Spaces:
Running
Running
File size: 61,797 Bytes
2b18b2c 7fb286d bcae4e2 7fb286d 45d6af3 c1ad2a1 45d6af3 b871fd6 bb04c63 a953180 0f1a97c 4868d91 a953180 0095ae9 6a8393c d7b6536 6a8393c a953180 0095ae9 2c223b3 bcae4e2 0095ae9 2c223b3 0095ae9 bcae4e2 0095ae9 d7b6536 0095ae9 d7b6536 0f1a97c 4868d91 0f1a97c 4868d91 0f1a97c 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 0095ae9 bcae4e2 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 0095ae9 4868d91 2c223b3 4868d91 0095ae9 a953180 0095ae9 bcae4e2 0095ae9 a953180 0095ae9 a953180 12d0eea 6a8393c a953180 0095ae9 a953180 0095ae9 a953180 0095ae9 a953180 0095ae9 a953180 0095ae9 71e2885 0095ae9 71e2885 0095ae9 2c223b3 0095ae9 a953180 0095ae9 a953180 0095ae9 a953180 2c223b3 bcae4e2 2c223b3 12d0eea d7b6536 2c223b3 a953180 0095ae9 4868d91 d7b6536 a953180 0095ae9 bcae4e2 0f1a97c 0095ae9 0f1a97c bcae4e2 71e2885 0095ae9 71e2885 bcae4e2 71e2885 0095ae9 0f1a97c 71e2885 0095ae9 71e2885 0f1a97c 71e2885 0095ae9 71e2885 0095ae9 0f1a97c 71e2885 0095ae9 71e2885 0095ae9 71e2885 2c223b3 bcae4e2 2c223b3 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 2c223b3 0095ae9 71e2885 0f1a97c bcae4e2 2c223b3 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 bcae4e2 0095ae9 bcae4e2 0095ae9 bcae4e2 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 71e2885 0095ae9 bcae4e2 2c223b3 0095ae9 71e2885 2c223b3 bcae4e2 0095ae9 bcae4e2 0095ae9 0f1a97c a953180 45d6af3 a953180 0095ae9 a953180 0095ae9 a953180 2c223b3 bcae4e2 0095ae9 bcae4e2 0095ae9 a953180 bcae4e2 a953180 bcae4e2 a953180 d7b6536 0095ae9 d7b6536 bcae4e2 d7b6536 0095ae9 bcae4e2 d7b6536 0f1a97c 432a60b 0f1a97c 1b33af5 71e2885 1b33af5 260f3d0 1b33af5 f5f80ba 1b33af5 260f3d0 3226415 71e2885 260f3d0 3226415 b871fd6 3226415 b871fd6 260f3d0 3226415 b871fd6 3226415 b871fd6 3226415 b871fd6 260f3d0 3226415 260f3d0 3226415 71e2885 3226415 260f3d0 3226415 260f3d0 b871fd6 3226415 260f3d0 b871fd6 3226415 b871fd6 3226415 b871fd6 3226415 b871fd6 3226415 b871fd6 3226415 b871fd6 d7b6536 71e2885 d7b6536 71e2885 d7b6536 2e65f0b d7b6536 2e65f0b d7b6536 4868d91 b0490f8 bcae4e2 b0490f8 0f1a97c a953180 bb04c63 45d6af3 0f1a97c 45d6af3 b871fd6 a953180 2b5f1d4 d7b6536 b871fd6 2c223b3 b871fd6 2b5f1d4 b871fd6 d7b6536 bb04c63 d7b6536 bb04c63 d7b6536 2b5f1d4 5cfae69 bcae4e2 2c223b3 bcae4e2 a953180 5cfae69 3472383 82fb410 5cfae69 b871fd6 3472383 432a60b 6239bbc a0d49a3 6239bbc 809cdad 3472383 809cdad b871fd6 809cdad 0f1a97c 45d6af3 b871fd6 a953180 1b33af5 a953180 1b33af5 b871fd6 1b33af5 b871fd6 b0490f8 a953180 82fb410 b0490f8 b871fd6 a953180 0f1a97c 1b33af5 b871fd6 0f1a97c b871fd6 c1ad2a1 0f1a97c 89450f2 0f1a97c c1ad2a1 22efa51 4868d91 45d6af3 6a8393c a7360b6 bcae4e2 4ae3df6 b871fd6 a7360b6 4ae3df6 0f1a97c b871fd6 07cdc1e b871fd6 45d6af3 a0cad87 1b33af5 12d0eea 07cdc1e e1d6be0 45d6af3 0f570bc e52dbe4 4ae3df6 4868d91 4ae3df6 0f1a97c 4ae3df6 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601 602 603 604 605 606 607 608 609 610 611 612 613 614 615 616 617 618 619 620 621 622 623 624 625 626 627 628 629 630 631 632 633 634 635 636 637 638 639 640 641 642 643 644 645 646 647 648 649 650 651 652 653 654 655 656 657 658 659 660 661 662 663 664 665 666 667 668 669 670 671 672 673 674 675 676 677 678 679 680 681 682 683 684 685 686 687 688 689 690 691 692 693 694 695 696 697 698 699 700 701 702 703 704 705 706 707 708 709 710 711 712 713 714 715 716 717 718 719 720 721 722 723 724 725 726 727 728 729 730 731 732 733 734 735 736 737 738 739 740 741 742 743 744 745 746 747 748 749 750 751 752 753 754 755 756 757 758 759 760 761 762 763 764 765 766 767 768 769 770 771 772 773 774 775 776 777 778 779 780 781 782 783 784 785 786 787 788 789 790 791 792 793 794 795 796 797 798 799 800 801 802 803 804 805 806 807 808 809 810 811 812 813 814 815 816 817 818 819 820 821 822 823 824 825 826 827 828 829 830 831 832 833 834 835 836 837 838 839 840 841 842 843 844 845 846 847 848 849 850 851 852 853 854 855 856 857 858 859 860 861 862 863 864 865 866 867 868 869 870 871 872 873 874 875 876 877 878 879 880 881 882 883 884 885 886 887 888 889 890 891 892 893 894 895 896 897 898 899 900 901 902 903 904 905 906 907 908 909 910 911 912 913 914 915 916 917 918 919 920 921 922 923 924 925 926 927 928 929 930 931 932 933 934 935 936 937 938 939 940 941 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1002 1003 1004 1005 1006 1007 1008 1009 1010 1011 1012 1013 1014 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 1026 1027 1028 1029 1030 1031 1032 1033 1034 1035 1036 1037 1038 1039 1040 1041 1042 1043 1044 1045 1046 1047 1048 1049 1050 1051 1052 1053 1054 1055 1056 1057 1058 1059 1060 1061 1062 1063 1064 1065 1066 1067 1068 1069 1070 1071 1072 1073 1074 1075 1076 1077 1078 1079 1080 1081 1082 1083 1084 1085 1086 1087 1088 1089 1090 1091 1092 1093 1094 1095 1096 1097 1098 1099 1100 1101 1102 1103 1104 1105 1106 1107 1108 1109 1110 1111 1112 1113 1114 1115 1116 1117 1118 1119 1120 1121 1122 1123 1124 1125 1126 1127 1128 1129 1130 1131 1132 1133 1134 1135 1136 1137 1138 1139 1140 1141 1142 1143 1144 1145 1146 1147 1148 1149 1150 1151 1152 1153 1154 1155 1156 1157 1158 1159 1160 1161 1162 1163 1164 1165 1166 1167 1168 1169 1170 1171 1172 1173 1174 1175 1176 1177 1178 1179 1180 1181 1182 1183 1184 1185 1186 1187 1188 1189 1190 1191 1192 1193 1194 1195 1196 1197 1198 1199 1200 1201 1202 1203 1204 1205 1206 1207 1208 1209 1210 1211 1212 1213 1214 1215 1216 1217 1218 1219 1220 1221 1222 1223 1224 1225 1226 1227 1228 1229 1230 1231 1232 1233 1234 1235 1236 1237 1238 1239 1240 1241 1242 1243 1244 1245 1246 1247 1248 1249 1250 1251 1252 1253 1254 1255 1256 1257 1258 1259 1260 1261 1262 1263 1264 1265 1266 1267 1268 1269 1270 1271 1272 1273 1274 1275 1276 1277 1278 1279 1280 1281 1282 1283 1284 1285 1286 1287 1288 1289 1290 1291 1292 1293 1294 1295 1296 1297 1298 1299 1300 1301 1302 1303 1304 1305 1306 1307 1308 1309 1310 1311 1312 1313 1314 1315 1316 1317 1318 1319 1320 1321 1322 1323 1324 1325 1326 1327 1328 1329 1330 1331 1332 1333 1334 1335 1336 1337 1338 1339 1340 1341 1342 1343 1344 1345 1346 1347 1348 1349 1350 1351 1352 1353 1354 1355 1356 1357 1358 1359 1360 1361 1362 1363 1364 1365 1366 1367 1368 1369 1370 1371 1372 1373 1374 1375 1376 1377 1378 1379 1380 1381 1382 1383 1384 1385 1386 1387 1388 1389 1390 1391 1392 1393 1394 1395 1396 1397 1398 1399 1400 1401 1402 1403 1404 1405 1406 1407 1408 1409 1410 1411 1412 1413 1414 1415 1416 1417 1418 1419 1420 1421 1422 1423 1424 1425 1426 1427 1428 1429 1430 1431 1432 1433 1434 1435 1436 1437 1438 1439 1440 1441 1442 1443 1444 1445 1446 1447 1448 1449 1450 1451 1452 1453 1454 1455 1456 1457 1458 1459 1460 1461 1462 1463 1464 1465 1466 1467 1468 1469 1470 1471 1472 1473 1474 1475 1476 1477 1478 1479 1480 1481 1482 1483 1484 1485 1486 1487 1488 1489 1490 1491 1492 1493 1494 1495 1496 |
