Upload folder using huggingface_hub
Browse files- .idea/workspace.xml +62 -0
- Example.ipynb +291 -0
- README.md +48 -0
- checkpoint-4120000/config.json +75 -0
- checkpoint-4120000/generation_config.json +13 -0
- checkpoint-4120000/global_step4120000/mp_rank_00_model_states.pt +3 -0
- checkpoint-4120000/global_step4120000/zero_pp_rank_0_mp_rank_00_optim_states.pt +3 -0
- checkpoint-4120000/global_step4120000/zero_pp_rank_1_mp_rank_00_optim_states.pt +3 -0
- checkpoint-4120000/latest +1 -0
- checkpoint-4120000/model.safetensors +3 -0
- checkpoint-4120000/rng_state_0.pth +3 -0
- checkpoint-4120000/rng_state_1.pth +3 -0
- checkpoint-4120000/trainer_state.json +0 -0
- checkpoint-4120000/training_args.bin +3 -0
- checkpoint-4120000/zero_to_fp32.py +587 -0
- data/vocab_morgan.txt +2670 -0
- model/__init__.py +0 -0
- model/tokenizer.py +325 -0
- model/trainer.py +57 -0
- model/utils.py +181 -0
- train.py +109 -0
.idea/workspace.xml
ADDED
|
@@ -0,0 +1,62 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
+
<project version="4">
|
| 3 |
+
<component name="AutoImportSettings">
|
| 4 |
+
<option name="autoReloadType" value="SELECTIVE" />
|
| 5 |
+
</component>
|
| 6 |
+
<component name="ChangeListManager">
|
| 7 |
+
<list default="true" id="c90ca726-b813-4875-9ed7-40059a328db6" name="Changes" comment="">
|
| 8 |
+
<change beforePath="$PROJECT_DIR$/README.md" beforeDir="false" afterPath="$PROJECT_DIR$/README.md" afterDir="false" />
|
| 9 |
+
</list>
|
| 10 |
+
<option name="SHOW_DIALOG" value="false" />
|
| 11 |
+
<option name="HIGHLIGHT_CONFLICTS" value="true" />
|
| 12 |
+
<option name="HIGHLIGHT_NON_ACTIVE_CHANGELIST" value="false" />
|
| 13 |
+
<option name="LAST_RESOLUTION" value="IGNORE" />
|
| 14 |
+
</component>
|
| 15 |
+
<component name="FileTemplateManagerImpl">
|
| 16 |
+
<option name="RECENT_TEMPLATES">
|
| 17 |
+
<list>
|
| 18 |
+
<option value="Python Script" />
|
| 19 |
+
</list>
|
| 20 |
+
</option>
|
| 21 |
+
</component>
|
| 22 |
+
<component name="Git.Settings">
|
| 23 |
+
<option name="RECENT_GIT_ROOT_PATH" value="$PROJECT_DIR$" />
|
| 24 |
+
</component>
|
| 25 |
+
<component name="MarkdownSettingsMigration">
|
| 26 |
+
<option name="stateVersion" value="1" />
|
| 27 |
+
</component>
|
| 28 |
+
<component name="ProjectId" id="2x4dTrhzelm4q7ZmUKxXU7syYIs" />
|
| 29 |
+
<component name="ProjectLevelVcsManager" settingsEditedManually="true" />
|
| 30 |
+
<component name="ProjectViewState">
|
| 31 |
+
<option name="hideEmptyMiddlePackages" value="true" />
|
| 32 |
+
<option name="showLibraryContents" value="true" />
|
| 33 |
+
</component>
|
| 34 |
+
<component name="PropertiesComponent">{
|
| 35 |
+
"keyToString": {
|
| 36 |
+
"RunOnceActivity.OpenProjectViewOnStart": "true",
|
| 37 |
+
"RunOnceActivity.ShowReadmeOnStart": "true",
|
| 38 |
+
"settings.editor.selected.configurable": "reference.idesettings.debugger.python"
|
| 39 |
+
}
|
| 40 |
+
}</component>
|
| 41 |
+
<component name="SpellCheckerSettings" RuntimeDictionaries="0" Folders="0" CustomDictionaries="0" DefaultDictionary="application-level" UseSingleDictionary="true" transferred="true" />
|
| 42 |
+
<component name="TaskManager">
|
| 43 |
+
<task active="true" id="Default" summary="Default task">
|
| 44 |
+
<changelist id="c90ca726-b813-4875-9ed7-40059a328db6" name="Changes" comment="" />
|
| 45 |
+
<created>1747201290280</created>
|
| 46 |
+
<option name="number" value="Default" />
|
| 47 |
+
<option name="presentableId" value="Default" />
|
| 48 |
+
<updated>1747201290280</updated>
|
| 49 |
+
</task>
|
| 50 |
+
<servers />
|
| 51 |
+
</component>
|
| 52 |
+
<component name="XDebuggerManager">
|
| 53 |
+
<breakpoint-manager>
|
| 54 |
+
<breakpoints>
|
| 55 |
+
<line-breakpoint enabled="true" suspend="THREAD" type="python-line">
|
| 56 |
+
<url>file://$PROJECT_DIR$/model/utils.py</url>
|
| 57 |
+
<option name="timeStamp" value="1" />
|
| 58 |
+
</line-breakpoint>
|
| 59 |
+
</breakpoints>
|
| 60 |
+
</breakpoint-manager>
|
| 61 |
+
</component>
|
| 62 |
+
</project>
|
Example.ipynb
ADDED
|
@@ -0,0 +1,291 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"cells": [
|
| 3 |
+
{
|
| 4 |
+
"cell_type": "code",
|
| 5 |
+
"execution_count": 1,
|
| 6 |
+
"id": "274b013f-9f96-4973-875f-f3910e2789c4",
|
| 7 |
+
"metadata": {},
|
| 8 |
+
"outputs": [],
|
| 9 |
+
"source": [
|
| 10 |
+
"from transformers import AutoModelForSeq2SeqLM\n",
|
| 11 |
+
"from model.utils import MorganFingerprint, morgan_fingerprint_to_text, clean_output, smiles_to_3d\n",
|
| 12 |
+
"from model.tokenizer import SmilesTokenizer"
|
| 13 |
+
]
|
| 14 |
+
},
|
| 15 |
+
{
|
| 16 |
+
"cell_type": "code",
|
| 17 |
+
"execution_count": 2,
|
| 18 |
+
"id": "b8c70b09-8c7d-439b-bd42-4cfbb41715ca",
|
| 19 |
+
"metadata": {},
|
| 20 |
+
"outputs": [],
|
| 21 |
+
"source": [
|
| 22 |
+
"checkpoint_path=\"checkpoint-4120000\"\n",
|
| 23 |
+
"model = AutoModelForSeq2SeqLM.from_pretrained(checkpoint_path)\n",
|
| 24 |
+
"tokenizer = SmilesTokenizer(vocab_file=\"data/vocab_morgan.txt\")"
|
| 25 |
+
]
|
| 26 |
+
},
|
| 27 |
+
{
|
| 28 |
+
"cell_type": "code",
|
| 29 |
+
"execution_count": 3,
|
| 30 |
+
"id": "9c49a040-13fd-4a63-aef1-6112a42f3eed",
|
| 31 |
+
"metadata": {},
|
| 32 |
+
"outputs": [
|
| 33 |
+
{
|
| 34 |
+
"name": "stderr",
|
| 35 |
+
"output_type": "stream",
|
| 36 |
+
"text": [
|
| 37 |
+
"[07:30:31] DEPRECATION WARNING: please use MorganGenerator\n"
|
| 38 |
+
]
|
| 39 |
+
}
|
| 40 |
+
],
|
| 41 |
+
"source": [
|
| 42 |
+
"smiles=\"CC(=O)OC1=CC=CC=C1C(=O)O\"\n",
|
| 43 |
+
"m = MorganFingerprint()\n",
|
| 44 |
+
"mf = m.smiles_to_morgan(smiles)"
|
| 45 |
+
]
|
| 46 |
+
},
|
| 47 |
+
{
|
| 48 |
+
"cell_type": "code",
|
| 49 |
+
"execution_count": 4,
|
| 50 |
+
"id": "a7be100a-8cdd-48cf-a6cb-5444d793e9c2",
|
| 51 |
+
"metadata": {},
|
| 52 |
+
"outputs": [
|
| 53 |
+
{
|
| 54 |
+
"name": "stdout",
|
| 55 |
+
"output_type": "stream",
|
| 56 |
+
"text": [
|
| 57 |
+
"[389][456][650][695][807][909][1017][1035][1047][1057][1088][1199][1380][1410][1447][1468][1616][1729][1750][1775][1873][1917][1970][1991]\n"
|
| 58 |
+
]
|
| 59 |
+
}
|
| 60 |
+
],
|
| 61 |
+
"source": [
|
| 62 |
+
"s = morgan_fingerprint_to_text(mf)\n",
|
| 63 |
+
"print(s)"
|
| 64 |
+
]
|
| 65 |
+
},
|
| 66 |
+
{
|
| 67 |
+
"cell_type": "code",
|
| 68 |
+
"execution_count": 5,
|
| 69 |
+
"id": "6740dcbc-86a4-4b32-a439-91312dd4a9fc",
|
| 70 |
+
"metadata": {},
|
| 71 |
+
"outputs": [],
|
| 72 |
+
"source": [
|
| 73 |
+
"input_ids = tokenizer.encode(s, return_tensors=\"pt\")\n",
|
| 74 |
+
"# Generate output sequence\n",
|
| 75 |
+
"output_ids = model.generate(input_ids, max_length=64, num_beams=5)"
|
| 76 |
+
]
|
| 77 |
+
},
|
| 78 |
+
{
|
| 79 |
+
"cell_type": "code",
|
| 80 |
+
"execution_count": 6,
|
| 81 |
+
"id": "f423bbe8-5717-4757-84f1-ab6dd5531ea7",
|
| 82 |
+
"metadata": {},
|
| 83 |
+
"outputs": [],
|
| 84 |
+
"source": [
|
| 85 |
+
"clean_output_ids = clean_output(output_ids[0])\n",
|
| 86 |
+
"# Decode the generated output\n",
|
| 87 |
+
"output_text = tokenizer.decode(clean_output_ids)\n",
|
| 88 |
+
"output_text = output_text.replace(\" \", \"\")"
|
| 89 |
+
]
|
| 90 |
+
},
|
| 91 |
+
{
|
| 92 |
+
"cell_type": "code",
|
| 93 |
+
"execution_count": 7,
|
| 94 |
+
"id": "e2678826-caa9-4cb2-bc4d-0ab5e54f76d0",
|
| 95 |
+
"metadata": {},
|
| 96 |
+
"outputs": [
|
| 97 |
+
{
|
| 98 |
+
"name": "stdout",
|
| 99 |
+
"output_type": "stream",
|
| 100 |
+
"text": [
|
| 101 |
+
"CC(=O)Oc1ccc(OC(O)=C(C)O)cc1OC1CC1\n"
|
| 102 |
+
]
|
| 103 |
+
}
|
| 104 |
+
],
|
| 105 |
+
"source": [
|
| 106 |
+
"print(output_text)"
|
| 107 |
+
]
|
| 108 |
+
},
|
| 109 |
+
{
|
| 110 |
+
"cell_type": "code",
|
| 111 |
+
"execution_count": 13,
|
| 112 |
+
"id": "c4dcff84-4552-48ca-8b2c-8f2d4911ec8a",
|
| 113 |
+
"metadata": {},
|
| 114 |
+
"outputs": [
|
| 115 |
+
{
|
| 116 |
+
"data": {
|
| 117 |
+
"application/3dmoljs_load.v0": "<div id=\"3dmolviewer_17472043464774249\" style=\"position: relative; width: 400px; height: 300px;\">\n <p id=\"3dmolwarning_17472043464774249\" style=\"background-color:#ffcccc;color:black\">3Dmol.js failed to load for some reason. Please check your browser console for error messages.<br></p>\n </div>\n<script>\n\nvar loadScriptAsync = function(uri){\n return new Promise((resolve, reject) => {\n //this is to ignore the existence of requirejs amd\n var savedexports, savedmodule;\n if (typeof exports !== 'undefined') savedexports = exports;\n else exports = {}\n if (typeof module !== 'undefined') savedmodule = module;\n else module = {}\n\n var tag = document.createElement('script');\n tag.src = uri;\n tag.async = true;\n tag.onload = () => {\n exports = savedexports;\n module = savedmodule;\n resolve();\n };\n var firstScriptTag = document.getElementsByTagName('script')[0];\n firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\n});\n};\n\nif(typeof $3Dmolpromise === 'undefined') {\n$3Dmolpromise = null;\n $3Dmolpromise = loadScriptAsync('https://cdnjs.cloudflare.com/ajax/libs/3Dmol/2.2.0/3Dmol-min.js');\n}\n\nvar viewer_17472043464774249 = null;\nvar warn = document.getElementById(\"3dmolwarning_17472043464774249\");\nif(warn) {\n warn.parentNode.removeChild(warn);\n}\n$3Dmolpromise.then(function() {\nviewer_17472043464774249 = $3Dmol.createViewer(document.getElementById(\"3dmolviewer_17472043464774249\"),{backgroundColor:\"white\"});\nviewer_17472043464774249.zoomTo();\n\tviewer_17472043464774249.addModel(\"HETATM 1 C1 UNL 1 -2.945 -2.264 -0.022 1.00 0.00 C \\nHETATM 2 C2 UNL 1 -2.075 -1.145 -0.483 1.00 0.00 C \\nHETATM 3 O1 UNL 1 -2.368 -0.527 -1.543 1.00 0.00 O \\nHETATM 4 O2 UNL 1 -0.889 -0.871 0.209 1.00 0.00 O \\nHETATM 5 C3 UNL 1 -0.099 0.280 0.046 1.00 0.00 C \\nHETATM 6 C4 UNL 1 -0.687 1.518 -0.278 1.00 0.00 C \\nHETATM 7 C5 UNL 1 0.099 2.661 -0.426 1.00 0.00 C \\nHETATM 8 C6 UNL 1 1.478 2.588 -0.241 1.00 0.00 C \\nHETATM 9 C7 UNL 1 2.075 1.374 0.100 1.00 0.00 C \\nHETATM 10 C8 UNL 1 1.301 0.208 0.254 1.00 0.00 C \\nHETATM 11 C9 UNL 1 1.979 -1.063 0.620 1.00 0.00 C \\nHETATM 12 O3 UNL 1 1.327 -2.135 0.744 1.00 0.00 O \\nHETATM 13 O4 UNL 1 3.356 -1.085 0.829 1.00 0.00 O \\nHETATM 14 H1 UNL 1 -4.010 -2.038 -0.245 1.00 0.00 H \\nHETATM 15 H2 UNL 1 -2.831 -2.404 1.073 1.00 0.00 H \\nHETATM 16 H3 UNL 1 -2.652 -3.199 -0.542 1.00 0.00 H \\nHETATM 17 H4 UNL 1 -1.759 1.611 -0.389 1.00 0.00 H \\nHETATM 18 H5 UNL 1 -0.364 3.607 -0.675 1.00 0.00 H \\nHETATM 19 H6 UNL 1 2.085 3.477 -0.355 1.00 0.00 H \\nHETATM 20 H7 UNL 1 3.148 1.351 0.244 1.00 0.00 H \\nHETATM 21 H8 UNL 1 3.831 -1.944 1.078 1.00 0.00 H \\nCONECT 1 2 14 15 16\\nCONECT 2 3 3 4\\nCONECT 4 5\\nCONECT 5 6 6 10\\nCONECT 6 7 17\\nCONECT 7 8 8 18\\nCONECT 8 9 19\\nCONECT 9 10 10 20\\nCONECT 10 11\\nCONECT 11 12 12 13\\nCONECT 13 21\\nEND\\n\",\"pdb\");\n\tviewer_17472043464774249.setStyle({\"stick\": {}});\n\tviewer_17472043464774249.zoomTo();\nviewer_17472043464774249.render();\n});\n</script>",
|
| 118 |
+
"text/html": [
|
| 119 |
+
"<div id=\"3dmolviewer_17472043464774249\" style=\"position: relative; width: 400px; height: 300px;\">\n",
|
| 120 |
+
" <p id=\"3dmolwarning_17472043464774249\" style=\"background-color:#ffcccc;color:black\">3Dmol.js failed to load for some reason. Please check your browser console for error messages.<br></p>\n",
|
| 121 |
+
" </div>\n",
|
| 122 |
+
"<script>\n",
|
| 123 |
+
"\n",
|
| 124 |
+
"var loadScriptAsync = function(uri){\n",
|
| 125 |
+
" return new Promise((resolve, reject) => {\n",
|
| 126 |
+
" //this is to ignore the existence of requirejs amd\n",
|
| 127 |
+
" var savedexports, savedmodule;\n",
|
| 128 |
+
" if (typeof exports !== 'undefined') savedexports = exports;\n",
|
| 129 |
+
" else exports = {}\n",
|
| 130 |
+
" if (typeof module !== 'undefined') savedmodule = module;\n",
|
| 131 |
+
" else module = {}\n",
|
| 132 |
+
"\n",
|
| 133 |
+
" var tag = document.createElement('script');\n",
|
| 134 |
+
" tag.src = uri;\n",
|
| 135 |
+
" tag.async = true;\n",
|
| 136 |
+
" tag.onload = () => {\n",
|
| 137 |
+
" exports = savedexports;\n",
|
| 138 |
+
" module = savedmodule;\n",
|
| 139 |
+
" resolve();\n",
|
| 140 |
+
" };\n",
|
| 141 |
+
" var firstScriptTag = document.getElementsByTagName('script')[0];\n",
|
| 142 |
+
" firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\n",
|
| 143 |
+
"});\n",
|
| 144 |
+
"};\n",
|
| 145 |
+
"\n",
|
| 146 |
+
"if(typeof $3Dmolpromise === 'undefined') {\n",
|
| 147 |
+
"$3Dmolpromise = null;\n",
|
| 148 |
+
" $3Dmolpromise = loadScriptAsync('https://cdnjs.cloudflare.com/ajax/libs/3Dmol/2.2.0/3Dmol-min.js');\n",
|
| 149 |
+
"}\n",
|
| 150 |
+
"\n",
|
| 151 |
+
"var viewer_17472043464774249 = null;\n",
|
| 152 |
+
"var warn = document.getElementById(\"3dmolwarning_17472043464774249\");\n",
|
| 153 |
+
"if(warn) {\n",
|
| 154 |
+
" warn.parentNode.removeChild(warn);\n",
|
| 155 |
+
"}\n",
|
| 156 |
+
"$3Dmolpromise.then(function() {\n",
|
| 157 |
+
"viewer_17472043464774249 = $3Dmol.createViewer(document.getElementById(\"3dmolviewer_17472043464774249\"),{backgroundColor:\"white\"});\n",
|
| 158 |
+
"viewer_17472043464774249.zoomTo();\n",
|
| 159 |
+
"\tviewer_17472043464774249.addModel(\"HETATM 1 C1 UNL 1 -2.945 -2.264 -0.022 1.00 0.00 C \\nHETATM 2 C2 UNL 1 -2.075 -1.145 -0.483 1.00 0.00 C \\nHETATM 3 O1 UNL 1 -2.368 -0.527 -1.543 1.00 0.00 O \\nHETATM 4 O2 UNL 1 -0.889 -0.871 0.209 1.00 0.00 O \\nHETATM 5 C3 UNL 1 -0.099 0.280 0.046 1.00 0.00 C \\nHETATM 6 C4 UNL 1 -0.687 1.518 -0.278 1.00 0.00 C \\nHETATM 7 C5 UNL 1 0.099 2.661 -0.426 1.00 0.00 C \\nHETATM 8 C6 UNL 1 1.478 2.588 -0.241 1.00 0.00 C \\nHETATM 9 C7 UNL 1 2.075 1.374 0.100 1.00 0.00 C \\nHETATM 10 C8 UNL 1 1.301 0.208 0.254 1.00 0.00 C \\nHETATM 11 C9 UNL 1 1.979 -1.063 0.620 1.00 0.00 C \\nHETATM 12 O3 UNL 1 1.327 -2.135 0.744 1.00 0.00 O \\nHETATM 13 O4 UNL 1 3.356 -1.085 0.829 1.00 0.00 O \\nHETATM 14 H1 UNL 1 -4.010 -2.038 -0.245 1.00 0.00 H \\nHETATM 15 H2 UNL 1 -2.831 -2.404 1.073 1.00 0.00 H \\nHETATM 16 H3 UNL 1 -2.652 -3.199 -0.542 1.00 0.00 H \\nHETATM 17 H4 UNL 1 -1.759 1.611 -0.389 1.00 0.00 H \\nHETATM 18 H5 UNL 1 -0.364 3.607 -0.675 1.00 0.00 H \\nHETATM 19 H6 UNL 1 2.085 3.477 -0.355 1.00 0.00 H \\nHETATM 20 H7 UNL 1 3.148 1.351 0.244 1.00 0.00 H \\nHETATM 21 H8 UNL 1 3.831 -1.944 1.078 1.00 0.00 H \\nCONECT 1 2 14 15 16\\nCONECT 2 3 3 4\\nCONECT 4 5\\nCONECT 5 6 6 10\\nCONECT 6 7 17\\nCONECT 7 8 8 18\\nCONECT 8 9 19\\nCONECT 9 10 10 20\\nCONECT 10 11\\nCONECT 11 12 12 13\\nCONECT 13 21\\nEND\\n\",\"pdb\");\n",
|
| 160 |
+
"\tviewer_17472043464774249.setStyle({\"stick\": {}});\n",
|
| 161 |
+
"\tviewer_17472043464774249.zoomTo();\n",
|
| 162 |
+
"viewer_17472043464774249.render();\n",
|
| 163 |
+
"});\n",
|
| 164 |
+
"</script>"
|
| 165 |
+
]
|
| 166 |
+
},
|
| 167 |
+
"metadata": {},
|
| 168 |
+
"output_type": "display_data"
|
| 169 |
+
},
|
| 170 |
+
{
|
| 171 |
+
"data": {
|
| 172 |
+
"text/plain": [
|
| 173 |
+
"<py3Dmol.view at 0x2e3934510>"
|
| 174 |
+
]
|
| 175 |
+
},
|
| 176 |
+
"execution_count": 13,
|
| 177 |
+
"metadata": {},
|
| 178 |
+
"output_type": "execute_result"
|
| 179 |
+
}
|
| 180 |
+
],
|
| 181 |
+
"source": [
|
| 182 |
+
"smiles_to_3d([smiles])"
|
| 183 |
+
]
|
| 184 |
+
},
|
| 185 |
+
{
|
| 186 |
+
"cell_type": "code",
|
| 187 |
+
"execution_count": 12,
|
| 188 |
+
"id": "e3f26dd2-4ef5-44cd-b52c-103feb68aea8",
|
| 189 |
+
"metadata": {},
|
| 190 |
+
"outputs": [
|
| 191 |
+
{
|
| 192 |
+
"data": {
|
| 193 |
+
"application/3dmoljs_load.v0": "<div id=\"3dmolviewer_174720434115202\" style=\"position: relative; width: 400px; height: 300px;\">\n <p id=\"3dmolwarning_174720434115202\" style=\"background-color:#ffcccc;color:black\">3Dmol.js failed to load for some reason. Please check your browser console for error messages.<br></p>\n </div>\n<script>\n\nvar loadScriptAsync = function(uri){\n return new Promise((resolve, reject) => {\n //this is to ignore the existence of requirejs amd\n var savedexports, savedmodule;\n if (typeof exports !== 'undefined') savedexports = exports;\n else exports = {}\n if (typeof module !== 'undefined') savedmodule = module;\n else module = {}\n\n var tag = document.createElement('script');\n tag.src = uri;\n tag.async = true;\n tag.onload = () => {\n exports = savedexports;\n module = savedmodule;\n resolve();\n };\n var firstScriptTag = document.getElementsByTagName('script')[0];\n firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\n});\n};\n\nif(typeof $3Dmolpromise === 'undefined') {\n$3Dmolpromise = null;\n $3Dmolpromise = loadScriptAsync('https://cdnjs.cloudflare.com/ajax/libs/3Dmol/2.2.0/3Dmol-min.js');\n}\n\nvar viewer_174720434115202 = null;\nvar warn = document.getElementById(\"3dmolwarning_174720434115202\");\nif(warn) {\n warn.parentNode.removeChild(warn);\n}\n$3Dmolpromise.then(function() {\nviewer_174720434115202 = $3Dmol.createViewer(document.getElementById(\"3dmolviewer_174720434115202\"),{backgroundColor:\"white\"});\nviewer_174720434115202.zoomTo();\n\tviewer_174720434115202.addModel(\"HETATM 1 C1 UNL 1 -4.710 0.483 -2.389 1.00 0.00 C \\nHETATM 2 C2 UNL 1 -3.254 0.734 -2.191 1.00 0.00 C \\nHETATM 3 O1 UNL 1 -2.675 1.612 -2.887 1.00 0.00 O \\nHETATM 4 O2 UNL 1 -2.582 0.069 -1.158 1.00 0.00 O \\nHETATM 5 C3 UNL 1 -1.192 0.054 -0.972 1.00 0.00 C \\nHETATM 6 C4 UNL 1 -0.319 0.062 -2.076 1.00 0.00 C \\nHETATM 7 C5 UNL 1 1.063 0.034 -1.891 1.00 0.00 C \\nHETATM 8 C6 UNL 1 1.605 -0.028 -0.607 1.00 0.00 C \\nHETATM 9 O3 UNL 1 3.000 -0.043 -0.469 1.00 0.00 O \\nHETATM 10 C7 UNL 1 3.699 -0.667 0.574 1.00 0.00 C \\nHETATM 11 O4 UNL 1 3.059 -1.628 1.363 1.00 0.00 O \\nHETATM 12 C8 UNL 1 4.989 -0.363 0.778 1.00 0.00 C \\nHETATM 13 C9 UNL 1 5.682 0.655 -0.083 1.00 0.00 C \\nHETATM 14 O5 UNL 1 5.698 -0.995 1.800 1.00 0.00 O \\nHETATM 15 C10 UNL 1 0.743 -0.034 0.502 1.00 0.00 C \\nHETATM 16 C11 UNL 1 -0.649 -0.005 0.336 1.00 0.00 C \\nHETATM 17 O6 UNL 1 -1.430 -0.020 1.505 1.00 0.00 O \\nHETATM 18 C12 UNL 1 -2.853 -0.040 1.551 1.00 0.00 C \\nHETATM 19 C13 UNL 1 -3.491 1.337 1.537 1.00 0.00 C \\nHETATM 20 C14 UNL 1 -3.397 0.552 2.836 1.00 0.00 C \\nHETATM 21 H1 UNL 1 -4.976 0.597 -3.461 1.00 0.00 H \\nHETATM 22 H2 UNL 1 -4.963 -0.548 -2.064 1.00 0.00 H \\nHETATM 23 H3 UNL 1 -5.295 1.209 -1.786 1.00 0.00 H \\nHETATM 24 H4 UNL 1 -0.706 0.063 -3.086 1.00 0.00 H \\nHETATM 25 H5 UNL 1 1.718 0.043 -2.754 1.00 0.00 H \\nHETATM 26 H6 UNL 1 3.523 -2.113 2.121 1.00 0.00 H \\nHETATM 27 H7 UNL 1 6.737 0.788 0.236 1.00 0.00 H \\nHETATM 28 H8 UNL 1 5.675 0.321 -1.142 1.00 0.00 H \\nHETATM 29 H9 UNL 1 5.165 1.635 -0.002 1.00 0.00 H \\nHETATM 30 H10 UNL 1 6.673 -0.786 1.979 1.00 0.00 H \\nHETATM 31 H11 UNL 1 1.145 -0.031 1.506 1.00 0.00 H \\nHETATM 32 H12 UNL 1 -3.410 -0.912 1.146 1.00 0.00 H \\nHETATM 33 H13 UNL 1 -2.773 2.181 1.454 1.00 0.00 H \\nHETATM 34 H14 UNL 1 -4.503 1.359 1.081 1.00 0.00 H \\nHETATM 35 H15 UNL 1 -4.364 0.118 3.171 1.00 0.00 H \\nHETATM 36 H16 UNL 1 -2.633 0.938 3.544 1.00 0.00 H \\nCONECT 1 2 21 22 23\\nCONECT 2 3 3 4\\nCONECT 4 5\\nCONECT 5 6 6 16\\nCONECT 6 7 24\\nCONECT 7 8 8 25\\nCONECT 8 9 15\\nCONECT 9 10\\nCONECT 10 11 12 12\\nCONECT 11 26\\nCONECT 12 13 14\\nCONECT 13 27 28 29\\nCONECT 14 30\\nCONECT 15 16 16 31\\nCONECT 16 17\\nCONECT 17 18\\nCONECT 18 19 20 32\\nCONECT 19 20 33 34\\nCONECT 20 35 36\\nEND\\n\",\"pdb\");\n\tviewer_174720434115202.setStyle({\"stick\": {}});\n\tviewer_174720434115202.zoomTo();\nviewer_174720434115202.render();\n});\n</script>",
|
| 194 |
+
"text/html": [
|
| 195 |
+
"<div id=\"3dmolviewer_174720434115202\" style=\"position: relative; width: 400px; height: 300px;\">\n",
|
| 196 |
+
" <p id=\"3dmolwarning_174720434115202\" style=\"background-color:#ffcccc;color:black\">3Dmol.js failed to load for some reason. Please check your browser console for error messages.<br></p>\n",
|
| 197 |
+
" </div>\n",
|
| 198 |
+
"<script>\n",
|
| 199 |
+
"\n",
|
| 200 |
+
"var loadScriptAsync = function(uri){\n",
|
| 201 |
+
" return new Promise((resolve, reject) => {\n",
|
| 202 |
+
" //this is to ignore the existence of requirejs amd\n",
|
| 203 |
