Upload 18 files

ClearPassAIApp.java

@@ -0,0 +1,10 @@
+import javax.swing.*;
+
+public class ClearPassAIApp {
+    public static void main(String[] args) {
+        SwingUtilities.invokeLater(() -> {
+            ClearPassAIGUI gui = new ClearPassAIGUI();
+            gui.setVisible(true);
+        });
+    }
+}

ClearPassAIGUI.java

@@ -0,0 +1,113 @@
+import javax.swing.*;
+import java.awt.*;
+import java.io.FileInputStream;
+import java.io.IOException;
+import java.util.Properties;
+
+public class ClearPassAIGUI extends JFrame {
+    private CardLayout cardLayout;
+    private JPanel mainPanel;
+    private LoginPage loginPage;
+    private WelcomeScreen welcomeScreen;
+    private InterviewScreen interviewScreen;
+    private ResultScreen resultScreen;
+    private String role;
+    private String currentUser;
+    private int questionCount = 5;
+    private GeminiClient geminiClient;
+    private ESpeakTTSClient ttsClient;
+    private DataModel dataModel;
+
+    public ClearPassAIGUI() {
+        setTitle("ClearPass AI - Interview Coach");
+        setSize(900, 700);
+        setDefaultCloseOperation(EXIT_ON_CLOSE);
+
+        Properties props = loadConfig();
+        String geminiApiKey = props.getProperty("GEMINI_API_KEY");
+        
+        geminiClient = new GeminiClient(geminiApiKey, "gemini-1.5-flash");
+        ttsClient = new ESpeakTTSClient();
+        dataModel = new DataModel();
+
+        cardLayout = new CardLayout();
+        mainPanel = new JPanel(cardLayout);
+
+        loginPage = new LoginPage(this);
+        welcomeScreen = new WelcomeScreen(this);
+        resultScreen = new ResultScreen(this);
+
+        mainPanel.add(loginPage, "Login");
+        mainPanel.add(welcomeScreen, "Welcome");
+        mainPanel.add(resultScreen, "Results");
+
+        add(mainPanel);
+        showScreen("Login");
+    }
+
+    private Properties loadConfig() {
+        Properties props = new Properties();
+        try (FileInputStream fis = new FileInputStream("config.properties")) {
+            props.load(fis);
+        } catch (IOException e) {
+            JOptionPane.showMessageDialog(this, "Configuration file not found", "Error", JOptionPane.ERROR_MESSAGE);
+        }
+        return props;
+    }
+
+    public void showScreen(String screenName) {
+        cardLayout.show(mainPanel, screenName);
+    }
+
+    public void startSession(String role, int questionCount) {
+        this.role = role;
+        this.questionCount = questionCount;
+        this.dataModel = new DataModel();
+        interviewScreen = new InterviewScreen(this, questionCount);
+        JScrollPane scrollPane = new JScrollPane(interviewScreen);
+        mainPanel.add(scrollPane, "Interview");
+        showScreen("Interview");
+    }
+
+    public void finishSession() {
+        resultScreen = new ResultScreen(this);
+        mainPanel.add(resultScreen, "Results");
+        showScreen("Results");
+    }
+
+    public GeminiClient getGeminiClient() {
+        return geminiClient;
+    }
+
+    public String getRole() {
+        return role;
+    }
+
+    public void setRole(String role) {
+        this.role = role;
+    }
+
+    public DataModel getDataModel() {
+        return dataModel;
+    }
+
+    public int getQuestionCount() {
+        return questionCount;
+    }
+
+    public void setQuestionCount(int questionCount) {
+        this.questionCount = questionCount;
+    }
+
+    public String getCurrentUser() {
+        return currentUser;
+    }
+
+    public void setCurrentUser(String currentUser) {
+        this.currentUser = currentUser;
+    }
+
+    public ESpeakTTSClient getTTSClient() {
+        return ttsClient;
+    }
+}

DataModel.java

@@ -0,0 +1,18 @@
+import java.util.ArrayList;
+import java.util.List;
+
+public class DataModel {
+	private List<QuestionData> history;
+
+	public DataModel() {
+		history = new ArrayList<>();
+	}
+
+	public void setHistory(QuestionData qd) {
+		history.add(qd);
+	}
+
+	public List<QuestionData> getHistory() {
+		return history;
+	}
+}

