message
stringlengths
2
433k
message_type
stringclasses
2 values
message_id
int64
0
1
conversation_id
int64
113
108k
cluster
float64
12
12
__index_level_0__
int64
226
217k
Provide tags and a correct Python 3 solution for this coding contest problem. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3].
instruction
0
64,235
12
128,470
Tags: combinatorics, dp, fft, math Correct Solution: ``` from functools import lru_cache import itertools def invnum(seq): N=len(seq) res=0 for i in range(N): for j in range(i+1,N): if seq[i]>seq[j]: res+=1 return res def naive(N,k,flag): res=0 for p in itertools.permutations(range(N),N): for q in itertools.permutations(range(N),N): if ((p<q) or (not(flag))) and (invnum(p)-invnum(q)>k): res+=1 return res n,mod=map(int,input().split()) memo=[[{},{}] for _ in range(n+1)] def solve(N,k,flag): if k in memo[N][flag]: return memo[N][flag][k] ''' 長さNの順列 invnum(p)-invnum(q)>kとなる場合の数 flag=True p<qの条件あり flag=False p<qの条件なし ''' if N==1: res=-1 if flag: res=0 else: if k<0: res=1 else: res=0 memo[N][flag][k]=res return res invnum_INF=(N*(N-1))//2 if k<-invnum_INF-1: res=solve(N,-invnum_INF-1,flag) memo[N][flag][k]=res return res if k>=invnum_INF: memo[N][flag][k]=0 return 0 res=0 for delta in range(-N+1,N): if flag and (delta>0): continue wt=min(N-delta,delta+N) res+=solve(N-1,k-delta,(delta==0)&flag)*wt res%=mod memo[N][flag][k]=res%mod return res%mod ans=solve(n,0,1)%mod print(ans) ```
output
1
64,235
12
128,471
Provide tags and a correct Python 3 solution for this coding contest problem. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3].
instruction
0
64,236
12
128,472
Tags: combinatorics, dp, fft, math Correct Solution: ``` import sys input = sys.stdin.readline def make_tree(n): i = 2 while True: if i >= n * 2: tree = [0] * i break else: i *= 2 return tree def update(i, x): i += len(tree) // 2 tree[i] = x i //= 2 while True: if i == 0: break tree[i] = tree[2 * i] + tree[2 * i + 1] i //= 2 return def get_sum(s, t): s += len(tree) // 2 t += len(tree) // 2 ans = 0 while True: if s > t: break if s % 2 == 0: s //= 2 else: ans += tree[s] s = (s + 1) // 2 if t % 2 == 1: t //= 2 else: ans += tree[t] t = (t - 1) // 2 return ans def prime_factorize(n): ans = [] for i in range(2, int(n ** (1 / 2)) + 1): while True: if n % i: break ans.append(i) n //= i if n == 1: break if not n == 1: ans.append(n) return ans def euler_func(n): p = set(prime_factorize(n)) x = n for i in p: x *= (i - 1) x //= i return x def f(a, b): ans = 1 for i in range(a + 1, b + 1): ans *= i ans %= mod return ans n, mod = map(int, input().split()) x = euler_func(mod) l = n + 5 fact = [1] * (l + 1) for i in range(1, l + 1): fact[i] = i * fact[i - 1] % mod if n <= 3: ans = 0 else: dp = [0] * 2000 dp[0], dp[1], dp[2], dp[3] = 1, 2, 2, 1 tree = make_tree(2005) for i in range(4): update(i, dp[i]) m = 3 ans = 0 for i in range(n - 3): dp0 = list(dp) ans0 = 0 for j in range(i + 3): for k in range(1, m + 2): ans0 += get_sum(j + k + 1, 2004) * dp0[k - 1] % mod ans0 %= mod dp[j + k] += dp0[k - 1] dp[j + k] %= mod update(j + k, dp[j + k]) m += i + 3 ans += f(i + 4, n) * ans0 % mod ans %= mod print(ans) ```
output
1
64,236
12
128,473
Provide tags and a correct Python 3 solution for this coding contest problem. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3].
instruction
0
64,237
12
128,474
Tags: combinatorics, dp, fft, math Correct Solution: ``` def solve(): n, mod = map(int, input().split());m = n*(n-1)//2;dp = [[0]*(n*(n-1)+1) for i in range(n+1)];dp1 = [[0]*(n*(n-1)+1) for i in range(n+1)];dp[1][m] = 1 for i in range(2, n+1): for x in range(m-(i-1)*(i-2)//2, m+(i-1)*(i-2)//2+1): for d in range(-i+1, i):dp[i][x+d] = (dp[i][x+d]+dp[i-1][x]*(i-abs(d))) % mod for i in range(2, n+1): for x in range(m-(i-1)*(i-2)//2, m+(i-1)*(i-2)//2+1):dp1[i][x] = dp1[i-1][x] * i % mod for x in range(m-(i-1)*(i-2)//2, m+(i-1)*(i-2)//2+1): for d in range(1, i):dp1[i][x-d] = (dp1[i][x-d]+dp[i-1][x]*(i-d)) % mod return sum(dp1[-1][m+1:]) % mod import sys;input = lambda: sys.stdin.readline().rstrip();print(solve()) ```
output
1
64,237
12
128,475
Provide tags and a correct Python 3 solution for this coding contest problem. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3].
instruction
0
64,238
12
128,476
Tags: combinatorics, dp, fft, math Correct Solution: ``` import sys sys.stderr = sys.stdout def egcd(a, b): r0 = a r1 = b s0 = 1 s1 = 0 t0 = 0 t1 = 1 while r1: q = r0 // r1 r0, r1 = r1, r0 - q*r1 s0, s1 = s1, s0 - q*s1 t0, t1 = t1, t0 - q*t1 return r0, s0 # def comb(n0, M): # C = [[None] * (i+1) for i in range(n0+1)] # C[0][0] = 1 # C[1][0] = C[1][1] = 1 # for n in range(2, n0+1): # Cp = C[n-1] # Cn = C[n] # Cn[0] = Cn[n] = 1 # for i in range(1, n): # Cn[i] = (Cp[i] + Cp[i-1]) % M # return C def tf(n, M): C = [0] * (n+1) C[n] = 1 for k in reversed(range(n)): C[k] = (C[k+1] * (k+1)) % M if not C[k]: break return C def app(n, M): K = [[[1]]] for i in range(n-1): Ki = K[i] ni = len(Ki) Ki_ = [[0] * (i+2) for _ in range(ni + i + 1)] K.append(Ki_) for j, Kij in enumerate(Ki): for k, v in enumerate(Kij): for h in range(i+1): Ki_[j+h][k] += v Ki_[j+h][k] %= M Ki_[j + i + 1][i+1] += v Ki_[j + i + 1][i+1] %= M # C = comb(n, M)[n] C = tf(n, M) s = 0 for i in range(1, n): Ki = K[i] ni = len(Ki) mi = len(Ki[0]) Si = [[None] * mi for _ in range(ni)] for j in range(ni): Si[j][mi-1] = Ki[j][mi-1] for k in reversed(range(mi-1)): Si[j][k] = (Ki[j][k] + Si[j][k+1]) % M for j in range(1, ni): for k in range(mi): Si[j][k] += Si[j-1][k] Si[j][k] %= M # log("i", i, "Ki", Ki, "Si", Si) si = 0 for j in range(1, ni): for k in range(mi-1): si += (Ki[j][k] * Si[j-1][k+1]) % M si %= M # log(" si", si) c = C[i+1] # log(" n", n, "k", i+1, "c", c) si *= c si %= M s += si s %= M return s def main(): n, m = readinti() print(app(n, m)) ########## def readint(): return int(input()) def readinti(): return map(int, input().split()) def readintt(): return tuple(readinti()) def readintl(): return list(readinti()) def readinttl(k): return [readintt() for _ in range(k)] def readintll(k): return [readintl() for _ in range(k)] def log(*args, **kwargs): print(*args, **kwargs, file=sys.__stderr__) if __name__ == '__main__': main() ```
output
1
64,238
12
128,477