+
" var savedexports, savedmodule;\n",
|
| 204 |
+
" if (typeof exports !== 'undefined') savedexports = exports;\n",
|
| 205 |
+
" else exports = {}\n",
|
| 206 |
+
" if (typeof module !== 'undefined') savedmodule = module;\n",
|
| 207 |
+
" else module = {}\n",
|
| 208 |
+
"\n",
|
| 209 |
+
" var tag = document.createElement('script');\n",
|
| 210 |
+
" tag.src = uri;\n",
|
| 211 |
+
" tag.async = true;\n",
|
| 212 |
+
" tag.onload = () => {\n",
|
| 213 |
+
" exports = savedexports;\n",
|
| 214 |
+
" module = savedmodule;\n",
|
| 215 |
+
" resolve();\n",
|
| 216 |
+
" };\n",
|
| 217 |
+
" var firstScriptTag = document.getElementsByTagName('script')[0];\n",
|
| 218 |
+
" firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\n",
|
| 219 |
+
"});\n",
|
| 220 |
+
"};\n",
|
| 221 |
+
"\n",
|
| 222 |
+
"if(typeof $3Dmolpromise === 'undefined') {\n",
|
| 223 |
+
"$3Dmolpromise = null;\n",
|
| 224 |
+
" $3Dmolpromise = loadScriptAsync('https://cdnjs.cloudflare.com/ajax/libs/3Dmol/2.2.0/3Dmol-min.js');\n",
|
| 225 |
+
"}\n",
|
| 226 |
+
"\n",
|
| 227 |
+
"var viewer_174720434115202 = null;\n",
|
| 228 |
+
"var warn = document.getElementById(\"3dmolwarning_174720434115202\");\n",
|
| 229 |
+
"if(warn) {\n",
|
| 230 |
+
" warn.parentNode.removeChild(warn);\n",
|
| 231 |
+
"}\n",
|
| 232 |
+
"$3Dmolpromise.then(function() {\n",
|
| 233 |
+
"viewer_174720434115202 = $3Dmol.createViewer(document.getElementById(\"3dmolviewer_174720434115202\"),{backgroundColor:\"white\"});\n",
|
| 234 |
+
"viewer_174720434115202.zoomTo();\n",
|
| 235 |
+
"\tviewer_174720434115202.addModel(\"HETATM 1 C1 UNL 1 -4.710 0.483 -2.389 1.00 0.00 C \\nHETATM 2 C2 UNL 1 -3.254 0.734 -2.191 1.00 0.00 C \\nHETATM 3 O1 UNL 1 -2.675 1.612 -2.887 1.00 0.00 O \\nHETATM 4 O2 UNL 1 -2.582 0.069 -1.158 1.00 0.00 O \\nHETATM 5 C3 UNL 1 -1.192 0.054 -0.972 1.00 0.00 C \\nHETATM 6 C4 UNL 1 -0.319 0.062 -2.076 1.00 0.00 C \\nHETATM 7 C5 UNL 1 1.063 0.034 -1.891 1.00 0.00 C \\nHETATM 8 C6 UNL 1 1.605 -0.028 -0.607 1.00 0.00 C \\nHETATM 9 O3 UNL 1 3.000 -0.043 -0.469 1.00 0.00 O \\nHETATM 10 C7 UNL 1 3.699 -0.667 0.574 1.00 0.00 C \\nHETATM 11 O4 UNL 1 3.059 -1.628 1.363 1.00 0.00 O \\nHETATM 12 C8 UNL 1 4.989 -0.363 0.778 1.00 0.00 C \\nHETATM 13 C9 UNL 1 5.682 0.655 -0.083 1.00 0.00 C \\nHETATM 14 O5 UNL 1 5.698 -0.995 1.800 1.00 0.00 O \\nHETATM 15 C10 UNL 1 0.743 -0.034 0.502 1.00 0.00 C \\nHETATM 16 C11 UNL 1 -0.649 -0.005 0.336 1.00 0.00 C \\nHETATM 17 O6 UNL 1 -1.430 -0.020 1.505 1.00 0.00 O \\nHETATM 18 C12 UNL 1 -2.853 -0.040 1.551 1.00 0.00 C \\nHETATM 19 C13 UNL 1 -3.491 1.337 1.537 1.00 0.00 C \\nHETATM 20 C14 UNL 1 -3.397 0.552 2.836 1.00 0.00 C \\nHETATM 21 H1 UNL 1 -4.976 0.597 -3.461 1.00 0.00 H \\nHETATM 22 H2 UNL 1 -4.963 -0.548 -2.064 1.00 0.00 H \\nHETATM 23 H3 UNL 1 -5.295 1.209 -1.786 1.00 0.00 H \\nHETATM 24 H4 UNL 1 -0.706 0.063 -3.086 1.00 0.00 H \\nHETATM 25 H5 UNL 1 1.718 0.043 -2.754 1.00 0.00 H \\nHETATM 26 H6 UNL 1 3.523 -2.113 2.121 1.00 0.00 H \\nHETATM 27 H7 UNL 1 6.737 0.788 0.236 1.00 0.00 H \\nHETATM 28 H8 UNL 1 5.675 0.321 -1.142 1.00 0.00 H \\nHETATM 29 H9 UNL 1 5.165 1.635 -0.002 1.00 0.00 H \\nHETATM 30 H10 UNL 1 6.673 -0.786 1.979 1.00 0.00 H \\nHETATM 31 H11 UNL 1 1.145 -0.031 1.506 1.00 0.00 H \\nHETATM 32 H12 UNL 1 -3.410 -0.912 1.146 1.00 0.00 H \\nHETATM 33 H13 UNL 1 -2.773 2.181 1.454 1.00 0.00 H \\nHETATM 34 H14 UNL 1 -4.503 1.359 1.081 1.00 0.00 H \\nHETATM 35 H15 UNL 1 -4.364 0.118 3.171 1.00 0.00 H \\nHETATM 36 H16 UNL 1 -2.633 0.938 3.544 1.00 0.00 H \\nCONECT 1 2 21 22 23\\nCONECT 2 3 3 4\\nCONECT 4 5\\nCONECT 5 6 6 16\\nCONECT 6 7 24\\nCONECT 7 8 8 25\\nCONECT 8 9 15\\nCONECT 9 10\\nCONECT 10 11 12 12\\nCONECT 11 26\\nCONECT 12 13 14\\nCONECT 13 27 28 29\\nCONECT 14 30\\nCONECT 15 16 16 31\\nCONECT 16 17\\nCONECT 17 18\\nCONECT 18 19 20 32\\nCONECT 19 20 33 34\\nCONECT 20 35 36\\nEND\\n\",\"pdb\");\n",
|
| 236 |
+
"\tviewer_174720434115202.setStyle({\"stick\": {}});\n",
|
| 237 |
+
"\tviewer_174720434115202.zoomTo();\n",
|
| 238 |
+
"viewer_174720434115202.render();\n",
|
| 239 |
+
"});\n",
|
| 240 |
+
"</script>"
|
| 241 |
+
]
|
| 242 |
+
},
|
| 243 |
+
"metadata": {},
|
| 244 |
+
"output_type": "display_data"
|
| 245 |
+
},
|
| 246 |
+
{
|
| 247 |
+
"data": {
|
| 248 |
+
"text/plain": [
|
| 249 |
+
"<py3Dmol.view at 0x2e38fc790>"
|
| 250 |
+
]
|
| 251 |
+
},
|
| 252 |
+
"execution_count": 12,
|
| 253 |
+
"metadata": {},
|
| 254 |
+
"output_type": "execute_result"
|
| 255 |
+
}
|
| 256 |
+
],
|
| 257 |
+
"source": [
|
| 258 |
+
"smiles_to_3d([output_text])"
|
| 259 |
+
]
|
| 260 |
+
},
|
| 261 |
+
{
|
| 262 |
+
"cell_type": "code",
|
| 263 |
+
"execution_count": null,
|
| 264 |
+
"id": "492c8624-cfb4-414e-a07b-a083ba74b108",
|
| 265 |
+
"metadata": {},
|
| 266 |
+
"outputs": [],
|
| 267 |
+
"source": []
|
| 268 |
+
}
|
| 269 |
+
],
|
| 270 |
+
"metadata": {
|
| 271 |
+
"kernelspec": {
|
| 272 |
+
"display_name": "Python 3 (ipykernel)",
|
| 273 |
+
"language": "python",
|
| 274 |
+
"name": "python3"
|
| 275 |
+
},
|
| 276 |
+
"language_info": {
|
| 277 |
+
"codemirror_mode": {
|
| 278 |
+
"name": "ipython",
|
| 279 |
+
"version": 3
|
| 280 |
+
},
|
| 281 |
+
"file_extension": ".py",
|
| 282 |
+
"mimetype": "text/x-python",
|
| 283 |
+
"name": "python",
|
| 284 |
+
"nbconvert_exporter": "python",
|
| 285 |
+
"pygments_lexer": "ipython3",
|
| 286 |
+
"version": "3.11.9"
|
| 287 |
+
}
|
| 288 |
+
},
|
| 289 |
+
"nbformat": 4,
|
| 290 |
+
"nbformat_minor": 5
|
| 291 |
+
}
|
README.md
CHANGED
|
@@ -1,3 +1,51 @@
|
|
| 1 |
---
|
| 2 |
license: mit
|
| 3 |
---
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
---
|
| 2 |
license: mit
|
| 3 |
---
|
| 4 |
+
## MorganGen
|
| 5 |
+
A generative model trained on 120 million SMILES strings from the ZINC database. The model takes as input a sequence of indices representing the active bits in a 2048-bit Morgan fingerprint. Each index corresponds to a bit set to 1, while all other bits are 0.
|
| 6 |
+
```
|
| 7 |
+
s = [12][184][1200]
|
| 8 |
+
```
|
| 9 |
+
represents a fingerprint where only bits 12, 184, and 1200 are set to 1, and the remaining bits are 0.
|
| 10 |
+
# Running example
|
| 11 |
+
The following code snippet in the notebook demonstrates how to load the model from a checkpoint and generate a new SMILES string, conditioned on a given input SMILES.
|
| 12 |
+
```python
|
| 13 |
+
from transformers import AutoModelForSeq2SeqLM
|
| 14 |
+
from model.utils import MorganFingerprint, morgan_fingerprint_to_text, clean_output, smiles_to_3d
|
| 15 |
+
from model.tokenizer import SmilesTokenizer
|
| 16 |
+
|
| 17 |
+
# Load the checkpoint and the tokenizer
|
| 18 |
+
checkpoint_path="checkpoint-4120000"
|
| 19 |
+
model = AutoModelForSeq2SeqLM.from_pretrained(checkpoint_path)
|
| 20 |
+
tokenizer = SmilesTokenizer(vocab_file="data/vocab_morgan.txt")
|
| 21 |
+
|
| 22 |
+
# Given a SMILES, get its fingerpint
|
| 23 |
+
smiles="CC(=O)OC1=CC=CC=C1C(=O)O"
|
| 24 |
+
m = MorganFingerprint()
|
| 25 |
+
mf = m.smiles_to_morgan(smiles)
|
| 26 |
+
|
| 27 |
+
# convert it to the indices text format
|
| 28 |
+
s = morgan_fingerprint_to_text(mf)
|
| 29 |
+
|
| 30 |
+
# encode
|
| 31 |
+
input_ids = tokenizer.encode(s, return_tensors="pt")
|
| 32 |
+
# Generate output sequence
|
| 33 |
+
output_ids = model.generate(input_ids, max_length=64, num_beams=5)
|
| 34 |
+
|
| 35 |
+
# decode
|
| 36 |
+
clean_output_ids = clean_output(output_ids[0])
|
| 37 |
+
# Decode the generated output
|
| 38 |
+
output_text = tokenizer.decode(clean_output_ids)
|
| 39 |
+
output_text = output_text.replace(" ", "")
|
| 40 |
+
```
|
| 41 |
+
|
| 42 |
+
# Reference
|
| 43 |
+
```
|
| 44 |
+
@inproceedings{hoang2024morgangen,
|
| 45 |
+
title={MorganGen: Generative Modeling of SMILES Using Morgan Fingerprint Features},
|
| 46 |
+
author={Hoang, Lam Thanh and D{\'\i}az, Ra{\'u}l Fern{\'a}ndez and Lopez, Vanessa},
|
| 47 |
+
booktitle={American Chemical Society (ACS) Fall Meeting},
|
| 48 |
+
year={2024}
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
```
|
checkpoint-4120000/config.json
ADDED
|
@@ -0,0 +1,75 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"_name_or_path": "facebook/bart-base",
|
| 3 |
+
"activation_dropout": 0.1,
|
| 4 |
+
"activation_function": "gelu",
|
| 5 |
+
"add_bias_logits": false,
|
| 6 |
+
"add_final_layer_norm": false,
|
| 7 |
+
"architectures": [
|
| 8 |
+
"BartForConditionalGeneration"
|
| 9 |
+
],
|
| 10 |
+
"attention_dropout": 0.1,
|
| 11 |
+
"bos_token_id": 0,
|
| 12 |
+
"classif_dropout": 0.1,
|
| 13 |
+
"classifier_dropout": 0.0,
|
| 14 |
+
"d_model": 768,
|
| 15 |
+
"decoder_attention_heads": 12,
|
| 16 |
+
"decoder_ffn_dim": 3072,
|
| 17 |
+
"decoder_layerdrop": 0.0,
|
| 18 |
+
"decoder_layers": 6,
|
| 19 |
+
"decoder_start_token_id": 2,
|
| 20 |
+
"dropout": 0.1,
|
| 21 |
+
"early_stopping": true,
|
| 22 |
+
"encoder_attention_heads": 12,
|
| 23 |
+
"encoder_ffn_dim": 3072,
|
| 24 |
+
"encoder_layerdrop": 0.0,
|
| 25 |
+
"encoder_layers": 6,
|
| 26 |
+
"eos_token_id": 2,
|
| 27 |
+
"forced_bos_token_id": 0,
|
| 28 |
+
"forced_eos_token_id": 2,
|
| 29 |
+
"gradient_checkpointing": false,
|
| 30 |
+
"id2label": {
|
| 31 |
+
"0": "LABEL_0",
|
| 32 |
+
"1": "LABEL_1",
|
| 33 |
+
"2": "LABEL_2"
|
| 34 |
+
},
|
| 35 |
+
"init_std": 0.02,
|
| 36 |
+
"is_encoder_decoder": true,
|
| 37 |
+
"label2id": {
|
| 38 |
+
"LABEL_0": 0,
|
| 39 |
+
"LABEL_1": 1,
|
| 40 |
+
"LABEL_2": 2
|
| 41 |
+
},
|
| 42 |
+
"max_position_embeddings": 1024,
|
| 43 |
+
"model_type": "bart",
|
| 44 |
+
"no_repeat_ngram_size": 3,
|
| 45 |
+
"normalize_before": false,
|
| 46 |
+
"normalize_embedding": true,
|
| 47 |
+
"num_beams": 4,
|
| 48 |
+
"num_hidden_layers": 6,
|
| 49 |
+
"pad_token_id": 1,
|
| 50 |
+
"scale_embedding": false,
|
| 51 |
+
"task_specific_params": {
|
| 52 |
+
"summarization": {
|
| 53 |
+
"length_penalty": 1.0,
|
| 54 |
+
"max_length": 128,
|
| 55 |
+
"min_length": 12,
|
| 56 |
+
"num_beams": 4
|
| 57 |
+
},
|
| 58 |
+
"summarization_cnn": {
|
| 59 |
+
"length_penalty": 2.0,
|
| 60 |
+
"max_length": 142,
|
| 61 |
+
"min_length": 56,
|
| 62 |
+
"num_beams": 4
|
| 63 |
+
},
|
| 64 |
+
"summarization_xsum": {
|
| 65 |
+
"length_penalty": 1.0,
|
| 66 |
+
"max_length": 62,
|
| 67 |
+
"min_length": 11,
|
| 68 |
+
"num_beams": 6
|
| 69 |
+
}
|
| 70 |
+
},
|
| 71 |
+
"torch_dtype": "float16",
|
| 72 |
+
"transformers_version": "4.37.0",
|
| 73 |
+
"use_cache": true,
|
| 74 |
+
"vocab_size": 50265
|
| 75 |
+
}
|
checkpoint-4120000/generation_config.json
ADDED
|
@@ -0,0 +1,13 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"_from_model_config": true,
|
| 3 |
+
"bos_token_id": 0,
|
| 4 |
+
"decoder_start_token_id": 2,
|
| 5 |
+
"early_stopping": true,
|
| 6 |
+
"eos_token_id": 2,
|
| 7 |
+
"forced_bos_token_id": 0,
|
| 8 |
+
"forced_eos_token_id": 2,
|
| 9 |
+
"no_repeat_ngram_size": 3,
|
| 10 |
+
"num_beams": 4,
|
| 11 |
+
"pad_token_id": 1,
|
| 12 |
+
"transformers_version": "4.37.0"
|
| 13 |
+
}
|
checkpoint-4120000/global_step4120000/mp_rank_00_model_states.pt
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:21d1573828b5ea09d93b840a2d0fddc4ff050baed01d8e418d5a108a4ca2abb5
|
| 3 |
+
size 279011960
|
checkpoint-4120000/global_step4120000/zero_pp_rank_0_mp_rank_00_optim_states.pt
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:4124c72760850e3dfe47ef6271cf52c342902ddf4895ab2af48c1cc85df94b7b
|
| 3 |
+
size 836532205
|
checkpoint-4120000/global_step4120000/zero_pp_rank_1_mp_rank_00_optim_states.pt
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:b99a8df8657f8304bd84ea3872b48ab441afd17d7dc7a6beb9462944a1769b15
|
| 3 |
+
size 836542061
|
checkpoint-4120000/latest
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
global_step4120000
|
checkpoint-4120000/model.safetensors
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:2add04b3d765e6b586d45a138bbdf5938a91d4668e23469c5fc977ec57685eb8
|
| 3 |
+
size 510592834
|
checkpoint-4120000/rng_state_0.pth
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:6cd095dfb9a400482d1cbe7aeb660e1635d4c46839d11b4c9fd38b3d26db3672
|
| 3 |
+
size 14512
|
checkpoint-4120000/rng_state_1.pth
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:92852906cdd6fb428f8147e3fdaadeb026c6cce1f3a0bf56c0c7593ab725edb5
|
| 3 |
+
size 14512
|
checkpoint-4120000/trainer_state.json
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
checkpoint-4120000/training_args.bin
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:5b2db6ec78a7157dbeee04114a5472abebf66b70394acaffb21a3238de5d390e
|
| 3 |
+
size 6200
|
checkpoint-4120000/zero_to_fp32.py
ADDED
|
@@ -0,0 +1,587 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#!/usr/bin/env python
|
| 2 |
+
|
| 3 |
+
# Copyright (c) Microsoft Corporation.
|
| 4 |
+
# SPDX-License-Identifier: Apache-2.0
|
| 5 |
+
|
| 6 |
+
# DeepSpeed Team
|
| 7 |
+
|
| 8 |
+
# This script extracts fp32 consolidated weights from a zero 1, 2 and 3 DeepSpeed checkpoints. It gets
|
| 9 |
+
# copied into the top level checkpoint dir, so the user can easily do the conversion at any point in
|
| 10 |
+
# the future. Once extracted, the weights don't require DeepSpeed and can be used in any
|
| 11 |
+
# application.
|
| 12 |
+
#
|
| 13 |
+
# example: python zero_to_fp32.py . pytorch_model.bin
|
| 14 |
+
|
| 15 |
+
import argparse
|
| 16 |
+
import torch
|
| 17 |
+
import glob
|
| 18 |
+
import math
|
| 19 |
+
import os
|
| 20 |
+
import re
|
| 21 |
+
from collections import OrderedDict
|
| 22 |
+
from dataclasses import dataclass
|
| 23 |
+
|
| 24 |
+
# while this script doesn't use deepspeed to recover data, since the checkpoints are pickled with
|
| 25 |
+
# DeepSpeed data structures it has to be available in the current python environment.
|
| 26 |
+
from deepspeed.utils import logger
|
| 27 |
+
from deepspeed.checkpoint.constants import (DS_VERSION, OPTIMIZER_STATE_DICT, SINGLE_PARTITION_OF_FP32_GROUPS,
|
| 28 |
+
FP32_FLAT_GROUPS, ZERO_STAGE, PARTITION_COUNT, PARAM_SHAPES, BUFFER_NAMES,
|
| 29 |
+
FROZEN_PARAM_SHAPES, FROZEN_PARAM_FRAGMENTS)
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
@dataclass
|
| 33 |
+
class zero_model_state:
|
| 34 |
+
buffers: dict()
|
| 35 |
+
param_shapes: dict()
|
| 36 |
+
shared_params: list
|
| 37 |
+
ds_version: int
|
| 38 |
+
frozen_param_shapes: dict()
|
| 39 |
+
frozen_param_fragments: dict()
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
debug = 0
|
| 43 |
+
|
| 44 |
+
# load to cpu
|
| 45 |
+
device = torch.device('cpu')
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
def atoi(text):
|
| 49 |
+
return int(text) if text.isdigit() else text
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
def natural_keys(text):
|
| 53 |
+
'''
|
| 54 |
+
alist.sort(key=natural_keys) sorts in human order
|
| 55 |
+
http://nedbatchelder.com/blog/200712/human_sorting.html
|
| 56 |
+
(See Toothy's implementation in the comments)
|
| 57 |
+
'''
|
| 58 |
+
return [atoi(c) for c in re.split(r'(\d+)', text)]
|
| 59 |
+
|
| 60 |
+
|
| 61 |
+
def get_model_state_file(checkpoint_dir, zero_stage):
|
| 62 |
+
if not os.path.isdir(checkpoint_dir):
|
| 63 |
+
raise FileNotFoundError(f"Directory '{checkpoint_dir}' doesn't exist")
|
| 64 |
+
|
| 65 |
+
# there should be only one file
|
| 66 |
+
if zero_stage <= 2:
|
| 67 |
+
file = os.path.join(checkpoint_dir, "mp_rank_00_model_states.pt")
|
| 68 |
+
elif zero_stage == 3:
|
| 69 |
+
file = os.path.join(checkpoint_dir, "zero_pp_rank_0_mp_rank_00_model_states.pt")
|
| 70 |
+
|
| 71 |
+
if not os.path.exists(file):
|
| 72 |
+
raise FileNotFoundError(f"can't find model states file at '{file}'")
|
| 73 |
+
|
| 74 |
+
return file
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
def get_checkpoint_files(checkpoint_dir, glob_pattern):
|
| 78 |
+
# XXX: need to test that this simple glob rule works for multi-node setup too
|
| 79 |
+
ckpt_files = sorted(glob.glob(os.path.join(checkpoint_dir, glob_pattern)), key=natural_keys)
|
| 80 |
+
|
| 81 |
+
if len(ckpt_files) == 0:
|
| 82 |
+
raise FileNotFoundError(f"can't find {glob_pattern} files in directory '{checkpoint_dir}'")
|
| 83 |
+
|
| 84 |
+
return ckpt_files
|
| 85 |
+
|
| 86 |
+
|
| 87 |
+
def get_optim_files(checkpoint_dir):
|
| 88 |
+
return get_checkpoint_files(checkpoint_dir, "*_optim_states.pt")
|
| 89 |
+
|
| 90 |
+
|
| 91 |
+
def get_model_state_files(checkpoint_dir):
|
| 92 |
+
return get_checkpoint_files(checkpoint_dir, "*_model_states.pt")
|
| 93 |
+
|
| 94 |
+
|
| 95 |
+
def parse_model_states(files):
|
| 96 |
+
zero_model_states = []
|
| 97 |
+
for file in files:
|
| 98 |
+
state_dict = torch.load(file, map_location=device)
|
| 99 |
+
|
| 100 |
+
if BUFFER_NAMES not in state_dict:
|
| 101 |
+
raise ValueError(f"{file} is not a model state checkpoint")
|
| 102 |
+
buffer_names = state_dict[BUFFER_NAMES]
|
| 103 |
+
if debug:
|
| 104 |
+
print("Found buffers:", buffer_names)
|
| 105 |
+
|
| 106 |
+
# recover just the buffers while restoring them to fp32 if they were saved in fp16
|
| 107 |
+
buffers = {k: v.float() for k, v in state_dict["module"].items() if k in buffer_names}
|
| 108 |
+
param_shapes = state_dict[PARAM_SHAPES]
|
| 109 |
+
|
| 110 |
+
# collect parameters that are included in param_shapes
|
| 111 |
+
param_names = []
|
| 112 |
+
for s in param_shapes:
|
| 113 |
+
for name in s.keys():
|
| 114 |
+
param_names.append(name)
|
| 115 |
+
|
| 116 |
+
# update with frozen parameters
|
| 117 |
+
frozen_param_shapes = state_dict.get(FROZEN_PARAM_SHAPES, None)
|
| 118 |
+
if frozen_param_shapes is not None:
|
| 119 |
+
if debug:
|
| 120 |
+
print(f"Found frozen_param_shapes: {frozen_param_shapes}")
|
| 121 |
+
param_names += list(frozen_param_shapes.keys())
|
| 122 |
+
|
| 123 |
+
# handle shared params
|
| 124 |
+
shared_params = [[k, v] for k, v in state_dict["shared_params"].items()]
|
| 125 |
+
|
| 126 |
+
ds_version = state_dict.get(DS_VERSION, None)
|
| 127 |
+
|
| 128 |
+
frozen_param_fragments = state_dict.get(FROZEN_PARAM_FRAGMENTS, None)
|
| 129 |
+
|
| 130 |
+
z_model_state = zero_model_state(buffers=buffers,
|
| 131 |
+
param_shapes=param_shapes,
|
| 132 |
+
shared_params=shared_params,
|
| 133 |
+
ds_version=ds_version,
|
| 134 |
+
frozen_param_shapes=frozen_param_shapes,
|
| 135 |
+
frozen_param_fragments=frozen_param_fragments)
|
| 136 |
+
zero_model_states.append(z_model_state)
|
| 137 |
+
|
| 138 |
+
return zero_model_states
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
def parse_optim_states(files, ds_checkpoint_dir):
|
| 142 |
+
|
| 143 |
+
total_files = len(files)
|
| 144 |
+
state_dicts = []
|
| 145 |
+
for f in files:
|
| 146 |
+
state_dict = torch.load(f, map_location=device)
|
| 147 |
+
# immediately discard the potentially huge 2 optimizer states as we only care for fp32 master weights
|
| 148 |
+
# and also handle the case where it was already removed by another helper script
|
| 149 |
+
state_dict["optimizer_state_dict"].pop("optimizer_state_dict", None)
|
| 150 |
+
state_dicts.append(state_dict)
|
| 151 |
+
|
| 152 |
+
if not ZERO_STAGE in state_dicts[0][OPTIMIZER_STATE_DICT]:
|
| 153 |
+
raise ValueError(f"{files[0]} is not a zero checkpoint")
|
| 154 |
+
zero_stage = state_dicts[0][OPTIMIZER_STATE_DICT][ZERO_STAGE]
|
| 155 |
+
world_size = state_dicts[0][OPTIMIZER_STATE_DICT][PARTITION_COUNT]
|
| 156 |
+
|
| 157 |
+
# For ZeRO-2 each param group can have different partition_count as data parallelism for expert
|
| 158 |
+
# parameters can be different from data parallelism for non-expert parameters. So we can just
|
| 159 |
+
# use the max of the partition_count to get the dp world_size.
|
| 160 |
+
|
| 161 |
+
if type(world_size) is list:
|
| 162 |
+
world_size = max(world_size)
|
| 163 |
+
|
| 164 |
+
if world_size != total_files:
|
| 165 |
+
raise ValueError(
|
| 166 |
+
f"Expected {world_size} of '*_optim_states.pt' under '{ds_checkpoint_dir}' but found {total_files} files. "
|
| 167 |
+
"Possibly due to an overwrite of an old checkpoint, or a checkpoint didn't get saved by one or more processes."
