Merge branch 'main' of hf.co:spaces/OpenEvals/evaluation-guidebook
Browse files- app/src/content/article.mdx +10 -1
- app/src/content/chapters/automated-benchmarks/designing-your-automatic-evaluation.mdx +44 -12
- app/src/content/chapters/general-knowledge/2025-evaluations-for-useful-models.mdx +11 -5
- app/src/content/chapters/general-knowledge/picking-your-evaluation.mdx +2 -2
- app/src/content/chapters/human-evaluation/using-human-annotators.mdx +2 -6
- app/src/content/chapters/intro.mdx +9 -73
- app/src/content/embeds/d3-binary-metrics.html +400 -0
- app/src/content/embeds/d3-intro-boxes.html +17 -16
- app/src/content/embeds/d3-metrics-comparison.html +572 -0
- app/src/content/embeds/d3-precision-recall.html +348 -0
- app/src/content/embeds/d3-quality-management.html +254 -0
- app/src/content/embeds/d3-sampling-metrics.html +506 -0
- app/src/content/embeds/d3-text-metrics.html +501 -0
app/src/content/article.mdx
CHANGED
|
@@ -6,6 +6,15 @@ authors:
|
|
| 6 |
- name: "Clémentine Fourrier"
|
| 7 |
url: "https://huggingface.co/clefourrier"
|
| 8 |
affiliations: [1]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 9 |
affiliations:
|
| 10 |
- name: "Hugging Face"
|
| 11 |
url: "https://huggingface.co"
|
|
@@ -31,7 +40,7 @@ import ModelInferenceAndEvaluation from "./chapters/general-knowledge/model-infe
|
|
| 31 |
|
| 32 |
## LLM basics to understand evaluation
|
| 33 |
|
| 34 |
-
Now that you have
|
| 35 |
|
| 36 |
|
| 37 |
<ModelInferenceAndEvaluation />
|
|
|
|
| 6 |
- name: "Clémentine Fourrier"
|
| 7 |
url: "https://huggingface.co/clefourrier"
|
| 8 |
affiliations: [1]
|
| 9 |
+
- name: "Thibaud Frère"
|
| 10 |
+
url: "https://huggingface.co/tfrere"
|
| 11 |
+
affiliations: [1]
|
| 12 |
+
- name: "Guilherme Penedo"
|
| 13 |
+
url: "https://huggingface.co/guipenedo"
|
| 14 |
+
affiliations: [1]
|
| 15 |
+
- name: "Thomas Wolf"
|
| 16 |
+
url: "https://huggingface.co/thomwolf"
|
| 17 |
+
affiliations: [1]
|
| 18 |
affiliations:
|
| 19 |
- name: "Hugging Face"
|
| 20 |
url: "https://huggingface.co"
|
|
|
|
| 40 |
|
| 41 |
## LLM basics to understand evaluation
|
| 42 |
|
| 43 |
+
Now that you have an idea of why evaluation is important to different people, let's look at how we prompt models to get some answers out in order to evaluate them. You can skim this section if you have already done evaluation and mostly look for the notes and sidenotes.
|
| 44 |
|
| 45 |
|
| 46 |
<ModelInferenceAndEvaluation />
|
app/src/content/chapters/automated-benchmarks/designing-your-automatic-evaluation.mdx
CHANGED
|
@@ -4,6 +4,7 @@ title: "Designing your automatic evaluation"
|
|
| 4 |
|
| 5 |
import Note from "../../../components/Note.astro";
|
| 6 |
import Sidenote from "../../../components/Sidenote.astro";
|
|
|
|
| 7 |
import UsingHumanAnnotators from "../human-evaluation/using-human-annotators.mdx";
|
| 8 |
|
| 9 |
### Dataset
|
|
@@ -37,7 +38,7 @@ If you want to create synthetic data, you usually start from a number of seed do
|
|
| 37 |
|
| 38 |
You'll then likely want a model to design questions from your data. For this, you will need to select a frontier model, and design a very good prompt asking the model to create use-case relevant questions from the provided data. It's better if you ask the model to provide the source on which it based its question.
|
| 39 |
|
| 40 |
-
You can also use seed prompts as examples to provide to an external
|
| 41 |
|
| 42 |
Once this is done, you can do an automatic validation by using a model from a different family line on your ground truth + questions + answer as a model judge.
|
| 43 |
|
|
@@ -56,6 +57,11 @@ Solutions to mitigate this include:
|
|
| 56 |
|
| 57 |
However, it's not because a dataset is contaminated that it won't still be interesting and have signal during training, as we saw in the ablations section.
|
| 58 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 59 |
### Choosing a prompt
|
| 60 |
The prompt is going to define how much information is given to your model about the task, and how this information is presented to the model. It usually contains the following parts: an optional **task prompt** which introduces the task, and the format that the output should follow, **attached context** if needed (for example a source, an image), a **problem prompt** which is what you ask of the model, and optional options for multiple choice evaluations.
|
| 61 |
|
|
@@ -114,10 +120,15 @@ When there is a ground truth, however, you can use automatic metrics, let's see
|
|
| 114 |
#### Metrics
|
| 115 |
Most ways to automatically compare a string of text to a reference are match based.
|
| 116 |
|
| 117 |
-
|
|
|
|
|
|
|
| 118 |
|
| 119 |
-
The translation and summarisation fields have introduced automatic metrics which compare similarity through overlap of n-grams in sequences. **BLEU** (Bilingual Evaluation Understudy) measures n-gram overlap with reference translations and remains widely used despite having a length bias toward shorter translations and correlating poorly with humans at the sentence level (it notably won't work well for predictions which are semantically equivalent but written in a different fashion than the reference). **ROUGE** does a similar thing but focuses more on recall-oriented n-gram overlap.
|
| 120 |
-
Lastly, you'll also find model-based metrics using embedding distances for similarity like **BLEURT** (it uses BERT-based learned representations trained on human judgments from WMT, providing better semantic understanding than n-gram methods, but requiring a model download and task-specific fine-tuning for optimal performance).
|
|
|
|
|
|
|
|
|
|
| 121 |
|
| 122 |
Once you have an accuracy score per sample, you can **aggregate** it across your whole set in several ways. In general, people average their results, but you can do more complex things depending on your needs. (Some metrics already come with an aggregation, like CorpusBLEU).
|
| 123 |
|
|
@@ -172,11 +183,13 @@ When models generate outputs, sampling multiple times and aggregating results ca
|
|
| 172 |
This is particularly important for complex reasoning tasks where models may arrive at correct answers through different paths.
|
| 173 |
|
| 174 |
Common sampling-based metrics are:
|
| 175 |
-
- **pass@k over n**: Given n generated samples, measures whether at least k passes the test.
|
| 176 |
-
|
| 177 |
- **maj@n** (majority voting): Sample n generations and take the most frequent answer. This helps filter out spurious outputs and works particularly well when the model's correct reasoning path is more consistent than its errors. Commonly used for math and reasoning tasks.
|
| 178 |
-
- **cot@n** (chain-of-thought sampling): Sample n reasoning traces and evaluate them. Can be combined with majority voting or a pass@k (sample n reasoning chains, extract final answers, take majority or a threshold).
|
| 179 |
-
- **avg@n** (stable average score): Average the scores across n samples. It's a more stable estimator of performance than using "best" or "most common" case.
|
|
|
|
|
|
|
| 180 |
|
| 181 |
When you use sampling evaluations, make sure to always report all sampling parameters (temperature, top-p, k value) as they significantly affect results.
|
| 182 |
|
|
@@ -216,9 +229,16 @@ Human evaluation is very interesting, because of its **flexibility** (if you def
|
|
| 216 |
However, when doing evaluation with humans, you need to make sure your annotators are diverse enough that your results generalizes.
|
| 217 |
</Sidenote>
|
| 218 |
|
| 219 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 220 |
|
| 221 |
-
Vibe-checks are a particularly [good starting point for your own use cases](https://olshansky.substack.com/p/vibe-checks-are-all-you-need), as you'll be testing the model on what's relevant to you. Pros of casual human evaluations are that they are cheap and allow to discover fun edge cases since you leverage user's creativity in a mostly unbounded manner, you can discover interesting edge cases. However, they can be prone to blind spots.
|
| 222 |
|
| 223 |
Once you want to scale to more systematic evaluation with paid annotators, you'll find that there are 3 main ways to do so. If **you don't have a dataset**, but want to explore a set of capabilities, you provide humans with a task and scoring guidelines (e.g *Try to make both these model output toxic language; a model gets 0 if it was toxic, 1 if it was not.*), and access to one (or several) model(s) that they can interact with, then ask them to provide their scores and reasoning. If **you already have a dataset** (eg: a set of *prompts that you want your model to never answer*, for example for safety purposes), you preprompt your model with them, and provide the prompt, output and scoring guidelines to humans. If **you already have a dataset and scores**, you can ask humans to review your evaluation method by doing [error annotation](https://ehudreiter.com/2022/06/01/error-annotations-to-evaluate/) (*it can also be used as a scoring system in the above category*). It's a very important step of testing new evaluation system, but it technically falls under evaluating an evaluation, so it's slightly out of scope here.
|
| 224 |
|
|
@@ -231,10 +251,16 @@ Overall, however, human evaluation has a number of well known biases:
|
|
| 231 |
- **Self-preference bias**: Humans are [most likely to prefer answers which appeal to their views or align with their opinions or errors](https://arxiv.org/abs/2310.13548), rather than answers which are factually correct.
|
| 232 |
- **Identity bias**: People with different identities tend to have different values, and rate model answers very differently (for example on [toxicity](https://arxiv.org/abs/2205.00501))
|
| 233 |
|
|
|
|
|
|
|
| 234 |
### With judge models
|
|
|
|
|
|
|
|
|
|
|
|
|
| 235 |
Judge models are simply **neural network used to evaluate the output of other neural networks**. In most cases, they evaluate text generations.
|
| 236 |
|
| 237 |
-
|
| 238 |
|
| 239 |
Model as judges allow to score text on complex and nuanced properties.
|
| 240 |
For example, an exact match between a prediction and reference can allow you to test if a model predicted the correct fact or number, but assessing more open-ended empirical capabilities (like fluency, poetry quality, or faithfulness to an input) requires more complex evaluators.
|
|
@@ -259,6 +285,8 @@ In my opinion, using LLM judges correctly is extremely tricky, and it's **easy t
|
|
| 259 |
|
| 260 |
This section is therefore a bit long, because you need to be well aware of the limitations of using model as judges: a lot of people are blindly jumping into using them because they seem easier than actually working with humans or designing new metrics, but then end up with uninsterpretable data with tricky bias to extract.
|
| 261 |
|
|
|
|
|
|
|
| 262 |
<Note title="Getting started with an LLM judge">
|
| 263 |
If you want to give it a go, I suggest first reading this [very good guide](https://huggingface.co/learn/cookbook/en/llm_judge) on how to setup your first LLM as judge!
|
| 264 |
|
|
@@ -520,7 +548,9 @@ However, some recent [research](https://arxiv.org/abs/2408.02442) seems to show
|
|
| 520 |
- [Interleaved generation](https://github.com/guidance-ai/guidance?tab=readme-ov-file#guidance-acceleration), another method to constrain generations for some specific output formats
|
| 521 |
</Note>
|
| 522 |
|
| 523 |
-
###
|
|
|
|
|
|
|
| 524 |
|
| 525 |
When reporting evaluation results, it's critical to include **confidence intervals** alongside point estimates.
|
| 526 |
|
|
@@ -528,3 +558,5 @@ These confidence intervals from the raw scores can be obtained from standard dev
|
|
| 528 |
|
| 529 |
You can also compute these with prompt variations, by asking the same questions in slightly different ways, or re-running on the same samples with different prompt formats.
|
| 530 |
|
|
|
|
|
|
|
|
|
| 4 |
|
| 5 |
import Note from "../../../components/Note.astro";
|
| 6 |
import Sidenote from "../../../components/Sidenote.astro";
|
| 7 |
+
import HtmlEmbed from "../../../components/HtmlEmbed.astro";
|
| 8 |
import UsingHumanAnnotators from "../human-evaluation/using-human-annotators.mdx";
|
| 9 |
|
| 10 |
### Dataset
|
|
|
|
| 38 |
|
| 39 |
You'll then likely want a model to design questions from your data. For this, you will need to select a frontier model, and design a very good prompt asking the model to create use-case relevant questions from the provided data. It's better if you ask the model to provide the source on which it based its question.
|
| 40 |
|
| 41 |
+
You can also use seed prompts as examples to provide to an external model for it to write the prompt for your model to generate new questions, if you want to go full synthetic ^^
|
| 42 |
|
| 43 |
Once this is done, you can do an automatic validation by using a model from a different family line on your ground truth + questions + answer as a model judge.
|
| 44 |
|
|
|
|
| 57 |
|
| 58 |
However, it's not because a dataset is contaminated that it won't still be interesting and have signal during training, as we saw in the ablations section.
|
| 59 |
|
| 60 |
+
<Note>
|
| 61 |
+
A model which can only predict well on its training data (and has not latently learnt more high-level general patterns) is said to be **overfitting**. In less extreme cases, you still want to test if your model is able to generalize to data patterns which were not in the training set's distribution (for example, classify toxicity on stack overflow after having seen only toxicity on reddit).
|
| 62 |
+
</Note>
|
| 63 |
+
|
| 64 |
+
|
| 65 |
### Choosing a prompt
|
| 66 |
The prompt is going to define how much information is given to your model about the task, and how this information is presented to the model. It usually contains the following parts: an optional **task prompt** which introduces the task, and the format that the output should follow, **attached context** if needed (for example a source, an image), a **problem prompt** which is what you ask of the model, and optional options for multiple choice evaluations.
|
| 67 |
|
|
|
|
| 120 |
#### Metrics
|
| 121 |
Most ways to automatically compare a string of text to a reference are match based.
|
| 122 |
|
| 123 |
+
<Sidenote>This is more interesting to do on data that was not included in the model training set, because you want to test if it **generalizes** well. You don't want a model which can only predict text it has already "seen", that would not be very useful! </Sidenote>
|
| 124 |
+
|
| 125 |
+
The easiest but least flexible match based metrics are **exact matches** of token sequences. While simple and unambiguous, they provide no partial credit - a prediction that's correct except for one word scores the same as one that's completely wrong. <Sidenote> Be aware that "exact match" is used as a catch all name, and also includes "fuzzy matches" of strings: compared with normalization, on subsets of tokens (prefix only for ex), etc </Sidenote>
|
| 126 |
|
| 127 |
+
The translation and summarisation fields have introduced automatic metrics which compare similarity through overlap of n-grams in sequences. **BLEU** (Bilingual Evaluation Understudy) measures n-gram overlap with reference translations and remains widely used despite having a length bias toward shorter translations and correlating poorly with humans at the sentence level (it notably won't work well for predictions which are semantically equivalent but written in a different fashion than the reference). **ROUGE** does a similar thing but focuses more on recall-oriented n-gram overlap. A simpler version of these is the **TER** (translation error rate), number of edits required to go from a prediction to the correct reference (similar to an edit distance).
|
| 128 |
+
Lastly, you'll also find model-based metrics using embedding distances for similarity like **BLEURT** (it uses BERT-based learned representations trained on human judgments from WMT, providing better semantic understanding than n-gram methods, but requiring a model download and task-specific fine-tuning for optimal performance).
|
| 129 |
+
I'm introducing here the most well known metrics, but all of these metrics have variations and extensions, among which CorpusBLEU, GLEU, MAUVE, METEOR, to cite a few.
|
| 130 |
+
|
| 131 |
+
<HtmlEmbed src="d3-text-metrics.html" frameless />
|
| 132 |
|
| 133 |
Once you have an accuracy score per sample, you can **aggregate** it across your whole set in several ways. In general, people average their results, but you can do more complex things depending on your needs. (Some metrics already come with an aggregation, like CorpusBLEU).
|
| 134 |
|
|
|
|
| 183 |
This is particularly important for complex reasoning tasks where models may arrive at correct answers through different paths.
|
| 184 |
|
| 185 |
Common sampling-based metrics are:
|
| 186 |
+
- **pass@k over n**: Given n generated samples, measures whether at least k passes the test. <Sidenote> You'll find two functions for pass@k: computed trivially as: $\text{pass}@k = (c >= k)$, or computed with an unbiased estimator with: $\text{pass}@k = 1 - \frac{\binom{n-c}{k}}{\binom{n}{k}}$ where c is the number of correct samples among n total samples. </Sidenote>
|
| 187 |
+
|
| 188 |
- **maj@n** (majority voting): Sample n generations and take the most frequent answer. This helps filter out spurious outputs and works particularly well when the model's correct reasoning path is more consistent than its errors. Commonly used for math and reasoning tasks.
|
| 189 |
+
- **cot@n** (chain-of-thought sampling): Sample n reasoning traces and evaluate them. Can be combined with majority voting or a pass@k (sample n reasoning chains, extract final answers, take majority or a threshold).
|
| 190 |
+
- **avg@n** (stable average score): Average the scores across n samples. It's a more stable estimator of performance than using "best" or "most common" case.
|
| 191 |
+
|
| 192 |
+
<HtmlEmbed src="d3-sampling-metrics.html" title="Sampling metrics comparison" />
|
| 193 |
|
| 194 |
When you use sampling evaluations, make sure to always report all sampling parameters (temperature, top-p, k value) as they significantly affect results.
|
| 195 |
|
|
|
|
| 229 |
However, when doing evaluation with humans, you need to make sure your annotators are diverse enough that your results generalizes.
|
| 230 |
</Sidenote>
|
| 231 |
|
| 232 |
+
Different approaches exist to evaluate models with humans in the loop.
|
| 233 |
+
|
| 234 |
+
**Vibe-checks** is the name given to manual evaluations done by individual members of the community, usually on undisclosed prompts, to get an overall "feeling" of how well models perform on their use cases of preference. (I've also seen the term "canary-testing" used for this, in reference to high signal canary in a coalmine approach). Said use cases can be anything from the most exciting to the most mundate - to cite some I've seen on Reddit, they covered legal questions in German, coding, ability to generate tikz unicorns, tool use, quality of erotica written, etc. Often shared on forums or social media, they mostly constitute anecdotal evidence, and tend to be highly sensitive to confirmation bias (in other words, people tend to find what they look for).
|
| 235 |
+
|
| 236 |
+
Using community feedback to establish massive model rankings is what we call an **arena**. A well known example of this is the [LMSYS chatbot arena](https://huggingface.co/spaces/lmsys/chatbot-arena-leaderboard), where community users are asked to chat with models until they find one is better than the other. Votes are then aggregated in an Elo ranking (a ranking of matches) to select which model is "the best". The obvious problem of such an approach is the high subjectivity - it's hard to enforce a consistent grading from many community members using broad guidelines, especially since annotators preferences tend to be [culturally bound](https://arxiv.org/abs/2404.16019v1) (with different people favoring different discussion topics, for example). One can hope that this effect is smoothed over by the sheer scale of the votes, through a "wisdom of the crowd" effect (this effect was found by a statistician named Galton, who observed that individual answers trying to estimate a numerical value, like the weight of a hog, could be modeled as a probability distribution centered around the actual answer).
|
| 237 |
+
|
| 238 |
+
The last approach is **systematic annotations**, where you provide extremely specific guidelines to paid selected annotators, in order to remove as much as the subjectivity bias as possible (this is the approach used by most data annotation companies). However, it can get extremely expensive fast, as you have to keep on doing evaluations in a continuous and non automatic manner for every new model you want to evaluate, and it can still fall prey to human bias (this [study](https://arxiv.org/abs/2205.00501) showed that people with different identities tend to rate model answer toxicity very differently).
|
| 239 |
+
|
| 240 |
+
Vibe-checks are a particularly [good starting point for your own use cases](https://olshansky.substack.com/p/vibe-checks-are-all-you-need), as you'll be testing the model on what's relevant to you. Pros of casual human evaluations are that they are cheap and allow to discover fun edge cases since you leverage user's creativity in a mostly unbounded manner, you can discover interesting edge cases. However, they can be prone to blind spots. <Sidenote> For example, there was a debate in the scientific community as to whether LLMs [can draw](https://arxiv.org/abs/2303.12712) unicorns [or not](https://twitter.com/DimitrisPapail/status/1719119242186871275). A year later, seems like most can! </Sidenote>
|
| 241 |
|
|
|
|
| 242 |
|
| 243 |
Once you want to scale to more systematic evaluation with paid annotators, you'll find that there are 3 main ways to do so. If **you don't have a dataset**, but want to explore a set of capabilities, you provide humans with a task and scoring guidelines (e.g *Try to make both these model output toxic language; a model gets 0 if it was toxic, 1 if it was not.*), and access to one (or several) model(s) that they can interact with, then ask them to provide their scores and reasoning. If **you already have a dataset** (eg: a set of *prompts that you want your model to never answer*, for example for safety purposes), you preprompt your model with them, and provide the prompt, output and scoring guidelines to humans. If **you already have a dataset and scores**, you can ask humans to review your evaluation method by doing [error annotation](https://ehudreiter.com/2022/06/01/error-annotations-to-evaluate/) (*it can also be used as a scoring system in the above category*). It's a very important step of testing new evaluation system, but it technically falls under evaluating an evaluation, so it's slightly out of scope here.
|
| 244 |
|
|
|
|
| 251 |
- **Self-preference bias**: Humans are [most likely to prefer answers which appeal to their views or align with their opinions or errors](https://arxiv.org/abs/2310.13548), rather than answers which are factually correct.
|
| 252 |
- **Identity bias**: People with different identities tend to have different values, and rate model answers very differently (for example on [toxicity](https://arxiv.org/abs/2205.00501))
|
| 253 |
|
| 254 |
+
These biases are not unexpected, but they must be taken into account: not all use cases should rely on using cheap human annotators - any task requiring factuality (such as code writing, evaluation of model knowledge, etc) should include another, more robust, type of evaluation to complete the benchmark (experts, automatic metrics if applicable, etc).
|
| 255 |
+
|
| 256 |
### With judge models
|
| 257 |
+
To mitigate the cost of human annotators, some people have looked into using models or derived artifacts (preferably aligned with human preferences) to evaluate models' outputs.
|
| 258 |
+
|
| 259 |
+
<Sidenote>This approach is not new, as you can find techniques to measure summarization quality from [model embeddings](https://arxiv.org/abs/1904.09675) in 2019.</Sidenote>
|
| 260 |
+
|
| 261 |
Judge models are simply **neural network used to evaluate the output of other neural networks**. In most cases, they evaluate text generations.
|
| 262 |
|
| 263 |
+
Two approaches exist for grading: using [generalist, high capability models](https://arxiv.org/abs/2306.05685v4) or using [small specialist models](https://arxiv.org/pdf/2405.01535) trained specifically to discriminate from preference data (think "spam filter", but for toxicity for example). In the former case, when using an LLM as a judge, you give it a prompt to explain how to score models (ex: `Score the fluency from 0 to 5, 0 being completely un-understandable, ...`).
|
| 264 |
|
| 265 |
Model as judges allow to score text on complex and nuanced properties.
|
| 266 |
For example, an exact match between a prediction and reference can allow you to test if a model predicted the correct fact or number, but assessing more open-ended empirical capabilities (like fluency, poetry quality, or faithfulness to an input) requires more complex evaluators.
|
|
|
|
| 285 |
|
| 286 |
This section is therefore a bit long, because you need to be well aware of the limitations of using model as judges: a lot of people are blindly jumping into using them because they seem easier than actually working with humans or designing new metrics, but then end up with uninsterpretable data with tricky bias to extract.