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3]. Submitted Solution: ``` import sys input = sys.stdin.readline def make_tree(n): i = 2 while True: if i >= n * 2: tree = [0] * i break else: i *= 2 return tree def update(i, x): i += len(tree) // 2 tree[i] = x i //= 2 while True: if i == 0: break tree[i] = tree[2 * i] + tree[2 * i + 1] i //= 2 return def get_sum(s, t): s += len(tree) // 2 t += len(tree) // 2 ans = 0 while True: if s > t: break if s % 2 == 0: s //= 2 else: ans += tree[s] s = (s + 1) // 2 if t % 2 == 1: t //= 2 else: ans += tree[t] t = (t - 1) // 2 return ans n, mod = map(int, input().split()) l = n + 5 fact = [1] * (l + 1) for i in range(1, l + 1): fact[i] = i * fact[i - 1] % mod if n <= 3: ans = 0 else: dp = [0] * 2000 dp[0], dp[1], dp[2], dp[3] = 1, 2, 2, 1 tree = make_tree(2005) for i in range(4): update(i, dp[i]) m = 3 ans = 0 for i in range(n - 3): dp0 = list(dp) ans0 = 0 for j in range(i + 3): for k in range(1, m + 2): ans0 += get_sum(j + k + 1, 2004) * dp0[k - 1] % mod ans0 %= mod dp[j + k] += dp0[k - 1] dp[j + k] %= mod update(j + k, dp[j + k]) m += i + 3 ans += fact[n] * pow(fact[i + 4], mod - 2, mod) * ans0 % mod ans %= mod print(ans) ```
instruction
0
64,239
12
128,478
No
output
1
64,239
12
128,479
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3]. Submitted Solution: ``` import sys input = sys.stdin.readline def make_tree(n): i = 2 while True: if i >= n * 2: tree = [0] * i break else: i *= 2 return tree def update(i, x): i += len(tree) // 2 tree[i] = x i //= 2 while True: if i == 0: break tree[i] = tree[2 * i] + tree[2 * i + 1] i //= 2 return def get_sum(s, t): s += len(tree) // 2 t += len(tree) // 2 ans = 0 while True: if s > t: break if s % 2 == 0: s //= 2 else: ans += tree[s] s = (s + 1) // 2 if t % 2 == 1: t //= 2 else: ans += tree[t] t = (t - 1) // 2 return ans n, mod = map(int, input().split()) if n <= 3: ans = 0 else: dp = [0] * 2500 dp[0], dp[1], dp[2], dp[3] = 1, 2, 2, 1 tree = make_tree(2505) for i in range(4): update(i, dp[i]) m = 3 ans = 0 for i in range(n - 3): dp0 = list(dp) for j in range(i + 3): for k in range(1, m + 2): ans += get_sum(j + k + 1, 2504) * dp0[k - 1] % mod ans %= mod dp[j + k] += dp0[k - 1] dp[j + k] %= mod update(j + k, dp[j + k]) m += i + 3 print(ans) ```
instruction
0
64,240
12
128,480
No
output
1
64,240
12
128,481
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3]. Submitted Solution: ``` def divisors(M): d=[] i=1 while M>=i**2: if M%i==0: d.append(i) if i**2!=M: d.append(M//i) i=i+1 return d def popcount(x): x = x - ((x >> 1) & 0x55555555) x = (x & 0x33333333) + ((x >> 2) & 0x33333333) x = (x + (x >> 4)) & 0x0f0f0f0f x = x + (x >> 8) x = x + (x >> 16) return x & 0x0000007f def eratosthenes(n): res=[0 for i in range(n+1)] prime=set([]) for i in range(2,n+1): if not res[i]: prime.add(i) for j in range(1,n//i+1): res[i*j]=1 return prime def factorization(n): res=[] for p in prime: if n%p==0: while n%p==0: n//=p res.append(p) if n!=1: res.append(n) return res def euler_phi(n): res = n for x in range(2,n+1): if x ** 2 > n: break if n%x==0: res = res//x * (x-1) while n%x==0: n //= x if n!=1: res = res//n * (n-1) return res def ind(b,n): res=0 while n%b==0: res+=1 n//=b return res def isPrimeMR(n): d = n - 1 d = d // (d & -d) L = [2, 3, 5, 7, 11, 13, 17] for a in L: t = d y = pow(a, t, n) if y == 1: continue while y != n - 1: y = (y * y) % n if y == 1 or t == n - 1: return 0 t <<= 1 return 1 def findFactorRho(n): from math import gcd m = 1 << n.bit_length() // 8 for c in range(1, 99): f = lambda x: (x * x + c) % n y, r, q, g = 2, 1, 1, 1 while g == 1: x = y for i in range(r): y = f(y) k = 0 while k < r and g == 1: ys = y for i in range(min(m, r - k)): y = f(y) q = q * abs(x - y) % n g = gcd(q, n) k += m r <<= 1 if g == n: g = 1 while g == 1: ys = f(ys) g = gcd(abs(x - ys), n) if g < n: if isPrimeMR(g): return g elif isPrimeMR(n // g): return n // g return findFactorRho(g) def primeFactor(n): i = 2 ret = {} rhoFlg = 0 while i*i <= n: k = 0 while n % i == 0: n //= i k += 1 if k: ret[i] = k i += 1 + i % 2 if i == 101 and n >= 2 ** 20: while n > 1: if isPrimeMR(n): ret[n], n = 1, 1 else: rhoFlg = 1 j = findFactorRho(n) k = 0 while n % j == 0: n //= j k += 1 ret[j] = k if n > 1: ret[n] = 1 if rhoFlg: ret = {x: ret[x] for x in sorted(ret)} return ret def divisors(n): res = [1] prime = primeFactor(n) for p in prime: newres = [] for d in res: for j in range(prime[p]+1): newres.append(d*p**j) res = newres res.sort() return res def xorfactorial(num): if num==0: return 0 elif num==1: return 1 elif num==2: return 3 elif num==3: return 0 else: x=baseorder(num) return (2**x)*((num-2**x+1)%2)+function(num-2**x) def xorconv(n,X,Y): if n==0: res=[(X[0]*Y[0])%mod] return res x=[X[i]+X[i+2**(n-1)] for i in range(2**(n-1))] y=[Y[i]+Y[i+2**(n-1)] for i in range(2**(n-1))] z=[X[i]-X[i+2**(n-1)] for i in range(2**(n-1))] w=[Y[i]-Y[i+2**(n-1)] for i in range(2**(n-1))] res1=xorconv(n-1,x,y) res2=xorconv(n-1,z,w) former=[(res1[i]+res2[i])*inv for i in range(2**(n-1))] latter=[(res1[i]-res2[i])*inv for i in range(2**(n-1))] former=list(map(lambda x:x%mod,former)) latter=list(map(lambda x:x%mod,latter)) return former+latter def merge_sort(A,B): pos_A,pos_B = 0,0 n,m = len(A),len(B) res = [] while pos_A < n and pos_B < m: a,b = A[pos_A],B[pos_B] if a < b: res.append(a) pos_A += 1 else: res.append(b) pos_B += 1 res += A[pos_A:] res += B[pos_B:] return res class UnionFindVerSize(): def __init__(self, N): self._parent = [n for n in range(0, N)] self._size = [1] * N self.group = N def find_root(self, x): if self._parent[x] == x: return x self._parent[x] = self.find_root(self._parent[x]) stack = [x] while self._parent[stack[-1]]!=stack[-1]: stack.append(self._parent[stack[-1]]) for v in stack: self._parent[v] = stack[-1] return self._parent[x] def unite(self, x, y): gx = self.find_root(x) gy = self.find_root(y) if gx == gy: return self.group -= 1 if self._size[gx] < self._size[gy]: self._parent[gx] = gy self._size[gy] += self._size[gx] else: self._parent[gy] = gx self._size[gx] += self._size[gy] def get_size(self, x): return self._size[self.find_root(x)] def is_same_group(self, x, y): return self.find_root(x) == self.find_root(y) class WeightedUnionFind(): def __init__(self,N): self.parent = [i for i in range(N)] self.size = [1 for i in range(N)] self.val = [0 for i in range(N)] self.flag = True self.edge = [[] for i in range(N)] def dfs(self,v,pv): stack = [(v,pv)] new_parent = self.parent[pv] while stack: v,pv = stack.pop() self.parent[v] = new_parent for nv,w in self.edge[v]: if nv!