ESpeakTTSClient.java

@@ -0,0 +1,77 @@
+import java.io.*;
+
+public class ESpeakTTSClient {
+    private Process currentProcess;
+    
+    public ESpeakTTSClient() {
+        // Check if espeak is installed
+        try {
+            Process process = Runtime.getRuntime().exec("espeak --version");
+            BufferedReader reader = new BufferedReader(new InputStreamReader(process.getInputStream()));
+            String version = reader.readLine();
+            System.out.println("eSpeak version: " + version);
+            
+            int exitCode = process.waitFor();
+            if (exitCode != 0) {
+                throw new RuntimeException("eSpeak is not installed. Please install it first.");
+            }
+        } catch (IOException | InterruptedException e) {
+            throw new RuntimeException("Error checking eSpeak installation: " + e.getMessage());
+        }
+    }
+
+    public void speakText(String text) throws IOException {
+        try {
+            // Stop any existing speech
+            stopSpeaking();
+            
+            System.out.println("Attempting to speak text: " + text);
+            
+            // Use espeak to generate speech directly
+            ProcessBuilder pb = new ProcessBuilder(
+                "espeak",
+                "-v", "en-gb",     // British English voice
+                "-s", "120",       // Slower speed for clarity
+                "-p", "50",        // Medium pitch
+                "-a", "100",       // Full amplitude
+                "-g", "5",         // Word gap
+                "-k", "5",         // Emphasis
+                text              // Text to speak
+            );
+            
+            System.out.println("Starting eSpeak process...");
+            currentProcess = pb.start();
+            
+            // Capture any error output
+            BufferedReader errorReader = new BufferedReader(new InputStreamReader(currentProcess.getErrorStream()));
+            String errorLine;
+            while ((errorLine = errorReader.readLine()) != null) {
+                System.err.println("eSpeak error: " + errorLine);
+            }
+            
+            int exitCode = currentProcess.waitFor();
+            System.out.println("eSpeak process completed with exit code: " + exitCode);
+            
+            if (exitCode != 0) {
+                System.err.println("Error generating speech with exit code: " + exitCode);
+                throw new IOException("Error generating speech: " + exitCode);
+            }
+            
+        } catch (InterruptedException e) {
+            System.err.println("Speech generation interrupted: " + e.getMessage());
+            throw new IOException("Speech generation interrupted: " + e.getMessage());
+        }
+    }
+
+    public void stopSpeaking() {
+        if (currentProcess != null && currentProcess.isAlive()) {
+            currentProcess.destroy();
+            try {
+                currentProcess.waitFor();
+            } catch (InterruptedException e) {
+                System.err.println("Error stopping speech: " + e.getMessage());
+            }
+            currentProcess = null;
+        }
+    }
+} 

GeminiClient.java

@@ -0,0 +1,64 @@
+import java.io.*;
+import java.net.HttpURLConnection;
+import java.net.URL;
+import org.json.JSONArray;
+import org.json.JSONObject;
+
+public class GeminiClient {
+    private final String apiKey;
+    private final String model;
+
+    public GeminiClient(String apiKey, String model) {
+        this.apiKey = apiKey;
+        this.model = model;
+    }
+
+    public String generateResponse(String prompt) throws IOException {
+        String safePrompt = prompt.replace("\"", "\\\"");
+        String inputJson = "{\n" +
+                "  \"contents\": [\n" +
+                "    {\n" +
+                "      \"parts\": [\n" +
+                "        { \"text\": \"" + safePrompt + "\" }\n" +
+                "      ]\n" +
+                "    }\n" +
+                "  ]\n" +
+                "}";
+
+        URL url = new URL(
+                "https://generativelanguage.googleapis.com/v1beta/models/" + model + ":generateContent?key=" + apiKey);
+        HttpURLConnection conn = (HttpURLConnection) url.openConnection();
+        conn.setRequestMethod("POST");
+        conn.setRequestProperty("Content-Type", "application/json");
+        conn.setDoOutput(true);
+
+        try (OutputStream os = conn.getOutputStream()) {
+            os.write(inputJson.getBytes("utf-8"));
+        }
+
+        int status = conn.getResponseCode();
+        InputStream stream = (status == 200) ? conn.getInputStream() : conn.getErrorStream();
+        BufferedReader br = new BufferedReader(new InputStreamReader(stream, "utf-8"));
+
+        StringBuilder response = new StringBuilder();
+        String line;
+        while ((line = br.readLine()) != null) {
+            response.append(line.trim());
+        }
+        br.close();
+
+        return extractTextFromResponse(response.toString());
+    }
+
+    private String extractTextFromResponse(String raw) {
+        try {
+            JSONObject json = new JSONObject(raw);
+            JSONArray candidates = json.getJSONArray("candidates");
+            JSONObject content = candidates.getJSONObject(0).getJSONObject("content");
+            JSONArray parts = content.getJSONArray("parts");
+            return parts.getJSONObject(0).getString("text");
+        } catch (Exception e) {
+            return "Error: Could not parse response.";
+        }
+    }
+}

