Create app.py
Browse files
app.py
ADDED
|
@@ -0,0 +1,437 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import streamlit as st
|
| 2 |
+
import sys
|
| 3 |
+
from fragment_embedder import FragmentEmbedder
|
| 4 |
+
from morgan_desc import *
|
| 5 |
+
from physchem_desc import *
|
| 6 |
+
from rdkit import Chem
|
| 7 |
+
import pandas as pd
|
| 8 |
+
import os
|
| 9 |
+
import random
|
| 10 |
+
import numpy as np
|
| 11 |
+
import joblib
|
| 12 |
+
from rdkit import Chem
|
| 13 |
+
from rdkit.Chem import Draw
|
| 14 |
+
from rdkit.Chem import Draw
|
| 15 |
+
from rdkit.Chem import AllChem
|
| 16 |
+
from rdkit import DataStructs
|
| 17 |
+
from rdkit.Chem import Descriptors
|
| 18 |
+
from scipy import stats
|
| 19 |
+
import textwrap
|
| 20 |
+
from datasets import load_dataset
|
| 21 |
+
import requests
|
| 22 |
+
from io import BytesIO
|
| 23 |
+
import urllib.request
|
| 24 |
+
|
| 25 |
+
import warnings
|
| 26 |
+
warnings.filterwarnings('ignore')
|
| 27 |
+
|
| 28 |
+
st.set_page_config(
|
| 29 |
+
page_title="Fragment predictor app",
|
| 30 |
+
layout="wide",
|
| 31 |
+
initial_sidebar_state="expanded",
|
| 32 |
+
page_icon=None,
|
| 33 |
+
)
|
| 34 |
+
|
| 35 |
+
dataset = load_dataset('ligdis/data', data_files={"predictions.csv"})
|
| 36 |
+
df_predictions = dataset['train'].to_pandas()
|
| 37 |
+
|
| 38 |
+
predictions_inchikeys = df_predictions["inchikey"].tolist()
|
| 39 |
+
df_predictions = df_predictions.rename(columns={"inchikey": "InChIKey"})
|
| 40 |
+
|
| 41 |
+
dataset = load_dataset('ligdis/data', data_files={"applicability.csv"})
|
| 42 |
+
df_applicability = dataset['train'].to_pandas()
|
| 43 |
+
|
| 44 |
+
df_predictions = pd.concat([df_predictions, df_applicability], axis=1)
|
| 45 |
+
|
| 46 |
+
dataset = load_dataset('ligdis/data', data_files={"cemm_smiles.csv"})
|
| 47 |
+
cemm_smiles = dataset['train'].to_pandas()
|
| 48 |
+
|
| 49 |
+
fid2smi = {}
|
| 50 |
+
for r in cemm_smiles.values:
|
| 51 |
+
fid2smi[r[0]] = r[1]
|
| 52 |
+
|
| 53 |
+
fe = FragmentEmbedder()
|
| 54 |
+
|
| 55 |
+
CRF_PATTERN = "CC1(CCC#C)N=N1"
|
| 56 |
+
CRF_PATTERN_0 = "C#CC"
|
| 57 |
+
CRF_PATTERN_1 = "N=N"
|
| 58 |
+
|
| 59 |
+
dataset = load_dataset('ligdis/data', data_files={"all_fff_enamine.csv"})
|
| 60 |
+
enamine_catalog = dataset['train'].to_pandas()
|
| 61 |
+
enamine_catalog_ids_set = set(enamine_catalog["catalog_id"])
|
| 62 |
+
enamine_catalog_dict = {}
|
| 63 |
+
catalog2inchikey = {}
|
| 64 |
+
smiles2catalog = {}
|
| 65 |
+
for i, r in enumerate(enamine_catalog.values):
|
| 66 |
+
enamine_catalog_dict[r[0]] = r[1]
|
| 67 |
+
catalog2inchikey[r[0]] = predictions_inchikeys[i]
|
| 68 |
+
smiles2catalog[r[1]] = r[0]
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
def is_enamine_catalog_id(identifier):
|
| 72 |
+
if identifier in enamine_catalog_ids_set:
|
| 73 |
+
return True
|
| 74 |
+
else:
|
| 75 |
+
return False
|
| 76 |
+
|
| 77 |
+
|
| 78 |
+
def is_enamine_smiles(identifier):
|
| 79 |
+
if identifier in smiles2catalog:
|
| 80 |
+
return True
|
| 81 |
+
else:
|
| 82 |
+
return False
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
def is_ligand_discovery_id(identifier):