=pv: self.val[nv] = self.val[v] + w stack.append((nv,v)) def unite(self,x,y,w): if not self.flag: return if self.parent[x]==self.parent[y]: self.flag = (self.val[x] - self.val[y] == w) return if self.size[self.parent[x]]>self.size[self.parent[y]]: self.edge[x].append((y,-w)) self.edge[y].append((x,w)) self.size[x] += self.size[y] self.val[y] = self.val[x] - w self.dfs(y,x) else: self.edge[x].append((y,-w)) self.edge[y].append((x,w)) self.size[y] += self.size[x] self.val[x] = self.val[y] + w self.dfs(x,y) class Dijkstra(): class Edge(): def __init__(self, _to, _cost): self.to = _to self.cost = _cost def __init__(self, V): self.G = [[] for i in range(V)] self._E = 0 self._V = V @property def E(self): return self._E @property def V(self): return self._V def add_edge(self, _from, _to, _cost): self.G[_from].append(self.Edge(_to, _cost)) self._E += 1 def shortest_path(self, s): import heapq que = [] d = [10**15] * self.V d[s] = 0 heapq.heappush(que, (0, s)) while len(que) != 0: cost, v = heapq.heappop(que) if d[v] < cost: continue for i in range(len(self.G[v])): e = self.G[v][i] if d[e.to] > d[v] + e.cost: d[e.to] = d[v] + e.cost heapq.heappush(que, (d[e.to], e.to)) return d #Z[i]:length of the longest list starting from S[i] which is also a prefix of S #O(|S|) def Z_algorithm(s): N = len(s) Z_alg = [0]*N Z_alg[0] = N i = 1 j = 0 while i < N: while i+j < N and s[j] == s[i+j]: j += 1 Z_alg[i] = j if j == 0: i += 1 continue k = 1 while i+k < N and k + Z_alg[k]<j: Z_alg[i+k] = Z_alg[k] k += 1 i += k j -= k return Z_alg class BIT(): def __init__(self,n,mod=0): self.BIT = [0]*(n+1) self.num = n self.mod = mod def query(self,idx): res_sum = 0 mod = self.mod while idx > 0: res_sum += self.BIT[idx] if mod: res_sum %= mod idx -= idx&(-idx) return res_sum #Ai += x O(logN) def update(self,idx,x): mod = self.mod while idx <= self.num: self.BIT[idx] += x if mod: self.BIT[idx] %= mod idx += idx&(-idx) return class dancinglink(): def __init__(self,n,debug=False): self.n = n self.debug = debug self._left = [i-1 for i in range(n)] self._right = [i+1 for i in range(n)] self.exist = [True for i in range(n)] def pop(self,k): if self.debug: assert self.exist[k] L = self._left[k] R = self._right[k] if L!=-1: if R!=self.n: self._right[L],self._left[R] = R,L else: self._right[L] = self.n elif R!=self.n: self._left[R] = -1 self.exist[k] = False def left(self,idx,k=1): if self.debug: assert self.exist[idx] res = idx while k: res = self._left[res] if res==-1: break k -= 1 return res def right(self,idx,k=1): if self.debug: assert self.exist[idx] res = idx while k: res = self._right[res] if res==self.n: break k -= 1 return res class SparseTable(): def __init__(self,A,merge_func,ide_ele): N=len(A) n=N.bit_length() self.table=[[ide_ele for i in range(n)] for i in range(N)] self.merge_func=merge_func for i in range(N): self.table[i][0]=A[i] for j in range(1,n): for i in range(0,N-2**j+1): f=self.table[i][j-1] s=self.table[i+2**(j-1)][j-1] self.table[i][j]=self.merge_func(f,s) def query(self,s,t): b=t-s+1 m=b.bit_length()-1 return self.merge_func(self.table[s][m],self.table[t-2**m+1][m]) class BinaryTrie: class node: def __init__(self,val): self.left = None self.right = None self.max = val def __init__(self): self.root = self.node(-10**15) def append(self,key,val): pos = self.root for i in range(29,-1,-1): pos.max = max(pos.max,val) if key>>i & 1: if pos.right is None: pos.right = self.node(val) pos = pos.right else: pos = pos.right else: if pos.left is None: pos.left = self.node(val) pos = pos.left else: pos = pos.left pos.max = max(pos.max,val) def search(self,M,xor): res = -10**15 pos = self.root for i in range(29,-1,-1): if pos is None: break if M>>i & 1: if xor>>i & 1: if pos.right: res = max(res,pos.right.max) pos = pos.left else: if pos.left: res = max(res,pos.left.max) pos = pos.right else: if xor>>i & 1: pos = pos.right else: pos = pos.left if pos: res = max(res,pos.max) return res def solveequation(edge,ans,n,m): #edge=[[to,dire,id]...] x=[0]*m used=[False]*n for v in range(n): if used[v]: continue y = dfs(v) if y!=0: return False return x def dfs(v): used[v]=True r=ans[v] for to,dire,id in edge[v]: if used[to]: continue y=dfs(to) if dire==-1: x[id]=y else: x[id]=-y r+=y return r class SegmentTree: def __init__(self, init_val, segfunc, ide_ele): n = len(init_val) self.segfunc = segfunc self.ide_ele = ide_ele self.num = 1 << (n - 1).bit_length() self.tree = [ide_ele] * 2 * self.num self.size = n for i in range(n): self.tree[self.num + i] = init_val[i] for i in range(self.num - 1, 0, -1): self.tree[i] = self.segfunc(self.tree[2 * i], self.tree[2 * i + 1]) def update(self, k, x): k += self.num self.tree[k] = x while k > 1: self.tree[k >> 1] = self.segfunc(self.tree[k], self.tree[k ^ 1]) k >>= 1 def query(self, l, r): if r==self.size: r = self.num res = self.ide_ele l += self.num r += self.num while l < r: if l & 1: res = self.segfunc(res, self.tree[l]) l += 1 if r & 1: res = self.segfunc(res, self.tree[r - 1]) l >>= 1 r >>= 1 return res def bisect_l(self,l,r,x): l += self.num r += self.num Lmin = -1 Rmin = -1 while l<r: if l & 1: if self.tree[l] <= x and Lmin==-1: Lmin = l l += 1 if r & 1: if self.tree[r-1] <=x: Rmin = r-1 l >>= 1 r >>= 1 if Lmin != -1: pos = Lmin while pos<self.num: if self.tree[2 * pos] <=x: pos = 2 * pos else: pos = 2 * pos +1 return pos-self.num elif Rmin != -1: pos = Rmin while pos<self.num: if self.tree[2 * pos] <=x: pos = 2 * pos else: pos = 2 * pos +1 return pos-self.num else: return -1 import sys,random,bisect from collections import deque,defaultdict from heapq import heapify,heappop,heappush from itertools import permutations from math import gcd,log input = lambda :sys.stdin.readline().rstrip() mi = lambda :map(int,input().split()) li = lambda :list(mi()) N,mod = mi() COMB = [[0 for j in range(N+1)] for i in range(N+1)] COMB[0][0] = 1 for i in range(1,N+1): COMB[i][0] = 1 for j in range(1,i+1): COMB[i][j] = COMB[i-1][j] + COMB[i-1][j-1] COMB[i][j] %= mod dp = [[0 for j in range(N*(N-1)//2+1)] for i in range(N+1)] dp[1][0] = 1 for i in range(2,N+1): for k in range(N*(N-1)//2+1): if not dp[i-1][k]: continue dp[i][k] += dp[i-1][k] dp[i][k] %= mod if k+i <= N*(N-1)//2: dp[i][k+i] -= dp[i-1][k] dp[i][k+i] %= mod for k in range(1,N*(N-1)//2+1): dp[i][k] += dp[i][k-1] dp[i][k] %= mod imos = [[dp[i][j] for j in range(N*(N-1)//2+1)] for i in range(N+1)] for i in range(1,N+1): for j in range(1,N*(N-1)//2+1): imos[i][j] += imos[i][j-1] imos[i][j] %= mod res = 0 for i in range(1,N): cnt = N - i inverse = [0 for inv in range(-(N-i+1),0)] for j in range(1,N-i+1): for k in range(j+1,N-i+2): inv = j-k inverse[inv] += 1 inverse[inv] %= mod for inv in range(-(N-i+1),0): for ip in range(cnt*(cnt-1)//2+1): if ip+inv <= 0: continue R = ip+inv-1 res += (COMB[N][i-1] * dp[cnt][ip] % mod) * (imos[cnt][R] * inverse[inv] % mod) res %= mod #for iq in range(cnt*(cnt-1)//2+1): #if ip-iq+inverse > 0: #res += COMB[N][i-1] * dp[cnt][ip] * dp[cnt][iq] #res %= mod print(res) ```
instruction
0
64,241
12
128,482
No
output
1
64,241
12
128,483
