Commit ·
ec17199
1
Parent(s): 77abf89
Add working webserver
Browse files- README.md +2 -2
- app.py +404 -0
- packages.txt +1 -0
- requirements.txt +17 -0
- sample_input.sdf +387 -0
- sample_input_smiles.csv +6 -0
- utils.py +172 -0
README.md
CHANGED
|
@@ -1,8 +1,8 @@
|
|
| 1 |
---
|
| 2 |
title: B3lcf
|
| 3 |
emoji: 🏆
|
| 4 |
-
colorFrom:
|
| 5 |
-
colorTo:
|
| 6 |
sdk: streamlit
|
| 7 |
sdk_version: 1.41.1
|
| 8 |
app_file: app.py
|
|
|
|
| 1 |
---
|
| 2 |
title: B3lcf
|
| 3 |
emoji: 🏆
|
| 4 |
+
colorFrom: blue
|
| 5 |
+
colorTo: pink
|
| 6 |
sdk: streamlit
|
| 7 |
sdk_version: 1.41.1
|
| 8 |
app_file: app.py
|
app.py
ADDED
|
@@ -0,0 +1,404 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import itertools as it
|
| 2 |
+
import os
|
| 3 |
+
import tempfile
|
| 4 |
+
from io import StringIO
|
| 5 |
+
|
| 6 |
+
import joblib
|
| 7 |
+
import numpy as np
|
| 8 |
+
import pandas as pd
|
| 9 |
+
import pkg_resources
|
| 10 |
+
# page set up
|
| 11 |
+
import streamlit as st
|
| 12 |
+
from b3clf.descriptor_padel import compute_descriptors
|
| 13 |
+
from b3clf.geometry_opt import geometry_optimize
|
| 14 |
+
from b3clf.utils import get_descriptors, scale_descriptors, select_descriptors
|
| 15 |
+
# from PIL import Image
|
| 16 |
+
from streamlit_extras.let_it_rain import rain
|
| 17 |
+
from streamlit_ketcher import st_ketcher
|
| 18 |
+
|
| 19 |
+
from utils import generate_predictions, load_all_models
|
| 20 |
+
|
| 21 |
+
st.cache_data.clear()
|
| 22 |
+
|
| 23 |
+
st.set_page_config(
|
| 24 |
+
page_title="BBB Permeability Prediction with Imbalanced Learning",
|
| 25 |
+
# page_icon="🧊",
|
| 26 |
+
layout="wide",
|
| 27 |
+
# initial_sidebar_state="expanded",
|
| 28 |
+
# menu_items={
|
| 29 |
+
# "Get Help": "https://www.extremelycoolapp.com/help",
|
| 30 |
+
# "Report a bug": "https://www.extremelycoolapp.com/bug",
|
| 31 |
+
# "About": "# This is a header. This is an *extremely* cool app!"
|
| 32 |
+
# }
|
| 33 |
+
)
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
keep_features = "no"
|
| 37 |
+
keep_sdf = "no"
|
| 38 |
+
classifiers_dict = {
|
| 39 |
+
"decision tree": "dtree",
|
| 40 |
+
"kNN": "knn",
|
| 41 |
+
"logistic regression": "logreg",
|
| 42 |
+
"XGBoost": "xgb",
|
| 43 |
+
}
|
| 44 |
+
resample_methods_dict = {
|
| 45 |
+
"random undersampling": "classic_RandUndersampling",
|
| 46 |
+
"SMOTE": "classic_SMOTE",
|
| 47 |
+
"Borderline SMOTE": "borderline_SMOTE",
|
| 48 |
+
"k-means SMOTE": "kmeans_SMOTE",
|
| 49 |
+
"ADASYN": "classic_ADASYN",
|
| 50 |
+
"no resampling": "common",
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
pandas_display_options = {
|
| 54 |
+
"line_limit": 50,
|
| 55 |
+
}
|
| 56 |
+
mol_features = None
|
| 57 |
+
info_df = None
|
| 58 |
+
results = None
|
| 59 |
+
temp_file_path = None
|
| 60 |
+
all_models = load_all_models()
|
| 61 |
+
|
| 62 |
+
# Initialize global variables and cleanup function
|
| 63 |
+
if 'temp_dir' not in st.session_state:
|
| 64 |
+
st.session_state.temp_dir = None
|
| 65 |
+
if 'processing' not in st.session_state:
|
| 66 |
+
st.session_state.processing = False
|
| 67 |
+
|
| 68 |
+
def cleanup_temp_files():
|
| 69 |
+
"""Clean up temporary directory and files"""
|
| 70 |
+
if st.session_state.temp_dir and os.path.exists(st.session_state.temp_dir):
|
| 71 |
+
try:
|
| 72 |
+
import shutil
|
| 73 |
+
shutil.rmtree(st.session_state.temp_dir)
|
| 74 |
+
st.session_state.temp_dir = None
|
| 75 |
+
except Exception as e:
|
| 76 |
+
st.error(f"Error cleaning up temporary files: {e}")
|
| 77 |
+
|
| 78 |
+
def clear_cache():
|
| 79 |
+
"""Clear Streamlit cache and session state data"""
|
| 80 |
+
st.cache_data.clear()
|
| 81 |
+
st.cache_resource.clear()
|
| 82 |
+
if 'mol_features' in st.session_state:
|
| 83 |
+
st.session_state.mol_features = None
|
| 84 |
+
if 'info_df' in st.session_state:
|
| 85 |
+
st.session_state.info_df = None
|
| 86 |
+
cleanup_temp_files()
|
| 87 |
+
|
| 88 |
+
# Create the Streamlit app
|
| 89 |
+
st.title(":blue[BBB Permeability Prediction with Imbalanced Learning]")
|
| 90 |
+
info_column, upload_column = st.columns(2)
|
| 91 |
+
|
| 92 |
+
# inatialize the molecule features and info dataframe session state
|
| 93 |
+
if "mol_features" not in st.session_state:
|
| 94 |
+
st.session_state.mol_features = None
|
| 95 |
+
if "info_df" not in st.session_state:
|
| 96 |
+
st.session_state.info_df = None
|
| 97 |
+
if "classifier" not in st.session_state:
|
| 98 |
+
st.session_state.classifier = "XGBoost"
|
| 99 |
+
if "resampler" not in st.session_state:
|
| 100 |
+
st.session_state.resampler = "ADASYN"
|
| 101 |
+
if "historical_data" not in st.session_state:
|
| 102 |
+
st.session_state.historical_data = []
|
| 103 |
+
|
| 104 |
+
# download sample files
|
| 105 |
+
with info_column:
|
| 106 |
+
st.subheader("About `B3clf`")
|
| 107 |
+
# fmt: off
|
| 108 |
+
st.markdown(
|
| 109 |
+
"""
|
| 110 |
+
`B3clf` is a Python package for predicting the blood-brain barrier (BBB) permeability of small molecules using imbalanced learning. It supports decision tree, XGBoost, kNN, logistical regression and 5 resampling strategies (SMOTE, Borderline SMOTE, k-means SMOTE and ADASYN). The workflow of `B3clf` is summarized as below. The Source code and more details are available at https://github.com/theochem/B3clf. This project is supported by Digital Research Alliance of Canada (originally known as Compute Canada) and NSERC. This project is maintained by QC-Dev comminity. For further information and inquiries please contact us at qcdevs@gmail.com."""
