext: A context manager.
+        """
+        return PagerContext(self, pager=pager, styles=styles, links=links)
+
+    def line(self, count: int = 1) -> None:
+        """Write new line(s).
+
+        Args:
+            count (int, optional): Number of new lines. Defaults to 1.
+        """
+
+        assert count >= 0, "count must be >= 0"
+        self.print(NewLine(count))
+
+    def clear(self, home: bool = True) -> None:
+        """Clear the screen.
+
+        Args:
+            home (bool, optional): Also move the cursor to 'home' position. Defaults to True.
+        """
+        if home:
+            self.control(Control.clear(), Control.home())
+        else:
+            self.control(Control.clear())
+
+    def status(
+        self,
+        status: RenderableType,
+        *,
+        spinner: str = "dots",
+        spinner_style: StyleType = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ) -> "Status":
+        """Display a status and spinner.
+
+        Args:
+            status (RenderableType): A status renderable (str or Text typically).
+            spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+            spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+            speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+            refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+
+        Returns:
+            Status: A Status object that may be used as a context manager.
+        """
+        from .status import Status
+
+        status_renderable = Status(
+            status,
+            console=self,
+            spinner=spinner,
+            spinner_style=spinner_style,
+            speed=speed,
+            refresh_per_second=refresh_per_second,
+        )
+        return status_renderable
+
+    def show_cursor(self, show: bool = True) -> bool:
+        """Show or hide the cursor.
+
+        Args:
+            show (bool, optional): Set visibility of the cursor.
+        """
+        if self.is_terminal:
+            self.control(Control.show_cursor(show))
+            return True
+        return False
+
+    def set_alt_screen(self, enable: bool = True) -> bool:
+        """Enables alternative screen mode.
+
+        Note, if you enable this mode, you should ensure that is disabled before
+        the application exits. See :meth:`~rich.Console.screen` for a context manager
+        that handles this for you.
+
+        Args:
+            enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True.
+
+        Returns:
+            bool: True if the control codes were written.
+
+        """
+        changed = False
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.alt_screen(enable))
+            changed = True
+            self._is_alt_screen = enable
+        return changed
+
+    @property
+    def is_alt_screen(self) -> bool:
+        """Check if the alt screen was enabled.
+
+        Returns:
+            bool: True if the alt screen was enabled, otherwise False.
+        """
+        return self._is_alt_screen
+
+    def set_window_title(self, title: str) -> bool:
+        """Set the title of the console terminal window.
+
+        Warning: There is no means within Rich of "resetting" the window title to its
+        previous value, meaning the title you set will persist even after your application
+        exits.
+
+        ``fish`` shell resets the window title before and after each command by default,
+        negating this issue. Windows Terminal and command prompt will also reset the title for you.
+        Most other shells and terminals, however, do not do this.
+
+        Some terminals may require configuration changes before you can set the title.
+        Some terminals may not support setting the title at all.
+
+        Other software (including the terminal itself, the shell, custom prompts, plugins, etc.)
+        may also set the terminal window title. This could result in whatever value you write
+        using this method being overwritten.
+
+        Args:
+            title (str): The new title of the terminal window.
+
+        Returns:
+            bool: True if the control code to change the terminal title was
+                written, otherwise False. Note that a return value of True
+                does not guarantee that the window title has actually changed,
+                since the feature may be unsupported/disabled in some terminals.
+        """
+        if self.is_terminal:
+            self.control(Control.title(title))
+            return True
+        return False
+
+    def screen(
+        self, hide_cursor: bool = True, style: Optional[StyleType] = None
+    ) -> "ScreenContext":
+        """Context manager to enable and disable 'alternative screen' mode.
+
+        Args:
+            hide_cursor (bool, optional): Also hide the cursor. Defaults to False.
+            style (Style, optional): Optional style for screen. Defaults to None.
+
+        Returns:
+            ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit.
+        """
+        return ScreenContext(self, hide_cursor=hide_cursor, style=style or "")
+
+    def measure(
+        self, renderable: RenderableType, *, options: Optional[ConsoleOptions] = None
+    ) -> Measurement:
+        """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains
+        information regarding the number of characters required to print the renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable or string.
+            options (Optional[ConsoleOptions], optional): Options to use when measuring, or None
+                to use default options. Defaults to None.
+
+        Returns:
+            Measurement: A measurement of the renderable.
+        """
+        measurement = Measurement.get(self, options or self.options, renderable)
+        return measurement
+
+    def render(
+        self, renderable: RenderableType, options: Optional[ConsoleOptions] = None
+    ) -> Iterable[Segment]:
+        """Render an object in to an iterable of `Segment` instances.
+
+        This method contains the logic for rendering objects with the console protocol.
+        You are unlikely to need to use it directly, unless you are extending the library.
+
+        Args:
+            renderable (RenderableType): An object supporting the console protocol, or
+                an object that may be converted to a string.
+            options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None.
+
+        Returns:
+            Iterable[Segment]: An iterable of segments that may be rendered.
+        """
+
+        _options = options or self.options
+        if _options.max_width < 1:
+            # No space to render anything. This prevents potential recursion errors.
+            return
+        render_iterable: RenderResult
+
+        renderable = rich_cast(renderable)
+        if hasattr(renderable, "__rich_console__") and not isclass(renderable):
+            render_iterable = renderable.__rich_console__(self, _options)  # type: ignore[union-attr]
+        elif isinstance(renderable, str):
+            text_renderable = self.render_str(
+                renderable, highlight=_options.highlight, markup=_options.markup
+            )
+            render_iterable = text_renderable.__rich_console__(self, _options)
+        else:
+            raise errors.NotRenderableError(
+                f"Unable to render {renderable!r}; "
+                "A str, Segment or object with __rich_console__ method is required"
+            )
+
+        try:
+            iter_render = iter(render_iterable)
+        except TypeError:
+            raise errors.NotRenderableError(
+                f"object {render_iterable!r} is not renderable"
+            )
+        _Segment = Segment
+        _options = _options.reset_height()
+        for render_output in iter_render:
+            if isinstance(render_output, _Segment):
+                yield render_output
+            else:
+                yield from self.render(render_output, _options)
+
+    def render_lines(
+        self,
+        renderable: RenderableType,
+        options: Optional[ConsoleOptions] = None,
+        *,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        new_lines: bool = False,
+    ) -> List[List[Segment]]:
+        """Render objects in to a list of lines.
+
+        The output of render_lines is useful when further formatting of rendered console text
+        is required, such as the Panel class which draws a border around any renderable object.
+
+        Args:
+            renderable (RenderableType): Any object renderable in the console.
+            options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``.
+            style (Style, optional): Optional style to apply to renderables. Defaults to ``None``.
+            pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``.
+            new_lines (bool, optional): Include "\n" characters at end of lines.
+
+        Returns:
+            List[List[Segment]]: A list of lines, where a line is a list of Segment objects.
+        """
+        with self._lock:
+            render_options = options or self.options
+            _rendered = self.render(renderable, render_options)
+            if style:
+                _rendered = Segment.apply_style(_rendered, style)
+
+            render_height = render_options.height
+            if render_height is not None:
+                render_height = max(0, render_height)
+
+            lines = list(
+                islice(
+                    Segment.split_and_crop_lines(
+                        _rendered,
+                        render_options.max_width,
+                        include_new_lines=new_lines,
+                        pad=pad,
+                        style=style,
+                    ),
+                    None,
+                    render_height,
+                )
+            )
+            if render_options.height is not None:
+                extra_lines = render_options.height - len(lines)
+                if extra_lines > 0:
+                    pad_line = [
+                        [Segment(" " * render_options.max_width, style), Segment("\n")]
+                        if new_lines
+                        else [Segment(" " * render_options.max_width, style)]
+                    ]
+                    lines.extend(pad_line * extra_lines)
+
+            return lines
+
+    def render_str(
+        self,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        highlighter: Optional[HighlighterType] = None,
+    ) -> "Text":
+        """Convert a string to a Text instance. This is called automatically if
+        you print or log a string.
+
+        Args:
+            text (str): Text to render.
+            style (Union[str, Style], optional): Style to apply to rendered text.
+            justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default.
+            highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default.
+            highlighter (HighlighterType, optional): Optional highlighter to apply.
+        Returns:
+            ConsoleRenderable: Renderable object.
+
+        """
+        emoji_enabled = emoji or (emoji is None and self._emoji)
+        markup_enabled = markup or (markup is None and self._markup)
+        highlight_enabled = highlight or (highlight is None and self._highlight)
+
+        if markup_enabled:
+            rich_text = render_markup(
+                text,
+                style=style,
+                emoji=emoji_enabled,
+                emoji_variant=self._emoji_variant,
+            )
+            rich_text.justify = justify
+            rich_text.overflow = overflow
+        else:
+            rich_text = Text(
+                _emoji_replace(text, default_variant=self._emoji_variant)
+                if emoji_enabled
+                else text,
+                justify=justify,
+                overflow=overflow,
+                style=style,
+            )
+
+        _highlighter = (highlighter or self.highlighter) if highlight_enabled else None
+        if _highlighter is not None:
+            highlight_text = _highlighter(str(rich_text))
+            highlight_text.copy_styles(rich_text)
+            return highlight_text
+
+        return rich_text
+
+    def get_style(
+        self, name: Union[str, Style], *, default: Optional[Union[Style, str]] = None
+    ) -> Style:
+        """Get a Style instance by its theme name or parse a definition.
+
+        Args:
+            name (str): The name of a style or a style definition.
+
+        Returns:
+            Style: A Style object.
+
+        Raises:
+            MissingStyle: If no style could be parsed from name.
+
+        """
+        if isinstance(name, Style):
+            return name
+
+        try:
+            style = self._theme_stack.get(name)
+            if style is None:
+                style = Style.parse(name)
+            return style.copy() if style.link else style
+        except errors.StyleSyntaxError as error:
+            if default is not None:
+                return self.get_style(default)
+            raise errors.MissingStyle(
+                f"Failed to get style {name!r}; {error}"
+            ) from None
+
+    def _collect_renderables(
+        self,
+        objects: Iterable[Any],
+        sep: str,
+        end: str,
+        *,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+    ) -> List[ConsoleRenderable]:
+        """Combine a number of renderables and text into one renderable.
+
+        Args:
+            objects (Iterable[Any]): Anything that Rich can render.
+            sep (str): String to write between print data.
+            end (str): String to write at end of print data.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default.
+
+        Returns:
+            List[ConsoleRenderable]: A list of things to render.
+        """
+        renderables: List[ConsoleRenderable] = []
+        _append = renderables.append
+        text: List[Text] = []
+        append_text = text.append
+
+        append = _append
+        if justify in ("left", "center", "right"):
+
+            def align_append(renderable: RenderableType) -> None:
+                _append(Align(renderable, cast(AlignMethod, justify)))
+
+            append = align_append
+
+        _highlighter: HighlighterType = _null_highlighter
+        if highlight or (highlight is None and self._highlight):
+            _highlighter = self.highlighter
+
+        def check_text() -> None:
+            if text:
+                sep_text = Text(sep, justify=justify, end=end)
+                append(sep_text.join(text))
+                text.clear()
+
+        for renderable in objects:
+            renderable = rich_cast(renderable)
+            if isinstance(renderable, str):
+                append_text(
+                    self.render_str(
+                        renderable, emoji=emoji, markup=markup, highlighter=_highlighter
+                    )
+                )
+            elif isinstance(renderable, Text):
+                append_text(renderable)
+            elif isinstance(renderable, ConsoleRenderable):
+                check_text()
+                append(renderable)
+            elif is_expandable(renderable):
+                check_text()
+                append(Pretty(renderable, highlighter=_highlighter))
+            else:
+                append_text(_highlighter(str(renderable)))
+
+        check_text()
+
+        if self.style is not None:
+            style = self.get_style(self.style)
+            renderables = [Styled(renderable, style) for renderable in renderables]
+
+        return renderables
+
+    def rule(
+        self,
+        title: TextType = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        align: AlignMethod = "center",
+    ) -> None:
+        """Draw a line with optional centered title.
+
+        Args:
+            title (str, optional): Text to render over the rule. Defaults to "".
+            characters (str, optional): Character(s) to form the line. Defaults to "─".
+            style (str, optional): Style of line. Defaults to "rule.line".
+            align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+        """
+        from .rule import Rule
+
+        rule = Rule(title=title, characters=characters, style=style, align=align)
+        self.print(rule)
+
+    def control(self, *control: Control) -> None:
+        """Insert non-printing control codes.
+
+        Args:
+            control_codes (str): Control codes, such as those that may move the cursor.
+        """
+        if not self.is_dumb_terminal:
+            with self:
+                self._buffer.extend(_control.segment for _control in control)
+
+    def out(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        highlight: Optional[bool] = None,
+    ) -> None:
+        """Output to the terminal. This is a low-level way of writing to the terminal which unlike
+        :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will
+        optionally apply highlighting and a basic style.
+
+        Args:
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use
+                console default. Defaults to ``None``.
+        """
+        raw_output: str = sep.join(str(_object) for _object in objects)
+        self.print(
+            raw_output,
+            style=style,
+            highlight=highlight,
+            emoji=False,
+            markup=False,
+            no_wrap=True,
+            overflow="ignore",
+            crop=False,
+            end=end,
+        )
+
+    def print(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        no_wrap: Optional[bool] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        crop: bool = True,
+        soft_wrap: Optional[bool] = None,
+        new_line_start: bool = False,
+    ) -> None:
+        """Print to the console.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None.
+            no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``.
+            width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``.
+            crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True.
+            soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for
+                Console default. Defaults to ``None``.
+            new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        if soft_wrap is None:
+            soft_wrap = self.soft_wrap
+        if soft_wrap:
+            if no_wrap is None:
+                no_wrap = True
+            if overflow is None:
+                overflow = "ignore"
+            crop = False
+        render_hooks = self._render_hooks[:]
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            render_options = self.options.update(
+                justify=justify,
+                overflow=overflow,
+                width=min(width, self.width) if width is not None else NO_CHANGE,
+                height=height,
+                no_wrap=no_wrap,
+                markup=markup,
+                highlight=highlight,
+            )
+
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            if style is None:
+                for renderable in renderables:
+                    extend(render(renderable, render_options))
+            else:
+                for renderable in renderables:
+                    extend(
+                        Segment.apply_style(
+                            render(renderable, render_options), self.get_style(style)
+                        )
+                    )
+            if new_line_start:
+                if (
+                    len("".join(segment.text for segment in new_segments).splitlines())
+                    > 1
+                ):
+                    new_segments.insert(0, Segment.line())
+            if crop:
+                buffer_extend = self._buffer.extend
+                for line in Segment.split_and_crop_lines(
+                    new_segments, self.width, pad=False
+                ):
+                    buffer_extend(line)
+            else:
+                self._buffer.extend(new_segments)
+
+    def print_json(
+        self,
+        json: Optional[str] = None,
+        *,
+        data: Any = None,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = False,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        """Pretty prints JSON. Output will be valid JSON.
+
+        Args:
+            json (Optional[str]): A string containing JSON.
+            data (Any): If json is not supplied, then encode this data.
+            indent (Union[None, int, str], optional): Number of spaces to indent. Defaults to 2.
+            highlight (bool, optional): Enable highlighting of output: Defaults to True.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+        """
+        from pip._vendor.rich.json import JSON
+
+        if json is None:
+            json_renderable = JSON.from_data(
+                data,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        else:
+            if not isinstance(json, str):
+                raise TypeError(
+                    f"json must be str. Did you mean print_json(data={json!r}) ?"
+                )
+            json_renderable = JSON(
+                json,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        self.print(json_renderable, soft_wrap=True)
+
+    def update_screen(
+        self,
+        renderable: RenderableType,
+        *,
+        region: Optional[Region] = None,
+        options: Optional[ConsoleOptions] = None,
+    ) -> None:
+        """Update the screen at a given offset.
+
+        Args:
+            renderable (RenderableType): A Rich renderable.
+            region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None.
+            x (int, optional): x offset. Defaults to 0.
+            y (int, optional): y offset. Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        render_options = options or self.options
+        if region is None:
+            x = y = 0
+            render_options = render_options.update_dimensions(
+                render_options.max_width, render_options.height or self.height
+            )
+        else:
+            x, y, width, height = region
+            render_options = render_options.update_dimensions(width, height)
+
+        lines = self.render_lines(renderable, options=render_options)
+        self.update_screen_lines(lines, x, y)
+
+    def update_screen_lines(
+        self, lines: List[List[Segment]], x: int = 0, y: int = 0
+    ) -> None:
+        """Update lines of the screen at a given offset.
+
+        Args:
+            lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`).
+            x (int, optional): x offset (column no). Defaults to 0.
+            y (int, optional): y offset (column no). Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        screen_update = ScreenUpdate(lines, x, y)
+        segments = self.render(screen_update)
+        self._buffer.extend(segments)
+        self._check_buffer()
+
+    def print_exception(
+        self,
+        *,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> None:
+        """Prints a rich render of the last exception and traceback.
+
+        Args:
+            width (Optional[int], optional): Number of characters used to render code. Defaults to 100.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+        """
+        from .traceback import Traceback
+
+        traceback = Traceback(
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+        self.print(traceback)
+
+    @staticmethod
+    def _caller_frame_info(
+        offset: int,
+        currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe,
+    ) -> Tuple[str, int, Dict[str, Any]]:
+        """Get caller frame information.
+
+        Args:
+            offset (int): the caller offset within the current frame stack.
+            currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to
+                retrieve the current frame. Defaults to ``inspect.currentframe``.
+
+        Returns:
+            Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and
+                the dictionary of local variables associated with the caller frame.
+
+        Raises:
+            RuntimeError: If the stack offset is invalid.
+        """
+        # Ignore the frame of this local helper
+        offset += 1
+
+        frame = currentframe()
+        if frame is not None:
+            # Use the faster currentframe where implemented
+            while offset and frame is not None:
+                frame = frame.f_back
+                offset -= 1
+            assert frame is not None
+            return frame.f_code.co_filename, frame.f_lineno, frame.f_locals
+        else:
+            # Fallback to the slower stack
+            frame_info = inspect.stack()[offset]
+            return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals
+
+    def log(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        log_locals: bool = False,
+        _stack_offset: int = 1,
+    ) -> None:
+        """Log rich content to the terminal.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None.
+            log_locals (bool, optional): Boolean to enable logging of locals where ``log()``
+                was called. Defaults to False.
+            _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        render_hooks = self._render_hooks[:]
+
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            if style is not None:
+                renderables = [Styled(renderable, style) for renderable in renderables]
+
+            filename, line_no, locals = self._caller_frame_info(_stack_offset)
+            link_path = None if filename.startswith("<") else os.path.abspath(filename)
+            path = filename.rpartition(os.sep)[-1]
+            if log_locals:
+                locals_map = {
+                    key: value
+                    for key, value in locals.items()
+                    if not key.startswith("__")
+                }
+                renderables.append(render_scope(locals_map, title="[i]locals"))
+
+            renderables = [
+                self._log_render(
+                    self,
+                    renderables,
+                    log_time=self.get_datetime(),
+                    path=path,
+                    line_no=line_no,
+                    link_path=link_path,
+                )
+            ]
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            render_options = self.options
+            for renderable in renderables:
+                extend(render(renderable, render_options))
+            buffer_extend = self._buffer.extend
+            for line in Segment.split_and_crop_lines(
+                new_segments, self.width, pad=False
+            ):
+                buffer_extend(line)
+
+    def _check_buffer(self) -> None:
+        """Check if the buffer may be rendered. Render it if it can (e.g. Console.quiet is False)
+        Rendering is supported on Windows, Unix and Jupyter environments. For
+        legacy Windows consoles, the win32 API is called directly.
+        This method will also record what it renders if recording is enabled via Console.record.
+        """
+        if self.quiet:
+            del self._buffer[:]
+            return
+        with self._lock:
+            if self.record:
+                with self._record_buffer_lock:
+                    self._record_buffer.extend(self._buffer[:])
+
+            if self._buffer_index == 0:
+                if self.is_jupyter:  # pragma: no cover
+                    from .jupyter import display
+
+                    display(self._buffer, self._render_buffer(self._buffer[:]))
+                    del self._buffer[:]
+                else:
+                    if WINDOWS:
+                        use_legacy_windows_render = False
+                        if self.legacy_windows:
+                            fileno = get_fileno(self.file)
+                            if fileno is not None:
+                                use_legacy_windows_render = (
+                                    fileno in _STD_STREAMS_OUTPUT
+                                )
+
+                        if use_legacy_windows_render:
+                            from pip._vendor.rich._win32_console import LegacyWindowsTerm
+                            from pip._vendor.rich._windows_renderer import legacy_windows_render
+
+                            buffer = self._buffer[:]
+                            if self.no_color and self._color_system:
+                                buffer = list(Segment.remove_color(buffer))
+
+                            legacy_windows_render(buffer, LegacyWindowsTerm(self.file))
+                        else:
+                            # Either a non-std stream on legacy Windows, or modern Windows.
+                            text = self._render_buffer(self._buffer[:])
+                            # https://bugs.python.org/issue37871
+                            # https://github.com/python/cpython/issues/82052
+                            # We need to avoid writing more than 32Kb in a single write, due to the above bug
+                            write = self.file.write
+                            # Worse case scenario, every character is 4 bytes of utf-8
+                            MAX_WRITE = 32 * 1024 // 4
+                            try:
+                                if len(text) <= MAX_WRITE:
+                                    write(text)
+                                else:
+                                    batch: List[str] = []
+                                    batch_append = batch.append
+                                    size = 0
+                                    for line in text.splitlines(True):
+                                        if size + len(line) > MAX_WRITE and batch:
+                                            write("".join(batch))
+                                            batch.clear()
+                                            size = 0
+                                        batch_append(line)
+                                        size += len(line)
+                                    if batch:
+                                        write("".join(batch))
+                                        batch.clear()
+                            except UnicodeEncodeError as error:
+                                error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***"
+                                raise
+                    else:
+                        text = self._render_buffer(self._buffer[:])
+                        try:
+                            self.file.write(text)
+                        except UnicodeEncodeError as error:
+                            error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***"
+                            raise
+
+                    self.file.flush()
+                    del self._buffer[:]
+
+    def _render_buffer(self, buffer: Iterable[Segment]) -> str:
+        """Render buffered output, and clear buffer."""
+        output: List[str] = []
+        append = output.append
+        color_system = self._color_system
+        legacy_windows = self.legacy_windows
+        not_terminal = not self.is_terminal
+        if self.no_color and color_system:
+            buffer = Segment.remove_color(buffer)
+        for text, style, control in buffer:
+            if style:
+                append(
+                    style.render(
+                        text,
+                        color_system=color_system,
+                        legacy_windows=legacy_windows,
+                    )
+                )
+            elif not (not_terminal and control):
+                append(text)
+
+        rendered = "".join(output)
+        return rendered
+
+    def input(
+        self,
+        prompt: TextType = "",
+        *,
+        markup: bool = True,
+        emoji: bool = True,
+        password: bool = False,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Displays a prompt and waits for input from the user. The prompt may contain color / style.
+
+        It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded.
+
+        Args:
+            prompt (Union[str, Text]): Text to render in the prompt.
+            markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True.
+            emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True.
+            password: (bool, optional): Hide typed text. Defaults to False.
+            stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None.
+
+        Returns:
+            str: Text read from stdin.
+        """
+        if prompt:
+            self.print(prompt, markup=markup, emoji=emoji, end="")
+        if password:
+            result = getpass("", stream=stream)
+        else:
+            if stream:
+                result = stream.readline()
+            else:
+                result = input()
+        return result
+
+    def export_text(self, *, clear: bool = True, styles: bool = False) -> str:
+        """Generate text from console contents (requires record=True argument in constructor).
+
+        Args:
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        Returns:
+            str: String containing console contents.
+
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+
+        with self._record_buffer_lock:
+            if styles:
+                text = "".join(
+                    (style.render(text) if style else text)
+                    for text, style, _ in self._record_buffer
+                )
+            else:
+                text = "".join(
+                    segment.text
+                    for segment in self._record_buffer
+                    if not segment.control
+                )
+            if clear:
+                del self._record_buffer[:]
+        return text
+
+    def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None:
+        """Generate text from console and save to a given location (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write text files.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        """
+        text = self.export_text(clear=clear, styles=styles)
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(text)
+
+    def export_html(
+        self,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: Optional[str] = None,
+        inline_styles: bool = False,
+    ) -> str:
+        """Generate HTML from console contents (requires record=True argument in constructor).
+
+        Args:
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML. In addition to '{foreground}',
+                '{background}', and '{code}', should contain '{stylesheet}' if inline_styles is ``False``.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        Returns:
+            str: String containing console contents as HTML.
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+        fragments: List[str] = []
+        append = fragments.append
+        _theme = theme or DEFAULT_TERMINAL_THEME
+        stylesheet = ""
+
+        render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format
+
+        with self._record_buffer_lock:
+            if inline_styles:
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        if style.link:
+                            text = f'<a href="{style.link}">{text}</a>'
+                        text = f'<span style="{rule}">{text}</span>' if rule else text
+                    append(text)
+            else:
+                styles: Dict[str, int] = {}
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        style_number = styles.setdefault(rule, len(styles) + 1)
+                        if style.link:
+                            text = f'<a class="r{style_number}" href="{style.link}">{text}</a>'
+                        else:
+                            text = f'<span class="r{style_number}">{text}</span>'
+                    append(text)
+                stylesheet_rules: List[str] = []
+                stylesheet_append = stylesheet_rules.append
+                for style_rule, style_number in styles.items():
+                    if style_rule:
+                        stylesheet_append(f".r{style_number} {{{style_rule}}}")
+                stylesheet = "\n".join(stylesheet_rules)
+
+            rendered_code = render_code_format.format(
+                code="".join(fragments),
+                stylesheet=stylesheet,
+                foreground=_theme.foreground_color.hex,
+                background=_theme.background_color.hex,
+            )
+            if clear:
+                del self._record_buffer[:]
+        return rendered_code
+
+    def save_html(
+        self,
+        path: str,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_HTML_FORMAT,
+        inline_styles: bool = False,
+    ) -> None:
+        """Generate HTML from console contents and write to a file (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write html file.
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML. In addition to '{foreground}',
+                '{background}', and '{code}', should contain '{stylesheet}' if inline_styles is ``False``.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        """
+        html = self.export_html(
+            theme=theme,
+            clear=clear,
+            code_format=code_format,
+            inline_styles=inline_styles,
+        )
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(html)
+
+    def export_svg(
+        self,
+        *,
+        title: str = "Rich",
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_SVG_FORMAT,
+        font_aspect_ratio: float = 0.61,
+        unique_id: Optional[str] = None,
+    ) -> str:
+        """
+        Generate an SVG from the console contents (requires record=True in Console constructor).
+
+        Args:
+            title (str, optional): The title of the tab in the output image
+            theme (TerminalTheme, optional): The ``TerminalTheme`` object to use to style the terminal
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``
+            code_format (str, optional): Format string used to generate the SVG. Rich will inject a number of variables
+                into the string in order to form the final SVG output. The default template used and the variables
+                injected by Rich can be found by inspecting the ``console.CONSOLE_SVG_FORMAT`` variable.
+            font_aspect_ratio (float, optional): The width to height ratio of the font used in the ``code_format``
+                string. Defaults to 0.61, which is the width to height ratio of Fira Code (the default font).
+                If you aren't specifying a different font inside ``code_format``, you probably don't need this.
+            unique_id (str, optional): unique id that is used as the prefix for various elements (CSS styles, node
+                ids). If not set, this defaults to a computed value based on the recorded content.
+        """
+
+        from pip._vendor.rich.cells import cell_len
+
+        style_cache: Dict[Style, str] = {}
+
+        def get_svg_style(style: Style) -> str:
+            """Convert a Style to CSS rules for SVG."""
+            if style in style_cache:
+                return style_cache[style]
+            css_rules = []
+            color = (
+                _theme.foreground_color
+                if (style.color is None or style.color.is_default)
+                else style.color.get_truecolor(_theme)
+            )
+            bgcolor = (
+                _theme.background_color
+                if (style.bgcolor is None or style.bgcolor.is_default)
+                else style.bgcolor.get_truecolor(_theme)
+            )
+            if style.reverse:
+                color, bgcolor = bgcolor, color
+            if style.dim:
+                color = blend_rgb(color, bgcolor, 0.4)
+            css_rules.append(f"fill: {color.hex}")
+            if style.bold:
+                css_rules.append("font-weight: bold")
+            if style.italic:
+                css_rules.append("font-style: italic;")
+            if style.underline:
+                css_rules.append("text-decoration: underline;")
+            if style.strike:
+                css_rules.append("text-decoration: line-through;")
+
+            css = ";".join(css_rules)
+            style_cache[style] = css
+            return css
+
+        _theme = theme or SVG_EXPORT_THEME
+
+        width = self.width
+        char_height = 20
+        char_width = char_height * font_aspect_ratio
+        line_height = char_height * 1.22
+
+        margin_top = 1
+        margin_right = 1
+        margin_bottom = 1
+        margin_left = 1
+
+        padding_top = 40
+        padding_right = 8
+        padding_bottom = 8
+        padding_left = 8
+
+        padding_width = padding_left + padding_right
+        padding_height = padding_top + padding_bottom
+        margin_width = margin_left + margin_right
+        margin_height = margin_top + margin_bottom
+
+        text_backgrounds: List[str] = []
+        text_group: List[str] = []
+        classes: Dict[str, int] = {}
+        style_no = 1
+
+        def escape_text(text: str) -> str:
+            """HTML escape text and replace spaces with nbsp."""
