Spaces:
Sleeping
Sleeping
Commit
·
7d38fe9
1
Parent(s):
2842604
Removed splitting bonds highlights and added examples.
Browse files- protac_splitter/display_utils.py +8 -7
- protac_splitter_app.py +114 -50
protac_splitter/display_utils.py
CHANGED
|
@@ -1,5 +1,6 @@
|
|
| 1 |
import os
|
| 2 |
import sys
|
|
|
|
| 3 |
from typing import Optional
|
| 4 |
|
| 5 |
from rdkit import Chem
|
|
@@ -15,7 +16,7 @@ def safe_display(*args):
|
|
| 15 |
if 'ipykernel' in sys.modules:
|
| 16 |
display(*args)
|
| 17 |
else:
|
| 18 |
-
|
| 19 |
|
| 20 |
|
| 21 |
def display_mol(
|
|
@@ -28,7 +29,7 @@ def display_mol(
|
|
| 28 |
):
|
| 29 |
""" Display a molecule in a Jupyter notebook. Useful for having """
|
| 30 |
if mol is None:
|
| 31 |
-
|
| 32 |
return None
|
| 33 |
if use_smiles_as_legend and legend is None:
|
| 34 |
legend = Chem.MolToSmiles(mol)
|
|
@@ -97,7 +98,7 @@ def get_mapped_protac_img(
|
|
| 97 |
return None
|
| 98 |
|
| 99 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 100 |
-
|
| 101 |
poi_attachment_idx = get_atom_idx_at_attachment(protac_mol, poi_mol, e3_mol)
|
| 102 |
e3_attachment_idx = get_atom_idx_at_attachment(protac_mol, e3_mol, poi_mol)
|
| 103 |
else:
|
|
@@ -118,9 +119,9 @@ def get_mapped_protac_img(
|
|
| 118 |
if poi_attachment_idx is not None:
|
| 119 |
if len(poi_attachment_idx) != 2:
|
| 120 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 121 |
-
|
| 122 |
else:
|
| 123 |
-
|
| 124 |
else:
|
| 125 |
poi_bond_idx = protac_mol.GetBondBetweenAtoms(*poi_attachment_idx).GetIdx()
|
| 126 |
highlight_atoms += poi_attachment_idx
|
|
@@ -132,9 +133,9 @@ def get_mapped_protac_img(
|
|
| 132 |
if e3_attachment_idx is not None:
|
| 133 |
if len(e3_attachment_idx) != 2:
|
| 134 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 135 |
-
|
| 136 |
else:
|
| 137 |
-
|
| 138 |
else:
|
| 139 |
e3_bond_idx = protac_mol.GetBondBetweenAtoms(*e3_attachment_idx).GetIdx()
|
| 140 |
highlight_atoms += e3_attachment_idx
|
|
|
|
| 1 |
import os
|
| 2 |
import sys
|
| 3 |
+
import logging
|
| 4 |
from typing import Optional
|
| 5 |
|
| 6 |
from rdkit import Chem
|
|
|
|
| 16 |
if 'ipykernel' in sys.modules:
|
| 17 |
display(*args)
|
| 18 |
else:
|
| 19 |
+
logging.warning(*args)
|
| 20 |
|
| 21 |
|
| 22 |
def display_mol(
|
|
|
|
| 29 |
):
|
| 30 |
""" Display a molecule in a Jupyter notebook. Useful for having """
|
| 31 |
if mol is None:
|
| 32 |
+
logging.warning('Molecule is None')
|
| 33 |
return None
|
| 34 |
if use_smiles_as_legend and legend is None:
|
| 35 |
legend = Chem.MolToSmiles(mol)
|
|
|
|
| 98 |
return None
|
| 99 |
|
| 100 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 101 |
+
logging.warning('WARNING. Linker is empty.')
