Joey Callanan commited on
Commit ·
e2b7617
1
Parent(s): 44c0eb3
adding SCMG
Browse filesThis view is limited to 50 files because it contains too many changes.
See raw diff
- SCMG/__pycache__/_version.cpython-310.pyc +0 -0
- SCMG/_version.py +2 -0
- SCMG/config/__init__.py +0 -0
- SCMG/config/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/config/__pycache__/modelparameters.cpython-310.pyc +0 -0
- SCMG/config/__pycache__/varables.cpython-310.pyc +0 -0
- SCMG/config/modelparameters.py +21 -0
- SCMG/config/varables.py +234 -0
- SCMG/models/GPT/__init__.py +0 -0
- SCMG/models/GPT/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/GPT/__pycache__/model.cpython-310.pyc +0 -0
- SCMG/models/GPT/__pycache__/sampler.cpython-310.pyc +0 -0
- SCMG/models/GPT/model.py +197 -0
- SCMG/models/GPT/sampler.py +85 -0
- SCMG/models/GPT2/__init__.py +0 -0
- SCMG/models/GPT2/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/GPT2/__pycache__/model.cpython-310.pyc +0 -0
- SCMG/models/GPT2/__pycache__/sampler.cpython-310.pyc +0 -0
- SCMG/models/GPT2/model.py +197 -0
- SCMG/models/GPT2/sampler.py +85 -0
- SCMG/models/LSTM/__init__.py +0 -0
- SCMG/models/LSTM/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/LSTM/__pycache__/model.cpython-310.pyc +0 -0
- SCMG/models/LSTM/__pycache__/sampler.cpython-310.pyc +0 -0
- SCMG/models/LSTM/__pycache__/trainer.cpython-310.pyc +0 -0
- SCMG/models/LSTM/model.py +48 -0
- SCMG/models/LSTM/sampler.py +20 -0
- SCMG/models/LSTM/trainer.py +195 -0
- SCMG/models/Reinvent/__init__.py +0 -0
- SCMG/models/Reinvent/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/Reinvent/__pycache__/model copy 2.cpython-310.pyc +0 -0
- SCMG/models/Reinvent/__pycache__/model copy.cpython-310.pyc +0 -0
- SCMG/models/Reinvent/__pycache__/model.cpython-310.pyc +0 -0
- SCMG/models/Reinvent/__pycache__/sampler.cpython-310.pyc +0 -0
- SCMG/models/Reinvent/model copy 2.py +420 -0
- SCMG/models/Reinvent/model copy.py +187 -0
- SCMG/models/Reinvent/model.py +278 -0
- SCMG/models/Reinvent/sampler.py +85 -0
- SCMG/models/Reinvent_Scaffold_Decorator/__init__.py +0 -0
- SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/model copy 2.cpython-310.pyc +0 -0
- SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/model copy.cpython-310.pyc +0 -0
- SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/sampler.cpython-310.pyc +0 -0
- SCMG/models/Reinvent_Scaffold_Decorator/model copy 2.py +420 -0
- SCMG/models/Reinvent_Scaffold_Decorator/model copy.py +187 -0
- SCMG/models/Reinvent_Scaffold_Decorator/model.py +276 -0
- SCMG/models/Reinvent_Scaffold_Decorator/sampler.py +85 -0
- SCMG/models/Transformer/__init__.py +1 -0
- SCMG/models/Transformer/__pycache__/__init__.cpython-310.pyc +0 -0
- SCMG/models/Transformer/__pycache__/model copy 2.cpython-310.pyc +0 -0
SCMG/__pycache__/_version.cpython-310.pyc
ADDED
|
Binary file (280 Bytes). View file
|
|
|
SCMG/_version.py
ADDED
|
@@ -0,0 +1,2 @@
|
|
|
|
|
|
|
|
|
|
| 1 |
+
def get_versions():
|
| 2 |
+
version = "0.1.1"
|
SCMG/config/__init__.py
ADDED
|
File without changes
|
SCMG/config/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (168 Bytes). View file
|
|
|
SCMG/config/__pycache__/modelparameters.cpython-310.pyc
ADDED
|
Binary file (430 Bytes). View file
|
|
|
SCMG/config/__pycache__/varables.cpython-310.pyc
ADDED
|
Binary file (6.19 kB). View file
|
|
|
SCMG/config/modelparameters.py
ADDED
|
@@ -0,0 +1,21 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# class ModelParameters():
|
| 2 |
+
# def __init__(self):
|
| 3 |
+
# self.NUM_LAYERS = "num_layers"
|
| 4 |
+
# self.NUM_HEADS = "num_heads"
|
| 5 |
+
# self.DIM_ATTENTION = "dim_attention"
|
| 6 |
+
# self.DIM_FEEDFORWARD = "dim_feedforward"
|
| 7 |
+
# self.DIM_LSTM = "dim_lstm"
|
| 8 |
+
# self.DIM_EMBEDDING = "dim_embedding"
|
| 9 |
+
# self.DIM_OUTPUT = "dim_output"
|
| 10 |
+
# self.RATE_DROPOUT = "rate_dropout"
|
| 11 |
+
# return
|
| 12 |
+
#
|
| 13 |
+
|
| 14 |
+
NUM_LAYERS = "num_layers"
|
| 15 |
+
NUM_HEADS = "num_heads"
|
| 16 |
+
DIM_ATTENTION = "dim_attention"
|
| 17 |
+
DIM_FEEDFORWARD = "dim_feedforward"
|
| 18 |
+
DIM_LSTM = "dim_lstm"
|
| 19 |
+
DIM_EMBEDDING = "dim_embedding"
|
| 20 |
+
DIM_OUTPUT = "dim_output"
|
| 21 |
+
RATE_DROPOUT = "rate_dropout"
|
SCMG/config/varables.py
ADDED
|
@@ -0,0 +1,234 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import re
|
| 2 |
+
from rdkit import Chem
|
| 3 |
+
|
| 4 |
+
DEFAULT = "default"
|
| 5 |
+
AUTO = "auto"
|
| 6 |
+
|
| 7 |
+
# Variables
|
| 8 |
+
COLUMN_SMILES = "SMILES"
|
| 9 |
+
COLUMN_ENCODER = "Encoder"
|
| 10 |
+
COLUMN_DECODER = "Decoder"
|
| 11 |
+
COLUMN_TASK_TYPE = "TaskType"
|
| 12 |
+
COLUMN_ENCODER_SEQUENCE = "EncoderSequence"
|
| 13 |
+
COLUMN_DECODER_SEQUENCE = "DecoderSequence"
|
| 14 |
+
COLUMN_BOS_TOKEN = "TokenBOS"
|
| 15 |
+
COLUMN_CUTS = "Cuts"
|
| 16 |
+
COLUMN_MIN_TOP_P = "MinTopP"
|
| 17 |
+
COLUMN_MIN_TOKEN_PROB = "MinTokenProb"
|
| 18 |
+
COLUMN_TOKEN_EOS_PROB = "TokenEOSProb"
|
| 19 |
+
COLUMN_MOLNAME = "MolName"
|
| 20 |
+
COLUMN_MOLINDEX = "MolIndex"
|
| 21 |
+
COLUMN_MOL_PROB = "MolProb"
|
| 22 |
+
COLUMN_MOL_PROB_TOPP = "MolProb_TopP"
|
| 23 |
+
|
| 24 |
+
# Task
|
| 25 |
+
TOKEN_BEGIN = "<bos>"
|
| 26 |
+
TOKEN_END = "<eos>"
|
| 27 |
+
TOKEN_SEP = "<sep>"
|
| 28 |
+
TOKEN_CODER_SEP = "<delim>"
|
| 29 |
+
# TRAIN = "Train"
|
| 30 |
+
TOKEN_PAD = "<pad>"
|
| 31 |
+
COLUMN_EXCLUDED_MIN = "ExcludedSize"
|
| 32 |
+
COLUMN_SIZE_ToRunForNExt = "ExcludedSize"
|
| 33 |
+
COLUMN_SIZE_EXCLUDED = "ExcludedSize"
|
| 34 |
+
|
| 35 |
+
# char_level_molecule_generation
|
| 36 |
+
COLUMN_task_char_mg = "char_mg"
|
| 37 |
+
TOKEN_TASK_CHAR_MG = "<char_mg>"
|
| 38 |
+
|
| 39 |
+
# char_level_scaffold_constrained_molecule_generation
|
| 40 |
+
COLUMN_task_char_scmg = "char_scmg"
|
| 41 |
+
TOKEN_TASK_SCMG_CHAR_RAND = "<scmg_char_rand>"
|
| 42 |
+
TOKEN_TASK_SCMG_CHAR_CANO = "<scmg_char_cano>"
|
| 43 |
+
TOKEN_TASK_DG_CHAR_RAND = "<dg_char_rand>"
|
| 44 |
+
TOKEN_TASK_DG_CHAR_CANO = "<dg_char_cano>"
|
| 45 |
+
LIST_HEAVY_ATOMS = ['c', 'C', 'O', 'N', 'n', 'F', '[C@H]', 'Cl', '[C@@H]', 'S', '[nH]', 's', 'o', 'Br', '[C@]', '[C@@]', 'P', 'B', '[N+]', '[P@@]', '[P@]', '[S@@]', '[N@+]', '[S@]', '[N@@+]', '[N-]', 'p']
|
| 46 |
+
COLUMN_EXCLUDE_REASON = "Excluded"
|
| 47 |
+
COLUMN_STATE = "State"
|
| 48 |
+
# chemical_property_prediction
|
| 49 |
+
COLUMN_task_chem_pd = "chem_pd"
|
| 50 |
+
TOKEN_TASK_CHEM_PD = "<chem_pd>"
|
| 51 |
+
|
| 52 |
+
# molecule_identification
|
| 53 |
+
COLUMN_task_mol_id = "mol_id"
|
| 54 |
+
TOKEN_TASK_MOL_ID = "<mol_id>"
|
| 55 |
+
|
| 56 |
+
|
| 57 |
+
|
| 58 |
+
FILEPATH_MODEL = "filepath_model"
|
| 59 |
+
FILEPATH_INPUT = "filepath_input"
|
| 60 |
+
DIRPATH_OUTPUT = "dirpath_output"
|
| 61 |
+
RANDOM_AUGUMENT = "random_augument"
|
| 62 |
+
TOP_P = "top_p"
|
| 63 |
+
TOP_K = "top_k"
|
| 64 |
+
MIN_MOL_PROB = "minimum_mol_prob"
|
| 65 |
+
MIN_TOKEN_PROB = "minimum_token_prob"
|
| 66 |
+
MAX_HEAVY_ATOMS = "maximum_heavy_atoms"
|
| 67 |
+
TEMPERATURE = "temperature"
|
| 68 |
+
|
| 69 |
+
# Data
|
| 70 |
+
VOCAB = "vocab"
|
| 71 |
+
SIZE_VOCAB = "size_vocab"
|
| 72 |
+
FILENAME_VOCAB = "vocab.pt"
|
| 73 |
+
FILENAME_VOCABSTATE = "vocabstate.pt"
|
| 74 |
+
FILENAME_DATA_RAW = "data.csv"
|
| 75 |
+
|
| 76 |
+
TRAIN = "train"
|
| 77 |
+
TEST = "test"
|
| 78 |
+
FILENAME_TRAIN_RAW = "train.pt"
|
| 79 |
+
FILENAME_TRAIN_EPOCH = lambda x: "train_"+str(x)+".pt"
|
| 80 |
+
|
| 81 |
+
FILENAME_TEST = "test.pt"
|
| 82 |
+
FILENAME_TEST_RAW = "test.pt"
|
| 83 |
+
FILENAME_TEST_EPOCH = lambda x: "test_"+str(x)+".pt"
|
| 84 |
+
FILEPATH_VOCAB = "filepath_vocab"
|
| 85 |
+
#
|
| 86 |
+
# try:
|
| 87 |
+
# config.screen_width = os.get_terminal_size()[0]
|
| 88 |
+
# except:
|
| 89 |
+
# config.screen_width = 141
|
| 90 |
+
MAX_SEQUENCE_LENGTH = "max_sequence_length"
|
| 91 |
+
COLUMN_INCHIKEY = "InchiKey"
|
| 92 |
+
# Train
|
| 93 |
+
MODEL_NAME = "model_name"
|
| 94 |
+
MODEL_TYPE = "model_type"
|
| 95 |
+
MODEL = "model"
|
| 96 |
+
TASKS = "tasks"
|
| 97 |
+
DIRPATH_CHECKPOINT = "dirpath_checkpoint"
|
| 98 |
+
DIRPATH_DATA = "dirpath_data"
|
| 99 |
+
SIZE_BATCH = "size_batch"
|
| 100 |
+
SIZE_BLOCK = "size_block"
|
| 101 |
+
RATE_LEARNING = "rate_learning"
|
| 102 |
+
DEVICE = "device"
|
| 103 |
+
EPOCH = "epoch"
|
| 104 |
+
EPOCHS = "epochs"
|
| 105 |
+
NUM_WORKERS = "num_workers"
|
| 106 |
+
DIRPATH_COMPLETED = "dirpath_completed"
|
| 107 |
+
DIRPATH_EXCLUDED = "dirpath_excluded"
|
| 108 |
+
DIRPATH_SBATCH = "dirpath_sbatch"
|
| 109 |
+
|
| 110 |
+
# Stats
|
| 111 |
+
TRAIN_LOSS = "train_loss"
|
| 112 |
+
TEST_LOSS = "test_loss"
|
| 113 |
+
TIME_ELAPSED = "time_elapsed"
|
| 114 |
+
RATE_LEARNING = "rate_learning"
|
| 115 |
+
TOKENS = "tokens"
|
| 116 |
+
|
| 117 |
+
# Model
|
| 118 |
+
FILENAME_MODEL_INIT = "model_init.pt"
|
| 119 |
+
FILENAME_MODEL_LATEST = "model.pt"
|
| 120 |
+
FILENAME_MODEL_TRAINED = lambda x: "model_"+str(x)+".pt"
|
| 121 |
+
|
| 122 |
+
FILENAME_MODELSTATE_INIT = "modelstate_init.pt"
|
| 123 |
+
FILENAME_MODELSTATE_LATEST = "modelstate.pt"
|
| 124 |
+
FILENAME_MODELSTATE_TRAINED = lambda x: "modelstate_"+str(x)+".pt"
|
| 125 |
+
|
| 126 |
+
FILENAME_SCHEDULER_INIT = "scheduler_init.pt"
|
| 127 |
+
FILENAME_SCHEDULER_LATEST = "scheduler.pt"
|
| 128 |
+
FILENAME_SCHEDULER_TRAINED = lambda x: "scheduler_"+str(x)+".pt"
|
| 129 |
+
|
| 130 |
+
FILENAME_OPTIMIZER_INIT = "optimizer_init.pt"
|
| 131 |
+
FILENAME_OPTIMIZER_LATEST = "optimizer.pt"
|
| 132 |
+
FILENAME_OPTIMIZER_TRAINED = lambda x: "optimizer_"+str(x)+".pt"
|
| 133 |
+
|
| 134 |
+
# FILENAME_TRAINLOG_INIT = "train_init.pt"
|
| 135 |
+
FILENAME_TRAINSTATS_LATEST = "trainstats_latest.csv"
|
| 136 |
+
FILENAME_TRAINSTATS_TRAINED = lambda x: "trainstats_"+str(x)+".csv"
|
| 137 |
+
|
| 138 |
+
FILENAME_TRAINLOG = "train"
|
| 139 |
+
FORMAT_TIMESTAMP_FILEHANDLER = "%Y%m%d%H%M%S_%f.log"
|
| 140 |
+
FORMAT_TIMESTAMP = "%Y/%m/%d %H:%M:%S %f"
|
| 141 |
+
|
| 142 |
+
FORMAT_LOG = ""
|
| 143 |
+
DRY_RUN = "dry_run"
|
| 144 |
+
LOG_LEVEL = "log_level"
|
| 145 |
+
TOKENIZER = "tokenizer"
|
| 146 |
+
RUN_ONE_EPOCH = "run_one_epoch"
|
| 147 |
+
# # Column names
|
| 148 |
+
# IS_NOVEL = "IS_NOVAL"
|
| 149 |
+
# NOVALTY = "Novalty"
|
| 150 |
+
# # VALIDITY = "Validity"
|
| 151 |
+
# IS_VALID = "IS_VALID"
|
| 152 |
+
# IS_NOVAL = "IS_NOVAL"
|
| 153 |
+
# DIR_SAVE = "dir_save"
|
| 154 |
+
# MODEL_LATEST = "model.pt"
|
| 155 |
+
# LOG_TRAIN_LATEST = "train_log.csv"
|
| 156 |
+
# OPTIMIZER_LATEST = "optimizer.pt"
|
| 157 |
+
# SCHEDULER_LATEST = "scheduler.pt"
|
| 158 |
+
# TRAIN_LOSS = "train_loss"
|
| 159 |
+
# TEST_LOSS = "test_loss"
|
| 160 |
+
# TIME_ELAPSED = "time_elapsed"
|
| 161 |
+
# # LR = "lr"
|
| 162 |
+
# TOKENS = "tokens"
|
| 163 |
+
|
| 164 |
+
LOGP = "logP"
|
| 165 |
+
WEIGHT = "weight"
|
| 166 |
+
QED = "QED"
|
| 167 |
+
VALIDITY = "SMILES_VALID"
|
| 168 |
+
FILENAME_TRAIN_DIST = "train_dist.pt"
|
| 169 |
+
FILENAME_TEST_DIST = "test_dist.pt"
|
| 170 |
+
MODEL_PRETRAIN = "model_pretrained.pt"
|
| 171 |
+
|
| 172 |
+
PYFILE_SAMPLER = "sampler.py"
|
| 173 |
+
PYFILE_TRAINER = "trainer.py"
|
| 174 |
+
PYFILE_DATALOADER = "dataloader.py"
|
| 175 |
+
# PYFILE_SAMPLER = "sampler.py"
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
|
| 179 |
+
|
| 180 |
+
# Model parameters
|
| 181 |
+
NUM_LAYERS = "num_layers"
|
| 182 |
+
NUM_ENCODER_LAYERS = "num_encoder_layers"
|
| 183 |
+
NUM_DECODER_LAYERS = "num_decoder_layers"
|
| 184 |
+
NUM_HEADS = "num_heads"
|
| 185 |
+
DIM_ATTENTION = "dim_attention"
|
| 186 |
+
DIM_FEEDFORWARD = "dim_feedforward"
|
| 187 |
+
DIM_LSTM = "dim_lstm"
|
| 188 |
+
DIM_EMBEDDING = "dim_embedding"
|
| 189 |
+
DIM_OUTPUT = "dim_output"
|
| 190 |
+
RATE_DROPOUT = "rate_dropout"
|
| 191 |
+
|
| 192 |
+
|
| 193 |
+
|
| 194 |
+
|
| 195 |
+
#Scheduler
|
| 196 |
+
SIZE_STEP = "size_step"
|
| 197 |
+
GAMMA = "gamma"
|
| 198 |
+
|
| 199 |
+
|
| 200 |
+
|
| 201 |
+
|
| 202 |
+
|
| 203 |
+
|
| 204 |
+
|
| 205 |
+
|
| 206 |
+
# From Reinvent-Scaffold-Decorator
|
| 207 |
+
ATTACHMENT_POINT_TOKEN = "*"
|
| 208 |
+
ATTACHMENT_POINT_NUM_REGEXP = r"\[{}:(\d+)\]".format(re.escape(ATTACHMENT_POINT_TOKEN))
|
| 209 |
+
ATTACHMENT_POINT_REGEXP = r"(?:{0}|\[{0}[^\]]*\])".format(re.escape(ATTACHMENT_POINT_TOKEN))
|
| 210 |
+
ATTACHMENT_POINT_NO_BRACKETS_REGEXP = r"(?<!\[){}".format(re.escape(ATTACHMENT_POINT_TOKEN))
|
| 211 |
+
|
| 212 |
+
ATTACHMENT_SEPARATOR_TOKEN = "|"
|
| 213 |
+
|
| 214 |
+
SLICE_SMARTS = {
|
| 215 |
+
"hr": [
|
| 216 |
+
"[*]!@-[*]"
|
| 217 |
+
],
|
| 218 |
+
"recap": [
|
| 219 |
+
"[C;$(C=O)]!@-N", # amides and urea
|
| 220 |
+
"[C;$(C=O)]!@-O", # esters
|
| 221 |
+
"C!@-[N;!$(NC=O)]", # amines
|
| 222 |
+
"C!@-[O;!$(NC=O)]", # ether
|
| 223 |
+
"[CX3]!@=[CX3]", # olefin
|
| 224 |
+
"[N+X4]!@-C", # quaternary nitrogen
|
| 225 |
+
"n!@-C", # aromatic N - aliphatic C
|
| 226 |
+
"[$([NR][CR]=O)]!@-C", # lactam nitrogen - aliphatic carbon
|
| 227 |
+
"c!@-c", # aromatic C - aromatic C
|
| 228 |
+
"N!@-[$(S(=O)=O)]" # sulphonamides
|
| 229 |
+
]
|
| 230 |
+
}
|
| 231 |
+
SLICE_SMARTS = {name: [Chem.MolFromSmarts(sma) for sma in smarts] for name, smarts in SLICE_SMARTS.items()}
|
| 232 |
+
|
| 233 |
+
|
| 234 |
+
|
SCMG/models/GPT/__init__.py
ADDED
|
File without changes
|
SCMG/models/GPT/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (172 Bytes). View file
|
|
|
SCMG/models/GPT/__pycache__/model.cpython-310.pyc
ADDED
|
Binary file (7.55 kB). View file
|
|
|
SCMG/models/GPT/__pycache__/sampler.cpython-310.pyc
ADDED
|
Binary file (3.16 kB). View file
|
|
|
SCMG/models/GPT/model.py
ADDED
|
@@ -0,0 +1,197 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
# logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
from torch.autograd import Variable
|
| 11 |
+
|
| 12 |
+
class PositionalEncoder(nn.Module):
|
| 13 |
+
def __init__(self, config):
|
| 14 |
+
super(PositionalEncoder, self).__init__()
|
| 15 |
+
self.Dropout = nn.Dropout(p=config[varables.RATE_DROPOUT])
|
| 16 |
+
max_len = config[varables.SIZE_BLOCK]
|
| 17 |
+
pe = torch.zeros(max_len, config[varables.DIM_ATTENTION])
|
| 18 |
+
position = torch.arange(0, max_len, dtype=torch.float).unsqueeze(1)
|
| 19 |
+
div_term = torch.exp(torch.arange(0, config[varables.DIM_ATTENTION], 2).float() * (-math.log(10000.0) / config[varables.DIM_ATTENTION]))
|
| 20 |
+
pe[:, 0::2] = torch.sin(position * div_term)
|
| 21 |
+
pe[:, 1::2] = torch.cos(position * div_term)
|
| 22 |
+
pe = pe.unsqueeze(0)
|
| 23 |
+
self.register_buffer('pe', pe)
|
| 24 |
+
def forward(self, T):
|
| 25 |
+
x = self.Dropout(self.pe[:,:T, :])
|
| 26 |
+
return x
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
class Attention(nn.Module):
|
| 30 |
+
def __init__(self, config):
|
| 31 |
+
super().__init__()
|
| 32 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 33 |
+
self.Key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 34 |
+
self.Query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 35 |
+
self.Value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 36 |
+
self.Dropout_Attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 37 |
+
self.Dropout_Residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 38 |
+
self.Projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 39 |
+
self.NumberOfHeads = config[varables.NUM_HEADS]
|
| 40 |
+
self.DimHead = config[varables.DIM_ATTENTION] // self.NumberOfHeads
|
| 41 |
+
self.DimAttention = config[varables.DIM_ATTENTION]
|
| 42 |
+
|
| 43 |
+
def forward(self, X_1,X_2, mask=None):
|
| 44 |
+
if X_2 is None:
|
| 45 |
+
X_2 = X_1
|
| 46 |
+
BatchSize, T_Encoder, _ = X_1.size()
|
| 47 |
+
BatchSize, T_Decoder, _ = X_2.size()
|
| 48 |
+
K = self.Key( X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 49 |
+
Q = self.Query(X_2).view(BatchSize, T_Decoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 50 |
+
V = self.Value(X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 51 |
+
# k,q,v dimension: (BatchSize, SequenceSize, NumberOfHeads, HeadDimension) 3,4,5,16
|
| 52 |
+
ScoreAttention = (Q @ K.transpose(-2, -1)) / math.sqrt(self.DimHead)
|
| 53 |
+
ScoreAttention = ScoreAttention.masked_fill(mask==0, -1e9)
|
| 54 |
+
ScoreAttention = F.softmax(ScoreAttention, dim=-1)
|
| 55 |
+
ScoreAttention = self.Dropout_Attention(ScoreAttention)
|
| 56 |
+
# k.transpose(-2,-1): 3,4,16,5
|
| 57 |
+
# (q@(k.transpose(-2,-1))): 3,4,5,5
|
| 58 |
+
Z = ScoreAttention @ V
|
| 59 |
+
# y dimension: 3,4,5,16
|
| 60 |
+
Z = Z.transpose(1, 2).contiguous().view(BatchSize, T_Decoder, self.DimAttention)
|
| 61 |
+
# y dimension: 3,5,64
|
| 62 |
+
Z = self.Dropout_Residue(self.Projection(Z))
|
| 63 |
+
return Z
|
| 64 |
+
|
| 65 |
+
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
|
| 72 |
+
|
| 73 |
+
|
| 74 |
+
class FeedForward(nn.Module):
|
| 75 |
+
def __init__(self, config):
|
| 76 |
+
super().__init__()
|
| 77 |
+
if config[varables.DIM_FEEDFORWARD] == 0:
|
| 78 |
+
Dim_FeedForward = config[varables.DIM_ATTENTION] *4
|
| 79 |
+
else:
|
| 80 |
+
Dim_FeedForward = config[varables.DIM_FEEDFORWARD]
|
| 81 |
+
self.Linear1 = nn.Linear(config[varables.DIM_EMBEDDING], Dim_FeedForward)
|
| 82 |
+
self.GELU = nn.GELU()
|
| 83 |
+
self.Linear2 = nn.Linear(Dim_FeedForward, config[varables.DIM_EMBEDDING])
|
| 84 |
+
self.Dropout = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 85 |
+
|
| 86 |
+
def forward(self,x):
|
| 87 |
+
x = self.Linear1(x)
|
| 88 |
+
x = self.GELU (x)
|
| 89 |
+
x = self.Dropout(x)
|
| 90 |
+
x = self.Linear2(x)
|
| 91 |
+
return x
|
| 92 |
+
|
| 93 |
+
class DecoderBlock(nn.Module):
|
| 94 |
+
def __init__(self, config):