|
| 111 |
+
)
|
| 112 |
+
st.text(" \n")
|
| 113 |
+
# text_body = """
|
| 114 |
+
# `B3clf` is a Python package for predicting the blood-brain barrier (BBB) permeability of small molecules using imbalanced learning. It supports decision tree, XGBoost, kNN, logistical regression and 5 resampling strategies (SMOTE, Borderline SMOTE, k-means SMOTE and ADASYN). The workflow of `B3clf` is summarized as below. The Source code and more details are available at https://github.com/theochem/B3clf.
|
| 115 |
+
# """
|
| 116 |
+
# st.markdown(f"<p align="justify">{text_body}</p>",
|
| 117 |
+
# unsafe_allow_html=True)
|
| 118 |
+
|
| 119 |
+
# image = Image.open("images/b3clf_workflow.png")
|
| 120 |
+
# st.image(image=image, use_column_width=True)
|
| 121 |
+
|
| 122 |
+
# image_path = "images/b3clf_workflow.png"
|
| 123 |
+
# image_width_percent = 80
|
| 124 |
+
# info_column.markdown(
|
| 125 |
+
# f"<img src="{image_path}" style="max-width: {image_width_percent}%; height: auto;">",
|
| 126 |
+
# unsafe_allow_html=True
|
| 127 |
+
# )
|
| 128 |
+
|
| 129 |
+
# fmt: on
|
| 130 |
+
sdf_col, smi_col = st.columns(2)
|
| 131 |
+
with sdf_col:
|
| 132 |
+
# uneven columns
|
| 133 |
+
# st.columns((2, 1, 1, 1))
|
| 134 |
+
# two subcolumns for sample input files
|
| 135 |
+
# download sample sdf
|
| 136 |
+
# st.markdown(" \n \n")
|
| 137 |
+
with open("sample_input.sdf", "r") as file_sdf:
|
| 138 |
+
btn = st.download_button(
|
| 139 |
+
label="Download SDF sample file",
|
| 140 |
+
data=file_sdf,
|
| 141 |
+
file_name="sample_input.sdf",
|
| 142 |
+
)
|
| 143 |
+
with smi_col:
|
| 144 |
+
with open("sample_input_smiles.csv", "r") as file_smi:
|
| 145 |
+
btn = st.download_button(
|
| 146 |
+
label="Download SMILES sample file",
|
| 147 |
+
data=file_smi,
|
| 148 |
+
file_name="sample_input_smiles.csv",
|
| 149 |
+
)
|
| 150 |
+
|
| 151 |
+
# Create a file uploader
|
| 152 |
+
with upload_column:
|
| 153 |
+
st.subheader("Model Selection")
|
| 154 |
+
with st.container():
|
| 155 |
+
algorithm_col, resampler_col = st.columns(2)
|
| 156 |
+
# algorithm and resampling method selection column
|
| 157 |
+
with algorithm_col:
|
| 158 |
+
classifier = st.selectbox(
|
| 159 |
+
label="Classification Algorithm:",
|
| 160 |
+
options=("XGBoost", "kNN", "decision tree", "logistic regression"),
|
| 161 |
+
key="classifier",
|
| 162 |
+
help="Select the classification algorithm to use"
|
| 163 |
+
)
|
| 164 |
+
with resampler_col:
|
| 165 |
+
resampler = st.selectbox(
|
| 166 |
+
label="Resampling Method:",
|
| 167 |
+
options=(
|
| 168 |
+
"ADASYN",
|
| 169 |
+
"random undersampling",
|
| 170 |
+
"Borderline SMOTE",
|
| 171 |
+
"k-means SMOTE",
|
| 172 |
+
"SMOTE",
|
| 173 |
+
"no resampling",
|
| 174 |
+
),
|
| 175 |
+
key="resampler",
|
| 176 |
+
help="Select the resampling method to handle imbalanced data"
|
| 177 |
+
)
|
| 178 |
+
|
| 179 |
+
# Update session state based on selections
|
| 180 |
+
if "classifier" not in st.session_state:
|
| 181 |
+
st.session_state.classifier = classifier
|
| 182 |
+
if "resampler" not in st.session_state:
|
| 183 |
+
st.session_state.resampler = resampler
|
| 184 |
+
|
| 185 |
+
# horizontal line
|
| 186 |
+
st.divider()
|
| 187 |
+
# upload_col, submit_job_col = st.columns((2, 1))
|
| 188 |
+
upload_col, _, submit_job_col, _ = st.columns((4, 0.05, 1, 0.05))
|
| 189 |
+
# upload file column
|
| 190 |
+
with upload_col:
|
| 191 |
+
# session state tracking of the file uploader
|
| 192 |
+
if "uploaded_file" not in st.session_state:
|
| 193 |
+
st.session_state.uploaded_file = None
|
| 194 |
+
if "uploaded_file_changed" not in st.session_state:
