Spaces:
Runtime error
Runtime error
Eachan Johnson commited on
Commit ·
6cf1162
1
Parent(s): fd0246d
Update examples
Browse files- app.py +4 -4
- example-data/examples.json +83 -33
- example-data/liu23-abau-1000.csv +0 -0
- example-data/liu23-abau.csv +0 -0
- example-data/stokes20-eco-1000.csv +0 -0
- example-data/stokes2020-eco.csv +0 -0
- example-data/wong24-sau-tox-1000.csv +0 -0
- example-data/wong24-sau-tox-5000.csv +0 -0
app.py
CHANGED
|
@@ -32,8 +32,8 @@ THEME = gr.themes.Default()
|
|
| 32 |
DEVICE = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
| 33 |
|
| 34 |
CACHE = "./cache"
|
| 35 |
-
MAX_ROWS =
|
| 36 |
-
BATCH_SIZE =
|
| 37 |
HEADER_FILE = os.path.join("sources", "header.md")
|
| 38 |
with open("repos.json", "r") as f:
|
| 39 |
MODEL_REPOS = json.load(f)
|
|
@@ -676,7 +676,7 @@ if __name__ == "__main__":
|
|
| 676 |
"\n".join(eg["strings"]),
|
| 677 |
"smiles",
|
| 678 |
eg["species"],
|
| 679 |
-
list(EXTRA_METRICS)[:
|
| 680 |
]
|
| 681 |
for eg in EXAMPLES["line input examples"]
|
| 682 |
],
|
|
@@ -732,7 +732,7 @@ if __name__ == "__main__":
|
|
| 732 |
"smiles",
|
| 733 |
eg["species"],
|
| 734 |
"",
|
| 735 |
-
list(EXTRA_METRICS)[:
|
| 736 |
] for eg in EXAMPLES["file examples"]
|
| 737 |
],
|
| 738 |
example_labels=[
|
|
|
|
| 32 |
DEVICE = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
| 33 |
|
| 34 |
CACHE = "./cache"
|
| 35 |
+
MAX_ROWS = 1000
|
| 36 |
+
BATCH_SIZE = 16
|
| 37 |
HEADER_FILE = os.path.join("sources", "header.md")
|
| 38 |
with open("repos.json", "r") as f:
|
| 39 |
MODEL_REPOS = json.load(f)
|
|
|
|
| 676 |
"\n".join(eg["strings"]),
|
| 677 |
"smiles",
|
| 678 |
eg["species"],
|
| 679 |
+
list(EXTRA_METRICS)[:3],
|
| 680 |
]
|
| 681 |
for eg in EXAMPLES["line input examples"]
|
| 682 |
],
|
|
|
|
| 732 |
"smiles",
|
| 733 |
eg["species"],
|
| 734 |
"",
|
| 735 |
+
list(EXTRA_METRICS)[:3],
|
| 736 |
] for eg in EXAMPLES["file examples"]
|
| 737 |
],
|
| 738 |
example_labels=[
|
example-data/examples.json
CHANGED
|
@@ -1,25 +1,47 @@
|
|
| 1 |
{
|
| 2 |
"line input examples": [
|
| 3 |
{
|
| 4 |
-
"label": "Y. pestis (plague) vs Ciprofloxacin, Ceftriaxone, Cefiderocol
|
| 5 |
"strings": [
|
| 6 |
"Ciprofloxacin: C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O",
|
| 7 |
"Ceftriaxone: CN1C(=NC(=O)C(=O)N1)SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N\\OC)/C4=CSC(=N4)N)SC2)C(=O)O",
|
| 8 |
"Cefiderocol: CC(C)(C(=O)O)O/N=C(/C1=CSC(=N1)N)\\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[N+]4(CCCC4)CCNC(=O)C5=C(C(=C(C=C5)O)O)Cl)C(=O)[O-]",
|
| 9 |
-
"Linezolid: CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F",
|
| 10 |
-
"Gepotidacin: C1CC2=CC(=NC=C2OC1)CNC3CCN(CC3)C[C@@H]4CN5C(=O)C=CC6=C5N4C(=O)C=N6"
|
| 11 |
],
|
| 12 |
"species": [
|
| 13 |
"Yersinia pestis"
|
| 14 |
]
|
| 15 |
},
|
| 16 |
{
|
| 17 |
-
"label": "S. aureus vs
|
| 18 |
"strings": [
|
| 19 |
-
