Spaces:
Sleeping
Sleeping
| from __future__ import annotations | |
| from pathlib import Path | |
| import time | |
| from biotite.application.autodock import VinaApp | |
| import gradio as gr | |
| from gradio_molecule3d import Molecule3D | |
| from gradio_molecule2d import molecule2d | |
| import numpy as np | |
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| import pandas as pd | |
| from biotite.structure import centroid, from_template | |
| from biotite.structure.io import load_structure | |
| from biotite.structure.io.mol import MOLFile, SDFile | |
| from biotite.structure.io.pdb import PDBFile | |
| from plinder.eval.docking.write_scores import evaluate | |
| EVAL_METRICS = ["system", "LDDT-PLI", "LDDT-LP", "BISY-RMSD"] | |
| def vina( | |
| ligand, receptor, pocket_center, output_folder: Path, size=10, max_num_poses=5 | |
| ): | |
| app = VinaApp( | |
| ligand, | |
| receptor, | |
| center=pocket_center, | |
| size=[size, size, size], | |
| ) | |
| app.set_max_number_of_models(max_num_poses) | |
| app.start() | |
| app.join() | |
| docked_ligand = from_template(ligand, app.get_ligand_coord()) | |
| docked_ligand = docked_ligand[..., ~np.isnan(docked_ligand.coord[0]).any(axis=-1)] | |
| output_files = [] | |
| for i in range(max_num_poses): | |
| sdf_file = MOLFile() | |
| sdf_file.set_structure(docked_ligand[i]) | |
| output_file = output_folder / f"docked_ligand_{i}.sdf" | |
| sdf_file.write(output_file) | |
| output_files.append(output_file) | |
| return output_files | |
| def predict( | |
| input_sequence: str, | |
| input_ligand: str, | |
| input_msa: gr.File | None = None, | |
| input_protein: gr.File | None = None, | |
| max_num_poses: int = 1, | |
| ): | |
| """ | |
| Main prediction function that calls ligsite and smina | |
| Parameters | |
| ---------- | |
| input_sequence: str | |
| monomer sequence | |
| input_ligand: str | |
| ligand as SMILES string | |
| input_msa: gradio.File | None | |
| Gradio file object to MSA a3m file | |
| input_protein: gradio.File | None | |
| Gradio file object to monomer protein structure as CIF file | |
| max_num_poses: int | |
| Number of poses to generate | |
| Returns | |
| ------- | |
| output_structures: tuple | |
| (output_protein, output_ligand_sdf) | |
| run_time: float | |
| run time of the program | |
| """ | |
| start_time = time.time() | |
| if input_protein is None: | |
| raise gr.Error("need input_protein") | |
| print(input_protein) | |
| ligand_file = Path(input_protein).parent / "ligand.sdf" | |
| print(ligand_file) | |
| conformer = Chem.AddHs(Chem.MolFromSmiles(input_ligand)) | |
| AllChem.EmbedMolecule(conformer) | |
| AllChem.MMFFOptimizeMolecule(conformer) | |
| Chem.SDWriter(ligand_file).write(conformer) | |
| ligand = SDFile.read(ligand_file).record.get_structure() | |
| receptor = load_structure(input_protein, include_bonds=True) | |
| docking_poses = vina( | |
| ligand, | |
| receptor, | |
| centroid(receptor), | |
| Path(input_protein).parent, | |
| max_num_poses=max_num_poses, | |
| ) | |
| end_time = time.time() | |
| run_time = end_time - start_time | |
| pdb_file = PDBFile() | |
| pdb_file.set_structure(receptor) | |
| output_pdb = Path(input_protein).parent / "receptor.pdb" | |
| pdb_file.write(output_pdb) | |
| return [str(output_pdb), str(docking_poses[0])], run_time | |
| def get_metrics( | |
| system_id: str, | |
| receptor_file: Path, | |
| ligand_file: Path, | |
| flexible: bool = True, | |
| posebusters: bool = True, | |
| ) -> tuple[pd.DataFrame, float]: | |
| start_time = time.time() | |
| metrics = pd.DataFrame( | |
| [ | |
| evaluate( | |
| model_system_id=system_id, | |
| reference_system_id=system_id, | |
| receptor_file=receptor_file, | |
| ligand_file_list=[Path(ligand_file)], | |
| flexible=flexible, | |
| posebusters=posebusters, | |
| posebusters_full=False, | |
| ).get("LIG_0", {}) | |
| ] | |
| ) | |
| if posebusters: | |
| metrics["posebusters"] = metrics[ | |
| [col for col in metrics.columns if col.startswith("posebusters_")] | |
| ].sum(axis=1) | |
| metrics["posebusters_valid"] = metrics[ | |
| [col for col in metrics.columns if col.startswith("posebusters_")] | |
| ].sum(axis=1) == 20 | |
| columns = ["reference", "lddt_pli_ave", "lddt_lp_ave", "bisy_rmsd_ave"] | |
| if flexible: | |
| columns.extend(["lddt", "bb_lddt"]) | |
| if posebusters: | |
| columns.extend([col for col in metrics.columns if col.startswith("posebusters")]) | |
| metrics = metrics[columns].copy() | |
| mapping = { | |