|
| 86 |
+
if identifier in fid2smi:
|
| 87 |
+
return True
|
| 88 |
+
else:
|
| 89 |
+
return False
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
def is_valid_smiles(smiles):
|
| 93 |
+
try:
|
| 94 |
+
mol = Chem.MolFromSmiles(smiles)
|
| 95 |
+
except:
|
| 96 |
+
mol = None
|
| 97 |
+
if mol is None:
|
| 98 |
+
return False
|
| 99 |
+
else:
|
| 100 |
+
return True
|
| 101 |
+
|
| 102 |
+
|
| 103 |
+
def has_crf(mol):
|
| 104 |
+
pattern = CRF_PATTERN
|
| 105 |
+
has_pattern = mol.HasSubstructMatch(Chem.MolFromSmarts(pattern))
|
| 106 |
+
if not has_pattern:
|
| 107 |
+
if mol.HasSubstructMatch(
|
| 108 |
+
Chem.MolFromSmarts(CRF_PATTERN_0)
|
| 109 |
+
) and mol.HasSubstructMatch(Chem.MolFromSmarts(CRF_PATTERN_1)):
|
| 110 |
+
return True
|
| 111 |
+
else:
|
| 112 |
+
return False
|
| 113 |
+
return True
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
st.title("Fully-functionalized fragment predictions")
|
| 117 |
+
|
| 118 |
+
dataset = load_dataset('ligdis/data', data_files={"model_catalog.csv"})
|
| 119 |
+
dm = dataset['train'].to_pandas()
|
| 120 |
+
all_models = dm["model_name"].tolist()
|
| 121 |
+
|
| 122 |
+
dataset = load_dataset('ligdis/data', data_files={"models_performance.tsv"})
|
| 123 |
+
dp = dataset['train'].to_pandas()
|
| 124 |
+
|
| 125 |
+
model_display = {}
|
| 126 |
+
model_description = {}
|
| 127 |
+
for r in dm.values:
|
| 128 |
+
model_display[r[0]] = r[1]
|
| 129 |
+
model_description[r[0]] = r[2]
|
| 130 |
+
model_auroc = {}
|
| 131 |
+
for r in dp.values:
|
| 132 |
+
model_auroc[r[0]] = r[1]
|
| 133 |
+
|
| 134 |
+
prom_models = [x for x in dm["model_name"].tolist() if x.startswith("promiscuity")]
|
| 135 |
+
sign_models = [x for x in dm["model_name"].tolist() if x.startswith("signature")]
|
| 136 |
+
|
| 137 |
+
def model_to_markdown(model_names):
|
| 138 |
+
items = []
|
| 139 |
+
for mn in model_names:
|
| 140 |
+
items += [
|
| 141 |
+
"{0} ({1:.3f}): {2}".format(
|
| 142 |
+
model_display[mn].ljust(8), model_auroc[mn], model_description[mn]
|
| 143 |
+
)
|
| 144 |
+
]
|
| 145 |
+
markdown_list = "\n".join(items)
|
| 146 |
+
return markdown_list
|
| 147 |
+
|
| 148 |
+
st.sidebar.title("Promiscuity models")
|
| 149 |
+
|
| 150 |
+
st.sidebar.markdown("**Global models**")
|
| 151 |
+
|
| 152 |
+
global_promiscuity_models = ["promiscuity_pxf0", "promiscuity_pxf1", "promiscuity_pxf2"]
|
| 153 |
+
st.sidebar.text(model_to_markdown(global_promiscuity_models))
|
| 154 |
+
|
| 155 |
+
st.sidebar.markdown("**Specific models**")
|
| 156 |
+
|
| 157 |
+
specific_promiscuity_models = [
|
| 158 |
+
"promiscuity_fxp0_pxf0",
|
| 159 |
+
"promiscuity_fxp1_pxf0",
|
| 160 |
+
"promiscuity_fxp2_pxf0",
|
| 161 |
+
"promiscuity_fxp0_pxf1",
|
| 162 |
+
"promiscuity_fxp1_pxf1",
|
| 163 |
+
"promiscuity_fxp2_pxf1",
|
| 164 |
+
"promiscuity_fxp0_pxf2",
|
| 165 |
+
"promiscuity_fxp1_pxf2",
|
| 166 |
+
"promiscuity_fxp2_pxf2",
|
| 167 |
+
]
|
| 168 |
+
st.sidebar.text(model_to_markdown(specific_promiscuity_models))
|
| 169 |
+
|
| 170 |
+
st.sidebar.markdown("**Aggregated score**")
|
| 171 |
+
st.sidebar.text("Sum : Sum of individual promiscuity predictors.")