"Doxorubicin: C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
|
| 20 |
"Ampicillin: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)C",
|
|
|
|
| 21 |
"Amoxicillin: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C",
|
| 22 |
-
"Meropenem: C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)N(C)C)C(=O)O)[C@@H](C)O"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 23 |
"Tetracycline: C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O",
|
| 24 |
"Anhydrotetracycline: CC1=C2C=CC=C(C2=C(C3=C1C[C@H]4[C@@H](C(=O)C(=C([C@]4(C3=O)O)O)C(=O)N)N(C)C)O)O"
|
| 25 |
],
|
|
@@ -28,43 +50,70 @@
|
|
| 28 |
]
|
| 29 |
},
|
| 30 |
{
|
| 31 |
-
"label": "E. coli
|
| 32 |
"strings": [
|
| 33 |
-
"Halicin: C1=C(SC(=N1)SC2=NN=C(S2)N)[N+](=O)[O-]",
|
| 34 |
-
"Abaucin: C1CN(CCC12C3=CC=CC=C3NC(=O)O2)CCC4=CC=C(C=C4)C(F)(F)F",
|
| 35 |
"Trimethoprim: COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N",
|
| 36 |
-
"Amikacin: CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N",
|
| 37 |
"Sulfamethoxazole: C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCN)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N",
|
| 38 |
-
"Isoniazid: C1=CN=CC=C1C(=O)NN"
|
| 39 |
],
|
| 40 |
"species": [
|
| 41 |
-
"Escherichia coli"
|
| 42 |
-
"Acinetobacter baumannii"
|
| 43 |
]
|
| 44 |
},
|
| 45 |
{
|
| 46 |
-
"label": "A. baumannii vs
|
| 47 |
"strings": [
|
| 48 |
-
"
|
| 49 |
-
"
|
| 50 |
-
"
|
| 51 |
-
"Plazomicin: C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H](CC=C(O3)CNCCO)N)N)NC(=O)[C@H](CCN)O)O",
|
| 52 |
-
"Gentamicin: CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)NC",
|
| 53 |
-
"Rifampicin: C[C@H]1/C=C/C=C(\\C(=O)NC2=C(C(=C3C(=C2O)C(=C(C4=C3C(=O)[C@](O4)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)/C=N/N5CCN(CC5)C)/CC"
|
| 54 |
],
|
| 55 |
"species": [
|
| 56 |
-
"
|
|
|
|
|
|
|
|
|
|
| 57 |
]
|
| 58 |
},
|
| 59 |
{
|
| 60 |
-
"label": "E. coli vs Debio-1452, Debio-1452-NH3, Fabimycin
|
| 61 |
"strings": [
|
| 62 |
"Debio-1452: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)CC4)N=C3",
|
| 63 |
"Debio-1452-NH3: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)[C@@H](C4)N)N=C3",
|
| 64 |
-
"Fabimycin: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)[C@H](CC4)[NH3+])N=C3.[Cl-]"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 65 |
"5-FU: C1=C(C(=O)NC(=O)N1)F",
|
| 66 |
"Carmofur: CCCCCCNC(=O)N1C=C(C(=O)NC1=O)F",
|
| 67 |
-
"Etoposide: C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 68 |
],
|
| 69 |
"species": [
|
| 70 |
"Escherichia coli"
|
|
@@ -85,7 +134,7 @@
|
|
| 85 |
]
|
| 86 |
},
|
| 87 |
{
|
| 88 |
-
"label": "K. pneumoniae vs CHIR-090, SCH79797, DBeQ, Tenovin-6, Pyrimethamine, Aminopterin",
|
| 89 |
"strings": [
|
| 90 |
"CHIR-090: C[C@H]([C@@H](C(=O)NO)NC(=O)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)CN3CCOCC3)O",
|
| 91 |
"SCH79797: CC(C)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)NC5CC5)N",
|
|
@@ -95,6 +144,7 @@