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. This is the easy version of the problem. The only difference between the easy version and the hard version is the constraints on n. You can only make hacks if both versions are solved. A permutation of 1, 2, …, n is a sequence of n integers, where each integer from 1 to n appears exactly once. For example, [2,3,1,4] is a permutation of 1, 2, 3, 4, but [1,4,2,2] isn't because 2 appears twice in it. Recall that the number of inversions in a permutation a_1, a_2, …, a_n is the number of pairs of indices (i, j) such that i < j and a_i > a_j. Let p and q be two permutations of 1, 2, …, n. Find the number of permutation pairs (p,q) that satisfy the following conditions: * p is lexicographically smaller than q. * the number of inversions in p is greater than the number of inversions in q. Print the number of such pairs modulo mod. Note that mod may not be a prime. Input The only line contains two integers n and mod (1≤ n≤ 50, 1≤ mod≤ 10^9). Output Print one integer, which is the answer modulo mod. Example Input 4 403458273 Output 17 Note The following are all valid pairs (p,q) when n=4. * p=[1,3,4,2], q=[2,1,3,4], * p=[1,4,2,3], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,3,4], * p=[1,4,3,2], q=[2,1,4,3], * p=[1,4,3,2], q=[2,3,1,4], * p=[1,4,3,2], q=[3,1,2,4], * p=[2,3,4,1], q=[3,1,2,4], * p=[2,4,1,3], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,2,4], * p=[2,4,3,1], q=[3,1,4,2], * p=[2,4,3,1], q=[3,2,1,4], * p=[2,4,3,1], q=[4,1,2,3], * p=[3,2,4,1], q=[4,1,2,3], * p=[3,4,1,2], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,2,3], * p=[3,4,2,1], q=[4,1,3,2], * p=[3,4,2,1], q=[4,2,1,3]. Submitted Solution: ``` import sys sys.stderr = sys.stdout def egcd(a, b): r0 = a r1 = b s0 = 1 s1 = 0 t0 = 0 t1 = 1 while r1: q = r0 // r1 r0, r1 = r1, r0 - q*r1 s0, s1 = s1, s0 - q*s1 t0, t1 = t1, t0 - q*t1 return r0, s0 def app(n, M): K = [[[1]]] for i in range(n-1): Ki = K[i] ni = len(Ki) Ki_ = [[0] * (i+2) for _ in range(ni + i + 1)] K.append(Ki_) for j, Kij in enumerate(Ki): for k, v in enumerate(Kij): for h in range(i+1): Ki_[j+h][k] += v Ki_[j+h][k] %= M Ki_[j + i + 1][i+1] += v Ki_[j + i + 1][i+1] %= M c = n s = 0 for i in range(1, n): Ki = K[i] ni = len(Ki) mi = len(Ki[0]) Si = [[None] * mi for _ in range(ni)] for j in range(ni): Si[j][mi-1] = Ki[j][mi-1] for k in reversed(range(mi-1)): Si[j][k] = (Ki[j][k] + Si[j][k+1]) % M for j in range(1, ni): for k in range(mi): Si[j][k] += Si[j-1][k] Si[j][k] %= M # log("i", i, "Ki", Ki, "Si", Si) si = 0 for j in range(1, ni): for k in range(mi-1): si += (Ki[j][k] * Si[j-1][k+1]) % M si %= M # log(" si", si) # log(" n", n, "i+1", i+1, "c", c) x, y = egcd(i+1, M) c = (c * y) % M # log(" x", x, "y", y) # assert c % x == 0 c = (c // x) % M c = (c * (n - i)) % M # log(" c", c) si *= c si %= M s += si s %= M return s def main(): n, m = readinti() print(app(n, m)) ########## def readint(): return int(input()) def readinti(): return map(int, input().split()) def readintt(): return tuple(readinti()) def readintl(): return list(readinti()) def readinttl(k): return [readintt() for _ in range(k)] def readintll(k): return [readintl() for _ in range(k)] def log(*args, **kwargs): print(*args, **kwargs, file=sys.__stderr__) if __name__ == '__main__': main() ```
instruction
0
64,242
12
128,484
No
output
1
64,242
12
128,485
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,272
12
128,544
Tags: implementation Correct Solution: ``` mat = [input().split(), input().split(), input().split(), input().split(), input().split()] m = 2 for x, a in enumerate(mat): if "1" in a: for y, b in enumerate(a): if b == "1": print(abs(x - m) + abs(y - m)) ```
output
1
64,272
12
128,545
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,273
12
128,546
Tags: implementation Correct Solution: ``` i=j=2 arr=[] for _ in range(5): arr.append(list(map(int,input().rstrip().split()))) flag=False for x in range(0,5): for y in range(0,5): if arr[x][y]==1: flag=True break if flag is True: break print(abs(x-i)+abs(y-j)) ```
output
1
64,273
12
128,547
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,275
12
128,550
Tags: implementation Correct Solution: ``` for i in range(5): ls=list(map(int,input().split())) if 1 in ls: print(abs(ls.index(1)-2)+abs(i-2)) ```
output
1
64,275
12
128,551
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,276
12
128,552
Tags: implementation Correct Solution: ``` a1,a2 = 0, 0 for i in range(5): l = list(map(int,input().split())) if 1 in l: a1 = i+1 a2 = l.index(1)+1 print(abs(3-a1)+abs(3-a2)) ```
output
1
64,276
12
128,553
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,277
12
128,554
Tags: implementation Correct Solution: ``` c=0 pos=0 for i in range(0,5): if pos!=0: break c=c+1 list1=list(map(int,input().split())) for i in range(0,len(list1)): if list1[i]==1: pos=i+1 break print(abs(3-c)+abs(3-pos)) ```
output
1
64,277
12
128,555
Provide tags and a correct Python 3 solution for this coding contest problem. You've got a 5 × 5 matrix, consisting of 24 zeroes and a single number one. Let's index the matrix rows by numbers from 1 to 5 from top to bottom, let's index the matrix columns by numbers from 1 to 5 from left to right. In one move, you are allowed to apply one of the two following transformations to the matrix: 1. Swap two neighboring matrix rows, that is, rows with indexes i and i + 1 for some integer i (1 ≤ i < 5). 2. Swap two neighboring matrix columns, that is, columns with indexes j and j + 1 for some integer j (1 ≤ j < 5). You think that a matrix looks beautiful, if the single number one of the matrix is located in its middle (in the cell that is on the intersection of the third row and the third column). Count the minimum number of moves needed to make the matrix beautiful. Input The input consists of five lines, each line contains five integers: the j-th integer in the i-th line of the input represents the element of the matrix that is located on the intersection of the i-th row and the j-th column. It is guaranteed that the matrix consists of 24 zeroes and a single number one. Output Print a single integer — the minimum number of moves needed to make the matrix beautiful. Examples Input 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 3 Input 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 Output 1
instruction
0
64,278
12
128,556
Tags: implementation Correct Solution: ``` for i in range(5): l = str(input()) if '1' in l: y=i+1 l=l.split() z=l.index('1') z=z+1 print(abs(3-y)+abs(3-z)) ```
output
1
64,278
12
128,557
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,414
12
128,828
Tags: greedy, implementation Correct Solution: ``` n = int(input()) b = list(map(int,input().split())) print(abs(b[0])+ sum([abs(b[i]-b[i-1]) for i in range(1,n)])) # Made By Mostafa_Khaled ```
output
1
64,414
12
128,829
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,415
12
128,830
Tags: greedy, implementation Correct Solution: ``` def array(bs): s = 0 k = 0 for b in bs: s += abs(b-k) k = b return s if __name__ == '__main__': n = int(input()) bs = tuple(map(int, input().split())) print(array(bs)) ```
output
1
64,415
12
128,831
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,416
12
128,832