GoogleTTSClient.java

@@ -0,0 +1,83 @@
+import java.io.*;
+import java.net.HttpURLConnection;
+import java.net.URL;
+import javax.sound.sampled.*;
+import org.json.JSONObject;
+
+public class GoogleTTSClient {
+    private final String apiKey;
+    private final String voiceName = "en-US-Neural2-F"; // Female voice
+    private final String languageCode = "en-US";
+
+    public GoogleTTSClient(String apiKey) {
+        this.apiKey = apiKey;
+    }
+
+    public void speakText(String text) throws IOException {
+        String inputJson = "{\n" +
+                "  \"input\": {\n" +
+                "    \"text\": \"" + text.replace("\"", "\\\"") + "\"\n" +
+                "  },\n" +
+                "  \"voice\": {\n" +
+                "    \"languageCode\": \"" + languageCode + "\",\n" +
+                "    \"name\": \"" + voiceName + "\"\n" +
+                "  },\n" +
+                "  \"audioConfig\": {\n" +
+                "    \"audioEncoding\": \"LINEAR16\",\n" +
+                "    \"speakingRate\": 1.0,\n" +
+                "    \"pitch\": 0.0\n" +
+                "  }\n" +
+                "}";
+
+        URL url = new URL("https://texttospeech.googleapis.com/v1/text:synthesize?key=" + apiKey);
+        HttpURLConnection conn = (HttpURLConnection) url.openConnection();
+        conn.setRequestMethod("POST");
+        conn.setRequestProperty("Content-Type", "application/json");
+        conn.setDoOutput(true);
+
+        try (OutputStream os = conn.getOutputStream()) {
+            os.write(inputJson.getBytes("utf-8"));
+        }
+
+        int status = conn.getResponseCode();
+        if (status == 200) {
+            try (InputStream is = conn.getInputStream()) {
+                // Parse the response
+                BufferedReader br = new BufferedReader(new InputStreamReader(is));
+                StringBuilder response = new StringBuilder();
+                String line;
+                while ((line = br.readLine()) != null) {
+                    response.append(line);
+                }
+                
+                JSONObject jsonResponse = new JSONObject(response.toString());
+                String audioContent = jsonResponse.getString("audioContent");
+                
+                // Decode base64 audio content
+                byte[] audioBytes = java.util.Base64.getDecoder().decode(audioContent);
+                
+                // Save to temporary file
+                File tempFile = File.createTempFile("speech", ".wav");
+                try (FileOutputStream fos = new FileOutputStream(tempFile)) {
+                    fos.write(audioBytes);
+                }
+
+                // Play the audio
+                try (AudioInputStream audioIn = AudioSystem.getAudioInputStream(tempFile)) {
+                    Clip clip = AudioSystem.getClip();
+                    clip.open(audioIn);
+                    clip.start();
+                    clip.drain();
+                    clip.close();
+                } catch (UnsupportedAudioFileException | LineUnavailableException e) {
+                    throw new IOException("Error playing audio: " + e.getMessage());
+                }
+
+                // Clean up
+                tempFile.delete();
+            }
+        } else {
+            throw new IOException("Error: " + status);
+        }
+    }
+} 