|
|
| 95 |
"Aminopterin: C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N"
|
| 96 |
],
|
| 97 |
"species": [
|
|
|
|
| 98 |
"Klebsiella pneumoniae"
|
| 99 |
]
|
| 100 |
}
|
|
@@ -102,20 +152,20 @@
|
|
| 102 |
"file examples": [
|
| 103 |
{
|
| 104 |
"label": "E. coli training data from Stokes J. et al., Cell (2020)",
|
| 105 |
-
"file": "example-data/stokes2020-eco.csv",
|
| 106 |
-
"column": "
|
| 107 |
"species": "Escherichia coli"
|
| 108 |
},
|
| 109 |
{
|
| 110 |
-
"label": "A. baumannii training data from Liu (2023)",
|
| 111 |
-
"file": "example-data/liu23-abau.csv",
|
| 112 |
-
"column": "
|
| 113 |
"species": "Acinetobacter baumannii"
|
| 114 |
},
|
| 115 |
{
|
| 116 |
-
"label": "S. aureus training data from Wong (2024)",
|
| 117 |
-
"file": "example-data/wong24-sau-tox-
|
| 118 |
-
"column": "
|
| 119 |
"species": "Staphylococcus aureus"
|
| 120 |
}
|
| 121 |
]
|
|
|
|
| 1 |
{
|
| 2 |
"line input examples": [
|
| 3 |
{
|
| 4 |
+
"label": "Y. pestis (plague) vs Ciprofloxacin, Ceftriaxone, Cefiderocol",
|
| 5 |
"strings": [
|
| 6 |
"Ciprofloxacin: C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O",
|
| 7 |
"Ceftriaxone: CN1C(=NC(=O)C(=O)N1)SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N\\OC)/C4=CSC(=N4)N)SC2)C(=O)O",
|
| 8 |
"Cefiderocol: CC(C)(C(=O)O)O/N=C(/C1=CSC(=N1)N)\\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[N+]4(CCCC4)CCNC(=O)C5=C(C(=C(C=C5)O)O)Cl)C(=O)[O-]",
|
|
|
|
|
|
|
| 9 |
],
|
| 10 |
"species": [
|
| 11 |
"Yersinia pestis"
|
| 12 |
]
|
| 13 |
},
|
| 14 |
{
|
| 15 |
+
"label": "E. coli, K. pneumoniae, & S. aureus vs Ampicillin, Linezolid, Amoxicillin, Meropenem",
|
| 16 |
"strings": [
|
|
|
|
| 17 |
"Ampicillin: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)C",
|
| 18 |
+
"Linezolid: CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F",
|
| 19 |
"Amoxicillin: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C",
|
| 20 |
+
"Meropenem: C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)N(C)C)C(=O)O)[C@@H](C)O"
|
| 21 |
+
],
|
| 22 |
+
"species": [
|
| 23 |
+
"Escherichia coli",
|
| 24 |
+
"Klebsiella pneumoniae",
|
| 25 |
+
"Staphylococcus aureus"
|
| 26 |
+
]
|
| 27 |
+
},
|
| 28 |
+
{
|
| 29 |
+
"label": "E. coli, P. aeruginosa, & S. aureus vs Gepotidacin, Murepavadin, Zosurabalpin, Plazomicin",
|
| 30 |
+
"strings": [
|
| 31 |
+
"Murepavadin: CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@@H]2C(=O)N3CCC[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC4=CNC5=CC=CC=C54)[C@@H](C)O)CO)C)CCN)CCN)CC6=CNC7=CC=CC=C76)CCN)CCN)CCCN)CCN",
|
| 32 |
+
"Gepotidacin: C1CC2=CC(=NC=C2OC1)CNC3CCN(CC3)C[C@@H]4CN5C(=O)C=CC6=C5N4C(=O)C=N6",
|
| 33 |
+
"Zosurabalpin: CN1[C@H](C(=O)NCC2=C(C=CC=C2SC3=C(CN[C@H](C(=O)N[C@H](C1=O)CCCCN)CCCN)C=CC=N3)C4=CC=C(C=C4)C(=O)O)CC5=CNC6=CC=CC=C65",
|
| 34 |
+
"Plazomicin: C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H](CC=C(O3)CNCCO)N)N)NC(=O)[C@H](CCN)O)O"