+            return escape(text).replace(" ", "&#160;")
+
+        def make_tag(
+            name: str, content: Optional[str] = None, **attribs: object
+        ) -> str:
+            """Make a tag from name, content, and attributes."""
+
+            def stringify(value: object) -> str:
+                if isinstance(value, (float)):
+                    return format(value, "g")
+                return str(value)
+
+            tag_attribs = " ".join(
+                f'{k.lstrip("_").replace("_", "-")}="{stringify(v)}"'
+                for k, v in attribs.items()
+            )
+            return (
+                f"<{name} {tag_attribs}>{content}</{name}>"
+                if content
+                else f"<{name} {tag_attribs}/>"
+            )
+
+        with self._record_buffer_lock:
+            segments = list(Segment.filter_control(self._record_buffer))
+            if clear:
+                self._record_buffer.clear()
+
+        if unique_id is None:
+            unique_id = "terminal-" + str(
+                zlib.adler32(
+                    ("".join(repr(segment) for segment in segments)).encode(
+                        "utf-8",
+                        "ignore",
+                    )
+                    + title.encode("utf-8", "ignore")
+                )
+            )
+        y = 0
+        for y, line in enumerate(Segment.split_and_crop_lines(segments, length=width)):
+            x = 0
+            for text, style, _control in line:
+                style = style or Style()
+                rules = get_svg_style(style)
+                if rules not in classes:
+                    classes[rules] = style_no
+                    style_no += 1
+                class_name = f"r{classes[rules]}"
+
+                if style.reverse:
+                    has_background = True
+                    background = (
+                        _theme.foreground_color.hex
+                        if style.color is None
+                        else style.color.get_truecolor(_theme).hex
+                    )
+                else:
+                    bgcolor = style.bgcolor
+                    has_background = bgcolor is not None and not bgcolor.is_default
+                    background = (
+                        _theme.background_color.hex
+                        if style.bgcolor is None
+                        else style.bgcolor.get_truecolor(_theme).hex
+                    )
+
+                text_length = cell_len(text)
+                if has_background:
+                    text_backgrounds.append(
+                        make_tag(
+                            "rect",
+                            fill=background,
+                            x=x * char_width,
+                            y=y * line_height + 1.5,
+                            width=char_width * text_length,
+                            height=line_height + 0.25,
+                            shape_rendering="crispEdges",
+                        )
+                    )
+
+                if text != " " * len(text):
+                    text_group.append(
+                        make_tag(
+                            "text",
+                            escape_text(text),
+                            _class=f"{unique_id}-{class_name}",
+                            x=x * char_width,
+                            y=y * line_height + char_height,
+                            textLength=char_width * len(text),
+                            clip_path=f"url(#{unique_id}-line-{y})",
+                        )
+                    )
+                x += cell_len(text)
+
+        line_offsets = [line_no * line_height + 1.5 for line_no in range(y)]
+        lines = "\n".join(
+            f"""<clipPath id="{unique_id}-line-{line_no}">
+    {make_tag("rect", x=0, y=offset, width=char_width * width, height=line_height + 0.25)}
+            </clipPath>"""
+            for line_no, offset in enumerate(line_offsets)
+        )
+
+        styles = "\n".join(
+            f".{unique_id}-r{rule_no} {{ {css} }}" for css, rule_no in classes.items()
+        )
+        backgrounds = "".join(text_backgrounds)
+        matrix = "".join(text_group)
+
+        terminal_width = ceil(width * char_width + padding_width)
+        terminal_height = (y + 1) * line_height + padding_height
+        chrome = make_tag(
+            "rect",
+            fill=_theme.background_color.hex,
+            stroke="rgba(255,255,255,0.35)",
+            stroke_width="1",
+            x=margin_left,
+            y=margin_top,
+            width=terminal_width,
+            height=terminal_height,
+            rx=8,
+        )
+
+        title_color = _theme.foreground_color.hex
+        if title:
+            chrome += make_tag(
+                "text",
+                escape_text(title),
+                _class=f"{unique_id}-title",
+                fill=title_color,
+                text_anchor="middle",
+                x=terminal_width // 2,
+                y=margin_top + char_height + 6,
+            )
+        chrome += f"""
+            <g transform="translate(26,22)">
+            <circle cx="0" cy="0" r="7" fill="#ff5f57"/>
+            <circle cx="22" cy="0" r="7" fill="#febc2e"/>
+            <circle cx="44" cy="0" r="7" fill="#28c840"/>
+            </g>
+        """
+
+        svg = code_format.format(
+            unique_id=unique_id,
+            char_width=char_width,
+            char_height=char_height,
+            line_height=line_height,
+            terminal_width=char_width * width - 1,
+            terminal_height=(y + 1) * line_height - 1,
+            width=terminal_width + margin_width,
+            height=terminal_height + margin_height,
+            terminal_x=margin_left + padding_left,
+            terminal_y=margin_top + padding_top,
+            styles=styles,
+            chrome=chrome,
+            backgrounds=backgrounds,
+            matrix=matrix,
+            lines=lines,
+        )
+        return svg
+
+    def save_svg(
+        self,
+        path: str,
+        *,
+        title: str = "Rich",
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_SVG_FORMAT,
+        font_aspect_ratio: float = 0.61,
+        unique_id: Optional[str] = None,
+    ) -> None:
+        """Generate an SVG file from the console contents (requires record=True in Console constructor).
+
+        Args:
+            path (str): The path to write the SVG to.
+            title (str, optional): The title of the tab in the output image
+            theme (TerminalTheme, optional): The ``TerminalTheme`` object to use to style the terminal
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``
+            code_format (str, optional): Format string used to generate the SVG. Rich will inject a number of variables
+                into the string in order to form the final SVG output. The default template used and the variables
+                injected by Rich can be found by inspecting the ``console.CONSOLE_SVG_FORMAT`` variable.
+            font_aspect_ratio (float, optional): The width to height ratio of the font used in the ``code_format``
+                string. Defaults to 0.61, which is the width to height ratio of Fira Code (the default font).
+                If you aren't specifying a different font inside ``code_format``, you probably don't need this.
+            unique_id (str, optional): unique id that is used as the prefix for various elements (CSS styles, node
+                ids). If not set, this defaults to a computed value based on the recorded content.
+        """
+        svg = self.export_svg(
+            title=title,
+            theme=theme,
+            clear=clear,
+            code_format=code_format,
+            font_aspect_ratio=font_aspect_ratio,
+            unique_id=unique_id,
+        )
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(svg)
+
+
+def _svg_hash(svg_main_code: str) -> str:
+    """Returns a unique hash for the given SVG main code.
+
+    Args:
+        svg_main_code (str): The content we're going to inject in the SVG envelope.
+
+    Returns:
+        str: a hash of the given content
+    """
+    return str(zlib.adler32(svg_main_code.encode()))
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console(record=True)
+
+    console.log(
+        "JSONRPC [i]request[/i]",
+        5,
+        1.3,
+        True,
+        False,
+        None,
+        {
+            "jsonrpc": "2.0",
+            "method": "subtract",
+            "params": {"minuend": 42, "subtrahend": 23},
+            "id": 3,
+        },
+    )
+
+    console.log("Hello, World!", "{'a': 1}", repr(console))
+
+    console.print(
+        {
+            "name": None,
+            "empty": [],
+            "quiz": {
+                "sport": {
+                    "answered": True,
+                    "q1": {
+                        "question": "Which one is correct team name in NBA?",
+                        "options": [
+                            "New York Bulls",
+                            "Los Angeles Kings",
+                            "Golden State Warriors",
+                            "Huston Rocket",
+                        ],
+                        "answer": "Huston Rocket",
+                    },
+                },
+                "maths": {
+                    "answered": False,
+                    "q1": {
+                        "question": "5 + 7 = ?",
+                        "options": [10, 11, 12, 13],
+                        "answer": 12,
+                    },
+                    "q2": {
+                        "question": "12 - 8 = ?",
+                        "options": [1, 2, 3, 4],
+                        "answer": 4,
+                    },
+                },
+            },
+        }
+    )
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/constrain.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/constrain.py
new file mode 100644
index 0000000000000000000000000000000000000000..65fdf56342e8b5b8e181914881025231684e1871
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/constrain.py
@@ -0,0 +1,37 @@
+from typing import Optional, TYPE_CHECKING
+
+from .jupyter import JupyterMixin
+from .measure import Measurement
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Constrain(JupyterMixin):
+    """Constrain the width of a renderable to a given number of characters.
+
+    Args:
+        renderable (RenderableType): A renderable object.
+        width (int, optional): The maximum width (in characters) to render. Defaults to 80.
+    """
+
+    def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None:
+        self.renderable = renderable
+        self.width = width
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.width is None:
+            yield self.renderable
+        else:
+            child_options = options.update_width(min(self.width, options.max_width))
+            yield from console.render(self.renderable, child_options)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.width is not None:
+            options = options.update_width(self.width)
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/control.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/control.py
new file mode 100644
index 0000000000000000000000000000000000000000..88fcb9295164f4e18827ef61fff6723e94ef7381
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/control.py
@@ -0,0 +1,225 @@
+import sys
+import time
+from typing import TYPE_CHECKING, Callable, Dict, Iterable, List, Union
+
+if sys.version_info >= (3, 8):
+    from typing import Final
+else:
+    from pip._vendor.typing_extensions import Final  # pragma: no cover
+
+from .segment import ControlCode, ControlType, Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+STRIP_CONTROL_CODES: Final = [
+    7,  # Bell
+    8,  # Backspace
+    11,  # Vertical tab
+    12,  # Form feed
+    13,  # Carriage return
+]
+_CONTROL_STRIP_TRANSLATE: Final = {
+    _codepoint: None for _codepoint in STRIP_CONTROL_CODES
+}
+
+CONTROL_ESCAPE: Final = {
+    7: "\\a",
+    8: "\\b",
+    11: "\\v",
+    12: "\\f",
+    13: "\\r",
+}
+
+CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = {
+    ControlType.BELL: lambda: "\x07",
+    ControlType.CARRIAGE_RETURN: lambda: "\r",
+    ControlType.HOME: lambda: "\x1b[H",
+    ControlType.CLEAR: lambda: "\x1b[2J",
+    ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h",
+    ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l",
+    ControlType.SHOW_CURSOR: lambda: "\x1b[?25h",
+    ControlType.HIDE_CURSOR: lambda: "\x1b[?25l",
+    ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A",
+    ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B",
+    ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C",
+    ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D",
+    ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G",
+    ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K",
+    ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H",
+    ControlType.SET_WINDOW_TITLE: lambda title: f"\x1b]0;{title}\x07",
+}
+
+
+class Control:
+    """A renderable that inserts a control code (non printable but may move cursor).
+
+    Args:
+        *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a
+            tuple of ControlType and an integer parameter
+    """
+
+    __slots__ = ["segment"]
+
+    def __init__(self, *codes: Union[ControlType, ControlCode]) -> None:
+        control_codes: List[ControlCode] = [
+            (code,) if isinstance(code, ControlType) else code for code in codes
+        ]
+        _format_map = CONTROL_CODES_FORMAT
+        rendered_codes = "".join(
+            _format_map[code](*parameters) for code, *parameters in control_codes
+        )
+        self.segment = Segment(rendered_codes, None, control_codes)
+
+    @classmethod
+    def bell(cls) -> "Control":
+        """Ring the 'bell'."""
+        return cls(ControlType.BELL)
+
+    @classmethod
+    def home(cls) -> "Control":
+        """Move cursor to 'home' position."""
+        return cls(ControlType.HOME)
+
+    @classmethod
+    def move(cls, x: int = 0, y: int = 0) -> "Control":
+        """Move cursor relative to current position.
+
+        Args:
+            x (int): X offset.
+            y (int): Y offset.
+
+        Returns:
+            ~Control: Control object.
+
+        """
+
+        def get_codes() -> Iterable[ControlCode]:
+            control = ControlType
+            if x:
+                yield (
+                    control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD,
+                    abs(x),
+                )
+            if y:
+                yield (
+                    control.CURSOR_DOWN if y > 0 else control.CURSOR_UP,
+                    abs(y),
+                )
+
+        control = cls(*get_codes())
+        return control
+
+    @classmethod
+    def move_to_column(cls, x: int, y: int = 0) -> "Control":
+        """Move to the given column, optionally add offset to row.
+
+        Returns:
+            x (int): absolute x (column)
+            y (int): optional y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+
+        return (
+            cls(
+                (ControlType.CURSOR_MOVE_TO_COLUMN, x),
+                (
+                    ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP,
+                    abs(y),
+                ),
+            )
+            if y
+            else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x))
+        )
+
+    @classmethod
+    def move_to(cls, x: int, y: int) -> "Control":
+        """Move cursor to absolute position.
+
+        Args:
+            x (int): x offset (column)
+            y (int): y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+        return cls((ControlType.CURSOR_MOVE_TO, x, y))
+
+    @classmethod
+    def clear(cls) -> "Control":
+        """Clear the screen."""
+        return cls(ControlType.CLEAR)
+
+    @classmethod
+    def show_cursor(cls, show: bool) -> "Control":
+        """Show or hide the cursor."""
+        return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR)
+
+    @classmethod
+    def alt_screen(cls, enable: bool) -> "Control":
+        """Enable or disable alt screen."""
+        if enable:
+            return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME)
+        else:
+            return cls(ControlType.DISABLE_ALT_SCREEN)
+
+    @classmethod
+    def title(cls, title: str) -> "Control":
+        """Set the terminal window title
+
+        Args:
+            title (str): The new terminal window title
+        """
+        return cls((ControlType.SET_WINDOW_TITLE, title))
+
+    def __str__(self) -> str:
+        return self.segment.text
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.segment.text:
+            yield self.segment
+
+
+def strip_control_codes(
+    text: str, _translate_table: Dict[int, None] = _CONTROL_STRIP_TRANSLATE
+) -> str:
+    """Remove control codes from text.
+
+    Args:
+        text (str): A string possibly contain control codes.
+
+    Returns:
+        str: String with control codes removed.
+    """
+    return text.translate(_translate_table)
+
+
+def escape_control_codes(
+    text: str,
+    _translate_table: Dict[int, str] = CONTROL_ESCAPE,
+) -> str:
+    """Replace control codes with their "escaped" equivalent in the given text.
+    (e.g. "\b" becomes "\\b")
+
+    Args:
+        text (str): A string possibly containing control codes.
+
+    Returns:
+        str: String with control codes replaced with their escaped version.
+    """
+    return text.translate(_translate_table)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    console.print("Look at the title of your terminal window ^")
+    # console.print(Control((ControlType.SET_WINDOW_TITLE, "Hello, world!")))
+    for i in range(10):
+        console.set_window_title("🚀 Loading" + "." * i)
+        time.sleep(0.5)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/file_proxy.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/file_proxy.py
new file mode 100644
index 0000000000000000000000000000000000000000..4b0b0da6c2a62b2b1468c35ddd69f1bbb9b91aa8
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/file_proxy.py
@@ -0,0 +1,57 @@
+import io
+from typing import IO, TYPE_CHECKING, Any, List
+
+from .ansi import AnsiDecoder
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import Console
+
+
+class FileProxy(io.TextIOBase):
+    """Wraps a file (e.g. sys.stdout) and redirects writes to a console."""
+
+    def __init__(self, console: "Console", file: IO[str]) -> None:
+        self.__console = console
+        self.__file = file
+        self.__buffer: List[str] = []
+        self.__ansi_decoder = AnsiDecoder()
+
+    @property
+    def rich_proxied_file(self) -> IO[str]:
+        """Get proxied file."""
+        return self.__file
+
+    def __getattr__(self, name: str) -> Any:
+        return getattr(self.__file, name)
+
+    def write(self, text: str) -> int:
+        if not isinstance(text, str):
+            raise TypeError(f"write() argument must be str, not {type(text).__name__}")
+        buffer = self.__buffer
+        lines: List[str] = []
+        while text:
+            line, new_line, text = text.partition("\n")
+            if new_line:
+                lines.append("".join(buffer) + line)
+                buffer.clear()
+            else:
+                buffer.append(line)
+                break
+        if lines:
+            console = self.__console
+            with console:
+                output = Text("\n").join(
+                    self.__ansi_decoder.decode_line(line) for line in lines
+                )
+                console.print(output)
+        return len(text)
+
+    def flush(self) -> None:
+        output = "".join(self.__buffer)
+        if output:
+            self.__console.print(output)
+        del self.__buffer[:]
+
+    def fileno(self) -> int:
+        return self.__file.fileno()
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/highlighter.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/highlighter.py
new file mode 100644
index 0000000000000000000000000000000000000000..c2646794a98578bdb735f5047dbc6b1d50b90230
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/highlighter.py
@@ -0,0 +1,232 @@
+import re
+from abc import ABC, abstractmethod
+from typing import List, Union
+
+from .text import Span, Text
+
+
+def _combine_regex(*regexes: str) -> str:
+    """Combine a number of regexes in to a single regex.
+
+    Returns:
+        str: New regex with all regexes ORed together.
+    """
+    return "|".join(regexes)
+
+
+class Highlighter(ABC):
+    """Abstract base class for highlighters."""
+
+    def __call__(self, text: Union[str, Text]) -> Text:
+        """Highlight a str or Text instance.
+
+        Args:
+            text (Union[str, ~Text]): Text to highlight.
+
+        Raises:
+            TypeError: If not called with text or str.
+
+        Returns:
+            Text: A test instance with highlighting applied.
+        """
+        if isinstance(text, str):
+            highlight_text = Text(text)
+        elif isinstance(text, Text):
+            highlight_text = text.copy()
+        else:
+            raise TypeError(f"str or Text instance required, not {text!r}")
+        self.highlight(highlight_text)
+        return highlight_text
+
+    @abstractmethod
+    def highlight(self, text: Text) -> None:
+        """Apply highlighting in place to text.
+
+        Args:
+            text (~Text): A text object highlight.
+        """
+
+
+class NullHighlighter(Highlighter):
+    """A highlighter object that doesn't highlight.
+
+    May be used to disable highlighting entirely.
+
+    """
+
+    def highlight(self, text: Text) -> None:
+        """Nothing to do"""
+
+
+class RegexHighlighter(Highlighter):
+    """Applies highlighting from a list of regular expressions."""
+
+    highlights: List[str] = []
+    base_style: str = ""
+
+    def highlight(self, text: Text) -> None:
+        """Highlight :class:`rich.text.Text` using regular expressions.
+
+        Args:
+            text (~Text): Text to highlighted.
+
+        """
+
+        highlight_regex = text.highlight_regex
+        for re_highlight in self.highlights:
+            highlight_regex(re_highlight, style_prefix=self.base_style)
+
+
+class ReprHighlighter(RegexHighlighter):
+    """Highlights the text typically produced from ``__repr__`` methods."""
+
+    base_style = "repr."
+    highlights = [
+        r"(?P<tag_start><)(?P<tag_name>[-\w.:|]*)(?P<tag_contents>[\w\W]*)(?P<tag_end>>)",
+        r'(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>"?[\w_]+"?)?',
+        r"(?P<brace>[][{}()])",
+        _combine_regex(
+            r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})",
+            r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})",
+            r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})",
+            r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})",
+            r"(?P<uuid>[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})",
+            r"(?P<call>[\w.]*?)\(",
+            r"\b(?P<bool_true>True)\b|\b(?P<bool_false>False)\b|\b(?P<none>None)\b",
+            r"(?P<ellipsis>\.\.\.)",
+            r"(?P<number_complex>(?<!\w)(?:\-?[0-9]+\.?[0-9]*(?:e[-+]?\d+?)?)(?:[-+](?:[0-9]+\.?[0-9]*(?:e[-+]?\d+)?))?j)",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[-+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?P<path>\B(/[-\w._+]+)*\/)(?P<filename>[-\w._+]*)?",
+            r"(?<![\\\w])(?P<str>b?'''.*?(?<!\\)'''|b?'.*?(?<!\\)'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")",
+            r"(?P<url>(file|https|http|ws|wss)://[-0-9a-zA-Z$_+!`(),.?/;:&=%#]*)",
+        ),
+    ]
+
+
+class JSONHighlighter(RegexHighlighter):
+    """Highlights JSON"""
+
+    # Captures the start and end of JSON strings, handling escaped quotes
+    JSON_STR = r"(?<![\\\w])(?P<str>b?\".*?(?<!\\)\")"
+    JSON_WHITESPACE = {" ", "\n", "\r", "\t"}
+
+    base_style = "json."
+    highlights = [
+        _combine_regex(
+            r"(?P<brace>[\{\[\(\)\]\}])",
+            r"\b(?P<bool_true>true)\b|\b(?P<bool_false>false)\b|\b(?P<null>null)\b",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            JSON_STR,
+        ),
+    ]
+
+    def highlight(self, text: Text) -> None:
+        super().highlight(text)
+
+        # Additional work to handle highlighting JSON keys
+        plain = text.plain
+        append = text.spans.append
+        whitespace = self.JSON_WHITESPACE
+        for match in re.finditer(self.JSON_STR, plain):
+            start, end = match.span()
+            cursor = end
+            while cursor < len(plain):
+                char = plain[cursor]
+                cursor += 1
+                if char == ":":
+                    append(Span(start, end, "json.key"))
+                elif char in whitespace:
+                    continue
+                break
+
+
+class ISO8601Highlighter(RegexHighlighter):
+    """Highlights the ISO8601 date time strings.
+    Regex reference: https://www.oreilly.com/library/view/regular-expressions-cookbook/9781449327453/ch04s07.html
+    """
+
+    base_style = "iso8601."
+    highlights = [
+        #
+        # Dates
+        #
+        # Calendar month (e.g. 2008-08). The hyphen is required
+        r"^(?P<year>[0-9]{4})-(?P<month>1[0-2]|0[1-9])$",
+        # Calendar date w/o hyphens (e.g. 20080830)
+        r"^(?P<date>(?P<year>[0-9]{4})(?P<month>1[0-2]|0[1-9])(?P<day>3[01]|0[1-9]|[12][0-9]))$",
+        # Ordinal date (e.g. 2008-243). The hyphen is optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?(?P<day>36[0-6]|3[0-5][0-9]|[12][0-9]{2}|0[1-9][0-9]|00[1-9]))$",
+        #
+        # Weeks
+        #
+        # Week of the year (e.g., 2008-W35). The hyphen is optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]|[1-4][0-9]|0[1-9]))$",
+        # Week date (e.g., 2008-W35-6). The hyphens are optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]|[1-4][0-9]|0[1-9])-?(?P<day>[1-7]))$",
+        #
+        # Times
+        #
+        # Hours and minutes (e.g., 17:21). The colon is optional
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9]):?(?P<minute>[0-5][0-9]))$",
+        # Hours, minutes, and seconds w/o colons (e.g., 172159)
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))$",
+        # Time zone designator (e.g., Z, +07 or +07:00). The colons and the minutes are optional
+        r"^(?P<timezone>(Z|[+-](?:2[0-3]|[01][0-9])(?::?(?:[0-5][0-9]))?))$",
+        # Hours, minutes, and seconds with time zone designator (e.g., 17:21:59+07:00).
+        # All the colons are optional. The minutes in the time zone designator are also optional
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9])(?::?(?:[0-5][0-9]))?)$",
+        #
+        # Date and Time
+        #
+        # Calendar date with hours, minutes, and seconds (e.g., 2008-08-30 17:21:59 or 20080830 172159).
+        # A space is required between the date and the time. The hyphens and colons are optional.
+        # This regex matches dates and times that specify some hyphens or colons but omit others.
+        # This does not follow ISO 8601
+        r"^(?P<date>(?P<year>[0-9]{4})(?P<hyphen>-)?(?P<month>1[0-2]|0[1-9])(?(hyphen)-)(?P<day>3[01]|0[1-9]|[12][0-9])) (?P<time>(?P<hour>2[0-3]|[01][0-9])(?(hyphen):)(?P<minute>[0-5][0-9])(?(hyphen):)(?P<second>[0-5][0-9]))$",
+        #
+        # XML Schema dates and times
+        #
+        # Date, with optional time zone (e.g., 2008-08-30 or 2008-08-30+07:00).
+        # Hyphens are required. This is the XML Schema 'date' type
+        r"^(?P<date>(?P<year>-?(?:[1-9][0-9]*)?[0-9]{4})-(?P<month>1[0-2]|0[1-9])-(?P<day>3[01]|0[1-9]|[12][0-9]))(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+        # Time, with optional fractional seconds and time zone (e.g., 01:45:36 or 01:45:36.123+07:00).
+        # There is no limit on the number of digits for the fractional seconds. This is the XML Schema 'time' type
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<frac>\.[0-9]+)?)(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+        # Date and time, with optional fractional seconds and time zone (e.g., 2008-08-30T01:45:36 or 2008-08-30T01:45:36.123Z).
+        # This is the XML Schema 'dateTime' type
+        r"^(?P<date>(?P<year>-?(?:[1-9][0-9]*)?[0-9]{4})-(?P<month>1[0-2]|0[1-9])-(?P<day>3[01]|0[1-9]|[12][0-9]))T(?P<time>(?P<hour>2[0-3]|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<ms>\.[0-9]+)?)(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+    ]
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console()
+    console.print("[bold green]hello world![/bold green]")
+    console.print("'[bold green]hello world![/bold green]'")
+
+    console.print(" /foo")
+    console.print("/foo/")
+    console.print("/foo/bar")
+    console.print("foo/bar/baz")
+
+    console.print("/foo/bar/baz?foo=bar+egg&egg=baz")
+    console.print("/foo/bar/baz/")
+    console.print("/foo/bar/baz/egg")
+    console.print("/foo/bar/baz/egg.py")
+    console.print("/foo/bar/baz/egg.py word")
+    console.print(" /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/ba._++z/egg+.py word")
+    console.print("https://example.org?foo=bar#header")
+
+    console.print(1234567.34)
+    console.print(1 / 2)
+    console.print(-1 / 123123123123)
+
+    console.print(
+        "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo"
+    )
+    import json
+
+    console.print_json(json.dumps(obj={"name": "apple", "count": 1}), indent=None)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/json.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/json.py
new file mode 100644
index 0000000000000000000000000000000000000000..ea94493f21e6f5583469d882d08203381ee31117
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/json.py
@@ -0,0 +1,140 @@
+from pathlib import Path
+from json import loads, dumps
+from typing import Any, Callable, Optional, Union
+
+from .text import Text
+from .highlighter import JSONHighlighter, NullHighlighter
+
+
+class JSON:
+    """A renderable which pretty prints JSON.
+
+    Args:
+        json (str): JSON encoded data.
+        indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+        highlight (bool, optional): Enable highlighting. Defaults to True.
+        skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+        ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+        check_circular (bool, optional): Check for circular references. Defaults to True.
+        allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+        default (Callable, optional): A callable that converts values that can not be encoded
+            in to something that can be JSON encoded. Defaults to None.
+        sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        json: str,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = False,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        data = loads(json)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        self.text = highlighter(json)
+        self.text.no_wrap = True
+        self.text.overflow = None
+
+    @classmethod
+    def from_data(
+        cls,
+        data: Any,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = False,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> "JSON":
+        """Encodes a JSON object from arbitrary data.
+
+        Args:
+            data (Any): An object that may be encoded in to JSON
+            indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+            highlight (bool, optional): Enable highlighting. Defaults to True.
+            default (Callable, optional): Optional callable which will be called for objects that cannot be serialized. Defaults to None.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+
+        Returns:
+            JSON: New JSON object from the given data.
+        """
+        json_instance: "JSON" = cls.__new__(cls)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        json_instance.text = highlighter(json)
+        json_instance.text.no_wrap = True
+        json_instance.text.overflow = None
+        return json_instance
+
+    def __rich__(self) -> Text:
+        return self.text
+
+
+if __name__ == "__main__":
+
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(description="Pretty print json")
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent",
+        metavar="SPACES",
+        type=int,
+        help="Number of spaces in an indent",
+        default=2,
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    error_console = Console(stderr=True)
+
+    try:
+        if args.path == "-":
+            json_data = sys.stdin.read()
+        else:
+            json_data = Path(args.path).read_text()
+    except Exception as error:
+        error_console.print(f"Unable to read {args.path!r}; {error}")
+        sys.exit(-1)
+
+    console.print(JSON(json_data, indent=args.indent), soft_wrap=True)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/layout.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/layout.py
new file mode 100644
index 0000000000000000000000000000000000000000..849356ea9a03a031abce367b955a30fce26c9845
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/layout.py
@@ -0,0 +1,443 @@
+from abc import ABC, abstractmethod
+from itertools import islice
+from operator import itemgetter
+from threading import RLock
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Union,
+)
+
+from ._ratio import ratio_resolve
+from .align import Align
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .highlighter import ReprHighlighter
+from .panel import Panel
+from .pretty import Pretty
+from .region import Region
+from .repr import Result, rich_repr
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.tree import Tree
+
+
+class LayoutRender(NamedTuple):
+    """An individual layout render."""
+
+    region: Region
+    render: List[List[Segment]]
+
+
+RegionMap = Dict["Layout", Region]
+RenderMap = Dict["Layout", LayoutRender]
+
+
+class LayoutError(Exception):
+    """Layout related error."""