|
| 195 |
+
st.session_state.uploaded_file_changed = False
|
| 196 |
+
|
| 197 |
+
# def update_uploader_session_info():
|
| 198 |
+
# """Update the session state of the file uploader."""
|
| 199 |
+
# st.session_state.uploaded_file = uploaded_file
|
| 200 |
+
|
| 201 |
+
uploaded_file = st.file_uploader(
|
| 202 |
+
label="Upload a CSV, SDF, TXT or SMI file",
|
| 203 |
+
type=["csv", "sdf", "txt", "smi"],
|
| 204 |
+
help="Input molecule file only supports *.csv, *.sdf, *.txt and *.smi.",
|
| 205 |
+
accept_multiple_files=False,
|
| 206 |
+
# key="uploaded_file",
|
| 207 |
+
# on_change=update_uploader_session_info,
|
| 208 |
+
)
|
| 209 |
+
|
| 210 |
+
if uploaded_file:
|
| 211 |
+
# st.write(f"the uploaded file: {uploaded_file}")
|
| 212 |
+
# when new file is uploaded is different from the previous one
|
| 213 |
+
if st.session_state.uploaded_file != uploaded_file:
|
| 214 |
+
st.session_state.uploaded_file_changed = True
|
| 215 |
+
else:
|
| 216 |
+
st.session_state.uploaded_file_changed = False
|
| 217 |
+
st.session_state.uploaded_file = uploaded_file
|
| 218 |
+
# when new file is the same as the previous one
|
| 219 |
+
# else:
|
| 220 |
+
# st.session_state.uploaded_file_changed = False
|
| 221 |
+
# st.session_state.uploaded_file = uploaded_file
|
| 222 |
+
|
| 223 |
+
# set session state for the file uploader
|
| 224 |
+
# st.write(f"the state of uploaded file: {st.session_state.uploaded_file}")
|
| 225 |
+
# st.write(f"the state of uploaded file changed: {st.session_state.uploaded_file_changed}")
|
| 226 |
+
|
| 227 |
+
# submit job column
|
| 228 |
+
with submit_job_col:
|
| 229 |
+
st.text(" \n")
|
| 230 |
+
st.text(" \n")
|
| 231 |
+
st.markdown(
|
| 232 |
+
"<div style='display: flex; justify-content: center;'>",
|
| 233 |
+
unsafe_allow_html=True,
|
| 234 |
+
)
|
| 235 |
+
submit_job_button = st.button(
|
| 236 |
+
label="Submit Job",
|
| 237 |
+
type="secondary",
|
| 238 |
+
key="job_button",
|
| 239 |
+
help="Click to start calculations with current configuration"
|
| 240 |
+
)
|
| 241 |
+
|
| 242 |
+
if not submit_job_button:
|
| 243 |
+
if "results" in locals():
|
| 244 |
+
del results
|
| 245 |
+
if "mol_features" in locals():
|
| 246 |
+
del mol_features
|
| 247 |
+
if "info_df" in locals():
|
| 248 |
+
del info_df
|
| 249 |
+
|
| 250 |
+
# Display sections
|
| 251 |
+
feature_column, prediction_column = st.columns(2)
|
| 252 |
+
with feature_column:
|
| 253 |
+
st.subheader("Molecular Features")
|
| 254 |
+
placeholder_features = st.empty()
|
| 255 |
+
|
| 256 |
+
with prediction_column:
|
| 257 |
+
st.subheader("Predictions")
|
| 258 |
+
|
| 259 |
+
# Only process when Submit Job is clicked
|
| 260 |
+
if submit_job_button:
|
| 261 |
+
if not uploaded_file and not st.session_state.mol_features:
|
| 262 |
+
st.warning("Please upload a file first or select data from history to process.")
|
| 263 |
+
else:
|
| 264 |
+
if st.session_state.processing:
|
| 265 |
+
st.warning("A job is already running. Please wait for it to complete.")
|
| 266 |
+
else:
|
| 267 |
+
try:
|
| 268 |
+
st.session_state.processing = True
|
| 269 |
+
with st.spinner('Processing... Please wait.'):
|
| 270 |
+
# Clean up previous files and cache
|
| 271 |
+
cleanup_temp_files()
|
| 272 |
+
clear_cache()
|
| 273 |
+
|
| 274 |
+
# Case 1: New file uploaded
|
| 275 |
+
if uploaded_file:
|
| 276 |
+
# Create new temporary directory
|
| 277 |
+
st.session_state.temp_dir = tempfile.mkdtemp()
|
| 278 |
+
temp_file_path = os.path.join(st.session_state.temp_dir, uploaded_file.name)
|
| 279 |
+
|
| 280 |
+
with open(temp_file_path, "wb") as temp_file:
|
| 281 |
+
temp_file.write(uploaded_file.read())
|
| 282 |
+
|
| 283 |
+
# Store current data in history before processing new data
|
| 284 |
+
if st.session_state.mol_features is not None and st.session_state.info_df is not None:
|
| 285 |
+
st.session_state.historical_data.append({
|
| 286 |
+
'mol_features': st.session_state.mol_features.copy(),
|
| 287 |
+
'info_df': st.session_state.info_df.copy()
|
| 288 |
+
})
|
| 289 |
+
|
| 290 |
+
# Clear current data
|
| 291 |
+
st.session_state.mol_features = None
|
| 292 |
+
st.session_state.info_df = None
|
| 293 |
+
|
| 294 |
+
try:
|
| 295 |
+
mol_features, info_df, results = generate_predictions(
|
| 296 |
+
input_fname=temp_file_path,
|
| 297 |
+
sep="\s+|\t+",
|
| 298 |
+
clf=classifiers_dict[st.session_state.classifier],
|
| 299 |
+
_models_dict=all_models,
|
| 300 |
+
sampling=resample_methods_dict[st.session_state.resampler],
|
| 301 |
+
time_per_mol=120,
|
| 302 |
+
mol_features=None,
|
| 303 |
+
info_df=None,
|
| 304 |
+
)
|
| 305 |
+
finally:
|
| 306 |
+
# Clean up temporary files after processing
|
| 307 |
+
cleanup_temp_files()
|
| 308 |
+
|
| 309 |
+
# Case 2: Recalculate with existing data
|
| 310 |
+
else:
|
| 311 |
+
mol_features, info_df, results = generate_predictions(
|
| 312 |
+
input_fname=None,
|
| 313 |
+
sep="\s+|\t+",
|
| 314 |
+
clf=classifiers_dict[st.session_state.classifier],
|
| 315 |
+
_models_dict=all_models,
|
| 316 |
+
sampling=resample_methods_dict[st.session_state.resampler],
|
| 317 |
+
time_per_mol=120,
|
| 318 |
+
mol_features=st.session_state.mol_features,
|
| 319 |
+
info_df=st.session_state.info_df,
|
| 320 |
+
)
|
| 321 |
+
|
| 322 |
+
# Update session state with new results
|
| 323 |
+
if mol_features is not None and info_df is not None:
|
| 324 |
+
st.session_state.mol_features = mol_features
|
| 325 |
+
st.session_state.info_df = info_df
|
| 326 |
+
|
| 327 |
+
except Exception as e:
|
| 328 |
+
st.error(f"Error during processing: {str(e)}")
|
| 329 |
+
finally:
|
| 330 |
+
st.session_state.processing = False
|
| 331 |
+
|
| 332 |
+
# Display results
|
| 333 |
+
# feture table
|
| 334 |
+
with feature_column:
|
| 335 |
+
if st.session_state.mol_features is not None:
|
| 336 |
+
selected_feature_rows = np.min(
|
| 337 |
+
[st.session_state.mol_features.shape[0], pandas_display_options["line_limit"]]
|
| 338 |
+
)
|
| 339 |
+