|
| 168 |
+
)
|
| 169 |
+
|
| 170 |
+
# the groups are named differently in each stage
|
| 171 |
+
if zero_stage <= 2:
|
| 172 |
+
fp32_groups_key = SINGLE_PARTITION_OF_FP32_GROUPS
|
| 173 |
+
elif zero_stage == 3:
|
| 174 |
+
fp32_groups_key = FP32_FLAT_GROUPS
|
| 175 |
+
else:
|
| 176 |
+
raise ValueError(f"unknown zero stage {zero_stage}")
|
| 177 |
+
|
| 178 |
+
if zero_stage <= 2:
|
| 179 |
+
fp32_flat_groups = [state_dicts[i][OPTIMIZER_STATE_DICT][fp32_groups_key] for i in range(len(state_dicts))]
|
| 180 |
+
elif zero_stage == 3:
|
| 181 |
+
# if there is more than one param group, there will be multiple flattened tensors - one
|
| 182 |
+
# flattened tensor per group - for simplicity merge them into a single tensor
|
| 183 |
+
#
|
| 184 |
+
# XXX: could make the script more memory efficient for when there are multiple groups - it
|
| 185 |
+
# will require matching the sub-lists of param_shapes for each param group flattened tensor
|
| 186 |
+
|
| 187 |
+
fp32_flat_groups = [
|
| 188 |
+
torch.cat(state_dicts[i][OPTIMIZER_STATE_DICT][fp32_groups_key], 0) for i in range(len(state_dicts))
|
| 189 |
+
]
|
| 190 |
+
|
| 191 |
+
return zero_stage, world_size, fp32_flat_groups
|
| 192 |
+
|
| 193 |
+
|
| 194 |
+
def _get_fp32_state_dict_from_zero_checkpoint(ds_checkpoint_dir):
|
| 195 |
+
"""
|
| 196 |
+
Returns fp32 state_dict reconstructed from ds checkpoint
|
| 197 |
+
|
| 198 |
+
Args:
|
| 199 |
+
- ``ds_checkpoint_dir``: path to the deepspeed checkpoint folder (where the optimizer files are)
|
| 200 |
+
|
| 201 |
+
"""
|
| 202 |
+
print(f"Processing zero checkpoint '{ds_checkpoint_dir}'")
|
| 203 |
+
|
| 204 |
+
optim_files = get_optim_files(ds_checkpoint_dir)
|
| 205 |
+
zero_stage, world_size, fp32_flat_groups = parse_optim_states(optim_files, ds_checkpoint_dir)
|
| 206 |
+
print(f"Detected checkpoint of type zero stage {zero_stage}, world_size: {world_size}")
|
| 207 |
+
|
| 208 |
+
model_files = get_model_state_files(ds_checkpoint_dir)
|
| 209 |
+
|
| 210 |
+
zero_model_states = parse_model_states(model_files)
|
| 211 |
+
print(f'Parsing checkpoint created by deepspeed=={zero_model_states[0].ds_version}')
|
| 212 |
+
|
| 213 |
+
if zero_stage <= 2:
|
| 214 |
+
return _get_fp32_state_dict_from_zero2_checkpoint(world_size, fp32_flat_groups, zero_model_states)
|
| 215 |
+
elif zero_stage == 3:
|
| 216 |
+
return _get_fp32_state_dict_from_zero3_checkpoint(world_size, fp32_flat_groups, zero_model_states)
|
| 217 |
+
|
| 218 |
+
|
| 219 |
+
def _zero2_merge_frozen_params(state_dict, zero_model_states):
|
| 220 |
+
if zero_model_states[0].frozen_param_shapes is None or len(zero_model_states[0].frozen_param_shapes) == 0:
|
| 221 |
+
return
|
| 222 |
+
|
| 223 |
+
frozen_param_shapes = zero_model_states[0].frozen_param_shapes
|
| 224 |
+
frozen_param_fragments = zero_model_states[0].frozen_param_fragments
|
| 225 |
+
|
| 226 |
+
if debug:
|
| 227 |
+
num_elem = sum(s.numel() for s in frozen_param_shapes.values())
|
| 228 |
+
print(f'rank 0: {FROZEN_PARAM_SHAPES}.numel = {num_elem}')
|
| 229 |
+
|
| 230 |
+
wanted_params = len(frozen_param_shapes)
|
| 231 |
+
wanted_numel = sum(s.numel() for s in frozen_param_shapes.values())
|
| 232 |
+
avail_numel = sum([p.numel() for p in frozen_param_fragments.values()])
|
| 233 |
+
print(f'Frozen params: Have {avail_numel} numels to process.')
|
| 234 |
+
print(f'Frozen params: Need {wanted_numel} numels in {wanted_params} params')
|
| 235 |
+
|
| 236 |
+
total_params = 0
|
| 237 |
+
total_numel = 0
|
| 238 |
+
for name, shape in frozen_param_shapes.items():
|
| 239 |
+
total_params += 1
|
| 240 |
+
unpartitioned_numel = shape.numel()
|
| 241 |
+
total_numel += unpartitioned_numel
|
| 242 |
+
|
| 243 |
+
state_dict[name] = frozen_param_fragments[name]
|
| 244 |
+
|
| 245 |
+
if debug:
|
| 246 |
+
print(f"{name} full shape: {shape} unpartitioned numel {unpartitioned_numel} ")
|
| 247 |
+
|
| 248 |
+
print(f"Reconstructed Frozen fp32 state dict with {total_params} params {total_numel} elements")
|
| 249 |
+
|
| 250 |
+
|
| 251 |
+
def _zero2_merge_trainable_params(state_dict, world_size, fp32_flat_groups, zero_model_states):
|
| 252 |
+
param_shapes = zero_model_states[0].param_shapes
|
| 253 |
+
|
| 254 |
+
# Reconstruction protocol:
|
| 255 |
+
#
|
| 256 |
+
# XXX: document this
|
| 257 |
+
|
| 258 |
+
if debug:
|
| 259 |
+
for i in range(world_size):
|
| 260 |
+
for j in range(len(fp32_flat_groups[0])):
|
| 261 |
+
print(f"{FP32_FLAT_GROUPS}[{i}][{j}].shape={fp32_flat_groups[i][j].shape}")
|
| 262 |
+
|
| 263 |
+
# XXX: memory usage doubles here (zero2)
|
| 264 |
+
num_param_groups = len(fp32_flat_groups[0])
|
| 265 |
+
merged_single_partition_of_fp32_groups = []
|
| 266 |
+
for i in range(num_param_groups):
|
| 267 |
+
merged_partitions = [sd[i] for sd in fp32_flat_groups]
|
| 268 |
+
full_single_fp32_vector = torch.cat(merged_partitions, 0)
|
| 269 |
+
merged_single_partition_of_fp32_groups.append(full_single_fp32_vector)
|
| 270 |
+
avail_numel = sum(
|
| 271 |
+
[full_single_fp32_vector.numel() for full_single_fp32_vector in merged_single_partition_of_fp32_groups])
|
| 272 |
+
|
| 273 |
+
if debug:
|
| 274 |
+
wanted_params = sum([len(shapes) for shapes in param_shapes])
|
| 275 |
+
wanted_numel = sum([sum(shape.numel() for shape in shapes.values()) for shapes in param_shapes])
|
| 276 |
+
# not asserting if there is a mismatch due to possible padding
|
| 277 |
+
print(f"Have {avail_numel} numels to process.")
|
| 278 |
+
print(f"Need {wanted_numel} numels in {wanted_params} params.")
|
| 279 |
+
|
| 280 |
+
# params
|
| 281 |
+
# XXX: for huge models that can't fit into the host's RAM we will have to recode this to support
|
| 282 |
+
# out-of-core computing solution
|
| 283 |
+
total_numel = 0
|
| 284 |
+
total_params = 0
|
| 285 |
+
for shapes, full_single_fp32_vector in zip(param_shapes, merged_single_partition_of_fp32_groups):
|
| 286 |
+
offset = 0
|
| 287 |
+
avail_numel = full_single_fp32_vector.numel()
|
| 288 |
+
for name, shape in shapes.items():
|
| 289 |
+
|
| 290 |
+
unpartitioned_numel = shape.numel()
|
| 291 |
+
total_numel += unpartitioned_numel
|
| 292 |
+
total_params += 1
|
| 293 |
+
|
| 294 |
+
if debug:
|
| 295 |
+
print(f"{name} full shape: {shape} unpartitioned numel {unpartitioned_numel} ")
|
| 296 |
+
state_dict[name] = full_single_fp32_vector.narrow(0, offset, unpartitioned_numel).view(shape)
|
| 297 |
+
offset += unpartitioned_numel
|
| 298 |
+
|
| 299 |
+
# Z2 started to align to 2*world_size to improve nccl performance. Therefore both offset and
|
| 300 |
+
# avail_numel can differ by anywhere between 0..2*world_size. Due to two unrelated complex
|
| 301 |
+
# paddings performed in the code it's almost impossible to predict the exact numbers w/o the
|
| 302 |
+
# live optimizer object, so we are checking that the numbers are within the right range
|
| 303 |
+
align_to = 2 * world_size
|
| 304 |
+
|
| 305 |
+
def zero2_align(x):
|
| 306 |
+
return align_to * math.ceil(x / align_to)
|
| 307 |
+
|
| 308 |
+
if debug:
|
| 309 |
+
print(f"original offset={offset}, avail_numel={avail_numel}")
|
| 310 |
+
|
| 311 |
+
offset = zero2_align(offset)
|
| 312 |
+
avail_numel = zero2_align(avail_numel)
|
| 313 |
+
|
| 314 |
+
if debug:
|
| 315 |
+
print(f"aligned offset={offset}, avail_numel={avail_numel}")
|
| 316 |
+
|
| 317 |
+
# Sanity check
|
| 318 |
+
if offset != avail_numel:
|
| 319 |
+
raise ValueError(f"consumed {offset} numels out of {avail_numel} - something is wrong")
|
| 320 |
+
|
| 321 |
+
print(f"Reconstructed fp32 state dict with {total_params} params {total_numel} elements")
|
| 322 |
+
|
| 323 |
+
|
| 324 |
+
def _get_fp32_state_dict_from_zero2_checkpoint(world_size, fp32_flat_groups, zero_model_states):
|
| 325 |
+
state_dict = OrderedDict()
|
| 326 |
+
|
| 327 |
+
# buffers
|
| 328 |
+
buffers = zero_model_states[0].buffers
|
| 329 |
+
state_dict.update(buffers)
|
| 330 |
+
if debug:
|
| 331 |
+
print(f"added {len(buffers)} buffers")
|
| 332 |
+
|
| 333 |
+
_zero2_merge_frozen_params(state_dict, zero_model_states)
|
| 334 |
+
|
| 335 |
+
_zero2_merge_trainable_params(state_dict, world_size, fp32_flat_groups, zero_model_states)
|
| 336 |
+
|
| 337 |
+
# recover shared parameters
|
| 338 |
+
for pair in zero_model_states[0].shared_params:
|
| 339 |
+
if pair[1] in state_dict:
|
| 340 |
+
state_dict[pair[0]] = state_dict[pair[1]]
|
| 341 |
+
|
| 342 |
+
return state_dict
|
| 343 |
+
|
| 344 |
+
|
| 345 |
+
def zero3_partitioned_param_info(unpartitioned_numel, world_size):
|
| 346 |
+
remainder = unpartitioned_numel % world_size
|
| 347 |
+
padding_numel = (world_size - remainder) if remainder else 0
|
| 348 |
+
partitioned_numel = math.ceil(unpartitioned_numel / world_size)
|
| 349 |
+
return partitioned_numel, padding_numel
|
| 350 |
+
|
| 351 |
+
|
| 352 |
+
def _zero3_merge_frozen_params(state_dict, world_size, zero_model_states):
|
| 353 |
+
if zero_model_states[0].frozen_param_shapes is None or len(zero_model_states[0].frozen_param_shapes) == 0:
|
| 354 |
+
return
|
| 355 |
+
|
| 356 |
+
if debug:
|
| 357 |
+
for i in range(world_size):
|
| 358 |
+
num_elem = sum(s.numel() for s in zero_model_states[i].frozen_param_fragments.values())
|
| 359 |
+
print(f'rank {i}: {FROZEN_PARAM_SHAPES}.numel = {num_elem}')
|
| 360 |
+
|
| 361 |
+
frozen_param_shapes = zero_model_states[0].frozen_param_shapes
|
| 362 |
+
wanted_params = len(frozen_param_shapes)
|
| 363 |
+
wanted_numel = sum(s.numel() for s in frozen_param_shapes.values())
|
| 364 |
+
avail_numel = sum([p.numel() for p in zero_model_states[0].frozen_param_fragments.values()]) * world_size
|
| 365 |
+
print(f'Frozen params: Have {avail_numel} numels to process.')
|
| 366 |
+
print(f'Frozen params: Need {wanted_numel} numels in {wanted_params} params')
|
| 367 |
+
|
| 368 |
+
total_params = 0
|
| 369 |
+
total_numel = 0
|
| 370 |
+
for name, shape in zero_model_states[0].frozen_param_shapes.items():
|
| 371 |
+
total_params += 1
|
| 372 |
+
unpartitioned_numel = shape.numel()
|
| 373 |
+
total_numel += unpartitioned_numel
|
| 374 |
+
|
| 375 |
+
param_frags = tuple(model_state.frozen_param_fragments[name] for model_state in zero_model_states)
|
| 376 |
+
state_dict[name] = torch.cat(param_frags, 0).narrow(0, 0, unpartitioned_numel).view(shape)
|
| 377 |
+
|
| 378 |
+
partitioned_numel, partitioned_padding_numel = zero3_partitioned_param_info(unpartitioned_numel, world_size)
|
| 379 |
+
|
| 380 |
+
if debug:
|
| 381 |
+
print(
|
| 382 |
+
f"Frozen params: {total_params} {name} full shape: {shape} partition0 numel={partitioned_numel} partitioned_padding_numel={partitioned_padding_numel}"
|
| 383 |
+
)
|
| 384 |
+
|
| 385 |
+
print(f"Reconstructed Frozen fp32 state dict with {total_params} params {total_numel} elements")
|
| 386 |
+
|
| 387 |
+
|
| 388 |
+
def _zero3_merge_trainable_params(state_dict, world_size, fp32_flat_groups, zero_model_states):
|
| 389 |
+
param_shapes = zero_model_states[0].param_shapes
|
| 390 |
+
avail_numel = fp32_flat_groups[0].numel() * world_size
|
| 391 |
+
# Reconstruction protocol: For zero3 we need to zip the partitions together at boundary of each
|
| 392 |
+
# param, re-consolidating each param, while dealing with padding if any
|
| 393 |
+
|
| 394 |
+
# merge list of dicts, preserving order
|
| 395 |
+
param_shapes = {k: v for d in param_shapes for k, v in d.items()}
|
| 396 |
+
|
| 397 |
+
if debug:
|
| 398 |
+
for i in range(world_size):
|
| 399 |
+
print(f"{FP32_FLAT_GROUPS}[{i}].shape={fp32_flat_groups[i].shape}")
|
| 400 |
+
|
| 401 |
+
wanted_params = len(param_shapes)
|
| 402 |
+
wanted_numel = sum(shape.numel() for shape in param_shapes.values())
|
| 403 |
+
# not asserting if there is a mismatch due to possible padding
|
| 404 |
+
avail_numel = fp32_flat_groups[0].numel() * world_size
|
| 405 |
+
print(f"Trainable params: Have {avail_numel} numels to process.")
|
| 406 |
+
print(f"Trainable params: Need {wanted_numel} numels in {wanted_params} params.")
|
| 407 |
+
|
| 408 |
+
# params
|
| 409 |
+
# XXX: for huge models that can't fit into the host's RAM we will have to recode this to support
|
| 410 |
+
# out-of-core computing solution
|
| 411 |
+
offset = 0
|
| 412 |
+
total_numel = 0
|
| 413 |
+
total_params = 0
|
| 414 |
+
for name, shape in param_shapes.items():
|
| 415 |
+
|
| 416 |
+
unpartitioned_numel = shape.numel()
|
| 417 |
+
total_numel += unpartitioned_numel
|
| 418 |
+
total_params += 1
|
| 419 |
+
|
| 420 |
+
partitioned_numel, partitioned_padding_numel = zero3_partitioned_param_info(unpartitioned_numel, world_size)
|
| 421 |
+
|
| 422 |
+
if debug:
|
| 423 |
+
print(
|
| 424 |
+
f"Trainable params: {total_params} {name} full shape: {shape} partition0 numel={partitioned_numel} partitioned_padding_numel={partitioned_padding_numel}"
|
| 425 |
+
)
|
| 426 |
+
|
| 427 |
+
# XXX: memory usage doubles here
|
| 428 |
+
state_dict[name] = torch.cat(
|
| 429 |
+
tuple(fp32_flat_groups[i].narrow(0, offset, partitioned_numel) for i in range(world_size)),
|
| 430 |
+
0).narrow(0, 0, unpartitioned_numel).view(shape)
|
| 431 |
+
offset += partitioned_numel
|
| 432 |
+
|
| 433 |
+
offset *= world_size
|
| 434 |
+
|
| 435 |
+
# Sanity check
|
| 436 |
+
if offset != avail_numel:
|
| 437 |
+
raise ValueError(f"consumed {offset} numels out of {avail_numel} - something is wrong")
|
| 438 |
+
|
| 439 |
+
print(f"Reconstructed Trainable fp32 state dict with {total_params} params {total_numel} elements")
|
| 440 |
+
|
| 441 |
+
|
| 442 |
+
def _get_fp32_state_dict_from_zero3_checkpoint(world_size, fp32_flat_groups, zero_model_states):
|
| 443 |
+
state_dict = OrderedDict()
|
| 444 |
+
|
| 445 |
+
# buffers
|
| 446 |
+
buffers = zero_model_states[0].buffers
|
| 447 |
+
state_dict.update(buffers)
|
| 448 |
+
if debug:
|
| 449 |
+
print(f"added {len(buffers)} buffers")
|
| 450 |
+
|
| 451 |
+
_zero3_merge_frozen_params(state_dict, world_size, zero_model_states)
|
| 452 |
+
|
| 453 |
+
_zero3_merge_trainable_params(state_dict, world_size, fp32_flat_groups, zero_model_states)
|
| 454 |
+
|
| 455 |
+
# recover shared parameters
|
| 456 |
+
for pair in zero_model_states[0].shared_params:
|
| 457 |
+
if pair[1] in state_dict:
|
| 458 |
+
state_dict[pair[0]] = state_dict[pair[1]]
|
| 459 |
+
|
| 460 |
+
return state_dict
|
| 461 |
+
|
| 462 |
+
|
| 463 |
+
def get_fp32_state_dict_from_zero_checkpoint(checkpoint_dir, tag=None):
|
| 464 |
+
"""
|
| 465 |
+
Convert ZeRO 2 or 3 checkpoint into a single fp32 consolidated state_dict that can be loaded with
|
| 466 |
+
``load_state_dict()`` and used for training without DeepSpeed or shared with others, for example
|
| 467 |
+
via a model hub.
|
| 468 |
+
|
| 469 |
+
Args:
|
| 470 |
+
- ``checkpoint_dir``: path to the desired checkpoint folder
|
| 471 |
+
- ``tag``: checkpoint tag used as a unique identifier for checkpoint. If not provided will attempt to load tag in 'latest' file. e.g., ``global_step14``
|
| 472 |
+
|
| 473 |
+
Returns:
|
| 474 |
+
- pytorch ``state_dict``
|
| 475 |
+
|
| 476 |
+
Note: this approach may not work if your application doesn't have sufficient free CPU memory and
|
| 477 |
+
you may need to use the offline approach using the ``zero_to_fp32.py`` script that is saved with
|
| 478 |
+
the checkpoint.
|
| 479 |
+
|
| 480 |
+
A typical usage might be ::
|
| 481 |
+
|
| 482 |
+
from deepspeed.utils.zero_to_fp32 import get_fp32_state_dict_from_zero_checkpoint
|
| 483 |
+
# do the training and checkpoint saving
|
| 484 |
+
state_dict = get_fp32_state_dict_from_zero_checkpoint(checkpoint_dir) # already on cpu
|
| 485 |
+
model = model.cpu() # move to cpu
|
| 486 |
+
model.load_state_dict(state_dict)
|
| 487 |
+
# submit to model hub or save the model to share with others
|
| 488 |
+
|
| 489 |
+
In this example the ``model`` will no longer be usable in the deepspeed context of the same
|
| 490 |
+
application. i.e. you will need to re-initialize the deepspeed engine, since
|
| 491 |
+
``model.load_state_dict(state_dict)`` will remove all the deepspeed magic from it.
|
| 492 |
+
|
| 493 |
+
If you want it all done for you, use ``load_state_dict_from_zero_checkpoint`` instead.
|
| 494 |
+
|
| 495 |
+
"""
|
| 496 |
+
if tag is None:
|
| 497 |
+
latest_path = os.path.join(checkpoint_dir, 'latest')
|
| 498 |
+
if os.path.isfile(latest_path):
|
| 499 |
+
with open(latest_path, 'r') as fd:
|
| 500 |
+
tag = fd.read().strip()
|
| 501 |
+
else:
|
| 502 |
+
raise ValueError(f"Unable to find 'latest' file at {latest_path}")
|
| 503 |
+
|
| 504 |
+
ds_checkpoint_dir = os.path.join(checkpoint_dir, tag)
|
| 505 |
+
|
| 506 |
+
if not os.path.isdir(ds_checkpoint_dir):
|
| 507 |
+
raise FileNotFoundError(f"Directory '{ds_checkpoint_dir}' doesn't exist")
|
| 508 |
+
|
| 509 |
+
return _get_fp32_state_dict_from_zero_checkpoint(ds_checkpoint_dir)
|
| 510 |
+
|
| 511 |
+
|
| 512 |
+
def convert_zero_checkpoint_to_fp32_state_dict(checkpoint_dir, output_file, tag=None):
|
| 513 |
+
"""
|
| 514 |
+
Convert ZeRO 2 or 3 checkpoint into a single fp32 consolidated ``state_dict`` file that can be
|
| 515 |
+
loaded with ``torch.load(file)`` + ``load_state_dict()`` and used for training without DeepSpeed.
|
| 516 |
+
|
| 517 |
+
Args:
|
| 518 |
+
- ``checkpoint_dir``: path to the desired checkpoint folder. (one that contains the tag-folder, like ``global_step14``)
|
| 519 |
+
- ``output_file``: path to the pytorch fp32 state_dict output file (e.g. path/pytorch_model.bin)
|
| 520 |
+
- ``tag``: checkpoint tag used as a unique identifier for checkpoint. If not provided will attempt to load tag in the file named ``latest`` in the checkpoint folder, e.g., ``global_step14``
|
| 521 |
+
"""
|
| 522 |
+
|
| 523 |
+
state_dict = get_fp32_state_dict_from_zero_checkpoint(checkpoint_dir, tag)
|
| 524 |
+
print(f"Saving fp32 state dict to {output_file}")
|
| 525 |
+
torch.save(state_dict, output_file)
|
| 526 |
+
|
| 527 |
+
|
| 528 |
+
def load_state_dict_from_zero_checkpoint(model, checkpoint_dir, tag=None):
|
| 529 |
+
"""
|
| 530 |
+
1. Put the provided model to cpu
|
| 531 |
+
2. Convert ZeRO 2 or 3 checkpoint into a single fp32 consolidated ``state_dict``
|
| 532 |
+
3. Load it into the provided model
|
| 533 |
+
|
| 534 |
+
Args:
|
| 535 |
+
- ``model``: the model object to update
|
| 536 |
+
- ``checkpoint_dir``: path to the desired checkpoint folder. (one that contains the tag-folder, like ``global_step14``)
|
| 537 |
+
- ``tag``: checkpoint tag used as a unique identifier for checkpoint. If not provided will attempt to load tag in the file named ``latest`` in the checkpoint folder, e.g., ``global_step14``
|
| 538 |
+
|
| 539 |
+
Returns:
|
| 540 |
+
- ``model`: modified model
|
| 541 |
+
|
| 542 |
+
Make sure you have plenty of CPU memory available before you call this function. If you don't
|
| 543 |
+
have enough use the ``zero_to_fp32.py`` utility to do the conversion. You will find it
|
| 544 |
+
conveniently placed for you in the checkpoint folder.
|
| 545 |
+
|
| 546 |
+
A typical usage might be ::
|
| 547 |
+
|
| 548 |
+
from deepspeed.utils.zero_to_fp32 import load_state_dict_from_zero_checkpoint
|
| 549 |
+
model = load_state_dict_from_zero_checkpoint(trainer.model, checkpoint_dir)
|
| 550 |
+
# submit to model hub or save the model to share with others
|
| 551 |
+
|
| 552 |
+
Note, that once this was run, the ``model`` will no longer be usable in the deepspeed context
|
| 553 |
+
of the same application. i.e. you will need to re-initialize the deepspeed engine, since
|
| 554 |
+
``model.load_state_dict(state_dict)`` will remove all the deepspeed magic from it.
