File size: 49,148 Bytes
005ad92 2171cab 005ad92 74acc1b dafa47a 74acc1b 347cff1 d33329a 347cff1 d33329a 9c44c5b 347cff1 053a1c9 3b7f36c 54a82d6 37f60bf 54a82d6 37f60bf 54a82d6 37f60bf 3b7f36c c11b4ec 005ad92 54a82d6 005ad92 3b7f36c d33329a 3b7f36c c8e574b d33329a 3b7f36c c8e574b d33329a 3b7f36c a26b7e6 f6b0807 a26b7e6 108b9bc a26b7e6 7ffe13c a26b7e6 f685541 005ad92 3b7f36c 7f77ca2 90d06f0 3b7f36c 41b73a8 3b7f36c 005ad92 55b7cf1 487a9d5 60e7cd3 3b7f36c 60e7cd3 55b7cf1 c11b4ec 487a9d5 f685541 3b7f36c 861a5a5 60e7cd3 861a5a5 f685541 861a5a5 60e7cd3 861a5a5 60e7cd3 861a5a5 487a9d5 60e7cd3 487a9d5 f685541 487a9d5 60e7cd3 861a5a5 053a1c9 861a5a5 412bfc6 fb99284 3b7f36c d5d763c 861a5a5 f685541 3b7f36c f685541 3b7f36c f685541 a9c1329 74acc1b 861a5a5 f685541 861a5a5 60e7cd3 861a5a5 f685541 861a5a5 60e7cd3 861a5a5 487a9d5 861a5a5 7f77ca2 74acc1b 3b7f36c 861a5a5 60e7cd3 487a9d5 025faf2 a76ae75 025faf2 41b73a8 c11b4ec 347cff1 9c44c5b 347cff1 9c44c5b 347cff1 c11b4ec f9ba676 d33329a f9ba676 c11b4ec 55b7cf1 c11b4ec 005ad92 c11b4ec 005ad92 861a5a5 bd5fb72 861a5a5 bd5fb72 861a5a5 412bfc6 861a5a5 005ad92 48eb4c1 55b7cf1 412bfc6 bd5fb72 412bfc6 55b7cf1 412bfc6 c11b4ec 412bfc6 c11b4ec 412bfc6 bd5fb72 412bfc6 bd5fb72 c11b4ec 412bfc6 c11b4ec 412bfc6 c11b4ec 412bfc6 c11b4ec 7b3dbe4 fb99284 7b3dbe4 dafa47a 74acc1b 3b7f36c a9c1329 74acc1b 41b73a8 a9c1329 74acc1b dafa47a 74acc1b dafa47a 74acc1b 5b6026f dafa47a 108b9bc dafa47a 74acc1b dafa47a 3b7f36c dafa47a 74acc1b 3b7f36c 41b73a8 3b7f36c 108b9bc 3b7f36c 41b73a8 3b7f36c 41b73a8 3b7f36c 41b73a8 3b7f36c 108b9bc 3b7f36c a9c1329 3b7f36c 41b73a8 108b9bc 41b73a8 a9c1329 41b73a8 3b7f36c a9c1329 3b7f36c a26b7e6 3b7f36c a9c1329 3b7f36c a9c1329 3b7f36c a9c1329 3b7f36c a9c1329 3b7f36c 25ef50a a9c1329 3b7f36c a9c1329 3b7f36c a26b7e6 3b7f36c 108b9bc 3b7f36c 108b9bc 3b7f36c a9c1329 3b7f36c 108b9bc 3b7f36c 41b73a8 3b7f36c 89ec0e5 3b7f36c 41b73a8 3b7f36c 41b73a8 3b7f36c 108b9bc 3b7f36c a9c1329 3b7f36c a9c1329 41b73a8 108b9bc 41b73a8 a9c1329 41b73a8 3b7f36c a9c1329 3b7f36c 8ba861b 3b7f36c a26b7e6 6a4a1e6 a26b7e6 3b7f36c 6a4a1e6 3b7f36c a9c1329 3b7f36c a9c1329 3b7f36c a9c1329 3b7f36c a9c1329 c8e574b 3b7f36c a9c1329 3b7f36c 74acc1b | 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601 602 603 604 605 606 607 608 609 610 611 612 613 614 615 616 617 618 619 620 621 622 623 624 625 626 627 628 629 630 631 632 633 634 635 636 637 638 639 640 641 642 643 644 645 646 647 648 649 650 651 652 653 654 655 656 657 658 659 660 661 662 663 664 665 666 667 668 669 670 671 672 673 674 675 676 677 678 679 680 681 682 683 684 685 686 687 688 689 690 691 692 693 694 695 696 697 698 699 700 701 702 703 704 705 706 707 708 709 710 711 712 713 714 715 716 717 718 719 720 721 722 723 724 725 726 727 728 729 730 731 732 733 734 735 736 737 738 739 740 741 742 743 744 745 746 747 748 749 750 751 752 753 754 755 756 757 758 759 760 761 762 763 764 765 766 767 768 769 770 771 772 773 774 775 776 777 778 779 780 781 782 783 784 785 786 787 788 789 790 791 792 793 794 795 796 797 798 799 800 801 802 803 804 805 806 807 808 809 810 811 812 813 814 815 816 817 818 819 820 821 822 823 824 825 826 827 828 829 830 831 832 833 834 835 836 837 838 839 840 841 842 843 844 845 846 847 848 849 850 851 852 853 854 855 856 857 858 859 860 861 862 863 864 865 866 867 868 869 870 871 872 873 874 875 876 877 878 879 880 881 882 883 884 885 886 887 888 889 890 891 892 893 894 895 896 897 898 899 900 901 902 903 904 905 906 907 908 909 910 911 912 913 914 915 916 917 918 919 920 921 922 923 924 925 926 927 928 929 930 931 932 933 934 935 936 937 938 939 940 941 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1002 1003 1004 1005 1006 1007 1008 1009 1010 1011 1012 1013 1014 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 1026 1027 1028 1029 1030 1031 1032 1033 1034 1035 1036 1037 1038 1039 1040 1041 1042 1043 1044 1045 1046 1047 1048 1049 1050 1051 1052 1053 1054 1055 1056 1057 1058 1059 1060 1061 1062 1063 1064 1065 1066 1067 1068 1069 1070 1071 1072 1073 1074 1075 1076 1077 1078 1079 1080 1081 1082 1083 1084 1085 1086 1087 1088 1089 1090 1091 1092 1093 1094 1095 1096 1097 1098 1099 1100 1101 1102 1103 1104 1105 1106 1107 1108 1109 1110 1111 1112 1113 1114 1115 1116 1117 1118 1119 1120 1121 1122 1123 1124 1125 1126 1127 1128 1129 1130 1131 1132 1133 1134 1135 1136 1137 1138 1139 1140 1141 1142 1143 1144 1145 1146 1147 1148 1149 1150 1151 1152 1153 1154 1155 1156 1157 1158 1159 1160 1161 1162 1163 1164 1165 1166 1167 1168 1169 1170 | import sys,os,glob,re,string
from collections import Counter
from operator import itemgetter
import nltk
import pandas as pd
import numpy as np
import pubchempy as pcp
import cirpy
import chemicals
import bs4
import urllib
import requests
import json
ORGANIC_ATOM_SET = {5, 6, 7, 8, 9, 15, 16, 17, 35, 53}
METAL_ATOM_SET = set([3,4,11,12,13] + list(range(19,31+1)) + list(range(37,50+1)) + list(range(55,84+1)) + list(range(87,114+1)) + [116])
with open('data/ceramics_list.txt', 'r') as fp:
lines = fp.readlines()
CERAMICS_SET = {line.strip() for line in lines}
with open('data/salt_list.txt', 'r') as fp:
lines = fp.readlines()
SALT_SET = {line.strip() for line in lines}
ERROR_CODES = {0:None, 1:'Structure could not be determined from the identifier', 2:'Invalid SMILES code', 3:'Invalid CAS number', 4:'Invalid identifier type selected'}
## not sure if this will be possible on pythonanywhere; use this flag to disable related code blocks
try_dsstox = True
if try_dsstox:
import selenium
import selenium.webdriver
from selenium.webdriver.chrome.options import Options
from selenium.webdriver.chrome.service import Service
## NOTE this does not seem very robust
uname = os.uname()
if uname.sysname == 'Darwin':
# mac
import chromedriver_binary
driver_exe = chromedriver_binary.chromedriver_filename
elif uname.sysname == 'Linux':
# pythonanywhere
driver_exe = '/usr/local/bin/chromedriver'
else:
# fallback...
import chromedriver_binary
driver_exe = chromedriver_binary.chromedriver_filename
from io import BytesIO
from PIL import ImageOps
import base64
import rdkit
from rdkit.Chem import AllChem as Chem
from rdkit.Chem import Descriptors,Draw,Crippen
## add custom chemical definitions (i.e., to correct confusion between methane and carbon)
db = chemicals.identifiers.get_pubchem_db()
db.load('data/custom_chemicals_db.tsv')
## load experimental and predicted properties
#dfmp_expt = pd.read_excel('PHYSPROP_MP_data.xlsx')
dfmp_expt = pd.read_csv('data/PHYSPROP_MP_data.tsv', sep='\t')
#dfmp_pred = pd.read_excel('DSSTOX_MP_pred_data.xlsx')
#df_pred = pd.read_excel('Comptox_pred_data.xlsx')
df_pred = pd.read_csv('data/Comptox_pred_data.tsv', sep='\t')
## OPERA melting point model
import dill as pickle
import sklearn
import sklearn.neighbors
import sklearn.metrics
import padelpy
from functions import weight_func
class opera_data_mp():
n_neighbors = 5
#weight_factor = 5e-3
desc_list = ['SHBd', 'nN', 'maxHBd', 'ATSC1v', 'AATS1i', 'TopoPSA', 'nT6Ring', 'nHBDon', 'WTPT-5', 'minHBd', 'nHBint2', 'IC0', 'MLFER_S', 'MLFER_BO', 'WTPT-3']
with open('mp/model-opera-knn.pkl', 'rb') as fp:
knn_all = pickle.load(fp)
knn_all.weights = weight_func # fix weird problem on pythonanywhere...
with open('mp/model-opera-scalerX.pkl', 'rb') as fp:
scaler_X = pickle.load(fp)
with open('mp/model-opera-scalerY.pkl', 'rb') as fp:
scaler_y = pickle.load(fp)
my_opera_data_mp = opera_data_mp()
def ResolveChemical(chemName, IDtype, debug=False, get_properties=['logp','rho','mp']):
#LogP_func = Crippen.MolLogP
LogP_func = getLogP
# remove excess whitespace
chemName = chemName.strip()
name = None
smiles = None
cas = None
Mw = None
LogP = None
rho = None
mp = None
im64 = None
mp_origin = None
rho_origin = None
LogP_origin = None
error = 0
if IDtype == 'CAS':
cas = chemName
if not is_cas(cas):
error = 3 #invalid cas
return (name, cas, smiles, Mw, LogP, rho, mp, im64, error)
smiles = cas2smiles(cas)
if smiles:
name = cas2name(cas)
if 'rho' in get_properties:
rho, rho_origin = string2density(cas)
if 'mp' in get_properties:
mp, mp_origin = mol2mp(cas, name, smiles)
if 'rho' in get_properties and pd.isna(rho) and name:
rho, rho_origin = string2density(name)
try:
mol = Chem.MolFromSmiles(smiles)
except:
error = 2 #invalid smiles
if mol:
Mw = Descriptors.MolWt(mol)
if 'logp' in get_properties:
LogP, LogP_origin = LogP_func(cas, mol)
im = ImageFromSmiles(smiles)
im64 = Imageto64(im)
else:
error = 2 #invalid smiles
else:
error = 1 # no smiles found
elif IDtype == 'SMILES':
smiles = chemName
try:
mol = Chem.MolFromSmiles(smiles)
except:
error = 2
if mol:
Mw = Descriptors.MolWt(mol)
if 'logp' in get_properties:
LogP, LogP_origin = LogP_func(cas, mol)
im = ImageFromSmiles(smiles)
im64 = Imageto64(im)
else:
error = 2
# if SMILES is not valid, skip the other stuff
if not error:
name = smiles2name(smiles)
if name:
cas = name2cas(name)
if 'rho' in get_properties:
rho, rho_origin = string2density(name)
if 'rho' in get_properties and pd.isna(rho) and cas:
rho, rho_origin = string2density(cas)
if 'mp' in get_properties:
mp, mp_origin = mol2mp(cas, name, smiles)
elif IDtype == 'common':
name = chemName
name, name_origin = name2iupac(name)
smiles = name2smiles(name)
cas = name2cas(name)
if not smiles:
smiles = cas2smiles(cas)
if 'rho' in get_properties and pd.isna(rho) and cas:
rho, rho_origin = string2density(cas)
if 'rho' in get_properties and pd.isna(rho):
rho, rho_origin = string2density(name)
if 'rho' in get_properties and pd.isna(rho):
# try this because sometimes iupac names don't work
rho, rho_origin = string2density(chemName)
if smiles:
if 'mp' in get_properties:
mp, mp_origin = mol2mp(cas, name, smiles)
try:
mol = Chem.MolFromSmiles(smiles)
except:
error = 2
if mol:
Mw = Descriptors.MolWt(mol)
if 'logp' in get_properties:
LogP, LogP_origin = LogP_func(cas, mol)
im = ImageFromSmiles(smiles)
im64 = Imageto64(im)
else:
error = 2
else:
error = 1
else:
## should never be here
name = None
smiles = None
cas = None
Mw = None
LogP = None
rho = None
mp = None
im64 = None
error = 4 # invalid IDtype selection, probably not possible
# if we couldn't find a name or CAS (but do have SMILES)
if not error:
if not name:
name = 'Not found'
if not cas:
cas = 'Not found'
if mp is not None:
mp = float(mp)
if debug:
return (name, cas, smiles, Mw, LogP, LogP_origin, rho, rho_origin, mp, mp_origin, im64, error)
else:
return (name, cas, smiles, Mw, LogP, rho, mp, im64, error)
def CeramicOrMetal(smiles,mp):
# metals/ceramics logic
is_ceramic = False
mol = Chem.MolFromSmiles(smiles)
atom_num_list = [a.GetAtomicNum() for a in mol.GetAtoms()]
is_metal = set(atom_num_list) <= METAL_ATOM_SET
if not is_metal:
# check composition against list of ceramics/salts
elements = ','.join(sorted(set([a.GetSymbol() for a in mol.GetAtoms()])))
if elements in CERAMICS_SET:
is_ceramic = True
if elements in SALT_SET:
is_ceramic = True
if not is_ceramic:
# get number of carbon-carbon bonds
num_CC_bonds = sum([1 if b.GetBeginAtom().GetAtomicNum() == 6 and b.GetEndAtom().GetAtomicNum() == 6 else 0 for b in mol.GetBonds()])
if not num_CC_bonds and (mp is not None) and mp > 700.:
# if not a metal, no C-C bonds, and mp > 700 (sodium chloride has mp ~ 800), assume ceramic...
is_ceramic = True
return is_metal, is_ceramic
#Generates an image of the molecule represented by the SMILES code given.
#Returns None if the image cannot be generated. From https://github.com/ronaldo-prata/flask-test/blob/master/functions.py
def ImageFromSmiles(smiles):
image = None
if type(smiles) is str:
try:
if smiles == 'C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Mn+2]':
mol = next(Chem.SDMolSupplier('data/MnPC.sdf', removeHs=False))
image = Draw.MolToImage(mol, size=(350, 350))
else:
image = Draw.MolToImage(Chem.MolFromSmiles(smiles), size=(350, 350))
except ValueError:
pass
return image
#Trims the image into a box, removing any excess white background.
#The box cannot be smaller than 400x400. This is done due to the difference in quality in the images generated by MolToImage,
# if the size is too small (300x300), big molecules are too low quality, but if the size is too big (1000*1000), small molecules appear zoomed out.
def wTrim(img):
bbox = ImageOps.invert(img).getbbox()
crop = (bbox[0], bbox[1], bbox[2], bbox[3])
return img.crop(crop)
#Converts a PIL image into its base64 representation.
def Imageto64(img):
img = wTrim(img)
buf = BytesIO()
img.save(buf, format="PNG")
pngImageB64String = "data:image/png;base64,"
pngImageB64String += base64.b64encode(buf.getvalue()).decode("utf-8")
return pngImageB64String
# function to convert SMILES to name
def smiles2name(smiles):
name = None
# first try chemicals package
try:
cm = chemicals.search_chemical(smiles)
if cm.iupac_name:
name = cm.iupac_name
elif cm.common_name:
name = cm.common_name
except:
name = None
# then try pubchem for compounds
if not name:
try:
compounds = pcp.get_compounds(smiles, namespace='smiles')
c = compounds[0]
name = c.iupac_name
if not name:
# have seen empty iupac_name before, try synonyms if this happens
name = c.synonyms[0]
except:
name = None
# next try cirpy
if not name:
try:
name = cirpy.resolve(smiles, 'iupac_name')
except:
name = None
if type(name) is list:
name = name[0]
# finally try it as a pubchem substance
if not name:
try:
compounds = pcp.get_substances(smiles, namespace='smiles')
# sometimes there are multiple substances, and multiple synonyms per substance
allsyns = [syn for c in compounds for syn in c.iupac_name if cas not in syn]
# choose the most common synonym
fd = nltk.FreqDist(allsyns)
name = fd.most_common(1)[0][0]
except:
name = None
return name
# function to convert CAS to SMILES
def cas2smiles(cas):
smiles = None
# first try chemicals package
try:
cm = chemicals.search_chemical(cas)
smiles = cm.smiles
except:
smiles = None
# then try pubchem for compounds
if not smiles:
try:
compounds = pcp.get_compounds(cas, namespace='name')
c = compounds[0]
smiles = c.isomeric_smiles
except:
smiles = None
# next try cirpy
if not smiles:
try:
smiles = cirpy.resolve(cas, 'smiles')
except:
smiles = None
if type(smiles) is list:
smiles = smiles[0]
# finally try it as a pubchem substance
if not smiles:
try:
compounds = pcp.get_substances(cas, namespace='name')
# sometimes there are multiple substances, and multiple synonyms per substance
allsyns = [syn for c in compounds for syn in c.isomeric_smiles if cas not in syn]
# choose the most common synonym
fd = nltk.FreqDist(allsyns)
smiles = fd.most_common(1)[0][0]
except:
smiles = None
return smiles
# function to convert cas to name
def cas2name(cas):
name = None
#if not is_cas(cas):
# name = 'INVALID CAS'
# first try chemicals package
try:
cm = chemicals.search_chemical(cas)
if cm.iupac_name:
name = cm.iupac_name
elif cm.common_name:
name = cm.common_name
except:
name = None
# then try cirpy
if not name:
try:
name = cirpy.resolve(cas, 'iupac_name')
except:
name = None
if type(name) is list:
name = name[0]
# next try pubchem for compounds
if not name:
try:
compounds = pcp.get_compounds(cas, namespace='name')
c = compounds[0]
name = c.iupac_name
if not name:
# have seen empty iupac_name before, try synonyms if this happens
name = c.synonyms[0]
except:
name = None
return name
# function to convert chemical name to iupac name
def name2iupac(string):
name = None
origin = None
# try chemicals package
try:
cm = chemicals.search_chemical(string)
if cm.iupac_name:
name = cm.iupac_name
elif cm.common_name:
name = cm.common_name
origin = 'chemicals'
except:
name = None
origin = None
# try pubchem for compounds
if not name:
try:
compounds = pcp.get_compounds(string, namespace='name')
c = compounds[0]
name = c.iupac_name
if not name:
# have seen empty iupac_name before, try synonyms if this happens
name = c.synonyms[0]
origin = 'PubChem'
except:
name = None
origin = None
# next try cirpy
if not name:
try:
#name = cirpy.resolve(string, 'names')
name = cirpy.resolve(string, 'iupac_name')
if name: origin = 'CIRPY'
except:
name = None
origin = None
if type(name) is list:
name = name[0]
# now try it as a pubchem substance
if not name:
try:
compounds = pcp.get_substances(string, namespace='name')
# sometimes there are multiple substances, and multiple synonyms per substance
allsyns = [syn for c in compounds for syn in c.synonyms if cas not in syn]
# choose the most common synonym
fd = nltk.FreqDist(allsyns)
name = fd.most_common(1)[0][0]
origin = 'PubChem/substance'
except:
name = None
origin = None
# strip all spaces and try again...
if not name:
string_strip = re.sub(' ','',string)
# first try pubchem for compounds
try:
compounds = pcp.get_compounds(string_strip, namespace='name')
c = compounds[0]
name = c.iupac_name
if not name:
# have seen empty iupac_name before, try synonyms if this happens
name = c.synonyms[0]
origin = 'PubChem'
except:
name = None
origin = None
# next try cirpy
if not name:
try:
#name = cirpy.resolve(string_strip, 'names')
name = cirpy.resolve(string, 'iupac_name')
if name: origin = 'CIRPY'
except:
name = None
origin = None
if type(name) is list:
name = name[0]
return name, origin
# function to convert name to cas
def name2cas(name):
cas = None
# try chemicals package
try:
cm = chemicals.search_chemical(name)
cas = cm.CASs
except:
cas = None
# then try cirpy
if not cas:
try:
cas = cirpy.resolve(name, 'cas')
except:
cas = None
if type(cas) is list:
cas.sort(key=lambda s: np.array(s.split('-'), dtype=int).sum())
cas = cas[0]
# next try pubchem for compounds
if not cas:
try:
compounds = pcp.get_compounds(name, namespace='name')
c = compounds[0]
syns = c.synonyms
possible_cas = [syn for syn in syns if is_cas(syn)]
# if multiple choose option with smallest sum of digits
possible_cas.sort(key=lambda s: np.array(s.split('-'), dtype=int).sum())
cas = possible_cas[0]
except:
cas = None
return cas
# function to convert name to SMILES
def name2smiles(name):
smiles = None
# first try chemicals package
try:
cm = chemicals.search_chemical(name)
smiles = cm.smiles
except:
smiles = None
# then try pubchem for compounds
if not smiles:
try:
compounds = pcp.get_compounds(name, namespace='name')
c = compounds[0]
smiles = c.isomeric_smiles
except:
smiles = None
# next try cirpy
if not smiles:
try:
smiles = cirpy.resolve(name, 'smiles')
except:
smiles = None
if type(smiles) is list:
smiles = smiles[0]
# then try it as a pubchem substance
if not smiles:
try:
compounds = pcp.get_substances(name, namespace='name')
# sometimes there are multiple substances, and multiple synonyms per substance
allsyns = [syn for c in compounds for syn in c.isomeric_smiles if name not in syn]
# choose the most common synonym
fd = nltk.FreqDist(allsyns)
smiles = fd.most_common(1)[0][0]
except:
smiles = None
# finally try to resolve SMILES from name using OPSIN
#if not smiles:
# try:
# with open('opsin.tmp.1', 'w') as fp:
# fp.write(name)
# os.system('java -jar /Users/robert.elder/software/utils/opsin-2.4.0-jar-with-dependencies.jar -osmi opsin.tmp.1 opsin.tmp.2 &> /dev/null')
# with open('opsin.tmp.2') as fp:
# smiles = fp.read()
# if smiles == '\n':
# smiles = None
# smiles = smiles.strip() #remove trailing newline
# except KeyboardInterrupt:
# raise
# except:
# smiles = None
return smiles
def check_cas(cas):
n1,n2,n3 = cas.split('-')
# combine and flip first 2 numbers
tmp = ''.join([n1,n2])[::-1]
# sum of number*position in string
check = sum([i*int(tmp[i-1]) for i in range(1,len(tmp)+1)])
# mod 10
check = check%10
# if these match, then it's a legit cas number
return check == int(n3)
def is_cas(cas):
try:
return check_cas(cas)
except:
return False
def string2density(name):
rho, rho_origin = None, None
# predicted values from TEST (CompTox dashboard)
if is_cas(name):
mask = df_pred['CASRN'] == name
if sum(mask):
rho = float(df_pred[mask]['DENSITY_G/CM^3_TEST_PRED'])
rho_origin = 'comptox/pred'
# try to scrape from PubChem
if pd.isna(rho):
content = None
try:
compounds = pcp.get_compounds(name, namespace='name')
c = compounds[0]
cid = c.cid
url = f'https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/compound/{cid}/JSON'
#fid = urllib.request.urlopen(url)
#webpage = fid.read().decode('utf-8')
webpage = requests.get(url).text
content = json.loads(webpage)
except:
pass
if content:
rho_list = []
for i in content['Record']['Section']:
if i['TOCHeading'] == 'Chemical and Physical Properties':
for j in i['Section']:
if j['TOCHeading'] == 'Experimental Properties':
for k in j['Section']:
if k['TOCHeading'] == 'Density':
for ii in k['Information']:
try:
rho_string = ii['Value']['StringWithMarkup'][0]['String']
rho_string = rho_string.replace('Relative density (water = 1): ', '')
#print(rho_string)
#tmp_rho = re.match('(?:\d+(?:\.\d*)?|\.\d+)',rho_string)
m = re.match(r'((?:\d+(?:\.\d*)?|\.\d+))(?:-((?:\d+(?:\.\d*)?|\.\d+)))?',rho_string)
groups = m.groups()
if len(groups):
for g in groups:
try:
tmp_rho = float(g)
rho_list.append(tmp_rho)
except:
continue
except:
continue
if rho_list:
## remove outliers using interquartile range (IQR)
rho_list = np.array(rho_list)
q75,q25 = np.percentile(rho_list,[75,25])
intr_qr = q75-q25
hi = q75+(1.5*intr_qr)
lo = q25-(1.5*intr_qr)
mask = (rho_list <= hi) & (rho_list >= lo)
rho_list = rho_list[mask]
rho = np.mean(rho_list)
rho_origin = 'pubchem'
else:
rho, rho_origin = None, None
# try to scrape from DSSTOX
if try_dsstox:
if pd.isna(rho):
dtxsid = None
try:
# try to find it via the dsstox dashboard
name_urlsafe = urllib.parse.quote(name)
url = f'https://comptox.epa.gov/dashboard/search-results?input_type=synonym_substring&inputs={name_urlsafe}'