|
| 172 |
+
|
| 173 |
+
st.sidebar.title("Signature models")
|
| 174 |
+
signature_models = ["signature_{0}".format(i) for i in range(10)]
|
| 175 |
+
st.sidebar.text(model_to_markdown(signature_models))
|
| 176 |
+
|
| 177 |
+
st.sidebar.title("Chemical space")
|
| 178 |
+
s = ["MW : Molecular weight.",
|
| 179 |
+
"LogP : Walden-Crippen LogP.",
|
| 180 |
+
"Sim-1 : Tanimoto similarity to the most ",
|
| 181 |
+
" similar fragment in the training set.",
|
| 182 |
+
"Sim-3 : Tanimoto similarity to the third ",
|
| 183 |
+
" most similar fragment in the training set."]
|
| 184 |
+
|
| 185 |
+
st.sidebar.text("\n".join(s))
|
| 186 |
+
|
| 187 |
+
s = textwrap.wrap("* The score in parenthesis corresponds to the mean AUROC in 10 train-test splits.")
|
| 188 |
+
st.sidebar.text("\n".join(s))
|
| 189 |
+
|
| 190 |
+
st.sidebar.markdown("**In the main page...**")
|
| 191 |
+
s = textwrap.wrap("1. Percentages in parenthesis denote the percentile of the score across the Enamine collection of FFFs (>250k compounds)", width=60)
|
| 192 |
+
st.sidebar.text("\n".join(s))
|
| 193 |
+
s = textwrap.wrap("2. The exclamation sign (!) indicates that the corresponding model has an AUROC accuracy below 0.7.", width=60)
|
| 194 |
+
st.sidebar.text("\n".join(s))
|
| 195 |
+
|
| 196 |
+
placeholder_text = []
|
| 197 |
+
keys = random.sample(sorted(enamine_catalog_ids_set), 5)
|
| 198 |
+
for k in keys:
|
| 199 |
+
placeholder_text += [random.choice([k, enamine_catalog_dict[k]])]
|
| 200 |
+
placeholder_text = "\n".join(placeholder_text)
|
| 201 |
+
|
| 202 |
+
text_input = st.text_area(label="Input your fully functionalized fragments:")
|
| 203 |
+
inputs = [x.strip(" ") for x in text_input.split("\n")]
|
| 204 |
+
inputs = [x for x in inputs if x != ""]
|
| 205 |
+
if len(inputs) > 999:
|
| 206 |
+
st.error("Please limit the number of input fragments to 999.")
|
| 207 |
+
|
| 208 |
+
R = []
|
| 209 |
+
all_inputs_are_valid = True
|
| 210 |
+
for i, inp in enumerate(inputs):
|
| 211 |
+
input_id = "input-{0}".format(str(i).zfill(3))
|
| 212 |
+
if is_enamine_catalog_id(inp):
|
| 213 |
+
smiles = enamine_catalog_dict[inp]
|
| 214 |
+
inchikey = catalog2inchikey[inp]
|
| 215 |
+
r = [inp, smiles, inchikey]
|
| 216 |
+
elif is_ligand_discovery_id(inp):
|
| 217 |
+
smiles = fid2smi[inp]
|
| 218 |
+
inchikey = Chem.MolToInchiKey(Chem.MolFromSmiles(smiles))
|
| 219 |
+
r = [inp, smiles, inchikey]
|
| 220 |
+
elif is_enamine_smiles(inp):
|
| 221 |
+
smiles = inp
|
| 222 |
+
inp = smiles2catalog[smiles]
|
| 223 |
+
inchikey = catalog2inchikey[inp]
|
| 224 |
+
r = [inp, smiles, inchikey]
|
| 225 |
+
elif is_valid_smiles(inp):
|
| 226 |
+
mol = Chem.MolFromSmiles(inp)
|
| 227 |
+
if has_crf(mol):
|