st.dataframe(st.session_state.mol_features.iloc[:selected_feature_rows, :], hide_index=False)
|
| 340 |
+
# placeholder_features.dataframe(mol_features, hide_index=False)
|
| 341 |
+
feature_file_name = uploaded_file.name.split(".")[0] + "_b3clf_features.csv"
|
| 342 |
+
features_csv = st.session_state.mol_features.to_csv(index=True)
|
| 343 |
+
st.download_button(
|
| 344 |
+
"Download features as CSV",
|
| 345 |
+
data=features_csv,
|
| 346 |
+
file_name=feature_file_name,
|
| 347 |
+
)
|
| 348 |
+
# prediction table
|
| 349 |
+
with prediction_column:
|
| 350 |
+
# st.subheader("Predictions")
|
| 351 |
+
if results is not None:
|
| 352 |
+
# Display the predictions in a table
|
| 353 |
+
selected_result_rows = np.min(
|
| 354 |
+
[results.shape[0], pandas_display_options["line_limit"]]
|
| 355 |
+
)
|
| 356 |
+
results_df_display = results.iloc[:selected_result_rows, :].style.format(
|
| 357 |
+
{"B3clf_predicted_probability": "{:.6f}".format}
|
| 358 |
+
)
|
| 359 |
+
st.dataframe(results_df_display, hide_index=True)
|
| 360 |
+
# Add a button to download the predictions as a CSV file
|
| 361 |
+
predictions_csv = results.to_csv(index=True)
|
| 362 |
+
results_file_name = (
|
| 363 |
+
uploaded_file.name.split(".")[0] + "_b3clf_predictions.csv"
|
| 364 |
+
)
|
| 365 |
+
st.download_button(
|
| 366 |
+
"Download predictions as CSV",
|
| 367 |
+
data=predictions_csv,
|
| 368 |
+
file_name=results_file_name,
|
| 369 |
+
)
|
| 370 |
+
# indicate the success of the job
|
| 371 |
+
# rain(
|
| 372 |
+
# emoji="🎈",
|
| 373 |
+
# font_size=54,
|
| 374 |
+
# falling_speed=5,
|
| 375 |
+
# animation_length=10,
|
| 376 |
+
# )
|
| 377 |
+
st.balloons()
|
| 378 |
+
|
| 379 |
+
|
| 380 |
+
# hide footer
|
| 381 |
+
# https://github.com/streamlit/streamlit/issues/892
|
| 382 |
+
hide_streamlit_style = """
|
| 383 |
+
<style>
|
| 384 |
+
#MainMenu {visibility: hidden;}
|
| 385 |
+
footer {visibility: hidden;}
|
| 386 |
+
</style>
|
| 387 |
+
"""
|
| 388 |
+
st.markdown(hide_streamlit_style, unsafe_allow_html=True)
|
| 389 |
+
|
| 390 |
+
# add google analytics
|
| 391 |
+
st.markdown(
|
| 392 |
+
"""
|
| 393 |
+
<!-- Google tag (gtag.js) -->
|
| 394 |
+
<script async src="https://www.googletagmanager.com/gtag/js?id=G-WG8QYRELP9"></script>
|
| 395 |
+
<script>
|
| 396 |
+
window.dataLayer = window.dataLayer || [];
|
| 397 |
+
function gtag(){dataLayer.push(arguments);}
|
| 398 |
+
gtag("js", new Date());
|
| 399 |
+
|
| 400 |
+
gtag("config", "G-WG8QYRELP9");
|
| 401 |
+
</script>
|
| 402 |
+
""",
|
| 403 |
+
unsafe_allow_html=True,
|
| 404 |
+
)
|
packages.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
default-jre
|
requirements.txt
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
numpy==1.24.4
|
| 2 |
+
scipy==1.10.1
|
| 3 |
+
scikit-learn==0.24.2
|
| 4 |
+
joblib==1.3.2
|
| 5 |
+
pandas==2.0.3
|
| 6 |
+
openpyxl==3.1.2
|
| 7 |
+
xgboost==1.4.2
|
| 8 |
+
padelpy>=0.1.11
|
| 9 |
+
rdkit==2023.03.3
|
| 10 |
+
# streamlit-extra==0.3.4
|
| 11 |
+
git+https://github.com/arnaudmiribel/streamlit-extras@v0.3.4
|
| 12 |
+
# for visualization
|
| 13 |
+
streamlit-ketcher
|
| 14 |
+
# for single molecule
|
| 15 |
+
# py3Dmol==2.0.0.post2
|
| 16 |
+
# stmol==0.0.9
|
| 17 |
+
git+https://github.com/theochem/B3clf.git
|
sample_input.sdf
ADDED
|
@@ -0,0 +1,387 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
H1_Bepotastine
|
| 2 |
+
RDKit 3D
|
| 3 |
+
|
| 4 |
+
52 54 0 0 1 0 0 0 0 0999 V2000
|
| 5 |
+
6.2601 3.8627 -0.7580 Cl 0 0 0 0 0 0 0 0 0 0 0 0
|
| 6 |
+
0.7350 0.2169 -0.1032 O 0 0 0 0 0 0 0 0 0 0 0 0
|
| 7 |
+
-7.2627 2.0029 -1.7812 O 0 0 0 0 0 0 0 0 0 0 0 0
|
| 8 |
+
-7.8739 -0.0429 -1.1421 O 0 0 0 0 0 0 0 0 0 0 0 0
|
| 9 |
+
-3.2826 0.1387 1.0997 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 10 |
+
2.0420 -2.0119 -1.2138 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 11 |
+
-0.4341 -0.2713 0.5552 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 12 |
+
-1.5088 -0.5144 -0.4974 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 13 |
+
-0.9255 0.7694 1.5572 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 14 |
+
-2.8345 -0.8975 0.1550 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 15 |
+
-2.2740 0.3674 2.1479 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 16 |
+
-4.5811 -0.1850 1.7144 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 17 |
+
-5.7574 -0.2607 0.7330 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 18 |
+
1.9672 -0.2099 0.5040 C 0 0 2 0 0 0 0 0 0 0 0 0
|
| 19 |
+
-5.9298 1.0111 -0.0974 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 20 |
+
3.0410 0.8232 0.1855 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 21 |
+
2.3687 -1.6155 0.0463 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 22 |
+
3.9935 1.1819 1.1545 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 23 |
+
3.1185 1.4155 -1.0867 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 24 |
+
-7.1061 0.8976 -1.0266 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 25 |
+
3.0746 -2.4482 0.9176 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 26 |
+
4.9873 2.1194 0.8610 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 27 |
+
4.1084 2.3564 -1.3784 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 28 |
+
3.4496 -3.7187 0.4871 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 29 |
+
5.0380 2.7045 -0.4026 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 30 |
+
2.4252 -3.2455 -1.6060 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 31 |
+
3.1214 -4.1271 -0.7990 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 32 |
+
-0.2263 -1.2199 1.0679 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 33 |
+
-1.6364 0.3807 -1.1209 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 34 |
+
-1.1831 -1.3082 -1.1808 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 35 |
+
-0.1894 0.8975 2.3595 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 36 |
+
-1.0042 1.7496 1.0680 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 37 |