+
+
+class NoSplitter(LayoutError):
+    """Requested splitter does not exist."""
+
+
+class _Placeholder:
+    """An internal renderable used as a Layout placeholder."""
+
+    highlighter = ReprHighlighter()
+
+    def __init__(self, layout: "Layout", style: StyleType = "") -> None:
+        self.layout = layout
+        self.style = style
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = options.max_width
+        height = options.height or options.size.height
+        layout = self.layout
+        title = (
+            f"{layout.name!r} ({width} x {height})"
+            if layout.name
+            else f"({width} x {height})"
+        )
+        yield Panel(
+            Align.center(Pretty(layout), vertical="middle"),
+            style=self.style,
+            title=self.highlighter(title),
+            border_style="blue",
+            height=height,
+        )
+
+
+class Splitter(ABC):
+    """Base class for a splitter."""
+
+    name: str = ""
+
+    @abstractmethod
+    def get_tree_icon(self) -> str:
+        """Get the icon (emoji) used in layout.tree"""
+
+    @abstractmethod
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        """Divide a region amongst several child layouts.
+
+        Args:
+            children (Sequence(Layout)): A number of child layouts.
+            region (Region): A rectangular region to divide.
+        """
+
+
+class RowSplitter(Splitter):
+    """Split a layout region in to rows."""
+
+    name = "row"
+
+    def get_tree_icon(self) -> str:
+        return "[layout.tree.row]⬌"
+
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        x, y, width, height = region
+        render_widths = ratio_resolve(width, children)
+        offset = 0
+        _Region = Region
+        for child, child_width in zip(children, render_widths):
+            yield child, _Region(x + offset, y, child_width, height)
+            offset += child_width
+
+
+class ColumnSplitter(Splitter):
+    """Split a layout region in to columns."""
+
+    name = "column"
+
+    def get_tree_icon(self) -> str:
+        return "[layout.tree.column]⬍"
+
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        x, y, width, height = region
+        render_heights = ratio_resolve(height, children)
+        offset = 0
+        _Region = Region
+        for child, child_height in zip(children, render_heights):
+            yield child, _Region(x, y + offset, width, child_height)
+            offset += child_height
+
+
+@rich_repr
+class Layout:
+    """A renderable to divide a fixed height in to rows or columns.
+
+    Args:
+        renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None.
+        name (str, optional): Optional identifier for Layout. Defaults to None.
+        size (int, optional): Optional fixed size of layout. Defaults to None.
+        minimum_size (int, optional): Minimum size of layout. Defaults to 1.
+        ratio (int, optional): Optional ratio for flexible layout. Defaults to 1.
+        visible (bool, optional): Visibility of layout. Defaults to True.
+    """
+
+    splitters = {"row": RowSplitter, "column": ColumnSplitter}
+
+    def __init__(
+        self,
+        renderable: Optional[RenderableType] = None,
+        *,
+        name: Optional[str] = None,
+        size: Optional[int] = None,
+        minimum_size: int = 1,
+        ratio: int = 1,
+        visible: bool = True,
+    ) -> None:
+        self._renderable = renderable or _Placeholder(self)
+        self.size = size
+        self.minimum_size = minimum_size
+        self.ratio = ratio
+        self.name = name
+        self.visible = visible
+        self.splitter: Splitter = self.splitters["column"]()
+        self._children: List[Layout] = []
+        self._render_map: RenderMap = {}
+        self._lock = RLock()
+
+    def __rich_repr__(self) -> Result:
+        yield "name", self.name, None
+        yield "size", self.size, None
+        yield "minimum_size", self.minimum_size, 1
+        yield "ratio", self.ratio, 1
+
+    @property
+    def renderable(self) -> RenderableType:
+        """Layout renderable."""
+        return self if self._children else self._renderable
+
+    @property
+    def children(self) -> List["Layout"]:
+        """Gets (visible) layout children."""
+        return [child for child in self._children if child.visible]
+
+    @property
+    def map(self) -> RenderMap:
+        """Get a map of the last render."""
+        return self._render_map
+
+    def get(self, name: str) -> Optional["Layout"]:
+        """Get a named layout, or None if it doesn't exist.
+
+        Args:
+            name (str): Name of layout.
+
+        Returns:
+            Optional[Layout]: Layout instance or None if no layout was found.
+        """
+        if self.name == name:
+            return self
+        else:
+            for child in self._children:
+                named_layout = child.get(name)
+                if named_layout is not None:
+                    return named_layout
+        return None
+
+    def __getitem__(self, name: str) -> "Layout":
+        layout = self.get(name)
+        if layout is None:
+            raise KeyError(f"No layout with name {name!r}")
+        return layout
+
+    @property
+    def tree(self) -> "Tree":
+        """Get a tree renderable to show layout structure."""
+        from pip._vendor.rich.styled import Styled
+        from pip._vendor.rich.table import Table
+        from pip._vendor.rich.tree import Tree
+
+        def summary(layout: "Layout") -> Table:
+
+            icon = layout.splitter.get_tree_icon()
+
+            table = Table.grid(padding=(0, 1, 0, 0))
+
+            text: RenderableType = (
+                Pretty(layout) if layout.visible else Styled(Pretty(layout), "dim")
+            )
+            table.add_row(icon, text)
+            _summary = table
+            return _summary
+
+        layout = self
+        tree = Tree(
+            summary(layout),
+            guide_style=f"layout.tree.{layout.splitter.name}",
+            highlight=True,
+        )
+
+        def recurse(tree: "Tree", layout: "Layout") -> None:
+            for child in layout._children:
+                recurse(
+                    tree.add(
+                        summary(child),
+                        guide_style=f"layout.tree.{child.splitter.name}",
+                    ),
+                    child,
+                )
+
+        recurse(tree, self)
+        return tree
+
+    def split(
+        self,
+        *layouts: Union["Layout", RenderableType],
+        splitter: Union[Splitter, str] = "column",
+    ) -> None:
+        """Split the layout in to multiple sub-layouts.
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+            splitter (Union[Splitter, str]): Splitter instance or name of splitter.
+        """
+        _layouts = [
+            layout if isinstance(layout, Layout) else Layout(layout)
+            for layout in layouts
+        ]
+        try:
+            self.splitter = (
+                splitter
+                if isinstance(splitter, Splitter)
+                else self.splitters[splitter]()
+            )
+        except KeyError:
+            raise NoSplitter(f"No splitter called {splitter!r}")
+        self._children[:] = _layouts
+
+    def add_split(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Add a new layout(s) to existing split.
+
+        Args:
+            *layouts (Union[Layout, RenderableType]): Positional arguments should be renderables or (sub) Layout instances.
+
+        """
+        _layouts = (
+            layout if isinstance(layout, Layout) else Layout(layout)
+            for layout in layouts
+        )
+        self._children.extend(_layouts)
+
+    def split_row(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Split the layout in to a row (layouts side by side).
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+        """
+        self.split(*layouts, splitter="row")
+
+    def split_column(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Split the layout in to a column (layouts stacked on top of each other).
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+        """
+        self.split(*layouts, splitter="column")
+
+    def unsplit(self) -> None:
+        """Reset splits to initial state."""
+        del self._children[:]
+
+    def update(self, renderable: RenderableType) -> None:
+        """Update renderable.
+
+        Args:
+            renderable (RenderableType): New renderable object.
+        """
+        with self._lock:
+            self._renderable = renderable
+
+    def refresh_screen(self, console: "Console", layout_name: str) -> None:
+        """Refresh a sub-layout.
+
+        Args:
+            console (Console): Console instance where Layout is to be rendered.
+            layout_name (str): Name of layout.
+        """
+        with self._lock:
+            layout = self[layout_name]
+            region, _lines = self._render_map[layout]
+            (x, y, width, height) = region
+            lines = console.render_lines(
+                layout, console.options.update_dimensions(width, height)
+            )
+            self._render_map[layout] = LayoutRender(region, lines)
+            console.update_screen_lines(lines, x, y)
+
+    def _make_region_map(self, width: int, height: int) -> RegionMap:
+        """Create a dict that maps layout on to Region."""
+        stack: List[Tuple[Layout, Region]] = [(self, Region(0, 0, width, height))]
+        push = stack.append
+        pop = stack.pop
+        layout_regions: List[Tuple[Layout, Region]] = []
+        append_layout_region = layout_regions.append
+        while stack:
+            append_layout_region(pop())
+            layout, region = layout_regions[-1]
+            children = layout.children
+            if children:
+                for child_and_region in layout.splitter.divide(children, region):
+                    push(child_and_region)
+
+        region_map = {
+            layout: region
+            for layout, region in sorted(layout_regions, key=itemgetter(1))
+        }
+        return region_map
+
+    def render(self, console: Console, options: ConsoleOptions) -> RenderMap:
+        """Render the sub_layouts.
+
+        Args:
+            console (Console): Console instance.
+            options (ConsoleOptions): Console options.
+
+        Returns:
+            RenderMap: A dict that maps Layout on to a tuple of Region, lines
+        """
+        render_width = options.max_width
+        render_height = options.height or console.height
+        region_map = self._make_region_map(render_width, render_height)
+        layout_regions = [
+            (layout, region)
+            for layout, region in region_map.items()
+            if not layout.children
+        ]
+        render_map: Dict["Layout", "LayoutRender"] = {}
+        render_lines = console.render_lines
+        update_dimensions = options.update_dimensions
+
+        for layout, region in layout_regions:
+            lines = render_lines(
+                layout.renderable, update_dimensions(region.width, region.height)
+            )
+            render_map[layout] = LayoutRender(region, lines)
+        return render_map
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        with self._lock:
+            width = options.max_width or console.width
+            height = options.height or console.height
+            render_map = self.render(console, options.update_dimensions(width, height))
+            self._render_map = render_map
+            layout_lines: List[List[Segment]] = [[] for _ in range(height)]
+            _islice = islice
+            for (region, lines) in render_map.values():
+                _x, y, _layout_width, layout_height = region
+                for row, line in zip(
+                    _islice(layout_lines, y, y + layout_height), lines
+                ):
+                    row.extend(line)
+
+            new_line = Segment.line()
+            for layout_row in layout_lines:
+                yield from layout_row
+                yield new_line
+
+
+if __name__ == "__main__":
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    layout = Layout()
+
+    layout.split_column(
+        Layout(name="header", size=3),
+        Layout(ratio=1, name="main"),
+        Layout(size=10, name="footer"),
+    )
+
+    layout["main"].split_row(Layout(name="side"), Layout(name="body", ratio=2))
+
+    layout["body"].split_row(Layout(name="content", ratio=2), Layout(name="s2"))
+
+    layout["s2"].split_column(
+        Layout(name="top"), Layout(name="middle"), Layout(name="bottom")
+    )
+
+    layout["side"].split_column(Layout(layout.tree, name="left1"), Layout(name="left2"))
+
+    layout["content"].update("foo")
+
+    console.print(layout)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/markup.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/markup.py
new file mode 100644
index 0000000000000000000000000000000000000000..fd80d8c1129722b84771bd6a0f6ccfd57f5cf78e
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/markup.py
@@ -0,0 +1,246 @@
+import re
+from ast import literal_eval
+from operator import attrgetter
+from typing import Callable, Iterable, List, Match, NamedTuple, Optional, Tuple, Union
+
+from ._emoji_replace import _emoji_replace
+from .emoji import EmojiVariant
+from .errors import MarkupError
+from .style import Style
+from .text import Span, Text
+
+RE_TAGS = re.compile(
+    r"""((\\*)\[([a-z#/@][^[]*?)])""",
+    re.VERBOSE,
+)
+
+RE_HANDLER = re.compile(r"^([\w.]*?)(\(.*?\))?$")
+
+
+class Tag(NamedTuple):
+    """A tag in console markup."""
+
+    name: str
+    """The tag name. e.g. 'bold'."""
+    parameters: Optional[str]
+    """Any additional parameters after the name."""
+
+    def __str__(self) -> str:
+        return (
+            self.name if self.parameters is None else f"{self.name} {self.parameters}"
+        )
+
+    @property
+    def markup(self) -> str:
+        """Get the string representation of this tag."""
+        return (
+            f"[{self.name}]"
+            if self.parameters is None
+            else f"[{self.name}={self.parameters}]"
+        )
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EscapeSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def escape(
+    markup: str,
+    _escape: _EscapeSubMethod = re.compile(r"(\\*)(\[[a-z#/@][^[]*?])").sub,
+) -> str:
+    """Escapes text so that it won't be interpreted as markup.
+
+    Args:
+        markup (str): Content to be inserted in to markup.
+
+    Returns:
+        str: Markup with square brackets escaped.
+    """
+
+    def escape_backslashes(match: Match[str]) -> str:
+        """Called by re.sub replace matches."""
+        backslashes, text = match.groups()
+        return f"{backslashes}{backslashes}\\{text}"
+
+    markup = _escape(escape_backslashes, markup)
+    return markup
+
+
+def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]:
+    """Parse markup in to an iterable of tuples of (position, text, tag).
+
+    Args:
+        markup (str): A string containing console markup
+
+    """
+    position = 0
+    _divmod = divmod
+    _Tag = Tag
+    for match in RE_TAGS.finditer(markup):
+        full_text, escapes, tag_text = match.groups()
+        start, end = match.span()
+        if start > position:
+            yield start, markup[position:start], None
+        if escapes:
+            backslashes, escaped = _divmod(len(escapes), 2)
+            if backslashes:
+                # Literal backslashes
+                yield start, "\\" * backslashes, None
+                start += backslashes * 2
+            if escaped:
+                # Escape of tag
+                yield start, full_text[len(escapes) :], None
+                position = end
+                continue
+        text, equals, parameters = tag_text.partition("=")
+        yield start, None, _Tag(text, parameters if equals else None)
+        position = end
+    if position < len(markup):
+        yield position, markup[position:], None
+
+
+def render(
+    markup: str,
+    style: Union[str, Style] = "",
+    emoji: bool = True,
+    emoji_variant: Optional[EmojiVariant] = None,
+) -> Text:
+    """Render console markup in to a Text instance.
+
+    Args:
+        markup (str): A string containing console markup.
+        emoji (bool, optional): Also render emoji code. Defaults to True.
+
+    Raises:
+        MarkupError: If there is a syntax error in the markup.
+
+    Returns:
+        Text: A test instance.
+    """
+    emoji_replace = _emoji_replace
+    if "[" not in markup:
+        return Text(
+            emoji_replace(markup, default_variant=emoji_variant) if emoji else markup,
+            style=style,
+        )
+    text = Text(style=style)
+    append = text.append
+    normalize = Style.normalize
+
+    style_stack: List[Tuple[int, Tag]] = []
+    pop = style_stack.pop
+
+    spans: List[Span] = []
+    append_span = spans.append
+
+    _Span = Span
+    _Tag = Tag
+
+    def pop_style(style_name: str) -> Tuple[int, Tag]:
+        """Pop tag matching given style name."""
+        for index, (_, tag) in enumerate(reversed(style_stack), 1):
+            if tag.name == style_name:
+                return pop(-index)
+        raise KeyError(style_name)
+
+    for position, plain_text, tag in _parse(markup):
+        if plain_text is not None:
+            # Handle open brace escapes, where the brace is not part of a tag.
+            plain_text = plain_text.replace("\\[", "[")
+            append(emoji_replace(plain_text) if emoji else plain_text)
+        elif tag is not None:
+            if tag.name.startswith("/"):  # Closing tag
+                style_name = tag.name[1:].strip()
+
+                if style_name:  # explicit close
+                    style_name = normalize(style_name)
+                    try:
+                        start, open_tag = pop_style(style_name)
+                    except KeyError:
+                        raise MarkupError(
+                            f"closing tag '{tag.markup}' at position {position} doesn't match any open tag"
+                        ) from None
+                else:  # implicit close
+                    try:
+                        start, open_tag = pop()
+                    except IndexError:
+                        raise MarkupError(
+                            f"closing tag '[/]' at position {position} has nothing to close"
+                        ) from None
+
+                if open_tag.name.startswith("@"):
+                    if open_tag.parameters:
+                        handler_name = ""
+                        parameters = open_tag.parameters.strip()
+                        handler_match = RE_HANDLER.match(parameters)
+                        if handler_match is not None:
+                            handler_name, match_parameters = handler_match.groups()
+                            parameters = (
+                                "()" if match_parameters is None else match_parameters
+                            )
+
+                        try:
+                            meta_params = literal_eval(parameters)
+                        except SyntaxError as error:
+                            raise MarkupError(
+                                f"error parsing {parameters!r} in {open_tag.parameters!r}; {error.msg}"
+                            )
+                        except Exception as error:
+                            raise MarkupError(
+                                f"error parsing {open_tag.parameters!r}; {error}"
+                            ) from None
+
+                        if handler_name:
+                            meta_params = (
+                                handler_name,
+                                meta_params
+                                if isinstance(meta_params, tuple)
+                                else (meta_params,),
+                            )
+
+                    else:
+                        meta_params = ()
+
+                    append_span(
+                        _Span(
+                            start, len(text), Style(meta={open_tag.name: meta_params})
+                        )
+                    )
+                else:
+                    append_span(_Span(start, len(text), str(open_tag)))
+
+            else:  # Opening tag
+                normalized_tag = _Tag(normalize(tag.name), tag.parameters)
+                style_stack.append((len(text), normalized_tag))
+
+    text_length = len(text)
+    while style_stack:
+        start, tag = style_stack.pop()
+        style = str(tag)
+        if style:
+            append_span(_Span(start, text_length, style))
+
+    text.spans = sorted(spans[::-1], key=attrgetter("start"))
+    return text
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    MARKUP = [
+        "[red]Hello World[/red]",
+        "[magenta]Hello [b]World[/b]",
+        "[bold]Bold[italic] bold and italic [/bold]italic[/italic]",
+        "Click [link=https://www.willmcgugan.com]here[/link] to visit my Blog",
+        ":warning-emoji: [bold red blink] DANGER![/]",
+    ]
+
+    from pip._vendor.rich import print
+    from pip._vendor.rich.table import Table
+
+    grid = Table("Markup", "Result", padding=(0, 1))
+
+    for markup in MARKUP:
+        grid.add_row(Text(markup), markup)
+
+    print(grid)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/palette.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/palette.py
new file mode 100644
index 0000000000000000000000000000000000000000..fa0c4dd40381addf5b42fae4228b6d8fef03abd9
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/palette.py
@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from pip._vendor.rich.color import Color
+        from pip._vendor.rich.style import Style
+        from pip._vendor.rich.text import Text
+        from pip._vendor.rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from pip._vendor.rich.color import Color
+    from pip._vendor.rich.console import Console, ConsoleOptions
+    from pip._vendor.rich.segment import Segment
+    from pip._vendor.rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress.py
new file mode 100644
index 0000000000000000000000000000000000000000..8b0a315f32466ac03a205898394f958f221818a7
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress.py
@@ -0,0 +1,1702 @@
+import io
+import sys
+import typing
+import warnings
+from abc import ABC, abstractmethod
+from collections import deque
+from dataclasses import dataclass, field
+from datetime import timedelta
+from io import RawIOBase, UnsupportedOperation
+from math import ceil
+from mmap import mmap
+from operator import length_hint
+from os import PathLike, stat
+from threading import Event, RLock, Thread
+from types import TracebackType
+from typing import (
+    Any,
+    BinaryIO,
+    Callable,
+    ContextManager,
+    Deque,
+    Dict,
+    Generic,
+    Iterable,
+    List,
+    NamedTuple,
+    NewType,
+    Optional,
+    Sequence,
+    TextIO,
+    Tuple,
+    Type,
+    TypeVar,
+    Union,
+)
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+from . import filesize, get_console
+from .console import Console, Group, JustifyMethod, RenderableType
+from .highlighter import Highlighter
+from .jupyter import JupyterMixin
+from .live import Live
+from .progress_bar import ProgressBar
+from .spinner import Spinner
+from .style import StyleType
+from .table import Column, Table
+from .text import Text, TextType
+
+TaskID = NewType("TaskID", int)
+
+ProgressType = TypeVar("ProgressType")
+
+GetTimeCallable = Callable[[], float]
+
+
+_I = typing.TypeVar("_I", TextIO, BinaryIO)
+
+
+class _TrackThread(Thread):
+    """A thread to periodically update progress."""
+
+    def __init__(self, progress: "Progress", task_id: "TaskID", update_period: float):
+        self.progress = progress
+        self.task_id = task_id
+        self.update_period = update_period
+        self.done = Event()
+
+        self.completed = 0
+        super().__init__()
+
+    def run(self) -> None:
+        task_id = self.task_id
+        advance = self.progress.advance
+        update_period = self.update_period
+        last_completed = 0
+        wait = self.done.wait
+        while not wait(update_period):
+            completed = self.completed
+            if last_completed != completed:
+                advance(task_id, completed - last_completed)
+                last_completed = completed
+
+        self.progress.update(self.task_id, completed=self.completed, refresh=True)
+
+    def __enter__(self) -> "_TrackThread":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.done.set()
+        self.join()
+
+
+def track(
+    sequence: Union[Sequence[ProgressType], Iterable[ProgressType]],
+    description: str = "Working...",
+    total: Optional[float] = None,
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    update_period: float = 0.1,
+    disable: bool = False,
+    show_speed: bool = True,
+) -> Iterable[ProgressType]:
+    """Track progress by iterating over a sequence.
+
+    Args:
+        sequence (Iterable[ProgressType]): A sequence (must support "len") you wish to iterate over.
+        description (str, optional): Description of task show next to progress bar. Defaults to "Working".
+        total: (float, optional): Total number of steps. Default is len(sequence).
+        auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        console (Console, optional): Console to write to. Default creates internal Console instance.
+        refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1.
+        disable (bool, optional): Disable display of progress.
+        show_speed (bool, optional): Show speed if total isn't known. Defaults to True.
+    Returns:
+        Iterable[ProgressType]: An iterable of the values in the sequence.
+
+    """
+
+    columns: List["ProgressColumn"] = (
+        [TextColumn("[progress.description]{task.description}")] if description else []
+    )
+    columns.extend(
+        (
+            BarColumn(
+                style=style,
+                complete_style=complete_style,
+                finished_style=finished_style,
+                pulse_style=pulse_style,
+            ),
+            TaskProgressColumn(show_speed=show_speed),
+            TimeRemainingColumn(elapsed_when_finished=True),
+        )
+    )
+    progress = Progress(
+        *columns,
+        auto_refresh=auto_refresh,
+        console=console,
+        transient=transient,
+        get_time=get_time,
+        refresh_per_second=refresh_per_second or 10,
+        disable=disable,
+    )
+
+    with progress:
+        yield from progress.track(
+            sequence, total=total, description=description, update_period=update_period
+        )
+
+
+class _Reader(RawIOBase, BinaryIO):
+    """A reader that tracks progress while it's being read from."""
+
+    def __init__(
+        self,
+        handle: BinaryIO,
+        progress: "Progress",
+        task: TaskID,
+        close_handle: bool = True,
+    ) -> None:
+        self.handle = handle
+        self.progress = progress
+        self.task = task
+        self.close_handle = close_handle
+        self._closed = False
+
+    def __enter__(self) -> "_Reader":
+        self.handle.__enter__()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.close()
+
+    def __iter__(self) -> BinaryIO:
+        return self
+
+    def __next__(self) -> bytes:
+        line = next(self.handle)
+        self.progress.advance(self.task, advance=len(line))
+        return line
+
+    @property
+    def closed(self) -> bool:
+        return self._closed
+
+    def fileno(self) -> int:
+        return self.handle.fileno()
+
+    def isatty(self) -> bool:
+        return self.handle.isatty()
+
+    @property
+    def mode(self) -> str:
+        return self.handle.mode
+
+    @property
+    def name(self) -> str:
+        return self.handle.name
+
+    def readable(self) -> bool:
+        return self.handle.readable()
+
+    def seekable(self) -> bool:
+        return self.handle.seekable()
+
+    def writable(self) -> bool:
+        return False
+
+    def read(self, size: int = -1) -> bytes:
+        block = self.handle.read(size)
+        self.progress.advance(self.task, advance=len(block))
+        return block
+
+    def readinto(self, b: Union[bytearray, memoryview, mmap]):  # type: ignore[no-untyped-def, override]
+        n = self.handle.readinto(b)  # type: ignore[attr-defined]
+        self.progress.advance(self.task, advance=n)
+        return n
+
+    def readline(self, size: int = -1) -> bytes:  # type: ignore[override]
+        line = self.handle.readline(size)
+        self.progress.advance(self.task, advance=len(line))
+        return line
+
+    def readlines(self, hint: int = -1) -> List[bytes]:
+        lines = self.handle.readlines(hint)
+        self.progress.advance(self.task, advance=sum(map(len, lines)))
+        return lines
+
+    def close(self) -> None:
+        if self.close_handle:
+            self.handle.close()
+        self._closed = True
+
+    def seek(self, offset: int, whence: int = 0) -> int:
+        pos = self.handle.seek(offset, whence)
+        self.progress.update(self.task, completed=pos)
+        return pos
+
+    def tell(self) -> int:
+        return self.handle.tell()
+
+    def write(self, s: Any) -> int:
+        raise UnsupportedOperation("write")
+
+
+class _ReadContext(ContextManager[_I], Generic[_I]):
+    """A utility class to handle a context for both a reader and a progress."""
+
+    def __init__(self, progress: "Progress", reader: _I) -> None:
+        self.progress = progress
+        self.reader: _I = reader
+
+    def __enter__(self) -> _I:
+        self.progress.start()
+        return self.reader.__enter__()
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.progress.stop()
+        self.reader.__exit__(exc_type, exc_val, exc_tb)
+
+
+def wrap_file(
+    file: BinaryIO,
+    total: int,
+    *,
+    description: str = "Reading...",
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    disable: bool = False,
+) -> ContextManager[BinaryIO]:
+    """Read bytes from a file while tracking progress.
+
+    Args:
+        file (Union[str, PathLike[str], BinaryIO]): The path to the file to read, or a file-like object in binary mode.
+        total (int): Total number of bytes to read.
+        description (str, optional): Description of task show next to progress bar. Defaults to "Reading".
+        auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        console (Console, optional): Console to write to. Default creates internal Console instance.
+        refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        disable (bool, optional): Disable display of progress.
+    Returns:
+        ContextManager[BinaryIO]: A context manager yielding a progress reader.
+
+    """
+
+    columns: List["ProgressColumn"] = (
+        [TextColumn("[progress.description]{task.description}")] if description else []
+    )
+    columns.extend(
+        (
+            BarColumn(
+                style=style,
+                complete_style=complete_style,
+                finished_style=finished_style,
+                pulse_style=pulse_style,
+            ),
+            DownloadColumn(),
+            TimeRemainingColumn(),
+        )
+    )
+    progress = Progress(
+        *columns,
+        auto_refresh=auto_refresh,
+        console=console,
+        transient=transient,
+        get_time=get_time,
+        refresh_per_second=refresh_per_second or 10,
+        disable=disable,
+    )
+
+    reader = progress.wrap_file(file, total=total, description=description)
+    return _ReadContext(progress, reader)
+
+
+@typing.overload
+def open(
+    file: Union[str, "PathLike[str]", bytes],
+    mode: Union[Literal["rt"], Literal["r"]],
+    buffering: int = -1,
+    encoding: Optional[str] = None,
+    errors: Optional[str] = None,
+    newline: Optional[str] = None,
+    *,
+    total: Optional[int] = None,
+    description: str = "Reading...",
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    disable: bool = False,
+) -> ContextManager[TextIO]:
+    pass
+
+
+@typing.overload
+def open(
+    file: Union[str, "PathLike[str]", bytes],
+    mode: Literal["rb"],
+    buffering: int = -1,
+    encoding: Optional[str] = None,
+    errors: Optional[str] = None,
+    newline: Optional[str] = None,
+    *,
+    total: Optional[int] = None,
+    description: str = "Reading...",
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    disable: bool = False,
+) -> ContextManager[BinaryIO]:
+    pass
+
+
+def open(
+    file: Union[str, "PathLike[str]", bytes],
+    mode: Union[Literal["rb"], Literal["rt"], Literal["r"]] = "r",
+    buffering: int = -1,
+    encoding: Optional[str] = None,
+    errors: Optional[str] = None,
+    newline: Optional[str] = None,
+    *,
+    total: Optional[int] = None,
+    description: str = "Reading...",
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    disable: bool = False,
+) -> Union[ContextManager[BinaryIO], ContextManager[TextIO]]:
+    """Read bytes from a file while tracking progress.
+
+    Args:
+        path (Union[str, PathLike[str], BinaryIO]): The path to the file to read, or a file-like object in binary mode.
+        mode (str): The mode to use to open the file. Only supports "r", "rb" or "rt".
+        buffering (int): The buffering strategy to use, see :func:`io.open`.
+        encoding (str, optional): The encoding to use when reading in text mode, see :func:`io.open`.
+        errors (str, optional): The error handling strategy for decoding errors, see :func:`io.open`.
+        newline (str, optional): The strategy for handling newlines in text mode, see :func:`io.open`
+        total: (int, optional): Total number of bytes to read. Must be provided if reading from a file handle. Default for a path is os.stat(file).st_size.
+        description (str, optional): Description of task show next to progress bar. Defaults to "Reading".