InterviewScreen.java

@@ -0,0 +1,211 @@
+import javax.swing.*;
+import java.awt.*;
+import java.awt.event.*;
+import java.io.*;
+
+public class InterviewScreen extends JPanel {
+    private ClearPassAIGUI controller;
+    private JTextArea questionArea;
+    private JTextArea answerInput;
+    private JTextArea feedbackArea;
+    private JButton generateBtn, nextBtn, evaluateBtn, submitBtn, readBtn, stopBtn;
+    private JLabel timerLabel, counterLabel, welcomeLabel;
+    private Timer timer;
+    private int timeLeft = 60;
+    private int answeredCount = 0;
+    private int totalQuestions;
+
+    public InterviewScreen(ClearPassAIGUI controller, int questionCount) {
+        this.controller = controller;
+        this.totalQuestions = questionCount;
+        setLayout(new BorderLayout(10, 10));
+
+        String username = controller.getCurrentUser();
+        welcomeLabel = new JLabel("Welcome, " + username + "!");
+        welcomeLabel.setFont(new Font("Arial", Font.BOLD, 16));
+        welcomeLabel.setHorizontalAlignment(SwingConstants.CENTER);
+
+        questionArea = createTextArea(false);
+        answerInput = createTextArea(true);
+        feedbackArea = createTextArea(false);
+        disableCopyPaste(answerInput);
+
+        generateBtn = new JButton("Generate Question");
+        evaluateBtn = new JButton("Evaluate Answer");
+        nextBtn = new JButton("Next Question");
+        readBtn = new JButton("Read Question");
+        stopBtn = new JButton("Stop Reading");
+        submitBtn = new JButton("Submit Interview");
+        timerLabel = new JLabel("Time Left: 60s");
+        counterLabel = new JLabel(getCounterText());
+
+        JPanel buttonPanel = new JPanel(new GridBagLayout());
+        GridBagConstraints gbc = new GridBagConstraints();
+        gbc.insets = new Insets(5, 10, 5, 10);
+
+        gbc.gridx = 0;
+        buttonPanel.add(generateBtn, gbc);
+        gbc.gridx = 1;
+        buttonPanel.add(evaluateBtn, gbc);
+        gbc.gridx = 2;
+        buttonPanel.add(nextBtn, gbc);
+        gbc.gridx = 3;
+        buttonPanel.add(readBtn, gbc);
+        gbc.gridx = 4;
+        buttonPanel.add(stopBtn, gbc);
+        gbc.gridx = 5;
+        buttonPanel.add(timerLabel, gbc);
+        gbc.gridx = 6;
+        buttonPanel.add(counterLabel, gbc);
+
+        JPanel topPanel = new JPanel(new BorderLayout());
+        topPanel.add(welcomeLabel, BorderLayout.NORTH);
+        topPanel.add(buttonPanel, BorderLayout.CENTER);
+
+        JPanel centerPanel = new JPanel();
+        centerPanel.setLayout(new BoxLayout(centerPanel, BoxLayout.Y_AXIS));
+        centerPanel.setBorder(BorderFactory.createEmptyBorder(10, 10, 10, 10));
+        centerPanel.add(new JLabel("Generated Question:"));
+        centerPanel.add(new JScrollPane(questionArea));
+        centerPanel.add(Box.createVerticalStrut(10));
+        centerPanel.add(new JLabel("Your Answer:"));
+        centerPanel.add(new JScrollPane(answerInput));
+        centerPanel.add(Box.createVerticalStrut(10));
+        centerPanel.add(new JLabel("AI Feedback:"));
+        centerPanel.add(new JScrollPane(feedbackArea));
+
+        // Create bottom panel for submit button
+        JPanel bottomPanel = new JPanel(new FlowLayout(FlowLayout.CENTER));
+        submitBtn.setPreferredSize(new Dimension(200, 40)); // Make submit button larger
+        bottomPanel.add(submitBtn);
+
+        add(topPanel, BorderLayout.NORTH);
+        add(centerPanel, BorderLayout.CENTER);
+        add(bottomPanel, BorderLayout.SOUTH);
+
+        addListeners();
+    }
+
+    private JTextArea createTextArea(boolean editable) {
+        JTextArea ta = new JTextArea(5, 50);
+        ta.setLineWrap(true);
+        ta.setWrapStyleWord(true);
+        ta.setEditable(editable);
+        return ta;
+    }
+
+    private void disableCopyPaste(JTextArea ta) {
+        ta.getInputMap().put(KeyStroke.getKeyStroke("ctrl C"), "none");
+        ta.getInputMap().put(KeyStroke.getKeyStroke("ctrl V"), "none");
+        ta.getInputMap().put(KeyStroke.getKeyStroke("ctrl X"), "none");
+        ta.setComponentPopupMenu(null);
+        ta.setTransferHandler(null);
+    }
+
+    private void addListeners() {
+        generateBtn.addActionListener(e -> generateQuestion());
+        evaluateBtn.addActionListener(e -> evaluateAnswer());
+        nextBtn.addActionListener(e -> generateBtn.doClick());
+        submitBtn.addActionListener(e -> {
+            if (answeredCount > 0) {
+                controller.finishSession();
+            } else {
+                JOptionPane.showMessageDialog(this, 
+                    "Please answer at least one question before submitting.", 
+                    "No Answers", 
+                    JOptionPane.WARNING_MESSAGE);
+            }
+        });
+        readBtn.addActionListener(e -> {
+            String question = questionArea.getText().trim();
+            if (!question.isEmpty()) {
+                try {
+                    controller.getTTSClient().speakText(question);
+                } catch (IOException ex) {
+                    JOptionPane.showMessageDialog(this,
+                        "Error reading question: " + ex.getMessage(),
+                        "Error",
+                        JOptionPane.ERROR_MESSAGE);
+                }
+            }
+        });
+        stopBtn.addActionListener(e -> {
+            controller.getTTSClient().stopSpeaking();
+        });
+    }
+
+    private void generateQuestion() {
+        String role = controller.getRole();
+        String username = controller.getCurrentUser();
+        if (!role.isEmpty()) {
+            String prompt = "Imagine you are an expert interviewer. The candidate is applying for the job role: \""
+                    + role + "\". Please create a thoughtful and beginner-friendly interview question.";
+            try {
+                questionArea.setText(controller.getGeminiClient().generateResponse(prompt));
+                answerInput.setText("");
+                feedbackArea.setText("");
+                startTimer();
+            } catch (IOException ex) {
+                questionArea.setText("Error: " + ex.getMessage());
+            }
+        }
+    }
+
+    private void evaluateAnswer() {
+        String question = questionArea.getText().trim();
+        String answer = answerInput.getText().trim();
+        if (!question.isEmpty() && !answer.isEmpty()) {
+            String evalPrompt = "Evaluate this answer to the question: \"" + question + "\".\n\nAnswer: \"" + answer
+                    + "\"\n\nGive short, clear feedback.";
+            try {
+                String feedback = controller.getGeminiClient().generateResponse(evalPrompt);
+                feedbackArea.setText(feedback);
+                recordAnswer(question, answer, feedback);
+            } catch (IOException ex) {
+                feedbackArea.setText("Error: " + ex.getMessage());
+            }
+        }
+    }
+
+    private void startTimer() {
+        timeLeft = 60;
+        if (timer != null)
+            timer.stop();
+        timer = new Timer(1000, e -> {
+            if (timeLeft <= 0) {
+                timer.stop();
+                nextBtn.doClick();
+            } else {
+                timeLeft--;
+                timerLabel.setText("Time Left: " + timeLeft + "s");
+            }
+        });
+        timer.start();
+    }
+
+    private void recordAnswer(String question, String answer, String feedback) {
+        QuestionData qd = new QuestionData();
+        qd.setQuestion(question);
+        qd.setAnswer(answer);
+        qd.setFeedback(feedback);
+        controller.getDataModel().setHistory(qd);
+
+        String filename = controller.getCurrentUser() + "_answers.txt";
+        try (BufferedWriter writer = new BufferedWriter(new FileWriter(filename, true))) {
+            writer.write("Q: " + question + "\nA: " + answer + "\nF: " + feedback + "\n\n");
+        } catch (IOException e) {
+            e.printStackTrace();
+        }
+
+        answeredCount++;
+        counterLabel.setText(getCounterText());
+
+        if (answeredCount >= totalQuestions) {
+            controller.finishSession();
+        }
+    }
+
+    private String getCounterText() {
+        return "Answered: " + answeredCount + "/" + totalQuestions;
+    }
+}

