| --- |
| license: apache-2.0 |
| tags: |
| - sentence-transformers |
| - cross-encoder |
| - reranker |
| - modchembert |
| - cheminformatics |
| - smiles |
| - generated_from_trainer |
| - dataset_size:3193917 |
| - loss:MultipleNegativesRankingLoss |
| base_model: Derify/ModChemBERT-IR-BASE |
| pipeline_tag: text-ranking |
| library_name: sentence-transformers |
| metrics: |
| - map |
| - mrr@10 |
| - ndcg@10 |
| co2_eq_emissions: |
| emissions: 3666.7922463213226 |
| energy_consumed: 17.863338649668595 |
| source: codecarbon |
| training_type: fine-tuning |
| on_cloud: false |
| cpu_model: AMD Ryzen 7 3700X 8-Core Processor |
| ram_total_size: 62.69877243041992 |
| hours_used: 29.477 |
| hardware_used: 2 x NVIDIA GeForce RTX 3090 |
| model-index: |
| - name: 'Derify/ChemRanker-alpha-qed-sim' |
| results: |
| - task: |
| type: cross-encoder-reranking |
| name: Cross Encoder Reranking |
| dataset: |
| name: Unknown |
| type: unknown |
| metrics: |
| - type: map |
| value: 0.4266379953496367 |
| name: Map |
| - type: mrr@10 |
| value: 0.6710111071325281 |
| name: Mrr@10 |
| - type: ndcg@10 |
| value: 0.6901091880496036 |
| name: Ndcg@10 |
| --- |
| |
| # Derify/ChemRanker-alpha-qed-sim |
|
|
| This [Cross Encoder](https://www.sbert.net/docs/cross_encoder/usage/usage.html) is finetuned from [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) using hard-negative triplets derived from [Derify/pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity). Positive SMILES pairs are first filtered by quality and similarity constraints, then reduced to one strongest positive target per anchor molecule to create a high-signal training set for reranking. The model computes relevance scores for pairs of SMILES strings, enabling SMILES reranking and molecular semantic search. |
|
|
| For this variant, the positives are selected with a composite ranking criterion that combines high QED and similarity without an additional similarity-contribution cutoff. The quality stage uses strict inequality filtering (`QED > 0.85`, `similarity > 0.5`, with similarity also bounded below 1.0), and then keeps the top-scoring pair per anchor molecule. |
|
|
| Hard negatives are mined with [Sentence Transformers](https://www.sbert.net/) using [Derify/ChemMRL-beta](https://huggingface.co/Derify/ChemMRL-beta) as the teacher model and a TopK-PercPos-style margin setting based on [NV-Retriever](https://arxiv.org/abs/2407.15831), with `relative_margin=0.05` and `max_negative_score_threshold = pos_score * percentage_margin`. Training uses triplet-format samples with 5 mined negatives per anchor-positive pair and optimizes a multiple-negatives ranking objective, while reranking evaluation uses n-tuple samples with 30 mined negatives per query. |
|
|
| ## Model Details |
|
|
| ### Model Description |
| - **Model Type:** Cross Encoder |
| - **Base model:** [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) <!-- at revision 1d8fd449edb3eadeaa5ebdd1c891e3ce95aebc3d --> |
| - **Maximum Sequence Length:** 512 tokens |
| - **Number of Output Labels:** 1 label |
| - **Training Dataset:** |
| - [Derify/pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) Mined Hard Negatives |
| - **License:** apache-2.0 |
|
|
| ### Model Sources |
|
|
| - **Documentation:** [Sentence Transformers Documentation](https://sbert.net) |
| - **Documentation:** [Cross Encoder Documentation](https://www.sbert.net/docs/cross_encoder/usage/usage.html) |
| - **Repository:** [Sentence Transformers on GitHub](https://github.com/huggingface/sentence-transformers) |