+        auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        console (Console, optional): Console to write to. Default creates internal Console instance.
+        refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        disable (bool, optional): Disable display of progress.
+        encoding (str, optional): The encoding to use when reading in text mode.
+
+    Returns:
+        ContextManager[BinaryIO]: A context manager yielding a progress reader.
+
+    """
+
+    columns: List["ProgressColumn"] = (
+        [TextColumn("[progress.description]{task.description}")] if description else []
+    )
+    columns.extend(
+        (
+            BarColumn(
+                style=style,
+                complete_style=complete_style,
+                finished_style=finished_style,
+                pulse_style=pulse_style,
+            ),
+            DownloadColumn(),
+            TimeRemainingColumn(),
+        )
+    )
+    progress = Progress(
+        *columns,
+        auto_refresh=auto_refresh,
+        console=console,
+        transient=transient,
+        get_time=get_time,
+        refresh_per_second=refresh_per_second or 10,
+        disable=disable,
+    )
+
+    reader = progress.open(
+        file,
+        mode=mode,
+        buffering=buffering,
+        encoding=encoding,
+        errors=errors,
+        newline=newline,
+        total=total,
+        description=description,
+    )
+    return _ReadContext(progress, reader)  # type: ignore[return-value, type-var]
+
+
+class ProgressColumn(ABC):
+    """Base class for a widget to use in progress display."""
+
+    max_refresh: Optional[float] = None
+
+    def __init__(self, table_column: Optional[Column] = None) -> None:
+        self._table_column = table_column
+        self._renderable_cache: Dict[TaskID, Tuple[float, RenderableType]] = {}
+        self._update_time: Optional[float] = None
+
+    def get_table_column(self) -> Column:
+        """Get a table column, used to build tasks table."""
+        return self._table_column or Column()
+
+    def __call__(self, task: "Task") -> RenderableType:
+        """Called by the Progress object to return a renderable for the given task.
+
+        Args:
+            task (Task): An object containing information regarding the task.
+
+        Returns:
+            RenderableType: Anything renderable (including str).
+        """
+        current_time = task.get_time()
+        if self.max_refresh is not None and not task.completed:
+            try:
+                timestamp, renderable = self._renderable_cache[task.id]
+            except KeyError:
+                pass
+            else:
+                if timestamp + self.max_refresh > current_time:
+                    return renderable
+
+        renderable = self.render(task)
+        self._renderable_cache[task.id] = (current_time, renderable)
+        return renderable
+
+    @abstractmethod
+    def render(self, task: "Task") -> RenderableType:
+        """Should return a renderable object."""
+
+
+class RenderableColumn(ProgressColumn):
+    """A column to insert an arbitrary column.
+
+    Args:
+        renderable (RenderableType, optional): Any renderable. Defaults to empty string.
+    """
+
+    def __init__(
+        self, renderable: RenderableType = "", *, table_column: Optional[Column] = None
+    ):
+        self.renderable = renderable
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> RenderableType:
+        return self.renderable
+
+
+class SpinnerColumn(ProgressColumn):
+    """A column with a 'spinner' animation.
+
+    Args:
+        spinner_name (str, optional): Name of spinner animation. Defaults to "dots".
+        style (StyleType, optional): Style of spinner. Defaults to "progress.spinner".
+        speed (float, optional): Speed factor of spinner. Defaults to 1.0.
+        finished_text (TextType, optional): Text used when task is finished. Defaults to " ".
+    """
+
+    def __init__(
+        self,
+        spinner_name: str = "dots",
+        style: Optional[StyleType] = "progress.spinner",
+        speed: float = 1.0,
+        finished_text: TextType = " ",
+        table_column: Optional[Column] = None,
+    ):
+        self.spinner = Spinner(spinner_name, style=style, speed=speed)
+        self.finished_text = (
+            Text.from_markup(finished_text)
+            if isinstance(finished_text, str)
+            else finished_text
+        )
+        super().__init__(table_column=table_column)
+
+    def set_spinner(
+        self,
+        spinner_name: str,
+        spinner_style: Optional[StyleType] = "progress.spinner",
+        speed: float = 1.0,
+    ) -> None:
+        """Set a new spinner.
+
+        Args:
+            spinner_name (str): Spinner name, see python -m rich.spinner.
+            spinner_style (Optional[StyleType], optional): Spinner style. Defaults to "progress.spinner".
+            speed (float, optional): Speed factor of spinner. Defaults to 1.0.
+        """
+        self.spinner = Spinner(spinner_name, style=spinner_style, speed=speed)
+
+    def render(self, task: "Task") -> RenderableType:
+        text = (
+            self.finished_text
+            if task.finished
+            else self.spinner.render(task.get_time())
+        )
+        return text
+
+
+class TextColumn(ProgressColumn):
+    """A column containing text."""
+
+    def __init__(
+        self,
+        text_format: str,
+        style: StyleType = "none",
+        justify: JustifyMethod = "left",
+        markup: bool = True,
+        highlighter: Optional[Highlighter] = None,
+        table_column: Optional[Column] = None,
+    ) -> None:
+        self.text_format = text_format
+        self.justify: JustifyMethod = justify
+        self.style = style
+        self.markup = markup
+        self.highlighter = highlighter
+        super().__init__(table_column=table_column or Column(no_wrap=True))
+
+    def render(self, task: "Task") -> Text:
+        _text = self.text_format.format(task=task)
+        if self.markup:
+            text = Text.from_markup(_text, style=self.style, justify=self.justify)
+        else:
+            text = Text(_text, style=self.style, justify=self.justify)
+        if self.highlighter:
+            self.highlighter.highlight(text)
+        return text
+
+
+class BarColumn(ProgressColumn):
+    """Renders a visual progress bar.
+
+    Args:
+        bar_width (Optional[int], optional): Width of bar or None for full width. Defaults to 40.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+    """
+
+    def __init__(
+        self,
+        bar_width: Optional[int] = 40,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        table_column: Optional[Column] = None,
+    ) -> None:
+        self.bar_width = bar_width
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> ProgressBar:
+        """Gets a progress bar widget for a task."""
+        return ProgressBar(
+            total=max(0, task.total) if task.total is not None else None,
+            completed=max(0, task.completed),
+            width=None if self.bar_width is None else max(1, self.bar_width),
+            pulse=not task.started,
+            animation_time=task.get_time(),
+            style=self.style,
+            complete_style=self.complete_style,
+            finished_style=self.finished_style,
+            pulse_style=self.pulse_style,
+        )
+
+
+class TimeElapsedColumn(ProgressColumn):
+    """Renders time elapsed."""
+
+    def render(self, task: "Task") -> Text:
+        """Show time elapsed."""
+        elapsed = task.finished_time if task.finished else task.elapsed
+        if elapsed is None:
+            return Text("-:--:--", style="progress.elapsed")
+        delta = timedelta(seconds=int(elapsed))
+        return Text(str(delta), style="progress.elapsed")
+
+
+class TaskProgressColumn(TextColumn):
+    """Show task progress as a percentage.
+
+    Args:
+        text_format (str, optional): Format for percentage display. Defaults to "[progress.percentage]{task.percentage:>3.0f}%".
+        text_format_no_percentage (str, optional): Format if percentage is unknown. Defaults to "".
+        style (StyleType, optional): Style of output. Defaults to "none".
+        justify (JustifyMethod, optional): Text justification. Defaults to "left".
+        markup (bool, optional): Enable markup. Defaults to True.
+        highlighter (Optional[Highlighter], optional): Highlighter to apply to output. Defaults to None.
+        table_column (Optional[Column], optional): Table Column to use. Defaults to None.
+        show_speed (bool, optional): Show speed if total is unknown. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        text_format: str = "[progress.percentage]{task.percentage:>3.0f}%",
+        text_format_no_percentage: str = "",
+        style: StyleType = "none",
+        justify: JustifyMethod = "left",
+        markup: bool = True,
+        highlighter: Optional[Highlighter] = None,
+        table_column: Optional[Column] = None,
+        show_speed: bool = False,
+    ) -> None:
+
+        self.text_format_no_percentage = text_format_no_percentage
+        self.show_speed = show_speed
+        super().__init__(
+            text_format=text_format,
+            style=style,
+            justify=justify,
+            markup=markup,
+            highlighter=highlighter,
+            table_column=table_column,
+        )
+
+    @classmethod
+    def render_speed(cls, speed: Optional[float]) -> Text:
+        """Render the speed in iterations per second.
+
+        Args:
+            task (Task): A Task object.
+
+        Returns:
+            Text: Text object containing the task speed.
+        """
+        if speed is None:
+            return Text("", style="progress.percentage")
+        unit, suffix = filesize.pick_unit_and_suffix(
+            int(speed),
+            ["", "×10³", "×10⁶", "×10⁹", "×10¹²"],
+            1000,
+        )
+        data_speed = speed / unit
+        return Text(f"{data_speed:.1f}{suffix} it/s", style="progress.percentage")
+
+    def render(self, task: "Task") -> Text:
+        if task.total is None and self.show_speed:
+            return self.render_speed(task.finished_speed or task.speed)
+        text_format = (
+            self.text_format_no_percentage if task.total is None else self.text_format
+        )
+        _text = text_format.format(task=task)
+        if self.markup:
+            text = Text.from_markup(_text, style=self.style, justify=self.justify)
+        else:
+            text = Text(_text, style=self.style, justify=self.justify)
+        if self.highlighter:
+            self.highlighter.highlight(text)
+        return text
+
+
+class TimeRemainingColumn(ProgressColumn):
+    """Renders estimated time remaining.
+
+    Args:
+        compact (bool, optional): Render MM:SS when time remaining is less than an hour. Defaults to False.
+        elapsed_when_finished (bool, optional): Render time elapsed when the task is finished. Defaults to False.
+    """
+
+    # Only refresh twice a second to prevent jitter
+    max_refresh = 0.5
+
+    def __init__(
+        self,
+        compact: bool = False,
+        elapsed_when_finished: bool = False,
+        table_column: Optional[Column] = None,
+    ):
+        self.compact = compact
+        self.elapsed_when_finished = elapsed_when_finished
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> Text:
+        """Show time remaining."""
+        if self.elapsed_when_finished and task.finished:
+            task_time = task.finished_time
+            style = "progress.elapsed"
+        else:
+            task_time = task.time_remaining
+            style = "progress.remaining"
+
+        if task.total is None:
+            return Text("", style=style)
+
+        if task_time is None:
+            return Text("--:--" if self.compact else "-:--:--", style=style)
+
+        # Based on https://github.com/tqdm/tqdm/blob/master/tqdm/std.py
+        minutes, seconds = divmod(int(task_time), 60)
+        hours, minutes = divmod(minutes, 60)
+
+        if self.compact and not hours:
+            formatted = f"{minutes:02d}:{seconds:02d}"
+        else:
+            formatted = f"{hours:d}:{minutes:02d}:{seconds:02d}"
+
+        return Text(formatted, style=style)
+
+
+class FileSizeColumn(ProgressColumn):
+    """Renders completed filesize."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data completed."""
+        data_size = filesize.decimal(int(task.completed))
+        return Text(data_size, style="progress.filesize")
+
+
+class TotalFileSizeColumn(ProgressColumn):
+    """Renders total filesize."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data completed."""
+        data_size = filesize.decimal(int(task.total)) if task.total is not None else ""
+        return Text(data_size, style="progress.filesize.total")
+
+
+class MofNCompleteColumn(ProgressColumn):
+    """Renders completed count/total, e.g. '  10/1000'.
+
+    Best for bounded tasks with int quantities.
+
+    Space pads the completed count so that progress length does not change as task progresses
+    past powers of 10.
+
+    Args:
+        separator (str, optional): Text to separate completed and total values. Defaults to "/".
+    """
+
+    def __init__(self, separator: str = "/", table_column: Optional[Column] = None):
+        self.separator = separator
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> Text:
+        """Show completed/total."""
+        completed = int(task.completed)
+        total = int(task.total) if task.total is not None else "?"
+        total_width = len(str(total))
+        return Text(
+            f"{completed:{total_width}d}{self.separator}{total}",
+            style="progress.download",
+        )
+
+
+class DownloadColumn(ProgressColumn):
+    """Renders file size downloaded and total, e.g. '0.5/2.3 GB'.
+
+    Args:
+        binary_units (bool, optional): Use binary units, KiB, MiB etc. Defaults to False.
+    """
+
+    def __init__(
+        self, binary_units: bool = False, table_column: Optional[Column] = None
+    ) -> None:
+        self.binary_units = binary_units
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> Text:
+        """Calculate common unit for completed and total."""
+        completed = int(task.completed)
+
+        unit_and_suffix_calculation_base = (
+            int(task.total) if task.total is not None else completed
+        )
+        if self.binary_units:
+            unit, suffix = filesize.pick_unit_and_suffix(
+                unit_and_suffix_calculation_base,
+                ["bytes", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"],
+                1024,
+            )
+        else:
+            unit, suffix = filesize.pick_unit_and_suffix(
+                unit_and_suffix_calculation_base,
+                ["bytes", "kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"],
+                1000,
+            )
+        precision = 0 if unit == 1 else 1
+
+        completed_ratio = completed / unit
+        completed_str = f"{completed_ratio:,.{precision}f}"
+
+        if task.total is not None:
+            total = int(task.total)
+            total_ratio = total / unit
+            total_str = f"{total_ratio:,.{precision}f}"
+        else:
+            total_str = "?"
+
+        download_status = f"{completed_str}/{total_str} {suffix}"
+        download_text = Text(download_status, style="progress.download")
+        return download_text
+
+
+class TransferSpeedColumn(ProgressColumn):
+    """Renders human readable transfer speed."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data transfer speed."""
+        speed = task.finished_speed or task.speed
+        if speed is None:
+            return Text("?", style="progress.data.speed")
+        data_speed = filesize.decimal(int(speed))
+        return Text(f"{data_speed}/s", style="progress.data.speed")
+
+
+class ProgressSample(NamedTuple):
+    """Sample of progress for a given time."""
+
+    timestamp: float
+    """Timestamp of sample."""
+    completed: float
+    """Number of steps completed."""
+
+
+@dataclass
+class Task:
+    """Information regarding a progress task.
+
+    This object should be considered read-only outside of the :class:`~Progress` class.
+
+    """
+
+    id: TaskID
+    """Task ID associated with this task (used in Progress methods)."""
+
+    description: str
+    """str: Description of the task."""
+
+    total: Optional[float]
+    """Optional[float]: Total number of steps in this task."""
+
+    completed: float
+    """float: Number of steps completed"""
+
+    _get_time: GetTimeCallable
+    """Callable to get the current time."""
+
+    finished_time: Optional[float] = None
+    """float: Time task was finished."""
+
+    visible: bool = True
+    """bool: Indicates if this task is visible in the progress display."""
+
+    fields: Dict[str, Any] = field(default_factory=dict)
+    """dict: Arbitrary fields passed in via Progress.update."""
+
+    start_time: Optional[float] = field(default=None, init=False, repr=False)
+    """Optional[float]: Time this task was started, or None if not started."""
+
+    stop_time: Optional[float] = field(default=None, init=False, repr=False)
+    """Optional[float]: Time this task was stopped, or None if not stopped."""
+
+    finished_speed: Optional[float] = None
+    """Optional[float]: The last speed for a finished task."""
+
+    _progress: Deque[ProgressSample] = field(
+        default_factory=lambda: deque(maxlen=1000), init=False, repr=False
+    )
+
+    _lock: RLock = field(repr=False, default_factory=RLock)
+    """Thread lock."""
+
+    def get_time(self) -> float:
+        """float: Get the current time, in seconds."""
+        return self._get_time()
+
+    @property
+    def started(self) -> bool:
+        """bool: Check if the task as started."""
+        return self.start_time is not None
+
+    @property
+    def remaining(self) -> Optional[float]:
+        """Optional[float]: Get the number of steps remaining, if a non-None total was set."""
+        if self.total is None:
+            return None
+        return self.total - self.completed
+
+    @property
+    def elapsed(self) -> Optional[float]:
+        """Optional[float]: Time elapsed since task was started, or ``None`` if the task hasn't started."""
+        if self.start_time is None:
+            return None
+        if self.stop_time is not None:
+            return self.stop_time - self.start_time
+        return self.get_time() - self.start_time
+
+    @property
+    def finished(self) -> bool:
+        """Check if the task has finished."""
+        return self.finished_time is not None
+
+    @property
+    def percentage(self) -> float:
+        """float: Get progress of task as a percentage. If a None total was set, returns 0"""
+        if not self.total:
+            return 0.0
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100.0, max(0.0, completed))
+        return completed
+
+    @property
+    def speed(self) -> Optional[float]:
+        """Optional[float]: Get the estimated speed in steps per second."""
+        if self.start_time is None:
+            return None
+        with self._lock:
+            progress = self._progress
+            if not progress:
+                return None
+            total_time = progress[-1].timestamp - progress[0].timestamp
+            if total_time == 0:
+                return None
+            iter_progress = iter(progress)
+            next(iter_progress)
+            total_completed = sum(sample.completed for sample in iter_progress)
+            speed = total_completed / total_time
+            return speed
+
+    @property
+    def time_remaining(self) -> Optional[float]:
+        """Optional[float]: Get estimated time to completion, or ``None`` if no data."""
+        if self.finished:
+            return 0.0
+        speed = self.speed
+        if not speed:
+            return None
+        remaining = self.remaining
+        if remaining is None:
+            return None
+        estimate = ceil(remaining / speed)
+        return estimate
+
+    def _reset(self) -> None:
+        """Reset progress."""
+        self._progress.clear()
+        self.finished_time = None
+        self.finished_speed = None
+
+
+class Progress(JupyterMixin):
+    """Renders an auto-updating progress bar(s).
+
+    Args:
+        console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout.
+        auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()`.
+        refresh_per_second (Optional[float], optional): Number of times per second to refresh the progress information or None to use default (10). Defaults to None.
+        speed_estimate_period: (float, optional): Period (in seconds) used to calculate the speed estimate. Defaults to 30.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        redirect_stdout: (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True.
+        redirect_stderr: (bool, optional): Enable redirection of stderr. Defaults to True.
+        get_time: (Callable, optional): A callable that gets the current time, or None to use Console.get_time. Defaults to None.
+        disable (bool, optional): Disable progress display. Defaults to False
+        expand (bool, optional): Expand tasks table to fit width. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        *columns: Union[str, ProgressColumn],
+        console: Optional[Console] = None,
+        auto_refresh: bool = True,
+        refresh_per_second: float = 10,
+        speed_estimate_period: float = 30.0,
+        transient: bool = False,
+        redirect_stdout: bool = True,
+        redirect_stderr: bool = True,
+        get_time: Optional[GetTimeCallable] = None,
+        disable: bool = False,
+        expand: bool = False,
+    ) -> None:
+        assert refresh_per_second > 0, "refresh_per_second must be > 0"
+        self._lock = RLock()
+        self.columns = columns or self.get_default_columns()
+        self.speed_estimate_period = speed_estimate_period
+
+        self.disable = disable
+        self.expand = expand
+        self._tasks: Dict[TaskID, Task] = {}
+        self._task_index: TaskID = TaskID(0)
+        self.live = Live(
+            console=console or get_console(),
+            auto_refresh=auto_refresh,
+            refresh_per_second=refresh_per_second,
+            transient=transient,
+            redirect_stdout=redirect_stdout,
+            redirect_stderr=redirect_stderr,
+            get_renderable=self.get_renderable,
+        )
+        self.get_time = get_time or self.console.get_time
+        self.print = self.console.print
+        self.log = self.console.log
+
+    @classmethod
+    def get_default_columns(cls) -> Tuple[ProgressColumn, ...]:
+        """Get the default columns used for a new Progress instance:
+           - a text column for the description (TextColumn)
+           - the bar itself (BarColumn)
+           - a text column showing completion percentage (TextColumn)
+           - an estimated-time-remaining column (TimeRemainingColumn)
+        If the Progress instance is created without passing a columns argument,
+        the default columns defined here will be used.
+
+        You can also create a Progress instance using custom columns before
+        and/or after the defaults, as in this example:
+
+            progress = Progress(
+                SpinnerColumn(),
+                *Progress.default_columns(),
+                "Elapsed:",
+                TimeElapsedColumn(),
+            )
+
+        This code shows the creation of a Progress display, containing
+        a spinner to the left, the default columns, and a labeled elapsed
+        time column.
+        """
+        return (
+            TextColumn("[progress.description]{task.description}"),
+            BarColumn(),
+            TaskProgressColumn(),
+            TimeRemainingColumn(),
+        )
+
+    @property
+    def console(self) -> Console:
+        return self.live.console
+
+    @property
+    def tasks(self) -> List[Task]:
+        """Get a list of Task instances."""
+        with self._lock:
+            return list(self._tasks.values())
+
+    @property
+    def task_ids(self) -> List[TaskID]:
+        """A list of task IDs."""
+        with self._lock:
+            return list(self._tasks.keys())
+
+    @property
+    def finished(self) -> bool:
+        """Check if all tasks have been completed."""
+        with self._lock:
+            if not self._tasks:
+                return True
+            return all(task.finished for task in self._tasks.values())
+
+    def start(self) -> None:
+        """Start the progress display."""
+        if not self.disable:
+            self.live.start(refresh=True)
+
+    def stop(self) -> None:
+        """Stop the progress display."""
+        self.live.stop()
+        if not self.console.is_interactive:
+            self.console.print()
+
+    def __enter__(self) -> "Progress":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+    def track(
+        self,
+        sequence: Union[Iterable[ProgressType], Sequence[ProgressType]],
+        total: Optional[float] = None,
+        task_id: Optional[TaskID] = None,
+        description: str = "Working...",
+        update_period: float = 0.1,
+    ) -> Iterable[ProgressType]:
+        """Track progress by iterating over a sequence.
+
+        Args:
+            sequence (Sequence[ProgressType]): A sequence of values you want to iterate over and track progress.
+            total: (float, optional): Total number of steps. Default is len(sequence).
+            task_id: (TaskID): Task to track. Default is new task.
+            description: (str, optional): Description of task, if new task is created.
+            update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1.
+
+        Returns:
+            Iterable[ProgressType]: An iterable of values taken from the provided sequence.
+        """
+        if total is None:
+            total = float(length_hint(sequence)) or None
+
+        if task_id is None:
+            task_id = self.add_task(description, total=total)
+        else:
+            self.update(task_id, total=total)
+
+        if self.live.auto_refresh:
+            with _TrackThread(self, task_id, update_period) as track_thread:
+                for value in sequence:
+                    yield value
+                    track_thread.completed += 1
+        else:
+            advance = self.advance
+            refresh = self.refresh
+            for value in sequence:
+                yield value
+                advance(task_id, 1)
+                refresh()
+
+    def wrap_file(
+        self,
+        file: BinaryIO,
+        total: Optional[int] = None,
+        *,
+        task_id: Optional[TaskID] = None,
+        description: str = "Reading...",
+    ) -> BinaryIO:
+        """Track progress file reading from a binary file.
+
+        Args:
+            file (BinaryIO): A file-like object opened in binary mode.
+            total (int, optional): Total number of bytes to read. This must be provided unless a task with a total is also given.
+            task_id (TaskID): Task to track. Default is new task.
+            description (str, optional): Description of task, if new task is created.
+
+        Returns:
+            BinaryIO: A readable file-like object in binary mode.
+
+        Raises:
+            ValueError: When no total value can be extracted from the arguments or the task.
+        """
+        # attempt to recover the total from the task
+        total_bytes: Optional[float] = None
+        if total is not None:
+            total_bytes = total
+        elif task_id is not None:
+            with self._lock:
+                total_bytes = self._tasks[task_id].total
+        if total_bytes is None:
+            raise ValueError(
+                f"unable to get the total number of bytes, please specify 'total'"
+            )
+
+        # update total of task or create new task
+        if task_id is None:
+            task_id = self.add_task(description, total=total_bytes)
+        else:
+            self.update(task_id, total=total_bytes)
+
+        return _Reader(file, self, task_id, close_handle=False)
+
+    @typing.overload
+    def open(
+        self,
+        file: Union[str, "PathLike[str]", bytes],
+        mode: Literal["rb"],
+        buffering: int = -1,
+        encoding: Optional[str] = None,
+        errors: Optional[str] = None,
+        newline: Optional[str] = None,
+        *,
+        total: Optional[int] = None,
+        task_id: Optional[TaskID] = None,
+        description: str = "Reading...",
+    ) -> BinaryIO:
+        pass
+
+    @typing.overload
+    def open(
+        self,
+        file: Union[str, "PathLike[str]", bytes],
+        mode: Union[Literal["r"], Literal["rt"]],
+        buffering: int = -1,
+        encoding: Optional[str] = None,
+        errors: Optional[str] = None,
+        newline: Optional[str] = None,
+        *,
+        total: Optional[int] = None,
+        task_id: Optional[TaskID] = None,
+        description: str = "Reading...",
+    ) -> TextIO:
+        pass
+
+    def open(
+        self,
+        file: Union[str, "PathLike[str]", bytes],
+        mode: Union[Literal["rb"], Literal["rt"], Literal["r"]] = "r",
+        buffering: int = -1,
+        encoding: Optional[str] = None,
+        errors: Optional[str] = None,
+        newline: Optional[str] = None,
+        *,
+        total: Optional[int] = None,
+        task_id: Optional[TaskID] = None,
+        description: str = "Reading...",
+    ) -> Union[BinaryIO, TextIO]:
+        """Track progress while reading from a binary file.
+
+        Args:
+            path (Union[str, PathLike[str]]): The path to the file to read.
+            mode (str): The mode to use to open the file. Only supports "r", "rb" or "rt".
+            buffering (int): The buffering strategy to use, see :func:`io.open`.
+            encoding (str, optional): The encoding to use when reading in text mode, see :func:`io.open`.
+            errors (str, optional): The error handling strategy for decoding errors, see :func:`io.open`.
+            newline (str, optional): The strategy for handling newlines in text mode, see :func:`io.open`.
+            total (int, optional): Total number of bytes to read. If none given, os.stat(path).st_size is used.
+            task_id (TaskID): Task to track. Default is new task.
+            description (str, optional): Description of task, if new task is created.
+
+        Returns:
+            BinaryIO: A readable file-like object in binary mode.
+
+        Raises:
+            ValueError: When an invalid mode is given.
+        """
+        # normalize the mode (always rb, rt)
+        _mode = "".join(sorted(mode, reverse=False))
+        if _mode not in ("br", "rt", "r"):
+            raise ValueError("invalid mode {!r}".format(mode))
+
+        # patch buffering to provide the same behaviour as the builtin `open`
+        line_buffering = buffering == 1
+        if _mode == "br" and buffering == 1:
+            warnings.warn(
+                "line buffering (buffering=1) isn't supported in binary mode, the default buffer size will be used",
+                RuntimeWarning,
+            )
+            buffering = -1
+        elif _mode in ("rt", "r"):
+            if buffering == 0:
+                raise ValueError("can't have unbuffered text I/O")
+            elif buffering == 1:
+                buffering = -1
+
+        # attempt to get the total with `os.stat`
+        if total is None:
+            total = stat(file).st_size
+
+        # update total of task or create new task
+        if task_id is None:
+            task_id = self.add_task(description, total=total)
+        else:
+            self.update(task_id, total=total)
+
+        # open the file in binary mode,
+        handle = io.open(file, "rb", buffering=buffering)
+        reader = _Reader(handle, self, task_id, close_handle=True)
+
+        # wrap the reader in a `TextIOWrapper` if text mode
+        if mode in ("r", "rt"):
+            return io.TextIOWrapper(
+                reader,
+                encoding=encoding,
+                errors=errors,
+                newline=newline,
+                line_buffering=line_buffering,
+            )
+
+        return reader
+
+    def start_task(self, task_id: TaskID) -> None:
+        """Start a task.
+
+        Starts a task (used when calculating elapsed time). You may need to call this manually,
+        if you called ``add_task`` with ``start=False``.
+
+        Args:
+            task_id (TaskID): ID of task.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            if task.start_time is None:
+                task.start_time = self.get_time()
+
+    def stop_task(self, task_id: TaskID) -> None:
+        """Stop a task.
+
+        This will freeze the elapsed time on the task.
+
+        Args:
+            task_id (TaskID): ID of task.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            current_time = self.get_time()
+            if task.start_time is None:
+                task.start_time = current_time
+            task.stop_time = current_time
+
+    def update(
+        self,
+        task_id: TaskID,
+        *,
+        total: Optional[float] = None,
+        completed: Optional[float] = None,
+        advance: Optional[float] = None,
+        description: Optional[str] = None,
+        visible: Optional[bool] = None,
+        refresh: bool = False,
+        **fields: Any,
+    ) -> None:
+        """Update information associated with a task.
+
+        Args:
+            task_id (TaskID): Task id (returned by add_task).
+            total (float, optional): Updates task.total if not None.
+            completed (float, optional): Updates task.completed if not None.
+            advance (float, optional): Add a value to task.completed if not None.
+            description (str, optional): Change task description if not None.
+            visible (bool, optional): Set visible flag if not None.
+            refresh (bool): Force a refresh of progress information. Default is False.