LoginPage.java

@@ -0,0 +1,145 @@
+import javax.swing.*;
+import java.awt.*;
+import java.awt.event.*;
+import java.io.*;
+
+public class LoginPage extends JPanel {
+    private JTextField usernameField;
+    private JPasswordField passwordField;
+    private JButton loginButton, signupButton;
+    private JLabel statusLabel;
+    private boolean isSignUpMode = false;
+    private ClearPassAIGUI controller;
+
+    public LoginPage(ClearPassAIGUI controller) {
+        this.controller = controller;
+        setLayout(new GridBagLayout());
+        GridBagConstraints gbc = new GridBagConstraints();
+        gbc.insets = new Insets(10, 10, 10, 10);
+        gbc.fill = GridBagConstraints.HORIZONTAL;
+
+        JLabel titleLabel = new JLabel("Welcome to ClearPass AI", SwingConstants.CENTER);
+        titleLabel.setFont(new Font("Arial", Font.BOLD, 24));
+        gbc.gridx = 0;
+        gbc.gridy = 0;
+        gbc.gridwidth = 2;
+        add(titleLabel, gbc);
+
+        gbc.gridy++;
+        gbc.gridwidth = 1;
+        add(new JLabel("Username:"), gbc);
+        gbc.gridx = 1;
+        usernameField = new JTextField(15);
+        add(usernameField, gbc);
+
+        gbc.gridx = 0;
+        gbc.gridy++;
+        add(new JLabel("Password:"), gbc);
+        gbc.gridx = 1;
+        passwordField = new JPasswordField(15);
+        add(passwordField, gbc);
+
+        gbc.gridx = 0;
+        gbc.gridy++;
+        gbc.gridwidth = 2;
+        loginButton = new JButton("Login");
+        signupButton = new JButton("Sign Up");
+        JPanel buttonPanel = new JPanel(new FlowLayout());
+        buttonPanel.add(loginButton);
+        buttonPanel.add(signupButton);
+        add(buttonPanel, gbc);
+
+        gbc.gridy++;
+        statusLabel = new JLabel("", SwingConstants.CENTER);
+        add(statusLabel, gbc);
+
+        loginButton.addActionListener(e -> {
+            if (isSignUpMode)
+                handleSignUp();
+            else
+                handleLogin();
+        });
+
+        signupButton.addActionListener(e -> toggleMode());
+    }
+
+    private void toggleMode() {
+        isSignUpMode = !isSignUpMode;
+        loginButton.setText(isSignUpMode ? "Create Account" : "Login");
+        signupButton.setText(isSignUpMode ? "Back to Login" : "Sign Up");
+        statusLabel.setText("");
+    }
+
+    private void handleLogin() {
+        String username = usernameField.getText().trim();
+        String password = new String(passwordField.getPassword());
+
+        if (username.isEmpty() || password.isEmpty()) {
+            showMessage("Please enter both fields", Color.RED);
+            return;
+        }
+
+        if (authenticate(username, password)) {
+            controller.setCurrentUser(username);
+            controller.showScreen("Welcome");
+        } else {
+            showMessage("Invalid credentials", Color.RED);
+        }
+    }
+
+    private void handleSignUp() {
+        String username = usernameField.getText().trim();
+        String password = new String(passwordField.getPassword());
+
+        if (username.isEmpty() || password.isEmpty()) {
+            showMessage("Please fill all fields", Color.RED);
+            return;
+        }
+
+        File file = new File("users.txt");
+        try {
+            file.createNewFile();
+            BufferedReader reader = new BufferedReader(new FileReader(file));
+            String line;
+            while ((line = reader.readLine()) != null) {
+                if (line.startsWith(username + ":")) {
+                    reader.close();
+                    showMessage("Username already exists", Color.RED);
+                    return;
+                }
+            }
+            reader.close();
+
+            BufferedWriter writer = new BufferedWriter(new FileWriter(file, true));
+            writer.write(username + ":" + password);
+            writer.newLine();
+            writer.close();
+
+            JOptionPane.showMessageDialog(this, "Account created successfully!");
+            toggleMode();
+        } catch (IOException ex) {
+            showMessage("Error accessing file", Color.RED);
+        }
+    }
+
+    private boolean authenticate(String username, String password) {
+        File file = new File("users.txt");
+        try (BufferedReader reader = new BufferedReader(new FileReader(file))) {
+            String line;
+            while ((line = reader.readLine()) != null) {
+                String[] parts = line.split(":");
+                if (parts.length == 2 && parts[0].equals(username) && parts[1].equals(password)) {
+                    return true;
+                }
+            }
+        } catch (IOException e) {
+            showMessage("Error reading file", Color.RED);
+        }
+        return false;
+    }
+
+    private void showMessage(String message, Color color) {
+        statusLabel.setText(message);
+        statusLabel.setForeground(color);
+    }
+}