| - **Hugging Face:** [Cross Encoders on Hugging Face](https://huggingface.co/models?library=sentence-transformers&other=cross-encoder) |
|
|
| ## Usage |
|
|
| ### Direct Usage (Sentence Transformers) |
|
|
| First install the Transformers and Sentence Transformers libraries: |
|
|
| ```bash |
| pip install -U "transformers>=4.57.1,<5.0.0" |
| pip install -U sentence-transformers |
| ``` |
|
|
| Then you can load this model and run inference. |
| ```python |
| from sentence_transformers import CrossEncoder |
| |
| # Download from the 🤗 Hub |
| model = CrossEncoder("Derify/ChemRanker-alpha-qed-sim") |
| # Get scores for pairs of texts |
| pairs = [ |
| ['c1snnc1C[NH2+]Cc1cc2c(s1)CCC2', 'c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2'], |
| ['c1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2', 'O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1'], |
| ['c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCN2CCCC2C1', 'c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1'], |
| ['c1sc(CC[NH+]2CCOCC2)nc1C[NH2+]C1CC1', 'CCc1nc(C[NH2+]C2CC2)cs1'], |
| ['c1sc(CC2CCC[NH2+]2)nc1C1CCCO1', 'c1sc(CC2CCC[NH2+]2)nc1C1CCCC1'], |
| ] |
| scores = model.predict(pairs) |
| print(scores.shape) |
| # (5,) |
| |
| # Or rank different texts based on similarity to a single text |
| ranks = model.rank( |
| 'c1snnc1C[NH2+]Cc1cc2c(s1)CCC2', |
| [ |
| 'c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2', |
| 'O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1', |
| 'c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1', |
| 'CCc1nc(C[NH2+]C2CC2)cs1', |
| 'c1sc(CC2CCC[NH2+]2)nc1C1CCCC1', |
| ] |
| ) |
| # [{'corpus_id': ..., 'score': ...}, {'corpus_id': ..., 'score': ...}, ...] |
| ``` |
|
|
| <!-- |
| ### Direct Usage (Transformers) |
|
|
| <details><summary>Click to see the direct usage in Transformers</summary> |
|
|
| </details> |
| --> |
|
|
| <!-- |
| ### Downstream Usage (Sentence Transformers) |
|
|
| You can finetune this model on your own dataset. |
|
|
| <details><summary>Click to expand</summary> |
|
|
| </details> |
| --> |
|
|
| <!-- |
| ### Out-of-Scope Use |
|
|
| *List how the model may foreseeably be misused and address what users ought not to do with the model.* |
| --> |
|
|
| ## Evaluation |
|
|
| ### Metrics |
|
|
| #### Cross Encoder Reranking |
|
|
| * Evaluated with [<code>CrossEncoderRerankingEvaluator</code>](https://sbert.net/docs/package_reference/cross_encoder/evaluation.html#sentence_transformers.cross_encoder.evaluation.CrossEncoderRerankingEvaluator) with these parameters: |
| ```json |
| { |
| "at_k": 10 |
| } |
| ``` |
|
|
| | Metric | Value | |
| | :---------- | :--------- | |
| | map | 0.4266 | |
| | mrr@10 | 0.671 | |
| | **ndcg@10** | **0.6901** | |
|
|
| <!-- |
| ## Bias, Risks and Limitations |
|
|
| *What are the known or foreseeable issues stemming from this model? You could also flag here known failure cases or weaknesses of the model.* |
| --> |
|
|
| <!-- |
| ### Recommendations |
|
|
| *What are recommendations with respect to the foreseeable issues? For example, filtering explicit content.* |
| --> |
|
|
| ## Training Details |
|
|
| ### Training Dataset |
|
|
| #### GenMol Similarity Hard Negatives |
|
|
| * Dataset: GenMol Similarity Hard Negatives |
| * Size: 3,193,917 training samples |
| * Columns: <code>smiles_a</code>, <code>smiles_b</code>, and <code>negative</code> |
| * Approximate statistics based on the first 1000 samples: |
| | | smiles_a | smiles_b | negative | |
| | :------ | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | |
| | type | string | string | string | |