| 228 |
+
inchikey = Chem.rdinchi.InchiToInchiKey(Chem.MolToInchi(mol))
|
| 229 |
+
r = [inchikey, inp, inchikey]
|
| 230 |
+
else:
|
| 231 |
+
st.error(
|
| 232 |
+
"Input SMILES {0} does not have the CRF. The CRF pattern is {1}.".format(
|
| 233 |
+
inp, CRF_PATTERN
|
| 234 |
+
)
|
| 235 |
+
)
|
| 236 |
+
all_inputs_are_valid = False
|
| 237 |
+
else:
|
| 238 |
+
st.error(
|
| 239 |
+
"Input {0} is not valid. Please enter a valid fully-functionalized fragment SMILES string or an Enamine catalog identifier of a fully-functionalized fragment".format(
|
| 240 |
+
inp
|
| 241 |
+
)
|
| 242 |
+
)
|
| 243 |
+
all_inputs_are_valid = False
|
| 244 |
+
R += [r]
|
| 245 |
+
|
| 246 |
+
|
| 247 |
+
def get_fragment_image(smiles):
|
| 248 |
+
m = Chem.MolFromSmiles(smiles)
|
| 249 |
+
AllChem.Compute2DCoords(m)
|
| 250 |
+
im = Draw.MolToImage(m, size=(200, 200))
|
| 251 |
+
return im
|
| 252 |
+
|
| 253 |
+
if all_inputs_are_valid and len(R) > 0:
|
| 254 |
+
sum_of_promiscuities = np.sum(
|
| 255 |
+
df_predictions[global_promiscuity_models + specific_promiscuity_models], axis=1
|
| 256 |
+
)
|
| 257 |
+
df = pd.DataFrame(R, columns=["Identifier", "SMILES", "InChIKey"])
|
| 258 |
+
|
| 259 |
+
my_inchikeys = df["InChIKey"].tolist()
|
| 260 |
+
|
| 261 |
+
df_done = df[df["InChIKey"].isin(predictions_inchikeys)]
|
| 262 |
+
df_todo = df[~df["InChIKey"].isin(predictions_inchikeys)]
|
| 263 |
+
|
| 264 |
+
if df_done.shape[0] > 0:
|
| 265 |
+
df_done = df_done.merge(
|
| 266 |
+
df_predictions, on="InChIKey", how="left"
|
| 267 |
+
).drop_duplicates()
|
| 268 |
+
|
| 269 |
+
if df_todo.shape[0] > 0:
|
| 270 |
+
X = fe.transform(df_todo["SMILES"].tolist())
|
| 271 |
+
|
| 272 |
+
st.info("Making predictions... this make take a few seconds. Please be patient. We may experience high traffic. If something goes wrong, please try again later.")
|
| 273 |
+
|
| 274 |
+
progress_bar = st.progress(0)
|
| 275 |
+
|
| 276 |
+
for i, model_name in enumerate(all_models):
|
| 277 |
+
url = ''.join(('https://huggingface.co/ligdis/fpred/resolve/main/', model_name, '.joblib')) # The URL of the file you want to load
|
| 278 |
+
with urllib.request.urlopen(url) as response: # Download the file
|
| 279 |
+
model = joblib.load(BytesIO(response.read()))
|
| 280 |
+
vals = model.predict(X)
|
| 281 |
+
del model
|
| 282 |
+
progress_bar.progress((i + 1) / len(all_models))
|
| 283 |
+
df_todo[model_name] = vals
|
| 284 |
+
|
| 285 |
+
url = 'https://huggingface.co/ligdis/fpred/resolve/main/cemm_ecfp_2_1024.joblib' # The URL of the file you want to load
|
| 286 |
+
with urllib.request.urlopen(url) as response: # Download the file
|
| 287 |
+
dataset_fps = joblib.load(BytesIO(response.read()))
|
| 288 |
+