fid = urllib.request.urlopen(url)
webpage = fid.read().decode('utf-8')
hits = re.findall(r'DTXSID[0-9]+', webpage)
if len(hits):
dtxsid = hits[0]
except:
pass
if dtxsid:
mysoup = None
url = f'https://comptox.epa.gov/dashboard/chemical/properties/{dtxsid}'
#print(url)
try:
options = Options()
options.add_argument("--headless") # runs in background instead of showing browser window
service = Service(driver_exe)
driver = selenium.webdriver.Chrome(service=service, options=options)
driver.set_page_load_timeout(15)
driver.get(url)
webpage = driver.page_source
driver.quit()
mysoup = bs4.BeautifulSoup(webpage, features='lxml')
except KeyboardInterrupt:
raise
except:
pass
if mysoup:
ifound = None
# column of property names
rows = mysoup.find_all('div', attrs={'col-id':'property'})
for i,row in enumerate(rows):
if 'Density' in row.text:
ifound = i
break
if ifound:
rows = mysoup.find_all('div', attrs={'col-id':'exavg'})
text = rows[ifound].text
value = re.sub(r' \([0-9]*\)', '', text.strip())
try:
rho = float(value)
rho_origin = 'dsstox/expt'
except:
rho, rho_origin = None, None
if pd.isna(rho):
rows = mysoup.find_all('div', attrs={'col-id':'predavg'})
text = rows[ifound].text
value = re.sub(r' \([0-9]*\)', '', text.strip())
try:
rho = float(value)
rho_origin = 'dsstox/pred'
except:
rho, rho_origin = None, None
else:
rho, rho_origin = None, None
else:
rho, rho_origin = None, None
if pd.isna(rho): rho,rho_origin = None, None
return rho, rho_origin
def return_non_duplicate_index(tuples): ##Given a list of sets return index of non_duplicate items
## from https://github.com/curieshicy/JRgui/
##step 1, create a new tuple, named "new_tuples"
new_tuples = [] ##the elements are the sets
for i in tuples:
for j in i:
new_tuples.append(set(j))
##step 2, create a dictionary storing one to one relationship between new_tuple and old_tuple
values = []
for index, item in enumerate(tuples):
if len(item) == 1:
values.append(index)
else:
for i in [index]*len(item):
values.append(i)
keys = [i for i in range(len(new_tuples))]
dict_tuples = {} ## {0:0, 1:1, 2:2, 3:3, 4:3, 5:3, 6:4, 7:4, 8:4, 9:5, 10:6, 11:7, 12:8}
for i, j in zip(keys, values):
dict_tuples[i] = j
##step 3, remove duplicates in sets terminology
remove_index = []
for index_1, item in enumerate(new_tuples): ##starting from beginning
for index_2 in range(index_1 + 1, len(new_tuples)): ##loop over the rest items
if len(item & new_tuples[index_2]) != 0:
if len(item)>len(new_tuples[index_2]):
remove_index.append(index_2) #indefoirx
elif len(item)<len(new_tuples[index_2]):
remove_index.append(index_1) #index
elif len(item)==len(new_tuples[index_2]):
remove_index.append(index_2) #index
remain_sets = set(range(len(new_tuples))).difference(set(remove_index))
##step 4, spit out final index and length
index_1 = [] ## [0,1,2,3,3,3,4,4]
index_length = []
for i in remain_sets:
index_1.append(dict_tuples[i])
counts = Counter(index_1) ##this is a dictionary return Counter({3:3, 4:2, 0:1, 1:1, 2:1}) ##index:length
list_counts = counts.most_common() ## convert to a list [(3,3), (4,2), (0,1), (1,1), (2,1)]
for i in range(len(list_counts)):
index_length.append([list_counts[i][0], list_counts[i][1]])
index_length = sorted(index_length, key = itemgetter(0))
return index_length
def search_func_groups(smiles): ##this is to search functional groups and print out them with numbers
## from https://github.com/curieshicy/JRgui/
smarts = ["[$([CX2H0](=*)=*)]", "[$([CX2H1]#[!#7])]", "[$([CX2H0]#[!#7])]", "[OX2H]-[C]=O", "[#6X3H0;!$([#6X3H0](~O)(~O)(~O))](=[#8X1])[#8X2H0]",
"[$([#6X3H0](=[OX1]));!$([#6X3](=[#8X1])~[#8X2]);R]=O", "[CH;D2;$(C-!@C)](=O)", "[OX2H;!$([OX2H]-[#6]=[O]);!$([OX2H]-a)]", "[O;H1;$(O-!@c)]",
"[#8X2H0;R;!$([#8X2H0]~[#6]=[#8])]", "[$([CX3H0](=[OX1]));!$([CX3](=[OX1])-[OX2]);!R]=O", "[OX2H0;!R;!$([OX2H0]-[#6]=[#8])]",
"[$([#7X3,#7X3+][!#8])](=[O])~[O-]", "[OX1H0;!$([OX1H0]~[#6X3]);!$([OX1H0]~[#7X3]~[#8])]", "[#7X2H0;R]", "[#7X3H1;R]", "[#7X2H1]",
"[#7X2H0;!R]","[#6X2]#[#7X1H0]","[NX3H2]", "[NX3H1;!R]", "[#7X3H0;!$([#7](~O)~O)]","[SX2H]","[#16X2H0;!R]","[#16X2H0;R]", "[R;CX3H1,cX3H1]",
"[$([R;#6X3H0]);!$([R;#6X3H0]=[#8])]","[R;CX4H2]","[R;CX4H]","[R;CX4H0]", "[CX3H2]", "[!R;CX3H1;!$([CX3H1](=O))]",
"[$([!R;#6X3H0]);!$([!R;#6X3H0]=[#8])]","[CX4H3]","[!R;CX4H2]", "[!R;CX4H]","[!R;CX4H0]","[F]","[Cl]","[Br]", "[I]"]
tuples = []
index_list = []
final_index_and_length = []
m = Chem.MolFromSmiles(str(smiles))
for index, smart in enumerate(smarts):
if m.HasSubstructMatch(Chem.MolFromSmarts(smart)) == True:
tuples.append(m.GetSubstructMatches(Chem.MolFromSmarts(smart))) ## this is atom position
index_list.append(index)
temp = return_non_duplicate_index(tuples) # [[0, 1], [1, 1], [3, 1], [4, 7], [5, 6], [6, 1], [7, 1], [8, 1], [9, 1]]
for i in temp:
final_index_and_length.append([index_list[i[0]], i[1]])
return final_index_and_length
def compute_phys_properties(smiles):
## from https://github.com/curieshicy/JRgui/
## method from: K. G. Joback, R. C. Reid, ESTIMATION OF PURE-COMPONENT PROPERTIES FROM GROUP-CONTRIBUTIONS. Chemical Engineering Communications 57, 233-243 (1987).