|
| 102 |
poi_attachment_idx = get_atom_idx_at_attachment(protac_mol, poi_mol, e3_mol)
|
| 103 |
e3_attachment_idx = get_atom_idx_at_attachment(protac_mol, e3_mol, poi_mol)
|
| 104 |
else:
|
|
|
|
| 119 |
if poi_attachment_idx is not None:
|
| 120 |
if len(poi_attachment_idx) != 2:
|
| 121 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 122 |
+
logging.warning(f'WARNING. Linker is empty, no highlighting will be showed for the POI.')
|
| 123 |
else:
|
| 124 |
+
logging.warning(f'WARNING. POI attachment points must be only two, got instead: {poi_attachment_idx}')
|
| 125 |
else:
|
| 126 |
poi_bond_idx = protac_mol.GetBondBetweenAtoms(*poi_attachment_idx).GetIdx()
|
| 127 |
highlight_atoms += poi_attachment_idx
|
|
|
|
| 133 |
if e3_attachment_idx is not None:
|
| 134 |
if len(e3_attachment_idx) != 2:
|
| 135 |
if linker_smiles in ['[*:1][*:2]', '[*:2][*:1]']:
|
| 136 |
+
logging.warning(f'WARNING. Linker is empty, no highlighting will be showed for the E3.')
|
| 137 |
else:
|
| 138 |
+
logging.warning(f'WARNING. E3 attachment points must be only two, got instead: {e3_attachment_idx}')
|
| 139 |
else:
|
| 140 |
e3_bond_idx = protac_mol.GetBondBetweenAtoms(*e3_attachment_idx).GetIdx()
|
| 141 |
highlight_atoms += e3_attachment_idx
|
protac_splitter_app.py
CHANGED
|
@@ -79,55 +79,61 @@ def process_single_smiles(protac_smiles: str, use_transformer: bool = False, use
|
|
| 79 |
raise gr.Error(f"An error occurred while processing the input SMILES: {exception_message}", duration=10)
|
| 80 |
|
| 81 |
valid_molecules = []
|
| 82 |
-
pred_key = f
|
| 83 |
valid_molecules.append(results[pred_key])
|
| 84 |
|
| 85 |
# Generate images and corresponding SMILES text
|
| 86 |
images = []
|
| 87 |
-
smiles_texts = []
|
| 88 |
input_mol = Chem.MolFromSmiles(protac_smiles)
|
| 89 |
|
| 90 |
if input_mol is not None:
|
| 91 |
input_img = Draw.MolToImage(input_mol, legend="", size=(1000, 200))
|
| 92 |
else:
|
| 93 |
-
input_img = Image.new(
|
| 94 |
|
|
|
|
| 95 |
splits = {}
|
| 96 |
for smiles in results[pred_key].split("."):
|
| 97 |
mol = Chem.MolFromSmiles(smiles)
|
| 98 |
if mol:
|
| 99 |
if "[*:1]" in smiles and "[*:2]" in smiles:
|
| 100 |
legend = "Linker"
|
| 101 |
-
splits[
|
| 102 |
elif "[*:1]" in smiles:
|
| 103 |
legend = "Warhead"
|
| 104 |
-
splits[
|
| 105 |
elif "[*:2]" in smiles:
|
| 106 |
legend = "E3 Ligase Ligand"
|
| 107 |
-
splits[
|
| 108 |
|
| 109 |
img = Draw.MolToImage(mol, legend="", size=(1000, 1000))
|
| 110 |
images.append(img)
|
| 111 |
-
smiles_texts.append(f"{legend}: {smiles}")
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
)
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 131 |
|
| 132 |
def process_csv(
|
| 133 |
file: gr.File,
|
|
@@ -198,8 +204,17 @@ def create_interface():
|
|
| 198 |
Returns:
|
| 199 |
gr.Blocks: The Gradio interface
|
| 200 |
"""
|
| 201 |
-
|
| 202 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 203 |
|
| 204 |
Upload a CSV file or enter a single SMILES string to predict PROTAC substructures.