+
-3.5642 -1.0250 -0.6514 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 38 |
+
-2.7343 -1.8665 0.6611 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 39 |
+
-2.1498 -0.5299 2.7684 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 40 |
+
-2.6054 1.1766 2.8103 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 41 |
+
-4.5185 -1.1314 2.2673 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 42 |
+
-4.8272 0.5917 2.4507 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 43 |
+
-5.6514 -1.1306 0.0739 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 44 |
+
-6.6737 -0.4399 1.3108 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 45 |
+
1.8204 -0.2159 1.5927 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 46 |
+
-6.0945 1.8686 0.5639 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 47 |
+
-5.0396 1.1941 -0.7083 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 48 |
+
3.9687 0.7355 2.1458 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 49 |
+
2.3964 1.1402 -1.8552 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 50 |
+
3.3355 -2.1177 1.9176 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 51 |
+
5.7167 2.3889 1.6199 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 52 |
+
4.1451 2.8085 -2.3655 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 53 |
+
3.9993 -4.3824 1.1485 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 54 |
+
2.1492 -3.5132 -2.6219 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 55 |
+
3.4047 -5.1069 -1.1664 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 56 |
+
-8.0410 1.8004 -2.3409 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 57 |
+
1 25 1 0
|
| 58 |
+
2 7 1 0
|
| 59 |
+
2 14 1 0
|
| 60 |
+
3 20 1 0
|
| 61 |
+
3 52 1 0
|
| 62 |
+
4 20 2 0
|
| 63 |
+
5 10 1 0
|
| 64 |
+
5 11 1 0
|
| 65 |
+
5 12 1 0
|
| 66 |
+
6 17 2 0
|
| 67 |
+
6 26 1 0
|
| 68 |
+
7 8 1 0
|
| 69 |
+
7 9 1 0
|
| 70 |
+
7 28 1 0
|
| 71 |
+
8 10 1 0
|
| 72 |
+
8 29 1 0
|
| 73 |
+
8 30 1 0
|
| 74 |
+
9 11 1 0
|
| 75 |
+
9 31 1 0
|
| 76 |
+
9 32 1 0
|
| 77 |
+
10 33 1 0
|
| 78 |
+
10 34 1 0
|
| 79 |
+
11 35 1 0
|
| 80 |
+
11 36 1 0
|
| 81 |
+
12 13 1 0
|
| 82 |
+
12 37 1 0
|
| 83 |
+
12 38 1 0
|
| 84 |
+
13 15 1 0
|
| 85 |
+
13 39 1 0
|
| 86 |
+
13 40 1 0
|
| 87 |
+
14 16 1 0
|
| 88 |
+
14 17 1 0
|
| 89 |
+
14 41 1 1
|
| 90 |
+
15 20 1 0
|
| 91 |
+
15 42 1 0
|
| 92 |
+
15 43 1 0
|
| 93 |
+
16 18 2 0
|
| 94 |
+
16 19 1 0
|
| 95 |
+
17 21 1 0
|
| 96 |
+
18 22 1 0
|
| 97 |
+
18 44 1 0
|
| 98 |
+
19 23 2 0
|
| 99 |
+
19 45 1 0
|
| 100 |
+
21 24 2 0
|
| 101 |
+
21 46 1 0
|
| 102 |
+
22 25 2 0
|
| 103 |
+
22 47 1 0
|
| 104 |
+
23 25 1 0
|
| 105 |
+
23 48 1 0
|
| 106 |
+
24 27 1 0
|
| 107 |
+
24 49 1 0
|
| 108 |
+
26 27 2 0
|
| 109 |
+
26 50 1 0
|
| 110 |
+
27 51 1 0
|
| 111 |
+
M END
|
| 112 |
+
> <compoud_name> (1)
|
| 113 |
+
H1_Bepotastine
|
| 114 |
+
|
| 115 |
+
> <SMILES> (1)
|
| 116 |
+
[H]OC(=O)C([H])([H])C([H])([H])C([H])([H])N1C([H])([H])C([H])([H])C([H])(OC([H])(c2nc([H])c([H])c([H])c2[H])c2c([H])c([H])c(Cl)c([H])c2[H])C([H])([H])C1([H])[H]
|
| 117 |
+
|
| 118 |
+
> <cid> (1)
|
| 119 |
+
2350
|
| 120 |
+
|
| 121 |
+
> <category> (1)
|
| 122 |
+
N
|
| 123 |
+
|
| 124 |
+
> <inchi> (1)
|
| 125 |
+
InChI=1S/C21H25ClN2O3/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26)/t21-/m1/s1
|
| 126 |
+
|
| 127 |
+
> <Energy> (1)
|
| 128 |
+
49.1758
|
| 129 |
+
|
| 130 |
+
$$$$
|
| 131 |
+
H1_Quifenadine
|
| 132 |
+
RDKit 3D
|
| 133 |
+
|
| 134 |
+
45 48 0 0 1 0 0 0 0 0999 V2000
|
| 135 |
+
0.1106 0.2102 -1.7897 O 0 0 0 0 0 0 0 0 0 0 0 0
|
| 136 |
+
3.4646 1.0770 -0.0854 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 137 |
+
2.0931 -1.1209 0.1252 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 138 |
+
1.1729 0.1166 0.3820 C 0 0 1 0 0 0 0 0 0 0 0 0
|
| 139 |
+
2.0299 1.3864 0.1159 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 140 |
+
2.7971 -1.0339 -1.2379 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 141 |
+
3.2148 -1.0584 1.1848 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 142 |
+
3.5902 0.2772 -1.3240 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 143 |
+
3.9592 0.2796 1.0561 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 144 |
+
-0.2029 0.1255 -0.3860 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 145 |
+
-1.1272 1.3230 -0.0602 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 146 |
+
-0.9736 -1.1857 -0.1269 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 147 |
+
-1.0387 2.0636 1.1310 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 148 |
+
-1.3454 -2.0428 -1.1782 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 149 |
+
-2.1533 1.6708 -0.9653 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 150 |
+
-1.3459 -1.5543 1.1811 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 151 |
+
-1.9065 3.1310 1.3840 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 152 |
+
-2.0526 -3.2227 -0.9327 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 153 |
+
-3.0179 2.7377 -0.7134 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 154 |
+
-2.0493 -2.7364 1.4259 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 155 |
+
-2.8897 3.4721 0.4604 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 156 |
+
-2.4022 -3.5700 0.3691 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 157 |
+
1.5541 -2.0675 0.2237 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 158 |
+
0.9532 0.0967 1.4588 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 159 |
+
1.6691 1.9630 -0.7430 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 160 |
+
1.9423 2.0685 0.9712 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 161 |
+
2.0851 -1.1104 -2.0638 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 162 |
+
3.4846 -1.8820 -1.3506 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 163 |
+
3.9137 -1.8918 1.0436 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 164 |
+
2.7942 -1.1596 2.1923 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 165 |
