Update app.py
Browse files
app.py
CHANGED
|
@@ -18,6 +18,7 @@ TXT = "#f1f5f9"
|
|
| 18 |
GRN = "#22c55e"
|
| 19 |
RED = "#ef4444"
|
| 20 |
DIM = "#8e9bae"
|
|
|
|
| 21 |
|
| 22 |
LOG_PATH = Path("/tmp/lab_journal.csv")
|
| 23 |
|
|
@@ -26,13 +27,11 @@ def log_entry(tab, inputs, result, note=""):
|
|
| 26 |
write_header = not LOG_PATH.exists()
|
| 27 |
with open(LOG_PATH, "a", newline="", encoding="utf-8") as f:
|
| 28 |
w = csv.DictWriter(f, fieldnames=["timestamp","tab","inputs","result","note"])
|
| 29 |
-
if write_header:
|
| 30 |
-
w.writeheader()
|
| 31 |
w.writerow({"timestamp": datetime.now().strftime("%Y-%m-%d %H:%M"),
|
| 32 |
"tab": tab, "inputs": str(inputs),
|
| 33 |
"result": str(result)[:200], "note": note})
|
| 34 |
-
except Exception:
|
| 35 |
-
pass
|
| 36 |
|
| 37 |
def load_journal():
|
| 38 |
try:
|
|
@@ -167,9 +166,8 @@ def predict_drug(pocket):
|
|
| 167 |
fig, ax = plt.subplots(figsize=(6, 4), facecolor=CARD)
|
| 168 |
ax.set_facecolor(CARD)
|
| 169 |
ax.barh(df["Compound"], df["Final_score"], color=ACC)
|
| 170 |
-
ax.set_xlabel("Final Score", color=TXT)
|
| 171 |
-
ax.
|
| 172 |
-
for sp in ax.spines.values(): sp.set_edgecolor("#334155")
|
| 173 |
ax.set_title(f"Top compounds — {pocket}", color=TXT, fontsize=10)
|
| 174 |
plt.tight_layout()
|
| 175 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
|
@@ -179,8 +177,7 @@ def predict_drug(pocket):
|
|
| 179 |
def predict_variant(hgvs, sift, polyphen, gnomad):
|
| 180 |
hgvs = hgvs.strip()
|
| 181 |
if hgvs in VARIANT_DB:
|
| 182 |
-
r = VARIANT_DB[hgvs]
|
| 183 |
-
cls, conf, score = r["cls"], r["conf"], r["score"]
|
| 184 |
else:
|
| 185 |
score = 0.0
|
| 186 |
if sift < 0.05: score += 0.4
|
|
@@ -191,19 +188,16 @@ def predict_variant(hgvs, sift, polyphen, gnomad):
|
|
| 191 |
conf = "High" if (sift < 0.01 or sift > 0.9) else "Moderate"
|
| 192 |
colour = RED if "Pathogenic" in cls else GRN
|
| 193 |
icon = "⚠️ WARNING" if "Pathogenic" in cls else "✅ OK"
|
| 194 |
-
explanation = PLAIN.get(cls, "")
|
| 195 |
log_entry("S1-A | S1-R1 | OpenVariant", hgvs or f"SIFT={sift}", f"{cls} score={score}")
|
| 196 |
return (
|
| 197 |
f"<div style=\'background:{CARD};padding:16px;border-radius:8px;font-family:sans-serif;color:{TXT}\'>"
|
| 198 |
-
f"<p style=\'font-size:11px;color:{DIM};margin:0 0 8px\'>"
|
| 199 |
-
f"S1 · Biomedical › S1-A · PHYLO-GENOMICS › S1-R1 · OpenVariant</p>"
|
| 200 |
f"<h3 style=\'color:{colour};margin:0 0 8px\'>{icon} {cls}</h3>"
|
| 201 |
f"<p>Score: <b>{score:.3f}</b> | Confidence: <b>{conf}</b></p>"
|
| 202 |
-
f"<div style=\'background:
|
| 203 |
f"<div style=\'background:{colour};height:14px;border-radius:4px;width:{int(score*100)}%\'></div></div>"
|
| 204 |
-
f"<p style=\'margin-top:12px\'>{
|
| 205 |
-
f"<p style=\'font-size:11px;color:{DIM}\'>Research only. Not clinical advice.</p>"
|
| 206 |
-
f"</div>"
|
| 207 |
)
|
| 208 |
|
| 209 |
def predict_corona(size, zeta, peg, lipid):
|
|
@@ -216,43 +210,39 @@ def predict_corona(size, zeta, peg, lipid):
|
|
| 216 |
dominant = ["ApoE","Albumin","Fibrinogen","Vitronectin","ApoA-I"][min(score, 4)]
|
| 217 |
efficacy = "High" if score >= 4 else "Medium" if score >= 2 else "Low"
|
| 218 |
log_entry("S1-D | S1-R6 | Corona", f"size={size},peg={peg}", f"dominant={dominant}")
|
| 219 |
-
return
|
| 220 |
-
f"**Predicted efficacy:** {efficacy}\n\n"
|
| 221 |
-
f"**Score:** {score}/6")
|
| 222 |
|
| 223 |
def predict_cancer(c1,c2,c3,c4,c5,c6,c7,c8,c9,c10):
|
| 224 |
-
vals
|
| 225 |
-
names
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
colour = RED if prob > 0.5 else GRN
|
| 231 |
contribs = [v*w for v,w in zip(vals, weights)]
|
| 232 |
-
fig, ax
|
| 233 |
ax.set_facecolor(CARD)
|
| 234 |
ax.barh(names, contribs, color=[ACC if c > 0 else ACC2 for c in contribs])
|
| 235 |
ax.axvline(0, color=TXT, linewidth=0.8)
|
| 236 |
ax.set_xlabel("Contribution to cancer score", color=TXT)
|
| 237 |
ax.tick_params(colors=TXT, labelsize=8)
|
| 238 |
-
for sp in ax.spines.values(): sp.set_edgecolor(
|
| 239 |
ax.set_title("Protein contributions", color=TXT, fontsize=10)
|
| 240 |
plt.tight_layout()
|
| 241 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
| 242 |
log_entry("S1-E | S1-R9 | LiquidBiopsy", f"CTHRC1={c1},FHL2={c2}", f"{label} {prob:.2f}")
|
| 243 |
return (
|
| 244 |
-
f"<div style=\'background:{CARD};padding:
|
| 245 |
f"<p style=\'font-size:11px;color:{DIM};margin:0 0 6px\'>S1-E · PHYLO-BIOMARKERS · S1-R9</p>"
|
| 246 |
-
f"<span style=\'color:{colour};font-size:
|
| 247 |
f"<span style=\'color:{TXT};font-size:14px\'>Probability: {prob:.2f}</span></div>"
|
| 248 |
), Image.open(buf)
|
| 249 |
|
| 250 |
def predict_flow(size, zeta, peg, charge, flow_rate):
|
| 251 |
csi = round(min((flow_rate/40)*0.6 + (peg/5)*0.2 + (1 if charge=="Cationic" else 0)*0.2, 1.0), 3)
|
| 252 |
stability = "High remodeling" if csi > 0.6 else "Medium" if csi > 0.3 else "Stable"
|
| 253 |
-
t
|
| 254 |
-
kf = 0.03
|
| 255 |
-
ks = 0.038 * (1 + flow_rate/40)
|
| 256 |
fig, ax = plt.subplots(figsize=(6, 3.5), facecolor=CARD)
|
| 257 |
ax.set_facecolor(CARD)
|
| 258 |
ax.plot(t, 60*np.exp(-0.03*t)+20, color="#60a5fa", ls="--", label="Albumin (static)")
|
|
@@ -260,9 +250,8 @@ def predict_flow(size, zeta, peg, charge, flow_rate):
|
|
| 260 |
ax.plot(t, 14*(1-np.exp(-0.038*t))+5, color=ACC, ls="--", label="ApoE (static)")
|
| 261 |
ax.plot(t, 20*(1-np.exp(-ks*t))+5, color=ACC, label="ApoE (flow)")
|
| 262 |
ax.set_xlabel("Time (min)", color=TXT); ax.set_ylabel("% Corona", color=TXT)
|
| 263 |
-
ax.tick_params(colors=TXT)
|
| 264 |
-
ax.