import os
import gradio_client.utils as client_utils
# Monkey path gradio_client issue
_original = client_utils._json_schema_to_python_type
def _safe_json_schema_to_python_type(schema, defs=None):
if isinstance(schema, bool):
return "Any"
return _original(schema, defs)
client_utils._json_schema_to_python_type = _safe_json_schema_to_python_type
client_utils.json_schema_to_python_type = _safe_json_schema_to_python_type
import gradio as gr
import gradio.blocks
import re
import pandas as pd
from io import StringIO
import rdkit
from rdkit import Chem
from rdkit.Chem import AllChem, Draw
import numpy as np
from PIL import Image, ImageDraw, ImageFont
import matplotlib.pyplot as plt
import matplotlib.patches as patches
from io import BytesIO
import tempfile
from rdkit import Chem
from swisssidechain import all_aminos
from aminoacid_selective import specific_aminos
def _internal_from_cterm(cterm: str) -> str:
s = cterm.strip()
s = re.sub(r'C\(=O\)\[\*:\s*2\]\s*$', '', s) # drop trailing carbonyl anchor
s = re.sub(r'^\[\*:\s*1\]', '', s) # drop leading anchor
s = re.sub(r'^\(?N\)?', '', s) # drop leading N
return s
def _internal_from_nterm(nterm: str) -> str:
s = nterm.strip()
s = re.sub(r'^\[\*:\s*1\]', '', s) # drop leading anchor
s = re.sub(r'^\(?N\)?', '', s) # drop leading N
s = re.sub(r'C\(=O\)O\s*$', '', s) # drop trailing COOH
return s
def _chirality_agnostic_regex(literal_smiles: str) -> re.Pattern:
"""
Make a regex that matches the literal SMILES but ignores stereo/ring digit specifics.
- Escapes all chars
- Makes '@' optional (so [C@@H] / [C@H] / [CH] all match)
- Allows any ring digit where a digit appears
"""
esc = re.escape(literal_smiles)
# make any '@' optional (two steps to handle @@)
esc = esc.replace(r'\@\@', r'\@?\@?')
esc = esc.replace(r'\@', r'\@?')
# allow any ring digit(s) where digits appear
esc = re.sub(r'\\\d+', r'\\d+', esc)
return re.compile(esc)
class PeptideAnalyzer:
def __init__(self):
self.bond_patterns = [
#(r'OC\(=O\)', 'ester'), # Ester bond
(r'N\(C\)C\(=O\)', 'n_methyl'), # N-methylated peptide bond
(r'N[0-9]C\(=O\)', 'proline'), # Proline peptide bond
(r'NC\(=O\)', 'peptide'), # Standard peptide bond
(r'C\(=O\)N\(C\)', 'n_methyl_reverse'), # Reverse N-methylated
(r'C\(=O\)N[12]?', 'peptide_reverse') # Reverse peptide bond
]
self.complex_residue_patterns = [
(r'\[C[@]H\]\(CCCNC\(=O\)CCC\[C@@H\]\(NC\(=O\)CCCCCCCCCCCCCCCC\)C\(=O\)OC\(C\)\(C\)C\)', 'Kpg'),
(r'CCCCCCCCCCCCCCCCC\(=O\)N\[C@H\]\(CCCC\(=O\)NCCC\[C@@H\]', 'Kpg'),
(r'\[C@*H\]\(CSC\(c\d+ccccc\d+\)\(c\d+ccccc\d+\)c\d+ccc\(OC\)cc\d+\)', 'Cmt'),
(r'CSC\(c.*?c.*?OC\)', 'Cmt'),
(r'COc.*?ccc\(C\(SC', 'Cmt'),
(r'c2ccccc2\)c2ccccc2\)cc', 'Cmt'),
# Glu(OAll)
(r'C=CCOC\(=O\)CC\[C@@H\]', 'Eal'),
(r'\(C\)OP\(=O\)\(O\)OCc\d+ccccc\d+', 'Tpb'),
#(r'COc\d+ccc\(C\(SC\[C@@H\]\d+.*?\)\(c\d+ccccc\d+\)c\d+ccccc\d+\)cc\d+', 'Cmt-cyclic'),
# Dtg - Asp(OtBu)-(Dmb)Gly
(r'CN\(Cc\d+ccc\(OC\)cc\d+OC\)C\(=O\)\[C@H\]\(CC\(=O\)OC\(C\)\(C\)C\)', 'Dtg'),
(r'C\(=O\)N\(CC\d+=C\(C=C\(C=C\d+\)OC\)OC\)CC\(=O\)', 'Dtg'),
(r'N\[C@@H\]\(CC\(=O\)OC\(C\)\(C\)C\)C\(=O\)N\(CC\d+=C\(C=C\(C=C\d+\)OC\)OC\)CC\(=O\)', 'Dtg'),
]
# Three to one letter code mapping
self.three_to_one = {
'Ala': 'A', 'Cys': 'C', 'Asp': 'D', 'Glu': 'E',
'Phe': 'F', 'Gly': 'G', 'His': 'H', 'Ile': 'I',
'Lys': 'K', 'Leu': 'L', 'Met': 'M', 'Asn': 'N',
'Pro': 'P', 'Gln': 'Q', 'Arg': 'R', 'Ser': 'S',
'Thr': 'T', 'Val': 'V', 'Trp': 'W', 'Tyr': 'Y',
'ala': 'a', 'cys': 'c', 'asp': 'd', 'glu': 'e',
'phe': 'f', 'gly': 'g', 'his': 'h', 'ile': 'i',
'lys': 'k', 'leu': 'l', 'met': 'm', 'asn': 'n',
'pro': 'p', 'gln': 'q', 'arg': 'r', 'ser': 's',
'thr': 't', 'val': 'v', 'trp': 'w', 'tyr': 'y', 'Cmt-cyclic': 'Ĉ',
'Aib': 'Ŷ', 'Dtg': 'Ĝ', 'Cmt': 'Ĉ', 'Eal': 'Ė', 'Nml': "Ŀ", 'Nma': 'Ṃ',
'Kpg': 'Ƙ', 'Tpb': 'Ṯ', 'Cyl': 'Ċ', 'Nle': 'Ł', 'Hph': 'Ĥ', 'Cys-Cys': 'CC', 'cys-cys': 'cc',
}
self._build_swisssidechain_lookups()
def _build_swisssidechain_lookups(self):
self.exact_smiles_lookup = {}
self.clean_smiles_lookup = {}
self.uaa_internal_exact = {}
self.uaa_internal_patterns = []
for uaa_name, uaa_data in all_aminos.items():
code = uaa_data["Code"]
smiles = uaa_data.get("SMILES", "")
nterm = uaa_data.get("nterm", "")
cterm = uaa_data.get("cterm", "")
letter = uaa_data.get("Letter")
# keep existing full-aa lookups
if smiles:
self.exact_smiles_lookup[smiles] = code
clean = self._remove_stereochemistry(smiles)
self.clean_smiles_lookup.setdefault(clean, []).append(code)
internal = ""
if cterm:
internal = _internal_from_cterm(cterm)
elif nterm:
internal = _internal_from_nterm(nterm)
if internal:
self.exact_smiles_lookup[internal] = code
clean_int = self._remove_stereochemistry(internal)
self.clean_smiles_lookup.setdefault(clean_int, []).append(code)
self.uaa_internal_exact[code] = internal
self.uaa_internal_patterns.append((_chirality_agnostic_regex(internal), code))
if letter:
self.three_to_one[code] = letter
def _remove_stereochemistry(self, smiles):
"""Remove stereochemistry from SMILES"""
cleaned = smiles
stereochemistry_patterns = [
'[C@@H]', '[C@H]', '[C@@]', '[C@]',
'[S@@]', '[S@]', '[N@@]', '[N@]',
'@@', '@'
]
for pattern in stereochemistry_patterns:
cleaned = cleaned.replace(pattern, pattern.replace('@@', '').replace('@', '').replace('[', '').replace(']', ''))
return cleaned
def preprocess_complex_residues(self, smiles):
complex_positions = []
for pattern, residue_type in self.complex_residue_patterns:
for match in re.finditer(pattern, smiles):
if not any(pos['start'] <= match.start() < pos['end'] or
pos['start'] < match.end() <= pos['end'] for pos in complex_positions):
complex_positions.append({
'start': match.start(),
'end': match.end(),
'type': residue_type,
'pattern': match.group()
})
for rgx, code in getattr(self, 'uaa_internal_patterns', []):
for match in rgx.finditer(smiles):
if not any(pos['start'] <= match.start() < pos['end'] or
pos['start'] < match.end() <= pos['end'] for pos in complex_positions):
complex_positions.append({
'start': match.start(),
'end': match.end(),
'type': code, # e.g., 'Dtg'
'pattern': match.group()
})
complex_positions.sort(key=lambda x: x['start'])
if not complex_positions:
return smiles, []
preprocessed_smiles = smiles
offset = 0
protected_residues = []
for pos in complex_positions:
start = pos['start'] + offset
end = pos['end'] + offset
complex_part = preprocessed_smiles[start:end]
# keep your stereo sanity check (OK to keep)
if not ('[C@H]' in complex_part or '[C@@H]' in complex_part):
