Update README.md

README.md

@@ -46,7 +46,7 @@ molecular embeddings from SMILES strings.
 
 - **Description:** Table of chemicals with their SMILES representations.
 - **Input format:**
-  - **Shape:** `[n, 2]`
+  - **Shape:** `[n, 2]`, where `n` is the number of chemical compounds
   - **Columns:**
     - `chem_name` *(str)*: Name of the molecule (e.g., *Halicin*).
     - `smiles` *(str)*: SMILES representation of the molecule (e.g.,`C1=C(SC(=N1)SC2=NN=C(S2)N)[N+](=O)[O-]`).
@@ -67,7 +67,7 @@ molecular embeddings from SMILES strings.
 
 - **Description:** For each compound, the model predicts growth inhibition scores for 40 different bacterial strains.
 - **Output format:** table
-  - **Shape:** `[n × 40, 2]`
+  - **Shape:** `[n × 40, 2]`, where `n` is the number of chemical compounds
   - **Columns:**
     - `pred_id` *(str)*: Combination of the molecule name and bacterial strain (e.g., `Halicin:Akkermansia muciniphila (NT5021)`).
     - `antimicrobial_predictive_probability` *(float)*: Predicted probability that the compound inhibits microbial growth.