|
| 555 |
+
|
| 556 |
+
"""
|
| 557 |
+
logger.info(f"Extracting fp32 weights")
|
| 558 |
+
state_dict = get_fp32_state_dict_from_zero_checkpoint(checkpoint_dir, tag)
|
| 559 |
+
|
| 560 |
+
logger.info(f"Overwriting model with fp32 weights")
|
| 561 |
+
model = model.cpu()
|
| 562 |
+
model.load_state_dict(state_dict, strict=False)
|
| 563 |
+
|
| 564 |
+
return model
|
| 565 |
+
|
| 566 |
+
|
| 567 |
+
if __name__ == "__main__":
|
| 568 |
+
|
| 569 |
+
parser = argparse.ArgumentParser()
|
| 570 |
+
parser.add_argument("checkpoint_dir",
|
| 571 |
+
type=str,
|
| 572 |
+
help="path to the desired checkpoint folder, e.g., path/checkpoint-12")
|
| 573 |
+
parser.add_argument(
|
| 574 |
+
"output_file",
|
| 575 |
+
type=str,
|
| 576 |
+
help="path to the pytorch fp32 state_dict output file (e.g. path/checkpoint-12/pytorch_model.bin)")
|
| 577 |
+
parser.add_argument("-t",
|
| 578 |
+
"--tag",
|
| 579 |
+
type=str,
|
| 580 |
+
default=None,
|
| 581 |
+
help="checkpoint tag used as a unique identifier for checkpoint. e.g., global_step1")
|
| 582 |
+
parser.add_argument("-d", "--debug", action='store_true', help="enable debug")
|
| 583 |
+
args = parser.parse_args()
|
| 584 |
+
|
| 585 |
+
debug = args.debug
|
| 586 |
+
|
| 587 |
+
convert_zero_checkpoint_to_fp32_state_dict(args.checkpoint_dir, args.output_file, tag=args.tag)
|
data/vocab_morgan.txt
ADDED
|
@@ -0,0 +1,2670 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[PAD]
|
| 2 |
+
[unused1]
|
| 3 |
+
[unused2]
|
| 4 |
+
[unused3]
|
| 5 |
+
[unused4]
|
| 6 |
+
[unused5]
|
| 7 |
+
[unused6]
|
| 8 |
+
[unused7]
|
| 9 |
+
[unused8]
|
| 10 |
+
[unused9]
|
| 11 |
+
[unused10]
|
| 12 |
+
[UNK]
|
| 13 |
+
[CLS]
|
| 14 |
+
[SEP]
|
| 15 |
+
[MASK]
|
| 16 |
+
c
|
| 17 |
+
C
|
| 18 |
+
(
|
| 19 |
+
)
|
| 20 |
+
O
|
| 21 |
+
1
|
| 22 |
+
2
|
| 23 |
+
=
|
| 24 |
+
N
|
| 25 |
+
.
|
| 26 |
+
n
|
| 27 |
+
3
|
| 28 |
+
F
|
| 29 |
+
Cl
|
| 30 |
+
>>
|
| 31 |
+
~
|
| 32 |
+
-
|
| 33 |
+
4
|
| 34 |
+
[C@H]
|
| 35 |
+
S
|
| 36 |
+
[C@@H]
|
| 37 |
+
[O-]
|
| 38 |
+
Br
|
| 39 |
+
#
|
| 40 |
+
/
|
| 41 |
+
[nH]
|
| 42 |
+
[N+]
|
| 43 |
+
s
|
| 44 |
+
5
|
| 45 |
+
o
|
| 46 |
+
P
|
| 47 |
+
[Na+]
|
| 48 |
+
[Si]
|
| 49 |
+
I
|
| 50 |
+
[Na]
|
| 51 |
+
[Pd]
|
| 52 |
+
[K+]
|
| 53 |
+
[K]
|
| 54 |
+
[P]
|
| 55 |
+
B
|
| 56 |
+
[C@]
|
| 57 |
+
[C@@]
|
| 58 |
+
[Cl-]
|
| 59 |
+
6
|
| 60 |
+
[OH-]
|
| 61 |
+
\
|
| 62 |
+
[N-]
|
| 63 |
+
[Li]
|
| 64 |
+
[H]
|
| 65 |
+
[2H]
|
| 66 |
+
[NH4+]
|
| 67 |
+
[c-]
|
| 68 |
+
[P-]
|
| 69 |
+
[Cs+]
|
| 70 |
+
[Li+]
|
| 71 |
+
[Cs]
|
| 72 |
+
[NaH]
|
| 73 |
+
[H-]
|
| 74 |
+
[O+]
|
| 75 |
+
[BH4-]
|
| 76 |
+
[Cu]
|
| 77 |
+
7
|
| 78 |
+
[Mg]
|
| 79 |
+
[Fe+2]
|
| 80 |
+
[n+]
|
| 81 |
+
[Sn]
|
| 82 |
+
[BH-]
|
| 83 |
+
[Pd+2]
|
| 84 |
+
[CH]
|
| 85 |
+
[I-]
|
| 86 |
+
[Br-]
|
| 87 |
+
[C-]
|
| 88 |
+
[Zn]
|
| 89 |
+
[B-]
|
| 90 |
+
[F-]
|
| 91 |
+
[Al]
|
| 92 |
+
[P+]
|
| 93 |
+
[BH3-]
|
| 94 |
+
[Fe]
|
| 95 |
+
[C]
|
| 96 |
+
[AlH4]
|
| 97 |
+
[Ni]
|
| 98 |
+
[SiH]
|
| 99 |
+
8
|
| 100 |
+
[Cu+2]
|
| 101 |
+
[Mn]
|
| 102 |
+
[AlH]
|
| 103 |
+
[nH+]
|
| 104 |
+
[AlH4-]
|
| 105 |
+
[O-2]
|
| 106 |
+
[Cr]
|
| 107 |
+
[Mg+2]
|
| 108 |
+
[NH3+]
|
| 109 |
+
[S@]
|
| 110 |
+
[Pt]
|
| 111 |
+
[Al+3]
|
| 112 |
+
[S@@]
|
| 113 |
+
[S-]
|
| 114 |
+
[Ti]
|
| 115 |
+
[Zn+2]
|
| 116 |
+
[PH]
|
| 117 |
+
[NH2+]
|
| 118 |
+
[Ru]
|
| 119 |
+
[Ag+]
|
| 120 |
+
[S+]
|
| 121 |
+
[I+3]
|
| 122 |
+
[NH+]
|
| 123 |
+
[Ca+2]
|
| 124 |
+
[Ag]
|
| 125 |
+
9
|
| 126 |
+
[Os]
|
| 127 |
+
[Se]
|
| 128 |
+
[SiH2]
|
| 129 |
+
[Ca]
|
| 130 |
+
[Ti+4]
|
| 131 |
+
[Ac]
|
| 132 |
+
[Cu+]
|
| 133 |
+
[S]
|
| 134 |
+
[Rh]
|
| 135 |
+
[Cl+3]
|
| 136 |
+
[cH-]
|
| 137 |
+
[Zn+]
|
| 138 |
+
[O]
|
| 139 |
+
[Cl+]
|
| 140 |
+
[SH]
|
| 141 |
+
[H+]
|
| 142 |
+
[Pd+]
|
| 143 |
+
[se]
|
| 144 |
+
[PH+]
|
| 145 |
+
[I]
|
| 146 |
+
[Pt+2]
|
| 147 |
+
[C+]
|
| 148 |
+
[Mg+]
|
| 149 |
+
[Hg]
|
| 150 |
+
[W]
|
| 151 |
+
[SnH]
|
| 152 |
+
[SiH3]
|
| 153 |
+
[Fe+3]
|
| 154 |
+
[NH]
|
| 155 |
+
[Mo]
|
| 156 |
+
[CH2+]
|
| 157 |
+
%10
|
| 158 |
+
[CH2-]
|
| 159 |
+
[CH2]
|
| 160 |
+
[n-]
|
| 161 |
+
[Ce+4]
|
| 162 |
+
[NH-]
|
| 163 |
+
[Co]
|
| 164 |
+
[I+]
|
| 165 |
+
[PH2]
|
| 166 |
+
[Pt+4]
|
| 167 |
+
[Ce]
|
| 168 |
+
[B]
|
| 169 |
+
[Sn+2]
|
| 170 |
+
[Ba+2]
|
| 171 |
+
%11
|
| 172 |
+
[Fe-3]
|
| 173 |
+
[18F]
|
| 174 |
+
[SH-]
|
| 175 |
+
[Pb+2]
|
| 176 |
+
[Os-2]
|
| 177 |
+
[Zr+4]
|
| 178 |
+
[N]
|
| 179 |
+
[Ir]
|
| 180 |
+
[Bi]
|
| 181 |
+
[Ni+2]
|
| 182 |
+
[P@]
|
| 183 |
+
[Co+2]
|
| 184 |
+
[s+]
|
| 185 |
+
[As]
|
| 186 |
+
[P+3]
|
| 187 |
+
[Hg+2]
|
| 188 |
+
[Yb+3]
|
| 189 |
+
[CH-]
|
| 190 |
+
[Zr+2]
|
| 191 |
+
[Mn+2]
|
| 192 |
+
[CH+]
|
| 193 |
+
[In]
|
| 194 |
+
[KH]
|
| 195 |
+
[Ce+3]
|
| 196 |
+
[Zr]
|
| 197 |
+
[AlH2-]
|
| 198 |
+
[OH2+]
|
| 199 |
+
[Ti+3]
|
| 200 |
+
[Rh+2]
|
| 201 |
+
[Sb]
|
| 202 |
+
[S-2]
|
| 203 |
+
%12
|
| 204 |
+
[P@@]
|
| 205 |
+
[Si@H]
|
| 206 |
+
[Mn+4]
|
| 207 |
+
p
|
| 208 |
+
[Ba]
|
| 209 |
+
[NH2-]
|
| 210 |
+
[Ge]
|
| 211 |
+
[Pb+4]
|
| 212 |
+
[Cr+3]
|
| 213 |
+
[Au]
|
| 214 |
+
[LiH]
|
| 215 |
+
[Sc+3]
|
| 216 |
+
[o+]
|
| 217 |
+
[Rh-3]
|
| 218 |
+
%13
|
| 219 |
+
[Br]
|
| 220 |
+
[Sb-]
|
| 221 |
+
[S@+]
|
| 222 |
+
[I+2]
|
| 223 |
+
[Ar]
|
| 224 |
+
[V]
|
| 225 |
+
[Cu-]
|
| 226 |
+
[Al-]
|
| 227 |
+
[Te]
|
| 228 |
+
[13c]
|
| 229 |
+
[13C]
|
| 230 |
+
[Cl]
|
| 231 |
+
[PH4+]
|
| 232 |
+
[SiH4]
|
| 233 |
+
[te]
|
| 234 |
+
[CH3-]
|
| 235 |
+
[S@@+]
|
| 236 |
+
[Rh+3]
|
| 237 |
+
[SH+]
|
| 238 |
+
[Bi+3]
|
| 239 |
+
[Br+2]
|
| 240 |
+
[La]
|
| 241 |
+
[La+3]
|
| 242 |
+
[Pt-2]
|
| 243 |
+
[N@@]
|
| 244 |
+
[PH3+]
|
| 245 |
+
[N@]
|
| 246 |
+
[Si+4]
|
| 247 |
+
[Sr+2]
|
| 248 |
+
[Al+]
|
| 249 |
+
[Pb]
|
| 250 |
+
[SeH]
|
| 251 |
+
[Si-]
|
| 252 |
+
[V+5]
|
| 253 |
+
[Y+3]
|
| 254 |
+
[Re]
|
| 255 |
+
[Ru+]
|
| 256 |
+
[Sm]
|
| 257 |
+
*
|
| 258 |
+
[3H]
|
| 259 |
+
[NH2]
|
| 260 |
+
[Ag-]
|
| 261 |
+
[13CH3]
|
| 262 |
+
[OH+]
|
| 263 |
+
[Ru+3]
|
| 264 |
+
[OH]
|
| 265 |
+
[Gd+3]
|
| 266 |
+
[13CH2]
|
| 267 |
+
[In+3]
|
| 268 |
+
[Si@@]
|
| 269 |
+
[Si@]
|
| 270 |
+
[Ti+2]
|
| 271 |
+
[Sn+]
|
| 272 |
+
[Cl+2]
|
| 273 |
+
[AlH-]
|
| 274 |
+
[Pd-2]
|
| 275 |
+
[SnH3]
|
| 276 |
+
[B+3]
|
| 277 |
+
[Cu-2]
|
| 278 |
+
[Nd+3]
|
| 279 |
+
[Pb+3]
|
| 280 |
+
[13cH]
|
| 281 |
+
[Fe-4]
|
| 282 |
+
[Ga]
|
| 283 |
+
[Sn+4]
|
| 284 |
+
[Hg+]
|
| 285 |
+
[11CH3]
|
| 286 |
+
[Hf]
|
| 287 |
+
[Pr]
|
| 288 |
+
[Y]
|
| 289 |
+
[S+2]
|
| 290 |
+
[Cd]
|
| 291 |
+
[Cr+6]
|
| 292 |
+
[Zr+3]
|
| 293 |
+
[Rh+]
|
| 294 |
+
[CH3]
|
| 295 |
+
[N-3]
|
| 296 |
+
[Hf+2]
|
| 297 |
+
[Th]
|
| 298 |
+
[Sb+3]
|
| 299 |
+
%14
|
| 300 |
+
[Cr+2]
|
| 301 |
+
[Ru+2]
|
| 302 |
+
[Hf+4]
|
| 303 |
+
[14C]
|
| 304 |
+
[Ta]
|
| 305 |
+
[Tl+]
|
| 306 |
+
[B+]
|
| 307 |
+
[Os+4]
|
| 308 |
+
[PdH2]
|
| 309 |
+
[Pd-]
|
| 310 |
+
[Cd+2]
|
| 311 |
+
[Co+3]
|
| 312 |
+
[S+4]
|
| 313 |
+
[Nb+5]
|
| 314 |
+
[123I]
|
| 315 |
+
[c+]
|
| 316 |
+
[Rb+]
|
| 317 |
+
[V+2]
|
| 318 |
+
[CH3+]
|
| 319 |
+
[Ag+2]
|
| 320 |
+
[cH+]
|
| 321 |
+
[Mn+3]
|
| 322 |
+
[Se-]
|
| 323 |
+
[As-]
|
| 324 |
+
[Eu+3]
|
| 325 |
+
[SH2]
|
| 326 |
+
[Sm+3]
|
| 327 |
+
[IH+]
|
| 328 |
+
%15
|
| 329 |
+
[OH3+]
|
| 330 |
+
[PH3]
|
| 331 |
+
[IH2+]
|
| 332 |
+
[SH2+]
|
| 333 |
+
[Ir+3]
|
| 334 |
+
[AlH3]
|
| 335 |
+
[Sc]
|
| 336 |
+
[Yb]
|
| 337 |
+
[15NH2]
|
| 338 |
+
[Lu]
|
| 339 |
+
[sH+]
|
| 340 |
+
[Gd]
|
| 341 |
+
[18F-]
|
| 342 |
+
[SH3+]
|
| 343 |
+
[SnH4]
|
| 344 |
+
[TeH]
|
| 345 |
+
[Si@@H]
|
| 346 |
+
[Ga+3]
|
| 347 |
+
[CaH2]
|
| 348 |
+
[Tl]
|
| 349 |
+
[Ta+5]
|
| 350 |
+
[GeH]
|
| 351 |
+
[Br+]
|
| 352 |
+
[Sr]
|
| 353 |
+
[Tl+3]
|
| 354 |
+
[Sm+2]
|
| 355 |
+
[PH5]
|
| 356 |
+
%16
|
| 357 |
+
[N@@+]
|
| 358 |
+
[Au+3]
|
| 359 |
+
[C-4]
|
| 360 |
+
[Nd]
|
| 361 |
+
[Ti+]
|
| 362 |
+
[IH]
|
| 363 |
+
[N@+]
|
| 364 |
+
[125I]
|
| 365 |
+
[Eu]
|
| 366 |
+
[Sn+3]
|
| 367 |
+
[Nb]
|
| 368 |
+
[Er+3]
|
| 369 |
+
[123I-]
|
| 370 |
+
[14c]
|
| 371 |
+
%17
|
| 372 |
+
[SnH2]
|
| 373 |
+
[YH]
|
| 374 |
+
[Sb+5]
|
| 375 |
+
[Pr+3]
|
| 376 |
+
[Ir+]
|
| 377 |
+
[N+3]
|
| 378 |
+
[AlH2]
|
| 379 |
+
[19F]
|
| 380 |
+
%18
|
| 381 |
+
[Tb]
|
| 382 |
+
[14CH]
|
| 383 |
+
[Mo+4]
|
| 384 |
+
[Si+]
|
| 385 |
+
[BH]
|
| 386 |
+
[Be]
|
| 387 |
+
[Rb]
|
| 388 |
+
[pH]
|
| 389 |
+
%19
|
| 390 |
+
%20
|
| 391 |
+
[Xe]
|
| 392 |
+
[Ir-]
|
| 393 |
+
[Be+2]
|
| 394 |
+
[C+4]
|
| 395 |
+
[RuH2]
|
| 396 |
+
[15NH]
|
| 397 |
+
[U+2]
|
| 398 |
+
[Au-]
|
| 399 |
+
%21
|
| 400 |
+
%22
|
| 401 |
+
[Au+]
|
| 402 |
+
[15n]
|
| 403 |
+
[Al+2]
|
| 404 |
+
[Tb+3]
|
| 405 |
+
[15N]
|
| 406 |
+
[V+3]
|
| 407 |
+
[W+6]
|
| 408 |
+
[14CH3]
|
| 409 |
+
[Cr+4]
|
| 410 |
+
[ClH+]
|
| 411 |
+
b
|
| 412 |
+
[Ti+6]
|
| 413 |
+
[Nd+]
|
| 414 |
+
[Zr+]
|
| 415 |
+
[PH2+]
|
| 416 |
+
[Fm]
|
| 417 |
+
[N@H+]
|
| 418 |
+
[RuH]
|
| 419 |
+
[Dy+3]
|
| 420 |
+
%23
|
| 421 |
+
[Hf+3]
|
| 422 |
+
[W+4]
|
| 423 |
+
[11C]
|
| 424 |
+
[13CH]
|
| 425 |
+
[Er]
|
| 426 |
+
[124I]
|
| 427 |
+
[LaH]
|
| 428 |
+
[F]
|
| 429 |
+
[siH]
|
| 430 |
+
[Ga+]
|
| 431 |
+
[Cm]
|
| 432 |
+
[GeH3]
|
| 433 |
+
[IH-]
|
| 434 |
+
[U+6]
|
| 435 |
+
[SeH+]
|
| 436 |
+
[32P]
|
| 437 |
+
[SeH-]
|
| 438 |
+
[Pt-]
|
| 439 |
+
[Ir+2]
|
| 440 |
+
[se+]
|
| 441 |
+
[U]
|
| 442 |
+
[F+]
|
| 443 |
+
[BH2]
|
| 444 |
+
[As+]
|
| 445 |
+
[Cf]
|
| 446 |
+
[ClH2+]
|
| 447 |
+
[Ni+]
|
| 448 |
+
[TeH3]
|
| 449 |
+
[SbH2]
|
| 450 |
+
[Ag+3]
|
| 451 |
+
%24
|
| 452 |
+
[18O]
|
| 453 |
+
[PH4]
|
| 454 |
+
[Os+2]
|
| 455 |
+
[Na-]
|
| 456 |
+
[Sb+2]
|
| 457 |
+
[V+4]
|
| 458 |
+
[Ho+3]
|
| 459 |
+
[68Ga]
|
| 460 |
+
[PH-]
|
| 461 |
+
[Bi+2]
|
| 462 |
+
[Ce+2]
|
| 463 |
+
[Pd+3]
|
| 464 |
+
[99Tc]
|
| 465 |
+
[13C@@H]
|
| 466 |
+
[Fe+6]
|
| 467 |
+
[c]
|
| 468 |
+
[GeH2]
|
| 469 |
+
[10B]
|
| 470 |
+
[Cu+3]
|
| 471 |
+
[Mo+2]
|
| 472 |
+
[Cr+]
|
| 473 |
+
[Pd+4]
|
| 474 |
+
[Dy]
|
| 475 |
+
[AsH]
|
| 476 |
+
[Ba+]
|
| 477 |
+
[SeH2]
|
| 478 |
+
[In+]
|
| 479 |
+
[TeH2]
|
| 480 |
+
[BrH+]
|
| 481 |
+
[14cH]
|
| 482 |
+
[W+]
|
| 483 |
+
[13C@H]
|
| 484 |
+
[AsH2]
|
| 485 |
+
[In+2]
|
| 486 |
+
[N+2]
|
| 487 |
+
[N@@H+]
|
| 488 |
+
[SbH]
|
| 489 |
+
[60Co]
|
| 490 |
+
[AsH4+]
|
| 491 |
+
[AsH3]
|
| 492 |
+
[18OH]
|
| 493 |
+
[Ru-2]
|
| 494 |
+
[Na-2]
|
| 495 |
+
[CuH2]
|
| 496 |
+
[31P]
|
| 497 |
+
[Ti+5]
|
| 498 |
+
[35S]
|
| 499 |
+
[P@@H]
|
| 500 |
+
[ArH]
|
| 501 |
+
[Co+]
|
| 502 |
+
[Zr-2]
|
| 503 |
+
[BH2-]
|
| 504 |
+
[131I]
|
| 505 |
+
[SH5]
|
| 506 |
+
[VH]
|
| 507 |
+
[B+2]
|
| 508 |
+
[Yb+2]
|
| 509 |
+
[14C@H]
|
| 510 |
+
[211At]
|
| 511 |
+
[NH3+2]
|
| 512 |
+
[IrH]
|
| 513 |
+
[IrH2]
|
| 514 |
+
[Rh-]
|
| 515 |
+
[Cr-]
|
| 516 |
+
[Sb+]
|
| 517 |
+
[Ni+3]
|
| 518 |
+
[TaH3]
|
| 519 |
+
[Tl+2]
|
| 520 |
+
[64Cu]
|
| 521 |
+
[Tc]
|
| 522 |
+
[Cd+]
|
| 523 |
+
[1H]
|
| 524 |
+
[15nH]
|
| 525 |
+
[AlH2+]
|
| 526 |
+
[FH+2]
|
| 527 |
+
[BiH3]
|
| 528 |
+
[Ru-]
|
| 529 |
+
[Mo+6]
|
| 530 |
+
[AsH+]
|
| 531 |
+
[BaH2]
|
| 532 |
+
[BaH]
|
| 533 |
+
[Fe+4]
|
| 534 |
+
[229Th]
|
| 535 |
+
[Th+4]
|
| 536 |
+
[As+3]
|
| 537 |
+
[NH+3]
|
| 538 |
+
[P@H]
|
| 539 |
+
[Li-]
|
| 540 |
+
[7NaH]
|
| 541 |
+
[Bi+]
|
| 542 |
+
[PtH+2]
|
| 543 |
+
[p-]
|
| 544 |
+
[Re+5]
|
| 545 |
+
[NiH]
|
| 546 |
+
[Ni-]
|
| 547 |
+
[Xe+]
|
| 548 |
+
[Ca+]
|
| 549 |
+
[11c]
|
| 550 |
+
[Rh+4]
|
| 551 |
+
[AcH]
|
| 552 |
+
[HeH]
|
| 553 |
+
[Sc+2]
|
| 554 |
+
[Mn+]
|
| 555 |
+
[UH]
|
| 556 |
+
[14CH2]
|
| 557 |
+
[SiH4+]
|
| 558 |
+
[18OH2]
|
| 559 |
+
[Ac-]
|
| 560 |
+
[Re+4]
|
| 561 |
+
[118Sn]
|
| 562 |
+
[153Sm]
|
| 563 |
+
[P+2]
|
| 564 |
+
[9CH]
|
| 565 |
+
[9CH3]
|
| 566 |
+
[Y-]
|
| 567 |
+
[NiH2]
|
| 568 |
+
[Si+2]
|
| 569 |
+
[Mn+6]
|
| 570 |
+
[ZrH2]
|
| 571 |
+
[C-2]
|
| 572 |
+
[Bi+5]
|
| 573 |
+
[24NaH]
|
| 574 |
+
[Fr]
|
| 575 |
+
[15CH]
|
| 576 |
+
[Se+]
|
| 577 |
+
[At]
|
| 578 |
+
[P-3]
|
| 579 |
+
[124I-]
|
| 580 |
+
[CuH2-]
|
| 581 |
+
[Nb+4]
|
| 582 |
+
[Nb+3]
|
| 583 |
+
[MgH]
|
| 584 |
+
[Ir+4]
|
| 585 |
+
[67Ga+3]
|
| 586 |
+
[67Ga]
|
| 587 |
+
[13N]
|
| 588 |
+
[15OH2]
|
| 589 |
+
[2NH]
|
| 590 |
+
[Ho]
|
| 591 |
+
[Cn]
|
| 592 |
+
[He]
|
| 593 |
+
[Ne]
|
| 594 |
+
[Kr]
|
| 595 |
+
[Pm]
|
| 596 |
+
[Tm]
|
| 597 |
+
[Po]
|
| 598 |
+
[Rn]
|
| 599 |
+
[Ra]
|
| 600 |
+
[Pa]
|
| 601 |
+
[Np]
|
| 602 |
+
[Pu]
|
| 603 |
+
[Am]
|
| 604 |
+
[Bk]
|
| 605 |
+
[Es]
|
| 606 |
+
[Md]
|
| 607 |
+
[No]
|
| 608 |
+
[Lr]
|
| 609 |
+
[Rf]
|
| 610 |
+
[Db]
|
| 611 |
+
[Sg]
|
| 612 |
+
[Bh]
|
| 613 |
+
[Hs]
|
| 614 |
+
[Mt]
|
| 615 |
+
[Ds]
|
| 616 |
+
[Rg]
|
| 617 |
+
[Nh]
|
| 618 |
+
[Fl]
|
| 619 |
+
[Mc]
|
| 620 |
+
[Lv]
|
| 621 |
+
[Ts]
|
| 622 |
+
[Og]
|
| 623 |
+
[0]
|
| 624 |
+
[1]
|
| 625 |
+
[2]
|
| 626 |
+
[3]
|
| 627 |
+
[4]
|
| 628 |
+
[5]
|
| 629 |
+
[6]
|
| 630 |
+
[7]
|
| 631 |
+
[8]
|
| 632 |
+
[9]
|
| 633 |
+
[10]
|
| 634 |
+
[11]
|
| 635 |
+
[12]
|
| 636 |
+
[13]
|
| 637 |
+
[14]
|
| 638 |
+
[15]
|
| 639 |
+
[16]
|
| 640 |
+
[17]
|
| 641 |
+
[18]
|
| 642 |
+
[19]
|
| 643 |
+
[20]
|
| 644 |
+
[21]
|
| 645 |
+
[22]
|
| 646 |
+
[23]
|
| 647 |
+
[24]
|
| 648 |
+
[25]
|
| 649 |
+
[26]
|
| 650 |
+
[27]
|
| 651 |
+
[28]
|
| 652 |
+
[29]
|
| 653 |
+
[30]
|
| 654 |
+
[31]
|
| 655 |
+
[32]
|
| 656 |
+
[33]
|
| 657 |
+
[34]
|
| 658 |
+
[35]
|
| 659 |
+
[36]
|
| 660 |
+
[37]
|
| 661 |
+
[38]
|
| 662 |
+
[39]
|
| 663 |
+
[40]
|
| 664 |
+
[41]
|
| 665 |
+
[42]
|
| 666 |
+
[43]
|
| 667 |
+
[44]
|
| 668 |
+
[45]
|
| 669 |
+
[46]
|
| 670 |
+
[47]
|
| 671 |
+
[48]
|
| 672 |
+
[49]
|
| 673 |
+
[50]
|
| 674 |
+
[51]
|
| 675 |
+
[52]
|
| 676 |
+
[53]
|
| 677 |
+
[54]
|
| 678 |
+
[55]
|
| 679 |
+
[56]
|
| 680 |
+
[57]
|
| 681 |
+
[58]
|
| 682 |
+
[59]
|
| 683 |
+
[60]
|
| 684 |
+
[61]
|
| 685 |
+
[62]
|
| 686 |
+
[63]
|
| 687 |
+
[64]
|
| 688 |
+
[65]
|
| 689 |
+
[66]
|
| 690 |
+
[67]
|
| 691 |
+
[68]
|
| 692 |
+
[69]
|
| 693 |
+
[70]
|
| 694 |
+
[71]
|
| 695 |
+
[72]
|
| 696 |
+
[73]
|
| 697 |
+
[74]
|
| 698 |
+
[75]
|
| 699 |
+
[76]
|
| 700 |
+
[77]
|
| 701 |
+
[78]
|
| 702 |
+
[79]
|
| 703 |
+
[80]
|
| 704 |
+
[81]
|
| 705 |
+
[82]
|
| 706 |
+
[83]
|
| 707 |
+
[84]
|
| 708 |
+
[85]
|
| 709 |
+
[86]
|
| 710 |
+
[87]
|
| 711 |
+
[88]
|
| 712 |
+
[89]
|
| 713 |
+
[90]
|
| 714 |
+
[91]
|
| 715 |
+
[92]
|
| 716 |
+
[93]
|
| 717 |
+
[94]
|
| 718 |
+
[95]
|
| 719 |
+
[96]
|
| 720 |
+
[97]
|
| 721 |
+
[98]
|
| 722 |
+
[99]
|
| 723 |
+
[100]
|
| 724 |
+
[101]
|
| 725 |
+
[102]
|
| 726 |
+
[103]
|
| 727 |
+
[104]
|
| 728 |
+
[105]
|
| 729 |
+
[106]
|
| 730 |
+
[107]
|
| 731 |
+
[108]
|
| 732 |
+
[109]
|
| 733 |
+
[110]
|
| 734 |
+
[111]
|
| 735 |
+
[112]
|
| 736 |
+
[113]
|
| 737 |
+
[114]
|
| 738 |
+
[115]
|
| 739 |
+
[116]
|
| 740 |
+
[117]
|
| 741 |
+
[118]
|
| 742 |
+
[119]
|
| 743 |
+
[120]
|
| 744 |
+
[121]
|
| 745 |
+
[122]
|
| 746 |
+
[123]
|
| 747 |
+
[124]
|
| 748 |
+
[125]
|
| 749 |
+
[126]
|
| 750 |
+
[127]
|
| 751 |
+
[128]
|
| 752 |
+
[129]
|
| 753 |
+
[130]
|
| 754 |
+
[131]
|
| 755 |
+
[132]
|
| 756 |
+
[133]
|
| 757 |
+
[134]
|
| 758 |
+
[135]
|
| 759 |
+
[136]
|
| 760 |
+
[137]
|
| 761 |
+
[138]
|
| 762 |
+
[139]
|
| 763 |
+
[140]
|
| 764 |
+
[141]
|
| 765 |
+
[142]
|
| 766 |