|
| 35 |
+
],
|
| 36 |
+
"species": [
|
| 37 |
+
"Escherichia coli",
|
| 38 |
+
"Pseudomonas aeruginosa",
|
| 39 |
+
"Staphylococcus aureus"
|
| 40 |
+
]
|
| 41 |
+
},
|
| 42 |
+
{
|
| 43 |
+
"label": "S. aureus vs Tetracycline, Anhydrotetracycline",
|
| 44 |
+
"strings": [
|
| 45 |
"Tetracycline: C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O",
|
| 46 |
"Anhydrotetracycline: CC1=C2C=CC=C(C2=C(C3=C1C[C@H]4[C@@H](C(=O)C(=C([C@]4(C3=O)O)O)C(=O)N)N(C)C)O)O"
|
| 47 |
],
|
|
|
|
| 50 |
]
|
| 51 |
},
|
| 52 |
{
|
| 53 |
+
"label": "E. coli & A. baumannii vs Trimethoprim, Sulfamethoxazole",
|
| 54 |
"strings": [
|
|
|
|
|
|
|
| 55 |
"Trimethoprim: COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N",
|
|
|
|
| 56 |
"Sulfamethoxazole: C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCN)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N",
|
|
|
|
| 57 |
],
|
| 58 |
"species": [
|
| 59 |
+
"Escherichia coli"
|
|
|
|
| 60 |
]
|
| 61 |
},
|
| 62 |
{
|
| 63 |
+
"label": "E. coli, A. baumannii, & S. aureus vs Halicin, Abaucin, Compound 1 (from Wong, 2024)",
|
| 64 |
"strings": [
|
| 65 |
+
"Halicin: C1=C(SC(=N1)SC2=NN=C(S2)N)[N+](=O)[O-]",
|
| 66 |
+
"Abaucin: C1CN(CCC12C3=CC=CC=C3NC(=O)O2)CCC4=CC=C(C=C4)C(F)(F)F",
|
| 67 |
+
"Compound 1: ClC1=CC(Cl)=CC=C1OCC(NC2=C(C(O)=O)C=CC(Cl)=C2)=O"
|
|
|
|
|
|
|
|
|
|
| 68 |
],
|
| 69 |
"species": [
|
| 70 |
+
"Escherichia coli",
|
| 71 |
+
"Acinetobacter baumannii",
|
| 72 |
+
"Staphylococcus aureus"
|
| 73 |
+
|
| 74 |
]
|
| 75 |
},
|
| 76 |
{
|
| 77 |
+
"label": "E. coli, P. aeruginosa & S. aureus vs Debio-1452, Debio-1452-NH3, Fabimycin",
|
| 78 |
"strings": [
|
| 79 |
"Debio-1452: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)CC4)N=C3",
|
| 80 |
"Debio-1452-NH3: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)[C@@H](C4)N)N=C3",
|
| 81 |
+
"Fabimycin: CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)[C@H](CC4)[NH3+])N=C3.[Cl-]"
|
| 82 |
+
],
|
| 83 |
+
"species": [
|
| 84 |
+
"Escherichia coli",
|
| 85 |
+
"Pseudomonas aeruginosa",
|
| 86 |
+
"Staphylococcus aureus"
|
| 87 |
+
]
|
| 88 |
+
},
|
| 89 |
+
{
|
| 90 |
+
"label": "E. coli, A. baumannii, K. pneumoniae, P. aeruginosa & S. aureus vs 6NDM, 6NDM-NH3",
|
| 91 |
+
"strings": [
|
| 92 |
+
"6NDM: CN1C(C=C(C)C2=CC3=C(N4C(C=C3C)=O)C(OCC4)=C12)=O",
|
| 93 |
+
"6NDM-NH3: CN1C(C=C(C)C2=CC3=C(N4C(C=C3C)=O)C(OCC4C[NH3+])=C12)=O",
|
| 94 |
+
],
|
| 95 |
+
"species": [
|
| 96 |
+
"Escherichia coli",
|
| 97 |
+
"Acinetobacter baumannii",
|
| 98 |
+
"Klebsiella pneumoniae",
|
| 99 |
+
"Pseudomonas aeruginosa",
|
| 100 |
+
"Staphylococcus aureus"
|
| 101 |
+
]
|
| 102 |
+
},
|
| 103 |
+
{
|
| 104 |
+
"label": "E. coli vs Doxorubicin, 5-FU, Carmofur, Etoposide, Bleomycin, Cyclophosphamide, Vincristine, Procarbazine, Oxaliplatin, Docetaxel, Gemcitabine",
|
| 105 |
+
"strings": [
|
| 106 |
+
"Doxorubicin: C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
