repo
stringlengths
1
99
file
stringlengths
13
215
code
stringlengths
12
59.2M
file_length
int64
12
59.2M
avg_line_length
float64
3.82
1.48M
max_line_length
int64
12
2.51M
extension_type
stringclasses
1 value
rej-summ
rej-summ-main/examples/MMPT/mmpt/tasks/milncetask.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from .task import Task class MILNCETask(Task): def reshape_subsample(self, sample): if ( hasattr(self.config.dataset, "subsampling") and self.config.dataset.subsampling is not None and self.config.dataset.subsampling > 1 ): for key in sample: if torch.is_tensor(sample[key]): tensor = self.flat_subsample(sample[key]) if key in ["caps", "cmasks"]: size = tensor.size() batch_size = size[0] * size[1] expanded_size = (batch_size,) + size[2:] tensor = tensor.view(expanded_size) sample[key] = tensor return sample
954
33.107143
65
py
rej-summ
rej-summ-main/examples/MMPT/mmpt/tasks/task.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from .. import tasks from .. import models from .. import losses from ..datasets import MMDataset from .. import processors class Task(object): """ A task refers to one generic training task (e.g., training one model). """ @classmethod def config_task(cls, config): """ determine whether to load a hard-coded task or config from a generic one. via if a task string is available in config. """ if config.task is not None: # TODO (huxu): expand the search scope. task_cls = getattr(tasks, config.task) return task_cls(config) else: return Task(config) def __init__(self, config): self.config = config self.train_data = None self.val_data = None self.test_data = None self.model = None self.loss_fn = None self.eval_fn = None def build_dataset(self): """TODO (huxu): move processor breakdown to MMDataset.""" """fill-in `self.train_data`, `self.val_data` and `self.test_data`.""" meta_processor_cls = getattr( processors, self.config.dataset.meta_processor) video_processor_cls = getattr( processors, self.config.dataset.video_processor) text_processor_cls = getattr( processors, self.config.dataset.text_processor) aligner_cls = getattr( processors, self.config.dataset.aligner) if self.config.dataset.train_path is not None: self.config.dataset.split = "train" # may be used by meta processor. # meta_processor controls different dataset. meta_processor = meta_processor_cls(self.config.dataset) video_processor = video_processor_cls(self.config.dataset) text_processor = text_processor_cls(self.config.dataset) aligner = aligner_cls(self.config.dataset) self.train_data = MMDataset( meta_processor, video_processor, text_processor, aligner ) print("train_len", len(self.train_data)) output = self.train_data[0] self.train_data.print_example(output) if self.config.dataset.val_path is not None: self.config.dataset.split = "valid" # may be used by meta processor. meta_processor = meta_processor_cls(self.config.dataset) video_processor = video_processor_cls(self.config.dataset) text_processor = text_processor_cls(self.config.dataset) aligner = aligner_cls(self.config.dataset) self.val_data = MMDataset( meta_processor, video_processor, text_processor, aligner ) print("val_len", len(self.val_data)) output = self.val_data[0] self.val_data.print_example(output) if self.config.dataset.split == "test": # the following is run via lauching fairseq-validate. meta_processor = meta_processor_cls(self.config.dataset) video_processor = video_processor_cls(self.config.dataset) text_processor = text_processor_cls(self.config.dataset) self.test_data = MMDataset( meta_processor, video_processor, text_processor, aligner ) print("test_len", len(self.test_data)) output = self.test_data[0] self.test_data.print_example(output) def build_model(self, checkpoint=None): if self.model is None: model_cls = getattr(models, self.config.model.model_cls) self.model = model_cls(self.config) if checkpoint is not None: self.load_checkpoint(checkpoint) return self.model def load_checkpoint(self, checkpoint): if self.model is None: raise ValueError("model is not initialized.") state_dict = torch.load(checkpoint) state_dict = self._trim_state_dict(state_dict) self.model.load_state_dict(state_dict, strict=False) # if it's a fp16 model, turn it back. if next(self.model.parameters()).dtype == torch.float16: self.model = self.model.float() return self.model def _trim_state_dict(self, state_dict): from collections import OrderedDict if "state_dict" in state_dict: state_dict = state_dict["state_dict"] if "model" in state_dict: # fairseq checkpoint format. state_dict = state_dict["model"] ret_state_dict = OrderedDict() for ( key, value, ) in state_dict.items(): # remove fairseq wrapper since this is a task. if key.startswith("mmmodel"): key = key[len("mmmodel."):] ret_state_dict[key] = value return ret_state_dict def build_loss(self): if self.loss_fn is None and self.config.loss is not None: loss_cls = getattr(losses, self.config.loss.loss_cls) self.loss_fn = loss_cls() return self.loss_fn def flat_subsample(self, tensor): size = tensor.size() if len(size) >= 2: batch_size = size[0] * size[1] expanded_size = ( (batch_size,) + size[2:] if len(size) > 2 else (batch_size,) ) tensor = tensor.view(expanded_size) return tensor def reshape_subsample(self, sample): if ( hasattr(self.config.dataset, "subsampling") and self.config.dataset.subsampling is not None and self.config.dataset.subsampling > 1 ): for key in sample: if torch.is_tensor(sample[key]): sample[key] = self.flat_subsample(sample[key]) return sample def __call__(self, model, sample): loss = None loss_scalar = float("inf") sample = self.reshape_subsample(sample) outputs = self.model(**sample) sample.update(outputs) if self.loss_fn is not None: loss = self.loss_fn(**sample) loss_scalar = loss.item() batch_size = sample["caps"].size(0) sample_size = 1 return { "loss": loss, "loss_scalar": loss_scalar, "max_len": self.config.dataset.max_len, "batch_size": batch_size, "sample_size": sample_size, } def build_dataloader(self): """only used for trainer that lacks building loaders.""" raise NotImplementedError
6,780
35.654054
81
py
rej-summ
rej-summ-main/examples/MMPT/mmpt/tasks/vlmtask.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from .task import Task class VLMTask(Task): """A VLM task for reproducibility. the collator split subsamples into two sub-batches. This has should have no logic changes. but changed the randomness in frame masking. """ def flat_subsample(self, tensor): size = tensor.size() if len(size) >= 2: batch_size = size[0] * (size[1] // 2) expanded_size = ( (batch_size, 2) + size[2:] if len(size) > 2 else (batch_size, 2) ) tensor = tensor.view(expanded_size) tensor = torch.cat([tensor[:, 0], tensor[:, 1]], dim=0) return tensor
856
29.607143
67
py
rej-summ
rej-summ-main/examples/MMPT/mmpt/losses/loss.py
# Copyright (c) Facebook, Inc. All Rights Reserved import torch from torch import nn class Loss(object): def __call__(self, *args, **kwargs): raise NotImplementedError # Dummy Loss for testing. class DummyLoss(Loss): def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, logits, targets, **kwargs): return self.loss(logits, targets) class DummyK400Loss(Loss): """dummy k400 loss for MViT.""" def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, logits, targets, **kwargs): return self.loss( logits, torch.randint(0, 400, (logits.size(0),), device=logits.device)) class CrossEntropy(Loss): def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, logits, targets, **kwargs): return self.loss(logits.reshape(-1, logits.size(-1)), targets.reshape(-1)) class ArgmaxCrossEntropy(Loss): def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, logits, targets, **kwargs): return self.loss(logits, targets.argmax(dim=1)) class BCE(Loss): def __init__(self): self.loss = nn.BCEWithLogitsLoss() def __call__(self, logits, targets, **kwargs): targets = targets.squeeze(0) return self.loss(logits, targets) class NLGLoss(Loss): def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, logits, text_label, **kwargs): targets = text_label[text_label != -100] return self.loss(logits, targets) class MSE(Loss): def __init__(self): self.loss = nn.MSELoss() def __call__(self, logits, targets, **kwargs): return self.loss(logits, targets) class L1(Loss): def __init__(self): self.loss = nn.L1Loss() def __call__(self, logits, targets, **kwargs): return self.loss(logits, targets) class SmoothL1(Loss): def __init__(self): self.loss = nn.SmoothL1Loss() def __call__(self, logits, targets, **kwargs): return self.loss(logits, targets)
2,095
22.818182
83
py
rej-summ
rej-summ-main/examples/MMPT/mmpt/losses/nce.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ softmax-based NCE loss, used by this project. """ import torch from torch import nn from .loss import Loss class NCE(Loss): def __init__(self): # TODO (huxu): define temperature. self.loss = nn.CrossEntropyLoss() def __call__(self, align_scores, **kargs): # note: we reuse the same shape as cls head in BERT (batch_size, 2) # but NCE only needs one logits. # (so we drop all weights in the second neg logits.) align_scores = align_scores[:, :1] # duplicate negative examples batch_size = align_scores.size(0) // 2 pos_scores = align_scores[:batch_size] neg_scores = align_scores[batch_size:].view(1, batch_size).repeat( batch_size, 1) scores = torch.cat([pos_scores, neg_scores], dim=1) return self.loss( scores, torch.zeros( (batch_size,), dtype=torch.long, device=align_scores.device), ) class T2VContraLoss(Loss): """NCE for MM joint space, on softmax text2video matrix. """ def __init__(self): # TODO (huxu): define temperature. self.loss = nn.CrossEntropyLoss() def __call__(self, pooled_video, pooled_text, **kargs): batch_size = pooled_video.size(0) logits = torch.mm(pooled_text, pooled_video.transpose(1, 0)) targets = torch.arange( batch_size, dtype=torch.long, device=pooled_video.device) return self.loss(logits, targets) class V2TContraLoss(Loss): """NCE for MM joint space, with softmax on video2text matrix.""" def __init__(self): # TODO (huxu): define temperature. self.loss = nn.CrossEntropyLoss() def __call__(self, pooled_video, pooled_text, **kargs): batch_size = pooled_video.size(0) logits = torch.mm(pooled_video, pooled_text.transpose(1, 0)) targets = torch.arange( batch_size, dtype=torch.long, device=pooled_video.device) return self.loss(logits, targets) class MMContraLoss(Loss): def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__(self, pooled_video, pooled_text, **kwargs): logits_per_video = pooled_video @ pooled_text.t() logits_per_text = pooled_text @ pooled_video.t() targets = torch.arange( pooled_video.size(0), dtype=torch.long, device=pooled_video.device) loss_video = self.loss(logits_per_video, targets) loss_text = self.loss(logits_per_text, targets) return loss_video + loss_text class MTM(Loss): """Combination of MFM and MLM.""" def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__( self, video_logits, text_logits, video_label, text_label, **kwargs ): text_logits = torch.cat([ text_logits, torch.zeros( (text_logits.size(0), 1), device=text_logits.device) ], dim=1) vt_logits = torch.cat([video_logits, text_logits], dim=0) # loss for video. video_label = torch.zeros( (video_logits.size(0),), dtype=torch.long, device=video_logits.device ) # loss for text. text_label = text_label.reshape(-1) labels_mask = text_label != -100 selected_text_label = text_label[labels_mask] vt_label = torch.cat([video_label, selected_text_label], dim=0) return self.loss(vt_logits, vt_label) class MFMMLM(Loss): """Combination of MFM and MLM.""" def __init__(self): self.loss = nn.CrossEntropyLoss() def __call__( self, video_logits, text_logits, video_label, text_label, **kwargs ): # loss for video. video_label = torch.zeros( (video_logits.size(0),), dtype=torch.long, device=video_logits.device ) masked_frame_loss = self.loss(video_logits, video_label) # loss for text. text_label = text_label.reshape(-1) labels_mask = text_label != -100 selected_text_label = text_label[labels_mask] masked_lm_loss = self.loss(text_logits, selected_text_label) return masked_frame_loss + masked_lm_loss
4,586
28.216561
75
py
rej-summ
rej-summ-main/examples/MMPT/scripts/text_token_extractor/pretokenization.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import pickle import os import argparse import numpy as np from torch.utils.data import Dataset, DataLoader from mmpt.processors import PKLJSONStrTextProcessor from mmpt.utils import ShardedTensor, recursive_config class TokenizerDataset(Dataset): def __init__(self, config): self.text_processor = PKLJSONStrTextProcessor(config) self.video_ids = list(self.text_processor.data.keys()) def __getitem__(self, idx): video_id = self.video_ids[idx] return video_id, self.text_processor(video_id) def __len__(self): return len(self.video_ids) def numpify(shard_idx, video_ids, captions, target_dir, split, prefix, max_cap_len=32): startends = [] caps_ids = [] for video_id in video_ids: caption = captions[video_id] startend = [] cap_ids = [] for start, end, cap in zip( caption["start"], caption["end"], caption["cap"]): startend.append(np.array([start, end]).astype("float32")) cap_id = np.full((max_cap_len,), -1, dtype=np.int32) cap = cap[:max_cap_len] cap_id[:len(cap)] = cap cap_ids.append(cap_id) startends.append(np.stack(startend)) caps_ids.append(np.stack(cap_ids)) startends = ShardedTensor.from_list(startends) target_path = os.path.join( target_dir, prefix + split + "_" + str(shard_idx) ) print("save to", target_path) startends.save(target_path + ".startends") caps_ids = ShardedTensor.from_list(caps_ids) caps_ids.save(target_path + ".caps_ids") def sharding(config, out_file): with open(out_file, "rb") as fr: captions = pickle.load(fr) target_dir = config.target_dir prefix = os.path.basename( os.path.splitext(config.caption_pkl_path)[0] ) + "." + config.bert_name + "." for split in ["train", "val"]: target_path = os.path.join(target_dir, split + "_meta") with open(target_path + ".pkl", "rb") as fr: meta = pickle.load(fr) print("load meta", target_path, len(meta)) for shard_id in meta: numpify( shard_id, meta[shard_id], captions, target_dir, split, prefix ) def tokenize(config, out_file): def collator(samples): return samples dataset = TokenizerDataset(config) data = {} for idx, batch in enumerate( DataLoader(dataset, collate_fn=collator, num_workers=16)): for video_id, caption in batch: data[video_id] = caption if idx % 5000 == 0: print(idx) with open(out_file, "wb") as fw: pickle.dump(data, fw, pickle.HIGHEST_PROTOCOL) def main(args): config = recursive_config(args.config).dataset out_file = os.path.splitext(config.caption_pkl_path)[0] \ + "." + config.bert_name + ".pkl" if not os.path.isfile(out_file): tokenize(config, out_file) sharding(config, out_file) if __name__ == "__main__": parser = argparse.ArgumentParser( description="pretokenize (raw_)caption.json into pkl.") parser.add_argument('config', type=str) args = parser.parse_args() main(args)
3,408
30.859813
87
py
rej-summ
rej-summ-main/examples/MMPT/scripts/video_feature_extractor/videoreader.py
# Copyright Howto100M authors. # Copyright (c) Facebook, Inc. All Rights Reserved import torch as th import pandas as pd import os import numpy as np import ffmpeg import random from torch.utils.data import Dataset class VideoLoader(Dataset): """modified from how2's video_feature_extractor.""" def __init__( self, csv=None, video_dict=None, framerate=1, size=112, centercrop=False, hflip=False, **kwargs ): if csv is None and video_dict is None: raise ValueError("csv and video_dict cannot be both None.") if csv is not None: self.csv = pd.read_csv(csv) if video_dict is not None: self.csv = pd.DataFrame.from_dict(video_dict) self.centercrop = centercrop self.size = size self.framerate = framerate self.hflip = hflip def __len__(self): return len(self.csv) def _get_video_dim(self, video_path): probe = ffmpeg.probe(video_path) video_stream = next((stream for stream in probe['streams'] if stream['codec_type'] == 'video'), None) width = int(video_stream['width']) height = int(video_stream['height']) return height, width def _get_video_info(self, video_path): probe = ffmpeg.probe(video_path) video_stream = next((stream for stream in probe['streams'] if stream['codec_type'] == 'video'), None) return video_stream def _get_output_dim(self, h, w): if isinstance(self.size, tuple) and len(self.size) == 2: return self.size elif h >= w: return int(h * self.size / w), self.size else: return self.size, int(w * self.size / h) def __getitem__(self, idx): video_path = self.csv['video_path'].values[idx] output_file = self.csv['feature_path'].values[idx] return self._decode(output_file, video_path) def _decode(self, output_file, video_path): if not(os.path.isfile(output_file)) and os.path.isfile(video_path): try: h, w = self._get_video_dim(video_path) except Exception: print('ffprobe failed at: {}'.format(video_path)) return {'video': th.zeros(1), 'input': video_path, 'output': output_file} try: os.makedirs(os.path.dirname(output_file), exist_ok=True) height, width = self._get_output_dim(h, w) cmd = ( ffmpeg .input(video_path) .filter('fps', fps=self.framerate) .filter('scale', width, height) ) if self.hflip: cmd = cmd.filter('hflip') if self.centercrop: x = int((width - self.size) / 2.0) y = int((height - self.size) / 2.0) cmd = cmd.crop(x, y, self.size, self.size) video = self._run(cmd, output_file) except Exception: video = th.zeros(1) else: video = th.zeros(1) return {'video': video, 'input': video_path, 'output': output_file} def _run(self, cmd, output_file): out, _ = ( cmd.output('pipe:', format='rawvideo', pix_fmt='rgb24') .run(capture_stdout=True, quiet=True) ) if self.centercrop and isinstance(self.size, int): height, width = self.size, self.size video = np.frombuffer(out, np.uint8).reshape([-1, height, width, 3]) video = th.from_numpy(video.astype('float32')) return video.permute(0, 3, 1, 2) class VideoVerifier(VideoLoader): def __getitem__(self, idx): video_path = self.csv['video_path'].values[idx] try: return self._get_video_info(video_path) except Exception: # print('ffprobe failed at: {}'.format(video_path)) return None class VideoCompressor(VideoLoader): def __init__( self, csv=None, video_dict=None, framerate=1, size=112, centercrop=False, hflip=False, crf=32, **kwargs ): super().__init__( csv, video_dict, framerate, size, centercrop, hflip ) self.crf = crf def _run(self, cmd, output_file): out, _ = ( cmd.output(filename=output_file, crf=self.crf) .run(quiet=True) ) video = None return video class VideoDownloader(VideoCompressor): """download""" def __getitem__(self, idx): video_path = self.csv['video_path'].values[idx] output_file = self.csv['feature_path'].values[idx] if not(os.path.isfile(output_file)): os.makedirs(os.path.dirname(output_file), exist_ok=True) cmd = "wget -O" + output_file + " " + video_path # import subprocess # subprocess.check_output( # cmd, # stderr=subprocess.STDOUT, shell=True) os.system(cmd) return {'video': None, 'input': video_path, 'output': output_file} class AvKeyframeVideoCompressor(VideoLoader): """extract keyframes from a video and save it as jpg. TODO: consider to merge with `CodecProcessor`. """ def __init__( self, csv=None, video_dict=None, framerate=1, size=112, centercrop=False, max_num_frames=5, **kwargs ): super().__init__(csv, video_dict, framerate, size, centercrop) self.max_num_frames = max_num_frames def _get_video_dim(self, video_fn): """decord cannot probe the size of a video, we use pyav instead.""" import av with av.open(video_fn) as container: height = container.streams.video[0].codec_context.height width = container.streams.video[0].codec_context.width return height, width def _get_output_dim(self, height, width): """ keep the shorter side be `self.size`, strech the other. """ if height >= width: return int(height * self.size / width), self.size else: return self.size, int(width * self.size / height) def __getitem__(self, idx): import av video_path = self.csv['video_path'].values[idx] output_file = self.csv['feature_path'].values[idx] if not(os.path.isdir(output_file)) and os.path.isfile(video_path): try: h, w = self._get_video_dim(video_path) except Exception: print('probe failed at: {}'.format(video_path)) return {'video': th.zeros(1), 'input': video_path, 'output': output_file} try: height, width = self._get_output_dim(h, w) # new for av. with av.open(video_path) as container: container.streams.video[0].thread_type = "AUTO" container.streams.video[0].codec_context.height = height container.streams.video[0].codec_context.width = width if self.framerate == 0: # keyframe. container.streams.video[0].codec_context.skip_frame = 'NONKEY' frames = [] for frame in container.decode(video=0): frames.append(frame) frames = random.sample(frames, self.max_num_frames) os.makedirs(output_file, exist_ok=True) for frame in frames: frame.to_image().save( os.path.join( output_file, "%04d.jpg" % frame.index)) except Exception: print('extract failed at: {}'.format(video_path)) return {'video': th.zeros(1), 'input': video_path, 'output': output_file} video = th.zeros(1) return {'video': video, 'input': video_path, 'output': output_file}
8,322
33.251029
86
py
rej-summ
rej-summ-main/examples/MMPT/scripts/video_feature_extractor/preprocessing.py
# Copyright Howto100m authors. # Copyright (c) Facebook, Inc. All Rights Reserved import torch as th class Normalize(object): def __init__(self, mean, std): self.mean = th.FloatTensor(mean).view(1, 3, 1, 1) self.std = th.FloatTensor(std).view(1, 3, 1, 1) def __call__(self, tensor): tensor = (tensor - self.mean) / (self.std + 1e-8) return tensor class Preprocessing(object): def __init__(self, type): self.type = type if type == '2d': self.norm = Normalize(mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]) elif type == '3d': self.norm = Normalize(mean=[110.6, 103.2, 96.3], std=[1.0, 1.0, 1.0]) elif type == 'vmz': self.norm = Normalize(mean=[110.201, 100.64, 95.997], std=[58.1489, 56.4701, 55.3324]) def _zero_pad(self, tensor, size): n = size - len(tensor) % size if n == size: return tensor else: z = th.zeros(n, tensor.shape[1], tensor.shape[2], tensor.shape[3]) return th.cat((tensor, z), 0) def __call__(self, tensor): if self.type == '2d': tensor = tensor / 255.0 tensor = self.norm(tensor) elif self.type == 'vmz': #tensor = self._zero_pad(tensor, 8) tensor = self._zero_pad(tensor, 10) tensor = self.norm(tensor) #tensor = tensor.view(-1, 8, 3, 112, 112) tensor = tensor.view(-1, 10, 3, 112, 112) tensor = tensor.transpose(1, 2) elif self.type == '3d': tensor = self._zero_pad(tensor, 16) tensor = self.norm(tensor) tensor = tensor.view(-1, 16, 3, 112, 112) tensor = tensor.transpose(1, 2) elif self.type == 's3d': tensor = tensor / 255.0 tensor = self._zero_pad(tensor, 30) tensor = tensor.view(-1, 30, 3, 224, 224) # N x 30 x 3 x H x W tensor = tensor.transpose(1, 2) # N x 3 x 30 x H x W # for vae do nothing return tensor
2,071
34.724138
98
py
rej-summ
rej-summ-main/examples/MMPT/scripts/video_feature_extractor/model.py
# Copyright (c) Howto100M authors and Facebook, Inc. All Rights Reserved import torch as th from torch import nn class GlobalAvgPool(nn.Module): def __init__(self): super(GlobalAvgPool, self).__init__() def forward(self, x): return th.mean(x, dim=[-2, -1]) def get_model(args): assert args.type in ['2d', '3d', 'vmz', 's3d', 'vae'] if args.type == '2d': print('Loading 2D-ResNet-152 ...') import torchvision.models as models model = models.resnet152(pretrained=True) model = nn.Sequential(*list(model.children())[:-2], GlobalAvgPool()) model = model.cuda() elif args.type == 'vmz': print('Loading VMZ ...') from vmz34 import r2plus1d_34 model = r2plus1d_34(pretrained_path=args.vmz_model_path, pretrained_num_classes=487) model = model.cuda() elif args.type == 's3d': # we use one copy of s3d instead of dup another one for feature extraction. from mmpt.processors.models.s3dg import S3D model = S3D('pretrained_models/s3d_dict.npy', 512) model.load_state_dict(th.load('pretrained_models/s3d_howto100m.pth')) model = model.cuda() elif args.type == '3d': print('Loading 3D-ResneXt-101 ...') from videocnn.models import resnext model = resnext.resnet101( num_classes=400, shortcut_type='B', cardinality=32, sample_size=112, sample_duration=16, last_fc=False) model = model.cuda() model_data = th.load(args.resnext101_model_path) model.load_state_dict(model_data) elif args.type == 'vae': from openaivae import OpenAIParallelDiscreteVAE model = OpenAIParallelDiscreteVAE() model = model.cuda() else: raise ValueError("model not supported yet.") model.eval() print('loaded') return model
1,921
31.576271
92
py
rej-summ
rej-summ-main/examples/MMPT/scripts/video_feature_extractor/extract.py
# Copyright Howto100M authors. # Copyright (c) Facebook, Inc. All Rights Reserved import torch as th import torch.nn.functional as F import math import numpy as np import argparse from torch.utils.data import DataLoader from model import get_model from preprocessing import Preprocessing from random_sequence_shuffler import RandomSequenceSampler from tqdm import tqdm from pathbuilder import PathBuilder from videoreader import VideoLoader parser = argparse.ArgumentParser(description='Easy video feature extractor') parser.add_argument('--vdir', type=str) parser.add_argument('--fdir', type=str) parser.add_argument('--hflip', type=int, default=0) parser.add_argument('--batch_size', type=int, default=64, help='batch size') parser.add_argument('--type', type=str, default='2d', help='CNN type') parser.add_argument('--half_precision', type=int, default=0, help='output half precision float') parser.add_argument('--num_decoding_thread', type=int, default=4, help='Num parallel thread for video decoding') parser.add_argument('--l2_normalize', type=int, default=1, help='l2 normalize feature') parser.add_argument('--resnext101_model_path', type=str, default='model/resnext101.pth', help='Resnext model path') parser.add_argument('--vmz_model_path', type=str, default='model/r2plus1d_34_clip8_ig65m_from_scratch-9bae36ae.pth', help='vmz model path') args = parser.parse_args() # TODO: refactor all args into config. (current code is from different people.) CONFIGS = { "2d": { "fps": 1, "size": 224, "centercrop": False, "shards": 0, }, "3d": { "fps": 24, "size": 112, "centercrop": True, "shards": 0, }, "s3d": { "fps": 30, "size": 224, "centercrop": True, "shards": 0, }, "vmz": { "fps": 24, "size": 112, "centercrop": True, "shards": 0, }, "vae": { "fps": 2, "size": 256, "centercrop": True, "shards": 100, } } config = CONFIGS[args.type] video_dirs = args.vdir feature_dir = args.fdir video_dict = PathBuilder.build(video_dirs, feature_dir, ".npy", config["shards"]) dataset = VideoLoader( video_dict=video_dict, framerate=config["fps"], size=config["size"], centercrop=config["centercrop"], hflip=args.hflip ) n_dataset = len(dataset) sampler = RandomSequenceSampler(n_dataset, 10) loader = DataLoader( dataset, batch_size=1, shuffle=False, num_workers=args.num_decoding_thread, sampler=sampler if n_dataset > 10 else None, ) preprocess = Preprocessing(args.type) model = get_model(args) with th.no_grad(): for k, data in tqdm(enumerate(loader), total=loader.__len__(), ascii=True): input_file = data['input'][0] output_file = data['output'][0] if len(data['video'].shape) > 3: video = data['video'].squeeze() if len(video.shape) == 4: video = preprocess(video) n_chunk = len(video) if args.type == 'vmz': n_chunk = math.ceil(n_chunk/float(3)) features = th.cuda.FloatTensor(n_chunk, 512).fill_(0) elif args.type == 's3d': features = th.cuda.FloatTensor(n_chunk, 512).fill_(0) elif args.type == "vae": features = th.cuda.LongTensor(n_chunk, 1024).fill_(0) else: features = th.cuda.FloatTensor(n_chunk, 2048).fill_(0) n_iter = int(math.ceil(n_chunk / float(args.batch_size))) for i in range(n_iter): factor = 1 if args.type == 'vmz': factor = 3 min_ind = factor * i * args.batch_size max_ind = factor * (i + 1) * args.batch_size video_batch = video[min_ind:max_ind:factor].cuda() if args.type == '2d': batch_features = model(video_batch) # (51, 487), (51, 512) elif args.type == 's3d': batch_features = model(video_batch) batch_features = batch_features['video_embedding'] elif args.type == "vae": # image_code. batch_features = model(video_batch) else: batch_pred, batch_features = model(video_batch) # (51, 487), (51, 512) if args.l2_normalize: batch_features = F.normalize(batch_features, dim=1) features[i*args.batch_size:(i+1)*args.batch_size] = batch_features features = features.cpu().numpy() if args.half_precision: if args.type == "vae": features = features.astype(np.int16) else: features = features.astype('float16') else: if args.type == "vae": features = features.astype(np.int32) else: features = features.astype('float32') np.save(output_file, features) else: print('Video {} error.'.format(input_file))
5,529
34
116
py
rej-summ
rej-summ-main/examples/MMPT/scripts/video_feature_extractor/random_sequence_shuffler.py
# Copyright (c) Facebook, Inc. All Rights Reserved import numpy as np from torch.utils.data.sampler import Sampler class RandomSequenceSampler(Sampler): def __init__(self, n_sample, seq_len): self.n_sample = n_sample self.seq_len = seq_len def _pad_ind(self, ind): zeros = np.zeros(self.seq_len - self.n_sample % self.seq_len) ind = np.concatenate((ind, zeros)) return ind def __iter__(self): idx = np.arange(self.n_sample) if self.n_sample % self.seq_len != 0: idx = self._pad_ind(idx) idx = np.reshape(idx, (-1, self.seq_len)) np.random.shuffle(idx) idx = np.reshape(idx, (-1)) return iter(idx.astype(int)) def __len__(self): return self.n_sample + (self.seq_len - self.n_sample % self.seq_len)
829
26.666667
76
py
rej-summ
rej-summ-main/examples/translation_moe/translation_moe_src/mean_pool_gating_network.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import torch.nn.functional as F class MeanPoolGatingNetwork(torch.nn.Module): """A simple mean-pooling gating network for selecting experts. This module applies mean pooling over an encoder's output and returns reponsibilities for each expert. The encoder format is expected to match :class:`fairseq.models.transformer.TransformerEncoder`. """ def __init__(self, embed_dim, num_experts, dropout=None): super().__init__() self.embed_dim = embed_dim self.num_experts = num_experts self.fc1 = torch.nn.Linear(embed_dim, embed_dim) self.dropout = torch.nn.Dropout(dropout) if dropout is not None else None self.fc2 = torch.nn.Linear(embed_dim, num_experts) def forward(self, encoder_out): if not ( "encoder_out" in encoder_out and "encoder_padding_mask" in encoder_out and encoder_out["encoder_out"][0].size(2) == self.embed_dim ): raise ValueError("Unexpected format for encoder_out") # mean pooling over time encoder_padding_mask = encoder_out["encoder_padding_mask"][0] # B x T encoder_out = encoder_out["encoder_out"][0].transpose(0, 1) # B x T x C if encoder_padding_mask is not None: encoder_out = encoder_out.clone() # required because of transpose above encoder_out[encoder_padding_mask] = 0 ntokens = torch.sum(~encoder_padding_mask, dim=1, keepdim=True) x = torch.sum(encoder_out, dim=1) / ntokens.type_as(encoder_out) else: x = torch.mean(encoder_out, dim=1) x = torch.tanh(self.fc1(x)) if self.dropout is not None: x = self.dropout(x) x = self.fc2(x) return F.log_softmax(x, dim=-1, dtype=torch.float32).type_as(x)
2,011
38.45098
84
py
rej-summ
rej-summ-main/examples/translation_moe/translation_moe_src/logsumexp_moe.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch class LogSumExpMoE(torch.autograd.Function): """Standard LogSumExp forward pass, but use *posterior* for the backward. See `"Mixture Models for Diverse Machine Translation: Tricks of the Trade" (Shen et al., 2019) <https://arxiv.org/abs/1902.07816>`_. """ @staticmethod def forward(ctx, logp, posterior, dim=-1): ctx.save_for_backward(posterior) ctx.dim = dim return torch.logsumexp(logp, dim=dim) @staticmethod def backward(ctx, grad_output): (posterior,) = ctx.saved_tensors grad_logp = grad_output.unsqueeze(ctx.dim) * posterior return grad_logp, None, None
837
30.037037
78
py
rej-summ
