Update app.py
Browse files
app.py
CHANGED
|
@@ -456,8 +456,8 @@ with gr.Blocks(css=css, title="K R&D Lab") as demo:
|
|
| 456 |
hgvs = gr.Textbox(label="HGVS notation", placeholder="BRCA1:p.R1699Q")
|
| 457 |
gr.Markdown("**Or enter scores manually:**")
|
| 458 |
with gr.Row():
|
| 459 |
-
sift = gr.Slider(0, 1, value=0.5,
|
| 460 |
-
pp = gr.Slider(0, 1, value=0.5,
|
| 461 |
gn = gr.Slider(0, 0.01, value=0.001, step=0.0001, label="gnomAD AF")
|
| 462 |
b5 = gr.Button("Predict Pathogenicity", variant="primary")
|
| 463 |
o5 = gr.HTML(label="Result")
|
|
@@ -527,7 +527,7 @@ with gr.Blocks(css=css, title="K R&D Lab") as demo:
|
|
| 527 |
smi = gr.Textbox(label="Ionizable lipid SMILES",
|
| 528 |
value="CC(C)CC(=O)OCC(COC(=O)CC(C)C)OC(=O)CC(C)C")
|
| 529 |
with gr.Row():
|
| 530 |
-
pk = gr.Slider(4, 8,
|
| 531 |
zt9 = gr.Slider(-20, 10, value=-3, step=1, label="Zeta (mV)")
|
| 532 |
b9 = gr.Button("Predict BBB Crossing", variant="primary")
|
| 533 |
o9t = gr.Markdown()
|
|
@@ -562,7 +562,7 @@ with gr.Blocks(css=css, title="K R&D Lab") as demo:
|
|
| 562 |
save_msg = gr.Markdown()
|
| 563 |
journal_df = gr.Dataframe(
|
| 564 |
label="📋 Full History",
|
| 565 |
-
value=load_journal,
|
| 566 |
interactive=False)
|
| 567 |
refresh_btn = gr.Button("🔄 Refresh")
|
| 568 |
refresh_btn.click(load_journal, [], journal_df)
|
|
|
|
| 456 |
hgvs = gr.Textbox(label="HGVS notation", placeholder="BRCA1:p.R1699Q")
|
| 457 |
gr.Markdown("**Or enter scores manually:**")
|
| 458 |
with gr.Row():
|
| 459 |
+
sift = gr.Slider(0, 1, value=0.5, step=0.01, label="SIFT (0=damaging)")
|
| 460 |
+
pp = gr.Slider(0, 1, value=0.5, step=0.01, label="PolyPhen-2")
|
| 461 |
gn = gr.Slider(0, 0.01, value=0.001, step=0.0001, label="gnomAD AF")
|
| 462 |
b5 = gr.Button("Predict Pathogenicity", variant="primary")
|
| 463 |
o5 = gr.HTML(label="Result")
|
|
|
|
| 527 |
smi = gr.Textbox(label="Ionizable lipid SMILES",
|
| 528 |
value="CC(C)CC(=O)OCC(COC(=O)CC(C)C)OC(=O)CC(C)C")
|
| 529 |
with gr.Row():
|
| 530 |
+
pk = gr.Slider(4, 8, value=6.5, step=0.1, label="pKa")
|
| 531 |
zt9 = gr.Slider(-20, 10, value=-3, step=1, label="Zeta (mV)")
|
| 532 |
b9 = gr.Button("Predict BBB Crossing", variant="primary")
|
| 533 |
o9t = gr.Markdown()
|
|
|
|
| 562 |
save_msg = gr.Markdown()
|
| 563 |
journal_df = gr.Dataframe(
|
| 564 |
label="📋 Full History",
|
| 565 |
+
value=load_journal(),
|
| 566 |
interactive=False)
|
| 567 |
refresh_btn = gr.Button("🔄 Refresh")
|
| 568 |
refresh_btn.click(load_journal, [], journal_df)
|