|
| 95 |
+
super().__init__()
|
| 96 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 97 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 98 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 99 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 100 |
+
self.AttentionMasked = Attention( config)
|
| 101 |
+
self.AttentionCross = Attention( config)
|
| 102 |
+
self.FeedForward = FeedForward(config)
|
| 103 |
+
|
| 104 |
+
def forward(self, X_Decoder,Mask_Decoder):
|
| 105 |
+
X_Decoder = self.Dropout1(X_Decoder + self.AttentionMasked(self.LayerNorm1(X_Decoder), None, Mask_Decoder))
|
| 106 |
+
X_Decoder = self.Dropout2(X_Decoder + self.FeedForward (self.LayerNorm2(X_Decoder) ))
|
| 107 |
+
return X_Decoder
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
|
| 117 |
+
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
|
| 122 |
+
|
| 123 |
+
|
| 124 |
+
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
class Model(nn.Module):
|
| 128 |
+
def __init__(self, config):
|
| 129 |
+
super().__init__()
|
| 130 |
+
# Varables
|
| 131 |
+
self.Dim_Attention = config[varables.DIM_ATTENTION]
|
| 132 |
+
self.Token_Padding_Decoder = config["Token_Padding_Decoder"]
|
| 133 |
+
# Embedding and positional encoding layers
|
| 134 |
+
self.Embedding_Decoder = nn.Embedding(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION])
|
| 135 |
+
self.pos_emb = PositionalEncoder(config)
|
| 136 |
+
# Dropout and normalization layers
|
| 137 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 138 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 139 |
+
# Transformer layers
|
| 140 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 141 |
+
# Output layer
|
| 142 |
+
self.head = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]), bias=False)
|
| 143 |
+
# Init
|
| 144 |
+
self.apply(self._init_weights)
|
| 145 |
+
self.optimizer = None
|
| 146 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 147 |
+
|
| 148 |
+
def _init_weights(self, module):
|
| 149 |
+
for p in module.parameters():
|
| 150 |
+
if p.dim() > 1:
|
| 151 |
+
nn.init.xavier_uniform_(p)
|
| 152 |
+
# if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 153 |
+
# module.weight.data.normal_(mean=0.0, std=0.02)
|
| 154 |
+
# if isinstance(module, nn.Linear) and module.bias is not None:
|
| 155 |
+
# module.bias.data.zero_()
|
| 156 |
+
# elif isinstance(module, nn.LayerNorm):
|
| 157 |
+
# module.bias.data.zero_()
|
| 158 |
+
# module.weight.data.fill_(1.0)
|
| 159 |
+
def init_optimizers(self,train_config):
|
| 160 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 161 |
+
return optimizer
|
| 162 |
+
def init_scheduler(self,train_config):
|
| 163 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 164 |
+
return scheduler
|
| 165 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 166 |
+
def collate(results):
|
| 167 |
+
X_Encoder = [a[0] for a in results]
|
| 168 |
+
X_Decoder = [a[1] for a in results]
|
| 169 |
+
boundary = -1
|
| 170 |
+
max_len_x = max([len(a) for a in X_Encoder])
|
| 171 |
+
max_len_y = max([len(a) for a in X_Decoder])
|
| 172 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in X_Encoder],dtype=torch.long)
|
| 173 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in X_Decoder],dtype=torch.long)
|
| 174 |
+
return x,y,boundary
|
| 175 |
+
return collate
|
| 176 |
+
|
| 177 |
+
def generate_masks(self, X_Decoder):
|
| 178 |
+
# Generate encoder, decoder, cross masks
|
| 179 |
+
T = X_Decoder.shape[1]
|
| 180 |
+
Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).unsqueeze(-2).repeat(1,1,T,1)
|
| 181 |
+
mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T).to(Mask_Decoder.device)
|
| 182 |
+
Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 183 |
+
return Mask_Decoder
|
| 184 |
+
|
| 185 |
+
def forward(self, X_Encoder, X_Decoder, Y_Decoder_Ref=None,boundary=None):
|
| 186 |
+
Mask_Decoder = self.generate_masks(X_Decoder)
|
| 187 |
+
# preprocess
|
| 188 |
+
X_Decoder = self.Dropout1(self.Embedding_Decoder(X_Decoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Decoder.size(1)))
|
| 189 |
+
# Decoder blocks
|
| 190 |
+
for decoder_block in self.decoder_blocks:
|
| 191 |
+
X_Decoder = decoder_block(X_Decoder,Mask_Decoder)
|
| 192 |
+
X_Decoder = self.LayerNorm1(X_Decoder)
|
| 193 |
+
Y_Decoder_Logits = self.head(X_Decoder)
|
| 194 |
+
loss = None
|
| 195 |
+
if Y_Decoder_Ref is not None:
|
| 196 |
+
loss = F.cross_entropy(Y_Decoder_Logits.view(-1, Y_Decoder_Logits.size(-1)), Y_Decoder_Ref.view(-1),ignore_index=self.Token_Padding_Decoder)
|
| 197 |
+
return Y_Decoder_Logits, loss
|
SCMG/models/GPT/sampler.py
ADDED
|
@@ -0,0 +1,85 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import random
|
| 2 |
+
import numpy as np
|
| 3 |
+
import torch
|
| 4 |
+
import torch.nn as nn
|
| 5 |
+
from torch.nn import functional as F
|
| 6 |
+
|
| 7 |
+
def set_seed(seed):
|
| 8 |
+
random.seed(seed)
|
| 9 |
+
np.random.seed(seed)
|
| 10 |
+
torch.manual_seed(seed)
|
| 11 |
+
torch.cuda.manual_seed_all(seed)
|
| 12 |
+
|
| 13 |
+
def top_k_logits(logits, k):
|
| 14 |
+
v, ix = torch.topk(logits, k)
|
| 15 |
+
out = logits.clone()
|
| 16 |
+
out[out < v[:, [-1]]] = -float('Inf')
|
| 17 |
+
return out
|
| 18 |
+
|
| 19 |
+
@torch.no_grad()
|
| 20 |
+
def sample(model, x, steps, temperature=1.0, sample=False, top_k=None):
|
| 21 |
+
block_size = model.get_block_size()
|
| 22 |
+
model.eval()
|
| 23 |
+
for k in range(steps):
|
| 24 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 25 |
+
logits, _ = model(x_cond)
|
| 26 |
+
logits = logits[:, -1, :] / temperature
|
| 27 |
+
if top_k is not None:
|
| 28 |
+
logits = top_k_logits(logits, top_k)
|
| 29 |
+
probs = F.softmax(logits, dim=-1)
|
| 30 |
+
if sample:
|
| 31 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 32 |
+
else:
|
| 33 |
+
_, ix = torch.topk(probs, k=1, dim=-1)
|
| 34 |
+
x = torch.cat((x, ix), dim=1)
|
| 35 |
+
|
| 36 |
+
return x
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
@torch.no_grad()
|
| 42 |
+
def sample(model, x, steps, temperature=1.0,boundary=None):
|
| 43 |
+
block_size = model.get_block_size()
|
| 44 |
+
model.eval()
|
| 45 |
+
for k in range(steps):
|
| 46 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 47 |
+
logits, _ = model(x_cond,boundary=boundary)
|
| 48 |
+
logits = logits[:, -1, :] / temperature
|
| 49 |
+
probs = F.softmax(logits, dim=-1)
|
| 50 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 51 |
+
x = torch.cat((x, ix), dim=1)
|
| 52 |
+
return x
|
| 53 |
+
|
| 54 |
+
'L_5*C(=O)NCc1cccc(OC)c1.*c1nsc2ccccc12COc1cccc(CNC(=O)c2cccc(NC(=O)c3nsc4ccccc34)c2)c1'
|
| 55 |
+
|
| 56 |
+
# for i in range(1,21):
|
| 57 |
+
def sample_L(i,option='string'):
|
| 58 |
+
# i=2
|
| 59 |
+
prefix = 'L_'+str(i)
|
| 60 |
+
string_input = prefix + '*O=C1NN=Cc2c1cccc2.*O=C(C1CC1)N1CCNCC1'
|
| 61 |
+
array_input = [vocab[a] for a in ['<bos>'] + list(string_input)]
|
| 62 |
+
boundary = [len(array_input)]
|
| 63 |
+
tensor_input = torch.tensor(array_input,device='cuda').unsqueeze(0).repeat(32,1)
|
| 64 |
+
boundary = boundary*32
|
| 65 |
+
tensor_output = sample(model,tensor_input,250,boundary=boundary)
|
| 66 |
+
strings_output = []
|
| 67 |
+
for j in range(tensor_output.shape[0]):
|
| 68 |
+
list_string_output = [inv[a] for a in tensor_output[j,boundary[j]:].cpu().numpy() if a != vocab['<pad>']]
|
| 69 |
+
# if list_string_output[0] == '<bos>':
|
| 70 |
+
# list_string_output = list_string_output[1:]
|
| 71 |
+
if list_string_output[-1] == '<eos>':
|
| 72 |
+
list_string_output = list_string_output[:-1]
|
| 73 |
+
string_output = ''.join(list_string_output)
|
| 74 |
+
strings_output.append(string_output)
|
| 75 |
+
print(string_output)
|
| 76 |
+
for j in range(tensor_output.shape[0]):
|
| 77 |
+
if test_valid(strings_output[j]):
|
| 78 |
+
print(1)
|
| 79 |
+
else:
|
| 80 |
+
print(0)
|
| 81 |
+
|
| 82 |
+
# logits,_ = model(tensor_input,boundary=boundary)
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
['<bos>', 'L', '_', '5', '*', 'C', '(', '=', 'O', ')', 'N', 'C', 'c', '1', 'c', 'c', 'c', 'c', '(', 'O', 'C', ')', 'c', '1', '.', '*', 'c', '1', 'n', 's', 'c', '2', 'c', 'c', 'c', 'c', 'c', '1', '2', 'C', 'O', 'c', '1', 'c', 'c', 'c', 'c', '(', 'C', 'N', 'C', '(', '=', 'O', ')', 'c', '2', 'c', 'c', 'c', 'c', '(', 'N', 'C', '(', '=', 'O', ')', 'c', '3', 'n', 's', 'c', '4', 'c', 'c', 'c', 'c', 'c', '3', '4', ')', 'c', '2', ')', 'c', '1', '<eos>']
|
SCMG/models/GPT2/__init__.py
ADDED
|
File without changes
|
SCMG/models/GPT2/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (173 Bytes). View file
|
|
|
SCMG/models/GPT2/__pycache__/model.cpython-310.pyc
ADDED
|
Binary file (7.56 kB). View file
|
|
|
SCMG/models/GPT2/__pycache__/sampler.cpython-310.pyc
ADDED
|
Binary file (3.17 kB). View file
|
|
|
SCMG/models/GPT2/model.py
ADDED
|
@@ -0,0 +1,197 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
# logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
from torch.autograd import Variable
|
| 11 |
+
|
| 12 |
+
class PositionalEncoder(nn.Module):
|
| 13 |
+
def __init__(self, config):
|
| 14 |
+
super(PositionalEncoder, self).__init__()
|
| 15 |
+
self.Dropout = nn.Dropout(p=config[varables.RATE_DROPOUT])
|
| 16 |
+
max_len = config[varables.SIZE_BLOCK]
|
| 17 |
+
pe = torch.zeros(max_len, config[varables.DIM_ATTENTION])
|
| 18 |
+
position = torch.arange(0, max_len, dtype=torch.float).unsqueeze(1)
|
| 19 |
+
div_term = torch.exp(torch.arange(0, config[varables.DIM_ATTENTION], 2).float() * (-math.log(10000.0) / config[varables.DIM_ATTENTION]))
|
| 20 |
+
pe[:, 0::2] = torch.sin(position * div_term)
|
| 21 |
+
pe[:, 1::2] = torch.cos(position * div_term)
|
| 22 |
+
pe = pe.unsqueeze(0)
|
| 23 |
+
self.register_buffer('pe', pe)
|
| 24 |
+
def forward(self, T):
|
| 25 |
+
x = self.Dropout(self.pe[:,:T, :])
|
| 26 |
+
return x
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
class Attention(nn.Module):
|
| 30 |
+
def __init__(self, config):
|
| 31 |
+
super().__init__()
|
| 32 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 33 |
+
self.Key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 34 |
+
self.Query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 35 |
+
self.Value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 36 |
+
self.Dropout_Attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 37 |
+
self.Dropout_Residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 38 |
+
self.Projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 39 |
+
self.NumberOfHeads = config[varables.NUM_HEADS]
|
| 40 |
+
self.DimHead = config[varables.DIM_ATTENTION] // self.NumberOfHeads
|
| 41 |
+
self.DimAttention = config[varables.DIM_ATTENTION]
|
| 42 |
+
|
| 43 |
+
def forward(self, X_1,X_2, mask=None):
|
| 44 |
+
if X_2 is None:
|
| 45 |
+
X_2 = X_1
|
| 46 |
+
BatchSize, T_Encoder, _ = X_1.size()
|
| 47 |
+
BatchSize, T_Decoder, _ = X_2.size()
|
| 48 |
+
K = self.Key( X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 49 |
+
Q = self.Query(X_2).view(BatchSize, T_Decoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 50 |
+
V = self.Value(X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 51 |
+
# k,q,v dimension: (BatchSize, SequenceSize, NumberOfHeads, HeadDimension) 3,4,5,16
|
| 52 |
+
ScoreAttention = (Q @ K.transpose(-2, -1)) / math.sqrt(self.DimHead)
|
| 53 |
+
ScoreAttention = ScoreAttention.masked_fill(mask==0, -1e9)
|
| 54 |
+
ScoreAttention = F.softmax(ScoreAttention, dim=-1)
|
| 55 |
+
ScoreAttention = self.Dropout_Attention(ScoreAttention)
|
| 56 |
+
# k.transpose(-2,-1): 3,4,16,5
|
| 57 |
+
# (q@(k.transpose(-2,-1))): 3,4,5,5
|
| 58 |
+
Z = ScoreAttention @ V
|
| 59 |
+
# y dimension: 3,4,5,16
|
| 60 |
+
Z = Z.transpose(1, 2).contiguous().view(BatchSize, T_Decoder, self.DimAttention)
|
| 61 |
+
# y dimension: 3,5,64
|
| 62 |
+
Z = self.Dropout_Residue(self.Projection(Z))
|
| 63 |
+
return Z
|
| 64 |
+
|
| 65 |
+
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
|
| 72 |
+
|
| 73 |
+
|
| 74 |
+
class FeedForward(nn.Module):
|
| 75 |
+
def __init__(self, config):
|
| 76 |
+
super().__init__()
|
| 77 |
+
if config[varables.DIM_FEEDFORWARD] == 0:
|
| 78 |
+
Dim_FeedForward = config[varables.DIM_ATTENTION] *4
|
| 79 |
+
else:
|
| 80 |
+
Dim_FeedForward = config[varables.DIM_FEEDFORWARD]
|
| 81 |
+
self.Linear1 = nn.Linear(config[varables.DIM_EMBEDDING], Dim_FeedForward)
|
| 82 |
+
self.GELU = nn.GELU()
|
| 83 |
+
self.Linear2 = nn.Linear(Dim_FeedForward, config[varables.DIM_EMBEDDING])
|
| 84 |
+
self.Dropout = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 85 |
+
|
| 86 |
+
def forward(self,x):
|
| 87 |
+
x = self.Linear1(x)
|
| 88 |
+
x = self.GELU (x)
|
| 89 |
+
x = self.Dropout(x)
|
| 90 |
+
x = self.Linear2(x)
|
| 91 |
+
return x
|
| 92 |
+
|
| 93 |
+
class DecoderBlock(nn.Module):
|
| 94 |
+
def __init__(self, config):
|
| 95 |
+
super().__init__()
|
| 96 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 97 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 98 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 99 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 100 |
+
self.AttentionMasked = Attention( config)
|
| 101 |
+
self.AttentionCross = Attention( config)
|
| 102 |
+
self.FeedForward = FeedForward(config)
|
| 103 |
+
|
| 104 |
+
def forward(self, X_Decoder,Mask_Decoder):
|
| 105 |
+
X_Decoder = self.Dropout1(X_Decoder + self.AttentionMasked(self.LayerNorm1(X_Decoder), None, Mask_Decoder))
|
| 106 |
+
X_Decoder = self.Dropout2(X_Decoder + self.FeedForward (self.LayerNorm2(X_Decoder) ))
|
| 107 |
+
return X_Decoder
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
|
| 117 |
+
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
|
| 122 |
+
|
| 123 |
+
|
| 124 |
+
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
class Model(nn.Module):
|
| 128 |
+
def __init__(self, config):
|
| 129 |
+
super().__init__()
|
| 130 |
+
# Varables
|
| 131 |
+
self.Dim_Attention = config[varables.DIM_ATTENTION]
|
| 132 |
+
self.Token_Padding_Decoder = config["Token_Padding_Decoder"]
|
| 133 |
+
# Embedding and positional encoding layers
|
| 134 |
+
self.Embedding_Decoder = nn.Embedding(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION])
|
| 135 |
+
self.pos_emb = PositionalEncoder(config)
|
| 136 |
+
# Dropout and normalization layers
|
| 137 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 138 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 139 |
+
# Transformer layers
|
| 140 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_DECODER_LAYERS])])
|
| 141 |
+
# Output layer
|
| 142 |
+
self.head = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]), bias=False)
|
| 143 |
+
# Init
|
| 144 |
+
self.apply(self._init_weights)
|
| 145 |
+
self.optimizer = None
|
| 146 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 147 |
+
|
| 148 |
+
def _init_weights(self, module):
|
| 149 |
+
for p in module.parameters():
|
| 150 |
+
if p.dim() > 1:
|
| 151 |
+
nn.init.xavier_uniform_(p)
|
| 152 |
+
# if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 153 |
+
# module.weight.data.normal_(mean=0.0, std=0.02)
|
| 154 |
+
# if isinstance(module, nn.Linear) and module.bias is not None:
|
| 155 |
+
# module.bias.data.zero_()
|
| 156 |
+
# elif isinstance(module, nn.LayerNorm):
|
| 157 |
+
# module.bias.data.zero_()
|
| 158 |
+
# module.weight.data.fill_(1.0)
|
| 159 |
+
def init_optimizers(self,train_config):
|
| 160 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 161 |
+
return optimizer
|
| 162 |
+
def init_scheduler(self,train_config):
|
| 163 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 164 |
+
return scheduler
|
| 165 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 166 |
+
def collate(results):
|
| 167 |
+
X_Encoder = [a[0] for a in results]
|
| 168 |
+
X_Decoder = [a[1] for a in results]
|
| 169 |
+
boundary = -1
|
| 170 |
+
max_len_x = max([len(a) for a in X_Encoder])
|
| 171 |
+
max_len_y = max([len(a) for a in X_Decoder])
|
| 172 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in X_Encoder],dtype=torch.long)
|
| 173 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in X_Decoder],dtype=torch.long)
|
| 174 |
+
return x,y,boundary
|
| 175 |
+
return collate
|
| 176 |
+
|
| 177 |
+
def generate_masks(self, X_Decoder):
|
| 178 |
+
# Generate encoder, decoder, cross masks
|
| 179 |
+
T = X_Decoder.shape[1]
|
| 180 |
+
Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).unsqueeze(-2).repeat(1,1,T,1)
|
| 181 |
+
mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T).to(Mask_Decoder.device)
|
| 182 |
+
Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 183 |
+
return Mask_Decoder
|
| 184 |
+
|
| 185 |
+
def forward(self, X_Encoder, X_Decoder, Y_Decoder_Ref=None,boundary=None):
|
| 186 |
+
Mask_Decoder = self.generate_masks(X_Decoder)
|
| 187 |
+
# preprocess
|
| 188 |
+
X_Decoder = self.Dropout1(self.Embedding_Decoder(X_Decoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Decoder.size(1)))
|
| 189 |
+
# Decoder blocks
|
| 190 |
+
for decoder_block in self.decoder_blocks:
|
| 191 |
+
X_Decoder = decoder_block(X_Decoder,Mask_Decoder)
|
| 192 |
+
X_Decoder = self.LayerNorm1(X_Decoder)
|
| 193 |
+
Y_Decoder_Logits = self.head(X_Decoder)
|
| 194 |
+
loss = None
|
| 195 |
+
if Y_Decoder_Ref is not None:
|
| 196 |
+
loss = F.cross_entropy(Y_Decoder_Logits.view(-1, Y_Decoder_Logits.size(-1)), Y_Decoder_Ref.view(-1),ignore_index=self.Token_Padding_Decoder)
|
| 197 |
+
return Y_Decoder_Logits, loss
|
SCMG/models/GPT2/sampler.py
ADDED
|
@@ -0,0 +1,85 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import random