rej-summ-main/examples/translation_moe/translation_moe_src/translation_moe.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from dataclasses import dataclass, field import torch from omegaconf import II from fairseq import metrics, utils from fairseq.dataclass import ChoiceEnum from fairseq.tasks import register_task from fairseq.tasks.translation import TranslationConfig, TranslationTask from .logsumexp_moe import LogSumExpMoE from .mean_pool_gating_network import MeanPoolGatingNetwork METHOD_CHOICES = ChoiceEnum(["sMoElp", "sMoEup", "hMoElp", "hMoEup"]) @dataclass class TranslationMoEConfig(TranslationConfig): method: METHOD_CHOICES = field( default="hMoEup", metadata={"help": "MoE method"}, ) num_experts: int = field( default=3, metadata={"help": "number of experts"}, ) mean_pool_gating_network: bool = field( default=False, metadata={"help": "use a simple mean-pooling gating network"}, ) mean_pool_gating_network_dropout: float = field( default=0, metadata={"help": "dropout for mean-pooling gating network"}, ) mean_pool_gating_network_encoder_dim: int = field( default=0, metadata={"help": "encoder output dim for mean-pooling gating network"}, ) gen_expert: int = field( default=0, metadata={"help": "which expert to use for generation"}, ) sentence_avg: bool = II("optimization.sentence_avg") @register_task("translation_moe", dataclass=TranslationMoEConfig) class TranslationMoETask(TranslationTask): """ Translation task for Mixture of Experts (MoE) models. See `"Mixture Models for Diverse Machine Translation: Tricks of the Trade" (Shen et al., 2019) <https://arxiv.org/abs/1902.07816>`_. Args: src_dict (~fairseq.data.Dictionary): dictionary for the source language tgt_dict (~fairseq.data.Dictionary): dictionary for the target language .. note:: The translation task is compatible with :mod:`fairseq-train`, :mod:`fairseq-generate` and :mod:`fairseq-interactive`. The translation task provides the following additional command-line arguments: .. argparse:: :ref: fairseq.tasks.translation_parser :prog: """ cfg: TranslationMoEConfig def __init__(self, cfg: TranslationMoEConfig, src_dict, tgt_dict): if cfg.method == "sMoElp": # soft MoE with learned prior self.uniform_prior = False self.hard_selection = False elif cfg.method == "sMoEup": # soft MoE with uniform prior self.uniform_prior = True self.hard_selection = False elif cfg.method == "hMoElp": # hard MoE with learned prior self.uniform_prior = False self.hard_selection = True elif cfg.method == "hMoEup": # hard MoE with uniform prior self.uniform_prior = True self.hard_selection = True # add indicator tokens for each expert for i in range(cfg.num_experts): # add to both dictionaries in case we're sharing embeddings src_dict.add_symbol("<expert_{}>".format(i)) tgt_dict.add_symbol("<expert_{}>".format(i)) super().__init__(cfg, src_dict, tgt_dict) def build_model(self, cfg, from_checkpoint=False): from fairseq import models model = models.build_model(cfg, self) if not self.uniform_prior and not hasattr(model, "gating_network"): if self.cfg.mean_pool_gating_network: if self.cfg.mean_pool_gating_network_encoder_dim > 0: encoder_dim = self.cfg.mean_pool_gating_network_encoder_dim elif getattr(cfg, "encoder_embed_dim", None): # assume that encoder_embed_dim is the encoder's output dimension encoder_dim = cfg.encoder_embed_dim else: raise ValueError( "Must specify --mean-pool-gating-network-encoder-dim" ) if self.cfg.mean_pool_gating_network_dropout > 0: dropout = self.cfg.mean_pool_gating_network_dropout elif getattr(cfg, "dropout", None): dropout = cfg.dropout else: raise ValueError("Must specify task.mean_pool_gating_network_dropout") model.gating_network = MeanPoolGatingNetwork( encoder_dim, self.cfg.num_experts, dropout, ) else: raise ValueError( "translation_moe task with learned prior requires the model to " "have a gating network; try using --mean-pool-gating-network" ) return model def expert_index(self, i): return i + self.tgt_dict.index("<expert_0>") def _get_loss(self, sample, model, criterion): assert hasattr( criterion, "compute_loss" ), "translation_moe task requires the criterion to implement the compute_loss() method" k = self.cfg.num_experts bsz = sample["target"].size(0) def get_lprob_y(encoder_out, prev_output_tokens_k): net_output = model.decoder( prev_output_tokens=prev_output_tokens_k, encoder_out=encoder_out, ) loss, _ = criterion.compute_loss(model, net_output, sample, reduce=False) loss = loss.view(bsz, -1) return -loss.sum(dim=1, keepdim=True) # -> B x 1 def get_lprob_yz(winners=None): encoder_out = model.encoder( src_tokens=sample["net_input"]["src_tokens"], src_lengths=sample["net_input"]["src_lengths"], ) if winners is None: lprob_y = [] for i in range(k): prev_output_tokens_k = sample["net_input"][ "prev_output_tokens" ].clone() assert not prev_output_tokens_k.requires_grad prev_output_tokens_k[:, 0] = self.expert_index(i) lprob_y.append(get_lprob_y(encoder_out, prev_output_tokens_k)) lprob_y = torch.cat(lprob_y, dim=1) # -> B x K else: prev_output_tokens_k = sample["net_input"]["prev_output_tokens"].clone() prev_output_tokens_k[:, 0] = self.expert_index(winners) lprob_y = get_lprob_y(encoder_out, prev_output_tokens_k) # -> B if self.uniform_prior: lprob_yz = lprob_y else: lprob_z = model.gating_network(encoder_out) # B x K if winners is not None: lprob_z = lprob_z.gather(dim=1, index=winners.unsqueeze(-1)) lprob_yz = lprob_y + lprob_z.type_as(lprob_y) # B x K return lprob_yz # compute responsibilities without dropout with utils.model_eval(model): # disable dropout with torch.no_grad(): # disable autograd lprob_yz = get_lprob_yz() # B x K prob_z_xy = torch.nn.functional.softmax(lprob_yz, dim=1) assert not prob_z_xy.requires_grad # compute loss with dropout if self.hard_selection: winners = prob_z_xy.max(dim=1)[1] loss = -get_lprob_yz(winners) else: lprob_yz = get_lprob_yz() # B x K loss = -LogSumExpMoE.apply(lprob_yz, prob_z_xy, 1) loss = loss.sum() sample_size = ( sample["target"].size(0) if self.cfg.sentence_avg else sample["ntokens"] ) logging_output = { "loss": utils.item(loss.data), "ntokens": sample["ntokens"], "nsentences": bsz, "sample_size": sample_size, "posterior": prob_z_xy.float().sum(dim=0).cpu(), } return loss, sample_size, logging_output def train_step( self, sample, model, criterion, optimizer, update_num, ignore_grad=False ): model.train() loss, sample_size, logging_output = self._get_loss(sample, model, criterion) if ignore_grad: loss *= 0 optimizer.backward(loss) return loss, sample_size, logging_output def valid_step(self, sample, model, criterion): model.eval() with torch.no_grad(): loss, sample_size, logging_output = self._get_loss(sample, model, criterion) return loss, sample_size, logging_output def inference_step( self, generator, models, sample, prefix_tokens=None, expert=None, constraints=None, ): expert = expert or self.cfg.gen_expert with torch.no_grad(): return generator.generate( models, sample, prefix_tokens=prefix_tokens, constraints=constraints, bos_token=self.expert_index(expert), ) def reduce_metrics(self, logging_outputs, criterion): super().reduce_metrics(logging_outputs, criterion) metrics.log_scalar( "posterior", sum(log["posterior"] for log in logging_outputs if "posterior" in log), )
9,507
35.710425
95
py
rej-summ
rej-summ-main/examples/laser/laser_src/laser_transformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging from typing import Any, Dict, List, Optional from torch import Tensor import torch import torch.nn as nn from fairseq.models import ( FairseqEncoderDecoderModel, register_model, register_model_architecture, ) from fairseq.models.transformer import ( base_architecture, Embedding, TransformerModel, TransformerEncoder, TransformerDecoder, ) from fairseq.modules import ( TransformerDecoderLayer, ) logger = logging.getLogger(__name__) @register_model("laser_transformer") class LaserTransformerModel(FairseqEncoderDecoderModel): """Train Transformer for LASER task Requires --task laser """ def __init__(self, encoder, decoder): super().__init__(encoder, decoder) def forward( self, src_tokens, src_lengths, prev_output_tokens=None, tgt_tokens=None, tgt_lengths=None, target_language_id=-1, dataset_name="", ): laser_encoder_out = self.encoder(src_tokens, src_lengths) return self.decoder( prev_output_tokens, laser_encoder_out, lang_id=target_language_id ) @staticmethod def add_args(parser): """Add model-specific arguments to the parser.""" TransformerModel.add_args(parser) parser.add_argument( "--decoder-lang-embed-dim", type=int, metavar="N", help="decoder language embedding dimension", ) @classmethod def build_model(cls, args, task): base_laser_transformer_architecture(args) num_langs = task.num_tasks if hasattr(task, "num_tasks") else 0 def load_embed_tokens(dictionary, embed_dim): num_embeddings = len(dictionary) padding_idx = dictionary.pad() return Embedding(num_embeddings, embed_dim, padding_idx) encoder_embed_tokens = load_embed_tokens( task.source_dictionary, args.encoder_embed_dim ) decoder_embed_tokens = load_embed_tokens( task.target_dictionary, args.decoder_embed_dim ) num_langs = task.num_tasks if hasattr(task, "num_tasks") else 0 encoder = LaserTransformerEncoder( args, task.source_dictionary, encoder_embed_tokens ) decoder = LaserTransformerDecoder( args, task.target_dictionary, decoder_embed_tokens, num_langs=num_langs, lang_embed_dim=args.decoder_lang_embed_dim, ) return cls(encoder, decoder) class LaserTransformerEncoder(TransformerEncoder): def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) def forward(self, src_tokens, *args, **kwargs): encoder_out = super().forward(src_tokens, *args, **kwargs) x = encoder_out["encoder_out"][0] # T x B x C padding_mask = src_tokens.eq(self.padding_idx).t().unsqueeze(-1) if padding_mask.any(): x = x.float().masked_fill_(padding_mask, float("-inf")).type_as(x) # Build the sentence embedding by max-pooling over the encoder outputs sentemb = x.max(dim=0)[0] # The Pytorch Mobile lite interpreter does not supports returning NamedTuple in # `foward` so we use a dictionary instead. # TorchScript does not support mixed values so the values are all lists. # The empty list is equivalent to None. return {"sentemb": [sentemb]} # B x C @torch.jit.export def reorder_encoder_out(self, encoder_out: Dict[str, List[Tensor]], new_order): """ Same as the one in transformer.py, with new_sentemb """ if len(encoder_out["sentemb"]) == 0: new_sentemb = [] else: new_sentemb = [encoder_out["sentemb"][0].index_select(0, new_order)] return { "sentemb": new_sentemb, # B x C } class LaserTransformerDecoder(TransformerDecoder): def __init__(self, args, dictionary, *kargs, **kwargs): self.num_langs = kwargs.get("num_langs", 1) self.lang_embed_dim = kwargs.get("lang_embed_dim", 0) kwargs.pop("num_langs", None) kwargs.pop("lang_embed_dim", None) super().__init__(args, dictionary, *kargs, **kwargs, no_encoder_attn=True) if self.lang_embed_dim == 0: self.embed_lang = None else: self.embed_lang = nn.Embedding(self.num_langs, self.lang_embed_dim) nn.init.uniform_(self.embed_lang.weight, -0.1, 0.1) if self.output_projection is not None: laser_output_embed_dim = ( self.output_embed_dim + self.lang_embed_dim + args.encoder_embed_dim ) self.output_projection = nn.Linear( laser_output_embed_dim, len(dictionary), bias=False ) nn.init.normal_( self.output_projection.weight, mean=0, std=laser_output_embed_dim ** -0.5, ) def build_decoder_layer(self, args, no_encoder_attn=False): decoder_embed_dim = args.decoder_embed_dim args.decoder_embed_dim = ( decoder_embed_dim + self.lang_embed_dim + args.encoder_embed_dim ) res = TransformerDecoderLayer(args, no_encoder_attn=True) args.decoder_embed_dim = decoder_embed_dim return res def extract_features( self, prev_output_tokens, encoder_out: Optional[Dict[str, List[Tensor]]], incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, full_context_alignment: bool = False, alignment_layer: Optional[int] = None, alignment_heads: Optional[int] = None, lang_id: Optional[int] = None, ): """ Similar to *forward* but only return features. Includes several features from "Jointly Learning to Align and Translate with Transformer Models" (Garg et al., EMNLP 2019). Args: full_context_alignment (bool, optional): don't apply auto-regressive mask to self-attention (default: False). alignment_layer (int, optional): return mean alignment over heads at this layer (default: last layer). alignment_heads (int, optional): only average alignment over this many heads (default: all heads). Returns: tuple: - the decoder's features of shape `(batch, tgt_len, embed_dim)` - a dictionary with any model-specific outputs """ if alignment_layer is None: alignment_layer = self.num_layers - 1 # embed positions positions = ( self.embed_positions( prev_output_tokens, incremental_state=incremental_state ) if self.embed_positions is not None else None ) if incremental_state is not None: prev_output_tokens = prev_output_tokens[:, -1:] if positions is not None: positions = positions[:, -1:] bsz, seqlen = prev_output_tokens.size() # embed tokens and positions x = self.embed_scale * self.embed_tokens(prev_output_tokens) if self.quant_noise is not None: x = self.quant_noise(x) if self.project_in_dim is not None: x = self.project_in_dim(x) if positions is not None: x += positions if self.layernorm_embedding is not None: x = self.layernorm_embedding(x) x = self.dropout_module(x) # B x T x C -> T x B x C x = x.transpose(0, 1) if self.embed_lang is not None: lang_ids = prev_output_tokens.data.new_full((bsz,), lang_id) langemb = self.embed_lang(lang_ids) langemb = langemb.unsqueeze(0) repeat_vals = [x.shape[0] // langemb.shape[0]] + [-1] * ( len(langemb.shape) - 1 ) x = torch.cat((x, langemb.expand(*repeat_vals)), dim=-1) sentemb = encoder_out["sentemb"][0] sentemb = sentemb.unsqueeze(0) repeat_vals = [x.shape[0] // sentemb.shape[0]] + [-1] * (len(sentemb.shape) - 1) x = torch.cat((x, sentemb.expand(*repeat_vals)), dim=-1) self_attn_padding_mask: Optional[Tensor] = None if self.cross_self_attention or prev_output_tokens.eq(self.padding_idx).any(): self_attn_padding_mask = prev_output_tokens.eq(self.padding_idx) # decoder layers attn: Optional[Tensor] = None inner_states: List[Optional[Tensor]] = [x] for idx, layer in enumerate(self.layers): if incremental_state is None and not full_context_alignment: self_attn_mask = self.buffered_future_mask(x) else: self_attn_mask = None x, layer_attn, _ = layer( x, None, None, incremental_state, self_attn_mask=self_attn_mask, self_attn_padding_mask=self_attn_padding_mask, need_attn=bool((idx == alignment_layer)), need_head_weights=bool((idx == alignment_layer)), ) inner_states.append(x) if layer_attn is not None and idx == alignment_layer: attn = layer_attn.float().to(x) if attn is not None: if alignment_heads is not None: attn = attn[:alignment_heads] # average probabilities over heads attn = attn.mean(dim=0) if self.layer_norm is not None: x = self.layer_norm(x) # T x B x C -> B x T x C x = x.transpose(0, 1) if self.project_out_dim is not None: x = self.project_out_dim(x) return x, {"attn": [attn], "inner_states": inner_states} def forward( self, prev_output_tokens, encoder_out: Optional[Dict[str, List[Tensor]]] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, features_only: bool = False, alignment_layer: Optional[int] = None, alignment_heads: Optional[int] = None, src_lengths: Optional[Any] = None, return_all_hiddens: bool = False, lang_id: Optional[int] = None, ): """ Args: prev_output_tokens (LongTensor): previous decoder outputs of shape `(batch, tgt_len)`, for teacher forcing encoder_out (optional): output from the encoder, used for encoder-side attention incremental_state (dict): dictionary used for storing state during :ref:`Incremental decoding` features_only (bool, optional): only return features without applying output layer (default: False). Returns: tuple: - the decoder's output of shape `(batch, tgt_len, vocab)` - a dictionary with any model-specific outputs """ assert lang_id is not None x, extra = self.extract_features( prev_output_tokens, encoder_out=encoder_out, incremental_state=incremental_state, alignment_layer=alignment_layer, alignment_heads=alignment_heads, lang_id=lang_id, ) if not features_only: x = self.output_layer(x) return x, extra @register_model_architecture("laser_transformer", "laser_transformer") def base_laser_transformer_architecture(args): base_architecture(args) args.decoder_lang_embed_dim = getattr(args, "decoder_lang_embed_dim", 0)
11,947
32.656338
88
py
rej-summ
rej-summ-main/examples/laser/laser_src/laser_lstm.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import torch.nn as nn import torch.nn.functional as F from fairseq import options, utils from fairseq.models import ( FairseqEncoder, FairseqIncrementalDecoder, FairseqEncoderDecoderModel, register_model, register_model_architecture, ) @register_model("laser_lstm") class LSTMModel(FairseqEncoderDecoderModel): def __init__(self, encoder, decoder): super().__init__(encoder, decoder) def forward( self, src_tokens, src_lengths, prev_output_tokens=None, tgt_tokens=None, tgt_lengths=None, target_language_id=None, dataset_name="", ): assert target_language_id is not None src_encoder_out = self.encoder(src_tokens, src_lengths, dataset_name) return self.decoder( prev_output_tokens, src_encoder_out, lang_id=target_language_id ) @staticmethod def add_args(parser): """Add model-specific arguments to the parser.""" parser.add_argument( "--dropout", default=0.1, type=float, metavar="D", help="dropout probability", ) parser.add_argument( "--encoder-embed-dim", type=int, metavar="N", help="encoder embedding dimension", ) parser.add_argument( "--encoder-embed-path", default=None, type=str, metavar="STR", help="path to pre-trained encoder embedding", ) parser.add_argument( "--encoder-hidden-size", type=int, metavar="N", help="encoder hidden size" ) parser.add_argument( "--encoder-layers", type=int, metavar="N", help="number of encoder layers" ) parser.add_argument( "--encoder-bidirectional", action="store_true", help="make all layers of encoder bidirectional", ) parser.add_argument( "--decoder-embed-dim", type=int, metavar="N", help="decoder embedding dimension", ) parser.add_argument( "--decoder-embed-path", default=None, type=str, metavar="STR", help="path to pre-trained decoder embedding", ) parser.add_argument( "--decoder-hidden-size", type=int, metavar="N", help="decoder hidden size" ) parser.add_argument( "--decoder-layers", type=int, metavar="N", help="number of decoder layers" ) parser.add_argument( "--decoder-out-embed-dim", type=int, metavar="N", help="decoder output embedding dimension", ) parser.add_argument( "--decoder-zero-init", type=str, metavar="BOOL", help="initialize the decoder hidden/cell state to zero", ) parser.add_argument( "--decoder-lang-embed-dim", type=int, metavar="N", help="decoder language embedding dimension", ) parser.add_argument( "--fixed-embeddings", action="store_true", help="keep embeddings fixed (ENCODER ONLY)", ) # TODO Also apply to decoder embeddings? # Granular dropout settings (if not specified these default to --dropout) parser.add_argument( "--encoder-dropout-in", type=float, metavar="D", help="dropout probability for encoder input embedding", ) parser.add_argument( "--encoder-dropout-out", type=float, metavar="D", help="dropout probability for encoder output", ) parser.add_argument( "--decoder-dropout-in", type=float, metavar="D", help="dropout probability for decoder input embedding", ) parser.add_argument( "--decoder-dropout-out", type=float, metavar="D", help="dropout probability for decoder output", ) @classmethod def build_model(cls, args, task): """Build a new model instance.""" # make sure that all args are properly defaulted (in case there are any new ones) base_architecture(args) def load_pretrained_embedding_from_file(embed_path, dictionary, embed_dim): num_embeddings = len(dictionary) padding_idx = dictionary.pad() embed_tokens = Embedding(num_embeddings, embed_dim, padding_idx) embed_dict = utils.parse_embedding(embed_path) utils.print_embed_overlap(embed_dict, dictionary) return utils.load_embedding(embed_dict, dictionary, embed_tokens) pretrained_encoder_embed = None if args.encoder_embed_path: pretrained_encoder_embed = load_pretrained_embedding_from_file( args.encoder_embed_path, task.source_dictionary, args.encoder_embed_dim ) pretrained_decoder_embed = None if args.decoder_embed_path: pretrained_decoder_embed = load_pretrained_embedding_from_file( args.decoder_embed_path, task.target_dictionary, args.decoder_embed_dim ) num_langs = task.num_tasks if hasattr(task, "num_tasks") else 0 encoder = LSTMEncoder( dictionary=task.source_dictionary, embed_dim=args.encoder_embed_dim, hidden_size=args.encoder_hidden_size, num_layers=args.encoder_layers, dropout_in=args.encoder_dropout_in, dropout_out=args.encoder_dropout_out, bidirectional=args.encoder_bidirectional, pretrained_embed=pretrained_encoder_embed, fixed_embeddings=args.fixed_embeddings, ) decoder = LSTMDecoder( dictionary=task.target_dictionary, embed_dim=args.decoder_embed_dim, hidden_size=args.decoder_hidden_size, out_embed_dim=args.decoder_out_embed_dim, num_layers=args.decoder_layers, dropout_in=args.decoder_dropout_in, dropout_out=args.decoder_dropout_out, zero_init=options.eval_bool(args.decoder_zero_init), encoder_embed_dim=args.encoder_embed_dim, encoder_output_units=encoder.output_units, pretrained_embed=pretrained_decoder_embed, num_langs=num_langs, lang_embed_dim=args.decoder_lang_embed_dim, ) return cls(encoder, decoder) class LSTMEncoder(FairseqEncoder): """LSTM encoder.""" def __init__( self, dictionary, embed_dim=512, hidden_size=512, num_layers=1, dropout_in=0.1, dropout_out=0.1, bidirectional=False, left_pad=True, pretrained_embed=None, padding_value=0.0, fixed_embeddings=False, ): super().__init__(dictionary) self.num_layers = num_layers self.dropout_in = dropout_in self.dropout_out = dropout_out self.bidirectional = bidirectional self.hidden_size = hidden_size num_embeddings = len(dictionary) self.padding_idx = dictionary.pad() if pretrained_embed is None: self.embed_tokens = Embedding(num_embeddings, embed_dim, self.padding_idx) else: self.embed_tokens = pretrained_embed if fixed_embeddings: self.embed_tokens.weight.requires_grad = False self.lstm = LSTM( input_size=embed_dim, hidden_size=hidden_size, num_layers=num_layers, dropout=self.dropout_out if num_layers > 1 else 0.0, bidirectional=bidirectional, ) self.left_pad = left_pad self.padding_value = padding_value self.output_units = hidden_size if bidirectional: self.output_units *= 2 def forward(self, src_tokens, src_lengths, dataset_name): if self.left_pad: # convert left-padding to right-padding src_tokens = utils.convert_padding_direction( src_tokens, self.padding_idx, left_to_right=True, ) bsz, seqlen = src_tokens.size() # embed tokens x = self.embed_tokens(src_tokens) x = F.dropout(x, p=self.dropout_in, training=self.training) # B x T x C -> T x B x C x = x.transpose(0, 1) # pack embedded source tokens into a PackedSequence try: packed_x = nn.utils.rnn.pack_padded_sequence(x, src_lengths.data.tolist()) except BaseException: raise Exception(f"Packing failed in dataset {dataset_name}") # apply LSTM if self.bidirectional: state_size = 2 * self.num_layers, bsz, self.hidden_size else: state_size = self.num_layers, bsz, self.hidden_size h0 = x.data.new(*state_size).zero_() c0 = x.data.new(*state_size).zero_() packed_outs, (final_hiddens, final_cells) = self.lstm(packed_x, (h0, c0)) # unpack outputs and apply dropout x, _ = nn.utils.rnn.pad_packed_sequence( packed_outs, padding_value=self.padding_value ) x = F.dropout(x, p=self.dropout_out, training=self.training) assert list(x.size()) == [seqlen, bsz, self.output_units] if self.bidirectional: def combine_bidir(outs): return torch.cat( [ torch.cat([outs[2 * i], outs[2 * i + 1]], dim=0).view( 1, bsz, self.output_units ) for i in range(self.num_layers) ], dim=0, ) final_hiddens = combine_bidir(final_hiddens) final_cells = combine_bidir(final_cells) encoder_padding_mask = src_tokens.eq(self.padding_idx).t() # Set padded outputs to -inf so they are not selected by max-pooling padding_mask = src_tokens.eq(self.padding_idx).t().unsqueeze(-1) if padding_mask.any(): x = x.float().masked_fill_(padding_mask, float("-inf")).type_as(x) # Build the sentence embedding by max-pooling over the encoder outputs sentemb = x.max(dim=0)[0] return { "sentemb": sentemb, "encoder_out": (x, final_hiddens, final_cells), "encoder_padding_mask": encoder_padding_mask if encoder_padding_mask.any() else None, } def reorder_encoder_out(self, encoder_out_dict, new_order): encoder_out_dict["sentemb"] = encoder_out_dict["sentemb"].index_select( 0, new_order ) encoder_out_dict["encoder_out"] = tuple( eo.index_select(1, new_order) for eo in encoder_out_dict["encoder_out"] ) if encoder_out_dict["encoder_padding_mask"] is not None: encoder_out_dict["encoder_padding_mask"] = encoder_out_dict[ "encoder_padding_mask" ].index_select(1, new_order) return encoder_out_dict def max_positions(self): """Maximum input length supported by the encoder.""" return int(1e5) # an arbitrary large number class LSTMDecoder(FairseqIncrementalDecoder): """LSTM decoder.""" def __init__( self, dictionary, embed_dim=512, hidden_size=512, out_embed_dim=512, num_layers=1, dropout_in=0.1, dropout_out=0.1, zero_init=False, encoder_embed_dim=512, encoder_output_units=512, pretrained_embed=None, num_langs=1, lang_embed_dim=0, ): super().__init__(dictionary) self.dropout_in = dropout_in self.dropout_out = dropout_out self.hidden_size = hidden_size num_embeddings = len(dictionary) padding_idx = dictionary.pad() if pretrained_embed is None: self.embed_tokens = Embedding(num_embeddings, embed_dim, padding_idx) else: self.embed_tokens = pretrained_embed self.layers = nn.ModuleList( [ LSTMCell( input_size=encoder_output_units + embed_dim + lang_embed_dim if layer == 0 else hidden_size, hidden_size=hidden_size, ) for layer in range(num_layers) ] ) if hidden_size != out_embed_dim: self.additional_fc = Linear(hidden_size, out_embed_dim) self.fc_out = Linear(out_embed_dim, num_embeddings, dropout=dropout_out) if zero_init: self.sentemb2init = None else: self.sentemb2init = Linear( encoder_output_units, 2 * num_layers * hidden_size ) if lang_embed_dim == 0: self.embed_lang = None else: self.embed_lang = nn.Embedding(num_langs, lang_embed_dim) nn.init.uniform_(self.embed_lang.weight, -0.1, 0.1) def forward( self, prev_output_tokens, encoder_out_dict, incremental_state=None, lang_id=0 ): sentemb = encoder_out_dict["sentemb"] encoder_out = encoder_out_dict["encoder_out"] if incremental_state is not None: prev_output_tokens = prev_output_tokens[:, -1:] bsz, seqlen = prev_output_tokens.size() # get outputs from encoder encoder_outs, _, _ = encoder_out[:3] srclen = encoder_outs.size(0) # embed tokens x = self.embed_tokens(prev_output_tokens) x = F.dropout(x, p=self.dropout_in, training=self.training) # embed language identifier if self.embed_lang is not None: lang_ids = prev_output_tokens.data.new_full((bsz,), lang_id) langemb = self.embed_lang(lang_ids) # TODO Should we dropout here??? # B x T x C -> T x B x C x = x.transpose(0, 1) # initialize previous states (or get from cache during incremental generation) cached_state = utils.get_incremental_state( self, incremental_state, "cached_state" ) if cached_state is not None: prev_hiddens, prev_cells, input_feed = cached_state else: num_layers = len(self.layers) if self.sentemb2init is None: prev_hiddens = [ x.data.new(bsz, self.hidden_size).zero_() for i in range(num_layers) ] prev_cells = [ x.data.new(bsz, self.hidden_size).zero_() for i in range(num_layers) ] else: init = self.sentemb2init(sentemb) prev_hiddens = [ init[:, (2 * i) * self.hidden_size : (2 * i + 1) * self.hidden_size] for i in range(num_layers) ] prev_cells = [ init[ :, (2 * i + 1) * self.hidden_size : (2 * i + 2) * self.hidden_size, ] for i in range(num_layers) ] input_feed = x.data.new(bsz, self.hidden_size).zero_() attn_scores = x.data.new(srclen, seqlen, bsz).zero_() outs = [] for j in range(seqlen): if self.embed_lang is None: input = torch.cat((x[j, :, :], sentemb), dim=1) else: input = torch.cat((x[j, :, :], sentemb, langemb), dim=1) for i, rnn in enumerate(self.layers): # recurrent cell hidden, cell = rnn(input, (prev_hiddens[i], prev_cells[i])) # hidden state becomes the input to the next layer input = F.dropout(hidden, p=self.dropout_out, training=self.training) # save state for next time step prev_hiddens[i] = hidden prev_cells[i] = cell out = hidden out = F.dropout(out, p=self.dropout_out, training=self.training) # input feeding input_feed = out # save final output outs.append(out) # cache previous states (no-op except during incremental generation) utils.set_incremental_state( self, incremental_state, "cached_state", (prev_hiddens, prev_cells, input_feed), ) # collect outputs across time steps x = torch.cat(outs, dim=0).view(seqlen, bsz, self.hidden_size) # T x B x C -> B x T x C x = x.transpose(1, 0) # srclen x tgtlen x bsz -> bsz x tgtlen x srclen attn_scores = attn_scores.transpose(0, 2) # project back to size of vocabulary if hasattr(self, "additional_fc"): x = self.additional_fc(x) x = F.dropout(x, p=self.dropout_out, training=self.training) x = self.fc_out(x) return x, attn_scores def reorder_incremental_state(self, incremental_state, new_order): super().reorder_incremental_state(incremental_state, new_order) cached_state = utils.get_incremental_state( self, incremental_state, "cached_state" ) if cached_state is None: return def reorder_state(state): if isinstance(state, list): return [reorder_state(state_i) for state_i in state] return state.index_select(0, new_order) new_state = tuple(map(reorder_state, cached_state)) utils.set_incremental_state(self, incremental_state, "cached_state", new_state) def max_positions(self): """Maximum output length supported by the decoder.""" return int(1e5) # an arbitrary large number def Embedding(num_embeddings, embedding_dim, padding_idx): m = nn.Embedding(num_embeddings, embedding_dim, padding_idx=padding_idx) nn.init.uniform_(m.weight, -0.1, 0.1) nn.init.constant_(m.weight[padding_idx], 0) return m def LSTM(input_size, hidden_size, **kwargs): m = nn.LSTM(input_size, hidden_size, **kwargs) for name, param in m.named_parameters(): if "weight" in name or "bias" in name: param.data.uniform_(-0.1, 0.1) return m def LSTMCell(input_size, hidden_size, **kwargs): m = nn.LSTMCell(input_size, hidden_size, **kwargs) for name, param in m.named_parameters(): if "weight" in name or "bias" in name: param.data.uniform_(-0.1, 0.1) return m def Linear(in_features, out_features, bias=True, dropout=0): """Weight-normalized Linear layer (input: N x T x C)""" m = nn.Linear(in_features, out_features, bias=bias) m.weight.data.uniform_(-0.1, 0.1) if bias: m.bias.data.uniform_(-0.1, 0.1) return m @register_model_architecture("laser_lstm", "laser_lstm") def base_architecture(args): args.encoder_embed_dim = getattr(args, "encoder_embed_dim", 512) args.encoder_embed_path = getattr(args, "encoder_embed_path", None) args.encoder_hidden_size = getattr( args, "encoder_hidden_size", args.encoder_embed_dim ) args.encoder_layers = getattr(args, "encoder_layers", 1) args.encoder_bidirectional = getattr(args, "encoder_bidirectional", False) args.encoder_dropout_in = getattr(args, "encoder_dropout_in", args.dropout) args.encoder_dropout_out = getattr(args, "encoder_dropout_out", args.dropout) args.decoder_embed_dim = getattr(args, "decoder_embed_dim", 512) args.decoder_embed_path = getattr(args, "decoder_embed_path", None) args.decoder_hidden_size = getattr( args, "decoder_hidden_size", args.decoder_embed_dim ) args.decoder_layers = getattr(args, "decoder_layers", 1) args.decoder_out_embed_dim = getattr(args, "decoder_out_embed_dim", 512) args.decoder_dropout_in = getattr(args, "decoder_dropout_in", args.dropout) args.decoder_dropout_out = getattr(args, "decoder_dropout_out", args.dropout) args.decoder_zero_init = getattr(args, "decoder_zero_init", "0") args.decoder_lang_embed_dim = getattr(args, "decoder_lang_embed_dim", 0) args.fixed_embeddings = getattr(args, "fixed_embeddings", False)
20,672
34.278157
89
py
rej-summ