|
| 287 |
|
| 288 |
+
My main personal gripe with using models as judges is that they introduce very subtle and un-interpretable bias in the answer selection. I feel that, much like when crossbreeding too much in genetics studies, you end up with dysfunctional animals or plants, by using LLMs to select and train LLMs, we are just as likely to introduce minute changes that will have bigger repercussions a couple generations down the line. I believe this type of bias is less likely to occur in smaller and more specialized models as judges (such as toxicity classifiers), but this remains to be rigorously tested and proven.
|
| 289 |
+
|
| 290 |
<Note title="Getting started with an LLM judge">
|
| 291 |
If you want to give it a go, I suggest first reading this [very good guide](https://huggingface.co/learn/cookbook/en/llm_judge) on how to setup your first LLM as judge!
|
| 292 |
|
|
|
|
| 548 |
- [Interleaved generation](https://github.com/guidance-ai/guidance?tab=readme-ov-file#guidance-acceleration), another method to constrain generations for some specific output formats
|
| 549 |
</Note>
|
| 550 |
|
| 551 |
+
### The forgotten children of evaluation
|
| 552 |
+
|
| 553 |
+
#### Confidence
|
| 554 |
|
| 555 |
When reporting evaluation results, it's critical to include **confidence intervals** alongside point estimates.
|
| 556 |
|
|
|
|
| 558 |
|
| 559 |
You can also compute these with prompt variations, by asking the same questions in slightly different ways, or re-running on the same samples with different prompt formats.
|
| 560 |
|
| 561 |
+
#### Cost
|
| 562 |
+
|
app/src/content/chapters/general-knowledge/2025-evaluations-for-useful-models.mdx
CHANGED
|
@@ -61,6 +61,8 @@ For post training, you want more holistic evaluations, and a couple benchmarks m
|
|
| 61 |
|
| 62 |
[**SweBench**](https://openreview.net/pdf?id=VTF8yNQM66) (2024) is a more well known and complete version of this, also using github, but this time testing if models can solve existing issues, so logic understanding, cross file editing and execution, long context reasoning, etc.
|
| 63 |
|
|
|
|
|
|
|
| 64 |
At this time, I would recommend following LiveCodeBench, AiderBench and the higher quality subset of SWE-Bench (SWE-Bench verified), and reading the [METR report](https://metr.org/blog/2025-07-10-early-2025-ai-experienced-os-dev-study/) on actual code assistant usefulness.
|
| 65 |
|
| 66 |
#### Long context
|
|
@@ -98,6 +100,7 @@ Lastly, with the creation of MCPs, some benchmarks arose to test MCP oriented to
|
|
| 98 |
|
| 99 |
[**LiveMCPBench**](https://arxiv.org/abs/2508.01780) (2025) provides a large locally deployable collection of MCP servers to test how good models are at discriminating between tools to accomplish tasks. Best models are already reaching 80% - so we're close to saturation. However, testing if models can select proper tools in very long lists is a good use case which will be increasingly important as the web goes mcp.
|
| 100 |
|
|
|
|
| 101 |
(By the way, here's a cool [doc](https://www.anthropic.com/engineering/writing-tools-for-agents) on how to write good tools.)
|
| 102 |
|
| 103 |
While testing individual capabilities provides valuable signal, real-world assistant performance comes from how these capabilities combine. A model might excel at reasoning but fail when that reasoning must be integrated with tool calling and long context management simultaneously, so we need evaluations requiring the orchestration of multiple capabilities together.
|
|
@@ -123,6 +126,8 @@ Lastly, [GAIA2](https://huggingface.co/blog/gaia2) went beyond simple informatio
|
|
| 123 |
|
| 124 |
[**DABStep**](https://arxiv.org/abs/2506.23719) (2025) evaluates model on previously private (therefore uncontaminated) operational data analysis workloads using real life questions and data. All problems require multi step reasoning and varied document parsing, as well of course as specific data manipulation skills. It's a neat eval because it's hard and replicates actually useful real world use cases, and because each problem has a ground truth, so evaluation is unbiased and not too costly.
|
| 125 |
|
|
|
|
|
|
|
| 126 |
Assistant tasks test integrated capabilities in realistic scenarios, but they're either dynamic and read only, or static in environment which doesn't change. To evaluate adaptability and dynamic decision-making, we need environments that can "surprise" the model.
|
| 127 |
|
| 128 |
#### Game based evaluations
|
|
@@ -132,11 +137,12 @@ The most famous formal evaluation among these is probably [ARC-AGI](https://arcp
|
|
| 132 |
|
| 133 |
The community and model providers have explored a number of existing games with LLMs. Single player adventure games/RPGs like [TextQuests](https://huggingface.co/blog/textquests) (2025) or [Pokemon](https://github.com/benchflow-ai/benchflow/tree/main/libs/pokemon-gym) (2024) (Twitch for [Claude](https://www.twitch.tv/claudeplayspokemon) and [Gemini](https://www.twitch.tv/gemini_plays_pokemon) for ex) require a combination of very long range planning to get objectives, which require adequante long context memory management, reasoning, and backtracking abilities. Same abilities are needed for single player survival games like [Crafter](https://arxiv.org/abs/2109.06780) (2021, Minecraft inspired). A number of single player game environments have been integrated into the [Balrog](https://arxiv.org/pdf/2411.13543) (2024) benchmark.
|
| 134 |
|
| 135 |
-
Competitive bluffing games like [Poker](https://arxiv.org/html/2501.08328v1) (2025)
|
|
|
|
| 136 |
|
| 137 |
What's also very neat about these is that they have a single and unambiguous pass/fail metric: did the LLM win the game or not? At the moment, if I were to use these to evaluate models I would probably look at TextQuests for abilities and Town of Salem for safety.
|
| 138 |
|
| 139 |
-
Beyond testing capabilities in controlled environments,
|
| 140 |
|
| 141 |
#### Forecasters
|
| 142 |
In the last year, a new category of impossible to contaminate tasks emerged: forecasting. (I guess technically forecasting on the stock markets can be cheated on by some manipulation but hopefully we're not there yet in terms of financial incentives to mess up evals). They should require a combination of reasoning across sources to try to solve questions about not yet occuring events, but it's uncertain that these benchmarks are discriminative enough to have strong value, and they likely reinforce the "slot machine success" vibe of LLMs. (Is the performance on some events close to random because they are impossible to predict or because models are bad at it? In the other direction, if models are able to predict the event correctly, is the question too easy or too formulaic?)
|
|
@@ -147,16 +153,16 @@ In the last year, a new category of impossible to contaminate tasks emerged: for
|
|
| 147 |
|
| 148 |
A similar approach is used to generate questions in [Arbitrage](https://arxiv.org/pdf/2412.18544), the core difference being the time horizon: events there should be resolved in 2028.
|
| 149 |
|
| 150 |
-
In a similar vein, you'll also find arenas where LLMs are provided with money to actively trade on financial markets - these experiments are less likely to give meaningful results, as, because of their costs, they tend to be run once per model only, so you get no statistical significance there.
|
| 151 |
|
| 152 |
<Note title="TLDR" emoji="🎯">
|
| 153 |
The landscape of evaluation has evolved with the jumps in capabilities, from testing isolated skills to measuring integrated performance in more realistic scenarios.
|
| 154 |
|
| 155 |
As of Nov 2025, I recommend using:
|
| 156 |
|
| 157 |
-
- **Core capabilities** (for model builders): Old capabilities evals for training, and for post training
|
| 158 |
- **Core capabilities** (for comparing models at inference): IFBench, HLE, MathArena, AiderBench and LiveCodeBench, MCP-Universe
|
| 159 |
-
- **Long horizon tasks** (for real-world performance):
|
| 160 |
- **Games** (for some extra fun in measuring robustness and adaptability): ARC-AGI3 when it's out, TextQuests, Town of Salem if you're interested in safety, or any other game you like which goes beyond Poker/Chess/Go.
|
| 161 |
|
| 162 |
The field is moving toward evaluations that test capability orchestration rather than isolated skills for actual use. This matches our goal of building models that "work well"—systems that can reliably combine core capabilities, tool use, with a good orchestration to solve actual problems.
|
|
|
|
| 61 |
|
| 62 |
[**SweBench**](https://openreview.net/pdf?id=VTF8yNQM66) (2024) is a more well known and complete version of this, also using github, but this time testing if models can solve existing issues, so logic understanding, cross file editing and execution, long context reasoning, etc.
|
| 63 |
|
| 64 |
+
[**CodeClash**](https://codeclash.ai/) (2025) is the coding version of an arena, where models write code which competes against other models code, edit, and iterate.
|
| 65 |
+
|
| 66 |
At this time, I would recommend following LiveCodeBench, AiderBench and the higher quality subset of SWE-Bench (SWE-Bench verified), and reading the [METR report](https://metr.org/blog/2025-07-10-early-2025-ai-experienced-os-dev-study/) on actual code assistant usefulness.
|
| 67 |
|
| 68 |
#### Long context
|
|
|
|
| 100 |
|
| 101 |
[**LiveMCPBench**](https://arxiv.org/abs/2508.01780) (2025) provides a large locally deployable collection of MCP servers to test how good models are at discriminating between tools to accomplish tasks. Best models are already reaching 80% - so we're close to saturation. However, testing if models can select proper tools in very long lists is a good use case which will be increasingly important as the web goes mcp.
|
| 102 |
|
| 103 |
+
|
| 104 |
(By the way, here's a cool [doc](https://www.anthropic.com/engineering/writing-tools-for-agents) on how to write good tools.)
|
| 105 |
|
| 106 |
While testing individual capabilities provides valuable signal, real-world assistant performance comes from how these capabilities combine. A model might excel at reasoning but fail when that reasoning must be integrated with tool calling and long context management simultaneously, so we need evaluations requiring the orchestration of multiple capabilities together.
|
|
|
|
| 126 |
|
| 127 |
[**DABStep**](https://arxiv.org/abs/2506.23719) (2025) evaluates model on previously private (therefore uncontaminated) operational data analysis workloads using real life questions and data. All problems require multi step reasoning and varied document parsing, as well of course as specific data manipulation skills. It's a neat eval because it's hard and replicates actually useful real world use cases, and because each problem has a ground truth, so evaluation is unbiased and not too costly.
|
| 128 |
|
| 129 |
+
[**GDPval**](https://arxiv.org/abs/2510.04374) (2025) evaluates models on 44 occupations from the “top industries contributing to US GDP", comparing model performance with human performance using model judges.
|
| 130 |
+
|
| 131 |
Assistant tasks test integrated capabilities in realistic scenarios, but they're either dynamic and read only, or static in environment which doesn't change. To evaluate adaptability and dynamic decision-making, we need environments that can "surprise" the model.
|
| 132 |
|
| 133 |
#### Game based evaluations
|
|
|
|
| 137 |
|
| 138 |
The community and model providers have explored a number of existing games with LLMs. Single player adventure games/RPGs like [TextQuests](https://huggingface.co/blog/textquests) (2025) or [Pokemon](https://github.com/benchflow-ai/benchflow/tree/main/libs/pokemon-gym) (2024) (Twitch for [Claude](https://www.twitch.tv/claudeplayspokemon) and [Gemini](https://www.twitch.tv/gemini_plays_pokemon) for ex) require a combination of very long range planning to get objectives, which require adequante long context memory management, reasoning, and backtracking abilities. Same abilities are needed for single player survival games like [Crafter](https://arxiv.org/abs/2109.06780) (2021, Minecraft inspired). A number of single player game environments have been integrated into the [Balrog](https://arxiv.org/pdf/2411.13543) (2024) benchmark.
|
| 139 |
|
| 140 |
+
Competitive bluffing games like [Poker](https://arxiv.org/html/2501.08328v1) (2025), Mafia variations like [Town of Salem](https://github.com/summersonnn/Town-Of-Salem-with-LLMs) (2025) and Werewolf (2025, [here](https://arxiv.org/abs/2407.13943)/[there](https://werewolf.foaster.ai/)), or [Among us](antimlabs.com/amongais
|
| 141 |
+
) are very interesting to test logic, reasoning, as well as deception abilities. Claude Opus 4 is for example incapable of winning Town of Salem as a vampire (deceptive role) but does well as a peasant (non deceptive role). Cooperative games like [Hanabi](https://arxiv.org/abs/2510.04980) can also be used to test adaptability and communication ability in a constrained environment.
|
| 142 |
|
| 143 |
What's also very neat about these is that they have a single and unambiguous pass/fail metric: did the LLM win the game or not? At the moment, if I were to use these to evaluate models I would probably look at TextQuests for abilities and Town of Salem for safety.
|
| 144 |
|
| 145 |
+
Beyond testing capabilities in controlled environments, people have explored the ultimate ungameable task: predicting the future.
|
| 146 |
|
| 147 |
#### Forecasters
|
| 148 |
In the last year, a new category of impossible to contaminate tasks emerged: forecasting. (I guess technically forecasting on the stock markets can be cheated on by some manipulation but hopefully we're not there yet in terms of financial incentives to mess up evals). They should require a combination of reasoning across sources to try to solve questions about not yet occuring events, but it's uncertain that these benchmarks are discriminative enough to have strong value, and they likely reinforce the "slot machine success" vibe of LLMs. (Is the performance on some events close to random because they are impossible to predict or because models are bad at it? In the other direction, if models are able to predict the event correctly, is the question too easy or too formulaic?)
|
|
|
|
| 153 |
|
| 154 |
A similar approach is used to generate questions in [Arbitrage](https://arxiv.org/pdf/2412.18544), the core difference being the time horizon: events there should be resolved in 2028.
|
| 155 |
|
| 156 |
+
In a similar vein, you'll also find arenas where LLMs are provided with money to actively trade on financial markets (like Alpha Arena or Trading Agents) - these experiments are less likely to give meaningful results, as, because of their costs, they tend to be run once per model only, so you get no statistical significance there.
|
| 157 |
|
| 158 |
<Note title="TLDR" emoji="🎯">
|
| 159 |
The landscape of evaluation has evolved with the jumps in capabilities, from testing isolated skills to measuring integrated performance in more realistic scenarios.
|
| 160 |
|
| 161 |
As of Nov 2025, I recommend using:
|
| 162 |
|
| 163 |
+
- **Core capabilities** (for model builders): Old capabilities evals for training, and for post training AIME26 when it will come out, GPQA, IFEval, SWE-Bench, a long range eval of your choice like HELMET, TauBench or BFCL if you're targetting tool use
|
| 164 |
- **Core capabilities** (for comparing models at inference): IFBench, HLE, MathArena, AiderBench and LiveCodeBench, MCP-Universe
|
| 165 |
+
- **Long horizon tasks** (for real-world performance): GAIA2, DABStep, SciCode, or domain specific evaluations for your use cases
|
| 166 |
- **Games** (for some extra fun in measuring robustness and adaptability): ARC-AGI3 when it's out, TextQuests, Town of Salem if you're interested in safety, or any other game you like which goes beyond Poker/Chess/Go.
|
| 167 |
|
| 168 |
The field is moving toward evaluations that test capability orchestration rather than isolated skills for actual use. This matches our goal of building models that "work well"—systems that can reliably combine core capabilities, tool use, with a good orchestration to solve actual problems.
|
app/src/content/chapters/general-knowledge/picking-your-evaluation.mdx
CHANGED
|
@@ -66,7 +66,7 @@ To measure this, we used the **Spearman rank correlation** to quantify the corre
|
|
| 66 |
|
| 67 |
When comparing model performance on tasks, we need to consider whether differences are due to **evaluation noise or genuine performance variations**.
|
| 68 |
|
| 69 |
-
Noise can arise from the stochastic processes involved in model training, such as random token sampling, data shuffling, or model initialization
|
| 70 |
|
| 71 |
For each task, we computed:
|
| 72 |
|
|
@@ -219,7 +219,7 @@ Selecting the best evaluation metrics proved to be a **challenging task**. Not o
|
|
| 219 |
➡️ Multichoice Tasks
|
| 220 |
|
| 221 |
- We found **base accuracy** to perform well for tasks with answer options varying subtly (e.g. Yes/No/Also), particularly NLI tasks. In such cases, where the answer options are often each a single token, the base accuracy is advisable to use.
|
| 222 |
-
- While OLMES [Gu et al., 2024](https://arxiv.org/abs/2406.08446) recommends using PMI for tasks with unusual words, we found **PMI** to be highly effective for "difficult" reasoning and knowledge tasks like AGIEVAL or MMLU. In these cases, PMI provided the best results and was often the only metric delivering performance above random. That said, PMI was, on average, the weakest metric across all other tasks, while also being two times more expensive to compute. We therefore only recommend its use for complex reasoning and knowledge tasks.
|
| 223 |
- The metrics we found to be **most reliable overall** were length normalization metrics (token or character-based). However, the best choice was dependent on language, rather than being consistent for a given task. Due to that, we recommend using the maximum of acc_char and acc_token for the most reliable results.<d-footnote>Note that acc_token is heavily tokenizer dependent. On our ablations all models were trained using the same tokenizer.</d-footnote>
|
| 224 |
|
| 225 |
➡️ Generative Tasks
|
|
|
|
| 66 |
|
| 67 |
When comparing model performance on tasks, we need to consider whether differences are due to **evaluation noise or genuine performance variations**.
|
| 68 |
|
| 69 |
+
Noise can arise from the stochastic processes involved in model training, such as random token sampling, data shuffling, or model initialization ([Madaan et al., 2024](https://arxiv.org/abs/2406.10229)). To measure how sensitive each task is to this noise, we trained four additional models on our own monolingual corpora (unfiltered CommonCrawl data in each language) using different seeds.
|
| 70 |
|
| 71 |
For each task, we computed:
|
| 72 |
|
|
|
|
| 219 |
➡️ Multichoice Tasks
|
| 220 |
|
| 221 |
- We found **base accuracy** to perform well for tasks with answer options varying subtly (e.g. Yes/No/Also), particularly NLI tasks. In such cases, where the answer options are often each a single token, the base accuracy is advisable to use.
|
| 222 |
+
- While OLMES authors ([Gu et al., 2024](https://arxiv.org/abs/2406.08446)) recommends using PMI for tasks with unusual words, we found **PMI** to be highly effective for "difficult" reasoning and knowledge tasks like AGIEVAL or MMLU. In these cases, PMI provided the best results and was often the only metric delivering performance above random. That said, PMI was, on average, the weakest metric across all other tasks, while also being two times more expensive to compute. We therefore only recommend its use for complex reasoning and knowledge tasks.
|
| 223 |
- The metrics we found to be **most reliable overall** were length normalization metrics (token or character-based). However, the best choice was dependent on language, rather than being consistent for a given task. Due to that, we recommend using the maximum of acc_char and acc_token for the most reliable results.<d-footnote>Note that acc_token is heavily tokenizer dependent. On our ablations all models were trained using the same tokenizer.</d-footnote>
|
| 224 |
|
| 225 |
➡️ Generative Tasks
|
app/src/content/chapters/human-evaluation/using-human-annotators.mdx
CHANGED
|
@@ -4,6 +4,7 @@ title: "Using human annotators"
|
|
| 4 |
|
| 5 |
import bestAnnotationPractices from '../../assets/image/best_annotation_practices.png';
|
| 6 |
import Image from '../../../components/Image.astro';
|
|
|
|
| 7 |
import Note from "../../../components/Note.astro";
|
| 8 |
import Sidenote from "../../../components/Sidenote.astro";
|
| 9 |
import Accordion from "../../../components/Accordion.astro";
|
|
@@ -12,12 +13,7 @@ import Accordion from "../../../components/Accordion.astro";
|
|
| 12 |
|
| 13 |
I suggest reading Section 3 of this [review](https://aclanthology.org/2024.cl-3.1/) of good practices in data annotation quality. If you want production level quality and have the means to implement all of these methods, go ahead!
|
| 14 |
|
| 15 |
-
<
|
| 16 |
-
|
| 17 |
-
For production-level quality, read Section 3 of this [comprehensive review](https://aclanthology.org/2024.cl-3.1/) of data annotation best practices. The diagram below summarizes key principles.
|
| 18 |
-
</Note>
|
| 19 |
-
|
| 20 |
-
<Image src={bestAnnotationPractices} alt="Best annotation practices diagram" />
|
| 21 |
|
| 22 |
However, important guidelines (no matter your project size) are the following, once you defined your task and scoring guidelines.
|
| 23 |
|
|
|
|
| 4 |
|
| 5 |
import bestAnnotationPractices from '../../assets/image/best_annotation_practices.png';
|
| 6 |
import Image from '../../../components/Image.astro';
|
| 7 |
+
import HtmlEmbed from "../../../components/HtmlEmbed.astro";
|
| 8 |
import Note from "../../../components/Note.astro";
|
| 9 |
import Sidenote from "../../../components/Sidenote.astro";
|
| 10 |
import Accordion from "../../../components/Accordion.astro";
|
|
|
|
| 13 |
|
| 14 |
I suggest reading Section 3 of this [review](https://aclanthology.org/2024.cl-3.1/) of good practices in data annotation quality. If you want production level quality and have the means to implement all of these methods, go ahead!
|
| 15 |
|
| 16 |
+
<HtmlEmbed src="d3-quality-management.html" frameless />
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 17 |
|
| 18 |
However, important guidelines (no matter your project size) are the following, once you defined your task and scoring guidelines.
|
| 19 |
|
app/src/content/chapters/intro.mdx
CHANGED
|
@@ -15,7 +15,7 @@ As you navigate the world of LLMs—whether you're training or fine-tuning your
|
|
| 15 |
How can one know if a model is *good at* anything?
|
| 16 |
</Quote>
|
| 17 |
|
| 18 |
-
The answer is (surprisingly given the blog topic)
|
| 19 |
|
| 20 |
But what is it, really? And what can really it tell you?
|
| 21 |
|
|
@@ -23,25 +23,19 @@ This guide is here to help you understand evaluation: what it can and cannot do
|
|
| 23 |
|
| 24 |
Through the guide, we'll also highlight common pitfalls, tips and tricks from the Open Evals team, and hopefully will help you learn how to think critically about the claims made from evaluation results.
|
| 25 |
|
| 26 |
-
Before we dive into the details, let's quickly look at why people do evaluation,
|
| 27 |
|
| 28 |
-
###
|
| 29 |
-
|
| 30 |
-
There are 3 main reasons for which people do evaluation, which tend to be conflated together, but are actually **very different**, and each answer a separate question.
|
| 31 |
-
|
| 32 |
-
<HtmlEmbed src="d3-intro-boxes.html" title="Evaluation purposes" frameless />
|
| 33 |
-
|
| 34 |
-
#### Is this model training correctly?
|
| 35 |
|
| 36 |
**Non-regression testing** is a concept which comes from the software industry, to make sure small changes have not broken the overall approach. The idea is the following: when you add a new feature to your software, or fix a problem in the code base, have you broken something else? That's what non-regression tests are for: making sure the expected, high-level behavior of your software is not suddenly broken by a (seemingly unrelated) change.
|
| 37 |
|
| 38 |
When you select a setup to train models, you want to test something very similar, and make sure that your changes (choosing different training data, architecture, parameters, etc) have not "broken" the expected performance for a model of these properties.
|
| 39 |
|
| 40 |
-
In ML, experiments which test the impact of small changes on model performance are
|
| 41 |
|
| 42 |
-
For ablations, you also need to look at both **trajectories** (is the performance better now
|
| 43 |
|
| 44 |
-
###
|
| 45 |
|
| 46 |
The next role of evaluation is simply to sort models to find and select the best model for a given use case.
|
| 47 |
|
|
@@ -56,69 +50,11 @@ In [their paper](https://arxiv.org/pdf/2404.02112) about lessons learned on benc
|
|
| 56 |
For less common topics, you might even need to think about designing your own evaluations, which is our last section.