|
| 2 |
+
import numpy as np
|
| 3 |
+
import torch
|
| 4 |
+
import torch.nn as nn
|
| 5 |
+
from torch.nn import functional as F
|
| 6 |
+
|
| 7 |
+
def set_seed(seed):
|
| 8 |
+
random.seed(seed)
|
| 9 |
+
np.random.seed(seed)
|
| 10 |
+
torch.manual_seed(seed)
|
| 11 |
+
torch.cuda.manual_seed_all(seed)
|
| 12 |
+
|
| 13 |
+
def top_k_logits(logits, k):
|
| 14 |
+
v, ix = torch.topk(logits, k)
|
| 15 |
+
out = logits.clone()
|
| 16 |
+
out[out < v[:, [-1]]] = -float('Inf')
|
| 17 |
+
return out
|
| 18 |
+
|
| 19 |
+
@torch.no_grad()
|
| 20 |
+
def sample(model, x, steps, temperature=1.0, sample=False, top_k=None):
|
| 21 |
+
block_size = model.get_block_size()
|
| 22 |
+
model.eval()
|
| 23 |
+
for k in range(steps):
|
| 24 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 25 |
+
logits, _ = model(x_cond)
|
| 26 |
+
logits = logits[:, -1, :] / temperature
|
| 27 |
+
if top_k is not None:
|
| 28 |
+
logits = top_k_logits(logits, top_k)
|
| 29 |
+
probs = F.softmax(logits, dim=-1)
|
| 30 |
+
if sample:
|
| 31 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 32 |
+
else:
|
| 33 |
+
_, ix = torch.topk(probs, k=1, dim=-1)
|
| 34 |
+
x = torch.cat((x, ix), dim=1)
|
| 35 |
+
|
| 36 |
+
return x
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
@torch.no_grad()
|
| 42 |
+
def sample(model, x, steps, temperature=1.0,boundary=None):
|
| 43 |
+
block_size = model.get_block_size()
|
| 44 |
+
model.eval()
|
| 45 |
+
for k in range(steps):
|
| 46 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 47 |
+
logits, _ = model(x_cond,boundary=boundary)
|
| 48 |
+
logits = logits[:, -1, :] / temperature
|
| 49 |
+
probs = F.softmax(logits, dim=-1)
|
| 50 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 51 |
+
x = torch.cat((x, ix), dim=1)
|
| 52 |
+
return x
|
| 53 |
+
|
| 54 |
+
'L_5*C(=O)NCc1cccc(OC)c1.*c1nsc2ccccc12COc1cccc(CNC(=O)c2cccc(NC(=O)c3nsc4ccccc34)c2)c1'
|
| 55 |
+
|
| 56 |
+
# for i in range(1,21):
|
| 57 |
+
def sample_L(i,option='string'):
|
| 58 |
+
# i=2
|
| 59 |
+
prefix = 'L_'+str(i)
|
| 60 |
+
string_input = prefix + '*O=C1NN=Cc2c1cccc2.*O=C(C1CC1)N1CCNCC1'
|
| 61 |
+
array_input = [vocab[a] for a in ['<bos>'] + list(string_input)]
|
| 62 |
+
boundary = [len(array_input)]
|
| 63 |
+
tensor_input = torch.tensor(array_input,device='cuda').unsqueeze(0).repeat(32,1)
|
| 64 |
+
boundary = boundary*32
|
| 65 |
+
tensor_output = sample(model,tensor_input,250,boundary=boundary)
|
| 66 |
+
strings_output = []
|
| 67 |
+
for j in range(tensor_output.shape[0]):
|
| 68 |
+
list_string_output = [inv[a] for a in tensor_output[j,boundary[j]:].cpu().numpy() if a != vocab['<pad>']]
|
| 69 |
+
# if list_string_output[0] == '<bos>':
|
| 70 |
+
# list_string_output = list_string_output[1:]
|
| 71 |
+
if list_string_output[-1] == '<eos>':
|
| 72 |
+
list_string_output = list_string_output[:-1]
|
| 73 |
+
string_output = ''.join(list_string_output)
|
| 74 |
+
strings_output.append(string_output)
|
| 75 |
+
print(string_output)
|
| 76 |
+
for j in range(tensor_output.shape[0]):
|
| 77 |
+
if test_valid(strings_output[j]):
|
| 78 |
+
print(1)
|
| 79 |
+
else:
|
| 80 |
+
print(0)
|
| 81 |
+
|
| 82 |
+
# logits,_ = model(tensor_input,boundary=boundary)
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
['<bos>', 'L', '_', '5', '*', 'C', '(', '=', 'O', ')', 'N', 'C', 'c', '1', 'c', 'c', 'c', 'c', '(', 'O', 'C', ')', 'c', '1', '.', '*', 'c', '1', 'n', 's', 'c', '2', 'c', 'c', 'c', 'c', 'c', '1', '2', 'C', 'O', 'c', '1', 'c', 'c', 'c', 'c', '(', 'C', 'N', 'C', '(', '=', 'O', ')', 'c', '2', 'c', 'c', 'c', 'c', '(', 'N', 'C', '(', '=', 'O', ')', 'c', '3', 'n', 's', 'c', '4', 'c', 'c', 'c', 'c', 'c', '3', '4', ')', 'c', '2', ')', 'c', '1', '<eos>']
|
SCMG/models/LSTM/__init__.py
ADDED
|
File without changes
|
SCMG/models/LSTM/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (173 Bytes). View file
|
|
|
SCMG/models/LSTM/__pycache__/model.cpython-310.pyc
ADDED
|
Binary file (2.76 kB). View file
|
|
|
SCMG/models/LSTM/__pycache__/sampler.cpython-310.pyc
ADDED
|
Binary file (1 kB). View file
|
|
|
SCMG/models/LSTM/__pycache__/trainer.cpython-310.pyc
ADDED
|
Binary file (5.35 kB). View file
|
|
|
SCMG/models/LSTM/model.py
ADDED
|
@@ -0,0 +1,48 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import torch
|
| 2 |
+
import torch.nn as nn
|
| 3 |
+
import torch.nn.functional as F
|
| 4 |
+
import torch.nn.utils.rnn as rnn_utils
|
| 5 |
+
from SCMG.config import varables
|
| 6 |
+
|
| 7 |
+
class Model(nn.Module):
|
| 8 |
+
def __init__(self, config):
|
| 9 |
+
super().__init__()
|
| 10 |
+
self.vocab = config["vocab_encoder"]
|
| 11 |
+
# self.vocabulary = vocabulary
|
| 12 |
+
# self.hidden_size = config.hidden
|
| 13 |
+
# self.num_layers = config.num_layers
|
| 14 |
+
# self.dropout = config.dropout
|
| 15 |
+
# self.vocab_size = self.input_size = self.output_size = len(vocabulary)
|
| 16 |
+
self.embedding_layer = nn.Embedding(len(config["vocab_encoder"]), config[varables.DIM_EMBEDDING])
|
| 17 |
+
self.lstm_layer = nn.LSTM(config[varables.DIM_EMBEDDING], config[varables.DIM_LSTM],
|
| 18 |
+
config[varables.NUM_LAYERS], dropout=config[varables.RATE_DROPOUT],
|
| 19 |
+
batch_first=True)
|
| 20 |
+
self.linear_layer = nn.Linear(config[varables.DIM_LSTM], len(config["vocab_encoder"]))
|
| 21 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 22 |
+
def collate(results):
|
| 23 |
+
x_in = None
|
| 24 |
+
y_in = [a[0] + [vocab_encoder[varables.TOKEN_SEP]] + a[1] for a in results]
|
| 25 |
+
# boundary = [a[2] for a in results]
|
| 26 |
+
max_len = max([len(a) for a in y_in])
|
| 27 |
+
y = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len-len(a))) for a in y_in],dtype=torch.long)
|
| 28 |
+
return x_in,y,0
|
| 29 |
+
return collate
|
| 30 |
+
def init_optimizers(self,train_config):
|
| 31 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 32 |
+
return optimizer
|
| 33 |
+
def init_scheduler(self,train_config):
|
| 34 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 35 |
+
return scheduler
|
| 36 |
+
def forward(self, src, trg, trg_out, boundary=None):
|
| 37 |
+
# x = ([src , torch.tensor([self.vocab["<sep>"]]*x.size[0]).unsqueeze(1).to(x.device), trg],dim=1)
|
| 38 |
+
hiddens=None
|
| 39 |
+
x = self.embedding_layer(trg)
|
| 40 |
+
# x = rnn_utils.pack_padded_sequence(x, lengths, batch_first=True)
|
| 41 |
+
self.lstm_layer.flatten_parameters()
|
| 42 |
+
x, hiddens = self.lstm_layer(x, hiddens)
|
| 43 |
+
# x, _ = rnn_utils.pad_packed_sequence(x, batch_first=True)
|
| 44 |
+
logits = self.linear_layer(x)
|
| 45 |
+
loss = None
|
| 46 |
+
if trg_out is not None:
|
| 47 |
+
loss = F.cross_entropy(logits.view(-1, logits.size(-1)), trg_out.view(-1))
|
| 48 |
+
return logits, loss
|
SCMG/models/LSTM/sampler.py
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from MoleculeProcessing.utils.utils import *
|
| 2 |
+
from MoleculeProcessing.utils.utils_sample import *
|
| 3 |
+
import torch.nn.functional as F
|
| 4 |
+
|
| 5 |
+
def sample(model,vocab_bos,size_batch=32,size_block=70,temperature=1.,):
|
| 6 |
+
model,device = load_to_device(model)
|
| 7 |
+
model.eval()
|
| 8 |
+
with torch.no_grad():
|
| 9 |
+
tensor_sampled = torch.zeros(size_batch,size_block+1,dtype=torch.long,device=device)
|
| 10 |
+
tensor_sampled[:,0] = vocab_bos
|
| 11 |
+
hiddens = None
|
| 12 |
+
for i in range(size_block):
|
| 13 |
+
input_current = tensor_sampled[:,[i]]
|
| 14 |
+
probs,hiddens = model.forward(input_current,hiddens)
|
| 15 |
+
probs = probs[:,-1]
|
| 16 |
+
probs = probs * temperature
|
| 17 |
+
probs = F.softmax(probs,dim=-1)
|
| 18 |
+
sample = torch.distributions.categorical.Categorical(probs).sample()
|
| 19 |
+
tensor_sampled[:,i+1] = sample
|
| 20 |
+
return tensor_sampled
|
SCMG/models/LSTM/trainer.py
ADDED
|
@@ -0,0 +1,195 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
import time
|
| 4 |
+
from tqdm import tqdm
|
| 5 |
+
import numpy as np
|
| 6 |
+
|
| 7 |
+
import torch
|
| 8 |
+
import torch.nn as nn
|
| 9 |
+
import torch.optim as optim
|
| 10 |
+
from torch.optim.lr_scheduler import LambdaLR
|
| 11 |
+
from torch.utils.data.dataloader import DataLoader
|
| 12 |
+
from MoleculeProcessing.utils.utils_train import *
|
| 13 |
+
logger = logging.getLogger(__name__)
|
| 14 |
+
from MoleculeProcessing.utils.utils import *
|
| 15 |
+
from MoleculeProcessing.utils.utils_train import *
|
| 16 |
+
from MoleculeProcessing.config.config import *
|
| 17 |
+
|
| 18 |
+
class TrainerConfig:
|
| 19 |
+
learning_rate = 3e-4
|
| 20 |
+
betas = (0.9, 0.95)
|
| 21 |
+
grad_norm_clip = 1.0
|
| 22 |
+
weight_decay = 0.1
|
| 23 |
+
lr_decay = False
|
| 24 |
+
warmup_tokens = 375e6
|
| 25 |
+
final_tokens = 260e9
|
| 26 |
+
ckpt_path = None
|
| 27 |
+
num_workers = 0
|
| 28 |
+
config = None
|
| 29 |
+
epoch = 0
|
| 30 |
+
|
| 31 |
+
def __init__(self, **kwargs):
|
| 32 |
+
for k,v in kwargs.items():
|
| 33 |
+
setattr(self, k, v)
|
| 34 |
+
|
| 35 |
+
class Trainer:
|
| 36 |
+
def __init__(self, model, train_dataset, test_dataset, config):
|
| 37 |
+
self.model = model
|
| 38 |
+
self.train_dataset = train_dataset
|
| 39 |
+
self.test_dataset = test_dataset
|
| 40 |
+
self.config = config
|
| 41 |
+
# continue train if previous model exists
|
| 42 |
+
self.train_log = init_train_log()
|
| 43 |
+
if os.path.exists(os.path.join(self.config.config.path_checkpoint,LOG_TRAIN_LATEST)):
|
| 44 |
+
self.train_log = pd.read_csv(os.path.join(self.config.config.path_checkpoint,LOG_TRAIN_LATEST))
|
| 45 |
+
self.config.epoch = self.train_log.shape[0]
|
| 46 |
+
if self.train_log.shape[0]>0:
|
| 47 |
+
self.model = load_model( self.config.config.path_checkpoint,self.config.epoch-1)
|
| 48 |
+
self.optimizer = load_optimizer(self.config.config.path_checkpoint,self.config.epoch-1)
|
| 49 |
+
self.tokens = self.train_log.loc[self.config.epoch-1,TOKENS]
|
| 50 |
+
self.scheduler = load_scheduler(self.config.config.path_checkpoint,self.config.epoch-1)
|
| 51 |
+
else:
|
| 52 |
+
self.tokens = 0 # counter used for learning rate decay
|
| 53 |
+
self.optimizer = model.configure_optimizers(config)
|
| 54 |
+
self.scheduler = optim.lr_scheduler.StepLR(self.optimizer,
|
| 55 |
+
10,
|
| 56 |
+
0.5)
|
| 57 |
+
self.criterion = nn.CrossEntropyLoss()
|
| 58 |
+
# take over whatever gpus are on the system
|
| 59 |
+
self.device = 'cpu'
|
| 60 |
+
if torch.cuda.is_available():
|
| 61 |
+
self.device = torch.cuda.current_device()
|
| 62 |
+
self.model = torch.nn.DataParallel(self.model).to(self.device)
|
| 63 |
+
|
| 64 |
+
def save_checkpoint(self):
|
| 65 |
+
path_checkpoint = self.config.config.path_checkpoint
|
| 66 |
+
# DataParallel wrappers keep raw model object in .module attribute
|
| 67 |
+
raw_model = self.model.module if hasattr(self.model, "module") else self.model
|
| 68 |
+
logger.info("saving %s", path_checkpoint)
|
| 69 |
+
path_model_epoch = add_before_extension(os.path.join(path_checkpoint,
|
| 70 |
+
MODEL_LATEST),
|
| 71 |
+
str(self.config.epoch))
|
| 72 |
+
torch.save(raw_model, path_model_epoch)
|
| 73 |
+
# optimizer
|
| 74 |
+
path_optimizer_epoch = \
|
| 75 |
+
add_before_extension(
|
| 76 |
+
os.path.join(
|
| 77 |
+
path_checkpoint,
|
| 78 |
+
OPTIMIZER_LATEST
|
| 79 |
+
),
|
| 80 |
+
str(self.config.epoch)
|
| 81 |
+
)
|
| 82 |
+
torch.save(
|
| 83 |
+
self.optimizer,
|
| 84 |
+
path_optimizer_epoch
|
| 85 |
+
)
|
| 86 |
+
# optimizer
|
| 87 |
+
path_scheduler_epoch = \
|
| 88 |
+
add_before_extension(
|
| 89 |
+
os.path.join(
|
| 90 |
+
path_checkpoint,
|
| 91 |
+
SCHEDULER_LATEST
|
| 92 |
+
),
|
| 93 |
+
str(self.config.epoch)
|
| 94 |
+
)
|
| 95 |
+
torch.save(
|
| 96 |
+
self.scheduler,
|
| 97 |
+
path_scheduler_epoch
|
| 98 |
+
)
|
| 99 |
+
# train log
|
| 100 |
+
self.train_log.to_csv(
|
| 101 |
+
os.path.join(
|
| 102 |
+
path_checkpoint,
|
| 103 |
+
LOG_TRAIN_LATEST
|
| 104 |
+
)
|
| 105 |
+
,index=False
|
| 106 |
+
)
|
| 107 |
+
path_train_log_epoch = \
|
| 108 |
+
add_before_extension(
|
| 109 |
+
os.path.join(
|
| 110 |
+
path_checkpoint,
|
| 111 |
+
LOG_TRAIN_LATEST
|
| 112 |
+
),
|
| 113 |
+
str(self.config.epoch)
|
| 114 |
+
)
|
| 115 |
+
self.train_log.to_csv(
|
| 116 |
+
path_train_log_epoch,
|
| 117 |
+
index=False)
|
| 118 |
+
|
| 119 |
+
# torch.save(self.token,os.path.join(path_checkpoint,'tokens_'+self.config.epoch+'.pt'))
|
| 120 |
+
def train(self):
|
| 121 |
+
model, config = self.model, self.config
|
| 122 |
+
raw_model = model.module if hasattr(self.model, "module") else model
|
| 123 |
+
optimizer = self.optimizer
|
| 124 |
+
scheduler = self.scheduler
|
| 125 |
+
while self.config.epoch < config.config.epochs and self.config.epoch != config.config.epochs:
|
| 126 |
+
current_status = dict([[a,None] for a in self.train_log.columns])
|
| 127 |
+
current_status[EPOCH] = self.config.epoch
|
| 128 |
+
time_start = time.time()
|
| 129 |
+
current_status = self.run_epoch('train',current_status)
|
| 130 |
+
current_status[TIME_ELAPSED] = int(time.time()-time_start)
|
| 131 |
+
current_status[TOKENS] = self.tokens
|
| 132 |
+
if self.test_dataset is not None:
|
| 133 |
+
current_status = self.run_epoch('test',current_status)
|
| 134 |
+
self.train_log.loc[self.config.epoch] = current_status
|
| 135 |
+
scheduler.step()
|
| 136 |
+
self.save_checkpoint()
|
| 137 |
+
self.config.epoch += 1
|
| 138 |
+
|
| 139 |
+
def run_epoch(self,split,current_status):
|
| 140 |
+
model = self.model
|
| 141 |
+
is_train = split == 'train'
|
| 142 |
+
model.train(is_train)
|
| 143 |
+
data = self.train_dataset if is_train else self.test_dataset
|
| 144 |
+
data.shuffle(random_state=self.config.epoch)
|
| 145 |
+
loader = DataLoader(data, shuffle=False, pin_memory=True,
|
| 146 |
+
batch_size=self.config.config.size_batch,
|
| 147 |
+
num_workers=self.config.num_workers)
|
| 148 |
+
|
| 149 |
+
losses = []
|
| 150 |
+
pbar = tqdm(enumerate(loader), total=len(loader)) if is_train else enumerate(loader)
|
| 151 |
+
for it, (x, y) in pbar:
|
| 152 |
+
|
| 153 |
+
# place data on the correct device
|
| 154 |
+
x = x.to(self.device)
|
| 155 |
+
y = y.to(self.device)
|
| 156 |
+
|
| 157 |
+
# forward the model
|
| 158 |
+
with torch.set_grad_enabled(is_train):
|
| 159 |
+
outputs,_ = model.forward(x)
|
| 160 |
+
loss = self.criterion(outputs.view(-1, outputs.shape[-1]),
|
| 161 |
+
y.view(-1))
|
| 162 |
+
loss = loss.mean() # collapse all losses if they are scattered on multiple gpus
|
| 163 |
+
losses.append(loss.item())
|
| 164 |
+
|
| 165 |
+
if is_train:
|
| 166 |
+
# backprop and update the parameters
|
| 167 |
+
model.zero_grad()
|
| 168 |
+
loss.backward()
|
| 169 |
+
torch.nn.utils.clip_grad_norm_(model.parameters(), self.config.grad_norm_clip)
|
| 170 |
+
self.optimizer.step()
|
| 171 |
+
|
| 172 |
+
# decay the learning rate based on our progress
|
| 173 |
+
if self.config.lr_decay:
|
| 174 |
+
self.tokens += (y >= 0).sum() # number of tokens processed this step (i.e. label is not -100)
|
| 175 |
+
if self.tokens < self.config.warmup_tokens:
|
| 176 |
+
# linear warmup
|
| 177 |
+
lr_mult = float(self.tokens) / float(max(1, self.config.warmup_tokens))
|
| 178 |
+
else:
|
| 179 |
+
# cosine learning rate decay
|
| 180 |
+
progress = float(self.tokens - self.config.warmup_tokens) / float(max(1, self.config.final_tokens - self.config.warmup_tokens))
|
| 181 |
+
lr_mult = max(0.1, 0.5 * (1.0 + math.cos(math.pi * progress)))
|
| 182 |
+
lr = self.config.learning_rate * lr_mult
|
| 183 |
+
for param_group in optimizer.param_groups:
|
| 184 |
+
param_group['lr'] = lr
|
| 185 |
+
else:
|
| 186 |
+
lr = self.config.learning_rate
|
| 187 |
+
current_status[LR] = lr
|
| 188 |
+
|
| 189 |
+
# report progress
|
| 190 |
+
pbar.set_description(f"epoch {self.config.epoch+1} iter {it}: train loss {loss.item():.5f}. lr {lr:e}")
|
| 191 |
+
current_status[split+'_loss'] = float(np.mean(losses))
|
| 192 |
+
if not is_train:
|
| 193 |
+
test_loss = float(np.mean(losses))
|
| 194 |
+
logger.info("test loss: %f", test_loss)
|
| 195 |
+
return current_status
|
SCMG/models/Reinvent/__init__.py
ADDED
|
File without changes
|
SCMG/models/Reinvent/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (177 Bytes). View file
|
|
|
SCMG/models/Reinvent/__pycache__/model copy 2.cpython-310.pyc
ADDED
|
Binary file (14.4 kB). View file
|
|
|
SCMG/models/Reinvent/__pycache__/model copy.cpython-310.pyc
ADDED
|
Binary file (8.39 kB). View file
|
|
|
SCMG/models/Reinvent/__pycache__/model.cpython-310.pyc
ADDED
|
Binary file (8.79 kB). View file
|
|
|
SCMG/models/Reinvent/__pycache__/sampler.cpython-310.pyc
ADDED
|
Binary file (3.17 kB). View file
|
|
|
SCMG/models/Reinvent/model copy 2.py
ADDED
|
@@ -0,0 +1,420 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
|
| 11 |
+
# class ModelConfig():
|
| 12 |
+
# rate_dropout_embedding = 0.1
|
| 13 |
+
# rate_dropout_residue = 0.1
|
| 14 |
+
# rate_dropout_attention = 0.1
|
| 15 |
+
# block_size=125
|
| 16 |
+
# def __init__(self, size_vocab, **kwargs):
|
| 17 |
+
# self.size_vocab = size_vocab
|
| 18 |
+
# for k,v in kwargs.items():
|
| 19 |
+
# setattr(self, k, v)
|
| 20 |
+
|
| 21 |
+
class CausalSelfAttention(nn.Module):
|
| 22 |
+
def __init__(self, config):
|
| 23 |
+
super().__init__()
|
| 24 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 25 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 26 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 27 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 28 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 29 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 30 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 31 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 32 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 33 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 34 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 35 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 36 |