rej-summ-main/examples/latent_depth/latent_depth_src/modules/latent_layers.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import torch.nn as nn class LayerSelect(nn.Module): """Compute samples (from a Gumbel-Sigmoid distribution) which is used as either (soft) weighting or (hard) selection of residual connection. https://arxiv.org/abs/2009.13102 """ def __init__(self, num_layers, num_logits, soft_select=False, sampling_tau=5.): super(LayerSelect, self).__init__() self.layer_logits = torch.nn.Parameter( torch.Tensor(num_logits, num_layers), requires_grad=True, ) self.hard_select = not soft_select self.tau = sampling_tau self.detach_grad = False self.layer_samples = [None] * num_logits def sample(self, logit_idx): """To leverage the efficiency of distributed training, samples for all layers are computed at once for each logit_idx. Logits are parameters learnt independent of each other. Args: logit_idx: The index of logit parameters used for sampling. """ assert logit_idx is not None self.samples = self._gumbel_sigmoid( self.layer_logits[logit_idx, :].detach() if self.detach_grad else self.layer_logits[logit_idx, :], dim=-1, tau=self.tau, hard=self.hard_select, ) self.layer_samples[logit_idx] = self.samples def forward(self, i): sample = self.samples[i] return sample def _gumbel_sigmoid( self, logits, tau=1, hard=False, eps=1e-10, dim=-1, threshold=0.5 ): # ~Gumbel(0,1) gumbels1 = ( -torch.empty_like(logits, memory_format=torch.legacy_contiguous_format) .exponential_() .log() ) gumbels2 = ( -torch.empty_like(logits, memory_format=torch.legacy_contiguous_format) .exponential_() .log() ) # Difference of two gumbels because we apply a sigmoid gumbels1 = (logits + gumbels1 - gumbels2) / tau y_soft = gumbels1.sigmoid() if hard: # Straight through. y_hard = torch.zeros_like( logits, memory_format=torch.legacy_contiguous_format ).masked_fill(y_soft > threshold, 1.0) ret = y_hard - y_soft.detach() + y_soft else: # Reparametrization trick. ret = y_soft return ret
2,605
33.289474
83
py
rej-summ
rej-summ-main/examples/latent_depth/latent_depth_src/models/latent_transformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Any, Dict, Optional import torch.nn as nn from fairseq.models.fairseq_encoder import EncoderOut from fairseq.models.transformer import TransformerDecoder, TransformerEncoder from fairseq.modules import TransformerDecoderLayer, TransformerEncoderLayer from torch import Tensor from ..modules.latent_layers import LayerSelect class LatentTransformerEncoder(TransformerEncoder): """Latent depth (https://arxiv.org/abs/2009.13102) implemented in TransformerEncoder. """ def __init__(self, args, dictionary, embed_tokens, num_logits=1): self.num_logits = num_logits self.num_layers = args.encoder_layers super().__init__(args, dictionary, embed_tokens) self.layer_select = LayerSelect( num_layers=self.num_layers, num_logits=self.num_logits, soft_select=getattr(args, "soft_select", False), sampling_tau=getattr(args, "sampling_tau", 5.), ) self.lang_idx = None self.layers = nn.ModuleList( [self._build_encoder_layer(args, idx) for idx in range(args.encoder_layers)] ) def set_lang_idx(self, lang_idx): self.lang_idx = lang_idx def _build_encoder_layer(self, args, idx=None): return LatentTransformerEncoderLayer(args, idx, layer_select=self.layer_select) def forward(self, src_tokens, src_lengths, return_all_hiddens: bool = False): self.layer_select.sample(self.lang_idx) return super().forward(src_tokens, src_lengths, return_all_hiddens) class LatentTransformerEncoderLayer(TransformerEncoderLayer): """Encoder layer with each (non_residual) block weighted by samples of Bernouli or Gumbel Signmoid samples. Args: args (argparse.Namespace): parsed command-line arguments from standard TransformerEncoderLayer. idx (int): layer index (used to retrieve samples). layer_select (LayerSelect, optional): instance of LayerSelect module with logits parameters and sampling method. """ def __init__(self, args, idx, layer_select=None): super().__init__(args) self.idx = idx self.layer_select = layer_select def residual_connection(self, x, residual): return residual + x * self.layer_select(self.idx) class LatentTransformerDecoder(TransformerDecoder): """Latent depth (https://arxiv.org/abs/2009.13102) implemented in TransformerDecoder. """ def __init__( self, args, dictionary, embed_tokens, no_encoder_attn=False, num_logits=1 ): self.num_logits = num_logits self.num_layers = args.decoder_layers super().__init__( args, dictionary, embed_tokens, no_encoder_attn=no_encoder_attn ) self.layer_select = LayerSelect( num_layers=self.num_layers, num_logits=self.num_logits, soft_select=getattr(args, "soft_select", False), sampling_tau=getattr(args, "sampling_tau", 5.), ) self.lang_idx = None self.layers = nn.ModuleList( [ self._build_decoder_layer(args, no_encoder_attn, idx) for idx in range(args.decoder_layers) ] ) def set_lang_idx(self, lang_idx): self.lang_idx = lang_idx def _build_decoder_layer(self, args, no_encoder_attn=False, idx=None): return LatentTransformerDecoderLayer( args, idx, layer_select=self.layer_select, no_encoder_attn=no_encoder_attn ) def forward( self, prev_output_tokens, encoder_out: Optional[EncoderOut] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, features_only: bool = False, alignment_layer: Optional[int] = None, alignment_heads: Optional[int] = None, src_lengths: Optional[Any] = None, return_all_hiddens: bool = False, ): self.layer_select.sample(self.lang_idx) return super().forward( prev_output_tokens=prev_output_tokens, encoder_out=encoder_out, incremental_state=incremental_state, features_only=features_only, alignment_layer=alignment_layer, src_lengths=src_lengths, return_all_hiddens=return_all_hiddens, ) class LatentTransformerDecoderLayer(TransformerDecoderLayer): """Decoder layer with each (non_residual) block weighted by samples of Bernouli or Gumbel Signmoid samples. Args: args (argparse.Namespace): parsed command-line arguments from standard TransformerDecoderLayer. idx (int): layer index (used to retrieve samples). layer_select (LayerSelect, optional): instance of LayerSelect module with logits parameters and sampling method. no_encoder_attn (bool, optional): whether to attend to encoder outputs (default: False). """ def __init__( self, args, idx, layer_select=None, no_encoder_attn=False, add_bias_kv=False, add_zero_attn=False, ): super().__init__(args, no_encoder_attn, add_bias_kv, add_zero_attn) self.idx = idx self.layer_select = layer_select def residual_connection(self, x, residual): return residual + x * self.layer_select(self.idx)
5,584
34.573248
88
py
rej-summ
rej-summ-main/examples/latent_depth/latent_depth_src/loss/latent_depth.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import math import torch from torch.nn.modules.loss import _Loss class LatentLayersKLLoss(_Loss): def __init__(self, args): super().__init__() self.args = args def forward(self, layer_samples, lang_idx, update_num, sample_size): prior = self.args.prior samples = layer_samples[lang_idx] eps = 1e-7 if prior == "uniform": # uniform prior kl_loss = (samples * (torch.log(samples + eps) - math.log(0.5))).sum(-1) elif prior == "agged_posterior": # aggregated posterior y_t = torch.stack([x.detach() for x in layer_samples], dim=0) agged_q = torch.sum(y_t, dim=0) row_norm = agged_q.sum(-1) normed_agg_q = agged_q / row_norm kl_loss = ( samples * (torch.log(samples + eps) - torch.log(normed_agg_q + eps)) ).sum(-1) else: raise NotImplementedError("The specified prior is not implemented.") # normalized by number of layers kl_loss /= layer_samples[0].size()[0] kl_weight = min( self.args.sparsity_weight, (update_num - self.args.soft_update) * self.args.sparsity_weight / self.args.anneal_updates, ) kl_loss *= kl_weight * sample_size return kl_loss class LatentLayersSparsityLoss(_Loss): def __init__(self, args): super().__init__() self.args = args def is_valid(self, update_num): if self.args.target_layers <= 0: return False return update_num > (self.args.soft_update + self.args.anneal_updates) def forward(self, layer_samples_list, update_num, sample_size): batch_loss = 0 share_loss = 0 global_sparsity_loss = 0 layer_samples = torch.stack(layer_samples_list, dim=0) if ( self.args.target_layers > 0 or self.args.share_weight > 0 ) and update_num > (self.args.soft_update + self.args.anneal_updates): # anneal sparsity weight if update_num < (self.args.anneal_updates + self.args.soft_update): weight_anneal = 0 elif update_num < (2 * self.args.anneal_updates + self.args.soft_update): weight_anneal = ( (update_num - self.args.soft_update - self.args.anneal_updates) * self.args.share_weight / self.args.anneal_updates ) else: weight_anneal = 1 # compute ratio among languages layer_utilization = torch.sum(layer_samples, dim=0) layer_utilization /= layer_samples.size()[0] if self.args.share_weight > 0: # encouraging sharing across languages share_loss = sum( -1.0 * v * math.log(v) for v in layer_utilization if v > 0 ) batch_loss += ( weight_anneal * self.args.share_weight * sample_size * share_loss ) if self.args.target_layers > 0: # computed expected number of layers selected expeted_layers = sum(layer_utilization) # compute l2 loss wrt target number of layers global_sparsity_loss = (expeted_layers - self.args.target_layers) ** 2 batch_loss += ( weight_anneal * self.args.share_weight * sample_size * global_sparsity_loss ) return batch_loss
3,802
37.03
86
py
rej-summ
rej-summ-main/examples/hubert/update_ckpt.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch src_ckpt = "/checkpoint/wnhsu/w2v/archived/hubert_base_ls960_it2.pt" ref_ckpt = "/checkpoint/wnhsu/w2v/hubert_icassp_oss_v3/iter2_km100-400k-grp-L6/oss.km500_p0_1_s334.pmw1_0.puw0_0.grpnorm.ml10.mp0_8.untie.mxsz250000.ufreq1.maxtok1400000.MU100k.s1337.ngpu32/checkpoint_last.pt" new_ckpt = "/checkpoint/wnhsu/w2v/archived/hubert_base_ls960_it2_updated.pt" def update_state(state): state["model"]["label_embs_concat"] = state["model"].pop("label_embs") state["args"].task = "hubert_pretraining" state["args"].labels = f"['{state['args'].labels}']" return state src_state = torch.load(src_ckpt) src_state = update_state(src_state) torch.save(src_state, new_ckpt)
873
37
209
py
rej-summ
rej-summ-main/examples/hubert/simple_kmeans/dump_km_label.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import os import sys import numpy as np import joblib import torch import tqdm logging.basicConfig( format="%(asctime)s | %(levelname)s | %(name)s | %(message)s", datefmt="%Y-%m-%d %H:%M:%S", level=os.environ.get("LOGLEVEL", "INFO").upper(), stream=sys.stdout, ) logger = logging.getLogger("dump_km_label") class ApplyKmeans(object): def __init__(self, km_path): self.km_model = joblib.load(km_path) self.C_np = self.km_model.cluster_centers_.transpose() self.Cnorm_np = (self.C_np ** 2).sum(0, keepdims=True) self.C = torch.from_numpy(self.C_np) self.Cnorm = torch.from_numpy(self.Cnorm_np) if torch.cuda.is_available(): self.C = self.C.cuda() self.Cnorm = self.Cnorm.cuda() def __call__(self, x): if isinstance(x, torch.Tensor): dist = ( x.pow(2).sum(1, keepdim=True) - 2 * torch.matmul(x, self.C) + self.Cnorm ) return dist.argmin(dim=1).cpu().numpy() else: dist = ( (x ** 2).sum(1, keepdims=True) - 2 * np.matmul(x, self.C_np) + self.Cnorm_np ) return np.argmin(dist, axis=1) def get_feat_iterator(feat_dir, split, nshard, rank): feat_path = f"{feat_dir}/{split}_{rank}_{nshard}.npy" leng_path = f"{feat_dir}/{split}_{rank}_{nshard}.len" with open(leng_path, "r") as f: lengs = [int(line.rstrip()) for line in f] offsets = [0] + np.cumsum(lengs[:-1]).tolist() def iterate(): feat = np.load(feat_path, mmap_mode="r") assert feat.shape[0] == (offsets[-1] + lengs[-1]) for offset, leng in zip(offsets, lengs): yield feat[offset: offset + leng] return iterate, len(lengs) def dump_label(feat_dir, split, km_path, nshard, rank, lab_dir): apply_kmeans = ApplyKmeans(km_path) generator, num = get_feat_iterator(feat_dir, split, nshard, rank) iterator = generator() lab_path = f"{lab_dir}/{split}_{rank}_{nshard}.km" os.makedirs(lab_dir, exist_ok=True) with open(lab_path, "w") as f: for feat in tqdm.tqdm(iterator, total=num): # feat = torch.from_numpy(feat).cuda() lab = apply_kmeans(feat).tolist() f.write(" ".join(map(str, lab)) + "\n") logger.info("finished successfully") if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("feat_dir") parser.add_argument("split") parser.add_argument("km_path") parser.add_argument("nshard", type=int) parser.add_argument("rank", type=int) parser.add_argument("lab_dir") args = parser.parse_args() logging.info(str(args)) dump_label(**vars(args))
3,008
29.393939
69
py
rej-summ
rej-summ-main/examples/hubert/simple_kmeans/dump_mfcc_feature.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import os import sys import soundfile as sf import torch import torchaudio from feature_utils import get_path_iterator, dump_feature from fairseq.data.audio.audio_utils import get_features_or_waveform logging.basicConfig( format="%(asctime)s | %(levelname)s | %(name)s | %(message)s", datefmt="%Y-%m-%d %H:%M:%S", level=os.environ.get("LOGLEVEL", "INFO").upper(), stream=sys.stdout, ) logger = logging.getLogger("dump_mfcc_feature") class MfccFeatureReader(object): def __init__(self, sample_rate): self.sample_rate = sample_rate def read_audio(self, path, ref_len=None): wav = get_features_or_waveform(path, need_waveform=True, use_sample_rate=self.sample_rate) if ref_len is not None and abs(ref_len - len(wav)) > 160: logging.warning(f"ref {ref_len} != read {len(wav)} ({path})") return wav def get_feats(self, path, ref_len=None): x = self.read_audio(path, ref_len=ref_len) with torch.no_grad(): x = torch.from_numpy(x).float() x = x.view(1, -1) mfccs = torchaudio.compliance.kaldi.mfcc( waveform=x, sample_frequency=self.sample_rate, use_energy=False, ) # (time, freq) mfccs = mfccs.transpose(0, 1) # (freq, time) deltas = torchaudio.functional.compute_deltas(mfccs) ddeltas = torchaudio.functional.compute_deltas(deltas) concat = torch.cat([mfccs, deltas, ddeltas], dim=0) concat = concat.transpose(0, 1).contiguous() # (freq, time) return concat def main(tsv_dir, split, nshard, rank, feat_dir, sample_rate): reader = MfccFeatureReader(sample_rate) generator, num = get_path_iterator(f"{tsv_dir}/{split}.tsv", nshard, rank) dump_feature(reader, generator, num, split, nshard, rank, feat_dir) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("tsv_dir") parser.add_argument("split") parser.add_argument("nshard", type=int) parser.add_argument("rank", type=int) parser.add_argument("feat_dir") parser.add_argument("--sample_rate", type=int, default=16000) args = parser.parse_args() logger.info(args) main(**vars(args))
2,495
32.28
98
py
rej-summ
rej-summ-main/examples/hubert/simple_kmeans/dump_w2v2_feature.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import os import sys import fairseq import soundfile as sf import torch import torch.nn.functional as F from feature_utils import get_path_iterator, dump_feature logging.basicConfig( format="%(asctime)s | %(levelname)s | %(name)s | %(message)s", datefmt="%Y-%m-%d %H:%M:%S", level=os.environ.get("LOGLEVEL", "INFO").upper(), stream=sys.stdout, ) logger = logging.getLogger("dump_w2v2_feature") class Wav2Vec2FeatureReader(object): def __init__(self, ckpt_path, layer, max_chunk=1600000): ( model, cfg, task, ) = fairseq.checkpoint_utils.load_model_ensemble_and_task([ckpt_path]) self.model = model[0].eval().cuda() self.task = task self.layer = layer # assume this is 1-based like HuBERT self.max_chunk = max_chunk logger.info(f"TASK CONFIG:\n{self.task.cfg}") logger.info(f" max_chunk = {self.max_chunk}") logger.info(f" model:\n{self.model}") def read_audio(self, path, ref_len=None): wav, sr = sf.read(path) assert sr == self.task.cfg.sample_rate, sr if wav.ndim == 2: wav = wav.mean(-1) assert wav.ndim == 1, wav.ndim if ref_len is not None and abs(ref_len - len(wav)) > 160: logging.warning(f"ref {ref_len} != read {len(wav)} ({path})") return wav def get_feats(self, path, ref_len=None): x = self.read_audio(path, ref_len) with torch.no_grad(): x = torch.from_numpy(x).float().cuda() if self.task.cfg.normalize: x = F.layer_norm(x, x.shape) x = x.view(1, -1) feat = [] for start in range(0, x.size(1), self.max_chunk): x_chunk = x[:, start: start + self.max_chunk] res = self.model.extract_features( source=x_chunk, padding_mask=None, mask=False, layer=self.layer - 1, ) feat_chunk = res["x"] feat.append(feat_chunk) return torch.cat(feat, 1).squeeze(0) def main(tsv_dir, split, ckpt_path, layer, nshard, rank, feat_dir, max_chunk): reader = Wav2Vec2FeatureReader(ckpt_path, layer, max_chunk) generator, num = get_path_iterator(f"{tsv_dir}/{split}.tsv", nshard, rank) dump_feature(reader, generator, num, split, nshard, rank, feat_dir) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("tsv_dir") parser.add_argument("split") parser.add_argument("ckpt_path") parser.add_argument("layer", type=int) parser.add_argument("nshard", type=int) parser.add_argument("rank", type=int) parser.add_argument("feat_dir") parser.add_argument("--max_chunk", type=int, default=1600000) args = parser.parse_args() logger.info(args) main(**vars(args))
3,129
31.604167
78
py
rej-summ
rej-summ-main/examples/hubert/simple_kmeans/dump_hubert_feature.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import os import sys import fairseq import soundfile as sf import torch import torch.nn.functional as F from feature_utils import get_path_iterator, dump_feature from fairseq.data.audio.audio_utils import get_features_or_waveform logging.basicConfig( format="%(asctime)s | %(levelname)s | %(name)s | %(message)s", datefmt="%Y-%m-%d %H:%M:%S", level=os.environ.get("LOGLEVEL", "INFO").upper(), stream=sys.stdout, ) logger = logging.getLogger("dump_hubert_feature") class HubertFeatureReader(object): def __init__(self, ckpt_path, layer, max_chunk=1600000): ( model, cfg, task, ) = fairseq.checkpoint_utils.load_model_ensemble_and_task([ckpt_path]) self.model = model[0].eval().cuda() self.task = task self.layer = layer self.max_chunk = max_chunk logger.info(f"TASK CONFIG:\n{self.task.cfg}") logger.info(f" max_chunk = {self.max_chunk}") def read_audio(self, path, ref_len=None): wav = get_features_or_waveform(path, need_waveform=True, use_sample_rate=self.task.cfg.sample_rate) if wav.ndim == 2: wav = wav.mean(-1) assert wav.ndim == 1, wav.ndim if ref_len is not None and abs(ref_len - len(wav)) > 160: logging.warning(f"ref {ref_len} != read {len(wav)} ({path})") return wav def get_feats(self, path, ref_len=None): x = self.read_audio(path, ref_len=ref_len) with torch.no_grad(): x = torch.from_numpy(x).float().cuda() if self.task.cfg.normalize: x = F.layer_norm(x, x.shape) x = x.view(1, -1) feat = [] for start in range(0, x.size(1), self.max_chunk): x_chunk = x[:, start : start + self.max_chunk] feat_chunk, _ = self.model.extract_features( source=x_chunk, padding_mask=None, mask=False, output_layer=self.layer, ) feat.append(feat_chunk) return torch.cat(feat, 1).squeeze(0) def main(tsv_dir, split, ckpt_path, layer, nshard, rank, feat_dir, max_chunk): reader = HubertFeatureReader(ckpt_path, layer, max_chunk) generator, num = get_path_iterator(f"{tsv_dir}/{split}.tsv", nshard, rank) dump_feature(reader, generator, num, split, nshard, rank, feat_dir) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("tsv_dir") parser.add_argument("split") parser.add_argument("ckpt_path") parser.add_argument("layer", type=int) parser.add_argument("nshard", type=int) parser.add_argument("rank", type=int) parser.add_argument("feat_dir") parser.add_argument("--max_chunk", type=int, default=1600000) args = parser.parse_args() logger.info(args) main(**vars(args))
3,120
32.202128
107
py
rej-summ
rej-summ-main/examples/speech_to_text/prep_covost_data.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging from pathlib import Path import shutil from tempfile import NamedTemporaryFile from typing import Optional, Tuple import pandas as pd import torchaudio from examples.speech_to_text.data_utils import ( create_zip, extract_fbank_features, filter_manifest_df, gen_config_yaml, gen_vocab, get_zip_manifest, load_df_from_tsv, save_df_to_tsv, ) from torch import Tensor from torch.utils.data import Dataset from torchaudio.datasets.utils import download_url, extract_archive from tqdm import tqdm log = logging.getLogger(__name__) MANIFEST_COLUMNS = ["id", "audio", "n_frames", "tgt_text", "speaker"] class CoVoST(Dataset): """Create a Dataset for CoVoST (https://github.com/facebookresearch/covost). Args: root (str): root path to the dataset and generated manifests/features source_language (str): source (audio) language target_language (str, optional): target (text) language, None for no translation (default: None) version (int, optional): CoVoST version. (default: 2) download (bool, optional): Whether to download the dataset if it is not found at root path. (default: ``False``). """ COVOST_URL_TEMPLATE = ( "https://dl.fbaipublicfiles.com/covost/" "covost_v2.{src_lang}_{tgt_lang}.tsv.tar.gz" ) VERSIONS = {2} SPLITS = ["train", "dev", "test"] XX_EN_LANGUAGES = { 1: ["fr", "de", "nl", "ru", "es", "it", "tr", "fa", "sv-SE", "mn", "zh-CN"], 2: [ "fr", "de", "es", "ca", "it", "ru", "zh-CN", "pt", "fa", "et", "mn", "nl", "tr", "ar", "sv-SE", "lv", "sl", "ta", "ja", "id", "cy", ], } EN_XX_LANGUAGES = { 1: [], 2: [ "de", "tr", "fa", "sv-SE", "mn", "zh-CN", "cy", "ca", "sl", "et", "id", "ar", "ta", "lv", "ja", ], } def __init__( self, root: str, split: str, source_language: str, target_language: Optional[str] = None, version: int = 2, ) -> None: assert version in self.VERSIONS and split in self.SPLITS assert source_language is not None self.no_translation = target_language is None if not self.no_translation: assert "en" in {source_language, target_language} if source_language == "en": assert target_language in self.EN_XX_LANGUAGES[version] else: assert source_language in self.XX_EN_LANGUAGES[version] else: # Hack here so that we can get "split" column from CoVoST TSV. # Note that we use CoVoST train split for ASR which is an extension # to Common Voice train split. target_language = "de" if source_language == "en" else "en" self.root: Path = Path(root) cv_tsv_path = self.root / "validated.tsv" assert cv_tsv_path.is_file() covost_url = self.COVOST_URL_TEMPLATE.format( src_lang=source_language, tgt_lang=target_language ) covost_archive = self.root / Path(covost_url).name if not covost_archive.is_file(): download_url(covost_url, self.root.as_posix(), hash_value=None) extract_archive(covost_archive.as_posix()) cv_tsv = load_df_from_tsv(cv_tsv_path) covost_tsv = load_df_from_tsv( self.root / Path(covost_url).name.replace(".tar.gz", "") ) df = pd.merge( left=cv_tsv[["path", "sentence", "client_id"]], right=covost_tsv[["path", "translation", "split"]], how="inner", on="path", ) if split == "train": df = df[(df["split"] == split) | (df["split"] == f"{split}_covost")] else: df = df[df["split"] == split] data = df.to_dict(orient="index").items() data = [v for k, v in sorted(data, key=lambda x: x[0])] self.data = [] for e in data: try: path = self.root / "clips" / e["path"] _ = torchaudio.info(path.as_posix()) self.data.append(e) except RuntimeError: pass def __getitem__( self, n: int ) -> Tuple[Tensor, int, str, str, Optional[str], str, str]: """Load the n-th sample from the dataset. Args: n (int): The index of the sample to be loaded Returns: tuple: ``(waveform, sample_rate, sentence, translation, speaker_id, sample_id)`` """ data = self.data[n] path = self.root / "clips" / data["path"] waveform, sample_rate = torchaudio.load(path) sentence = data["sentence"] translation = None if self.no_translation else data["translation"] speaker_id = data["client_id"] _id = data["path"].replace(".mp3", "") return waveform, sample_rate, sentence, translation, speaker_id, _id def __len__(self) -> int: return len(self.data) def process(args): root = Path(args.data_root).absolute() / args.src_lang if not root.is_dir(): raise NotADirectoryError(f"{root} does not exist") # Extract features feature_root = root / "fbank80" feature_root.mkdir(exist_ok=True) for split in CoVoST.SPLITS: print(f"Fetching split {split}...") dataset = CoVoST(root, split, args.src_lang, args.tgt_lang) print("Extracting log mel filter bank features...") for waveform, sample_rate, _, _, _, utt_id in tqdm(dataset): extract_fbank_features( waveform, sample_rate, feature_root / f"{utt_id}.npy" ) # Pack features into ZIP zip_path = root / "fbank80.zip" print("ZIPing features...") create_zip(feature_root, zip_path) print("Fetching ZIP manifest...") audio_paths, audio_lengths = get_zip_manifest(zip_path) # Generate TSV manifest print("Generating manifest...") train_text = [] task = f"asr_{args.src_lang}" if args.tgt_lang is not None: task = f"st_{args.src_lang}_{args.tgt_lang}" for split in CoVoST.SPLITS: manifest = {c: [] for c in MANIFEST_COLUMNS} dataset = CoVoST(root, split, args.src_lang, args.tgt_lang) for _, _, src_utt, tgt_utt, speaker_id, utt_id in tqdm(dataset): manifest["id"].append(utt_id) manifest["audio"].append(audio_paths[utt_id]) manifest["n_frames"].append(audio_lengths[utt_id]) manifest["tgt_text"].append(src_utt if args.tgt_lang is None else tgt_utt) manifest["speaker"].append(speaker_id) is_train_split = split.startswith("train") if is_train_split: train_text.extend(manifest["tgt_text"]) df = pd.DataFrame.from_dict(manifest) df = filter_manifest_df(df, is_train_split=is_train_split) save_df_to_tsv(df, root / f"{split}_{task}.tsv") # Generate vocab vocab_size_str = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{vocab_size_str}_{task}" with NamedTemporaryFile(mode="w") as f: for t in train_text: f.write(t + "\n") gen_vocab( Path(f.name), root / spm_filename_prefix, args.vocab_type, args.vocab_size ) # Generate config YAML gen_config_yaml( root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{task}.yaml", specaugment_policy="lb", ) # Clean up shutil.rmtree(feature_root) def main(): parser = argparse.ArgumentParser() parser.add_argument( "--data-root", "-d", required=True, type=str, help="data root with sub-folders for each language <root>/<src_lang>" ) parser.add_argument( "--vocab-type", default="unigram", required=True, type=str, choices=["bpe", "unigram", "char"], ), parser.add_argument("--vocab-size", default=1000, type=int) parser.add_argument("--src-lang", "-s", required=True, type=str) parser.add_argument("--tgt-lang", "-t", type=str) args = parser.parse_args() process(args) if __name__ == "__main__": main()
8,909
30.821429
86
py
rej-summ
rej-summ-main/examples/speech_to_text/prep_mtedx_data.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging import os from pathlib import Path import shutil from itertools import groupby from tempfile import NamedTemporaryFile from typing import Tuple import pandas as pd import soundfile as sf from examples.speech_to_text.data_utils import ( create_zip, extract_fbank_features, filter_manifest_df, gen_config_yaml, gen_vocab, get_zip_manifest, load_df_from_tsv, save_df_to_tsv, ) import torch from torch.utils.data import Dataset from tqdm import tqdm from fairseq.data.audio.audio_utils import get_waveform, convert_waveform log = logging.getLogger(__name__) MANIFEST_COLUMNS = [ "id", "audio", "n_frames", "tgt_text", "speaker", "tgt_lang" ] class mTEDx(Dataset): """ Create a Dataset for Multilingual TEDx. Each item is a tuple of the form: waveform, sample_rate, source utterance, target utterance, speaker_id, utterance_id """ SPLITS = ["train", "valid", "test"] LANGPAIRS = ["es-es", "fr-fr", "pt-pt", "it-it", "ru-ru", "el-el", "ar-ar", "de-de", "es-en", "es-fr", "es-pt", "es-it", "fr-en", "fr-es", "fr-pt", "pt-en", "pt-es", "it-en", "it-es", "ru-en", "el-en"] def __init__(self, root: str, lang: str, split: str) -> None: assert split in self.SPLITS and lang in self.LANGPAIRS _root = Path(root) / f"{lang}" / "data" / split wav_root, txt_root = _root / "wav", _root / "txt" assert _root.is_dir() and wav_root.is_dir() and txt_root.is_dir() # Load audio segments try: import yaml except ImportError: print( "Please install PyYAML to load the Multilingual TEDx YAML files" ) with open(txt_root / f"{split}.yaml") as f: segments = yaml.load(f, Loader=yaml.BaseLoader) # Load source and target utterances src, tgt = lang.split("-") for _lang in [src, tgt]: with open(txt_root / f"{split}.{_lang}") as f: utterances = [r.strip() for r in f] assert len(segments) == len(utterances) for i, u in enumerate(utterances): segments[i][_lang] = u # Gather info self.data = [] for wav_filename, _seg_group in groupby(segments, lambda x: x["wav"]): wav_filename = wav_filename.replace(".wav", ".flac") wav_path = wav_root / wav_filename sample_rate = sf.info(wav_path.as_posix()).samplerate seg_group = sorted(_seg_group, key=lambda x: float(x["offset"])) for i, segment in enumerate(seg_group): offset = int(float(segment["offset"]) * sample_rate) n_frames = int(float(segment["duration"]) * sample_rate) _id = f"{wav_path.stem}_{i}" self.data.append( ( wav_path.as_posix(), offset, n_frames, sample_rate, segment[src], segment[tgt], segment["speaker_id"], tgt, _id, ) ) def __getitem__( self, n: int ) -> Tuple[torch.Tensor, int, str, str, str, str, str]: wav_path, offset, n_frames, sr, src_utt, tgt_utt, spk_id, tgt_lang, \ utt_id = self.data[n] waveform, _ = get_waveform(wav_path, frames=n_frames, start=offset) waveform = torch.from_numpy(waveform) return waveform, sr, src_utt, tgt_utt, spk_id, tgt_lang, utt_id def __len__(self) -> int: return len(self.data) def process(args): root = Path(args.data_root).absolute() for lang in mTEDx.LANGPAIRS: cur_root = root / f"{lang}" if not cur_root.is_dir(): print(f"{cur_root.as_posix()} does not exist. Skipped.") continue # Extract features audio_root = cur_root / ("flac" if args.use_audio_input else "fbank80") audio_root.mkdir(exist_ok=True) for split in mTEDx.SPLITS: print(f"Fetching split {split}...") dataset = mTEDx(root.as_posix(), lang, split) if args.use_audio_input: print("Converting audios...") for waveform, sample_rate, _, _, _, utt_id in tqdm(dataset): tgt_sample_rate = 16_000 _wavform, _ = convert_waveform( waveform, sample_rate, to_mono=True, to_sample_rate=tgt_sample_rate ) sf.write( (audio_root / f"{utt_id}.flac").as_posix(), _wavform.numpy(), tgt_sample_rate ) else: print("Extracting log mel filter bank features...") for waveform, sample_rate, _, _, _, _, utt_id in tqdm(dataset): extract_fbank_features( waveform, sample_rate, audio_root / f"{utt_id}.npy" ) # Pack features into ZIP zip_path = cur_root / f"{audio_root.name}.zip" print("ZIPing audios/features...") create_zip(audio_root, zip_path) print("Fetching ZIP manifest...") audio_paths, audio_lengths = get_zip_manifest(zip_path) # Generate TSV manifest print("Generating manifest...") train_text = [] for split in mTEDx.SPLITS: is_train_split = split.startswith("train") manifest = {c: [] for c in MANIFEST_COLUMNS} ds = mTEDx(args.data_root, lang, split) for _, _, src_utt, tgt_utt, spk_id, tgt_lang, utt_id in tqdm(ds): manifest["id"].append(utt_id) manifest["audio"].append(audio_paths[utt_id]) manifest["n_frames"].append(audio_lengths[utt_id]) manifest["tgt_text"].append( src_utt if args.task == "asr" else tgt_utt ) manifest["speaker"].append(spk_id) manifest["tgt_lang"].append(tgt_lang) if is_train_split: train_text.extend(manifest["tgt_text"]) df = pd.DataFrame.from_dict(manifest) df = filter_manifest_df(df, is_train_split=is_train_split) save_df_to_tsv(df, cur_root / f"{split}_{args.task}.tsv") # Generate vocab v_size_str = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{v_size_str}_{args.task}" with NamedTemporaryFile(mode="w") as f: for t in train_text: f.write(t + "\n") gen_vocab( Path(f.name), cur_root / spm_filename_prefix, args.vocab_type, args.vocab_size, ) # Generate config YAML if args.use_audio_input: gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy=None, extra={"use_audio_input": True} ) else: gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy="lb", ) # Clean up shutil.rmtree(audio_root) def process_joint(args): cur_root = Path(args.data_root) assert all((cur_root / f"{lang}").is_dir() for lang in mTEDx.LANGPAIRS), \ "do not have downloaded data available for all languages" # Generate vocab vocab_size_str = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{vocab_size_str}_{args.task}" with NamedTemporaryFile(mode="w") as f: for lang in mTEDx.LANGPAIRS: tsv_path = cur_root / f"{lang}" / f"train_{args.task}.tsv" df = load_df_from_tsv(tsv_path) for t in df["tgt_text"]: f.write(t + "\n") special_symbols = None if args.joint: # Add tgt_lang tags to dict special_symbols = list( {f'<lang:{lang.split("-")[1]}>' for lang in mTEDx.LANGPAIRS} ) gen_vocab( Path(f.name), cur_root / spm_filename_prefix, args.vocab_type, args.vocab_size, special_symbols=special_symbols ) # Generate config YAML gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy="ld", prepend_tgt_lang_tag=(args.joint), ) # Make symbolic links to manifests for lang in mTEDx.LANGPAIRS: for split in mTEDx.SPLITS: src_path = cur_root / f"{lang}" / f"{split}_{args.task}.tsv" desc_path = cur_root / f"{split}_{lang}_{args.task}.tsv" if not desc_path.is_symlink(): os.symlink(src_path, desc_path) def main(): parser = argparse.ArgumentParser() parser.add_argument("--data-root", "-d", required=True, type=str) parser.add_argument( "--vocab-type", default="unigram", required=True, type=str, choices=["bpe", "unigram", "char"], ), parser.add_argument("--vocab-size", default=8000, type=int) parser.add_argument("--task", type=str, choices=["asr", "st"]) parser.add_argument("--joint", action="store_true", help="") parser.add_argument("--use-audio-input", action="store_true") args = parser.parse_args() if args.joint: process_joint(args) else: process(args) if __name__ == "__main__": main()