| | details | <ul><li>min: 19 characters</li><li>mean: 33.64 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 20 characters</li><li>mean: 34.24 characters</li><li>max: 48 characters</li></ul> | <ul><li>min: 19 characters</li><li>mean: 33.27 characters</li><li>max: 57 characters</li></ul> | |
| * Samples: |
| | smiles_a | smiles_b | negative | |
| | :---------------------------------------------- | :------------------------------------------------- | :------------------------------------------------- | |
| | <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>[NH3+]CCCc1cc2c(cc1C1CC1)OCO2</code> | |
| | <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>COc1cc2c(cc1C[NH2+]C1CCC1)OCO2</code> | |
| | <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>O=c1[nH]c2cc3c(cc2cc1CNC1CCCCC1)OCCO3</code> | |
| * Loss: [<code>MultipleNegativesRankingLoss</code>](https://sbert.net/docs/package_reference/cross_encoder/losses.html#multiplenegativesrankingloss) with these parameters: |
| ```json |
| { |
| "scale": 10.0, |
| "num_negatives": 4, |
| "activation_fn": "torch.nn.modules.activation.Sigmoid" |
| } |
| ``` |
|
|
| ### Evaluation Dataset |
|
|
| #### GenMol Similarity Hard Negatives |
|
|
| * Dataset: GenMol Similarity Hard Negatives |
| * Size: 165,968 evaluation samples |
| * Columns: <code>smiles_a</code>, <code>smiles_b</code>, <code>negative_1</code>, <code>negative_2</code>, <code>negative_3</code>, <code>negative_4</code>, <code>negative_5</code>, <code>negative_6</code>, <code>negative_7</code>, <code>negative_8</code>, <code>negative_9</code>, <code>negative_10</code>, <code>negative_11</code>, <code>negative_12</code>, <code>negative_13</code>, <code>negative_14</code>, <code>negative_15</code>, <code>negative_16</code>, <code>negative_17</code>, <code>negative_18</code>, <code>negative_19</code>, <code>negative_20</code>, <code>negative_21</code>, <code>negative_22</code>, <code>negative_23</code>, <code>negative_24</code>, <code>negative_25</code>, <code>negative_26</code>, <code>negative_27</code>, <code>negative_28</code>, <code>negative_29</code>, and <code>negative_30</code> |
| * Approximate statistics based on the first 1000 samples: |
| | | smiles_a | smiles_b | negative_1 | negative_2 | negative_3 | negative_4 | negative_5 | negative_6 | negative_7 | negative_8 | negative_9 | negative_10 | negative_11 | negative_12 | negative_13 | negative_14 | negative_15 | negative_16 | negative_17 | negative_18 | negative_19 | negative_20 | negative_21 | negative_22 | negative_23 | negative_24 | negative_25 | negative_26 | negative_27 | negative_28 | negative_29 | negative_30 | |
| | :------ | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :-------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | |
| | type | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | |
| | details | <ul><li>min: 17 characters</li><li>mean: 37.57 characters</li><li>max: 96 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 34.45 characters</li><li>max: 70 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.67 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 12 characters</li><li>mean: 35.13 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.28 characters</li><li>max: 81 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.36 characters</li><li>max: 73 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.12 characters</li><li>max: 70 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.09 characters</li><li>max: 84 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.16 characters</li><li>max: 