+
|
| 37 |
+
def forward(self, x, layer_past=None):
|
| 38 |
+
B, T, C = x.size()
|
| 39 |
+
k = self.key(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 40 |
+
q = self.query(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 41 |
+
v = self.value(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 42 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 43 |
+
att = att.masked_fill(self.mask[:,:,:T,:T] == 0, float('-inf'))
|
| 44 |
+
att = F.softmax(att, dim=-1)
|
| 45 |
+
att = self.dropout_attention(att)
|
| 46 |
+
y = att @ v
|
| 47 |
+
y = y.transpose(1, 2).contiguous().view(B, T, self.attention_features)
|
| 48 |
+
y = self.dropout_residue(self.projection(y))
|
| 49 |
+
return y
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
class CrossAttention(nn.Module):
|
| 53 |
+
def __init__(self, config):
|
| 54 |
+
super().__init__()
|
| 55 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 56 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 57 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 58 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 59 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 60 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 61 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 62 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 63 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 64 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 65 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 66 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 67 |
+
|
| 68 |
+
def forward(self, x_encoder,x_decoder, layer_past=None):
|
| 69 |
+
B_encoder, T_encoder, C_encoder = x_encoder.size()
|
| 70 |
+
B_decoder, T_decoder, C_decoder = x_decoder.size()
|
| 71 |
+
k = self.key( x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 72 |
+
q = self.query(x_decoder).view(B_encoder, T_decoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 73 |
+
v = self.value(x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 74 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 75 |
+
att = att.masked_fill(self.mask[:,:,:T_decoder,:T_encoder] == 0, float('-inf'))
|
| 76 |
+
att = F.softmax(att, dim=-1)
|
| 77 |
+
att = self.dropout_attention(att)
|
| 78 |
+
y = att @ v
|
| 79 |
+
y = y.transpose(1, 2).contiguous().view(B_encoder, T_decoder, self.attention_features)
|
| 80 |
+
y = self.dropout_residue(self.projection(y))
|
| 81 |
+
return y
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
class EncoderBlock(nn.Module):
|
| 87 |
+
def __init__(self, config):
|
| 88 |
+
super().__init__()
|
| 89 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 90 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 91 |
+
self.attn = CausalSelfAttention(config)
|
| 92 |
+
self.mlp = nn.Sequential(
|
| 93 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 94 |
+
nn.GELU(),
|
| 95 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 96 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 97 |
+
)
|
| 98 |
+
|
| 99 |
+
def forward(self, x):
|
| 100 |
+
# = y_input
|
| 101 |
+
x = x + self.attn(self.ln1(x))
|
| 102 |
+
x = x + self.mlp(self.ln2(x))
|
| 103 |
+
return x
|
| 104 |
+
|
| 105 |
+
class DecoderBlock(nn.Module):
|
| 106 |
+
def __init__(self, config):
|
| 107 |
+
super().__init__()
|
| 108 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 109 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 110 |
+
self.masked_attn = CausalSelfAttention(config)
|
| 111 |
+
self.cross_attn = CrossAttention(config)
|
| 112 |
+
self.mlp = nn.Sequential(
|
| 113 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 114 |
+
nn.GELU(),
|
| 115 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 116 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 117 |
+
)
|
| 118 |
+
|
| 119 |
+
def forward(self, x_encoder,x):
|
| 120 |
+
# = y_input
|
| 121 |
+
x = x + self.masked_attn(self.ln1(x))
|
| 122 |
+
x = x + self.cross_attn(x_encoder,self.ln1(x))
|
| 123 |
+
x = x + self.mlp(self.ln2(x))
|
| 124 |
+
return x
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
|
| 130 |
+
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
|
| 134 |
+
|
| 135 |
+
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
|
| 142 |
+
import torch
|
| 143 |
+
import torch.nn as nn
|
| 144 |
+
import torch.nn.functional as F
|
| 145 |
+
import math
|
| 146 |
+
|
| 147 |
+
|
| 148 |
+
class Norm(nn.Module):
|
| 149 |
+
def __init__(self, d_model, eps = 1e-6):
|
| 150 |
+
super().__init__()
|
| 151 |
+
|
| 152 |
+
self.size = d_model
|
| 153 |
+
|
| 154 |
+
# create two learnable parameters to calibrate normalisation
|
| 155 |
+
self.alpha = nn.Parameter(torch.ones(self.size))
|
| 156 |
+
self.bias = nn.Parameter(torch.zeros(self.size))
|
| 157 |
+
|
| 158 |
+
self.eps = eps
|
| 159 |
+
|
| 160 |
+
def forward(self, x):
|
| 161 |
+
norm = self.alpha * (x - x.mean(dim=-1, keepdim=True)) \
|
| 162 |
+
/ (x.std(dim=-1, keepdim=True) + self.eps) + self.bias
|
| 163 |
+
return norm
|
| 164 |
+
|
| 165 |
+
def attention(q, k, v, d_k, mask=None, dropout=None):
|
| 166 |
+
|
| 167 |
+
scores = torch.matmul(q, k.transpose(-2, -1)) / math.sqrt(d_k)
|
| 168 |
+
|
| 169 |
+
if mask is not None:
|
| 170 |
+
mask = mask.unsqueeze(1)
|
| 171 |
+
scores = scores.masked_fill(mask == 0, -1e9)
|
| 172 |
+
|
| 173 |
+
scores = F.softmax(scores, dim=-1)
|
| 174 |
+
|
| 175 |
+
if dropout is not None:
|
| 176 |
+
scores = dropout(scores)
|
| 177 |
+
|
| 178 |
+
output = torch.matmul(scores, v)
|
| 179 |
+
return output
|
| 180 |
+
|
| 181 |
+
class MultiHeadAttention(nn.Module):
|
| 182 |
+
def __init__(self, heads, d_model, dropout = 0.1):
|
| 183 |
+
super().__init__()
|
| 184 |
+
|
| 185 |
+
self.d_model = d_model
|
| 186 |
+
self.d_k = d_model // heads
|
| 187 |
+
self.h = heads
|
| 188 |
+
|
| 189 |
+
self.q_linear = nn.Linear(d_model, d_model)
|
| 190 |
+
self.v_linear = nn.Linear(d_model, d_model)
|
| 191 |
+
self.k_linear = nn.Linear(d_model, d_model)
|
| 192 |
+
|
| 193 |
+
self.dropout = nn.Dropout(dropout)
|
| 194 |
+
self.out = nn.Linear(d_model, d_model)
|
| 195 |
+
|
| 196 |
+
def forward(self, q, k, v, mask=None):
|
| 197 |
+
|
| 198 |
+
bs = q.size(0)
|
| 199 |
+
|
| 200 |
+
# perform linear operation and split into N heads
|
| 201 |
+
k = self.k_linear(k).view(bs, -1, self.h, self.d_k)
|
| 202 |
+
q = self.q_linear(q).view(bs, -1, self.h, self.d_k)
|
| 203 |
+
v = self.v_linear(v).view(bs, -1, self.h, self.d_k)
|
| 204 |
+
|
| 205 |
+
# transpose to get dimensions bs * N * sl * d_model
|
| 206 |
+
k = k.transpose(1,2)
|
| 207 |
+
q = q.transpose(1,2)
|
| 208 |
+
v = v.transpose(1,2)
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
# calculate attention using function we will define next
|
| 212 |
+
scores = attention(q, k, v, self.d_k, mask, self.dropout)
|
| 213 |
+
# concatenate heads and put through final linear layer
|
| 214 |
+
concat = scores.transpose(1,2).contiguous()\
|
| 215 |
+
.view(bs, -1, self.d_model)
|
| 216 |
+
output = self.out(concat)
|
| 217 |
+
|
| 218 |
+
return output
|
| 219 |
+
|
| 220 |
+
class FeedForward(nn.Module):
|
| 221 |
+
def __init__(self, d_model, d_ff=2048, dropout = 0.1):
|
| 222 |
+
super().__init__()
|
| 223 |
+
|
| 224 |
+
# We set d_ff as a default to 2048
|
| 225 |
+
self.linear_1 = nn.Linear(d_model, d_ff)
|
| 226 |
+
self.dropout = nn.Dropout(dropout)
|
| 227 |
+
self.linear_2 = nn.Linear(d_ff, d_model)
|
| 228 |
+
|
| 229 |
+
def forward(self, x):
|
| 230 |
+
x = self.dropout(F.relu(self.linear_1(x)))
|
| 231 |
+
x = self.linear_2(x)
|
| 232 |
+
return x
|
| 233 |
+
|
| 234 |
+
|
| 235 |
+
|
| 236 |
+
|
| 237 |
+
import torch
|
| 238 |
+
import torch.nn as nn
|
| 239 |
+
import copy
|
| 240 |
+
|
| 241 |
+
|
| 242 |
+
class EncoderLayer(nn.Module):
|
| 243 |
+
def __init__(self, d_model, heads, dropout=0.1):
|
| 244 |
+
super().__init__()
|
| 245 |
+
self.norm_1 = Norm(d_model)
|
| 246 |
+
self.norm_2 = Norm(d_model)
|
| 247 |
+
self.attn = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 248 |
+
self.ff = FeedForward(d_model, dropout=dropout)
|
| 249 |
+
self.dropout_1 = nn.Dropout(dropout)
|
| 250 |
+
self.dropout_2 = nn.Dropout(dropout)
|
| 251 |
+
|
| 252 |
+
def forward(self, x, mask):
|
| 253 |
+
x2 = self.norm_1(x)
|
| 254 |
+
x = x + self.dropout_1(self.attn(x2,x2,x2,mask))
|
| 255 |
+
x2 = self.norm_2(x)
|
| 256 |
+
x = x + self.dropout_2(self.ff(x2))
|
| 257 |
+
return x
|
| 258 |
+
|
| 259 |
+
# build a decoder layer with two multi-head attention layers and
|
| 260 |
+
# one feed-forward layer
|
| 261 |
+
class DecoderLayer(nn.Module):
|
| 262 |
+
def __init__(self, d_model, heads, dropout=0.1):
|
| 263 |
+
super().__init__()
|
| 264 |
+
self.norm_1 = Norm(d_model)
|
| 265 |
+
self.norm_2 = Norm(d_model)
|
| 266 |
+
self.norm_3 = Norm(d_model)
|
| 267 |
+
|
| 268 |
+
self.dropout_1 = nn.Dropout(dropout)
|
| 269 |
+
self.dropout_2 = nn.Dropout(dropout)
|
| 270 |
+
self.dropout_3 = nn.Dropout(dropout)
|
| 271 |
+
|
| 272 |
+
self.attn_1 = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 273 |
+
self.attn_2 = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 274 |
+
self.ff = FeedForward(d_model, dropout=dropout)
|
| 275 |
+
|
| 276 |
+
def forward(self, x, e_outputs, src_mask, trg_mask):
|
| 277 |
+
x2 = self.norm_1(x)
|
| 278 |
+
x = x + self.dropout_1(self.attn_1(x2, x2, x2, trg_mask))
|
| 279 |
+
x2 = self.norm_2(x)
|
| 280 |
+
x = x + self.dropout_2(self.attn_2(x2, e_outputs, e_outputs, \
|
| 281 |
+
src_mask))
|
| 282 |
+
x2 = self.norm_3(x)
|
| 283 |
+
x = x + self.dropout_3(self.ff(x2))
|
| 284 |
+
return x
|
| 285 |
+
|
| 286 |
+
|
| 287 |
+
import torch
|
| 288 |
+
import torch.nn as nn
|
| 289 |
+
import math
|
| 290 |
+
from torch.autograd import Variable
|
| 291 |
+
|
| 292 |
+
class Embedder(nn.Module):
|
| 293 |
+
def __init__(self, vocab_size, d_model):
|
| 294 |
+
super().__init__()
|
| 295 |
+
self.d_model = d_model
|
| 296 |
+
self.embed = nn.Embedding(vocab_size, d_model)
|
| 297 |
+
def forward(self, x):
|
| 298 |
+
return self.embed(x)
|
| 299 |
+
|
| 300 |
+
class PositionalEncoder(nn.Module):
|
| 301 |
+
def __init__(self, d_model, max_seq_len = 200, dropout = 0.1):
|
| 302 |
+
super().__init__()
|
| 303 |
+
self.d_model = d_model
|
| 304 |
+
self.dropout = nn.Dropout(dropout)
|
| 305 |
+
# create constant 'pe' matrix with values dependant on
|
| 306 |
+
# pos and i
|
| 307 |
+
pe = torch.zeros(max_seq_len, d_model)
|
| 308 |
+
for pos in range(max_seq_len):
|
| 309 |
+
for i in range(0, d_model, 2):
|
| 310 |
+
pe[pos, i] = \
|
| 311 |
+
math.sin(pos / (10000 ** ((2 * i)/d_model)))
|
| 312 |
+
pe[pos, i + 1] = \
|
| 313 |
+
math.cos(pos / (10000 ** ((2 * (i + 1))/d_model)))
|
| 314 |
+
pe = pe.unsqueeze(0)
|
| 315 |
+
self.register_buffer('pe', pe)
|
| 316 |
+
|
| 317 |
+
|
| 318 |
+
def forward(self, x):
|
| 319 |
+
# make embeddings relatively larger
|
| 320 |
+
x = x * math.sqrt(self.d_model)
|
| 321 |
+
#add constant to embedding
|
| 322 |
+
seq_len = x.size(1)
|
| 323 |
+
pe = Variable(self.pe[:,:seq_len], requires_grad=False)
|
| 324 |
+
if x.is_cuda:
|
| 325 |
+
pe.cuda()
|
| 326 |
+
x = x + pe
|
| 327 |
+
return self.dropout(x)
|
| 328 |
+
|
| 329 |
+
def get_clones(module, N):
|
| 330 |
+
return nn.ModuleList([copy.deepcopy(module) for i in range(N)])
|
| 331 |
+
|
| 332 |
+
class Encoder(nn.Module):
|
| 333 |
+
def __init__(self, vocab_size, d_model, N, heads, dropout):
|
| 334 |
+
super().__init__()
|
| 335 |
+
self.N = N
|
| 336 |
+
self.embed = Embedder(vocab_size, d_model)
|
| 337 |
+
self.pe = PositionalEncoder(d_model, dropout=dropout)
|
| 338 |
+
self.layers = get_clones(EncoderLayer(d_model, heads, dropout), N)
|
| 339 |
+
self.norm = Norm(d_model)
|
| 340 |
+
def forward(self, src, mask):
|
| 341 |
+
x = self.embed(src)
|
| 342 |
+
x = self.pe(x)
|
| 343 |
+
for i in range(self.N):
|
| 344 |
+
x = self.layers[i](x, mask)
|
| 345 |
+
return self.norm(x)
|
| 346 |
+
|
| 347 |
+
class Decoder(nn.Module):
|
| 348 |
+
def __init__(self, vocab_size, d_model, N, heads, dropout):
|
| 349 |
+
super().__init__()
|
| 350 |
+
self.N = N
|
| 351 |
+
self.embed = Embedder(vocab_size, d_model)
|
| 352 |
+
self.pe = PositionalEncoder(d_model, dropout=dropout)
|
| 353 |
+
self.layers = get_clones(DecoderLayer(d_model, heads, dropout), N)
|
| 354 |
+
self.norm = Norm(d_model)
|
| 355 |
+
def forward(self, trg, e_outputs, src_mask, trg_mask):
|
| 356 |
+
x = self.embed(trg)
|
| 357 |
+
x = self.pe(x)
|
| 358 |
+
for i in range(self.N):
|
| 359 |
+
x = self.layers[i](x, e_outputs, src_mask, trg_mask)
|
| 360 |
+
return self.norm(x)
|
| 361 |
+
|
| 362 |
+
class Model(nn.Module):
|
| 363 |
+
def __init__(self, config):
|
| 364 |
+
super().__init__()
|
| 365 |
+
self.encoder = Encoder(len(config["vocab_encoder"]), config[varables.DIM_ATTENTION], config[varables.NUM_LAYERS], config[varables.NUM_HEADS], config[varables.RATE_DROPOUT])
|
| 366 |
+
self.decoder = Decoder(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION], config[varables.NUM_LAYERS], config[varables.NUM_HEADS], config[varables.RATE_DROPOUT])
|
| 367 |
+
self.out = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]))
|
| 368 |
+
# self.tok_emb = nn.Embedding(config[varables.SIZE_VOCAB], config[varables.DIM_EMBEDDING])
|
| 369 |
+
# self.pos_emb = nn.Parameter(torch.zeros(1, config[varables.SIZE_BLOCK], config[varables.DIM_EMBEDDING]))
|
| 370 |
+
# self.drop = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 371 |
+
# self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 372 |
+
# self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 373 |
+
# self.blocks = nn.Sequential(*[DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 374 |
+
# self.ln_f = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 375 |
+
# self.head = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.SIZE_VOCAB], bias=False)
|
| 376 |
+
# self.block_size = config[varables.SIZE_BLOCK]
|
| 377 |
+
# self.apply(self._init_weights)
|
| 378 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 379 |
+
self.optimizer = None
|
| 380 |
+
|
| 381 |
+
def get_block_size(self):
|
| 382 |
+
return self.block_size
|
| 383 |
+
|
| 384 |
+
def _init_weights(self, module):
|
| 385 |
+
if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 386 |
+
module.weight.data.normal_(mean=0.0, std=0.02)
|
| 387 |
+
if isinstance(module, nn.Linear) and module.bias is not None:
|
| 388 |
+
module.bias.data.zero_()
|
| 389 |
+
elif isinstance(module, nn.LayerNorm):
|
| 390 |
+
module.bias.data.zero_()
|
| 391 |
+
module.weight.data.fill_(1.0)
|
| 392 |
+
def init_optimizers(self,train_config):
|
| 393 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 394 |
+
return optimizer
|
| 395 |
+
def init_scheduler(self,train_config):
|
| 396 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 397 |
+
return scheduler
|
| 398 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 399 |
+
def collate(results):
|
| 400 |
+
x_in = [a[0] for a in results]
|
| 401 |
+
y_in = [a[1] for a in results]
|
| 402 |
+
boundary = -1
|
| 403 |
+
max_len_x = max([len(a) for a in x_in])
|
| 404 |
+
max_len_y = max([len(a) for a in y_in])
|
| 405 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in x_in],dtype=torch.long)
|
| 406 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in y_in],dtype=torch.long)
|
| 407 |
+
return x,y,boundary
|
| 408 |
+
return collate
|
| 409 |
+
def forward(self, src, trg, trg_out, boundary=None):
|
| 410 |
+
src_mask = None
|
| 411 |
+
trg_mask = torch.tril(torch.ones(trg.shape[1], trg.shape[1])).view(1, 1, trg.shape[1], trg.shape[1]).to(trg.device)
|
| 412 |
+
e_outputs = self.encoder(src, src_mask)
|
| 413 |
+
d_output = self.decoder(trg, e_outputs, src_mask, trg_mask)
|
| 414 |
+
logits = self.out(d_output)
|
| 415 |
+
loss = None
|
| 416 |
+
if trg_out is not None:
|
| 417 |
+
loss = F.cross_entropy(logits.view(-1, logits.size(-1)), trg_out.view(-1))
|
| 418 |
+
return logits, loss
|
| 419 |
+
|
| 420 |
+
# mark test
|
SCMG/models/Reinvent/model copy.py
ADDED
|
@@ -0,0 +1,187 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
|
| 11 |
+
# class ModelConfig():
|
| 12 |
+
# rate_dropout_embedding = 0.1
|
| 13 |
+
# rate_dropout_residue = 0.1
|
| 14 |
+
# rate_dropout_attention = 0.1
|
| 15 |
+
# block_size=125
|
| 16 |
+
# def __init__(self, size_vocab, **kwargs):
|
| 17 |
+
# self.size_vocab = size_vocab
|
| 18 |
+
# for k,v in kwargs.items():
|
| 19 |
+
# setattr(self, k, v)
|
| 20 |
+
|
| 21 |
+
class CausalSelfAttention(nn.Module):
|
| 22 |
+
def __init__(self, config):
|
| 23 |
+
super().__init__()
|
| 24 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 25 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 26 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 27 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 28 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 29 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 30 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 31 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 32 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 33 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 34 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 35 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 36 |