| "lddt_pli_ave": "LDDT-PLI", | |
| "lddt_lp_ave": "LDDT-LP", | |
| "bisy_rmsd_ave": "BISY-RMSD", | |
| "reference": "system", | |
| } | |
| if flexible: | |
| mapping["lddt"] = "LDDT" | |
| mapping["bb_lddt"] = "Backbone LDDT" | |
| if posebusters: | |
| mapping["posebusters"] = "PoseBusters #checks" | |
| mapping["posebusters_valid"] = "PoseBusters valid" | |
| metrics.rename( | |
| columns=mapping, | |
| inplace=True, | |
| ) | |
| end_time = time.time() | |
| run_time = end_time - start_time | |
| return metrics, run_time | |
| with gr.Blocks() as app: | |
| with gr.Tab("🧬 Vina"): | |
| gr.Markdown( | |
| "Example model using Vina to dock the ligand with the pocket center defined by the centroid of the input protein." | |
| ) | |
| with gr.Row(): | |
| input_sequence = gr.Textbox(lines=3, label="Input Protein sequence (FASTA)") | |
| input_ligand = gr.Textbox(lines=3, label="Input ligand SMILES") | |
| input_msa = gr.File(label="Input MSA (a3m)") | |
| input_protein = gr.File(label="Input protein monomer (CIF)") | |
| max_num_poses = gr.Slider( | |
| 1, 10, value=1, label="Max number of poses to generate" | |
| ) | |
| inference_btn = gr.Button("Run Inference") | |
| gr.Examples( | |
| [ | |
| [ | |
| "QECTKFKVSSCRECIESGPGCTWCQKLNFTGPGDPDSIRCDTRPQLLMRGCAADDIMDPTSLAETQEDHNGGQKQLSPQKVTLYLRPGQAAAFNVTFRRAKGYPIDLYYLMDLSYSMLDDLRNVKKLGGDLLRALNEITESGRIGFGSFVDKTVLPFVNTHPDKLRNPCPNKEKECQPPFAFRHVLKLTDNSNQFQTEVGKQLISGNLDAPEGGLDAMMQVAACPEEIGWRKVTRLLVFATDDGFHFAGDGKLGAILTPNDGRCHLEDNLYKRSNEFDYPSVGQLAHKLAENNIQPIFAVTSRMVKTYEKLTEIIPKSAVGELSEDSSNVVQLIKNAYNKLSSRVFLDHNALPDTLKVTYDSFCSNGVTHRNQPRGDCDGVQINVPITFQVKVTATECIQEQSFVIRALGFTDIVTVQVLPQCECRCRDQSRDRSLCHGKGFLECGICRCDTGYIGKNCECQTQGRSSQELEGSCRKDNNSIICSGLGDCVCGQCLCHTSDVPGKLIYGQYCECDTINCERYNGQVCGGPGRGLCFCGKCRCHPGFEGSACQCERTTEGCLNPRRVECSGRGRCRCNVCECHSGYQLPLCQECPGCPSPCGKYISCAECLKFEKGPFGKNCSAACPGLQLSNNPVKGRTCKERDSEGCWVAYTLEQQDGMDRYLIYVDESRECCGGPAALQTLFQG", | |
| "CC(=O)N[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)CO[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O", | |
| "input_protein_test.cif", | |
| "input_protein_test.cif", | |
| ], | |
| ], | |
| [input_sequence, input_ligand, input_msa, input_protein], | |
| ) | |
| reps = [ | |
| { | |
| "model": 0, | |
| "style": "cartoon", | |
| "color": "whiteCarbon", | |
| }, | |
| { | |
| "model": 0, | |
| "resname": "UNK", | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| { | |
| "model": 0, | |
| "resname": "LIG", | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| { | |
| "model": 1, | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| ] | |
| # smiles = molecule2d(input_ligand) | |
| out = Molecule3D(reps=reps) | |
| run_time = gr.Textbox(label="Runtime") | |
| inference_btn.click( | |
| predict, | |
| inputs=[ | |
| input_sequence, | |
| input_ligand, | |
| input_msa, | |
| input_protein, | |
| max_num_poses, | |
| ], | |
| outputs=[out, run_time], | |
| ) | |
| with gr.Tab("⚖️ PLINDER evaluation template"): | |
| with gr.Row(): | |
| with gr.Column(): | |
| input_system_id = gr.Textbox(label="PLINDER system ID") | |
| input_receptor_file = gr.File(label="Receptor file (CIF)") | |
| input_ligand_file = gr.File(label="Ligand file (SDF)") | |
| flexible = gr.Checkbox(label="Flexible docking", value=True) | |
| posebusters = gr.Checkbox(label="PoseBusters", value=True) | |
| eval_btn = gr.Button("Run Evaluation") | |
| gr.Examples( | |
| [ | |
| [ | |
| "4neh__1__1.B__1.H", | |
| "input_protein_test.cif", | |
| "input_ligand_test.sdf", | |
| True, | |
| True, | |
| ], | |
| ], | |
| [input_system_id, input_receptor_file, input_ligand_file, flexible, posebusters], | |
| ) | |
| reps = [ | |
| { | |
| "model": 0, | |
| "style": "cartoon", | |
| "color": "whiteCarbon", | |
| }, | |
| { | |
| "model": 0, | |
| "resname": "UNK", | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| { | |
| "model": 0, | |
| "resname": "LIG", | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| { | |
| "model": 1, | |
| "style": "stick", | |
| "color": "greenCarbon", | |
| }, | |
| ] | |
| # pred_native = Molecule3D(reps=reps, config={"backgroundColor": "black"}) | |
| eval_run_time = gr.Textbox(label="Evaluation runtime") | |
| metric_table = gr.DataFrame( | |
| pd.DataFrame([], columns=EVAL_METRICS), label="Evaluation metrics" | |
| ) | |
| eval_btn.click( | |
| get_metrics, | |
| inputs=[input_system_id, input_receptor_file, input_ligand_file, flexible, posebusters], | |
| outputs=[metric_table, eval_run_time], | |
| ) | |
| app.launch() | |