+
4.6485 0.0638 -1.5199 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 166 |
+
3.2467 0.8670 -2.1831 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 167 |
+
3.8541 0.8576 1.9828 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 168 |
+
5.0353 0.0986 0.9430 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 169 |
+
0.1304 1.1516 -2.0295 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 170 |
+
-0.3059 1.8245 1.8958 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 171 |
+
-1.0856 -1.7976 -2.2061 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 172 |
+
-2.2926 1.0941 -1.8795 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 173 |
+
-1.0974 -0.9178 2.0267 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 174 |
+
-1.8179 3.6927 2.3110 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 175 |
+
-2.3308 -3.8683 -1.7614 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 176 |
+
-3.7962 2.9864 -1.4300 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 177 |
+
-2.3260 -3.0022 2.4429 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 178 |
+
-3.5643 4.2999 0.6616 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 179 |
+
-2.9530 -4.4872 0.5586 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 180 |
+
1 10 1 0
|
| 181 |
+
1 35 1 0
|
| 182 |
+
2 5 1 0
|
| 183 |
+
2 8 1 0
|
| 184 |
+
2 9 1 0
|
| 185 |
+
3 4 1 0
|
| 186 |
+
3 6 1 0
|
| 187 |
+
3 7 1 0
|
| 188 |
+
3 23 1 0
|
| 189 |
+
4 5 1 0
|
| 190 |
+
4 10 1 0
|
| 191 |
+
4 24 1 1
|
| 192 |
+
5 25 1 0
|
| 193 |
+
5 26 1 0
|
| 194 |
+
6 8 1 0
|
| 195 |
+
6 27 1 0
|
| 196 |
+
6 28 1 0
|
| 197 |
+
7 9 1 0
|
| 198 |
+
7 29 1 0
|
| 199 |
+
7 30 1 0
|
| 200 |
+
8 31 1 0
|
| 201 |
+
8 32 1 0
|
| 202 |
+
9 33 1 0
|
| 203 |
+
9 34 1 0
|
| 204 |
+
10 11 1 0
|
| 205 |
+
10 12 1 0
|
| 206 |
+
11 13 2 0
|
| 207 |
+
11 15 1 0
|
| 208 |
+
12 14 2 0
|
| 209 |
+
12 16 1 0
|
| 210 |
+
13 17 1 0
|
| 211 |
+
13 36 1 0
|
| 212 |
+
14 18 1 0
|
| 213 |
+
14 37 1 0
|
| 214 |
+
15 19 2 0
|
| 215 |
+
15 38 1 0
|
| 216 |
+
16 20 2 0
|
| 217 |
+
16 39 1 0
|
| 218 |
+
17 21 2 0
|
| 219 |
+
17 40 1 0
|
| 220 |
+
18 22 2 0
|
| 221 |
+
18 41 1 0
|
| 222 |
+
19 21 1 0
|
| 223 |
+
19 42 1 0
|
| 224 |
+
20 22 1 0
|
| 225 |
+
20 43 1 0
|
| 226 |
+
21 44 1 0
|
| 227 |
+
22 45 1 0
|
| 228 |
+
M END
|
| 229 |
+
> <compoud_name> (2)
|
| 230 |
+
H1_Quifenadine
|
| 231 |
+
|
| 232 |
+
> <SMILES> (2)
|
| 233 |
+
[H]OC(c1c([H])c([H])c([H])c([H])c1[H])(c1c([H])c([H])c([H])c([H])c1[H])C1([H])C([H])([H])N2C([H])([H])C([H])([H])C1([H])C([H])([H])C2([H])[H]
|
| 234 |
+
|
| 235 |
+
> <cid> (2)
|
| 236 |
+
65600
|
| 237 |
+
|
| 238 |
+
> <category> (2)
|
| 239 |
+
N
|
| 240 |
+
|
| 241 |
+
> <inchi> (2)
|
| 242 |
+
InChI=1S/C20H23NO/c22-20(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-15-21-13-11-16(19)12-14-21/h1-10,16,19,22H,11-15H2/t19-/m1/s1
|
| 243 |
+
|
| 244 |
+
> <Energy> (2)
|
| 245 |
+
84.891
|
| 246 |
+
|
| 247 |
+
$$$$
|
| 248 |
+
H1_Rupatadine
|
| 249 |
+
RDKit 3D
|
| 250 |
+
|
| 251 |
+
56 60 0 0 0 0 0 0 0 0999 V2000
|
| 252 |
+
6.5298 3.3080 0.0562 Cl 0 0 0 0 0 0 0 0 0 0 0 0
|
| 253 |
+
-2.1780 1.1440 -0.1081 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 254 |
+
1.8055 -2.5028 1.6263 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 255 |
+
-6.5347 -0.2932 -1.5666 N 0 0 0 0 0 0 0 0 0 0 0 0
|
| 256 |
+
0.4984 0.2017 0.7391 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 257 |
+
-0.7596 -0.6401 0.9176 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 258 |
+
0.1325 1.6779 0.6992 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 259 |
+
-1.8276 -0.2907 -0.1321 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 260 |
+
-0.9697 1.9571 -0.3378 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 261 |
+
1.7535 -0.3064 0.5966 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 262 |
+
-3.2065 1.4670 -1.1132 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 263 |
+
2.9347 0.5760 0.4016 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 264 |
+
1.9383 -1.7730 0.4937 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 265 |
+
3.7669 0.4917 -0.7359 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 266 |
+
3.6248 -0.5108 -1.8705 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 267 |
+
2.3939 -1.4219 -1.9523 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 268 |
+
2.2514 -2.3194 -0.7533 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 269 |
+
-4.5656 0.8945 -0.7963 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 270 |
+
3.2715 1.4705 1.4385 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 271 |
+
4.8769 1.3617 -0.8210 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 272 |
+
2.4290 -3.7014 -0.8308 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 273 |
+
4.3729 2.3200 1.3344 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 274 |
+
5.1670 2.2679 0.1982 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 275 |
+
-5.1566 1.0467 0.4633 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 276 |
+
-5.3042 0.2290 -1.7686 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 277 |
+
2.2947 -4.4730 0.3198 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 278 |
+
1.9875 -3.8347 1.5112 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 279 |
+
-6.4311 0.5316 0.7094 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 280 |
+
-7.0633 -0.1364 -0.3325 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 281 |
+
-7.0626 0.6338 2.0605 C 0 0 0 0 0 0 0 0 0 0 0 0
|
| 282 |
+
-0.5731 -1.7154 0.8560 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 283 |
+
-1.1596 -0.4557 1.9235 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 284 |
+
-0.2119 1.9818 1.6961 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 285 |
+
0.9793 2.3217 0.4489 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 286 |
+
-1.4699 -0.5848 -1.1284 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 287 |
+
