|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
import itertools |
|
|
from collections import defaultdict |
|
|
|
|
|
import numpy as np |
|
|
from rdkit import Chem |
|
|
|
|
|
|
|
|
def neutralize_atoms(mol: Chem.Mol): |
|
|
pattern = Chem.MolFromSmarts( |
|
|
"[+1!h0!$([*]~[-1,-2,-3,-4]),-1!#4!#5!$([*]~[+1,+2,+3,+4])]" |
|
|
) |
|
|
at_matches = mol.GetSubstructMatches(pattern) |
|
|
at_matches_list = [y[0] for y in at_matches] |
|
|
if len(at_matches_list) > 0: |
|
|
for at_idx in at_matches_list: |
|
|
atom = mol.GetAtomWithIdx(at_idx) |
|
|
chg = atom.GetFormalCharge() |
|
|
hcount = atom.GetTotalNumHs() |
|
|
atom.SetFormalCharge(0) |
|
|
atom.SetNumExplicitHs(hcount - chg) |
|
|
atom.UpdatePropertyCache() |
|
|
return mol |
|
|
|
|
|
|
|
|
def recursive_permutation(atom_inds, permutation_list, res): |
|
|
def _permute_atom_ind(atom_inds, permutation): |
|
|
|
|
|
|
|
|
permute_inds = [i for i, a in enumerate(atom_inds) if a in permutation] |
|
|
for i, perm_ind in enumerate(permute_inds): |
|
|
atom_inds[perm_ind] = permutation[i] |
|
|
return atom_inds |
|
|
|
|
|
if len(permutation_list) == 0: |
|
|
res.append(atom_inds) |
|
|
else: |
|
|
current_permutation_list = permutation_list.copy() |
|
|
for permutation in current_permutation_list.pop(0): |
|
|
atom_inds_permed = _permute_atom_ind(atom_inds.copy(), permutation) |
|
|
recursive_permutation(atom_inds_permed, current_permutation_list, res) |
|
|
|
|
|
|
|
|
def augment_atom_maps_with_conjugate_terminal_groups( |
|
|
original_maps, atomic_number_mapping, terminal_group_tuples, MaxMatches=1e6 |
|
|
): |
|
|
""" |
|
|
Augment atom maps from GetSubstructMatches with extra symmetry from confjugated terminal groups. |
|
|
Parameters |
|
|
-------------- |
|
|
original_maps: Tuple(Tuples), all possible atom index mappings, note we require that the mappings should range from 0 to n_heavy_atom-1 (a.k.a. no gap in indexing) |
|
|
atomic_number_mapping: dict, mapping from atom (positional) indices to its atomic numbers, for splitting/removing different types of atoms in each terminal group |
|
|
terminal_group_tuples: Tuple(Tuples), a group of pair of atoms whose bonds match the SMARTS string. Ex: ((0, 1), (2, 1), (10, 9), (11, 9), (12, 9), (14, 13), (15, 13)) |
|
|
MaxMatches: int, cutoff for total number of matches (n_original_perm * n_conjugate perm) |
|
|
|
|
|
Returns |
|
|
-------------- |
|
|
augmented_maps: Tuple(Tuples) , original_maps augmented by muliplying the permutations induced by terminal_group_tuples. |
|
|
""" |
|
|
|
|
|
def _terminal_atom_cluster_from_pairs(edges): |
|
|
graph = defaultdict(set) |
|
|
for u, v in edges: |
|
|
graph[u].add(v) |
|
|
graph[v].add(u) |
|
|
return graph |
|
|
|
|
|
def _split_sets_by_mapped_values(list_of_sets, mapping): |
|
|
result = [] |
|
|
for s in list_of_sets: |
|
|
mapped_sets = {} |
|
|
for elem in s: |
|
|
mapped_value = mapping.get(elem) |
|
|
if mapped_value not in mapped_sets: |
|
|
mapped_sets[mapped_value] = set() |
|
|
mapped_sets[mapped_value].add(elem) |
|
|
result.extend(mapped_sets.values()) |
|
|
return result |
|
|
|
|
|
|
|
|
terminal_atom_clusters = _terminal_atom_cluster_from_pairs(terminal_group_tuples) |
|
|
MaxTerminalGroups = max( |
|
|
1, int(np.ceil(np.emath.logn(3, MaxMatches / len(original_maps)))) |
|
|
) |
|
|
|
|
|
|
|
|
perm_groups = sorted( |
|
|
[ |
|
|
atom_inds |
|
|
for common_id, atom_inds in terminal_atom_clusters.items() |
|
|
if len(atom_inds) > 1 |
|
|
] |
|
|
)[: min(MaxTerminalGroups, len(terminal_atom_clusters))] |
|
|
|
|
|
|
|
|
perm_groups = _split_sets_by_mapped_values(perm_groups, atomic_number_mapping) |
|
|
perm_groups = [p for p in perm_groups if len(p) > 1] |
|
|
|
|
|
|
|
|
perm_groups = [sorted(list(itertools.permutations(g))) for g in perm_groups] |
|
|
|
|
|
|
|
|
augmented_maps = [] |
|
|
for initial_mapping in original_maps: |
|
|
recursive_permutation(list(initial_mapping), perm_groups, augmented_maps) |
|
|
|
|
|
|
|
|
augmented_maps = tuple(tuple(a) for a in augmented_maps) |
|
|
|
|
|
return tuple(set(augmented_maps)) |