|
| 205 |
|
|
@@ -208,35 +223,49 @@ Warheads and E3 ligase ligands connections to the linker are marked with dummy a
|
|
| 208 |
- Warhead: `[*:1]`
|
| 209 |
- E3 Ligase ligand: `[*:2]`
|
| 210 |
|
| 211 |
-
|
| 212 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 213 |
|
|
|
|
| 214 |
# Model selection section - common to both tabs
|
| 215 |
-
|
|
|
|
| 216 |
|
| 217 |
You can choose which model to use for splitting PROTAC molecules:
|
| 218 |
|
| 219 |
- **XGBoost model** (default): Fast graph-based edge classification model
|
| 220 |
-
- **Transformer model**:
|
| 221 |
- If both are selected, the Transformer model will be used first, then if it fails, the XGBoost model will be used.
|
| 222 |
- If no model is selected, splitting will be done using graph-based heuristics, with no AI model involved.
|
| 223 |
|
| 224 |
-
For fast splitting, we reccommend using the XGBoost model only, which is fast and efficient for most cases.
|
| 225 |
-
|
| 226 |
-
|
|
|
|
| 227 |
with gr.Row():
|
| 228 |
with gr.Column(scale=2):
|
| 229 |
with gr.Row():
|
| 230 |
use_xgboost = gr.Checkbox(label="Use XGBoost model", value=True)
|
| 231 |
use_transformer = gr.Checkbox(label="Use Transformer model", value=False)
|
| 232 |
|
|
|
|
| 233 |
# Performance configuration section
|
| 234 |
-
|
|
|
|
| 235 |
|
| 236 |
Change the following parameters to optimize performance based on your machine's capabilities. Particularly useful when processing large CSV files or when using the Transformer model.
|
| 237 |
For single SMILES processing, the default values should work well in most cases.
|
| 238 |
-
"""
|
| 239 |
-
gr.Markdown(performance_configs)
|
| 240 |
with gr.Column(scale=1):
|
| 241 |
# Add a num_proc input
|
| 242 |
with gr.Row():
|
|
@@ -285,32 +314,68 @@ For single SMILES processing, the default values should work well in most cases.
|
|
| 285 |
outputs=[batch_size]
|
| 286 |
)
|
| 287 |
|
|
|
|
| 288 |
# Single SMILES Input tab
|
| 289 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 290 |
with gr.Tab("Single SMILES Input"):
|
| 291 |
# Input area
|
| 292 |
# NOTE: A challenging SMILES to test the app is: CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O
|
| 293 |
smiles_input = gr.Textbox(
|
| 294 |
-
label="Enter SMILES String",
|
| 295 |
placeholder="E.g., CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCOCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O",
|
| 296 |
-
# value="CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCOCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O",
|
| 297 |
)
|
| 298 |
-
|
| 299 |
submit_smiles = gr.Button("Process SMILES")
|
| 300 |
|
| 301 |
# Output area
|
| 302 |
-
smiles_input_image = gr.Image(label="Input PROTAC"
|
| 303 |
-
smiles_output_images = gr.Gallery(
|
| 304 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 305 |
|
| 306 |
# Connect the button click event to the processing function
|
| 307 |
submit_smiles.click(
|
| 308 |
process_single_smiles,
|
| 309 |
inputs=[smiles_input, use_transformer, use_xgboost, beam_size],
|
| 310 |
-
outputs=[smiles_input_image, smiles_output_images, smiles_output_texts]
|
| 311 |
)
|
| 312 |
|
|
|
|
| 313 |
# CSV file processing tab
|
|
|
|
| 314 |
with gr.Tab("Upload CSV"):
|
| 315 |
# File upload area
|
| 316 |
file_input = gr.File(label="Upload CSV File")
|
|
@@ -331,13 +396,12 @@ For single SMILES processing, the default values should work well in most cases.