64 characters</li></ul> | <ul><li>min: 13 characters</li><li>mean: 35.26 characters</li><li>max: 90 characters</li></ul> | <ul><li>min: 11 characters</li><li>mean: 35.16 characters</li><li>max: 90 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.36 characters</li><li>max: 74 characters</li></ul> | <ul><li>min: 12 characters</li><li>mean: 35.16 characters</li><li>max: 63 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.51 characters</li><li>max: 73 characters</li></ul> | <ul><li>min: 13 characters</li><li>mean: 35.21 characters</li><li>max: 69 characters</li></ul> | <ul><li>min: 10 characters</li><li>mean: 34.93 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.41 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.1 characters</li><li>max: 72 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.43 characters</li><li>max: 62 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.36 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.48 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.25 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.48 characters</li><li>max: 81 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.38 characters</li><li>max: 68 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.67 characters</li><li>max: 68 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.53 characters</li><li>max: 67 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.39 characters</li><li>max: 83 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.74 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.56 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 11 characters</li><li>mean: 35.37 characters</li><li>max: 64 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.51 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.35 characters</li><li>max: 72 characters</li></ul> | |
| * Samples: |
| | smiles_a | smiles_b | negative_1 | negative_2 | negative_3 | negative_4 | negative_5 | negative_6 | negative_7 | negative_8 | negative_9 | negative_10 | negative_11 | negative_12 | negative_13 | negative_14 | negative_15 | negative_16 | negative_17 | negative_18 | negative_19 | negative_20 | negative_21 | negative_22 | negative_23 | negative_24 | negative_25 | negative_26 | negative_27 | negative_28 | negative_29 | negative_30 | |
| | :--------------------------------------------------- | :---------------------------------------------------------- | :---------------------------------------------------------- | :---------------------------------------------------- | :------------------------------------------------- | :------------------------------------------ | :-------------------------------------------------- | :----------------------------------------- | :------------------------------------------------- | :--------------------------------------------------- | :---------------------------------------------------- | :------------------------------------------------- | :------------------------------------------------------- | :----------------------------------------------- | :------------------------------------------------------ | :------------------------------------------------ | :------------------------------------------------------ | :--------------------------------------------------- | :------------------------------------------------ | :----------------------------------------------- | :---------------------------------------------------- | :----------------------------------------------- | :----------------------------------------------------- | :-------------------------------------------------- | :----------------------------------------------------- | :------------------------------------------------- | :--------------------------------------------- | :--------------------------------------------------------- | :------------------------------------------------ | :--------------------------------------------------- | :------------------------------------------------------- | :----------------------------------------------- | |