+            **fields (Any): Additional data fields required for rendering.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            completed_start = task.completed
+
+            if total is not None and total != task.total:
+                task.total = total
+                task._reset()
+            if advance is not None:
+                task.completed += advance
+            if completed is not None:
+                task.completed = completed
+            if description is not None:
+                task.description = description
+            if visible is not None:
+                task.visible = visible
+            task.fields.update(fields)
+            update_completed = task.completed - completed_start
+
+            current_time = self.get_time()
+            old_sample_time = current_time - self.speed_estimate_period
+            _progress = task._progress
+
+            popleft = _progress.popleft
+            while _progress and _progress[0].timestamp < old_sample_time:
+                popleft()
+            if update_completed > 0:
+                _progress.append(ProgressSample(current_time, update_completed))
+            if (
+                task.total is not None
+                and task.completed >= task.total
+                and task.finished_time is None
+            ):
+                task.finished_time = task.elapsed
+
+        if refresh:
+            self.refresh()
+
+    def reset(
+        self,
+        task_id: TaskID,
+        *,
+        start: bool = True,
+        total: Optional[float] = None,
+        completed: int = 0,
+        visible: Optional[bool] = None,
+        description: Optional[str] = None,
+        **fields: Any,
+    ) -> None:
+        """Reset a task so completed is 0 and the clock is reset.
+
+        Args:
+            task_id (TaskID): ID of task.
+            start (bool, optional): Start the task after reset. Defaults to True.
+            total (float, optional): New total steps in task, or None to use current total. Defaults to None.
+            completed (int, optional): Number of steps completed. Defaults to 0.
+            visible (bool, optional): Enable display of the task. Defaults to True.
+            description (str, optional): Change task description if not None. Defaults to None.
+            **fields (str): Additional data fields required for rendering.
+        """
+        current_time = self.get_time()
+        with self._lock:
+            task = self._tasks[task_id]
+            task._reset()
+            task.start_time = current_time if start else None
+            if total is not None:
+                task.total = total
+            task.completed = completed
+            if visible is not None:
+                task.visible = visible
+            if fields:
+                task.fields = fields
+            if description is not None:
+                task.description = description
+            task.finished_time = None
+        self.refresh()
+
+    def advance(self, task_id: TaskID, advance: float = 1) -> None:
+        """Advance task by a number of steps.
+
+        Args:
+            task_id (TaskID): ID of task.
+            advance (float): Number of steps to advance. Default is 1.
+        """
+        current_time = self.get_time()
+        with self._lock:
+            task = self._tasks[task_id]
+            completed_start = task.completed
+            task.completed += advance
+            update_completed = task.completed - completed_start
+            old_sample_time = current_time - self.speed_estimate_period
+            _progress = task._progress
+
+            popleft = _progress.popleft
+            while _progress and _progress[0].timestamp < old_sample_time:
+                popleft()
+            while len(_progress) > 1000:
+                popleft()
+            _progress.append(ProgressSample(current_time, update_completed))
+            if (
+                task.total is not None
+                and task.completed >= task.total
+                and task.finished_time is None
+            ):
+                task.finished_time = task.elapsed
+                task.finished_speed = task.speed
+
+    def refresh(self) -> None:
+        """Refresh (render) the progress information."""
+        if not self.disable and self.live.is_started:
+            self.live.refresh()
+
+    def get_renderable(self) -> RenderableType:
+        """Get a renderable for the progress display."""
+        renderable = Group(*self.get_renderables())
+        return renderable
+
+    def get_renderables(self) -> Iterable[RenderableType]:
+        """Get a number of renderables for the progress display."""
+        table = self.make_tasks_table(self.tasks)
+        yield table
+
+    def make_tasks_table(self, tasks: Iterable[Task]) -> Table:
+        """Get a table to render the Progress display.
+
+        Args:
+            tasks (Iterable[Task]): An iterable of Task instances, one per row of the table.
+
+        Returns:
+            Table: A table instance.
+        """
+        table_columns = (
+            (
+                Column(no_wrap=True)
+                if isinstance(_column, str)
+                else _column.get_table_column().copy()
+            )
+            for _column in self.columns
+        )
+        table = Table.grid(*table_columns, padding=(0, 1), expand=self.expand)
+
+        for task in tasks:
+            if task.visible:
+                table.add_row(
+                    *(
+                        (
+                            column.format(task=task)
+                            if isinstance(column, str)
+                            else column(task)
+                        )
+                        for column in self.columns
+                    )
+                )
+        return table
+
+    def __rich__(self) -> RenderableType:
+        """Makes the Progress class itself renderable."""
+        with self._lock:
+            return self.get_renderable()
+
+    def add_task(
+        self,
+        description: str,
+        start: bool = True,
+        total: Optional[float] = 100.0,
+        completed: int = 0,
+        visible: bool = True,
+        **fields: Any,
+    ) -> TaskID:
+        """Add a new 'task' to the Progress display.
+
+        Args:
+            description (str): A description of the task.
+            start (bool, optional): Start the task immediately (to calculate elapsed time). If set to False,
+                you will need to call `start` manually. Defaults to True.
+            total (float, optional): Number of total steps in the progress if known.
+                Set to None to render a pulsing animation. Defaults to 100.
+            completed (int, optional): Number of steps completed so far. Defaults to 0.
+            visible (bool, optional): Enable display of the task. Defaults to True.
+            **fields (str): Additional data fields required for rendering.
+
+        Returns:
+            TaskID: An ID you can use when calling `update`.
+        """
+        with self._lock:
+            task = Task(
+                self._task_index,
+                description,
+                total,
+                completed,
+                visible=visible,
+                fields=fields,
+                _get_time=self.get_time,
+                _lock=self._lock,
+            )
+            self._tasks[self._task_index] = task
+            if start:
+                self.start_task(self._task_index)
+            new_task_index = self._task_index
+            self._task_index = TaskID(int(self._task_index) + 1)
+        self.refresh()
+        return new_task_index
+
+    def remove_task(self, task_id: TaskID) -> None:
+        """Delete a task if it exists.
+
+        Args:
+            task_id (TaskID): A task ID.
+
+        """
+        with self._lock:
+            del self._tasks[task_id]
+
+
+if __name__ == "__main__":  # pragma: no coverage
+
+    import random
+    import time
+
+    from .panel import Panel
+    from .rule import Rule
+    from .syntax import Syntax
+    from .table import Table
+
+    syntax = Syntax(
+        '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value''',
+        "python",
+        line_numbers=True,
+    )
+
+    table = Table("foo", "bar", "baz")
+    table.add_row("1", "2", "3")
+
+    progress_renderables = [
+        "Text may be printed while the progress bars are rendering.",
+        Panel("In fact, [i]any[/i] renderable will work"),
+        "Such as [magenta]tables[/]...",
+        table,
+        "Pretty printed structures...",
+        {"type": "example", "text": "Pretty printed"},
+        "Syntax...",
+        syntax,
+        Rule("Give it a try!"),
+    ]
+
+    from itertools import cycle
+
+    examples = cycle(progress_renderables)
+
+    console = Console(record=True)
+
+    with Progress(
+        SpinnerColumn(),
+        *Progress.get_default_columns(),
+        TimeElapsedColumn(),
+        console=console,
+        transient=False,
+    ) as progress:
+
+        task1 = progress.add_task("[red]Downloading", total=1000)
+        task2 = progress.add_task("[green]Processing", total=1000)
+        task3 = progress.add_task("[yellow]Thinking", total=None)
+
+        while not progress.finished:
+            progress.update(task1, advance=0.5)
+            progress.update(task2, advance=0.3)
+            time.sleep(0.01)
+            if random.randint(0, 100) < 1:
+                progress.log(next(examples))
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress_bar.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress_bar.py
new file mode 100644
index 0000000000000000000000000000000000000000..67361df2e49d48dd56c91e291ba92553e9afe344
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/progress_bar.py
@@ -0,0 +1,224 @@
+import math
+from functools import lru_cache
+from time import monotonic
+from typing import Iterable, List, Optional
+
+from .color import Color, blend_rgb
+from .color_triplet import ColorTriplet
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleType
+
+# Number of characters before 'pulse' animation repeats
+PULSE_SIZE = 20
+
+
+class ProgressBar(JupyterMixin):
+    """Renders a (progress) bar. Used by rich.progress.
+
+    Args:
+        total (float, optional): Number of steps in the bar. Defaults to 100. Set to None to render a pulsing animation.
+        completed (float, optional): Number of steps completed. Defaults to 0.
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        pulse (bool, optional): Enable pulse effect. Defaults to False. Will pulse if a None total was passed.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time.
+    """
+
+    def __init__(
+        self,
+        total: Optional[float] = 100.0,
+        completed: float = 0,
+        width: Optional[int] = None,
+        pulse: bool = False,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        animation_time: Optional[float] = None,
+    ):
+        self.total = total
+        self.completed = completed
+        self.width = width
+        self.pulse = pulse
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        self.animation_time = animation_time
+
+        self._pulse_segments: Optional[List[Segment]] = None
+
+    def __repr__(self) -> str:
+        return f"<Bar {self.completed!r} of {self.total!r}>"
+
+    @property
+    def percentage_completed(self) -> Optional[float]:
+        """Calculate percentage complete."""
+        if self.total is None:
+            return None
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100, max(0.0, completed))
+        return completed
+
+    @lru_cache(maxsize=16)
+    def _get_pulse_segments(
+        self,
+        fore_style: Style,
+        back_style: Style,
+        color_system: str,
+        no_color: bool,
+        ascii: bool = False,
+    ) -> List[Segment]:
+        """Get a list of segments to render a pulse animation.
+
+        Returns:
+            List[Segment]: A list of segments, one segment per character.
+        """
+        bar = "-" if ascii else "━"
+        segments: List[Segment] = []
+        if color_system not in ("standard", "eight_bit", "truecolor") or no_color:
+            segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2)
+            segments += [Segment(" " if no_color else bar, back_style)] * (
+                PULSE_SIZE - (PULSE_SIZE // 2)
+            )
+            return segments
+
+        append = segments.append
+        fore_color = (
+            fore_style.color.get_truecolor()
+            if fore_style.color
+            else ColorTriplet(255, 0, 255)
+        )
+        back_color = (
+            back_style.color.get_truecolor()
+            if back_style.color
+            else ColorTriplet(0, 0, 0)
+        )
+        cos = math.cos
+        pi = math.pi
+        _Segment = Segment
+        _Style = Style
+        from_triplet = Color.from_triplet
+
+        for index in range(PULSE_SIZE):
+            position = index / PULSE_SIZE
+            fade = 0.5 + cos((position * pi * 2)) / 2.0
+            color = blend_rgb(fore_color, back_color, cross_fade=fade)
+            append(_Segment(bar, _Style(color=from_triplet(color))))
+        return segments
+
+    def update(self, completed: float, total: Optional[float] = None) -> None:
+        """Update progress with new values.
+
+        Args:
+            completed (float): Number of steps completed.
+            total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None.
+        """
+        self.completed = completed
+        self.total = total if total is not None else self.total
+
+    def _render_pulse(
+        self, console: Console, width: int, ascii: bool = False
+    ) -> Iterable[Segment]:
+        """Renders the pulse animation.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Width in characters of pulse animation.
+
+        Returns:
+            RenderResult: [description]
+
+        Yields:
+            Iterator[Segment]: Segments to render pulse
+        """
+        fore_style = console.get_style(self.pulse_style, default="white")
+        back_style = console.get_style(self.style, default="black")
+
+        pulse_segments = self._get_pulse_segments(
+            fore_style, back_style, console.color_system, console.no_color, ascii=ascii
+        )
+        segment_count = len(pulse_segments)
+        current_time = (
+            monotonic() if self.animation_time is None else self.animation_time
+        )
+        segments = pulse_segments * (int(width / segment_count) + 2)
+        offset = int(-current_time * 15) % segment_count
+        segments = segments[offset : offset + width]
+        yield from segments
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        width = min(self.width or options.max_width, options.max_width)
+        ascii = options.legacy_windows or options.ascii_only
+        should_pulse = self.pulse or self.total is None
+        if should_pulse:
+            yield from self._render_pulse(console, width, ascii=ascii)
+            return
+
+        completed: Optional[float] = (
+            min(self.total, max(0, self.completed)) if self.total is not None else None
+        )
+
+        bar = "-" if ascii else "━"
+        half_bar_right = " " if ascii else "╸"
+        half_bar_left = " " if ascii else "╺"
+        complete_halves = (
+            int(width * 2 * completed / self.total)
+            if self.total and completed is not None
+            else width * 2
+        )
+        bar_count = complete_halves // 2
+        half_bar_count = complete_halves % 2
+        style = console.get_style(self.style)
+        is_finished = self.total is None or self.completed >= self.total
+        complete_style = console.get_style(
+            self.finished_style if is_finished else self.complete_style
+        )
+        _Segment = Segment
+        if bar_count:
+            yield _Segment(bar * bar_count, complete_style)
+        if half_bar_count:
+            yield _Segment(half_bar_right * half_bar_count, complete_style)
+
+        if not console.no_color:
+            remaining_bars = width - bar_count - half_bar_count
+            if remaining_bars and console.color_system is not None:
+                if not half_bar_count and bar_count:
+                    yield _Segment(half_bar_left, style)
+                    remaining_bars -= 1
+                if remaining_bars:
+                    yield _Segment(bar * remaining_bars, style)
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+    bar = ProgressBar(width=50, total=100)
+
+    import time
+
+    console.show_cursor(False)
+    for n in range(0, 101, 1):
+        bar.update(n)
+        console.print(bar)
+        console.file.write("\r")
+        time.sleep(0.05)
+    console.show_cursor(True)
+    console.print()
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/region.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/region.py
new file mode 100644
index 0000000000000000000000000000000000000000..75b3631c3879294549f1f27418859aefb63925a7
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/region.py
@@ -0,0 +1,10 @@
+from typing import NamedTuple
+
+
+class Region(NamedTuple):
+    """Defines a rectangular region of the screen."""
+
+    x: int
+    y: int
+    width: int
+    height: int
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/repr.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/repr.py
new file mode 100644
index 0000000000000000000000000000000000000000..f284bcafa6ab2e1c9ae51be54107836e68cfb0d3
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/repr.py
@@ -0,0 +1,149 @@
+import inspect
+from functools import partial
+from typing import (
+    Any,
+    Callable,
+    Iterable,
+    List,
+    Optional,
+    Tuple,
+    Type,
+    TypeVar,
+    Union,
+    overload,
+)
+
+T = TypeVar("T")
+
+
+Result = Iterable[Union[Any, Tuple[Any], Tuple[str, Any], Tuple[str, Any, Any]]]
+RichReprResult = Result
+
+
+class ReprError(Exception):
+    """An error occurred when attempting to build a repr."""
+
+
+@overload
+def auto(cls: Optional[Type[T]]) -> Type[T]:
+    ...
+
+
+@overload
+def auto(*, angular: bool = False) -> Callable[[Type[T]], Type[T]]:
+    ...
+
+
+def auto(
+    cls: Optional[Type[T]] = None, *, angular: Optional[bool] = None
+) -> Union[Type[T], Callable[[Type[T]], Type[T]]]:
+    """Class decorator to create __repr__ from __rich_repr__"""
+
+    def do_replace(cls: Type[T], angular: Optional[bool] = None) -> Type[T]:
+        def auto_repr(self: T) -> str:
+            """Create repr string from __rich_repr__"""
+            repr_str: List[str] = []
+            append = repr_str.append
+
+            angular: bool = getattr(self.__rich_repr__, "angular", False)  # type: ignore[attr-defined]
+            for arg in self.__rich_repr__():  # type: ignore[attr-defined]
+                if isinstance(arg, tuple):
+                    if len(arg) == 1:
+                        append(repr(arg[0]))
+                    else:
+                        key, value, *default = arg
+                        if key is None:
+                            append(repr(value))
+                        else:
+                            if default and default[0] == value:
+                                continue
+                            append(f"{key}={value!r}")
+                else:
+                    append(repr(arg))
+            if angular:
+                return f"<{self.__class__.__name__} {' '.join(repr_str)}>"
+            else:
+                return f"{self.__class__.__name__}({', '.join(repr_str)})"
+
+        def auto_rich_repr(self: Type[T]) -> Result:
+            """Auto generate __rich_rep__ from signature of __init__"""
+            try:
+                signature = inspect.signature(self.__init__)
+                for name, param in signature.parameters.items():
+                    if param.kind == param.POSITIONAL_ONLY:
+                        yield getattr(self, name)
+                    elif param.kind in (
+                        param.POSITIONAL_OR_KEYWORD,
+                        param.KEYWORD_ONLY,
+                    ):
+                        if param.default == param.empty:
+                            yield getattr(self, param.name)
+                        else:
+                            yield param.name, getattr(self, param.name), param.default
+            except Exception as error:
+                raise ReprError(
+                    f"Failed to auto generate __rich_repr__; {error}"
+                ) from None
+
+        if not hasattr(cls, "__rich_repr__"):
+            auto_rich_repr.__doc__ = "Build a rich repr"
+            cls.__rich_repr__ = auto_rich_repr  # type: ignore[attr-defined]
+
+        auto_repr.__doc__ = "Return repr(self)"
+        cls.__repr__ = auto_repr  # type: ignore[assignment]
+        if angular is not None:
+            cls.__rich_repr__.angular = angular  # type: ignore[attr-defined]
+        return cls
+
+    if cls is None:
+        return partial(do_replace, angular=angular)
+    else:
+        return do_replace(cls, angular=angular)
+
+
+@overload
+def rich_repr(cls: Optional[Type[T]]) -> Type[T]:
+    ...
+
+
+@overload
+def rich_repr(*, angular: bool = False) -> Callable[[Type[T]], Type[T]]:
+    ...
+
+
+def rich_repr(
+    cls: Optional[Type[T]] = None, *, angular: bool = False
+) -> Union[Type[T], Callable[[Type[T]], Type[T]]]:
+    if cls is None:
+        return auto(angular=angular)
+    else:
+        return auto(cls)
+
+
+if __name__ == "__main__":
+
+    @auto
+    class Foo:
+        def __rich_repr__(self) -> Result:
+            yield "foo"
+            yield "bar", {"shopping": ["eggs", "ham", "pineapple"]}
+            yield "buy", "hand sanitizer"
+
+    foo = Foo()
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+
+    console.rule("Standard repr")
+    console.print(foo)
+
+    console.print(foo, width=60)
+    console.print(foo, width=30)
+
+    console.rule("Angular repr")
+    Foo.__rich_repr__.angular = True  # type: ignore[attr-defined]
+
+    console.print(foo)
+
+    console.print(foo, width=60)
+    console.print(foo, width=30)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/scope.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/scope.py
new file mode 100644
index 0000000000000000000000000000000000000000..c9d134cc3cedae929e5bef2b5547f7e33dc10a52
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/scope.py
@@ -0,0 +1,86 @@
+from collections.abc import Mapping
+from typing import TYPE_CHECKING, Any, Optional, Tuple
+
+from .highlighter import ReprHighlighter
+from .panel import Panel
+from .pretty import Pretty
+from .table import Table
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import ConsoleRenderable
+
+
+def render_scope(
+    scope: "Mapping[str, Any]",
+    *,
+    title: Optional[TextType] = None,
+    sort_keys: bool = True,
+    indent_guides: bool = False,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+) -> "ConsoleRenderable":
+    """Render python variables in a given scope.
+
+    Args:
+        scope (Mapping): A mapping containing variable names and values.
+        title (str, optional): Optional title. Defaults to None.
+        sort_keys (bool, optional): Enable sorting of items. Defaults to True.
+        indent_guides (bool, optional): Enable indentation guides. Defaults to False.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None.
+
+    Returns:
+        ConsoleRenderable: A renderable object.
+    """
+    highlighter = ReprHighlighter()
+    items_table = Table.grid(padding=(0, 1), expand=False)
+    items_table.add_column(justify="right")
+
+    def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]:
+        """Sort special variables first, then alphabetically."""
+        key, _ = item
+        return (not key.startswith("__"), key.lower())
+
+    items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items()
+    for key, value in items:
+        key_text = Text.assemble(
+            (key, "scope.key.special" if key.startswith("__") else "scope.key"),
+            (" =", "scope.equals"),
+        )
+        items_table.add_row(
+            key_text,
+            Pretty(
+                value,
+                highlighter=highlighter,
+                indent_guides=indent_guides,
+                max_length=max_length,
+                max_string=max_string,
+            ),
+        )
+    return Panel.fit(
+        items_table,
+        title=title,
+        border_style="scope.border",
+        padding=(0, 1),
+    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+
+    print()
+
+    def test(foo: float, bar: float) -> None:
+        list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"]
+        dict_of_things = {
+            "version": "1.1",
+            "method": "confirmFruitPurchase",
+            "params": [["apple", "orange", "mangoes", "pomelo"], 1.123],
+            "id": "194521489",
+        }
+        print(render_scope(locals(), title="[i]locals", sort_keys=False))
+
+    test(20.3423, 3.1427)
+    print()
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/spinner.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/spinner.py
new file mode 100644
index 0000000000000000000000000000000000000000..91ea630e10f893bf5d6b17fcd9a1fedcecee6f02
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/spinner.py
@@ -0,0 +1,137 @@
+from typing import cast, List, Optional, TYPE_CHECKING, Union
+
+from ._spinners import SPINNERS
+from .measure import Measurement
+from .table import Table
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult, RenderableType
+    from .style import StyleType
+
+
+class Spinner:
+    """A spinner animation.
+
+    Args:
+        name (str): Name of spinner (run python -m rich.spinner).
+        text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "".
+        style (StyleType, optional): Style for spinner animation. Defaults to None.
+        speed (float, optional): Speed factor for animation. Defaults to 1.0.
+
+    Raises:
+        KeyError: If name isn't one of the supported spinner animations.
+    """
+
+    def __init__(
+        self,
+        name: str,
+        text: "RenderableType" = "",
+        *,
+        style: Optional["StyleType"] = None,
+        speed: float = 1.0,
+    ) -> None:
+        try:
+            spinner = SPINNERS[name]
+        except KeyError:
+            raise KeyError(f"no spinner called {name!r}")
+        self.text: "Union[RenderableType, Text]" = (
+            Text.from_markup(text) if isinstance(text, str) else text
+        )
+        self.frames = cast(List[str], spinner["frames"])[:]
+        self.interval = cast(float, spinner["interval"])
+        self.start_time: Optional[float] = None
+        self.style = style
+        self.speed = speed
+        self.frame_no_offset: float = 0.0
+        self._update_speed = 0.0
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        yield self.render(console.get_time())
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        text = self.render(0)
+        return Measurement.get(console, options, text)
+
+    def render(self, time: float) -> "RenderableType":
+        """Render the spinner for a given time.
+
+        Args:
+            time (float): Time in seconds.
+
+        Returns:
+            RenderableType: A renderable containing animation frame.
+        """
+        if self.start_time is None:
+            self.start_time = time
+
+        frame_no = ((time - self.start_time) * self.speed) / (
+            self.interval / 1000.0
+        ) + self.frame_no_offset
+        frame = Text(
+            self.frames[int(frame_no) % len(self.frames)], style=self.style or ""
+        )
+
+        if self._update_speed:
+            self.frame_no_offset = frame_no
+            self.start_time = time
+            self.speed = self._update_speed
+            self._update_speed = 0.0
+
+        if not self.text:
+            return frame
+        elif isinstance(self.text, (str, Text)):
+            return Text.assemble(frame, " ", self.text)
+        else:
+            table = Table.grid(padding=1)
+            table.add_row(frame, self.text)
+            return table
+
+    def update(
+        self,
+        *,
+        text: "RenderableType" = "",
+        style: Optional["StyleType"] = None,
+        speed: Optional[float] = None,
+    ) -> None:
+        """Updates attributes of a spinner after it has been started.
+
+        Args:
+            text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "".
+            style (StyleType, optional): Style for spinner animation. Defaults to None.
+            speed (float, optional): Speed factor for animation. Defaults to None.
+        """
+        if text:
+            self.text = Text.from_markup(text) if isinstance(text, str) else text
+        if style:
+            self.style = style
+        if speed:
+            self._update_speed = speed
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from time import sleep
+
+    from .columns import Columns
+    from .panel import Panel
+    from .live import Live
+
+    all_spinners = Columns(
+        [
+            Spinner(spinner_name, text=Text(repr(spinner_name), style="green"))
+            for spinner_name in sorted(SPINNERS.keys())
+        ],
+        column_first=True,
+        expand=True,
+    )
+
+    with Live(
+        Panel(all_spinners, title="Spinners", border_style="blue"),
+        refresh_per_second=20,
+    ) as live:
+        while True:
+            sleep(0.1)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/status.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/status.py
new file mode 100644
index 0000000000000000000000000000000000000000..09eff405ec194ee2884f203cb48c5df54ff0b9c7
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/status.py
@@ -0,0 +1,132 @@
+from types import TracebackType
+from typing import Optional, Type
+
+from .console import Console, RenderableType
+from .jupyter import JupyterMixin
+from .live import Live
+from .spinner import Spinner
+from .style import StyleType
+
+
+class Status(JupyterMixin):
+    """Displays a status indicator with a 'spinner' animation.
+
+    Args:
+        status (RenderableType): A status renderable (str or Text typically).
+        console (Console, optional): Console instance to use, or None for global console. Defaults to None.
+        spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+        spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+        speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+        refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+    """
+
+    def __init__(
+        self,
+        status: RenderableType,
+        *,
+        console: Optional[Console] = None,
+        spinner: str = "dots",
+        spinner_style: StyleType = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ):
+        self.status = status
+        self.spinner_style = spinner_style
+        self.speed = speed
+        self._spinner = Spinner(spinner, text=status, style=spinner_style, speed=speed)
+        self._live = Live(
+            self.renderable,
+            console=console,
+            refresh_per_second=refresh_per_second,
+            transient=True,
+        )
+
+    @property
+    def renderable(self) -> Spinner:
+        return self._spinner
+
+    @property
+    def console(self) -> "Console":
+        """Get the Console used by the Status objects."""
+        return self._live.console
+
+    def update(
+        self,
+        status: Optional[RenderableType] = None,
+        *,
+        spinner: Optional[str] = None,
+        spinner_style: Optional[StyleType] = None,
+        speed: Optional[float] = None,
+    ) -> None:
+        """Update status.
+
+        Args:
+            status (Optional[RenderableType], optional): New status renderable or None for no change. Defaults to None.
+            spinner (Optional[str], optional): New spinner or None for no change. Defaults to None.
+            spinner_style (Optional[StyleType], optional): New spinner style or None for no change. Defaults to None.
+            speed (Optional[float], optional): Speed factor for spinner animation or None for no change. Defaults to None.
+        """
+        if status is not None:
+            self.status = status
+        if spinner_style is not None:
+            self.spinner_style = spinner_style
+        if speed is not None:
+            self.speed = speed
+        if spinner is not None:
+            self._spinner = Spinner(
+                spinner, text=self.status, style=self.spinner_style, speed=self.speed
+            )
+            self._live.update(self.renderable, refresh=True)
+        else:
+            self._spinner.update(
+                text=self.status, style=self.spinner_style, speed=self.speed
+            )
+
+    def start(self) -> None:
+        """Start the status animation."""
+        self._live.start()
+
+    def stop(self) -> None:
+        """Stop the spinner animation."""
+        self._live.stop()
+
+    def __rich__(self) -> RenderableType:
+        return self.renderable
+
+    def __enter__(self) -> "Status":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from time import sleep
+
+    from .console import Console
+
+    console = Console()
+    with console.status("[magenta]Covid detector booting up") as status:
+        sleep(3)
+        console.log("Importing advanced AI")
+        sleep(3)
+        console.log("Advanced Covid AI Ready")
+        sleep(3)
+        status.update(status="[bold blue] Scanning for Covid", spinner="earth")
+        sleep(3)
+        console.log("Found 10,000,000,000 copies of Covid32.exe")
+        sleep(3)
+        status.update(
+            status="[bold red]Moving Covid32.exe to Trash",
+            spinner="bouncingBall",
+            spinner_style="yellow",
+        )
+        sleep(5)
+    console.print("[bold green]Covid deleted successfully")
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/style.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/style.py
new file mode 100644
index 0000000000000000000000000000000000000000..313c889496d90cef94d5537c122e5c5e898e3bb4
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/style.py
@@ -0,0 +1,796 @@
+import sys
+from functools import lru_cache
+from marshal import dumps, loads
+from random import randint
+from typing import Any, Dict, Iterable, List, Optional, Type, Union, cast
+
+from . import errors
+from .color import Color, ColorParseError, ColorSystem, blend_rgb
+from .repr import Result, rich_repr
+from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme
+
+# Style instances and style definitions are often interchangeable
+StyleType = Union[str, "Style"]
+
+
+class _Bit:
+    """A descriptor to get/set a style attribute bit."""
+
+    __slots__ = ["bit"]
+
+    def __init__(self, bit_no: int) -> None:
+        self.bit = 1 << bit_no
+
+    def __get__(self, obj: "Style", objtype: Type["Style"]) -> Optional[bool]:
+        if obj._set_attributes & self.bit:
+            return obj._attributes & self.bit != 0
+        return None
+
+
+@rich_repr
+class Style:
+    """A terminal style.
+
+    A terminal style consists of a color (`color`), a background color (`bgcolor`), and a number of attributes, such
+    as bold, italic etc. The attributes have 3 states: they can either be on
+    (``True``), off (``False``), or not set (``None``).
+
+    Args:
+        color (Union[Color, str], optional): Color of terminal text. Defaults to None.