MozillaTTSClient.java

@@ -0,0 +1,63 @@
+import java.io.*;
+import java.net.HttpURLConnection;
+import java.net.URL;
+import javax.sound.sampled.*;
+
+public class MozillaTTSClient {
+    private final String voiceId = "en_US/vctk_low"; // Free voice model
+    private final String apiUrl = "https://api-inference.huggingface.co/models/mozilla/tts";
+
+    public MozillaTTSClient() {
+        // No API key needed for basic usage
+    }
+
+    public void speakText(String text) throws IOException {
+        String inputJson = "{\n" +
+                "  \"inputs\": \"" + text.replace("\"", "\\\"") + "\",\n" +
+                "  \"parameters\": {\n" +
+                "    \"voice_preset\": \"" + voiceId + "\"\n" +
+                "  }\n" +
+                "}";
+
+        URL url = new URL(apiUrl);
+        HttpURLConnection conn = (HttpURLConnection) url.openConnection();
+        conn.setRequestMethod("POST");
+        conn.setRequestProperty("Content-Type", "application/json");
+        conn.setDoOutput(true);
+
+        try (OutputStream os = conn.getOutputStream()) {
+            os.write(inputJson.getBytes("utf-8"));
+        }
+
+        int status = conn.getResponseCode();
+        if (status == 200) {
+            try (InputStream is = conn.getInputStream()) {
+                // Save the audio to a temporary file
+                File tempFile = File.createTempFile("speech", ".wav");
+                try (FileOutputStream fos = new FileOutputStream(tempFile)) {
+                    byte[] buffer = new byte[1024];
+                    int bytesRead;
+                    while ((bytesRead = is.read(buffer)) != -1) {
+                        fos.write(buffer, 0, bytesRead);
+                    }
+                }
+
+                // Play the audio
+                try (AudioInputStream audioIn = AudioSystem.getAudioInputStream(tempFile)) {
+                    Clip clip = AudioSystem.getClip();
+                    clip.open(audioIn);
+                    clip.start();
+                    clip.drain();
+                    clip.close();
+                } catch (UnsupportedAudioFileException | LineUnavailableException e) {
+                    throw new IOException("Error playing audio: " + e.getMessage());
+                }
+
+                // Clean up the temporary file
+                tempFile.delete();
+            }
+        } else {
+            throw new IOException("Error: " + status);
+        }
+    }
+} 

QuestionData.java

@@ -0,0 +1,35 @@
+public class QuestionData {
+	private String question;
+	private String answer;
+	private String feedback;
+
+	public QuestionData() {
+		this.question = "";
+		this.feedback = "";
+		this.answer = "";
+	}
+
+	public void setQuestion(String question) {
+		this.question = question;
+	}
+
+	public void setFeedback(String feedback) {
+		this.feedback = feedback;
+	}
+
+	public void setAnswer(String answer) {
+		this.answer = answer;
+	}
+
+	public String getQuestion() {
+		return question;
+	}
+
+	public String getFeedback() {
+		return feedback;
+	}
+
+	public String getAnswer() {
+		return answer;
+	}
+}