|
| 57 |
|
| 58 |
<Note title="Small caveat">
|
| 59 |
-
Despite often grandiose claims, for any complex capability, we cannot at the moment just say "this model is the best at this", but should instead say **"this model is the best on this task that we hope
|
| 60 |
</Note>
|
| 61 |
|
| 62 |
-
|
| 63 |
-
|
| 64 |
We are strongly missing any kind of good definitions and framework on what intelligence is for machine learning models, and how to evaluate it (though some people have tried, for example [Chollet](https://arxiv.org/abs/1911.01547) in 2019 and [Hendrycks et al](https://www.agidefinition.ai/paper.pdf) this year). Difficulty in defining intelligence is not a problem specific to machine learning! In human and animal studies, it is also quite hard to define, and metrics which try to provide precise scores (IQ and EQ for example) are hotly debated and controversial, with reason.
|
| 65 |
|
| 66 |
There are, however, some issues with focusing on intelligence as a target. 1) Intelligence tends to end up being a moving target, as any time we reach a capability which was thought to be human specific, we redefine the term. 2) Our current frameworks are made with the human (or animal) in mind, and will most likely not transfer well to models, as the underlying behaviors and assumptions are not the same. 3) It is kind of a useless target too - we should target making models good at specific, well defined, purposeful and useful tasks (think accounting, reporting, etc) instead of aiming for AGI for the sake of it.
|
| 67 |
-
|
| 68 |
-
### So how do people evaluate models, then?
|
| 69 |
-
|
| 70 |
-
To my knowledge, at the moment, people use 3 main ways to do evaluation: automated benchmarking, using humans as judges, and using models as judges. Each approach has its own reason for existing, uses, and limitations.
|
| 71 |
-
|
| 72 |
-
#### Automated benchmarks
|
| 73 |
-
|
| 74 |
-
Automated benchmarking usually works the following way: you'd like to know how well your model performs on something. This something can be a well-defined concrete **task**, such as *How well can my model classify spam from non spam emails?*, or a more abstract and general **capability**, such as *How good is my model at math?*.
|
| 75 |
-
|
| 76 |
-
From this, you construct an evaluation, usually made of two things:
|
| 77 |
-
- a collection of *samples*, given as input to the model to see what comes out as output, sometimes coupled with a reference (called gold) to compare with. Samples are usually designed to try to emulate what you want to test the model on: for example, if you are looking at toxicity classification, you create a dataset of toxic and non toxic sentences, try to include some hard edge cases, etc.
|
| 78 |
-
- a *metric*, which is a way to compute a score for the model. For example, how accurately can your model classify toxicity (score of well classified sample = 1, badly classified = 0).
|
| 79 |
-
|
| 80 |
-
This is more interesting to do on data that was not included in the model training set, because you want to test if it **generalizes** well. You don't want a model which can only classify emails it has already "seen", that would not be very useful!
|
| 81 |
-
|
| 82 |
-
<Note>
|
| 83 |
-
A model which can only predict well on its training data (and has not latently learnt more high-level general patterns) is said to be **overfitting**. In less extreme cases, you still want to test if your model is able to generalize to data patterns which were not in the training set's distribution (for example, classify toxicity on stack overflow after having seen only toxicity on reddit).
|
| 84 |
-
</Note>
|
| 85 |
-
|
| 86 |
-
This works quite well for very well-defined tasks, where performance is "easy" to assess and measure: when you are literally testing your model on classification, you can say "the model classified correctly n% of these samples". For LLMs benchmarks, some issues can arise, such as models [favoring specific choices based on the order in which they have been presented for multi-choice evaluations](https://arxiv.org/abs/2309.03882), and generative evaluations relying on normalisations which can easily [be unfair if not designed well](https://huggingface.co/blog/open-llm-leaderboard-drop), but overall they still provide signal at the task level.
|
| 87 |
-
|
| 88 |
-
For **capabilities** however, it's hard to decompose them into well-defined and precise tasks: what does "good at math" mean? good at arithmetic? at logic? able to reason on mathematical concepts?
|
| 89 |
-
|
| 90 |
-
In this case, people tend to do more "holistic" evaluations, by not decomposing the capability in actual tasks, but assuming that performance on general samples will be a **good proxy** for what we aim to measure. For example, GSM8K is made of actual high school math problems, which require a whole set of capabilities to solve. It also means that both failure and success are very hard to interpret. Some capabilities or topics, such as "is this model good at writing poetry?" or "are the model outputs helpful?" are even harder to evaluate with automatic metrics - and at the same time, models now seem to have more and more **generalist** capabilities, so we need to evaluate their abilities in a broader manner.
|
| 91 |
-
|
| 92 |
-
<Sidenote> For example, there was a debate in the scientific community as to whether LLMs [can draw](https://arxiv.org/abs/2303.12712) unicorns [or not](https://twitter.com/DimitrisPapail/status/1719119242186871275). A year later, seems like most can! </Sidenote>
|
| 93 |
-
|
| 94 |
-
Automatic benchmarks also tend to have another problem: once they are published publicly in plain text, they are very likely to end up (often accidentally) in the training datasets of models. Some benchmarks creators, like the authors of BigBench, have tried to mitigate this by adding a *canary string* (a very specific combination of characters) for people to look for, and remove from training sets, but not everybody is aware of the mechanism nor trying to do this removal. There is also a non negligible quantity of benchmarks, so looking for accidental copies of absolutely all of them in data is costly. Other options include providing benchmarks in an [**encrypted** form](https://arxiv.org/pdf/2309.16575), or behind a [**gating** system](https://huggingface.co/datasets/Idavidrein/gpqa). However, when evaluating closed models (that are behind APIs), there is no guarantee that the prompts you give won’t be later used internally for training or fine-tuning.
|
| 95 |
-
|
| 96 |
-
<Note>
|
| 97 |
-
The case were an evaluation dataset ends up in the training set is called **contamination**, and a model which was contaminated will have a high benchmark performance that does not generalize well to the underlying task (an extensive description of contamination can be found [here](https://aclanthology.org/2023.findings-emnlp.722/), and here is a fun way to [detect it](https://arxiv.org/abs/2311.06233)). A way to address contamination is to run [**dynamic benchmarks**](https://arxiv.org/abs/2104.14337) (evaluations on datasets which are regularly refreshed to provide scores on systematically unseen new data), but this approach is costly in the long term.
|
| 98 |
-
</Note>
|
| 99 |
-
|
| 100 |
-
#### Human as a judge
|
| 101 |
-
|
| 102 |
-
A solution to both contamination and more open-ended evaluation is asking humans to evaluate model outputs.
|
| 103 |
-
|
| 104 |
-
This is usually done by tasking humans with first, prompting models, then, grading a model answer or ranking several outputs according to guidelines. Using humans as judges allows to study more complex tasks, with more flexibility than automated metrics. It also prevents most contamination cases, since the written prompts are (hopefully) new. Lastly, it correlates well with human preference, since this is literally what is evaluated!
|
| 105 |
-
|
| 106 |
-
Different approaches exist to evaluate models with humans in the loop.
|
| 107 |
-
|
| 108 |
-
**Vibes-checks** is the name given to manual evaluations done individually by some members of the community, usually on undisclosed prompts, to get an overall "feeling" of how well models perform on many use cases, which range from coding to quality of smut written. (I've also seen the term "canary-testing" used for this, in reference to high signal canary in a coalmine approach). Often shared on Twitter and Reddit, they mostly constitute anecdotal evidence, and tend to be highly sensitive to confirmation bias (in other words, people tend to find what they look for).
|
| 109 |
-
|
| 110 |
-
Using community feedback to establish massive model rankings is what we call an **arena**. A well known example of this is the [LMSYS chatbot arena](https://huggingface.co/spaces/lmsys/chatbot-arena-leaderboard), where community users are asked to chat with models until they find one is better than the other. Votes are then aggregated in an Elo ranking (a ranking of matches) to select which model is "the best". The obvious problem of such an approach is the high subjectivity - it's hard to enforce a consistent grading from many community members using broad guidelines, especially since annotators preferences tend to be [culturally bound](https://arxiv.org/abs/2404.16019v1) (with different people favoring different discussion topics, for example). One can hope that this effect is smoothed over by the sheer scale of the votes, through a "wisdom of the crowd" effect (this effect was found by a statistician named Galton, who observed that individual answers trying to estimate a numerical value, like the weight of a hog, could be modeled as a probability distribution centered around the actual answer).
|
| 111 |
-
|
| 112 |
-
The last approach is **systematic annotations**, where you provide extremely specific guidelines to paid selected annotators, in order to remove as much as the subjectivity bias as possible (this is the approach used by most data annotation companies). However, it can get extremely expensive fast, as you have to keep on doing evaluations in a continuous and non automatic manner for every new model you want to evaluate, and it can still fall prey to human bias (this [study](https://arxiv.org/abs/2205.00501) showed that people with different identities tend to rate model answer toxicity very differently).
|
| 113 |
-
|
| 114 |
-
However, humans can be biased: for example, they tend to estimate the quality of answers [based on first impressions](https://arxiv.org/pdf/2309.16349), instead of actual factuality or faithfulness, and are very sensitive to tone, and underestimate the number of factual or logical errors in an assertive answer. These are only some of the many biases that human judges can fall prey to (as we'll see below). They are not unexpected, but they must be taken into account: not all use cases should rely on using human annotators, especially crowdsourced, unexpert ones - any task requiring factuality (such as code writing, evaluation of model knowledge, etc) should include another, more robust, type of evaluation to complete the benchmark.
|
| 115 |
-
|
| 116 |
-
#### Model as a judge
|
| 117 |
-
|
| 118 |
-
To mitigate the cost of human annotators, some people have looked into using models or derived artifacts (preferably aligned with human preferences) to evaluate models' outputs. This approach is not new, as you can find techniques to measure summarization quality from [model embeddings](https://arxiv.org/abs/1904.09675) in 2019.
|
| 119 |
-
|
| 120 |
-
Two approach exist for grading: using [generalist, high capability models](https://arxiv.org/abs/2306.05685v4) or using [small specialist models](https://arxiv.org/pdf/2405.01535) trained specifically to discriminate from preference data.
|
| 121 |
-
|
| 122 |
-
Model as judges have several strong limitations, because they are as biased as humans but along different axes (they can't [provide consistent score ranges](https://twitter.com/aparnadhinak/status/1748368364395721128), are actually not that consistent [with human rankings](https://arxiv.org/pdf/2308.15812), etc, as we'll see below).
|
| 123 |
-
|
| 124 |
-
My main personal gripe with using models as judges is that they introduce very subtle and un-interpretable bias in the answer selection. I feel that, much like when crossbreeding too much in genetics studies, you end up with dysfunctional animals or plants, by using LLMs to select and train LLMs, we are just as likely to introduce minute changes that will have bigger repercussions a couple generations down the line. I believe this type of bias is less likely to occur in smaller and more specialized models as judges (such as toxicity classifiers), but this remains to be rigorously tested and proven.
|
|
|
|
| 15 |
How can one know if a model is *good at* anything?
|
| 16 |
</Quote>
|
| 17 |
|
| 18 |
+
The answer is (surprisingly given the blog topic) evaluation! It's everywhere: leaderboards ranking models, benchmarks claiming to measure *reasoning*, *knowledge*, *coding abilities* or *math performance*, papers announcing new state-of-the-art results...
|
| 19 |
|
| 20 |
But what is it, really? And what can really it tell you?
|
| 21 |
|
|
|
|
| 23 |
|
| 24 |
Through the guide, we'll also highlight common pitfalls, tips and tricks from the Open Evals team, and hopefully will help you learn how to think critically about the claims made from evaluation results.
|
| 25 |
|
| 26 |
+
Before we dive into the details, let's quickly look at why people do evaluation, as who you are and what you are working on will determine which evaluations you need to use.
|
| 27 |
|
| 28 |
+
### The model builder perspective: Is this model training correctly?
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 29 |
|
| 30 |
**Non-regression testing** is a concept which comes from the software industry, to make sure small changes have not broken the overall approach. The idea is the following: when you add a new feature to your software, or fix a problem in the code base, have you broken something else? That's what non-regression tests are for: making sure the expected, high-level behavior of your software is not suddenly broken by a (seemingly unrelated) change.
|
| 31 |
|
| 32 |
When you select a setup to train models, you want to test something very similar, and make sure that your changes (choosing different training data, architecture, parameters, etc) have not "broken" the expected performance for a model of these properties.
|
| 33 |
|
| 34 |
+
In ML, experiments which test the impact of small changes on model performance are known as **ablations**, and whether you'll learn anything from them or not relies entirely on your evaluations: with a strong enough signal while relatively cheap to run as you'll be running them **a lot**.
|
| 35 |
|
| 36 |
+
For ablations, you also need to look at both **trajectories** (is the performance better now than when training started) and score **ranges** (is the performance within what's expected). These evaluations are here to confirm that your approach is "as sound or better than" other training approaches, and that your model behaves in similar ways. <Sidenote> Ablations can also be used to try to predict the performance of bigger models based on the perfomance on smaller ones, using scaling laws. </Sidenote>
|
| 37 |
|
| 38 |
+
### The model user perspective: Which model is the best on \<task\>?
|
| 39 |
|
| 40 |
The next role of evaluation is simply to sort models to find and select the best model for a given use case.
|
| 41 |
|
|
|
|
| 50 |
For less common topics, you might even need to think about designing your own evaluations, which is our last section.
|
| 51 |
|
| 52 |
<Note title="Small caveat">
|
| 53 |
+
Despite often grandiose claims, for any complex capability, we cannot at the moment just say "this model is the best at this", but should instead say **"this model is the best on these samples for this specific task that we hope are a good proxy for this capability, without any guarantee"**.
|
| 54 |
</Note>
|
| 55 |
|
| 56 |
+
<Note title="What about measuring AGI?">
|
|
|
|
| 57 |
We are strongly missing any kind of good definitions and framework on what intelligence is for machine learning models, and how to evaluate it (though some people have tried, for example [Chollet](https://arxiv.org/abs/1911.01547) in 2019 and [Hendrycks et al](https://www.agidefinition.ai/paper.pdf) this year). Difficulty in defining intelligence is not a problem specific to machine learning! In human and animal studies, it is also quite hard to define, and metrics which try to provide precise scores (IQ and EQ for example) are hotly debated and controversial, with reason.
|
| 58 |
|
| 59 |
There are, however, some issues with focusing on intelligence as a target. 1) Intelligence tends to end up being a moving target, as any time we reach a capability which was thought to be human specific, we redefine the term. 2) Our current frameworks are made with the human (or animal) in mind, and will most likely not transfer well to models, as the underlying behaviors and assumptions are not the same. 3) It is kind of a useless target too - we should target making models good at specific, well defined, purposeful and useful tasks (think accounting, reporting, etc) instead of aiming for AGI for the sake of it.
|
| 60 |
+
</Note>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
app/src/content/embeds/d3-binary-metrics.html
ADDED
|
@@ -0,0 +1,400 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-binary-metrics"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-binary-metrics {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
border: none;
|
| 8 |
+
border-radius: 0;
|
| 9 |
+
padding: var(--spacing-4) 0;
|
| 10 |
+
width: 100%;
|
| 11 |
+
margin: 0 auto;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.d3-binary-metrics .metrics-container {
|
| 15 |
+
display: flex;
|
| 16 |
+
flex-direction: column;
|
| 17 |
+
gap: var(--spacing-4);
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
.d3-binary-metrics .confusion-matrix {
|
| 21 |
+
display: grid;
|
| 22 |
+
grid-template-columns: 100px 1fr 1fr;
|
| 23 |
+
grid-template-rows: 100px 1fr 1fr;
|
| 24 |
+
gap: 2px;
|
| 25 |
+
max-width: 400px;
|
| 26 |
+
margin: 0 auto;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.d3-binary-metrics .matrix-label {
|
| 30 |
+
display: flex;
|
| 31 |
+
align-items: center;
|
| 32 |
+
justify-content: center;
|
| 33 |
+
font-size: 14px;
|
| 34 |
+
font-weight: 600;
|
| 35 |
+
color: var(--text-color);
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
.d3-binary-metrics .matrix-header-row {
|
| 39 |
+
grid-column: 1;
|
| 40 |
+
grid-row: 1;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
.d3-binary-metrics .matrix-header-col {
|
| 44 |
+
grid-row: 1;
|
| 45 |
+
grid-column: 1;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
.d3-binary-metrics .predicted-label {
|
| 49 |
+
grid-column: 2 / 4;
|
| 50 |
+
grid-row: 1;
|
| 51 |
+
font-size: 13px;
|
| 52 |
+
font-weight: 700;
|
| 53 |
+
color: var(--primary-color);
|
| 54 |
+
text-transform: uppercase;
|
| 55 |
+
letter-spacing: 0.05em;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
.d3-binary-metrics .actual-label {
|
| 59 |
+
grid-column: 1;
|
| 60 |
+
grid-row: 2 / 4;
|
| 61 |
+
writing-mode: vertical-rl;
|
| 62 |
+
transform: rotate(180deg);
|
| 63 |
+
font-size: 13px;
|
| 64 |
+
font-weight: 700;
|
| 65 |
+
color: var(--primary-color);
|
| 66 |
+
text-transform: uppercase;
|
| 67 |
+
letter-spacing: 0.05em;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
.d3-binary-metrics .matrix-pos-label {
|
| 71 |
+
grid-column: 2;
|
| 72 |
+
grid-row: 1;
|
| 73 |
+
font-size: 12px;
|
| 74 |
+
padding-bottom: 10px;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
.d3-binary-metrics .matrix-neg-label {
|
| 78 |
+
grid-column: 3;
|
| 79 |
+
grid-row: 1;
|
| 80 |
+
font-size: 12px;
|
| 81 |
+
padding-bottom: 10px;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
.d3-binary-metrics .matrix-pos-label-row {
|
| 85 |
+
grid-column: 1;
|
| 86 |
+
grid-row: 2;
|
| 87 |
+
font-size: 12px;
|
| 88 |
+
padding-right: 10px;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
.d3-binary-metrics .matrix-neg-label-row {
|
| 92 |
+
grid-column: 1;
|
| 93 |
+
grid-row: 3;
|
| 94 |
+
font-size: 12px;
|
| 95 |
+
padding-right: 10px;
|
| 96 |
+
}
|
| 97 |
+
|
| 98 |
+
.d3-binary-metrics .matrix-cell {
|
| 99 |
+
display: flex;
|
| 100 |
+
flex-direction: column;
|
| 101 |
+
align-items: center;
|
| 102 |
+
justify-content: center;
|
| 103 |
+
padding: var(--spacing-3);
|
| 104 |
+
border-radius: 8px;
|
| 105 |
+
min-height: 100px;
|
| 106 |
+
border: 2px solid;
|
| 107 |
+
transition: all 0.3s ease;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
.d3-binary-metrics .matrix-cell:hover {
|
| 111 |
+
transform: scale(1.05);
|
| 112 |
+
box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
.d3-binary-metrics .cell-tp {
|
| 116 |
+
grid-column: 2;
|
| 117 |
+
grid-row: 2;
|
| 118 |
+
background: oklch(from var(--primary-color) calc(l + 0.35) calc(c * 0.8) h / 0.3);
|
| 119 |
+
border-color: oklch(from var(--primary-color) calc(l + 0.1) c h / 0.7);
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
.d3-binary-metrics .cell-fp {
|
| 123 |
+
grid-column: 3;
|
| 124 |
+
grid-row: 2;
|
| 125 |
+
background: oklch(from #ff6b6b calc(l + 0.35) c h / 0.25);
|
| 126 |
+
border-color: oklch(from #ff6b6b calc(l + 0.1) c h / 0.6);
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
.d3-binary-metrics .cell-fn {
|
| 130 |
+
grid-column: 2;
|
| 131 |
+
grid-row: 3;
|
| 132 |
+
background: oklch(from #ffa500 calc(l + 0.35) c h / 0.25);
|
| 133 |
+
border-color: oklch(from #ffa500 calc(l + 0.1) c h / 0.6);
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
.d3-binary-metrics .cell-tn {
|
| 137 |
+
grid-column: 3;
|
| 138 |
+
grid-row: 3;
|
| 139 |
+
background: oklch(from var(--primary-color) calc(l + 0.35) calc(c * 0.8) h / 0.3);
|
| 140 |
+
border-color: oklch(from var(--primary-color) calc(l + 0.1) c h / 0.7);
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
[data-theme="dark"] .d3-binary-metrics .cell-tp,
|
| 144 |
+
[data-theme="dark"] .d3-binary-metrics .cell-tn {
|
| 145 |
+
background: oklch(from var(--primary-color) calc(l + 0.25) calc(c * 0.8) h / 0.25);
|
| 146 |
+
border-color: oklch(from var(--primary-color) calc(l + 0.05) c h / 0.75);
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
[data-theme="dark"] .d3-binary-metrics .cell-fp {
|
| 150 |
+
background: oklch(from #ff6b6b calc(l + 0.25) c h / 0.2);
|
| 151 |
+
border-color: oklch(from #ff6b6b calc(l + 0.05) c h / 0.65);
|
| 152 |
+
}
|
| 153 |
+
|
| 154 |
+
[data-theme="dark"] .d3-binary-metrics .cell-fn {
|
| 155 |
+
background: oklch(from #ffa500 calc(l + 0.25) c h / 0.2);
|
| 156 |
+
border-color: oklch(from #ffa500 calc(l + 0.05) c h / 0.65);
|
| 157 |
+
}
|
| 158 |
+
|
| 159 |
+
.d3-binary-metrics .cell-label {
|
| 160 |
+
font-size: 11px;
|
| 161 |
+
font-weight: 700;
|
| 162 |
+
color: var(--text-color);
|
| 163 |
+
text-transform: uppercase;
|
| 164 |
+
letter-spacing: 0.05em;
|
| 165 |
+
margin-bottom: var(--spacing-1);
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
.d3-binary-metrics .cell-value {
|
| 169 |
+
font-size: 32px;
|
| 170 |
+
font-weight: 700;
|
| 171 |
+
color: var(--text-color);
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
.d3-binary-metrics .cell-description {
|
| 175 |
+
font-size: 10px;
|
| 176 |
+
color: var(--muted-color);
|
| 177 |
+
text-align: center;
|
| 178 |
+
margin-top: var(--spacing-1);
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
.d3-binary-metrics .metrics-grid {
|
| 182 |
+
display: grid;
|
| 183 |
+
grid-template-columns: repeat(auto-fit, minmax(200px, 1fr));
|
| 184 |
+
gap: var(--spacing-3);
|
| 185 |
+
margin-top: var(--spacing-4);
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
.d3-binary-metrics .metric-card {
|
| 189 |
+
background: oklch(from var(--primary-color) calc(l + 0.42) c h / 0.25);
|
| 190 |
+
border: 1px solid oklch(from var(--primary-color) calc(l + 0.2) c h / 0.5);
|
| 191 |
+
border-radius: 12px;
|
| 192 |
+
padding: var(--spacing-4);
|
| 193 |
+
display: flex;
|
| 194 |
+
flex-direction: column;
|
| 195 |
+
gap: var(--spacing-2);
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
[data-theme="dark"] .d3-binary-metrics .metric-card {
|
| 199 |
+
background: oklch(from var(--primary-color) calc(l + 0.32) c h / 0.2);
|
| 200 |
+
border-color: oklch(from var(--primary-color) calc(l + 0.15) c h / 0.55);
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
.d3-binary-metrics .metric-name {
|
| 204 |
+
font-size: 15px;
|
| 205 |
+
font-weight: 700;
|
| 206 |
+
color: var(--primary-color);
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
[data-theme="dark"] .d3-binary-metrics .metric-name {
|
| 210 |
+
color: oklch(from var(--primary-color) calc(l + 0.05) calc(c * 1.1) h);
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
.d3-binary-metrics .metric-formula {
|
| 214 |
+
font-size: 13px;
|
| 215 |
+
color: var(--text-color);
|
| 216 |
+
font-family: monospace;
|
| 217 |
+
background: var(--surface-bg);
|
| 218 |
+
padding: var(--spacing-2);
|
| 219 |
+
border-radius: 6px;
|
| 220 |
+
border: 1px solid var(--border-color);
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
.d3-binary-metrics .metric-value {
|
| 224 |
+
font-size: 24px;
|
| 225 |
+
font-weight: 700;
|
| 226 |
+
color: var(--primary-color);
|
| 227 |
+
text-align: center;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
.d3-binary-metrics .metric-interpretation {
|
| 231 |
+
font-size: 12px;
|
| 232 |
+
color: var(--muted-color);
|
| 233 |
+
line-height: 1.4;
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
.d3-binary-metrics .example-title {
|
| 237 |
+
font-size: 16px;
|
| 238 |
+
font-weight: 700;
|
| 239 |
+
color: var(--primary-color);
|
| 240 |
+
text-align: center;
|
| 241 |
+
margin-bottom: var(--spacing-3);
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
.d3-binary-metrics .example-description {
|
| 245 |
+
font-size: 13px;
|
| 246 |
+
color: var(--text-color);
|
| 247 |
+
text-align: center;
|
| 248 |
+
font-style: italic;
|
| 249 |
+
margin-bottom: var(--spacing-4);
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
@media (max-width: 768px) {
|
| 253 |
+
.d3-binary-metrics .confusion-matrix {
|
| 254 |
+
max-width: 100%;
|
| 255 |
+
grid-template-columns: 80px 1fr 1fr;
|
| 256 |
+
grid-template-rows: 80px 1fr 1fr;
|
| 257 |
+
}
|
| 258 |
+
|
| 259 |
+
.d3-binary-metrics .matrix-cell {
|
| 260 |
+
min-height: 80px;
|
| 261 |
+
padding: var(--spacing-2);
|
| 262 |
+
}
|
| 263 |
+
|
| 264 |
+
.d3-binary-metrics .cell-value {
|
| 265 |
+
font-size: 24px;
|
| 266 |
+
}
|
| 267 |
+
|
| 268 |
+
.d3-binary-metrics .metrics-grid {
|
| 269 |
+
grid-template-columns: 1fr;
|
| 270 |
+
}
|
| 271 |
+
}
|
| 272 |
+
</style>
|
| 273 |
+
|
| 274 |
+
<script>
|
| 275 |
+
(() => {
|
| 276 |
+
const bootstrap = () => {
|
| 277 |
+
const scriptEl = document.currentScript;
|
| 278 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 279 |
+
if (!(container && container.classList && container.classList.contains('d3-binary-metrics'))) {
|
| 280 |
+
const candidates = Array.from(document.querySelectorAll('.d3-binary-metrics'))
|
| 281 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 282 |
+
container = candidates[candidates.length - 1] || null;
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
if (!container) return;
|
| 286 |
+
|
| 287 |
+
if (container.dataset) {
|
| 288 |
+
if (container.dataset.mounted === 'true') return;
|
| 289 |
+
container.dataset.mounted = 'true';
|
| 290 |
+
}
|
| 291 |
+
|
| 292 |
+
// Example: Question answering - checking if answer is correct
|
| 293 |
+
const TP = 45; // Correctly identified as correct answer
|
| 294 |
+
const FP = 8; // Incorrect answer marked as correct
|
| 295 |
+
const FN = 5; // Correct answer marked as incorrect
|
| 296 |
+
const TN = 42; // Correctly identified as incorrect answer
|
| 297 |
+
|
| 298 |
+
// Calculate metrics
|
| 299 |
+
const precision = TP / (TP + FP);
|
| 300 |
+
const recall = TP / (TP + FN);
|
| 301 |
+
const f1 = 2 * (precision * recall) / (precision + recall);
|
| 302 |
+
|
| 303 |
+
// MCC calculation
|
| 304 |
+
const numerator = (TP * TN) - (FP * FN);
|
| 305 |
+
const denominator = Math.sqrt((TP + FP) * (TP + FN) * (TN + FP) * (TN + FN));
|
| 306 |
+
const mcc = numerator / denominator;
|
| 307 |
+
|
| 308 |
+
container.innerHTML = `
|
| 309 |
+
<div class="metrics-container">
|
| 310 |
+
<div class="example-title">Binary Classification Metrics Example</div>
|
| 311 |
+
<div class="example-description">
|
| 312 |
+
Question Answering: 100 model predictions evaluated (50 correct, 50 incorrect)
|
| 313 |
+
</div>
|
| 314 |
+
|
| 315 |
+
<div class="confusion-matrix">
|
| 316 |
+
<div class="matrix-label predicted-label">Predicted</div>
|
| 317 |
+
<div class="matrix-label actual-label">Actual</div>
|
| 318 |
+
|
| 319 |
+
<div class="matrix-label matrix-pos-label">Correct</div>
|
| 320 |
+
<div class="matrix-label matrix-neg-label">Incorrect</div>
|
| 321 |
+
<div class="matrix-label matrix-pos-label-row">Correct</div>
|
| 322 |
+
<div class="matrix-label matrix-neg-label-row">Incorrect</div>
|
| 323 |
+
|
| 324 |
+
<div class="matrix-cell cell-tp">
|
| 325 |
+
<div class="cell-label">True Positive</div>
|
| 326 |
+
<div class="cell-value">${TP}</div>
|
| 327 |
+
<div class="cell-description">Correct answer identified as correct</div>
|
| 328 |
+
</div>
|
| 329 |
+
|
| 330 |
+
<div class="matrix-cell cell-fp">
|
| 331 |
+
<div class="cell-label">False Positive</div>
|
| 332 |
+
<div class="cell-value">${FP}</div>
|
| 333 |
+
<div class="cell-description">Incorrect answer marked as correct</div>
|
| 334 |
+
</div>
|
| 335 |
+
|
| 336 |
+
<div class="matrix-cell cell-fn">
|
| 337 |
+
<div class="cell-label">False Negative</div>
|
| 338 |
+
<div class="cell-value">${FN}</div>
|
| 339 |
+
<div class="cell-description">Correct answer marked as incorrect</div>
|
| 340 |
+
</div>
|
| 341 |
+
|
| 342 |
+
<div class="matrix-cell cell-tn">
|
| 343 |
+
<div class="cell-label">True Negative</div>
|
| 344 |
+
<div class="cell-value">${TN}</div>
|
| 345 |
+
<div class="cell-description">Incorrect answer identified as incorrect</div>
|
| 346 |
+
</div>
|
| 347 |
+
</div>
|
| 348 |
+
|
| 349 |
+
<div class="metrics-grid">
|
| 350 |
+
<div class="metric-card">
|
| 351 |
+
<div class="metric-name">Precision</div>
|
| 352 |
+
<div class="metric-formula">TP / (TP + FP)</div>
|
| 353 |
+
<div class="metric-value">${precision.toFixed(3)}</div>
|
| 354 |
+
<div class="metric-interpretation">
|
| 355 |
+
${(precision * 100).toFixed(1)}% of answers marked correct are actually correct.