|
|
| 331 |
outputs=[download_output]
|
| 332 |
)
|
| 333 |
|
| 334 |
-
|
| 335 |
|
| 336 |
-
- `
|
| 337 |
- `default_pred_n0`: The predicted SMILES strings for the splits
|
| 338 |
- `model_name`: The model used for the prediction
|
| 339 |
-
"""
|
| 340 |
-
gr.Markdown(csv_notes)
|
| 341 |
|
| 342 |
return demo
|
| 343 |
|
|
|
|
| 79 |
raise gr.Error(f"An error occurred while processing the input SMILES: {exception_message}", duration=10)
|
| 80 |
|
| 81 |
valid_molecules = []
|
| 82 |
+
pred_key = f"default_pred_n0"
|
| 83 |
valid_molecules.append(results[pred_key])
|
| 84 |
|
| 85 |
# Generate images and corresponding SMILES text
|
| 86 |
images = []
|
|
|
|
| 87 |
input_mol = Chem.MolFromSmiles(protac_smiles)
|
| 88 |
|
| 89 |
if input_mol is not None:
|
| 90 |
input_img = Draw.MolToImage(input_mol, legend="", size=(1000, 200))
|
| 91 |
else:
|
| 92 |
+
input_img = Image.new("RGB", (1000, 1000))
|
| 93 |
|
| 94 |
+
smiles_texts = []
|
| 95 |
splits = {}
|
| 96 |
for smiles in results[pred_key].split("."):
|
| 97 |
mol = Chem.MolFromSmiles(smiles)
|
| 98 |
if mol:
|
| 99 |
if "[*:1]" in smiles and "[*:2]" in smiles:
|
| 100 |
legend = "Linker"
|
| 101 |
+
splits["linker"] = smiles
|
| 102 |
elif "[*:1]" in smiles:
|
| 103 |
legend = "Warhead"
|
| 104 |
+
splits["poi"] = smiles
|
| 105 |
elif "[*:2]" in smiles:
|
| 106 |
legend = "E3 Ligase Ligand"
|
| 107 |
+
splits["e3"] = smiles
|
| 108 |
|
| 109 |
img = Draw.MolToImage(mol, legend="", size=(1000, 1000))
|
| 110 |
images.append(img)
|
| 111 |
+
# smiles_texts.append(f"{legend}: {smiles}")
|
| 112 |
+
smiles_texts.append(smiles)
|
| 113 |
+
|
| 114 |
+
smiles_texts = ".".join(smiles_texts)
|
| 115 |
+
smiles_df = pd.DataFrame({
|
| 116 |
+
"Substructure": ["E3 Ligase Ligand", "Linker", "Warhead"],
|
| 117 |
+
"SMILES": [splits.get("e3", ""), splits.get("linker", ""), splits.get("poi", "")]
|
| 118 |
+
})
|
| 119 |
+
|
| 120 |
+
# use_svg = False
|
| 121 |
+
# input_img = get_mapped_protac_img(
|
| 122 |
+
# protac_smiles=protac_smiles,
|
| 123 |
+
# poi_smiles=splits.get('poi', ''),
|
| 124 |
+
# linker_smiles=splits.get('linker', ''),
|
| 125 |
+
# e3_smiles=splits.get('e3', ''),
|
| 126 |
+
# w=1000,
|
| 127 |
+
# h=500,
|
| 128 |
+
# legend=None,
|
| 129 |
+
# useSVG=use_svg,
|
| 130 |
+
# )
|
| 131 |
+
#
|
| 132 |
+
# if use_svg:
|
| 133 |
+
# input_img = save_svg_to_tempfile(input_img)
|
| 134 |
+
# logging.debug(f"Returning processed image path: {input_img}")
|
| 135 |
+
|
| 136 |
+
return input_img, list(images), smiles_texts, smiles_df
|
| 137 |
|
| 138 |
def process_csv(
|
| 139 |
file: gr.File,
|
|
|
|
| 204 |
Returns:
|
| 205 |
gr.Blocks: The Gradio interface
|
| 206 |
"""
|
| 207 |
+
css = """
|
| 208 |
+
h1 {
|
| 209 |
+
text-align: center;
|
| 210 |
+
display:block;
|
| 211 |
+
}
|
| 212 |
+
"""
|
| 213 |
+
with gr.Blocks(css=css) as demo:
|
| 214 |
+
# ----------------------------------------------------------------------
|
| 215 |
+
# Application title and description
|
| 216 |
+
# ----------------------------------------------------------------------
|
| 217 |
+
gr.Markdown("""# ✂️ PROTAC-Splitter Web Application ✂️
|
| 218 |
|
| 219 |
Upload a CSV file or enter a single SMILES string to predict PROTAC substructures.