README.md

@@ -1,12 +1,77 @@
----
-title: AIProject
-emoji: 😻
-colorFrom: blue
-colorTo: yellow
-sdk: gradio
-sdk_version: 5.27.1
-app_file: app.py
-pinned: false
----
+# ClearPass AI - Java Swing Interview Simulator
+
+ClearPass AI is a Java Swing-based desktop application that simulates AI-powered interview questions. It allows users to log in, specify a job role, answer AI-generated questions, receive real-time feedback, and view or export their session summaries.
+
+## ✨ Features
+- 🔐 User login and signup system (local file-based)
+- 🧠 AI-generated interview questions based on job role (using Google's Gemini API)
+- 😊 Sentiment analysis of answers (using HuggingFace's DistilBERT model)
+- ✅ Real-time feedback on user responses
+- ⏱ Countdown timer per question
+- 📊 Progress tracker (answered vs. remaining)
+- 💾 Save full session summary and result to `.txt` files
+- 🧾 Clean MVC-based structure for easy updates
+
+## 🛠 Requirements
+- Java 8 or higher
+- Internet connection (for AI API calls)
+- JSON library (org.json)
+
+## 📁 File Structure
+```
+project-root/
+├── ClearPassAIApp.java
+├── ClearPassAIGUI.java
+├── InterviewScreen.java
+├── LoginPage.java
+├── WelcomeScreen.java
+├── ResultScreen.java
+├── DataModel.java
+├── QuestionData.java
+├── GeminiClient.java
+├── HuggingFaceClient.java
+├── users.txt
+├── config.properties    <-- contains your API keys
+```
+
+## 🔑 Setup API Keys
+1. Create a `config.properties` file in the root directory.
+2. Add your API keys:
+
+```properties
+GEMINI_API_KEY=your_gemini_api_key_here
+HUGGINGFACE_API_KEY=your_huggingface_api_key_here
+```
 
-Check out the configuration reference at https://huggingface.co/docs/hub/spaces-config-reference
+## ▶️ How to Run
+### If using terminal:
+```bash
+javac -cp ".:lib/json-20250107.jar" *.java
+java -cp ".:lib/json-20250107.jar" ClearPassAIApp
+```
+
+### If using an IDE:
+- Open the project.
+- Add the JSON library to your project dependencies.
+- Set `ClearPassAIApp` as the main class.
+- Run the project.
+
+## 💬 Sample Credentials
+- Username: `dhruvparmar`
+- Password: `1234`
+
+You can create new users via the Sign-Up screen.
+
+## 📂 Output Files
+- `username_answers.txt` → contains each Q&A + feedback
+- `username_summary.txt` → full interview session
+- `username_result.txt` → saved from Result screen (if user clicks save)
+
+## ✅ Future Improvements
+- Add more AI models for different types of analysis
+- Implement voice input/output
+- Add support for different languages
+- Enhance the UI with modern design elements
+
+---
+Made with 💙 by Dhruv Parmar

ResultScreen.java

@@ -0,0 +1,63 @@
+import javax.swing.*;
+import java.awt.*;
+import java.awt.event.ActionEvent;
+import java.io.*;
+import java.util.List;
+
+public class ResultScreen extends JPanel {
+    private JTextArea resultArea;
+
+    public ResultScreen(ClearPassAIGUI controller) {
+        setLayout(new BorderLayout());
+
+        resultArea = new JTextArea();
+        resultArea.setEditable(false);
+        JScrollPane scrollPane = new JScrollPane(resultArea);
+        add(scrollPane, BorderLayout.CENTER);
+
+        List<QuestionData> history = controller.getDataModel().getHistory();
+        int total = controller.getQuestionCount();
+        String username = controller.getCurrentUser();
+
+        if (history.isEmpty()) {
+            resultArea.setText("No responses recorded.");
+        } else {
+            StringBuilder sb = new StringBuilder();
+            sb.append("Summary: You answered ").append(history.size()).append(" out of ").append(total)
+                    .append(" questions.\n\n");
+
+            for (int i = 0; i < history.size(); i++) {
+                QuestionData q = history.get(i);
+                sb.append("Q").append(i + 1).append(": ").append(q.getQuestion()).append("\n");
+                sb.append("Your Answer: ").append(q.getAnswer()).append("\n");
+                sb.append("AI Feedback: ").append(q.getFeedback()).append("\n\n");
+            }
+
+            resultArea.setText(sb.toString());
+        }
+
+        JButton backBtn = new JButton("Back to Welcome");
+        backBtn.addActionListener(e -> controller.showScreen("Welcome"));
+
+        JButton saveBtn = new JButton("Save Result");
+        saveBtn.addActionListener(
+                (ActionEvent e) -> saveResultToFile(controller.getCurrentUser(), resultArea.getText()));
+
+        JPanel bottomPanel = new JPanel(new FlowLayout());
+        bottomPanel.add(backBtn);
+        bottomPanel.add(saveBtn);
+
+        add(bottomPanel, BorderLayout.SOUTH);
+    }
+
+    private void saveResultToFile(String username, String content) {
+        String filename = username + "_result.txt";
+        try (BufferedWriter writer = new BufferedWriter(new FileWriter(filename))) {
+            writer.write(content);
+            JOptionPane.showMessageDialog(this, "Result saved to " + filename);
+        } catch (IOException e) {
+            JOptionPane.showMessageDialog(this, "Failed to save result.", "Error", JOptionPane.ERROR_MESSAGE);
+            e.printStackTrace();
+        }
+    }
+}