# Dtg internal often *does* have [C@@H], so it will pass.
# If you find UAAs without explicit stereo, you may relax this guard.
pass
placeholder = f"COMPLEX_RESIDUE_{len(protected_residues)}"
preprocessed_smiles = preprocessed_smiles[:start] + placeholder + preprocessed_smiles[end:]
offset += len(placeholder) - (end - start)
protected_residues.append({
'placeholder': placeholder,
'type': pos['type'],
'content': complex_part
})
return preprocessed_smiles, protected_residues
def split_on_bonds(self, smiles, protected_residues=None):
"""Split SMILES into segments based on peptide bonds, with improved handling of protected residues"""
positions = []
used = set()
# Handle protected complex residues if any
if protected_residues:
for residue in protected_residues:
match = re.search(residue['placeholder'], smiles)
if match:
positions.append({
'start': match.start(),
'end': match.end(),
'type': 'complex',
'pattern': residue['placeholder'],
'residue_type': residue['type'],
'content': residue['content']
})
used.update(range(match.start(), match.end()))
# Find all peptide bonds
bond_positions = []
# Find Gly pattern first
gly_pattern = r'NCC\(=O\)'
for match in re.finditer(gly_pattern, smiles):
if not any(p in range(match.start(), match.end()) for p in used):
bond_positions.append({
'start': match.start(),
'end': match.end(),
'type': 'gly',
'pattern': match.group()
})
used.update(range(match.start(), match.end()))
for pattern, bond_type in self.bond_patterns:
for match in re.finditer(pattern, smiles):
if not any(p in range(match.start(), match.end()) for p in used):
bond_positions.append({
'start': match.start(),
'end': match.end(),
'type': bond_type,
'pattern': match.group()
})
used.update(range(match.start(), match.end()))
bond_positions.sort(key=lambda x: x['start'])
all_positions = positions + bond_positions
all_positions.sort(key=lambda x: x['start'])
segments = []
if all_positions and all_positions[0]['start'] > 0:
segments.append({
'content': smiles[0:all_positions[0]['start']],
'bond_after': all_positions[0]['pattern'] if all_positions[0]['type'] != 'complex' else None,
'complex_after': all_positions[0]['pattern'] if all_positions[0]['type'] == 'complex' else None
})
for i in range(len(all_positions)-1):
current = all_positions[i]
next_pos = all_positions[i+1]
if current['type'] == 'complex':
segments.append({
'content': current['content'],
'bond_before': all_positions[i-1]['pattern'] if i > 0 and all_positions[i-1]['type'] != 'complex' else None,
'bond_after': next_pos['pattern'] if next_pos['type'] != 'complex' else None,
'complex_type': current['residue_type']
})
elif current['type'] == 'gly':
segments.append({
'content': 'NCC(=O)',
'bond_before': all_positions[i-1]['pattern'] if i > 0 and all_positions[i-1]['type'] != 'complex' else None,
'bond_after': next_pos['pattern'] if next_pos['type'] != 'complex' else None
})
else:
content = smiles[current['end']:next_pos['start']]
if content and next_pos['type'] != 'complex':
segments.append({
'content': content,
'bond_before': current['pattern'],
'bond_after': next_pos['pattern'] if next_pos['type'] != 'complex' else None
})
# Last segment
if all_positions and all_positions[-1]['end'] < len(smiles):
if all_positions[-1]['type'] == 'complex':
segments.append({
'content': all_positions[-1]['content'],
'bond_before': all_positions[-2]['pattern'] if len(all_positions) > 1 and all_positions[-2]['type'] != 'complex' else None,
'complex_type': all_positions[-1]['residue_type']
})
else:
segments.append({
'content': smiles[all_positions[-1]['end']:],
'bond_before': all_positions[-1]['pattern']
})
return segments
def is_peptide(self, smiles):
"""Check if the SMILES represents a peptide structure"""
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return False
# Look for peptide bonds: NC(=O) pattern
peptide_bond_pattern = Chem.MolFromSmarts('[NH][C](=O)')
if mol.HasSubstructMatch(peptide_bond_pattern):
return True
# Look for N-methylated peptide bonds: N(C)C(=O) pattern
n_methyl_pattern = Chem.MolFromSmarts('[N;H0;$(NC)](C)[C](=O)')
if mol.HasSubstructMatch(n_methyl_pattern):
return True
return False
def is_cyclic(self, smiles):
# Check for C-terminal carboxyl
if smiles.endswith('C(=O)O'):
return False, [], []
# Find all numbers used in ring closures
ring_numbers = re.findall(r'(?:^|[^c])[0-9](?=[A-Z@\(\)])', smiles)
# Aromatic ring numbers
aromatic_matches = re.findall(r'c[0-9](?:ccccc|c\[nH\]c)[0-9]', smiles)
aromatic_cycles = []
for match in aromatic_matches:
numbers = re.findall(r'[0-9]', match)
aromatic_cycles.extend(numbers)
peptide_cycles = [n for n in ring_numbers if n not in aromatic_cycles]
is_cyclic = len(peptide_cycles) > 0 and not smiles.endswith('C(=O)O')
return is_cyclic, peptide_cycles, aromatic_cycles
def clean_terminal_carboxyl(self, segment):
"""Remove C-terminal carboxyl only if it's the true terminus"""
content = segment['content']
# Only clean if:
# 1. Contains C(=O)O
# 2. No bond_after exists (meaning it's the last segment)
if 'C(=O)O' in content and not segment.get('bond_after'):
# Remove C(=O)O pattern regardless of position
cleaned = re.sub(r'\(C\(=O\)O\)', '', content)
# Remove any leftover empty parentheses
cleaned = re.sub(r'\(\)', '', cleaned)
return cleaned
return content
def identify_residue(self, segment):
if 'complex_type' in segment:
return segment['complex_type'], []
# If this was protected by dynamic UAA shielding
if segment.get('complex_type') in self.uaa_internal_exact:
return segment['complex_type'], []
content = self.clean_terminal_carboxyl(segment)
mods = self.get_modifications(segment)
if content.startswith('COc1ccc(C(SC[C@@H]'):
print("DIRECT MATCH: Found Cmt at beginning")
return 'Cmt', mods
if '[C@@H]3CCCN3C2=O)(c2ccccc2)c2ccccc2)cc' in content:
print("DIRECT MATCH: Found Pro at end")
return 'Pro', mods
# Eal - Glu(OAll)
if 'CCC(=O)OCC=C' in content or 'CC(=O)OCC=C' in content or 'C=CCOC(=O)CC' in content:
return 'Eal', mods
# Proline (P)
if any([
(segment.get('bond_after', '').startswith(f'N{n}C(=O)') and 'CCC' in content and
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
for n in '123456789'
]) or any([(segment.get('bond_before', '').startswith(f'C(=O)N{n}') and 'CCC' in content and
any(f'CCC{n}' for n in '123456789'))
for n in '123456789'
]) or any([
(f'CCCN{n}' in content and content.endswith('=O') and
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
for n in '123456789'
]) or any([
# CCC[C@H]n
(content == f'CCC[C@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
(content == f'CCC[C@@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
# N-terminal Pro with any ring number
(f'N{n}CCC[C@H]{n}' in content) or