Tags: greedy, implementation Correct Solution: ``` n=int(input()) value=0 ans=0 b=list(map(int,input().split())) i=0 while(i<n): if value==b[i]: i+=1 else: ans+=abs(value-b[i]) value=b[i] i+=1 print(ans) ```
output
1
64,416
12
128,833
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,417
12
128,834
Tags: greedy, implementation Correct Solution: ``` n = int(input()) arr = list(map(int, input().split())) count = 0 num = 0 for x in arr: if num != x: if num > x: sub = abs(num-x) count += sub num -= sub if num < x: add = abs(num-x) count += add num += add print(count) ```
output
1
64,417
12
128,835
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,418
12
128,836
Tags: greedy, implementation Correct Solution: ``` def vilbur(lst): a = [0] + lst count = 0 for i in range(len(a) - 1): count += abs(a[i + 1] - a[i]) return count n = int(input()) b = [int(j) for j in input().split()] print(vilbur(b)) ```
output
1
64,418
12
128,837
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,419
12
128,838
Tags: greedy, implementation Correct Solution: ``` n = int(input()) a = list(map(int,input().split())) ans = 0 for i in range(n): if i > 0: ans += abs(a[i]-a[i-1]) else: ans += abs(a[i]) print(ans) ```
output
1
64,419
12
128,839
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,420
12
128,840
Tags: greedy, implementation Correct Solution: ``` input() ans = int(0) curr = int(0) for x in input().split(): x = int(x) ans += abs(curr - x) curr = x print(ans) ```
output
1
64,420
12
128,841
Provide tags and a correct Python 3 solution for this coding contest problem. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1.
instruction
0
64,421
12
128,842
Tags: greedy, implementation Correct Solution: ``` import math,string,itertools,fractions,heapq,collections,re,array,bisect,sys,copy,functools import random sys.setrecursionlimit(10**7) inf = 10**20 eps = 1.0 / 10**10 mod = 10**9+7 dd = [(-1,0),(0,1),(1,0),(0,-1)] ddn = [(-1,0),(-1,1),(0,1),(1,1),(1,0),(1,-1),(0,-1),(-1,-1)] def LI(): return list(map(int, sys.stdin.readline().split())) def LLI(): return [list(map(int, l.split())) for l in sys.stdin.readlines()] def LI_(): return [int(x)-1 for x in sys.stdin.readline().split()] def LF(): return [float(x) for x in sys.stdin.readline().split()] def LS(): return sys.stdin.readline().split() def I(): return int(sys.stdin.readline()) def F(): return float(sys.stdin.readline()) def S(): return input() def pf(s): return print(s, flush=True) def pe(s): return print(str(s), file=sys.stderr) def main(): n = I() a = LI() r = abs(a[0]) for i in range(1,n): r += abs(a[i] - a[i-1]) return r print(main()) ```
output
1
64,421
12
128,843
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` if __name__ == "__main__": n = int( input() ) b = [ int(x) for x in input().split() ] res = abs(b[0]) for i in range(1,n): res += abs( b[i] - b[i-1] ) print( res ) ```
instruction
0
64,422
12
128,844
Yes
output
1
64,422
12
128,845
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n=int(input()) l=list(map(int,input().split())) t=0 for i in range(n): if(i==0): t=t+abs(l[i]) else: t=t+abs(l[i]-l[i-1]) print(t) ```
instruction
0
64,423
12
128,846
Yes
output
1
64,423
12
128,847
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` input() A = [0] + list(map(int, input().split())) print(sum(abs(a - b) for a, b in zip(A, A[1:]))) ```
instruction
0
64,424
12
128,848
Yes
output
1
64,424
12
128,849
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n=int(input()) x=list(map(int,input().split())) c=0 t=0 for i in x: c+=abs(t-i) t=i print(c) ```
instruction
0
64,425
12
128,850
Yes
output
1
64,425
12
128,851
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n = int(input()) b = [int(x) for x in input().split()] count = b[0] for i in range(1, n): count += abs(b[i]-b[i-1]) print(count) ```
instruction
0
64,426
12
128,852
No
output
1
64,426
12
128,853
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n=int(input()) r=[int(j) for j in input().split()] q=0 t=True ee=max(r) for j in range(1,n): if t==True: if r[j]>r[j-1]: q=q+1 else: if r[j]<r[j-1]: q=q+1 t=False else: if r[j]<r[j-1]: q=q+1 else: if r[j]>r[j-1]: q=q+1 t=True if q==0: print(ee) else: if ee>q+1: print(ee-(q+1)+ee) else: print(q+1) ```
instruction
0
64,427
12
128,854
No
output
1
64,427
12
128,855
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n = int(input()) l = list(map(int, input().split())) count = l[0] for i in range(n - 1): c = abs(l[i] - l[i + 1]) count += c print(count) ```
instruction
0
64,428
12
128,856
No
output
1
64,428
12
128,857
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. Wilbur the pig is tinkering with arrays again. He has the array a1, a2, ..., an initially consisting of n zeros. At one step, he can choose any index i and either add 1 to all elements ai, ai + 1, ... , an or subtract 1 from all elements ai, ai + 1, ..., an. His goal is to end up with the array b1, b2, ..., bn. Of course, Wilbur wants to achieve this goal in the minimum number of steps and asks you to compute this value. Input The first line of the input contains a single integer n (1 ≤ n ≤ 200 000) — the length of the array ai. Initially ai = 0 for every position i, so this array is not given in the input. The second line of the input contains n integers b1, b2, ..., bn ( - 109 ≤ bi ≤ 109). Output Print the minimum number of steps that Wilbur needs to make in order to achieve ai = bi for all i. Examples Input 5 1 2 3 4 5 Output 5 Input 4 1 2 2 1 Output 3 Note In the first sample, Wilbur may successively choose indices 1, 2, 3, 4, and 5, and add 1 to corresponding suffixes. In the second sample, Wilbur first chooses indices 1 and 2 and adds 1 to corresponding suffixes, then he chooses index 4 and subtract 1. Submitted Solution: ``` n=int(input()) l=list(map(int,input().split())) a=max(l) b=l.count(a) print(a+b-1) ```
instruction
0
64,429
12
128,858
No
output
1
64,429
12
128,859
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. One day, ZS the Coder wrote down an array of integers a with elements a1, a2, ..., an. A subarray of the array a is a sequence al, al + 1, ..., ar for some integers (l, r) such that 1 ≤ l ≤ r ≤ n. ZS the Coder thinks that a subarray of a is beautiful if the bitwise xor of all the elements in the subarray is at least k. Help ZS the Coder find the number of beautiful subarrays of a! Input The first line contains two integers n and k (1 ≤ n ≤ 106, 1 ≤ k ≤ 109) — the number of elements in the array a and the value of the parameter k. The second line contains n integers ai (0 ≤ ai ≤ 109) — the elements of the array a. Output Print the only integer c — the number of beautiful subarrays of the array a. Examples Input 3 1 1 2 3 Output 5 Input 3 2 1 2 3 Output 3 Input 3 3 1 2 3 Output 2 Submitted Solution: ``` import sys import math import itertools as it import operator as op import fractions as fr n,k = map(int, sys.stdin.readline().split()) A = list(map(int, sys.stdin.readline().split())) Ap = [0 for _ in range(n)] r = len(list(filter(lambda e: e >= k, A))) print(A) for i in range(1,n): App,Ap = Ap, A A = [0 for _ in range(n)] for j in range(i,n): A[j] = Ap[j-1] ^ Ap[j] ^ App[j-1] r += len(list(filter(lambda e: e >= k, A))) print(A) print(r) ```