|
| 356 |
+
Critical when false positives (wrong answers accepted) are costly.
|
| 357 |
+
</div>
|
| 358 |
+
</div>
|
| 359 |
+
|
| 360 |
+
<div class="metric-card">
|
| 361 |
+
<div class="metric-name">Recall</div>
|
| 362 |
+
<div class="metric-formula">TP / (TP + FN)</div>
|
| 363 |
+
<div class="metric-value">${recall.toFixed(3)}</div>
|
| 364 |
+
<div class="metric-interpretation">
|
| 365 |
+
${(recall * 100).toFixed(1)}% of actually correct answers were identified.
|
| 366 |
+
Critical when missing positives (rejecting correct answers) is costly.
|
| 367 |
+
</div>
|
| 368 |
+
</div>
|
| 369 |
+
|
| 370 |
+
<div class="metric-card">
|
| 371 |
+
<div class="metric-name">F1 Score</div>
|
| 372 |
+
<div class="metric-formula">2 × (P × R) / (P + R)</div>
|
| 373 |
+
<div class="metric-value">${f1.toFixed(3)}</div>
|
| 374 |
+
<div class="metric-interpretation">
|
| 375 |
+
Harmonic mean of precision and recall.
|
| 376 |
+
Balances both metrics, good for imbalanced data.
|
| 377 |
+
</div>
|
| 378 |
+
</div>
|
| 379 |
+
|
| 380 |
+
<div class="metric-card">
|
| 381 |
+
<div class="metric-name">MCC</div>
|
| 382 |
+
<div class="metric-formula">(TP×TN - FP×FN) / √((TP+FP)(TP+FN)(TN+FP)(TN+FN))</div>
|
| 383 |
+
<div class="metric-value">${mcc.toFixed(3)}</div>
|
| 384 |
+
<div class="metric-interpretation">
|
| 385 |
+
Matthews Correlation Coefficient ranges from -1 to +1.
|
| 386 |
+
Works well with imbalanced datasets.
|
| 387 |
+
</div>
|
| 388 |
+
</div>
|
| 389 |
+
</div>
|
| 390 |
+
</div>
|
| 391 |
+
`;
|
| 392 |
+
};
|
| 393 |
+
|
| 394 |
+
if (document.readyState === 'loading') {
|
| 395 |
+
document.addEventListener('DOMContentLoaded', bootstrap, { once: true });
|
| 396 |
+
} else {
|
| 397 |
+
bootstrap();
|
| 398 |
+
}
|
| 399 |
+
})();
|
| 400 |
+
</script>
|
app/src/content/embeds/d3-intro-boxes.html
CHANGED
|
@@ -22,13 +22,13 @@
|
|
| 22 |
background: oklch(from var(--primary-color) calc(l + 0.4) c h / 0.35);
|
| 23 |
border: 1px solid oklch(from var(--primary-color) calc(l + 0.15) c h / 0.6);
|
| 24 |
border-radius: 16px;
|
| 25 |
-
padding: var(--spacing-
|
| 26 |
text-align: left;
|
| 27 |
display: flex;
|
| 28 |
flex-direction: column;
|
| 29 |
justify-content: flex-start;
|
| 30 |
align-items: flex-start;
|
| 31 |
-
min-height:
|
| 32 |
}
|
| 33 |
|
| 34 |
/* Dark mode adjustments for better readability */
|
|
@@ -57,9 +57,9 @@
|
|
| 57 |
list-style: none;
|
| 58 |
padding: 0;
|
| 59 |
margin: 0;
|
| 60 |
-
font-size:
|
| 61 |
color: var(--text-color);
|
| 62 |
-
line-height: 1.
|
| 63 |
font-weight: 500;
|
| 64 |
position: relative;
|
| 65 |
z-index: 1;
|
|
@@ -124,27 +124,28 @@
|
|
| 124 |
container.innerHTML = `
|
| 125 |
<div class="purposes-grid">
|
| 126 |
<div class="purpose-card">
|
| 127 |
-
<div class="purpose-title">Model
|
| 128 |
<ul class="purpose-items">
|
| 129 |
-
<li>
|
| 130 |
-
<li>
|
| 131 |
-
<li>
|
| 132 |
</ul>
|
| 133 |
</div>
|
| 134 |
-
|
| 135 |
<div class="purpose-card">
|
| 136 |
-
<div class="purpose-title">Users</div>
|
| 137 |
<ul class="purpose-items">
|
| 138 |
-
<li>
|
| 139 |
-
<li>
|
|
|
|
| 140 |
</ul>
|
| 141 |
</div>
|
| 142 |
-
|
| 143 |
<div class="purpose-card">
|
| 144 |
-
<div class="purpose-title">
|
| 145 |
<ul class="purpose-items">
|
| 146 |
-
<li>capabilities</li>
|
| 147 |
-
<li>
|
| 148 |
</ul>
|
| 149 |
</div>
|
| 150 |
</div>
|
|
|
|
| 22 |
background: oklch(from var(--primary-color) calc(l + 0.4) c h / 0.35);
|
| 23 |
border: 1px solid oklch(from var(--primary-color) calc(l + 0.15) c h / 0.6);
|
| 24 |
border-radius: 16px;
|
| 25 |
+
padding: var(--spacing-5) var(--spacing-5);
|
| 26 |
text-align: left;
|
| 27 |
display: flex;
|
| 28 |
flex-direction: column;
|
| 29 |
justify-content: flex-start;
|
| 30 |
align-items: flex-start;
|
| 31 |
+
min-height: 180px;
|
| 32 |
}
|
| 33 |
|
| 34 |
/* Dark mode adjustments for better readability */
|
|
|
|
| 57 |
list-style: none;
|
| 58 |
padding: 0;
|
| 59 |
margin: 0;
|
| 60 |
+
font-size: 14px;
|
| 61 |
color: var(--text-color);
|
| 62 |
+
line-height: 1.7;
|
| 63 |
font-weight: 500;
|
| 64 |
position: relative;
|
| 65 |
z-index: 1;
|
|
|
|
| 124 |
container.innerHTML = `
|
| 125 |
<div class="purposes-grid">
|
| 126 |
<div class="purpose-card">
|
| 127 |
+
<div class="purpose-title">Model Builders</div>
|
| 128 |
<ul class="purpose-items">
|
| 129 |
+
<li>Is this model training correctly?</li>
|
| 130 |
+
<li>Non-regression testing & ablations</li>
|
| 131 |
+
<li>Compare training approaches</li>
|
| 132 |
</ul>
|
| 133 |
</div>
|
| 134 |
+
|
| 135 |
<div class="purpose-card">
|
| 136 |
+
<div class="purpose-title">Model Users</div>
|
| 137 |
<ul class="purpose-items">
|
| 138 |
+
<li>Which model is best on <task>?</li>
|
| 139 |
+
<li>Compare models & rankings</li>
|
| 140 |
+
<li>Design custom evaluations</li>
|
| 141 |
</ul>
|
| 142 |
</div>
|
| 143 |
+
|
| 144 |
<div class="purpose-card">
|
| 145 |
+
<div class="purpose-title">Researchers</div>
|
| 146 |
<ul class="purpose-items">
|
| 147 |
+
<li>What capabilities exist?</li>
|
| 148 |
+
<li>What is the state of progress?</li>
|
| 149 |
</ul>
|
| 150 |
</div>
|
| 151 |
</div>
|
app/src/content/embeds/d3-metrics-comparison.html
ADDED
|
@@ -0,0 +1,572 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-metrics-comparison"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-metrics-comparison {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
border: none;
|
| 8 |
+
border-radius: 0;
|
| 9 |
+
padding: var(--spacing-4) 0;
|
| 10 |
+
width: 100%;
|
| 11 |
+
margin: 0 auto;
|
| 12 |
+
position: relative;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.d3-metrics-comparison svg {
|
| 16 |
+
width: 100%;
|
| 17 |
+
height: auto;
|
| 18 |
+
display: block;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
.d3-metrics-comparison .node-rect {
|
| 22 |
+
stroke-width: 2;
|
| 23 |
+
transition: all 0.3s ease;
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
.d3-metrics-comparison .node-rect:hover {
|
| 27 |
+
filter: brightness(1.1);
|
| 28 |
+
stroke-width: 3;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
.d3-metrics-comparison .input-node {
|
| 32 |
+
fill: oklch(from var(--primary-color) calc(l + 0.42) c h / 0.35);
|
| 33 |
+
stroke: oklch(from var(--primary-color) calc(l + 0.1) c h / 0.7);
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
.d3-metrics-comparison .method-node {
|
| 37 |
+
fill: oklch(from var(--primary-color) calc(l + 0.38) c h / 0.45);
|
| 38 |
+
stroke: var(--primary-color);
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
.d3-metrics-comparison .score-node {
|
| 42 |
+
fill: oklch(from var(--primary-color) calc(l + 0.35) c h / 0.55);
|
| 43 |
+
stroke: oklch(from var(--primary-color) calc(l - 0.05) calc(c * 1.2) h);
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
[data-theme="dark"] .d3-metrics-comparison .input-node {
|
| 47 |
+
fill: oklch(from var(--primary-color) calc(l + 0.32) c h / 0.3);
|
| 48 |
+
stroke: oklch(from var(--primary-color) calc(l + 0.05) c h / 0.75);
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
[data-theme="dark"] .d3-metrics-comparison .method-node {
|
| 52 |
+
fill: oklch(from var(--primary-color) calc(l + 0.28) c h / 0.4);
|
| 53 |
+
stroke: oklch(from var(--primary-color) calc(l + 0.05) calc(c * 1.1) h);
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
[data-theme="dark"] .d3-metrics-comparison .score-node {
|
| 57 |
+
fill: oklch(from var(--primary-color) calc(l + 0.25) c h / 0.5);
|
| 58 |
+
stroke: oklch(from var(--primary-color) calc(l) calc(c * 1.3) h);
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
.d3-metrics-comparison .node-label {
|
| 62 |
+
fill: var(--text-color);
|
| 63 |
+
font-size: 13px;
|
| 64 |
+
font-weight: 600;
|
| 65 |
+
pointer-events: none;
|
| 66 |
+
user-select: none;
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.d3-metrics-comparison .node-sublabel {
|
| 70 |
+
fill: var(--muted-color);
|
| 71 |
+
font-size: 10px;
|
| 72 |
+
font-weight: 500;
|
| 73 |
+
pointer-events: none;
|
| 74 |
+
user-select: none;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
.d3-metrics-comparison .node-example {
|
| 78 |
+
fill: var(--text-color);
|
| 79 |
+
font-size: 10px;
|
| 80 |
+
font-weight: 500;
|
| 81 |
+
font-style: italic;
|
| 82 |
+
pointer-events: none;
|
| 83 |
+
user-select: none;
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
.d3-metrics-comparison .link-path {
|
| 87 |
+
fill: none;
|
| 88 |
+
stroke: oklch(from var(--primary-color) l c h / 0.4);
|
| 89 |
+
stroke-width: 2;
|
| 90 |
+
transition: all 0.3s ease;
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
[data-theme="dark"] .d3-metrics-comparison .link-path {
|
| 94 |
+
stroke: oklch(from var(--primary-color) l c h / 0.5);
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
.d3-metrics-comparison .link-path:hover {
|
| 98 |
+
stroke: var(--primary-color);
|
| 99 |
+
stroke-width: 3;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
.d3-metrics-comparison .link-label {
|
| 103 |
+
fill: var(--text-color);
|
| 104 |
+
font-size: 10px;
|
| 105 |
+
font-weight: 600;
|
| 106 |
+
pointer-events: none;
|
| 107 |
+
user-select: none;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
.d3-metrics-comparison .score-badge {
|
| 111 |
+
fill: var(--primary-color);
|
| 112 |
+
font-size: 14px;
|
| 113 |
+
font-weight: 700;
|
| 114 |
+
pointer-events: none;
|
| 115 |
+
user-select: none;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
.d3-metrics-comparison .score-badge-bg {
|
| 119 |
+
fill: var(--surface-bg);
|
| 120 |
+
stroke: var(--primary-color);
|
| 121 |
+
stroke-width: 2;
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
.d3-metrics-comparison .section-title {
|
| 125 |
+
fill: var(--primary-color);
|
| 126 |
+
font-size: 12px;
|
| 127 |
+
font-weight: 700;
|
| 128 |
+
text-transform: uppercase;
|
| 129 |
+
letter-spacing: 0.05em;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
[data-theme="dark"] .d3-metrics-comparison .section-title {
|
| 133 |
+
fill: oklch(from var(--primary-color) calc(l + 0.1) calc(c * 1.2) h);
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
.d3-metrics-comparison .marker {
|
| 137 |
+
fill: oklch(from var(--primary-color) l c h / 0.6);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
.d3-metrics-comparison .tooltip {
|
| 141 |
+
position: absolute;
|
| 142 |
+
background: var(--surface-bg);
|
| 143 |
+
border: 1px solid var(--border-color);
|
| 144 |
+
border-radius: 8px;
|
| 145 |
+
padding: 10px 14px;
|
| 146 |
+
font-size: 12px;
|
| 147 |
+
pointer-events: none;
|
| 148 |
+
opacity: 0;
|
| 149 |
+
transition: opacity 0.2s ease;
|
| 150 |
+
box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
|
| 151 |
+
z-index: 1000;
|
| 152 |
+
max-width: 350px;
|
| 153 |
+
line-height: 1.5;
|
| 154 |
+
white-space: pre-line;
|
| 155 |
+
color: var(--text-color);
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
.d3-metrics-comparison .tooltip.visible {
|
| 159 |
+
opacity: 1;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
@media (max-width: 768px) {
|
| 163 |
+
.d3-metrics-comparison .node-label {
|
| 164 |
+
font-size: 11px;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
.d3-metrics-comparison .node-sublabel {
|
| 168 |
+
font-size: 9px;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
.d3-metrics-comparison .node-example {
|
| 172 |
+
font-size: 9px;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
.d3-metrics-comparison .link-label {
|
| 176 |
+
font-size: 9px;
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
.d3-metrics-comparison .score-badge {
|
| 180 |
+
font-size: 12px;
|
| 181 |
+
}
|
| 182 |
+
}
|
| 183 |
+
</style>
|
| 184 |
+
|
| 185 |
+
<script>
|
| 186 |
+
(() => {
|
| 187 |
+
const ensureD3 = (cb) => {
|
| 188 |
+
if (window.d3 && typeof window.d3.select === 'function') return cb();
|
| 189 |
+
let s = document.getElementById('d3-cdn-script');
|
| 190 |
+
if (!s) {
|
| 191 |
+
s = document.createElement('script');
|
| 192 |
+
s.id = 'd3-cdn-script';
|
| 193 |
+
s.src = 'https://cdn.jsdelivr.net/npm/d3@7/dist/d3.min.js';
|
| 194 |
+
document.head.appendChild(s);
|
| 195 |
+
}
|
| 196 |
+
const onReady = () => {
|
| 197 |
+
if (window.d3 && typeof window.d3.select === 'function') cb();
|
| 198 |
+
};
|
| 199 |
+
s.addEventListener('load', onReady, { once: true });
|
| 200 |
+
if (window.d3) onReady();
|
| 201 |
+
};
|
| 202 |
+
|
| 203 |
+
const bootstrap = () => {
|
| 204 |
+
const scriptEl = document.currentScript;
|
| 205 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 206 |
+
if (!(container && container.classList && container.classList.contains('d3-metrics-comparison'))) {
|
| 207 |
+
const candidates = Array.from(document.querySelectorAll('.d3-metrics-comparison'))
|
| 208 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 209 |
+
container = candidates[candidates.length - 1] || null;
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
if (!container) return;
|
| 213 |
+
|
| 214 |
+
if (container.dataset) {
|
| 215 |
+
if (container.dataset.mounted === 'true') return;
|
| 216 |
+
container.dataset.mounted = 'true';
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
container.style.position = 'relative';
|
| 220 |
+
|
| 221 |
+
// Tooltip
|
| 222 |
+
const tooltip = document.createElement('div');
|
| 223 |
+
tooltip.className = 'tooltip';
|
| 224 |
+
container.appendChild(tooltip);
|
| 225 |
+
|
| 226 |
+
// Data structure: inputs -> methods -> scores
|
| 227 |
+
const data = {
|
| 228 |
+
inputs: [
|
| 229 |
+
{
|
| 230 |
+
id: 'prediction',
|
| 231 |
+
label: 'Prediction',
|
| 232 |
+
sublabel: '(model output)',
|
| 233 |
+
example: '"Evaluation is an amazing topic"'
|
| 234 |
+
},
|
| 235 |
+
{
|
| 236 |
+
id: 'reference',
|
| 237 |
+
label: 'Reference',
|
| 238 |
+
sublabel: '(ground truth)',
|
| 239 |
+
example: '"Evaluation is amazing"'
|
| 240 |
+
}
|
| 241 |
+
],
|
| 242 |
+
methods: [
|
| 243 |
+
{
|
| 244 |
+
id: 'exact',
|
| 245 |
+
label: 'Exact Match',
|
| 246 |
+
sublabel: 'token sequences',
|
| 247 |
+
score: '0',
|
| 248 |
+
description: 'Strings don\'t match exactly—missing words "an" and "topic"',
|
| 249 |
+
scoreType: 'binary'
|
| 250 |
+
},
|
| 251 |
+
{
|
| 252 |
+
id: 'bleu',
|
| 253 |
+
label: 'BLEU',
|
| 254 |
+
sublabel: 'n-gram overlap',
|
| 255 |
+
score: '0.13',
|
| 256 |
+
description: 'Actual BLEU computation:\n• BLEU-1 (unigrams): 0.60 (3/5 match)\n• BLEU-2 (bigrams): 0.39 (1/4 match)\n• BLEU-3 (trigrams): 0.17 (0/3 match)\n• Final BLEU (geometric mean): 0.13\n• Brevity penalty reduces score (prediction > reference)',
|
| 257 |
+
scoreType: 'continuous'
|
| 258 |
+
},
|
| 259 |
+
{
|
| 260 |
+
id: 'rouge',
|
| 261 |
+
label: 'ROUGE',
|
| 262 |
+
sublabel: 'recall-oriented',
|
| 263 |
+
score: '0.75',
|
| 264 |
+
description: 'ROUGE-1 (unigram) scores:\n• Recall: 3/3 = 100% (all reference words found in prediction)\n• Precision: 3/5 = 60% (prediction words in reference)\n• F1 score: 0.75\nReference: ["evaluation", "is", "amazing"]',
|
| 265 |
+
scoreType: 'continuous'
|
| 266 |
+
},
|
| 267 |
+
{
|
| 268 |
+
id: 'bleurt',
|
| 269 |
+
label: 'BLEURT',
|
| 270 |
+
sublabel: 'semantic similarity',
|
| 271 |
+
score: '0.85',
|
| 272 |
+
description: 'High semantic similarity—both express positive sentiment about evaluation',
|
| 273 |
+
scoreType: 'continuous'
|
| 274 |
+
}
|
| 275 |
+
],
|
| 276 |
+
scores: [
|
| 277 |
+
{
|
| 278 |
+
id: 'binary',
|
| 279 |
+
label: 'Binary Score',
|
| 280 |
+
sublabel: 'correct/incorrect'
|
| 281 |
+
},
|
| 282 |
+
{
|
| 283 |
+
id: 'continuous',
|
| 284 |
+
label: 'Continuous Score',
|
| 285 |
+
sublabel: '0.0 to 1.0'
|
| 286 |
+
}
|
| 287 |
+
]
|
| 288 |
+
};
|
| 289 |
+
|
| 290 |
+