|
| 265 |
-
for sp in ax.spines.values(): sp.set_edgecolor("#334155")
|
| 266 |
ax.set_title("Vroman Effect — flow vs static", color=TXT, fontsize=9)
|
| 267 |
plt.tight_layout()
|
| 268 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
|
@@ -270,15 +259,15 @@ def predict_flow(size, zeta, peg, charge, flow_rate):
|
|
| 270 |
return f"**Corona Shift Index: {csi}** — {stability}", Image.open(buf)
|
| 271 |
|
| 272 |
def predict_bbb(smiles, pka, zeta):
|
| 273 |
-
logp
|
| 274 |
apoe_pct = max(0, min(40, (7.0-pka)*8 + abs(zeta)*0.5 + logp*0.8))
|
| 275 |
bbb_prob = min(0.95, apoe_pct/30)
|
| 276 |
-
tier
|
| 277 |
-
cats
|
| 278 |
-
vals
|
| 279 |
-
angles
|
| 280 |
-
v2, a2
|
| 281 |
-
fig, ax
|
| 282 |
ax.set_facecolor(CARD)
|
| 283 |
ax.plot(a2, v2, color=ACC, linewidth=2); ax.fill(a2, v2, color=ACC, alpha=0.2)
|
| 284 |
ax.set_xticks(angles); ax.set_xticklabels(cats, color=TXT, fontsize=8)
|
|
@@ -291,12 +280,11 @@ def predict_bbb(smiles, pka, zeta):
|
|
| 291 |
def extract_corona(text):
|
| 292 |
out = {"nanoparticle_composition":"","size_nm":None,"zeta_mv":None,"PDI":None,
|
| 293 |
"protein_source":"","corona_proteins":[],"confidence":{}}
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
if m: out["PDI"] = float(m.group(1)); out["confidence"]["PDI"] = "HIGH"
|
| 300 |
for src in ["human plasma","human serum","fetal bovine serum","FBS","PBS"]:
|
| 301 |
if src.lower() in text.lower():
|
| 302 |
out["protein_source"] = src; out["confidence"]["protein_source"] = "HIGH"; break
|
|
@@ -312,364 +300,380 @@ def extract_corona(text):
|
|
| 312 |
log_entry("S1-D | S1-R10 | NLP", text[:80], f"proteins={len(out['corona_proteins'])}")
|
| 313 |
return json.dumps(out, indent=2), summary
|
| 314 |
|
| 315 |
-
# ──
|
| 316 |
-
def
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 320 |
return (
|
| 321 |
f"<div style=\'background:{CARD};border-left:3px solid {ACC};"
|
| 322 |
-
f"padding:
|
| 323 |
-
f"<span style=\'color:{DIM};font-size:11px\'>
|
| 324 |
-
f"
|
| 325 |
-
f"<span style=\'color:{TXT};font-weight:bold;font-size:15px\'>{project_name}</span><br>"
|
| 326 |
-
f"<span style=\'color:{DIM};font-size:12px\'>{description}</span>"
|
| 327 |
f"</div>"
|
| 328 |
)
|
| 329 |
|
| 330 |
# ── CSS ───────────────────────────────────────────────────────────────────────
|
| 331 |
-
css =
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 344 |
MAP_HTML = f"""
|
| 345 |
-
<div style="background:{CARD};padding:
|
| 346 |
-
font-size:13px;line-height:
|
| 347 |
|
| 348 |
-
<span style="color:{ACC};font-size:
|
| 349 |
-
<span style="color:{DIM};font-size:11px">
|
| 350 |
<br><br>
|
| 351 |
|
| 352 |
-
<span style="color:{ACC2}">S1-A · PHYLO-GENOMICS</span>
|
| 353 |
-
|
| 354 |
-
├─ <b>S1-
|
| 355 |
-
|
| 356 |
-
<
|
| 357 |
-
|
| 358 |
-
|
| 359 |
-
|
| 360 |
-
|
| 361 |
-
|
| 362 |
-
|
| 363 |
-
<
|
| 364 |
-
|
| 365 |
-
|
| 366 |
-
|
| 367 |
-
├─ <b>S1-
|
| 368 |
-
|
| 369 |
-
<
|
| 370 |
-
|
| 371 |
-
|
| 372 |
-
|
| 373 |
-
|
| 374 |
-
├─ <b>S1-
|
| 375 |
-
|
| 376 |
-
|
| 377 |
-
<br>
|
| 378 |
-
|
| 379 |
-
<span style="color:{
|
| 380 |
-
|
| 381 |
-
|
| 382 |
-
|
| 383 |
-
<
|
| 384 |
-
|
| 385 |
-
|
| 386 |
-
|
| 387 |
-
├─ <b>S1-
|
| 388 |
-
|
| 389 |
-
<
|
| 390 |
-
<span style="color:{
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 391 |
✅ Active in this demo · 🔶 In progress · 🔴 Planned / Frontier<br>
|
| 392 |
-
⭐
|
| 393 |
</span>
|
| 394 |
</div>
|
| 395 |
"""
|
| 396 |
|
| 397 |
-
|
| 398 |
-
## 🧪 Guided Investigations — S1 Biomedical
|
| 399 |
-
|
| 400 |
-
> Progress through levels: 🟢 Beginner → 🟡 Intermediate → 🔴 Advanced
|
| 401 |
-
|
| 402 |
-
---
|
| 403 |
-
|
| 404 |
-
### 🟢 Case 1 · S1-A · S1-R1 — Variant Pathogenicity
|
| 405 |
-
**Why does the same position give two different outcomes?**
|
| 406 |
-
|
| 407 |
-
1. **OpenVariant** → `BRCA1:p.R1699Q` → Benign
|
| 408 |
-
2. **OpenVariant** → `BRCA1:p.R1699W` → Pathogenic
|
| 409 |
-
3. Same position (R1699), different amino acid (Q vs W). What changed?
|
| 410 |
-
|
| 411 |
-
*Key concept: Amino acid polarity determines BRCT domain folding. Q is polar-uncharged; W is bulky-aromatic.*
|
| 412 |
-
|
| 413 |
-
---
|
| 414 |
-
|
| 415 |
-
### 🟢 Case 2 · S1-D · S1-R6 + S1-R8 — PEG and Brain Delivery
|
| 416 |
-
**How does PEG% change which protein coats your nanoparticle?**
|
| 417 |
-
|
| 418 |
-
1. **LNP Corona** → Ionizable, Zeta=−5, Size=100, **PEG=0.5%** → note protein
|
| 419 |
-
2. **PEG=2.5%** → compare dominant protein
|
| 420 |
-
3. **LNP Brain** → pKa=6.5 → check ApoE%
|
| 421 |
-
|
| 422 |
-
*Key concept: More PEG → steric shielding → less Fibrinogen → more ApoE → better BBB crossing.*
|
| 423 |
-
|
| 424 |
-
---
|
| 425 |
-
|
| 426 |
-
### 🟡 Case 3 · S1-D · S1-R7 — Vroman Effect Under Flow
|
| 427 |
-
**Does blood flow speed reshape the corona over time?**
|
| 428 |
-
|
| 429 |
-
1. **Flow Corona** → Flow=0, Ionizable → observe ApoE plateau minute
|
| 430 |
-
2. **Flow=40** (arterial) → compare same curve
|
| 431 |
-
3. At what minute does ApoE dominate under arterial flow?
|
| 432 |
-
|
| 433 |
-
*Key concept: Albumin adsorbs first (abundance), then displaced by ApoE (affinity). Flow accelerates exchange 3–4×.*
|
| 434 |
-
|
| 435 |
-
---
|
| 436 |
-
|
| 437 |
-
### 🟡 Case 4 · S1-B · S1-R3 — Novel siRNA Targets
|
| 438 |
-
**Which cancer type has the most undrugged therapeutic targets?**
|
| 439 |
-
|
| 440 |
-
1. **TP53 siRNA** → LUAD → count Drug_status = "Novel"
|
| 441 |
-
2. Repeat for BRCA, COAD
|
| 442 |
-
3. Pick one Novel gene → search: `[gene name] cancer PubMed`
|
| 443 |
-
|
| 444 |
-
*Key concept: "Novel" = no approved or clinical drug yet — highest opportunity for new therapeutic development.*
|
| 445 |
-
|
| 446 |
-
---
|
| 447 |
-
|
| 448 |
-
### 🔴 Case 5 · S1-E · S1-R9 — Cancer Detection Threshold
|
| 449 |
-
**What is the minimum signal that flips diagnosis to CANCER?**
|
| 450 |
-
|
| 451 |
-
1. **Liquid Biopsy** → all sliders = 0 → HEALTHY
|
| 452 |
-
2. Set CTHRC1=2.5, FHL2=2.0, LDHA=1.8 → observe
|
| 453 |
-
3. Reset all. Increase only CTHRC1 step by step. At what value does it tip?
|
| 454 |
-
|
| 455 |
-
*Key concept: CTHRC1 weight=0.18 is the dominant feature. One protein can outweigh a full panel.*
|
| 456 |
-
|
| 457 |
-
---
|
| 458 |
-
|
| 459 |
-
### 🔴 Case 6 · S1-B + S1-C · Cross-tool — Convergent Evidence
|
| 460 |
-
**Is there target overlap between RNA silencing and drug discovery?**
|
| 461 |
-
|
| 462 |
-
1. **miRNA** → gene=TP53 → find top silenced targets (BCL2, CDK6)
|
| 463 |
-
2. **FGFR3 Drug** → P1 → find if CDK6 pathway appears in compound targets
|
| 464 |
-
3. **siRNA** → BRCA → does CDK6 appear in synthetic lethal list?