+
|
| 37 |
+
def forward(self, x, layer_past=None):
|
| 38 |
+
B, T, C = x.size()
|
| 39 |
+
k = self.key(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 40 |
+
q = self.query(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 41 |
+
v = self.value(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 42 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 43 |
+
att = att.masked_fill(self.mask[:,:,:T,:T] == 0, float('-inf'))
|
| 44 |
+
att = F.softmax(att, dim=-1)
|
| 45 |
+
att = self.dropout_attention(att)
|
| 46 |
+
y = att @ v
|
| 47 |
+
y = y.transpose(1, 2).contiguous().view(B, T, self.attention_features)
|
| 48 |
+
y = self.dropout_residue(self.projection(y))
|
| 49 |
+
return y
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
class CrossAttention(nn.Module):
|
| 53 |
+
def __init__(self, config):
|
| 54 |
+
super().__init__()
|
| 55 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 56 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 57 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 58 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 59 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 60 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 61 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 62 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 63 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 64 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 65 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 66 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 67 |
+
|
| 68 |
+
def forward(self, x_encoder,x_decoder, layer_past=None):
|
| 69 |
+
B_encoder, T_encoder, C_encoder = x_encoder.size()
|
| 70 |
+
B_decoder, T_decoder, C_decoder = x_decoder.size()
|
| 71 |
+
k = self.key( x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 72 |
+
q = self.query(x_decoder).view(B_encoder, T_decoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 73 |
+
v = self.value(x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 74 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 75 |
+
att = att.masked_fill(self.mask[:,:,:T_decoder,:T_encoder] == 0, float('-inf'))
|
| 76 |
+
att = F.softmax(att, dim=-1)
|
| 77 |
+
att = self.dropout_attention(att)
|
| 78 |
+
y = att @ v
|
| 79 |
+
y = y.transpose(1, 2).contiguous().view(B_encoder, T_decoder, self.attention_features)
|
| 80 |
+
y = self.dropout_residue(self.projection(y))
|
| 81 |
+
return y
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
class EncoderBlock(nn.Module):
|
| 87 |
+
def __init__(self, config):
|
| 88 |
+
super().__init__()
|
| 89 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 90 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 91 |
+
self.attn = CausalSelfAttention(config)
|
| 92 |
+
self.mlp = nn.Sequential(
|
| 93 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 94 |
+
nn.GELU(),
|
| 95 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 96 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 97 |
+
)
|
| 98 |
+
|
| 99 |
+
def forward(self, x):
|
| 100 |
+
# = y_input
|
| 101 |
+
x = x + self.attn(self.ln1(x))
|
| 102 |
+
x = x + self.mlp(self.ln2(x))
|
| 103 |
+
return x
|
| 104 |
+
|
| 105 |
+
class DecoderBlock(nn.Module):
|
| 106 |
+
def __init__(self, config):
|
| 107 |
+
super().__init__()
|
| 108 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 109 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 110 |
+
self.masked_attn = CausalSelfAttention(config)
|
| 111 |
+
self.cross_attn = CrossAttention(config)
|
| 112 |
+
self.mlp = nn.Sequential(
|
| 113 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 114 |
+
nn.GELU(),
|
| 115 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 116 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 117 |
+
)
|
| 118 |
+
|
| 119 |
+
def forward(self, x_encoder,x):
|
| 120 |
+
# = y_input
|
| 121 |
+
x = x + self.masked_attn(self.ln1(x))
|
| 122 |
+
x = x + self.cross_attn(x_encoder,self.ln1(x))
|
| 123 |
+
x = x + self.mlp(self.ln2(x))
|
| 124 |
+
return x
|
| 125 |
+
|
| 126 |
+
class Model(nn.Module):
|
| 127 |
+
def __init__(self, config):
|
| 128 |
+
super().__init__()
|
| 129 |
+
self.tok_emb = nn.Embedding(config[varables.SIZE_VOCAB], config[varables.DIM_EMBEDDING])
|
| 130 |
+
self.pos_emb = nn.Parameter(torch.zeros(1, config[varables.SIZE_BLOCK], config[varables.DIM_EMBEDDING]))
|
| 131 |
+
self.drop = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 132 |
+
self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 133 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 134 |
+
# self.blocks = nn.Sequential(*[DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 135 |
+
self.ln_f = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 136 |
+
self.head = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.SIZE_VOCAB], bias=False)
|
| 137 |
+
self.block_size = config[varables.SIZE_BLOCK]
|
| 138 |
+
self.apply(self._init_weights)
|
| 139 |
+
logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 140 |
+
self.optimizer = None
|
| 141 |
+
|
| 142 |
+
def get_block_size(self):
|
| 143 |
+
return self.block_size
|
| 144 |
+
|
| 145 |
+
def _init_weights(self, module):
|
| 146 |
+
if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 147 |
+
module.weight.data.normal_(mean=0.0, std=0.02)
|
| 148 |
+
if isinstance(module, nn.Linear) and module.bias is not None:
|
| 149 |
+
module.bias.data.zero_()
|
| 150 |
+
elif isinstance(module, nn.LayerNorm):
|
| 151 |
+
module.bias.data.zero_()
|
| 152 |
+
module.weight.data.fill_(1.0)
|
| 153 |
+
def init_optimizers(self,train_config):
|
| 154 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 155 |
+
return optimizer
|
| 156 |
+
def init_scheduler(self,train_config):
|
| 157 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 158 |
+
return scheduler
|
| 159 |
+
def get_collate_fn(self, vocab):
|
| 160 |
+
def collate(results):
|
| 161 |
+
x_in = [a[0] for a in results]
|
| 162 |
+
y_in = [a[1] for a in results]
|
| 163 |
+
boundary = -1
|
| 164 |
+
max_len_x = max([len(a) for a in x_in])
|
| 165 |
+
max_len_y = max([len(a) for a in y_in])
|
| 166 |
+
x = torch.tensor([(a+[vocab[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in x_in],dtype=torch.long)
|
| 167 |
+
y = torch.tensor([(a+[vocab[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in y_in],dtype=torch.long)
|
| 168 |
+
return x,y,boundary
|
| 169 |
+
return collate
|
| 170 |
+
|
| 171 |
+
def forward(self, x_in, y_in, y_out=None,boundary=None):
|
| 172 |
+
x_in = self.drop(self.tok_emb(x_in) + self.pos_emb[:, :x_in.size()[1], :])
|
| 173 |
+
y_in = self.drop(self.tok_emb(y_in) + self.pos_emb[:, :y_in.size()[1], :])
|
| 174 |
+
#
|
| 175 |
+
for encoder_block in self.encoder_blocks:
|
| 176 |
+
x_in = encoder_block(x_in)
|
| 177 |
+
x_in = self.ln_f(x_in)
|
| 178 |
+
for decoder_block in self.decoder_blocks:
|
| 179 |
+
y_in = decoder_block(x_in,y_in)
|
| 180 |
+
y_in = self.ln_f(y_in)
|
| 181 |
+
logits = self.head(y_in)
|
| 182 |
+
loss = None
|
| 183 |
+
if y_out is not None:
|
| 184 |
+
loss = F.cross_entropy(logits.view(-1, logits.size(-1)), y_out.view(-1))
|
| 185 |
+
return logits, loss
|
| 186 |
+
|
| 187 |
+
# mark test
|
SCMG/models/Reinvent/model.py
ADDED
|
@@ -0,0 +1,278 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
# logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
from torch.autograd import Variable
|
| 11 |
+
|
| 12 |
+
# class PositionalEncoder(nn.Module):
|
| 13 |
+
# def __init__(self, config):
|
| 14 |
+
# super().__init__()
|
| 15 |
+
# pe = torch.zeros(config[varables.SIZE_BLOCK], config[varables.DIM_ATTENTION])
|
| 16 |
+
# for pos in range(config[varables.SIZE_BLOCK]):
|
| 17 |
+
# for i in range(0, config[varables.DIM_ATTENTION], 2):
|
| 18 |
+
# pe[pos, i] = \
|
| 19 |
+
# math.sin(pos / (10000 ** ((2 * i)/config[varables.DIM_ATTENTION])))
|
| 20 |
+
# pe[pos, i + 1] = \
|
| 21 |
+
# math.cos(pos / (10000 ** ((2 * (i + 1))/config[varables.DIM_ATTENTION])))
|
| 22 |
+
# pe = pe.unsqueeze(0)
|
| 23 |
+
# self.register_buffer('pe', pe)
|
| 24 |
+
# def forward(self, T):
|
| 25 |
+
# #add constant to embedding
|
| 26 |
+
# x = Variable(self.pe[:,:T], requires_grad=False)
|
| 27 |
+
# return x
|
| 28 |
+
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
class PositionalEncoder(nn.Module):
|
| 32 |
+
def __init__(self, config):
|
| 33 |
+
super(PositionalEncoder, self).__init__()
|
| 34 |
+
self.Dropout = nn.Dropout(p=config[varables.RATE_DROPOUT])
|
| 35 |
+
max_len = config[varables.SIZE_BLOCK]
|
| 36 |
+
pe = torch.zeros(max_len, config[varables.DIM_ATTENTION])
|
| 37 |
+
position = torch.arange(0, max_len, dtype=torch.float).unsqueeze(1)
|
| 38 |
+
div_term = torch.exp(torch.arange(0, config[varables.DIM_ATTENTION], 2).float() * (-math.log(10000.0) / config[varables.DIM_ATTENTION]))
|
| 39 |
+
pe[:, 0::2] = torch.sin(position * div_term)
|
| 40 |
+
pe[:, 1::2] = torch.cos(position * div_term)
|
| 41 |
+
pe = pe.unsqueeze(0)
|
| 42 |
+
self.register_buffer('pe', pe)
|
| 43 |
+
def forward(self, T):
|
| 44 |
+
x = self.Dropout(self.pe[:,:T, :])
|
| 45 |
+
return x
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
|
| 49 |
+
class Attention(nn.Module):
|
| 50 |
+
def __init__(self, config):
|
| 51 |
+
super().__init__()
|
| 52 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 53 |
+
self.Key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 54 |
+
self.Query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 55 |
+
self.Value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 56 |
+
self.Dropout_Attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 57 |
+
self.Dropout_Residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 58 |
+
self.Projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 59 |
+
self.NumberOfHeads = config[varables.NUM_HEADS]
|
| 60 |
+
self.DimHead = config[varables.DIM_ATTENTION] // self.NumberOfHeads
|
| 61 |
+
self.DimAttention = config[varables.DIM_ATTENTION]
|
| 62 |
+
|
| 63 |
+
def forward(self, X_1,X_2, mask=None):
|
| 64 |
+
if X_2 is None:
|
| 65 |
+
X_2 = X_1
|
| 66 |
+
BatchSize, T_Encoder, _ = X_1.size()
|
| 67 |
+
BatchSize, T_Decoder, _ = X_2.size()
|
| 68 |
+
K = self.Key( X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 69 |
+
Q = self.Query(X_2).view(BatchSize, T_Decoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 70 |
+
V = self.Value(X_1).view(BatchSize, T_Encoder, self.NumberOfHeads,self.DimHead).transpose(1, 2)
|
| 71 |
+
# k,q,v dimension: (BatchSize, SequenceSize, NumberOfHeads, HeadDimension) 3,4,5,16
|
| 72 |
+
ScoreAttention = (Q @ K.transpose(-2, -1)) / math.sqrt(self.DimHead)
|
| 73 |
+
ScoreAttention = ScoreAttention.masked_fill(mask==0, -1e9)
|
| 74 |
+
ScoreAttention = F.softmax(ScoreAttention, dim=-1)
|
| 75 |
+
ScoreAttention = self.Dropout_Attention(ScoreAttention)
|
| 76 |
+
# k.transpose(-2,-1): 3,4,16,5
|
| 77 |
+
# (q@(k.transpose(-2,-1))): 3,4,5,5
|
| 78 |
+
Z = ScoreAttention @ V
|
| 79 |
+
# y dimension: 3,4,5,16
|
| 80 |
+
Z = Z.transpose(1, 2).contiguous().view(BatchSize, T_Decoder, self.DimAttention)
|
| 81 |
+
# y dimension: 3,5,64
|
| 82 |
+
Z = self.Dropout_Residue(self.Projection(Z))
|
| 83 |
+
return Z
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
|
| 87 |
+
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
|
| 94 |
+
class FeedForward(nn.Module):
|
| 95 |
+
def __init__(self, config):
|
| 96 |
+
super().__init__()
|
| 97 |
+
if config[varables.DIM_FEEDFORWARD] == 0:
|
| 98 |
+
Dim_FeedForward = config[varables.DIM_ATTENTION] *4
|
| 99 |
+
else:
|
| 100 |
+
Dim_FeedForward = config[varables.DIM_FEEDFORWARD]
|
| 101 |
+
self.Linear1 = nn.Linear(config[varables.DIM_EMBEDDING], Dim_FeedForward)
|
| 102 |
+
self.GELU = nn.GELU()
|
| 103 |
+
self.Linear2 = nn.Linear(Dim_FeedForward, config[varables.DIM_EMBEDDING])
|
| 104 |
+
self.Dropout = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 105 |
+
|
| 106 |
+
def forward(self,x):
|
| 107 |
+
x = self.Linear1(x)
|
| 108 |
+
x = self.GELU (x)
|
| 109 |
+
x = self.Dropout(x)
|
| 110 |
+
x = self.Linear2(x)
|
| 111 |
+
return x
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
class EncoderBlock(nn.Module):
|
| 117 |
+
def __init__(self, config):
|
| 118 |
+
super().__init__()
|
| 119 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 120 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 121 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 122 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 123 |
+
self.Attention = Attention( config)
|
| 124 |
+
self.FeedForward = FeedForward(config)
|
| 125 |
+
|
| 126 |
+
def forward(self, X_Encoder,Mask_Encoder):
|
| 127 |
+
X_Encoder = self.Dropout1(X_Encoder + self.Attention (self.LayerNorm1(X_Encoder), None, Mask_Encoder))
|
| 128 |
+
X_Encoder = self.Dropout2(X_Encoder + self.FeedForward(self.LayerNorm2(X_Encoder)))
|
| 129 |
+
return X_Encoder
|
| 130 |
+
|
| 131 |
+
class DecoderBlock(nn.Module):
|
| 132 |
+
def __init__(self, config):
|
| 133 |
+
super().__init__()
|
| 134 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 135 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 136 |
+
self.LayerNorm3 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 137 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 138 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 139 |
+
self.Dropout3 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 140 |
+
self.AttentionMasked = Attention( config)
|
| 141 |
+
self.AttentionCross = Attention( config)
|
| 142 |
+
self.FeedForward = FeedForward(config)
|
| 143 |
+
|
| 144 |
+
def forward(self, X_Encoder,X_Decoder,Mask_Cross,Mask_Decoder):
|
| 145 |
+
X_Decoder = self.Dropout1(X_Decoder + self.AttentionMasked(self.LayerNorm1(X_Decoder), None, Mask_Decoder))
|
| 146 |
+
X_Decoder = self.Dropout2(X_Decoder + self.AttentionCross ( X_Encoder, self.LayerNorm2(X_Decoder), Mask_Cross ))
|
| 147 |
+
X_Decoder = self.Dropout3(X_Decoder + self.FeedForward (self.LayerNorm3(X_Decoder) ))
|
| 148 |
+
return X_Decoder
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
|
| 152 |
+
|
| 153 |
+
|
| 154 |
+
|
| 155 |
+
|
| 156 |
+
|
| 157 |
+
|
| 158 |
+
|
| 159 |
+
|
| 160 |
+
|
| 161 |
+
|
| 162 |
+
|
| 163 |
+
|
| 164 |
+
|
| 165 |
+
|
| 166 |
+
|
| 167 |
+
|
| 168 |
+
class Model(nn.Module):
|
| 169 |
+
def __init__(self, config):
|
| 170 |
+
super().__init__()
|
| 171 |
+
# Varables
|
| 172 |
+
self.Dim_Attention = config[varables.DIM_ATTENTION]
|
| 173 |
+
self.Token_Padding_Encoder = config["Token_Padding_Encoder"]
|
| 174 |
+
self.Token_Padding_Decoder = config["Token_Padding_Decoder"]
|
| 175 |
+
# Embedding and positional encoding layers
|
| 176 |
+
self.Embedding_Encoder = nn.Embedding(len(config["vocab_encoder"]), config[varables.DIM_ATTENTION])
|
| 177 |
+
self.Embedding_Decoder = nn.Embedding(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION])
|
| 178 |
+
self.pos_emb = PositionalEncoder(config)
|
| 179 |
+
# Dropout and normalization layers
|
| 180 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 181 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 182 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 183 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 184 |
+
# Transformer layers
|
| 185 |
+
self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 186 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 187 |
+
# Output layer
|
| 188 |
+
self.head = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]), bias=False)
|
| 189 |
+
# Init
|
| 190 |
+
self.apply(self._init_weights)
|
| 191 |
+
self.optimizer = None
|
| 192 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 193 |
+
|
| 194 |
+
def _init_weights(self, module):
|
| 195 |
+
for p in module.parameters():
|
| 196 |
+
if p.dim() > 1:
|
| 197 |
+
nn.init.xavier_uniform_(p)
|
| 198 |
+
# if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 199 |
+
# module.weight.data.normal_(mean=0.0, std=0.02)
|
| 200 |
+
# if isinstance(module, nn.Linear) and module.bias is not None:
|
| 201 |
+
# module.bias.data.zero_()
|
| 202 |
+
# elif isinstance(module, nn.LayerNorm):
|
| 203 |
+
# module.bias.data.zero_()
|
| 204 |
+
# module.weight.data.fill_(1.0)
|
| 205 |
+
def init_optimizers(self,train_config):
|
| 206 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 207 |
+
return optimizer
|
| 208 |
+
def init_scheduler(self,train_config):
|
| 209 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 210 |
+
return scheduler
|
| 211 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 212 |
+
def collate(results):
|
| 213 |
+
X_Encoder = [a[0] for a in results]
|
| 214 |
+
X_Decoder = [a[1] for a in results]
|
| 215 |
+
boundary = -1
|
| 216 |
+
max_len_x = max([len(a) for a in X_Encoder])
|
| 217 |
+
max_len_y = max([len(a) for a in X_Decoder])
|
| 218 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in X_Encoder],dtype=torch.long)
|
| 219 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in X_Decoder],dtype=torch.long)
|
| 220 |
+
return x,y,boundary
|
| 221 |
+
return collate
|
| 222 |
+
|
| 223 |
+
|
| 224 |
+
def generate_masks(self,X_Encoder, X_Decoder):
|
| 225 |
+
# Generate encoder, decoder, cross masks
|
| 226 |
+
T = X_Decoder.shape[1]
|
| 227 |
+
Mask_Encoder = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).unsqueeze(-2)
|
| 228 |
+
Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).unsqueeze(-2).repeat(1,1,T,1)
|
| 229 |
+
Mask_Cross = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).unsqueeze(-2)
|