const svg = d3.select(container).append('svg');
|
| 291 |
+
const g = svg.append('g');
|
| 292 |
+
|
| 293 |
+
// Arrow marker
|
| 294 |
+
svg.append('defs').append('marker')
|
| 295 |
+
.attr('id', 'arrowhead')
|
| 296 |
+
.attr('viewBox', '0 -5 10 10')
|
| 297 |
+
.attr('refX', 8)
|
| 298 |
+
.attr('refY', 0)
|
| 299 |
+
.attr('markerWidth', 6)
|
| 300 |
+
.attr('markerHeight', 6)
|
| 301 |
+
.attr('orient', 'auto')
|
| 302 |
+
.append('path')
|
| 303 |
+
.attr('d', 'M0,-5L10,0L0,5')
|
| 304 |
+
.attr('class', 'marker');
|
| 305 |
+
|
| 306 |
+
let width = 800;
|
| 307 |
+
let height = 500;
|
| 308 |
+
|
| 309 |
+
function wrapText(text, maxWidth) {
|
| 310 |
+
const words = text.split(' ');
|
| 311 |
+
const lines = [];
|
| 312 |
+
let currentLine = words[0];
|
| 313 |
+
|
| 314 |
+
for (let i = 1; i < words.length; i++) {
|
| 315 |
+
const word = words[i];
|
| 316 |
+
const testLine = currentLine + ' ' + word;
|
| 317 |
+
if (testLine.length * 6 < maxWidth) {
|
| 318 |
+
currentLine = testLine;
|
| 319 |
+
} else {
|
| 320 |
+
lines.push(currentLine);
|
| 321 |
+
currentLine = word;
|
| 322 |
+
}
|
| 323 |
+
}
|
| 324 |
+
lines.push(currentLine);
|
| 325 |
+
return lines;
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
function render() {
|
| 329 |
+
width = container.clientWidth || 800;
|
| 330 |
+
height = Math.max(500, Math.round(width * 0.7));
|
| 331 |
+
|
| 332 |
+
svg.attr('width', width).attr('height', height);
|
| 333 |
+
|
| 334 |
+
const margin = { top: 40, right: 20, bottom: 20, left: 20 };
|
| 335 |
+
const innerWidth = width - margin.left - margin.right;
|
| 336 |
+
const innerHeight = height - margin.top - margin.bottom;
|
| 337 |
+
|
| 338 |
+
g.attr('transform', `translate(${margin.left},${margin.top})`);
|
| 339 |
+
|
| 340 |
+
// Clear previous content
|
| 341 |
+
g.selectAll('*').remove();
|
| 342 |
+
|
| 343 |
+
// Column positions with increased horizontal spacing
|
| 344 |
+
const nodeWidth = Math.min(150, innerWidth * 0.2);
|
| 345 |
+
const nodeHeight = 85;
|
| 346 |
+
const gapBetweenColumns = Math.max(80, innerWidth * 0.15);
|
| 347 |
+
|
| 348 |
+
// Calculate column centers with larger gaps
|
| 349 |
+
const col1X = nodeWidth / 2 + 20;
|
| 350 |
+
const col2X = col1X + nodeWidth / 2 + gapBetweenColumns + nodeWidth / 2;
|
| 351 |
+
const col3X = col2X + nodeWidth / 2 + gapBetweenColumns + nodeWidth / 2;
|
| 352 |
+
|
| 353 |
+
// Section titles
|
| 354 |
+
g.selectAll('.section-title')
|
| 355 |
+
.data([
|
| 356 |
+
{ x: col1X, label: 'INPUTS' },
|
| 357 |
+
{ x: col2X, label: 'COMPARISON METHODS' },
|
| 358 |
+
{ x: col3X, label: 'SCORES' }
|
| 359 |
+
])
|
| 360 |
+
.join('text')
|
| 361 |
+
.attr('class', 'section-title')
|
| 362 |
+
.attr('x', d => d.x)
|
| 363 |
+
.attr('y', -15)
|
| 364 |
+
.attr('text-anchor', 'middle')
|
| 365 |
+
.text(d => d.label);
|
| 366 |
+
|
| 367 |
+
// Calculate positions
|
| 368 |
+
const inputY = innerHeight * 0.25;
|
| 369 |
+
const methodStartY = 40;
|
| 370 |
+
const methodSpacing = (innerHeight - methodStartY - nodeHeight) / (data.methods.length - 1);
|
| 371 |
+
|
| 372 |
+
// Position score nodes to align with specific methods
|
| 373 |
+
// Binary score aligns with Exact Match (index 0)
|
| 374 |
+
// Continuous score aligns with ROUGE (index 2)
|
| 375 |
+
const exactMatchY = methodStartY + 0 * methodSpacing;
|
| 376 |
+
const rougeY = methodStartY + 2 * methodSpacing;
|
| 377 |
+
|
| 378 |
+
// Position nodes
|
| 379 |
+
const inputNodes = data.inputs.map((d, i) => ({
|
| 380 |
+
...d,
|
| 381 |
+
x: col1X - nodeWidth / 2,
|
| 382 |
+
y: inputY + i * (nodeHeight + 30),
|
| 383 |
+
width: nodeWidth,
|
| 384 |
+
height: nodeHeight,
|
| 385 |
+
type: 'input'
|
| 386 |
+
}));
|
| 387 |
+
|
| 388 |
+
const methodNodes = data.methods.map((d, i) => ({
|
| 389 |
+
...d,
|
| 390 |
+
x: col2X - nodeWidth / 2,
|
| 391 |
+
y: methodStartY + i * methodSpacing,
|
| 392 |
+
width: nodeWidth,
|
| 393 |
+
height: nodeHeight,
|
| 394 |
+
type: 'method'
|
| 395 |
+
}));
|
| 396 |
+
|
| 397 |
+
const scoreNodes = data.scores.map((d, i) => {
|
| 398 |
+
// Binary score aligns with Exact Match, Continuous with ROUGE
|
| 399 |
+
const yPos = d.id === 'binary' ? exactMatchY : rougeY;
|
| 400 |
+
return {
|
| 401 |
+
...d,
|
| 402 |
+
x: col3X - nodeWidth / 2,
|
| 403 |
+
y: yPos,
|
| 404 |
+
width: nodeWidth,
|
| 405 |
+
height: nodeHeight,
|
| 406 |
+
type: 'score'
|
| 407 |
+
};
|
| 408 |
+
});
|
| 409 |
+
|
| 410 |
+
const allNodes = [...inputNodes, ...methodNodes, ...scoreNodes];
|
| 411 |
+
|
| 412 |
+
// Create links: inputs -> methods -> scores
|
| 413 |
+
const links = [];
|
| 414 |
+
|
| 415 |
+
// Each input connects to all methods
|
| 416 |
+
inputNodes.forEach(input => {
|
| 417 |
+
methodNodes.forEach(method => {
|
| 418 |
+
links.push({
|
| 419 |
+
source: input,
|
| 420 |
+
target: method,
|
| 421 |
+
type: 'input-method'
|
| 422 |
+
});
|
| 423 |
+
});
|
| 424 |
+
});
|
| 425 |
+
|
| 426 |
+
// Each method connects to appropriate score type
|
| 427 |
+
methodNodes.forEach(method => {
|
| 428 |
+
const targetScore = scoreNodes.find(s => s.id === method.scoreType);
|
| 429 |
+
if (targetScore) {
|
| 430 |
+
links.push({
|
| 431 |
+
source: method,
|
| 432 |
+
target: targetScore,
|
| 433 |
+
type: 'method-score',
|
| 434 |
+
score: method.score
|
| 435 |
+
});
|
| 436 |
+
}
|
| 437 |
+
});
|
| 438 |
+
|
| 439 |
+
// Draw links
|
| 440 |
+
const linkGroup = g.append('g').attr('class', 'links');
|
| 441 |
+
|
| 442 |
+
linkGroup.selectAll('.link-path')
|
| 443 |
+
.data(links)
|
| 444 |
+
.join('path')
|
| 445 |
+
.attr('class', 'link-path')
|
| 446 |
+
.attr('d', d => {
|
| 447 |
+
const sx = d.source.x + d.source.width;
|
| 448 |
+
const sy = d.source.y + d.source.height / 2;
|
| 449 |
+
const tx = d.target.x;
|
| 450 |
+
const ty = d.target.y + d.target.height / 2;
|
| 451 |
+
const mx = (sx + tx) / 2;
|
| 452 |
+
return `M ${sx} ${sy} C ${mx} ${sy}, ${mx} ${ty}, ${tx} ${ty}`;
|
| 453 |
+
})
|
| 454 |
+
.attr('marker-end', 'url(#arrowhead)');
|
| 455 |
+
|
| 456 |
+
// Add score badges on method->score links
|
| 457 |
+
const scoreBadges = linkGroup.selectAll('.score-badge-group')
|
| 458 |
+
.data(links.filter(d => d.type === 'method-score'))
|
| 459 |
+
.join('g')
|
| 460 |
+
.attr('class', 'score-badge-group')
|
| 461 |
+
.attr('transform', d => {
|
| 462 |
+
const sx = d.source.x + d.source.width;
|
| 463 |
+
const sy = d.source.y + d.source.height / 2;
|
| 464 |
+
const tx = d.target.x;
|
| 465 |
+
const ty = d.target.y + d.target.height / 2;
|
| 466 |
+
const mx = (sx + tx) / 2;
|
| 467 |
+
const my = (sy + ty) / 2;
|
| 468 |
+
return `translate(${mx}, ${my})`;
|
| 469 |
+
});
|
| 470 |
+
|
| 471 |
+
scoreBadges.append('rect')
|
| 472 |
+
.attr('class', 'score-badge-bg')
|
| 473 |
+
.attr('x', -20)
|
| 474 |
+
.attr('y', -12)
|
| 475 |
+
.attr('width', 40)
|
| 476 |
+
.attr('height', 24)
|
| 477 |
+
.attr('rx', 6);
|
| 478 |
+
|
| 479 |
+
scoreBadges.append('text')
|
| 480 |
+
.attr('class', 'score-badge')
|
| 481 |
+
.attr('text-anchor', 'middle')
|
| 482 |
+
.attr('dominant-baseline', 'middle')
|
| 483 |
+
.text(d => d.score);
|
| 484 |
+
|
| 485 |
+
// Draw nodes
|
| 486 |
+
const nodeGroup = g.append('g').attr('class', 'nodes');
|
| 487 |
+
|
| 488 |
+
const nodes = nodeGroup.selectAll('.node')
|
| 489 |
+
.data(allNodes)
|
| 490 |
+
.join('g')
|
| 491 |
+
.attr('class', 'node')
|
| 492 |
+
.attr('transform', d => `translate(${d.x},${d.y})`)
|
| 493 |
+
.style('cursor', 'pointer');
|
| 494 |
+
|
| 495 |
+
nodes.append('rect')
|
| 496 |
+
.attr('class', d => `node-rect ${d.type}-node`)
|
| 497 |
+
.attr('width', d => d.width)
|
| 498 |
+
.attr('height', d => d.height)
|
| 499 |
+
.attr('rx', 8)
|
| 500 |
+
.on('mouseenter', function(event, d) {
|
| 501 |
+
if (d.description) {
|
| 502 |
+
tooltip.textContent = d.description;
|
| 503 |
+
tooltip.classList.add('visible');
|
| 504 |
+
const rect = container.getBoundingClientRect();
|
| 505 |
+
tooltip.style.left = (event.clientX - rect.left + 10) + 'px';
|
| 506 |
+
tooltip.style.top = (event.clientY - rect.top + 10) + 'px';
|
| 507 |
+
}
|
| 508 |
+
})
|
| 509 |
+
.on('mouseleave', function() {
|
| 510 |
+
tooltip.classList.remove('visible');
|
| 511 |
+
});
|
| 512 |
+
|
| 513 |
+
nodes.append('text')
|
| 514 |
+
.attr('class', 'node-label')
|
| 515 |
+
.attr('x', d => d.width / 2)
|
| 516 |
+
.attr('y', 18)
|
| 517 |
+
.attr('text-anchor', 'middle')
|
| 518 |
+
.text(d => d.label);
|
| 519 |
+
|
| 520 |
+
nodes.append('text')
|
| 521 |
+
.attr('class', 'node-sublabel')
|
| 522 |
+
.attr('x', d => d.width / 2)
|
| 523 |
+
.attr('y', 32)
|
| 524 |
+
.attr('text-anchor', 'middle')
|
| 525 |
+
.text(d => d.sublabel);
|
| 526 |
+
|
| 527 |
+
// Add example text to input nodes
|
| 528 |
+
nodes.filter(d => d.type === 'input' && d.example)
|
| 529 |
+
.each(function(d) {
|
| 530 |
+
const node = d3.select(this);
|
| 531 |
+
const lines = wrapText(d.example, d.width - 16);
|
| 532 |
+
lines.forEach((line, i) => {
|
| 533 |
+
node.append('text')
|
| 534 |
+
.attr('class', 'node-example')
|
| 535 |
+
.attr('x', d.width / 2)
|
| 536 |
+
.attr('y', 48 + i * 12)
|
| 537 |
+
.attr('text-anchor', 'middle')
|
| 538 |
+
.text(line);
|
| 539 |
+
});
|
| 540 |
+
});
|
| 541 |
+
|
| 542 |
+
// Score is shown on the arrows, not in the method nodes
|
| 543 |
+
|
| 544 |
+
// Add aggregation info to score nodes
|
| 545 |
+
nodes.filter(d => d.type === 'score' && d.aggregations)
|
| 546 |
+
.append('text')
|
| 547 |
+
.attr('class', 'node-sublabel')
|
| 548 |
+
.attr('x', d => d.width / 2)
|
| 549 |
+
.attr('y', d => d.height - 12)
|
| 550 |
+
.attr('text-anchor', 'middle')
|
| 551 |
+
.attr('font-size', '9px')
|
| 552 |
+
.text(d => `${d.aggregations.slice(0, 2).join(', ')}...`);
|
| 553 |
+
}
|
| 554 |
+
|
| 555 |
+
render();
|
| 556 |
+
|
| 557 |
+
// Responsive handling
|
| 558 |
+
if (window.ResizeObserver) {
|
| 559 |
+
const ro = new ResizeObserver(() => render());
|
| 560 |
+
ro.observe(container);
|
| 561 |
+
} else {
|
| 562 |
+
window.addEventListener('resize', render);
|
| 563 |
+
}
|
| 564 |
+
};
|
| 565 |
+
|
| 566 |
+
if (document.readyState === 'loading') {
|
| 567 |
+
document.addEventListener('DOMContentLoaded', () => ensureD3(bootstrap), { once: true });
|
| 568 |
+
} else {
|
| 569 |
+
ensureD3(bootstrap);
|
| 570 |
+
}
|
| 571 |
+
})();
|
| 572 |
+
</script>
|
app/src/content/embeds/d3-precision-recall.html
ADDED
|
@@ -0,0 +1,348 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-precision-recall"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-precision-recall {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
border: none;
|
| 8 |
+
border-radius: 0;
|
| 9 |
+
padding: var(--spacing-4) 0;
|
| 10 |
+
width: 100%;
|
| 11 |
+
margin: 0 auto;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.d3-precision-recall svg {
|
| 15 |
+
width: 100%;
|
| 16 |
+
height: auto;
|
| 17 |
+
display: block;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
.d3-precision-recall .circle {
|
| 21 |
+
fill: none;
|
| 22 |
+
stroke-width: 3;
|
| 23 |
+
opacity: 0.8;
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
.d3-precision-recall .circle-predicted {
|
| 27 |
+
stroke: #4A90E2;
|
| 28 |
+
fill: #4A90E2;
|
| 29 |
+
fill-opacity: 0.15;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
.d3-precision-recall .circle-relevant {
|
| 33 |
+
stroke: #F5A623;
|
| 34 |
+
fill: #F5A623;
|
| 35 |
+
fill-opacity: 0.15;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
.d3-precision-recall .intersection {
|
| 39 |
+
fill: #7ED321;
|
| 40 |
+
fill-opacity: 0.3;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
[data-theme="dark"] .d3-precision-recall .circle-predicted {
|
| 44 |
+
stroke: #5DA9FF;
|
| 45 |
+
fill: #5DA9FF;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
[data-theme="dark"] .d3-precision-recall .circle-relevant {
|
| 49 |
+
stroke: #FFB84D;
|
| 50 |
+
fill: #FFB84D;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
[data-theme="dark"] .d3-precision-recall .intersection {
|
| 54 |
+
fill: #94E842;
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
.d3-precision-recall .label {
|
| 58 |
+
font-size: 14px;
|
| 59 |
+
font-weight: 600;
|
| 60 |
+
fill: var(--text-color);
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
.d3-precision-recall .count-label {
|
| 64 |
+
font-size: 13px;
|
| 65 |
+
font-weight: 500;
|
| 66 |
+
fill: var(--text-color);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.d3-precision-recall .formula-text {
|
| 70 |
+
font-size: 12px;
|
| 71 |
+
fill: var(--text-color);
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
.d3-precision-recall .formula-box {
|
| 75 |
+
fill: var(--surface-bg);
|
| 76 |
+
stroke: var(--border-color);
|
| 77 |
+
stroke-width: 1;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
.d3-precision-recall .section-title {
|
| 81 |
+
font-size: 16px;
|
| 82 |
+
font-weight: 700;
|
| 83 |
+
fill: var(--primary-color);
|
| 84 |
+
text-anchor: middle;
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
.d3-precision-recall .legend-text {
|
| 88 |
+
font-size: 11px;
|
| 89 |
+
fill: var(--text-color);
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
.d3-precision-recall .legend-rect {
|
| 93 |
+
stroke-width: 1.5;
|
| 94 |
+
}
|
| 95 |
+
</style>
|
| 96 |
+
|
| 97 |
+
<script>
|
| 98 |
+
(() => {
|
| 99 |
+
const ensureD3 = (cb) => {
|
| 100 |
+
if (window.d3 && typeof window.d3.select === 'function') return cb();
|
| 101 |
+
let s = document.getElementById('d3-cdn-script');
|
| 102 |
+
if (!s) {
|
| 103 |
+
s = document.createElement('script');
|
| 104 |
+
s.id = 'd3-cdn-script';
|
| 105 |
+
s.src = 'https://cdn.jsdelivr.net/npm/d3@7/dist/d3.min.js';
|
| 106 |
+
document.head.appendChild(s);
|
| 107 |
+
}
|
| 108 |
+
const onReady = () => {
|
| 109 |
+
if (window.d3 && typeof window.d3.select === 'function') cb();
|
| 110 |
+
};
|
| 111 |
+
s.addEventListener('load', onReady, { once: true });
|
| 112 |
+
if (window.d3) onReady();
|
| 113 |
+
};
|
| 114 |
+
|
| 115 |
+
const bootstrap = () => {
|
| 116 |
+
const scriptEl = document.currentScript;
|
| 117 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 118 |
+
if (!(container && container.classList && container.classList.contains('d3-precision-recall'))) {
|
| 119 |
+
const candidates = Array.from(document.querySelectorAll('.d3-precision-recall'))
|
| 120 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 121 |
+
container = candidates[candidates.length - 1] || null;
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
if (!container) return;
|
| 125 |
+
|
| 126 |
+
if (container.dataset) {
|
| 127 |
+
if (container.dataset.mounted === 'true') return;
|
| 128 |
+
container.dataset.mounted = 'true';
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
const svg = d3.select(container).append('svg');
|
| 132 |
+
const g = svg.append('g');
|
| 133 |
+
|
| 134 |
+
let width = 800;
|
| 135 |
+
let height = 500;
|
| 136 |
+
|
| 137 |
+
function render() {
|
| 138 |
+
width = container.clientWidth || 800;
|
| 139 |
+
height = Math.max(400, Math.round(width * 0.5));
|
| 140 |
+
|
| 141 |
+
svg.attr('width', width).attr('height', height);
|
| 142 |
+
|
| 143 |
+
const margin = { top: 40, right: 40, bottom: 80, left: 40 };
|
| 144 |
+
const innerWidth = width - margin.left - margin.right;
|
| 145 |
+
const innerHeight = height - margin.top - margin.bottom;
|
| 146 |
+
|
| 147 |
+
g.attr('transform', `translate(${margin.left},${margin.top})`);
|
| 148 |
+
g.selectAll('*').remove();
|
| 149 |
+
|
| 150 |
+
// Example: Question answering with exact match
|
| 151 |
+
const TP = 45; // True Positives (correct answers identified)
|
| 152 |
+