|
| 465 |
-
|
| 466 |
-
*Key concept: Convergence across S1-B and S1-C = higher-confidence therapeutic hypothesis. This is how real pipelines are built.*
|
| 467 |
-
"""
|
| 468 |
-
|
| 469 |
-
# ── BLOCKS UI ─────────────────────────────────────────────────────────────────
|
| 470 |
with gr.Blocks(css=css, title="K R&D Lab · S1 Biomedical") as demo:
|
| 471 |
|
| 472 |
gr.Markdown(
|
| 473 |
-
"# 🔬 K R&D Lab · Science Sphere\n"
|
| 474 |
-
"**
|
| 475 |
-
"[Oksana Kolisnyk](https://kosatiks-group.pp.ua) · KOSATIKS GROUP\n"
|
| 476 |
-
"> Research only. Not clinical advice. | "
|
| 477 |
"[GitHub](https://github.com/K-RnD-Lab) "
|
| 478 |
-
"[HuggingFace](https://huggingface.co/K-RnD-Lab)"
|
|
|
|
| 479 |
)
|
| 480 |
|
| 481 |
-
|
|
|
|
|
|
|
|
|
|
| 482 |
|
| 483 |
-
# ── MAP ─────────────────────────────────────────
|
| 484 |
with gr.TabItem("🗺️ Lab Map"):
|
| 485 |
gr.HTML(MAP_HTML)
|
| 486 |
|
| 487 |
-
# ── S1-A · GENOMICS ───────────────────────
|
| 488 |
-
with gr.TabItem("
|
| 489 |
-
gr.HTML(
|
| 490 |
-
|
| 491 |
-
|
| 492 |
-
|
| 493 |
-
|
| 494 |
-
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
|
| 498 |
-
|
| 499 |
-
|
| 500 |
-
|
| 501 |
-
|
| 502 |
-
|
| 503 |
-
|
| 504 |
-
|
| 505 |
-
|
| 506 |
-
|
| 507 |
-
|
| 508 |
-
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
|
| 513 |
-
|
| 514 |
-
|
| 515 |
-
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
|
| 519 |
-
|
| 520 |
-
|
| 521 |
-
)
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
| 525 |
-
|
| 526 |
-
|
| 527 |
-
|
| 528 |
-
|
| 529 |
-
|
| 530 |
-
|
| 531 |
-
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
|
| 535 |
-
|
| 536 |
-
|
| 537 |
-
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
|
| 541 |
-
|
| 542 |
-
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
|
| 550 |
-
|
| 551 |
-
|
| 552 |
-
|
| 553 |
-
|
| 554 |
-
|
| 555 |
-
|
| 556 |
-
|
| 557 |
-
|
| 558 |
-
|
| 559 |
-
|
| 560 |
-
|
| 561 |
-
|
| 562 |
-
|
| 563 |
-
|
| 564 |
-
|
| 565 |
-
|
| 566 |
-
|
| 567 |
-
|
| 568 |
-
|
| 569 |
-
|
| 570 |
-
|
| 571 |
-
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
|
| 575 |
-
|
| 576 |
-
|
| 577 |
-
|
| 578 |
-
|
| 579 |
-
|
| 580 |
-
|
| 581 |
-
|
| 582 |
-
|
| 583 |
-
|
| 584 |
-
|
| 585 |
-
with gr.
|
| 586 |
-
|
| 587 |
-
|
| 588 |
-
|
| 589 |
-
|
| 590 |
-
|
| 591 |
-
|
| 592 |
-
|
| 593 |
-
|
| 594 |
-
|
| 595 |
-
|
| 596 |
-
|
| 597 |
-
|
| 598 |
-
|
| 599 |
-
|
| 600 |
-
|
| 601 |
-
|
| 602 |
-
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
|
| 606 |
-
|
| 607 |
-
|
| 608 |
-
|
| 609 |
-
|
| 610 |
-
|
| 611 |
-
|
| 612 |
-
|
| 613 |
-
|
| 614 |
-
|
| 615 |
-
|
| 616 |
-
|
| 617 |
-
|
| 618 |
-
|
| 619 |
-
|
| 620 |
-
|
| 621 |
-
|
| 622 |
-
|
| 623 |
-
|
| 624 |
-
|
| 625 |
-
|
| 626 |
-
|
| 627 |
-
|
| 628 |
-
|
| 629 |
-
|
| 630 |
-
|
| 631 |
-
|
| 632 |
-
|
| 633 |
-
|
| 634 |
-
|
| 635 |
-
|
| 636 |
-
|
| 637 |
-
|
| 638 |
-
|
| 639 |
-
|
| 640 |
-
|
| 641 |
-
|
| 642 |
-
|
| 643 |
-
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
|
| 650 |
-
|
| 651 |
-
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 668 |
with gr.TabItem("📓 Journal"):
|
| 669 |
-
gr.Markdown("### Lab Journal
|
| 670 |
with gr.Row():
|
| 671 |
-
note_text = gr.Textbox(label="📝 Observation
|
| 672 |
-
placeholder="What did you discover?", lines=3)
|
| 673 |
note_tab = gr.Textbox(label="Project code (e.g. S1-R1)", value="General")
|
| 674 |
note_last = gr.Textbox(visible=False)
|
| 675 |
save_btn = gr.Button("💾 Save", variant="primary")
|
|
@@ -679,36 +683,73 @@ with gr.Blocks(css=css, title="K R&D Lab · S1 Biomedical") as demo:
|
|
| 679 |
refresh_btn.click(load_journal, [], journal_df)
|
| 680 |
save_btn.click(save_note, [note_text,note_tab,note_last], [save_msg,journal_df])
|
| 681 |
|
|
|
|
| 682 |
with gr.TabItem("📚 Learning"):
|
| 683 |
-
gr.Markdown(
|
| 684 |
-
|
| 685 |
-
|
| 686 |
-
|
| 687 |
-
|
| 688 |
-
|
| 689 |
-
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
|
| 693 |
-
|
| 694 |
-
|
| 695 |
-
|
| 696 |
-
|
| 697 |
-
|
| 698 |
-
|
| 699 |
-
|
| 700 |
-
|
| 701 |
-
|
| 702 |
-
|
| 703 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 704 |
""")
|
| 705 |
|
| 706 |
gr.Markdown(
|
| 707 |
-
|
| 708 |
-
|
| 709 |
-
|
| 710 |
-
|
| 711 |
-
f"[KOSATIKS GROUP 🦈](https://kosatiks-group.pp.ua) · MIT License"
|
| 712 |
)
|
| 713 |
|
| 714 |
demo.launch(server_name="0.0.0.0", server_port=7860)
|
|
|
|
| 18 |
GRN = "#22c55e"
|
| 19 |
RED = "#ef4444"
|
| 20 |
DIM = "#8e9bae"
|
| 21 |
+
BORDER = "#334155"
|
| 22 |
|
| 23 |
LOG_PATH = Path("/tmp/lab_journal.csv")
|
| 24 |
|
|
|
|
| 27 |
write_header = not LOG_PATH.exists()
|
| 28 |
with open(LOG_PATH, "a", newline="", encoding="utf-8") as f:
|
| 29 |
w = csv.DictWriter(f, fieldnames=["timestamp","tab","inputs","result","note"])
|
| 30 |
+
if write_header: w.writeheader()
|
|
|
|
| 31 |
w.writerow({"timestamp": datetime.now().strftime("%Y-%m-%d %H:%M"),
|
| 32 |
"tab": tab, "inputs": str(inputs),
|
| 33 |
"result": str(result)[:200], "note": note})
|
| 34 |
+
except Exception: pass
|
|
|
|
| 35 |
|
| 36 |
def load_journal():
|
| 37 |
try:
|
|
|
|
| 166 |
fig, ax = plt.subplots(figsize=(6, 4), facecolor=CARD)
|
| 167 |
ax.set_facecolor(CARD)
|
| 168 |
ax.barh(df["Compound"], df["Final_score"], color=ACC)
|
| 169 |
+
ax.set_xlabel("Final Score", color=TXT); ax.tick_params(colors=TXT)
|
| 170 |
+
for sp in ax.spines.values(): sp.set_edgecolor(BORDER)
|
|
|
|
| 171 |
ax.set_title(f"Top compounds — {pocket}", color=TXT, fontsize=10)
|
| 172 |
plt.tight_layout()
|
| 173 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
|
|
|
| 177 |
def predict_variant(hgvs, sift, polyphen, gnomad):
|
| 178 |
hgvs = hgvs.strip()
|
| 179 |
if hgvs in VARIANT_DB:
|
| 180 |
+
r = VARIANT_DB[hgvs]; cls, conf, score = r["cls"], r["conf"], r["score"]
|
|
|
|
| 181 |
else:
|
| 182 |
score = 0.0
|
| 183 |
if sift < 0.05: score += 0.4
|