10,168
36.386029
80
py
rej-summ
rej-summ-main/examples/speech_to_text/prep_librispeech_data.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging from pathlib import Path import shutil from tempfile import NamedTemporaryFile import pandas as pd from examples.speech_to_text.data_utils import ( create_zip, extract_fbank_features, gen_config_yaml, gen_vocab, get_zip_manifest, save_df_to_tsv, ) from torchaudio.datasets import LIBRISPEECH from tqdm import tqdm log = logging.getLogger(__name__) SPLITS = [ "train-clean-100", "train-clean-360", "train-other-500", "dev-clean", "dev-other", "test-clean", "test-other", ] MANIFEST_COLUMNS = ["id", "audio", "n_frames", "tgt_text", "speaker"] def process(args): out_root = Path(args.output_root).absolute() out_root.mkdir(exist_ok=True) # Extract features feature_root = out_root / "fbank80" feature_root.mkdir(exist_ok=True) for split in SPLITS: print(f"Fetching split {split}...") dataset = LIBRISPEECH(out_root.as_posix(), url=split, download=True) print("Extracting log mel filter bank features...") for wav, sample_rate, _, spk_id, chapter_no, utt_no in tqdm(dataset): sample_id = f"{spk_id}-{chapter_no}-{utt_no}" extract_fbank_features( wav, sample_rate, feature_root / f"{sample_id}.npy" ) # Pack features into ZIP zip_path = out_root / "fbank80.zip" print("ZIPing features...") create_zip(feature_root, zip_path) print("Fetching ZIP manifest...") audio_paths, audio_lengths = get_zip_manifest(zip_path) # Generate TSV manifest print("Generating manifest...") train_text = [] for split in SPLITS: manifest = {c: [] for c in MANIFEST_COLUMNS} dataset = LIBRISPEECH(out_root.as_posix(), url=split) for _, _, utt, spk_id, chapter_no, utt_no in tqdm(dataset): sample_id = f"{spk_id}-{chapter_no}-{utt_no}" manifest["id"].append(sample_id) manifest["audio"].append(audio_paths[sample_id]) manifest["n_frames"].append(audio_lengths[sample_id]) manifest["tgt_text"].append(utt.lower()) manifest["speaker"].append(spk_id) save_df_to_tsv( pd.DataFrame.from_dict(manifest), out_root / f"{split}.tsv" ) if split.startswith("train"): train_text.extend(manifest["tgt_text"]) # Generate vocab vocab_size = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{vocab_size}" with NamedTemporaryFile(mode="w") as f: for t in train_text: f.write(t + "\n") gen_vocab( Path(f.name), out_root / spm_filename_prefix, args.vocab_type, args.vocab_size, ) # Generate config YAML gen_config_yaml( out_root, spm_filename=spm_filename_prefix + ".model", specaugment_policy="ld" ) # Clean up shutil.rmtree(feature_root) def main(): parser = argparse.ArgumentParser() parser.add_argument("--output-root", "-o", required=True, type=str) parser.add_argument( "--vocab-type", default="unigram", required=True, type=str, choices=["bpe", "unigram", "char"], ), parser.add_argument("--vocab-size", default=10000, type=int) args = parser.parse_args() process(args) if __name__ == "__main__": main()
3,623
29.2
77
py
rej-summ
rej-summ-main/examples/speech_to_text/data_utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import csv from pathlib import Path import zipfile from functools import reduce from multiprocessing import cpu_count from typing import Any, Dict, List, Optional, Union import io import numpy as np import pandas as pd import sentencepiece as sp from fairseq.data.audio.audio_utils import ( convert_waveform, _get_kaldi_fbank, _get_torchaudio_fbank, is_npy_data, is_sf_audio_data ) import torch import soundfile as sf from tqdm import tqdm UNK_TOKEN, UNK_TOKEN_ID = "<unk>", 3 BOS_TOKEN, BOS_TOKEN_ID = "<s>", 0 EOS_TOKEN, EOS_TOKEN_ID = "</s>", 2 PAD_TOKEN, PAD_TOKEN_ID = "<pad>", 1 def gen_vocab( input_path: Path, output_path_prefix: Path, model_type="bpe", vocab_size=1000, special_symbols: Optional[List[str]] = None ): # Train SentencePiece Model arguments = [ f"--input={input_path.as_posix()}", f"--model_prefix={output_path_prefix.as_posix()}", f"--model_type={model_type}", f"--vocab_size={vocab_size}", "--character_coverage=1.0", f"--num_threads={cpu_count()}", f"--unk_id={UNK_TOKEN_ID}", f"--bos_id={BOS_TOKEN_ID}", f"--eos_id={EOS_TOKEN_ID}", f"--pad_id={PAD_TOKEN_ID}", ] if special_symbols is not None: _special_symbols = ",".join(special_symbols) arguments.append(f"--user_defined_symbols={_special_symbols}") sp.SentencePieceTrainer.Train(" ".join(arguments)) # Export fairseq dictionary spm = sp.SentencePieceProcessor() spm.Load(output_path_prefix.as_posix() + ".model") vocab = {i: spm.IdToPiece(i) for i in range(spm.GetPieceSize())} assert ( vocab.get(UNK_TOKEN_ID) == UNK_TOKEN and vocab.get(PAD_TOKEN_ID) == PAD_TOKEN and vocab.get(BOS_TOKEN_ID) == BOS_TOKEN and vocab.get(EOS_TOKEN_ID) == EOS_TOKEN ) vocab = { i: s for i, s in vocab.items() if s not in {UNK_TOKEN, BOS_TOKEN, EOS_TOKEN, PAD_TOKEN} } with open(output_path_prefix.as_posix() + ".txt", "w") as f_out: for _, s in sorted(vocab.items(), key=lambda x: x[0]): f_out.write(f"{s} 1\n") def extract_fbank_features( waveform: torch.FloatTensor, sample_rate: int, output_path: Optional[Path] = None, n_mel_bins: int = 80, overwrite: bool = False, ): if output_path is not None and output_path.is_file() and not overwrite: return _waveform, _ = convert_waveform(waveform, sample_rate, to_mono=True) # Kaldi compliance: 16-bit signed integers _waveform = _waveform * (2 ** 15) _waveform = _waveform.numpy() features = _get_kaldi_fbank(_waveform, sample_rate, n_mel_bins) if features is None: features = _get_torchaudio_fbank(_waveform, sample_rate, n_mel_bins) if features is None: raise ImportError( "Please install pyKaldi or torchaudio to enable fbank feature extraction" ) if output_path is not None: np.save(output_path.as_posix(), features) return features def create_zip(data_root: Path, zip_path: Path): paths = list(data_root.glob("*.npy")) paths.extend(data_root.glob("*.flac")) with zipfile.ZipFile(zip_path, "w", zipfile.ZIP_STORED) as f: for path in tqdm(paths): f.write(path, arcname=path.name) def get_zip_manifest( zip_path: Path, zip_root: Optional[Path] = None, is_audio=False ): _zip_path = Path.joinpath(zip_root or Path(""), zip_path) with zipfile.ZipFile(_zip_path, mode="r") as f: info = f.infolist() paths, lengths = {}, {} for i in tqdm(info): utt_id = Path(i.filename).stem offset, file_size = i.header_offset + 30 + len(i.filename), i.file_size paths[utt_id] = f"{zip_path.as_posix()}:{offset}:{file_size}" with open(_zip_path, "rb") as f: f.seek(offset) byte_data = f.read(file_size) assert len(byte_data) > 1 if is_audio: assert is_sf_audio_data(byte_data), i else: assert is_npy_data(byte_data), i byte_data_fp = io.BytesIO(byte_data) if is_audio: lengths[utt_id] = sf.info(byte_data_fp).frames else: lengths[utt_id] = np.load(byte_data_fp).shape[0] return paths, lengths def gen_config_yaml( manifest_root: Path, spm_filename: Optional[str] = None, vocab_name: Optional[str] = None, yaml_filename: str = "config.yaml", specaugment_policy: Optional[str] = "lb", prepend_tgt_lang_tag: bool = False, sampling_alpha: Optional[float] = None, input_channels: Optional[int] = 1, input_feat_per_channel: Optional[int] = 80, audio_root: str = "", cmvn_type: str = "utterance", gcmvn_path: Optional[Path] = None, extra=None ): manifest_root = manifest_root.absolute() writer = S2TDataConfigWriter(manifest_root / yaml_filename) assert spm_filename is not None or vocab_name is not None vocab_name = spm_filename.replace(".model", ".txt") if vocab_name is None \ else vocab_name writer.set_vocab_filename(vocab_name) if input_channels is not None: writer.set_input_channels(input_channels) if input_feat_per_channel is not None: writer.set_input_feat_per_channel(input_feat_per_channel) specaugment_setters = { "lb": writer.set_specaugment_lb_policy, "ld": writer.set_specaugment_ld_policy, "sm": writer.set_specaugment_sm_policy, "ss": writer.set_specaugment_ss_policy, } specaugment_setter = specaugment_setters.get(specaugment_policy, None) if specaugment_setter is not None: specaugment_setter() if spm_filename is not None: writer.set_bpe_tokenizer( { "bpe": "sentencepiece", "sentencepiece_model": (manifest_root / spm_filename).as_posix(), } ) if prepend_tgt_lang_tag: writer.set_prepend_tgt_lang_tag(True) if sampling_alpha is not None: writer.set_sampling_alpha(sampling_alpha) if cmvn_type not in ["global", "utterance"]: raise NotImplementedError if specaugment_policy is not None: writer.set_feature_transforms( "_train", [f"{cmvn_type}_cmvn", "specaugment"] ) writer.set_feature_transforms("*", [f"{cmvn_type}_cmvn"]) if cmvn_type == "global": if gcmvn_path is None: raise ValueError("Please provide path of global cmvn file.") else: writer.set_global_cmvn(gcmvn_path.as_posix()) if len(audio_root) > 0: writer.set_audio_root(audio_root) if extra is not None: writer.set_extra(extra) writer.flush() def load_df_from_tsv(path: Union[str, Path]) -> pd.DataFrame: _path = path if isinstance(path, str) else path.as_posix() return pd.read_csv( _path, sep="\t", header=0, encoding="utf-8", escapechar="\\", quoting=csv.QUOTE_NONE, na_filter=False, ) def save_df_to_tsv(dataframe, path: Union[str, Path]): _path = path if isinstance(path, str) else path.as_posix() dataframe.to_csv( _path, sep="\t", header=True, index=False, encoding="utf-8", escapechar="\\", quoting=csv.QUOTE_NONE, ) def load_tsv_to_dicts(path: Union[str, Path]) -> List[dict]: with open(path, "r") as f: reader = csv.DictReader( f, delimiter="\t", quotechar=None, doublequote=False, lineterminator="\n", quoting=csv.QUOTE_NONE, ) rows = [dict(e) for e in reader] return rows def filter_manifest_df( df, is_train_split=False, extra_filters=None, min_n_frames=5, max_n_frames=3000 ): filters = { "no speech": df["audio"] == "", f"short speech (<{min_n_frames} frames)": df["n_frames"] < min_n_frames, "empty sentence": df["tgt_text"] == "", } if is_train_split: filters[f"long speech (>{max_n_frames} frames)"] = df["n_frames"] > max_n_frames if extra_filters is not None: filters.update(extra_filters) invalid = reduce(lambda x, y: x | y, filters.values()) valid = ~invalid print( "| " + ", ".join(f"{n}: {f.sum()}" for n, f in filters.items()) + f", total {invalid.sum()} filtered, {valid.sum()} remained." ) return df[valid] def cal_gcmvn_stats(features_list): features = np.concatenate(features_list) square_sums = (features ** 2).sum(axis=0) mean = features.mean(axis=0) features = np.subtract(features, mean) var = square_sums / features.shape[0] - mean ** 2 std = np.sqrt(np.maximum(var, 1e-8)) return {"mean": mean.astype("float32"), "std": std.astype("float32")} class S2TDataConfigWriter(object): DEFAULT_VOCAB_FILENAME = "dict.txt" DEFAULT_INPUT_FEAT_PER_CHANNEL = 80 DEFAULT_INPUT_CHANNELS = 1 def __init__(self, yaml_path: Path): try: import yaml except ImportError: print("Please install PyYAML for S2T data config YAML files") self.yaml = yaml self.yaml_path = yaml_path self.config = {} def flush(self): with open(self.yaml_path, "w") as f: self.yaml.dump(self.config, f) def set_audio_root(self, audio_root=""): self.config["audio_root"] = audio_root def set_vocab_filename(self, vocab_filename: str = "dict.txt"): self.config["vocab_filename"] = vocab_filename def set_specaugment( self, time_wrap_w: int, freq_mask_n: int, freq_mask_f: int, time_mask_n: int, time_mask_t: int, time_mask_p: float, ): self.config["specaugment"] = { "time_wrap_W": time_wrap_w, "freq_mask_N": freq_mask_n, "freq_mask_F": freq_mask_f, "time_mask_N": time_mask_n, "time_mask_T": time_mask_t, "time_mask_p": time_mask_p, } def set_specaugment_lb_policy(self): self.set_specaugment( time_wrap_w=0, freq_mask_n=1, freq_mask_f=27, time_mask_n=1, time_mask_t=100, time_mask_p=1.0, ) def set_specaugment_ld_policy(self): self.set_specaugment( time_wrap_w=0, freq_mask_n=2, freq_mask_f=27, time_mask_n=2, time_mask_t=100, time_mask_p=1.0, ) def set_specaugment_sm_policy(self): self.set_specaugment( time_wrap_w=0, freq_mask_n=2, freq_mask_f=15, time_mask_n=2, time_mask_t=70, time_mask_p=0.2, ) def set_specaugment_ss_policy(self): self.set_specaugment( time_wrap_w=0, freq_mask_n=2, freq_mask_f=27, time_mask_n=2, time_mask_t=70, time_mask_p=0.2, ) def set_input_channels(self, input_channels: int = 1): self.config["input_channels"] = input_channels def set_input_feat_per_channel(self, input_feat_per_channel: int = 80): self.config["input_feat_per_channel"] = input_feat_per_channel def set_bpe_tokenizer(self, bpe_tokenizer: Dict[str, Any]): self.config["bpe_tokenizer"] = bpe_tokenizer def set_global_cmvn(self, stats_npz_path: str): self.config["global_cmvn"] = {"stats_npz_path": stats_npz_path} def set_feature_transforms(self, split: str, transforms: List[str]): if "transforms" not in self.config: self.config["transforms"] = {} self.config["transforms"][split] = transforms def set_prepend_tgt_lang_tag(self, flag: bool = True): self.config["prepend_tgt_lang_tag"] = flag def set_sampling_alpha(self, sampling_alpha: float = 1.0): self.config["sampling_alpha"] = sampling_alpha def set_extra(self, data): self.config.update(data)
12,272
30.960938
88
py
rej-summ
rej-summ-main/examples/speech_to_text/prep_mustc_data.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging import os from pathlib import Path import shutil from itertools import groupby from tempfile import NamedTemporaryFile from typing import Tuple import numpy as np import pandas as pd import soundfile as sf from examples.speech_to_text.data_utils import ( create_zip, extract_fbank_features, filter_manifest_df, gen_config_yaml, gen_vocab, get_zip_manifest, load_df_from_tsv, save_df_to_tsv, cal_gcmvn_stats, ) import torch from torch.utils.data import Dataset from tqdm import tqdm from fairseq.data.audio.audio_utils import get_waveform, convert_waveform log = logging.getLogger(__name__) MANIFEST_COLUMNS = ["id", "audio", "n_frames", "tgt_text", "speaker"] class MUSTC(Dataset): """ Create a Dataset for MuST-C. Each item is a tuple of the form: waveform, sample_rate, source utterance, target utterance, speaker_id, utterance_id """ SPLITS = ["train", "dev", "tst-COMMON", "tst-HE"] LANGUAGES = ["de", "es", "fr", "it", "nl", "pt", "ro", "ru"] def __init__(self, root: str, lang: str, split: str) -> None: assert split in self.SPLITS and lang in self.LANGUAGES _root = Path(root) / f"en-{lang}" / "data" / split wav_root, txt_root = _root / "wav", _root / "txt" assert _root.is_dir() and wav_root.is_dir() and txt_root.is_dir() # Load audio segments try: import yaml except ImportError: print("Please install PyYAML to load the MuST-C YAML files") with open(txt_root / f"{split}.yaml") as f: segments = yaml.load(f, Loader=yaml.BaseLoader) # Load source and target utterances for _lang in ["en", lang]: with open(txt_root / f"{split}.{_lang}") as f: utterances = [r.strip() for r in f] assert len(segments) == len(utterances) for i, u in enumerate(utterances): segments[i][_lang] = u # Gather info self.data = [] for wav_filename, _seg_group in groupby(segments, lambda x: x["wav"]): wav_path = wav_root / wav_filename sample_rate = sf.info(wav_path.as_posix()).samplerate seg_group = sorted(_seg_group, key=lambda x: x["offset"]) for i, segment in enumerate(seg_group): offset = int(float(segment["offset"]) * sample_rate) n_frames = int(float(segment["duration"]) * sample_rate) _id = f"{wav_path.stem}_{i}" self.data.append( ( wav_path.as_posix(), offset, n_frames, sample_rate, segment["en"], segment[lang], segment["speaker_id"], _id, ) ) def __getitem__( self, n: int ) -> Tuple[torch.Tensor, int, str, str, str, str]: wav_path, offset, n_frames, sr, src_utt, tgt_utt, spk_id, \ utt_id = self.data[n] waveform, _ = get_waveform(wav_path, frames=n_frames, start=offset) waveform = torch.from_numpy(waveform) return waveform, sr, src_utt, tgt_utt, spk_id, utt_id def __len__(self) -> int: return len(self.data) def process(args): root = Path(args.data_root).absolute() for lang in MUSTC.LANGUAGES: cur_root = root / f"en-{lang}" if not cur_root.is_dir(): print(f"{cur_root.as_posix()} does not exist. Skipped.") continue # Extract features audio_root = cur_root / ("flac" if args.use_audio_input else "fbank80") audio_root.mkdir(exist_ok=True) for split in MUSTC.SPLITS: print(f"Fetching split {split}...") dataset = MUSTC(root.as_posix(), lang, split) if args.use_audio_input: print("Converting audios...") for waveform, sample_rate, _, _, _, utt_id in tqdm(dataset): tgt_sample_rate = 16_000 _wavform, _ = convert_waveform( waveform, sample_rate, to_mono=True, to_sample_rate=tgt_sample_rate ) sf.write( (audio_root / f"{utt_id}.flac").as_posix(), _wavform.T.numpy(), tgt_sample_rate ) else: print("Extracting log mel filter bank features...") gcmvn_feature_list = [] if split == 'train' and args.cmvn_type == "global": print("And estimating cepstral mean and variance stats...") for waveform, sample_rate, _, _, _, utt_id in tqdm(dataset): features = extract_fbank_features( waveform, sample_rate, audio_root / f"{utt_id}.npy" ) if split == 'train' and args.cmvn_type == "global": if len(gcmvn_feature_list) < args.gcmvn_max_num: gcmvn_feature_list.append(features) if split == 'train' and args.cmvn_type == "global": # Estimate and save cmv stats = cal_gcmvn_stats(gcmvn_feature_list) with open(cur_root / "gcmvn.npz", "wb") as f: np.savez(f, mean=stats["mean"], std=stats["std"]) # Pack features into ZIP zip_path = cur_root / f"{audio_root.name}.zip" print("ZIPing audios/features...") create_zip(audio_root, zip_path) print("Fetching ZIP manifest...") audio_paths, audio_lengths = get_zip_manifest( zip_path, is_audio=args.use_audio_input, ) # Generate TSV manifest print("Generating manifest...") train_text = [] for split in MUSTC.SPLITS: is_train_split = split.startswith("train") manifest = {c: [] for c in MANIFEST_COLUMNS} dataset = MUSTC(args.data_root, lang, split) for _, _, src_utt, tgt_utt, speaker_id, utt_id in tqdm(dataset): manifest["id"].append(utt_id) manifest["audio"].append(audio_paths[utt_id]) manifest["n_frames"].append(audio_lengths[utt_id]) manifest["tgt_text"].append( src_utt if args.task == "asr" else tgt_utt ) manifest["speaker"].append(speaker_id) if is_train_split: train_text.extend(manifest["tgt_text"]) df = pd.DataFrame.from_dict(manifest) df = filter_manifest_df(df, is_train_split=is_train_split) save_df_to_tsv(df, cur_root / f"{split}_{args.task}.tsv") # Generate vocab v_size_str = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{v_size_str}_{args.task}" with NamedTemporaryFile(mode="w") as f: for t in train_text: f.write(t + "\n") gen_vocab( Path(f.name), cur_root / spm_filename_prefix, args.vocab_type, args.vocab_size, ) # Generate config YAML if args.use_audio_input: gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy=None, extra={"use_audio_input": True} ) else: gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy="lb", cmvn_type=args.cmvn_type, gcmvn_path=( cur_root / "gcmvn.npz" if args.cmvn_type == "global" else None ), ) # Clean up shutil.rmtree(audio_root) def process_joint(args): cur_root = Path(args.data_root) assert all( (cur_root / f"en-{lang}").is_dir() for lang in MUSTC.LANGUAGES ), "do not have downloaded data available for all 8 languages" # Generate vocab vocab_size_str = "" if args.vocab_type == "char" else str(args.vocab_size) spm_filename_prefix = f"spm_{args.vocab_type}{vocab_size_str}_{args.task}" with NamedTemporaryFile(mode="w") as f: for lang in MUSTC.LANGUAGES: tsv_path = cur_root / f"en-{lang}" / f"train_{args.task}.tsv" df = load_df_from_tsv(tsv_path) for t in df["tgt_text"]: f.write(t + "\n") special_symbols = None if args.task == 'st': special_symbols = [f'<lang:{lang}>' for lang in MUSTC.LANGUAGES] gen_vocab( Path(f.name), cur_root / spm_filename_prefix, args.vocab_type, args.vocab_size, special_symbols=special_symbols ) # Generate config YAML gen_config_yaml( cur_root, spm_filename=spm_filename_prefix + ".model", yaml_filename=f"config_{args.task}.yaml", specaugment_policy="ld", prepend_tgt_lang_tag=(args.task == "st"), ) # Make symbolic links to manifests for lang in MUSTC.LANGUAGES: for split in MUSTC.SPLITS: src_path = cur_root / f"en-{lang}" / f"{split}_{args.task}.tsv" desc_path = cur_root / f"{split}_{lang}_{args.task}.tsv" if not desc_path.is_symlink(): os.symlink(src_path, desc_path) def main(): parser = argparse.ArgumentParser() parser.add_argument("--data-root", "-d", required=True, type=str) parser.add_argument( "--vocab-type", default="unigram", required=True, type=str, choices=["bpe", "unigram", "char"], ), parser.add_argument("--vocab-size", default=8000, type=int) parser.add_argument("--task", type=str, choices=["asr", "st"]) parser.add_argument("--joint", action="store_true", help="") parser.add_argument( "--cmvn-type", default="utterance", choices=["global", "utterance"], help="The type of cepstral mean and variance normalization" ) parser.add_argument( "--gcmvn-max-num", default=150000, type=int, help="Maximum number of sentences to use to estimate global mean and " "variance" ) parser.add_argument("--use-audio-input", action="store_true") args = parser.parse_args() if args.joint: process_joint(args) else: process(args) if __name__ == "__main__": main()
11,080
36.562712
79
py
rej-summ
rej-summ-main/examples/speech_to_text/simultaneous_translation/agents/fairseq_simul_st_agent.py
import math import os import json import numpy as np import torch import torchaudio.compliance.kaldi as kaldi import yaml from fairseq import checkpoint_utils, tasks from fairseq.file_io import PathManager try: from simuleval import READ_ACTION, WRITE_ACTION, DEFAULT_EOS from simuleval.agents import SpeechAgent from simuleval.states import ListEntry, SpeechStates except ImportError: print("Please install simuleval 'pip install simuleval'") SHIFT_SIZE = 10 WINDOW_SIZE = 25 SAMPLE_RATE = 16000 FEATURE_DIM = 80 BOW_PREFIX = "\u2581" class OnlineFeatureExtractor: """ Extract speech feature on the fly. """ def __init__(self, args): self.shift_size = args.shift_size self.window_size = args.window_size assert self.window_size >= self.shift_size self.sample_rate = args.sample_rate self.feature_dim = args.feature_dim self.num_samples_per_shift = int(self.shift_size * self.sample_rate / 1000) self.num_samples_per_window = int(self.window_size * self.sample_rate / 1000) self.len_ms_to_samples = lambda x: x * self.sample_rate / 1000 self.previous_residual_samples = [] self.global_cmvn = args.global_cmvn def clear_cache(self): self.previous_residual_samples = [] def __call__(self, new_samples): samples = self.previous_residual_samples + new_samples if len(samples) < self.num_samples_per_window: self.previous_residual_samples = samples return # num_frames is the number of frames from the new segment num_frames = math.floor( (len(samples) - self.len_ms_to_samples(self.window_size - self.shift_size)) / self.num_samples_per_shift ) # the number of frames used for feature extraction # including some part of thte previous segment effective_num_samples = int( num_frames * self.len_ms_to_samples(self.shift_size) + self.len_ms_to_samples(self.window_size - self.shift_size) ) input_samples = samples[:effective_num_samples] self.previous_residual_samples = samples[ num_frames * self.num_samples_per_shift: ] torch.manual_seed(1) output = kaldi.fbank( torch.FloatTensor(input_samples).unsqueeze(0), num_mel_bins=self.feature_dim, frame_length=self.window_size, frame_shift=self.shift_size, ).numpy() output = self.transform(output) return torch.from_numpy(output) def transform(self, input): if self.global_cmvn is None: return input mean = self.global_cmvn["mean"] std = self.global_cmvn["std"] x = np.subtract(input, mean) x = np.divide(x, std) return x class TensorListEntry(ListEntry): """ Data structure to store a list of tensor. """ def append(self, value): if len(self.value) == 0: self.value = value return self.value = torch.cat([self.value] + [value], dim=0) def info(self): return { "type": str(self.new_value_type), "length": self.__len__(), "value": "" if type(self.value) is list else self.value.size(), } class FairseqSimulSTAgent(SpeechAgent): speech_segment_size = 40 # in ms, 4 pooling ratio * 10 ms step size def __init__(self, args): super().__init__(args) self.eos = DEFAULT_EOS self.gpu = getattr(args, "gpu", False) self.args = args self.load_model_vocab(args) if getattr( self.model.decoder.layers[0].encoder_attn, 'pre_decision_ratio', None ) is not None: self.speech_segment_size *= ( self.model.decoder.layers[0].encoder_attn.pre_decision_ratio ) args.global_cmvn = None if args.config: with open(os.path.join(args.data_bin, args.config), "r") as f: config = yaml.load(f, Loader=yaml.BaseLoader) if "global_cmvn" in config: args.global_cmvn = np.load(config["global_cmvn"]["stats_npz_path"]) if args.global_stats: with PathManager.open(args.global_stats, "r") as f: global_cmvn = json.loads(f.read()) self.global_cmvn = {"mean": global_cmvn["mean"], "std": global_cmvn["stddev"]} self.feature_extractor = OnlineFeatureExtractor(args) self.max_len = args.max_len self.force_finish = args.force_finish torch.set_grad_enabled(False) def build_states(self, args, client, sentence_id): # Initialize states here, for example add customized entry to states # This function will be called at beginning of every new sentence states = SpeechStates(args, client, sentence_id, self) self.initialize_states(states) return states def to_device(self, tensor): if self.gpu: return tensor.cuda() else: return tensor.cpu() @staticmethod def add_args(parser): # fmt: off parser.add_argument('--model-path', type=str, required=True, help='path to your pretrained model.') parser.add_argument("--data-bin", type=str, required=True, help="Path of data binary") parser.add_argument("--config", type=str, default=None, help="Path to config yaml file") parser.add_argument("--global-stats", type=str, default=None, help="Path to json file containing cmvn stats") parser.add_argument("--tgt-splitter-type", type=str, default="SentencePiece", help="Subword splitter type for target text") parser.add_argument("--tgt-splitter-path", type=str, default=None, help="Subword splitter model path for target text") parser.add_argument("--user-dir", type=str, default="examples/simultaneous_translation", help="User directory for simultaneous translation") parser.add_argument("--max-len", type=int, default=200, help="Max length of translation") parser.add_argument("--force-finish", default=False, action="store_true", help="Force the model to finish the hypothsis if the source is not finished") parser.add_argument("--shift-size", type=int, default=SHIFT_SIZE, help="Shift size of feature extraction window.") parser.add_argument("--window-size", type=int, default=WINDOW_SIZE, help="Window size of feature extraction window.") parser.add_argument("--sample-rate", type=int, default=SAMPLE_RATE, help="Sample rate") parser.add_argument("--feature-dim", type=int, default=FEATURE_DIM, help="Acoustic feature dimension.") # fmt: on return parser def load_model_vocab(self, args): filename = args.model_path if not os.path.exists(filename): raise IOError("Model file not found: {}".format(filename)) state = checkpoint_utils.load_checkpoint_to_cpu(filename) task_args = state["cfg"]["task"] task_args.data = args.data_bin if args.config is not None: task_args.config_yaml = args.config task = tasks.setup_task(task_args) # build model for ensemble state["cfg"]["model"].load_pretrained_encoder_from = None state["cfg"]["model"].load_pretrained_decoder_from = None self.model = task.build_model(state["cfg"]["model"]) self.model.load_state_dict(state["model"], strict=True) self.model.eval() self.model.share_memory() if self.gpu: self.model.cuda() # Set dictionary self.dict = {} self.dict["tgt"] = task.target_dictionary def initialize_states(self, states): self.feature_extractor.clear_cache() states.units.source = TensorListEntry() states.units.target = ListEntry() states.incremental_states = dict() def segment_to_units(self, segment, states): # Convert speech samples to features features = self.feature_extractor(segment) if features is not None: return [features] else: return [] def units_to_segment(self, units, states): # Merge sub word to full word. if self.model.decoder.dictionary.eos() == units[0]: return DEFAULT_EOS segment = [] if None in units.value: units.value.remove(None) for index in units: if index is None: units.pop() token = self.model.decoder.dictionary.string([index]) if token.startswith(BOW_PREFIX): if len(segment) == 0: segment += [token.replace(BOW_PREFIX, "")] else: for j in range(len(segment)): units.pop() string_to_return = ["".join(segment)] if self.model.decoder.dictionary.eos() == units[0]: string_to_return += [DEFAULT_EOS] return string_to_return else: segment += [token.replace(BOW_PREFIX, "")] if ( len(units) > 0 and self.model.decoder.dictionary.eos() == units[-1] or len(states.units.target) > self.max_len ): tokens = [self.model.decoder.dictionary.string([unit]) for unit in units] return ["".join(tokens).replace(BOW_PREFIX, "")] + [DEFAULT_EOS] return None def update_model_encoder(self, states): if len(states.units.source) == 0: return src_indices = self.to_device( states.units.source.value.unsqueeze(0) ) src_lengths = self.to_device( torch.LongTensor([states.units.source.value.size(0)]) ) states.encoder_states = self.model.encoder(src_indices, src_lengths) torch.cuda.empty_cache() def update_states_read(self, states): # Happens after a read action. self.update_model_encoder(states) def policy(self, states): if not getattr(states, "encoder_states", None): return READ_ACTION tgt_indices = self.to_device( torch.LongTensor( [self.model.decoder.dictionary.eos()] + [x for x in states.units.target.value if x is not None] ).unsqueeze(0) ) states.incremental_states["steps"] = { "src": states.encoder_states["encoder_out"][0].size(0), "tgt": 1 + len(states.units.target), } states.incremental_states["online"] = {"only": torch.tensor(not states.finish_read())} x, outputs = self.model.decoder.forward( prev_output_tokens=tgt_indices, encoder_out=states.encoder_states, incremental_state=states.incremental_states, ) states.decoder_out = x states.decoder_out_extra = outputs torch.cuda.empty_cache() if outputs.action == 0: return READ_ACTION else: return WRITE_ACTION def predict(self, states): decoder_states = states.decoder_out lprobs = self.model.get_normalized_probs( [decoder_states[:, -1:]], log_probs=True ) index = lprobs.argmax(dim=-1) index = index[0, 0].item() if ( self.force_finish and index == self.model.decoder.dictionary.eos() and not states.finish_read() ): # If we want to force finish the translation # (don't stop before finish reading), return a None # self.model.decoder.clear_cache(states.incremental_states) index = None return index
