try: from openbabel import pybel except: import pybel import pandas as pd import argparse from functools import partial from multiprocessing import Pool from tqdm.auto import tqdm import os from pathlib import Path import rdkit from rdkit import Chem from func_timeout import func_set_timeout # from pebble import concurrent, ProcessPool # from concurrent.futures import TimeoutError ######## Gilde enviroment setting schrodinger_root_path='/public/software/schrodinger/2021-2' # schrodinger_root_path='/opt/schrodinger2021-2' glide = f"{schrodinger_root_path}/glide" structconvert = f"{schrodinger_root_path}/utilities/structconvert" prepwizard = f"{schrodinger_root_path}/utilities/prepwizard" ligprep = f"{schrodinger_root_path}/ligprep" glide_sort = f"{schrodinger_root_path}/utilities/glide_sort" mol2convert = f"{schrodinger_root_path}/utilities/mol2convert" ################################# def smi_mae(id_smi, size_upper_limit=60, fast_flag=0): ''' The SMILES of ligand will be transformed into maestro format. id_smi:[name, SMILES] output file: {id_smi[0]}.mae fast_flag: only explore the best tautormers ''' # chembl_id = col['ChEMBL ID'] chembl_id = str(id_smi[0]) smi = id_smi[1] # path=Path(path) opfile = f'{chembl_id}' try: # if 1: # smi = col['Smiles'] mol = pybel.readstring("smi", smi) # strip salt mol.OBMol.StripSalts(10) mols = mol.OBMol.Separate() # print(pybel.Molecule(mols)) mol = pybel.Molecule(mols[0]) for imol in mols: imol = pybel.Molecule(imol) if len(imol.atoms) > len(mol.atoms): mol = imol if len(mol.atoms)>size_upper_limit: print(f'SMILES is larger than {size_upper_limit}') return 0 # print(mol) mol.addh() mol.title = chembl_id # print(mol) mol.make3D(forcefield='mmff94', steps=100) mol.localopt() mol.write(format='mol2', filename=f'{opfile}.mol2', overwrite=True) os.system(f'{structconvert} -imol2 {opfile}.mol2 -omae {opfile}_raw.mae') if fast_flag: os.system(f'{ligprep} -imae {opfile}_raw.mae -omae {opfile}.mae -epik -s 1 -t 1 -WAIT -NOJOBID') else: os.system(f'{ligprep} -imae {opfile}_raw.mae -omae {opfile}.mae -epik -WAIT -NOJOBID') # clean if os.path.exists(f'{opfile}.mol2'): os.system(f'rm {opfile}.mol2') return 1 except: print(f"Tranformation of {smi} failed! ") if os.path.exists(f'{opfile}.mol2'): os.system(f'rm {opfile}.mol2') return 0 def write_dockInput(id_smi, dockInput_template): '''Prepare the docking control script of glide''' dockInput_new_file = f'{id_smi[0]}.in' dockInput_new_f = open(dockInput_new_file, 'w') with open(dockInput_template, 'r') as dockInput_template_f: for line in dockInput_template_f.readlines(): line_new = line.replace('$MaeFile', f'{str(id_smi[0])}.mae') # line_new = line_new.replace('$n_jobs', str(n_jobs)) dockInput_new_f.write(line_new) dockInput_template_f.close() dockInput_new_f.close() return dockInput_new_file # @func_set_timeout(100) def dock(id_smi, dockInput_template,fast_flag=0): #### dock a single compound if 'sdf' in str(dockInput_template): suffix='pv.sdfgz' if 'mae' in str(dockInput_template): suffix='pv.maegz' if Path(f"{id_smi[0]}_{suffix}").exists(): return f"{id_smi[0]}_{suffix}" else: mae_stat=smi_mae(id_smi,fast_flag=fast_flag) if mae_stat: dockInput_new_file = write_dockInput(id_smi, dockInput_template) print(f'dockInput_new_f= {dockInput_new_file}') os.system(f'{glide} -WAIT -OVERWRITE -NOJOBID {dockInput_new_file}') # clean the output tempFiles = [f"{id_smi[0]}.in", f"{id_smi[0]}.mae", f"{id_smi[0]}_raw.mae"] for ifile in tempFiles: try: os.system(f'rm {ifile}') except Exception as e: print(e) continue return f"{id_smi[0]}_{suffix}" else: return 0 def get_docking_score(imaegz): try: isimple_name = imaegz.replace('_pv.sdfgz', '') isimple_name=isimple_name.replace('_pv.maegz', '') report_file=f'{isimple_name}.rept' if not Path(report_file).exists(): os.system( f'{glide_sort} -r {report_file} {imaegz} -o ./{isimple_name}.mae') with open(report_file, 'r') as report_file_f: parse_mark = 0 dockScore_list = [] for line in report_file_f.readlines(): line_sp = line.strip().split() if parse_mark > 0 and len(line_sp) == 0: break if len(line_sp) > 0: if line_sp[0] == '====': parse_mark += 1 continue if len(line_sp) == 19 and parse_mark > 0: dockScore_list.append([line_sp[0], line_sp[3], line_sp[1]]) return dockScore_list except: return [[0.0,0.0,0.0]] def dock_score(id_smi, dockInput_template,fast_flag=0): '''The Dock results will be saved locally!''' try: maegz_file=dock(id_smi, dockInput_template,fast_flag=fast_flag) except Exception as e: print(e) return 0.0 if maegz_file: score=get_docking_score(maegz_file) if len(score)>0: return score[0][1] else: return 0 return 0.0 ### Test of code if __name__ == "__main__": os.system('mkdir test') os.chdir('test') id_smi=['test','CC(C)C1C2C(NC=1C1C=C(OC)C3=NC=NN3C=1)=CC=C(N=2)C1CCC(CC1)N1CCCC1'] dockInput_template='../TLR7_dock.in' d_score = dock_score(id_smi,dockInput_template) print(d_score)