|
|
|
| 188 |
conf = "High" if (sift < 0.01 or sift > 0.9) else "Moderate"
|
| 189 |
colour = RED if "Pathogenic" in cls else GRN
|
| 190 |
icon = "⚠️ WARNING" if "Pathogenic" in cls else "✅ OK"
|
|
|
|
| 191 |
log_entry("S1-A | S1-R1 | OpenVariant", hgvs or f"SIFT={sift}", f"{cls} score={score}")
|
| 192 |
return (
|
| 193 |
f"<div style=\'background:{CARD};padding:16px;border-radius:8px;font-family:sans-serif;color:{TXT}\'>"
|
| 194 |
+
f"<p style=\'font-size:11px;color:{DIM};margin:0 0 8px\'>S1-A · PHYLO-GENOMICS · S1-R1</p>"
|
|
|
|
| 195 |
f"<h3 style=\'color:{colour};margin:0 0 8px\'>{icon} {cls}</h3>"
|
| 196 |
f"<p>Score: <b>{score:.3f}</b> | Confidence: <b>{conf}</b></p>"
|
| 197 |
+
f"<div style=\'background:{BORDER};border-radius:4px;height:14px\'>"
|
| 198 |
f"<div style=\'background:{colour};height:14px;border-radius:4px;width:{int(score*100)}%\'></div></div>"
|
| 199 |
+
f"<p style=\'margin-top:12px\'>{PLAIN.get(cls,'')}</p>"
|
| 200 |
+
f"<p style=\'font-size:11px;color:{DIM}\'>Research only. Not clinical advice.</p></div>"
|
|
|
|
| 201 |
)
|
| 202 |
|
| 203 |
def predict_corona(size, zeta, peg, lipid):
|
|
|
|
| 210 |
dominant = ["ApoE","Albumin","Fibrinogen","Vitronectin","ApoA-I"][min(score, 4)]
|
| 211 |
efficacy = "High" if score >= 4 else "Medium" if score >= 2 else "Low"
|
| 212 |
log_entry("S1-D | S1-R6 | Corona", f"size={size},peg={peg}", f"dominant={dominant}")
|
| 213 |
+
return f"**Dominant corona protein:** {dominant}\n\n**Predicted efficacy:** {efficacy}\n\n**Score:** {score}/6"
|
|
|
|
|
|
|
| 214 |
|
| 215 |
def predict_cancer(c1,c2,c3,c4,c5,c6,c7,c8,c9,c10):
|
| 216 |
+
vals = [c1,c2,c3,c4,c5,c6,c7,c8,c9,c10]
|
| 217 |
+
names, weights = list(BM_W.keys()), list(BM_W.values())
|
| 218 |
+
raw = sum(v*w for v,w in zip(vals, weights))
|
| 219 |
+
prob = 1 / (1 + np.exp(-raw * 2))
|
| 220 |
+
label = "CANCER" if prob > 0.5 else "HEALTHY"
|
| 221 |
+
colour = RED if prob > 0.5 else GRN
|
|
|
|
| 222 |
contribs = [v*w for v,w in zip(vals, weights)]
|
| 223 |
+
fig, ax = plt.subplots(figsize=(6, 3.5), facecolor=CARD)
|
| 224 |
ax.set_facecolor(CARD)
|
| 225 |
ax.barh(names, contribs, color=[ACC if c > 0 else ACC2 for c in contribs])
|
| 226 |
ax.axvline(0, color=TXT, linewidth=0.8)
|
| 227 |
ax.set_xlabel("Contribution to cancer score", color=TXT)
|
| 228 |
ax.tick_params(colors=TXT, labelsize=8)
|
| 229 |
+
for sp in ax.spines.values(): sp.set_edgecolor(BORDER)
|
| 230 |
ax.set_title("Protein contributions", color=TXT, fontsize=10)
|
| 231 |
plt.tight_layout()
|
| 232 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
| 233 |
log_entry("S1-E | S1-R9 | LiquidBiopsy", f"CTHRC1={c1},FHL2={c2}", f"{label} {prob:.2f}")
|
| 234 |
return (
|
| 235 |
+
f"<div style=\'background:{CARD};padding:14px;border-radius:8px;font-family:sans-serif;\'>"
|
| 236 |
f"<p style=\'font-size:11px;color:{DIM};margin:0 0 6px\'>S1-E · PHYLO-BIOMARKERS · S1-R9</p>"
|
| 237 |
+
f"<span style=\'color:{colour};font-size:24px;font-weight:bold\'>{label}</span><br>"
|
| 238 |
f"<span style=\'color:{TXT};font-size:14px\'>Probability: {prob:.2f}</span></div>"
|
| 239 |
), Image.open(buf)
|
| 240 |
|
| 241 |
def predict_flow(size, zeta, peg, charge, flow_rate):
|
| 242 |
csi = round(min((flow_rate/40)*0.6 + (peg/5)*0.2 + (1 if charge=="Cationic" else 0)*0.2, 1.0), 3)
|
| 243 |
stability = "High remodeling" if csi > 0.6 else "Medium" if csi > 0.3 else "Stable"
|
| 244 |
+
t = np.linspace(0, 60, 200)
|
| 245 |
+
kf, ks = 0.03*(1+flow_rate/40), 0.038*(1+flow_rate/40)
|
|
|
|
| 246 |
fig, ax = plt.subplots(figsize=(6, 3.5), facecolor=CARD)
|
| 247 |
ax.set_facecolor(CARD)
|
| 248 |
ax.plot(t, 60*np.exp(-0.03*t)+20, color="#60a5fa", ls="--", label="Albumin (static)")
|
|
|
|
| 250 |
ax.plot(t, 14*(1-np.exp(-0.038*t))+5, color=ACC, ls="--", label="ApoE (static)")
|
| 251 |
ax.plot(t, 20*(1-np.exp(-ks*t))+5, color=ACC, label="ApoE (flow)")
|
| 252 |
ax.set_xlabel("Time (min)", color=TXT); ax.set_ylabel("% Corona", color=TXT)
|
| 253 |
+
ax.tick_params(colors=TXT); ax.legend(fontsize=7, labelcolor=TXT, facecolor=CARD)
|
| 254 |
+
for sp in ax.spines.values(): sp.set_edgecolor(BORDER)
|
|
|
|
| 255 |
ax.set_title("Vroman Effect — flow vs static", color=TXT, fontsize=9)
|
| 256 |
plt.tight_layout()
|
| 257 |
buf = BytesIO(); plt.savefig(buf, format="png", dpi=120, facecolor=CARD); plt.close(); buf.seek(0)
|
|
|
|
| 259 |
return f"**Corona Shift Index: {csi}** — {stability}", Image.open(buf)
|
| 260 |
|
| 261 |
def predict_bbb(smiles, pka, zeta):
|
| 262 |
+
logp = smiles.count("C")*0.3 - smiles.count("O")*0.5 + 1.5
|
| 263 |
apoe_pct = max(0, min(40, (7.0-pka)*8 + abs(zeta)*0.5 + logp*0.8))
|
| 264 |
bbb_prob = min(0.95, apoe_pct/30)
|
| 265 |
+
tier = "HIGH (>20%)" if apoe_pct > 20 else "MEDIUM (10-20%)" if apoe_pct > 10 else "LOW (<10%)"
|
| 266 |
+
cats = ["ApoE%","BBB","logP","pKa fit","Zeta"]
|
| 267 |
+
vals = [apoe_pct/40, bbb_prob, min(logp/5,1), (7-abs(pka-6.5))/7, (10-abs(zeta))/10]
|
| 268 |
+
angles = np.linspace(0, 2*np.pi, len(cats), endpoint=False).tolist()
|
| 269 |
+
v2, a2 = vals+[vals[0]], angles+[angles[0]]
|
| 270 |
+
fig, ax = plt.subplots(figsize=(5, 4), subplot_kw={"polar":True}, facecolor=CARD)
|
| 271 |
ax.set_facecolor(CARD)
|
| 272 |
ax.plot(a2, v2, color=ACC, linewidth=2); ax.fill(a2, v2, color=ACC, alpha=0.2)
|
| 273 |
ax.set_xticks(angles); ax.set_xticklabels(cats, color=TXT, fontsize=8)
|
|
|
|
| 280 |
def extract_corona(text):
|
| 281 |
out = {"nanoparticle_composition":"","size_nm":None,"zeta_mv":None,"PDI":None,
|
| 282 |
"protein_source":"","corona_proteins":[],"confidence":{}}
|
| 283 |
+
for pat, key in [(r"(\d+\.?\d*)\s*(?:nm|nanometer)","size_nm"),
|
| 284 |
+
(r"([+-]?\d+\.?\d*)\s*mV","zeta_mv"),
|
| 285 |
+
(r"PDI\s*[=:of]*\s*(\d+\.?\d*)","PDI")]:
|
| 286 |
+
m = re.search(pat, text, re.I)
|
| 287 |
+
if m: out[key] = float(m.group(1)); out["confidence"][key] = "HIGH"