12,193
32.5
105
py
rej-summ
rej-summ-main/examples/roberta/commonsense_qa/commonsense_qa_task.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import json import os import numpy as np import torch from fairseq.data import ( Dictionary, IdDataset, ListDataset, NestedDictionaryDataset, NumelDataset, NumSamplesDataset, RawLabelDataset, RightPadDataset, SortDataset, data_utils, encoders, ) from fairseq.tasks import LegacyFairseqTask, register_task @register_task("commonsense_qa") class CommonsenseQATask(LegacyFairseqTask): """Task to finetune RoBERTa for Commonsense QA.""" @staticmethod def add_args(parser): """Add task-specific arguments to the parser.""" parser.add_argument( "data", metavar="DIR", help="path to data directory; we load <split>.jsonl" ) parser.add_argument( "--init-token", type=int, default=None, help="add token at the beginning of each batch item", ) parser.add_argument("--num-classes", type=int, default=5) def __init__(self, args, vocab): super().__init__(args) self.vocab = vocab self.mask = vocab.add_symbol("<mask>") self.bpe = encoders.build_bpe(args) @classmethod def load_dictionary(cls, filename): """Load the dictionary from the filename Args: filename (str): the filename """ dictionary = Dictionary.load(filename) dictionary.add_symbol("<mask>") return dictionary @classmethod def setup_task(cls, args, **kwargs): assert ( args.criterion == "sentence_ranking" ), "Must set --criterion=sentence_ranking" # load data and label dictionaries vocab = cls.load_dictionary(os.path.join(args.data, "dict.txt")) print("| dictionary: {} types".format(len(vocab))) return cls(args, vocab) def load_dataset( self, split, epoch=1, combine=False, data_path=None, return_only=False, **kwargs ): """Load a given dataset split. Args: split (str): name of the split (e.g., train, valid, test) """ def binarize(s, append_bos=False): if self.bpe is not None: s = self.bpe.encode(s) tokens = self.vocab.encode_line( s, append_eos=True, add_if_not_exist=False, ).long() if append_bos and self.args.init_token is not None: tokens = torch.cat([tokens.new([self.args.init_token]), tokens]) return tokens if data_path is None: data_path = os.path.join(self.args.data, split + ".jsonl") if not os.path.exists(data_path): raise FileNotFoundError("Cannot find data: {}".format(data_path)) src_tokens = [[] for i in range(self.args.num_classes)] src_lengths = [[] for i in range(self.args.num_classes)] labels = [] with open(data_path) as h: for line in h: example = json.loads(line.strip()) if "answerKey" in example: label = ord(example["answerKey"]) - ord("A") labels.append(label) question = example["question"]["stem"] assert len(example["question"]["choices"]) == self.args.num_classes # format: `<s> Q: Where would I not want a fox? </s> A: hen house </s>` question = "Q: " + question question_toks = binarize(question, append_bos=True) for i, choice in enumerate(example["question"]["choices"]): src = "A: " + choice["text"] src_bin = torch.cat([question_toks, binarize(src)]) src_tokens[i].append(src_bin) src_lengths[i].append(len(src_bin)) assert all( len(src_tokens[0]) == len(src_tokens[i]) for i in range(self.args.num_classes) ) assert len(src_tokens[0]) == len(src_lengths[0]) assert len(labels) == 0 or len(labels) == len(src_tokens[0]) for i in range(self.args.num_classes): src_lengths[i] = np.array(src_lengths[i]) src_tokens[i] = ListDataset(src_tokens[i], src_lengths[i]) src_lengths[i] = ListDataset(src_lengths[i]) dataset = { "id": IdDataset(), "nsentences": NumSamplesDataset(), "ntokens": NumelDataset(src_tokens[0], reduce=True), } for i in range(self.args.num_classes): dataset.update( { "net_input{}".format(i + 1): { "src_tokens": RightPadDataset( src_tokens[i], pad_idx=self.source_dictionary.pad(), ), "src_lengths": src_lengths[i], } } ) if len(labels) > 0: dataset.update({"target": RawLabelDataset(labels)}) dataset = NestedDictionaryDataset( dataset, sizes=[np.maximum.reduce([src_token.sizes for src_token in src_tokens])], ) with data_utils.numpy_seed(self.args.seed): dataset = SortDataset( dataset, # shuffle sort_order=[np.random.permutation(len(dataset))], ) print("| Loaded {} with {} samples".format(split, len(dataset))) self.datasets[split] = dataset return self.datasets[split] def build_model(self, args, from_checkpoint=False): from fairseq import models model = models.build_model(args, self) model.register_classification_head( "sentence_classification_head", num_classes=1, ) return model @property def source_dictionary(self): return self.vocab @property def target_dictionary(self): return self.vocab
6,147
31.188482
88
py
rej-summ
rej-summ-main/examples/roberta/wsc/wsc_task.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import json import os import tempfile import numpy as np import torch import torch.nn.functional as F from fairseq import utils from fairseq.data import ( Dictionary, IdDataset, ListDataset, NestedDictionaryDataset, NumelDataset, NumSamplesDataset, PadDataset, SortDataset, data_utils, encoders, ) from fairseq.tasks import LegacyFairseqTask, register_task from . import wsc_utils @register_task("wsc") class WSCTask(LegacyFairseqTask): """Task to finetune RoBERTa for Winograd Schemas.""" @staticmethod def add_args(parser): """Add task-specific arguments to the parser.""" parser.add_argument( "data", metavar="DIR", help="path to data directory; we load <split>.jsonl" ) parser.add_argument( "--init-token", type=int, default=None, help="add token at the beginning of each batch item", ) def __init__(self, args, vocab): super().__init__(args) self.vocab = vocab self.mask = vocab.add_symbol("<mask>") self.bpe = encoders.build_bpe(args) self.tokenizer = encoders.build_tokenizer(args) # hack to handle GPT-2 BPE, which includes leading spaces if args.bpe == "gpt2": self.leading_space = True self.trailing_space = False else: self.leading_space = False self.trailing_space = True @classmethod def load_dictionary(cls, filename): """Load the dictionary from the filename Args: filename (str): the filename """ dictionary = Dictionary.load(filename) dictionary.add_symbol("<mask>") return dictionary @classmethod def setup_task(cls, args, **kwargs): assert args.criterion == "wsc", "Must set --criterion=wsc" # load data and label dictionaries vocab = cls.load_dictionary(os.path.join(args.data, "dict.txt")) print("| dictionary: {} types".format(len(vocab))) return cls(args, vocab) def binarize(self, s: str, append_eos: bool = False): if self.tokenizer is not None: s = self.tokenizer.encode(s) if self.bpe is not None: s = self.bpe.encode(s) tokens = self.vocab.encode_line( s, append_eos=append_eos, add_if_not_exist=False, ).long() if self.args.init_token is not None: tokens = torch.cat([tokens.new([self.args.init_token]), tokens]) return tokens def binarize_with_mask(self, txt, prefix, suffix, leading_space, trailing_space): toks = self.binarize( prefix + leading_space + txt + trailing_space + suffix, append_eos=True, ) mask = torch.zeros_like(toks, dtype=torch.bool) mask_start = len(self.binarize(prefix)) mask_size = len(self.binarize(leading_space + txt)) mask[mask_start : mask_start + mask_size] = 1 return toks, mask def load_dataset( self, split, epoch=1, combine=False, data_path=None, return_only=False, **kwargs ): """Load a given dataset split. Args: split (str): name of the split (e.g., train, valid, test) """ if data_path is None: data_path = os.path.join(self.args.data, split + ".jsonl") if not os.path.exists(data_path): raise FileNotFoundError("Cannot find data: {}".format(data_path)) query_tokens = [] query_masks = [] query_lengths = [] candidate_tokens = [] candidate_masks = [] candidate_lengths = [] labels = [] for sentence, pronoun_span, query, label in wsc_utils.jsonl_iterator(data_path): prefix = sentence[: pronoun_span.start].text suffix = sentence[pronoun_span.end :].text_with_ws # spaCy spans include trailing spaces, but we need to know about # leading spaces for the GPT-2 BPE leading_space = ( " " if sentence[: pronoun_span.start].text_with_ws.endswith(" ") else "" ) trailing_space = " " if pronoun_span.text_with_ws.endswith(" ") else "" # get noun phrases, excluding pronouns and anything overlapping with the query cand_spans = wsc_utils.filter_noun_chunks( wsc_utils.extended_noun_chunks(sentence), exclude_pronouns=True, exclude_query=query, exact_match=False, ) if query is not None: query_toks, query_mask = self.binarize_with_mask( query, prefix, suffix, leading_space, trailing_space ) query_len = len(query_toks) else: query_toks, query_mask, query_len = None, None, 0 query_tokens.append(query_toks) query_masks.append(query_mask) query_lengths.append(query_len) cand_toks, cand_masks = [], [] for cand_span in cand_spans: toks, mask = self.binarize_with_mask( cand_span.text, prefix, suffix, leading_space, trailing_space, ) cand_toks.append(toks) cand_masks.append(mask) # collate candidates cand_toks = data_utils.collate_tokens(cand_toks, pad_idx=self.vocab.pad()) cand_masks = data_utils.collate_tokens(cand_masks, pad_idx=0) assert cand_toks.size() == cand_masks.size() candidate_tokens.append(cand_toks) candidate_masks.append(cand_masks) candidate_lengths.append(cand_toks.size(1)) labels.append(label) query_lengths = np.array(query_lengths) query_tokens = ListDataset(query_tokens, query_lengths) query_masks = ListDataset(query_masks, query_lengths) candidate_lengths = np.array(candidate_lengths) candidate_tokens = ListDataset(candidate_tokens, candidate_lengths) candidate_masks = ListDataset(candidate_masks, candidate_lengths) labels = ListDataset(labels, [1] * len(labels)) dataset = { "id": IdDataset(), "query_tokens": query_tokens, "query_masks": query_masks, "candidate_tokens": candidate_tokens, "candidate_masks": candidate_masks, "labels": labels, "nsentences": NumSamplesDataset(), "ntokens": NumelDataset(query_tokens, reduce=True), } nested_dataset = NestedDictionaryDataset( dataset, sizes=[query_lengths], ) with data_utils.numpy_seed(self.args.seed): shuffle = np.random.permutation(len(query_tokens)) dataset = SortDataset( nested_dataset, # shuffle sort_order=[shuffle], ) if return_only: return dataset self.datasets[split] = dataset return self.datasets[split] def build_dataset_for_inference(self, sample_json): with tempfile.NamedTemporaryFile(buffering=0) as h: h.write((json.dumps(sample_json) + "\n").encode("utf-8")) dataset = self.load_dataset( "disambiguate_pronoun", data_path=h.name, return_only=True, ) return dataset def disambiguate_pronoun(self, model, sentence, use_cuda=False): sample_json = wsc_utils.convert_sentence_to_json(sentence) dataset = self.build_dataset_for_inference(sample_json) sample = dataset.collater([dataset[0]]) if use_cuda: sample = utils.move_to_cuda(sample) def get_masked_input(tokens, mask): masked_tokens = tokens.clone() masked_tokens[mask.bool()] = self.mask return masked_tokens def get_lprobs(tokens, mask): logits, _ = model(src_tokens=get_masked_input(tokens, mask)) lprobs = F.log_softmax(logits, dim=-1, dtype=torch.float) scores = lprobs.gather(2, tokens.unsqueeze(-1)).squeeze(-1) mask = mask.type_as(scores) scores = (scores * mask).sum(dim=-1) / mask.sum(dim=-1) return scores cand_lprobs = get_lprobs( sample["candidate_tokens"][0], sample["candidate_masks"][0], ) if sample["query_tokens"][0] is not None: query_lprobs = get_lprobs( sample["query_tokens"][0].unsqueeze(0), sample["query_masks"][0].unsqueeze(0), ) return (query_lprobs >= cand_lprobs).all().item() == 1 else: best_idx = cand_lprobs.argmax().item() full_cand = sample["candidate_tokens"][0][best_idx] mask = sample["candidate_masks"][0][best_idx] toks = full_cand[mask.bool()] return self.bpe.decode(self.source_dictionary.string(toks)).strip() @property def source_dictionary(self): return self.vocab @property def target_dictionary(self): return self.vocab @register_task("winogrande") class WinograndeTask(WSCTask): """ Task for WinoGrande dataset. Efficient implementation for Winograd schema tasks with exactly two candidates, one of which is correct. """ @classmethod def setup_task(cls, args, **kwargs): assert args.criterion == "winogrande", "Must set --criterion=winogrande" # load data and label dictionaries vocab = cls.load_dictionary(os.path.join(args.data, "dict.txt")) print("| dictionary: {} types".format(len(vocab))) return cls(args, vocab) def load_dataset( self, split, epoch=1, combine=False, data_path=None, return_only=False, **kwargs ): """Load a given dataset split. Args: split (str): name of the split (e.g., train, valid, test) """ if data_path is None: data_path = os.path.join(self.args.data, split + ".jsonl") if not os.path.exists(data_path): raise FileNotFoundError("Cannot find data: {}".format(data_path)) query_tokens = [] query_masks = [] query_lengths = [] candidate_tokens = [] candidate_masks = [] candidate_lengths = [] itr = wsc_utils.winogrande_jsonl_iterator(data_path, eval=(split == "test")) for sample in itr: sentence, pronoun_span, query, cand_text = sample prefix = sentence[: pronoun_span[0]].rstrip() suffix = sentence[pronoun_span[1] :] leading_space = " " if sentence[: pronoun_span[0]].endswith(" ") else "" trailing_space = "" if query is not None: query_toks, query_mask = self.binarize_with_mask( query, prefix, suffix, leading_space, trailing_space, ) query_len = len(query_toks) else: query_toks, query_mask, query_len = None, None, 0 query_tokens.append(query_toks) query_masks.append(query_mask) query_lengths.append(query_len) cand_toks, cand_mask = self.binarize_with_mask( cand_text, prefix, suffix, leading_space, trailing_space, ) candidate_tokens.append(cand_toks) candidate_masks.append(cand_mask) candidate_lengths.append(cand_toks.size(0)) query_lengths = np.array(query_lengths) def get_pad_dataset_fn(tokens, length, pad_idx): return PadDataset( ListDataset(tokens, length), pad_idx=pad_idx, left_pad=False, ) query_tokens = get_pad_dataset_fn(query_tokens, query_lengths, self.vocab.pad()) query_masks = get_pad_dataset_fn(query_masks, query_lengths, 0) candidate_lengths = np.array(candidate_lengths) candidate_tokens = get_pad_dataset_fn( candidate_tokens, candidate_lengths, self.vocab.pad() ) candidate_masks = get_pad_dataset_fn(candidate_masks, candidate_lengths, 0) dataset = { "id": IdDataset(), "query_tokens": query_tokens, "query_masks": query_masks, "candidate_tokens": candidate_tokens, "candidate_masks": candidate_masks, "nsentences": NumSamplesDataset(), "ntokens": NumelDataset(query_tokens, reduce=True), } nested_dataset = NestedDictionaryDataset( dataset, sizes=[query_lengths], ) with data_utils.numpy_seed(self.args.seed): shuffle = np.random.permutation(len(query_tokens)) dataset = SortDataset( nested_dataset, # shuffle sort_order=[shuffle], ) if return_only: return dataset self.datasets[split] = dataset return self.datasets[split]
13,524
32.644279
90
py
rej-summ
rej-summ-main/examples/roberta/wsc/wsc_criterion.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import math import torch import torch.nn.functional as F from fairseq import utils from fairseq.criterions import LegacyFairseqCriterion, register_criterion from fairseq.data import encoders @register_criterion("wsc") class WSCCriterion(LegacyFairseqCriterion): def __init__(self, args, task): super().__init__(args, task) if self.args.save_predictions is not None: self.prediction_h = open(self.args.save_predictions, "w") else: self.prediction_h = None self.bpe = encoders.build_bpe(args.bpe) self.tokenizer = encoders.build_tokenizer(args.tokenizer) def __del__(self): if self.prediction_h is not None: self.prediction_h.close() @staticmethod def add_args(parser): """Add criterion-specific arguments to the parser.""" parser.add_argument("--wsc-margin-alpha", type=float, metavar="A", default=1.0) parser.add_argument("--wsc-margin-beta", type=float, metavar="B", default=0.0) parser.add_argument( "--wsc-cross-entropy", action="store_true", help="use cross entropy formulation instead of margin loss", ) parser.add_argument( "--save-predictions", metavar="FILE", help="file to save predictions to" ) def get_masked_input(self, tokens, mask): masked_tokens = tokens.clone() masked_tokens[mask] = self.task.mask return masked_tokens def get_lprobs(self, model, tokens, mask): logits, _ = model(src_tokens=self.get_masked_input(tokens, mask)) lprobs = F.log_softmax(logits, dim=-1, dtype=torch.float) scores = lprobs.gather(2, tokens.unsqueeze(-1)).squeeze(-1) mask = mask.type_as(scores) scores = (scores * mask).sum(dim=-1) / mask.sum(dim=-1) return scores def get_loss(self, query_lprobs, cand_lprobs): if self.args.wsc_cross_entropy: return F.cross_entropy( torch.cat([query_lprobs, cand_lprobs]).unsqueeze(0), query_lprobs.new([0]).long(), ) else: return ( -query_lprobs + self.args.wsc_margin_alpha * (cand_lprobs - query_lprobs + self.args.wsc_margin_beta).clamp(min=0) ).sum() def forward(self, model, sample, reduce=True): # compute loss and accuracy loss, nloss = 0.0, 0 ncorrect, nqueries = 0, 0 for i, label in enumerate(sample["labels"]): query_lprobs = self.get_lprobs( model, sample["query_tokens"][i].unsqueeze(0), sample["query_masks"][i].unsqueeze(0), ) cand_lprobs = self.get_lprobs( model, sample["candidate_tokens"][i], sample["candidate_masks"][i], ) pred = (query_lprobs >= cand_lprobs).all().item() if label is not None: label = 1 if label else 0 ncorrect += 1 if pred == label else 0 nqueries += 1 if label: # only compute a loss for positive instances nloss += 1 loss += self.get_loss(query_lprobs, cand_lprobs) id = sample["id"][i].item() if self.prediction_h is not None: print("{}\t{}\t{}".format(id, pred, label), file=self.prediction_h) if nloss == 0: loss = torch.tensor(0.0, requires_grad=True) sample_size = nqueries if nqueries > 0 else 1 logging_output = { "loss": utils.item(loss.data) if reduce else loss.data, "ntokens": sample["ntokens"], "nsentences": sample["nsentences"], "sample_size": sample_size, "ncorrect": ncorrect, "nqueries": nqueries, } return loss, sample_size, logging_output @staticmethod def aggregate_logging_outputs(logging_outputs): """Aggregate logging outputs from data parallel training.""" loss_sum = sum(log.get("loss", 0) for log in logging_outputs) ntokens = sum(log.get("ntokens", 0) for log in logging_outputs) nsentences = sum(log.get("nsentences", 0) for log in logging_outputs) sample_size = sum(log.get("sample_size", 0) for log in logging_outputs) agg_output = { "loss": loss_sum / sample_size / math.log(2), "ntokens": ntokens, "nsentences": nsentences, "sample_size": sample_size, } ncorrect = sum(log.get("ncorrect", 0) for log in logging_outputs) nqueries = sum(log.get("nqueries", 0) for log in logging_outputs) if nqueries > 0: agg_output["accuracy"] = ncorrect / float(nqueries) return agg_output @register_criterion("winogrande") class WinograndeCriterion(WSCCriterion): def forward(self, model, sample, reduce=True): # compute loss and accuracy query_lprobs = self.get_lprobs( model, sample["query_tokens"], sample["query_masks"], ) cand_lprobs = self.get_lprobs( model, sample["candidate_tokens"], sample["candidate_masks"], ) pred = query_lprobs >= cand_lprobs loss = self.get_loss(query_lprobs, cand_lprobs) sample_size = sample["query_tokens"].size(0) ncorrect = pred.sum().item() logging_output = { "loss": utils.item(loss.data) if reduce else loss.data, "ntokens": sample["ntokens"], "nsentences": sample["nsentences"], "sample_size": sample_size, "ncorrect": ncorrect, "nqueries": sample_size, } return loss, sample_size, logging_output
6,037
34.940476
87
py
rej-summ
rej-summ-main/examples/speech_recognition/infer.py
#!/usr/bin/env python3 -u # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Run inference for pre-processed data with a trained model. """ import ast import logging import math import os import sys import editdistance import numpy as np import torch from fairseq import checkpoint_utils, options, progress_bar, tasks, utils from fairseq.data.data_utils import post_process from fairseq.logging.meters import StopwatchMeter, TimeMeter logging.basicConfig() logging.root.setLevel(logging.INFO) logging.basicConfig(level=logging.INFO) logger = logging.getLogger(__name__) def add_asr_eval_argument(parser): parser.add_argument("--kspmodel", default=None, help="sentence piece model") parser.add_argument( "--wfstlm", default=None, help="wfstlm on dictonary output units" ) parser.add_argument( "--rnnt_decoding_type", default="greedy", help="wfstlm on dictonary\ output units", ) try: parser.add_argument( "--lm-weight", "--lm_weight", type=float, default=0.2, help="weight for lm while interpolating with neural score", ) except: pass parser.add_argument( "--rnnt_len_penalty", default=-0.5, help="rnnt length penalty on word level" ) parser.add_argument( "--w2l-decoder", choices=["viterbi", "kenlm", "fairseqlm"], help="use a w2l decoder", ) parser.add_argument("--lexicon", help="lexicon for w2l decoder") parser.add_argument("--unit-lm", action="store_true", help="if using a unit lm") parser.add_argument("--kenlm-model", "--lm-model", help="lm model for w2l decoder") parser.add_argument("--beam-threshold", type=float, default=25.0) parser.add_argument("--beam-size-token", type=float, default=100) parser.add_argument("--word-score", type=float, default=1.0) parser.add_argument("--unk-weight", type=float, default=-math.inf) parser.add_argument("--sil-weight", type=float, default=0.0) parser.add_argument( "--dump-emissions", type=str, default=None, help="if present, dumps emissions into this file and exits", ) parser.add_argument( "--dump-features", type=str, default=None, help="if present, dumps features into this file and exits", ) parser.add_argument( "--load-emissions", type=str, default=None, help="if present, loads emissions from this file", ) return parser def check_args(args): # assert args.path is not None, "--path required for generation!" # assert args.results_path is not None, "--results_path required for generation!" assert ( not args.sampling or args.nbest == args.beam ), "--sampling requires --nbest to be equal to --beam" assert ( args.replace_unk is None or args.raw_text ), "--replace-unk requires a raw text dataset (--raw-text)" def get_dataset_itr(args, task, models): return task.get_batch_iterator( dataset=task.dataset(args.gen_subset), max_tokens=args.max_tokens, max_sentences=args.batch_size, max_positions=(sys.maxsize, sys.maxsize), ignore_invalid_inputs=args.skip_invalid_size_inputs_valid_test, required_batch_size_multiple=args.required_batch_size_multiple, num_shards=args.num_shards, shard_id=args.shard_id, num_workers=args.num_workers, data_buffer_size=args.data_buffer_size, ).next_epoch_itr(shuffle=False) def process_predictions( args, hypos, sp, tgt_dict, target_tokens, res_files, speaker, id ): for hypo in hypos[: min(len(hypos), args.nbest)]: hyp_pieces = tgt_dict.string(hypo["tokens"].int().cpu()) if "words" in hypo: hyp_words = " ".join(hypo["words"]) else: hyp_words = post_process(hyp_pieces, args.post_process) if res_files is not None: print( "{} ({}-{})".format(hyp_pieces, speaker, id), file=res_files["hypo.units"], ) print( "{} ({}-{})".format(hyp_words, speaker, id), file=res_files["hypo.words"], ) tgt_pieces = tgt_dict.string(target_tokens) tgt_words = post_process(tgt_pieces, args.post_process) if res_files is not None: print( "{} ({}-{})".format(tgt_pieces, speaker, id), file=res_files["ref.units"], ) print( "{} ({}-{})".format(tgt_words, speaker, id), file=res_files["ref.words"] ) if not args.quiet: logger.info("HYPO:" + hyp_words) logger.info("TARGET:" + tgt_words) logger.info("___________________") hyp_words = hyp_words.split() tgt_words = tgt_words.split() return editdistance.eval(hyp_words, tgt_words), len(tgt_words) def prepare_result_files(args): def get_res_file(file_prefix): if args.num_shards > 1: file_prefix = f"{args.shard_id}_{file_prefix}" path = os.path.join( args.results_path, "{}-{}-{}.txt".format( file_prefix, os.path.basename(args.path), args.gen_subset ), ) return open(path, "w", buffering=1) if not args.results_path: return None return { "hypo.words": get_res_file("hypo.word"), "hypo.units": get_res_file("hypo.units"), "ref.words": get_res_file("ref.word"), "ref.units": get_res_file("ref.units"), } def optimize_models(args, use_cuda, models): """Optimize ensemble for generation""" for model in models: model.make_generation_fast_( beamable_mm_beam_size=None if args.no_beamable_mm else args.beam, need_attn=args.print_alignment, ) if args.fp16: model.half() if use_cuda: model.cuda() def apply_half(t): if t.dtype is torch.float32: return t.to(dtype=torch.half) return t class ExistingEmissionsDecoder(object): def __init__(self, decoder, emissions): self.decoder = decoder self.emissions = emissions def generate(self, models, sample, **unused): ids = sample["id"].cpu().numpy() try: emissions = np.stack(self.emissions[ids]) except: print([x.shape for x in self.emissions[ids]]) raise Exception("invalid sizes") emissions = torch.from_numpy(emissions) return self.decoder.decode(emissions) def main(args, task=None, model_state=None): check_args(args) use_fp16 = args.fp16 if args.max_tokens is None and args.batch_size is None: args.max_tokens = 4000000 logger.info(args) use_cuda = torch.cuda.is_available() and not args.cpu logger.info("| decoding with criterion {}".format(args.criterion)) task = tasks.setup_task(args) # Load ensemble if args.load_emissions: models, criterions = [], [] task.load_dataset(args.gen_subset) else: logger.info("| loading model(s) from {}".format(args.path)) models, saved_cfg, task = checkpoint_utils.load_model_ensemble_and_task( utils.split_paths(args.path, separator="\\"), arg_overrides=ast.literal_eval(args.model_overrides), task=task, suffix=args.checkpoint_suffix, strict=(args.checkpoint_shard_count == 1), num_shards=args.checkpoint_shard_count, state=model_state, ) optimize_models(args, use_cuda, models) task.load_dataset(args.gen_subset, task_cfg=saved_cfg.task) # Set dictionary tgt_dict = task.target_dictionary logger.info( "| {} {} {} examples".format( args.data, args.gen_subset, len(task.dataset(args.gen_subset)) ) ) # hack to pass transitions to W2lDecoder if args.criterion == "asg_loss": raise NotImplementedError("asg_loss is currently not supported") # trans = criterions[0].asg.trans.data # args.asg_transitions = torch.flatten(trans).tolist() # Load dataset (possibly sharded) itr = get_dataset_itr(args, task, models) # Initialize generator gen_timer = StopwatchMeter() def build_generator(args): w2l_decoder = getattr(args, "w2l_decoder", None) if w2l_decoder == "viterbi": from examples.speech_recognition.w2l_decoder import W2lViterbiDecoder return W2lViterbiDecoder(args, task.target_dictionary) elif w2l_decoder == "kenlm": from examples.speech_recognition.w2l_decoder import W2lKenLMDecoder return W2lKenLMDecoder(args, task.target_dictionary) elif w2l_decoder == "fairseqlm": from examples.speech_recognition.w2l_decoder import W2lFairseqLMDecoder return W2lFairseqLMDecoder(args, task.target_dictionary) else: print( "only flashlight decoders with (viterbi, kenlm, fairseqlm) options are supported at the moment" ) # please do not touch this unless you test both generate.py and infer.py with audio_pretraining task generator = build_generator(args) if args.load_emissions: generator = ExistingEmissionsDecoder( generator, np.load(args.load_emissions, allow_pickle=True) ) logger.info("loaded emissions from " + args.load_emissions) num_sentences = 0 if args.results_path is not None and not os.path.exists(args.results_path): os.makedirs(args.results_path) max_source_pos = ( utils.resolve_max_positions( task.max_positions(), *[model.max_positions() for model in models] ), ) if max_source_pos is not None: max_source_pos = max_source_pos[0] if max_source_pos is not None: max_source_pos = max_source_pos[0] - 1 if args.dump_emissions: emissions = {} if args.dump_features: features = {} models[0].bert.proj = None else: res_files = prepare_result_files(args) errs_t = 0 lengths_t = 0 with progress_bar.build_progress_bar(args, itr) as t: wps_meter = TimeMeter() for sample in t: sample = utils.move_to_cuda(sample) if use_cuda else sample if use_fp16: sample = utils.apply_to_sample(apply_half, sample) if "net_input" not in sample: continue prefix_tokens = None if args.prefix_size > 0: prefix_tokens = sample["target"][:, : args.prefix_size] gen_timer.start() if args.dump_emissions: with torch.no_grad(): encoder_out = models[0](**sample["net_input"]) emm = models[0].get_normalized_probs(encoder_out, log_probs=True) emm = emm.transpose(0, 1).cpu().numpy() for i, id in enumerate(sample["id"]): emissions[id.item()] = emm[i] continue elif args.dump_features: with torch.no_grad(): encoder_out = models[0](**sample["net_input"]) feat = encoder_out["encoder_out"].transpose(0, 1).cpu().numpy() for i, id in enumerate(sample["id"]): padding = ( encoder_out["encoder_padding_mask"][i].cpu().numpy() if encoder_out["encoder_padding_mask"] is not None else None ) features[id.item()] = (feat[i], padding) continue hypos = task.inference_step(generator, models, sample, prefix_tokens) num_generated_tokens = sum(len(h[0]["tokens"]) for h in hypos) gen_timer.stop(num_generated_tokens) for i, sample_id in enumerate(sample["id"].tolist()): speaker = None # id = task.dataset(args.gen_subset).ids[int(sample_id)] id = sample_id toks = ( sample["target"][i, :] if "target_label" not in sample else sample["target_label"][i, :] ) target_tokens = utils.strip_pad(toks, tgt_dict.pad()).int().cpu() # Process top predictions errs, length = process_predictions( args, hypos[i], None, tgt_dict, target_tokens, res_files, speaker, id, ) errs_t += errs lengths_t += length wps_meter.update(num_generated_tokens) t.log({"wps": round(wps_meter.avg)}) num_sentences += ( sample["nsentences"] if "nsentences" in sample else sample["id"].numel() ) wer = None if args.dump_emissions: emm_arr = [] for i in range(len(emissions)): emm_arr.append(emissions[i]) np.save(args.dump_emissions, emm_arr) logger.info(f"saved {len(emissions)} emissions to {args.dump_emissions}") elif args.dump_features: feat_arr = [] for i in range(len(features)): feat_arr.append(features[i]) np.save(args.dump_features, feat_arr) logger.info(f"saved {len(features)} emissions to {args.dump_features}") else: if lengths_t > 0: wer = errs_t * 100.0 / lengths_t logger.info(f"WER: {wer}") logger.info( "| Processed {} sentences ({} tokens) in {:.1f}s ({:.2f}" "sentences/s, {:.2f} tokens/s)".format( num_sentences, gen_timer.n, gen_timer.sum, num_sentences / gen_timer.sum, 1.0 / gen_timer.avg, ) ) logger.info("| Generate {} with beam={}".format(args.gen_subset, args.beam)) return task, wer def make_parser(): parser = options.get_generation_parser() parser = add_asr_eval_argument(parser) return parser def cli_main(): parser = make_parser() args = options.parse_args_and_arch(parser) main(args) if __name__ == "__main__": cli_main()
14,677
32.588101
111
py
rej-summ