+        bgcolor (Union[Color, str], optional): Color of terminal background. Defaults to None.
+        bold (bool, optional): Enable bold text. Defaults to None.
+        dim (bool, optional): Enable dim text. Defaults to None.
+        italic (bool, optional): Enable italic text. Defaults to None.
+        underline (bool, optional): Enable underlined text. Defaults to None.
+        blink (bool, optional): Enabled blinking text. Defaults to None.
+        blink2 (bool, optional): Enable fast blinking text. Defaults to None.
+        reverse (bool, optional): Enabled reverse text. Defaults to None.
+        conceal (bool, optional): Enable concealed text. Defaults to None.
+        strike (bool, optional): Enable strikethrough text. Defaults to None.
+        underline2 (bool, optional): Enable doubly underlined text. Defaults to None.
+        frame (bool, optional): Enable framed text. Defaults to None.
+        encircle (bool, optional): Enable encircled text. Defaults to None.
+        overline (bool, optional): Enable overlined text. Defaults to None.
+        link (str, link): Link URL. Defaults to None.
+
+    """
+
+    _color: Optional[Color]
+    _bgcolor: Optional[Color]
+    _attributes: int
+    _set_attributes: int
+    _hash: Optional[int]
+    _null: bool
+    _meta: Optional[bytes]
+
+    __slots__ = [
+        "_color",
+        "_bgcolor",
+        "_attributes",
+        "_set_attributes",
+        "_link",
+        "_link_id",
+        "_ansi",
+        "_style_definition",
+        "_hash",
+        "_null",
+        "_meta",
+    ]
+
+    # maps bits on to SGR parameter
+    _style_map = {
+        0: "1",
+        1: "2",
+        2: "3",
+        3: "4",
+        4: "5",
+        5: "6",
+        6: "7",
+        7: "8",
+        8: "9",
+        9: "21",
+        10: "51",
+        11: "52",
+        12: "53",
+    }
+
+    STYLE_ATTRIBUTES = {
+        "dim": "dim",
+        "d": "dim",
+        "bold": "bold",
+        "b": "bold",
+        "italic": "italic",
+        "i": "italic",
+        "underline": "underline",
+        "u": "underline",
+        "blink": "blink",
+        "blink2": "blink2",
+        "reverse": "reverse",
+        "r": "reverse",
+        "conceal": "conceal",
+        "c": "conceal",
+        "strike": "strike",
+        "s": "strike",
+        "underline2": "underline2",
+        "uu": "underline2",
+        "frame": "frame",
+        "encircle": "encircle",
+        "overline": "overline",
+        "o": "overline",
+    }
+
+    def __init__(
+        self,
+        *,
+        color: Optional[Union[Color, str]] = None,
+        bgcolor: Optional[Union[Color, str]] = None,
+        bold: Optional[bool] = None,
+        dim: Optional[bool] = None,
+        italic: Optional[bool] = None,
+        underline: Optional[bool] = None,
+        blink: Optional[bool] = None,
+        blink2: Optional[bool] = None,
+        reverse: Optional[bool] = None,
+        conceal: Optional[bool] = None,
+        strike: Optional[bool] = None,
+        underline2: Optional[bool] = None,
+        frame: Optional[bool] = None,
+        encircle: Optional[bool] = None,
+        overline: Optional[bool] = None,
+        link: Optional[str] = None,
+        meta: Optional[Dict[str, Any]] = None,
+    ):
+        self._ansi: Optional[str] = None
+        self._style_definition: Optional[str] = None
+
+        def _make_color(color: Union[Color, str]) -> Color:
+            return color if isinstance(color, Color) else Color.parse(color)
+
+        self._color = None if color is None else _make_color(color)
+        self._bgcolor = None if bgcolor is None else _make_color(bgcolor)
+        self._set_attributes = sum(
+            (
+                bold is not None,
+                dim is not None and 2,
+                italic is not None and 4,
+                underline is not None and 8,
+                blink is not None and 16,
+                blink2 is not None and 32,
+                reverse is not None and 64,
+                conceal is not None and 128,
+                strike is not None and 256,
+                underline2 is not None and 512,
+                frame is not None and 1024,
+                encircle is not None and 2048,
+                overline is not None and 4096,
+            )
+        )
+        self._attributes = (
+            sum(
+                (
+                    bold and 1 or 0,
+                    dim and 2 or 0,
+                    italic and 4 or 0,
+                    underline and 8 or 0,
+                    blink and 16 or 0,
+                    blink2 and 32 or 0,
+                    reverse and 64 or 0,
+                    conceal and 128 or 0,
+                    strike and 256 or 0,
+                    underline2 and 512 or 0,
+                    frame and 1024 or 0,
+                    encircle and 2048 or 0,
+                    overline and 4096 or 0,
+                )
+            )
+            if self._set_attributes
+            else 0
+        )
+
+        self._link = link
+        self._meta = None if meta is None else dumps(meta)
+        self._link_id = (
+            f"{randint(0, 999999)}{hash(self._meta)}" if (link or meta) else ""
+        )
+        self._hash: Optional[int] = None
+        self._null = not (self._set_attributes or color or bgcolor or link or meta)
+
+    @classmethod
+    def null(cls) -> "Style":
+        """Create an 'null' style, equivalent to Style(), but more performant."""
+        return NULL_STYLE
+
+    @classmethod
+    def from_color(
+        cls, color: Optional[Color] = None, bgcolor: Optional[Color] = None
+    ) -> "Style":
+        """Create a new style with colors and no attributes.
+
+        Returns:
+            color (Optional[Color]): A (foreground) color, or None for no color. Defaults to None.
+            bgcolor (Optional[Color]): A (background) color, or None for no color. Defaults to None.
+        """
+        style: Style = cls.__new__(Style)
+        style._ansi = None
+        style._style_definition = None
+        style._color = color
+        style._bgcolor = bgcolor
+        style._set_attributes = 0
+        style._attributes = 0
+        style._link = None
+        style._link_id = ""
+        style._meta = None
+        style._null = not (color or bgcolor)
+        style._hash = None
+        return style
+
+    @classmethod
+    def from_meta(cls, meta: Optional[Dict[str, Any]]) -> "Style":
+        """Create a new style with meta data.
+
+        Returns:
+            meta (Optional[Dict[str, Any]]): A dictionary of meta data. Defaults to None.
+        """
+        style: Style = cls.__new__(Style)
+        style._ansi = None
+        style._style_definition = None
+        style._color = None
+        style._bgcolor = None
+        style._set_attributes = 0
+        style._attributes = 0
+        style._link = None
+        style._meta = dumps(meta)
+        style._link_id = f"{randint(0, 999999)}{hash(style._meta)}"
+        style._hash = None
+        style._null = not (meta)
+        return style
+
+    @classmethod
+    def on(cls, meta: Optional[Dict[str, Any]] = None, **handlers: Any) -> "Style":
+        """Create a blank style with meta information.
+
+        Example:
+            style = Style.on(click=self.on_click)
+
+        Args:
+            meta (Optional[Dict[str, Any]], optional): An optional dict of meta information.
+            **handlers (Any): Keyword arguments are translated in to handlers.
+
+        Returns:
+            Style: A Style with meta information attached.
+        """
+        meta = {} if meta is None else meta
+        meta.update({f"@{key}": value for key, value in handlers.items()})
+        return cls.from_meta(meta)
+
+    bold = _Bit(0)
+    dim = _Bit(1)
+    italic = _Bit(2)
+    underline = _Bit(3)
+    blink = _Bit(4)
+    blink2 = _Bit(5)
+    reverse = _Bit(6)
+    conceal = _Bit(7)
+    strike = _Bit(8)
+    underline2 = _Bit(9)
+    frame = _Bit(10)
+    encircle = _Bit(11)
+    overline = _Bit(12)
+
+    @property
+    def link_id(self) -> str:
+        """Get a link id, used in ansi code for links."""
+        return self._link_id
+
+    def __str__(self) -> str:
+        """Re-generate style definition from attributes."""
+        if self._style_definition is None:
+            attributes: List[str] = []
+            append = attributes.append
+            bits = self._set_attributes
+            if bits & 0b0000000001111:
+                if bits & 1:
+                    append("bold" if self.bold else "not bold")
+                if bits & (1 << 1):
+                    append("dim" if self.dim else "not dim")
+                if bits & (1 << 2):
+                    append("italic" if self.italic else "not italic")
+                if bits & (1 << 3):
+                    append("underline" if self.underline else "not underline")
+            if bits & 0b0000111110000:
+                if bits & (1 << 4):
+                    append("blink" if self.blink else "not blink")
+                if bits & (1 << 5):
+                    append("blink2" if self.blink2 else "not blink2")
+                if bits & (1 << 6):
+                    append("reverse" if self.reverse else "not reverse")
+                if bits & (1 << 7):
+                    append("conceal" if self.conceal else "not conceal")
+                if bits & (1 << 8):
+                    append("strike" if self.strike else "not strike")
+            if bits & 0b1111000000000:
+                if bits & (1 << 9):
+                    append("underline2" if self.underline2 else "not underline2")
+                if bits & (1 << 10):
+                    append("frame" if self.frame else "not frame")
+                if bits & (1 << 11):
+                    append("encircle" if self.encircle else "not encircle")
+                if bits & (1 << 12):
+                    append("overline" if self.overline else "not overline")
+            if self._color is not None:
+                append(self._color.name)
+            if self._bgcolor is not None:
+                append("on")
+                append(self._bgcolor.name)
+            if self._link:
+                append("link")
+                append(self._link)
+            self._style_definition = " ".join(attributes) or "none"
+        return self._style_definition
+
+    def __bool__(self) -> bool:
+        """A Style is false if it has no attributes, colors, or links."""
+        return not self._null
+
+    def _make_ansi_codes(self, color_system: ColorSystem) -> str:
+        """Generate ANSI codes for this style.
+
+        Args:
+            color_system (ColorSystem): Color system.
+
+        Returns:
+            str: String containing codes.
+        """
+
+        if self._ansi is None:
+            sgr: List[str] = []
+            append = sgr.append
+            _style_map = self._style_map
+            attributes = self._attributes & self._set_attributes
+            if attributes:
+                if attributes & 1:
+                    append(_style_map[0])
+                if attributes & 2:
+                    append(_style_map[1])
+                if attributes & 4:
+                    append(_style_map[2])
+                if attributes & 8:
+                    append(_style_map[3])
+                if attributes & 0b0000111110000:
+                    for bit in range(4, 9):
+                        if attributes & (1 << bit):
+                            append(_style_map[bit])
+                if attributes & 0b1111000000000:
+                    for bit in range(9, 13):
+                        if attributes & (1 << bit):
+                            append(_style_map[bit])
+            if self._color is not None:
+                sgr.extend(self._color.downgrade(color_system).get_ansi_codes())
+            if self._bgcolor is not None:
+                sgr.extend(
+                    self._bgcolor.downgrade(color_system).get_ansi_codes(
+                        foreground=False
+                    )
+                )
+            self._ansi = ";".join(sgr)
+        return self._ansi
+
+    @classmethod
+    @lru_cache(maxsize=1024)
+    def normalize(cls, style: str) -> str:
+        """Normalize a style definition so that styles with the same effect have the same string
+        representation.
+
+        Args:
+            style (str): A style definition.
+
+        Returns:
+            str: Normal form of style definition.
+        """
+        try:
+            return str(cls.parse(style))
+        except errors.StyleSyntaxError:
+            return style.strip().lower()
+
+    @classmethod
+    def pick_first(cls, *values: Optional[StyleType]) -> StyleType:
+        """Pick first non-None style."""
+        for value in values:
+            if value is not None:
+                return value
+        raise ValueError("expected at least one non-None style")
+
+    def __rich_repr__(self) -> Result:
+        yield "color", self.color, None
+        yield "bgcolor", self.bgcolor, None
+        yield "bold", self.bold, None,
+        yield "dim", self.dim, None,
+        yield "italic", self.italic, None
+        yield "underline", self.underline, None,
+        yield "blink", self.blink, None
+        yield "blink2", self.blink2, None
+        yield "reverse", self.reverse, None
+        yield "conceal", self.conceal, None
+        yield "strike", self.strike, None
+        yield "underline2", self.underline2, None
+        yield "frame", self.frame, None
+        yield "encircle", self.encircle, None
+        yield "link", self.link, None
+        if self._meta:
+            yield "meta", self.meta
+
+    def __eq__(self, other: Any) -> bool:
+        if not isinstance(other, Style):
+            return NotImplemented
+        return self.__hash__() == other.__hash__()
+
+    def __ne__(self, other: Any) -> bool:
+        if not isinstance(other, Style):
+            return NotImplemented
+        return self.__hash__() != other.__hash__()
+
+    def __hash__(self) -> int:
+        if self._hash is not None:
+            return self._hash
+        self._hash = hash(
+            (
+                self._color,
+                self._bgcolor,
+                self._attributes,
+                self._set_attributes,
+                self._link,
+                self._meta,
+            )
+        )
+        return self._hash
+
+    @property
+    def color(self) -> Optional[Color]:
+        """The foreground color or None if it is not set."""
+        return self._color
+
+    @property
+    def bgcolor(self) -> Optional[Color]:
+        """The background color or None if it is not set."""
+        return self._bgcolor
+
+    @property
+    def link(self) -> Optional[str]:
+        """Link text, if set."""
+        return self._link
+
+    @property
+    def transparent_background(self) -> bool:
+        """Check if the style specified a transparent background."""
+        return self.bgcolor is None or self.bgcolor.is_default
+
+    @property
+    def background_style(self) -> "Style":
+        """A Style with background only."""
+        return Style(bgcolor=self.bgcolor)
+
+    @property
+    def meta(self) -> Dict[str, Any]:
+        """Get meta information (can not be changed after construction)."""
+        return {} if self._meta is None else cast(Dict[str, Any], loads(self._meta))
+
+    @property
+    def without_color(self) -> "Style":
+        """Get a copy of the style with color removed."""
+        if self._null:
+            return NULL_STYLE
+        style: Style = self.__new__(Style)
+        style._ansi = None
+        style._style_definition = None
+        style._color = None
+        style._bgcolor = None
+        style._attributes = self._attributes
+        style._set_attributes = self._set_attributes
+        style._link = self._link
+        style._link_id = f"{randint(0, 999999)}" if self._link else ""
+        style._null = False
+        style._meta = None
+        style._hash = None
+        return style
+
+    @classmethod
+    @lru_cache(maxsize=4096)
+    def parse(cls, style_definition: str) -> "Style":
+        """Parse a style definition.
+
+        Args:
+            style_definition (str): A string containing a style.
+
+        Raises:
+            errors.StyleSyntaxError: If the style definition syntax is invalid.
+
+        Returns:
+            `Style`: A Style instance.
+        """
+        if style_definition.strip() == "none" or not style_definition:
+            return cls.null()
+
+        STYLE_ATTRIBUTES = cls.STYLE_ATTRIBUTES
+        color: Optional[str] = None
+        bgcolor: Optional[str] = None
+        attributes: Dict[str, Optional[Any]] = {}
+        link: Optional[str] = None
+
+        words = iter(style_definition.split())
+        for original_word in words:
+            word = original_word.lower()
+            if word == "on":
+                word = next(words, "")
+                if not word:
+                    raise errors.StyleSyntaxError("color expected after 'on'")
+                try:
+                    Color.parse(word) is None
+                except ColorParseError as error:
+                    raise errors.StyleSyntaxError(
+                        f"unable to parse {word!r} as background color; {error}"
+                    ) from None
+                bgcolor = word
+
+            elif word == "not":
+                word = next(words, "")
+                attribute = STYLE_ATTRIBUTES.get(word)
+                if attribute is None:
+                    raise errors.StyleSyntaxError(
+                        f"expected style attribute after 'not', found {word!r}"
+                    )
+                attributes[attribute] = False
+
+            elif word == "link":
+                word = next(words, "")
+                if not word:
+                    raise errors.StyleSyntaxError("URL expected after 'link'")
+                link = word
+
+            elif word in STYLE_ATTRIBUTES:
+                attributes[STYLE_ATTRIBUTES[word]] = True
+
+            else:
+                try:
+                    Color.parse(word)
+                except ColorParseError as error:
+                    raise errors.StyleSyntaxError(
+                        f"unable to parse {word!r} as color; {error}"
+                    ) from None
+                color = word
+        style = Style(color=color, bgcolor=bgcolor, link=link, **attributes)
+        return style
+
+    @lru_cache(maxsize=1024)
+    def get_html_style(self, theme: Optional[TerminalTheme] = None) -> str:
+        """Get a CSS style rule."""
+        theme = theme or DEFAULT_TERMINAL_THEME
+        css: List[str] = []
+        append = css.append
+
+        color = self.color
+        bgcolor = self.bgcolor
+        if self.reverse:
+            color, bgcolor = bgcolor, color
+        if self.dim:
+            foreground_color = (
+                theme.foreground_color if color is None else color.get_truecolor(theme)
+            )
+            color = Color.from_triplet(
+                blend_rgb(foreground_color, theme.background_color, 0.5)
+            )
+        if color is not None:
+            theme_color = color.get_truecolor(theme)
+            append(f"color: {theme_color.hex}")
+            append(f"text-decoration-color: {theme_color.hex}")
+        if bgcolor is not None:
+            theme_color = bgcolor.get_truecolor(theme, foreground=False)
+            append(f"background-color: {theme_color.hex}")
+        if self.bold:
+            append("font-weight: bold")
+        if self.italic:
+            append("font-style: italic")
+        if self.underline:
+            append("text-decoration: underline")
+        if self.strike:
+            append("text-decoration: line-through")
+        if self.overline:
+            append("text-decoration: overline")
+        return "; ".join(css)
+
+    @classmethod
+    def combine(cls, styles: Iterable["Style"]) -> "Style":
+        """Combine styles and get result.
+
+        Args:
+            styles (Iterable[Style]): Styles to combine.
+
+        Returns:
+            Style: A new style instance.
+        """
+        iter_styles = iter(styles)
+        return sum(iter_styles, next(iter_styles))
+
+    @classmethod
+    def chain(cls, *styles: "Style") -> "Style":
+        """Combine styles from positional argument in to a single style.
+
+        Args:
+            *styles (Iterable[Style]): Styles to combine.
+
+        Returns:
+            Style: A new style instance.
+        """
+        iter_styles = iter(styles)
+        return sum(iter_styles, next(iter_styles))
+
+    def copy(self) -> "Style":
+        """Get a copy of this style.
+
+        Returns:
+            Style: A new Style instance with identical attributes.
+        """
+        if self._null:
+            return NULL_STYLE
+        style: Style = self.__new__(Style)
+        style._ansi = self._ansi
+        style._style_definition = self._style_definition
+        style._color = self._color
+        style._bgcolor = self._bgcolor
+        style._attributes = self._attributes
+        style._set_attributes = self._set_attributes
+        style._link = self._link
+        style._link_id = f"{randint(0, 999999)}" if self._link else ""
+        style._hash = self._hash
+        style._null = False
+        style._meta = self._meta
+        return style
+
+    @lru_cache(maxsize=128)
+    def clear_meta_and_links(self) -> "Style":
+        """Get a copy of this style with link and meta information removed.
+
+        Returns:
+            Style: New style object.
+        """
+        if self._null:
+            return NULL_STYLE
+        style: Style = self.__new__(Style)
+        style._ansi = self._ansi
+        style._style_definition = self._style_definition
+        style._color = self._color
+        style._bgcolor = self._bgcolor
+        style._attributes = self._attributes
+        style._set_attributes = self._set_attributes
+        style._link = None
+        style._link_id = ""
+        style._hash = self._hash
+        style._null = False
+        style._meta = None
+        return style
+
+    def update_link(self, link: Optional[str] = None) -> "Style":
+        """Get a copy with a different value for link.
+
+        Args:
+            link (str, optional): New value for link. Defaults to None.
+
+        Returns:
+            Style: A new Style instance.
+        """
+        style: Style = self.__new__(Style)
+        style._ansi = self._ansi
+        style._style_definition = self._style_definition
+        style._color = self._color
+        style._bgcolor = self._bgcolor
+        style._attributes = self._attributes
+        style._set_attributes = self._set_attributes
+        style._link = link
+        style._link_id = f"{randint(0, 999999)}" if link else ""
+        style._hash = None
+        style._null = False
+        style._meta = self._meta
+        return style
+
+    def render(
+        self,
+        text: str = "",
+        *,
+        color_system: Optional[ColorSystem] = ColorSystem.TRUECOLOR,
+        legacy_windows: bool = False,
+    ) -> str:
+        """Render the ANSI codes for the style.
+
+        Args:
+            text (str, optional): A string to style. Defaults to "".
+            color_system (Optional[ColorSystem], optional): Color system to render to. Defaults to ColorSystem.TRUECOLOR.
+
+        Returns:
+            str: A string containing ANSI style codes.
+        """
+        if not text or color_system is None:
+            return text
+        attrs = self._ansi or self._make_ansi_codes(color_system)
+        rendered = f"\x1b[{attrs}m{text}\x1b[0m" if attrs else text
+        if self._link and not legacy_windows:
+            rendered = (
+                f"\x1b]8;id={self._link_id};{self._link}\x1b\\{rendered}\x1b]8;;\x1b\\"
+            )
+        return rendered
+
+    def test(self, text: Optional[str] = None) -> None:
+        """Write text with style directly to terminal.
+
+        This method is for testing purposes only.
+
+        Args:
+            text (Optional[str], optional): Text to style or None for style name.
+
+        """
+        text = text or str(self)
+        sys.stdout.write(f"{self.render(text)}\n")
+
+    @lru_cache(maxsize=1024)
+    def _add(self, style: Optional["Style"]) -> "Style":
+        if style is None or style._null:
+            return self
+        if self._null:
+            return style
+        new_style: Style = self.__new__(Style)
+        new_style._ansi = None
+        new_style._style_definition = None
+        new_style._color = style._color or self._color
+        new_style._bgcolor = style._bgcolor or self._bgcolor
+        new_style._attributes = (self._attributes & ~style._set_attributes) | (
+            style._attributes & style._set_attributes
+        )
+        new_style._set_attributes = self._set_attributes | style._set_attributes
+        new_style._link = style._link or self._link
+        new_style._link_id = style._link_id or self._link_id
+        new_style._null = style._null
+        if self._meta and style._meta:
+            new_style._meta = dumps({**self.meta, **style.meta})
+        else:
+            new_style._meta = self._meta or style._meta
+        new_style._hash = None
+        return new_style
+
+    def __add__(self, style: Optional["Style"]) -> "Style":
+        combined_style = self._add(style)
+        return combined_style.copy() if combined_style.link else combined_style
+
+
+NULL_STYLE = Style()
+
+
+class StyleStack:
+    """A stack of styles."""
+
+    __slots__ = ["_stack"]
+
+    def __init__(self, default_style: "Style") -> None:
+        self._stack: List[Style] = [default_style]
+
+    def __repr__(self) -> str:
+        return f"<stylestack {self._stack!r}>"
+
+    @property
+    def current(self) -> Style:
+        """Get the Style at the top of the stack."""
+        return self._stack[-1]
+
+    def push(self, style: Style) -> None:
+        """Push a new style on to the stack.
+
+        Args:
+            style (Style): New style to combine with current style.
+        """
+        self._stack.append(self._stack[-1] + style)
+
+    def pop(self) -> Style:
+        """Pop last style and discard.
+
+        Returns:
+            Style: New current style (also available as stack.current)
+        """
+        self._stack.pop()
+        return self._stack[-1]
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/styled.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/styled.py
new file mode 100644
index 0000000000000000000000000000000000000000..91cd0db31c14e30d4c1e2e9f36382b7a5e022870
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/styled.py
@@ -0,0 +1,42 @@
+from typing import TYPE_CHECKING
+
+from .measure import Measurement
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult, RenderableType
+
+
+class Styled:
+    """Apply a style to a renderable.
+
+    Args:
+        renderable (RenderableType): Any renderable.
+        style (StyleType): A style to apply across the entire renderable.
+    """
+
+    def __init__(self, renderable: "RenderableType", style: "StyleType") -> None:
+        self.renderable = renderable
+        self.style = style
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style)
+        rendered_segments = console.render(self.renderable, options)
+        segments = Segment.apply_style(rendered_segments, style)
+        return segments
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        return Measurement.get(console, options, self.renderable)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+    from pip._vendor.rich.panel import Panel
+
+    panel = Styled(Panel("hello"), "on blue")
+    print(panel)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/syntax.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/syntax.py
new file mode 100644
index 0000000000000000000000000000000000000000..570337664835d01904c8ff708626b447edc5640a
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/syntax.py
@@ -0,0 +1,948 @@
+import os.path
+import platform
+import re
+import sys
+import textwrap
+from abc import ABC, abstractmethod
+from pathlib import Path
+from typing import (
+    Any,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Set,
+    Tuple,
+    Type,
+    Union,
+)
+
+from pip._vendor.pygments.lexer import Lexer
+from pip._vendor.pygments.lexers import get_lexer_by_name, guess_lexer_for_filename
+from pip._vendor.pygments.style import Style as PygmentsStyle
+from pip._vendor.pygments.styles import get_style_by_name
+from pip._vendor.pygments.token import (
+    Comment,
+    Error,
+    Generic,
+    Keyword,
+    Name,
+    Number,
+    Operator,
+    String,
+    Token,
+    Whitespace,
+)
+from pip._vendor.pygments.util import ClassNotFound
+
+from pip._vendor.rich.containers import Lines
+from pip._vendor.rich.padding import Padding, PaddingDimensions
+
+from ._loop import loop_first
+from .cells import cell_len
+from .color import Color, blend_rgb
+from .console import Console, ConsoleOptions, JustifyMethod, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment, Segments
+from .style import Style, StyleType
+from .text import Text
+
+TokenType = Tuple[str, ...]
+
+WINDOWS = platform.system() == "Windows"
+DEFAULT_THEME = "monokai"
+
+# The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py
+# A few modifications were made
+
+ANSI_LIGHT: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="white"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="cyan"),
+    Keyword: Style(color="blue"),
+    Keyword.Type: Style(color="cyan"),
+    Operator.Word: Style(color="magenta"),
+    Name.Builtin: Style(color="cyan"),
+    Name.Function: Style(color="green"),
+    Name.Namespace: Style(color="cyan", underline=True),
+    Name.Class: Style(color="green", underline=True),
+    Name.Exception: Style(color="cyan"),
+    Name.Decorator: Style(color="magenta", bold=True),
+    Name.Variable: Style(color="red"),
+    Name.Constant: Style(color="red"),
+    Name.Attribute: Style(color="cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+ANSI_DARK: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="bright_black"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="bright_cyan"),
+    Keyword: Style(color="bright_blue"),
+    Keyword.Type: Style(color="bright_cyan"),
+    Operator.Word: Style(color="bright_magenta"),
+    Name.Builtin: Style(color="bright_cyan"),
+    Name.Function: Style(color="bright_green"),
+    Name.Namespace: Style(color="bright_cyan", underline=True),
+    Name.Class: Style(color="bright_green", underline=True),
+    Name.Exception: Style(color="bright_cyan"),
+    Name.Decorator: Style(color="bright_magenta", bold=True),
+    Name.Variable: Style(color="bright_red"),
+    Name.Constant: Style(color="bright_red"),
+    Name.Attribute: Style(color="bright_cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="bright_blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="bright_green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="bright_magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK}
+NUMBERS_COLUMN_DEFAULT_PADDING = 2
+
+
+class SyntaxTheme(ABC):
+    """Base class for a syntax theme."""
+
+    @abstractmethod
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style for a given Pygments token."""
+        raise NotImplementedError  # pragma: no cover
+
+    @abstractmethod
+    def get_background_style(self) -> Style:
+        """Get the background color."""
+        raise NotImplementedError  # pragma: no cover
+
+
+class PygmentsSyntaxTheme(SyntaxTheme):
+    """Syntax theme that delegates to Pygments theme."""
+
+    def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None:
+        self._style_cache: Dict[TokenType, Style] = {}
+        if isinstance(theme, str):
+            try:
+                self._pygments_style_class = get_style_by_name(theme)
+            except ClassNotFound:
+                self._pygments_style_class = get_style_by_name("default")
+        else:
+            self._pygments_style_class = theme
+
+        self._background_color = self._pygments_style_class.background_color
+        self._background_style = Style(bgcolor=self._background_color)
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style from a Pygments class."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            try:
+                pygments_style = self._pygments_style_class.style_for_token(token_type)
+            except KeyError:
+                style = Style.null()
+            else:
+                color = pygments_style["color"]
+                bgcolor = pygments_style["bgcolor"]
+                style = Style(
+                    color="#" + color if color else "#000000",
+                    bgcolor="#" + bgcolor if bgcolor else self._background_color,
+                    bold=pygments_style["bold"],
+                    italic=pygments_style["italic"],
+                    underline=pygments_style["underline"],
+                )
+            self._style_cache[token_type] = style
+        return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+class ANSISyntaxTheme(SyntaxTheme):
+    """Syntax theme to use standard colors."""