| 230 |
+
mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T).to(Mask_Decoder.device)
|
| 231 |
+
Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 232 |
+
return Mask_Encoder,Mask_Decoder,Mask_Cross
|
| 233 |
+
|
| 234 |
+
def forward(self, X_Encoder, X_Decoder, Y_Decoder_Ref=None,boundary=None):
|
| 235 |
+
Mask_Encoder, Mask_Decoder,Mask_Cross = self.generate_masks(X_Encoder, X_Decoder)
|
| 236 |
+
# preprocess
|
| 237 |
+
X_Encoder = self.Dropout1(self.Embedding_Encoder(X_Encoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Encoder.size(1)))
|
| 238 |
+
X_Decoder = self.Dropout2(self.Embedding_Decoder(X_Decoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Decoder.size(1)))
|
| 239 |
+
#### Now X_Encoder: BatchSize, SequenceLength, DimAttention
|
| 240 |
+
# Encoder blocks
|
| 241 |
+
for encoder_block in self.encoder_blocks:
|
| 242 |
+
X_Encoder = encoder_block(X_Encoder,Mask_Encoder)
|
| 243 |
+
X_Encoder = self.LayerNorm1(X_Encoder)
|
| 244 |
+
# Decoder blocks
|
| 245 |
+
for decoder_block in self.decoder_blocks:
|
| 246 |
+
X_Decoder = decoder_block(X_Encoder,X_Decoder,Mask_Cross,Mask_Decoder)
|
| 247 |
+
X_Decoder = self.LayerNorm2(X_Decoder)
|
| 248 |
+
Y_Decoder_Logits = self.head(X_Decoder)
|
| 249 |
+
loss = None
|
| 250 |
+
if Y_Decoder_Ref is not None:
|
| 251 |
+
loss = F.cross_entropy(Y_Decoder_Logits.view(-1, Y_Decoder_Logits.size(-1)), Y_Decoder_Ref.view(-1),ignore_index=self.Token_Padding_Decoder)
|
| 252 |
+
return Y_Decoder_Logits, loss
|
| 253 |
+
|
| 254 |
+
|
| 255 |
+
|
| 256 |
+
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
|
| 260 |
+
|
| 261 |
+
|
| 262 |
+
|
| 263 |
+
|
| 264 |
+
|
| 265 |
+
# def generate_masks(self,X_Encoder, X_Decoder):
|
| 266 |
+
# # Generate encoder, decoder, cross masks
|
| 267 |
+
# Mask_Encoder = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).int().cpu()
|
| 268 |
+
# Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).int().cpu()
|
| 269 |
+
# Mask_Cross = Mask_Decoder.unsqueeze(-1) @ Mask_Encoder.unsqueeze(-2)
|
| 270 |
+
# Mask_Encoder = Mask_Encoder.unsqueeze(-1) @ Mask_Encoder.unsqueeze(-2)
|
| 271 |
+
# Mask_Decoder = Mask_Decoder.unsqueeze(-1) @ Mask_Decoder.unsqueeze(-2)
|
| 272 |
+
# T = X_Decoder.shape[1]
|
| 273 |
+
# mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T)
|
| 274 |
+
# Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 275 |
+
# Mask_Encoder = Mask_Encoder.to(X_Encoder.device)
|
| 276 |
+
# Mask_Decoder = Mask_Decoder.to(X_Decoder.device)
|
| 277 |
+
# Mask_Cross = Mask_Cross.to(X_Encoder.device)
|
| 278 |
+
# return Mask_Encoder,Mask_Decoder,Mask_Cross
|
SCMG/models/Reinvent/sampler.py
ADDED
|
@@ -0,0 +1,85 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import random
|
| 2 |
+
import numpy as np
|
| 3 |
+
import torch
|
| 4 |
+
import torch.nn as nn
|
| 5 |
+
from torch.nn import functional as F
|
| 6 |
+
|
| 7 |
+
def set_seed(seed):
|
| 8 |
+
random.seed(seed)
|
| 9 |
+
np.random.seed(seed)
|
| 10 |
+
torch.manual_seed(seed)
|
| 11 |
+
torch.cuda.manual_seed_all(seed)
|
| 12 |
+
|
| 13 |
+
def top_k_logits(logits, k):
|
| 14 |
+
v, ix = torch.topk(logits, k)
|
| 15 |
+
out = logits.clone()
|
| 16 |
+
out[out < v[:, [-1]]] = -float('Inf')
|
| 17 |
+
return out
|
| 18 |
+
|
| 19 |
+
@torch.no_grad()
|
| 20 |
+
def sample(model, x, steps, temperature=1.0, sample=False, top_k=None):
|
| 21 |
+
block_size = model.get_block_size()
|
| 22 |
+
model.eval()
|
| 23 |
+
for k in range(steps):
|
| 24 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 25 |
+
logits, _ = model(x_cond)
|
| 26 |
+
logits = logits[:, -1, :] / temperature
|
| 27 |
+
if top_k is not None:
|
| 28 |
+
logits = top_k_logits(logits, top_k)
|
| 29 |
+
probs = F.softmax(logits, dim=-1)
|
| 30 |
+
if sample:
|
| 31 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 32 |
+
else:
|
| 33 |
+
_, ix = torch.topk(probs, k=1, dim=-1)
|
| 34 |
+
x = torch.cat((x, ix), dim=1)
|
| 35 |
+
|
| 36 |
+
return x
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
@torch.no_grad()
|
| 42 |
+
def sample(model, x, steps, temperature=1.0,boundary=None):
|
| 43 |
+
block_size = model.get_block_size()
|
| 44 |
+
model.eval()
|
| 45 |
+
for k in range(steps):
|
| 46 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 47 |
+
logits, _ = model(x_cond,boundary=boundary)
|
| 48 |
+
logits = logits[:, -1, :] / temperature
|
| 49 |
+
probs = F.softmax(logits, dim=-1)
|
| 50 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 51 |
+
x = torch.cat((x, ix), dim=1)
|
| 52 |
+
return x
|
| 53 |
+
|
| 54 |
+
'L_5*C(=O)NCc1cccc(OC)c1.*c1nsc2ccccc12COc1cccc(CNC(=O)c2cccc(NC(=O)c3nsc4ccccc34)c2)c1'
|
| 55 |
+
|
| 56 |
+
# for i in range(1,21):
|
| 57 |
+
def sample_L(i,option='string'):
|
| 58 |
+
# i=2
|
| 59 |
+
prefix = 'L_'+str(i)
|
| 60 |
+
string_input = prefix + '*O=C1NN=Cc2c1cccc2.*O=C(C1CC1)N1CCNCC1'
|
| 61 |
+
array_input = [vocab[a] for a in ['<bos>'] + list(string_input)]
|
| 62 |
+
boundary = [len(array_input)]
|
| 63 |
+
tensor_input = torch.tensor(array_input,device='cuda').unsqueeze(0).repeat(32,1)
|
| 64 |
+
boundary = boundary*32
|
| 65 |
+
tensor_output = sample(model,tensor_input,250,boundary=boundary)
|
| 66 |
+
strings_output = []
|
| 67 |
+
for j in range(tensor_output.shape[0]):
|
| 68 |
+
list_string_output = [inv[a] for a in tensor_output[j,boundary[j]:].cpu().numpy() if a != vocab['<pad>']]
|
| 69 |
+
# if list_string_output[0] == '<bos>':
|
| 70 |
+
# list_string_output = list_string_output[1:]
|
| 71 |
+
if list_string_output[-1] == '<eos>':
|
| 72 |
+
list_string_output = list_string_output[:-1]
|
| 73 |
+
string_output = ''.join(list_string_output)
|
| 74 |
+
strings_output.append(string_output)
|
| 75 |
+
print(string_output)
|
| 76 |
+
for j in range(tensor_output.shape[0]):
|
| 77 |
+
if test_valid(strings_output[j]):
|
| 78 |
+
print(1)
|
| 79 |
+
else:
|
| 80 |
+
print(0)
|
| 81 |
+
|
| 82 |
+
# logits,_ = model(tensor_input,boundary=boundary)
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
['<bos>', 'L', '_', '5', '*', 'C', '(', '=', 'O', ')', 'N', 'C', 'c', '1', 'c', 'c', 'c', 'c', '(', 'O', 'C', ')', 'c', '1', '.', '*', 'c', '1', 'n', 's', 'c', '2', 'c', 'c', 'c', 'c', 'c', '1', '2', 'C', 'O', 'c', '1', 'c', 'c', 'c', 'c', '(', 'C', 'N', 'C', '(', '=', 'O', ')', 'c', '2', 'c', 'c', 'c', 'c', '(', 'N', 'C', '(', '=', 'O', ')', 'c', '3', 'n', 's', 'c', '4', 'c', 'c', 'c', 'c', 'c', '3', '4', ')', 'c', '2', ')', 'c', '1', '<eos>']
|
SCMG/models/Reinvent_Scaffold_Decorator/__init__.py
ADDED
|
File without changes
|
SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (196 Bytes). View file
|
|
|
SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/model copy 2.cpython-310.pyc
ADDED
|
Binary file (14.4 kB). View file
|
|
|
SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/model copy.cpython-310.pyc
ADDED
|
Binary file (8.41 kB). View file
|
|
|
SCMG/models/Reinvent_Scaffold_Decorator/__pycache__/sampler.cpython-310.pyc
ADDED
|
Binary file (3.19 kB). View file
|
|
|
SCMG/models/Reinvent_Scaffold_Decorator/model copy 2.py
ADDED
|
@@ -0,0 +1,420 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
|
| 11 |
+
# class ModelConfig():
|
| 12 |
+
# rate_dropout_embedding = 0.1
|
| 13 |
+
# rate_dropout_residue = 0.1
|
| 14 |
+
# rate_dropout_attention = 0.1
|
| 15 |
+
# block_size=125
|
| 16 |
+
# def __init__(self, size_vocab, **kwargs):
|
| 17 |
+
# self.size_vocab = size_vocab
|
| 18 |
+
# for k,v in kwargs.items():
|
| 19 |
+
# setattr(self, k, v)
|
| 20 |
+
|
| 21 |
+
class CausalSelfAttention(nn.Module):
|
| 22 |
+
def __init__(self, config):
|
| 23 |
+
super().__init__()
|
| 24 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 25 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 26 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 27 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 28 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 29 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 30 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 31 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 32 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 33 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 34 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 35 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 36 |
+
|
| 37 |
+
def forward(self, x, layer_past=None):
|
| 38 |
+
B, T, C = x.size()
|
| 39 |
+
k = self.key(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 40 |
+
q = self.query(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 41 |
+
v = self.value(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 42 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 43 |
+
att = att.masked_fill(self.mask[:,:,:T,:T] == 0, float('-inf'))
|
| 44 |
+
att = F.softmax(att, dim=-1)
|
| 45 |
+
att = self.dropout_attention(att)
|
| 46 |
+
y = att @ v
|
| 47 |
+
y = y.transpose(1, 2).contiguous().view(B, T, self.attention_features)
|
| 48 |
+
y = self.dropout_residue(self.projection(y))
|
| 49 |
+
return y
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
class CrossAttention(nn.Module):
|
| 53 |
+
def __init__(self, config):
|
| 54 |
+
super().__init__()
|
| 55 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 56 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 57 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 58 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 59 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 60 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 61 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 62 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 63 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 64 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 65 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 66 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 67 |
+
|
| 68 |
+
def forward(self, x_encoder,x_decoder, layer_past=None):
|
| 69 |
+
B_encoder, T_encoder, C_encoder = x_encoder.size()
|
| 70 |
+
B_decoder, T_decoder, C_decoder = x_decoder.size()
|
| 71 |
+
k = self.key( x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 72 |
+
q = self.query(x_decoder).view(B_encoder, T_decoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 73 |
+
v = self.value(x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 74 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 75 |
+
att = att.masked_fill(self.mask[:,:,:T_decoder,:T_encoder] == 0, float('-inf'))
|
| 76 |
+
att = F.softmax(att, dim=-1)
|
| 77 |
+
att = self.dropout_attention(att)
|
| 78 |
+
y = att @ v
|
| 79 |
+
y = y.transpose(1, 2).contiguous().view(B_encoder, T_decoder, self.attention_features)
|
| 80 |
+
y = self.dropout_residue(self.projection(y))
|
| 81 |
+
return y
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
class EncoderBlock(nn.Module):
|
| 87 |
+
def __init__(self, config):
|
| 88 |
+
super().__init__()
|
| 89 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 90 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 91 |
+
self.attn = CausalSelfAttention(config)
|
| 92 |
+
self.mlp = nn.Sequential(
|
| 93 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 94 |
+
nn.GELU(),
|
| 95 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 96 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 97 |
+
)
|
| 98 |
+
|
| 99 |
+
def forward(self, x):
|
| 100 |
+
# = y_input
|
| 101 |
+
x = x + self.attn(self.ln1(x))
|
| 102 |
+
x = x + self.mlp(self.ln2(x))
|
| 103 |
+
return x
|
| 104 |
+
|
| 105 |
+
class DecoderBlock(nn.Module):
|
| 106 |
+
def __init__(self, config):
|
| 107 |
+
super().__init__()
|
| 108 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 109 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 110 |
+
self.masked_attn = CausalSelfAttention(config)
|
| 111 |
+
self.cross_attn = CrossAttention(config)
|
| 112 |
+
self.mlp = nn.Sequential(
|
| 113 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 114 |
+
nn.GELU(),
|
| 115 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 116 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 117 |
+
)
|
| 118 |
+
|
| 119 |
+
def forward(self, x_encoder,x):
|
| 120 |
+
# = y_input
|
| 121 |
+
x = x + self.masked_attn(self.ln1(x))
|
| 122 |
+
x = x + self.cross_attn(x_encoder,self.ln1(x))
|
| 123 |
+
x = x + self.mlp(self.ln2(x))
|
| 124 |
+
return x
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
|
| 130 |
+
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
|
| 134 |
+
|
| 135 |
+
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
|
| 142 |
+
import torch
|
| 143 |
+
import torch.nn as nn
|
| 144 |
+
import torch.nn.functional as F
|
| 145 |
+
import math
|
| 146 |
+
|
| 147 |
+
|
| 148 |
+
class Norm(nn.Module):
|
| 149 |
+
def __init__(self, d_model, eps = 1e-6):
|
| 150 |
+
super().__init__()
|
| 151 |
+
|
| 152 |
+
self.size = d_model
|
| 153 |
+
|
| 154 |
+
# create two learnable parameters to calibrate normalisation
|
| 155 |
+
self.alpha = nn.Parameter(torch.ones(self.size))
|
| 156 |
+
self.bias = nn.Parameter(torch.zeros(self.size))
|
| 157 |
+
|
| 158 |
+
self.eps = eps
|
| 159 |
+
|
| 160 |
+
def forward(self, x):
|
| 161 |
+
norm = self.alpha * (x - x.mean(dim=-1, keepdim=True)) \
|
| 162 |
+
/ (x.std(dim=-1, keepdim=True) + self.eps) + self.bias
|
| 163 |
+
return norm
|
| 164 |
+
|
| 165 |
+
def attention(q, k, v, d_k, mask=None, dropout=None):
|
| 166 |
+
|
| 167 |
+
scores = torch.matmul(q, k.transpose(-2, -1)) / math.sqrt(d_k)
|
| 168 |
+
|
| 169 |
+
if mask is not None:
|
| 170 |
+
mask = mask.unsqueeze(1)
|
| 171 |
+
scores = scores.masked_fill(mask == 0, -1e9)
|
| 172 |
+
|
| 173 |
+
scores = F.softmax(scores, dim=-1)
|
| 174 |
+
|
| 175 |
+
if dropout is not None:
|
| 176 |
+
scores = dropout(scores)
|
| 177 |
+
|
| 178 |
+
output = torch.matmul(scores, v)
|
| 179 |
+
return output
|
| 180 |
+
|
| 181 |
+
class MultiHeadAttention(nn.Module):
|
| 182 |
+
def __init__(self, heads, d_model, dropout = 0.1):
|
| 183 |
+
super().__init__()
|
| 184 |
+
|
| 185 |
+
self.d_model = d_model
|
| 186 |
+
self.d_k = d_model // heads
|
| 187 |
+
self.h = heads
|
| 188 |
+
|
| 189 |
+
self.q_linear = nn.Linear(d_model, d_model)
|
| 190 |
+
self.v_linear = nn.Linear(d_model, d_model)
|
| 191 |
+
self.k_linear = nn.Linear(d_model, d_model)
|
| 192 |
+
|
| 193 |
+
self.dropout = nn.Dropout(dropout)
|
| 194 |
+
self.out = nn.Linear(d_model, d_model)
|
| 195 |
+
|
| 196 |
+
def forward(self, q, k, v, mask=None):
|
| 197 |
+
|
| 198 |
+
bs = q.size(0)
|
| 199 |
+
|
| 200 |
+
# perform linear operation and split into N heads
|
| 201 |
+
k = self.k_linear(k).view(bs, -1, self.h, self.d_k)
|
| 202 |
+
q = self.q_linear(q).view(bs, -1, self.h, self.d_k)
|
| 203 |
+
v = self.v_linear(v).view(bs, -1, self.h, self.d_k)
|
| 204 |
+
|
| 205 |
+
# transpose to get dimensions bs * N * sl * d_model
|
| 206 |
+
k = k.transpose(1,2)
|
| 207 |
+
q = q.transpose(1,2)
|
| 208 |
+
v = v.transpose(1,2)
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
# calculate attention using function we will define next
|
| 212 |
+
scores = attention(q, k, v, self.d_k, mask, self.dropout)
|
| 213 |
+
# concatenate heads and put through final linear layer
|
| 214 |
+
concat = scores.transpose(1,2).contiguous()\
|
| 215 |
+
.view(bs, -1, self.d_model)
|
| 216 |
+
output = self.out(concat)
|
| 217 |
+
|
| 218 |
+
return output
|
| 219 |
+
|
| 220 |
+
class FeedForward(nn.Module):
|
| 221 |
+
def __init__(self, d_model, d_ff=2048, dropout = 0.1):
|
| 222 |
+
super().__init__()
|
| 223 |
+
|
| 224 |
+
# We set d_ff as a default to 2048
|
| 225 |
+
self.linear_1 = nn.Linear(d_model, d_ff)
|
| 226 |
+
self.dropout = nn.Dropout(dropout)
|
| 227 |
+
self.linear_2 = nn.Linear(d_ff, d_model)
|
| 228 |
+
|
| 229 |
+
def forward(self, x):
|
| 230 |
+
x = self.dropout(F.relu(self.linear_1(x)))
|
| 231 |
+
x = self.linear_2(x)
|
| 232 |
+
return x
|
| 233 |
+
|
| 234 |
+
|
| 235 |
+
|
| 236 |
+
|
| 237 |
+
import torch
|
| 238 |
+
import torch.nn as nn
|
| 239 |
+
import copy
|
| 240 |
+
|
| 241 |
+
|
| 242 |
+
class EncoderLayer(nn.Module):
|
| 243 |
+
def __init__(self, d_model, heads, dropout=0.1):
|
| 244 |
+
super().__init__()
|
| 245 |
+
self.norm_1 = Norm(d_model)
|
| 246 |
+
self.norm_2 = Norm(d_model)
|
| 247 |
+
self.attn = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 248 |
+
self.ff = FeedForward(d_model, dropout=dropout)
|
| 249 |
+
self.dropout_1 = nn.Dropout(dropout)
|
| 250 |
+
self.dropout_2 = nn.Dropout(dropout)
|
| 251 |
+
|
| 252 |
+
def forward(self, x, mask):
|
| 253 |
+
x2 = self.norm_1(x)
|
| 254 |
+
x = x + self.dropout_1(self.attn(x2,x2,x2,mask))
|
| 255 |
+
x2 = self.norm_2(x)
|
| 256 |
+
x = x + self.dropout_2(self.ff(x2))
|
| 257 |
+
return x
|
| 258 |
+
|
| 259 |
+
# build a decoder layer with two multi-head attention layers and
|
| 260 |
+
# one feed-forward layer
|
| 261 |
+
class DecoderLayer(nn.Module):
|
| 262 |
+
def __init__(self, d_model, heads, dropout=0.1):
|
| 263 |
+
super().__init__()
|
| 264 |
+
self.norm_1 = Norm(d_model)
|
| 265 |
+
self.norm_2 = Norm(d_model)
|
| 266 |
+
self.norm_3 = Norm(d_model)
|
| 267 |
+
|
| 268 |
+
self.dropout_1 = nn.Dropout(dropout)
|
| 269 |
+
self.dropout_2 = nn.Dropout(dropout)
|
| 270 |
+
self.dropout_3 = nn.Dropout(dropout)
|
| 271 |
+
|
| 272 |
+
self.attn_1 = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 273 |
+
self.attn_2 = MultiHeadAttention(heads, d_model, dropout=dropout)
|
| 274 |
+
self.ff = FeedForward(d_model, dropout=dropout)
|
| 275 |
+
|
| 276 |
+