| | <code>c1snnc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2</code> | <code>Cn1cc(C[NH2+]Cc2cc3c(s2)CCC3)nn1</code> | <code>Cn1cc(CC[NH2+]Cc2cc3c(s2)CCC3)nn1</code> | <code>Cc1cc(C[NH2+]Cc2csnn2)sc1C</code> | <code>NC(=O)c1csc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>Cc1cc(CC[NH2+]Cc2csnn2)sc1C</code> | <code>N#CCc1csc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>Ic1ccc(C[NH2+]Cc2cc3c(s2)CCC3)o1</code> | <code>c1ncc(C[NH2+]Cc2csnn2)s1</code> | <code>c1c(C[NH2+]CC2CC2)sc2c1CSCC2</code> | <code>N#Cc1cc(F)cc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>c1cc(C[NH2+]Cc2nc3c(s2)CCC3)no1</code> | <code>CCc1ccc(C[NH2+]Cc2csnn2)s1</code> | <code>NCc1csc(NCc2cc3c(s2)CCC3)n1</code> | <code>C[NH+](Cc1cscn1)Cc1nnc(-c2cc3c(s2)CCCC3)o1</code> | <code>Fc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1Br</code> | <code>FC(F)(F)C[NH2+]Cc1cc2c(s1)CCSC2</code> | <code>c1cc(C[NH2+]Cc2cc3c(s2)CCC3)c[nH]1</code> | <code>Cc1cc(C)c(CC[NH2+]Cc2cc3c(s2)CCC3)c(C)c1</code> | <code>Oc1ccc(C[NH2+]Cc2cc3c(s2)CCC3)cc1Br</code> | <code>O=C([O-])c1ccc(CC[NH2+]Cc2cc3c(s2)CCC3)s1</code> | <code>c1c(C[NH2+]CC2CCCC2)sc2c1CCC2</code> | <code>O=C([O-])c1ccc(C[NH2+]Cc2cc3c(s2)CCC3)s1</code> | <code>COc1cc(C)cc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>CCc1cnc(C[NH2+]Cc2csnn2)s1</code> | <code>Clc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1Br</code> | <code>c1c(C[NH2+]CC2CC2)sc2c1CCCCC2</code> | <code>Cc1ccccc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1cc(C[NH+]2CCCC2)sc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>Cc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1F</code> | |
| | <code>c1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2</code> | <code>O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1</code> | <code>Nc1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2</code> | <code>Nc1sc2c(c1-c1nc(C3CCC3)no1)CCCC2</code> | <code>c1c(-c2nc(C3CCCNC3)no2)sc2c1CCCCCC2</code> | <code>Nc1sccc1-c1nc(C2CCCOC2)no1</code> | <code>Nc1sc2c(c1-c1nc(C3CCCO3)no1)CCCC2</code> | <code>Cc1csc(-c2nc(C3CCOCC3)no2)c1N</code> | <code>Cc1oc2c(c1-c1nc(C3CCOC3)no1)C(=O)CCC2</code> | <code>c1c(-c2nc(C3C[NH2+]CCO3)no2)sc2c1CCCCC2</code> | <code>O=C([O-])Nc1sc2c(c1-c1nc(C3CC3)no1)CCCC2</code> | <code>c1cc2c(s1)CCCC2c1nc(C2CC2)no1</code> | <code>CC(=O)N1CCCC(c2noc(-c3cc4c(s3)CCCCCC4)n2)C1</code> | <code>Cc1cc(-c2nc([C@@H]3CCOC3)no2)c(N)s1</code> | <code>c1cc2c(nc1-c1noc(C3CCCOC3)n1)CCCC2</code> | <code>Nc1sccc1-c1nc(C2CCCC2)no1</code> | <code>c1cc2c(nc1-c1noc(C3CCOCC3)n1)CCCC2</code> | <code>[NH3+]C(c1noc(-c2cc3c(s2)CCCC3)n1)C1CC1</code> | <code>c1cc2c(c(-c3nc(C4CCOCC4)no3)c1)CCCN2</code> | <code>c1c(-c2nc(C3CC3)no2)nn2c1CCCC2</code> | <code>CN1CC(c2noc(-c3cc4c(s3)CCCC4)n2)CC1=O</code> | <code>O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1</code> | <code>Oc1c(-c2nc(C3CCC(F)(F)C3)no2)ccc2c1CCCC2</code> | <code>Cc1cc(=O)c(-c2noc(C3CCCOC3)n2)c2n1CCC2</code> | <code>O=C([O-])CNc1sc2c(c1-c1nc(C3CC3)no1)CCCC2</code> | <code>CC1CCc2c(sc(N)c2-c2nc(C3CC3)no2)C1</code> | <code>Cn1nc(-c2nc(C3CCCO3)no2)c2c1CCCC2</code> | <code>O=C(Nc1sc2c(c1-c1nc(C3CC3)no1)COCC2)C1=CCCCC1</code> | <code>Cc1cscc1-c1noc(C2CCOCC2)n1</code> | <code>CC1(C)CCCc2sc(N)c(-c3nc(C4CC4)no3)c21</code> | <code>Clc1cc2c(c(-c3nc(C4CCOC4)no3)c1)OCC2</code> | <code>Nc1sc2c(c1-c1nnc(C3CC3)o1)CCCC2</code> | |