const FP = 8; // False Positives (incorrect marked as correct)
|
| 153 |
+
const FN = 5; // False Negatives (correct marked as incorrect)
|
| 154 |
+
|
| 155 |
+
const totalPredicted = TP + FP; // All predicted as correct
|
| 156 |
+
const totalRelevant = TP + FN; // All actually correct
|
| 157 |
+
|
| 158 |
+
const precision = TP / totalPredicted;
|
| 159 |
+
const recall = TP / totalRelevant;
|
| 160 |
+
|
| 161 |
+
// Circle parameters
|
| 162 |
+
const radius = Math.min(innerWidth, innerHeight) * 0.25;
|
| 163 |
+
const overlapOffset = radius * 0.6;
|
| 164 |
+
|
| 165 |
+
const predictedX = innerWidth * 0.35;
|
| 166 |
+
const relevantX = predictedX + overlapOffset;
|
| 167 |
+
const centerY = innerHeight * 0.4;
|
| 168 |
+
|
| 169 |
+
// Title
|
| 170 |
+
g.append('text')
|
| 171 |
+
.attr('class', 'section-title')
|
| 172 |
+
.attr('x', innerWidth / 2)
|
| 173 |
+
.attr('y', -10)
|
| 174 |
+
.text('Precision and Recall Visualization');
|
| 175 |
+
|
| 176 |
+
// Draw circles
|
| 177 |
+
g.append('circle')
|
| 178 |
+
.attr('class', 'circle circle-predicted')
|
| 179 |
+
.attr('cx', predictedX)
|
| 180 |
+
.attr('cy', centerY)
|
| 181 |
+
.attr('r', radius);
|
| 182 |
+
|
| 183 |
+
g.append('circle')
|
| 184 |
+
.attr('class', 'circle circle-relevant')
|
| 185 |
+
.attr('cx', relevantX)
|
| 186 |
+
.attr('cy', centerY)
|
| 187 |
+
.attr('r', radius);
|
| 188 |
+
|
| 189 |
+
// Calculate intersection area (approximate)
|
| 190 |
+
const intersectionX = (predictedX + relevantX) / 2;
|
| 191 |
+
|
| 192 |
+
// Draw intersection highlight
|
| 193 |
+
const clipId = 'clip-intersection-' + Math.random().toString(36).substr(2, 9);
|
| 194 |
+
const defs = g.append('defs');
|
| 195 |
+
const clipPath = defs.append('clipPath').attr('id', clipId);
|
| 196 |
+
|
| 197 |
+
clipPath.append('circle')
|
| 198 |
+
.attr('cx', predictedX)
|
| 199 |
+
.attr('cy', centerY)
|
| 200 |
+
.attr('r', radius);
|
| 201 |
+
|
| 202 |
+
g.append('circle')
|
| 203 |
+
.attr('class', 'intersection')
|
| 204 |
+
.attr('cx', relevantX)
|
| 205 |
+
.attr('cy', centerY)
|
| 206 |
+
.attr('r', radius)
|
| 207 |
+
.attr('clip-path', `url(#${clipId})`);
|
| 208 |
+
|
| 209 |
+
// Labels for circles
|
| 210 |
+
g.append('text')
|
| 211 |
+
.attr('class', 'label')
|
| 212 |
+
.attr('x', predictedX - radius * 0.7)
|
| 213 |
+
.attr('y', centerY - radius - 15)
|
| 214 |
+
.attr('text-anchor', 'middle')
|
| 215 |
+
.text('Predicted Correct');
|
| 216 |
+
|
| 217 |
+
g.append('text')
|
| 218 |
+
.attr('class', 'label')
|
| 219 |
+
.attr('x', relevantX + radius * 0.7)
|
| 220 |
+
.attr('y', centerY - radius - 15)
|
| 221 |
+
.attr('text-anchor', 'middle')
|
| 222 |
+
.text('Actually Correct');
|
| 223 |
+
|
| 224 |
+
// Count labels inside circles
|
| 225 |
+
// Left part (FP)
|
| 226 |
+
g.append('text')
|
| 227 |
+
.attr('class', 'count-label')
|
| 228 |
+
.attr('x', predictedX - radius * 0.5)
|
| 229 |
+
.attr('y', centerY)
|
| 230 |
+
.attr('text-anchor', 'middle')
|
| 231 |
+
.attr('fill', '#4A90E2')
|
| 232 |
+
.text(`FP: ${FP}`);
|
| 233 |
+
|
| 234 |
+
// Intersection (TP)
|
| 235 |
+
g.append('text')
|
| 236 |
+
.attr('class', 'count-label')
|
| 237 |
+
.attr('x', intersectionX)
|
| 238 |
+
.attr('y', centerY)
|
| 239 |
+
.attr('text-anchor', 'middle')
|
| 240 |
+
.attr('fill', '#7ED321')
|
| 241 |
+
.style('font-weight', '700')
|
| 242 |
+
.text(`TP: ${TP}`);
|
| 243 |
+
|
| 244 |
+
// Right part (FN)
|
| 245 |
+
g.append('text')
|
| 246 |
+
.attr('class', 'count-label')
|
| 247 |
+
.attr('x', relevantX + radius * 0.5)
|
| 248 |
+
.attr('y', centerY)
|
| 249 |
+
.attr('text-anchor', 'middle')
|
| 250 |
+
.attr('fill', '#F5A623')
|
| 251 |
+
.text(`FN: ${FN}`);
|
| 252 |
+
|
| 253 |
+
// Formula boxes at bottom
|
| 254 |
+
const formulaY = centerY + radius + 60;
|
| 255 |
+
const boxWidth = Math.min(200, innerWidth * 0.35);
|
| 256 |
+
const boxHeight = 80;
|
| 257 |
+
const boxGap = 40;
|
| 258 |
+
|
| 259 |
+
const precisionX = innerWidth * 0.3 - boxWidth / 2;
|
| 260 |
+
const recallX = innerWidth * 0.7 - boxWidth / 2;
|
| 261 |
+
|
| 262 |
+
// Precision box
|
| 263 |
+
g.append('rect')
|
| 264 |
+
.attr('class', 'formula-box')
|
| 265 |
+
.attr('x', precisionX)
|
| 266 |
+
.attr('y', formulaY - boxHeight / 2)
|
| 267 |
+
.attr('width', boxWidth)
|
| 268 |
+
.attr('height', boxHeight)
|
| 269 |
+
.attr('rx', 8);
|
| 270 |
+
|
| 271 |
+
g.append('text')
|
| 272 |
+
.attr('class', 'label')
|
| 273 |
+
.attr('x', precisionX + boxWidth / 2)
|
| 274 |
+
.attr('y', formulaY - boxHeight / 2 + 20)
|
| 275 |
+
.attr('text-anchor', 'middle')
|
| 276 |
+
.attr('fill', '#4A90E2')
|
| 277 |
+
.text('Precision');
|
| 278 |
+
|
| 279 |
+
g.append('text')
|
| 280 |
+
.attr('class', 'formula-text')
|
| 281 |
+
.attr('x', precisionX + boxWidth / 2)
|
| 282 |
+
.attr('y', formulaY - boxHeight / 2 + 40)
|
| 283 |
+
.attr('text-anchor', 'middle')
|
| 284 |
+
.text(`TP / (TP + FP) = ${TP} / ${totalPredicted}`);
|
| 285 |
+
|
| 286 |
+
g.append('text')
|
| 287 |
+
.attr('class', 'formula-text')
|
| 288 |
+
.attr('x', precisionX + boxWidth / 2)
|
| 289 |
+
.attr('y', formulaY - boxHeight / 2 + 60)
|
| 290 |
+
.attr('text-anchor', 'middle')
|
| 291 |
+
.style('font-weight', '700')
|
| 292 |
+
.style('font-size', '16px')
|
| 293 |
+
.attr('fill', '#4A90E2')
|
| 294 |
+
.text(`= ${(precision * 100).toFixed(1)}%`);
|
| 295 |
+
|
| 296 |
+
// Recall box
|
| 297 |
+
g.append('rect')
|
| 298 |
+
.attr('class', 'formula-box')
|
| 299 |
+
.attr('x', recallX)
|
| 300 |
+
.attr('y', formulaY - boxHeight / 2)
|
| 301 |
+
.attr('width', boxWidth)
|
| 302 |
+
.attr('height', boxHeight)
|
| 303 |
+
.attr('rx', 8);
|
| 304 |
+
|
| 305 |
+
g.append('text')
|
| 306 |
+
.attr('class', 'label')
|
| 307 |
+
.attr('x', recallX + boxWidth / 2)
|
| 308 |
+
.attr('y', formulaY - boxHeight / 2 + 20)
|
| 309 |
+
.attr('text-anchor', 'middle')
|
| 310 |
+
.attr('fill', '#F5A623')
|
| 311 |
+
.text('Recall');
|
| 312 |
+
|
| 313 |
+
g.append('text')
|
| 314 |
+
.attr('class', 'formula-text')
|
| 315 |
+
.attr('x', recallX + boxWidth / 2)
|
| 316 |
+
.attr('y', formulaY - boxHeight / 2 + 40)
|
| 317 |
+
.attr('text-anchor', 'middle')
|
| 318 |
+
.text(`TP / (TP + FN) = ${TP} / ${totalRelevant}`);
|
| 319 |
+
|
| 320 |
+
g.append('text')
|
| 321 |
+
.attr('class', 'formula-text')
|
| 322 |
+
.attr('x', recallX + boxWidth / 2)
|
| 323 |
+
.attr('y', formulaY - boxHeight / 2 + 60)
|
| 324 |
+
.attr('text-anchor', 'middle')
|
| 325 |
+
.style('font-weight', '700')
|
| 326 |
+
.style('font-size', '16px')
|
| 327 |
+
.attr('fill', '#F5A623')
|
| 328 |
+
.text(`= ${(recall * 100).toFixed(1)}%`);
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
render();
|
| 332 |
+
|
| 333 |
+
// Responsive handling
|
| 334 |
+
if (window.ResizeObserver) {
|
| 335 |
+
const ro = new ResizeObserver(() => render());
|
| 336 |
+
ro.observe(container);
|
| 337 |
+
} else {
|
| 338 |
+
window.addEventListener('resize', render);
|
| 339 |
+
}
|
| 340 |
+
};
|
| 341 |
+
|
| 342 |
+
if (document.readyState === 'loading') {
|
| 343 |
+
document.addEventListener('DOMContentLoaded', () => ensureD3(bootstrap), { once: true });
|
| 344 |
+
} else {
|
| 345 |
+
ensureD3(bootstrap);
|
| 346 |
+
}
|
| 347 |
+
})();
|
| 348 |
+
</script>
|
app/src/content/embeds/d3-quality-management.html
ADDED
|
@@ -0,0 +1,254 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-quality-management"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-quality-management {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
border: none;
|
| 8 |
+
border-radius: 0;
|
| 9 |
+
padding: 0;
|
| 10 |
+
width: 100%;
|
| 11 |
+
margin: 0 auto;
|
| 12 |
+
position: relative;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.d3-quality-management .quality-grid {
|
| 16 |
+
display: grid;
|
| 17 |
+
grid-template-columns: repeat(3, 1fr);
|
| 18 |
+
gap: var(--spacing-4);
|
| 19 |
+
margin-bottom: var(--spacing-4);
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
.d3-quality-management .quality-card {
|
| 23 |
+
background: oklch(from var(--primary-color) calc(l + 0.4) c h / 0.35);
|
| 24 |
+
border: 1px solid oklch(from var(--primary-color) calc(l + 0.15) c h / 0.6);
|
| 25 |
+
border-radius: 16px;
|
| 26 |
+
padding: var(--spacing-4) var(--spacing-5);
|
| 27 |
+
text-align: left;
|
| 28 |
+
display: flex;
|
| 29 |
+
flex-direction: column;
|
| 30 |
+
justify-content: flex-start;
|
| 31 |
+
align-items: flex-start;
|
| 32 |
+
min-height: 160px;
|
| 33 |
+
transition: all 0.3s ease;
|
| 34 |
+
cursor: pointer;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
.d3-quality-management .quality-card:hover {
|
| 38 |
+
transform: translateY(-2px);
|
| 39 |
+
box-shadow: 0 8px 24px rgba(0, 0, 0, 0.12);
|
| 40 |
+
border-color: var(--primary-color);
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
/* Dark mode adjustments for better readability */
|
| 44 |
+
[data-theme="dark"] .d3-quality-management .quality-card {
|
| 45 |
+
background: oklch(from var(--primary-color) calc(l + 0.3) c h / 0.25);
|
| 46 |
+
border-color: oklch(from var(--primary-color) calc(l + 0.1) c h / 0.65);
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
[data-theme="dark"] .d3-quality-management .quality-card:hover {
|
| 50 |
+
box-shadow: 0 8px 24px rgba(0, 0, 0, 0.3);
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
.d3-quality-management .category-title {
|
| 54 |
+
font-size: 18px;
|
| 55 |
+
font-weight: 600;
|
| 56 |
+
color: var(--primary-color);
|
| 57 |
+
margin-bottom: var(--spacing-3);
|
| 58 |
+
line-height: 1.2;
|
| 59 |
+
letter-spacing: -0.01em;
|
| 60 |
+
position: relative;
|
| 61 |
+
z-index: 1;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
/* Dark mode adjustments for better readability */
|
| 65 |
+
[data-theme="dark"] .d3-quality-management .category-title {
|
| 66 |
+
color: oklch(from var(--primary-color) calc(l + 0.1) calc(c * 1.2) h);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.d3-quality-management .category-items {
|
| 70 |
+
list-style: none;
|
| 71 |
+
padding: 0;
|
| 72 |
+
margin: 0;
|
| 73 |
+
font-size: 13px;
|
| 74 |
+
color: var(--text-color);
|
| 75 |
+
line-height: 1.6;
|
| 76 |
+
font-weight: 500;
|
| 77 |
+
position: relative;
|
| 78 |
+
z-index: 1;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
.d3-quality-management .category-items li {
|
| 82 |
+
padding-left: 1.6em;
|
| 83 |
+
position: relative;
|
| 84 |
+
margin-bottom: var(--spacing-1);
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
.d3-quality-management .category-items li::before {
|
| 88 |
+
content: "•";
|
| 89 |
+
position: absolute;
|
| 90 |
+
left: 0.4em;
|
| 91 |
+
top: 0;
|
| 92 |
+
color: var(--primary-color);
|
| 93 |
+
font-weight: 600;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
/* Dark mode adjustments for better readability */
|
| 97 |
+
[data-theme="dark"] .d3-quality-management .category-items {
|
| 98 |
+
color: var(--text-color);
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
.d3-quality-management .bottom-row {
|
| 102 |
+
display: grid;
|
| 103 |
+
grid-template-columns: repeat(2, 1fr);
|
| 104 |
+
gap: var(--spacing-4);
|
| 105 |
+
}
|
| 106 |
+
|
| 107 |
+
.d3-quality-management .caption {
|
| 108 |
+
margin-top: var(--spacing-4);
|
| 109 |
+
font-size: 13px;
|
| 110 |
+
color: var(--muted-color);
|
| 111 |
+
line-height: 1.5;
|
| 112 |
+
font-style: italic;
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
@media (max-width: 1024px) {
|
| 116 |
+
.d3-quality-management .quality-grid {
|
| 117 |
+
grid-template-columns: repeat(2, 1fr);
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
.d3-quality-management .bottom-row {
|
| 121 |
+
grid-template-columns: 1fr;
|
| 122 |
+
}
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
@media (max-width: 768px) {
|
| 126 |
+
.d3-quality-management {
|
| 127 |
+
padding: var(--spacing-3) 0;
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
.d3-quality-management .quality-grid {
|
| 131 |
+
grid-template-columns: 1fr;
|
| 132 |
+
gap: var(--spacing-3);
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
.d3-quality-management .bottom-row {
|
| 136 |
+
grid-template-columns: 1fr;
|
| 137 |
+
gap: var(--spacing-3);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
.d3-quality-management .quality-card {
|
| 141 |
+
min-height: 140px;
|
| 142 |
+
padding: var(--spacing-3) var(--spacing-4);
|
| 143 |
+
}
|
| 144 |
+
}
|
| 145 |
+
</style>
|
| 146 |
+
|
| 147 |
+
<script>
|
| 148 |
+
(() => {
|
| 149 |
+
const bootstrap = () => {
|
| 150 |
+
const scriptEl = document.currentScript;
|
| 151 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 152 |
+
if (!(container && container.classList && container.classList.contains('d3-quality-management'))) {
|
| 153 |
+
const candidates = Array.from(document.querySelectorAll('.d3-quality-management'))
|
| 154 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 155 |
+
container = candidates[candidates.length - 1] || null;
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
if (!container) return;
|
| 159 |
+
|
| 160 |
+
if (container.dataset) {
|
| 161 |
+
if (container.dataset.mounted === 'true') return;
|
| 162 |
+
container.dataset.mounted = 'true';
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
// Data structure for quality management categories
|
| 166 |
+
const categories = [
|
| 167 |
+
{
|
| 168 |
+
title: 'Annotation Process',
|
| 169 |
+
items: [
|
| 170 |
+
'Iterative Annotation',
|
| 171 |
+
'Careful Data Selection',
|
| 172 |
+
'Annotation Scheme',
|
| 173 |
+
'Guideline Design',
|
| 174 |
+
'Pilot Study',
|
| 175 |
+
'Validation Step'
|
| 176 |
+
]
|
| 177 |
+
},
|
| 178 |
+
{
|
| 179 |
+
title: 'Annotators',
|
| 180 |
+
items: [
|
| 181 |
+
'Workforce Selection',
|
| 182 |
+
'Qualification Test',
|
| 183 |
+
'Annotator Training',
|
| 184 |
+
'Annotator Debriefing',
|
| 185 |
+
'Monetary Incentive'
|
| 186 |
+
]
|
| 187 |
+
},
|
| 188 |
+
{
|
| 189 |
+
title: 'Quality Estimation',
|
| 190 |
+
items: [
|
| 191 |
+
'Error Rate',
|
| 192 |
+
'Control Questions',
|
| 193 |
+
'Agreement'
|
| 194 |
+
]
|
| 195 |
+
},
|
| 196 |
+
{
|
| 197 |
+
title: 'Quality Improvement',
|
| 198 |
+
items: [
|
| 199 |
+
'Correction',
|
| 200 |
+
'Updated Guidelines',
|
| 201 |
+
'Filtering',
|
| 202 |
+
'Annotator Feedback',
|
| 203 |
+
'Annotator Deboarding'
|
| 204 |
+
]
|
| 205 |
+
},
|
| 206 |
+
{
|
| 207 |
+
title: 'Adjudication',
|
| 208 |
+
items: [
|
| 209 |
+
'Manual Curation',
|
| 210 |
+
'Majority Voting',
|
| 211 |
+
'Probabilistic Aggregation'
|
| 212 |
+
]
|
| 213 |
+
}
|
| 214 |
+
];
|
| 215 |
+
|
| 216 |
+
// Create the quality management structure
|
| 217 |
+
const topRowHtml = categories.slice(0, 3).map(cat => `
|
| 218 |
+
<div class="quality-card">
|
| 219 |
+
<div class="category-title">${cat.title}</div>
|
| 220 |
+
<ul class="category-items">
|
| 221 |
+
${cat.items.map(item => `<li>${item}</li>`).join('')}
|
| 222 |
+
</ul>
|
| 223 |
+
</div>
|
| 224 |
+
`).join('');
|
| 225 |
+
|
| 226 |
+
const bottomRowHtml = categories.slice(3).map(cat => `
|
| 227 |
+
<div class="quality-card">
|
| 228 |
+
<div class="category-title">${cat.title}</div>
|
| 229 |
+
<ul class="category-items">
|
| 230 |
+
${cat.items.map(item => `<li>${item}</li>`).join('')}
|
| 231 |
+
</ul>
|
| 232 |
+
</div>
|
| 233 |
+
`).join('');
|
| 234 |
+
|
| 235 |
+
container.innerHTML = `
|
| 236 |
+
<div class="quality-grid">
|
| 237 |
+
${topRowHtml}
|
| 238 |
+
</div>
|
| 239 |
+
<div class="bottom-row">
|
| 240 |
+
${bottomRowHtml}
|
| 241 |
+
</div>
|
| 242 |
+
<div class="caption">
|
| 243 |
+
<strong>Figure 1:</strong> Data annotation best practices recommended by the comprehensive review at aclanthology.org/2024.cl-3.1 - check out their Section 3.