+
[143]
|
| 767 |
+
[144]
|
| 768 |
+
[145]
|
| 769 |
+
[146]
|
| 770 |
+
[147]
|
| 771 |
+
[148]
|
| 772 |
+
[149]
|
| 773 |
+
[150]
|
| 774 |
+
[151]
|
| 775 |
+
[152]
|
| 776 |
+
[153]
|
| 777 |
+
[154]
|
| 778 |
+
[155]
|
| 779 |
+
[156]
|
| 780 |
+
[157]
|
| 781 |
+
[158]
|
| 782 |
+
[159]
|
| 783 |
+
[160]
|
| 784 |
+
[161]
|
| 785 |
+
[162]
|
| 786 |
+
[163]
|
| 787 |
+
[164]
|
| 788 |
+
[165]
|
| 789 |
+
[166]
|
| 790 |
+
[167]
|
| 791 |
+
[168]
|
| 792 |
+
[169]
|
| 793 |
+
[170]
|
| 794 |
+
[171]
|
| 795 |
+
[172]
|
| 796 |
+
[173]
|
| 797 |
+
[174]
|
| 798 |
+
[175]
|
| 799 |
+
[176]
|
| 800 |
+
[177]
|
| 801 |
+
[178]
|
| 802 |
+
[179]
|
| 803 |
+
[180]
|
| 804 |
+
[181]
|
| 805 |
+
[182]
|
| 806 |
+
[183]
|
| 807 |
+
[184]
|
| 808 |
+
[185]
|
| 809 |
+
[186]
|
| 810 |
+
[187]
|
| 811 |
+
[188]
|
| 812 |
+
[189]
|
| 813 |
+
[190]
|
| 814 |
+
[191]
|
| 815 |
+
[192]
|
| 816 |
+
[193]
|
| 817 |
+
[194]
|
| 818 |
+
[195]
|
| 819 |
+
[196]
|
| 820 |
+
[197]
|
| 821 |
+
[198]
|
| 822 |
+
[199]
|
| 823 |
+
[200]
|
| 824 |
+
[201]
|
| 825 |
+
[202]
|
| 826 |
+
[203]
|
| 827 |
+
[204]
|
| 828 |
+
[205]
|
| 829 |
+
[206]
|
| 830 |
+
[207]
|
| 831 |
+
[208]
|
| 832 |
+
[209]
|
| 833 |
+
[210]
|
| 834 |
+
[211]
|
| 835 |
+
[212]
|
| 836 |
+
[213]
|
| 837 |
+
[214]
|
| 838 |
+
[215]
|
| 839 |
+
[216]
|
| 840 |
+
[217]
|
| 841 |
+
[218]
|
| 842 |
+
[219]
|
| 843 |
+
[220]
|
| 844 |
+
[221]
|
| 845 |
+
[222]
|
| 846 |
+
[223]
|
| 847 |
+
[224]
|
| 848 |
+
[225]
|
| 849 |
+
[226]
|
| 850 |
+
[227]
|
| 851 |
+
[228]
|
| 852 |
+
[229]
|
| 853 |
+
[230]
|
| 854 |
+
[231]
|
| 855 |
+
[232]
|
| 856 |
+
[233]
|
| 857 |
+
[234]
|
| 858 |
+
[235]
|
| 859 |
+
[236]
|
| 860 |
+
[237]
|
| 861 |
+
[238]
|
| 862 |
+
[239]
|
| 863 |
+
[240]
|
| 864 |
+
[241]
|
| 865 |
+
[242]
|
| 866 |
+
[243]
|
| 867 |
+
[244]
|
| 868 |
+
[245]
|
| 869 |
+
[246]
|
| 870 |
+
[247]
|
| 871 |
+
[248]
|
| 872 |
+
[249]
|
| 873 |
+
[250]
|
| 874 |
+
[251]
|
| 875 |
+
[252]
|
| 876 |
+
[253]
|
| 877 |
+
[254]
|
| 878 |
+
[255]
|
| 879 |
+
[256]
|
| 880 |
+
[257]
|
| 881 |
+
[258]
|
| 882 |
+
[259]
|
| 883 |
+
[260]
|
| 884 |
+
[261]
|
| 885 |
+
[262]
|
| 886 |
+
[263]
|
| 887 |
+
[264]
|
| 888 |
+
[265]
|
| 889 |
+
[266]
|
| 890 |
+
[267]
|
| 891 |
+
[268]
|
| 892 |
+
[269]
|
| 893 |
+
[270]
|
| 894 |
+
[271]
|
| 895 |
+
[272]
|
| 896 |
+
[273]
|
| 897 |
+
[274]
|
| 898 |
+
[275]
|
| 899 |
+
[276]
|
| 900 |
+
[277]
|
| 901 |
+
[278]
|
| 902 |
+
[279]
|
| 903 |
+
[280]
|
| 904 |
+
[281]
|
| 905 |
+
[282]
|
| 906 |
+
[283]
|
| 907 |
+
[284]
|
| 908 |
+
[285]
|
| 909 |
+
[286]
|
| 910 |
+
[287]
|
| 911 |
+
[288]
|
| 912 |
+
[289]
|
| 913 |
+
[290]
|
| 914 |
+
[291]
|
| 915 |
+
[292]
|
| 916 |
+
[293]
|
| 917 |
+
[294]
|
| 918 |
+
[295]
|
| 919 |
+
[296]
|
| 920 |
+
[297]
|
| 921 |
+
[298]
|
| 922 |
+
[299]
|
| 923 |
+
[300]
|
| 924 |
+
[301]
|
| 925 |
+
[302]
|
| 926 |
+
[303]
|
| 927 |
+
[304]
|
| 928 |
+
[305]
|
| 929 |
+
[306]
|
| 930 |
+
[307]
|
| 931 |
+
[308]
|
| 932 |
+
[309]
|
| 933 |
+
[310]
|
| 934 |
+
[311]
|
| 935 |
+
[312]
|
| 936 |
+
[313]
|
| 937 |
+
[314]
|
| 938 |
+
[315]
|
| 939 |
+
[316]
|
| 940 |
+
[317]
|
| 941 |
+
[318]
|
| 942 |
+
[319]
|
| 943 |
+
[320]
|
| 944 |
+
[321]
|
| 945 |
+
[322]
|
| 946 |
+
[323]
|
| 947 |
+
[324]
|
| 948 |
+
[325]
|
| 949 |
+
[326]
|
| 950 |
+
[327]
|
| 951 |
+
[328]
|
| 952 |
+
[329]
|
| 953 |
+
[330]
|
| 954 |
+
[331]
|
| 955 |
+
[332]
|
| 956 |
+
[333]
|
| 957 |
+
[334]
|
| 958 |
+
[335]
|
| 959 |
+
[336]
|
| 960 |
+
[337]
|
| 961 |
+
[338]
|
| 962 |
+
[339]
|
| 963 |
+
[340]
|
| 964 |
+
[341]
|
| 965 |
+
[342]
|
| 966 |
+
[343]
|
| 967 |
+
[344]
|
| 968 |
+
[345]
|
| 969 |
+
[346]
|
| 970 |
+
[347]
|
| 971 |
+
[348]
|
| 972 |
+
[349]
|
| 973 |
+
[350]
|
| 974 |
+
[351]
|
| 975 |
+
[352]
|
| 976 |
+
[353]
|
| 977 |
+
[354]
|
| 978 |
+
[355]
|
| 979 |
+
[356]
|
| 980 |
+
[357]
|
| 981 |
+
[358]
|
| 982 |
+
[359]
|
| 983 |
+
[360]
|
| 984 |
+
[361]
|
| 985 |
+
[362]
|
| 986 |
+
[363]
|
| 987 |
+
[364]
|
| 988 |
+
[365]
|
| 989 |
+
[366]
|
| 990 |
+
[367]
|
| 991 |
+
[368]
|
| 992 |
+
[369]
|
| 993 |
+
[370]
|
| 994 |
+
[371]
|
| 995 |
+
[372]
|
| 996 |
+
[373]
|
| 997 |
+
[374]
|
| 998 |
+
[375]
|
| 999 |
+
[376]
|
| 1000 |
+
[377]
|
| 1001 |
+
[378]
|
| 1002 |
+
[379]
|
| 1003 |
+
[380]
|
| 1004 |
+
[381]
|
| 1005 |
+
[382]
|
| 1006 |
+
[383]
|
| 1007 |
+
[384]
|
| 1008 |
+
[385]
|
| 1009 |
+
[386]
|
| 1010 |
+
[387]
|
| 1011 |
+
[388]
|
| 1012 |
+
[389]
|
| 1013 |
+
[390]
|
| 1014 |
+
[391]
|
| 1015 |
+
[392]
|
| 1016 |
+
[393]
|
| 1017 |
+
[394]
|
| 1018 |
+
[395]
|
| 1019 |
+
[396]
|
| 1020 |
+
[397]
|
| 1021 |
+
[398]
|
| 1022 |
+
[399]
|
| 1023 |
+
[400]
|
| 1024 |
+
[401]
|
| 1025 |
+
[402]
|
| 1026 |
+
[403]
|
| 1027 |
+
[404]
|
| 1028 |
+
[405]
|
| 1029 |
+
[406]
|
| 1030 |
+
[407]
|
| 1031 |
+
[408]
|
| 1032 |
+
[409]
|
| 1033 |
+
[410]
|
| 1034 |
+
[411]
|
| 1035 |
+
[412]
|
| 1036 |
+
[413]
|
| 1037 |
+
[414]
|
| 1038 |
+
[415]
|
| 1039 |
+
[416]
|
| 1040 |
+
[417]
|
| 1041 |
+
[418]
|
| 1042 |
+
[419]
|
| 1043 |
+
[420]
|
| 1044 |
+
[421]
|
| 1045 |
+
[422]
|
| 1046 |
+
[423]
|
| 1047 |
+
[424]
|
| 1048 |
+
[425]
|
| 1049 |
+
[426]
|
| 1050 |
+
[427]
|
| 1051 |
+
[428]
|
| 1052 |
+
[429]
|
| 1053 |
+
[430]
|
| 1054 |
+
[431]
|
| 1055 |
+
[432]
|
| 1056 |
+
[433]
|
| 1057 |
+
[434]
|
| 1058 |
+
[435]
|
| 1059 |
+
[436]
|
| 1060 |
+
[437]
|
| 1061 |
+
[438]
|
| 1062 |
+
[439]
|
| 1063 |
+
[440]
|
| 1064 |
+
[441]
|
| 1065 |
+
[442]
|
| 1066 |
+
[443]
|
| 1067 |
+
[444]
|
| 1068 |
+
[445]
|
| 1069 |
+
[446]
|
| 1070 |
+
[447]
|
| 1071 |
+
[448]
|
| 1072 |
+
[449]
|
| 1073 |
+
[450]
|
| 1074 |
+
[451]
|
| 1075 |
+
[452]
|
| 1076 |
+
[453]
|
| 1077 |
+
[454]
|
| 1078 |
+
[455]
|
| 1079 |
+
[456]
|
| 1080 |
+
[457]
|
| 1081 |
+
[458]
|
| 1082 |
+
[459]
|
| 1083 |
+
[460]
|
| 1084 |
+
[461]
|
| 1085 |
+
[462]
|
| 1086 |
+
[463]
|
| 1087 |
+
[464]
|
| 1088 |
+
[465]
|
| 1089 |
+
[466]
|
| 1090 |
+
[467]
|
| 1091 |
+
[468]
|
| 1092 |
+
[469]
|
| 1093 |
+
[470]
|
| 1094 |
+
[471]
|
| 1095 |
+
[472]
|
| 1096 |
+
[473]
|
| 1097 |
+
[474]
|
| 1098 |
+
[475]
|
| 1099 |
+
[476]
|
| 1100 |
+
[477]
|
| 1101 |
+
[478]
|
| 1102 |
+
[479]
|
| 1103 |
+
[480]
|
| 1104 |
+
[481]
|
| 1105 |
+
[482]
|
| 1106 |
+
[483]
|
| 1107 |
+
[484]
|
| 1108 |
+
[485]
|
| 1109 |
+
[486]
|
| 1110 |
+
[487]
|
| 1111 |
+
[488]
|
| 1112 |
+
[489]
|
| 1113 |
+
[490]
|
| 1114 |
+
[491]
|
| 1115 |
+
[492]
|
| 1116 |
+
[493]
|
| 1117 |
+
[494]
|
| 1118 |
+
[495]
|
| 1119 |
+
[496]
|
| 1120 |
+
[497]
|
| 1121 |
+
[498]
|
| 1122 |
+
[499]
|
| 1123 |
+
[500]
|
| 1124 |
+
[501]
|
| 1125 |
+
[502]
|
| 1126 |
+
[503]
|
| 1127 |
+
[504]
|
| 1128 |
+
[505]
|
| 1129 |
+
[506]
|
| 1130 |
+
[507]
|
| 1131 |
+
[508]
|
| 1132 |
+
[509]
|
| 1133 |
+
[510]
|
| 1134 |
+
[511]
|
| 1135 |
+
[512]
|
| 1136 |
+
[513]
|
| 1137 |
+
[514]
|
| 1138 |
+
[515]
|
| 1139 |
+
[516]
|
| 1140 |
+
[517]
|
| 1141 |
+
[518]
|
| 1142 |
+
[519]
|
| 1143 |
+
[520]
|
| 1144 |
+
[521]
|
| 1145 |
+
[522]
|
| 1146 |
+
[523]
|
| 1147 |
+
[524]
|
| 1148 |
+
[525]
|
| 1149 |
+
[526]
|
| 1150 |
+
[527]
|
| 1151 |
+
[528]
|
| 1152 |
+
[529]
|
| 1153 |
+
[530]
|
| 1154 |
+
[531]
|
| 1155 |
+
[532]
|
| 1156 |
+
[533]
|
| 1157 |
+
[534]
|
| 1158 |
+
[535]
|
| 1159 |
+
[536]
|
| 1160 |
+
[537]
|
| 1161 |
+
[538]
|
| 1162 |
+
[539]
|
| 1163 |
+
[540]
|
| 1164 |
+
[541]
|
| 1165 |
+
[542]
|
| 1166 |
+
[543]
|
| 1167 |
+
[544]
|
| 1168 |
+
[545]
|
| 1169 |
+
[546]
|
| 1170 |
+
[547]
|
| 1171 |
+
[548]
|
| 1172 |
+
[549]
|
| 1173 |
+
[550]
|
| 1174 |
+
[551]
|
| 1175 |
+
[552]
|
| 1176 |
+
[553]
|
| 1177 |
+
[554]
|
| 1178 |
+
[555]
|
| 1179 |
+
[556]
|
| 1180 |
+
[557]
|
| 1181 |
+
[558]
|
| 1182 |
+
[559]
|
| 1183 |
+
[560]
|
| 1184 |
+
[561]
|
| 1185 |
+
[562]
|
| 1186 |
+
[563]
|
| 1187 |
+
[564]
|
| 1188 |
+
[565]
|
| 1189 |
+
[566]
|
| 1190 |
+
[567]
|
| 1191 |
+
[568]
|
| 1192 |
+
[569]
|
| 1193 |
+
[570]
|
| 1194 |
+
[571]
|
| 1195 |
+
[572]
|
| 1196 |
+
[573]
|
| 1197 |
+
[574]
|
| 1198 |
+
[575]
|
| 1199 |
+
[576]
|
| 1200 |
+
[577]
|
| 1201 |
+
[578]
|
| 1202 |
+
[579]
|
| 1203 |
+
[580]
|
| 1204 |
+
[581]
|
| 1205 |
+
[582]
|
| 1206 |
+
[583]
|
| 1207 |
+
[584]
|
| 1208 |
+
[585]
|
| 1209 |
+
[586]
|
| 1210 |
+
[587]
|
| 1211 |
+
[588]
|
| 1212 |
+
[589]
|
| 1213 |
+
[590]
|
| 1214 |
+
[591]
|
| 1215 |
+
[592]
|
| 1216 |
+
[593]
|
| 1217 |
+
[594]
|
| 1218 |
+
[595]
|
| 1219 |
+
[596]
|
| 1220 |
+
[597]
|
| 1221 |
+
[598]
|
| 1222 |
+
[599]
|
| 1223 |
+
[600]
|
| 1224 |
+
[601]
|
| 1225 |
+
[602]
|
| 1226 |
+
[603]
|
| 1227 |
+
[604]
|
| 1228 |
+
[605]
|
| 1229 |
+
[606]
|
| 1230 |
+
[607]
|
| 1231 |
+
[608]
|
| 1232 |
+
[609]
|
| 1233 |
+
[610]
|
| 1234 |
+
[611]
|
| 1235 |
+
[612]
|
| 1236 |
+
[613]
|
| 1237 |
+
[614]
|
| 1238 |
+
[615]
|
| 1239 |
+
[616]
|
| 1240 |
+
[617]
|
| 1241 |
+
[618]
|
| 1242 |
+
[619]
|
| 1243 |
+
[620]
|
| 1244 |
+
[621]
|
| 1245 |
+
[622]
|
| 1246 |
+
[623]
|
| 1247 |
+
[624]
|
| 1248 |
+
[625]
|
| 1249 |
+
[626]
|
| 1250 |
+
[627]
|
| 1251 |
+
[628]
|
| 1252 |
+
[629]
|
| 1253 |
+
[630]
|
| 1254 |
+
[631]
|
| 1255 |
+
[632]
|
| 1256 |
+
[633]
|
| 1257 |
+
[634]
|
| 1258 |
+
[635]
|
| 1259 |
+
[636]
|
| 1260 |
+
[637]
|
| 1261 |
+
[638]
|
| 1262 |
+
[639]
|
| 1263 |
+
[640]
|
| 1264 |
+
[641]
|
| 1265 |
+
[642]
|
| 1266 |
+
[643]
|
| 1267 |
+
[644]
|
| 1268 |
+
[645]
|
| 1269 |
+
[646]
|
| 1270 |
+
[647]
|
| 1271 |
+
[648]
|
| 1272 |
+
[649]
|
| 1273 |
+
[650]
|
| 1274 |
+
[651]
|
| 1275 |
+
[652]
|
| 1276 |
+
[653]
|
| 1277 |
+
[654]
|
| 1278 |
+
[655]
|
| 1279 |
+
[656]
|
| 1280 |
+
[657]
|
| 1281 |
+
[658]
|
| 1282 |
+
[659]
|
| 1283 |
+
[660]
|
| 1284 |
+
[661]
|
| 1285 |
+
[662]
|
| 1286 |
+
[663]
|
| 1287 |
+
[664]
|
| 1288 |
+
[665]
|
| 1289 |
+
[666]
|
| 1290 |
+
[667]
|
| 1291 |
+
[668]
|
| 1292 |
+
[669]
|
| 1293 |
+
[670]
|
| 1294 |
+
[671]
|
| 1295 |
+
[672]
|
| 1296 |
+
[673]
|
| 1297 |
+
[674]
|
| 1298 |
+
[675]
|
| 1299 |
+
[676]
|
| 1300 |
+
[677]
|
| 1301 |
+
[678]
|
| 1302 |
+
[679]
|
| 1303 |
+
[680]
|
| 1304 |
+
[681]
|
| 1305 |
+
[682]
|
| 1306 |
+
[683]
|
| 1307 |
+
[684]
|
| 1308 |
+
[685]
|
| 1309 |
+
[686]
|
| 1310 |
+
[687]
|
| 1311 |
+
[688]
|
| 1312 |
+
[689]
|
| 1313 |
+
[690]
|
| 1314 |
+
[691]
|
| 1315 |
+
[692]
|
| 1316 |
+
[693]
|
| 1317 |
+
[694]
|
| 1318 |
+
[695]
|
| 1319 |
+
[696]
|
| 1320 |
+
[697]
|
| 1321 |
+
[698]
|
| 1322 |
+
[699]
|
| 1323 |
+
[700]
|
| 1324 |
+
[701]
|
| 1325 |
+
[702]
|
| 1326 |
+
[703]
|
| 1327 |
+
[704]
|
| 1328 |
+
[705]
|
| 1329 |
+
[706]
|
| 1330 |
+
[707]
|
| 1331 |
+
[708]
|
| 1332 |
+
[709]
|
| 1333 |
+
[710]
|
| 1334 |
+
[711]
|
| 1335 |
+
[712]
|
| 1336 |
+
[713]
|
| 1337 |
+
[714]
|
| 1338 |
+
[715]
|
| 1339 |
+
[716]
|
| 1340 |
+
[717]
|
| 1341 |
+
[718]
|
| 1342 |
+
[719]
|
| 1343 |
+
[720]
|
| 1344 |
+
[721]
|
| 1345 |
+
[722]
|
| 1346 |
+
[723]
|
| 1347 |
+
[724]
|
| 1348 |
+
[725]
|
| 1349 |
+
[726]
|
| 1350 |
+
[727]
|
| 1351 |
+
[728]
|
| 1352 |
+
[729]
|
| 1353 |
+
[730]
|
| 1354 |
+
[731]
|
| 1355 |
+
[732]
|
| 1356 |
+
[733]
|
| 1357 |
+
[734]
|
| 1358 |
+
[735]
|
| 1359 |
+
[736]
|
| 1360 |
+
[737]
|
| 1361 |
+
[738]
|
| 1362 |
+
[739]
|
| 1363 |
+
[740]
|
| 1364 |
+
[741]
|
| 1365 |
+
[742]
|
| 1366 |
+
[743]
|
| 1367 |
+
[744]
|
| 1368 |
+
[745]
|
| 1369 |
+
[746]
|
| 1370 |
+
[747]
|
| 1371 |
+
[748]
|
| 1372 |
+
[749]
|
| 1373 |
+
[750]
|
| 1374 |
+
[751]
|
| 1375 |
+
[752]
|
| 1376 |
+
[753]
|
| 1377 |
+
[754]
|
| 1378 |
+
[755]
|
| 1379 |
+
[756]
|
| 1380 |
+
[757]
|
| 1381 |
+
[758]
|
| 1382 |
+
[759]
|
| 1383 |
+
[760]
|
| 1384 |
+
[761]
|
| 1385 |
+
[762]
|
| 1386 |
+
[763]
|
| 1387 |
+
[764]
|
| 1388 |
+
[765]
|
| 1389 |
+
[766]
|
| 1390 |
+
[767]
|
| 1391 |
+
[768]
|
| 1392 |
+
[769]
|
| 1393 |
+
[770]
|
| 1394 |
+
[771]
|
| 1395 |
+
[772]
|
| 1396 |
+
[773]
|
| 1397 |
+
[774]
|
| 1398 |
+
[775]
|
| 1399 |
+
[776]
|
| 1400 |
+
[777]
|
| 1401 |
+
[778]
|
| 1402 |
+
[779]
|
| 1403 |
+
[780]
|
| 1404 |
+
[781]
|
| 1405 |
+
[782]
|
| 1406 |
+
[783]
|
| 1407 |
+
[784]
|
| 1408 |
+
[785]
|
| 1409 |
+
[786]
|
| 1410 |
+
[787]
|
| 1411 |
+
[788]
|
| 1412 |
+
[789]
|
| 1413 |
+
[790]
|
| 1414 |
+
[791]
|
| 1415 |
+
[792]
|
| 1416 |
+
[793]
|
| 1417 |
+
[794]
|
| 1418 |
+
[795]
|
| 1419 |
+
[796]
|
| 1420 |
+
[797]
|
| 1421 |
+
[798]
|
| 1422 |
+
[799]
|
| 1423 |
+
[800]
|
| 1424 |
+
[801]
|
| 1425 |
+
[802]
|
| 1426 |
+
[803]
|
| 1427 |
+
[804]
|
| 1428 |
+
[805]
|
| 1429 |
+
[806]
|
| 1430 |
+
[807]
|
| 1431 |
+
[808]
|
| 1432 |
+
[809]
|
| 1433 |
+
[810]
|
| 1434 |
+
[811]
|
| 1435 |
+
[812]
|
| 1436 |
+
[813]
|
| 1437 |
+
[814]
|
| 1438 |
+
[815]
|
| 1439 |
+
[816]
|
| 1440 |
+
[817]
|
| 1441 |
+
[818]
|
| 1442 |
+
[819]
|
| 1443 |
+
[820]
|
| 1444 |
+
[821]
|
| 1445 |
+
[822]
|
| 1446 |
+
[823]
|
| 1447 |
+
[824]
|
| 1448 |
+
[825]
|
| 1449 |
+
[826]
|
| 1450 |
+
[827]
|
| 1451 |
+
[828]
|
| 1452 |
+
[829]
|
| 1453 |
+
[830]
|
| 1454 |
+
[831]
|
| 1455 |
+
[832]
|
| 1456 |
+
[833]
|
| 1457 |
+
[834]
|
| 1458 |
+
[835]
|
| 1459 |
+
[836]
|
| 1460 |
+
[837]
|
| 1461 |
+
[838]
|
| 1462 |
+
[839]
|
| 1463 |
+
[840]
|
| 1464 |
+
[841]
|
| 1465 |
+
[842]
|
| 1466 |
+
[843]
|
| 1467 |
+
[844]
|
| 1468 |
+
[845]
|
| 1469 |
+
[846]
|
| 1470 |
+
[847]
|
| 1471 |
+
[848]
|
| 1472 |
+
[849]
|
| 1473 |
+
[850]
|
| 1474 |
+
[851]
|
| 1475 |
+
[852]
|
| 1476 |
+
[853]
|
| 1477 |
+
[854]
|
| 1478 |
+
[855]
|
| 1479 |
+
[856]
|
| 1480 |
+
[857]
|
| 1481 |
+
[858]
|
| 1482 |
+
[859]
|
| 1483 |
+
[860]
|
| 1484 |
+
[861]
|
| 1485 |
+
[862]
|
| 1486 |
+
[863]
|
| 1487 |
+
[864]
|
| 1488 |
+
[865]
|
| 1489 |
+
[866]
|
| 1490 |
+
[867]
|
| 1491 |
+
[868]
|
| 1492 |
+
[869]
|
| 1493 |
+
[870]
|
| 1494 |
+
[871]
|
| 1495 |
+
[872]
|
| 1496 |
+
[873]
|
| 1497 |
+
[874]
|
| 1498 |
+
[875]
|
| 1499 |
+
[876]
|
| 1500 |
+
[877]
|
| 1501 |
+
[878]
|
| 1502 |
+
[879]
|
| 1503 |
+
[880]
|
| 1504 |
+
[881]
|
| 1505 |
+
[882]
|
| 1506 |
+
[883]
|
| 1507 |
+
[884]
|
| 1508 |
+
[885]
|
| 1509 |
+
[886]
|
| 1510 |
+
[887]
|
| 1511 |
+
[888]
|
| 1512 |
+
[889]
|
| 1513 |
+
[890]
|
| 1514 |
+
[891]
|
| 1515 |
+
[892]
|
| 1516 |
+
[893]
|
| 1517 |
+
[894]
|
| 1518 |
+
[895]
|
| 1519 |
+
[896]
|
| 1520 |
+
[897]
|
| 1521 |
+
[898]
|
| 1522 |
+
[899]
|
| 1523 |
+
[900]
|
| 1524 |
+
[901]
|
| 1525 |
+
[902]
|
| 1526 |
+
[903]
|
| 1527 |
+
[904]
|
| 1528 |
+
[905]
|
| 1529 |
+
[906]
|
| 1530 |
+
[907]
|
| 1531 |
+
[908]
|
| 1532 |
+
[909]
|
| 1533 |
+
[910]
|
| 1534 |
+
[911]
|
| 1535 |
+
[912]
|
| 1536 |
+
[913]
|
| 1537 |
+
[914]
|
| 1538 |
+
[915]
|
| 1539 |
+
[916]
|
| 1540 |
+
[917]
|
| 1541 |
+
[918]
|
| 1542 |
+
[919]
|
| 1543 |
+
[920]
|
| 1544 |
+
[921]
|
| 1545 |
+
[922]
|
| 1546 |
+
[923]
|
| 1547 |
+
[924]
|
| 1548 |
+
[925]
|
| 1549 |
+
[926]
|
| 1550 |
+
[927]
|
| 1551 |
+
[928]
|
| 1552 |
+
[929]
|
| 1553 |
+
[930]
|
| 1554 |
+
[931]
|
| 1555 |
+
[932]
|
| 1556 |
+
[933]
|
| 1557 |
+
[934]
|
| 1558 |
+
[935]
|
| 1559 |
+
[936]
|
| 1560 |
+
[937]
|
| 1561 |
+
[938]
|
| 1562 |
+
[939]
|
| 1563 |
+
[940]
|
| 1564 |
+
[941]
|
