ALHCH's picture
Create app.py
81fbb55 verified
import gradio as gr
import torch
import numpy as np
from rdkit import Chem
from rdkit.Chem import AllChem, Descriptors
import py3Dmol
import json
import os
from huggingface_hub import hf_hub_download
# Download Boltz-2 model weights
def load_boltz_model():
"""Load the Boltz-2 model from Hugging Face"""
try:
# Download model files
model_path = hf_hub_download(
repo_id="boltz-community/boltz-2",
filename="pytorch_model.bin",
cache_dir="./models"
)
# Load configuration if available
config_path = hf_hub_download(
repo_id="boltz-community/boltz-2",
filename="config.json",
cache_dir="./models"
)
return model_path, config_path
except Exception as e:
print(f"Error loading model: {e}")
return None, None
def parse_smiles(smiles_string):
"""Parse SMILES string and generate 3D coordinates"""
try:
mol = Chem.MolFromSmiles(smiles_string)
if mol is None:
return None, "Invalid SMILES string"
# Add hydrogens
mol = Chem.AddHs(mol)
# Generate 3D coordinates
AllChem.EmbedMolecule(mol, randomSeed=42)
AllChem.MMFFOptimizeMolecule(mol)
return mol, None
except Exception as e:
return None, str(e)
def calculate_descriptors(mol):
"""Calculate molecular descriptors"""
descriptors = {
"Molecular Weight": Descriptors.MolWt(mol),
"LogP": Descriptors.MolLogP(mol),
"H-Bond Donors": Descriptors.NumHDonors(mol),
"H-Bond Acceptors": Descriptors.NumHAcceptors(mol),
"Rotatable Bonds": Descriptors.NumRotatableBonds(mol),
"TPSA": Descriptors.TPSA(mol),
"Aromatic Rings": Descriptors.NumAromaticRings(mol)
}
return descriptors
def visualize_molecule(mol):
"""Create 3D visualization of molecule"""
if mol is None:
return None
# Convert to PDB format for visualization
pdb_block = Chem.MolToPDBBlock(mol)
# Create 3D viewer
viewer = py3Dmol.view(width=600, height=400)
viewer.addModel(pdb_block, "pdb")
viewer.setStyle({"stick": {"radius": 0.15}})
viewer.setBackgroundColor("white")
viewer.zoomTo()
return viewer.js()
def predict_structure(protein_sequence):
"""Predict protein structure using Boltz-2"""
# This is a placeholder - actual Boltz-2 implementation would go here
# You'll need to implement the actual model inference
structure_info = {
"status": "Model inference placeholder",
"note": "Actual Boltz-2 inference needs to be implemented",
"sequence_length": len(protein_sequence)
}
return structure_info
def analyze_binding(smiles, protein_sequence, binding_site=""):
"""Analyze potential binding between compound and protein"""
results = {"status": "Analysis Started"}
# Parse SMILES
mol, error = parse_smiles(smiles)
if error:
return f"Error: {error}", None, None
# Calculate molecular properties
descriptors = calculate_descriptors(mol)
# Get protein structure (placeholder)
structure = predict_structure(protein_sequence)
# Prepare results
results_text = "## Compound Analysis\n\n"
results_text += f"**SMILES:** {smiles}\n\n"
results_text += "### Molecular Descriptors:\n"
for key, value in descriptors.items():
results_text += f"- **{key}:** {value:.2f}\n"
results_text += "\n## Protein Structure\n"
results_text += f"- Sequence Length: {len(protein_sequence)}\n"
results_text += f"- Status: {structure['status']}\n"
results_text += "\n## Binding Site Analysis\n"
if binding_site:
results_text += f"- Target Site: {binding_site}\n"
else:
results_text += "- No specific binding site specified\n"
results_text += "\n⚠️ **Note:** This is a demonstration interface. "
results_text += "For actual binding affinity predictions, you would need:\n"
results_text += "1. Complete Boltz-2 structure prediction implementation\n"
results_text += "2. Molecular docking software (AutoDock Vina, etc.)\n"
results_text += "3. Binding affinity scoring functions\n"
# Create visualization
mol_viz = visualize_molecule(mol)
return results_text, mol_viz, descriptors
# Create Gradio interface
def create_interface():
with gr.Blocks(title="Boltz-2 Binding Affinity Analyzer") as app:
gr.Markdown("""
# 🧬 Boltz-2 Binding Affinity Analyzer
This tool combines Boltz-2 protein structure prediction with molecular analysis for binding affinity estimation.
**Note:** This is a demonstration interface. Full implementation requires:
- Complete Boltz-2 model integration
- Molecular docking algorithms
- Binding affinity scoring functions
""")
with gr.Tabs():
with gr.Tab("Binding Analysis"):
with gr.Row():
with gr.Column():
smiles_input = gr.Textbox(
label="Compound SMILES",
placeholder="Enter SMILES notation (e.g., CCCCCCc1cc2OC(C)(C)[C@@H]3CCC(C)C[C@H]3c2c(O)c1)",
value="CCCCCCc1cc2OC(C)(C)[C@@H]3CCC(C)C[C@H]3c2c(O)c1" # HHCh example
)
protein_input = gr.Textbox(
label="Protein Sequence",
placeholder="Enter protein sequence in FASTA format",
lines=5
)
binding_site = gr.Textbox(
label="Binding Site (Optional)",
placeholder="Specify binding site residues or region"
)
analyze_btn = gr.Button("Analyze Binding", variant="primary")
with gr.Column():
results_output = gr.Markdown(label="Analysis Results")
mol_viewer = gr.HTML(label="3D Molecule Visualization")
with gr.Row():
descriptors_output = gr.JSON(label="Molecular Properties")
analyze_btn.click(
fn=analyze_binding,
inputs=[smiles_input, protein_input, binding_site],
outputs=[results_output, mol_viewer, descriptors_output]
)
with gr.Tab("Batch Analysis"):
gr.Markdown("### Batch Processing (Coming Soon)")
gr.Markdown("Upload multiple compounds for batch analysis")
with gr.Tab("Documentation"):
gr.Markdown("""
## How to Use
1. **Enter Compound SMILES**: Input the SMILES notation for your compound
2. **Enter Protein Sequence**: Provide the target protein sequence
3. **Specify Binding Site** (Optional): Define specific binding regions
4. **Click Analyze**: Run the binding analysis
## Interpreting Results
- **Molecular Descriptors**: Key properties affecting binding
- **Lipinski's Rule of Five**: Drug-likeness assessment
- **Predicted Binding Affinity**: Estimated binding strength (when fully implemented)
## Limitations
- This is a demonstration interface
- Actual binding predictions require full model implementation
- GPU resources recommended for faster processing
""")
# Load model on startup
gr.Markdown("### Model Status")
model_status = gr.Textbox(value="Checking model availability...", interactive=False)
def check_model():
model_path, config_path = load_boltz_model()
if model_path:
return "✅ Model loaded successfully"
else:
return "⚠️ Model not fully loaded - using demo mode"
app.load(check_model, outputs=model_status)
return app
# Launch the app
if __name__ == "__main__":
app = create_interface()
app.launch()