## this doesn't look very accurate, but it's a start
##[[], [], ...[]] in total 41 nested list inside a list
DB = [[0.0026, 0.0028, 36, 26.15, 17.78, 142.14, 136.70, 2.74E+1, -5.57E-2, 1.01E-4, -5.02E-8, 4.720, 2.661, None, None],
[0.0027, -0.0008,46, 9.20, -11.18, 79.30, 77.71, 2.45E+1, -2.71E-2, 1.11E-4, -6.78E-8, 2.322, 1.155, None, None],
[0.0020, 0.0016, 37, 27.38, 64.32, 115.51, 109.82, 7.87, 2.01E-2, -8.33E-6, 1.39E-9, 4.151, 3.302, None, None],
[0.0791, 0.0077, 89, 169.09, 155.50, -426.72,-387.87,2.41E+1, 4.27E-2, 8.04E-5, -6.87E-8, 11.051, 19.537, 1317.23,-2.578],
[0.0481, 0.0005, 82, 81.10, 53.60, -337.92,-301.95,2.45E+1, 4.02E-2, 4.02E-5, -4.52E-8, 6.959, 9.633, 483.88, -0.966],
[0.0284, 0.0028, 55, 94.97, 75.97, -164.50,-126.27,3.04E+1, -8.29E-2, 2.36E-4, -1.31E-7, None, 6.645, None, None],
[0.0379, 0.0030, 82, 72.24, 36.90, -162.03,-143.48,3.09E+1, -3.36E-2, 1.60E-4, -9.88E-8, 3.197, 9.093, 740.92, -1.713],
[0.0741, 0.0112, 28, 92.88, 44.45, -208.04,-189.20,2.57E+1, -6.91E-2, 1.77E-4, -9.88E-8, 2.406, 16.826, 2173.72,-5.057],
[0.0240, 0.0184, -25, 76.34, 82.83, -221.65,-197.37,-2.81, 1.11E-1, -1.16E-4, 4.94E-8, 4.490, 12.499, 3018.17,-7.314],
[0.0098, 0.0048, 13, 31.22, 23.05, -138.16,-98.22, 1.22E+1, -1.26E-2, 6.03E-5, -3.86E-8, 5.879, 4.682, 440.24, -0.953],
[0.0380, 0.0031, 62, 76.75, 61.20, -133.22,-120.50,6.45, 6.70E-2, -3.57E-5, 2.86E-9, 4.189, 8.972, 340.35, -0.350],
[0.0168, 0.0015, 18, 22.42, 22.23, -132.22,-105.00,2.55E+1, -6.32E-2, 1.11E-4, -5.48E-8, 1.188, 2.410, 122.09, -0.386],
[0.0437, 0.0064, 91, 152.54, 127.24, -66.57, -16.83, 2.59E+1, -3.74E-3, 1.29E-4, -8.88E-8, 9.679, 16.738, None, None],
[0.0143, 0.0101, 36, -10.50, 2.08, -247.61,-250.83,6.82, 1.96E-2, 1.27E-5, -1.78E-8, 3.624, 5.909, 675.24, -1.340],
[0.0085, 0.0076, 34, 57.55, 68.40, 55.52, 79.93, 8.83, -3.84E-3, 4.35E-5, -2.60E-8, 3.649, 6.528, None, None],
[0.0130, 0.0114, 29, 52.82, 101.51, 31.65,75.61,1.18E+1, -2.30E-2, 1.07E-4, -6.28E-8, 7.490, 6.930, None, None],
[None, None, None, 83.08, 68.91, 93.70, 119.66, 5.69, -4.12E-3, 1.28E-4, -8.88E-8, None, 12.169, None, None],
[0.0255, -0.0099,None, 74.60, None, 23.61, None, None, None, None, None, None, 3.335, None, None],
[0.0496, -0.0101,91, 125.66, 59.89, 88.43, 89.22, 3.65E+1, -7.33E-2, 1.84E-4, -1.03E-7, 2.414, 12.851, None, None],
[0.0243, 0.0109, 38, 73.23, 66.89, -2.02, 14.07,2.69E+1, -4.12E-2, 1.64E-4, -9.76E-8, 3.515, 10.788, None, None],
[0.0295, 0.0077, 35, 50.17, 52.66, 53.47, 89.39,-1.21, 7.62E-2, -4.86E-5, 1.05E-8, 5.009, 6.436, None, None],
[0.0169, 0.0074, 9, 11.74, 48.84, 123.34, 163.16,-3.11E+1, 2.27E-1, -3.20E-4, 1.46E-7, 4.703, 1.896, None, None],
[0.0031, 0.0084, 63, 63.56, 20.09, -17.33, -22.99, 3.53E+1, -7.58E-2, 1.85E-4, -1.03E-7, 2.360, 6.884, None, None],
[0.0119, 0.0049, 54, 68.78, 34.40, 41.87, 33.12, 1.96E+1, -5.61E-3, 4.02E-5, -2.76E-8, 4.130, 6.817, None, None],
[0.0019, 0.0051, 38, 52.10, 79.93, 39.10, 27.76, 1.67E+1, 4.81E-3, 2.77E-5, -2.11E-8, 1.557, 5.984, None, None],
[0.0082, 0.0011, 41, 26.73, 8.13, 2.09, 11.30, -2.14, 5.74E-2, -1.64E-6, -1.59E-8, 1.101, 2.544, 259.65, -0.702],
[0.0143, 0.0008, 32, 31.01, 37.02, 46.43, 54.05, -8.25, 1.01E-1, -1.42E-4, 6.78E-8, 2.394, 3.059, -245.74,0.912],
[0.0100, 0.0025, 48, 27.15, 7.75, -26.80, -3.68, -6.03, 8.54E-2, -8.00E-6, -1.80E-8, 0.490, 2.398, 307.53, -0.798],
[0.0122, 0.0004, 38, 21.78, 19.88, 8.67, 40.99, -2.05E+1, 1.62E-1, -1.60E-4, 6.24E-8, 3.243, 1.942, -394.29,1.251],
[0.0042, 0.0061, 27, 21.32, 60.15, 79.72, 87.88, -9.09E+1, 5.57E-1, -9.00E-4, 4.69E-7, -1.373, 0.644, None, None],
[0.0113, -0.0028,56, 18.18, -4.32, -9.630, 3.77, 2.36E+1, -3.81E-2, 1.72E-4, -1.03E-7, -0.473, 1.724, 495.01, -1.539],
[0.0129, -0.0006,46, 24.96, 8.73, 37.97, 48.53, -8.00, 1.05E-1, -9.63E-5, 3.56E-8, 2.691, 2.205, 82.28, -0.242],
[0.0117, 0.0011, 38, 24.14, 11.14, 83.99, 92.36, -2.81E+1, 2.08E-1, -3.06E-4, 1.46E-7, 3.063, 2.138, None, None],