| 1565 |
+
[942]
|
| 1566 |
+
[943]
|
| 1567 |
+
[944]
|
| 1568 |
+
[945]
|
| 1569 |
+
[946]
|
| 1570 |
+
[947]
|
| 1571 |
+
[948]
|
| 1572 |
+
[949]
|
| 1573 |
+
[950]
|
| 1574 |
+
[951]
|
| 1575 |
+
[952]
|
| 1576 |
+
[953]
|
| 1577 |
+
[954]
|
| 1578 |
+
[955]
|
| 1579 |
+
[956]
|
| 1580 |
+
[957]
|
| 1581 |
+
[958]
|
| 1582 |
+
[959]
|
| 1583 |
+
[960]
|
| 1584 |
+
[961]
|
| 1585 |
+
[962]
|
| 1586 |
+
[963]
|
| 1587 |
+
[964]
|
| 1588 |
+
[965]
|
| 1589 |
+
[966]
|
| 1590 |
+
[967]
|
| 1591 |
+
[968]
|
| 1592 |
+
[969]
|
| 1593 |
+
[970]
|
| 1594 |
+
[971]
|
| 1595 |
+
[972]
|
| 1596 |
+
[973]
|
| 1597 |
+
[974]
|
| 1598 |
+
[975]
|
| 1599 |
+
[976]
|
| 1600 |
+
[977]
|
| 1601 |
+
[978]
|
| 1602 |
+
[979]
|
| 1603 |
+
[980]
|
| 1604 |
+
[981]
|
| 1605 |
+
[982]
|
| 1606 |
+
[983]
|
| 1607 |
+
[984]
|
| 1608 |
+
[985]
|
| 1609 |
+
[986]
|
| 1610 |
+
[987]
|
| 1611 |
+
[988]
|
| 1612 |
+
[989]
|
| 1613 |
+
[990]
|
| 1614 |
+
[991]
|
| 1615 |
+
[992]
|
| 1616 |
+
[993]
|
| 1617 |
+
[994]
|
| 1618 |
+
[995]
|
| 1619 |
+
[996]
|
| 1620 |
+
[997]
|
| 1621 |
+
[998]
|
| 1622 |
+
[999]
|
| 1623 |
+
[1000]
|
| 1624 |
+
[1001]
|
| 1625 |
+
[1002]
|
| 1626 |
+
[1003]
|
| 1627 |
+
[1004]
|
| 1628 |
+
[1005]
|
| 1629 |
+
[1006]
|
| 1630 |
+
[1007]
|
| 1631 |
+
[1008]
|
| 1632 |
+
[1009]
|
| 1633 |
+
[1010]
|
| 1634 |
+
[1011]
|
| 1635 |
+
[1012]
|
| 1636 |
+
[1013]
|
| 1637 |
+
[1014]
|
| 1638 |
+
[1015]
|
| 1639 |
+
[1016]
|
| 1640 |
+
[1017]
|
| 1641 |
+
[1018]
|
| 1642 |
+
[1019]
|
| 1643 |
+
[1020]
|
| 1644 |
+
[1021]
|
| 1645 |
+
[1022]
|
| 1646 |
+
[1023]
|
| 1647 |
+
[1024]
|
| 1648 |
+
[1025]
|
| 1649 |
+
[1026]
|
| 1650 |
+
[1027]
|
| 1651 |
+
[1028]
|
| 1652 |
+
[1029]
|
| 1653 |
+
[1030]
|
| 1654 |
+
[1031]
|
| 1655 |
+
[1032]
|
| 1656 |
+
[1033]
|
| 1657 |
+
[1034]
|
| 1658 |
+
[1035]
|
| 1659 |
+
[1036]
|
| 1660 |
+
[1037]
|
| 1661 |
+
[1038]
|
| 1662 |
+
[1039]
|
| 1663 |
+
[1040]
|
| 1664 |
+
[1041]
|
| 1665 |
+
[1042]
|
| 1666 |
+
[1043]
|
| 1667 |
+
[1044]
|
| 1668 |
+
[1045]
|
| 1669 |
+
[1046]
|
| 1670 |
+
[1047]
|
| 1671 |
+
[1048]
|
| 1672 |
+
[1049]
|
| 1673 |
+
[1050]
|
| 1674 |
+
[1051]
|
| 1675 |
+
[1052]
|
| 1676 |
+
[1053]
|
| 1677 |
+
[1054]
|
| 1678 |
+
[1055]
|
| 1679 |
+
[1056]
|
| 1680 |
+
[1057]
|
| 1681 |
+
[1058]
|
| 1682 |
+
[1059]
|
| 1683 |
+
[1060]
|
| 1684 |
+
[1061]
|
| 1685 |
+
[1062]
|
| 1686 |
+
[1063]
|
| 1687 |
+
[1064]
|
| 1688 |
+
[1065]
|
| 1689 |
+
[1066]
|
| 1690 |
+
[1067]
|
| 1691 |
+
[1068]
|
| 1692 |
+
[1069]
|
| 1693 |
+
[1070]
|
| 1694 |
+
[1071]
|
| 1695 |
+
[1072]
|
| 1696 |
+
[1073]
|
| 1697 |
+
[1074]
|
| 1698 |
+
[1075]
|
| 1699 |
+
[1076]
|
| 1700 |
+
[1077]
|
| 1701 |
+
[1078]
|
| 1702 |
+
[1079]
|
| 1703 |
+
[1080]
|
| 1704 |
+
[1081]
|
| 1705 |
+
[1082]
|
| 1706 |
+
[1083]
|
| 1707 |
+
[1084]
|
| 1708 |
+
[1085]
|
| 1709 |
+
[1086]
|
| 1710 |
+
[1087]
|
| 1711 |
+
[1088]
|
| 1712 |
+
[1089]
|
| 1713 |
+
[1090]
|
| 1714 |
+
[1091]
|
| 1715 |
+
[1092]
|
| 1716 |
+
[1093]
|
| 1717 |
+
[1094]
|
| 1718 |
+
[1095]
|
| 1719 |
+
[1096]
|
| 1720 |
+
[1097]
|
| 1721 |
+
[1098]
|
| 1722 |
+
[1099]
|
| 1723 |
+
[1100]
|
| 1724 |
+
[1101]
|
| 1725 |
+
[1102]
|
| 1726 |
+
[1103]
|
| 1727 |
+
[1104]
|
| 1728 |
+
[1105]
|
| 1729 |
+
[1106]
|
| 1730 |
+
[1107]
|
| 1731 |
+
[1108]
|
| 1732 |
+
[1109]
|
| 1733 |
+
[1110]
|
| 1734 |
+
[1111]
|
| 1735 |
+
[1112]
|
| 1736 |
+
[1113]
|
| 1737 |
+
[1114]
|
| 1738 |
+
[1115]
|
| 1739 |
+
[1116]
|
| 1740 |
+
[1117]
|
| 1741 |
+
[1118]
|
| 1742 |
+
[1119]
|
| 1743 |
+
[1120]
|
| 1744 |
+
[1121]
|
| 1745 |
+
[1122]
|
| 1746 |
+
[1123]
|
| 1747 |
+
[1124]
|
| 1748 |
+
[1125]
|
| 1749 |
+
[1126]
|
| 1750 |
+
[1127]
|
| 1751 |
+
[1128]
|
| 1752 |
+
[1129]
|
| 1753 |
+
[1130]
|
| 1754 |
+
[1131]
|
| 1755 |
+
[1132]
|
| 1756 |
+
[1133]
|
| 1757 |
+
[1134]
|
| 1758 |
+
[1135]
|
| 1759 |
+
[1136]
|
| 1760 |
+
[1137]
|
| 1761 |
+
[1138]
|
| 1762 |
+
[1139]
|
| 1763 |
+
[1140]
|
| 1764 |
+
[1141]
|
| 1765 |
+
[1142]
|
| 1766 |
+
[1143]
|
| 1767 |
+
[1144]
|
| 1768 |
+
[1145]
|
| 1769 |
+
[1146]
|
| 1770 |
+
[1147]
|
| 1771 |
+
[1148]
|
| 1772 |
+
[1149]
|
| 1773 |
+
[1150]
|
| 1774 |
+
[1151]
|
| 1775 |
+
[1152]
|
| 1776 |
+
[1153]
|
| 1777 |
+
[1154]
|
| 1778 |
+
[1155]
|
| 1779 |
+
[1156]
|
| 1780 |
+
[1157]
|
| 1781 |
+
[1158]
|
| 1782 |
+
[1159]
|
| 1783 |
+
[1160]
|
| 1784 |
+
[1161]
|
| 1785 |
+
[1162]
|
| 1786 |
+
[1163]
|
| 1787 |
+
[1164]
|
| 1788 |
+
[1165]
|
| 1789 |
+
[1166]
|
| 1790 |
+
[1167]
|
| 1791 |
+
[1168]
|
| 1792 |
+
[1169]
|
| 1793 |
+
[1170]
|
| 1794 |
+
[1171]
|
| 1795 |
+
[1172]
|
| 1796 |
+
[1173]
|
| 1797 |
+
[1174]
|
| 1798 |
+
[1175]
|
| 1799 |
+
[1176]
|
| 1800 |
+
[1177]
|
| 1801 |
+
[1178]
|
| 1802 |
+
[1179]
|
| 1803 |
+
[1180]
|
| 1804 |
+
[1181]
|
| 1805 |
+
[1182]
|
| 1806 |
+
[1183]
|
| 1807 |
+
[1184]
|
| 1808 |
+
[1185]
|
| 1809 |
+
[1186]
|
| 1810 |
+
[1187]
|
| 1811 |
+
[1188]
|
| 1812 |
+
[1189]
|
| 1813 |
+
[1190]
|
| 1814 |
+
[1191]
|
| 1815 |
+
[1192]
|
| 1816 |
+
[1193]
|
| 1817 |
+
[1194]
|
| 1818 |
+
[1195]
|
| 1819 |
+
[1196]
|
| 1820 |
+
[1197]
|
| 1821 |
+
[1198]
|
| 1822 |
+
[1199]
|
| 1823 |
+
[1200]
|
| 1824 |
+
[1201]
|
| 1825 |
+
[1202]
|
| 1826 |
+
[1203]
|
| 1827 |
+
[1204]
|
| 1828 |
+
[1205]
|
| 1829 |
+
[1206]
|
| 1830 |
+
[1207]
|
| 1831 |
+
[1208]
|
| 1832 |
+
[1209]
|
| 1833 |
+
[1210]
|
| 1834 |
+
[1211]
|
| 1835 |
+
[1212]
|
| 1836 |
+
[1213]
|
| 1837 |
+
[1214]
|
| 1838 |
+
[1215]
|
| 1839 |
+
[1216]
|
| 1840 |
+
[1217]
|
| 1841 |
+
[1218]
|
| 1842 |
+
[1219]
|
| 1843 |
+
[1220]
|
| 1844 |
+
[1221]
|
| 1845 |
+
[1222]
|
| 1846 |
+
[1223]
|
| 1847 |
+
[1224]
|
| 1848 |
+
[1225]
|
| 1849 |
+
[1226]
|
| 1850 |
+
[1227]
|
| 1851 |
+
[1228]
|
| 1852 |
+
[1229]
|
| 1853 |
+
[1230]
|
| 1854 |
+
[1231]
|
| 1855 |
+
[1232]
|
| 1856 |
+
[1233]
|
| 1857 |
+
[1234]
|
| 1858 |
+
[1235]
|
| 1859 |
+
[1236]
|
| 1860 |
+
[1237]
|
| 1861 |
+
[1238]
|
| 1862 |
+
[1239]
|
| 1863 |
+
[1240]
|
| 1864 |
+
[1241]
|
| 1865 |
+
[1242]
|
| 1866 |
+
[1243]
|
| 1867 |
+
[1244]
|
| 1868 |
+
[1245]
|
| 1869 |
+
[1246]
|
| 1870 |
+
[1247]
|
| 1871 |
+
[1248]
|
| 1872 |
+
[1249]
|
| 1873 |
+
[1250]
|
| 1874 |
+
[1251]
|
| 1875 |
+
[1252]
|
| 1876 |
+
[1253]
|
| 1877 |
+
[1254]
|
| 1878 |
+
[1255]
|
| 1879 |
+
[1256]
|
| 1880 |
+
[1257]
|
| 1881 |
+
[1258]
|
| 1882 |
+
[1259]
|
| 1883 |
+
[1260]
|
| 1884 |
+
[1261]
|
| 1885 |
+
[1262]
|
| 1886 |
+
[1263]
|
| 1887 |
+
[1264]
|
| 1888 |
+
[1265]
|
| 1889 |
+
[1266]
|
| 1890 |
+
[1267]
|
| 1891 |
+
[1268]
|
| 1892 |
+
[1269]
|
| 1893 |
+
[1270]
|
| 1894 |
+
[1271]
|
| 1895 |
+
[1272]
|
| 1896 |
+
[1273]
|
| 1897 |
+
[1274]
|
| 1898 |
+
[1275]
|
| 1899 |
+
[1276]
|
| 1900 |
+
[1277]
|
| 1901 |
+
[1278]
|
| 1902 |
+
[1279]
|
| 1903 |
+
[1280]
|
| 1904 |
+
[1281]
|
| 1905 |
+
[1282]
|
| 1906 |
+
[1283]
|
| 1907 |
+
[1284]
|
| 1908 |
+
[1285]
|
| 1909 |
+
[1286]
|
| 1910 |
+
[1287]
|
| 1911 |
+
[1288]
|
| 1912 |
+
[1289]
|
| 1913 |
+
[1290]
|
| 1914 |
+
[1291]
|
| 1915 |
+
[1292]
|
| 1916 |
+
[1293]
|
| 1917 |
+
[1294]
|
| 1918 |
+
[1295]
|
| 1919 |
+
[1296]
|
| 1920 |
+
[1297]
|
| 1921 |
+
[1298]
|
| 1922 |
+
[1299]
|
| 1923 |
+
[1300]
|
| 1924 |
+
[1301]
|
| 1925 |
+
[1302]
|
| 1926 |
+
[1303]
|
| 1927 |
+
[1304]
|
| 1928 |
+
[1305]
|
| 1929 |
+
[1306]
|
| 1930 |
+
[1307]
|
| 1931 |
+
[1308]
|
| 1932 |
+
[1309]
|
| 1933 |
+
[1310]
|
| 1934 |
+
[1311]
|
| 1935 |
+
[1312]
|
| 1936 |
+
[1313]
|
| 1937 |
+
[1314]
|
| 1938 |
+
[1315]
|
| 1939 |
+
[1316]
|
| 1940 |
+
[1317]
|
| 1941 |
+
[1318]
|
| 1942 |
+
[1319]
|
| 1943 |
+
[1320]
|
| 1944 |
+
[1321]
|
| 1945 |
+
[1322]
|
| 1946 |
+
[1323]
|
| 1947 |
+
[1324]
|
| 1948 |
+
[1325]
|
| 1949 |
+
[1326]
|
| 1950 |
+
[1327]
|
| 1951 |
+
[1328]
|
| 1952 |
+
[1329]
|
| 1953 |
+
[1330]
|
| 1954 |
+
[1331]
|
| 1955 |
+
[1332]
|
| 1956 |
+
[1333]
|
| 1957 |
+
[1334]
|
| 1958 |
+
[1335]
|
| 1959 |
+
[1336]
|
| 1960 |
+
[1337]
|
| 1961 |
+
[1338]
|
| 1962 |
+
[1339]
|
| 1963 |
+
[1340]
|
| 1964 |
+
[1341]
|
| 1965 |
+
[1342]
|
| 1966 |
+
[1343]
|
| 1967 |
+
[1344]
|
| 1968 |
+
[1345]
|
| 1969 |
+
[1346]
|
| 1970 |
+
[1347]
|
| 1971 |
+
[1348]
|
| 1972 |
+
[1349]
|
| 1973 |
+
[1350]
|
| 1974 |
+
[1351]
|
| 1975 |
+
[1352]
|
| 1976 |
+
[1353]
|
| 1977 |
+
[1354]
|
| 1978 |
+
[1355]
|
| 1979 |
+
[1356]
|
| 1980 |
+
[1357]
|
| 1981 |
+
[1358]
|
| 1982 |
+
[1359]
|
| 1983 |
+
[1360]
|
| 1984 |
+
[1361]
|
| 1985 |
+
[1362]
|
| 1986 |
+
[1363]
|
| 1987 |
+
[1364]
|
| 1988 |
+
[1365]
|
| 1989 |
+
[1366]
|
| 1990 |
+
[1367]
|
| 1991 |
+
[1368]
|
| 1992 |
+
[1369]
|
| 1993 |
+
[1370]
|
| 1994 |
+
[1371]
|
| 1995 |
+
[1372]
|
| 1996 |
+
[1373]
|
| 1997 |
+
[1374]
|
| 1998 |
+
[1375]
|
| 1999 |
+
[1376]
|
| 2000 |
+
[1377]
|
| 2001 |
+
[1378]
|
| 2002 |
+
[1379]
|
| 2003 |
+
[1380]
|
| 2004 |
+
[1381]
|
| 2005 |
+
[1382]
|
| 2006 |
+
[1383]
|
| 2007 |
+
[1384]
|
| 2008 |
+
[1385]
|
| 2009 |
+
[1386]
|
| 2010 |
+
[1387]
|
| 2011 |
+
[1388]
|
| 2012 |
+
[1389]
|
| 2013 |
+
[1390]
|
| 2014 |
+
[1391]
|
| 2015 |
+
[1392]
|
| 2016 |
+
[1393]
|
| 2017 |
+
[1394]
|
| 2018 |
+
[1395]
|
| 2019 |
+
[1396]
|
| 2020 |
+
[1397]
|
| 2021 |
+
[1398]
|
| 2022 |
+
[1399]
|
| 2023 |
+
[1400]
|
| 2024 |
+
[1401]
|
| 2025 |
+
[1402]
|
| 2026 |
+
[1403]
|
| 2027 |
+
[1404]
|
| 2028 |
+
[1405]
|
| 2029 |
+
[1406]
|
| 2030 |
+
[1407]
|
| 2031 |
+
[1408]
|
| 2032 |
+
[1409]
|
| 2033 |
+
[1410]
|
| 2034 |
+
[1411]
|
| 2035 |
+
[1412]
|
| 2036 |
+
[1413]
|
| 2037 |
+
[1414]
|
| 2038 |
+
[1415]
|
| 2039 |
+
[1416]
|
| 2040 |
+
[1417]
|
| 2041 |
+
[1418]
|
| 2042 |
+
[1419]
|
| 2043 |
+
[1420]
|
| 2044 |
+
[1421]
|
| 2045 |
+
[1422]
|
| 2046 |
+
[1423]
|
| 2047 |
+
[1424]
|
| 2048 |
+
[1425]
|
| 2049 |
+
[1426]
|
| 2050 |
+
[1427]
|
| 2051 |
+
[1428]
|
| 2052 |
+
[1429]
|
| 2053 |
+
[1430]
|
| 2054 |
+
[1431]
|
| 2055 |
+
[1432]
|
| 2056 |
+
[1433]
|
| 2057 |
+
[1434]
|
| 2058 |
+
[1435]
|
| 2059 |
+
[1436]
|
| 2060 |
+
[1437]
|
| 2061 |
+
[1438]
|
| 2062 |
+
[1439]
|
| 2063 |
+
[1440]
|
| 2064 |
+
[1441]
|
| 2065 |
+
[1442]
|
| 2066 |
+
[1443]
|
| 2067 |
+
[1444]
|
| 2068 |
+
[1445]
|
| 2069 |
+
[1446]
|
| 2070 |
+
[1447]
|
| 2071 |
+
[1448]
|
| 2072 |
+
[1449]
|
| 2073 |
+
[1450]
|
| 2074 |
+
[1451]
|
| 2075 |
+
[1452]
|
| 2076 |
+
[1453]
|
| 2077 |
+
[1454]
|
| 2078 |
+
[1455]
|
| 2079 |
+
[1456]
|
| 2080 |
+
[1457]
|
| 2081 |
+
[1458]
|
| 2082 |
+
[1459]
|
| 2083 |
+
[1460]
|
| 2084 |
+
[1461]
|
| 2085 |
+
[1462]
|
| 2086 |
+
[1463]
|
| 2087 |
+
[1464]
|
| 2088 |
+
[1465]
|
| 2089 |
+
[1466]
|
| 2090 |
+
[1467]
|
| 2091 |
+
[1468]
|
| 2092 |
+
[1469]
|
| 2093 |
+
[1470]
|
| 2094 |
+
[1471]
|
| 2095 |
+
[1472]
|
| 2096 |
+
[1473]
|
| 2097 |
+
[1474]
|
| 2098 |
+
[1475]
|
| 2099 |
+
[1476]
|
| 2100 |
+
[1477]
|
| 2101 |
+
[1478]
|
| 2102 |
+
[1479]
|
| 2103 |
+
[1480]
|
| 2104 |
+
[1481]
|
| 2105 |
+
[1482]
|
| 2106 |
+
[1483]
|
| 2107 |
+
[1484]
|
| 2108 |
+
[1485]
|
| 2109 |
+
[1486]
|
| 2110 |
+
[1487]
|
| 2111 |
+
[1488]
|
| 2112 |
+
[1489]
|
| 2113 |
+
[1490]
|
| 2114 |
+
[1491]
|
| 2115 |
+
[1492]
|
| 2116 |
+
[1493]
|
| 2117 |
+
[1494]
|
| 2118 |
+
[1495]
|
| 2119 |
+
[1496]
|
| 2120 |
+
[1497]
|
| 2121 |
+
[1498]
|
| 2122 |
+
[1499]
|
| 2123 |
+
[1500]
|
| 2124 |
+
[1501]
|
| 2125 |
+
[1502]
|
| 2126 |
+
[1503]
|
| 2127 |
+
[1504]
|
| 2128 |
+
[1505]
|
| 2129 |
+
[1506]
|
| 2130 |
+
[1507]
|
| 2131 |
+
[1508]
|
| 2132 |
+
[1509]
|
| 2133 |
+
[1510]
|
| 2134 |
+
[1511]
|
| 2135 |
+
[1512]
|
| 2136 |
+
[1513]
|
| 2137 |
+
[1514]
|
| 2138 |
+
[1515]
|
| 2139 |
+
[1516]
|
| 2140 |
+
[1517]
|
| 2141 |
+
[1518]
|
| 2142 |
+
[1519]
|
| 2143 |
+
[1520]
|
| 2144 |
+
[1521]
|
| 2145 |
+
[1522]
|
| 2146 |
+
[1523]
|
| 2147 |
+
[1524]
|
| 2148 |
+
[1525]
|
| 2149 |
+
[1526]
|
| 2150 |
+
[1527]
|
| 2151 |
+
[1528]
|
| 2152 |
+
[1529]
|
| 2153 |
+
[1530]
|
| 2154 |
+
[1531]
|
| 2155 |
+
[1532]
|
| 2156 |
+
[1533]
|
| 2157 |
+
[1534]
|
| 2158 |
+
[1535]
|
| 2159 |
+
[1536]
|
| 2160 |
+
[1537]
|
| 2161 |
+
[1538]
|
| 2162 |
+
[1539]
|
| 2163 |
+
[1540]
|
| 2164 |
+
[1541]
|
| 2165 |
+
[1542]
|
| 2166 |
+
[1543]
|
| 2167 |
+
[1544]
|
| 2168 |
+
[1545]
|
| 2169 |
+
[1546]
|
| 2170 |
+
[1547]
|
| 2171 |
+
[1548]
|
| 2172 |
+
[1549]
|
| 2173 |
+
[1550]
|
| 2174 |
+
[1551]
|
| 2175 |
+
[1552]
|
| 2176 |
+
[1553]
|
| 2177 |
+
[1554]
|
| 2178 |
+
[1555]
|
| 2179 |
+
[1556]
|
| 2180 |
+
[1557]
|
| 2181 |
+
[1558]
|
| 2182 |
+
[1559]
|
| 2183 |
+
[1560]
|
| 2184 |
+
[1561]
|
| 2185 |
+
[1562]
|
| 2186 |
+
[1563]
|
| 2187 |
+
[1564]
|
| 2188 |
+
[1565]
|
| 2189 |
+
[1566]
|
| 2190 |
+
[1567]
|
| 2191 |
+
[1568]
|
| 2192 |
+
[1569]
|
| 2193 |
+
[1570]
|
| 2194 |
+
[1571]
|
| 2195 |
+
[1572]
|
| 2196 |
+
[1573]
|
| 2197 |
+
[1574]
|
| 2198 |
+
[1575]
|
| 2199 |
+
[1576]
|
| 2200 |
+
[1577]
|
| 2201 |
+
[1578]
|
| 2202 |
+
[1579]
|
| 2203 |
+
[1580]
|
| 2204 |
+
[1581]
|
| 2205 |
+
[1582]
|
| 2206 |
+
[1583]
|
| 2207 |
+
[1584]
|
| 2208 |
+
[1585]
|
| 2209 |
+
[1586]
|
| 2210 |
+
[1587]
|
| 2211 |
+
[1588]
|
| 2212 |
+
[1589]
|
| 2213 |
+
[1590]
|
| 2214 |
+
[1591]
|
| 2215 |
+
[1592]
|
| 2216 |
+
[1593]
|
| 2217 |
+
[1594]
|
| 2218 |
+
[1595]
|
| 2219 |
+
[1596]
|
| 2220 |
+
[1597]
|
| 2221 |
+
[1598]
|
| 2222 |
+
[1599]
|
| 2223 |
+
[1600]
|
| 2224 |
+
[1601]
|
| 2225 |
+
[1602]
|
| 2226 |
+
[1603]
|
| 2227 |
+
[1604]
|
| 2228 |
+
[1605]
|
| 2229 |
+
[1606]
|
| 2230 |
+
[1607]
|
| 2231 |
+
[1608]
|
| 2232 |
+
[1609]
|
| 2233 |
+
[1610]
|
| 2234 |
+
[1611]
|
| 2235 |
+
[1612]
|
| 2236 |
+
[1613]
|
| 2237 |
+
[1614]
|
| 2238 |
+
[1615]
|
| 2239 |
+
[1616]
|
| 2240 |
+
[1617]
|
| 2241 |
+
[1618]
|
| 2242 |
+
[1619]
|
| 2243 |
+
[1620]
|
| 2244 |
+
[1621]
|
| 2245 |
+
[1622]
|
| 2246 |
+
[1623]
|
| 2247 |
+
[1624]
|
| 2248 |
+
[1625]
|
| 2249 |
+
[1626]
|
| 2250 |
+
[1627]
|
| 2251 |
+
[1628]
|
| 2252 |
+
[1629]
|
| 2253 |
+
[1630]
|
| 2254 |
+
[1631]
|
| 2255 |
+
[1632]
|
| 2256 |
+
[1633]
|
| 2257 |
+
[1634]
|
| 2258 |
+
[1635]
|
| 2259 |
+
[1636]
|
| 2260 |
+
[1637]
|
| 2261 |
+
[1638]
|
| 2262 |
+
[1639]
|
| 2263 |
+
[1640]
|
| 2264 |
+
[1641]
|
| 2265 |
+
[1642]
|
| 2266 |
+
[1643]
|
| 2267 |
+
[1644]
|
| 2268 |
+
[1645]
|
| 2269 |
+
[1646]
|
| 2270 |
+
[1647]
|
| 2271 |
+
[1648]
|
| 2272 |
+
[1649]
|
| 2273 |
+
[1650]
|
| 2274 |
+
[1651]
|
| 2275 |
+
[1652]
|
| 2276 |
+
[1653]
|
| 2277 |
+
[1654]
|
| 2278 |
+
[1655]
|
| 2279 |
+
[1656]
|
| 2280 |
+
[1657]
|
| 2281 |
+
[1658]
|
| 2282 |
+
[1659]
|
| 2283 |
+
[1660]
|
| 2284 |
+
[1661]
|
| 2285 |
+
[1662]
|
| 2286 |
+
[1663]
|
| 2287 |
+
[1664]
|
| 2288 |
+
[1665]
|
| 2289 |
+
[1666]
|
| 2290 |
+
[1667]
|
| 2291 |
+
[1668]
|
| 2292 |
+
[1669]
|
| 2293 |
+
[1670]
|
| 2294 |
+
[1671]
|
| 2295 |
+
[1672]
|
| 2296 |
+
[1673]
|
| 2297 |
+
[1674]
|
| 2298 |
+
[1675]
|
| 2299 |
+
[1676]
|
| 2300 |
+
[1677]
|
| 2301 |
+
[1678]
|
| 2302 |
+
[1679]
|
| 2303 |
+
[1680]
|
| 2304 |
+
[1681]
|
| 2305 |
+
[1682]
|
| 2306 |
+
[1683]
|
| 2307 |
+
[1684]
|
| 2308 |
+
[1685]
|
| 2309 |
+
[1686]
|
| 2310 |
+
[1687]
|
| 2311 |
+
[1688]
|
| 2312 |
+
[1689]
|
| 2313 |
+
[1690]
|
| 2314 |
+
[1691]
|
