Update agent.py

agent.py

@@ -122,12 +122,6 @@ class TeLLAgent:
         else: 
             prompt = str(' ' + outputs["input"] + ' ' + outputs["intermediate_steps"][0][0].log.split('Action')[0].replace("*", ""))
             outputs = self.agent_executor2.invoke( {"input": prompt})
-        return outputs 
+        return outputs['output']
     
-if __name__ == '__main__':
-        chem_model = TeLLAgent( temp=0.1, streaming=  True,
-                           openai_api_key =r'sk-itPrztYm9F6XZZpsBMJB9O7Vq0pYUABVVBSoThuBxEGTnDik', 
-                           image_path= r"C:\Users\BM109X32G-10GPU-02\Desktop\acceptor\1.png" ,file_path = r"..." )
-       # A = chem_model.run(r"""who are you""")
-       # A = chem_model.run(r"""I want to know some basic chemical properties, HOMO /LUMO and PCE values of molecules  CC(C)CCCC(C)CCC1=C(/C=C\2/C(=C(C#N)C#N)C3=C(C=C(C(=C3)F)F)C2=O)SC4=C1N(CCC(C)CCCC(C)C)C5=C4C6=NSN=C6C7=C5N(CCC(C)CCCC(C)C)C8=C7SC(=C8CCC(C)CCCC(C)C)/C=C\9/C(=C(C#N)C#N)C%10=C(C=C(C(=C%10)F)F)C9=O""")
-        a  = chem_model.run(r""" Compare the PCE and similarity of acceptor Y6 and acceptor in image""")
+