|
| 220 |
|
|
|
|
| 223 |
- Warhead: `[*:1]`
|
| 224 |
- E3 Ligase ligand: `[*:2]`
|
| 225 |
|
| 226 |
+
If you find this tool useful, please consider citing the following paper:
|
| 227 |
+
|
| 228 |
+
```
|
| 229 |
+
@article{ribes2025protac,
|
| 230 |
+
title={PROTAC-Splitter...},
|
| 231 |
+
author={Ribes, Stefano and others},
|
| 232 |
+
journal={Journal of...},
|
| 233 |
+
year={2025},
|
| 234 |
+
publisher={...}
|
| 235 |
+
}
|
| 236 |
+
```
|
| 237 |
+
""")
|
| 238 |
|
| 239 |
+
# ----------------------------------------------------------------------
|
| 240 |
# Model selection section - common to both tabs
|
| 241 |
+
# ----------------------------------------------------------------------
|
| 242 |
+
gr.Markdown("""## Model Selection
|
| 243 |
|
| 244 |
You can choose which model to use for splitting PROTAC molecules:
|
| 245 |
|
| 246 |
- **XGBoost model** (default): Fast graph-based edge classification model
|
| 247 |
+
- **Transformer model**: Often more accurate, but slower deep learning model
|
| 248 |
- If both are selected, the Transformer model will be used first, then if it fails, the XGBoost model will be used.
|
| 249 |
- If no model is selected, splitting will be done using graph-based heuristics, with no AI model involved.
|
| 250 |
|
| 251 |
+
For fast splitting, we reccommend using the XGBoost model only, which is fast and efficient for most cases.
|
| 252 |
+
|
| 253 |
+
The Transformer model runs on CPU, so it is slower, especially for processing large CSV files.
|
| 254 |
+
""")
|
| 255 |
with gr.Row():
|
| 256 |
with gr.Column(scale=2):
|
| 257 |
with gr.Row():
|
| 258 |
use_xgboost = gr.Checkbox(label="Use XGBoost model", value=True)
|
| 259 |
use_transformer = gr.Checkbox(label="Use Transformer model", value=False)
|
| 260 |
|
| 261 |
+
# ----------------------------------------------------------------------
|
| 262 |
# Performance configuration section
|
| 263 |
+
# ----------------------------------------------------------------------
|
| 264 |
+
gr.Markdown("""### Performance Configurations
|
| 265 |
|
| 266 |
Change the following parameters to optimize performance based on your machine's capabilities. Particularly useful when processing large CSV files or when using the Transformer model.
|
| 267 |
For single SMILES processing, the default values should work well in most cases.
|
| 268 |
+
""")
|
|
|
|
| 269 |
with gr.Column(scale=1):
|
| 270 |
# Add a num_proc input
|
| 271 |
with gr.Row():
|
|
|
|
| 314 |
outputs=[batch_size]
|
| 315 |
)
|
| 316 |
|
| 317 |
+
# ----------------------------------------------------------------------
|
| 318 |
# Single SMILES Input tab
|
| 319 |
+
# ----------------------------------------------------------------------
|
| 320 |
+
gr.Markdown("""## Specify Inputs
|
| 321 |
+
|
| 322 |
+
**Disclaimer**: The input SMILES is checked for validity before processing. There is no check on whether the SMILES is a PROTAC-like molecule or not.
|
| 323 |
+
For example, attempting to split the SMILES `c1ccccc` (benzene) with the XGBoost or heuristic strategies will return an error, as ring bonds are ignored for splitting.