(f'N{n}CCC[C@@H]{n}' in content)
for n in '123456789'
]):
return 'Pro', mods
# D-Proline (p)
if ('N1[C@H](CCC1)' in content):
return 'pro', mods
# Tryptophan (W)
if re.search(r'c[0-9]c\[nH\]c[0-9]ccccc[0-9][0-9]', content) and \
'c[nH]c' in content.replace(' ', ''):
if '[C@H](CC' in content: # D-form
return 'trp', mods
return 'Trp', mods
# Lysine (K)
if '[C@@H](CCCCN)' in content or '[C@H](CCCCN)' in content:
if '[C@H](CCCCN)' in content: # D-form
return 'lys', mods
return 'Lys', mods
# Arginine (R)
if '[C@@H](CCCNC(=N)N)' in content or '[C@H](CCCNC(=N)N)' in content:
if '[C@H](CCCNC(=N)N)' in content: # D-form
return 'arg', mods
return 'Arg', mods
if content == 'C' and segment.get('bond_before') and segment.get('bond_after'):
if ('C(=O)N' in segment['bond_before'] or 'NC(=O)' in segment['bond_before'] or 'N(C)C(=O)' in segment['bond_before']) and \
('NC(=O)' in segment['bond_after'] or 'C(=O)N' in segment['bond_after'] or 'N(C)C(=O)' in segment['bond_after']):
return 'Gly', mods
if 'CNC' in content and any(f'C{i}=' in content for i in range(1, 10)):
return 'Gly', mods #'CNC1=O'
if not segment.get('bond_before') and segment.get('bond_after'):
if content == 'C' or content == 'NC':
if ('NC(=O)' in segment['bond_after'] or 'C(=O)N' in segment['bond_after'] or 'N(C)C(=O)' in segment['bond_after']):
return 'Gly', mods
# Leucine patterns (L/l)
if 'CC(C)C[C@H]' in content or 'CC(C)C[C@@H]' in content or '[C@@H](CC(C)C)' in content or '[C@H](CC(C)C)' in content or (('N[C@H](CCC(C)C)' in content or 'N[C@@H](CCC(C)C)' in content) and segment.get('bond_before') is None):
if '[C@H](CC(C)C)' in content or 'CC(C)C[C@H]' in content: # D-form
return 'leu', mods
return 'Leu', mods
# Threonine patterns (T/t)
if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content or '[C@@H]([C@H](C)O)' in content or '[C@H]([C@@H](C)O)' in content:
if '[C@H]([C@@H](C)O)' in content: # D-form
return 'thr', mods
return 'Thr', mods
if re.search(r'\[C@H\]\(CCc\d+ccccc\d+\)', content) or re.search(r'\[C@@H\]\(CCc\d+ccccc\d+\)', content):
return 'Hph', mods
# Phenylalanine patterns (F/f)
if re.search(r'\[C@H\]\(Cc\d+ccccc\d+\)', content) or re.search(r'\[C@@H\]\(Cc\d+ccccc\d+\)', content):
if re.search(r'\[C@H\]\(Cc\d+ccccc\d+\)', content): # D-form
return 'phe', mods
return 'Phe', mods
if ('CC(C)[C@@H]' in content or 'CC(C)[C@H]' in content or
'[C@H](C(C)C)' in content or '[C@@H](C(C)C)' in content or
'C(C)C[C@H]' in content or 'C(C)C[C@@H]' in content):
if not any(p in content for p in ['CC(C)C[C@H]', 'CC(C)C[C@@H]', 'CCC(=O)']):
if '[C@H]' in content and not '[C@@H]' in content: # D-form
return 'val', mods
return 'Val', mods
# Isoleucine patterns (I/i)
if (any(['CC[C@@H](C)' in content, '[C@@H](C)CC' in content, '[C@@H](CC)C' in content,
'C(C)C[C@@H]' in content, '[C@@H]([C@H](C)CC)' in content, '[C@H]([C@@H](C)CC)' in content,
'[C@@H]([C@@H](C)CC)' in content, '[C@H]([C@H](C)CC)' in content,
'C[C@H](CC)[C@@H]' in content, 'C[C@@H](CC)[C@H]' in content,
'C[C@H](CC)[C@H]' in content, 'C[C@@H](CC)[C@@H]' in content,
'CC[C@H](C)[C@@H]' in content, 'CC[C@@H](C)[C@H]' in content,
'CC[C@H](C)[C@H]' in content, 'CC[C@@H](C)[C@@H]' in content])
and 'CC(C)C' not in content): # Exclude valine pattern
if any(['[C@H]([C@@H](CC)C)' in content, '[C@H](CC)C' in content,
'[C@H]([C@@H](C)CC)' in content, '[C@H]([C@H](C)CC)' in content,
'C[C@@H](CC)[C@H]' in content, 'C[C@H](CC)[C@H]' in content,
'CC[C@@H](C)[C@H]' in content, 'CC[C@H](C)[C@H]' in content]):
# D-form
return 'ile', mods
return 'Ile', mods
# Tpb - Thr(PO(OBzl)OH)
if re.search(r'\(C\)OP\(=O\)\(O\)OCc[0-9]ccccc[0-9]', content) or 'OP(=O)(O)OCC' in content:
return 'Tpb', mods
# Alanine patterns (A/a)
if ('[C@H](C)' in content or '[C@@H](C)' in content):
if not any(p in content for p in ['C(C)C', 'COC', 'CN(', 'C(C)O', 'CC[C@H]', 'CC[C@@H]']):
if '[C@H](C)' in content: # D-form
return 'ala', mods
return 'Ala', mods
# Tyrosine patterns (Y/y)
if re.search(r'Cc[0-9]ccc\(O\)cc[0-9]', content):
if '[C@H](Cc1ccc(O)cc1)' in content: # D-form
return 'tyr', mods
return 'Tyr', mods
# Serine patterns (S/s)
if '[C@H](CO)' in content or '[C@@H](CO)' in content:
if not ('C(C)O' in content or 'COC' in content):
if '[C@H](CO)' in content: # D-form
return 'ser', mods
return 'Ser', mods
if 'CSSC' in content:
# cysteine-cysteine bridge
if re.search(r'\[C@@H\].*CSSC.*\[C@@H\]', content) or re.search(r'\[C@H\].*CSSC.*\[C@H\]', content):
if '[C@H]' in content and not '[C@@H]' in content: # D-form
return 'cys-cys', mods
return 'Cys-Cys', mods
# N-terminal amine group
if '[C@@H](N)CSSC' in content or '[C@H](N)CSSC' in content:
if '[C@H](N)CSSC' in content: # D-form
return 'cys-cys', mods
return 'Cys-Cys', mods
# C-terminal carboxyl
if 'CSSC[C@@H](C(=O)O)' in content or 'CSSC[C@H](C(=O)O)' in content:
if 'CSSC[C@H](C(=O)O)' in content: # D-form
return 'cys-cys', mods
return 'Cys-Cys', mods
# Cysteine patterns (C/c)
if '[C@H](CS)' in content or '[C@@H](CS)' in content:
if '[C@H](CS)' in content: # D-form
return 'cys', mods
return 'Cys', mods
# Methionine patterns (M/m)
if ('CCSC' in content) or ("CSCC" in content):
if '[C@H](CCSC)' in content: # D-form
return 'met', mods
elif '[C@H]' in content:
return 'met', mods
return 'Met', mods
# Glutamine patterns (Q/q)
if (content == '[C@@H](CC' or content == '[C@H](CC' and segment.get('bond_before')=='C(=O)N' and segment.get('bond_after')=='C(=O)N') or ('CCC(=O)N' in content) or ('CCC(N)=O' in content):
if '[C@H](CCC(=O)N)' in content: # D-form
return 'gln', mods
return 'Gln', mods
# Asparagine patterns (N/n)
if (content == '[C@@H](C' or content == '[C@H](C' and segment.get('bond_before')=='C(=O)N' and segment.get('bond_after')=='C(=O)N') or ('CC(=O)N' in content) or ('CCN(=O)' in content) or ('CC(N)=O' in content):
if '[C@H](CC(=O)N)' in content: # D-form
return 'asn', mods
return 'Asn', mods
# Glutamic acid patterns (E/e)
if ('CCC(=O)O' in content):
if '[C@H](CCC(=O)O)' in content: # D-form
return 'glu', mods
return 'Glu', mods
# Aspartic acid patterns (D/d)
if ('CC(=O)O' in content):
if '[C@H](CC(=O)O)' in content: # D-form
return 'asp', mods
return 'Asp', mods
if re.search(r'Cc\d+c\[nH\]cn\d+', content) or re.search(r'Cc\d+cnc\[nH\]\d+', content):
if '[C@H]' in content: # D-form
return 'his', mods
return 'His', mods
if 'C2(CCCC2)' in content or 'C1(CCCC1)' in content or re.search(r'C\d+\(CCCC\d+\)', content):
return 'Cyl', mods
if ('N[C@@H](CCCC)' in content or '[C@@H](CCCC)' in content or 'CCCC[C@@H]' in content or
'N[C@H](CCCC)' in content or '[C@H](CCCC)' in content) and 'CC(C)' not in content:
return 'Nle', mods
if 'C(C)(C)(N)' in content:
return 'Aib', mods
if 'C(C)(C)' in content and 'OC(C)(C)C' not in content:
if (segment.get('bond_before') and segment.get('bond_after') and
any(bond in segment['bond_before'] for bond in ['C(=O)N', 'NC(=O)', 'N(C)C(=O)']) and
any(bond in segment['bond_after'] for bond in ['NC(=O)', 'C(=O)N', 'N(C)C(=O)'])):
return 'Aib', mods
# Dtg - Asp(OtBu)-(Dmb)Gly
if 'CC(=O)OC(C)(C)C' in content and 'CC1=C(C=C(C=C1)OC)OC' in content:
return 'Dtg', mods
# Kpg - Lys(palmitoyl-Glu-OtBu)
if 'CCCNC(=O)' in content and 'CCCCCCCCCCCC' in content:
return 'Kpg', mods
#======================Other UAAs from the SwissSidechain==========================================
# ADD SWISSSIDECHAIN MATCHING AT THE VERY END - only if nothing else matched
if content in self.exact_smiles_lookup:
return self.exact_smiles_lookup[content], mods
# Look up without stereochemistry differences)
content_clean = self._remove_stereochemistry(content)
if content_clean in self.clean_smiles_lookup:
matches = self.clean_smiles_lookup[content_clean]
if len(matches) == 1:
return matches[0], mods
else:
# Prefer L-forms (non-D prefixed codes) over D-forms
l_forms = [m for m in matches if not m.startswith('D')]
if l_forms:
return l_forms[0], mods
return matches[0], mods
return None, mods
def get_modifications(self, segment):
"""Get modifications based on bond types and segment content - fixed to avoid duplicates"""
mods = []
# Check for N-methylation in any form, but only add it once
# Check both bonds and segment content for N-methylation patterns
if ((segment.get('bond_after') and
('N(C)' in segment['bond_after'] or segment['bond_after'].startswith('C(=O)N(C)'))) or
('N(C)C(=O)' in segment['content'] or 'N(C)C1=O' in segment['content']) or
(segment['content'].endswith('N(C)C(=O)') or segment['content'].endswith('N(C)C1=O'))):
mods.append('N-Me')
# Check for O-linked modifications
#if segment.get('bond_after') and 'OC(=O)' in segment['bond_after']:
#mods.append('O-linked')
return mods
def analyze_structure(self, smiles, verbose=False):
logs = []
preprocessed_smiles, protected_residues = self.preprocess_complex_residues(smiles)
is_cyclic, peptide_cycles, aromatic_cycles = self.is_cyclic(smiles)
segments = self.split_on_bonds(preprocessed_smiles, protected_residues)
sequence = []
for i, segment in enumerate(segments):
if verbose:
logs.append(f"\nSegment {i}:")
logs.append(f" Content: {segment.get('content','None')}")
logs.append(f" Bond before: {segment.get('bond_before','None')}")
logs.append(f" Bond after: {segment.get('bond_after','None')}")
residue, mods = self.identify_residue(segment)
if residue:
if mods:
sequence.append(f"{residue}({','.join(mods)})")
else:
sequence.append(residue)
else:
logs.append(f"Warning: Could not identify residue in segment: {segment.get('content', 'None')}")
three_letter = '-'.join(sequence)
one_letter = ''.join(self.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence)
if is_cyclic:
three_letter = f"cyclo({three_letter})"
one_letter = f"cyclo({one_letter})"
return {
'three_letter': three_letter,
'one_letter': one_letter,
'is_cyclic': is_cyclic,
'residues': sequence,
'details': "\n".join(logs)
}
def get_uaa_information(self):
uaa_info = """
## Supported Non-Standard Amino Acids (UAAs) (Common)
- **Kpg** - Lys(palmitoyl-Glu-OtBu)
- **Cmt** - Cys(Mmt)
- **Eal** - Glu(OAll)
- **Tpb** - Thr(PO(OBzl)OH)
- **Dtg** - Asp(OtBu)-(Dmb)Gly
- **Aib** - α-Aminoisobutyric acid
- **Nle** - Norleucine
- **Hph** - Homophenylalanine
- **Cyl** - Cycloleucine
- **Nml** - N-methylleucine
- **Nma** - N-methylalanine
### Special Cases:
- **Cys-Cys** - Disulfide-bridged cysteine dimer
---
## Three-to-One Letter Code Mapping
### Standard Amino Acids:
**L-amino acids:** A, C, D, E, F, G, H, I, K, L, M, N, P, Q, R, S, T, V, W, Y
**D-amino acids:** a, c, d, e, f, g, h, i, k, l, m, n, p, q, r, s, t, v, w, y
### UAA Single Letter Codes:
| UAA | Code | UAA | Code | UAA | Code |
|-----|------|-----|------|-----|------|
| Aib | Ŷ | Dtg | Ĝ | Cmt | Ĉ |
| Eal | Ė | Nml | Ŀ | Nma | Ṃ |
| Kpg | Ƙ | Tpb | Ṯ | Cyl | Ċ |
| Nle | Ł | Hph | Ĥ | | |
### Special Cases:
- **Cys-Cys:** CC (L-form) or cc (D-form)
## For other mappings, please refer to the [SwissSideChain webside](https://www.swisssidechain.ch/browse/family/table.php?family=all)
"""
return uaa_info
def annotate_cyclic_structure(mol, sequence):
"""Create structure visualization"""
AllChem.Compute2DCoords(mol)
drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000)
drawer.drawOptions().addAtomIndices = False
drawer.DrawMolecule(mol)
drawer.FinishDrawing()
img = Image.open(BytesIO(drawer.GetDrawingText()))
draw = ImageDraw.Draw(img)
try:
small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60)
except OSError:
try:
small_font = ImageFont.truetype("arial.ttf", 60)
except OSError:
print("Warning: TrueType fonts not available, using default font")
small_font = ImageFont.load_default()
seq_text = f"Sequence: {sequence}"
bbox = draw.textbbox((1000, 100), seq_text, font=small_font)
padding = 10
draw.rectangle([bbox[0]-padding, bbox[1]-padding,
bbox[2]+padding, bbox[3]+padding],
fill='white', outline='white')
draw.text((1000, 100), seq_text,
font=small_font, fill='black', anchor="mm")
return img
def create_enhanced_linear_viz(sequence, smiles):
""""Linear visualization"""
analyzer = PeptideAnalyzer()
fig = plt.figure(figsize=(15, 10))
gs = fig.add_gridspec(2, 1, height_ratios=[1, 2])
ax_struct = fig.add_subplot(gs[0])
ax_detail = fig.add_subplot(gs[1])
if sequence.startswith('cyclo('):
residues = sequence[6:-1].split('-')
else:
residues = sequence.split('-')
segments = analyzer.split_on_bonds(smiles)
print(f"Number of residues: {len(residues)}")
print(f"Number of segments: {len(segments)}")
ax_struct.set_xlim(0, 10)
ax_struct.set_ylim(0, 2)
num_residues = len(residues)
spacing = 9.0 / (num_residues - 1) if num_residues > 1 else 9.0
y_pos = 1.5
for i in range(num_residues):
x_pos = 0.5 + i * spacing
rect = patches.Rectangle((x_pos-0.3, y_pos-0.2), 0.6, 0.4,
facecolor='lightblue', edgecolor='black')
ax_struct.add_patch(rect)
if i < num_residues - 1:
segment = segments[i] if i < len(segments) else None
if segment:
bond_type = 'ester' if 'O-linked' in segment.get('bond_after', '') else 'peptide'
is_n_methylated = 'N-Me' in segment.get('bond_after', '')
bond_color = 'red' if bond_type == 'ester' else 'black'
linestyle = '--' if bond_type == 'ester' else '-'
ax_struct.plot([x_pos+0.3, x_pos+spacing-0.3], [y_pos, y_pos],
color=bond_color, linestyle=linestyle, linewidth=2)
mid_x = x_pos + spacing/2
bond_label = f"{bond_type}"
if is_n_methylated:
bond_label += "\n(N-Me)"
ax_struct.text(mid_x, y_pos+0.1, bond_label,
ha='center', va='bottom', fontsize=10,
color=bond_color)