rej-summ-main/examples/speech_recognition/w2l_decoder.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Flashlight decoders. """ import gc import itertools as it import os.path as osp from typing import List import warnings from collections import deque, namedtuple import numpy as np import torch from examples.speech_recognition.data.replabels import unpack_replabels from fairseq import tasks from fairseq.utils import apply_to_sample from omegaconf import open_dict from fairseq.dataclass.utils import convert_namespace_to_omegaconf try: from flashlight.lib.text.dictionary import create_word_dict, load_words from flashlight.lib.sequence.criterion import CpuViterbiPath, get_data_ptr_as_bytes from flashlight.lib.text.decoder import ( CriterionType, LexiconDecoderOptions, KenLM, LM, LMState, SmearingMode, Trie, LexiconDecoder, ) except: warnings.warn( "flashlight python bindings are required to use this functionality. Please install from https://github.com/facebookresearch/flashlight/tree/master/bindings/python" ) LM = object LMState = object class W2lDecoder(object): def __init__(self, args, tgt_dict): self.tgt_dict = tgt_dict self.vocab_size = len(tgt_dict) self.nbest = args.nbest # criterion-specific init self.criterion_type = CriterionType.CTC self.blank = ( tgt_dict.index("<ctc_blank>") if "<ctc_blank>" in tgt_dict.indices else tgt_dict.bos() ) if "<sep>" in tgt_dict.indices: self.silence = tgt_dict.index("<sep>") elif "|" in tgt_dict.indices: self.silence = tgt_dict.index("|") else: self.silence = tgt_dict.eos() self.asg_transitions = None def generate(self, models, sample, **unused): """Generate a batch of inferences.""" # model.forward normally channels prev_output_tokens into the decoder # separately, but SequenceGenerator directly calls model.encoder encoder_input = { k: v for k, v in sample["net_input"].items() if k != "prev_output_tokens" } emissions = self.get_emissions(models, encoder_input) return self.decode(emissions) def get_emissions(self, models, encoder_input): """Run encoder and normalize emissions""" model = models[0] encoder_out = model(**encoder_input) if hasattr(model, "get_logits"): emissions = model.get_logits(encoder_out) # no need to normalize emissions else: emissions = model.get_normalized_probs(encoder_out, log_probs=True) return emissions.transpose(0, 1).float().cpu().contiguous() def get_tokens(self, idxs): """Normalize tokens by handling CTC blank, ASG replabels, etc.""" idxs = (g[0] for g in it.groupby(idxs)) idxs = filter(lambda x: x != self.blank, idxs) return torch.LongTensor(list(idxs)) class W2lViterbiDecoder(W2lDecoder): def __init__(self, args, tgt_dict): super().__init__(args, tgt_dict) def decode(self, emissions): B, T, N = emissions.size() hypos = [] if self.asg_transitions is None: transitions = torch.FloatTensor(N, N).zero_() else: transitions = torch.FloatTensor(self.asg_transitions).view(N, N) viterbi_path = torch.IntTensor(B, T) workspace = torch.ByteTensor(CpuViterbiPath.get_workspace_size(B, T, N)) CpuViterbiPath.compute( B, T, N, get_data_ptr_as_bytes(emissions), get_data_ptr_as_bytes(transitions), get_data_ptr_as_bytes(viterbi_path), get_data_ptr_as_bytes(workspace), ) return [ [{"tokens": self.get_tokens(viterbi_path[b].tolist()), "score": 0}] for b in range(B) ] class W2lKenLMDecoder(W2lDecoder): def __init__(self, args, tgt_dict): super().__init__(args, tgt_dict) self.unit_lm = getattr(args, "unit_lm", False) if args.lexicon: self.lexicon = load_words(args.lexicon) self.word_dict = create_word_dict(self.lexicon) self.unk_word = self.word_dict.get_index("<unk>") self.lm = KenLM(args.kenlm_model, self.word_dict) self.trie = Trie(self.vocab_size, self.silence) start_state = self.lm.start(False) for i, (word, spellings) in enumerate(self.lexicon.items()): word_idx = self.word_dict.get_index(word) _, score = self.lm.score(start_state, word_idx) for spelling in spellings: spelling_idxs = [tgt_dict.index(token) for token in spelling] assert ( tgt_dict.unk() not in spelling_idxs ), f"{spelling} {spelling_idxs}" self.trie.insert(spelling_idxs, word_idx, score) self.trie.smear(SmearingMode.MAX) self.decoder_opts = LexiconDecoderOptions( beam_size=args.beam, beam_size_token=int(getattr(args, "beam_size_token", len(tgt_dict))), beam_threshold=args.beam_threshold, lm_weight=args.lm_weight, word_score=args.word_score, unk_score=args.unk_weight, sil_score=args.sil_weight, log_add=False, criterion_type=self.criterion_type, ) if self.asg_transitions is None: N = 768 # self.asg_transitions = torch.FloatTensor(N, N).zero_() self.asg_transitions = [] self.decoder = LexiconDecoder( self.decoder_opts, self.trie, self.lm, self.silence, self.blank, self.unk_word, self.asg_transitions, self.unit_lm, ) else: assert args.unit_lm, "lexicon free decoding can only be done with a unit language model" from flashlight.lib.text.decoder import LexiconFreeDecoder, LexiconFreeDecoderOptions d = {w: [[w]] for w in tgt_dict.symbols} self.word_dict = create_word_dict(d) self.lm = KenLM(args.kenlm_model, self.word_dict) self.decoder_opts = LexiconFreeDecoderOptions( beam_size=args.beam, beam_size_token=int(getattr(args, "beam_size_token", len(tgt_dict))), beam_threshold=args.beam_threshold, lm_weight=args.lm_weight, sil_score=args.sil_weight, log_add=False, criterion_type=self.criterion_type, ) self.decoder = LexiconFreeDecoder( self.decoder_opts, self.lm, self.silence, self.blank, [] ) def get_timesteps(self, token_idxs: List[int]) -> List[int]: """Returns frame numbers corresponding to every non-blank token. Parameters ---------- token_idxs : List[int] IDs of decoded tokens. Returns ------- List[int] Frame numbers corresponding to every non-blank token. """ timesteps = [] for i, token_idx in enumerate(token_idxs): if token_idx == self.blank: continue if i == 0 or token_idx != token_idxs[i-1]: timesteps.append(i) return timesteps def decode(self, emissions): B, T, N = emissions.size() hypos = [] for b in range(B): emissions_ptr = emissions.data_ptr() + 4 * b * emissions.stride(0) results = self.decoder.decode(emissions_ptr, T, N) nbest_results = results[: self.nbest] hypos.append( [ { "tokens": self.get_tokens(result.tokens), "score": result.score, "timesteps": self.get_timesteps(result.tokens), "words": [ self.word_dict.get_entry(x) for x in result.words if x >= 0 ], } for result in nbest_results ] ) return hypos FairseqLMState = namedtuple("FairseqLMState", ["prefix", "incremental_state", "probs"]) class FairseqLM(LM): def __init__(self, dictionary, model): LM.__init__(self) self.dictionary = dictionary self.model = model self.unk = self.dictionary.unk() self.save_incremental = False # this currently does not work properly self.max_cache = 20_000 model.cuda() model.eval() model.make_generation_fast_() self.states = {} self.stateq = deque() def start(self, start_with_nothing): state = LMState() prefix = torch.LongTensor([[self.dictionary.eos()]]) incremental_state = {} if self.save_incremental else None with torch.no_grad(): res = self.model(prefix.cuda(), incremental_state=incremental_state) probs = self.model.get_normalized_probs(res, log_probs=True, sample=None) if incremental_state is not None: incremental_state = apply_to_sample(lambda x: x.cpu(), incremental_state) self.states[state] = FairseqLMState( prefix.numpy(), incremental_state, probs[0, -1].cpu().numpy() ) self.stateq.append(state) return state def score(self, state: LMState, token_index: int, no_cache: bool = False): """ Evaluate language model based on the current lm state and new word Parameters: ----------- state: current lm state token_index: index of the word (can be lexicon index then you should store inside LM the mapping between indices of lexicon and lm, or lm index of a word) Returns: -------- (LMState, float): pair of (new state, score for the current word) """ curr_state = self.states[state] def trim_cache(targ_size): while len(self.stateq) > targ_size: rem_k = self.stateq.popleft() rem_st = self.states[rem_k] rem_st = FairseqLMState(rem_st.prefix, None, None) self.states[rem_k] = rem_st if curr_state.probs is None: new_incremental_state = ( curr_state.incremental_state.copy() if curr_state.incremental_state is not None else None ) with torch.no_grad(): if new_incremental_state is not None: new_incremental_state = apply_to_sample( lambda x: x.cuda(), new_incremental_state ) elif self.save_incremental: new_incremental_state = {} res = self.model( torch.from_numpy(curr_state.prefix).cuda(), incremental_state=new_incremental_state, ) probs = self.model.get_normalized_probs( res, log_probs=True, sample=None ) if new_incremental_state is not None: new_incremental_state = apply_to_sample( lambda x: x.cpu(), new_incremental_state ) curr_state = FairseqLMState( curr_state.prefix, new_incremental_state, probs[0, -1].cpu().numpy() ) if not no_cache: self.states[state] = curr_state self.stateq.append(state) score = curr_state.probs[token_index].item() trim_cache(self.max_cache) outstate = state.child(token_index) if outstate not in self.states and not no_cache: prefix = np.concatenate( [curr_state.prefix, torch.LongTensor([[token_index]])], -1 ) incr_state = curr_state.incremental_state self.states[outstate] = FairseqLMState(prefix, incr_state, None) if token_index == self.unk: score = float("-inf") return outstate, score def finish(self, state: LMState): """ Evaluate eos for language model based on the current lm state Returns: -------- (LMState, float): pair of (new state, score for the current word) """ return self.score(state, self.dictionary.eos()) def empty_cache(self): self.states = {} self.stateq = deque() gc.collect() class W2lFairseqLMDecoder(W2lDecoder): def __init__(self, args, tgt_dict): super().__init__(args, tgt_dict) self.unit_lm = getattr(args, "unit_lm", False) self.lexicon = load_words(args.lexicon) if args.lexicon else None self.idx_to_wrd = {} checkpoint = torch.load(args.kenlm_model, map_location="cpu") if "cfg" in checkpoint and checkpoint["cfg"] is not None: lm_args = checkpoint["cfg"] else: lm_args = convert_namespace_to_omegaconf(checkpoint["args"]) with open_dict(lm_args.task): lm_args.task.data = osp.dirname(args.kenlm_model) task = tasks.setup_task(lm_args.task) model = task.build_model(lm_args.model) model.load_state_dict(checkpoint["model"], strict=False) self.trie = Trie(self.vocab_size, self.silence) self.word_dict = task.dictionary self.unk_word = self.word_dict.unk() self.lm = FairseqLM(self.word_dict, model) if self.lexicon: start_state = self.lm.start(False) for i, (word, spellings) in enumerate(self.lexicon.items()): if self.unit_lm: word_idx = i self.idx_to_wrd[i] = word score = 0 else: word_idx = self.word_dict.index(word) _, score = self.lm.score(start_state, word_idx, no_cache=True) for spelling in spellings: spelling_idxs = [tgt_dict.index(token) for token in spelling] assert ( tgt_dict.unk() not in spelling_idxs ), f"{spelling} {spelling_idxs}" self.trie.insert(spelling_idxs, word_idx, score) self.trie.smear(SmearingMode.MAX) self.decoder_opts = LexiconDecoderOptions( beam_size=args.beam, beam_size_token=int(getattr(args, "beam_size_token", len(tgt_dict))), beam_threshold=args.beam_threshold, lm_weight=args.lm_weight, word_score=args.word_score, unk_score=args.unk_weight, sil_score=args.sil_weight, log_add=False, criterion_type=self.criterion_type, ) self.decoder = LexiconDecoder( self.decoder_opts, self.trie, self.lm, self.silence, self.blank, self.unk_word, [], self.unit_lm, ) else: assert args.unit_lm, "lexicon free decoding can only be done with a unit language model" from flashlight.lib.text.decoder import LexiconFreeDecoder, LexiconFreeDecoderOptions d = {w: [[w]] for w in tgt_dict.symbols} self.word_dict = create_word_dict(d) self.lm = KenLM(args.kenlm_model, self.word_dict) self.decoder_opts = LexiconFreeDecoderOptions( beam_size=args.beam, beam_size_token=int(getattr(args, "beam_size_token", len(tgt_dict))), beam_threshold=args.beam_threshold, lm_weight=args.lm_weight, sil_score=args.sil_weight, log_add=False, criterion_type=self.criterion_type, ) self.decoder = LexiconFreeDecoder( self.decoder_opts, self.lm, self.silence, self.blank, [] ) def decode(self, emissions): B, T, N = emissions.size() hypos = [] def idx_to_word(idx): if self.unit_lm: return self.idx_to_wrd[idx] else: return self.word_dict[idx] def make_hypo(result): hypo = {"tokens": self.get_tokens(result.tokens), "score": result.score} if self.lexicon: hypo["words"] = [idx_to_word(x) for x in result.words if x >= 0] return hypo for b in range(B): emissions_ptr = emissions.data_ptr() + 4 * b * emissions.stride(0) results = self.decoder.decode(emissions_ptr, T, N) nbest_results = results[: self.nbest] hypos.append([make_hypo(result) for result in nbest_results]) self.lm.empty_cache() return hypos
17,396
34.722793
171
py
rej-summ
rej-summ-main/examples/speech_recognition/criterions/cross_entropy_acc.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from __future__ import absolute_import, division, print_function, unicode_literals import logging import math import torch import torch.nn.functional as F from fairseq import utils from fairseq.criterions import FairseqCriterion, register_criterion @register_criterion("cross_entropy_acc") class CrossEntropyWithAccCriterion(FairseqCriterion): def __init__(self, task, sentence_avg): super().__init__(task) self.sentence_avg = sentence_avg def compute_loss(self, model, net_output, target, reduction, log_probs): # N, T -> N * T target = target.view(-1) lprobs = model.get_normalized_probs(net_output, log_probs=log_probs) if not hasattr(lprobs, "batch_first"): logging.warning( "ERROR: we need to know whether " "batch first for the net output; " "you need to set batch_first attribute for the return value of " "model.get_normalized_probs. Now, we assume this is true, but " "in the future, we will raise exception instead. " ) batch_first = getattr(lprobs, "batch_first", True) if not batch_first: lprobs = lprobs.transpose(0, 1) # N, T, D -> N * T, D lprobs = lprobs.view(-1, lprobs.size(-1)) loss = F.nll_loss( lprobs, target, ignore_index=self.padding_idx, reduction=reduction ) return lprobs, loss def get_logging_output(self, sample, target, lprobs, loss): target = target.view(-1) mask = target != self.padding_idx correct = torch.sum( lprobs.argmax(1).masked_select(mask) == target.masked_select(mask) ) total = torch.sum(mask) sample_size = ( sample["target"].size(0) if self.sentence_avg else sample["ntokens"] ) logging_output = { "loss": utils.item(loss.data), # * sample['ntokens'], "ntokens": sample["ntokens"], "nsentences": sample["target"].size(0), "sample_size": sample_size, "correct": utils.item(correct.data), "total": utils.item(total.data), "nframes": torch.sum(sample["net_input"]["src_lengths"]).item(), } return sample_size, logging_output def forward(self, model, sample, reduction="sum", log_probs=True): """Computes the cross entropy with accuracy metric for the given sample. This is similar to CrossEntropyCriterion in fairseq, but also computes accuracy metrics as part of logging Args: logprobs (Torch.tensor) of shape N, T, D i.e. batchsize, timesteps, dimensions targets (Torch.tensor) of shape N, T i.e batchsize, timesteps Returns: tuple: With three elements: 1) the loss 2) the sample size, which is used as the denominator for the gradient 3) logging outputs to display while training TODO: * Currently this Criterion will only work with LSTMEncoderModels or FairseqModels which have decoder, or Models which return TorchTensor as net_output. We need to make a change to support all FairseqEncoder models. """ net_output = model(**sample["net_input"]) target = model.get_targets(sample, net_output) lprobs, loss = self.compute_loss( model, net_output, target, reduction, log_probs ) sample_size, logging_output = self.get_logging_output( sample, target, lprobs, loss ) return loss, sample_size, logging_output @staticmethod def aggregate_logging_outputs(logging_outputs): """Aggregate logging outputs from data parallel training.""" correct_sum = sum(log.get("correct", 0) for log in logging_outputs) total_sum = sum(log.get("total", 0) for log in logging_outputs) loss_sum = sum(log.get("loss", 0) for log in logging_outputs) ntokens = sum(log.get("ntokens", 0) for log in logging_outputs) nsentences = sum(log.get("nsentences", 0) for log in logging_outputs) sample_size = sum(log.get("sample_size", 0) for log in logging_outputs) nframes = sum(log.get("nframes", 0) for log in logging_outputs) agg_output = { "loss": loss_sum / sample_size / math.log(2) if sample_size > 0 else 0.0, # if args.sentence_avg, then sample_size is nsentences, then loss # is per-sentence loss; else sample_size is ntokens, the loss # becomes per-output token loss "ntokens": ntokens, "nsentences": nsentences, "nframes": nframes, "sample_size": sample_size, "acc": correct_sum * 100.0 / total_sum if total_sum > 0 else 0.0, "correct": correct_sum, "total": total_sum, # total is the number of validate tokens } if sample_size != ntokens: agg_output["nll_loss"] = loss_sum / ntokens / math.log(2) # loss: per output token loss # nll_loss: per sentence loss return agg_output
5,372
40.015267
85
py
rej-summ
rej-summ-main/examples/speech_recognition/criterions/ASG_loss.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from examples.speech_recognition.data.replabels import pack_replabels from fairseq import utils from fairseq.criterions import FairseqCriterion, register_criterion @register_criterion("asg_loss") class ASGCriterion(FairseqCriterion): @staticmethod def add_args(parser): group = parser.add_argument_group("ASG Loss") group.add_argument( "--asg-transitions-init", help="initial diagonal value of transition matrix", type=float, default=0.0, ) group.add_argument( "--max-replabel", help="maximum # of replabels", type=int, default=2 ) group.add_argument( "--linseg-updates", help="# of training updates to use LinSeg initialization", type=int, default=0, ) group.add_argument( "--hide-linseg-messages", help="hide messages about LinSeg initialization", action="store_true", ) def __init__( self, task, silence_token, asg_transitions_init, max_replabel, linseg_updates, hide_linseg_messages, ): from flashlight.lib.sequence.criterion import ASGLoss, CriterionScaleMode super().__init__(task) self.tgt_dict = task.target_dictionary self.eos = self.tgt_dict.eos() self.silence = ( self.tgt_dict.index(silence_token) if silence_token in self.tgt_dict else None ) self.max_replabel = max_replabel num_labels = len(self.tgt_dict) self.asg = ASGLoss(num_labels, scale_mode=CriterionScaleMode.TARGET_SZ_SQRT) self.asg.trans = torch.nn.Parameter( asg_transitions_init * torch.eye(num_labels), requires_grad=True ) self.linseg_progress = torch.nn.Parameter( torch.tensor([0], dtype=torch.int), requires_grad=False ) self.linseg_maximum = linseg_updates self.linseg_message_state = "none" if hide_linseg_messages else "start" @classmethod def build_criterion(cls, args, task): return cls( task, args.silence_token, args.asg_transitions_init, args.max_replabel, args.linseg_updates, args.hide_linseg_messages, ) def linseg_step(self): if not self.training: return False if self.linseg_progress.item() < self.linseg_maximum: if self.linseg_message_state == "start": print("| using LinSeg to initialize ASG") self.linseg_message_state = "finish" self.linseg_progress.add_(1) return True elif self.linseg_message_state == "finish": print("| finished LinSeg initialization") self.linseg_message_state = "none" return False def replace_eos_with_silence(self, tgt): if tgt[-1] != self.eos: return tgt elif self.silence is None or (len(tgt) > 1 and tgt[-2] == self.silence): return tgt[:-1] else: return tgt[:-1] + [self.silence] def forward(self, model, sample, reduce=True): """Compute the loss for the given sample. Returns a tuple with three elements: 1) the loss 2) the sample size, which is used as the denominator for the gradient 3) logging outputs to display while training """ net_output = model(**sample["net_input"]) emissions = net_output["encoder_out"].transpose(0, 1).contiguous() B = emissions.size(0) T = emissions.size(1) device = emissions.device target = torch.IntTensor(B, T) target_size = torch.IntTensor(B) using_linseg = self.linseg_step() for b in range(B): initial_target_size = sample["target_lengths"][b].item() if initial_target_size == 0: raise ValueError("target size cannot be zero") tgt = sample["target"][b, :initial_target_size].tolist() tgt = self.replace_eos_with_silence(tgt) tgt = pack_replabels(tgt, self.tgt_dict, self.max_replabel) tgt = tgt[:T] if using_linseg: tgt = [tgt[t * len(tgt) // T] for t in range(T)] target[b][: len(tgt)] = torch.IntTensor(tgt) target_size[b] = len(tgt) loss = self.asg.forward(emissions, target.to(device), target_size.to(device)) if reduce: loss = torch.sum(loss) sample_size = ( sample["target"].size(0) if self.args.sentence_avg else sample["ntokens"] ) logging_output = { "loss": utils.item(loss.data) if reduce else loss.data, "ntokens": sample["ntokens"], "nsentences": sample["target"].size(0), "sample_size": sample_size, } return loss, sample_size, logging_output @staticmethod def aggregate_logging_outputs(logging_outputs): """Aggregate logging outputs from data parallel training.""" loss_sum = sum(log.get("loss", 0) for log in logging_outputs) ntokens = sum(log.get("ntokens", 0) for log in logging_outputs) nsentences = sum(log.get("nsentences", 0) for log in logging_outputs) sample_size = sum(log.get("sample_size", 0) for log in logging_outputs) agg_output = { "loss": loss_sum / nsentences, "ntokens": ntokens, "nsentences": nsentences, "sample_size": sample_size, } return agg_output
5,870
33.333333
85
py
rej-summ
rej-summ-main/examples/speech_recognition/models/vggtransformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import math from collections.abc import Iterable import torch import torch.nn as nn from examples.speech_recognition.data.data_utils import lengths_to_encoder_padding_mask from fairseq import utils from fairseq.models import ( FairseqEncoder, FairseqEncoderDecoderModel, FairseqEncoderModel, FairseqIncrementalDecoder, register_model, register_model_architecture, ) from fairseq.modules import ( LinearizedConvolution, TransformerDecoderLayer, TransformerEncoderLayer, VGGBlock, ) @register_model("asr_vggtransformer") class VGGTransformerModel(FairseqEncoderDecoderModel): """ Transformers with convolutional context for ASR https://arxiv.org/abs/1904.11660 """ def __init__(self, encoder, decoder): super().__init__(encoder, decoder) @staticmethod def add_args(parser): """Add model-specific arguments to the parser.""" parser.add_argument( "--input-feat-per-channel", type=int, metavar="N", help="encoder input dimension per input channel", ) parser.add_argument( "--vggblock-enc-config", type=str, metavar="EXPR", help=""" an array of tuples each containing the configuration of one vggblock: [(out_channels, conv_kernel_size, pooling_kernel_size, num_conv_layers, use_layer_norm), ...]) """, ) parser.add_argument( "--transformer-enc-config", type=str, metavar="EXPR", help="""" a tuple containing the configuration of the encoder transformer layers configurations: [(input_dim, num_heads, ffn_dim, normalize_before, dropout, attention_dropout, relu_dropout), ...]') """, ) parser.add_argument( "--enc-output-dim", type=int, metavar="N", help=""" encoder output dimension, can be None. If specified, projecting the transformer output to the specified dimension""", ) parser.add_argument( "--in-channels", type=int, metavar="N", help="number of encoder input channels", ) parser.add_argument( "--tgt-embed-dim", type=int, metavar="N", help="embedding dimension of the decoder target tokens", ) parser.add_argument( "--transformer-dec-config", type=str, metavar="EXPR", help=""" a tuple containing the configuration of the decoder transformer layers configurations: [(input_dim, num_heads, ffn_dim, normalize_before, dropout, attention_dropout, relu_dropout), ...] """, ) parser.add_argument( "--conv-dec-config", type=str, metavar="EXPR", help=""" an array of tuples for the decoder 1-D convolution config [(out_channels, conv_kernel_size, use_layer_norm), ...]""", ) @classmethod def build_encoder(cls, args, task): return VGGTransformerEncoder( input_feat_per_channel=args.input_feat_per_channel, vggblock_config=eval(args.vggblock_enc_config), transformer_config=eval(args.transformer_enc_config), encoder_output_dim=args.enc_output_dim, in_channels=args.in_channels, ) @classmethod def build_decoder(cls, args, task): return TransformerDecoder( dictionary=task.target_dictionary, embed_dim=args.tgt_embed_dim, transformer_config=eval(args.transformer_dec_config), conv_config=eval(args.conv_dec_config), encoder_output_dim=args.enc_output_dim, ) @classmethod def build_model(cls, args, task): """Build a new model instance.""" # make sure that all args are properly defaulted # (in case there are any new ones) base_architecture(args) encoder = cls.build_encoder(args, task) decoder = cls.build_decoder(args, task) return cls(encoder, decoder) def get_normalized_probs(self, net_output, log_probs, sample=None): # net_output['encoder_out'] is a (B, T, D) tensor lprobs = super().get_normalized_probs(net_output, log_probs, sample) lprobs.batch_first = True return lprobs DEFAULT_ENC_VGGBLOCK_CONFIG = ((32, 3, 2, 2, False),) * 2 DEFAULT_ENC_TRANSFORMER_CONFIG = ((256, 4, 1024, True, 0.2, 0.2, 0.2),) * 2 # 256: embedding dimension # 4: number of heads # 1024: FFN # True: apply layerNorm before (dropout + resiaul) instead of after # 0.2 (dropout): dropout after MultiheadAttention and second FC # 0.2 (attention_dropout): dropout in MultiheadAttention # 0.2 (relu_dropout): dropout after ReLu DEFAULT_DEC_TRANSFORMER_CONFIG = ((256, 2, 1024, True, 0.2, 0.2, 0.2),) * 2 DEFAULT_DEC_CONV_CONFIG = ((256, 3, True),) * 2 # TODO: repace transformer encoder config from one liner # to explicit args to get rid of this transformation def prepare_transformer_encoder_params( input_dim, num_heads, ffn_dim, normalize_before, dropout, attention_dropout, relu_dropout, ): args = argparse.Namespace() args.encoder_embed_dim = input_dim args.encoder_attention_heads = num_heads args.attention_dropout = attention_dropout args.dropout = dropout args.activation_dropout = relu_dropout args.encoder_normalize_before = normalize_before args.encoder_ffn_embed_dim = ffn_dim return args def prepare_transformer_decoder_params( input_dim, num_heads, ffn_dim, normalize_before, dropout, attention_dropout, relu_dropout, ): args = argparse.Namespace() args.encoder_embed_dim = None args.decoder_embed_dim = input_dim args.decoder_attention_heads = num_heads args.attention_dropout = attention_dropout args.dropout = dropout args.activation_dropout = relu_dropout args.decoder_normalize_before = normalize_before args.decoder_ffn_embed_dim = ffn_dim return args class VGGTransformerEncoder(FairseqEncoder): """VGG + Transformer encoder""" def __init__( self, input_feat_per_channel, vggblock_config=DEFAULT_ENC_VGGBLOCK_CONFIG, transformer_config=DEFAULT_ENC_TRANSFORMER_CONFIG, encoder_output_dim=512, in_channels=1, transformer_context=None, transformer_sampling=None, ): """constructor for VGGTransformerEncoder Args: - input_feat_per_channel: feature dim (not including stacked, just base feature) - in_channel: # input channels (e.g., if stack 8 feature vector together, this is 8) - vggblock_config: configuration of vggblock, see comments on DEFAULT_ENC_VGGBLOCK_CONFIG - transformer_config: configuration of transformer layer, see comments on DEFAULT_ENC_TRANSFORMER_CONFIG - encoder_output_dim: final transformer output embedding dimension - transformer_context: (left, right) if set, self-attention will be focused on (t-left, t+right) - transformer_sampling: an iterable of int, must match with len(transformer_config), transformer_sampling[i] indicates sampling factor for i-th transformer layer, after multihead att and feedfoward part """ super().__init__(None) self.num_vggblocks = 0 if vggblock_config is not None: if not isinstance(vggblock_config, Iterable): raise ValueError("vggblock_config is not iterable") self.num_vggblocks = len(vggblock_config) self.conv_layers = nn.ModuleList() self.in_channels = in_channels self.input_dim = input_feat_per_channel self.pooling_kernel_sizes = [] if vggblock_config is not None: for _, config in enumerate(vggblock_config): ( out_channels, conv_kernel_size, pooling_kernel_size, num_conv_layers, layer_norm, ) = config self.conv_layers.append( VGGBlock( in_channels, out_channels, conv_kernel_size, pooling_kernel_size, num_conv_layers, input_dim=input_feat_per_channel, layer_norm=layer_norm, ) ) self.pooling_kernel_sizes.append(pooling_kernel_size) in_channels = out_channels input_feat_per_channel = self.conv_layers[-1].output_dim transformer_input_dim = self.infer_conv_output_dim( self.in_channels, self.input_dim ) # transformer_input_dim is the output dimension of VGG part self.validate_transformer_config(transformer_config) self.transformer_context = self.parse_transformer_context(transformer_context) self.transformer_sampling = self.parse_transformer_sampling( transformer_sampling, len(transformer_config) ) self.transformer_layers = nn.ModuleList() if transformer_input_dim != transformer_config[0][0]: self.transformer_layers.append( Linear(transformer_input_dim, transformer_config[0][0]) ) self.transformer_layers.append( TransformerEncoderLayer( prepare_transformer_encoder_params(*transformer_config[0]) ) ) for i in range(1, len(transformer_config)): if transformer_config[i - 1][0] != transformer_config[i][0]: self.transformer_layers.append( Linear(transformer_config[i - 1][0], transformer_config[i][0]) ) self.transformer_layers.append( TransformerEncoderLayer( prepare_transformer_encoder_params(*transformer_config[i]) ) ) self.encoder_output_dim = encoder_output_dim self.transformer_layers.extend( [ Linear(transformer_config[-1][0], encoder_output_dim), LayerNorm(encoder_output_dim), ] ) def forward(self, src_tokens, src_lengths, **kwargs): """ src_tokens: padded tensor (B, T, C * feat) src_lengths: tensor of original lengths of input utterances (B,) """ bsz, max_seq_len, _ = src_tokens.size() x = src_tokens.view(bsz, max_seq_len, self.in_channels, self.input_dim) x = x.transpose(1, 2).contiguous() # (B, C, T, feat) for layer_idx in range(len(self.conv_layers)): x = self.conv_layers[layer_idx](x) bsz, _, output_seq_len, _ = x.size() # (B, C, T, feat) -> (B, T, C, feat) -> (T, B, C, feat) -> (T, B, C * feat) x = x.transpose(1, 2).transpose(0, 1) x = x.contiguous().view(output_seq_len, bsz, -1) input_lengths = src_lengths.clone() for s in self.pooling_kernel_sizes: input_lengths = (input_lengths.float() / s).ceil().long() encoder_padding_mask, _ = lengths_to_encoder_padding_mask( input_lengths, batch_first=True ) if not encoder_padding_mask.any(): encoder_padding_mask = None subsampling_factor = int(max_seq_len * 1.0 / output_seq_len + 0.5) attn_mask = self.lengths_to_attn_mask(input_lengths, subsampling_factor) transformer_layer_idx = 0 for layer_idx in range(len(self.transformer_layers)): if isinstance(self.transformer_layers[layer_idx], TransformerEncoderLayer): x = self.transformer_layers[layer_idx]( x, encoder_padding_mask, attn_mask ) if self.transformer_sampling[transformer_layer_idx] != 1: sampling_factor = self.transformer_sampling[transformer_layer_idx] x, encoder_padding_mask, attn_mask = self.slice( x, encoder_padding_mask, attn_mask, sampling_factor ) transformer_layer_idx += 1 else: x = self.transformer_layers[layer_idx](x) # encoder_padding_maks is a (T x B) tensor, its [t, b] elements indicate # whether encoder_output[t, b] is valid or not (valid=0, invalid=1) return { "encoder_out": x, # (T, B, C) "encoder_padding_mask": encoder_padding_mask.t() if encoder_padding_mask is not None else None, # (B, T) --> (T, B) } def infer_conv_output_dim(self, in_channels, input_dim): sample_seq_len = 200 sample_bsz = 10 x = torch.randn(sample_bsz, in_channels, sample_seq_len, input_dim) for i, _ in enumerate(self.conv_layers): x = self.conv_layers[i](x) x = x.transpose(1, 2) mb, seq = x.size()[:2] return x.contiguous().view(mb, seq, -1).size(-1) def validate_transformer_config(self, transformer_config): for config in transformer_config: input_dim, num_heads = config[:2] if input_dim % num_heads != 0: msg = ( "ERROR in transformer config {}: ".format(config) + "input dimension {} ".format(input_dim) + "not dividable by number of heads {}".format(num_heads) ) raise ValueError(msg) def parse_transformer_context(self, transformer_context): """ transformer_context can be the following: - None; indicates no context is used, i.e., transformer can access full context - a tuple/list of two int; indicates left and right context, any number <0 indicates infinite context * e.g., (5, 6) indicates that for query at x_t, transformer can access [t-5, t+6] (inclusive) * e.g., (-1, 6) indicates that for query at x_t, transformer can access [0, t+6] (inclusive) """ if transformer_context is None: return None if not isinstance(transformer_context, Iterable): raise ValueError("transformer context must be Iterable if it is not None") if len(transformer_context) != 2: raise ValueError("transformer context must have length 2") left_context = transformer_context[0] if left_context < 0: left_context = None right_context = transformer_context[1] if right_context < 0: right_context = None if left_context is None and right_context is None: return None return (left_context, right_context) def parse_transformer_sampling(self, transformer_sampling, num_layers): """ parsing transformer sampling configuration Args: - transformer_sampling, accepted input: * None, indicating no sampling * an Iterable with int (>0) as element - num_layers, expected number of transformer layers, must match with the length of transformer_sampling if it is not None Returns: - A tuple with length num_layers """ if transformer_sampling is None: return (1,) * num_layers if not isinstance(transformer_sampling, Iterable): raise ValueError( "transformer_sampling must be an iterable if it is not None" ) if len(transformer_sampling) != num_layers: raise ValueError( "transformer_sampling {} does not match with the number " "of layers {}".format(transformer_sampling, num_layers) ) for layer, value in enumerate(transformer_sampling): if not isinstance(value, int): raise ValueError("Invalid value in transformer_sampling: ") if value < 1: raise ValueError( "{} layer's subsampling is {}.".format(layer, value) + " This is not allowed! " ) return transformer_sampling def slice(self, embedding, padding_mask, attn_mask, sampling_factor): """ embedding is a (T, B, D) tensor padding_mask is a (B, T) tensor or None attn_mask is a (T, T) tensor or None """ embedding = embedding[::sampling_factor, :, :] if padding_mask is not None: padding_mask = padding_mask[:, ::sampling_factor] if attn_mask is not None: attn_mask = attn_mask[::sampling_factor, ::sampling_factor] return embedding, padding_mask, attn_mask def lengths_to_attn_mask(self, input_lengths, subsampling_factor=1): """ create attention mask according to sequence lengths and transformer context Args: - input_lengths: (B, )-shape Int/Long tensor; input_lengths[b] is the length of b-th sequence - subsampling_factor: int * Note that the left_context and right_context is specified in the input frame-level while input to transformer may already go through subsampling (e.g., the use of striding in vggblock) we use subsampling_factor to scale the left/right context Return: - a (T, T) binary tensor or None, where T is max(input_lengths) * if self.transformer_context is None, None * if left_context is None, * attn_mask[t, t + right_context + 1:] = 1 * others = 0 * if right_context is None, * attn_mask[t, 0:t - left_context] = 1 * others = 0 * elsif * attn_mask[t, t - left_context: t + right_context + 1] = 0 * others = 1 """ if self.transformer_context is None: return None maxT = torch.max(input_lengths).item() attn_mask = torch.zeros(maxT, maxT) left_context = self.transformer_context[0] right_context = self.transformer_context[1] if left_context is not None: left_context = math.ceil(self.transformer_context[0] / subsampling_factor) if right_context is not None: right_context = math.ceil(self.transformer_context[1] / subsampling_factor) for t in range(maxT): if left_context is not None: st = 0 en = max(st, t - left_context) attn_mask[t, st:en] = 1 if right_context is not None: st = t + right_context + 1 st = min(st, maxT - 1) attn_mask[t, st:] = 1 return attn_mask.to(input_lengths.device) def reorder_encoder_out(self, encoder_out, new_order): encoder_out["encoder_out"] = encoder_out["encoder_out"].index_select( 1, new_order ) if encoder_out["encoder_padding_mask"] is not None: encoder_out["encoder_padding_mask"] = encoder_out[ "encoder_padding_mask" ].index_select(1, new_order) return encoder_out class TransformerDecoder(FairseqIncrementalDecoder): """ Transformer decoder consisting of *args.decoder_layers* layers. Each layer is a :class:`TransformerDecoderLayer`. Args: args (argparse.Namespace): parsed command-line arguments dictionary (~fairseq.data.Dictionary): decoding dictionary embed_tokens (torch.nn.Embedding): output embedding no_encoder_attn (bool, optional): whether to attend to encoder outputs. Default: ``False`` left_pad (bool, optional): whether the input is left-padded. Default: ``False`` """ def __init__( self, dictionary, embed_dim=512, transformer_config=DEFAULT_ENC_TRANSFORMER_CONFIG, conv_config=DEFAULT_DEC_CONV_CONFIG, encoder_output_dim=512, ): super().