|
| 324 |
+
On the other end, `c1ccccc1CCC1CCCC1` will return a plausible split, even though it is not a PROTAC molecule.
|
| 325 |
+
""")
|
| 326 |
with gr.Tab("Single SMILES Input"):
|
| 327 |
# Input area
|
| 328 |
# NOTE: A challenging SMILES to test the app is: CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O
|
| 329 |
smiles_input = gr.Textbox(
|
| 330 |
+
label="Enter SMILES String",
|
| 331 |
placeholder="E.g., CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCOCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O",
|
|
|
|
| 332 |
)
|
|
|
|
| 333 |
submit_smiles = gr.Button("Process SMILES")
|
| 334 |
|
| 335 |
# Output area
|
| 336 |
+
smiles_input_image = gr.Image(label="Input PROTAC")
|
| 337 |
+
smiles_output_images = gr.Gallery(
|
| 338 |
+
label="Predicted Splits",
|
| 339 |
+
columns=3,
|
| 340 |
+
)
|
| 341 |
+
smiles_output_df = gr.DataFrame(
|
| 342 |
+
label="Substructure Predictions",
|
| 343 |
+
interactive=False,
|
| 344 |
+
headers=["Substructure", "SMILES"],
|
| 345 |
+
show_copy_button=True,
|
| 346 |
+
)
|
| 347 |
+
smiles_output_texts = gr.Textbox(
|
| 348 |
+
label="SMILES of the Splits",
|
| 349 |
+
interactive=False,
|
| 350 |
+
lines=1,
|
| 351 |
+
show_copy_button=True,
|
| 352 |
+
)
|
| 353 |
+
|
| 354 |
+
# Add this Examples component
|
| 355 |
+
gr.Examples(
|
| 356 |
+
examples=[
|
| 357 |
+
# SMILES, use_transformer, use_xgboost, beam_size
|
| 358 |
+
["CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OCCOCCOCCOCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O", False, True, 5],
|
| 359 |
+
["Cc1nnc2n1-c1sc(C#Cc3cnn(-c4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c3)c(Cc3ccccc3)c1COC2", False, True, 5],
|
| 360 |
+
["c1ccccc1CCC1CCCC1", False, False, 5],
|
| 361 |
+
["O=C(NCCOCCOCCN1CCCC1)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O", False, False, 5],
|
| 362 |
+
],
|
| 363 |
+
inputs=[smiles_input, use_transformer, use_xgboost, beam_size],
|
| 364 |
+
outputs=[smiles_input_image, smiles_output_images, smiles_output_texts, smiles_output_df],
|
| 365 |
+
fn=process_single_smiles,
|
| 366 |
+
cache_examples=True,
|
| 367 |
+
)
|
| 368 |
|
| 369 |
# Connect the button click event to the processing function
|
| 370 |
submit_smiles.click(
|
| 371 |
process_single_smiles,
|
| 372 |
inputs=[smiles_input, use_transformer, use_xgboost, beam_size],
|
| 373 |
+
outputs=[smiles_input_image, smiles_output_images, smiles_output_texts, smiles_output_df]
|
| 374 |
)
|
| 375 |
|
| 376 |
+
# ----------------------------------------------------------------------
|
| 377 |
# CSV file processing tab
|
| 378 |
+
# ----------------------------------------------------------------------
|
| 379 |
with gr.Tab("Upload CSV"):
|
| 380 |
# File upload area
|
| 381 |
file_input = gr.File(label="Upload CSV File")
|
|
|
|
| 396 |
outputs=[download_output]
|
| 397 |
)
|
| 398 |
|
| 399 |
+
gr.Markdown(f"""**Note:** The output CSV will contain the following columns:
|
| 400 |
|
| 401 |
+
- `smiles_column`: The original PROTAC SMILES string
|
| 402 |
- `default_pred_n0`: The predicted SMILES strings for the splits
|
| 403 |
- `model_name`: The model used for the prediction
|
| 404 |
+
""")
|
|
|
|
| 405 |
|
| 406 |
return demo
|
| 407 |
|