instruction
0
64,462
12
128,924
No
output
1
64,462
12
128,925
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. One day, ZS the Coder wrote down an array of integers a with elements a1, a2, ..., an. A subarray of the array a is a sequence al, al + 1, ..., ar for some integers (l, r) such that 1 ≤ l ≤ r ≤ n. ZS the Coder thinks that a subarray of a is beautiful if the bitwise xor of all the elements in the subarray is at least k. Help ZS the Coder find the number of beautiful subarrays of a! Input The first line contains two integers n and k (1 ≤ n ≤ 106, 1 ≤ k ≤ 109) — the number of elements in the array a and the value of the parameter k. The second line contains n integers ai (0 ≤ ai ≤ 109) — the elements of the array a. Output Print the only integer c — the number of beautiful subarrays of the array a. Examples Input 3 1 1 2 3 Output 5 Input 3 2 1 2 3 Output 3 Input 3 3 1 2 3 Output 2 Submitted Solution: ``` class Trie(object): def __init__(self): self.size = [0, 0] self.child = [None, None] def add(self, bit: int, d: int): node = self digit = 1 << d while digit > 1: b = (1 if bit & digit else 0) if not node.child[b]: node.child[b] = Trie() node.size[b] += 1 node = node.child[b] digit >>= 1 node.size[bit & 1] += 1 if __name__ == '__main__': import sys n, k = map(int, sys.stdin.buffer.readline().decode('utf-8').split()) a = list(map(int, sys.stdin.buffer.readline().decode('utf-8').split())) trie = Trie() trie.add(0, 29) acc, ans = 0, 0 for x in a: node = trie acc ^= x digit = 1 << 29 mask, req = 0, 0 while digit and node: mask |= digit if ((acc ^ req) & mask | digit) >= k: ans += node.size[0 if (acc & digit) else 1] node = node.child[1 if (acc & digit) else 0] req |= (acc & digit) else: node = node.child[1 if (acc & digit) else 0] req |= (acc & digit) ^ digit digit >>= 1 trie.add(acc, 29) print(ans) ```
instruction
0
64,463
12
128,926
No
output
1
64,463
12
128,927
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. One day, ZS the Coder wrote down an array of integers a with elements a1, a2, ..., an. A subarray of the array a is a sequence al, al + 1, ..., ar for some integers (l, r) such that 1 ≤ l ≤ r ≤ n. ZS the Coder thinks that a subarray of a is beautiful if the bitwise xor of all the elements in the subarray is at least k. Help ZS the Coder find the number of beautiful subarrays of a! Input The first line contains two integers n and k (1 ≤ n ≤ 106, 1 ≤ k ≤ 109) — the number of elements in the array a and the value of the parameter k. The second line contains n integers ai (0 ≤ ai ≤ 109) — the elements of the array a. Output Print the only integer c — the number of beautiful subarrays of the array a. Examples Input 3 1 1 2 3 Output 5 Input 3 2 1 2 3 Output 3 Input 3 3 1 2 3 Output 2 Submitted Solution: ``` import sys import math import itertools as it import operator as op import fractions as fr n,k = map(int, sys.stdin.readline().split()) A = list(map(int, sys.stdin.readline().split())) Ap = [0 for _ in range(n)] r = len(list(filter(lambda e: e >= k, A))) for i in range(1,n): App,Ap = Ap, A A = [0 for _ in range(n)] for j in range(i,n): A[i] = Ap[i-1] ^ Ap[i] ^ App[i-1] r += len(list(filter(lambda e: e >= k, A))) print(r) ```
instruction
0
64,464
12
128,928
No
output
1
64,464
12
128,929
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. One day, ZS the Coder wrote down an array of integers a with elements a1, a2, ..., an. A subarray of the array a is a sequence al, al + 1, ..., ar for some integers (l, r) such that 1 ≤ l ≤ r ≤ n. ZS the Coder thinks that a subarray of a is beautiful if the bitwise xor of all the elements in the subarray is at least k. Help ZS the Coder find the number of beautiful subarrays of a! Input The first line contains two integers n and k (1 ≤ n ≤ 106, 1 ≤ k ≤ 109) — the number of elements in the array a and the value of the parameter k. The second line contains n integers ai (0 ≤ ai ≤ 109) — the elements of the array a. Output Print the only integer c — the number of beautiful subarrays of the array a. Examples Input 3 1 1 2 3 Output 5 Input 3 2 1 2 3 Output 3 Input 3 3 1 2 3 Output 2 Submitted Solution: ``` def sort(a,p,r): if(p==r): return [a[p]] elif(r>p): q,a=partition(a,p,r) return sort(a,p,q-1)+[a[q]]+sort(a,q+1,r) def partition(a,p,r): c=a[r] j=p-1 for i in range(p,r): if(a[i]<=c): j=j+1 a[j],a[i]=a[i],a[j] a[j+1],a[r]=a[r],a[j+1] return j+1,a def find(k,e,f,g,h): l=[] r=[] for i in range(len(e)): r.append(e[i]) for i in range(len(g)): r.append(r[len(e)-1] ^ g[i]) for i in range(len(h)): l.append(h[i]) x=h[0] for i in range(len(f)): l.insert(0,x ^ f[len(f)-i-1]) rt=0 #print(l[len(e):len(l)]) for i in range(len(e),len(r)): if(r[i]>=k): rt=rt+1 #print(r[0:len(f)]) lt=0 for i in range(1,len(f)): if(l[i]>=k): lt=lt+1 s=0 for i in range(len(g)): for j in range(len(f)): if(g[i]^f[j]>=k): s=s+1 return s,r,l """ a=sort(sl,0,len(sl)-1) b=sort(su,0,len(su)-1) i=j=0 s=None while(i<len(a) and j<len(b)): if(a[i]+b[j]>=k): s=[i,j] break if(i==len(a)-1): i=i+1 elif(j==len(b)-1): j=j+1 elif(a[i]<=b[j]): i=i+1 else: j=j+1 if(s==None): return 0 else: return (len(a)-s[0])*(len(b)-s[1]) """ def subarray(a,p,r,k): if(p==r): if(a[p]>=k): return 1,[a[p]],[a[p]] else: return 0,[a[p]],[a[p]] q=int((p+r)/2) l,e,f=subarray(a,p,q,k) m,g,h=subarray(a,q+1,r,k) x,j,t=find(k,e,f,g,h) return l+m+x,j,t #print(0 ^ 0) #u=[1,2,3,4] #print(u[1:3]) x=input().split() y=input().split() x=[int(n) for n in x] y=[int(n) for n in y] #print(find([1,2],0,1,1,[1],[1],[2],[2])) print(subarray(y,0,len(y)-1,x[1])) #print(1 ^ 2 ^ 3) ```
instruction
0
64,465
12
128,930
No
output
1
64,465
12
128,931
Provide a correct Python 3 solution for this coding contest problem. You are given integers N, K, and an integer sequence A of length M. An integer sequence where each element is between 1 and K (inclusive) is said to be colorful when there exists a contiguous subsequence of length K of the sequence that contains one occurrence of each integer between 1 and K (inclusive). For every colorful integer sequence of length N, count the number of the contiguous subsequences of that sequence which coincide with A, then find the sum of all the counts. Here, the answer can be extremely large, so find the sum modulo 10^9+7. Constraints * 1 \leq N \leq 25000 * 1 \leq K \leq 400 * 1 \leq M \leq N * 1 \leq A_i \leq K * All values in input are integers. Input Input is given from Standard Input in the following format: N K M A_1 A_2 ... A_M Output For every colorful integer sequence of length N, count the number of the contiguous subsequences of that sequence which coincide with A, then print the sum of all the counts modulo 10^9+7. Examples Input 3 2 1 1 Output 9 Input 4 2 2 1 2 Output 12 Input 7 4 5 1 2 3 1 2 Output 17 Input 5 4 3 1 1 1 Output 0 Input 10 3 5 1 1 2 3 3 Output 1458 Input 25000 400 4 3 7 31 127 Output 923966268 Input 9954 310 12 267 193 278 294 6 63 86 166 157 193 168 43 Output 979180369