__init__(dictionary) vocab_size = len(dictionary) self.padding_idx = dictionary.pad() self.embed_tokens = Embedding(vocab_size, embed_dim, self.padding_idx) self.conv_layers = nn.ModuleList() for i in range(len(conv_config)): out_channels, kernel_size, layer_norm = conv_config[i] if i == 0: conv_layer = LinearizedConv1d( embed_dim, out_channels, kernel_size, padding=kernel_size - 1 ) else: conv_layer = LinearizedConv1d( conv_config[i - 1][0], out_channels, kernel_size, padding=kernel_size - 1, ) self.conv_layers.append(conv_layer) if layer_norm: self.conv_layers.append(nn.LayerNorm(out_channels)) self.conv_layers.append(nn.ReLU()) self.layers = nn.ModuleList() if conv_config[-1][0] != transformer_config[0][0]: self.layers.append(Linear(conv_config[-1][0], transformer_config[0][0])) self.layers.append( TransformerDecoderLayer( prepare_transformer_decoder_params(*transformer_config[0]) ) ) for i in range(1, len(transformer_config)): if transformer_config[i - 1][0] != transformer_config[i][0]: self.layers.append( Linear(transformer_config[i - 1][0], transformer_config[i][0]) ) self.layers.append( TransformerDecoderLayer( prepare_transformer_decoder_params(*transformer_config[i]) ) ) self.fc_out = Linear(transformer_config[-1][0], vocab_size) def forward(self, prev_output_tokens, encoder_out=None, incremental_state=None): """ Args: prev_output_tokens (LongTensor): previous decoder outputs of shape `(batch, tgt_len)`, for input feeding/teacher forcing encoder_out (Tensor, optional): output from the encoder, used for encoder-side attention incremental_state (dict): dictionary used for storing state during :ref:`Incremental decoding` Returns: tuple: - the last decoder layer's output of shape `(batch, tgt_len, vocab)` - the last decoder layer's attention weights of shape `(batch, tgt_len, src_len)` """ target_padding_mask = ( (prev_output_tokens == self.padding_idx).to(prev_output_tokens.device) if incremental_state is None else None ) if incremental_state is not None: prev_output_tokens = prev_output_tokens[:, -1:] # embed tokens x = self.embed_tokens(prev_output_tokens) # B x T x C -> T x B x C x = self._transpose_if_training(x, incremental_state) for layer in self.conv_layers: if isinstance(layer, LinearizedConvolution): x = layer(x, incremental_state) else: x = layer(x) # B x T x C -> T x B x C x = self._transpose_if_inference(x, incremental_state) # decoder layers for layer in self.layers: if isinstance(layer, TransformerDecoderLayer): x, *_ = layer( x, (encoder_out["encoder_out"] if encoder_out is not None else None), ( encoder_out["encoder_padding_mask"].t() if encoder_out["encoder_padding_mask"] is not None else None ), incremental_state, self_attn_mask=( self.buffered_future_mask(x) if incremental_state is None else None ), self_attn_padding_mask=( target_padding_mask if incremental_state is None else None ), ) else: x = layer(x) # T x B x C -> B x T x C x = x.transpose(0, 1) x = self.fc_out(x) return x, None def buffered_future_mask(self, tensor): dim = tensor.size(0) if ( not hasattr(self, "_future_mask") or self._future_mask is None or self._future_mask.device != tensor.device ): self._future_mask = torch.triu( utils.fill_with_neg_inf(tensor.new(dim, dim)), 1 ) if self._future_mask.size(0) < dim: self._future_mask = torch.triu( utils.fill_with_neg_inf(self._future_mask.resize_(dim, dim)), 1 ) return self._future_mask[:dim, :dim] def _transpose_if_training(self, x, incremental_state): if incremental_state is None: x = x.transpose(0, 1) return x def _transpose_if_inference(self, x, incremental_state): if incremental_state: x = x.transpose(0, 1) return x @register_model("asr_vggtransformer_encoder") class VGGTransformerEncoderModel(FairseqEncoderModel): def __init__(self, encoder): super().__init__(encoder) @staticmethod def add_args(parser): """Add model-specific arguments to the parser.""" parser.add_argument( "--input-feat-per-channel", type=int, metavar="N", help="encoder input dimension per input channel", ) parser.add_argument( "--vggblock-enc-config", type=str, metavar="EXPR", help=""" an array of tuples each containing the configuration of one vggblock [(out_channels, conv_kernel_size, pooling_kernel_size,num_conv_layers), ...] """, ) parser.add_argument( "--transformer-enc-config", type=str, metavar="EXPR", help=""" a tuple containing the configuration of the Transformer layers configurations: [(input_dim, num_heads, ffn_dim, normalize_before, dropout, attention_dropout, relu_dropout), ]""", ) parser.add_argument( "--enc-output-dim", type=int, metavar="N", help="encoder output dimension, projecting the LSTM output", ) parser.add_argument( "--in-channels", type=int, metavar="N", help="number of encoder input channels", ) parser.add_argument( "--transformer-context", type=str, metavar="EXPR", help=""" either None or a tuple of two ints, indicating left/right context a transformer can have access to""", ) parser.add_argument( "--transformer-sampling", type=str, metavar="EXPR", help=""" either None or a tuple of ints, indicating sampling factor in each layer""", ) @classmethod def build_model(cls, args, task): """Build a new model instance.""" base_architecture_enconly(args) encoder = VGGTransformerEncoderOnly( vocab_size=len(task.target_dictionary), input_feat_per_channel=args.input_feat_per_channel, vggblock_config=eval(args.vggblock_enc_config), transformer_config=eval(args.transformer_enc_config), encoder_output_dim=args.enc_output_dim, in_channels=args.in_channels, transformer_context=eval(args.transformer_context), transformer_sampling=eval(args.transformer_sampling), ) return cls(encoder) def get_normalized_probs(self, net_output, log_probs, sample=None): # net_output['encoder_out'] is a (T, B, D) tensor lprobs = super().get_normalized_probs(net_output, log_probs, sample) # lprobs is a (T, B, D) tensor # we need to transoose to get (B, T, D) tensor lprobs = lprobs.transpose(0, 1).contiguous() lprobs.batch_first = True return lprobs class VGGTransformerEncoderOnly(VGGTransformerEncoder): def __init__( self, vocab_size, input_feat_per_channel, vggblock_config=DEFAULT_ENC_VGGBLOCK_CONFIG, transformer_config=DEFAULT_ENC_TRANSFORMER_CONFIG, encoder_output_dim=512, in_channels=1, transformer_context=None, transformer_sampling=None, ): super().__init__( input_feat_per_channel=input_feat_per_channel, vggblock_config=vggblock_config, transformer_config=transformer_config, encoder_output_dim=encoder_output_dim, in_channels=in_channels, transformer_context=transformer_context, transformer_sampling=transformer_sampling, ) self.fc_out = Linear(self.encoder_output_dim, vocab_size) def forward(self, src_tokens, src_lengths, **kwargs): """ src_tokens: padded tensor (B, T, C * feat) src_lengths: tensor of original lengths of input utterances (B,) """ enc_out = super().forward(src_tokens, src_lengths) x = self.fc_out(enc_out["encoder_out"]) # x = F.log_softmax(x, dim=-1) # Note: no need this line, because model.get_normalized_prob will call # log_softmax return { "encoder_out": x, # (T, B, C) "encoder_padding_mask": enc_out["encoder_padding_mask"], # (T, B) } def max_positions(self): """Maximum input length supported by the encoder.""" return (1e6, 1e6) # an arbitrary large number def Embedding(num_embeddings, embedding_dim, padding_idx): m = nn.Embedding(num_embeddings, embedding_dim, padding_idx=padding_idx) # nn.init.uniform_(m.weight, -0.1, 0.1) # nn.init.constant_(m.weight[padding_idx], 0) return m def Linear(in_features, out_features, bias=True, dropout=0): """Linear layer (input: N x T x C)""" m = nn.Linear(in_features, out_features, bias=bias) # m.weight.data.uniform_(-0.1, 0.1) # if bias: # m.bias.data.uniform_(-0.1, 0.1) return m def LinearizedConv1d(in_channels, out_channels, kernel_size, dropout=0, **kwargs): """Weight-normalized Conv1d layer optimized for decoding""" m = LinearizedConvolution(in_channels, out_channels, kernel_size, **kwargs) std = math.sqrt((4 * (1.0 - dropout)) / (m.kernel_size[0] * in_channels)) nn.init.normal_(m.weight, mean=0, std=std) nn.init.constant_(m.bias, 0) return nn.utils.weight_norm(m, dim=2) def LayerNorm(embedding_dim): m = nn.LayerNorm(embedding_dim) return m # seq2seq models def base_architecture(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 40) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", DEFAULT_ENC_VGGBLOCK_CONFIG ) args.transformer_enc_config = getattr( args, "transformer_enc_config", DEFAULT_ENC_TRANSFORMER_CONFIG ) args.enc_output_dim = getattr(args, "enc_output_dim", 512) args.in_channels = getattr(args, "in_channels", 1) args.tgt_embed_dim = getattr(args, "tgt_embed_dim", 128) args.transformer_dec_config = getattr( args, "transformer_dec_config", DEFAULT_ENC_TRANSFORMER_CONFIG ) args.conv_dec_config = getattr(args, "conv_dec_config", DEFAULT_DEC_CONV_CONFIG) args.transformer_context = getattr(args, "transformer_context", "None") @register_model_architecture("asr_vggtransformer", "vggtransformer_1") def vggtransformer_1(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 80) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", "[(64, 3, 2, 2, True), (128, 3, 2, 2, True)]" ) args.transformer_enc_config = getattr( args, "transformer_enc_config", "((1024, 16, 4096, True, 0.15, 0.15, 0.15),) * 14", ) args.enc_output_dim = getattr(args, "enc_output_dim", 1024) args.tgt_embed_dim = getattr(args, "tgt_embed_dim", 128) args.conv_dec_config = getattr(args, "conv_dec_config", "((256, 3, True),) * 4") args.transformer_dec_config = getattr( args, "transformer_dec_config", "((1024, 16, 4096, True, 0.15, 0.15, 0.15),) * 4", ) @register_model_architecture("asr_vggtransformer", "vggtransformer_2") def vggtransformer_2(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 80) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", "[(64, 3, 2, 2, True), (128, 3, 2, 2, True)]" ) args.transformer_enc_config = getattr( args, "transformer_enc_config", "((1024, 16, 4096, True, 0.15, 0.15, 0.15),) * 16", ) args.enc_output_dim = getattr(args, "enc_output_dim", 1024) args.tgt_embed_dim = getattr(args, "tgt_embed_dim", 512) args.conv_dec_config = getattr(args, "conv_dec_config", "((256, 3, True),) * 4") args.transformer_dec_config = getattr( args, "transformer_dec_config", "((1024, 16, 4096, True, 0.15, 0.15, 0.15),) * 6", ) @register_model_architecture("asr_vggtransformer", "vggtransformer_base") def vggtransformer_base(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 80) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", "[(64, 3, 2, 2, True), (128, 3, 2, 2, True)]" ) args.transformer_enc_config = getattr( args, "transformer_enc_config", "((512, 8, 2048, True, 0.15, 0.15, 0.15),) * 12" ) args.enc_output_dim = getattr(args, "enc_output_dim", 512) args.tgt_embed_dim = getattr(args, "tgt_embed_dim", 512) args.conv_dec_config = getattr(args, "conv_dec_config", "((256, 3, True),) * 4") args.transformer_dec_config = getattr( args, "transformer_dec_config", "((512, 8, 2048, True, 0.15, 0.15, 0.15),) * 6" ) # Size estimations: # Encoder: # - vggblock param: 64*1*3*3 + 64*64*3*3 + 128*64*3*3 + 128*128*3 = 258K # Transformer: # - input dimension adapter: 2560 x 512 -> 1.31M # - transformer_layers (x12) --> 37.74M # * MultiheadAttention: 512*512*3 (in_proj) + 512*512 (out_proj) = 1.048M # * FFN weight: 512*2048*2 = 2.097M # - output dimension adapter: 512 x 512 -> 0.26 M # Decoder: # - LinearizedConv1d: 512 * 256 * 3 + 256 * 256 * 3 * 3 # - transformer_layer: (x6) --> 25.16M # * MultiheadAttention (self-attention): 512*512*3 + 512*512 = 1.048M # * MultiheadAttention (encoder-attention): 512*512*3 + 512*512 = 1.048M # * FFN: 512*2048*2 = 2.097M # Final FC: # - FC: 512*5000 = 256K (assuming vocab size 5K) # In total: # ~65 M # CTC models def base_architecture_enconly(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 40) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", "[(32, 3, 2, 2, True)] * 2" ) args.transformer_enc_config = getattr( args, "transformer_enc_config", "((256, 4, 1024, True, 0.2, 0.2, 0.2),) * 2" ) args.enc_output_dim = getattr(args, "enc_output_dim", 512) args.in_channels = getattr(args, "in_channels", 1) args.transformer_context = getattr(args, "transformer_context", "None") args.transformer_sampling = getattr(args, "transformer_sampling", "None") @register_model_architecture("asr_vggtransformer_encoder", "vggtransformer_enc_1") def vggtransformer_enc_1(args): # vggtransformer_1 is the same as vggtransformer_enc_big, except the number # of layers is increased to 16 # keep it here for backward compatiablity purpose args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 80) args.vggblock_enc_config = getattr( args, "vggblock_enc_config", "[(64, 3, 2, 2, True), (128, 3, 2, 2, True)]" ) args.transformer_enc_config = getattr( args, "transformer_enc_config", "((1024, 16, 4096, True, 0.15, 0.15, 0.15),) * 16", ) args.enc_output_dim = getattr(args, "enc_output_dim", 1024)
37,260
35.494613
88
py
rej-summ
rej-summ-main/examples/speech_recognition/models/w2l_conv_glu_enc.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import math import torch import torch.nn as nn import torch.nn.functional as F from fairseq.models import ( FairseqEncoder, FairseqEncoderModel, register_model, register_model_architecture, ) from fairseq.modules.fairseq_dropout import FairseqDropout default_conv_enc_config = """[ (400, 13, 170, 0.2), (440, 14, 0, 0.214), (484, 15, 0, 0.22898), (532, 16, 0, 0.2450086), (584, 17, 0, 0.262159202), (642, 18, 0, 0.28051034614), (706, 19, 0, 0.30014607037), (776, 20, 0, 0.321156295296), (852, 21, 0, 0.343637235966), (936, 22, 0, 0.367691842484), (1028, 23, 0, 0.393430271458), (1130, 24, 0, 0.42097039046), (1242, 25, 0, 0.450438317792), (1366, 26, 0, 0.481969000038), (1502, 27, 0, 0.51570683004), (1652, 28, 0, 0.551806308143), (1816, 29, 0, 0.590432749713), ]""" @register_model("asr_w2l_conv_glu_encoder") class W2lConvGluEncoderModel(FairseqEncoderModel): def __init__(self, encoder): super().__init__(encoder) @staticmethod def add_args(parser): """Add model-specific arguments to the parser.""" parser.add_argument( "--input-feat-per-channel", type=int, metavar="N", help="encoder input dimension per input channel", ) parser.add_argument( "--in-channels", type=int, metavar="N", help="number of encoder input channels", ) parser.add_argument( "--conv-enc-config", type=str, metavar="EXPR", help=""" an array of tuples each containing the configuration of one conv layer [(out_channels, kernel_size, padding, dropout), ...] """, ) @classmethod def build_model(cls, args, task): """Build a new model instance.""" conv_enc_config = getattr(args, "conv_enc_config", default_conv_enc_config) encoder = W2lConvGluEncoder( vocab_size=len(task.target_dictionary), input_feat_per_channel=args.input_feat_per_channel, in_channels=args.in_channels, conv_enc_config=eval(conv_enc_config), ) return cls(encoder) def get_normalized_probs(self, net_output, log_probs, sample=None): lprobs = super().get_normalized_probs(net_output, log_probs, sample) lprobs.batch_first = False return lprobs class W2lConvGluEncoder(FairseqEncoder): def __init__( self, vocab_size, input_feat_per_channel, in_channels, conv_enc_config ): super().__init__(None) self.input_dim = input_feat_per_channel if in_channels != 1: raise ValueError("only 1 input channel is currently supported") self.conv_layers = nn.ModuleList() self.linear_layers = nn.ModuleList() self.dropouts = [] cur_channels = input_feat_per_channel for out_channels, kernel_size, padding, dropout in conv_enc_config: layer = nn.Conv1d(cur_channels, out_channels, kernel_size, padding=padding) layer.weight.data.mul_(math.sqrt(3)) # match wav2letter init self.conv_layers.append(nn.utils.weight_norm(layer)) self.dropouts.append( FairseqDropout(dropout, module_name=self.__class__.__name__) ) if out_channels % 2 != 0: raise ValueError("odd # of out_channels is incompatible with GLU") cur_channels = out_channels // 2 # halved by GLU for out_channels in [2 * cur_channels, vocab_size]: layer = nn.Linear(cur_channels, out_channels) layer.weight.data.mul_(math.sqrt(3)) self.linear_layers.append(nn.utils.weight_norm(layer)) cur_channels = out_channels // 2 def forward(self, src_tokens, src_lengths, **kwargs): """ src_tokens: padded tensor (B, T, C * feat) src_lengths: tensor of original lengths of input utterances (B,) """ B, T, _ = src_tokens.size() x = src_tokens.transpose(1, 2).contiguous() # (B, feat, T) assuming C == 1 for layer_idx in range(len(self.conv_layers)): x = self.conv_layers[layer_idx](x) x = F.glu(x, dim=1) x = self.dropouts[layer_idx](x) x = x.transpose(1, 2).contiguous() # (B, T, 908) x = self.linear_layers[0](x) x = F.glu(x, dim=2) x = self.dropouts[-1](x) x = self.linear_layers[1](x) assert x.size(0) == B assert x.size(1) == T encoder_out = x.transpose(0, 1) # (T, B, vocab_size) # need to debug this -- find a simpler/elegant way in pytorch APIs encoder_padding_mask = ( torch.arange(T).view(1, T).expand(B, -1).to(x.device) >= src_lengths.view(B, 1).expand(-1, T) ).t() # (B x T) -> (T x B) return { "encoder_out": encoder_out, # (T, B, vocab_size) "encoder_padding_mask": encoder_padding_mask, # (T, B) } def reorder_encoder_out(self, encoder_out, new_order): encoder_out["encoder_out"] = encoder_out["encoder_out"].index_select( 1, new_order ) encoder_out["encoder_padding_mask"] = encoder_out[ "encoder_padding_mask" ].index_select(1, new_order) return encoder_out def max_positions(self): """Maximum input length supported by the encoder.""" return (1e6, 1e6) # an arbitrary large number @register_model_architecture("asr_w2l_conv_glu_encoder", "w2l_conv_glu_enc") def w2l_conv_glu_enc(args): args.input_feat_per_channel = getattr(args, "input_feat_per_channel", 80) args.in_channels = getattr(args, "in_channels", 1) args.conv_enc_config = getattr(args, "conv_enc_config", default_conv_enc_config)
6,078
33.151685
87
py
rej-summ
rej-summ-main/examples/speech_recognition/datasets/asr_prep_json.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from __future__ import absolute_import, division, print_function, unicode_literals import argparse import concurrent.futures import json import multiprocessing import os from collections import namedtuple from itertools import chain import sentencepiece as spm from fairseq.data import Dictionary MILLISECONDS_TO_SECONDS = 0.001 def process_sample(aud_path, lable, utt_id, sp, tgt_dict): import torchaudio input = {} output = {} si, ei = torchaudio.info(aud_path) input["length_ms"] = int( si.length / si.channels / si.rate / MILLISECONDS_TO_SECONDS ) input["path"] = aud_path token = " ".join(sp.EncodeAsPieces(lable)) ids = tgt_dict.encode_line(token, append_eos=False) output["text"] = lable output["token"] = token output["tokenid"] = ", ".join(map(str, [t.tolist() for t in ids])) return {utt_id: {"input": input, "output": output}} def main(): parser = argparse.ArgumentParser() parser.add_argument( "--audio-dirs", nargs="+", default=["-"], required=True, help="input directories with audio files", ) parser.add_argument( "--labels", required=True, help="aggregated input labels with format <ID LABEL> per line", type=argparse.FileType("r", encoding="UTF-8"), ) parser.add_argument( "--spm-model", required=True, help="sentencepiece model to use for encoding", type=argparse.FileType("r", encoding="UTF-8"), ) parser.add_argument( "--dictionary", required=True, help="file to load fairseq dictionary from", type=argparse.FileType("r", encoding="UTF-8"), ) parser.add_argument("--audio-format", choices=["flac", "wav"], default="wav") parser.add_argument( "--output", required=True, type=argparse.FileType("w"), help="path to save json output", ) args = parser.parse_args() sp = spm.SentencePieceProcessor() sp.Load(args.spm_model.name) tgt_dict = Dictionary.load(args.dictionary) labels = {} for line in args.labels: (utt_id, label) = line.split(" ", 1) labels[utt_id] = label if len(labels) == 0: raise Exception("No labels found in ", args.labels_path) Sample = namedtuple("Sample", "aud_path utt_id") samples = [] for path, _, files in chain.from_iterable( os.walk(path) for path in args.audio_dirs ): for f in files: if f.endswith(args.audio_format): if len(os.path.splitext(f)) != 2: raise Exception("Expect <utt_id.extension> file name. Got: ", f) utt_id = os.path.splitext(f)[0] if utt_id not in labels: continue samples.append(Sample(os.path.join(path, f), utt_id)) utts = {} num_cpu = multiprocessing.cpu_count() with concurrent.futures.ThreadPoolExecutor(max_workers=num_cpu) as executor: future_to_sample = { executor.submit( process_sample, s.aud_path, labels[s.utt_id], s.utt_id, sp, tgt_dict ): s for s in samples } for future in concurrent.futures.as_completed(future_to_sample): try: data = future.result() except Exception as exc: print("generated an exception: ", exc) else: utts.update(data) json.dump({"utts": utts}, args.output, indent=4) if __name__ == "__main__": main()
3,775
28.968254
84
py
rej-summ
rej-summ-main/examples/speech_recognition/new/infer.py
#!/usr/bin/env python -u # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import ast import hashlib import logging import os import shutil import sys from dataclasses import dataclass, field, is_dataclass from pathlib import Path from typing import Any, Dict, List, Optional, Tuple, Union import editdistance import torch import torch.distributed as dist from examples.speech_recognition.new.decoders.decoder_config import ( DecoderConfig, FlashlightDecoderConfig, ) from examples.speech_recognition.new.decoders.decoder import Decoder from fairseq import checkpoint_utils, distributed_utils, progress_bar, tasks, utils from fairseq.data.data_utils import post_process from fairseq.dataclass.configs import ( CheckpointConfig, CommonConfig, CommonEvalConfig, DatasetConfig, DistributedTrainingConfig, FairseqDataclass, ) from fairseq.logging.meters import StopwatchMeter, TimeMeter from fairseq.logging.progress_bar import BaseProgressBar from fairseq.models.fairseq_model import FairseqModel from omegaconf import OmegaConf import hydra from hydra.core.config_store import ConfigStore logging.root.setLevel(logging.INFO) logging.basicConfig(level=logging.INFO) logger = logging.getLogger(__name__) config_path = Path(__file__).resolve().parent / "conf" @dataclass class DecodingConfig(DecoderConfig, FlashlightDecoderConfig): unique_wer_file: bool = field( default=False, metadata={"help": "If set, use a unique file for storing WER"}, ) results_path: Optional[str] = field( default=None, metadata={ "help": "If set, write hypothesis and reference sentences into this directory" }, ) @dataclass class InferConfig(FairseqDataclass): task: Any = None decoding: DecodingConfig = DecodingConfig() common: CommonConfig = CommonConfig() common_eval: CommonEvalConfig = CommonEvalConfig() checkpoint: CheckpointConfig = CheckpointConfig() distributed_training: DistributedTrainingConfig = DistributedTrainingConfig() dataset: DatasetConfig = DatasetConfig() is_ax: bool = field( default=False, metadata={ "help": "if true, assumes we are using ax for tuning and returns a tuple for ax to consume" }, ) def reset_logging(): root = logging.getLogger() for handler in root.handlers: root.removeHandler(handler) root.setLevel(os.environ.get("LOGLEVEL", "INFO").upper()) handler = logging.StreamHandler(sys.stdout) handler.setFormatter( logging.Formatter( fmt="%(asctime)s | %(levelname)s | %(name)s | %(message)s", datefmt="%Y-%m-%d %H:%M:%S", ) ) root.addHandler(handler) class InferenceProcessor: cfg: InferConfig def __init__(self, cfg: InferConfig) -> None: self.cfg = cfg self.task = tasks.setup_task(cfg.task) models, saved_cfg = self.load_model_ensemble() self.models = models self.saved_cfg = saved_cfg self.tgt_dict = self.task.target_dictionary self.task.load_dataset( self.cfg.dataset.gen_subset, task_cfg=saved_cfg.task, ) self.generator = Decoder(cfg.decoding, self.tgt_dict) self.gen_timer = StopwatchMeter() self.wps_meter = TimeMeter() self.num_sentences = 0 self.total_errors = 0 self.total_length = 0 self.hypo_words_file = None self.hypo_units_file = None self.ref_words_file = None self.ref_units_file = None self.progress_bar = self.build_progress_bar() def __enter__(self) -> "InferenceProcessor": if self.cfg.decoding.results_path is not None: self.hypo_words_file = self.get_res_file("hypo.word") self.hypo_units_file = self.get_res_file("hypo.units") self.ref_words_file = self.get_res_file("ref.word") self.ref_units_file = self.get_res_file("ref.units") return self def __exit__(self, *exc) -> bool: if self.cfg.decoding.results_path is not None: self.hypo_words_file.close() self.hypo_units_file.close() self.ref_words_file.close() self.ref_units_file.close() return False def __iter__(self) -> Any: for sample in self.progress_bar: if not self.cfg.common.cpu: sample = utils.move_to_cuda(sample) # Happens on the last batch. if "net_input" not in sample: continue yield sample def log(self, *args, **kwargs): self.progress_bar.log(*args, **kwargs) def print(self, *args, **kwargs): self.progress_bar.print(*args, **kwargs) def get_res_file(self, fname: str) -> None: fname = os.path.join(self.cfg.decoding.results_path, fname) if self.data_parallel_world_size > 1: fname = f"{fname}.{self.data_parallel_rank}" return open(fname, "w", buffering=1) def merge_shards(self) -> None: """Merges all shard files into shard 0, then removes shard suffix.""" shard_id = self.data_parallel_rank num_shards = self.data_parallel_world_size if self.data_parallel_world_size > 1: def merge_shards_with_root(fname: str) -> None: fname = os.path.join(self.cfg.decoding.results_path, fname) logger.info("Merging %s on shard %d", fname, shard_id) base_fpath = Path(f"{fname}.0") with open(base_fpath, "a") as out_file: for s in range(1, num_shards): shard_fpath = Path(f"{fname}.