-2.7127 -0.8992 0.0866 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 288 |
+
-1.2287 3.0211 -0.2712 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 289 |
+
-0.5727 1.7824 -1.3473 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 290 |
+
-2.8776 1.1445 -2.1102 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 291 |
+
-3.3405 2.5558 -1.1674 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 292 |
+
3.6660 0.0536 -2.8120 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 293 |
+
4.5182 -1.1506 -1.8447 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 294 |
+
2.4771 -2.0361 -2.8582 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 295 |
+
1.4795 -0.8292 -2.0837 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 296 |
+
2.6674 1.5029 2.3444 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 297 |
+
5.5326 1.3154 -1.6888 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 298 |
+
2.6741 -4.1805 -1.7747 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 299 |
+
4.6043 3.0064 2.1437 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 300 |
+
-4.6110 1.5606 1.2526 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 301 |
+
-4.9162 0.0859 -2.7735 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 302 |
+
2.4295 -5.5486 0.2902 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 303 |
+
1.8762 -4.3969 2.4339 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 304 |
+
-8.0471 -0.5796 -0.2022 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 305 |
+
-8.1536 0.6818 1.9793 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 306 |
+
-6.7913 -0.2348 2.6683 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 307 |
+
-6.7355 1.5422 2.5773 H 0 0 0 0 0 0 0 0 0 0 0 0
|
| 308 |
+
1 23 1 0
|
| 309 |
+
2 8 1 0
|
| 310 |
+
2 9 1 0
|
| 311 |
+
2 11 1 0
|
| 312 |
+
3 13 2 0
|
| 313 |
+
3 27 1 0
|
| 314 |
+
4 25 2 0
|
| 315 |
+
4 29 1 0
|
| 316 |
+
5 6 1 0
|
| 317 |
+
5 7 1 0
|
| 318 |
+
5 10 2 3
|
| 319 |
+
6 8 1 0
|
| 320 |
+
6 31 1 0
|
| 321 |
+
6 32 1 0
|
| 322 |
+
7 9 1 0
|
| 323 |
+
7 33 1 0
|
| 324 |
+
7 34 1 0
|
| 325 |
+
8 35 1 0
|
| 326 |
+
8 36 1 0
|
| 327 |
+
9 37 1 0
|
| 328 |
+
9 38 1 0
|
| 329 |
+
10 12 1 0
|
| 330 |
+
10 13 1 0
|
| 331 |
+
11 18 1 0
|
| 332 |
+
11 39 1 0
|
| 333 |
+
11 40 1 0
|
| 334 |
+
12 14 2 0
|
| 335 |
+
12 19 1 0
|
| 336 |
+
13 17 1 0
|
| 337 |
+
14 15 1 0
|
| 338 |
+
14 20 1 0
|
| 339 |
+
15 16 1 0
|
| 340 |
+
15 41 1 0
|
| 341 |
+
15 42 1 0
|
| 342 |
+
16 17 1 0
|
| 343 |
+
16 43 1 0
|
| 344 |
+
16 44 1 0
|
| 345 |
+
17 21 2 0
|
| 346 |
+
18 24 2 0
|
| 347 |
+
18 25 1 0
|
| 348 |
+
19 22 2 0
|
| 349 |
+
19 45 1 0
|
| 350 |
+
20 23 2 0
|
| 351 |
+
20 46 1 0
|
| 352 |
+
21 26 1 0
|
| 353 |
+
21 47 1 0
|
| 354 |
+
22 23 1 0
|
| 355 |
+
22 48 1 0
|
| 356 |
+
24 28 1 0
|
| 357 |
+
24 49 1 0
|
| 358 |
+
25 50 1 0
|
| 359 |
+
26 27 2 0
|
| 360 |
+
26 51 1 0
|
| 361 |
+
27 52 1 0
|
| 362 |
+
28 29 2 0
|
| 363 |
+
28 30 1 0
|
| 364 |
+
29 53 1 0
|
| 365 |
+
30 54 1 0
|
| 366 |
+
30 55 1 0
|
| 367 |
+
30 56 1 0
|
| 368 |
+
M END
|
| 369 |
+
> <compoud_name> (3)
|
| 370 |
+
H1_Rupatadine
|
| 371 |
+
|
| 372 |
+
> <SMILES> (3)
|
| 373 |
+
[H]c1nc2c(c([H])c1[H])C([H])([H])C([H])([H])c1c([H])c(Cl)c([H])c([H])c1C2=C1C([H])([H])C([H])([H])N(C([H])([H])c2c([H])nc([H])c(C([H])([H])[H])c2[H])C([H])([H])C1([H])[H]
|
| 374 |
+
|
| 375 |
+
> <cid> (3)
|
| 376 |
+
133017
|
| 377 |
+
|
| 378 |
+
> <category> (3)
|
| 379 |
+
N
|
| 380 |
+
|
| 381 |
+
> <inchi> (3)
|
| 382 |
+
InChI=1S/C26H26ClN3/c1-18-13-19(16-28-15-18)17-30-11-8-20(9-12-30)25-24-7-6-23(27)14-22(24)5-4-21-3-2-10-29-26(21)25/h2-3,6-7,10,13-16H,4-5,8-9,11-12,17H2,1H3
|
| 383 |
+
|
| 384 |
+
> <Energy> (3)
|
| 385 |
+
119.976
|
| 386 |
+
|
| 387 |
+
$$$$
|
sample_input_smiles.csv
ADDED
|
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
OC(=O)CCCN1CCC(OC(c2ncccc2)c2ccc(Cl)cc2)CC1
|
| 2 |
+
OC(c1ccccc1)(c1ccccc1)C1CN2CCC1CC2
|
| 3 |
+
c1nc2c(cc1)CCc1cc(Cl)ccc1C2=C1CCN(Cc2cncc(C)c2)CC1
|
| 4 |
+
C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N
|
| 5 |
+
CC(=O)Oc1ccccc1C(=O)O
|
| 6 |
+
CC(=O)Oc1c(cc(cc1)Cl)C(=O)OC(=O)c1c(ccc(c1)Cl)OC(=O)C
|
utils.py
ADDED
|
@@ -0,0 +1,172 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import itertools as it
|
| 2 |
+
import os
|
| 3 |
+
|
| 4 |
+
import joblib
|
| 5 |
+
import numpy as np
|
| 6 |
+
import pandas as pd
|
| 7 |
+
import pkg_resources
|
| 8 |
+
import streamlit as st
|
| 9 |
+
from b3clf.descriptor_padel import compute_descriptors
|
| 10 |
+
from b3clf.geometry_opt import geometry_optimize
|
| 11 |
+
from b3clf.utils import get_descriptors, scale_descriptors, select_descriptors
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
@st.cache_resource()
|
| 15 |
+
def load_all_models():
|
| 16 |
+
"""Get b3clf fitted classifier"""
|
| 17 |
+
clf_list = ["dtree", "knn", "logreg", "xgb"]
|
| 18 |
+
sampling_list = [
|
| 19 |
+
"borderline_SMOTE",
|
| 20 |
+
"classic_ADASYN",
|
| 21 |
+
"classic_RandUndersampling",
|
| 22 |
+
"classic_SMOTE",
|
| 23 |
+
"kmeans_SMOTE",
|
| 24 |
+
"common",
|
| 25 |
+
]
|
| 26 |
+
|
| 27 |
+
model_dict = {}
|
| 28 |
+
package_name = "b3clf"
|
| 29 |
+
|
| 30 |
+
for clf_str, sampling_str in it.product(clf_list, sampling_list):
|
| 31 |
+
# joblib_fpath = os.path.join(
|
| 32 |
+
# dirname, "pre_trained", "b3clf_{}_{}.joblib".format(clf_str, sampling_str))
|
| 33 |
+
# pred_model = joblib.load(joblib_fpath)
|
| 34 |
+
joblib_path_str = f"pre_trained/b3clf_{clf_str}_{sampling_str}.joblib"
|
| 35 |
+
with pkg_resources.resource_stream(package_name, joblib_path_str) as f:
|
| 36 |
+
pred_model = joblib.load(f)
|
| 37 |
+
|
| 38 |
+
model_dict[clf_str + "_" + sampling_str] = pred_model
|
| 39 |
+
|
| 40 |
+
return model_dict
|
| 41 |
+
|
| 42 |
+
|
| 43 |
+
@st.cache_resource
|
| 44 |
+
def predict_permeability(
|
| 45 |
+
clf_str, sampling_str, _models_dict, mol_features, info_df, threshold="none"
|
| 46 |
+
):
|
| 47 |
+
"""Compute permeability prediction for given feature data."""