|
|
|
|
| 288 |
for src in ["human plasma","human serum","fetal bovine serum","FBS","PBS"]:
|
| 289 |
if src.lower() in text.lower():
|
| 290 |
out["protein_source"] = src; out["confidence"]["protein_source"] = "HIGH"; break
|
|
|
|
| 300 |
log_entry("S1-D | S1-R10 | NLP", text[:80], f"proteins={len(out['corona_proteins'])}")
|
| 301 |
return json.dumps(out, indent=2), summary
|
| 302 |
|
| 303 |
+
# ── HELPERS ───────────────────────────────────────────────────────────────────
|
| 304 |
+
def section_header(code, name, tagline, projects_html):
|
| 305 |
+
return (
|
| 306 |
+
f"<div style=\'background:{BG};border:1px solid {BORDER};padding:14px 18px;"
|
| 307 |
+
f"border-radius:8px;margin-bottom:12px;\'>"
|
| 308 |
+
f"<div style=\'display:flex;align-items:baseline;gap:10px;\'>"
|
| 309 |
+
f"<span style=\'color:{ACC2};font-size:16px;font-weight:700\'>{code}</span>"
|
| 310 |
+
f"<span style=\'color:{TXT};font-size:14px;font-weight:600\'>{name}</span>"
|
| 311 |
+
f"<span style=\'color:{DIM};font-size:12px\'>{tagline}</span></div>"
|
| 312 |
+
f"<div style=\'margin-top:8px;font-size:12px;color:{DIM}\'>{projects_html}</div>"
|
| 313 |
+
f"</div>"
|
| 314 |
+
)
|
| 315 |
+
|
| 316 |
+
def proj_badge(code, title, metric=""):
|
| 317 |
+
m = (f"<span style=\'background:#0f2a3f;color:{ACC2};padding:1px 7px;border-radius:3px;"
|
| 318 |
+
f"font-size:10px;margin-left:6px\'>{metric}</span>") if metric else ""
|
| 319 |
return (
|
| 320 |
f"<div style=\'background:{CARD};border-left:3px solid {ACC};"
|
| 321 |
+
f"padding:8px 12px;border-radius:0 6px 6px 0;margin-bottom:8px;\'>"
|
| 322 |
+
f"<span style=\'color:{DIM};font-size:11px\'>{code}</span>{m}<br>"
|
| 323 |
+
f"<span style=\'color:{TXT};font-size:14px;font-weight:600\'>{title}</span>"
|
|
|
|
|
|
|
| 324 |
f"</div>"
|
| 325 |
)
|
| 326 |
|
| 327 |
# ── CSS ───────────────────────────────────────────────────────────────────────
|
| 328 |
+
css = f"""
|
| 329 |
+
body, .gradio-container {{ background: {BG} !important; color: {TXT} !important; }}
|
| 330 |
+
|
| 331 |
+
/* OUTER tab bar — PHYLO categories */
|
| 332 |
+
.outer-tabs .tab-nav button {{
|
| 333 |
+
color: {TXT} !important;
|
| 334 |
+
background: {CARD} !important;
|
| 335 |
+
font-size: 13px !important;
|
| 336 |
+
font-weight: 600 !important;
|
| 337 |
+
padding: 8px 16px !important;
|
| 338 |
+
border-radius: 6px 6px 0 0 !important;
|
| 339 |
+
}}
|
| 340 |
+
.outer-tabs .tab-nav button.selected {{
|
| 341 |
+
border-bottom: 3px solid {ACC} !important;
|
| 342 |
+
color: {ACC} !important;
|
| 343 |
+
background: {BG} !important;
|
| 344 |
+
}}
|
| 345 |
+
|
| 346 |
+
/* INNER sub-tab bar — individual tools */
|
| 347 |
+
.inner-tabs .tab-nav button {{
|
| 348 |
+
color: {DIM} !important;
|
| 349 |
+
background: {BG} !important;
|
| 350 |
+
font-size: 12px !important;
|
| 351 |
+
font-weight: 500 !important;
|
| 352 |
+
padding: 5px 12px !important;
|
| 353 |
+
border-radius: 4px 4px 0 0 !important;
|
| 354 |
+
border: 1px solid {BORDER} !important;
|
| 355 |
+
border-bottom: none !important;
|
| 356 |
+
margin-right: 3px !important;
|
| 357 |
+
}}
|
| 358 |
+
.inner-tabs .tab-nav button.selected {{
|
| 359 |
+
color: {ACC2} !important;
|
| 360 |
+
background: {CARD} !important;
|
| 361 |
+
border-color: {ACC2} !important;
|
| 362 |
+
border-bottom: none !important;
|
| 363 |
+
}}
|
| 364 |
+
.inner-tabs > .tabitem {{
|
| 365 |
+
background: {CARD} !important;
|
| 366 |
+
border: 1px solid {BORDER} !important;
|
| 367 |
+
border-radius: 0 6px 6px 6px !important;
|
| 368 |
+
padding: 14px !important;
|
| 369 |
+
}}
|
| 370 |
+
|
| 371 |
+
h1, h2, h3 {{ color: {ACC} !important; }}
|
| 372 |
+
.gr-button-primary {{ background: {ACC} !important; border: none !important; }}
|
| 373 |
+
footer {{ display: none !important; }}
|
| 374 |
+
"""
|
| 375 |
+
|
| 376 |
+
# ── LAB MAP HTML ──────────────────────────────────────────────────────────────
|
| 377 |
MAP_HTML = f"""
|
| 378 |
+
<div style="background:{CARD};padding:22px;border-radius:8px;font-family:monospace;
|
| 379 |
+
font-size:13px;line-height:2.0;color:{TXT}">
|
| 380 |
|
| 381 |
+
<span style="color:{ACC};font-size:16px;font-weight:bold">K R&D Lab · S1 Biomedical</span>
|
| 382 |
+
<span style="color:{DIM};font-size:11px;margin-left:12px">Science Sphere — sub-direction 1</span>
|
| 383 |
<br><br>
|
| 384 |
|
| 385 |
+
<span style="color:{ACC2};font-weight:600">S1-A · PHYLO-GENOMICS</span>
|
| 386 |
+
<span style="color:{DIM}"> — What breaks in DNA</span><br>
|
| 387 |
+
├─ <b>S1-R1</b> OpenVariant
|
| 388 |
+
<span style="color:{GRN}"> AUC=0.939 ✅</span><br>
|
| 389 |
+
├─ <b>S1-R1b</b> Somatic classifier
|
| 390 |
+
<span style="color:#f59e0b"> 🔶 In progress</span><br>
|
| 391 |
+
└─ <b>S1-R12a</b> Rare variants (DIPG · UVM)
|
| 392 |
+
<span style="color:{DIM}"> 🔴 Planned</span><br><br>
|
| 393 |
+
|
| 394 |
+
<span style="color:{ACC2};font-weight:600">S1-B · PHYLO-RNA</span>
|
| 395 |
+
<span style="color:{DIM}"> — How to silence it via RNA</span><br>
|
| 396 |
+
├─ <b>S1-R2</b> miRNA silencing (BRCA1/2, TP53)
|
| 397 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 398 |
+
├─ <b>S1-R3</b> siRNA synthetic lethal (LUAD · BRCA · COAD)
|
| 399 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 400 |
+
├─ <b>S1-R4</b> lncRNA-TREM2 ceRNA network
|
| 401 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 402 |
+
└─ <b>S1-R4b</b> ASO designer
|
| 403 |
+
<span style="color:{GRN}"> ✅</span><br><br>
|
| 404 |
+
|
| 405 |
+
<span style="color:{ACC2};font-weight:600">S1-C · PHYLO-DRUG</span>
|
| 406 |
+
<span style="color:{DIM}"> — Which molecule treats it</span><br>
|
| 407 |
+
├─ <b>S1-R5</b> FGFR3 RNA-directed compounds
|
| 408 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 409 |
+
├─ <b>S1-R5b</b> Synthetic lethal drug mapping
|
| 410 |
+
<span style="color:#f59e0b"> 🔶</span><br>
|
| 411 |
+
