Add SMILES to Name conversion tab

README.md

@@ -0,0 +1,38 @@
+---
+title: RDKit API
+emoji: 🔬
+colorFrom: blue
+colorTo: green
+sdk: gradio
+sdk_version: "4.44.1"
+app_file: app.py
+pinned: false
+---
+
+# RDKit API
+
+This is a Hugging Face Space providing API access to various RDKit cheminformatics functions.
+
+## Endpoints
+
+- `POST /api/name_to_smiles` : Convert chemical name to SMILES
+- `POST /api/name_to_3d_molecule` : Generate 3D molecule visualization
+- `POST /api/smiles_to_mol` : Convert SMILES to canonical SMILES
+- `POST /api/molecular_weight` : Calculate molecular weight
+- `POST /api/logp` : Calculate logP (partition coefficient)
+- `POST /api/tpsa` : Calculate topological polar surface area
+- `POST /api/tpsa` : Calculate TPSA (topological polar surface area)
+- `POST /api/mol_image` : Generate 2D molecule image (returns PIL Image)
+
+## Usage
+
+To deploy on Hugging Face Spaces, upload this repository.
+
+For local testing, run:
+
+```bash
+pip install -r requirements.txt
+python app.py
+```
+
+The API endpoints can be accessed programmatically using the Gradio client or HTTP requests.