+
+    def __init__(self, style_map: Dict[TokenType, Style]) -> None:
+        self.style_map = style_map
+        self._missing_style = Style.null()
+        self._background_style = Style.null()
+        self._style_cache: Dict[TokenType, Style] = {}
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Look up style in the style map."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            # Styles form a hierarchy
+            # We need to go from most to least specific
+            # e.g. ("foo", "bar", "baz") to ("foo", "bar")  to ("foo",)
+            get_style = self.style_map.get
+            token = tuple(token_type)
+            style = self._missing_style
+            while token:
+                _style = get_style(token)
+                if _style is not None:
+                    style = _style
+                    break
+                token = token[:-1]
+            self._style_cache[token_type] = style
+            return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+SyntaxPosition = Tuple[int, int]
+
+
+class _SyntaxHighlightRange(NamedTuple):
+    """
+    A range to highlight in a Syntax object.
+    `start` and `end` are 2-integers tuples, where the first integer is the line number
+    (starting from 1) and the second integer is the column index (starting from 0).
+    """
+
+    style: StyleType
+    start: SyntaxPosition
+    end: SyntaxPosition
+
+
+class Syntax(JupyterMixin):
+    """Construct a Syntax object to render syntax highlighted code.
+
+    Args:
+        code (str): Code to highlight.
+        lexer (Lexer | str): Lexer to use (see https://pygments.org/docs/lexers/)
+        theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai".
+        dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False.
+        line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+        start_line (int, optional): Starting number for line numbers. Defaults to 1.
+        line_range (Tuple[int | None, int | None], optional): If given should be a tuple of the start and end line to render.
+            A value of None in the tuple indicates the range is open in that direction.
+        highlight_lines (Set[int]): A set of line numbers to highlight.
+        code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+        tab_size (int, optional): Size of tabs. Defaults to 4.
+        word_wrap (bool, optional): Enable word wrapping.
+        background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+        indent_guides (bool, optional): Show indent guides. Defaults to False.
+        padding (PaddingDimensions): Padding to apply around the syntax. Defaults to 0 (no padding).
+    """
+
+    _pygments_style_class: Type[PygmentsStyle]
+    _theme: SyntaxTheme
+
+    @classmethod
+    def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme:
+        """Get a syntax theme instance."""
+        if isinstance(name, SyntaxTheme):
+            return name
+        theme: SyntaxTheme
+        if name in RICH_SYNTAX_THEMES:
+            theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name])
+        else:
+            theme = PygmentsSyntaxTheme(name)
+        return theme
+
+    def __init__(
+        self,
+        code: str,
+        lexer: Union[Lexer, str],
+        *,
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        start_line: int = 1,
+        line_range: Optional[Tuple[Optional[int], Optional[int]]] = None,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+        padding: PaddingDimensions = 0,
+    ) -> None:
+        self.code = code
+        self._lexer = lexer
+        self.dedent = dedent
+        self.line_numbers = line_numbers
+        self.start_line = start_line
+        self.line_range = line_range
+        self.highlight_lines = highlight_lines or set()
+        self.code_width = code_width
+        self.tab_size = tab_size
+        self.word_wrap = word_wrap
+        self.background_color = background_color
+        self.background_style = (
+            Style(bgcolor=background_color) if background_color else Style()
+        )
+        self.indent_guides = indent_guides
+        self.padding = padding
+
+        self._theme = self.get_theme(theme)
+        self._stylized_ranges: List[_SyntaxHighlightRange] = []
+
+    @classmethod
+    def from_path(
+        cls,
+        path: str,
+        encoding: str = "utf-8",
+        lexer: Optional[Union[Lexer, str]] = None,
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        line_range: Optional[Tuple[int, int]] = None,
+        start_line: int = 1,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+        padding: PaddingDimensions = 0,
+    ) -> "Syntax":
+        """Construct a Syntax object from a file.
+
+        Args:
+            path (str): Path to file to highlight.
+            encoding (str): Encoding of file.
+            lexer (str | Lexer, optional): Lexer to use. If None, lexer will be auto-detected from path/file content.
+            theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs".
+            dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True.
+            line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+            start_line (int, optional): Starting number for line numbers. Defaults to 1.
+            line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render.
+            highlight_lines (Set[int]): A set of line numbers to highlight.
+            code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+            tab_size (int, optional): Size of tabs. Defaults to 4.
+            word_wrap (bool, optional): Enable word wrapping of code.
+            background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+            indent_guides (bool, optional): Show indent guides. Defaults to False.
+            padding (PaddingDimensions): Padding to apply around the syntax. Defaults to 0 (no padding).
+
+        Returns:
+            [Syntax]: A Syntax object that may be printed to the console
+        """
+        code = Path(path).read_text(encoding=encoding)
+
+        if not lexer:
+            lexer = cls.guess_lexer(path, code=code)
+
+        return cls(
+            code,
+            lexer,
+            theme=theme,
+            dedent=dedent,
+            line_numbers=line_numbers,
+            line_range=line_range,
+            start_line=start_line,
+            highlight_lines=highlight_lines,
+            code_width=code_width,
+            tab_size=tab_size,
+            word_wrap=word_wrap,
+            background_color=background_color,
+            indent_guides=indent_guides,
+            padding=padding,
+        )
+
+    @classmethod
+    def guess_lexer(cls, path: str, code: Optional[str] = None) -> str:
+        """Guess the alias of the Pygments lexer to use based on a path and an optional string of code.
+        If code is supplied, it will use a combination of the code and the filename to determine the
+        best lexer to use. For example, if the file is ``index.html`` and the file contains Django
+        templating syntax, then "html+django" will be returned. If the file is ``index.html``, and no
+        templating language is used, the "html" lexer will be used. If no string of code
+        is supplied, the lexer will be chosen based on the file extension..
+
+        Args:
+             path (AnyStr): The path to the file containing the code you wish to know the lexer for.
+             code (str, optional): Optional string of code that will be used as a fallback if no lexer
+                is found for the supplied path.
+
+        Returns:
+            str: The name of the Pygments lexer that best matches the supplied path/code.
+        """
+        lexer: Optional[Lexer] = None
+        lexer_name = "default"
+        if code:
+            try:
+                lexer = guess_lexer_for_filename(path, code)
+            except ClassNotFound:
+                pass
+
+        if not lexer:
+            try:
+                _, ext = os.path.splitext(path)
+                if ext:
+                    extension = ext.lstrip(".").lower()
+                    lexer = get_lexer_by_name(extension)
+            except ClassNotFound:
+                pass
+
+        if lexer:
+            if lexer.aliases:
+                lexer_name = lexer.aliases[0]
+            else:
+                lexer_name = lexer.name
+
+        return lexer_name
+
+    def _get_base_style(self) -> Style:
+        """Get the base style."""
+        default_style = self._theme.get_background_style() + self.background_style
+        return default_style
+
+    def _get_token_color(self, token_type: TokenType) -> Optional[Color]:
+        """Get a color (if any) for the given token.
+
+        Args:
+            token_type (TokenType): A token type tuple from Pygments.
+
+        Returns:
+            Optional[Color]: Color from theme, or None for no color.
+        """
+        style = self._theme.get_style_for_token(token_type)
+        return style.color
+
+    @property
+    def lexer(self) -> Optional[Lexer]:
+        """The lexer for this syntax, or None if no lexer was found.
+
+        Tries to find the lexer by name if a string was passed to the constructor.
+        """
+
+        if isinstance(self._lexer, Lexer):
+            return self._lexer
+        try:
+            return get_lexer_by_name(
+                self._lexer,
+                stripnl=False,
+                ensurenl=True,
+                tabsize=self.tab_size,
+            )
+        except ClassNotFound:
+            return None
+
+    def highlight(
+        self,
+        code: str,
+        line_range: Optional[Tuple[Optional[int], Optional[int]]] = None,
+    ) -> Text:
+        """Highlight code and return a Text instance.
+
+        Args:
+            code (str): Code to highlight.
+            line_range(Tuple[int, int], optional): Optional line range to highlight.
+
+        Returns:
+            Text: A text instance containing highlighted syntax.
+        """
+
+        base_style = self._get_base_style()
+        justify: JustifyMethod = (
+            "default" if base_style.transparent_background else "left"
+        )
+
+        text = Text(
+            justify=justify,
+            style=base_style,
+            tab_size=self.tab_size,
+            no_wrap=not self.word_wrap,
+        )
+        _get_theme_style = self._theme.get_style_for_token
+
+        lexer = self.lexer
+
+        if lexer is None:
+            text.append(code)
+        else:
+            if line_range:
+                # More complicated path to only stylize a portion of the code
+                # This speeds up further operations as there are less spans to process
+                line_start, line_end = line_range
+
+                def line_tokenize() -> Iterable[Tuple[Any, str]]:
+                    """Split tokens to one per line."""
+                    assert lexer  # required to make MyPy happy - we know lexer is not None at this point
+
+                    for token_type, token in lexer.get_tokens(code):
+                        while token:
+                            line_token, new_line, token = token.partition("\n")
+                            yield token_type, line_token + new_line
+
+                def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]:
+                    """Convert tokens to spans."""
+                    tokens = iter(line_tokenize())
+                    line_no = 0
+                    _line_start = line_start - 1 if line_start else 0
+
+                    # Skip over tokens until line start
+                    while line_no < _line_start:
+                        try:
+                            _token_type, token = next(tokens)
+                        except StopIteration:
+                            break
+                        yield (token, None)
+                        if token.endswith("\n"):
+                            line_no += 1
+                    # Generate spans until line end
+                    for token_type, token in tokens:
+                        yield (token, _get_theme_style(token_type))
+                        if token.endswith("\n"):
+                            line_no += 1
+                            if line_end and line_no >= line_end:
+                                break
+
+                text.append_tokens(tokens_to_spans())
+
+            else:
+                text.append_tokens(
+                    (token, _get_theme_style(token_type))
+                    for token_type, token in lexer.get_tokens(code)
+                )
+            if self.background_color is not None:
+                text.stylize(f"on {self.background_color}")
+
+        if self._stylized_ranges:
+            self._apply_stylized_ranges(text)
+
+        return text
+
+    def stylize_range(
+        self, style: StyleType, start: SyntaxPosition, end: SyntaxPosition
+    ) -> None:
+        """
+        Adds a custom style on a part of the code, that will be applied to the syntax display when it's rendered.
+        Line numbers are 1-based, while column indexes are 0-based.
+
+        Args:
+            style (StyleType): The style to apply.
+            start (Tuple[int, int]): The start of the range, in the form `[line number, column index]`.
+            end (Tuple[int, int]): The end of the range, in the form `[line number, column index]`.
+        """
+        self._stylized_ranges.append(_SyntaxHighlightRange(style, start, end))
+
+    def _get_line_numbers_color(self, blend: float = 0.3) -> Color:
+        background_style = self._theme.get_background_style() + self.background_style
+        background_color = background_style.bgcolor
+        if background_color is None or background_color.is_system_defined:
+            return Color.default()
+        foreground_color = self._get_token_color(Token.Text)
+        if foreground_color is None or foreground_color.is_system_defined:
+            return foreground_color or Color.default()
+        new_color = blend_rgb(
+            background_color.get_truecolor(),
+            foreground_color.get_truecolor(),
+            cross_fade=blend,
+        )
+        return Color.from_triplet(new_color)
+
+    @property
+    def _numbers_column_width(self) -> int:
+        """Get the number of characters used to render the numbers column."""
+        column_width = 0
+        if self.line_numbers:
+            column_width = (
+                len(str(self.start_line + self.code.count("\n")))
+                + NUMBERS_COLUMN_DEFAULT_PADDING
+            )
+        return column_width
+
+    def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]:
+        """Get background, number, and highlight styles for line numbers."""
+        background_style = self._get_base_style()
+        if background_style.transparent_background:
+            return Style.null(), Style(dim=True), Style.null()
+        if console.color_system in ("256", "truecolor"):
+            number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(color=self._get_line_numbers_color()),
+                self.background_style,
+            )
+            highlight_number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(bold=True, color=self._get_line_numbers_color(0.9)),
+                self.background_style,
+            )
+        else:
+            number_style = background_style + Style(dim=True)
+            highlight_number_style = background_style + Style(dim=False)
+        return background_style, number_style, highlight_number_style
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        _, right, _, left = Padding.unpack(self.padding)
+        padding = left + right
+        if self.code_width is not None:
+            width = self.code_width + self._numbers_column_width + padding + 1
+            return Measurement(self._numbers_column_width, width)
+        lines = self.code.splitlines()
+        width = (
+            self._numbers_column_width
+            + padding
+            + (max(cell_len(line) for line in lines) if lines else 0)
+        )
+        if self.line_numbers:
+            width += 1
+        return Measurement(self._numbers_column_width, width)
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        segments = Segments(self._get_syntax(console, options))
+        if self.padding:
+            yield Padding(
+                segments, style=self._theme.get_background_style(), pad=self.padding
+            )
+        else:
+            yield segments
+
+    def _get_syntax(
+        self,
+        console: Console,
+        options: ConsoleOptions,
+    ) -> Iterable[Segment]:
+        """
+        Get the Segments for the Syntax object, excluding any vertical/horizontal padding
+        """
+        transparent_background = self._get_base_style().transparent_background
+        code_width = (
+            (
+                (options.max_width - self._numbers_column_width - 1)
+                if self.line_numbers
+                else options.max_width
+            )
+            if self.code_width is None
+            else self.code_width
+        )
+
+        ends_on_nl, processed_code = self._process_code(self.code)
+        text = self.highlight(processed_code, self.line_range)
+
+        if not self.line_numbers and not self.word_wrap and not self.line_range:
+            if not ends_on_nl:
+                text.remove_suffix("\n")
+            # Simple case of just rendering text
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            if self.indent_guides and not options.ascii_only:
+                text = text.with_indent_guides(self.tab_size, style=style)
+                text.overflow = "crop"
+            if style.transparent_background:
+                yield from console.render(
+                    text, options=options.update(width=code_width)
+                )
+            else:
+                syntax_lines = console.render_lines(
+                    text,
+                    options.update(width=code_width, height=None, justify="left"),
+                    style=self.background_style,
+                    pad=True,
+                    new_lines=True,
+                )
+                for syntax_line in syntax_lines:
+                    yield from syntax_line
+            return
+
+        start_line, end_line = self.line_range or (None, None)
+        line_offset = 0
+        if start_line:
+            line_offset = max(0, start_line - 1)
+        lines: Union[List[Text], Lines] = text.split("\n", allow_blank=ends_on_nl)
+        if self.line_range:
+            if line_offset > len(lines):
+                return
+            lines = lines[line_offset:end_line]
+
+        if self.indent_guides and not options.ascii_only:
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            lines = (
+                Text("\n")
+                .join(lines)
+                .with_indent_guides(self.tab_size, style=style + Style(italic=False))
+                .split("\n", allow_blank=True)
+            )
+
+        numbers_column_width = self._numbers_column_width
+        render_options = options.update(width=code_width)
+
+        highlight_line = self.highlight_lines.__contains__
+        _Segment = Segment
+        new_line = _Segment("\n")
+
+        line_pointer = "> " if options.legacy_windows else "❱ "
+
+        (
+            background_style,
+            number_style,
+            highlight_number_style,
+        ) = self._get_number_styles(console)
+
+        for line_no, line in enumerate(lines, self.start_line + line_offset):
+            if self.word_wrap:
+                wrapped_lines = console.render_lines(
+                    line,
+                    render_options.update(height=None, justify="left"),
+                    style=background_style,
+                    pad=not transparent_background,
+                )
+            else:
+                segments = list(line.render(console, end=""))
+                if options.no_wrap:
+                    wrapped_lines = [segments]
+                else:
+                    wrapped_lines = [
+                        _Segment.adjust_line_length(
+                            segments,
+                            render_options.max_width,
+                            style=background_style,
+                            pad=not transparent_background,
+                        )
+                    ]
+
+            if self.line_numbers:
+                wrapped_line_left_pad = _Segment(
+                    " " * numbers_column_width + " ", background_style
+                )
+                for first, wrapped_line in loop_first(wrapped_lines):
+                    if first:
+                        line_column = str(line_no).rjust(numbers_column_width - 2) + " "
+                        if highlight_line(line_no):
+                            yield _Segment(line_pointer, Style(color="red"))
+                            yield _Segment(line_column, highlight_number_style)
+                        else:
+                            yield _Segment("  ", highlight_number_style)
+                            yield _Segment(line_column, number_style)
+                    else:
+                        yield wrapped_line_left_pad
+                    yield from wrapped_line
+                    yield new_line
+            else:
+                for wrapped_line in wrapped_lines:
+                    yield from wrapped_line
+                    yield new_line
+
+    def _apply_stylized_ranges(self, text: Text) -> None:
+        """
+        Apply stylized ranges to a text instance,
+        using the given code to determine the right portion to apply the style to.
+
+        Args:
+            text (Text): Text instance to apply the style to.
+        """
+        code = text.plain
+        newlines_offsets = [
+            # Let's add outer boundaries at each side of the list:
+            0,
+            # N.B. using "\n" here is much faster than using metacharacters such as "^" or "\Z":
+            *[
+                match.start() + 1
+                for match in re.finditer("\n", code, flags=re.MULTILINE)
+            ],
+            len(code) + 1,
+        ]
+
+        for stylized_range in self._stylized_ranges:
+            start = _get_code_index_for_syntax_position(
+                newlines_offsets, stylized_range.start
+            )
+            end = _get_code_index_for_syntax_position(
+                newlines_offsets, stylized_range.end
+            )
+            if start is not None and end is not None:
+                text.stylize(stylized_range.style, start, end)
+
+    def _process_code(self, code: str) -> Tuple[bool, str]:
+        """
+        Applies various processing to a raw code string
+        (normalises it so it always ends with a line return, dedents it if necessary, etc.)
+
+        Args:
+            code (str): The raw code string to process
+
+        Returns:
+            Tuple[bool, str]: the boolean indicates whether the raw code ends with a line return,
+                while the string is the processed code.
+        """
+        ends_on_nl = code.endswith("\n")
+        processed_code = code if ends_on_nl else code + "\n"
+        processed_code = (
+            textwrap.dedent(processed_code) if self.dedent else processed_code
+        )
+        processed_code = processed_code.expandtabs(self.tab_size)
+        return ends_on_nl, processed_code
+
+
+def _get_code_index_for_syntax_position(
+    newlines_offsets: Sequence[int], position: SyntaxPosition
+) -> Optional[int]:
+    """
+    Returns the index of the code string for the given positions.
+
+    Args:
+        newlines_offsets (Sequence[int]): The offset of each newline character found in the code snippet.
+        position (SyntaxPosition): The position to search for.
+
+    Returns:
+        Optional[int]: The index of the code string for this position, or `None`
+            if the given position's line number is out of range (if it's the column that is out of range
+            we silently clamp its value so that it reaches the end of the line)
+    """
+    lines_count = len(newlines_offsets)
+
+    line_number, column_index = position
+    if line_number > lines_count or len(newlines_offsets) < (line_number + 1):
+        return None  # `line_number` is out of range
+    line_index = line_number - 1
+    line_length = newlines_offsets[line_index + 1] - newlines_offsets[line_index] - 1
+    # If `column_index` is out of range: let's silently clamp it:
+    column_index = min(line_length, column_index)
+    return newlines_offsets[line_index] + column_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(
+        description="Render syntax to the console with Rich"
+    )
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-c",
+        "--force-color",
+        dest="force_color",
+        action="store_true",
+        default=None,
+        help="force color for non-terminals",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent-guides",
+        dest="indent_guides",
+        action="store_true",
+        default=False,
+        help="display indent guides",
+    )
+    parser.add_argument(
+        "-l",
+        "--line-numbers",
+        dest="line_numbers",
+        action="store_true",
+        help="render line numbers",
+    )
+    parser.add_argument(
+        "-w",
+        "--width",
+        type=int,
+        dest="width",
+        default=None,
+        help="width of output (default will auto-detect)",
+    )
+    parser.add_argument(
+        "-r",
+        "--wrap",
+        dest="word_wrap",
+        action="store_true",
+        default=False,
+        help="word wrap long lines",
+    )
+    parser.add_argument(
+        "-s",
+        "--soft-wrap",
+        action="store_true",
+        dest="soft_wrap",
+        default=False,
+        help="enable soft wrapping mode",
+    )
+    parser.add_argument(
+        "-t", "--theme", dest="theme", default="monokai", help="pygments theme"
+    )
+    parser.add_argument(
+        "-b",
+        "--background-color",
+        dest="background_color",
+        default=None,
+        help="Override background color",
+    )
+    parser.add_argument(
+        "-x",
+        "--lexer",
+        default=None,
+        dest="lexer_name",
+        help="Lexer name",
+    )
+    parser.add_argument(
+        "-p", "--padding", type=int, default=0, dest="padding", help="Padding"
+    )
+    parser.add_argument(
+        "--highlight-line",
+        type=int,
+        default=None,
+        dest="highlight_line",
+        help="The line number (not index!) to highlight",
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console(force_terminal=args.force_color, width=args.width)
+
+    if args.path == "-":
+        code = sys.stdin.read()
+        syntax = Syntax(
+            code=code,
+            lexer=args.lexer_name,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+            padding=args.padding,
+            highlight_lines={args.highlight_line},
+        )
+    else:
+        syntax = Syntax.from_path(
+            args.path,
+            lexer=args.lexer_name,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+            padding=args.padding,
+            highlight_lines={args.highlight_line},
+        )
+    console.print(syntax, soft_wrap=args.soft_wrap)
diff --git a/.venv/lib/python3.11/site-packages/pip/_vendor/rich/text.py b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/text.py
new file mode 100644
index 0000000000000000000000000000000000000000..998cb87dab758332ecc17f8acddbd0378beef160
--- /dev/null
+++ b/.venv/lib/python3.11/site-packages/pip/_vendor/rich/text.py
@@ -0,0 +1,1307 @@
+import re
+from functools import partial, reduce
+from math import gcd
+from operator import itemgetter
+from typing import (
+    TYPE_CHECKING,
+    Any,
+    Callable,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Tuple,
+    Union,
+)
+
+from ._loop import loop_last
+from ._pick import pick_bool
+from ._wrap import divide_line
+from .align import AlignMethod
+from .cells import cell_len, set_cell_size
+from .containers import Lines
+from .control import strip_control_codes
+from .emoji import EmojiVariant
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleType
+
+if TYPE_CHECKING:  # pragma: no cover
+    from .console import Console, ConsoleOptions, JustifyMethod, OverflowMethod
+
+DEFAULT_JUSTIFY: "JustifyMethod" = "default"
+DEFAULT_OVERFLOW: "OverflowMethod" = "fold"
+
+
+_re_whitespace = re.compile(r"\s+$")
+
+TextType = Union[str, "Text"]
+
+GetStyleCallable = Callable[[str], Optional[StyleType]]
+
+
+class Span(NamedTuple):
+    """A marked up region in some text."""
+
+    start: int
+    """Span start index."""
+    end: int
+    """Span end index."""
+    style: Union[str, Style]
+    """Style associated with the span."""
+
+    def __repr__(self) -> str:
+        return f"Span({self.start}, {self.end}, {self.style!r})"
+
+    def __bool__(self) -> bool:
+        return self.end > self.start
+
+    def split(self, offset: int) -> Tuple["Span", Optional["Span"]]:
+        """Split a span in to 2 from a given offset."""
+
+        if offset < self.start:
+            return self, None
+        if offset >= self.end:
+            return self, None
+
+        start, end, style = self
+        span1 = Span(start, min(end, offset), style)
+        span2 = Span(span1.end, end, style)
+        return span1, span2
+
+    def move(self, offset: int) -> "Span":
+        """Move start and end by a given offset.
+
+        Args:
+            offset (int): Number of characters to add to start and end.
+
+        Returns:
+            TextSpan: A new TextSpan with adjusted position.
+        """
+        start, end, style = self
+        return Span(start + offset, end + offset, style)
+
+    def right_crop(self, offset: int) -> "Span":
+        """Crop the span at the given offset.
+
+        Args:
+            offset (int): A value between start and end.
+
+        Returns:
+            Span: A new (possibly smaller) span.
+        """
+        start, end, style = self
+        if offset >= end:
+            return self
+        return Span(start, min(offset, end), style)
+
+
+class Text(JupyterMixin):
+    """Text with color / style.
+
+    Args:
+        text (str, optional): Default unstyled text. Defaults to "".
+        style (Union[str, Style], optional): Base style for text. Defaults to "".
+        justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None.
+        overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None.
+        no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None.
+        end (str, optional): Character to end text with. Defaults to "\\\\n".
+        tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8.
+        spans (List[Span], optional). A list of predefined style spans. Defaults to None.
+    """
+
+    __slots__ = [
+        "_text",
+        "style",
+        "justify",
+        "overflow",
+        "no_wrap",
+        "end",
+        "tab_size",
+        "_spans",
+        "_length",
+    ]
+
+    def __init__(
+        self,
+        text: str = "",
+        style: Union[str, Style] = "",
+        *,
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        no_wrap: Optional[bool] = None,
+        end: str = "\n",
+        tab_size: Optional[int] = 8,
+        spans: Optional[List[Span]] = None,
+    ) -> None:
+        sanitized_text = strip_control_codes(text)
+        self._text = [sanitized_text]
+        self.style = style
+        self.justify: Optional["JustifyMethod"] = justify
+        self.overflow: Optional["OverflowMethod"] = overflow
+        self.no_wrap = no_wrap
+        self.end = end
+        self.tab_size = tab_size
+        self._spans: List[Span] = spans or []
+        self._length: int = len(sanitized_text)
+
+    def __len__(self) -> int:
+        return self._length
+
+    def __bool__(self) -> bool:
+        return bool(self._length)
+
+    def __str__(self) -> str:
+        return self.plain
+
+    def __repr__(self) -> str:
+        return f"<text {self.plain!r} {self._spans!r}>"
+
+    def __add__(self, other: Any) -> "Text":
+        if isinstance(other, (str, Text)):
+            result = self.copy()
+            result.append(other)
+            return result
+        return NotImplemented
+
+    def __eq__(self, other: object) -> bool:
+        if not isinstance(other, Text):
+            return NotImplemented
+        return self.plain == other.plain and self._spans == other._spans
+
+    def __contains__(self, other: object) -> bool:
+        if isinstance(other, str):
+            return other in self.plain
+        elif isinstance(other, Text):
+            return other.plain in self.plain
+        return False
+
+    def __getitem__(self, slice: Union[int, slice]) -> "Text":
+        def get_text_at(offset: int) -> "Text":
+            _Span = Span
+            text = Text(
+                self.plain[offset],
+                spans=[
+                    _Span(0, 1, style)
+                    for start, end, style in self._spans
+                    if end > offset >= start
+                ],
+                end="",
+            )
+            return text
+
+        if isinstance(slice, int):
+            return get_text_at(slice)
+        else:
+            start, stop, step = slice.indices(len(self.plain))
+            if step == 1:
+                lines = self.divide([start, stop])
+                return lines[1]
+            else:
+                # This would be a bit of work to implement efficiently
+                # For now, its not required
+                raise TypeError("slices with step!=1 are not supported")
+
+    @property
+    def cell_len(self) -> int:
+        """Get the number of cells required to render this text."""
+        return cell_len(self.plain)
+
+    @property
+    def markup(self) -> str:
+        """Get console markup to render this Text.
+
+        Returns:
+            str: A string potentially creating markup tags.
+        """
+        from .markup import escape
+
+        output: List[str] = []
+
+        plain = self.plain
+        markup_spans = [
+            (0, False, self.style),
+            *((span.start, False, span.style) for span in self._spans),
+            *((span.end, True, span.style) for span in self._spans),
+            (len(plain), True, self.style),
+        ]
+        markup_spans.sort(key=itemgetter(0, 1))
+        position = 0
+        append = output.append
+        for offset, closing, style in markup_spans:
+            if offset > position:
+                append(escape(plain[position:offset]))
+                position = offset
+            if style:
+                append(f"[/{style}]" if closing else f"[{style}]")
+        markup = "".join(output)
+        return markup
+
+    @classmethod
+    def from_markup(
+        cls,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        emoji: bool = True,
+        emoji_variant: Optional[EmojiVariant] = None,
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        end: str = "\n",
+    ) -> "Text":
+        """Create Text instance from markup.
+
+        Args:
+            text (str): A string containing console markup.
+            emoji (bool, optional): Also render emoji code. Defaults to True.
+            justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None.
+            overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None.
+            end (str, optional): Character to end text with. Defaults to "\\\\n".
+
+        Returns:
+            Text: A Text instance with markup rendered.
+        """
+        from .markup import render
+
+        rendered_text = render(text, style, emoji=emoji, emoji_variant=emoji_variant)
+        rendered_text.justify = justify
+        rendered_text.overflow = overflow
+        rendered_text.end = end
+        return rendered_text
+
+    @classmethod
+    def from_ansi(
+        cls,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        no_wrap: Optional[bool] = None,
+        end: str = "\n",
+        tab_size: Optional[int] = 8,
+    ) -> "Text":
+        """Create a Text object from a string containing ANSI escape codes.
+
+        Args:
+            text (str): A string containing escape codes.
+            style (Union[str, Style], optional): Base style for text. Defaults to "".
+            justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None.
+            overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None.
+            no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None.
+            end (str, optional): Character to end text with. Defaults to "\\\\n".
+            tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8.