ax_struct.text(x_pos, y_pos-0.5, residues[i],
ha='center', va='top', fontsize=14)
ax_detail.set_ylim(0, len(segments)+1)
ax_detail.set_xlim(0, 1)
segment_y = len(segments)
for i, segment in enumerate(segments):
y = segment_y - i
# Check if this is a bond or residue
residue, mods = analyzer.identify_residue(segment)
if residue:
text = f"Residue {i+1}: {residue}"
if mods:
text += f" ({', '.join(mods)})"
color = 'blue'
else:
text = f"Bond {i}: "
if 'O-linked' in segment.get('bond_after', ''):
text += "ester"
elif 'N-Me' in segment.get('bond_after', ''):
text += "peptide (N-methylated)"
else:
text += "peptide"
color = 'red'
ax_detail.text(0.05, y, text, fontsize=12, color=color)
ax_detail.text(0.5, y, f"SMILES: {segment.get('content', '')}", fontsize=10, color='gray')
# If cyclic, add connection indicator
if sequence.startswith('cyclo('):
ax_struct.annotate('', xy=(9.5, y_pos), xytext=(0.5, y_pos),
arrowprops=dict(arrowstyle='<->', color='red', lw=2))
ax_struct.text(5, y_pos+0.3, 'Cyclic Connection',
ha='center', color='red', fontsize=14)
ax_struct.set_title("Peptide Structure Overview", pad=20)
ax_detail.set_title("Segment Analysis Breakdown", pad=20)
for ax in [ax_struct, ax_detail]:
ax.set_xticks([])
ax.set_yticks([])
ax.axis('off')
plt.tight_layout()
return fig
class PeptideStructureGenerator:
"""Generate 3D structures of peptides using different embedding methods"""
@staticmethod
def prepare_molecule(smiles):
"""Prepare molecule with proper hydrogen handling"""
mol = Chem.MolFromSmiles(smiles, sanitize=False)
if mol is None:
raise ValueError("Failed to create molecule from SMILES")
for atom in mol.GetAtoms():
atom.UpdatePropertyCache(strict=False)
# Sanitize with reduced requirements
Chem.SanitizeMol(mol,
sanitizeOps=Chem.SANITIZE_FINDRADICALS|
Chem.SANITIZE_KEKULIZE|
Chem.SANITIZE_SETAROMATICITY|
Chem.SANITIZE_SETCONJUGATION|
Chem.SANITIZE_SETHYBRIDIZATION|
Chem.SANITIZE_CLEANUPCHIRALITY)
mol = Chem.AddHs(mol)
return mol
@staticmethod
def get_etkdg_params(attempt=0):
"""Get ETKDG parameters"""
params = AllChem.ETKDGv3()
params.randomSeed = -1
params.maxIterations = 200
params.numThreads = 4 # Reduced for web interface
params.useBasicKnowledge = True
params.enforceChirality = True
params.useExpTorsionAnglePrefs = True
params.useSmallRingTorsions = True
params.useMacrocycleTorsions = True
params.ETversion = 2
params.pruneRmsThresh = -1
params.embedRmsThresh = 0.5
if attempt > 10:
params.bondLength = 1.5 + (attempt - 10) * 0.02
params.useExpTorsionAnglePrefs = False
return params
def generate_structure_etkdg(self, smiles, max_attempts=20):
"""Generate 3D structure using ETKDG without UFF optimization"""
success = False
mol = None
for attempt in range(max_attempts):
try:
mol = self.prepare_molecule(smiles)
params = self.get_etkdg_params(attempt)
if AllChem.EmbedMolecule(mol, params) == 0:
success = True
break
except Exception as e:
continue
if not success:
raise ValueError("Failed to generate structure with ETKDG")
return mol
def generate_structure_uff(self, smiles, max_attempts=20):
"""Generate 3D structure using ETKDG followed by UFF optimization"""
best_mol = None
lowest_energy = float('inf')
for attempt in range(max_attempts):
try:
test_mol = self.prepare_molecule(smiles)
params = self.get_etkdg_params(attempt)
if AllChem.EmbedMolecule(test_mol, params) == 0:
res = AllChem.UFFOptimizeMolecule(test_mol, maxIters=2000,
vdwThresh=10.0, confId=0,
ignoreInterfragInteractions=True)
if res == 0:
ff = AllChem.UFFGetMoleculeForceField(test_mol)
if ff:
current_energy = ff.CalcEnergy()
if current_energy < lowest_energy:
lowest_energy = current_energy
best_mol = Chem.Mol(test_mol)
except Exception:
continue
if best_mol is None:
raise ValueError("Failed to generate optimized structure")
return best_mol
@staticmethod
def mol_to_sdf_bytes(mol):
"""Convert RDKit molecule to SDF file bytes"""
sio = StringIO()
writer = Chem.SDWriter(sio)
writer.write(mol)
writer.close()
return sio.getvalue().encode('utf-8')
class PeptideEncoder:
# map one-letter <-> three-letter
one_to_three = {
'A':'Ala','C':'Cys','D':'Asp','E':'Glu','F':'Phe','G':'Gly','H':'His','I':'Ile',
'K':'Lys','L':'Leu','M':'Met','N':'Asn','P':'Pro','Q':'Gln','R':'Arg','S':'Ser',
'T':'Thr','V':'Val','W':'Trp','Y':'Tyr',
'a':'ala','c':'cys','d':'asp','e':'glu','f':'phe','g':'gly','h':'his','i':'ile',
'k':'lys','l':'leu','m':'met','n':'asn','p':'pro','q':'gln','r':'arg','s':'ser',
't':'thr','v':'val','w':'trp','y':'tyr'
}
# L-form uses [C@@H], D-form uses [C@H].
SEG_L = {
'Ala': '[C@@H](C)',
'Gly': 'C', # your analyzer treats bare 'C' (or 'NC') as Gly in context
'Val': '[C@@H](C(C)C)',
'Leu': '[C@@H](CC(C)C)',
'Ile': '[C@@H]([C@H](C)CC)',
'Ser': '[C@@H](CO)',
'Thr': '[C@@H]([C@@H](C)O)',
'Cys': '[C@@H](CS)',
'Met': '[C@@H](CCSC)',
'Phe': '[C@@H](Cc1ccccc1)',
'Tyr': '[C@@H](Cc1ccc(O)cc1)',
'Trp': '[C@@H](Cc1c[nH]c2ccccc12)',
'His': '[C@@H](Cc1c[nH]cn1)',
'Asp': '[C@@H](CC(=O)O)',
'Glu': '[C@@H](CCC(=O)O)',
'Asn': '[C@@H](CC(=O)N)',
'Gln': '[C@@H](CCC(=O)N)',
'Lys': '[C@@H](CCCCN)',
'Arg': '[C@@H](CCCNC(=N)N)',
'Pro': 'CC[C@H]2CN2' # only used if not doing ring-number closure
}
# D-forms: flip chirality tag to [C@H]
SEG_D = {k.lower(): v.replace('[C@@H]', '[C@H]').replace('[C@H]2','[C@@H]2') for k, v in SEG_L.items()}
UAA_SEG = {
'Aib': 'C(C)(C)', # alpha,alpha-dimethyl gly (detected as Aib when bracketed by peptide bonds)
'Nle': '[C@@H](CCCC)', # norleucine ~ Lys w/o terminal amine
'Hph': '[C@@H](CCc1ccccc1)', # homophenylalanine
'Cyl': 'C1(CCCC1)', # cycloleucine
}
def __init__(self):
self.ssc_code_to_internal = {}
for name, data in specific_aminos.items():
code = data["Code"]
cterm = data.get("cterm", "")
nterm = data.get("nterm", "")
internal = ""
if cterm:
internal = _internal_from_cterm(cterm)
elif nterm:
internal = _internal_from_nterm(nterm)
if internal:
self.ssc_code_to_internal[code] = internal
for name, data in all_aminos.items():
code = data["Code"]
cterm = data.get("cterm", "")
nterm = data.get("nterm", "")
internal = ""
if cterm:
internal = _internal_from_cterm(cterm)
elif nterm:
internal = _internal_from_nterm(nterm)
if internal:
self.ssc_code_to_internal[code] = internal
def _segment_for(self, code):
if code in self.SEG_L: return self.SEG_L[code]
if code in self.SEG_D: return self.SEG_D[code]
if code in self.UAA_SEG: return self.UAA_SEG[code]
if code in self.ssc_code_to_internal:
return self.ssc_code_to_internal[code]
cap = code[:1].upper() + code[1:].lower()
if cap in self.SEG_L: return self.SEG_L[cap]
raise ValueError(f"Unknown residue code: {code}")
def _is_one_letter_seq(self, seq: str) -> bool:
"""Check if the input string looks like a one-letter code sequence."""