|
| 48 |
+
# load the model
|
| 49 |
+
# pred_model = load_all_models()[clf_str + "_" + sampling_str]
|
| 50 |
+
pred_model = _models_dict[clf_str + "_" + sampling_str]
|
| 51 |
+
|
| 52 |
+
# load the threshold data
|
| 53 |
+
package_name = "b3clf"
|
| 54 |
+
with pkg_resources.resource_stream(package_name, "data/B3clf_thresholds.xlsx") as f:
|
| 55 |
+
df_thres = pd.read_excel(f, index_col=0, engine="openpyxl")
|
| 56 |
+
|
| 57 |
+
# default threshold is 0.5
|
| 58 |
+
label_pool = np.zeros(mol_features.shape[0], dtype=int)
|
| 59 |
+
|
| 60 |
+
if type(mol_features) == pd.DataFrame:
|
| 61 |
+
if mol_features.index.tolist() != info_df.index.tolist():
|
| 62 |
+
raise ValueError("Features_df and Info_df do not have the same index.")
|
| 63 |
+
|
| 64 |
+
# get predicted probabilities
|
| 65 |
+
info_df.loc[:, "B3clf_predicted_probability"] = pred_model.predict_proba(
|
| 66 |
+
mol_features
|
| 67 |
+
)[:, 1]
|
| 68 |
+
# get predicted label from probability using the threshold
|
| 69 |
+
mask = np.greater_equal(
|
| 70 |
+
info_df["B3clf_predicted_probability"].to_numpy(),
|
| 71 |
+
# df_thres.loc[clf_str + "-" + sampling_str, threshold])
|
| 72 |
+
df_thres.loc["xgb-classic_ADASYN", threshold],
|
| 73 |
+
)
|
| 74 |
+
label_pool[mask] = 1
|
| 75 |
+
|
| 76 |
+
# save the predicted labels
|
| 77 |
+
info_df["B3clf_predicted_label"] = label_pool
|
| 78 |
+
info_df.reset_index(inplace=True)
|
| 79 |
+
|
| 80 |
+
return info_df
|
| 81 |
+
|
| 82 |
+
|
| 83 |
+
@st.cache_resource
|
| 84 |
+
def generate_predictions(
|
| 85 |
+
input_fname: str = None,
|
| 86 |
+
sep: str = "\s+|\t+",
|
| 87 |
+
clf: str = "xgb",
|
| 88 |
+
_models_dict: dict = None,
|
| 89 |
+
keep_sdf: str = "no",
|
| 90 |
+
sampling: str = "classic_ADASYN",
|
| 91 |
+
time_per_mol: int = 120,
|
| 92 |
+
mol_features: pd.DataFrame = None,
|
| 93 |
+
info_df: pd.DataFrame = None,
|
| 94 |
+
):
|
| 95 |
+
"""
|
| 96 |
+
Generate predictions for a given input file.
|
| 97 |
+
"""
|
| 98 |
+
try:
|
| 99 |
+
if mol_features is None and info_df is None:
|
| 100 |
+
if input_fname is None:
|
| 101 |
+
raise ValueError("Either input_fname or mol_features/info_df must be provided")
|
| 102 |
+
|
| 103 |
+
mol_tag = os.path.basename(input_fname).split(".")[0]
|
| 104 |
+
file_ext = os.path.splitext(input_fname)[1].lower()
|
| 105 |
+
internal_sdf = f"{mol_tag}_optimized_3d.sdf"
|
| 106 |
+
|
| 107 |
+
try:
|
| 108 |
+
# Handle different file types
|
| 109 |
+
if file_ext == '.csv':
|
| 110 |
+
sep = ','
|
| 111 |
+
elif file_ext == '.txt' or file_ext == '.smi':
|
| 112 |
+
sep = '\s+|\t+'
|
| 113 |
+
elif file_ext != '.sdf':
|
| 114 |
+
raise ValueError(f"Unsupported file type: {file_ext}")
|
| 115 |
+
|
| 116 |
+
# Geometry optimization
|
| 117 |
+
geometry_optimize(input_fname=input_fname, output_sdf=internal_sdf, sep=sep)
|
| 118 |
+
|
| 119 |
+
# Compute descriptors with timeout handling
|
| 120 |
+
df_features = compute_descriptors(
|
| 121 |
+
sdf_file=internal_sdf,
|
| 122 |
+
excel_out=None,
|
| 123 |
+
output_csv=None,
|
| 124 |
+
timeout=time_per_mol * 2, # Double the per-molecule time for total timeout
|
| 125 |
+
time_per_molecule=time_per_mol,
|
| 126 |
+
)
|
| 127 |
+
|
| 128 |
+
# Get computed descriptors
|
| 129 |
+
mol_features, info_df = get_descriptors(df=df_features)
|
| 130 |
+
|
| 131 |
+
# Select descriptors
|
| 132 |
+
mol_features = select_descriptors(df=mol_features)
|
| 133 |
+
|
| 134 |
+
# Scale descriptors
|
| 135 |
+
mol_features.iloc[:, :] = scale_descriptors(df=mol_features)
|
| 136 |
+
|
| 137 |
+
finally:
|
| 138 |
+
# Clean up temporary files
|
| 139 |
+
if os.path.exists(internal_sdf) and keep_sdf == "no":
|
| 140 |
+
try:
|
| 141 |
+
os.remove(internal_sdf)
|
| 142 |
+
except:
|
| 143 |
+
pass
|
| 144 |
+
|
| 145 |
+
# Get predictions
|
| 146 |
+
result_df = predict_permeability(
|
| 147 |
+
clf_str=clf,
|
| 148 |
+
sampling_str=sampling,
|
| 149 |
+
_models_dict=_models_dict,
|
| 150 |
+
mol_features=mol_features,
|
| 151 |
+
info_df=info_df,
|
| 152 |
+
threshold="none",
|
| 153 |
+
)
|
| 154 |
+
|
| 155 |
+
# Select display columns
|
| 156 |
+
display_cols = [
|
| 157 |
+
"ID",
|
| 158 |
+
"SMILES",
|
| 159 |
+
"B3clf_predicted_probability",
|
| 160 |
+
"B3clf_predicted_label",
|
| 161 |
+
]
|
| 162 |
+
|
| 163 |
+
result_df = result_df[
|
| 164 |
+
[col for col in result_df.columns.to_list() if col in display_cols]
|
| 165 |
+
]
|
| 166 |
+
|
| 167 |
+
return mol_features, info_df, result_df
|
| 168 |
+
|
| 169 |
+
except Exception as e:
|
| 170 |
+
import traceback
|
| 171 |
+
st.error(f"Error in generate_predictions: {str(e)}\n{traceback.format_exc()}")
|
| 172 |
+
raise
|