|
| 289 |
+
all_query_smiles = df_todo["SMILES"].tolist()
|
| 290 |
+
|
| 291 |
+
sims_1 = []
|
| 292 |
+
sims_3 = []
|
| 293 |
+
logps = []
|
| 294 |
+
mwts = []
|
| 295 |
+
for query_smiles in all_query_smiles:
|
| 296 |
+
query_mol = Chem.MolFromSmiles(query_smiles)
|
| 297 |
+
query_fp = AllChem.GetMorganFingerprintAsBitVect(query_mol, 2, nBits=1024)
|
| 298 |
+
similarity_scores = [
|
| 299 |
+
DataStructs.TanimotoSimilarity(query_fp, dataset_fp)
|
| 300 |
+
for dataset_fp in dataset_fps
|
| 301 |
+
]
|
| 302 |
+
sorted_scores_indices = sorted(
|
| 303 |
+
enumerate(similarity_scores), key=lambda x: x[1], reverse=True
|
| 304 |
+
)
|
| 305 |
+
top_n = 3
|
| 306 |
+
sims_1 += [sorted_scores_indices[0][1]]
|
| 307 |
+
sims_3 += [sorted_scores_indices[2][1]]
|
| 308 |
+
logps += [Descriptors.MolLogP(query_mol)]
|
| 309 |
+
mwts += [Descriptors.MolWt(query_mol)]
|
| 310 |
+
results = {"sims-1": sims_1, "sims-3": sims_3, "logp": logps, "mw": mwts}
|
| 311 |
+
for k in ["sims-1", "sims-3", "logp", "mw"]:
|
| 312 |
+
df_todo[k] = results[k]
|
| 313 |
+
|
| 314 |
+
if df_done.shape[0] > 0 and df_todo.shape[0] > 0:
|
| 315 |
+
df_ = pd.concat([df_done, df_todo])
|
| 316 |
+
else:
|
| 317 |
+
if df_done.shape[0] > 0:
|
| 318 |
+
df_ = df_done
|
| 319 |
+
else:
|
| 320 |
+
df_ = df_todo
|
| 321 |
+
df_ = df_.drop(columns=["Identifier", "SMILES"])
|
| 322 |
+
df = df.merge(df_, on="InChIKey", how="left")
|
| 323 |
+
df.drop_duplicates(subset=['InChIKey'], keep='first', inplace=True, ignore_index=True)
|
| 324 |
+
df = df.rename(columns=model_display)
|
| 325 |
+
applicability_display = {
|
| 326 |
+
"mw": "MW",
|
| 327 |
+
"logp": "LogP",
|
| 328 |
+
"sims-1": "Sim-1",
|
| 329 |
+
"sims-3": "Sim-3",
|
| 330 |
+
}
|
| 331 |
+
df = df.rename(columns=applicability_display)
|
| 332 |
+
|
| 333 |
+
df_predictions = df_predictions.rename(columns=model_display)
|
| 334 |
+
df_predictions = df_predictions.rename(columns=applicability_display)
|
| 335 |
+
|
| 336 |
+
prom_columns = []
|
| 337 |
+
for i in range(3):
|
| 338 |
+
prom_columns += ["Prom-{0}".format(i)]
|
| 339 |
+
for j in range(3):
|
| 340 |
+
prom_columns += ["Prom-{0}-{0}".format(i, j)]
|
| 341 |
+
|
| 342 |
+
def identifiers_text(ik, smi, ident):
|
| 343 |
+
s = ["{0}".format(ik), "{0}".format(smi)]
|
| 344 |
+
if ik != ident:
|
| 345 |
+
s += ["{0}".format(ident)]
|
| 346 |
+
return "\n".join(s)
|
| 347 |
+
|
| 348 |
+
def score_text(v, c):
|
| 349 |
+
all_scores = np.array(df_predictions[c])
|
| 350 |
+
perc = stats.percentileofscore(all_scores, v)
|
| 351 |
+
t = "{0}: {1:.2f} ({2:.1f}%)".format(c.ljust(8), v, perc).ljust(22)
|
| 352 |
+
if c == "Sign-4" or c == "Sign-7" or c == "Sign-3":
|
| 353 |
+
t += " (!)"