if "-" not in seq:
return True
def _norm_token(self, tok):
"""Normalize tokens like 'A', 'a', 'Ala', 'ala', 'Ala(N-Me)' -> (code, n_me_flag)"""
n_me = False
tok = tok.strip()
if tok in self.one_to_three:
base = self.one_to_three[tok]
else:
m = re.match(r'^([A-Za-z\-]+)(\((.*?)\))?$', tok)
if not m:
return tok, n_me
base = m.group(1)
mods = m.group(3) or ""
if 'N-Me' in mods or 'Nme' in mods or 'NME' in mods:
n_me = True
return base, n_me
def _bond_for(self, n_me=False, pro_ring=False, ring_idx=1):
"""Return the INTER-RESIDUE bond token your parser recognizes."""
if pro_ring:
return f'C(=O)N{ring_idx}'
return 'N(C)C(=O)' if n_me else 'NC(=O)'
def _split_tokens(self, seq):
if isinstance(seq, (list, tuple)):
return list(seq)
seq = seq.strip()
if self._is_one_letter_seq(seq):
return list(seq)
import re
return [t for t in re.split(r'-(?![^()]*\))', seq) if t]
def encode(self, seq, cyclic=False, use_proline_ring=True):
"""
Encode a peptide to a SMILES string using the same grammar your analyzer expects.
Args:
seq: list of tokens or a string like:
'Ala-Gly-Phe', 'A-G-F', 'Ala(N-Me)-Leu-Ser', 'Aib-Nle-Arg'
D-forms: 'ala-gly', or 'a-g'
cyclic: if True, connect C-terminus back to N-terminus (macrocycle)
use_proline_ring: if True, do ring-number closure for Pro (N{digit} ... [C@H]{digit})
"""
toks = self._split_tokens(seq)
res, mods = [], []
for t in toks:
base, n_me = self._norm_token(t) # your existing parser for "(N-Me)"
res.append(base)
mods.append(n_me)
# Build segments
segs = [self._segment_for(r) for r in res]
# Proline ring bookkeeping
# We only do the special N{digit}...{digit} closure when a bond *into* Pro occurs.
bonds = []
for i in range(len(segs)-1):
next_is_pro = res[i+1] in ('Pro','pro')
if use_proline_ring and next_is_pro:
bonds.append(self._bond_for(n_me=mods[i], pro_ring=True, ring_idx=1))
# Make the Pro segment end with the matching ring digit
segs[i+1] = 'CCC[C@H]1' if res[i+1]=='Pro' else 'CCC[C@@H]1'
else:
bonds.append(self._bond_for(n_me=mods[i], pro_ring=False))
# Assemble linear chain
# [segment0] + bond0 + [segment1] + bond1 + ... + [segmentN-1] + C(=O)O
out = []
for i, s in enumerate(segs):
out.append(s)
if i < len(bonds):
out.append(bonds[i])
if cyclic:
# TODO
pass
else:
out.append('C(=O)O')
return ''.join(out)
def process_input(
smiles_input=None,
file_obj=None,
#show_linear=False,
show_segment_details=False,
generate_3d=False,
use_uff=False
):
"""Actual Execution Command."""
analyzer = PeptideAnalyzer()
temp_dir = tempfile.mkdtemp() if generate_3d else None
structure_files = []
# Retrieve UAA information
uaa_info = analyzer.get_uaa_information()
# Handle direct SMILES input
if smiles_input:
smiles = smiles_input.strip()
if not analyzer.is_peptide(smiles):
return "Error: Input SMILES does not appear to be a peptide structure.", None, None, []
try:
# Preprocess to protect complex residues
pre_smiles, protected_residues = analyzer.preprocess_complex_residues(smiles)
# Report protected residues in summary if any
protected_info = None
if protected_residues:
protected_info = [res['type'] for res in protected_residues]
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return "Error: Invalid SMILES notation.", None, None, []
if generate_3d:
generator = PeptideStructureGenerator()
try:
# Generate ETKDG structure
mol_etkdg = generator.generate_structure_etkdg(smiles)
etkdg_path = os.path.join(temp_dir, "structure_etkdg.sdf")
writer = Chem.SDWriter(etkdg_path)
writer.write(mol_etkdg)
writer.close()
structure_files.append(etkdg_path)
# Generate UFF structure if requested
if use_uff:
mol_uff = generator.generate_structure_uff(smiles)
uff_path = os.path.join(temp_dir, "structure_uff.sdf")
writer = Chem.SDWriter(uff_path)
writer.write(mol_uff)
writer.close()
structure_files.append(uff_path)
except Exception as e:
return f"Error generating 3D structures: {str(e)}", None, None, []
analysis = analyzer.analyze_structure(smiles, verbose=show_segment_details)
three_letter = analysis['three_letter']
one_letter = analysis['one_letter']
is_cyclic = analysis['is_cyclic']
details = analysis.get('details', "")
img_cyclic = annotate_cyclic_structure(mol, three_letter)
summary = "Summary:\n"
summary += f"Sequence: {three_letter}\n"
summary += f"One-letter code: {one_letter}\n"
summary += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n"
# Add segment details if requested
if show_segment_details and details:
summary += "\n" + "="*50 + "\n"
summary += "SEGMENT ANALYSIS:\n"
summary += "="*50 + "\n"
summary += details + "\n"
detected_uaas = [aa for aa in analysis['residues'] if aa not in [
'Ala', 'Cys', 'Asp', 'Glu', 'Phe', 'Gly', 'His', 'Ile', 'Lys', 'Leu',
'Met', 'Asn', 'Pro', 'Gln', 'Arg', 'Ser', 'Thr', 'Val', 'Trp', 'Tyr',
'ala', 'cys', 'asp', 'glu', 'phe', 'gly', 'his', 'ile', 'lys', 'leu',
'met', 'asn', 'pro', 'gln', 'arg', 'ser', 'thr', 'val', 'trp', 'tyr'
]]
if detected_uaas:
summary += f"\nDetected UAAs: {', '.join(set(detected_uaas))}\n"
if structure_files:
summary += "\n3D Structures Generated:\n"
for filepath in structure_files:
summary += f"- {os.path.basename(filepath)}\n"
#return summary, img_cyclic, img_linear, structure_files if structure_files else None
return summary, img_cyclic, uaa_info
except Exception as e:
#return f"Error processing SMILES: {str(e)}", None, None, []
return f"Error processing SMILES: {str(e)}", None, uaa_info
# Handle file input
if file_obj is not None:
try:
if hasattr(file_obj, 'name'):
with open(file_obj.name, 'r') as f:
content = f.read()
else:
content = file_obj.decode('utf-8') if isinstance(file_obj, bytes) else str(file_obj)
output_text = ""
for line in content.splitlines():
smiles = line.strip()
if not smiles:
continue
if not analyzer.is_peptide(smiles):
output_text += f"Skipping non-peptide SMILES: {smiles}\n"
continue
try:
result = analyzer.analyze_structure(smiles)
output_text += f"\nSummary for SMILES: {smiles}\n"
output_text += f"Sequence: {result['three_letter']}\n"
output_text += f"One-letter code: {result['one_letter']}\n"
output_text += f"Is Cyclic: {'Yes' if result['is_cyclic'] else 'No'}\n"
output_text += "-" * 50 + "\n"
except Exception as e:
output_text += f"Error processing SMILES: {smiles} - {str(e)}\n"
output_text += "-" * 50 + "\n"
return output_text, None, uaa_info
except Exception as e:
#return f"Error processing file: {str(e)}", None, None, []
return f"Error processing file: {str(e)}", None, uaa_info
return (
output_text or "No analysis done.",
img_cyclic if 'img_cyclic' in locals() else None, uaa_info
#img_linear if 'img_linear' in locals() else None,
#structure_files if structure_files else []
)
def process_sequence_to_smiles(
seq_input: str,
show_segment_details: bool = False,
use_proline_ring: bool = True,
cyclic: bool = False
):
"""
Encode a peptide sequence to SMILES, then analyze back with PeptideAnalyzer for round-trip.
