wg25r commited on
Commit ·
ac549f4
1
Parent(s): a2d5af5
better GUI with gpt
Browse files
app.py
CHANGED
|
@@ -36,40 +36,47 @@ This app generates SMILES strings from images of molecules ball-and-stick models
|
|
| 36 |
col1, col2 = st.columns(2)
|
| 37 |
gen_strategy = col1.selectbox("Select a generative strategy", ("Beam Search", "Sampling", "Greedy Search"))
|
| 38 |
temp = col2.slider("Temperature", 0.0, 2.0, 1.0)
|
| 39 |
-
uploaded_file = st.file_uploader("Upload an image", type=["png", "jpg", "jpeg", "webp", "heic"])
|
| 40 |
|
| 41 |
-
lib = st.columns(2)
|
| 42 |
-
lib[0].markdown("Do not have an image? You can select a molecule from the library below.")
|
| 43 |
-
from_library = lib[1].button("Select from Library")
|
| 44 |
-
if from_library:
|
| 45 |
-
lib_modal()
|
| 46 |
|
| 47 |
-
|
| 48 |
-
if
|
|
|
|
|
|
|
| 49 |
col1.checkbox("Contribute To Public Library", value=True, help="If checked, images will be included in the PUBLIC library, and the image will be reviewed by our team and used for model training. When checked, do not upload any sensitive or personal data.")
|
| 50 |
else:
|
| 51 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 52 |
|
| 53 |
|
| 54 |
-
button =
|
| 55 |
if button:
|
| 56 |
if uploaded_file:
|
| 57 |
start_time = time.time()
|
| 58 |
image = Image.open(uploaded_file)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 59 |
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
img = Draw.MolToImage(m)
|
| 70 |
-
col.image(img, use_container_width=False)
|
| 71 |
-
pubchem_url = "https://pubchem.ncbi.nlm.nih.gov/compound/{}".format(cid[0].cid)
|
| 72 |
-
col.markdown("[PubChem]({})".format(pubchem_url))
|
| 73 |
|
| 74 |
-
|
| 75 |
-
|
|
|
|
| 36 |
col1, col2 = st.columns(2)
|
| 37 |
gen_strategy = col1.selectbox("Select a generative strategy", ("Beam Search", "Sampling", "Greedy Search"))
|
| 38 |
temp = col2.slider("Temperature", 0.0, 2.0, 1.0)
|
|
|
|
| 39 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 40 |
|
| 41 |
+
mode = st.radio("Select file source:", ["Upload File", "Choose from Our Demo Library"])
|
| 42 |
+
if mode == "Upload File":
|
| 43 |
+
st.session_state.pop("uploaded_file", None)
|
| 44 |
+
uploaded_file = st.file_uploader("Upload an image", type=["png", "jpg", "jpeg", "webp", "heic"])
|
| 45 |
col1.checkbox("Contribute To Public Library", value=True, help="If checked, images will be included in the PUBLIC library, and the image will be reviewed by our team and used for model training. When checked, do not upload any sensitive or personal data.")
|
| 46 |
else:
|
| 47 |
+
uploaded_file = None
|
| 48 |
+
from_library = st.button("Select from Library")
|
| 49 |
+
if from_library:
|
| 50 |
+
lib_modal()
|
| 51 |
+
if "uploaded_file" in st.session_state:
|
| 52 |
+
st.markdown("You have selected: {}".format(st.session_state.uploaded_file))
|
| 53 |
|
| 54 |
|
| 55 |
+
button = st.button("Submit")
|
| 56 |
if button:
|
| 57 |
if uploaded_file:
|
| 58 |
start_time = time.time()
|
| 59 |
image = Image.open(uploaded_file)
|
| 60 |
+
elif "uploaded_file" in st.session_state:
|
| 61 |
+
start_time = time.time()
|
| 62 |
+
image = Image.open("lib/{}".format(st.session_state.uploaded_file))
|
| 63 |
+
else:
|
| 64 |
+
st.error("Please upload an image or select from the library.")
|
| 65 |
+
st.stop()
|
| 66 |
+
|
| 67 |
+
options = ["CC(=O)OC1=CC=CC=C1C(=C)C(=O)O", "CC(=O)", "CC(=O)O", "CC(=O)C", "CC(=O)C1=CC=CC=C1"]
|
| 68 |
+
grid = [st.columns(2) for _ in range(len(options) // 3 + 1)]
|
| 69 |
+
cols = [col for row in grid for col in row]
|
| 70 |
|
| 71 |
+
for i, (smiles, col) in enumerate(zip(options, cols)):
|
| 72 |
+
cid = pcp.get_compounds(smiles, 'smiles')
|
| 73 |
+
name = cid[0].synonyms[0]
|
| 74 |
+
col.markdown(f"### {name}")
|
| 75 |
+
m = Chem.MolFromSmiles(smiles)
|
| 76 |
+
img = Draw.MolToImage(m)
|
| 77 |
+
col.image(img, use_container_width=False)
|
| 78 |
+
pubchem_url = "https://pubchem.ncbi.nlm.nih.gov/compound/{}".format(cid[0].cid)
|
| 79 |
+
col.markdown("[PubChem]({})".format(pubchem_url))
|
|
|
|
|
|
|
|
|
|
|
|
|
| 80 |
|
| 81 |
+
st.markdown("---")
|
| 82 |
+
st.markdown("Taken {} seconds".format(round(time.time() - start_time, 2)))
|