+        """
+        from .ansi import AnsiDecoder
+
+        joiner = Text(
+            "\n",
+            justify=justify,
+            overflow=overflow,
+            no_wrap=no_wrap,
+            end=end,
+            tab_size=tab_size,
+            style=style,
+        )
+        decoder = AnsiDecoder()
+        result = joiner.join(line for line in decoder.decode(text))
+        return result
+
+    @classmethod
+    def styled(
+        cls,
+        text: str,
+        style: StyleType = "",
+        *,
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+    ) -> "Text":
+        """Construct a Text instance with a pre-applied styled. A style applied in this way won't be used
+        to pad the text when it is justified.
+
+        Args:
+            text (str): A string containing console markup.
+            style (Union[str, Style]): Style to apply to the text. Defaults to "".
+            justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None.
+            overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None.
+
+        Returns:
+            Text: A text instance with a style applied to the entire string.
+        """
+        styled_text = cls(text, justify=justify, overflow=overflow)
+        styled_text.stylize(style)
+        return styled_text
+
+    @classmethod
+    def assemble(
+        cls,
+        *parts: Union[str, "Text", Tuple[str, StyleType]],
+        style: Union[str, Style] = "",
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        no_wrap: Optional[bool] = None,
+        end: str = "\n",
+        tab_size: int = 8,
+        meta: Optional[Dict[str, Any]] = None,
+    ) -> "Text":
+        """Construct a text instance by combining a sequence of strings with optional styles.
+        The positional arguments should be either strings, or a tuple of string + style.
+
+        Args:
+            style (Union[str, Style], optional): Base style for text. Defaults to "".
+            justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None.
+            overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None.
+            end (str, optional): Character to end text with. Defaults to "\\\\n".
+            tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8.
+            meta (Dict[str, Any], optional). Meta data to apply to text, or None for no meta data. Default to None
+
+        Returns:
+            Text: A new text instance.
+        """
+        text = cls(
+            style=style,
+            justify=justify,
+            overflow=overflow,
+            no_wrap=no_wrap,
+            end=end,
+            tab_size=tab_size,
+        )
+        append = text.append
+        _Text = Text
+        for part in parts:
+            if isinstance(part, (_Text, str)):
+                append(part)
+            else:
+                append(*part)
+        if meta:
+            text.apply_meta(meta)
+        return text
+
+    @property
+    def plain(self) -> str:
+        """Get the text as a single string."""
+        if len(self._text) != 1:
+            self._text[:] = ["".join(self._text)]
+        return self._text[0]
+
+    @plain.setter
+    def plain(self, new_text: str) -> None:
+        """Set the text to a new value."""
+        if new_text != self.plain:
+            sanitized_text = strip_control_codes(new_text)
+            self._text[:] = [sanitized_text]
+            old_length = self._length
+            self._length = len(sanitized_text)
+            if old_length > self._length:
+                self._trim_spans()
+
+    @property
+    def spans(self) -> List[Span]:
+        """Get a reference to the internal list of spans."""
+        return self._spans
+
+    @spans.setter
+    def spans(self, spans: List[Span]) -> None:
+        """Set spans."""
+        self._spans = spans[:]
+
+    def blank_copy(self, plain: str = "") -> "Text":
+        """Return a new Text instance with copied meta data (but not the string or spans)."""
+        copy_self = Text(
+            plain,
+            style=self.style,
+            justify=self.justify,
+            overflow=self.overflow,
+            no_wrap=self.no_wrap,
+            end=self.end,
+            tab_size=self.tab_size,
+        )
+        return copy_self
+
+    def copy(self) -> "Text":
+        """Return a copy of this instance."""
+        copy_self = Text(
+            self.plain,
+            style=self.style,
+            justify=self.justify,
+            overflow=self.overflow,
+            no_wrap=self.no_wrap,
+            end=self.end,
+            tab_size=self.tab_size,
+        )
+        copy_self._spans[:] = self._spans
+        return copy_self
+
+    def stylize(
+        self,
+        style: Union[str, Style],
+        start: int = 0,
+        end: Optional[int] = None,
+    ) -> None:
+        """Apply a style to the text, or a portion of the text.
+
+        Args:
+            style (Union[str, Style]): Style instance or style definition to apply.
+            start (int): Start offset (negative indexing is supported). Defaults to 0.
+            end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None.
+        """
+        if style:
+            length = len(self)
+            if start < 0:
+                start = length + start
+            if end is None:
+                end = length
+            if end < 0:
+                end = length + end
+            if start >= length or end <= start:
+                # Span not in text or not valid
+                return
+            self._spans.append(Span(start, min(length, end), style))
+
+    def stylize_before(
+        self,
+        style: Union[str, Style],
+        start: int = 0,
+        end: Optional[int] = None,
+    ) -> None:
+        """Apply a style to the text, or a portion of the text. Styles will be applied before other styles already present.
+
+        Args:
+            style (Union[str, Style]): Style instance or style definition to apply.
+            start (int): Start offset (negative indexing is supported). Defaults to 0.
+            end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None.
+        """
+        if style:
+            length = len(self)
+            if start < 0:
+                start = length + start
+            if end is None:
+                end = length
+            if end < 0:
+                end = length + end
+            if start >= length or end <= start:
+                # Span not in text or not valid
+                return
+            self._spans.insert(0, Span(start, min(length, end), style))
+
+    def apply_meta(
+        self, meta: Dict[str, Any], start: int = 0, end: Optional[int] = None
+    ) -> None:
+        """Apply meta data to the text, or a portion of the text.
+
+        Args:
+            meta (Dict[str, Any]): A dict of meta information.
+            start (int): Start offset (negative indexing is supported). Defaults to 0.
+            end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None.
+
+        """
+        style = Style.from_meta(meta)
+        self.stylize(style, start=start, end=end)
+
+    def on(self, meta: Optional[Dict[str, Any]] = None, **handlers: Any) -> "Text":
+        """Apply event handlers (used by Textual project).
+
+        Example:
+            >>> from rich.text import Text
+            >>> text = Text("hello world")
+            >>> text.on(click="view.toggle('world')")
+
+        Args:
+            meta (Dict[str, Any]): Mapping of meta information.
+            **handlers: Keyword args are prefixed with "@" to defined handlers.
+
+        Returns:
+            Text: Self is returned to method may be chained.
+        """
+        meta = {} if meta is None else meta
+        meta.update({f"@{key}": value for key, value in handlers.items()})
+        self.stylize(Style.from_meta(meta))
+        return self
+
+    def remove_suffix(self, suffix: str) -> None:
+        """Remove a suffix if it exists.
+
+        Args:
+            suffix (str): Suffix to remove.
+        """
+        if self.plain.endswith(suffix):
+            self.right_crop(len(suffix))
+
+    def get_style_at_offset(self, console: "Console", offset: int) -> Style:
+        """Get the style of a character at give offset.
+
+        Args:
+            console (~Console): Console where text will be rendered.
+            offset (int): Offset in to text (negative indexing supported)
+
+        Returns:
+            Style: A Style instance.
+        """
+        # TODO: This is a little inefficient, it is only used by full justify
+        if offset < 0:
+            offset = len(self) + offset
+        get_style = console.get_style
+        style = get_style(self.style).copy()
+        for start, end, span_style in self._spans:
+            if end > offset >= start:
+                style += get_style(span_style, default="")
+        return style
+
+    def highlight_regex(
+        self,
+        re_highlight: str,
+        style: Optional[Union[GetStyleCallable, StyleType]] = None,
+        *,
+        style_prefix: str = "",
+    ) -> int:
+        """Highlight text with a regular expression, where group names are
+        translated to styles.
+
+        Args:
+            re_highlight (str): A regular expression.
+            style (Union[GetStyleCallable, StyleType]): Optional style to apply to whole match, or a callable
+                which accepts the matched text and returns a style. Defaults to None.
+            style_prefix (str, optional): Optional prefix to add to style group names.
+
+        Returns:
+            int: Number of regex matches
+        """
+        count = 0
+        append_span = self._spans.append
+        _Span = Span
+        plain = self.plain
+        for match in re.finditer(re_highlight, plain):
+            get_span = match.span
+            if style:
+                start, end = get_span()
+                match_style = style(plain[start:end]) if callable(style) else style
+                if match_style is not None and end > start:
+                    append_span(_Span(start, end, match_style))
+
+            count += 1
+            for name in match.groupdict().keys():
+                start, end = get_span(name)
+                if start != -1 and end > start:
+                    append_span(_Span(start, end, f"{style_prefix}{name}"))
+        return count
+
+    def highlight_words(
+        self,
+        words: Iterable[str],
+        style: Union[str, Style],
+        *,
+        case_sensitive: bool = True,
+    ) -> int:
+        """Highlight words with a style.
+
+        Args:
+            words (Iterable[str]): Worlds to highlight.
+            style (Union[str, Style]): Style to apply.
+            case_sensitive (bool, optional): Enable case sensitive matchings. Defaults to True.
+
+        Returns:
+            int: Number of words highlighted.
+        """
+        re_words = "|".join(re.escape(word) for word in words)
+        add_span = self._spans.append
+        count = 0
+        _Span = Span
+        for match in re.finditer(
+            re_words, self.plain, flags=0 if case_sensitive else re.IGNORECASE
+        ):
+            start, end = match.span(0)
+            add_span(_Span(start, end, style))
+            count += 1
+        return count
+
+    def rstrip(self) -> None:
+        """Strip whitespace from end of text."""
+        self.plain = self.plain.rstrip()
+
+    def rstrip_end(self, size: int) -> None:
+        """Remove whitespace beyond a certain width at the end of the text.
+
+        Args:
+            size (int): The desired size of the text.
+        """
+        text_length = len(self)
+        if text_length > size:
+            excess = text_length - size
+            whitespace_match = _re_whitespace.search(self.plain)
+            if whitespace_match is not None:
+                whitespace_count = len(whitespace_match.group(0))
+                self.right_crop(min(whitespace_count, excess))
+
+    def set_length(self, new_length: int) -> None:
+        """Set new length of the text, clipping or padding is required."""
+        length = len(self)
+        if length != new_length:
+            if length < new_length:
+                self.pad_right(new_length - length)
+            else:
+                self.right_crop(length - new_length)
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Iterable[Segment]:
+        tab_size: int = console.tab_size or self.tab_size or 8
+        justify = self.justify or options.justify or DEFAULT_JUSTIFY
+
+        overflow = self.overflow or options.overflow or DEFAULT_OVERFLOW
+
+        lines = self.wrap(
+            console,
+            options.max_width,
+            justify=justify,
+            overflow=overflow,
+            tab_size=tab_size or 8,
+            no_wrap=pick_bool(self.no_wrap, options.no_wrap, False),
+        )
+        all_lines = Text("\n").join(lines)
+        yield from all_lines.render(console, end=self.end)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        text = self.plain
+        lines = text.splitlines()
+        max_text_width = max(cell_len(line) for line in lines) if lines else 0
+        words = text.split()
+        min_text_width = (
+            max(cell_len(word) for word in words) if words else max_text_width
+        )
+        return Measurement(min_text_width, max_text_width)
+
+    def render(self, console: "Console", end: str = "") -> Iterable["Segment"]:
+        """Render the text as Segments.
+
+        Args:
+            console (Console): Console instance.
+            end (Optional[str], optional): Optional end character.
+
+        Returns:
+            Iterable[Segment]: Result of render that may be written to the console.
+        """
+        _Segment = Segment
+        text = self.plain
+        if not self._spans:
+            yield Segment(text)
+            if end:
+                yield _Segment(end)
+            return
+        get_style = partial(console.get_style, default=Style.null())
+
+        enumerated_spans = list(enumerate(self._spans, 1))
+        style_map = {index: get_style(span.style) for index, span in enumerated_spans}
+        style_map[0] = get_style(self.style)
+
+        spans = [
+            (0, False, 0),
+            *((span.start, False, index) for index, span in enumerated_spans),
+            *((span.end, True, index) for index, span in enumerated_spans),
+            (len(text), True, 0),
+        ]
+        spans.sort(key=itemgetter(0, 1))
+
+        stack: List[int] = []
+        stack_append = stack.append
+        stack_pop = stack.remove
+
+        style_cache: Dict[Tuple[Style, ...], Style] = {}
+        style_cache_get = style_cache.get
+        combine = Style.combine
+
+        def get_current_style() -> Style:
+            """Construct current style from stack."""
+            styles = tuple(style_map[_style_id] for _style_id in sorted(stack))
+            cached_style = style_cache_get(styles)
+            if cached_style is not None:
+                return cached_style
+            current_style = combine(styles)
+            style_cache[styles] = current_style
+            return current_style
+
+        for (offset, leaving, style_id), (next_offset, _, _) in zip(spans, spans[1:]):
+            if leaving:
+                stack_pop(style_id)
+            else:
+                stack_append(style_id)
+            if next_offset > offset:
+                yield _Segment(text[offset:next_offset], get_current_style())
+        if end:
+            yield _Segment(end)
+
+    def join(self, lines: Iterable["Text"]) -> "Text":
+        """Join text together with this instance as the separator.
+
+        Args:
+            lines (Iterable[Text]): An iterable of Text instances to join.
+
+        Returns:
+            Text: A new text instance containing join text.
+        """
+
+        new_text = self.blank_copy()
+
+        def iter_text() -> Iterable["Text"]:
+            if self.plain:
+                for last, line in loop_last(lines):
+                    yield line
+                    if not last:
+                        yield self
+            else:
+                yield from lines
+
+        extend_text = new_text._text.extend
+        append_span = new_text._spans.append
+        extend_spans = new_text._spans.extend
+        offset = 0
+        _Span = Span
+
+        for text in iter_text():
+            extend_text(text._text)
+            if text.style:
+                append_span(_Span(offset, offset + len(text), text.style))
+            extend_spans(
+                _Span(offset + start, offset + end, style)
+                for start, end, style in text._spans
+            )
+            offset += len(text)
+        new_text._length = offset
+        return new_text
+
+    def expand_tabs(self, tab_size: Optional[int] = None) -> None:
+        """Converts tabs to spaces.
+
+        Args:
+            tab_size (int, optional): Size of tabs. Defaults to 8.
+
+        """
+        if "\t" not in self.plain:
+            return
+        pos = 0
+        if tab_size is None:
+            tab_size = self.tab_size
+        assert tab_size is not None
+        result = self.blank_copy()
+        append = result.append
+
+        _style = self.style
+        for line in self.split("\n", include_separator=True):
+            parts = line.split("\t", include_separator=True)
+            for part in parts:
+                if part.plain.endswith("\t"):
+                    part._text = [part.plain[:-1] + " "]
+                    append(part)
+                    pos += len(part)
+                    spaces = tab_size - ((pos - 1) % tab_size) - 1
+                    if spaces:
+                        append(" " * spaces, _style)
+                        pos += spaces
+                else:
+                    append(part)
+        self._text = [result.plain]
+        self._length = len(self.plain)
+        self._spans[:] = result._spans
+
+    def truncate(
+        self,
+        max_width: int,
+        *,
+        overflow: Optional["OverflowMethod"] = None,
+        pad: bool = False,
+    ) -> None:
+        """Truncate text if it is longer that a given width.
+
+        Args:
+            max_width (int): Maximum number of characters in text.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None, to use self.overflow.
+            pad (bool, optional): Pad with spaces if the length is less than max_width. Defaults to False.
+        """
+        _overflow = overflow or self.overflow or DEFAULT_OVERFLOW
+        if _overflow != "ignore":
+            length = cell_len(self.plain)
+            if length > max_width:
+                if _overflow == "ellipsis":
+                    self.plain = set_cell_size(self.plain, max_width - 1) + "…"
+                else:
+                    self.plain = set_cell_size(self.plain, max_width)
+            if pad and length < max_width:
+                spaces = max_width - length
+                self._text = [f"{self.plain}{' ' * spaces}"]
+                self._length = len(self.plain)
+
+    def _trim_spans(self) -> None:
+        """Remove or modify any spans that are over the end of the text."""
+        max_offset = len(self.plain)
+        _Span = Span
+        self._spans[:] = [
+            (
+                span
+                if span.end < max_offset
+                else _Span(span.start, min(max_offset, span.end), span.style)
+            )
+            for span in self._spans
+            if span.start < max_offset
+        ]
+
+    def pad(self, count: int, character: str = " ") -> None:
+        """Pad left and right with a given number of characters.
+
+        Args:
+            count (int): Width of padding.
+        """
+        assert len(character) == 1, "Character must be a string of length 1"
+        if count:
+            pad_characters = character * count
+            self.plain = f"{pad_characters}{self.plain}{pad_characters}"
+            _Span = Span
+            self._spans[:] = [
+                _Span(start + count, end + count, style)
+                for start, end, style in self._spans
+            ]
+
+    def pad_left(self, count: int, character: str = " ") -> None:
+        """Pad the left with a given character.
+
+        Args:
+            count (int): Number of characters to pad.
+            character (str, optional): Character to pad with. Defaults to " ".
+        """
+        assert len(character) == 1, "Character must be a string of length 1"
+        if count:
+            self.plain = f"{character * count}{self.plain}"
+            _Span = Span
+            self._spans[:] = [
+                _Span(start + count, end + count, style)
+                for start, end, style in self._spans
+            ]
+
+    def pad_right(self, count: int, character: str = " ") -> None:
+        """Pad the right with a given character.
+
+        Args:
+            count (int): Number of characters to pad.
+            character (str, optional): Character to pad with. Defaults to " ".
+        """
+        assert len(character) == 1, "Character must be a string of length 1"
+        if count:
+            self.plain = f"{self.plain}{character * count}"
+
+    def align(self, align: AlignMethod, width: int, character: str = " ") -> None:
+        """Align text to a given width.
+
+        Args:
+            align (AlignMethod): One of "left", "center", or "right".
+            width (int): Desired width.
+            character (str, optional): Character to pad with. Defaults to " ".
+        """
+        self.truncate(width)
+        excess_space = width - cell_len(self.plain)
+        if excess_space:
+            if align == "left":
+                self.pad_right(excess_space, character)
+            elif align == "center":
+                left = excess_space // 2
+                self.pad_left(left, character)
+                self.pad_right(excess_space - left, character)
+            else:
+                self.pad_left(excess_space, character)
+
+    def append(
+        self, text: Union["Text", str], style: Optional[Union[str, "Style"]] = None
+    ) -> "Text":
+        """Add text with an optional style.
+
+        Args:
+            text (Union[Text, str]): A str or Text to append.
+            style (str, optional): A style name. Defaults to None.
+
+        Returns:
+            Text: Returns self for chaining.
+        """
+
+        if not isinstance(text, (str, Text)):
+            raise TypeError("Only str or Text can be appended to Text")
+
+        if len(text):
+            if isinstance(text, str):
+                sanitized_text = strip_control_codes(text)
+                self._text.append(sanitized_text)
+                offset = len(self)
+                text_length = len(sanitized_text)
+                if style is not None:
+                    self._spans.append(Span(offset, offset + text_length, style))
+                self._length += text_length
+            elif isinstance(text, Text):
+                _Span = Span
+                if style is not None:
+                    raise ValueError(
+                        "style must not be set when appending Text instance"
+                    )
+                text_length = self._length
+                if text.style is not None:
+                    self._spans.append(
+                        _Span(text_length, text_length + len(text), text.style)
+                    )
+                self._text.append(text.plain)
+                self._spans.extend(
+                    _Span(start + text_length, end + text_length, style)
+                    for start, end, style in text._spans
+                )
+                self._length += len(text)
+        return self
+
+    def append_text(self, text: "Text") -> "Text":
+        """Append another Text instance. This method is more performant that Text.append, but
+        only works for Text.
+
+        Returns:
+            Text: Returns self for chaining.
+        """
+        _Span = Span
+        text_length = self._length
+        if text.style is not None:
+            self._spans.append(_Span(text_length, text_length + len(text), text.style))
+        self._text.append(text.plain)
+        self._spans.extend(
+            _Span(start + text_length, end + text_length, style)
+            for start, end, style in text._spans
+        )
+        self._length += len(text)
+        return self
+
+    def append_tokens(
+        self, tokens: Iterable[Tuple[str, Optional[StyleType]]]
+    ) -> "Text":
+        """Append iterable of str and style. Style may be a Style instance or a str style definition.
+
+        Args:
+            pairs (Iterable[Tuple[str, Optional[StyleType]]]): An iterable of tuples containing str content and style.
+
+        Returns:
+            Text: Returns self for chaining.
+        """
+        append_text = self._text.append
+        append_span = self._spans.append
+        _Span = Span
+        offset = len(self)
+        for content, style in tokens:
+            append_text(content)
+            if style is not None:
+                append_span(_Span(offset, offset + len(content), style))
+            offset += len(content)
+        self._length = offset
+        return self
+
+    def copy_styles(self, text: "Text") -> None:
+        """Copy styles from another Text instance.
+
+        Args:
+            text (Text): A Text instance to copy styles from, must be the same length.
+        """
+        self._spans.extend(text._spans)
+
+    def split(
+        self,
+        separator: str = "\n",
+        *,
+        include_separator: bool = False,
+        allow_blank: bool = False,
+    ) -> Lines:
+        """Split rich text in to lines, preserving styles.
+
+        Args:
+            separator (str, optional): String to split on. Defaults to "\\\\n".
+            include_separator (bool, optional): Include the separator in the lines. Defaults to False.
+            allow_blank (bool, optional): Return a blank line if the text ends with a separator. Defaults to False.
+
+        Returns:
+            List[RichText]: A list of rich text, one per line of the original.
+        """
+        assert separator, "separator must not be empty"
+
+        text = self.plain
+        if separator not in text:
+            return Lines([self.copy()])
+
+        if include_separator:
+            lines = self.divide(
+                match.end() for match in re.finditer(re.escape(separator), text)
+            )
+        else:
+
+            def flatten_spans() -> Iterable[int]:
+                for match in re.finditer(re.escape(separator), text):
+                    start, end = match.span()
+                    yield start
+                    yield end
+
+            lines = Lines(
+                line for line in self.divide(flatten_spans()) if line.plain != separator
+            )
+
+        if not allow_blank and text.endswith(separator):
+            lines.pop()
+
+        return lines
+
+    def divide(self, offsets: Iterable[int]) -> Lines:
+        """Divide text in to a number of lines at given offsets.
+
+        Args:
+            offsets (Iterable[int]): Offsets used to divide text.
+
+        Returns:
+            Lines: New RichText instances between offsets.
+        """
+        _offsets = list(offsets)
+
+        if not _offsets:
+            return Lines([self.copy()])
+
+        text = self.plain
+        text_length = len(text)
+        divide_offsets = [0, *_offsets, text_length]
+        line_ranges = list(zip(divide_offsets, divide_offsets[1:]))
+
+        style = self.style
+        justify = self.justify
+        overflow = self.overflow
+        _Text = Text
+        new_lines = Lines(
+            _Text(
+                text[start:end],
+                style=style,
+                justify=justify,
+                overflow=overflow,
+            )
+            for start, end in line_ranges
+        )
+        if not self._spans:
+            return new_lines
+
+        _line_appends = [line._spans.append for line in new_lines._lines]
+        line_count = len(line_ranges)
+        _Span = Span
+
+        for span_start, span_end, style in self._spans:
+
+            lower_bound = 0
+            upper_bound = line_count
+            start_line_no = (lower_bound + upper_bound) // 2
+
+            while True:
+                line_start, line_end = line_ranges[start_line_no]
+                if span_start < line_start:
+                    upper_bound = start_line_no - 1
+                elif span_start > line_end:
+                    lower_bound = start_line_no + 1
+                else:
+                    break
+                start_line_no = (lower_bound + upper_bound) // 2
+
+            if span_end < line_end:
+                end_line_no = start_line_no
+            else:
+                end_line_no = lower_bound = start_line_no
+                upper_bound = line_count
+
+                while True:
+                    line_start, line_end = line_ranges[end_line_no]
+                    if span_end < line_start:
+                        upper_bound = end_line_no - 1
+                    elif span_end > line_end:
+                        lower_bound = end_line_no + 1
+                    else:
+                        break
+                    end_line_no = (lower_bound + upper_bound) // 2
+
+            for line_no in range(start_line_no, end_line_no + 1):
+                line_start, line_end = line_ranges[line_no]
+                new_start = max(0, span_start - line_start)
+                new_end = min(span_end - line_start, line_end - line_start)
+                if new_end > new_start:
+                    _line_appends[line_no](_Span(new_start, new_end, style))
+
+        return new_lines
+
+    def right_crop(self, amount: int = 1) -> None:
+        """Remove a number of characters from the end of the text."""
+        max_offset = len(self.plain) - amount
+        _Span = Span
+        self._spans[:] = [
+            (
+                span
+                if span.end < max_offset
+                else _Span(span.start, min(max_offset, span.end), span.style)
+            )
+            for span in self._spans
+            if span.start < max_offset
+        ]
+        self._text = [self.plain[:-amount]]
+        self._length -= amount
+
+    def wrap(
+        self,
+        console: "Console",
+        width: int,
+        *,
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        tab_size: int = 8,
+        no_wrap: Optional[bool] = None,
+    ) -> Lines:
+        """Word wrap the text.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Number of characters per line.
+            emoji (bool, optional): Also render emoji code. Defaults to True.
+            justify (str, optional): Justify method: "default", "left", "center", "full", "right". Defaults to "default".
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None.
+            tab_size (int, optional): Default tab size. Defaults to 8.
+            no_wrap (bool, optional): Disable wrapping, Defaults to False.
+
+        Returns:
+            Lines: Number of lines.
+        """
+        wrap_justify = justify or self.justify or DEFAULT_JUSTIFY
+        wrap_overflow = overflow or self.overflow or DEFAULT_OVERFLOW
+
+        no_wrap = pick_bool(no_wrap, self.no_wrap, False) or overflow == "ignore"
+
+        lines = Lines()
+        for line in self.split(allow_blank=True):
+            if "\t" in line:
+                line.expand_tabs(tab_size)
+            if no_wrap:
+                new_lines = Lines([line])
+            else:
+                offsets = divide_line(str(line), width, fold=wrap_overflow == "fold")
+                new_lines = line.divide(offsets)
+            for line in new_lines:
+                line.rstrip_end(width)
+            if wrap_justify:
+                new_lines.justify(
+                    console, width, justify=wrap_justify, overflow=wrap_overflow
+                )
+            for line in new_lines:
+                line.truncate(width, overflow=wrap_overflow)
+            lines.extend(new_lines)
+        return lines
+
+    def fit(self, width: int) -> Lines:
+        """Fit the text in to given width by chopping in to lines.
+
+        Args:
+            width (int): Maximum characters in a line.
+
+        Returns:
+            Lines: Lines container.
+        """
+        lines: Lines = Lines()
+        append = lines.append
+        for line in self.split():
+            line.set_length(width)
+            append(line)
+        return lines
+
+    def detect_indentation(self) -> int:
+        """Auto-detect indentation of code.
+
+        Returns:
+            int: Number of spaces used to indent code.
+        """
+
+        _indentations = {
+            len(match.group(1))
+            for match in re.finditer(r"^( *)(.*)$", self.plain, flags=re.MULTILINE)
+        }
+
+        try:
+            indentation = (
+                reduce(gcd, [indent for indent in _indentations if not indent % 2]) or 1
+            )
+        except TypeError:
+            indentation = 1
+
+        return indentation
+
+    def with_indent_guides(
+        self,
+        indent_size: Optional[int] = None,
+        *,
+        character: str = "│",
+        style: StyleType = "dim green",
+    ) -> "Text":
+        """Adds indent guide lines to text.
+
+        Args:
+            indent_size (Optional[int]): Size of indentation, or None to auto detect. Defaults to None.
+            character (str, optional): Character to use for indentation. Defaults to "│".
+            style (Union[Style, str], optional): Style of indent guides.
+
+        Returns:
+            Text: New text with indentation guides.
+        """
+
+        _indent_size = self.detect_indentation() if indent_size is None else indent_size
+
+        text = self.copy()
+        text.expand_tabs()
+        indent_line = f"{character}{' ' * (_indent_size - 1)}"
+
+        re_indent = re.compile(r"^( *)(.*)$")
+        new_lines: List[Text] = []
+        add_line = new_lines.append
+        blank_lines = 0
+        for line in text.split(allow_blank=True):
+            match = re_indent.match(line.plain)
+            if not match or not match.group(2):
+                blank_lines += 1
+                continue
+            indent = match.group(1)
+            full_indents, remaining_space = divmod(len(indent), _indent_size)
+            new_indent = f"{indent_line * full_indents}{' ' * remaining_space}"
+            line.plain = new_indent + line.plain[len(new_indent) :]
+            line.stylize(style, 0, len(new_indent))
+            if blank_lines:
+                new_lines.extend([Text(new_indent, style=style)] * blank_lines)
+                blank_lines = 0
+            add_line(line)
+        if blank_lines:
+            new_lines.extend([Text("", style=style)] * blank_lines)
+
+        new_text = text.blank_copy("\n").join(new_lines)
+        return new_text
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+
+    text = Text(
+        """\nLorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.\n"""
+    )
+    text.highlight_words(["Lorem"], "bold")
+    text.highlight_words(["ipsum"], "italic")
+
+    console = Console()
+
+    console.rule("justify='left'")
+    console.print(text, style="red")
+    console.print()
+
+    console.rule("justify='center'")
+    console.print(text, style="green", justify="center")
+    console.print()
+
+    console.rule("justify='right'")
+    console.print(text, style="blue", justify="right")
+    console.print()
+
+    console.rule("justify='full'")
+    console.print(text, style="magenta", justify="full")
+    console.print()