|
|
--- |
|
|
license: mit |
|
|
--- |
|
|
This repository contains the model weights of the BERT model trained by predicting RDKit physio-chemical properties on 30% of the [GuacaMol](https://pubs.acs.org/doi/abs/10.1021/acs.jcim.8b00839) dataset. |
|
|
Further information can be found in our [publication](https://arxiv.org/abs/2503.03360). |
|
|
|
|
|
```python |
|
|
from transformers import AutoModel, AutoTokenizer |
|
|
|
|
|
mols = [ |
|
|
"CCOc1cc2nn(CCC(C)(C)O)cc2cc1NC(=O)c1cccc(C(F)F)n1", |
|
|
"CN(c1ncc(F)cn1)[C@H]1CCCNC1", |
|
|
"CC(C)(Oc1ccc(-c2cnc(N)c(-c3ccc(Cl)cc3)c2)cc1)C(=O)O", |
|
|
"CC(C)(O)CCn1cc2cc(NC(=O)c3cccc(C(F)(F)F)n3)c(C(C)(C)O)cc2n1", |
|
|
# ... |
|
|
] |
|
|
|
|
|
|
|
|
tokenizer = AutoTokenizer.from_pretrained("UdS-LSV/da4mt-mtr-30") |
|
|
model = AutoModel.from_pretrained("UdS-LSV/da4mt-mtr-30") |
|
|
|
|
|
inputs = tokenizer(mols, add_special_tokens=True, truncation=True, max_length=128, padding="max_length", return_tensors="pt") |
|
|
embeddings = model(**inputs).last_hidden_state[:, 0, :] |
|
|
``` |
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
### See also |
|
|
- https://huggingface.co/UdS-LSV/da4mt-mlm-30 |
|
|
- https://huggingface.co/UdS-LSV/da4mt-mlm-60 |
|
|
- https://huggingface.co/UdS-LSV/da4mt-mtr-60 |