└─ <b>S1-R13</b> m6A × Ferroptosis × Circadian ⭐
|
| 412 |
+
<span style="color:{DIM}"> 🔴 Frontier</span><br><br>
|
| 413 |
+
|
| 414 |
+
<span style="color:{ACC2};font-weight:600">S1-D · PHYLO-LNP</span>
|
| 415 |
+
<span style="color:{DIM}"> — How to deliver the drug</span><br>
|
| 416 |
+
├─ <b>S1-R6</b> LNP corona (serum)
|
| 417 |
+
<span style="color:{GRN}"> AUC=0.791 ✅</span><br>
|
| 418 |
+
├─ <b>S1-R7</b> Flow corona — Vroman effect
|
| 419 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 420 |
+
├─ <b>S1-R8</b> LNP brain / BBB / ApoE
|
| 421 |
+
<span style="color:{GRN}"> ✅</span><br>
|
| 422 |
+
├─ <b>S1-R10</b> AutoCorona NLP
|
| 423 |
+
<span style="color:{GRN}"> F1=0.71 ✅</span><br>
|
| 424 |
+
└─ <b>S1-R11</b> CSF · Vitreous · Bone Marrow ⭐
|
| 425 |
+
<span style="color:{DIM}"> 🔴 0 prior studies</span><br><br>
|
| 426 |
+
|
| 427 |
+
<span style="color:{ACC2};font-weight:600">S1-E · PHYLO-BIOMARKERS</span>
|
| 428 |
+
<span style="color:{DIM}"> — Detect without biopsy</span><br>
|
| 429 |
+
├─ <b>S1-R9</b> Liquid Biopsy classifier
|
| 430 |
+
<span style="color:{GRN}"> AUC=0.992* ✅</span><br>
|
| 431 |
+
├─ <b>S1-R9b</b> Protein panel validator
|
| 432 |
+
<span style="color:#f59e0b"> 🔶</span><br>
|
| 433 |
+
└─ <b>S1-R9c</b> ctDNA gap analysis
|
| 434 |
+
<span style="color:{DIM}"> 🔴</span><br><br>
|
| 435 |
+
|
| 436 |
+
<span style="color:{ACC2};font-weight:600">S1-F · PHYLO-RARE</span>
|
| 437 |
+
<span style="color:{DIM}"> — Where nobody looked yet</span><br>
|
| 438 |
+
├─ <b>S1-R12b</b> DIPG toolkit (H3K27M)
|
| 439 |
+
<span style="color:{DIM}"> 🔴</span><br>
|
| 440 |
+
├─ <b>S1-R12c</b> UVM toolkit (GNAQ/GNA11)
|
| 441 |
+
<span style="color:{DIM}"> 🔴</span><br>
|
| 442 |
+
└─ <b>S1-R12d</b> pAML toolkit (FLT3-ITD)
|
| 443 |
+
<span style="color:{DIM}"> 🔴</span><br><br>
|
| 444 |
+
|
| 445 |
+
<span style="color:{DIM};font-size:11px">
|
| 446 |
✅ Active in this demo · 🔶 In progress · 🔴 Planned / Frontier<br>
|
| 447 |
+
⭐ gap research (0–1 prior studies globally) · * tissue proxy, plasma validation pending
|
| 448 |
</span>
|
| 449 |
</div>
|
| 450 |
"""
|
| 451 |
|
| 452 |
+
# ── UI ────────────────────────────────────────────────────────────────────────
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 453 |
with gr.Blocks(css=css, title="K R&D Lab · S1 Biomedical") as demo:
|
| 454 |
|
| 455 |
gr.Markdown(
|
| 456 |
+
"# 🔬 K R&D Lab · Science Sphere — S1 Biomedical\n"
|
| 457 |
+
"**Oksana Kolisnyk** · [KOSATIKS GROUP](https://kosatiks-group.pp.ua) | "
|
|
|
|
|
|
|
| 458 |
"[GitHub](https://github.com/K-RnD-Lab) "
|
| 459 |
+
"[HuggingFace](https://huggingface.co/K-RnD-Lab) | "
|
| 460 |
+
"*Research only. Not clinical advice.*"
|
| 461 |
)
|
| 462 |
|
| 463 |
+
# ═══════════════════════════════════════════════════════
|
| 464 |
+
# OUTER TABS — one per PHYLO-* category
|
| 465 |
+
# ═══════════════════════════════════════════════════════
|
| 466 |
+
with gr.Tabs(elem_classes="outer-tabs"):
|
| 467 |
|
| 468 |
+
# ── 🗺️ MAP ─────────────────────────────────────────
|
| 469 |
with gr.TabItem("🗺️ Lab Map"):
|
| 470 |
gr.HTML(MAP_HTML)
|
| 471 |
|
| 472 |
+
# ── 🧬 S1-A · PHYLO-GENOMICS ───────────────────────
|
| 473 |
+
with gr.TabItem("🧬 PHYLO-GENOMICS"):
|
| 474 |
+
gr.HTML(section_header(
|
| 475 |
+
"S1-A", "PHYLO-GENOMICS", "— What breaks in DNA",
|
| 476 |
+
"S1-R1 OpenVariant ✅ · S1-R1b Somatic classifier 🔶 · S1-R12a Rare variants 🔴"
|
| 477 |
+
))
|
| 478 |
+
with gr.Tabs(elem_classes="inner-tabs"):
|
| 479 |
+
|
| 480 |
+
with gr.TabItem("S1-R1 · OpenVariant"):
|
| 481 |
+
gr.HTML(proj_badge("S1-A · PHYLO-GENOMICS · S1-R1",
|
| 482 |
+
"OpenVariant — SNV Pathogenicity Classifier", "AUC = 0.939"))
|
| 483 |
+
hgvs = gr.Textbox(label="HGVS notation", placeholder="BRCA1:p.R1699Q")
|
| 484 |
+
gr.Markdown("**Or enter functional scores manually:**")
|
| 485 |
+
with gr.Row():
|
| 486 |
+
sift = gr.Slider(0,1,value=0.5,step=0.01,label="SIFT (0=damaging)")
|
| 487 |
+
pp = gr.Slider(0,1,value=0.5,step=0.01,label="PolyPhen-2")
|
| 488 |
+
gn = gr.Slider(0,0.01,value=0.001,step=0.0001,label="gnomAD AF")
|
| 489 |
+
b_v = gr.Button("Predict Pathogenicity", variant="primary")
|
| 490 |
+
o_v = gr.HTML()
|
| 491 |
+
gr.Examples([["BRCA1:p.R1699Q",0.82,0.05,0.0012],
|
| 492 |
+
["TP53:p.R248W",0.00,1.00,0.0],
|
| 493 |
+
["BRCA2:p.D2723A",0.01,0.98,0.0]], inputs=[hgvs,sift,pp,gn])
|
| 494 |
+
b_v.click(predict_variant, [hgvs,sift,pp,gn], o_v)
|
| 495 |
+
|
| 496 |
+
with gr.TabItem("S1-R1b · Somatic 🔶"):
|
| 497 |
+
gr.HTML(proj_badge("S1-A · PHYLO-GENOMICS · S1-R1b",
|
| 498 |
+
"Somatic Mutation Classifier — BRCA · LUAD panels", "🔶 In progress"))
|
| 499 |
+
gr.Markdown("> This module is in active development. Coming in the next release.")
|
| 500 |
+
|
| 501 |
+
# ── 🔬 S1-B · PHYLO-RNA ────────────────────────────
|
| 502 |
+
with gr.TabItem("🔬 PHYLO-RNA"):
|
| 503 |
+
gr.HTML(section_header(
|
| 504 |
+
"S1-B", "PHYLO-RNA", "— How to silence it via RNA",
|
| 505 |
+
"S1-R2 miRNA ✅ · S1-R3 siRNA ✅ · S1-R4 lncRNA ✅ · S1-R4b ASO ✅"
|
| 506 |
+
))
|
| 507 |
+
with gr.Tabs(elem_classes="inner-tabs"):
|
| 508 |
+
|
| 509 |
+
with gr.TabItem("S1-R2 · miRNA"):
|
| 510 |
+
gr.HTML(proj_badge("S1-B · PHYLO-RNA · S1-R2",
|
| 511 |
+
"miRNA Silencing — BRCA1/2 · TP53 tumor suppressors"))
|
| 512 |
+
g1 = gr.Dropdown(["BRCA2","BRCA1","TP53"], value="BRCA2", label="Gene")
|
| 513 |
+
b1 = gr.Button("Find miRNAs", variant="primary")
|
| 514 |
+
o1 = gr.Dataframe(label="Top 5 downregulated miRNAs")
|
| 515 |
+
gr.Examples([["BRCA2"],["BRCA1"],["TP53"]], inputs=[g1])
|
| 516 |
+
b1.click(predict_mirna, g1, o1)
|
| 517 |
+
|
| 518 |
+
with gr.TabItem("S1-R3 · siRNA"):
|
| 519 |
+
gr.HTML(proj_badge("S1-B · PHYLO-RNA · S1-R3",
|
| 520 |
+
"siRNA Synthetic Lethal — TP53-null · LUAD · BRCA · COAD"))
|
| 521 |
+
g2 = gr.Dropdown(["LUAD","BRCA","COAD"], value="LUAD", label="Cancer type")