| | <code>c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCN2CCCC2C1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1</code> | <code>CC(C)[NH2+]Cc1nc(C[NH+]2CCC3CCCCC3C2)cs1</code> | <code>CN1C2CCC1C[NH+](Cc1csc(C[NH3+])n1)CC2</code> | <code>Nc1nc(CC[NH+]2CCCN3CCCC3C2)cs1</code> | <code>CC1C[NH+](Cc2csc(C[NH2+]C3CC3)n2)CCN1C</code> | <code>Oc1csc(CN2CCCC3C[NH2+]CC32)n1</code> | <code>CCc1nc(C[NH+]2CCCC3CCCCC32)cs1</code> | <code>C[NH2+]Cc1csc(N2CC[NH+]3CCCC3C2)n1</code> | <code>[NH3+]Cc1nc(C[NH+]2CCC3CCCCC32)cs1</code> | <code>CC1CN2CCCCC2C[NH+]1Cc1csc(CC[NH3+])n1</code> | <code>CCCc1nc(CN2CCCC2C2CCC[NH2+]2)cs1</code> | <code>ClCCc1nc(CN2CCCC2C2CCC[NH2+]2)cs1</code> | <code>c1cc(C[NH2+]C2CC2)c(C[NH+]2CCN3CCCCC3C2)o1</code> | <code>O=C(Cc1nc(CCl)cs1)N1CCC[NH+]2CCCC2C1</code> | <code>N#CCc1nc(C[NH+]2CCCC3CCCCC32)cs1</code> | <code>CC[NH2+]Cc1csc(N2CCC3C(CCC[NH+]3C)C2)n1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCCCC1</code> | <code>[NH3+]Cc1nc(C[NH+]2CCCC2C2CCCC2)cs1</code> | <code>Cc1csc(C[NH+]2CCC3C[NH2+]CC3C2)n1</code> | <code>ClOCc1csc(C[NH+]2CC3C[NH2+]CC3C2)n1</code> | <code>c1cc(C[NH+]2CCCN3CCCC3C2)nc(C2CC2)n1</code> | <code>Cc1ccsc1C[NH2+]CCN1CCN2CCCC2C1</code> | <code>c1sc(C[NH2+]C2CCCC2)nc1C[NH+]1CCCCC1</code> | <code>Brc1csc(C[NH2+]CCN2CCN3CCCCC3C2)c1</code> | <code>Cc1nc(CCC[NH2+]C2CCN3CCCCC23)cs1</code> | <code>CCOC(=O)c1nc(CN2CC3CCC[NH2+]C3C2)cs1</code> | <code>CCCC(=O)c1nc(CN2CC3CCC[NH2+]C3C2)cs1</code> | <code>CC(C)(C)c1csc(CN2CCC[NH2+]C(C3CC3)C2)n1</code> | <code>COCc1nc(CN2CCC([NH3+])C2)cs1</code> | <code>CCC[NH2+]Cc1nc(C[NH+]2CC3CCC2C3)cs1</code> | |
| * Loss: [<code>MultipleNegativesRankingLoss</code>](https://sbert.net/docs/package_reference/cross_encoder/losses.html#multiplenegativesrankingloss) with these parameters: |
| ```json |
| { |
| "scale": 10.0, |
| "num_negatives": 4, |
| "activation_fn": "torch.nn.modules.activation.Sigmoid" |
| } |
| ``` |
|
|
| ### Training Hyperparameters |
| #### Non-Default Hyperparameters |
|
|
| - `eval_strategy`: epoch |
| - `per_device_train_batch_size`: 256 |
| - `per_device_eval_batch_size`: 256 |
| - `torch_empty_cache_steps`: 1000 |
| - `learning_rate`: 3e-05 |
| - `weight_decay`: 1e-05 |
| - `max_grad_norm`: None |
| - `lr_scheduler_type`: warmup_stable_decay |
| - `lr_scheduler_kwargs`: {'num_decay_steps': 6238, 'warmup_type': 'linear', 'decay_type': '1-sqrt'} |
| - `warmup_steps`: 6238 |
| - `seed`: 12 |
| - `data_seed`: 24681357 |
| - `bf16`: True |
| - `bf16_full_eval`: True |
| - `tf32`: True |
| - `dataloader_num_workers`: 8 |
| - `dataloader_prefetch_factor`: 2 |
| - `load_best_model_at_end`: True |
| - `optim`: stable_adamw |
| - `optim_args`: decouple_lr=True,max_lr=3e-05 |
| - `dataloader_persistent_workers`: True |
| - `resume_from_checkpoint`: False |
| - `gradient_checkpointing`: True |
| - `torch_compile`: True |
| - `torch_compile_backend`: inductor |
| - `torch_compile_mode`: max-autotune |
| - `eval_on_start`: True |
| - `batch_sampler`: no_duplicates |
| |
| #### All Hyperparameters |
| <details><summary>Click to expand</summary> |
| |
| - `overwrite_output_dir`: False |
| - `do_predict`: False |
| - `eval_strategy`: epoch |
| - `prediction_loss_only`: True |
| - `per_device_train_batch_size`: 256 |
| - `per_device_eval_batch_size`: 256 |
| - `per_gpu_train_batch_size`: None |