|
| 354 |
+
return t
|
| 355 |
+
|
| 356 |
+
def score_texts(vs, cs):
|
| 357 |
+
all_texts = []
|
| 358 |
+
for v, c in zip(vs, cs):
|
| 359 |
+
all_texts += [score_text(v, c)]
|
| 360 |
+
return "\n".join(all_texts)
|
| 361 |
+
|
| 362 |
+
dorig = pd.DataFrame({"InChIKey": my_inchikeys})
|
| 363 |
+
df = dorig.merge(df, on="InChIKey", how="left")
|
| 364 |
+
df = df.reset_index(inplace=False, drop=True)
|
| 365 |
+
for i, r in enumerate(df.iterrows()):
|
| 366 |
+
v = r[1]
|
| 367 |
+
st.markdown("#### Input {0}: `{1}`".format(i+1, inputs[r[0]]))
|
| 368 |
+
cols = st.columns(4)
|
| 369 |
+
cols[0].markdown("**Fragment**")
|
| 370 |
+
cols[0].image(get_fragment_image(v["SMILES"]))
|
| 371 |
+
cols[0].text(identifiers_text(v["InChIKey"], v["SMILES"], v["Identifier"]))
|
| 372 |
+
|
| 373 |
+
cols[1].markdown("**Chemical space**")
|
| 374 |
+
my_cols = ["MW", "LogP", "Sim-1", "Sim-3"]
|
| 375 |
+
cols[1].text(score_texts(v[my_cols], my_cols))
|
| 376 |
+
|
| 377 |
+
cols[2].markdown("**Promiscuity**")
|
| 378 |
+
sum_prom = np.sum(v[prom_columns])
|
| 379 |
+
perc_prom = stats.percentileofscore(sum_of_promiscuities, sum_prom)
|
| 380 |
+
cols[2].text("Sum : {0:.2f} ({1:.1f}%)".format(sum_prom, perc_prom))
|
| 381 |
+
my_cols = ["Prom-0", "Prom-1", "Prom-2"]
|
| 382 |
+
cols[2].text(score_texts(v[my_cols], my_cols))
|
| 383 |
+
|
| 384 |
+
my_cols = [
|
| 385 |
+
"Prom-0-0",
|
| 386 |
+
"Prom-0-1",
|
| 387 |
+
"Prom-0-2",
|
| 388 |
+
"Prom-1-0",
|
| 389 |
+
"Prom-1-1",
|
| 390 |
+
"Prom-1-2",
|
| 391 |
+
"Prom-2-0",
|
| 392 |
+
"Prom-2-1",
|
| 393 |
+
"Prom-2-2",
|
| 394 |
+
]
|
| 395 |
+
cols[2].text(score_texts(v[my_cols], my_cols))
|
| 396 |
+
|
| 397 |
+
cols[3].markdown("**Signatures**")
|
| 398 |
+
my_cols = ["Sign-{0}".format(i) for i in range(10)]
|
| 399 |
+
cols[3].text(score_texts(v[my_cols], my_cols))
|
| 400 |
+
|
| 401 |
+
def convert_df(df):
|
| 402 |
+
return df.to_csv(index=False).encode("utf-8")
|
| 403 |
+
|
| 404 |
+
csv = convert_df(df)
|
| 405 |
+
|
| 406 |
+
st.download_button(
|
| 407 |
+
"Download as CSV", csv, "predictions.csv", "text/csv", key="download-csv"
|
| 408 |
+
)
|
| 409 |
+
|
| 410 |
+
else:
|
| 411 |
+
st.info(
|
| 412 |
+
"This tool expects fully functionalized fragments (FFF) as input, including the diazirine+alkyne probe (CRF). We have tailored the chemical space of the predictions to FFFs; the app will through an error if any of the input molecules does not contain a CRF region. Enamine provides a good [catalog](https://enamine.net/compound-libraries/fragment-libraries/fully-functionalized-probe-library) of FFFs. For a quick test input, use any of the options below."
|
| 413 |
+
)
|
| 414 |
+
|
| 415 |
+
example_0 = ["Z5645472552", "Z5645472643", "Z5645472785"]
|
| 416 |
+
st.markdown("**Input Enamine FFF identifiers...**")
|
| 417 |
+
st.text("\n".join(example_0))
|
| 418 |
+
|
| 419 |
+
example_1 = [
|
| 420 |
+
"C#CCCC1(CCCNC(=O)C(Cc2c[nH]c3ncccc23)NC(=O)OC(C)(C)C)N=N1",
|
| 421 |
+
"C#CCCC1(CCCNC(=O)[C@H]2CCC(=O)NC2)N=N1",
|
| 422 |
+
"C#CCCC1(CCCNC(=O)CSc2ncc(C(=O)OCC)c(N)n2)N=N1",
|
| 423 |
+
]
|
| 424 |
+
st.markdown("**Input FFF SMILES strings...**")
|
| 425 |
+
st.text("\n".join(example_1))
|
| 426 |
+
|
| 427 |
+
example_2 = ["C310", "C045", "C391"]
|
| 428 |
+
st.markdown("**Input Ligand Discovery identifiers...**")
|
| 429 |
+
st.text("\n".join(example_2))
|
| 430 |
+
|
| 431 |
+
example_3 = [
|
| 432 |
+
"Z5645486561",
|
| 433 |
+
"C#CCCCC1(CCCC(=O)N2CCC(C(C(=O)O)c3ccc(C)cc3)CC2)N=N1",
|
| 434 |
+
"C279",
|
| 435 |
+
]
|
| 436 |
+
st.markdown("**Input a mix of the above identifiers**")
|
| 437 |
+
st.text("\n".join(example_3))
|