Spaces:
Sleeping
Sleeping
| from bmfm_sm.api.smmv_api import SmallMoleculeMultiViewModel | |
| from bmfm_sm.core.data_modules.namespace import LateFusionStrategy | |
| from bmfm_sm.api.dataset_registry import DatasetRegistry | |
| import gradio as gr | |
| examples = [ | |
| ["CC(C)CC1=CC=C(C=C1)C(C)C(=O)O", "BACE"], | |
| ["CC(C)CC1=CC=C(C=C1)C(C)C(=O)O", "BBBP"], | |
| ["[N+](=O)([O-])[O-]", "CLINTOX"], | |
| ["OCC3OC(OCC2OC(OC(C#N)c1ccccc1)C(O)C(O)C2O)C(O)C(O)C3O", "ESOL"], | |
| ["CN(C)C(=O)c1ccc(cc1)OC", "FREESOLV"], | |
| ["CC(C)CC1=CC=C(C=C1)C(C)C(=O)O", "HIV"], | |
| ["Cn1c(CN2CCN(CC2)c3ccc(Cl)cc3)nc4ccccc14", "LIPOPHILICITY"], | |
| ["Cc1cccc(N2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)c1C", "MUV"], | |
| ["C([H])([H])([H])[H]", "QM7"], | |
| ["C(CNCCNCCNCCN)N", "SIDER"], | |
| ["CCOc1ccc2nc(S(N)(=O)=O)sc2c1", "TOX21"], | |
| ["CSc1nc(N)nc(-c2cccc(-c3ccc4[nH]ccc4c3)c2)n1", "Pretrained"] | |
| ] | |
| base_huggingface_path = 'ibm/biomed.sm.mv-te-84m' | |
| finetuned_huggingface_path = "-MoleculeNet-ligand_scaffold-" | |
| available_datasets = { | |
| "BACE": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-BACE-101", | |
| "BBBP": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-BBBP-101", | |
| "CLINTOX": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-CLINTOX-101", | |
| "ESOL": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-ESOL-101", | |
| "FREESOLV": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-FREESOLV-101", | |
| "HIV": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-HIV-101", | |
| "LIPOPHILICITY": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-LIPOPHILICITY-101", | |
| "MUV": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-MUV-101", | |
| "QM7": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-QM7-101", | |
| "SIDER": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-SIDER-101", | |
| "TOX21": "ibm/biomed.sm.mv-te-84m-MoleculeNet-ligand_scaffold-TOX21-101", | |
| } | |
| class PretrainedSMMVPipeline: | |
| def __init__(self, pretrained_model_name_or_path: str): | |
| self.model = SmallMoleculeMultiViewModel.from_pretrained( | |
| LateFusionStrategy.ATTENTIONAL, | |
| model_path=pretrained_model_name_or_path, | |
| huggingface=True | |
| ) | |
| def __call__(self, smiles: str) -> float: | |
| emb = SmallMoleculeMultiViewModel.get_embeddings( | |
| smiles=smiles, | |
| pretrained_model=self.model | |
| ) | |
| return str(emb.tolist()) | |
| class FinetunedSMMVPipeline: | |
| def __init__(self, dataset:str, pretrained_model_name_or_path: str): | |
| dataset_registry = DatasetRegistry() | |
| self.ds = dataset_registry.get_dataset_info(dataset) | |
| self.model = SmallMoleculeMultiViewModel.from_finetuned( | |
| self.ds, | |
| model_path=pretrained_model_name_or_path, | |
| inference_mode=True, | |
| huggingface=True | |
| ) | |
| def __call__(self, smiles: str) -> float: | |
| prediction = SmallMoleculeMultiViewModel.get_predictions( | |
| smiles, | |
| self.ds, | |
| finetuned_model=self.model | |
| ) | |
| return str(prediction.tolist()) | |
| def deploy(): | |
| print(f"Loading checkpoint: Pretrained from {base_huggingface_path}") | |
| pipeline_pretrained = PretrainedSMMVPipeline(base_huggingface_path) | |
| pipelines_finetuned = {} | |
| pipelines_finetuned["Pretrained"] = pipeline_pretrained | |
| for dataset, huggingface_path in available_datasets.items(): | |
| print(f"Loading checkpoint: {dataset} from {huggingface_path}") | |
| pipelines_finetuned[dataset] = FinetunedSMMVPipeline( | |
| dataset=dataset, | |
| pretrained_model_name_or_path=huggingface_path | |
| ) | |
| def pipeline( | |
| smiles: str, | |
| dataset: str | |
| ): | |
| return pipelines_finetuned[dataset](smiles) | |
| smiles_input = gr.Textbox(placeholder="SMILES", label="SMILES") | |
| datasets_input = gr.Dropdown( | |
| choices=list(pipelines_finetuned.keys()), | |
| label="Checkpoint", | |
| ) | |
| text_output = gr.Textbox( | |
| max_lines=10, | |
| label="Prediction", | |
| ) | |
| gradio_app = gr.Interface( | |
| pipeline, | |
| inputs=[smiles_input, datasets_input], | |
| outputs=text_output, | |
| examples=examples, | |
| examples_per_page=20, | |
| title="ibm/biomed.sm.mv-te-84m property prediction tasks", | |
| description="Predictions for Pretrained show embedding vector of base model. Predictions for datasets show output of model finetuned on that task", | |
| ) | |
| gradio_app.launch() | |
| if __name__ == "__main__": | |
| deploy() | |