instruction
0
64,655
12
129,310
"Correct Solution: ``` MOD = 10 ** 9 + 7 n, k, m = map(int, input().split()) a = list(map(int, input().split())) def include_perm(a): for i in range(m - k + 1): seen = [False] * (k + 1) for j in range(i, i + k): if seen[a[j]]: break seen[a[j]] = True else: return True return False def unique_len(a): seen = [False] * (k+1) ans = 0 for ai in a: if seen[ai]: break seen[ai] = True ans += 1 return ans if unique_len(a) < m: dp_fw = [[0] * k for _ in range(n-m+1)] dp_bw = [[0] * k for _ in range(n-m+1)] if not include_perm(a): dp_fw[0][unique_len(reversed(a))] = 1 dp_bw[0][unique_len(a)] = 1 for i in range(n-m): for j in range(k): dp_fw[i+1][j] = dp_fw[i][j] dp_bw[i+1][j] = dp_bw[i][j] for j in range(k-2, 0, -1): dp_fw[i+1][j] += dp_fw[i+1][j+1] dp_fw[i+1][j] %= MOD dp_bw[i+1][j] += dp_bw[i+1][j+1] dp_bw[i+1][j] %= MOD for j in range(k-1): dp_fw[i+1][j+1] += dp_fw[i][j] * (k-j) dp_fw[i+1][j] %= MOD dp_bw[i+1][j+1] += dp_bw[i][j] * (k-j) dp_bw[i+1][j] %= MOD ans = 0 tot = pow(k, n-m, MOD) for i in range(n-m+1): lcnt = i rcnt = n - m - i t = tot - sum(dp_fw[rcnt]) * sum(dp_bw[lcnt]) ans = (ans + t) % MOD print(ans) else: dp = [[0] * k for _ in range(n+1)] dp2 = [[0] * k for _ in range(n+1)] dp[0][0] = 1 for i in range(n): for j in range(1, k): dp[i+1][j] = dp[i][j] dp2[i+1][j] = dp2[i][j] for j in range(k-2, 0, -1): dp[i+1][j] += dp[i+1][j+1] dp[i+1][j] %= MOD dp2[i+1][j] += dp2[i+1][j+1] dp2[i+1][j] %= MOD for j in range(k-1): dp[i+1][j+1] += dp[i][j] * (k-j) dp[i+1][j+1] %= MOD dp2[i+1][j+1] += dp2[i][j] * (k-j) dp2[i+1][j+1] %= MOD for j in range(m, k): dp2[i+1][j] += dp[i+1][j] dp2[i+1][j] %= MOD f = 1 for i in range(m): f = f * (k - i) % MOD t = sum(dp2[n]) * pow(f, MOD-2, MOD) % MOD ans = ((n-m+1) * pow(k, n-m, MOD) - t) % MOD print(ans) ```
output
1
64,655
12
129,311
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,722
12
129,444
"Correct Solution: ``` n=int(input()) for _ in range(n): c=[i for i in input()] Max=int("".join(sorted(c,reverse=True))) Min=int("".join(sorted(c))) print(Max-Min) ```
output
1
64,722
12
129,445
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,723
12
129,446
"Correct Solution: ``` n = int(input()) for i in range(n): s = input() minv = ''.join(sorted(s)) maxv = ''.join(sorted(s, reverse=1)) print(int(maxv) - int(minv)) ```
output
1
64,723
12
129,447
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,724
12
129,448
"Correct Solution: ``` n = int(input()) for _ in range(n): s = list(input()) print(int("".join(sorted(s,reverse=True))) - int("".join(sorted(s)))) ```
output
1
64,724
12
129,449
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,725
12
129,450
"Correct Solution: ``` def join_num(arr): result = 0 for i in range(len(arr)): result += arr[i] * 10**(7-i) return result n = int(input()) x = [0] * n for i in range(n): x[i] = str(input()) for i in range(n): d = [] for c in x[i]: d.append(int(c)) d.sort() a = join_num(d) d.reverse() b = join_num(d) print(b-a) ```
output
1
64,725
12
129,451
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,726
12
129,452
"Correct Solution: ``` n=int(input()) for i in range(n): A=[] string=input() for j in string: A.append(j) A.sort(reverse=True) Max="".join(A) A.sort() Min="".join(A) Min=int(Min) Max=int(Max) print(Max-Min) ```
output
1
64,726
12
129,453
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,727
12
129,454
"Correct Solution: ``` m=int(input()) while m: n,m=''.join(sorted(input())),m-1 print(int(n[::-1]) - int(n)) ```
output
1
64,727
12
129,455
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,728
12
129,456
"Correct Solution: ``` diff=lambda l:int("".join(map(str,sorted(l,reverse=True))))-int("".join(map(str,sorted(l)))) [print(diff(input())) for i in range(int(input()))] ```
output
1
64,728
12
129,457
Provide a correct Python 3 solution for this coding contest problem. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531
instruction
0
64,729
12
129,458
"Correct Solution: ``` for i in range(int(input())): num = list(input()) num.sort() min = int(''.join(num)) num.reverse() max = int(''.join(num)) print(max-min) ```
output
1
64,729
12
129,459
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531 Submitted Solution: ``` def toValue(arr): s = 0 l = len(arr) - 1 i = 0 while l >= 0: s += int(arr[i]) * pow(10,l) i += 1 l -= 1 return s n = int(input()) for i in range(0,n): s = input() max = [] for j in s: max.append(j) max = sorted(max,reverse=True) min = sorted(max) print(toValue(max) - toValue(min)) ```
instruction
0
64,730
12
129,460
Yes
output
1
64,730
12
129,461
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531 Submitted Solution: ``` n = int(input()) for _ in range(n): data = list(input()) data.sort(reverse=True) max = int(''.join(d for d in data)) data.sort() min = int(''.join(d for d in data)) print(max - min) ```
instruction
0
64,732
12
129,464
Yes
output
1
64,732
12
129,465
Evaluate the correctness of the submitted Python 3 solution to the coding contest problem. Provide a "Yes" or "No" response. When you enter 8 numbers from 0 to 9, write a program that outputs the difference between the largest integer and the smallest integer that can sort the 8 numbers. The number that can be sorted may start from 0, such as 00135569. Input Given multiple datasets. The number of datasets n (n ≤ 50) is given on the first line. Then n rows of data are given. Each data is a sequence of 8 numbers (0 to 9 numbers). Output For each dataset, output the difference between the largest and smallest integers that can be rearranged in the entered numbers on one line. Example Input 2 65539010 65539010 Output 96417531 96417531 Submitted Solution: ``` n=int(input()) for i in range(n): nmax=[] nmin=[] for ii in str(input()): nmax.append(ii) nmin.append(ii) nmax.sort(reverse=True) nmin.sort() ans=int("".join(nmax))-int("".join(nmin)) print(ans) ```
instruction
0
64,733
12
129,466
Yes
output
1
64,733
12
129,467