| - `per_gpu_eval_batch_size`: None |
| - `gradient_accumulation_steps`: 1 |
| - `eval_accumulation_steps`: None |
| - `torch_empty_cache_steps`: 1000 |
| - `learning_rate`: 3e-05 |
| - `weight_decay`: 1e-05 |
| - `adam_beta1`: 0.9 |
| - `adam_beta2`: 0.999 |
| - `adam_epsilon`: 1e-08 |
| - `max_grad_norm`: None |
| - `num_train_epochs`: 3 |
| - `max_steps`: -1 |
| - `lr_scheduler_type`: warmup_stable_decay |
| - `lr_scheduler_kwargs`: {'num_decay_steps': 6238, 'warmup_type': 'linear', 'decay_type': '1-sqrt'} |
| - `warmup_ratio`: 0.0 |
| - `warmup_steps`: 6238 |
| - `log_level`: passive |
| - `log_level_replica`: warning |
| - `log_on_each_node`: True |
| - `logging_nan_inf_filter`: True |
| - `save_safetensors`: True |
| - `save_on_each_node`: False |
| - `save_only_model`: False |
| - `restore_callback_states_from_checkpoint`: False |
| - `no_cuda`: False |
| - `use_cpu`: False |
| - `use_mps_device`: False |
| - `seed`: 12 |
| - `data_seed`: 24681357 |
| - `jit_mode_eval`: False |
| - `bf16`: True |
| - `fp16`: False |
| - `fp16_opt_level`: O1 |
| - `half_precision_backend`: auto |
| - `bf16_full_eval`: True |
| - `fp16_full_eval`: False |
| - `tf32`: True |
| - `local_rank`: 0 |
| - `ddp_backend`: None |
| - `tpu_num_cores`: None |
| - `tpu_metrics_debug`: False |
| - `debug`: [] |
| - `dataloader_drop_last`: True |
| - `dataloader_num_workers`: 8 |
| - `dataloader_prefetch_factor`: 2 |
| - `past_index`: -1 |
| - `disable_tqdm`: False |
| - `remove_unused_columns`: True |
| - `label_names`: None |
| - `load_best_model_at_end`: True |
| - `ignore_data_skip`: False |
| - `fsdp`: [] |
| - `fsdp_min_num_params`: 0 |
| - `fsdp_config`: {'min_num_params': 0, 'xla': False, 'xla_fsdp_v2': False, 'xla_fsdp_grad_ckpt': False} |
| - `fsdp_transformer_layer_cls_to_wrap`: None |
| - `accelerator_config`: {'split_batches': False, 'dispatch_batches': None, 'even_batches': True, 'use_seedable_sampler': True, 'non_blocking': False, 'gradient_accumulation_kwargs': None} |
| - `parallelism_config`: None |
| - `deepspeed`: None |
| - `label_smoothing_factor`: 0.0 |
| - `optim`: stable_adamw |
| - `optim_args`: decouple_lr=True,max_lr=3e-05 |
| - `adafactor`: False |
| - `group_by_length`: False |
| - `length_column_name`: length |
| - `project`: huggingface |
| - `trackio_space_id`: trackio |
| - `ddp_find_unused_parameters`: None |
| - `ddp_bucket_cap_mb`: None |
| - `ddp_broadcast_buffers`: False |
| - `dataloader_pin_memory`: True |
| - `dataloader_persistent_workers`: True |
| - `skip_memory_metrics`: True |
| - `use_legacy_prediction_loop`: False |
| - `push_to_hub`: False |
| - `resume_from_checkpoint`: False |
| - `hub_model_id`: None |
| - `hub_strategy`: every_save |
| - `hub_private_repo`: None |
| - `hub_always_push`: False |
| - `hub_revision`: None |
| - `gradient_checkpointing`: True |
| - `gradient_checkpointing_kwargs`: None |
| - `include_inputs_for_metrics`: False |
| - `include_for_metrics`: [] |
| - `eval_do_concat_batches`: True |
| - `fp16_backend`: auto |
| - `push_to_hub_model_id`: None |
| - `push_to_hub_organization`: None |
| - `mp_parameters`: |
| - `auto_find_batch_size`: False |
| - `full_determinism`: False |
| - `torchdynamo`: None |
| - `ray_scope`: last |
| - `ddp_timeout`: 1800 |
| - `torch_compile`: True |
| - `torch_compile_backend`: inductor |
| - `torch_compile_mode`: max-autotune |
| - `include_tokens_per_second`: False |
| - `include_num_input_tokens_seen`: no |
| - `neftune_noise_alpha`: None |
| - `optim_target_modules`: None |
| - `batch_eval_metrics`: False |
| - `eval_on_start`: True |