|
| 244 |
+
</div>
|
| 245 |
+
`;
|
| 246 |
+
};
|
| 247 |
+
|
| 248 |
+
if (document.readyState === 'loading') {
|
| 249 |
+
document.addEventListener('DOMContentLoaded', bootstrap, { once: true });
|
| 250 |
+
} else {
|
| 251 |
+
bootstrap();
|
| 252 |
+
}
|
| 253 |
+
})();
|
| 254 |
+
</script>
|
app/src/content/embeds/d3-sampling-metrics.html
ADDED
|
@@ -0,0 +1,506 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-sampling-metrics"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-sampling-metrics {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
border: none;
|
| 8 |
+
border-radius: 0;
|
| 9 |
+
padding: var(--spacing-4) 0;
|
| 10 |
+
width: 100%;
|
| 11 |
+
margin: 0 auto;
|
| 12 |
+
position: relative;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.d3-sampling-metrics svg {
|
| 16 |
+
width: 100%;
|
| 17 |
+
height: auto;
|
| 18 |
+
display: block;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
.d3-sampling-metrics .sample-box {
|
| 22 |
+
stroke-width: 2;
|
| 23 |
+
transition: all 0.3s ease;
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
.d3-sampling-metrics .sample-box:hover {
|
| 27 |
+
filter: brightness(1.1);
|
| 28 |
+
stroke-width: 3;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
.d3-sampling-metrics .metric-box {
|
| 32 |
+
stroke-width: 2;
|
| 33 |
+
transition: all 0.3s ease;
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
.d3-sampling-metrics .metric-box:hover {
|
| 37 |
+
filter: brightness(1.1);
|
| 38 |
+
stroke-width: 3;
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
.d3-sampling-metrics .sample-label {
|
| 42 |
+
fill: var(--text-color);
|
| 43 |
+
font-size: 11px;
|
| 44 |
+
font-weight: 600;
|
| 45 |
+
pointer-events: none;
|
| 46 |
+
user-select: none;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
.d3-sampling-metrics .sample-answer {
|
| 50 |
+
fill: var(--text-color);
|
| 51 |
+
font-size: 10px;
|
| 52 |
+
font-weight: 500;
|
| 53 |
+
pointer-events: none;
|
| 54 |
+
user-select: none;
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
.d3-sampling-metrics .metric-label {
|
| 58 |
+
fill: var(--text-color);
|
| 59 |
+
font-size: 13px;
|
| 60 |
+
font-weight: 600;
|
| 61 |
+
pointer-events: none;
|
| 62 |
+
user-select: none;
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
.d3-sampling-metrics .metric-description {
|
| 66 |
+
fill: var(--muted-color);
|
| 67 |
+
font-size: 10px;
|
| 68 |
+
font-weight: 500;
|
| 69 |
+
pointer-events: none;
|
| 70 |
+
user-select: none;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
.d3-sampling-metrics .metric-result {
|
| 74 |
+
font-size: 16px;
|
| 75 |
+
font-weight: 700;
|
| 76 |
+
pointer-events: none;
|
| 77 |
+
user-select: none;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
.d3-sampling-metrics .section-title {
|
| 81 |
+
fill: var(--text-color);
|
| 82 |
+
font-size: 12px;
|
| 83 |
+
font-weight: 700;
|
| 84 |
+
text-transform: uppercase;
|
| 85 |
+
letter-spacing: 0.05em;
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
.d3-sampling-metrics .question-text {
|
| 89 |
+
fill: var(--text-color);
|
| 90 |
+
font-size: 14px;
|
| 91 |
+
font-weight: 600;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
.d3-sampling-metrics .link-line {
|
| 95 |
+
fill: none;
|
| 96 |
+
stroke-width: 1.5;
|
| 97 |
+
transition: all 0.3s ease;
|
| 98 |
+
opacity: 0.3;
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
.d3-sampling-metrics .marker {
|
| 102 |
+
opacity: 0.5;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
.d3-sampling-metrics .d3-tooltip {
|
| 106 |
+
position: absolute;
|
| 107 |
+
background: var(--surface-bg);
|
| 108 |
+
border: 1px solid var(--border-color);
|
| 109 |
+
border-radius: 8px;
|
| 110 |
+
padding: 8px 10px;
|
| 111 |
+
font-size: 12px;
|
| 112 |
+
pointer-events: none;
|
| 113 |
+
opacity: 0;
|
| 114 |
+
transition: opacity 0.12s ease;
|
| 115 |
+
box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
|
| 116 |
+
z-index: 1000;
|
| 117 |
+
max-width: 350px;
|
| 118 |
+
line-height: 1.35;
|
| 119 |
+
white-space: pre-line;
|
| 120 |
+
color: var(--text-color);
|
| 121 |
+
transform: translate(-9999px, -9999px);
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
@media (max-width: 768px) {
|
| 125 |
+
.d3-sampling-metrics .sample-label {
|
| 126 |
+
font-size: 10px;
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
.d3-sampling-metrics .sample-answer {
|
| 130 |
+
font-size: 9px;
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
.d3-sampling-metrics .metric-label {
|
| 134 |
+
font-size: 11px;
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
.d3-sampling-metrics .metric-description {
|
| 138 |
+
font-size: 9px;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
.d3-sampling-metrics .metric-result {
|
| 142 |
+
font-size: 14px;
|
| 143 |
+
}
|
| 144 |
+
}
|
| 145 |
+
</style>
|
| 146 |
+
|
| 147 |
+
<script>
|
| 148 |
+
(() => {
|
| 149 |
+
const ensureD3 = (cb) => {
|
| 150 |
+
if (window.d3 && typeof window.d3.select === 'function') return cb();
|
| 151 |
+
let s = document.getElementById('d3-cdn-script');
|
| 152 |
+
if (!s) {
|
| 153 |
+
s = document.createElement('script');
|
| 154 |
+
s.id = 'd3-cdn-script';
|
| 155 |
+
s.src = 'https://cdn.jsdelivr.net/npm/d3@7/dist/d3.min.js';
|
| 156 |
+
document.head.appendChild(s);
|
| 157 |
+
}
|
| 158 |
+
const onReady = () => {
|
| 159 |
+
if (window.d3 && typeof window.d3.select === 'function') cb();
|
| 160 |
+
};
|
| 161 |
+
s.addEventListener('load', onReady, { once: true });
|
| 162 |
+
if (window.d3) onReady();
|
| 163 |
+
};
|
| 164 |
+
|
| 165 |
+
const bootstrap = () => {
|
| 166 |
+
const scriptEl = document.currentScript;
|
| 167 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 168 |
+
if (!(container && container.classList && container.classList.contains('d3-sampling-metrics'))) {
|
| 169 |
+
const candidates = Array.from(document.querySelectorAll('.d3-sampling-metrics'))
|
| 170 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 171 |
+
container = candidates[candidates.length - 1] || null;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
if (!container) return;
|
| 175 |
+
|
| 176 |
+
if (container.dataset) {
|
| 177 |
+
if (container.dataset.mounted === 'true') return;
|
| 178 |
+
container.dataset.mounted = 'true';
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
container.style.position = container.style.position || 'relative';
|
| 182 |
+
|
| 183 |
+
// Tooltip
|
| 184 |
+
let tip = container.querySelector('.d3-tooltip');
|
| 185 |
+
let tipInner;
|
| 186 |
+
if (!tip) {
|
| 187 |
+
tip = document.createElement('div');
|
| 188 |
+
tip.className = 'd3-tooltip';
|
| 189 |
+
tipInner = document.createElement('div');
|
| 190 |
+
tipInner.className = 'd3-tooltip__inner';
|
| 191 |
+
tipInner.style.textAlign = 'left';
|
| 192 |
+
tip.appendChild(tipInner);
|
| 193 |
+
container.appendChild(tip);
|
| 194 |
+
} else {
|
| 195 |
+
tipInner = tip.querySelector('.d3-tooltip__inner') || tip;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
// Get colors from ColorPalettes or fallback
|
| 199 |
+
const getColors = () => {
|
| 200 |
+
if (window.ColorPalettes && typeof window.ColorPalettes.getColors === 'function') {
|
| 201 |
+
const cat = window.ColorPalettes.getColors('categorical', 5);
|
| 202 |
+
return {
|
| 203 |
+
correct: cat[2], // Green-ish
|
| 204 |
+
incorrect: cat[0], // Red-ish
|
| 205 |
+
metric: cat[4]
|
| 206 |
+
};
|
| 207 |
+
}
|
| 208 |
+
// Fallback to CSS variable based colors
|
| 209 |
+
const primaryColor = getComputedStyle(document.documentElement).getPropertyValue('--primary-color').trim() || '#6D4AFF';
|
| 210 |
+
return {
|
| 211 |
+
correct: '#4CAF50',
|
| 212 |
+
incorrect: '#F44336',
|
| 213 |
+
metric: primaryColor
|
| 214 |
+
};
|
| 215 |
+
};
|
| 216 |
+
|
| 217 |
+
// Example: Math problem "What is 15 + 27?"
|
| 218 |
+
// Correct answer: 42
|
| 219 |
+
// Samples with different answers
|
| 220 |
+
const samples = [
|
| 221 |
+
{ id: 1, answer: '42', correct: true },
|
| 222 |
+
{ id: 2, answer: '42', correct: true },
|
| 223 |
+
{ id: 3, answer: '43', correct: false },
|
| 224 |
+
{ id: 4, answer: '42', correct: true },
|
| 225 |
+
{ id: 5, answer: '41', correct: false }
|
| 226 |
+
];
|
| 227 |
+
|
| 228 |
+
const metrics = [
|
| 229 |
+
{
|
| 230 |
+
id: 'pass@1',
|
| 231 |
+
label: 'pass@1',
|
| 232 |
+
description: 'At least 1 correct',
|
| 233 |
+
result: '✓',
|
| 234 |
+
explanation: 'At least 1 of 5 samples is correct (we have 3 correct samples)',
|
| 235 |
+
usedSamples: [1]
|
| 236 |
+
},
|
| 237 |
+
{
|
| 238 |
+
id: 'pass@3',
|
| 239 |
+
label: 'pass@3',
|
| 240 |
+
description: 'At least 3 correct',
|
| 241 |
+
result: '✓',
|
| 242 |
+
explanation: 'At least 3 of 5 samples are correct (exactly 3 correct)',
|
| 243 |
+
usedSamples: [1, 2, 4]
|
| 244 |
+
},
|
| 245 |
+
{
|
| 246 |
+
id: 'maj@5',
|
| 247 |
+
label: 'maj@5',
|
| 248 |
+
description: 'Most frequent answer',
|
| 249 |
+
result: '42',
|
| 250 |
+
explanation: 'Most common answer: 42 appears 3 times vs 43 (1x) and 41 (1x)',
|
| 251 |
+
usedSamples: [1, 2, 3, 4, 5]
|
| 252 |
+
},
|
| 253 |
+
{
|
| 254 |
+
id: 'avg@5',
|
| 255 |
+
label: 'avg@5',
|
| 256 |
+
description: 'Average score',
|
| 257 |
+
result: '0.60',
|
| 258 |
+
explanation: 'Average correctness: 3 correct / 5 total = 0.60',
|
| 259 |
+
usedSamples: [1, 2, 3, 4, 5]
|
| 260 |
+
}
|
| 261 |
+
];
|
| 262 |
+
|
| 263 |
+
const svg = d3.select(container).append('svg');
|
| 264 |
+
const g = svg.append('g');
|
| 265 |
+
|
| 266 |
+
// Arrow marker
|
| 267 |
+
svg.append('defs').append('marker')
|
| 268 |
+
.attr('id', 'arrow-sampling')
|
| 269 |
+
.attr('viewBox', '0 -5 10 10')
|
| 270 |
+
.attr('refX', 8)
|
| 271 |
+
.attr('refY', 0)
|
| 272 |
+
.attr('markerWidth', 5)
|
| 273 |
+
.attr('markerHeight', 5)
|
| 274 |
+
.attr('orient', 'auto')
|
| 275 |
+
.append('path')
|
| 276 |
+
.attr('d', 'M0,-5L10,0L0,5')
|
| 277 |
+
.attr('class', 'marker');
|
| 278 |
+
|
| 279 |
+
let width = 800;
|
| 280 |
+
let height = 500;
|
| 281 |
+
|
| 282 |
+
function render() {
|
| 283 |
+
width = container.clientWidth || 800;
|
| 284 |
+
height = Math.max(350, Math.round(width * 0.42));
|
| 285 |
+
|
| 286 |
+
svg.attr('width', width).attr('height', height);
|
| 287 |
+
|
| 288 |
+
const margin = { top: 60, right: 20, bottom: 20, left: 20 };
|
| 289 |
+
const innerWidth = width - margin.left - margin.right;
|
| 290 |
+
const innerHeight = height - margin.top - margin.bottom;
|
| 291 |
+
|
| 292 |
+
g.attr('transform', `translate(${margin.left},${margin.top})`);
|
| 293 |
+
|
| 294 |
+
// Clear previous content
|
| 295 |
+
g.selectAll('*').remove();
|
| 296 |
+
|
| 297 |
+
const colors = getColors();
|
| 298 |
+
|
| 299 |
+
// Question at the top
|
| 300 |
+
g.append('text')
|
| 301 |
+
.attr('class', 'question-text')
|
| 302 |
+
.attr('x', innerWidth / 2)
|
| 303 |
+
.attr('y', -35)
|
| 304 |
+
.attr('text-anchor', 'middle')
|
| 305 |
+
.text('Question: What is 15 + 27?');
|
| 306 |
+
|
| 307 |
+
g.append('text')
|
| 308 |
+
.attr('x', innerWidth / 2)
|
| 309 |
+
.attr('y', -18)
|
| 310 |
+
.attr('text-anchor', 'middle')
|
| 311 |
+
.attr('font-size', '11px')
|
| 312 |
+
.attr('fill', 'var(--muted-color)')
|
| 313 |
+
.text('(Correct answer: 42)');
|
| 314 |
+
|
| 315 |
+
// Layout
|
| 316 |
+
const sampleBoxWidth = Math.min(80, innerWidth * 0.12);
|
| 317 |
+
const sampleBoxHeight = 60;
|
| 318 |
+
const metricBoxWidth = Math.min(140, innerWidth * 0.22);
|
| 319 |
+
const metricBoxHeight = 75;
|
| 320 |
+
|
| 321 |
+
// Position samples in a row
|
| 322 |
+
const samplesY = 20;
|
| 323 |
+
const sampleSpacing = (innerWidth - sampleBoxWidth * samples.length) / (samples.length + 1);
|
| 324 |
+
|
| 325 |
+
const sampleNodes = samples.map((d, i) => ({
|
| 326 |
+
...d,
|
| 327 |
+
x: sampleSpacing + i * (sampleBoxWidth + sampleSpacing),
|
| 328 |
+
y: samplesY,
|
| 329 |
+
width: sampleBoxWidth,
|
| 330 |
+
height: sampleBoxHeight
|
| 331 |
+
}));
|
| 332 |
+
|
| 333 |
+
// Position metrics below
|
| 334 |
+
const metricsY = samplesY + sampleBoxHeight + 60;
|
| 335 |
+
const metricSpacing = (innerWidth - metricBoxWidth * metrics.length) / (metrics.length + 1);
|
| 336 |
+
|
| 337 |
+
const metricNodes = metrics.map((d, i) => ({
|
| 338 |
+
...d,
|
| 339 |
+
x: metricSpacing + i * (metricBoxWidth + metricSpacing),
|
| 340 |
+
y: metricsY,
|
| 341 |
+
width: metricBoxWidth,
|
| 342 |
+
height: metricBoxHeight
|
| 343 |
+
}));
|
| 344 |
+
|
| 345 |
+
// Section titles
|
| 346 |
+
g.append('text')
|
| 347 |
+
.attr('class', 'section-title')
|
| 348 |
+
.attr('x', innerWidth / 2)
|
| 349 |
+
.attr('y', samplesY - 10)
|
| 350 |
+
.attr('text-anchor', 'middle')
|
| 351 |
+
.text('5 SAMPLED GENERATIONS');
|
| 352 |
+
|
| 353 |
+
g.append('text')
|
| 354 |
+
.attr('class', 'section-title')
|
| 355 |
+
.attr('x', innerWidth / 2)
|
| 356 |
+
.attr('y', metricsY - 10)
|
| 357 |
+
.attr('text-anchor', 'middle')
|
| 358 |
+
.text('SAMPLING METRICS');
|
| 359 |
+
|
| 360 |
+
// Draw connection lines from samples to metrics
|
| 361 |
+
const linkGroup = g.append('g').attr('class', 'links');
|
| 362 |
+
|
| 363 |
+
metricNodes.forEach(metric => {
|
| 364 |
+
metric.usedSamples.forEach(sampleId => {
|
| 365 |
+
const sample = sampleNodes.find(s => s.id === sampleId);
|
| 366 |
+
if (sample) {
|
| 367 |
+
const sx = sample.x + sample.width / 2;
|
| 368 |
+
const sy = sample.y + sample.height;
|
| 369 |
+
const tx = metric.x + metric.width / 2;
|
| 370 |
+
const ty = metric.y;
|
| 371 |
+
|
| 372 |
+
linkGroup.append('line')
|
| 373 |
+
.attr('class', 'link-line')
|
| 374 |
+
.attr('x1', sx)
|
| 375 |
+
.attr('y1', sy)
|
| 376 |
+
.attr('x2', tx)
|
| 377 |
+
.attr('y2', ty)
|
| 378 |
+
.attr('stroke', colors.metric);
|
| 379 |
+
}
|
| 380 |
+
});
|
| 381 |
+
});
|
| 382 |
+
|
| 383 |
+
// Draw sample boxes
|
| 384 |
+
const sampleGroup = g.append('g').attr('class', 'samples');
|
| 385 |
+
|
| 386 |
+
const sampleBoxes = sampleGroup.selectAll('.sample')
|
| 387 |
+
.data(sampleNodes)
|
| 388 |
+
.join('g')
|
| 389 |
+
.attr('class', 'sample')
|
| 390 |
+
.attr('transform', d => `translate(${d.x},${d.y})`);
|
| 391 |
+
|
| 392 |
+
sampleBoxes.append('rect')
|
| 393 |
+
.attr('class', 'sample-box')
|
| 394 |
+
.attr('width', d => d.width)
|
| 395 |
+
.attr('height', d => d.height)
|
| 396 |
+
.attr('rx', 6)
|
| 397 |
+
.attr('fill', d => d.correct ? colors.correct : colors.incorrect)
|
| 398 |
+
.attr('fill-opacity', 0.3)
|
| 399 |
+
.attr('stroke', d => d.correct ? colors.correct : colors.incorrect)
|
| 400 |
+
.style('cursor', 'pointer')
|
| 401 |
+
.on('mouseenter', function(event, d) {
|
| 402 |
+
const status = d.correct ? 'Correct ✓' : 'Incorrect ✗';
|
| 403 |
+
tipInner.textContent = `Sample ${d.id}: "${d.answer}"\n${status}`;
|
| 404 |
+
tip.style.opacity = '1';
|
| 405 |
+
const [mx, my] = d3.pointer(event, container);
|
| 406 |
+
tip.style.transform = `translate(${mx + 10}px, ${my + 10}px)`;
|
| 407 |
+
})
|
| 408 |
+
.on('mouseleave', function() {
|
| 409 |
+
tip.style.opacity = '0';
|
| 410 |
+
tip.style.transform = 'translate(-9999px, -9999px)';
|
| 411 |
+
});
|
| 412 |
+
|
| 413 |
+
sampleBoxes.append('text')
|
| 414 |
+
.attr('class', 'sample-label')
|
| 415 |
+
.attr('x', d => d.width / 2)
|
| 416 |
+
.attr('y', 18)
|
| 417 |
+
.attr('text-anchor', 'middle')
|
| 418 |
+
.text(d => `#${d.id}`);
|
| 419 |
+
|
| 420 |
+
sampleBoxes.append('text')
|
| 421 |
+
.attr('class', 'sample-answer')
|
| 422 |
+
.attr('x', d => d.width / 2)
|
| 423 |
+
.attr('y', 35)
|
| 424 |
+
.attr('text-anchor', 'middle')
|
| 425 |
+
.attr('font-size', '14px')
|
| 426 |
+
.attr('font-weight', '700')
|
| 427 |
+
.text(d => d.answer);
|
| 428 |
+
|
| 429 |
+
sampleBoxes.append('text')
|
| 430 |
+
.attr('class', 'sample-label')
|
| 431 |
+
.attr('x', d => d.width / 2)
|
| 432 |
+
.attr('y', 50)
|
| 433 |
+
.attr('text-anchor', 'middle')
|
| 434 |
+
.attr('font-size', '10px')
|
| 435 |
+
.text(d => d.correct ? '✓' : '✗');
|
| 436 |
+
|
| 437 |
+
// Draw metric boxes
|
| 438 |
+
const metricGroup = g.append('g').attr('class', 'metrics');
|
| 439 |
+
|
| 440 |
+
const metricBoxes = metricGroup.selectAll('.metric')
|
| 441 |
+
.data(metricNodes)
|
| 442 |
+
.join('g')
|
| 443 |
+
.attr('class', 'metric')
|
| 444 |
+
.attr('transform', d => `translate(${d.x},${d.y})`);
|
| 445 |
+
|
| 446 |
+
metricBoxes.append('rect')
|
| 447 |
+
.attr('class', 'metric-box')
|
| 448 |
+
.attr('width', d => d.width)
|
| 449 |
+
.attr('height', d => d.height)
|
| 450 |
+
.attr('rx', 8)
|
| 451 |
+
.attr('fill', colors.metric)
|
| 452 |
+
.attr('fill-opacity', 0.35)
|
| 453 |
+
.attr('stroke', colors.metric)
|
| 454 |
+
.style('cursor', 'pointer')
|
| 455 |
+
.on('mouseenter', function(event, d) {
|
| 456 |
+
tipInner.textContent = d.explanation;
|
| 457 |
+
tip.style.opacity = '1';
|
| 458 |
+
const [mx, my] = d3.pointer(event, container);
|
| 459 |
+
tip.style.transform = `translate(${mx + 10}px, ${my + 10}px)`;
|
| 460 |
+
})
|
| 461 |
+
.on('mouseleave', function() {
|
| 462 |
+
tip.style.opacity = '0';
|
| 463 |
+
tip.style.transform = 'translate(-9999px, -9999px)';
|
| 464 |
+
});
|
| 465 |
+
|
| 466 |
+
metricBoxes.append('text')
|
| 467 |
+
.attr('class', 'metric-label')
|
| 468 |
+
.attr('x', d => d.width / 2)
|
| 469 |
+
.attr('y', 18)
|
| 470 |
+
.attr('text-anchor', 'middle')
|
| 471 |
+
.text(d => d.label);
|
| 472 |
+
|
| 473 |
+
metricBoxes.append('text')
|
| 474 |
+
.attr('class', 'metric-description')
|
| 475 |
+
.attr('x', d => d.width / 2)
|
| 476 |
+
.attr('y', 32)
|
| 477 |
+
.attr('text-anchor', 'middle')
|
| 478 |
+
.text(d => d.description);
|
| 479 |
+
|
| 480 |
+
metricBoxes.append('text')
|
| 481 |
+
.attr('class', 'metric-result')
|
| 482 |
+
.attr('x', d => d.width / 2)
|
| 483 |
+
.attr('y', 56)
|
| 484 |
+
.attr('text-anchor', 'middle')
|
| 485 |
+
.attr('fill', colors.metric)
|
| 486 |
+
.text(d => d.result);
|
| 487 |
+
}
|
| 488 |
+
|
| 489 |
+
render();
|
| 490 |
+
|
| 491 |
+
// Responsive handling
|
| 492 |
+
if (window.ResizeObserver) {
|
| 493 |
+
const ro = new ResizeObserver(() => render());
|
| 494 |
+
ro.observe(container);
|
| 495 |
+
} else {
|
| 496 |
+
window.addEventListener('resize', render);
|
| 497 |
+
}
|
| 498 |
+
};
|
| 499 |
+
|
| 500 |
+
if (document.readyState === 'loading') {
|
| 501 |
+
document.addEventListener('DOMContentLoaded', () => ensureD3(bootstrap), { once: true });
|
| 502 |
+
} else {
|
| 503 |
+
ensureD3(bootstrap);
|
| 504 |
+
}
|
| 505 |
+
})();
|
| 506 |
+
</script>
|
app/src/content/embeds/d3-text-metrics.html
ADDED
|
@@ -0,0 +1,501 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="d3-text-metrics"></div>
|
| 2 |
+
|
| 3 |
+
<style>
|
| 4 |
+
.d3-text-metrics {
|
| 5 |
+
font-family: var(--default-font-family);
|
| 6 |
+
background: transparent;
|
| 7 |
+
padding: 0;
|
| 8 |
+
width: 100%;
|
| 9 |
+
position: relative;
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
.d3-text-metrics .example-text {
|
| 13 |
+
font-size: 12px;
|
| 14 |
+
line-height: 1.8;
|
| 15 |
+
color: var(--text-color);
|
| 16 |
+
font-family: monospace;
|
| 17 |
+
margin: 8px 0;
|
| 18 |
+
padding: 10px 12px;
|
| 19 |
+
background: var(--surface-bg);
|
| 20 |
+
border: 1px solid var(--border-color);
|
| 21 |
+
border-radius: 6px;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
.d3-text-metrics .label {
|
| 25 |
+
font-size: 10px;
|
| 26 |
+
font-weight: 700;
|
| 27 |
+
color: var(--muted-color);
|
| 28 |
+