[0.0141, -0.0012,65, 23.58, -5.10, -76.45, -43.96, 1.95E+1, -8.08E-3, 1.53E-4, -9.67E-8, 0.908, 2.373, 548.29, -1.719],
[0.0189, 0.0000, 56, 22.88, 11.27, -20.64, 8.42, -9.09E-1, 9.50E-2, -5.44E-5, 1.19E-8, 2.590, 2.226, 94.16, -0.199],
[0.0164, 0.0020, 41, 21.74, 12.64, 29.89, 58.36, -2.30E+1, 2.04E-1, -2.65E-4, 1.20E-7, 0.749, 1.691, -322.15,1.187],
[0.0067, 0.0043, 27, 18.25, 46.43, 82.23, 116.02, -6.62E+1, 4.27E-1, -6.41E-4, 3.01E-7, -1.460, 0.636, -573.56,2.307],
[0.0111, -0.0057,27, -0.03, -15.78, -251.92,-247.19,2.65E+1, -9.13E-2, 1.91E-4, -1.03E-7, 1.398, -0.670, None, None],
[0.0105, -0.0049,58, 38.13, 13.55, -71.55,-64.31, 3.33E+1, -9.63E-2, 1.87E-4, -9.96E-8, 2.515, 4.532, 625.45, -1.814],
[0.0133, 0.0057, 71, 66.86, 43.43, -29.48, -38.06, 2.86E+1, -6.49E-2, 1.36E-4, -7.45E-8, 3.603, 6.582, 738.91, -2.038],
[0.0068, -0.0034,97, 93.84, 41.69, 21.06, 5.74, 3.21E+1, -6.41E-2, 1.26E-4, -6.87E-8, 2.724, 9.520, 809.55, -2.224]]
mol = Chem.MolFromSmiles(str(smiles))
NoA = Chem.AddHs(mol).GetNumAtoms()
MW = Descriptors.MolWt(Chem.AddHs(mol))
LogP = Descriptors.MolLogP(Chem.AddHs(mol))
MR = Descriptors.MolMR(Chem.AddHs(mol))
double_lists = search_func_groups(smiles)
entry_index_by_users = []
entry_data_by_users = []
for item in double_lists:
entry_index_by_users.append(item[0])
entry_data_by_users.append(item[1])
fiveteen_columns = [] ##length = 15*len(entry_index_by_users)
for index, data in zip(entry_index_by_users, entry_data_by_users):
for i in range(15):
if DB[index][i] == None:
temp = None
else:
temp = data*DB[index][i]
fiveteen_columns.append(temp)
temperature = 310
Tc = []
Pc = []
Vc = []
Tb = []
Tm = []
Hfor = []
Gf = []
Cpa = []
Cpb = []
Cpc = []
Cpd = []
Hfus = []
Hvap = []
Ya = []
Yb =[]
fc = fiveteen_columns ## short hand
for i in range(len(entry_index_by_users)):
Tc.append(fc[i*15])
Pc.append(fc[i*15 + 1])
Vc.append(fc[i*15 + 2])
Tb.append(fc[i*15 + 3])
Tm.append(fc[i*15 + 4])
Hfor.append(fc[i*15 + 5])
Gf.append(fc[i*15 + 6])
Cpa.append(fc[i*15 + 7])
Cpb.append(fc[i*15 + 8])
Cpc.append(fc[i*15 + 9])
Cpd.append(fc[i*15 + 10])
Hfus.append(fc[i*15 + 11])
Hvap.append(fc[i*15 + 12])
Ya.append(fc[i*15 + 13])
Yb.append(fc[i*15 + 14])
try:
BoilingPoint = 198.2 + sum(Tb)
except:
BoilingPoint = None
try:
MeltingPoint = 122.5 + sum(Tm)
except:
MeltingPoint = None
try:
CriticalTemp = (sum(Tb) + 198.2)/(0.584 + 0.965*sum(Tc) - sum(Tc)**2)
except:
CriticalTemp = None
try:
CriticalPress = 1./(0.113 + 0.0032*float(NoA) - sum(Pc))**2
except:
CriticalPress = None
try:
CriticalVolume = 17.5 + sum(Vc)
except:
CriticalVolume = None
try:
EnthalpyForm = 68.29 + sum(Hfor)
except:
EnthalpyForm = None
try:
GibbsEnergy = 53.88 + sum(Gf)
except:
GibbsEnergy = None
try:
HeatCapacity = (sum(Cpa) - 37.93) + (sum(Cpb) + 0.210)*float(temperature) + (sum(Cpc) - 3.91*10**(-4))*float(temperature)**2 + (sum(Cpd) + 2.06*10**(-7))*float(temperature)**3
except:
HeatCapacity = None
try:
EnthalpyVap = 15.30 + sum(Hvap)
except:
EnthalpyVap = None
try:
EnthalpyFus = -0.88 + sum(Hfus)
except:
EnthalpyFus = None
try:
LiquidVisco = float(MW)*math.exp((sum(Ya) - 597.82)/float(temperature) + sum(Yb) - 11.202)
except:
LiquidVisco = None
try:
CrystalSolub_1 = 10**(0.8 - float(LogP) - 0.01*(sum(Tm)+122.5 - 273.15 - 25.))*1000.*float(MW)
except:
CrystalSolub_1 = None
try:
CrystalSolub_2 = 10**(0.5 - float(LogP) - 0.01*(sum(Tm)+122.5 - 273.15 - 25.))*1000.*float(MW)
except:
CrystalSolub_2 = None
try:
AmorphSolub_1 = 10**(0.8 - float(LogP) - 0.01*(sum(Tm)+122.5 - 273.15 - 25.)) *1000.*float(MW)*math.exp((sum(Hfus)-0.88)*(sum(Tm) + 122.5 - float(temperature))*float(temperature)/(sum(Tm) + 122.5)**2/(2.479*float(temperature)/298.))
except:
AmorphSolub_1 = None
try:
AmorphSolub_2 = 10**(0.5 - float(LogP) - 0.01*(sum(Tm)+122.5 - 273.15 - 25.)) *1000.*float(MW)*math.exp((sum(Hfus)-0.88)*(sum(Tm) + 122.5 - float(temperature))*float(temperature)/(sum(Tm) + 122.5)**2/(2.479*float(temperature)/298.))