def forward(self, x, e_outputs, src_mask, trg_mask):
|
| 277 |
+
x2 = self.norm_1(x)
|
| 278 |
+
x = x + self.dropout_1(self.attn_1(x2, x2, x2, trg_mask))
|
| 279 |
+
x2 = self.norm_2(x)
|
| 280 |
+
x = x + self.dropout_2(self.attn_2(x2, e_outputs, e_outputs, \
|
| 281 |
+
src_mask))
|
| 282 |
+
x2 = self.norm_3(x)
|
| 283 |
+
x = x + self.dropout_3(self.ff(x2))
|
| 284 |
+
return x
|
| 285 |
+
|
| 286 |
+
|
| 287 |
+
import torch
|
| 288 |
+
import torch.nn as nn
|
| 289 |
+
import math
|
| 290 |
+
from torch.autograd import Variable
|
| 291 |
+
|
| 292 |
+
class Embedder(nn.Module):
|
| 293 |
+
def __init__(self, vocab_size, d_model):
|
| 294 |
+
super().__init__()
|
| 295 |
+
self.d_model = d_model
|
| 296 |
+
self.embed = nn.Embedding(vocab_size, d_model)
|
| 297 |
+
def forward(self, x):
|
| 298 |
+
return self.embed(x)
|
| 299 |
+
|
| 300 |
+
class PositionalEncoder(nn.Module):
|
| 301 |
+
def __init__(self, d_model, max_seq_len = 200, dropout = 0.1):
|
| 302 |
+
super().__init__()
|
| 303 |
+
self.d_model = d_model
|
| 304 |
+
self.dropout = nn.Dropout(dropout)
|
| 305 |
+
# create constant 'pe' matrix with values dependant on
|
| 306 |
+
# pos and i
|
| 307 |
+
pe = torch.zeros(max_seq_len, d_model)
|
| 308 |
+
for pos in range(max_seq_len):
|
| 309 |
+
for i in range(0, d_model, 2):
|
| 310 |
+
pe[pos, i] = \
|
| 311 |
+
math.sin(pos / (10000 ** ((2 * i)/d_model)))
|
| 312 |
+
pe[pos, i + 1] = \
|
| 313 |
+
math.cos(pos / (10000 ** ((2 * (i + 1))/d_model)))
|
| 314 |
+
pe = pe.unsqueeze(0)
|
| 315 |
+
self.register_buffer('pe', pe)
|
| 316 |
+
|
| 317 |
+
|
| 318 |
+
def forward(self, x):
|
| 319 |
+
# make embeddings relatively larger
|
| 320 |
+
x = x * math.sqrt(self.d_model)
|
| 321 |
+
#add constant to embedding
|
| 322 |
+
seq_len = x.size(1)
|
| 323 |
+
pe = Variable(self.pe[:,:seq_len], requires_grad=False)
|
| 324 |
+
if x.is_cuda:
|
| 325 |
+
pe.cuda()
|
| 326 |
+
x = x + pe
|
| 327 |
+
return self.dropout(x)
|
| 328 |
+
|
| 329 |
+
def get_clones(module, N):
|
| 330 |
+
return nn.ModuleList([copy.deepcopy(module) for i in range(N)])
|
| 331 |
+
|
| 332 |
+
class Encoder(nn.Module):
|
| 333 |
+
def __init__(self, vocab_size, d_model, N, heads, dropout):
|
| 334 |
+
super().__init__()
|
| 335 |
+
self.N = N
|
| 336 |
+
self.embed = Embedder(vocab_size, d_model)
|
| 337 |
+
self.pe = PositionalEncoder(d_model, dropout=dropout)
|
| 338 |
+
self.layers = get_clones(EncoderLayer(d_model, heads, dropout), N)
|
| 339 |
+
self.norm = Norm(d_model)
|
| 340 |
+
def forward(self, src, mask):
|
| 341 |
+
x = self.embed(src)
|
| 342 |
+
x = self.pe(x)
|
| 343 |
+
for i in range(self.N):
|
| 344 |
+
x = self.layers[i](x, mask)
|
| 345 |
+
return self.norm(x)
|
| 346 |
+
|
| 347 |
+
class Decoder(nn.Module):
|
| 348 |
+
def __init__(self, vocab_size, d_model, N, heads, dropout):
|
| 349 |
+
super().__init__()
|
| 350 |
+
self.N = N
|
| 351 |
+
self.embed = Embedder(vocab_size, d_model)
|
| 352 |
+
self.pe = PositionalEncoder(d_model, dropout=dropout)
|
| 353 |
+
self.layers = get_clones(DecoderLayer(d_model, heads, dropout), N)
|
| 354 |
+
self.norm = Norm(d_model)
|
| 355 |
+
def forward(self, trg, e_outputs, src_mask, trg_mask):
|
| 356 |
+
x = self.embed(trg)
|
| 357 |
+
x = self.pe(x)
|
| 358 |
+
for i in range(self.N):
|
| 359 |
+
x = self.layers[i](x, e_outputs, src_mask, trg_mask)
|
| 360 |
+
return self.norm(x)
|
| 361 |
+
|
| 362 |
+
class Model(nn.Module):
|
| 363 |
+
def __init__(self, config):
|
| 364 |
+
super().__init__()
|
| 365 |
+
self.encoder = Encoder(len(config["vocab_encoder"]), config[varables.DIM_ATTENTION], config[varables.NUM_LAYERS], config[varables.NUM_HEADS], config[varables.RATE_DROPOUT])
|
| 366 |
+
self.decoder = Decoder(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION], config[varables.NUM_LAYERS], config[varables.NUM_HEADS], config[varables.RATE_DROPOUT])
|
| 367 |
+
self.out = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]))
|
| 368 |
+
# self.tok_emb = nn.Embedding(config[varables.SIZE_VOCAB], config[varables.DIM_EMBEDDING])
|
| 369 |
+
# self.pos_emb = nn.Parameter(torch.zeros(1, config[varables.SIZE_BLOCK], config[varables.DIM_EMBEDDING]))
|
| 370 |
+
# self.drop = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 371 |
+
# self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 372 |
+
# self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 373 |
+
# self.blocks = nn.Sequential(*[DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 374 |
+
# self.ln_f = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 375 |
+
# self.head = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.SIZE_VOCAB], bias=False)
|
| 376 |
+
# self.block_size = config[varables.SIZE_BLOCK]
|
| 377 |
+
# self.apply(self._init_weights)
|
| 378 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 379 |
+
self.optimizer = None
|
| 380 |
+
|
| 381 |
+
def get_block_size(self):
|
| 382 |
+
return self.block_size
|
| 383 |
+
|
| 384 |
+
def _init_weights(self, module):
|
| 385 |
+
if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 386 |
+
module.weight.data.normal_(mean=0.0, std=0.02)
|
| 387 |
+
if isinstance(module, nn.Linear) and module.bias is not None:
|
| 388 |
+
module.bias.data.zero_()
|
| 389 |
+
elif isinstance(module, nn.LayerNorm):
|
| 390 |
+
module.bias.data.zero_()
|
| 391 |
+
module.weight.data.fill_(1.0)
|
| 392 |
+
def init_optimizers(self,train_config):
|
| 393 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 394 |
+
return optimizer
|
| 395 |
+
def init_scheduler(self,train_config):
|
| 396 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 397 |
+
return scheduler
|
| 398 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 399 |
+
def collate(results):
|
| 400 |
+
x_in = [a[0] for a in results]
|
| 401 |
+
y_in = [a[1] for a in results]
|
| 402 |
+
boundary = -1
|
| 403 |
+
max_len_x = max([len(a) for a in x_in])
|
| 404 |
+
max_len_y = max([len(a) for a in y_in])
|
| 405 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in x_in],dtype=torch.long)
|
| 406 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in y_in],dtype=torch.long)
|
| 407 |
+
return x,y,boundary
|
| 408 |
+
return collate
|
| 409 |
+
def forward(self, src, trg, trg_out, boundary=None):
|
| 410 |
+
src_mask = None
|
| 411 |
+
trg_mask = torch.tril(torch.ones(trg.shape[1], trg.shape[1])).view(1, 1, trg.shape[1], trg.shape[1]).to(trg.device)
|
| 412 |
+
e_outputs = self.encoder(src, src_mask)
|
| 413 |
+
d_output = self.decoder(trg, e_outputs, src_mask, trg_mask)
|
| 414 |
+
logits = self.out(d_output)
|
| 415 |
+
loss = None
|
| 416 |
+
if trg_out is not None:
|
| 417 |
+
loss = F.cross_entropy(logits.view(-1, logits.size(-1)), trg_out.view(-1))
|
| 418 |
+
return logits, loss
|
| 419 |
+
|
| 420 |
+
# mark test
|
SCMG/models/Reinvent_Scaffold_Decorator/model copy.py
ADDED
|
@@ -0,0 +1,187 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import math
|
| 2 |
+
import logging
|
| 3 |
+
|
| 4 |
+
import torch
|
| 5 |
+
import torch.nn as nn
|
| 6 |
+
from torch.nn import functional as F
|
| 7 |
+
|
| 8 |
+
logger = logging.getLogger(__name__)
|
| 9 |
+
from SCMG.config import varables
|
| 10 |
+
|
| 11 |
+
# class ModelConfig():
|
| 12 |
+
# rate_dropout_embedding = 0.1
|
| 13 |
+
# rate_dropout_residue = 0.1
|
| 14 |
+
# rate_dropout_attention = 0.1
|
| 15 |
+
# block_size=125
|
| 16 |
+
# def __init__(self, size_vocab, **kwargs):
|
| 17 |
+
# self.size_vocab = size_vocab
|
| 18 |
+
# for k,v in kwargs.items():
|
| 19 |
+
# setattr(self, k, v)
|
| 20 |
+
|
| 21 |
+
class CausalSelfAttention(nn.Module):
|
| 22 |
+
def __init__(self, config):
|
| 23 |
+
super().__init__()
|
| 24 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 25 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 26 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 27 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 28 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 29 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 30 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 31 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 32 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 33 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 34 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 35 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 36 |
+
|
| 37 |
+
def forward(self, x, layer_past=None):
|
| 38 |
+
B, T, C = x.size()
|
| 39 |
+
k = self.key(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 40 |
+
q = self.query(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 41 |
+
v = self.value(x).view(B, T, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 42 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 43 |
+
att = att.masked_fill(self.mask[:,:,:T,:T] == 0, float('-inf'))
|
| 44 |
+
att = F.softmax(att, dim=-1)
|
| 45 |
+
att = self.dropout_attention(att)
|
| 46 |
+
y = att @ v
|
| 47 |
+
y = y.transpose(1, 2).contiguous().view(B, T, self.attention_features)
|
| 48 |
+
y = self.dropout_residue(self.projection(y))
|
| 49 |
+
return y
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
class CrossAttention(nn.Module):
|
| 53 |
+
def __init__(self, config):
|
| 54 |
+
super().__init__()
|
| 55 |
+
assert config[varables.DIM_ATTENTION] % config[varables.NUM_HEADS] == 0
|
| 56 |
+
self.key = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 57 |
+
self.query = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 58 |
+
self.value = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_ATTENTION])
|
| 59 |
+
self.dropout_attention = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 60 |
+
self.dropout_residue = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 61 |
+
self.projection = nn.Linear(config[varables.DIM_ATTENTION], config[varables.DIM_EMBEDDING])
|
| 62 |
+
self.n_head = config[varables.NUM_HEADS]
|
| 63 |
+
self.single_head_dim = config[varables.DIM_ATTENTION] // self.n_head
|
| 64 |
+
self.attention_features = config[varables.DIM_ATTENTION]
|
| 65 |
+
self.register_buffer("mask", torch.tril(torch.ones(config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 66 |
+
.view(1, 1, config[varables.SIZE_BLOCK], config[varables.SIZE_BLOCK]))
|
| 67 |
+
|
| 68 |
+
def forward(self, x_encoder,x_decoder, layer_past=None):
|
| 69 |
+
B_encoder, T_encoder, C_encoder = x_encoder.size()
|
| 70 |
+
B_decoder, T_decoder, C_decoder = x_decoder.size()
|
| 71 |
+
k = self.key( x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 72 |
+
q = self.query(x_decoder).view(B_encoder, T_decoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 73 |
+
v = self.value(x_encoder).view(B_encoder, T_encoder, self.n_head,self.single_head_dim).transpose(1, 2)
|
| 74 |
+
att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
|
| 75 |
+
att = att.masked_fill(self.mask[:,:,:T_decoder,:T_encoder] == 0, float('-inf'))
|
| 76 |
+
att = F.softmax(att, dim=-1)
|
| 77 |
+
att = self.dropout_attention(att)
|
| 78 |
+
y = att @ v
|
| 79 |
+
y = y.transpose(1, 2).contiguous().view(B_encoder, T_decoder, self.attention_features)
|
| 80 |
+
y = self.dropout_residue(self.projection(y))
|
| 81 |
+
return y
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
class EncoderBlock(nn.Module):
|
| 87 |
+
def __init__(self, config):
|
| 88 |
+
super().__init__()
|
| 89 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 90 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 91 |
+
self.attn = CausalSelfAttention(config)
|
| 92 |
+
self.mlp = nn.Sequential(
|
| 93 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 94 |
+
nn.GELU(),
|
| 95 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 96 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 97 |
+
)
|
| 98 |
+
|
| 99 |
+
def forward(self, x):
|
| 100 |
+
# = y_input
|
| 101 |
+
x = x + self.attn(self.ln1(x))
|
| 102 |
+
x = x + self.mlp(self.ln2(x))
|
| 103 |
+
return x
|
| 104 |
+
|
| 105 |
+
class DecoderBlock(nn.Module):
|
| 106 |
+
def __init__(self, config):
|
| 107 |
+
super().__init__()
|
| 108 |
+
self.ln1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 109 |
+
self.ln2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 110 |
+
self.masked_attn = CausalSelfAttention(config)
|
| 111 |
+
self.cross_attn = CrossAttention(config)
|
| 112 |
+
self.mlp = nn.Sequential(
|
| 113 |
+
nn.Linear(config[varables.DIM_EMBEDDING], config[varables.DIM_FEEDFORWARD]),
|
| 114 |
+
nn.GELU(),
|
| 115 |
+
nn.Linear(config[varables.DIM_FEEDFORWARD], config[varables.DIM_EMBEDDING]),
|
| 116 |
+
nn.Dropout(config[varables.RATE_DROPOUT]),
|
| 117 |
+
)
|
| 118 |
+
|
| 119 |
+
def forward(self, x_encoder,x):
|
| 120 |
+
# = y_input
|
| 121 |
+
x = x + self.masked_attn(self.ln1(x))
|
| 122 |
+
x = x + self.cross_attn(x_encoder,self.ln1(x))
|
| 123 |
+
x = x + self.mlp(self.ln2(x))
|
| 124 |
+
return x
|
| 125 |
+
|
| 126 |
+
class Model(nn.Module):
|
| 127 |
+
def __init__(self, config):
|
| 128 |
+
super().__init__()
|
| 129 |
+
self.tok_emb = nn.Embedding(config[varables.SIZE_VOCAB], config[varables.DIM_EMBEDDING])
|
| 130 |
+
self.pos_emb = nn.Parameter(torch.zeros(1, config[varables.SIZE_BLOCK], config[varables.DIM_EMBEDDING]))
|
| 131 |
+
self.drop = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 132 |
+
self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 133 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 134 |
+
# self.blocks = nn.Sequential(*[DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 135 |
+
self.ln_f = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 136 |
+
self.head = nn.Linear(config[varables.DIM_EMBEDDING], config[varables.SIZE_VOCAB], bias=False)
|
| 137 |
+
self.block_size = config[varables.SIZE_BLOCK]
|
| 138 |
+
self.apply(self._init_weights)
|
| 139 |
+
logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 140 |
+
self.optimizer = None
|
| 141 |
+
|
| 142 |
+
def get_block_size(self):
|
| 143 |
+
return self.block_size
|
| 144 |
+
|
| 145 |
+
def _init_weights(self, module):
|
| 146 |
+
if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 147 |
+
module.weight.data.normal_(mean=0.0, std=0.02)
|
| 148 |
+
if isinstance(module, nn.Linear) and module.bias is not None:
|
| 149 |
+
module.bias.data.zero_()
|
| 150 |
+
elif isinstance(module, nn.LayerNorm):
|
| 151 |
+
module.bias.data.zero_()
|
| 152 |
+
module.weight.data.fill_(1.0)
|
| 153 |
+
def init_optimizers(self,train_config):
|
| 154 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 155 |
+
return optimizer
|
| 156 |
+
def init_scheduler(self,train_config):
|
| 157 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 158 |
+
return scheduler
|
| 159 |
+
def get_collate_fn(self, vocab):
|
| 160 |
+
def collate(results):
|
| 161 |
+
x_in = [a[0] for a in results]
|
| 162 |
+
y_in = [a[1] for a in results]
|
| 163 |
+
boundary = -1
|
| 164 |
+
max_len_x = max([len(a) for a in x_in])
|
| 165 |
+
max_len_y = max([len(a) for a in y_in])
|
| 166 |
+
x = torch.tensor([(a+[vocab[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in x_in],dtype=torch.long)
|
| 167 |
+
y = torch.tensor([(a+[vocab[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in y_in],dtype=torch.long)
|
| 168 |
+
return x,y,boundary
|
| 169 |
+
return collate
|
| 170 |
+
|
| 171 |
+
def forward(self, x_in, y_in, y_out=None,boundary=None):
|
| 172 |
+
x_in = self.drop(self.tok_emb(x_in) + self.pos_emb[:, :x_in.size()[1], :])
|
| 173 |
+
y_in = self.drop(self.tok_emb(y_in) + self.pos_emb[:, :y_in.size()[1], :])
|
| 174 |
+
#
|
| 175 |
+
for encoder_block in self.encoder_blocks:
|
| 176 |
+
x_in = encoder_block(x_in)
|
| 177 |
+
x_in = self.ln_f(x_in)
|
| 178 |
+
for decoder_block in self.decoder_blocks:
|
| 179 |
+
y_in = decoder_block(x_in,y_in)
|
| 180 |
+
y_in = self.ln_f(y_in)
|
| 181 |
+
logits = self.head(y_in)
|
| 182 |
+
loss = None
|
| 183 |
+
if y_out is not None:
|
| 184 |
+
loss = F.cross_entropy(logits.view(-1, logits.size(-1)), y_out.view(-1))
|
| 185 |
+
return logits, loss
|
| 186 |
+
|
| 187 |
+
# mark test
|
SCMG/models/Reinvent_Scaffold_Decorator/model.py
ADDED
|
@@ -0,0 +1,276 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
Skip to content
|
| 3 |
+
|
| 4 |
+
Why GitHub?
|
| 5 |
+
|
| 6 |
+
Team
|
| 7 |
+
Enterprise
|
| 8 |
+
Explore
|
| 9 |
+
Marketplace
|
| 10 |
+
Pricing
|
| 11 |
+
|
| 12 |
+
Sign in
|
| 13 |
+
Sign up
|
| 14 |
+
undeadpixel /
|
| 15 |
+
reinvent-scaffold-decorator
|
| 16 |
+
Public
|
| 17 |
+
|
| 18 |
+
Code
|
| 19 |
+
Issues 3
|
| 20 |
+
Pull requests
|
| 21 |
+
Actions
|
| 22 |
+
Projects
|
| 23 |
+
Wiki
|
| 24 |
+
Security
|
| 25 |
+
|
| 26 |
+
Insights
|
| 27 |
+
|
| 28 |
+
reinvent-scaffold-decorator/models/model.py /
|
| 29 |
+
Arús-Pous, Josep updated to revised version
|
| 30 |
+
Latest commit 37d0a8a on May 8, 2020
|
| 31 |
+
History
|
| 32 |
+
0 contributors
|
| 33 |
+
136 lines (118 sloc) 5.75 KB
|
| 34 |
+
"""
|
| 35 |
+
Model class.
|
| 36 |
+
"""
|
| 37 |
+
|
| 38 |
+
import torch
|
| 39 |
+
import torch.nn as tnn
|
| 40 |
+
|
| 41 |
+
import models.decorator as mdec
|
| 42 |
+
|
| 43 |
+
|
| 44 |
+
class DecoratorModel:
|
| 45 |
+
|
| 46 |
+
def __init__(self, vocabulary, decorator, max_sequence_length=256, no_cuda=False, mode="train"):
|
| 47 |
+
"""
|
| 48 |
+
Implements the likelihood and sampling functions of the decorator model.
|
| 49 |
+
:param vocabulary: A DecoratorVocabulary instance with the vocabularies of both the encoder and decoder.
|
| 50 |
+
:param network_params: A dict with parameters for the encoder and decoder networks.
|
| 51 |
+
:param decorator: An decorator network instance.