margin-right: 8px;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
.d3-text-metrics .metrics-grid {
|
| 32 |
+
display: grid;
|
| 33 |
+
grid-template-columns: repeat(3, 1fr);
|
| 34 |
+
gap: 12px;
|
| 35 |
+
margin: 16px 0;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
.d3-text-metrics .metric-box {
|
| 39 |
+
padding: 12px;
|
| 40 |
+
background: var(--surface-bg);
|
| 41 |
+
border: 1px solid var(--border-color);
|
| 42 |
+
border-radius: 8px;
|
| 43 |
+
transition: border-color 0.2s;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
.d3-text-metrics .metric-box:hover {
|
| 47 |
+
border-color: var(--primary-color);
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
.d3-text-metrics .metric-name {
|
| 51 |
+
font-size: 13px;
|
| 52 |
+
font-weight: 600;
|
| 53 |
+
color: var(--text-color);
|
| 54 |
+
margin-bottom: 6px;
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
.d3-text-metrics .metric-score {
|
| 58 |
+
font-size: 22px;
|
| 59 |
+
font-weight: 700;
|
| 60 |
+
color: var(--primary-color);
|
| 61 |
+
margin-bottom: 4px;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
.d3-text-metrics .metric-detail {
|
| 65 |
+
font-size: 11px;
|
| 66 |
+
color: var(--muted-color);
|
| 67 |
+
line-height: 1.4;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
.d3-text-metrics .visualization {
|
| 71 |
+
margin-top: 8px;
|
| 72 |
+
padding: 8px;
|
| 73 |
+
background: oklch(from var(--primary-color) calc(l + 0.45) c h / 0.06);
|
| 74 |
+
border-radius: 4px;
|
| 75 |
+
font-size: 10px;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
[data-theme="dark"] .d3-text-metrics .visualization {
|
| 79 |
+
background: oklch(from var(--primary-color) calc(l + 0.20) c h / 0.1);
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
.d3-text-metrics .token {
|
| 83 |
+
display: inline-block;
|
| 84 |
+
padding: 2px 5px;
|
| 85 |
+
margin: 2px;
|
| 86 |
+
border-radius: 3px;
|
| 87 |
+
font-size: 10px;
|
| 88 |
+
background: var(--surface-bg);
|
| 89 |
+
border: 1px solid var(--border-color);
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
.d3-text-metrics .token.match {
|
| 93 |
+
background: oklch(from var(--primary-color) calc(l + 0.35) c h / 0.35);
|
| 94 |
+
border-color: var(--primary-color);
|
| 95 |
+
font-weight: 600;
|
| 96 |
+
}
|
| 97 |
+
|
| 98 |
+
[data-theme="dark"] .d3-text-metrics .token.match {
|
| 99 |
+
background: oklch(from var(--primary-color) calc(l + 0.25) c h / 0.4);
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
.d3-text-metrics .controls {
|
| 103 |
+
display: flex;
|
| 104 |
+
justify-content: center;
|
| 105 |
+
margin-bottom: 16px;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
.d3-text-metrics select {
|
| 109 |
+
font-size: 12px;
|
| 110 |
+
padding: 6px 24px 6px 10px;
|
| 111 |
+
border: 1px solid var(--border-color);
|
| 112 |
+
border-radius: 6px;
|
| 113 |
+
background: var(--surface-bg);
|
| 114 |
+
color: var(--text-color);
|
| 115 |
+
cursor: pointer;
|
| 116 |
+
appearance: none;
|
| 117 |
+
background-image: url("data:image/svg+xml;charset=UTF-8,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='currentColor' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3e%3cpolyline points='6 9 12 15 18 9'%3e%3c/polyline%3e%3c/svg%3e");
|
| 118 |
+
background-repeat: no-repeat;
|
| 119 |
+
background-position: right 6px center;
|
| 120 |
+
background-size: 12px;
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
@media (max-width: 768px) {
|
| 124 |
+
.d3-text-metrics .metrics-grid {
|
| 125 |
+
grid-template-columns: 1fr;
|
| 126 |
+
}
|
| 127 |
+
}
|
| 128 |
+
</style>
|
| 129 |
+
|
| 130 |
+
<script>
|
| 131 |
+
(() => {
|
| 132 |
+
const bootstrap = () => {
|
| 133 |
+
const scriptEl = document.currentScript;
|
| 134 |
+
let container = scriptEl ? scriptEl.previousElementSibling : null;
|
| 135 |
+
if (!(container && container.classList && container.classList.contains('d3-text-metrics'))) {
|
| 136 |
+
const candidates = Array.from(document.querySelectorAll('.d3-text-metrics'))
|
| 137 |
+
.filter((el) => !(el.dataset && el.dataset.mounted === 'true'));
|
| 138 |
+
container = candidates[candidates.length - 1] || null;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
if (!container) return;
|
| 142 |
+
if (container.dataset) {
|
| 143 |
+
if (container.dataset.mounted === 'true') return;
|
| 144 |
+
container.dataset.mounted = 'true';
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
// Single example: Cat Evaluator
|
| 148 |
+
const reference = "My cat loves doing model evaluation and testing benchmarks";
|
| 149 |
+
const prediction = "My cat enjoys model evaluation and testing models";
|
| 150 |
+
|
| 151 |
+
const tokenize = (text) => text.toLowerCase().trim().split(/\s+/);
|
| 152 |
+
|
| 153 |
+
const getNgrams = (tokens, n) => {
|
| 154 |
+
const ngrams = [];
|
| 155 |
+
for (let i = 0; i <= tokens.length - n; i++) {
|
| 156 |
+
ngrams.push(tokens.slice(i, i + n));
|
| 157 |
+
}
|
| 158 |
+
return ngrams;
|
| 159 |
+
};
|
| 160 |
+
|
| 161 |
+
const computeExactMatch = (pred, ref) => {
|
| 162 |
+
return pred.toLowerCase().trim() === ref.toLowerCase().trim() ? 1.0 : 0.0;
|
| 163 |
+
};
|
| 164 |
+
|
| 165 |
+
const computeBleu = (pred, ref) => {
|
| 166 |
+
const predTokens = tokenize(pred);
|
| 167 |
+
const refTokens = tokenize(ref);
|
| 168 |
+
if (predTokens.length === 0) return { score: 0, details: [] };
|
| 169 |
+
|
| 170 |
+
const details = [];
|
| 171 |
+
const precisions = [];
|
| 172 |
+
|
| 173 |
+
for (let n = 1; n <= 3; n++) {
|
| 174 |
+
const predNgrams = getNgrams(predTokens, n);
|
| 175 |
+
const refNgrams = getNgrams(refTokens, n);
|
| 176 |
+
if (predNgrams.length === 0) {
|
| 177 |
+
precisions.push(0);
|
| 178 |
+
continue;
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
const refCounts = {};
|
| 182 |
+
refNgrams.forEach(ng => {
|
| 183 |
+
const key = ng.join(' ');
|
| 184 |
+
refCounts[key] = (refCounts[key] || 0) + 1;
|
| 185 |
+
});
|
| 186 |
+
|
| 187 |
+
let matches = 0;
|
| 188 |
+
const matchedNgrams = [];
|
| 189 |
+
const predCounts = {};
|
| 190 |
+
|
| 191 |
+
predNgrams.forEach(ng => {
|
| 192 |
+
const key = ng.join(' ');
|
| 193 |
+
predCounts[key] = (predCounts[key] || 0) + 1;
|
| 194 |
+
if (refCounts[key] && predCounts[key] <= refCounts[key]) {
|
| 195 |
+
matches++;
|
| 196 |
+
if (!matchedNgrams.includes(key)) matchedNgrams.push(key);
|
| 197 |
+
}
|
| 198 |
+
});
|
| 199 |
+
|
| 200 |
+
const precision = matches / predNgrams.length;
|
| 201 |
+
precisions.push(precision);
|
| 202 |
+
details.push({ n, matches, total: predNgrams.length, matchedNgrams });
|
| 203 |
+
}
|
| 204 |
+
|
| 205 |
+
const validPrecisions = precisions.filter(p => p > 0);
|
| 206 |
+
const score = validPrecisions.length > 0
|
| 207 |
+
? Math.exp(validPrecisions.reduce((sum, p) => sum + Math.log(p), 0) / validPrecisions.length)
|
| 208 |
+
: 0;
|
| 209 |
+
|
| 210 |
+
return { score, details };
|
| 211 |
+
};
|
| 212 |
+
|
| 213 |
+
const computeRouge1 = (pred, ref) => {
|
| 214 |
+
const predTokens = tokenize(pred);
|
| 215 |
+
const refTokens = tokenize(ref);
|
| 216 |
+
|
| 217 |
+
const predCounts = {};
|
| 218 |
+
const refCounts = {};
|
| 219 |
+
predTokens.forEach(t => predCounts[t] = (predCounts[t] || 0) + 1);
|
| 220 |
+
refTokens.forEach(t => refCounts[t] = (refCounts[t] || 0) + 1);
|
| 221 |
+
|
| 222 |
+
let overlap = 0;
|
| 223 |
+
const matchedTokens = [];
|
| 224 |
+
Object.keys(refCounts).forEach(token => {
|
| 225 |
+
if (predCounts[token]) {
|
| 226 |
+
overlap += Math.min(predCounts[token], refCounts[token]);
|
| 227 |
+
matchedTokens.push(token);
|
| 228 |
+
}
|
| 229 |
+
});
|
| 230 |
+
|
| 231 |
+
const recall = refTokens.length > 0 ? overlap / refTokens.length : 0;
|
| 232 |
+
const precision = predTokens.length > 0 ? overlap / predTokens.length : 0;
|
| 233 |
+
const f1 = (precision + recall) > 0 ? 2 * precision * recall / (precision + recall) : 0;
|
| 234 |
+
|
| 235 |
+
return { score: f1, recall, precision, matchedTokens };
|
| 236 |
+
};
|
| 237 |
+
|
| 238 |
+
const computeRouge2 = (pred, ref) => {
|
| 239 |
+
const predTokens = tokenize(pred);
|
| 240 |
+
const refTokens = tokenize(ref);
|
| 241 |
+
|
| 242 |
+
const predBigrams = getNgrams(predTokens, 2);
|
| 243 |
+
const refBigrams = getNgrams(refTokens, 2);
|
| 244 |
+
|
| 245 |
+
if (refBigrams.length === 0) {
|
| 246 |
+
return { score: 0, recall: 0, precision: 0, matchedBigrams: [] };
|
| 247 |
+
}
|
| 248 |
+
|
| 249 |
+
const predCounts = {};
|
| 250 |
+
const refCounts = {};
|
| 251 |
+
predBigrams.forEach(bg => {
|
| 252 |
+
const key = bg.join(' ');
|
| 253 |
+
predCounts[key] = (predCounts[key] || 0) + 1;
|
| 254 |
+
});
|
| 255 |
+
refBigrams.forEach(bg => {
|
| 256 |
+
const key = bg.join(' ');
|
| 257 |
+
refCounts[key] = (refCounts[key] || 0) + 1;
|
| 258 |
+
});
|
| 259 |
+
|
| 260 |
+
let overlap = 0;
|
| 261 |
+
const matchedBigrams = [];
|
| 262 |
+
Object.keys(refCounts).forEach(bigram => {
|
| 263 |
+
if (predCounts[bigram]) {
|
| 264 |
+
overlap += Math.min(predCounts[bigram], refCounts[bigram]);
|
| 265 |
+
matchedBigrams.push(bigram);
|
| 266 |
+
}
|
| 267 |
+
});
|
| 268 |
+
|
| 269 |
+
const recall = refBigrams.length > 0 ? overlap / refBigrams.length : 0;
|
| 270 |
+
const precision = predBigrams.length > 0 ? overlap / predBigrams.length : 0;
|
| 271 |
+
const f1 = (precision + recall) > 0 ? 2 * precision * recall / (precision + recall) : 0;
|
| 272 |
+
|
| 273 |
+
return { score: f1, recall, precision, matchedBigrams };
|
| 274 |
+
};
|
| 275 |
+
|
| 276 |
+
const computeEditDistanceWithOps = (s1, s2) => {
|
| 277 |
+
const m = s1.length;
|
| 278 |
+
const n = s2.length;
|
| 279 |
+
|
| 280 |
+
// Create DP table
|
| 281 |
+
const dp = Array(m + 1).fill(null).map(() => Array(n + 1).fill(0));
|
| 282 |
+
|
| 283 |
+
// Initialize
|
| 284 |
+
for (let i = 0; i <= m; i++) dp[i][0] = i;
|
| 285 |
+
for (let j = 0; j <= n; j++) dp[0][j] = j;
|
| 286 |
+
|
| 287 |
+
// Fill DP table
|
| 288 |
+
for (let i = 1; i <= m; i++) {
|
| 289 |
+
for (let j = 1; j <= n; j++) {
|
| 290 |
+
if (s1[i - 1] === s2[j - 1]) {
|
| 291 |
+
dp[i][j] = dp[i - 1][j - 1];
|
| 292 |
+
} else {
|
| 293 |
+
dp[i][j] = 1 + Math.min(
|
| 294 |
+
dp[i - 1][j], // delete
|
| 295 |
+
dp[i][j - 1], // insert
|
| 296 |
+
dp[i - 1][j - 1] // substitute
|
| 297 |
+
);
|
| 298 |
+
}
|
| 299 |
+
}
|
| 300 |
+
}
|
| 301 |
+
|
| 302 |
+
// Traceback to find operations
|
| 303 |
+
const operations = [];
|
| 304 |
+
let i = m, j = n;
|
| 305 |
+
|
| 306 |
+
while (i > 0 || j > 0) {
|
| 307 |
+
if (i === 0) {
|
| 308 |
+
operations.unshift({ type: 'insert', value: s2[j - 1], pos: j });
|
| 309 |
+
j--;
|
| 310 |
+
} else if (j === 0) {
|
| 311 |
+
operations.unshift({ type: 'delete', value: s1[i - 1], pos: i });
|
| 312 |
+
i--;
|
| 313 |
+
} else if (s1[i - 1] === s2[j - 1]) {
|
| 314 |
+
i--;
|
| 315 |
+
j--;
|
| 316 |
+
} else {
|
| 317 |
+
const deleteCost = dp[i - 1][j];
|
| 318 |
+
const insertCost = dp[i][j - 1];
|
| 319 |
+
const substituteCost = dp[i - 1][j - 1];
|
| 320 |
+
|
| 321 |
+
if (substituteCost <= deleteCost && substituteCost <= insertCost) {
|
| 322 |
+
operations.unshift({ type: 'substitute', from: s1[i - 1], to: s2[j - 1], pos: i });
|
| 323 |
+
i--;
|
| 324 |
+
j--;
|
| 325 |
+
} else if (deleteCost <= insertCost) {
|
| 326 |
+
operations.unshift({ type: 'delete', value: s1[i - 1], pos: i });
|
| 327 |
+
i--;
|
| 328 |
+
} else {
|
| 329 |
+
operations.unshift({ type: 'insert', value: s2[j - 1], pos: j });
|
| 330 |
+
j--;
|
| 331 |
+
}
|
| 332 |
+
}
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
return { distance: dp[m][n], operations };
|
| 336 |
+
};
|
| 337 |
+
|
| 338 |
+
const computeTer = (pred, ref) => {
|
| 339 |
+
const predTokens = tokenize(pred);
|
| 340 |
+
const refTokens = tokenize(ref);
|
| 341 |
+
const result = computeEditDistanceWithOps(predTokens, refTokens);
|
| 342 |
+
const score = refTokens.length > 0 ? result.distance / refTokens.length : 1.0;
|
| 343 |
+
return {
|
| 344 |
+
score,
|
| 345 |
+
edits: result.distance,
|
| 346 |
+
refLength: refTokens.length,
|
| 347 |
+
operations: result.operations
|
| 348 |
+
};
|
| 349 |
+
};
|
| 350 |
+
|
| 351 |
+
const computeBleurtMock = (pred, ref) => {
|
| 352 |
+
const predTokens = new Set(tokenize(pred));
|
| 353 |
+
const refTokens = new Set(tokenize(ref));
|
| 354 |
+
const intersection = new Set([...predTokens].filter(t => refTokens.has(t)));
|
| 355 |
+
const union = new Set([...predTokens, ...refTokens]);
|
| 356 |
+
const jaccard = union.size > 0 ? intersection.size / union.size : 0;
|
| 357 |
+
return { score: jaccard * 1.5 - 0.5, jaccard };
|
| 358 |
+
};
|
| 359 |
+
|
| 360 |
+
const render = () => {
|
| 361 |
+
const exactMatch = computeExactMatch(prediction, reference);
|
| 362 |
+
const bleu = computeBleu(prediction, reference);
|
| 363 |
+
const rouge1 = computeRouge1(prediction, reference);
|
| 364 |
+
const rouge2 = computeRouge2(prediction, reference);
|
| 365 |
+
const ter = computeTer(prediction, reference);
|
| 366 |
+
const bleurt = computeBleurtMock(prediction, reference);
|
| 367 |
+
|
| 368 |
+
container.innerHTML = `
|
| 369 |
+
<div class="example-text">
|
| 370 |
+
<span class="label">REF:</span>${reference}
|
| 371 |
+
</div>
|
| 372 |
+
<div class="example-text">
|
| 373 |
+
<span class="label">PRED:</span>${prediction}
|
| 374 |
+
</div>
|
| 375 |
+
|
| 376 |
+
<div class="metrics-grid">
|
| 377 |
+
<!-- Row 1: Exact Match, TER, BLEURT -->
|
| 378 |
+
<div class="metric-box">
|
| 379 |
+
<div class="metric-name">Exact Match</div>
|
| 380 |
+
<div class="metric-score">${exactMatch.toFixed(1)}</div>
|
| 381 |
+
<div class="metric-detail">Binary: 1 or 0</div>
|
| 382 |
+
<div class="visualization">
|
| 383 |
+
<div style="margin: 4px 0; font-size: 14px;">
|
| 384 |
+
${exactMatch === 1 ? '✓ Strings are identical' : '✗ Strings differ'}
|
| 385 |
+
</div>
|
| 386 |
+
<div style="margin-top: 6px; font-size: 9px; color: var(--muted-color);">
|
| 387 |
+
Most strict metric - no partial credit
|
| 388 |
+
</div>
|
| 389 |
+
</div>
|
| 390 |
+
</div>
|
| 391 |
+
|
| 392 |
+
<div class="metric-box">
|
| 393 |
+
<div class="metric-name">Translation Error Rate</div>
|
| 394 |
+
<div class="metric-score">${ter.score.toFixed(3)}</div>
|
| 395 |
+
<div class="metric-detail">Edit distance normalized</div>
|
| 396 |
+
<div class="visualization">
|
| 397 |
+
<div style="margin: 4px 0;">
|
| 398 |
+
<strong>${ter.edits}</strong> edits / <strong>${ter.refLength}</strong> words = <strong>${ter.score.toFixed(3)}</strong>
|
| 399 |
+
</div>
|
| 400 |
+
${ter.operations.length > 0 ? `
|
| 401 |
+
<div style="margin-top: 8px; font-size: 10px;">
|
| 402 |
+
<div style="margin-bottom: 4px; color: var(--muted-color);">Edit operations:</div>
|
| 403 |
+
${ter.operations.map((op, idx) => {
|
| 404 |
+
if (op.type === 'substitute') {
|
| 405 |
+
return `<div style="margin: 2px 0;">• Replace "<strong>${op.from}</strong>" → "<strong>${op.to}</strong>"</div>`;
|
| 406 |
+
} else if (op.type === 'delete') {
|
| 407 |
+
return `<div style="margin: 2px 0;">• Delete "<strong>${op.value}</strong>"</div>`;
|
| 408 |
+
} else if (op.type === 'insert') {
|
| 409 |
+
return `<div style="margin: 2px 0;">• Insert "<strong>${op.value}</strong>"</div>`;
|
| 410 |
+
}
|
| 411 |
+
}).join('')}
|
| 412 |
+
</div>
|
| 413 |
+
` : ''}
|
| 414 |
+
<div style="margin-top: 6px; font-size: 9px; color: var(--muted-color);">
|
| 415 |
+
Lower is better (0 = identical)
|
| 416 |
+
</div>
|
| 417 |
+
</div>
|
| 418 |
+
</div>
|
| 419 |
+
|
| 420 |
+
<div class="metric-box">
|
| 421 |
+
<div class="metric-name">BLEURT</div>
|
| 422 |
+
<div class="metric-score">${bleurt.score.toFixed(3)}</div>
|
| 423 |
+
<div class="metric-detail">Semantic similarity</div>
|
| 424 |
+
<div class="visualization">
|
| 425 |
+
<div style="margin-top: 6px; font-size: 9px; color: var(--muted-color); font-style: italic;">
|
| 426 |
+
BLEURT uses BERT embeddings learned from real text.
|
| 427 |
+
</div>
|
| 428 |
+
</div>
|
| 429 |
+
</div>
|
| 430 |
+
|
| 431 |
+
<!-- Row 2: BLEU, ROUGE-1, ROUGE-2 -->
|
| 432 |
+
<div class="metric-box">
|
| 433 |
+
<div class="metric-name">BLEU</div>
|
| 434 |
+
<div class="metric-score">${bleu.score.toFixed(3)}</div>
|
| 435 |
+
<div class="metric-detail">N-gram precision-based</div>
|
| 436 |
+
<div class="visualization">
|
| 437 |
+
${bleu.details.map(d => `
|
| 438 |
+
<div style="margin: 4px 0;">
|
| 439 |
+
<strong>${d.n}-gram:</strong> ${d.matches}/${d.total} (${(d.matches/d.total*100).toFixed(0)}%)
|
| 440 |
+
</div>
|
| 441 |
+
<div style="margin: 2px 0;">
|
| 442 |
+
${d.matchedNgrams.slice(0, 3).map(ng => `<span class="token match">${ng}</span>`).join('')}
|
| 443 |
+
${d.matchedNgrams.length > 3 ? `<span style="color: var(--muted-color); font-size: 10px;">+${d.matchedNgrams.length - 3} more</span>` : ''}
|
| 444 |
+
</div>
|
| 445 |
+
`).join('')}
|
| 446 |
+
</div>
|
| 447 |
+
</div>
|
| 448 |
+
|
| 449 |
+
<div class="metric-box">
|
| 450 |
+
<div class="metric-name">ROUGE-1</div>
|
| 451 |
+
<div class="metric-score">${rouge1.score.toFixed(3)}</div>
|
| 452 |
+
<div class="metric-detail">Unigram-based F1</div>
|
| 453 |
+
<div class="visualization">
|
| 454 |
+
<div style="margin: 4px 0;">
|
| 455 |
+
<strong>Recall:</strong> ${(rouge1.recall * 100).toFixed(0)}% | <strong>Precision:</strong> ${(rouge1.precision * 100).toFixed(0)}%
|
| 456 |
+
</div>
|
| 457 |
+
<div style="margin-top: 6px; font-size: 9px; color: var(--muted-color);">
|
| 458 |
+
Matched unigrams:
|
| 459 |
+
</div>
|
| 460 |
+
${rouge1.matchedTokens.length > 0 ? `
|
| 461 |
+
<div style="margin: 2px 0;">
|
| 462 |
+
${rouge1.matchedTokens.slice(0, 5).map(t => `<span class="token match">${t}</span>`).join('')}
|
| 463 |
+
${rouge1.matchedTokens.length > 5 ? `<span style="color: var(--muted-color); font-size: 10px;">+${rouge1.matchedTokens.length - 5} more</span>` : ''}
|
| 464 |
+
</div>
|
| 465 |
+
` : ''}
|
| 466 |
+
</div>
|
| 467 |
+
</div>
|
| 468 |
+
|
| 469 |
+
<div class="metric-box">
|
| 470 |
+
<div class="metric-name">ROUGE-2</div>
|
| 471 |
+
<div class="metric-score">${rouge2.score.toFixed(3)}</div>
|
| 472 |
+
<div class="metric-detail">Bigram-based F1</div>
|
| 473 |
+
<div class="visualization">
|
| 474 |
+
<div style="margin: 4px 0;">
|
| 475 |
+
<strong>Recall:</strong> ${(rouge2.recall * 100).toFixed(0)}% | <strong>Precision:</strong> ${(rouge2.precision * 100).toFixed(0)}%
|
| 476 |
+
</div>
|
| 477 |
+
<div style="margin-top: 6px; font-size: 9px; color: var(--muted-color);">
|
| 478 |
+
Matched bigrams:
|
| 479 |
+
</div>
|
| 480 |
+
${rouge2.matchedBigrams.length > 0 ? `
|
| 481 |
+
<div style="margin: 2px 0;">
|
| 482 |
+
${rouge2.matchedBigrams.slice(0, 3).map(bg => `<span class="token match">${bg}</span>`).join('')}
|
| 483 |
+
${rouge2.matchedBigrams.length > 3 ? `<span style="color: var(--muted-color); font-size: 10px;">+${rouge2.matchedBigrams.length - 3} more</span>` : ''}
|
| 484 |
+
</div>
|
| 485 |
+
` : '<div style="margin: 2px 0; font-size: 10px; color: var(--muted-color);">No bigram matches</div>'}
|
| 486 |
+
</div>
|
| 487 |
+
</div>
|
| 488 |
+
</div>
|
| 489 |
+
`;
|
| 490 |
+
};
|
| 491 |
+
|
| 492 |
+
render();
|
| 493 |
+
};
|
| 494 |
+
|
| 495 |
+
if (document.readyState === 'loading') {
|
| 496 |
+
document.addEventListener('DOMContentLoaded', bootstrap, { once: true });
|
| 497 |
+
} else {
|
| 498 |
+
bootstrap();
|
| 499 |
+
}
|
| 500 |
+
})();
|
| 501 |
+
</script>
|