| - `use_liger_kernel`: False |
| - `liger_kernel_config`: None |
| - `eval_use_gather_object`: False |
| - `average_tokens_across_devices`: True |
| - `prompts`: None |
| - `batch_sampler`: no_duplicates |
| - `multi_dataset_batch_sampler`: proportional |
| - `router_mapping`: {} |
| - `learning_rate_mapping`: {} |
|
|
| </details> |
|
|
| ### Training Logs |
| | Epoch | Step | Training Loss | Validation Loss | ndcg@10 | |
| | :-----: | :-------: | :-----------: | :-------------: | :--------: | |
| | 0.0002 | 1 | 1.2724 | - | - | |
| | 0.1603 | 1000 | 0.1583 | - | - | |
| | 0.3206 | 2000 | 0.0196 | - | - | |
| | 0.4809 | 3000 | 0.0112 | - | - | |
| | 0.6412 | 4000 | 0.0079 | - | - | |
| | 0.8015 | 5000 | 0.0063 | - | - | |
| | 0.9618 | 6000 | 0.0053 | - | - | |
| | 1.0 | 6238 | - | 1.6835 | 0.6811 | |
| | 1.1222 | 7000 | 0.0045 | - | - | |
| | 1.2825 | 8000 | 0.0041 | - | - | |
| | 1.4428 | 9000 | 0.0037 | - | - | |
| | 1.6031 | 10000 | 0.0034 | - | - | |
| | 1.7634 | 11000 | 0.0032 | - | - | |
| | 1.9237 | 12000 | 0.003 | - | - | |
| | 2.0 | 12476 | - | 1.6853 | 0.6891 | |
| | 2.0840 | 13000 | 0.0028 | - | - | |
| | 2.2443 | 14000 | 0.0026 | - | - | |
| | 2.4046 | 15000 | 0.0026 | - | - | |
| | 2.5649 | 16000 | 0.0025 | - | - | |
| | 2.7252 | 17000 | 0.0024 | - | - | |
| | 2.8855 | 18000 | 0.0023 | - | - | |
| | **3.0** | **18714** | **-** | **1.6982** | **0.6901** | |
|
|
| * The bold row denotes the saved checkpoint. |
|
|
| ### Environmental Impact |
| Carbon emissions were measured using [CodeCarbon](https://github.com/mlco2/codecarbon). |
| - **Energy Consumed**: 17.863 kWh |
| - **Carbon Emitted**: 3.667 kg of CO2 |
| - **Hours Used**: 29.477 hours |
|
|
| ### Training Hardware |
| - **On Cloud**: No |
| - **GPU Model**: 2 x NVIDIA GeForce RTX 3090 |
| - **CPU Model**: AMD Ryzen 7 3700X 8-Core Processor |
| - **RAM Size**: 62.70 GB |
|
|
| ### Framework Versions |
| - Python: 3.13.7 |
| - Sentence Transformers: 5.1.2 |
| - Transformers: 4.57.1 |
| - PyTorch: 2.9.0+cu128 |
| - Accelerate: 1.11.0 |
| - Datasets: 4.4.1 |
| - Tokenizers: 0.22.1 |
|
|
| ## Citation |
|
|
| ### BibTeX |
|
|
| #### Sentence Transformers |
| ```bibtex |
| @inproceedings{reimers-2019-sentence-bert, |
| title = "Sentence-BERT: Sentence Embeddings using Siamese BERT-Networks", |
| author = "Reimers, Nils and Gurevych, Iryna", |
| booktitle = "Proceedings of the 2019 Conference on Empirical Methods in Natural Language Processing", |
| month = "11", |
| year = "2019", |
| publisher = "Association for Computational Linguistics", |
| url = "https://arxiv.org/abs/1908.10084", |
| } |
| ``` |
|
|
| #### NV-Retriever |
| ```bibtex |
| @misc{moreira2025nvretrieverimprovingtextembedding, |
| title={NV-Retriever: Improving text embedding models with effective hard-negative mining}, |
| author={Gabriel de Souza P. Moreira and Radek Osmulski and Mengyao Xu and Ronay Ak and Benedikt Schifferer and Even Oldridge}, |
| year={2025}, |
| eprint={2407.15831}, |
| archivePrefix={arXiv}, |
| primaryClass={cs.IR}, |
| url={https://arxiv.org/abs/2407.15831}, |
| } |
| ``` |
|
|
| <!-- |
| ## Glossary |
|
|
| *Clearly define terms in order to be accessible across audiences.* |
| --> |
|
|
| <!-- |
| ## Model Card Authors |
|
|
| *Lists the people who create the model card, providing recognition and accountability for the detailed work that goes into its construction.* |
| --> |
|
|
| <!-- |
| ## Model Card Contact |
|
|
| *Provides a way for people who have updates to the Model Card, suggestions, or questions, to contact the Model Card authors.* |
| --> |
|
|