TextToSpeechClient.java

@@ -0,0 +1,65 @@
+import java.io.*;
+import java.net.HttpURLConnection;
+import java.net.URL;
+import javax.sound.sampled.*;
+import org.json.JSONObject;
+
+public class TextToSpeechClient {
+    private final String apiKey;
+    private final String model = "facebook/fastspeech2-en-ljspeech";
+
+    public TextToSpeechClient(String apiKey) { 
+        this.apiKey = apiKey;
+    }
+
+    public void speakText(String text) throws IOException {
+        String inputJson = "{\n" +
+                "  \"inputs\": \"" + text.replace("\"", "\\\"") + "\",\n" +
+                "  \"parameters\": {\n" +
+                "    \"return_timestamps\": false\n" +
+                "  }\n" +
+                "}";
+
+        URL url = new URL("https://api-inference.huggingface.co/models/" + model);
+        HttpURLConnection conn = (HttpURLConnection) url.openConnection();
+        conn.setRequestMethod("POST");
+        conn.setRequestProperty("Authorization", "Bearer " + apiKey);
+        conn.setRequestProperty("Content-Type", "application/json");
+        conn.setDoOutput(true);
+
+        try (OutputStream os = conn.getOutputStream()) {
+            os.write(inputJson.getBytes("utf-8"));
+        }
+
+        int status = conn.getResponseCode();
+        if (status == 200) {
+            try (InputStream is = conn.getInputStream()) {
+                // Save the audio to a temporary file
+                File tempFile = File.createTempFile("speech", ".wav");
+                try (FileOutputStream fos = new FileOutputStream(tempFile)) {
+                    byte[] buffer = new byte[1024];
+                    int bytesRead;
+                    while ((bytesRead = is.read(buffer)) != -1) {
+                        fos.write(buffer, 0, bytesRead);
+                    }
+                }
+
+                // Play the audio
+                try (AudioInputStream audioIn = AudioSystem.getAudioInputStream(tempFile)) {
+                    Clip clip = AudioSystem.getClip();
+                    clip.open(audioIn);
+                    clip.start();
+                    clip.drain();
+                    clip.close();
+                } catch (UnsupportedAudioFileException | LineUnavailableException e) {
+                    throw new IOException("Error playing audio: " + e.getMessage());
+                }
+
+                // Clean up the temporary file
+                tempFile.delete();
+            }
+        } else {
+            throw new IOException("Error: " + status);
+        }
+    }
+} 

WelcomeScreen.java

@@ -0,0 +1,37 @@
+import javax.swing.*;
+import java.awt.*;
+
+public class WelcomeScreen extends JPanel {
+    private ClearPassAIGUI controller;
+    private JTextField roleField;
+    private JSpinner questionCountSpinner;
+
+    public WelcomeScreen(ClearPassAIGUI controller) {
+        this.controller = controller;
+        setLayout(new FlowLayout());
+
+        add(new JLabel("Enter Job Role:"));
+        roleField = new JTextField(20);
+        add(roleField);
+
+        add(new JLabel("Number of Questions:"));
+        questionCountSpinner = new JSpinner(new SpinnerNumberModel(5, 1, 20, 1));
+        add(questionCountSpinner);
+
+        JButton startButton = new JButton("Start Interview");
+        add(startButton);
+
+        startButton.addActionListener(e -> {
+            String role = roleField.getText().trim();
+            int questionCount = (int) questionCountSpinner.getValue();
+            if (!role.isEmpty()) {
+                controller.setRole(role);
+                controller.setQuestionCount(questionCount);
+                controller.startSession(role, questionCount);
+            } else {
+                JOptionPane.showMessageDialog(this, "Please enter a job role.", "Input Error",
+                        JOptionPane.ERROR_MESSAGE);
+            }
+        });
+    }
+}

users.txt

@@ -0,0 +1,6 @@
+dhruvparmar:1234
+aksha:123
+justin:123
+jason:123
+saahil:123
+justinTest:test