|
| 522 |
+
b2 = gr.Button("Find Targets", variant="primary")
|
| 523 |
+
o2 = gr.Dataframe(label="Top 5 synthetic lethal targets")
|
| 524 |
+
gr.Examples([["LUAD"],["BRCA"],["COAD"]], inputs=[g2])
|
| 525 |
+
b2.click(predict_sirna, g2, o2)
|
| 526 |
+
|
| 527 |
+
with gr.TabItem("S1-R4 · lncRNA + ASO"):
|
| 528 |
+
gr.HTML(proj_badge("S1-B · PHYLO-RNA · S1-R4 + S1-R4b",
|
| 529 |
+
"lncRNA-TREM2 ceRNA Network + ASO Candidates · Alzheimer neuroinflammation"))
|
| 530 |
+
b3 = gr.Button("Load Results", variant="primary")
|
| 531 |
+
o3a = gr.Dataframe(label="ceRNA Network (S1-R4)")
|
| 532 |
+
o3b = gr.Dataframe(label="ASO Candidates (S1-R4b)")
|
| 533 |
+
b3.click(get_lncrna, [], [o3a, o3b])
|
| 534 |
+
|
| 535 |
+
# ── 💊 S1-C · PHYLO-DRUG ───────────────────────────
|
| 536 |
+
with gr.TabItem("💊 PHYLO-DRUG"):
|
| 537 |
+
gr.HTML(section_header(
|
| 538 |
+
"S1-C", "PHYLO-DRUG", "— Which molecule treats it",
|
| 539 |
+
"S1-R5 FGFR3 ✅ · S1-R5b SL drug mapping 🔶 · S1-R13 m6A×Ferroptosis×Circadian 🔴⭐"
|
| 540 |
+
))
|
| 541 |
+
with gr.Tabs(elem_classes="inner-tabs"):
|
| 542 |
+
|
| 543 |
+
with gr.TabItem("S1-R5 · FGFR3"):
|
| 544 |
+
gr.HTML(proj_badge("S1-C · PHYLO-DRUG · S1-R5",
|
| 545 |
+
"FGFR3 RNA-Directed Drug Discovery · ChEMBL screen",
|
| 546 |
+
"top score 0.793"))
|
| 547 |
+
g4 = gr.Radio(["P1 (hairpin loop)","P10 (G-quadruplex)"],
|
| 548 |
+
value="P1 (hairpin loop)", label="Target pocket")
|
| 549 |
+
b4 = gr.Button("Screen Compounds", variant="primary")
|
| 550 |
+
o4t = gr.Dataframe(label="Top 5 candidates")
|
| 551 |
+
o4p = gr.Image(label="Binding scores")
|
| 552 |
+
gr.Examples([["P1 (hairpin loop)"],["P10 (G-quadruplex)"]], inputs=[g4])
|
| 553 |
+
b4.click(predict_drug, g4, [o4t, o4p])
|
| 554 |
+
|
| 555 |
+
with gr.TabItem("S1-R13 · Frontier 🔴⭐"):
|
| 556 |
+
gr.HTML(proj_badge("S1-C · PHYLO-DRUG · S1-R13",
|
| 557 |
+
"m6A × Ferroptosis × Circadian — Pan-cancer triad", "🔴 Frontier"))
|
| 558 |
+
gr.Markdown(
|
| 559 |
+
"> **Research gap:** This triple intersection has never been studied as an integrated system.\n\n"
|
| 560 |
+
"> **Planned datasets:** TCGA-PAAD · GEO m6A atlases · Circadian gene panels\n\n"
|
| 561 |
+
"> **Expected timeline:** Q3 2026"
|
| 562 |
+
)
|
| 563 |
+
|
| 564 |
+
# ── 🧪 S1-D · PHYLO-LNP ────────────────────────────
|
| 565 |
+
with gr.TabItem("🧪 PHYLO-LNP"):
|
| 566 |
+
gr.HTML(section_header(
|
| 567 |
+
"S1-D", "PHYLO-LNP", "— How to deliver the drug to the cell",
|
| 568 |
+
"S1-R6 Corona ✅ · S1-R7 Flow ✅ · S1-R8 Brain ✅ · S1-R10 NLP ✅ · S1-R11 CSF/BM 🔴⭐"
|
| 569 |
+
))
|
| 570 |
+
with gr.Tabs(elem_classes="inner-tabs"):
|
| 571 |
+
|
| 572 |
+
with gr.TabItem("S1-R6 · Corona"):
|
| 573 |
+
gr.HTML(proj_badge("S1-D · PHYLO-LNP · S1-R6",
|
| 574 |
+
"LNP Protein Corona (Serum)", "AUC = 0.791"))
|
| 575 |
+
with gr.Row():
|
| 576 |
+
sz = gr.Slider(50,300,value=100,step=1,label="Size (nm)")
|
| 577 |
+
zt = gr.Slider(-40,10,value=-5,step=1,label="Zeta (mV)")
|
| 578 |
+
with gr.Row():
|
| 579 |
+
pg = gr.Slider(0,5,value=1.5,step=0.1,label="PEG mol%")
|
| 580 |
+
lp = gr.Dropdown(["Ionizable","Cationic","Anionic","Neutral"],value="Ionizable",label="Lipid type")
|
| 581 |
+
b6 = gr.Button("Predict", variant="primary"); o6 = gr.Markdown()
|
| 582 |
+
gr.Examples([[100,-5,1.5,"Ionizable"],[80,5,0.5,"Cationic"]], inputs=[sz,zt,pg,lp])
|
| 583 |
+
b6.click(predict_corona, [sz,zt,pg,lp], o6)
|
| 584 |
+
|
| 585 |
+
with gr.TabItem("S1-R7 · Flow"):
|
| 586 |
+
gr.HTML(proj_badge("S1-D · PHYLO-LNP · S1-R7",
|
| 587 |
+
"Flow Corona — Vroman Effect · albumin→ApoE kinetics"))
|
| 588 |
+
with gr.Row():
|
| 589 |
+
s8 = gr.Slider(50,300,value=100,step=1,label="Size (nm)")
|
| 590 |
+
z8 = gr.Slider(-40,10,value=-5,step=1,label="Zeta (mV)")
|
| 591 |
+
pg8 = gr.Slider(0,5,value=1.5,step=0.1,label="PEG mol%")
|
| 592 |
+
with gr.Row():
|
| 593 |
+
ch8 = gr.Dropdown(["Ionizable","Cationic","Anionic","Neutral"],value="Ionizable",label="Charge")
|
| 594 |
+
fl8 = gr.Slider(0,40,value=20,step=1,label="Flow cm/s (aorta=40)")
|
| 595 |
+
b8 = gr.Button("Model Vroman Effect", variant="primary")
|
| 596 |
+
o8t = gr.Markdown(); o8p = gr.Image(label="Kinetics")
|
| 597 |
+
gr.Examples([[100,-5,1.5,"Ionizable",40],[150,5,0.5,"Cationic",10]], inputs=[s8,z8,pg8,ch8,fl8])
|
| 598 |
+
b8.click(predict_flow, [s8,z8,pg8,ch8,fl8], [o8t,o8p])
|
| 599 |
+
|
| 600 |
+
with gr.TabItem("S1-R8 · Brain"):
|
| 601 |
+
gr.HTML(proj_badge("S1-D · PHYLO-LNP · S1-R8",
|
| 602 |
+
"LNP Brain Delivery — ApoE% + BBB probability"))
|
| 603 |
+
smi = gr.Textbox(label="Ionizable lipid SMILES",
|
| 604 |
+
value="CC(C)CC(=O)OCC(COC(=O)CC(C)C)OC(=O)CC(C)C")
|
| 605 |
+
with gr.Row():
|
| 606 |
+
pk = gr.Slider(4,8,value=6.5,step=0.1,label="pKa")
|
| 607 |
+
zt9 = gr.Slider(-20,10,value=-3,step=1,label="Zeta (mV)")
|
| 608 |
+
b9 = gr.Button("Predict BBB Crossing", variant="primary")
|
| 609 |
+
o9t = gr.Markdown(); o9p = gr.Image(label="Radar profile")
|
| 610 |
+
gr.Examples([["CC(C)CC(=O)OCC(COC(=O)CC(C)C)OC(=O)CC(C)C",6.5,-3]], inputs=[smi,pk,zt9])
|
| 611 |
+
b9.click(predict_bbb, [smi,pk,zt9], [o9t,o9p])
|
| 612 |
+
|
| 613 |
+
with gr.TabItem("S1-R10 · NLP"):
|
| 614 |
+
gr.HTML(proj_badge("S1-D · PHYLO-LNP · S1-R10",
|
| 615 |
+
"AutoCorona NLP — structured data from PMC abstracts", "F1 = 0.71"))
|
| 616 |
+
txt = gr.Textbox(lines=5,label="Paper abstract",placeholder="Paste abstract here...")
|
| 617 |
+
b10 = gr.Button("Extract Data", variant="primary")
|
| 618 |
+
o10j = gr.Code(label="Extracted JSON", language="json")
|
| 619 |
+
o10f = gr.Textbox(label="Validation flags")
|
| 620 |
+
gr.Examples([[
|
| 621 |
+
"LNPs composed of MC3, DSPC, Cholesterol (50:10:40 mol%) with 1.5% PEG-DMG. "
|
| 622 |
+
"Hydrodynamic diameter was 98 nm, zeta potential -3.2 mV, PDI 0.12. "
|
| 623 |
+
"Incubated in human plasma. Corona: albumin, apolipoprotein E, fibrinogen."