|
|
|
|
|
|
|
|
def _get_substructure_perms( |
|
|
mol: Chem.Mol, |
|
|
Neutralize: bool = False, |
|
|
CheckStereochem: bool = True, |
|
|
SymmetrizeConjugatedTerminal: bool = True, |
|
|
MaxMatches: int = 512, |
|
|
) -> np.ndarray: |
|
|
""" |
|
|
Args: |
|
|
CheckStereochem: whether to assure stereochem does not change after permutation |
|
|
Neutralize: if true, neutralize the mol before computing the permutations |
|
|
SymmetrizeConjugatedTerminal: if true, consider symmetrization of conjugated terminal groups |
|
|
MaxMatches: int, cutoff for total number of matches |
|
|
|
|
|
return shape=[num_perms, num_atoms] |
|
|
""" |
|
|
ori_idx_w_h = [] |
|
|
for atom in mol.GetAtoms(): |
|
|
atom.SetProp("ori_idx_w_h", str(atom.GetIdx())) |
|
|
ori_idx_w_h.append(atom.GetIdx()) |
|
|
|
|
|
|
|
|
|
|
|
mol = Chem.RemoveHs(mol) |
|
|
if Neutralize: |
|
|
mol = neutralize_atoms(mol) |
|
|
|
|
|
|
|
|
base_perms = np.array( |
|
|
mol.GetSubstructMatches(mol, uniquify=False, maxMatches=MaxMatches) |
|
|
) |
|
|
assert len(base_perms) > 0, "no matches found, error" |
|
|
|
|
|
if CheckStereochem: |
|
|
chem_order = np.array( |
|
|
list(Chem.rdmolfiles.CanonicalRankAtoms(mol, breakTies=False)) |
|
|
) |
|
|
perms_mask = (chem_order[base_perms] == chem_order[None]).sum( |
|
|
-1 |
|
|
) == mol.GetNumAtoms() |
|
|
base_perms = base_perms[perms_mask] |
|
|
|
|
|
|
|
|
sma = "[O,N;D1;$([O,N;D1]-[*]=[O,N;D1]),$([O,N;D1]=[*]-[O,N;D1])]~[*]" |
|
|
patt = Chem.MolFromSmarts(sma) |
|
|
terminal_group_tuples = mol.GetSubstructMatches(patt) |
|
|
if ( |
|
|
len(terminal_group_tuples) > 0 and SymmetrizeConjugatedTerminal |
|
|
): |
|
|
atomic_number_mapping = { |
|
|
i: atom.GetAtomicNum() for i, atom in enumerate(mol.GetAtoms()) |
|
|
} |
|
|
base_perms = augment_atom_maps_with_conjugate_terminal_groups( |
|
|
tuple(tuple(a) for a in base_perms), |
|
|
atomic_number_mapping, |
|
|
terminal_group_tuples, |
|
|
MaxMatches, |
|
|
) |
|
|
base_perms = np.array(base_perms) |
|
|
|
|
|
if len(base_perms) > MaxMatches: |
|
|
base_perms = base_perms[:MaxMatches] |
|
|
|
|
|
new_to_ori_idx_map = {} |
|
|
ori_to_new_idx_map = {} |
|
|
for atom in mol.GetAtoms(): |
|
|
ori_idx = int(atom.GetProp("ori_idx_w_h")) |
|
|
new_idx = atom.GetIdx() |
|
|
new_to_ori_idx_map[new_idx] = ori_idx |
|
|
ori_to_new_idx_map[ori_idx] = new_idx |
|
|
|
|
|
base_perms = np.vectorize(new_to_ori_idx_map.get)(base_perms) |
|
|
perms = np.zeros(shape=(base_perms.shape[0], len(ori_idx_w_h))) |
|
|
for i in range(len(ori_idx_w_h)): |
|
|
if i in ori_to_new_idx_map: |
|
|
perms[:, i] = base_perms[:, ori_to_new_idx_map[i]] |
|
|
else: |
|
|
|
|
|
perms[:, i] = i |
|
|
return perms |
|
|
|
|
|
|
|
|
def get_substructure_perms( |
|
|
mol: Chem.Mol, |
|
|
CheckStereochem: bool = True, |
|
|
SymmetrizeConjugatedTerminal: bool = True, |
|
|
MaxMatches: int = 512, |
|
|
KeepProtonation: bool = False, |
|
|
) -> np.ndarray: |
|
|
kwargs = { |
|
|
"CheckStereochem": CheckStereochem, |
|
|
"SymmetrizeConjugatedTerminal": SymmetrizeConjugatedTerminal, |
|
|
"MaxMatches": MaxMatches, |
|
|
} |
|
|
|
|
|
if KeepProtonation: |
|
|
perms = _get_substructure_perms(mol, Neutralize=False, **kwargs) |
|
|
else: |
|
|
|
|
|
perms = np.unique( |
|
|
np.row_stack( |
|
|
( |
|
|
_get_substructure_perms(mol, Neutralize=False, **kwargs), |
|
|
_get_substructure_perms(mol, Neutralize=True, **kwargs), |
|
|
) |
|
|
), |
|
|
axis=0, |
|
|
) |
|
|
|
|
|
nperm = len(perms) |
|
|
if nperm > MaxMatches: |
|
|
perms = perms[np.random.choice(range(nperm), MaxMatches, replace=False)] |
|
|
return perms |
|
|
|
|
|
|
|
|
def test(): |
|
|
testcases = [ |
|
|
"C1=CC=CC=C1", |
|
|
"CC(=O)OC1=CC=CC=C1C(=O)O", |
|
|
"C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C", |
|
|
"CN1C=NC2=C1C(=O)N(C(=O)N2C)C", |
|
|
] |
|
|
for smiles in testcases: |
|
|
print(smiles) |
|
|
molecule = Chem.MolFromSmiles(smiles) |
|
|
perms = get_substructure_perms(molecule) |
|
|
print(perms.shape) |
|
|
print(perms.T) |
|
|
|
|
|
|
|
|
if __name__ == "__main__": |
|
|
test() |
|
|
|