Provide a correct Python 3 solution for this coding contest problem. Counting sort can be used for sorting elements in an array which each of the n input elements is an integer in the range 0 to k. The idea of counting sort is to determine, for each input element x, the number of elements less than x as C[x]. This information can be used to place element x directly into its position in the output array B. This scheme must be modified to handle the situation in which several elements have the same value. Please see the following pseudocode for the detail: Counting-Sort(A, B, k) 1 for i = 0 to k 2 do C[i] = 0 3 for j = 1 to length[A] 4 do C[A[j]] = C[A[j]]+1 5 /* C[i] now contains the number of elements equal to i */ 6 for i = 1 to k 7 do C[i] = C[i] + C[i-1] 8 /* C[i] now contains the number of elements less than or equal to i */ 9 for j = length[A] downto 1 10 do B[C[A[j]]] = A[j] 11 C[A[j]] = C[A[j]]-1 Write a program which sorts elements of given array ascending order based on the counting sort. Constraints * 1 ≤ n ≤ 2,000,000 * 0 ≤ A[i] ≤ 10,000 Input The first line of the input includes an integer n, the number of elements in the sequence. In the second line, n elements of the sequence are given separated by spaces characters. Output Print the sorted sequence. Two contiguous elements of the sequence should be separated by a space character. Example Input 7 2 5 1 3 2 3 0 Output 0 1 2 2 3 3 5
instruction
0
64,793
12
129,586
"Correct Solution: ``` n = int(input()) a = list(map(int, input().split())) k = max(a) + 1 b = [0 for i in range(n)] c = [0 for i in range(k)] for j in range(n): c[a[j]] += 1 for i in range(1, k): c[i] += c[i-1] for j in range(n-1, -1, -1): b[c[a[j]] - 1] = a[j] c[a[j]] -= 1 print(*b) ```
output
1
64,793
12
129,587
Provide a correct Python 3 solution for this coding contest problem. Counting sort can be used for sorting elements in an array which each of the n input elements is an integer in the range 0 to k. The idea of counting sort is to determine, for each input element x, the number of elements less than x as C[x]. This information can be used to place element x directly into its position in the output array B. This scheme must be modified to handle the situation in which several elements have the same value. Please see the following pseudocode for the detail: Counting-Sort(A, B, k) 1 for i = 0 to k 2 do C[i] = 0 3 for j = 1 to length[A] 4 do C[A[j]] = C[A[j]]+1 5 /* C[i] now contains the number of elements equal to i */ 6 for i = 1 to k 7 do C[i] = C[i] + C[i-1] 8 /* C[i] now contains the number of elements less than or equal to i */ 9 for j = length[A] downto 1 10 do B[C[A[j]]] = A[j] 11 C[A[j]] = C[A[j]]-1 Write a program which sorts elements of given array ascending order based on the counting sort. Constraints * 1 ≤ n ≤ 2,000,000 * 0 ≤ A[i] ≤ 10,000 Input The first line of the input includes an integer n, the number of elements in the sequence. In the second line, n elements of the sequence are given separated by spaces characters. Output Print the sorted sequence. Two contiguous elements of the sequence should be separated by a space character. Example Input 7 2 5 1 3 2 3 0 Output 0 1 2 2 3 3 5
instruction
0
64,794
12
129,588
"Correct Solution: ``` if __name__ == '__main__': n = int(input()) A = list(map(int, input().split())) B = [0] * n C = [0] * 10001 for i in A: C[i] += 1 for i in range(1, len(C)): C[i] += C[i - 1] for i in A: B[C[i] - 1] = i C[i] -= 1 print(' '.join(map(str, B))) ```
output
1
64,794
12
129,589
Provide a correct Python 3 solution for this coding contest problem. Counting sort can be used for sorting elements in an array which each of the n input elements is an integer in the range 0 to k. The idea of counting sort is to determine, for each input element x, the number of elements less than x as C[x]. This information can be used to place element x directly into its position in the output array B. This scheme must be modified to handle the situation in which several elements have the same value. Please see the following pseudocode for the detail: Counting-Sort(A, B, k) 1 for i = 0 to k 2 do C[i] = 0 3 for j = 1 to length[A] 4 do C[A[j]] = C[A[j]]+1 5 /* C[i] now contains the number of elements equal to i */ 6 for i = 1 to k 7 do C[i] = C[i] + C[i-1] 8 /* C[i] now contains the number of elements less than or equal to i */ 9 for j = length[A] downto 1 10 do B[C[A[j]]] = A[j] 11 C[A[j]] = C[A[j]]-1 Write a program which sorts elements of given array ascending order based on the counting sort. Constraints * 1 ≤ n ≤ 2,000,000 * 0 ≤ A[i] ≤ 10,000 Input The first line of the input includes an integer n, the number of elements in the sequence. In the second line, n elements of the sequence are given separated by spaces characters. Output Print the sorted sequence. Two contiguous elements of the sequence should be separated by a space character. Example Input 7 2 5 1 3 2 3 0 Output 0 1 2 2 3 3 5
instruction
0
64,795
12
129,590
"Correct Solution: ``` def countingsort(a, n): c = [0]*10001 for i in range(n): c[a[i]] += 1 for j in range(1, 10001): c[j] += c[j - 1] b = [0]*(n+1) for k in range(n, 0, -1): b[c[a[k-1]]] = a[k-1] c[a[k-1]] -= 1 return b[1:] n = int(input()) a = list(map(int, input().split())) print(*countingsort(a, n)) ```
output
1
64,795
12
129,591
Provide a correct Python 3 solution for this coding contest problem. Counting sort can be used for sorting elements in an array which each of the n input elements is an integer in the range 0 to k. The idea of counting sort is to determine, for each input element x, the number of elements less than x as C[x]. This information can be used to place element x directly into its position in the output array B. This scheme must be modified to handle the situation in which several elements have the same value. Please see the following pseudocode for the detail: Counting-Sort(A, B, k) 1 for i = 0 to k 2 do C[i] = 0 3 for j = 1 to length[A] 4 do C[A[j]] = C[A[j]]+1 5 /* C[i] now contains the number of elements equal to i */ 6 for i = 1 to k 7 do C[i] = C[i] + C[i-1] 8 /* C[i] now contains the number of elements less than or equal to i */ 9 for j = length[A] downto 1 10 do B[C[A[j]]] = A[j] 11 C[A[j]] = C[A[j]]-1 Write a program which sorts elements of given array ascending order based on the counting sort. Constraints * 1 ≤ n ≤ 2,000,000 * 0 ≤ A[i] ≤ 10,000 Input The first line of the input includes an integer n, the number of elements in the sequence. In the second line, n elements of the sequence are given separated by spaces characters. Output Print the sorted sequence. Two contiguous elements of the sequence should be separated by a space character. Example Input 7 2 5 1 3 2 3 0 Output 0 1 2 2 3 3 5
instruction
0
64,796
12
129,592
"Correct Solution: ``` def counting_sort(A, B, k): C=[0 for i in range(k)] for j in range(n): C[A[j]] += 1 for i in range(1,k): C[i] = C[i] + C[i-1] for j in range(n-1,-1, -1): B[C[A[j]]-1] = A[j] C[A[j]] -= 1 if __name__ == "__main__": n=int(input()) A=list(map(int,input().split())) B=[-1 for i in range(n)] counting_sort(A,B,max(A)+1) print(*B) ```
output
1
64,796
12
129,593