|
| 107 |
"5-FU: C1=C(C(=O)NC(=O)N1)F",
|
| 108 |
"Carmofur: CCCCCCNC(=O)N1C=C(C(=O)NC1=O)F",
|
| 109 |
+
"Etoposide: C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O",
|
| 110 |
+
"Bleomycin: CC1=C(N=C(N=C1N)[C@H](CC(=O)N)NC[C@@H](C(=O)N)N)C(=O)N[C@@H]([C@H](C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)N[C@H](C)[C@H]([C@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCC[S+](C)C)O",
|
| 111 |
+
"Cyclophosphamide: C1CNP(=O)(OC1)N(CCCl)CCCl ",
|
| 112 |
+
"Vincristine: CC[C@@]1(C[C@@H]2C[C@@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O ",
|
| 113 |
+
"Procarbazine: CC(C)NC(=O)C1=CC=C(C=C1)CNNC",
|
| 114 |
+
"Oxaliplatin: C1CC[C@H]([C@@H](C1)[NH-])[NH-].C(=O)(C(=O)O)O.[Pt+2]",
|
| 115 |
+
"Docetaxel: CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)O",
|
| 116 |
+
"Gemcitabine: C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F"
|
| 117 |
],
|
| 118 |
"species": [
|
| 119 |
"Escherichia coli"
|
|
|
|
| 134 |
]
|
| 135 |
},
|
| 136 |
{
|
| 137 |
+
"label": "E. coli & K. pneumoniae vs CHIR-090, SCH79797, DBeQ, Tenovin-6, Pyrimethamine, Aminopterin",
|
| 138 |
"strings": [
|
| 139 |
"CHIR-090: C[C@H]([C@@H](C(=O)NO)NC(=O)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)CN3CCOCC3)O",
|
| 140 |
"SCH79797: CC(C)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)NC5CC5)N",
|
|
|
|
| 144 |
"Aminopterin: C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N"
|
| 145 |
],
|
| 146 |
"species": [
|
| 147 |
+
"Escherichia coli",
|
| 148 |
"Klebsiella pneumoniae"
|
| 149 |
]
|
| 150 |
}
|
|
|
|
| 152 |
"file examples": [
|
| 153 |
{
|
| 154 |
"label": "E. coli training data from Stokes J. et al., Cell (2020)",
|
| 155 |
+
"file": "example-data/stokes2020-eco-1000.csv",
|
| 156 |
+
"column": "smiles",
|
| 157 |
"species": "Escherichia coli"
|
| 158 |
},
|
| 159 |
{
|
| 160 |
+
"label": "A. baumannii training data from Liu G., Nature Chemical Biology (2023)",
|
| 161 |
+
"file": "example-data/liu23-abau-1000.csv",
|
| 162 |
+
"column": "smiles",
|
| 163 |
"species": "Acinetobacter baumannii"
|
| 164 |
},
|
| 165 |
{
|
| 166 |
+
"label": "S. aureus training data from Wong F., Nature (2024)",
|
| 167 |
+
"file": "example-data/wong24-sau-tox-1000.csv",
|
| 168 |
+
"column": "smiles",
|
| 169 |
"species": "Staphylococcus aureus"
|
| 170 |
}
|
| 171 |
]
|
example-data/liu23-abau-1000.csv
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
example-data/liu23-abau.csv
DELETED
|
The diff for this file is too large to render.
See raw diff
|
|
|
example-data/stokes20-eco-1000.csv
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
example-data/stokes2020-eco.csv
DELETED
|
The diff for this file is too large to render.
See raw diff
|
|
|
example-data/wong24-sau-tox-1000.csv
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
example-data/wong24-sau-tox-5000.csv
DELETED
|
The diff for this file is too large to render.
See raw diff
|
|
|