"""
if not seq_input or not seq_input.strip():
return "Please enter a peptide sequence.", None, None
try:
enc = PeptideEncoder() # make sure this class is defined in your file
smiles = enc.encode(seq_input.strip(), cyclic=cyclic, use_proline_ring=use_proline_ring)
analyzer = PeptideAnalyzer()
# pre-check it's a peptide
if not analyzer.is_peptide(smiles):
return "Internal error: generated SMILES did not look like a peptide.", None, None
# analyze round-trip
analysis = analyzer.analyze_structure(smiles, verbose=show_segment_details)
three_letter = analysis['three_letter']
one_letter = analysis['one_letter']
is_cyclic = analysis['is_cyclic']
details = analysis.get('details', "")
img = annotate_cyclic_structure(Chem.MolFromSmiles(smiles), three_letter)
summary = []
summary.append("Peptide → SMILES")
summary.append("-" * 50)
summary.append(f"Input sequence: {seq_input}")
summary.append(f"Generated SMILES:\n{smiles}")
summary.append("")
summary.append("Round-trip check (SMILES → sequence):")
summary.append(f"Sequence: {three_letter}")
summary.append(f"One-letter code: {one_letter}")
summary.append(f"Is Cyclic: {'Yes' if is_cyclic else 'No'}")
if show_segment_details and details:
summary.append("\n" + "="*50)
summary.append("SEGMENT ANALYSIS")
summary.append("="*50)
summary.append(details)
# UAA report
detected_uaas = [aa for aa in analysis['residues'] if aa not in [
'Ala', 'Cys', 'Asp', 'Glu', 'Phe', 'Gly', 'His', 'Ile', 'Lys', 'Leu',
'Met', 'Asn', 'Pro', 'Gln', 'Arg', 'Ser', 'Thr', 'Val', 'Trp', 'Tyr',
'ala', 'cys', 'asp', 'glu', 'phe', 'gly', 'his', 'ile', 'lys', 'leu',
'met', 'asn', 'pro', 'gln', 'arg', 'ser', 'thr', 'val', 'trp', 'tyr'
]]
if detected_uaas:
summary.append(f"\nDetected UAAs (round-trip): {', '.join(sorted(set(detected_uaas)))}")
return "\n".join(summary), img, smiles
except Exception as e:
return f"Error: {str(e)}", None, None
with gr.Blocks(title="Peptide Structure Analyzer and Visualizer") as demo:
gr.Markdown("# Peptide Structure Analyzer and Visualizer")
# 👇 place your original multi-line description right here
gr.Markdown("""
Analyze and visualize peptide structures from SMILES notation:
1. Validates if the input is a peptide structure
2. Determines if the peptide is cyclic
3. Parses the amino acid sequence
4. Creates 2D structure visualization with residue annotations
Input: Either enter a SMILES string directly or upload a text file containing SMILES strings
Example SMILES strings (copy and paste):
```
CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H]2CCCN2C1=O
```
```
C(C)C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@H](C)NC(=O)[C@H](Cc2ccccc2)NC1=O
```
```
CC(C)C[C@H]1C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)NCC(=O)N[C@H](C(=O)N2CCCCC2)CC(=O)N(C)CC(=O)N[C@@H]([C@@H](C)O)C(=O)N(C)[C@@H](C)C(=O)N[C@@H](COC(C)(C)C)C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N1C
```
Example Peptide strings (copy and paste):
```
AGFS
```
```
Ala-Gly-Phe-Ser
```
```
Aib-Dtg-Ser
```
""")
with gr.Tab("SMILES → Sequence"):
gr.Markdown("Analyze peptide SMILES, detect cyclicity, parse sequence, and annotate.")
smiles_in = gr.Textbox(label="Enter SMILES string", lines=2, placeholder="Enter SMILES notation of peptide...")
file_in = gr.File(label="Or upload a text file with SMILES", file_types=[".txt"])
show_seg = gr.Checkbox(label="Show segmentation details", value=False)
run_btn_1 = gr.Button("Analyze")
out_text_1 = gr.Textbox(label="Analysis Results", lines=12)
out_img_1 = gr.Image(label="2D Structure with Annotations", type="pil")
out_md_1 = gr.Markdown(label="Side Notes for Non-Standard Amino Acids")
def _run_smiles(s_in, f_in, sh):
return process_input(
smiles_input=s_in,
file_obj=f_in,
show_segment_details=sh,
generate_3d=False,
use_uff=False
)
run_btn_1.click(
_run_smiles,
inputs=[smiles_in, file_in, show_seg],
outputs=[out_text_1, out_img_1, out_md_1]
)
with gr.Tab("Peptide → SMILES"):
gr.Markdown("Encode a peptide sequence to SMILES (one-letter or three-letter) and verify round-trip.")
seq_in = gr.Textbox(
label="Enter peptide sequence",
lines=2,
placeholder="Examples: AGFS | Ala-Gly-Phe-Ser | Ala(N-Me)-Pro-Phe | Aib-Dtg-Ser"
)
with gr.Row():
use_pro = gr.Checkbox(label="Use Proline ring join", value=True)
cyc = gr.Checkbox(label="Cyclic (macrocycle)", value=False)
show_seg2 = gr.Checkbox(label="Show segmentation details", value=False)
run_btn_2 = gr.Button("Encode")
out_text_2 = gr.Textbox(label="Results & Round-trip", lines=14)
out_img_2 = gr.Image(label="2D Structure with Annotations", type="pil")
out_smiles = gr.Textbox(label="Generated SMILES (copyable)", lines=2)
run_btn_2.click(
process_sequence_to_smiles,
inputs=[seq_in, show_seg2, use_pro, cyc],
outputs=[out_text_2, out_img_2, out_smiles]
)
if __name__ == "__main__":
demo.launch(share=True)
"""
iface = gr.Interface(
fn=process_input,
inputs=[
gr.Textbox(
label="Enter SMILES string",
placeholder="Enter SMILES notation of peptide...",
lines=2
),
gr.File(
label="Or upload a text file with SMILES",
file_types=[".txt"]
),
gr.Checkbox(
label="Show show segmentation details",
value=False
),],
outputs=[
gr.Textbox(
label="Analysis Results",
lines=10
),
gr.Image(
label="2D Structure with Annotations",
type="pil"
),
#gr.File(
#label="3D Structure Files",
#file_count="multiple"
#),
gr.Markdown(
label="Side Notes for Non-Standard Amino Acids",
)
],
title="Peptide Structure Analyzer and Visualizer",
description='''
Analyze and visualize peptide structures from SMILES notation:
1. Validates if the input is a peptide structure
2. Determines if the peptide is cyclic
3. Parses the amino acid sequence
4. Creates 2D structure visualization with residue annotations
Input: Either enter a SMILES string directly or upload a text file containing SMILES strings
Example SMILES strings (copy and paste):
```
CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H]2CCCN2C1=O
```
```
C(C)C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@H](C)NC(=O)[C@H](Cc2ccccc2)NC1=O
```
```
CC(C)C[C@H]1C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)NCC(=O)N[C@H](C(=O)N2CCCCC2)CC(=O)N(C)CC(=O)N[C@@H]([C@@H](C)O)C(=O)N(C)[C@@H](C)C(=O)N[C@@H](COC(C)(C)C)C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N1C
```
''',
flagging_mode="never"
)
if __name__ == "__main__":
iface.launch(share=True)
"""
"""
5. Optional linear representation
6. Optional 3D structure generation (ETKDG and UFF methods)
gr.Checkbox(
label="Generate 3D structure (sdf file format)",
value=False
),
gr.Checkbox(
label="Use UFF optimization (may take long)",
value=False
)
],
""" |