app.py

@@ -0,0 +1,200 @@
+import gradio as gr
+from rdkit import Chem
+from rdkit.Chem import Descriptors, Draw, AllChem
+import cirpy
+
+
+# RDKit API with multiple endpoints
+
+
+def _mol_from_smiles(smiles: str):
+    mol = Chem.MolFromSmiles(smiles)
+    if mol is None:
+        raise gr.Error("Invalid SMILES string.")
+    return mol
+
+
+def smiles_to_canonical(smiles: str) -> str:
+    mol = _mol_from_smiles(smiles)
+    return Chem.MolToSmiles(mol)
+
+
+def molecular_weight(smiles: str) -> float:
+    mol = _mol_from_smiles(smiles)
+    return float(Descriptors.MolWt(mol))
+
+
+def logp(smiles: str) -> float:
+    mol = _mol_from_smiles(smiles)
+    return float(Descriptors.MolLogP(mol))
+
+
+def tpsa(smiles: str) -> float:
+    mol = _mol_from_smiles(smiles)
+    return float(Descriptors.TPSA(mol))
+
+
+def mol_image(smiles: str):
+    mol = _mol_from_smiles(smiles)
+    return Draw.MolToImage(mol)
+
+
+def name_to_smiles(name: str) -> str:
+    """Convert chemical name to SMILES using Chemical Identifier Resolver (CIR)"""
+    try:
+        smiles = cirpy.resolve(name, 'smiles')
+        if smiles is None:
+            raise gr.Error(f"Could not find SMILES for chemical name: {name}")
+        return smiles
+    except Exception as e:
+        raise gr.Error(f"Error converting name to SMILES: {str(e)}")
+
+
+def smiles_to_name(smiles: str) -> str:
+    """Convert SMILES string to chemical name using Chemical Identifier Resolver (CIR)"""
+    try:
+        # First validate the SMILES
+        mol = _mol_from_smiles(smiles)
+        
+        # Try to resolve SMILES to a chemical name
+        name = cirpy.resolve(smiles, 'name')
+        if name is None:
+            # If no name found, return the canonical SMILES
+            return Chem.MolToSmiles(mol)
+        return name
+    except Exception as e:
+        raise gr.Error(f"Error converting SMILES to name: {str(e)}")
+
+
+def name_to_3d_molecule(name: str) -> str:
+    """Convert chemical name to 3D molecule visualization"""
+    try:
+        # Convert name to SMILES
+        smiles = cirpy.resolve(name, 'smiles')
+        if smiles is None:
+            raise gr.Error(f"Could not find SMILES for chemical name: {name}")
+
+        # Create molecule from SMILES
+        mol = Chem.MolFromSmiles(smiles)
+        if mol is None:
+            raise gr.Error(f"Could not create molecule from SMILES: {smiles}")
+
+        # Add hydrogens for better 3D structure
+        mol = Chem.AddHs(mol)
+
+        # Generate 3D coordinates
+        success = AllChem.EmbedMolecule(mol, AllChem.ETKDG())
+        if success == -1:
+            raise gr.Error(f"Could not generate 3D coordinates for: {name}")
+
+        # Optimize geometry
+        AllChem.MMFFOptimizeMolecule(mol)
+
+        # Convert to SDF format (contains 3D coordinates)
+        sdf_string = Chem.SDWriter.GetText(mol)
+
+        # Create HTML with embedded 3D viewer using 3Dmol.js
+        html_content = f"""
+        <!DOCTYPE html>
+        <html>
+        <head>
+            <script src="https://3dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
+        </head>
+        <body>
+            <div id="container" style="width: 400px; height: 400px; position: relative;"></div>
+            <script>
+                let viewer = $3Dmol.createViewer($("#container"));
+                let sdf = `{sdf_string}`;
+                viewer.addModel(sdf, "sdf");
+                viewer.setStyle({{'stick': {{}}}});
+                viewer.zoomTo();
+                viewer.render();
+            </script>
+        </body>
+        </html>
+        """
+
+        return html_content
+
+    except Exception as e:
+        raise gr.Error(f"Error creating 3D molecule: {str(e)}")
+
+
+smiles_interface = gr.Interface(
+    fn=smiles_to_canonical,
+    inputs=gr.Textbox(label="SMILES"),
+    outputs=gr.Textbox(label="Canonical SMILES"),
+    api_name="smiles_to_mol",
+    description="Convert an input SMILES string to its canonical form.",
+)
+
+smiles_to_name_interface = gr.Interface(
+    fn=smiles_to_name,
+    inputs=gr.Textbox(label="SMILES", placeholder="e.g., CC(=O)Oc1ccccc1C(=O)O"),
+    outputs=gr.Textbox(label="Chemical Name"),
+    api_name="smiles_to_name",
+    description="Convert a SMILES string to a chemical name.",
+    examples=[["CC(=O)Oc1ccccc1C(=O)O"], ["CN1C=NC2=C1C(=O)N(C(=O)N2C)C"], ["c1ccccc1"]],
+)
+
+name_interface = gr.Interface(
+    fn=name_to_smiles,
+    inputs=gr.Textbox(label="Chemical Name", placeholder="e.g., aspirin, caffeine, benzene"),
+    outputs=gr.Textbox(label="SMILES"),
+    api_name="name_to_smiles",
+    description="Convert a chemical name to SMILES notation.",
+    examples=[["aspirin"], ["caffeine"], ["benzene"], ["ethanol"]],
+)
+
+mw_interface = gr.Interface(
+    fn=molecular_weight,
+    inputs=gr.Textbox(label="SMILES"),
+    outputs=gr.Number(label="Molecular Weight (g/mol)"),
+    api_name="molecular_weight",
+    description="Compute the molecular weight from a SMILES string.",
+)
+
+logp_interface = gr.Interface(
+    fn=logp,
+    inputs=gr.Textbox(label="SMILES"),
+    outputs=gr.Number(label="logP"),
+    api_name="logp",
+    description="Calculate the octanol/water partition coefficient (logP).",
+)
+
+tpsa_interface = gr.Interface(
+    fn=tpsa,
+    inputs=gr.Textbox(label="SMILES"),
+    outputs=gr.Number(label="TPSA"),
+    api_name="tpsa",
+    description="Calculate the topological polar surface area (TPSA).",
+)
+
+molecule_3d_interface = gr.Interface(
+    fn=name_to_3d_molecule,
+    inputs=gr.Textbox(label="Chemical Name", placeholder="e.g., benzene, aspirin, caffeine"),
+    outputs=gr.HTML(label="3D Molecule Viewer"),
+    api_name="name_to_3d_molecule",
+    description="Convert a chemical name to an interactive 3D molecule visualization.",
+    examples=[["benzene"], ["aspirin"], ["caffeine"], ["ethanol"]],
+)
+
+
+demo = gr.TabbedInterface(
+    [name_interface, molecule_3d_interface, smiles_interface, smiles_to_name_interface, mw_interface, logp_interface, tpsa_interface],
+    [
+        "Name to SMILES",
+        "3D Molecule Viewer",
+        "SMILES to Canonical",
+        "SMILES to Name",
+        "Molecular Weight",
+        "LogP",
+        "TPSA",
+    ],
+    title="RDKit API",
+    css=".gradio-container {max-width: 800px; margin: auto;}",
+)
+
+
+if __name__ == "__main__":
+    demo.queue().launch(server_name="0.0.0.0", server_port=7860)

force_rebuild.txt

@@ -0,0 +1 @@
+# Force rebuild

requirements.txt

@@ -0,0 +1,5 @@
+# RDKit dependencies
+rdkit
+gradio==4.44.1
+huggingface_hub==0.19.4
+cirpy