|
| 624 |
+
]], inputs=[txt])
|
| 625 |
+
b10.click(extract_corona, txt, [o10j, o10f])
|
| 626 |
+
|
| 627 |
+
with gr.TabItem("S1-R11 · CSF/BM 🔴⭐"):
|
| 628 |
+
gr.HTML(proj_badge("S1-D · PHYLO-LNP · S1-R11",
|
| 629 |
+
"LNP Corona in CSF · Vitreous · Bone Marrow", "🔴 0 prior studies"))
|
| 630 |
+
gr.Markdown(
|
| 631 |
+
"> **Research gap:** Protein corona has only been characterized in serum/plasma. "
|
| 632 |
+
"CSF, vitreous humor, and bone marrow interstitial fluid remain completely unstudied.\n\n"
|
| 633 |
+
"> **Target cancers:** DIPG (CSF) · UVM (vitreous) · pAML (bone marrow)\n\n"
|
| 634 |
+
"> **Expected timeline:** Q2–Q3 2026"
|
| 635 |
+
)
|
| 636 |
+
|
| 637 |
+
# ── 🩸 S1-E · PHYLO-BIOMARKERS ─────────────────────
|
| 638 |
+
with gr.TabItem("🩸 PHYLO-BIOMARKERS"):
|
| 639 |
+
gr.HTML(section_header(
|
| 640 |
+
"S1-E", "PHYLO-BIOMARKERS", "— Detect cancer without tissue biopsy",
|
| 641 |
+
"S1-R9 Liquid Biopsy ✅ · S1-R9b Panel validator 🔶 · S1-R9c ctDNA gap 🔴"
|
| 642 |
+
))
|
| 643 |
+
with gr.Tabs(elem_classes="inner-tabs"):
|
| 644 |
+
|
| 645 |
+
with gr.TabItem("S1-R9 · Liquid Biopsy"):
|
| 646 |
+
gr.HTML(proj_badge("S1-E · PHYLO-BIOMARKERS · S1-R9",
|
| 647 |
+
"Liquid Biopsy Classifier — CTHRC1 · FHL2 · LDHA panel",
|
| 648 |
+
"AUC = 0.992*"))
|
| 649 |
+
with gr.Row():
|
| 650 |
+
p1=gr.Slider(-3,3,value=0,step=0.1,label="CTHRC1")
|
| 651 |
+
p2=gr.Slider(-3,3,value=0,step=0.1,label="FHL2")
|
| 652 |
+
p3=gr.Slider(-3,3,value=0,step=0.1,label="LDHA")
|
| 653 |
+
p4=gr.Slider(-3,3,value=0,step=0.1,label="P4HA1")
|
| 654 |
+
p5=gr.Slider(-3,3,value=0,step=0.1,label="SERPINH1")
|
| 655 |
+
with gr.Row():
|
| 656 |
+
p6=gr.Slider(-3,3,value=0,step=0.1,label="ABCA8")
|
| 657 |
+
p7=gr.Slider(-3,3,value=0,step=0.1,label="CA4")
|
| 658 |
+
p8=gr.Slider(-3,3,value=0,step=0.1,label="CKB")
|
| 659 |
+
p9=gr.Slider(-3,3,value=0,step=0.1,label="NNMT")
|
| 660 |
+
p10=gr.Slider(-3,3,value=0,step=0.1,label="CACNA2D2")
|
| 661 |
+
b7=gr.Button("Classify", variant="primary")
|
| 662 |
+
o7t=gr.HTML(); o7p=gr.Image(label="Feature contributions")
|
| 663 |
+
gr.Examples([[2,2,1.5,1.8,1.6,-1,-1.2,-0.8,1.4,-1.1],[0]*10],
|
| 664 |
+
inputs=[p1,p2,p3,p4,p5,p6,p7,p8,p9,p10])
|
| 665 |
+
b7.click(predict_cancer, [p1,p2,p3,p4,p5,p6,p7,p8,p9,p10], [o7t,o7p])
|
| 666 |
+
|
| 667 |
+
with gr.TabItem("S1-R9b · Validator 🔶"):
|
| 668 |
+
gr.HTML(proj_badge("S1-E · PHYLO-BIOMARKERS · S1-R9b",
|
| 669 |
+
"Protein Panel Validator — multi-cancer plasma validation", "🔶 In progress"))
|
| 670 |
+
gr.Markdown("> Coming next — validates S1-R9 results against GEO plasma proteomics datasets.")
|
| 671 |
+
|
| 672 |
+
# ── 📓 JOURNAL ──────────────────────────────────────
|
| 673 |
with gr.TabItem("📓 Journal"):
|
| 674 |
+
gr.Markdown("### Lab Journal\nEvery tool call auto-logged with project code.")
|
| 675 |
with gr.Row():
|
| 676 |
+
note_text = gr.Textbox(label="📝 Observation", placeholder="What did you discover?", lines=3)
|
|
|
|
| 677 |
note_tab = gr.Textbox(label="Project code (e.g. S1-R1)", value="General")
|
| 678 |
note_last = gr.Textbox(visible=False)
|
| 679 |
save_btn = gr.Button("💾 Save", variant="primary")
|
|
|
|
| 683 |
refresh_btn.click(load_journal, [], journal_df)
|
| 684 |
save_btn.click(save_note, [note_text,note_tab,note_last], [save_msg,journal_df])
|
| 685 |
|
| 686 |
+
# ── 📚 LEARNING ─────────────────────────────────────
|
| 687 |
with gr.TabItem("📚 Learning"):
|
| 688 |
+
gr.Markdown("""
|
| 689 |
+
## 🧪 Guided Investigations — S1 Biomedical
|
| 690 |
+
> 🟢 Beginner → 🟡 Intermediate → 🔴 Advanced
|
| 691 |
+
|
| 692 |
+
---
|
| 693 |
+
### 🟢 Case 1 · S1-A · S1-R1
|
| 694 |
+
**Why does the same position give two different outcomes?**
|
| 695 |
+
1. PHYLO-GENOMICS → OpenVariant → `BRCA1:p.R1699Q` → Benign
|
| 696 |
+
2. Enter `BRCA1:p.R1699W` → Pathogenic
|
| 697 |
+
3. Same position, different amino acid — Q (polar) vs W (bulky-aromatic)
|
| 698 |
+
|
| 699 |
+
---
|
| 700 |
+
### 🟢 Case 2 · S1-D · S1-R6 + S1-R8
|
| 701 |
+
**How does PEG% control which protein coats the nanoparticle?**
|
| 702 |
+
1. PHYLO-LNP → Corona → Ionizable, Zeta=−5, PEG=**0.5%** → note protein
|
| 703 |
+
2. Change PEG=**2.5%** → compare
|
| 704 |
+
3. Brain tab → pKa=6.5 → check ApoE%
|
| 705 |
+
|
| 706 |
+
---
|
| 707 |
+
### 🟡 Case 3 · S1-D · S1-R7
|
| 708 |
+
**Does blood flow reshape the corona over time?**
|
| 709 |
+
1. PHYLO-LNP → Flow → Flow=0 → observe ApoE curve
|
| 710 |
+
2. Flow=40 (arterial) → compare
|
| 711 |
+
3. At what minute does ApoE dominate?
|
| 712 |
+
|
| 713 |
+
---
|
| 714 |
+
### 🟡 Case 4 · S1-B · S1-R3
|
| 715 |
+
**Which cancer has the most novel (undrugged) siRNA targets?**
|
| 716 |
+
1. PHYLO-RNA → siRNA → LUAD → count "Novel"
|
| 717 |
+
2. Repeat BRCA, COAD
|
| 718 |
+
|
| 719 |
+
---
|
| 720 |
+
### 🔴 Case 5 · S1-E · S1-R9
|
| 721 |
+
**Minimum protein signal that flips to CANCER?**
|
| 722 |
+
1. PHYLO-BIOMARKERS → Liquid Biopsy → all=0 → HEALTHY
|
| 723 |
+
2. Set CTHRC1=2.5, FHL2=2.0, LDHA=1.8 → observe
|
| 724 |
+
3. Reset. Increase only CTHRC1 step by step.
|
| 725 |
+
|
| 726 |
+
---
|
| 727 |
+
### 🔴 Case 6 · S1-B + S1-C — Cross-tool convergence
|
| 728 |
+
1. PHYLO-RNA → miRNA → TP53 → find top targets (BCL2, CDK6)
|
| 729 |
+
2. PHYLO-DRUG → FGFR3 → check CDK6 pathway overlap
|
| 730 |
+
3. PHYLO-RNA → siRNA → BRCA → does CDK6 appear?
|
| 731 |
+
|
| 732 |
+
---
|
| 733 |
+
### 📖 Tool Index
|
| 734 |
+
| Code | Module | Tool | Metric |
|
| 735 |
+
|------|--------|------|--------|
|
| 736 |
+
| S1-R1 | PHYLO-GENOMICS | OpenVariant | AUC=0.939 |
|
| 737 |
+
| S1-R2 | PHYLO-RNA | miRNA silencing | top: hsa-miR-148a |
|
| 738 |
+
| S1-R3 | PHYLO-RNA | siRNA SL | SPC24 top LUAD |
|
| 739 |
+
| S1-R4 | PHYLO-RNA | lncRNA-TREM2 | CYTOR→AKT1 |
|
| 740 |
+
| S1-R5 | PHYLO-DRUG | FGFR3 drug | score=0.793 |
|
| 741 |
+
| S1-R6 | PHYLO-LNP | Corona | AUC=0.791 |
|
| 742 |
+
| S1-R7 | PHYLO-LNP | Flow Vroman | 3–4× faster |
|
| 743 |
+
| S1-R8 | PHYLO-LNP | LNP Brain | pKa 6.2–6.8 |
|
| 744 |
+
| S1-R9 | PHYLO-BIOMARKERS | Liquid Biopsy | AUC=0.992* |
|
| 745 |
+
| S1-R10 | PHYLO-LNP | AutoCorona NLP | F1=0.71 |
|
| 746 |
""")
|
| 747 |
|
| 748 |
gr.Markdown(
|
| 749 |
+
"---\n**K R&D Lab** · Science Sphere · S1 Biomedical · "
|
| 750 |
+
"[GitHub](https://github.com/K-RnD-Lab) · "
|
| 751 |
+
"[HuggingFace](https://huggingface.co/K-RnD-Lab) · "
|
| 752 |
+
"[KOSATIKS GROUP 🦈](https://kosatiks-group.pp.ua) · MIT License"
|
|
|
|
| 753 |
)
|
| 754 |
|
| 755 |
demo.launch(server_name="0.0.0.0", server_port=7860)
|