|
| 52 |
+
:param max_sequence_length: Maximium number of tokens allowed to sample.
|
| 53 |
+
:param no_cuda: Forces the model not to use CUDA, even if it is available.
|
| 54 |
+
:param mode: Mode in which the model should be initialized.
|
| 55 |
+
:return:
|
| 56 |
+
"""
|
| 57 |
+
self.vocabulary = vocabulary
|
| 58 |
+
self.max_sequence_length = max_sequence_length
|
| 59 |
+
self.network = decorator
|
| 60 |
+
|
| 61 |
+
if torch.cuda.is_available() and not no_cuda:
|
| 62 |
+
self.network.cuda()
|
| 63 |
+
|
| 64 |
+
self._nll_loss = tnn.NLLLoss(reduction="none", ignore_index=0)
|
| 65 |
+
self.set_mode(mode)
|
| 66 |
+
|
| 67 |
+
@classmethod
|
| 68 |
+
def load_from_file(cls, path, mode="train"):
|
| 69 |
+
"""
|
| 70 |
+
Loads a model from a single file
|
| 71 |
+
:param path: Path to the saved model.
|
| 72 |
+
:param mode: Mode in which the model should be initialized.
|
| 73 |
+
:return: An instance of the RNN.
|
| 74 |
+
"""
|
| 75 |
+
data = torch.load(path)
|
| 76 |
+
|
| 77 |
+
decorator = mdec.Decorator(**data["decorator"]["params"])
|
| 78 |
+
decorator.load_state_dict(data["decorator"]["state"])
|
| 79 |
+
|
| 80 |
+
model = DecoratorModel(
|
| 81 |
+
decorator=decorator,
|
| 82 |
+
mode=mode,
|
| 83 |
+
**data["model"]
|
| 84 |
+
)
|
| 85 |
+
|
| 86 |
+
return model
|
| 87 |
+
|
| 88 |
+
def save(self, path):
|
| 89 |
+
"""
|
| 90 |
+
Saves the model to a file.
|
| 91 |
+
:param path: Path to the file which the model will be saved to.
|
| 92 |
+
"""
|
| 93 |
+
save_dict = {
|
| 94 |
+
'model': {
|
| 95 |
+
'vocabulary': self.vocabulary,
|
| 96 |
+
'max_sequence_length': self.max_sequence_length
|
| 97 |
+
},
|
| 98 |
+
'decorator': {
|
| 99 |
+
'params': self.network.get_params(),
|
| 100 |
+
'state': self.network.state_dict()
|
| 101 |
+
}
|
| 102 |
+
}
|
| 103 |
+
torch.save(save_dict, path)
|
| 104 |
+
|
| 105 |
+
def set_mode(self, mode):
|
| 106 |
+
"""
|
| 107 |
+
Changes the mode of the RNN to training or eval.
|
| 108 |
+
:param mode: Mode to change to (training, eval)
|
| 109 |
+
:return: The model instance.
|
| 110 |
+
"""
|
| 111 |
+
if mode == "sampling" or mode == "eval":
|
| 112 |
+
self.network.eval()
|
| 113 |
+
else:
|
| 114 |
+
self.network.train()
|
| 115 |
+
return self
|
| 116 |
+
|
| 117 |
+
def likelihood(self, scaffold_seqs, scaffold_seq_lengths, decoration_seqs, decoration_seq_lengths, with_attention_weights=False):
|
| 118 |
+
"""
|
| 119 |
+
Retrieves the likelihood of a scaffold and its respective decorations.
|
| 120 |
+
:param scaffold_seqs: (batch, seq) A batch of padded scaffold sequences.
|
| 121 |
+
:param scaffold_seq_lengths: The length of the scaffold sequences (for packing purposes).
|
| 122 |
+
:param decoration_seqs: (batch, seq) A batch of decorator sequences.
|
| 123 |
+
:param decoration_seq_lengths: The length of the decorator sequences (for packing purposes).
|
| 124 |
+
:return: (batch) Log likelihood for each item in the batch.
|
| 125 |
+
"""
|
| 126 |
+
|
| 127 |
+
# NOTE: the decoration_seq_lengths have a - 1 to prevent the end token to be forward-passed.
|
| 128 |
+
logits, attention_weights = self.network(scaffold_seqs, scaffold_seq_lengths, decoration_seqs,
|
| 129 |
+
decoration_seq_lengths - 1) # (batch, seq - 1, voc)
|
| 130 |
+
log_probs = logits.log_softmax(dim=2).transpose(1, 2) # (batch, voc, seq - 1)
|
| 131 |
+
|
| 132 |
+
logits = self._nll_loss(log_probs, decoration_seqs[:, 1:]).sum(dim=1) # (batch)
|
| 133 |
+
if with_attention_weights:
|
| 134 |
+
return logits, attention_weights
|
| 135 |
+
else:
|
| 136 |
+
return logits
|
| 137 |
+
|
| 138 |
+
@torch.no_grad()
|
| 139 |
+
def sample_decorations(self, scaffold_seqs, scaffold_seq_lengths):
|
| 140 |
+
"""
|
| 141 |
+
Samples as many decorations as scaffolds in the tensor.
|
| 142 |
+
:param scaffold_seqs: A tensor with the scaffolds to sample already encoded and padded.
|
| 143 |
+
:param scaffold_seq_lengths: A tensor with the length of the scaffolds.
|
| 144 |
+
:return: An iterator with (scaffold_smi, decoration_smi, nll) triplets.
|
| 145 |
+
"""
|
| 146 |
+
batch_size = scaffold_seqs.size(0)
|
| 147 |
+
input_vector = torch.full(
|
| 148 |
+
(batch_size, 1), self.vocabulary.decoration_vocabulary["^"], dtype=torch.long).cuda() # (batch, 1)
|
| 149 |
+
seq_lengths = torch.ones(batch_size) # (batch)
|
| 150 |
+
encoder_padded_seqs, hidden_states = self.network.forward_encoder(scaffold_seqs, scaffold_seq_lengths)
|
| 151 |
+
nlls = torch.zeros(batch_size).cuda()
|
| 152 |
+
not_finished = torch.ones(batch_size, 1, dtype=torch.long).cuda()
|
| 153 |
+
sequences = []
|
| 154 |
+
for _ in range(self.max_sequence_length - 1):
|
| 155 |
+
logits, hidden_states, _ = self.network.forward_decoder(
|
| 156 |
+
input_vector, seq_lengths, encoder_padded_seqs, hidden_states) # (batch, 1, voc)
|
| 157 |
+
probs = logits.softmax(dim=2).squeeze() # (batch, voc)
|
| 158 |
+
log_probs = logits.log_softmax(dim=2).squeeze() # (batch, voc)
|
| 159 |
+
input_vector = torch.multinomial(probs, 1)*not_finished # (batch, 1)
|
| 160 |
+
sequences.append(input_vector)
|
| 161 |
+
nlls += self._nll_loss(log_probs, input_vector.squeeze())
|
| 162 |
+
not_finished = (input_vector > 1).type(torch.long) # 0 is padding, 1 is end token
|
| 163 |
+
if not_finished.sum() == 0:
|
| 164 |
+
break
|
| 165 |
+
|
| 166 |
+
decoration_smiles = [self.vocabulary.decode_decoration(seq)
|
| 167 |
+
for seq in torch.cat(sequences, 1).data.cpu().numpy()]
|
| 168 |
+
scaffold_smiles = [self.vocabulary.decode_scaffold(seq) for seq in scaffold_seqs.data.cpu().numpy()]
|
| 169 |
+
return zip(scaffold_smiles, decoration_smiles, nlls.data.cpu().numpy().tolist())
|
| 170 |
+
|
| 171 |
+
|
| 172 |
+
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
class Model(nn.Module):
|
| 179 |
+
def __init__(self, config):
|
| 180 |
+
super().__init__()
|
| 181 |
+
# Varables
|
| 182 |
+
self.Dim_Attention = config[varables.DIM_ATTENTION]
|
| 183 |
+
self.Token_Padding_Encoder = config["Token_Padding_Encoder"]
|
| 184 |
+
self.Token_Padding_Decoder = config["Token_Padding_Decoder"]
|
| 185 |
+
# Embedding and positional encoding layers
|
| 186 |
+
self.Embedding_Encoder = nn.Embedding(len(config["vocab_encoder"]), config[varables.DIM_ATTENTION])
|
| 187 |
+
self.Embedding_Decoder = nn.Embedding(len(config["vocab_decoder"]), config[varables.DIM_ATTENTION])
|
| 188 |
+
self.pos_emb = PositionalEncoder(config)
|
| 189 |
+
# Dropout and normalization layers
|
| 190 |
+
self.Dropout1 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 191 |
+
self.Dropout2 = nn.Dropout(config[varables.RATE_DROPOUT])
|
| 192 |
+
self.LayerNorm1 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 193 |
+
self.LayerNorm2 = nn.LayerNorm(config[varables.DIM_EMBEDDING])
|
| 194 |
+
# Transformer layers
|
| 195 |
+
self.encoder_blocks = nn.ModuleList([EncoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 196 |
+
self.decoder_blocks = nn.ModuleList([DecoderBlock(config) for _ in range(config[varables.NUM_LAYERS])])
|
| 197 |
+
# Output layer
|
| 198 |
+
self.head = nn.Linear(config[varables.DIM_ATTENTION], len(config["vocab_decoder"]), bias=False)
|
| 199 |
+
# Init
|
| 200 |
+
self.apply(self._init_weights)
|
| 201 |
+
self.optimizer = None
|
| 202 |
+
# logger.info("number of parameters: %e", sum(p.numel() for p in self.parameters()))
|
| 203 |
+
|
| 204 |
+
def _init_weights(self, module):
|
| 205 |
+
for p in module.parameters():
|
| 206 |
+
if p.dim() > 1:
|
| 207 |
+
nn.init.xavier_uniform_(p)
|
| 208 |
+
# if isinstance(module, (nn.Linear, nn.Embedding)):
|
| 209 |
+
# module.weight.data.normal_(mean=0.0, std=0.02)
|
| 210 |
+
# if isinstance(module, nn.Linear) and module.bias is not None:
|
| 211 |
+
# module.bias.data.zero_()
|
| 212 |
+
# elif isinstance(module, nn.LayerNorm):
|
| 213 |
+
# module.bias.data.zero_()
|
| 214 |
+
# module.weight.data.fill_(1.0)
|
| 215 |
+
def init_optimizers(self,train_config):
|
| 216 |
+
optimizer = torch.optim.Adam(self.parameters(), lr=train_config[varables.RATE_LEARNING])
|
| 217 |
+
return optimizer
|
| 218 |
+
def init_scheduler(self,train_config):
|
| 219 |
+
scheduler = torch.optim.lr_scheduler.StepLR(self.optimizer, step_size=train_config[varables.SIZE_STEP], gamma=train_config[varables.GAMMA])
|
| 220 |
+
return scheduler
|
| 221 |
+
def get_collate_fn(self, vocab_encoder,vocab_decoder):
|
| 222 |
+
def collate(results):
|
| 223 |
+
X_Encoder = [a[0] for a in results]
|
| 224 |
+
X_Decoder = [a[1] for a in results]
|
| 225 |
+
boundary = -1
|
| 226 |
+
max_len_x = max([len(a) for a in X_Encoder])
|
| 227 |
+
max_len_y = max([len(a) for a in X_Decoder])
|
| 228 |
+
x = torch.tensor([(a+[vocab_encoder[varables.TOKEN_PAD]]*(max_len_x-len(a))) for a in X_Encoder],dtype=torch.long)
|
| 229 |
+
y = torch.tensor([(a+[vocab_decoder[varables.TOKEN_PAD]]*(max_len_y-len(a))) for a in X_Decoder],dtype=torch.long)
|
| 230 |
+
return x,y,boundary
|
| 231 |
+
return collate
|
| 232 |
+
|
| 233 |
+
def generate_masks(self,X_Encoder, X_Decoder):
|
| 234 |
+
# Generate encoder, decoder, cross masks
|
| 235 |
+
T = X_Decoder.shape[1]
|
| 236 |
+
Mask_Encoder = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).unsqueeze(-2)
|
| 237 |
+
Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).unsqueeze(-2).repeat(1,1,T,1)
|
| 238 |
+
Mask_Cross = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).unsqueeze(-2)
|
| 239 |
+
mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T).to(Mask_Decoder.device)
|
| 240 |
+
Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 241 |
+
return Mask_Encoder,Mask_Decoder,Mask_Cross
|
| 242 |
+
|
| 243 |
+
def forward(self, X_Encoder, X_Decoder, Y_Decoder_Ref=None,boundary=None):
|
| 244 |
+
Mask_Encoder, Mask_Decoder,Mask_Cross = self.generate_masks(X_Encoder, X_Decoder)
|
| 245 |
+
# preprocess
|
| 246 |
+
X_Encoder = self.Dropout1(self.Embedding_Encoder(X_Encoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Encoder.size(1)))
|
| 247 |
+
X_Decoder = self.Dropout2(self.Embedding_Decoder(X_Decoder) * math.sqrt(self.Dim_Attention) + self.pos_emb(X_Decoder.size(1)))
|
| 248 |
+
#### Now X_Encoder: BatchSize, SequenceLength, DimAttention
|
| 249 |
+
# Encoder blocks
|
| 250 |
+
for encoder_block in self.encoder_blocks:
|
| 251 |
+
X_Encoder = encoder_block(X_Encoder,Mask_Encoder)
|
| 252 |
+
X_Encoder = self.LayerNorm1(X_Encoder)
|
| 253 |
+
# Decoder blocks
|
| 254 |
+
for decoder_block in self.decoder_blocks:
|
| 255 |
+
X_Decoder = decoder_block(X_Encoder,X_Decoder,Mask_Cross,Mask_Decoder)
|
| 256 |
+
X_Decoder = self.LayerNorm2(X_Decoder)
|
| 257 |
+
Y_Decoder_Logits = self.head(X_Decoder)
|
| 258 |
+
loss = None
|
| 259 |
+
if Y_Decoder_Ref is not None:
|
| 260 |
+
loss = F.cross_entropy(Y_Decoder_Logits.view(-1, Y_Decoder_Logits.size(-1)), Y_Decoder_Ref.view(-1),ignore_index=self.Token_Padding_Decoder)
|
| 261 |
+
return Y_Decoder_Logits, loss
|
| 262 |
+
|
| 263 |
+
# def generate_masks(self,X_Encoder, X_Decoder):
|
| 264 |
+
# # Generate encoder, decoder, cross masks
|
| 265 |
+
# Mask_Encoder = (X_Encoder != self.Token_Padding_Encoder).unsqueeze(-2).int().cpu()
|
| 266 |
+
# Mask_Decoder = (X_Decoder != self.Token_Padding_Decoder).unsqueeze(-2).int().cpu()
|
| 267 |
+
# Mask_Cross = Mask_Decoder.unsqueeze(-1) @ Mask_Encoder.unsqueeze(-2)
|
| 268 |
+
# Mask_Encoder = Mask_Encoder.unsqueeze(-1) @ Mask_Encoder.unsqueeze(-2)
|
| 269 |
+
# Mask_Decoder = Mask_Decoder.unsqueeze(-1) @ Mask_Decoder.unsqueeze(-2)
|
| 270 |
+
# T = X_Decoder.shape[1]
|
| 271 |
+
# mask_tril = torch.tril(torch.ones(T, T)).view(1, 1, T, T)
|
| 272 |
+
# Mask_Decoder = Mask_Decoder.masked_fill(mask_tril==0,0)
|
| 273 |
+
# Mask_Encoder = Mask_Encoder.to(X_Encoder.device)
|
| 274 |
+
# Mask_Decoder = Mask_Decoder.to(X_Decoder.device)
|
| 275 |
+
# Mask_Cross = Mask_Cross.to(X_Encoder.device)
|
| 276 |
+
# return Mask_Encoder,Mask_Decoder,Mask_Cross
|
SCMG/models/Reinvent_Scaffold_Decorator/sampler.py
ADDED
|
@@ -0,0 +1,85 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import random
|
| 2 |
+
import numpy as np
|
| 3 |
+
import torch
|
| 4 |
+
import torch.nn as nn
|
| 5 |
+
from torch.nn import functional as F
|
| 6 |
+
|
| 7 |
+
def set_seed(seed):
|
| 8 |
+
random.seed(seed)
|
| 9 |
+
np.random.seed(seed)
|
| 10 |
+
torch.manual_seed(seed)
|
| 11 |
+
torch.cuda.manual_seed_all(seed)
|
| 12 |
+
|
| 13 |
+
def top_k_logits(logits, k):
|
| 14 |
+
v, ix = torch.topk(logits, k)
|
| 15 |
+
out = logits.clone()
|
| 16 |
+
out[out < v[:, [-1]]] = -float('Inf')
|
| 17 |
+
return out
|
| 18 |
+
|
| 19 |
+
@torch.no_grad()
|
| 20 |
+
def sample(model, x, steps, temperature=1.0, sample=False, top_k=None):
|
| 21 |
+
block_size = model.get_block_size()
|
| 22 |
+
model.eval()
|
| 23 |
+
for k in range(steps):
|
| 24 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 25 |
+
logits, _ = model(x_cond)
|
| 26 |
+
logits = logits[:, -1, :] / temperature
|
| 27 |
+
if top_k is not None:
|
| 28 |
+
logits = top_k_logits(logits, top_k)
|
| 29 |
+
probs = F.softmax(logits, dim=-1)
|
| 30 |
+
if sample:
|
| 31 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 32 |
+
else:
|
| 33 |
+
_, ix = torch.topk(probs, k=1, dim=-1)
|
| 34 |
+
x = torch.cat((x, ix), dim=1)
|
| 35 |
+
|
| 36 |
+
return x
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
@torch.no_grad()
|
| 42 |
+
def sample(model, x, steps, temperature=1.0,boundary=None):
|
| 43 |
+
block_size = model.get_block_size()
|
| 44 |
+
model.eval()
|
| 45 |
+
for k in range(steps):
|
| 46 |
+
x_cond = x if x.size(1) <= block_size else x[:, -block_size:]
|
| 47 |
+
logits, _ = model(x_cond,boundary=boundary)
|
| 48 |
+
logits = logits[:, -1, :] / temperature
|
| 49 |
+
probs = F.softmax(logits, dim=-1)
|
| 50 |
+
ix = torch.multinomial(probs, num_samples=1)
|
| 51 |
+
x = torch.cat((x, ix), dim=1)
|
| 52 |
+
return x
|
| 53 |
+
|
| 54 |
+
'L_5*C(=O)NCc1cccc(OC)c1.*c1nsc2ccccc12COc1cccc(CNC(=O)c2cccc(NC(=O)c3nsc4ccccc34)c2)c1'
|
| 55 |
+
|
| 56 |
+
# for i in range(1,21):
|
| 57 |
+
def sample_L(i,option='string'):
|
| 58 |
+
# i=2
|
| 59 |
+
prefix = 'L_'+str(i)
|
| 60 |
+
string_input = prefix + '*O=C1NN=Cc2c1cccc2.*O=C(C1CC1)N1CCNCC1'
|
| 61 |
+
array_input = [vocab[a] for a in ['<bos>'] + list(string_input)]
|
| 62 |
+
boundary = [len(array_input)]
|
| 63 |
+
tensor_input = torch.tensor(array_input,device='cuda').unsqueeze(0).repeat(32,1)
|
| 64 |
+
boundary = boundary*32
|
| 65 |
+
tensor_output = sample(model,tensor_input,250,boundary=boundary)
|
| 66 |
+
strings_output = []
|
| 67 |
+
for j in range(tensor_output.shape[0]):
|
| 68 |
+
list_string_output = [inv[a] for a in tensor_output[j,boundary[j]:].cpu().numpy() if a != vocab['<pad>']]
|
| 69 |
+
# if list_string_output[0] == '<bos>':
|
| 70 |
+
# list_string_output = list_string_output[1:]
|
| 71 |
+
if list_string_output[-1] == '<eos>':
|
| 72 |
+
list_string_output = list_string_output[:-1]
|
| 73 |
+
string_output = ''.join(list_string_output)
|
| 74 |
+
strings_output.append(string_output)
|
| 75 |
+
print(string_output)
|
| 76 |
+
for j in range(tensor_output.shape[0]):
|
| 77 |
+
if test_valid(strings_output[j]):
|
| 78 |
+
print(1)
|
| 79 |
+
else:
|
| 80 |
+
print(0)
|
| 81 |
+
|
| 82 |
+
# logits,_ = model(tensor_input,boundary=boundary)
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
['<bos>', 'L', '_', '5', '*', 'C', '(', '=', 'O', ')', 'N', 'C', 'c', '1', 'c', 'c', 'c', 'c', '(', 'O', 'C', ')', 'c', '1', '.', '*', 'c', '1', 'n', 's', 'c', '2', 'c', 'c', 'c', 'c', 'c', '1', '2', 'C', 'O', 'c', '1', 'c', 'c', 'c', 'c', '(', 'C', 'N', 'C', '(', '=', 'O', ')', 'c', '2', 'c', 'c', 'c', 'c', '(', 'N', 'C', '(', '=', 'O', ')', 'c', '3', 'n', 's', 'c', '4', 'c', 'c', 'c', 'c', 'c', '3', '4', ')', 'c', '2', ')', 'c', '1', '<eos>']
|
SCMG/models/Transformer/__init__.py
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
from .model import *
|
SCMG/models/Transformer/__pycache__/__init__.cpython-310.pyc
ADDED
|
Binary file (202 Bytes). View file
|
|
|
SCMG/models/Transformer/__pycache__/model copy 2.cpython-310.pyc
ADDED
|
Binary file (8.45 kB). View file
|
|
|