| 2315 |
+
[1692]
|
| 2316 |
+
[1693]
|
| 2317 |
+
[1694]
|
| 2318 |
+
[1695]
|
| 2319 |
+
[1696]
|
| 2320 |
+
[1697]
|
| 2321 |
+
[1698]
|
| 2322 |
+
[1699]
|
| 2323 |
+
[1700]
|
| 2324 |
+
[1701]
|
| 2325 |
+
[1702]
|
| 2326 |
+
[1703]
|
| 2327 |
+
[1704]
|
| 2328 |
+
[1705]
|
| 2329 |
+
[1706]
|
| 2330 |
+
[1707]
|
| 2331 |
+
[1708]
|
| 2332 |
+
[1709]
|
| 2333 |
+
[1710]
|
| 2334 |
+
[1711]
|
| 2335 |
+
[1712]
|
| 2336 |
+
[1713]
|
| 2337 |
+
[1714]
|
| 2338 |
+
[1715]
|
| 2339 |
+
[1716]
|
| 2340 |
+
[1717]
|
| 2341 |
+
[1718]
|
| 2342 |
+
[1719]
|
| 2343 |
+
[1720]
|
| 2344 |
+
[1721]
|
| 2345 |
+
[1722]
|
| 2346 |
+
[1723]
|
| 2347 |
+
[1724]
|
| 2348 |
+
[1725]
|
| 2349 |
+
[1726]
|
| 2350 |
+
[1727]
|
| 2351 |
+
[1728]
|
| 2352 |
+
[1729]
|
| 2353 |
+
[1730]
|
| 2354 |
+
[1731]
|
| 2355 |
+
[1732]
|
| 2356 |
+
[1733]
|
| 2357 |
+
[1734]
|
| 2358 |
+
[1735]
|
| 2359 |
+
[1736]
|
| 2360 |
+
[1737]
|
| 2361 |
+
[1738]
|
| 2362 |
+
[1739]
|
| 2363 |
+
[1740]
|
| 2364 |
+
[1741]
|
| 2365 |
+
[1742]
|
| 2366 |
+
[1743]
|
| 2367 |
+
[1744]
|
| 2368 |
+
[1745]
|
| 2369 |
+
[1746]
|
| 2370 |
+
[1747]
|
| 2371 |
+
[1748]
|
| 2372 |
+
[1749]
|
| 2373 |
+
[1750]
|
| 2374 |
+
[1751]
|
| 2375 |
+
[1752]
|
| 2376 |
+
[1753]
|
| 2377 |
+
[1754]
|
| 2378 |
+
[1755]
|
| 2379 |
+
[1756]
|
| 2380 |
+
[1757]
|
| 2381 |
+
[1758]
|
| 2382 |
+
[1759]
|
| 2383 |
+
[1760]
|
| 2384 |
+
[1761]
|
| 2385 |
+
[1762]
|
| 2386 |
+
[1763]
|
| 2387 |
+
[1764]
|
| 2388 |
+
[1765]
|
| 2389 |
+
[1766]
|
| 2390 |
+
[1767]
|
| 2391 |
+
[1768]
|
| 2392 |
+
[1769]
|
| 2393 |
+
[1770]
|
| 2394 |
+
[1771]
|
| 2395 |
+
[1772]
|
| 2396 |
+
[1773]
|
| 2397 |
+
[1774]
|
| 2398 |
+
[1775]
|
| 2399 |
+
[1776]
|
| 2400 |
+
[1777]
|
| 2401 |
+
[1778]
|
| 2402 |
+
[1779]
|
| 2403 |
+
[1780]
|
| 2404 |
+
[1781]
|
| 2405 |
+
[1782]
|
| 2406 |
+
[1783]
|
| 2407 |
+
[1784]
|
| 2408 |
+
[1785]
|
| 2409 |
+
[1786]
|
| 2410 |
+
[1787]
|
| 2411 |
+
[1788]
|
| 2412 |
+
[1789]
|
| 2413 |
+
[1790]
|
| 2414 |
+
[1791]
|
| 2415 |
+
[1792]
|
| 2416 |
+
[1793]
|
| 2417 |
+
[1794]
|
| 2418 |
+
[1795]
|
| 2419 |
+
[1796]
|
| 2420 |
+
[1797]
|
| 2421 |
+
[1798]
|
| 2422 |
+
[1799]
|
| 2423 |
+
[1800]
|
| 2424 |
+
[1801]
|
| 2425 |
+
[1802]
|
| 2426 |
+
[1803]
|
| 2427 |
+
[1804]
|
| 2428 |
+
[1805]
|
| 2429 |
+
[1806]
|
| 2430 |
+
[1807]
|
| 2431 |
+
[1808]
|
| 2432 |
+
[1809]
|
| 2433 |
+
[1810]
|
| 2434 |
+
[1811]
|
| 2435 |
+
[1812]
|
| 2436 |
+
[1813]
|
| 2437 |
+
[1814]
|
| 2438 |
+
[1815]
|
| 2439 |
+
[1816]
|
| 2440 |
+
[1817]
|
| 2441 |
+
[1818]
|
| 2442 |
+
[1819]
|
| 2443 |
+
[1820]
|
| 2444 |
+
[1821]
|
| 2445 |
+
[1822]
|
| 2446 |
+
[1823]
|
| 2447 |
+
[1824]
|
| 2448 |
+
[1825]
|
| 2449 |
+
[1826]
|
| 2450 |
+
[1827]
|
| 2451 |
+
[1828]
|
| 2452 |
+
[1829]
|
| 2453 |
+
[1830]
|
| 2454 |
+
[1831]
|
| 2455 |
+
[1832]
|
| 2456 |
+
[1833]
|
| 2457 |
+
[1834]
|
| 2458 |
+
[1835]
|
| 2459 |
+
[1836]
|
| 2460 |
+
[1837]
|
| 2461 |
+
[1838]
|
| 2462 |
+
[1839]
|
| 2463 |
+
[1840]
|
| 2464 |
+
[1841]
|
| 2465 |
+
[1842]
|
| 2466 |
+
[1843]
|
| 2467 |
+
[1844]
|
| 2468 |
+
[1845]
|
| 2469 |
+
[1846]
|
| 2470 |
+
[1847]
|
| 2471 |
+
[1848]
|
| 2472 |
+
[1849]
|
| 2473 |
+
[1850]
|
| 2474 |
+
[1851]
|
| 2475 |
+
[1852]
|
| 2476 |
+
[1853]
|
| 2477 |
+
[1854]
|
| 2478 |
+
[1855]
|
| 2479 |
+
[1856]
|
| 2480 |
+
[1857]
|
| 2481 |
+
[1858]
|
| 2482 |
+
[1859]
|
| 2483 |
+
[1860]
|
| 2484 |
+
[1861]
|
| 2485 |
+
[1862]
|
| 2486 |
+
[1863]
|
| 2487 |
+
[1864]
|
| 2488 |
+
[1865]
|
| 2489 |
+
[1866]
|
| 2490 |
+
[1867]
|
| 2491 |
+
[1868]
|
| 2492 |
+
[1869]
|
| 2493 |
+
[1870]
|
| 2494 |
+
[1871]
|
| 2495 |
+
[1872]
|
| 2496 |
+
[1873]
|
| 2497 |
+
[1874]
|
| 2498 |
+
[1875]
|
| 2499 |
+
[1876]
|
| 2500 |
+
[1877]
|
| 2501 |
+
[1878]
|
| 2502 |
+
[1879]
|
| 2503 |
+
[1880]
|
| 2504 |
+
[1881]
|
| 2505 |
+
[1882]
|
| 2506 |
+
[1883]
|
| 2507 |
+
[1884]
|
| 2508 |
+
[1885]
|
| 2509 |
+
[1886]
|
| 2510 |
+
[1887]
|
| 2511 |
+
[1888]
|
| 2512 |
+
[1889]
|
| 2513 |
+
[1890]
|
| 2514 |
+
[1891]
|
| 2515 |
+
[1892]
|
| 2516 |
+
[1893]
|
| 2517 |
+
[1894]
|
| 2518 |
+
[1895]
|
| 2519 |
+
[1896]
|
| 2520 |
+
[1897]
|
| 2521 |
+
[1898]
|
| 2522 |
+
[1899]
|
| 2523 |
+
[1900]
|
| 2524 |
+
[1901]
|
| 2525 |
+
[1902]
|
| 2526 |
+
[1903]
|
| 2527 |
+
[1904]
|
| 2528 |
+
[1905]
|
| 2529 |
+
[1906]
|
| 2530 |
+
[1907]
|
| 2531 |
+
[1908]
|
| 2532 |
+
[1909]
|
| 2533 |
+
[1910]
|
| 2534 |
+
[1911]
|
| 2535 |
+
[1912]
|
| 2536 |
+
[1913]
|
| 2537 |
+
[1914]
|
| 2538 |
+
[1915]
|
| 2539 |
+
[1916]
|
| 2540 |
+
[1917]
|
| 2541 |
+
[1918]
|
| 2542 |
+
[1919]
|
| 2543 |
+
[1920]
|
| 2544 |
+
[1921]
|
| 2545 |
+
[1922]
|
| 2546 |
+
[1923]
|
| 2547 |
+
[1924]
|
| 2548 |
+
[1925]
|
| 2549 |
+
[1926]
|
| 2550 |
+
[1927]
|
| 2551 |
+
[1928]
|
| 2552 |
+
[1929]
|
| 2553 |
+
[1930]
|
| 2554 |
+
[1931]
|
| 2555 |
+
[1932]
|
| 2556 |
+
[1933]
|
| 2557 |
+
[1934]
|
| 2558 |
+
[1935]
|
| 2559 |
+
[1936]
|
| 2560 |
+
[1937]
|
| 2561 |
+
[1938]
|
| 2562 |
+
[1939]
|
| 2563 |
+
[1940]
|
| 2564 |
+
[1941]
|
| 2565 |
+
[1942]
|
| 2566 |
+
[1943]
|
| 2567 |
+
[1944]
|
| 2568 |
+
[1945]
|
| 2569 |
+
[1946]
|
| 2570 |
+
[1947]
|
| 2571 |
+
[1948]
|
| 2572 |
+
[1949]
|
| 2573 |
+
[1950]
|
| 2574 |
+
[1951]
|
| 2575 |
+
[1952]
|
| 2576 |
+
[1953]
|
| 2577 |
+
[1954]
|
| 2578 |
+
[1955]
|
| 2579 |
+
[1956]
|
| 2580 |
+
[1957]
|
| 2581 |
+
[1958]
|
| 2582 |
+
[1959]
|
| 2583 |
+
[1960]
|
| 2584 |
+
[1961]
|
| 2585 |
+
[1962]
|
| 2586 |
+
[1963]
|
| 2587 |
+
[1964]
|
| 2588 |
+
[1965]
|
| 2589 |
+
[1966]
|
| 2590 |
+
[1967]
|
| 2591 |
+
[1968]
|
| 2592 |
+
[1969]
|
| 2593 |
+
[1970]
|
| 2594 |
+
[1971]
|
| 2595 |
+
[1972]
|
| 2596 |
+
[1973]
|
| 2597 |
+
[1974]
|
| 2598 |
+
[1975]
|
| 2599 |
+
[1976]
|
| 2600 |
+
[1977]
|
| 2601 |
+
[1978]
|
| 2602 |
+
[1979]
|
| 2603 |
+
[1980]
|
| 2604 |
+
[1981]
|
| 2605 |
+
[1982]
|
| 2606 |
+
[1983]
|
| 2607 |
+
[1984]
|
| 2608 |
+
[1985]
|
| 2609 |
+
[1986]
|
| 2610 |
+
[1987]
|
| 2611 |
+
[1988]
|
| 2612 |
+
[1989]
|
| 2613 |
+
[1990]
|
| 2614 |
+
[1991]
|
| 2615 |
+
[1992]
|
| 2616 |
+
[1993]
|
| 2617 |
+
[1994]
|
| 2618 |
+
[1995]
|
| 2619 |
+
[1996]
|
| 2620 |
+
[1997]
|
| 2621 |
+
[1998]
|
| 2622 |
+
[1999]
|
| 2623 |
+
[2000]
|
| 2624 |
+
[2001]
|
| 2625 |
+
[2002]
|
| 2626 |
+
[2003]
|
| 2627 |
+
[2004]
|
| 2628 |
+
[2005]
|
| 2629 |
+
[2006]
|
| 2630 |
+
[2007]
|
| 2631 |
+
[2008]
|
| 2632 |
+
[2009]
|
| 2633 |
+
[2010]
|
| 2634 |
+
[2011]
|
| 2635 |
+
[2012]
|
| 2636 |
+
[2013]
|
| 2637 |
+
[2014]
|
| 2638 |
+
[2015]
|
| 2639 |
+
[2016]
|
| 2640 |
+
[2017]
|
| 2641 |
+
[2018]
|
| 2642 |
+
[2019]
|
| 2643 |
+
[2020]
|
| 2644 |
+
[2021]
|
| 2645 |
+
[2022]
|
| 2646 |
+
[2023]
|
| 2647 |
+
[2024]
|
| 2648 |
+
[2025]
|
| 2649 |
+
[2026]
|
| 2650 |
+
[2027]
|
| 2651 |
+
[2028]
|
| 2652 |
+
[2029]
|
| 2653 |
+
[2030]
|
| 2654 |
+
[2031]
|
| 2655 |
+
[2032]
|
| 2656 |
+
[2033]
|
| 2657 |
+
[2034]
|
| 2658 |
+
[2035]
|
| 2659 |
+
[2036]
|
| 2660 |
+
[2037]
|
| 2661 |
+
[2038]
|
| 2662 |
+
[2039]
|
| 2663 |
+
[2040]
|
| 2664 |
+
[2041]
|
| 2665 |
+
[2042]
|
| 2666 |
+
[2043]
|
| 2667 |
+
[2044]
|
| 2668 |
+
[2045]
|
| 2669 |
+
[2046]
|
| 2670 |
+
[2047]
|
model/__init__.py
ADDED
|
File without changes
|
model/tokenizer.py
ADDED
|
@@ -0,0 +1,325 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Requriments - transformers, tokenizers
|
| 2 |
+
# Right now, the Smiles Tokenizer uses an exiesting vocab file from rxnfp that is fairly comprehensive and from the USPTO dataset.
|
| 3 |
+
# The vocab may be expanded in the near future
|
| 4 |
+
|
| 5 |
+
import collections
|
| 6 |
+
import os
|
| 7 |
+
import re
|
| 8 |
+
import pkg_resources
|
| 9 |
+
from typing import List
|
| 10 |
+
from transformers import BertTokenizer
|
| 11 |
+
from logging import getLogger
|
| 12 |
+
from model.utils import get_atoms_from_smiles
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
logger = getLogger(__name__)
|
| 16 |
+
"""
|
| 17 |
+
SMI_REGEX_PATTERN: str
|
| 18 |
+
SMILES regex pattern for tokenization. Designed by Schwaller et. al.
|
| 19 |
+
|
| 20 |
+
References
|
| 21 |
+
----------
|
| 22 |
+
.. [1] Philippe Schwaller, Teodoro Laino, Théophile Gaudin, Peter Bolgar, Christopher A. Hunter, Costas Bekas, and Alpha A. Lee
|
| 23 |
+
ACS Central Science 2019 5 (9): Molecular Transformer: A Model for Uncertainty-Calibrated Chemical Reaction Prediction
|
| 24 |
+
1572-1583 DOI: 10.1021/acscentsci.9b00576
|
| 25 |
+
"""
|
| 26 |
+
|
| 27 |
+
SMI_REGEX_PATTERN = r"""(\[[^\]]+]|Br?|Cl?|N|O|S|P|F|I|b|c|n|o|s|p|\(|\)|\.|=|#|-|\+|\\|\/|:|~|@|\?|>>?|\*|\$|\%[0-9]{2}|[0-9])"""
|
| 28 |
+
|
| 29 |
+
# add vocab_file dict
|
| 30 |
+
VOCAB_FILES_NAMES = {"vocab_file": "vocab.txt"}
|
| 31 |
+
|
| 32 |
+
|
| 33 |
+
def get_default_tokenizer():
|
| 34 |
+
default_vocab_path = (pkg_resources.resource_filename("deepchem",
|
| 35 |
+
"feat/tests/vocab.txt"))
|
| 36 |
+
return SmilesTokenizer(default_vocab_path)
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
class SmilesTokenizer(BertTokenizer):
|
| 40 |
+
"""
|
| 41 |
+
Creates the SmilesTokenizer class. The tokenizer heavily inherits from the BertTokenizer
|
| 42 |
+
implementation found in Huggingface's transformers library. It runs a WordPiece tokenization
|
| 43 |
+
algorithm over SMILES strings using the tokenisation SMILES regex developed by Schwaller et. al.
|
| 44 |
+
|
| 45 |
+
Please see https://github.com/huggingface/transformers
|
| 46 |
+
and https://github.com/rxn4chemistry/rxnfp for more details.
|
| 47 |
+
|
| 48 |
+
Examples
|
| 49 |
+
--------
|
| 50 |
+
>>> from deepchem.feat.smiles_tokenizer import SmilesTokenizer
|
| 51 |
+
>>> current_dir = os.path.dirname(os.path.realpath(__file__))
|
| 52 |
+
>>> vocab_path = os.path.join(current_dir, 'tests/data', 'vocab.txt')
|
| 53 |
+
>>> tokenizer = SmilesTokenizer(vocab_path)
|
| 54 |
+
>>> print(tokenizer.encode("CC(=O)OC1=CC=CC=C1C(=O)O"))
|
| 55 |
+
[12, 16, 16, 17, 22, 19, 18, 19, 16, 20, 22, 16, 16, 22, 16, 16, 22, 16, 20, 16, 17, 22, 19, 18, 19, 13]
|
| 56 |
+
|
| 57 |
+
|
| 58 |
+
References
|
| 59 |
+
----------
|
| 60 |
+
.. [1] Schwaller, Philippe; Probst, Daniel; Vaucher, Alain C.; Nair, Vishnu H; Kreutter, David;
|
| 61 |
+
Laino, Teodoro; et al. (2019): Mapping the Space of Chemical Reactions using Attention-Based Neural
|
| 62 |
+
Networks. ChemRxiv. Preprint. https://doi.org/10.26434/chemrxiv.9897365.v3
|
| 63 |
+
|
| 64 |
+
Note
|
| 65 |
+
----
|
| 66 |
+
This class requires huggingface's transformers and tokenizers libraries to be installed.
|
| 67 |
+
"""
|
| 68 |
+
vocab_files_names = VOCAB_FILES_NAMES
|
| 69 |
+
|
| 70 |
+
def __init__(
|
| 71 |
+
self,
|
| 72 |
+
vocab_file: str = '',
|
| 73 |
+
# unk_token="[UNK]",
|
| 74 |
+
# sep_token="[SEP]",
|
| 75 |
+
# pad_token="[PAD]",
|
| 76 |
+
# cls_token="[CLS]",
|
| 77 |
+
# mask_token="[MASK]",
|
| 78 |
+
**kwargs):
|
| 79 |
+
"""Constructs a SmilesTokenizer.
|
| 80 |
+
|
| 81 |
+
Parameters
|
| 82 |
+
----------
|
| 83 |
+
vocab_file: str
|
| 84 |
+
Path to a SMILES character per line vocabulary file.
|
| 85 |
+
Default vocab file is found in deepchem/feat/tests/data/vocab.txt
|
| 86 |
+
"""
|
| 87 |
+
|
| 88 |
+
super().__init__(vocab_file, **kwargs)
|
| 89 |
+
# take into account special tokens in max length
|
| 90 |
+
# self.max_len_single_sentence = self.model_max_length - 2
|
| 91 |
+
# self.max_len_sentences_pair = self.model_max_length - 3
|
| 92 |
+
|
| 93 |
+
if not os.path.isfile(vocab_file):
|
| 94 |
+
raise ValueError(
|
| 95 |
+
"Can't find a vocab file at path '{}'.".format(vocab_file))
|
| 96 |
+
self.vocab = load_vocab(vocab_file)
|
| 97 |
+
self.highest_unused_index = max(
|
| 98 |
+
[i for i, v in enumerate(self.vocab.keys()) if v.startswith("[unused")])
|
| 99 |
+
self.ids_to_tokens = collections.OrderedDict(
|
| 100 |
+
[(ids, tok) for tok, ids in self.vocab.items()])
|
| 101 |
+
self.basic_tokenizer = BasicSmilesTokenizer()
|
| 102 |
+
self.init_kwargs["model_max_length"] = self.model_max_length
|
| 103 |
+
|
| 104 |
+
@property
|
| 105 |
+
def vocab_size(self):
|
| 106 |
+
return len(self.vocab)
|
| 107 |
+
|
| 108 |
+
@property
|
| 109 |
+
def vocab_list(self):
|
| 110 |
+
return list(self.vocab.keys())
|
| 111 |
+
|
| 112 |
+
def _tokenize(self, text: str):
|
| 113 |
+
"""Tokenize a string into a list of tokens.
|
| 114 |
+
|
| 115 |
+
Parameters
|
| 116 |
+
----------
|
| 117 |
+
text: str
|
| 118 |
+
Input string sequence to be tokenized.
|
| 119 |
+
"""
|
| 120 |
+
|
| 121 |
+
split_tokens = [str(token[1]) for token in get_atoms_from_smiles(text)]
|
| 122 |
+
return split_tokens
|
| 123 |
+
|
| 124 |
+
@staticmethod
|
| 125 |
+
def get_atom_indices(text):
|
| 126 |
+
atoms = get_atoms_from_smiles(text)
|
| 127 |
+
indices = []
|
| 128 |
+
for i, a in enumerate(atoms):
|
| 129 |
+
if a[0] == 'ATOM':
|
| 130 |
+
indices.append(i)
|
| 131 |
+
return indices
|
| 132 |
+
|
| 133 |
+
def _convert_token_to_id(self, token: str):
|
| 134 |
+
"""Converts a token (str/unicode) in an id using the vocab.
|
| 135 |
+
|
| 136 |
+
Parameters
|
| 137 |
+
----------
|
| 138 |
+
token: str
|
| 139 |
+
String token from a larger sequence to be converted to a numerical id.
|
| 140 |
+
"""
|
| 141 |
+
|
| 142 |
+
return self.vocab.get(token, self.vocab.get(self.unk_token))
|
| 143 |
+
|
| 144 |
+
def _convert_id_to_token(self, index: int):
|
| 145 |
+
"""Converts an index (integer) in a token (string/unicode) using the vocab.
|
| 146 |
+
|
| 147 |
+
Parameters
|
| 148 |
+
----------
|
| 149 |
+
index: int
|
| 150 |
+
Integer index to be converted back to a string-based token as part of a larger sequence.
|
| 151 |
+
"""
|
| 152 |
+
|
| 153 |
+
return self.ids_to_tokens.get(index, self.unk_token)
|
| 154 |
+
|
| 155 |
+
def convert_tokens_to_string(self, tokens: List[str]):
|
| 156 |
+
"""Converts a sequence of tokens (string) in a single string.
|
| 157 |
+
|
| 158 |
+
Parameters
|
| 159 |
+
----------
|
| 160 |
+
tokens: List[str]
|
| 161 |
+
List of tokens for a given string sequence.
|
| 162 |
+
|
| 163 |
+
Returns
|
| 164 |
+
-------
|
| 165 |
+
out_string: str
|
| 166 |
+
Single string from combined tokens.
|
| 167 |
+
"""
|
| 168 |
+
|
| 169 |
+
out_string: str = " ".join(tokens).replace(" ##", "").strip()
|
| 170 |
+
return out_string
|
| 171 |
+
|
| 172 |
+
def add_special_tokens_ids_single_sequence(self, token_ids: List[int]):
|
| 173 |
+
"""Adds special tokens to the a sequence for sequence classification tasks.
|
| 174 |
+
|
| 175 |
+
A BERT sequence has the following format: [CLS] X [SEP]
|
| 176 |
+
|
| 177 |
+
Parameters
|
| 178 |
+
----------
|
| 179 |
+
token_ids: list[int]
|
| 180 |
+
list of tokenized input ids. Can be obtained using the encode or encode_plus methods.
|
| 181 |
+
"""
|
| 182 |
+
|
| 183 |
+
return [self.cls_token_id] + token_ids + [self.sep_token_id]
|
| 184 |
+
|
| 185 |
+
def add_special_tokens_single_sequence(self, tokens: List[str]):
|
| 186 |
+
"""Adds special tokens to the a sequence for sequence classification tasks.