except:
AmorphSolub_2 = None
return MeltingPoint-273.15
def string2mp(name, namespace='name'):
mp, mp_origin = None, None
# try the chemicals package
if is_cas(name):
cas = name
if pd.isna(mp):
mp = chemicals.Tm(cas)
if mp: mp = mp-273.15
methods = chemicals.Tm_methods(cas)
if methods: mp_origin = 'chem/'+methods[0]
# experimental values
if pd.isna(mp):
# some rows have multiple comma-separated cas numbers
mask = dfmp_expt['CAS'].str.contains(cas)
if sum(mask):
subdf = dfmp_expt[mask]['CAS'].str.split(', ')
for index,subcas in zip(subdf.index,subdf):
if cas in subcas:
mp = float(dfmp_expt.iloc[index]['MP'])
mp_origin = 'expt'
# predicted values from Mansouri
#if pd.isna(mp):
# mask = dfmp_pred['Substance_CASRN'] == cas
# if sum(mask):
# mp = float(dfmp_pred[mask]['NCCT_MP'])
# mp_origin = 'pred'
# predicted values from OPERA (CompTox dashboard)
if pd.isna(mp):
mask = df_pred['CASRN'] == cas
if sum(mask):
mp = float(df_pred[mask]['MELTING_POINT_DEGC_OPERA_PRED'].iloc[0])
mp_origin = 'comptox/pred'
# try to scrape from PubChem
if pd.isna(mp):
content = None
try:
compounds = pcp.get_compounds(name, namespace=namespace)
c = compounds[0]
cid = c.cid
url = f'https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/compound/{cid}/JSON'
#fid = urllib.request.urlopen(url)
#webpage = fid.read().decode('utf-8')
webpage = requests.get(url).text
content = json.loads(webpage)
except:
pass
if content:
mp_list = []
for i in content['Record']['Section']:
if i['TOCHeading'] == 'Chemical and Physical Properties':
for j in i['Section']:
if j['TOCHeading'] == 'Experimental Properties':
for k in j['Section']:
if k['TOCHeading'] == 'Melting Point':
for ii in k['Information']:
try:
mp_string = ii['Value']['StringWithMarkup'][0]['String']
#rho_string = rho_string.replace('Relative density (water = 1): ', '')
#print(mp_string)
#tmp_rho = re.match('(?:\d+(?:\.\d*)?|\.\d+)',rho_string)
#m = re.match('((?:\d+(?:\.\d*)?|\.\d+))(?:-((?:\d+(?:\.\d*)?|\.\d+)))?',rho_string)
m = re.match(r'(-?(?:\d+(?:\.\d*)?|\.\d+))(?:-((?:\d+(?:\.\d*)?|\.\d+)))?( ?°?C)',mp_string)
if m is not None:
groups = m.groups()
if len(groups):
for g in groups:
try:
tmp_mp = float(g)
mp_list.append(tmp_mp)
except:
continue
m = re.match(r'(-?(?:\d+(?:\.\d*)?|\.\d+))(?:-((?:\d+(?:\.\d*)?|\.\d+)))?( ?°?F)',mp_string)
if m is not None:
groups = m.groups()
if len(groups):
for g in groups:
try:
# (T/F − 32) × 5/9 = T/C
tmp_mp = (float(g)-32)*5/9
mp_list.append(tmp_mp)
except:
continue
except:
continue
if mp_list:
## remove outliers using interquartile range (IQR)
mp_list = np.array(mp_list)
q75,q25 = np.percentile(mp_list,[75,25])
intr_qr = q75-q25
hi = q75+(1.5*intr_qr)
lo = q25-(1.5*intr_qr)
mask = (mp_list <= hi) & (mp_list >= lo)
mp_list = mp_list[mask]
mp = np.mean(mp_list)
mp_origin = 'pubchem'
else:
mp, mp_origin = None, None
# try to scrape from DSSTOX website...
if try_dsstox:
if pd.isna(mp):
dtxsid = None
# try to find it via the dsstox dashboard
try:
name_urlsafe = urllib.parse.quote(name)
url = f'https://comptox.epa.gov/dashboard/search-results?input_type=synonym_substring&inputs={name_urlsafe}'
fid = urllib.request.urlopen(url)
webpage = fid.read().decode('utf-8')
hits = re.findall(r'DTXSID[0-9]+', webpage)
if len(hits):
dtxsid = hits[0]
except:
pass
if dtxsid:
mysoup = None
url = f'https://comptox.epa.gov/dashboard/chemical/properties/{dtxsid}'
#print(url)
try:
#driver = selenium.webdriver.Firefox()
#driver.set_page_load_timeout(15)
#driver.get(url)
#driver_exe = 'chromedriver'
#driver_exe = chromedriver_binary.chromedriver_filename
options = Options()
options.add_argument("--headless") # runs in background instead of showing browser window
service = Service(driver_exe)
driver = selenium.webdriver.Chrome(service=service, options=options)
#driver = selenium.webdriver.Chrome(driver_exe, options=options)
driver.set_page_load_timeout(15)
driver.get(url)
webpage = driver.page_source
driver.quit()
mysoup = bs4.BeautifulSoup(webpage, features='lxml')
except:
pass
#print("timeout")
# column of property names
if mysoup:
ifound = None
rows = mysoup.find_all('div', attrs={'col-id':'property'})
for i,row in enumerate(rows):
if 'Melting Point' in row.text:
ifound = i
break
if ifound:
rows = mysoup.find_all('div', attrs={'col-id':'exavg'})
text = rows[ifound].text
value = re.sub(r' \([0-9]*\)', '', text.strip())
try:
mp = float(value)
mp_origin = 'dsstox/expt'
except:
mp, mp_origin = None, None
if pd.isna(mp):
rows = mysoup.find_all('div', attrs={'col-id':'predavg'})
text = rows[ifound].text
value = re.sub(r' \([0-9]*\)', '', text.strip())
try:
mp = float(value)
mp_origin = 'dsstox/pred'
except:
mp, mp_origin = None, None
else:
mp, mp_origin = None, None
else:
mp, mp_origin = None, None
if pd.isna(mp): mp, mp_origin = None, None
return mp, mp_origin
def smiles2mp(smiles):
try:
SUPPORTED_ATOM_SET = {6, 7, 8, 9, 16, 17, 35, 53}
m = Chem.MolFromSmiles(str(smiles))
atom_num_set = set([a.GetAtomicNum() for a in m.GetAtoms()])
if atom_num_set.issubset(SUPPORTED_ATOM_SET):
mp = compute_phys_properties(smiles)
else:
mp = None
except:
mp = None
return mp
def smiles2mp_opera(smiles):
descs = padelpy.from_smiles(smiles, descriptortypes='mp/descriptors.xml')
#dfd = pd.DataFrame(descs,index=[0])
#dfd = dfd.replace('',0).infer_objects(copy=False)
#dfd = pd.DataFrame(dfd, dtype=float)
dfd = pd.DataFrame(descs, index=[0]).apply(pd.to_numeric, errors="coerce").fillna(0.0).astype(float)
X = np.array(dfd[my_opera_data_mp.desc_list])
X_scale = my_opera_data_mp.scaler_X.transform(X)
y_pred = my_opera_data_mp.scaler_y.inverse_transform(my_opera_data_mp.knn_all.predict(X_scale))
return y_pred[0][0]
def mol2mp(cas, name, smiles):
mp, mp_origin = None, None
if pd.isna(mp) and smiles:
try:
mp = smiles2mp_opera(smiles)
mp_origin = 'opera/calc'
except:
mp, mp_origin = None, None
if pd.isna(mp) and cas:
try:
mp, mp_origin = string2mp(cas)
except:
mp, mp_origin = None, None
if pd.isna(mp) and name:
try:
mp, mp_origin = string2mp(name)
except:
mp, mp_origin = None, None
if pd.isna(mp) and smiles:
try:
mp = smiles2mp(smiles)
mp_origin = 'joback-reid/calc'
except:
mp, mp_origin = None, None
return mp, mp_origin
def getLogP(cas,mol):
LogP, LogP_origin = None, None
if cas:
mask = df_pred['CASRN'] == cas
if sum(mask):
LogP = float(df_pred[mask]['OCTANOL_WATER_PARTITION_LOGP_OPERA_PRED'])
LogP_origin = 'comptox/pred'
if pd.isna(LogP) and mol:
LogP = Crippen.MolLogP(mol)
LogP_origin = 'rdkit/calc'
return LogP, LogP_origin
|