|
| 187 |
+
A BERT sequence has the following format: [CLS] X [SEP]
|
| 188 |
+
|
| 189 |
+
Parameters
|
| 190 |
+
----------
|
| 191 |
+
tokens: List[str]
|
| 192 |
+
List of tokens for a given string sequence.
|
| 193 |
+
"""
|
| 194 |
+
return [self.cls_token] + tokens + [self.sep_token]
|
| 195 |
+
|
| 196 |
+
def add_special_tokens_ids_sequence_pair(self, token_ids_0: List[int],
|
| 197 |
+
token_ids_1: List[int]) -> List[int]:
|
| 198 |
+
"""Adds special tokens to a sequence pair for sequence classification tasks.
|
| 199 |
+
A BERT sequence pair has the following format: [CLS] A [SEP] B [SEP]
|
| 200 |
+
|
| 201 |
+
Parameters
|
| 202 |
+
----------
|
| 203 |
+
token_ids_0: List[int]
|
| 204 |
+
List of ids for the first string sequence in the sequence pair (A).
|
| 205 |
+
token_ids_1: List[int]
|
| 206 |
+
List of tokens for the second string sequence in the sequence pair (B).
|
| 207 |
+
"""
|
| 208 |
+
|
| 209 |
+
sep = [self.sep_token_id]
|
| 210 |
+
cls = [self.cls_token_id]
|
| 211 |
+
|
| 212 |
+
return cls + token_ids_0 + sep + token_ids_1 + sep
|
| 213 |
+
|
| 214 |
+
def add_padding_tokens(self,
|
| 215 |
+
token_ids: List[int],
|
| 216 |
+
length: int,
|
| 217 |
+
right: bool = True) -> List[int]:
|
| 218 |
+
"""Adds padding tokens to return a sequence of length max_length.
|
| 219 |
+
By default padding tokens are added to the right of the sequence.
|
| 220 |
+
|
| 221 |
+
Parameters
|
| 222 |
+
----------
|
| 223 |
+
token_ids: list[int]
|
| 224 |
+
list of tokenized input ids. Can be obtained using the encode or encode_plus methods.
|
| 225 |
+
length: int
|
| 226 |
+
TODO
|
| 227 |
+
right: bool, default True
|
| 228 |
+
TODO
|
| 229 |
+
|
| 230 |
+
Returns
|
| 231 |
+
-------
|
| 232 |
+
List[int]
|
| 233 |
+
TODO
|
| 234 |
+
"""
|
| 235 |
+
padding = [self.pad_token_id] * (length - len(token_ids))
|
| 236 |
+
|
| 237 |
+
if right:
|
| 238 |
+
return token_ids + padding
|
| 239 |
+
else:
|
| 240 |
+
return padding + token_ids
|
| 241 |
+
|
| 242 |
+
def save_vocabulary(
|
| 243 |
+
self, vocab_path: str
|
| 244 |
+
): # -> tuple[str]: doctest issue raised with this return type annotation
|
| 245 |
+
"""Save the tokenizer vocabulary to a file.
|
| 246 |
+
|
| 247 |
+
Parameters
|
| 248 |
+
----------
|
| 249 |
+
vocab_path: obj: str
|
| 250 |
+
The directory in which to save the SMILES character per line vocabulary file.
|
| 251 |
+
Default vocab file is found in deepchem/feat/tests/data/vocab.txt
|
| 252 |
+
|
| 253 |
+
Returns
|
| 254 |
+
-------
|
| 255 |
+
vocab_file: Tuple
|
| 256 |
+
Paths to the files saved.
|
| 257 |
+
typle with string to a SMILES character per line vocabulary file.
|
| 258 |
+
Default vocab file is found in deepchem/feat/tests/data/vocab.txt
|
| 259 |
+
"""
|
| 260 |
+
index = 0
|
| 261 |
+
if os.path.isdir(vocab_path):
|
| 262 |
+
vocab_file = os.path.join(vocab_path, VOCAB_FILES_NAMES["vocab_file"])
|
| 263 |
+
else:
|
| 264 |
+
vocab_file = vocab_path
|
| 265 |
+
with open(vocab_file, "w", encoding="utf-8") as writer:
|
| 266 |
+
for token, token_index in sorted(
|
| 267 |
+
self.vocab.items(), key=lambda kv: kv[1]):
|
| 268 |
+
if index != token_index:
|
| 269 |
+
logger.warning(
|
| 270 |
+
"Saving vocabulary to {}: vocabulary indices are not consecutive."
|
| 271 |
+
" Please check that the vocabulary is not corrupted!".format(
|
| 272 |
+
vocab_file))
|
| 273 |
+
index = token_index
|
| 274 |
+
writer.write(token + "\n")
|
| 275 |
+
index += 1
|
| 276 |
+
return (vocab_file,)
|
| 277 |
+
|
| 278 |
+
|
| 279 |
+
class BasicSmilesTokenizer(object):
|
| 280 |
+
"""
|
| 281 |
+
Run basic SMILES tokenization using a regex pattern developed by Schwaller et. al.
|
| 282 |
+
This tokenizer is to be used when a tokenizer that does not require the transformers library by HuggingFace is required.
|
| 283 |
+
|
| 284 |
+
Examples
|
| 285 |
+
--------
|
| 286 |
+
>>> from deepchem.feat.smiles_tokenizer import BasicSmilesTokenizer
|
| 287 |
+
>>> tokenizer = BasicSmilesTokenizer()
|
| 288 |
+
>>> print(tokenizer.tokenize("CC(=O)OC1=CC=CC=C1C(=O)O"))
|
| 289 |
+
['C', 'C', '(', '=', 'O', ')', 'O', 'C', '1', '=', 'C', 'C', '=', 'C', 'C', '=', 'C', '1', 'C', '(', '=', 'O', ')', 'O']
|
| 290 |
+
|
| 291 |
+
|
| 292 |
+
References
|
| 293 |
+
----------
|
| 294 |
+
.. [1] Philippe Schwaller, Teodoro Laino, Théophile Gaudin, Peter Bolgar, Christopher A. Hunter, Costas Bekas, and Alpha A. Lee
|
| 295 |
+
ACS Central Science 2019 5 (9): Molecular Transformer: A Model for Uncertainty-Calibrated Chemical Reaction Prediction
|
| 296 |
+
1572-1583 DOI: 10.1021/acscentsci.9b00576
|
| 297 |
+
"""
|
| 298 |
+
|
| 299 |
+
def __init__(self, regex_pattern: str = SMI_REGEX_PATTERN):
|
| 300 |
+
"""Constructs a BasicSMILESTokenizer.
|
| 301 |
+
|
| 302 |
+
Parameters
|
| 303 |
+
----------
|
| 304 |
+
regex: string
|
| 305 |
+
SMILES token regex
|
| 306 |
+
"""
|
| 307 |
+
self.regex_pattern = regex_pattern
|
| 308 |
+
self.regex = re.compile(self.regex_pattern)
|
| 309 |
+
|
| 310 |
+
def tokenize(self, text):
|
| 311 |
+
"""Basic Tokenization of a SMILES.
|
| 312 |
+
"""
|
| 313 |
+
tokens = [token for token in self.regex.findall(text)]
|
| 314 |
+
return tokens
|
| 315 |
+
|
| 316 |
+
|
| 317 |
+
def load_vocab(vocab_file):
|
| 318 |
+
"""Loads a vocabulary file into a dictionary."""
|
| 319 |
+
vocab = collections.OrderedDict()
|
| 320 |
+
with open(vocab_file, "r", encoding="utf-8") as reader:
|
| 321 |
+
tokens = reader.readlines()
|
| 322 |
+
for index, token in enumerate(tokens):
|
| 323 |
+
token = token.rstrip("\n")
|
| 324 |
+
vocab[token] = index
|
| 325 |
+
return vocab
|
model/trainer.py
ADDED
|
@@ -0,0 +1,57 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from typing import Optional, Dict, Union, Any, List, Tuple
|
| 2 |
+
from transformers import Trainer
|
| 3 |
+
import torch
|
| 4 |
+
from torch import nn
|
| 5 |
+
from torch.utils.data import DataLoader, Dataset
|
| 6 |
+
|
| 7 |
+
|
| 8 |
+
class CustomTrainer(Trainer):
|
| 9 |
+
def __init__(self, **kwargs):
|
| 10 |
+
self.num_chunks = kwargs.pop("num_chunks")
|
| 11 |
+
self.max_length = kwargs.pop("max_length")
|
| 12 |
+
self.my_tokenizer = kwargs.pop("my_tokenizer")
|
| 13 |
+
super(CustomTrainer, self).__init__(**kwargs)
|
| 14 |
+
print(f"Using device: {self.args.device}")
|
| 15 |
+
|
| 16 |
+
def training_step(self, model: nn.Module, inputs: Dict[str, Union[torch.Tensor, Any]]) -> torch.Tensor:
|
| 17 |
+
return super(CustomTrainer, self).training_step(model, inputs)
|
| 18 |
+
|
| 19 |
+
def prediction_step(
|
| 20 |
+
self,
|
| 21 |
+
model: nn.Module,
|
| 22 |
+
inputs: Dict[str, Union[torch.Tensor, Any]],
|
| 23 |
+
prediction_loss_only: bool,
|
| 24 |
+
ignore_keys: Optional[List[str]] = None,
|
| 25 |
+
) -> Tuple[Optional[torch.Tensor], Optional[torch.Tensor], Optional[torch.Tensor]]:
|
| 26 |
+
return super(CustomTrainer, self).prediction_step(model, inputs, prediction_loss_only, ignore_keys)
|
| 27 |
+
|
| 28 |
+
def get_train_dataloader(self):
|
| 29 |
+
train_dataloader = DataLoader(self.train_dataset,
|
| 30 |
+
batch_size=self.args.per_device_train_batch_size,
|
| 31 |
+
# num_workers=0,
|
| 32 |
+
pin_memory=True)
|
| 33 |
+
return train_dataloader
|
| 34 |
+
|
| 35 |
+
def get_eval_dataloader(self, eval_dataset: Optional[Dataset] = None) -> DataLoader:
|
| 36 |
+
if not eval_dataset:
|
| 37 |
+
eval_dataset = self.eval_dataset
|
| 38 |
+
validation_dataloader = DataLoader(eval_dataset,
|
| 39 |
+
batch_size=self.args.per_device_eval_batch_size,
|
| 40 |
+
# num_workers=0,
|
| 41 |
+
pin_memory=True,
|
| 42 |
+
# shuffle=False
|
| 43 |
+
)
|
| 44 |
+
return validation_dataloader
|
| 45 |
+
|
| 46 |
+
def compute_loss(self, model, inputs, return_outputs=False):
|
| 47 |
+
"""
|
| 48 |
+
How the loss is computed by Trainer. By default, all models return the loss in the first element.
|
| 49 |
+
|
| 50 |
+
Subclass and override for custom behavior.
|
| 51 |
+
"""
|
| 52 |
+
outputs = model(**inputs)
|
| 53 |
+
if self.state.global_step % 501 == 0:
|
| 54 |
+
print({'loss': torch.mean(outputs['loss']).item(),
|
| 55 |
+
'steps': self.state.global_step})
|
| 56 |
+
loss = outputs['loss']
|
| 57 |
+
return (loss, outputs) if return_outputs else loss
|
model/utils.py
ADDED
|
@@ -0,0 +1,181 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from typing import Optional
|
| 2 |
+
import numpy as np
|
| 3 |
+
import py3Dmol
|
| 4 |
+
from rdkit import Chem, DataStructs
|
| 5 |
+
from rdkit.Chem import AllChem
|
| 6 |
+
import torch
|
| 7 |
+
|
| 8 |
+
|
| 9 |
+
class MorganFingerprint:
|
| 10 |
+
def __init__(self, shape: Optional[int] = 2048, radius: Optional[int] = 2):
|
| 11 |
+
self.shape = shape
|
| 12 |
+
self.radius = radius
|
| 13 |
+
|
| 14 |
+
@staticmethod
|
| 15 |
+
def canonicalize(smiles):
|
| 16 |
+
mol = Chem.MolFromSmiles(smiles)
|
| 17 |
+
if mol is not None:
|
| 18 |
+
return Chem.MolToSmiles(mol, isomericSmiles=True)
|
| 19 |
+
else:
|
| 20 |
+
return smiles
|
| 21 |
+
|
| 22 |
+
def smiles_to_morgan(self, smile: str) -> torch.Tensor:
|
| 23 |
+
try:
|
| 24 |
+
smile = self.canonicalize(smile)
|
| 25 |
+
mol = Chem.MolFromSmiles(smile)
|
| 26 |
+
features_vec = AllChem.GetMorganFingerprintAsBitVect(
|
| 27 |
+
mol, self.radius, nBits=self.shape
|
| 28 |
+
)
|
| 29 |
+
features = np.zeros((1,))
|
| 30 |
+
DataStructs.ConvertToNumpyArray(features_vec, features)
|
| 31 |
+
except Exception as e:
|
| 32 |
+
features = np.zeros((self.shape,))
|
| 33 |
+
return torch.tensor(features, dtype=torch.float32)
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
def get_morgan(input_sequences):
|
| 37 |
+
m = MorganFingerprint()
|
| 38 |
+
morgans = []
|
| 39 |
+
for s in input_sequences:
|
| 40 |
+
r = m.smiles_to_morgan(s)
|
| 41 |
+
indices_of_ones = torch.nonzero(r == 1.0, as_tuple=False)
|
| 42 |
+
indices_of_ones = indices_of_ones.squeeze(-1)
|
| 43 |
+
indices_of_ones = indices_of_ones.tolist()
|
| 44 |
+
s = ""
|
| 45 |
+
for i in indices_of_ones:
|
| 46 |
+
s += "[" + str(i) + "]"
|
| 47 |
+
morgans.append(s)
|
| 48 |
+
return morgans
|
| 49 |
+
|
| 50 |
+
|
| 51 |
+
def prepare_input_and_labels_morgan(tokenizer, input_sequences, max_length):
|
| 52 |
+
outputs = {}
|
| 53 |
+
batch_size = len(input_sequences)
|
| 54 |
+
morgans = get_morgan(input_sequences)
|
| 55 |
+
input_sequences_morgans = input_sequences + morgans
|
| 56 |
+
inputs = tokenizer.batch_encode_plus(input_sequences_morgans, max_length=max_length, padding='max_length',
|
| 57 |
+
return_tensors='pt', truncation=True)
|
| 58 |
+
smiles_ids = inputs['input_ids'][:batch_size]
|
| 59 |
+
smiles_ids = torch.where(smiles_ids == 0, -100, smiles_ids)
|
| 60 |
+
morgan_ids = inputs['input_ids'][batch_size:]
|
| 61 |
+
morgan_attention_mask = inputs['attention_mask'][batch_size:]
|
| 62 |
+
outputs['labels'] = smiles_ids
|
| 63 |
+
outputs['input_ids'] = morgan_ids
|
| 64 |
+
outputs['attention_mask'] = morgan_attention_mask
|
| 65 |
+
return outputs
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
def get_atoms_from_smiles(smiles):
|
| 69 |
+
"""
|
| 70 |
+
Iterates over a SMILES string, yielding tokens and offsets
|
| 71 |
+
|
| 72 |
+
Parameters
|
| 73 |
+
----------
|
| 74 |
+
smiles : iterable
|
| 75 |
+
The SMILES string to iterate over
|
| 76 |
+
|
| 77 |
+
Yields
|
| 78 |
+
------
|
| 79 |
+
tuple(TokenType, str, int)
|
| 80 |
+
A tuple describing the type of token and the associated data and offset in the smiles string
|
| 81 |
+
"""
|
| 82 |
+
organic_subset = 'B C N O P S F Cl Br I * b c n o s p'.split()
|
| 83 |
+
s = smiles
|
| 84 |
+
smiles = iter(smiles)
|
| 85 |
+
token = ''
|
| 86 |
+
peek = None
|
| 87 |
+
offset = -1
|
| 88 |
+
atoms = []
|
| 89 |
+
while True:
|
| 90 |
+
if peek:
|
| 91 |
+
char = peek
|
| 92 |
+
else:
|
| 93 |
+
char = next(smiles, '')
|
| 94 |
+
offset += 1
|
| 95 |
+
peek = None
|
| 96 |
+
if not char:
|
| 97 |
+
break
|
| 98 |
+
if char == '[':
|
| 99 |
+
token = char
|
| 100 |
+
move = 0
|
| 101 |
+
for char in smiles:
|
| 102 |
+
move += 1
|
| 103 |
+
token += char
|
| 104 |
+
if char == ']':
|
| 105 |
+
break
|
| 106 |
+
atoms.append(('ATOM', token, offset))
|
| 107 |
+
offset += move
|
| 108 |
+
elif char in organic_subset:
|
| 109 |
+
peek = next(smiles, '')
|
| 110 |
+
if char + peek in organic_subset:
|
| 111 |
+
atoms.append(('ATOM', char + peek, offset))
|
| 112 |
+
peek = None
|
| 113 |
+
else:
|
| 114 |
+
atoms.append(('ATOM', char, offset))
|
| 115 |
+
offset += 1
|
| 116 |
+
elif char in '-=#$:.':
|
| 117 |
+
atoms.append(('BOND_TYPE', char, offset))
|
| 118 |
+
elif char == '(':
|
| 119 |
+
atoms.append(('BRANCH_START', '(', offset))
|
| 120 |
+
elif char == ')':
|
| 121 |
+
atoms.append(('BRANCH_END', ')', offset))
|
| 122 |
+
elif char == '%':
|
| 123 |
+
# If smiles is too short this will raise a ValueError, which is
|
| 124 |
+
# (slightly) prettier than a StopIteration.
|
| 125 |
+
atoms.append(('RING_NUM', int(next(smiles, '') + next(smiles, '')), offset + 1))
|
| 126 |
+
offset += 2
|
| 127 |
+
elif char in '/\\':
|
| 128 |
+
atoms.append(('EZSTEREO', char, offset))
|
| 129 |
+
elif char.isdigit():
|
| 130 |
+
atoms.append(('RING_NUM', int(char), offset))
|
| 131 |
+
for _, a, offset in atoms:
|
| 132 |
+
assert str(a) == s[offset: (offset + len(str(a)))]
|
| 133 |
+
return atoms
|
| 134 |
+
|
| 135 |
+
|
| 136 |
+
def clean_output(output_ids):
|
| 137 |
+
clean_output_ids = []
|
| 138 |
+
start = False
|
| 139 |
+
for i in output_ids:
|
| 140 |
+
if i == 13:
|
| 141 |
+
break
|
| 142 |
+
if start:
|
| 143 |
+
if i > 14:
|
| 144 |
+
clean_output_ids.append(i)
|
| 145 |
+
if i == 0:
|
| 146 |
+
start = True
|
| 147 |
+
return clean_output_ids
|
| 148 |
+
|
| 149 |
+
|
| 150 |
+
def morgan_fingerprint_to_text(morgan_fn):
|
| 151 |
+
indices_of_ones = torch.nonzero(morgan_fn == 1.0, as_tuple=False)
|
| 152 |
+
indices_of_ones = indices_of_ones.squeeze(-1)
|
| 153 |
+
indices_of_ones = indices_of_ones.tolist()
|
| 154 |
+
s = ""
|
| 155 |
+
for i in indices_of_ones:
|
| 156 |
+
s += "[" + str(i) + "]"
|
| 157 |
+
return s
|
| 158 |
+
|
| 159 |
+
|
| 160 |
+
def smiles_to_3d(smiles_list, width=400, height=300):
|
| 161 |
+
# Visualize the 3D structure using py3Dmol
|
| 162 |
+
view = py3Dmol.view(width=width, height=height)
|
| 163 |
+
for smiles in smiles_list:
|
| 164 |
+
# Generate the RDKit molecule object
|
| 165 |
+
mol = Chem.MolFromSmiles(smiles)
|
| 166 |
+
if mol is None:
|
| 167 |
+
raise ValueError("Invalid SMILES string")
|
| 168 |
+
|
| 169 |
+
# Add hydrogens to the molecule
|
| 170 |
+
mol = Chem.AddHs(mol)
|
| 171 |
+
|
| 172 |
+
# Generate 3D coordinates
|
| 173 |
+
AllChem.EmbedMolecule(mol, randomSeed=42)
|
| 174 |
+
AllChem.UFFOptimizeMolecule(mol)
|
| 175 |
+
|
| 176 |
+
# Generate the 3D structure in the form of a pdb string
|
| 177 |
+
pdb = Chem.MolToPDBBlock(mol)
|
| 178 |
+
view.addModel(pdb, 'pdb')
|
| 179 |
+
view.setStyle({'stick': {}})
|
| 180 |
+
view.zoomTo()
|
| 181 |
+
return view
|
train.py
ADDED
|
@@ -0,0 +1,109 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import argparse
|
| 2 |
+
from transformers import TrainingArguments, IntervalStrategy, EarlyStoppingCallback, AutoModelForSeq2SeqLM
|
| 3 |
+
from model.tokenizer import SmilesTokenizer
|
| 4 |
+
from model.trainer import CustomTrainer
|
| 5 |
+
from datasets import load_dataset
|
| 6 |
+
from model.utils import prepare_input_and_labels_morgan
|
| 7 |
+
import glob2
|
| 8 |
+
|
| 9 |
+
if __name__ == "__main__":
|
| 10 |
+
parser = argparse.ArgumentParser(description='AntBrain training')
|
| 11 |
+
parser.add_argument(
|
| 12 |
+
'-t', '--train', default='./data/train_graph.jsonl.gz',
|
| 13 |
+
type=str,
|
| 14 |
+
help='Root directory with the training data')
|
| 15 |
+
parser.add_argument(
|
| 16 |
+
'-v', '--validation', default='./data/train_graph.jsonl.gz', type=str,
|
| 17 |
+
help='Root directory with the validation data')
|
| 18 |
+
parser.add_argument("--learning-rate", default=3e-05, type=float)
|
| 19 |
+
parser.add_argument("--per-device-train-batch-size", default=8, type=int)
|
| 20 |
+
parser.add_argument("--per-device-eval-batch-size", default=8, type=int)
|
| 21 |
+
parser.add_argument("--weight-decay", default=0.01, type=float)
|
| 22 |
+
parser.add_argument("--epochs", default=5, type=int)
|
| 23 |
+
parser.add_argument("--save-total-limit", default=3, type=int)
|
| 24 |
+
parser.add_argument("--saving_steps", default=1000, type=int)
|
| 25 |
+
parser.add_argument("--evaluation_steps", default=1, type=int)
|
| 26 |
+
parser.add_argument("--adam-eps", default=1e-08, type=float)
|
| 27 |
+
parser.add_argument("--adam-betas", default=(0.9, 0.999), nargs="+", type=float)
|
| 28 |
+
parser.add_argument("--warmup-updates", default=500, type=int)
|
| 29 |
+
parser.add_argument("--warmup_steps", default=500, type=int)
|
| 30 |
+
parser.add_argument("--max_steps", default=500, type=int)
|
| 31 |
+
parser.add_argument("--patience", default=200, type=int)
|
| 32 |
+
parser.add_argument("--num_workers", default=10, type=int)
|
| 33 |
+
parser.add_argument("--logging-steps", default=1, type=int)
|
| 34 |
+
parser.add_argument("--fp16", action='store_true')
|
| 35 |
+
parser.add_argument("--deepspeed", default=None, type=str, help="Deep speed configuration file")
|
| 36 |
+
parser.add_argument("--local_rank", type=int, default=-1)
|
| 37 |
+
parser.add_argument('-m', '--model', type=str, default='facebook/bart-base', help='model name')
|
| 38 |
+
parser.add_argument('--max_length', type=int, default=128, help='Max sequence length')
|
| 39 |
+
parser.add_argument('--num_chunks', type=int, default=2, help='number of chunks per training step')
|
| 40 |
+
parser.add_argument('--vocab_path', type=str, default="./data/vocab_morgan.txt", help='vocab file path.')
|
| 41 |
+
parser.add_argument('--output_dir', type=str, default="./results", help='output dir where the models are saved')
|
| 42 |
+
parser.add_argument('--checkpoint', type=str, default=None, help='Path to the check point.')
|
| 43 |
+
parser.add_argument('--ignore_data_skip', type=str, default='yes', help='whether skip checking data before training '
|
| 44 |
+
'from checkpoint')
|
| 45 |
+
|
| 46 |
+
args = parser.parse_args()
|
| 47 |
+
tokenizer = SmilesTokenizer(vocab_file=args.vocab_path)
|
| 48 |
+
|
| 49 |
+
# DataLoaders
|
| 50 |
+
file_lists = args.train.replace("'", "").split(",")
|
| 51 |
+
train_files = []
|
| 52 |
+
for file_list in file_lists:
|
| 53 |
+
train_files += glob2.glob(file_list)
|
| 54 |
+
train_files.sort()
|
| 55 |
+
print("Training data")
|
| 56 |
+
for file in train_files:
|
| 57 |
+
print(file)
|
| 58 |
+
validation_files = glob2.glob(args.validation.replace("'", ""))
|
| 59 |
+
validation_files.sort()
|
| 60 |
+
print("Validation data", validation_files)
|
| 61 |
+
data_set = load_dataset('json',
|
| 62 |
+
data_files={'train': train_files,
|
| 63 |
+
'val': validation_files},
|
| 64 |
+
streaming=True)
|
| 65 |
+
data_set = data_set.map(lambda e: prepare_input_and_labels_morgan(tokenizer=tokenizer, input_sequences=e['smiles'],
|
| 66 |
+
max_length=args.max_length),
|
| 67 |
+
batched=True,
|
| 68 |
+
remove_columns=["atom", "smiles", "bond_edges", "bond_types"],
|
| 69 |
+
batch_size=100)
|
| 70 |
+
|
| 71 |
+
data_set = data_set.with_format('torch')
|
| 72 |
+
model = AutoModelForSeq2SeqLM.from_pretrained(args.model)
|
| 73 |
+
|
| 74 |
+
training_args = TrainingArguments(
|
| 75 |
+
output_dir=args.output_dir,
|
| 76 |
+
evaluation_strategy=IntervalStrategy.STEPS,
|
| 77 |
+
learning_rate=args.learning_rate,
|
| 78 |
+
per_device_train_batch_size=args.per_device_train_batch_size,
|
| 79 |
+
per_device_eval_batch_size=args.per_device_eval_batch_size,
|
| 80 |
+
weight_decay=args.weight_decay,
|
| 81 |
+
save_total_limit=args.save_total_limit,
|
| 82 |
+
save_steps=args.saving_steps,
|
| 83 |
+
eval_steps=args.evaluation_steps,
|
| 84 |
+
num_train_epochs=args.epochs,
|
| 85 |
+
logging_steps=args.logging_steps,
|
| 86 |
+
fp16=args.fp16,
|
| 87 |
+
dataloader_num_workers=args.num_workers,
|
| 88 |
+
load_best_model_at_end=True,
|
| 89 |
+
deepspeed=args.deepspeed,
|
| 90 |
+
max_steps=args.max_steps,
|
| 91 |
+
warmup_steps=args.warmup_steps,
|
| 92 |
+
ignore_data_skip=args.ignore_data_skip == 'yes'
|
| 93 |
+
)
|
| 94 |
+
|
| 95 |
+
trainer = CustomTrainer(
|
| 96 |
+
model=model,
|
| 97 |
+
args=training_args,
|
| 98 |
+
train_dataset=data_set['train'],
|
| 99 |
+
eval_dataset=data_set['val'],
|
| 100 |
+
num_chunks=args.num_chunks,
|
| 101 |
+
my_tokenizer=tokenizer,
|
| 102 |
+
max_length=args.max_length,
|
| 103 |
+
callbacks=[EarlyStoppingCallback(early_stopping_patience=args.patience)]
|
| 104 |
+
)
|
| 105 |
+
if args.checkpoint:
|
| 106 |
+
trainer.train(args.checkpoint)
|
| 107 |
+
else:
|
| 108 |
+
trainer.train()
|
| 109 |
+
trainer.evaluate()
|