{s}") with open(shard_fpath, "r") as in_file: for line in in_file: out_file.write(line) shard_fpath.unlink() shutil.move(f"{fname}.0", fname) dist.barrier() # ensure all shards finished writing if shard_id == (0 % num_shards): merge_shards_with_root("hypo.word") if shard_id == (1 % num_shards): merge_shards_with_root("hypo.units") if shard_id == (2 % num_shards): merge_shards_with_root("ref.word") if shard_id == (3 % num_shards): merge_shards_with_root("ref.units") dist.barrier() def optimize_model(self, model: FairseqModel) -> None: model.make_generation_fast_() if self.cfg.common.fp16: model.half() if not self.cfg.common.cpu: model.cuda() def load_model_ensemble(self) -> Tuple[List[FairseqModel], FairseqDataclass]: arg_overrides = ast.literal_eval(self.cfg.common_eval.model_overrides) models, saved_cfg = checkpoint_utils.load_model_ensemble( utils.split_paths(self.cfg.common_eval.path, separator="\\"), arg_overrides=arg_overrides, task=self.task, suffix=self.cfg.checkpoint.checkpoint_suffix, strict=(self.cfg.checkpoint.checkpoint_shard_count == 1), num_shards=self.cfg.checkpoint.checkpoint_shard_count, ) for model in models: self.optimize_model(model) return models, saved_cfg def get_dataset_itr(self, disable_iterator_cache: bool = False) -> None: return self.task.get_batch_iterator( dataset=self.task.dataset(self.cfg.dataset.gen_subset), max_tokens=self.cfg.dataset.max_tokens, max_sentences=self.cfg.dataset.batch_size, max_positions=(sys.maxsize, sys.maxsize), ignore_invalid_inputs=self.cfg.dataset.skip_invalid_size_inputs_valid_test, required_batch_size_multiple=self.cfg.dataset.required_batch_size_multiple, seed=self.cfg.common.seed, num_shards=self.data_parallel_world_size, shard_id=self.data_parallel_rank, num_workers=self.cfg.dataset.num_workers, data_buffer_size=self.cfg.dataset.data_buffer_size, disable_iterator_cache=disable_iterator_cache, ).next_epoch_itr(shuffle=False) def build_progress_bar( self, epoch: Optional[int] = None, prefix: Optional[str] = None, default_log_format: str = "tqdm", ) -> BaseProgressBar: return progress_bar.progress_bar( iterator=self.get_dataset_itr(), log_format=self.cfg.common.log_format, log_interval=self.cfg.common.log_interval, epoch=epoch, prefix=prefix, tensorboard_logdir=self.cfg.common.tensorboard_logdir, default_log_format=default_log_format, ) @property def data_parallel_world_size(self): if self.cfg.distributed_training.distributed_world_size == 1: return 1 return distributed_utils.get_data_parallel_world_size() @property def data_parallel_rank(self): if self.cfg.distributed_training.distributed_world_size == 1: return 0 return distributed_utils.get_data_parallel_rank() def process_sentence( self, sample: Dict[str, Any], hypo: Dict[str, Any], sid: int, batch_id: int, ) -> Tuple[int, int]: speaker = None # Speaker can't be parsed from dataset. if "target_label" in sample: toks = sample["target_label"] else: toks = sample["target"] toks = toks[batch_id, :] # Processes hypothesis. hyp_pieces = self.tgt_dict.string(hypo["tokens"].int().cpu()) if "words" in hypo: hyp_words = " ".join(hypo["words"]) else: hyp_words = post_process(hyp_pieces, self.cfg.common_eval.post_process) # Processes target. target_tokens = utils.strip_pad(toks, self.tgt_dict.pad()) tgt_pieces = self.tgt_dict.string(target_tokens.int().cpu()) tgt_words = post_process(tgt_pieces, self.cfg.common_eval.post_process) if self.cfg.decoding.results_path is not None: print(f"{hyp_pieces} ({speaker}-{sid})", file=self.hypo_units_file) print(f"{hyp_words} ({speaker}-{sid})", file=self.hypo_words_file) print(f"{tgt_pieces} ({speaker}-{sid})", file=self.ref_units_file) print(f"{tgt_words} ({speaker}-{sid})", file=self.ref_words_file) if not self.cfg.common_eval.quiet: logger.info(f"HYPO: {hyp_words}") logger.info(f"REF: {tgt_words}") logger.info("---------------------") hyp_words, tgt_words = hyp_words.split(), tgt_words.split() return editdistance.eval(hyp_words, tgt_words), len(tgt_words) def process_sample(self, sample: Dict[str, Any]) -> None: self.gen_timer.start() hypos = self.task.inference_step( generator=self.generator, models=self.models, sample=sample, ) num_generated_tokens = sum(len(h[0]["tokens"]) for h in hypos) self.gen_timer.stop(num_generated_tokens) self.wps_meter.update(num_generated_tokens) for batch_id, sample_id in enumerate(sample["id"].tolist()): errs, length = self.process_sentence( sample=sample, sid=sample_id, batch_id=batch_id, hypo=hypos[batch_id][0], ) self.total_errors += errs self.total_length += length self.log({"wps": round(self.wps_meter.avg)}) if "nsentences" in sample: self.num_sentences += sample["nsentences"] else: self.num_sentences += sample["id"].numel() def log_generation_time(self) -> None: logger.info( "Processed %d sentences (%d tokens) in %.1fs %.2f " "sentences per second, %.2f tokens per second)", self.num_sentences, self.gen_timer.n, self.gen_timer.sum, self.num_sentences / (self.gen_timer.sum + 1e-6), 1.0 / (self.gen_timer.avg + 1e-6), ) def parse_wer(wer_file: Path) -> float: with open(wer_file, "r") as f: return float(f.readline().strip().split(" ")[1]) def get_wer_file(cfg: InferConfig) -> Path: """Hashes the decoding parameters to a unique file ID.""" base_path = "wer" if cfg.decoding.results_path is not None: base_path = os.path.join(cfg.decoding.results_path, base_path) if cfg.decoding.unique_wer_file: yaml_str = OmegaConf.to_yaml(cfg.decoding) fid = int(hashlib.md5(yaml_str.encode("utf-8")).hexdigest(), 16) return Path(f"{base_path}.{fid % 1000000}") else: return Path(base_path) def main(cfg: InferConfig) -> float: """Entry point for main processing logic. Args: cfg: The inferance configuration to use. wer: Optional shared memory pointer for returning the WER. If not None, the final WER value will be written here instead of being returned. Returns: The final WER if `wer` is None, otherwise None. """ yaml_str, wer_file = OmegaConf.to_yaml(cfg.decoding), get_wer_file(cfg) # Validates the provided configuration. if cfg.dataset.max_tokens is None and cfg.dataset.batch_size is None: cfg.dataset.max_tokens = 4000000 if not cfg.common.cpu and not torch.cuda.is_available(): raise ValueError("CUDA not found; set `cpu=True` to run without CUDA") logger.info(cfg.common_eval.path) with InferenceProcessor(cfg) as processor: for sample in processor: processor.process_sample(sample) processor.log_generation_time() if cfg.decoding.results_path is not None: processor.merge_shards() errs_t, leng_t = processor.total_errors, processor.total_length if cfg.common.cpu: logger.warning("Merging WER requires CUDA.") elif processor.data_parallel_world_size > 1: stats = torch.LongTensor([errs_t, leng_t]).cuda() dist.all_reduce(stats, op=dist.ReduceOp.SUM) errs_t, leng_t = stats[0].item(), stats[1].item() wer = errs_t * 100.0 / leng_t if distributed_utils.is_master(cfg.distributed_training): with open(wer_file, "w") as f: f.write( ( f"WER: {wer}\n" f"err / num_ref_words = {errs_t} / {leng_t}\n\n" f"{yaml_str}" ) ) return wer @hydra.main(config_path=config_path, config_name="infer") def hydra_main(cfg: InferConfig) -> Union[float, Tuple[float, Optional[float]]]: container = OmegaConf.to_container(cfg, resolve=True, enum_to_str=True) cfg = OmegaConf.create(container) OmegaConf.set_struct(cfg, True) if cfg.common.reset_logging: reset_logging() utils.import_user_module(cfg.common) # logger.info("Config:\n%s", OmegaConf.to_yaml(cfg)) wer = float("inf") try: if cfg.common.profile: with torch.cuda.profiler.profile(): with torch.autograd.profiler.emit_nvtx(): distributed_utils.call_main(cfg, main) else: distributed_utils.call_main(cfg, main) wer = parse_wer(get_wer_file(cfg)) except BaseException as e: # pylint: disable=broad-except if not cfg.common.suppress_crashes: raise else: logger.error("Crashed! %s", str(e)) logger.info("Word error rate: %.4f", wer) if cfg.is_ax: return wer, None return wer def cli_main() -> None: try: from hydra._internal.utils import ( get_args, ) # pylint: disable=import-outside-toplevel cfg_name = get_args().config_name or "infer" except ImportError: logger.warning("Failed to get config name from hydra args") cfg_name = "infer" cs = ConfigStore.instance() cs.store(name=cfg_name, node=InferConfig) for k in InferConfig.__dataclass_fields__: if is_dataclass(InferConfig.__dataclass_fields__[k].type): v = InferConfig.__dataclass_fields__[k].default cs.store(name=k, node=v) hydra_main() # pylint: disable=no-value-for-parameter if __name__ == "__main__": cli_main()
16,597
33.869748
103
py
rej-summ
rej-summ-main/examples/speech_recognition/new/decoders/base_decoder.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import itertools as it from typing import Any, Dict, List import torch from fairseq.data.dictionary import Dictionary from fairseq.models.fairseq_model import FairseqModel class BaseDecoder: def __init__(self, tgt_dict: Dictionary) -> None: self.tgt_dict = tgt_dict self.vocab_size = len(tgt_dict) self.blank = ( tgt_dict.index("<ctc_blank>") if "<ctc_blank>" in tgt_dict.indices else tgt_dict.bos() ) if "<sep>" in tgt_dict.indices: self.silence = tgt_dict.index("<sep>") elif "|" in tgt_dict.indices: self.silence = tgt_dict.index("|") else: self.silence = tgt_dict.eos() def generate( self, models: List[FairseqModel], sample: Dict[str, Any], **unused ) -> List[List[Dict[str, torch.LongTensor]]]: encoder_input = { k: v for k, v in sample["net_input"].items() if k != "prev_output_tokens" } emissions = self.get_emissions(models, encoder_input) return self.decode(emissions) def get_emissions( self, models: List[FairseqModel], encoder_input: Dict[str, Any], ) -> torch.FloatTensor: model = models[0] encoder_out = model(**encoder_input) if hasattr(model, "get_logits"): emissions = model.get_logits(encoder_out) else: emissions = model.get_normalized_probs(encoder_out, log_probs=True) return emissions.transpose(0, 1).float().cpu().contiguous() def get_tokens(self, idxs: torch.IntTensor) -> torch.LongTensor: idxs = (g[0] for g in it.groupby(idxs)) idxs = filter(lambda x: x != self.blank, idxs) return torch.LongTensor(list(idxs)) def decode( self, emissions: torch.FloatTensor, ) -> List[List[Dict[str, torch.LongTensor]]]: raise NotImplementedError
2,093
32.238095
85
py
rej-summ
rej-summ-main/examples/speech_recognition/new/decoders/viterbi_decoder.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from typing import List, Dict from .base_decoder import BaseDecoder class ViterbiDecoder(BaseDecoder): def decode( self, emissions: torch.FloatTensor, ) -> List[List[Dict[str, torch.LongTensor]]]: def get_pred(e): toks = e.argmax(dim=-1).unique_consecutive() return toks[toks != self.blank] return [[{"tokens": get_pred(x), "score": 0}] for x in emissions]
641
24.68
73
py
rej-summ
rej-summ-main/examples/speech_recognition/new/decoders/flashlight_decoder.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import gc import os.path as osp import warnings from collections import deque, namedtuple from typing import Any, Dict, Tuple import numpy as np import torch from fairseq import tasks from fairseq.data.dictionary import Dictionary from fairseq.dataclass.utils import convert_namespace_to_omegaconf from fairseq.models.fairseq_model import FairseqModel from fairseq.utils import apply_to_sample from omegaconf import open_dict, OmegaConf from typing import List from .decoder_config import FlashlightDecoderConfig from .base_decoder import BaseDecoder try: from flashlight.lib.text.decoder import ( LM, CriterionType, DecodeResult, KenLM, LexiconDecoder, LexiconDecoderOptions, LexiconFreeDecoder, LexiconFreeDecoderOptions, LMState, SmearingMode, Trie, ) from flashlight.lib.text.dictionary import create_word_dict, load_words except ImportError: warnings.warn( "flashlight python bindings are required to use this functionality. " "Please install from " "https://github.com/facebookresearch/flashlight/tree/master/bindings/python" ) LM = object LMState = object class KenLMDecoder(BaseDecoder): def __init__(self, cfg: FlashlightDecoderConfig, tgt_dict: Dictionary) -> None: super().__init__(tgt_dict) self.nbest = cfg.nbest self.unitlm = cfg.unitlm if cfg.lexicon: self.lexicon = load_words(cfg.lexicon) self.word_dict = create_word_dict(self.lexicon) self.unk_word = self.word_dict.get_index("<unk>") self.lm = KenLM(cfg.lmpath, self.word_dict) self.trie = Trie(self.vocab_size, self.silence) start_state = self.lm.start(False) for word, spellings in self.lexicon.items(): word_idx = self.word_dict.get_index(word) _, score = self.lm.score(start_state, word_idx) for spelling in spellings: spelling_idxs = [tgt_dict.index(token) for token in spelling] assert ( tgt_dict.unk() not in spelling_idxs ), f"{word} {spelling} {spelling_idxs}" self.trie.insert(spelling_idxs, word_idx, score) self.trie.smear(SmearingMode.MAX) self.decoder_opts = LexiconDecoderOptions( beam_size=cfg.beam, beam_size_token=cfg.beamsizetoken or len(tgt_dict), beam_threshold=cfg.beamthreshold, lm_weight=cfg.lmweight, word_score=cfg.wordscore, unk_score=cfg.unkweight, sil_score=cfg.silweight, log_add=False, criterion_type=CriterionType.CTC, ) self.decoder = LexiconDecoder( self.decoder_opts, self.trie, self.lm, self.silence, self.blank, self.unk_word, [], self.unitlm, ) else: assert self.unitlm, "Lexicon-free decoding requires unit LM" d = {w: [[w]] for w in tgt_dict.symbols} self.word_dict = create_word_dict(d) self.lm = KenLM(cfg.lmpath, self.word_dict) self.decoder_opts = LexiconFreeDecoderOptions( beam_size=cfg.beam, beam_size_token=cfg.beamsizetoken or len(tgt_dict), beam_threshold=cfg.beamthreshold, lm_weight=cfg.lmweight, sil_score=cfg.silweight, log_add=False, criterion_type=CriterionType.CTC, ) self.decoder = LexiconFreeDecoder( self.decoder_opts, self.lm, self.silence, self.blank, [] ) def get_timesteps(self, token_idxs: List[int]) -> List[int]: """Returns frame numbers corresponding to every non-blank token. Parameters ---------- token_idxs : List[int] IDs of decoded tokens. Returns ------- List[int] Frame numbers corresponding to every non-blank token. """ timesteps = [] for i, token_idx in enumerate(token_idxs): if token_idx == self.blank: continue if i == 0 or token_idx != token_idxs[i-1]: timesteps.append(i) return timesteps def decode( self, emissions: torch.FloatTensor, ) -> List[List[Dict[str, torch.LongTensor]]]: B, T, N = emissions.size() hypos = [] for b in range(B): emissions_ptr = emissions.data_ptr() + 4 * b * emissions.stride(0) results = self.decoder.decode(emissions_ptr, T, N) nbest_results = results[: self.nbest] hypos.append( [ { "tokens": self.get_tokens(result.tokens), "score": result.score, "timesteps": self.get_timesteps(result.tokens), "words": [ self.word_dict.get_entry(x) for x in result.words if x >= 0 ], } for result in nbest_results ] ) return hypos FairseqLMState = namedtuple( "FairseqLMState", [ "prefix", "incremental_state", "probs", ], ) class FairseqLM(LM): def __init__(self, dictionary: Dictionary, model: FairseqModel) -> None: super().__init__() self.dictionary = dictionary self.model = model self.unk = self.dictionary.unk() self.save_incremental = False # this currently does not work properly self.max_cache = 20_000 if torch.cuda.is_available(): model.cuda() model.eval() model.make_generation_fast_() self.states = {} self.stateq = deque() def start(self, start_with_nothing: bool) -> LMState: state = LMState() prefix = torch.LongTensor([[self.dictionary.eos()]]) incremental_state = {} if self.save_incremental else None with torch.no_grad(): res = self.model(prefix.cuda(), incremental_state=incremental_state) probs = self.model.get_normalized_probs(res, log_probs=True, sample=None) if incremental_state is not None: incremental_state = apply_to_sample(lambda x: x.cpu(), incremental_state) self.states[state] = FairseqLMState( prefix.numpy(), incremental_state, probs[0, -1].cpu().numpy() ) self.stateq.append(state) return state def score( self, state: LMState, token_index: int, no_cache: bool = False, ) -> Tuple[LMState, int]: """ Evaluate language model based on the current lm state and new word Parameters: ----------- state: current lm state token_index: index of the word (can be lexicon index then you should store inside LM the mapping between indices of lexicon and lm, or lm index of a word) Returns: -------- (LMState, float): pair of (new state, score for the current word) """ curr_state = self.states[state] def trim_cache(targ_size: int) -> None: while len(self.stateq) > targ_size: rem_k = self.stateq.popleft() rem_st = self.states[rem_k] rem_st = FairseqLMState(rem_st.prefix, None, None) self.states[rem_k] = rem_st if curr_state.probs is None: new_incremental_state = ( curr_state.incremental_state.copy() if curr_state.incremental_state is not None else None ) with torch.no_grad(): if new_incremental_state is not None: new_incremental_state = apply_to_sample( lambda x: x.cuda(), new_incremental_state ) elif self.save_incremental: new_incremental_state = {} res = self.model( torch.from_numpy(curr_state.prefix).cuda(), incremental_state=new_incremental_state, ) probs = self.model.get_normalized_probs( res, log_probs=True, sample=None ) if new_incremental_state is not None: new_incremental_state = apply_to_sample( lambda x: x.cpu(), new_incremental_state ) curr_state = FairseqLMState( curr_state.prefix, new_incremental_state, probs[0, -1].cpu().numpy() ) if not no_cache: self.states[state] = curr_state self.stateq.append(state) score = curr_state.probs[token_index].item() trim_cache(self.max_cache) outstate = state.child(token_index) if outstate not in self.states and not no_cache: prefix = np.concatenate( [curr_state.prefix, torch.LongTensor([[token_index]])], -1 ) incr_state = curr_state.incremental_state self.states[outstate] = FairseqLMState(prefix, incr_state, None) if token_index == self.unk: score = float("-inf") return outstate, score def finish(self, state: LMState) -> Tuple[LMState, int]: """ Evaluate eos for language model based on the current lm state Returns: -------- (LMState, float): pair of (new state, score for the current word) """ return self.score(state, self.dictionary.eos()) def empty_cache(self) -> None: self.states = {} self.stateq = deque() gc.collect() class FairseqLMDecoder(BaseDecoder): def __init__(self, cfg: FlashlightDecoderConfig, tgt_dict: Dictionary) -> None: super().__init__(tgt_dict) self.nbest = cfg.nbest self.unitlm = cfg.unitlm self.lexicon = load_words(cfg.lexicon) if cfg.lexicon else None self.idx_to_wrd = {} checkpoint = torch.load(cfg.lmpath, map_location="cpu") if "cfg" in checkpoint and checkpoint["cfg"] is not None: lm_args = checkpoint["cfg"] else: lm_args = convert_namespace_to_omegaconf(checkpoint["args"]) if not OmegaConf.is_dict(lm_args): lm_args = OmegaConf.create(lm_args) with open_dict(lm_args.task): lm_args.task.data = osp.dirname(cfg.lmpath) task = tasks.setup_task(lm_args.task) model = task.build_model(lm_args.model) model.load_state_dict(checkpoint["model"], strict=False) self.trie = Trie(self.vocab_size, self.silence) self.word_dict = task.dictionary self.unk_word = self.word_dict.unk() self.lm = FairseqLM(self.word_dict, model) if self.lexicon: start_state = self.lm.start(False) for i, (word, spellings) in enumerate(self.lexicon.items()): if self.unitlm: word_idx = i self.idx_to_wrd[i] = word score = 0 else: word_idx = self.word_dict.index(word) _, score = self.lm.score(start_state, word_idx, no_cache=True) for spelling in spellings: spelling_idxs = [tgt_dict.index(token) for token in spelling] assert ( tgt_dict.unk() not in spelling_idxs ), f"{spelling} {spelling_idxs}" self.trie.insert(spelling_idxs, word_idx, score) self.trie.smear(SmearingMode.MAX) self.decoder_opts = LexiconDecoderOptions( beam_size=cfg.beam, beam_size_token=cfg.beamsizetoken or len(tgt_dict), beam_threshold=cfg.beamthreshold, lm_weight=cfg.lmweight, word_score=cfg.wordscore, unk_score=cfg.unkweight, sil_score=cfg.silweight, log_add=False, criterion_type=CriterionType.CTC, ) self.decoder = LexiconDecoder( self.decoder_opts, self.trie, self.lm, self.silence, self.blank, self.unk_word, [], self.unitlm, ) else: assert self.unitlm, "Lexicon-free decoding requires unit LM" d = {w: [[w]] for w in tgt_dict.symbols} self.word_dict = create_word_dict(d) self.lm = KenLM(cfg.lmpath, self.word_dict) self.decoder_opts = LexiconFreeDecoderOptions( beam_size=cfg.beam, beam_size_token=cfg.beamsizetoken or len(tgt_dict), beam_threshold=cfg.beamthreshold, lm_weight=cfg.lmweight, sil_score=cfg.silweight, log_add=False, criterion_type=CriterionType.CTC, ) self.decoder = LexiconFreeDecoder( self.decoder_opts, self.lm, self.silence, self.blank, [] ) def decode( self, emissions: torch.FloatTensor, ) -> List[List[Dict[str, torch.LongTensor]]]: B, T, N = emissions.size() hypos = [] def make_hypo(result: DecodeResult) -> Dict[str, Any]: hypo = { "tokens": self.get_tokens(result.tokens), "score": result.score, } if self.lexicon: hypo["words"] = [ self.idx_to_wrd[x] if self.unitlm else self.word_dict[x] for x in result.words if x >= 0 ] return hypo for b in range(B): emissions_ptr = emissions.data_ptr() + 4 * b * emissions.stride(0) results = self.decoder.decode(emissions_ptr, T, N) nbest_results = results[: self.nbest] hypos.append([make_hypo(result) for result in nbest_results]) self.lm.empty_cache() return hypos
14,746
33.136574
88
py
rej-summ
rej-summ-main/examples/speech_recognition/kaldi/kaldi_decoder.py
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from concurrent.futures import ThreadPoolExecutor import logging from omegaconf import MISSING import os import torch from typing import Optional import warnings from dataclasses import dataclass from fairseq.dataclass import FairseqDataclass from .kaldi_initializer import KaldiInitializerConfig, initalize_kaldi logger = logging.getLogger(__name__) @dataclass class KaldiDecoderConfig(FairseqDataclass): hlg_graph_path: Optional[str] = None output_dict: str = MISSING kaldi_initializer_config: Optional[KaldiInitializerConfig] = None acoustic_scale: float = 0.5 max_active: int = 10000 beam_delta: float = 0.5 hash_ratio: float = 2.0 is_lattice: bool = False lattice_beam: float = 10.0 prune_interval: int = 25 determinize_lattice: bool = True prune_scale: float = 0.1 max_mem: int = 0 phone_determinize: bool = True word_determinize: bool = True minimize: bool = True num_threads: int = 1 class KaldiDecoder(object): def __init__( self, cfg: KaldiDecoderConfig, beam: int, nbest: int = 1, ): try: from kaldi.asr import FasterRecognizer, LatticeFasterRecognizer from kaldi.base import set_verbose_level from kaldi.decoder import ( FasterDecoder, FasterDecoderOptions, LatticeFasterDecoder, LatticeFasterDecoderOptions, ) from kaldi.lat.functions import DeterminizeLatticePhonePrunedOptions from kaldi.fstext import read_fst_kaldi, SymbolTable except: warnings.warn( "pykaldi is required for this functionality. Please install from https://github.com/pykaldi/pykaldi" ) # set_verbose_level(2) self.acoustic_scale = cfg.acoustic_scale self.nbest = nbest if cfg.hlg_graph_path is None: assert ( cfg.kaldi_initializer_config is not None ), "Must provide hlg graph path or kaldi initializer config" cfg.hlg_graph_path = initalize_kaldi(cfg.kaldi_initializer_config) assert os.path.exists(cfg.hlg_graph_path), cfg.hlg_graph_path if cfg.is_lattice: self.dec_cls = LatticeFasterDecoder opt_cls = LatticeFasterDecoderOptions self.rec_cls = LatticeFasterRecognizer else: assert self.nbest == 1, "nbest > 1 requires lattice decoder" self.dec_cls = FasterDecoder opt_cls = FasterDecoderOptions self.rec_cls = FasterRecognizer self.decoder_options = opt_cls() self.decoder_options.beam = beam self.decoder_options.max_active = cfg.max_active self.decoder_options.beam_delta = cfg.beam_delta self.decoder_options.hash_ratio = cfg.hash_ratio if cfg.is_lattice: self.decoder_options.lattice_beam = cfg.lattice_beam self.decoder_options.prune_interval = cfg.prune_interval self.decoder_options.determinize_lattice = cfg.determinize_lattice self.decoder_options.prune_scale = cfg.prune_scale det_opts = DeterminizeLatticePhonePrunedOptions() det_opts.max_mem = cfg.max_mem det_opts.phone_determinize = cfg.phone_determinize det_opts.word_determinize = cfg.word_determinize det_opts.minimize = cfg.minimize self.decoder_options.det_opts = det_opts self.output_symbols = {} with open(cfg.output_dict, "r") as f: for line in f: items = line.rstrip().split() assert len(items) == 2 self.output_symbols[int(items[1])] = items[0] logger.info(f"Loading FST from {cfg.hlg_graph_path}") self.fst = read_fst_kaldi(cfg.hlg_graph_path) self.symbol_table = SymbolTable.read_text(cfg.output_dict) self.executor = ThreadPoolExecutor(max_workers=cfg.num_threads) def generate(self, models, sample, **unused): """Generate a batch of inferences.""" # model.forward normally channels prev_output_tokens into the decoder # separately, but SequenceGenerator directly calls model.encoder encoder_input = { k: v for k, v in sample["net_input"].items() if k != "prev_output_tokens" } emissions, padding = self.get_emissions(models, encoder_input) return self.decode(emissions, padding) def get_emissions(self, models, encoder_input): """Run encoder and normalize emissions""" model = models[0] all_encoder_out = [m(**encoder_input) for m in models] if len(all_encoder_out) > 1: if "encoder_out" in all_encoder_out[0]: encoder_out = { "encoder_out": sum(e["encoder_out"] for e in all_encoder_out) / len(all_encoder_out), "encoder_padding_mask": all_encoder_out[0]["encoder_padding_mask"], } padding = encoder_out["encoder_padding_mask"] else: encoder_out = { "logits": sum(e["logits"] for e in all_encoder_out) / len(all_encoder_out), "padding_mask": all_encoder_out[0]["padding_mask"], } padding = encoder_out["padding_mask"] else: encoder_out = all_encoder_out[0] padding = ( encoder_out["padding_mask"] if "padding_mask" in encoder_out else encoder_out["encoder_padding_mask"] ) if hasattr(model, "get_logits"): emissions = model.get_logits(encoder_out, normalize=True) else: emissions = model.get_normalized_probs(encoder_out, log_probs=True) return ( emissions.cpu().float().transpose(0, 1), padding.cpu() if padding is not None and padding.any() else None, ) def decode_one(self, logits, padding): from kaldi.matrix import Matrix decoder = self.dec_cls(self.fst, self.decoder_options) asr = self.rec_cls( decoder, self.symbol_table, acoustic_scale=self.acoustic_scale ) if padding is not None: logits = logits[~padding] mat = Matrix(logits.numpy()) out = asr.decode(mat) if self.nbest > 1: from kaldi.fstext import shortestpath from kaldi.fstext.utils import ( convert_compact_lattice_to_lattice, convert_lattice_to_std, convert_nbest_to_list, get_linear_symbol_sequence, ) lat = out["lattice"] sp = shortestpath(lat, nshortest=self.nbest) sp = convert_compact_lattice_to_lattice(sp) sp = convert_lattice_to_std(sp) seq = convert_nbest_to_list(sp) results = [] for s in seq: _, o, w = get_linear_symbol_sequence(s) words = list(self.output_symbols[z] for z in o) results.append( { "tokens": words, "words": words, "score": w.value, "emissions": logits, } ) return results else: words = out["text"].split() return [ { "tokens": words, "words": words, "score": out["likelihood"], "emissions": logits, } ] def decode(self, emissions, padding): if padding is None: padding = [None] * len(emissions) ret = list( map( lambda e, p: self.executor.submit(self.decode_one, e, p), emissions, padding, ) ) return ret
8,265
32.738776
116
py
rej-summ
rej-summ-main/examples/speech_recognition/data/collaters.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ This module contains collection of classes which implement collate functionalities for various tasks. Collaters should know what data to expect for each sample and they should pack / collate them into batches """ from __future__ import absolute_import, division, print_function, unicode_literals import numpy as np import torch from fairseq.data import data_utils as fairseq_data_utils class Seq2SeqCollater(object): """ Implements collate function mainly for seq2seq tasks This expects each sample to contain feature (src_tokens) and targets. This collator is also used for aligned training task. """ def __init__( self, feature_index=0, label_index=1, pad_index=1, eos_index=2, move_eos_to_beginning=True, ): self.feature_index = feature_index self.label_index = label_index self.pad_index = pad_index self.eos_index = eos_index self.move_eos_to_beginning = move_eos_to_beginning def _collate_frames(self, frames): """Convert a list of 2d frames into a padded 3d tensor Args: frames (list): list of 2d frames of size L[i]*f_dim. Where L[i] is length of i-th frame and f_dim is static dimension of features Returns: 3d tensor of size len(frames)*len_max*f_dim where len_max is max of L[i] """ len_max = max(frame.size(0) for frame in frames) f_dim = frames[0].size(1) res = frames[0].new(len(frames), len_max, f_dim).fill_(0.0) for i, v in enumerate(frames): res[i, : v.size(0)] = v return res def collate(self, samples): """ utility function to collate samples into batch for speech recognition. """ if len(samples) == 0: return {} # parse samples into torch tensors parsed_samples = [] for s in samples: # skip invalid samples if s["data"][self.feature_index] is None: continue source = s["data"][self.feature_index] if isinstance(source, (np.ndarray, np.generic)): source = torch.from_numpy(source) target = s["data"][self.label_index] if isinstance(target, (np.ndarray, np.generic)): target = torch.from_numpy(target).long() elif isinstance(target, list): target = torch.LongTensor(target) parsed_sample = {"id": s["id"], "source": source, "target": target} parsed_samples.append(parsed_sample) samples = parsed_samples id = torch.LongTensor([s["id"] for s in samples]) frames = self._collate_frames([s["source"] for s in samples]) # sort samples by descending number of frames frames_lengths = torch.LongTensor([s["source"].size(0) for s in samples]) frames_lengths, sort_order = frames_lengths.sort(descending=True) id = id.index_select(0, sort_order) frames = frames.index_select(0, sort_order) target = None target_lengths = None prev_output_tokens = None if samples[0].get("target", None) is not None: ntokens = sum(len(s["target"]) for s in samples) target = fairseq_data_utils.collate_tokens( [s["target"] for s in samples], self.pad_index, self.eos_index, left_pad=False, move_eos_to_beginning=False, ) target = target.index_select(0, sort_order) target_lengths = torch.LongTensor( [s["target"].size(0) for s in samples] ).index_select(0, sort_order) prev_output_tokens = fairseq_data_utils.collate_tokens( [s["target"] for s in samples], self.pad_index, self.eos_index, left_pad=False, move_eos_to_beginning=self.move_eos_to_beginning, ) prev_output_tokens = prev_output_tokens.index_select(0, sort_order) else: ntokens = sum(len(s["source"]) for s in samples) batch = { "id": id, "ntokens": ntokens, "net_input": {"src_tokens": frames, "src_lengths": frames_lengths}, "target": target, "target_lengths": target_lengths, "nsentences": len(samples), } if prev_output_tokens is not None: batch["net_input"]["prev_output_tokens"] = prev_output_tokens return batch
4,796
35.340909
84
py
rej-summ
rej-summ-main/examples/speech_recognition/data/data_utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch def calc_mean_invstddev(feature): if len(feature.size()) != 2: raise ValueError("We expect the input feature to be 2-D tensor") mean = feature.mean(0) var = feature.var(0) # avoid division by ~zero eps = 1e-8 if (var < eps).any(): return mean, 1.0 / (torch.sqrt(var) + eps) return mean, 1.0 / torch.sqrt(var) def apply_mv_norm(features): # If there is less than 2 spectrograms, the variance cannot be computed (is NaN) # and normalization is not possible, so return the item as it is if features.size(0) < 2: return features mean, invstddev = calc_mean_invstddev(features) res = (features - mean) * invstddev return res def lengths_to_encoder_padding_mask(lengths, batch_first=False): """ convert lengths (a 1-D Long/Int tensor) to 2-D binary tensor Args: lengths: a (B, )-shaped tensor Return: max_length: maximum length of B sequences encoder_padding_mask: a (max_length, B) binary mask, where [t, b] = 0 for t < lengths[b] and 1 otherwise TODO: kernelize this function if benchmarking shows this function is slow """ max_lengths = torch.max(lengths).item() bsz = lengths.size(0) encoder_padding_mask = torch.arange( max_lengths ).to( # a (T, ) tensor with [0, ..., T-1] lengths.device ).view( # move to the right device 1, max_lengths ).expand( # reshape to (1, T)-shaped tensor bsz, -1 ) >= lengths.view( # expand to (B, T)-shaped tensor bsz, 1 ).expand( -1, max_lengths ) if not batch_first: return encoder_padding_mask.t(), max_lengths else: return encoder_padding_mask, max_lengths def encoder_padding_mask_to_lengths( encoder_padding_mask, max_lengths, batch_size, device ): """ convert encoder_padding_mask (2-D binary tensor) to a 1-D tensor Conventionally, encoder output contains a encoder_padding_mask, which is a 2-D mask in a shape (T, B), whose (t, b) element indicate whether encoder_out[t, b] is a valid output (=0) or not (=1). Occasionally, we need to convert this mask tensor to a 1-D tensor in shape (B, ), where [b] denotes the valid length of b-th sequence Args: encoder_padding_mask: a (T, B)-shaped binary tensor or None; if None, indicating all are valid Return: seq_lengths: a (B,)-shaped tensor, where its (b, )-th element is the number of valid elements of b-th sequence max_lengths: maximum length of all sequence, if encoder_padding_mask is not None, max_lengths must equal to encoder_padding_mask.size(0) batch_size: batch size; if encoder_padding_mask is not None, max_lengths must equal to encoder_padding_mask.size(1) device: which device to put the result on """ if encoder_padding_mask is None: return torch.Tensor([max_lengths] * batch_size).to(torch.int32).to(device) assert encoder_padding_mask.size(0) == max_lengths, "max_lengths does not match" assert encoder_padding_mask.size(1) == batch_size, "batch_size does not match" return max_lengths - torch.sum(encoder_padding_mask, dim=0)
3,429
32.960396
84
py
rej-summ
rej-summ-main/examples/speech_recognition/data/asr_dataset.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os import numpy as np from fairseq.data import FairseqDataset from . import data_utils from .collaters import Seq2SeqCollater class AsrDataset(FairseqDataset): """ A dataset representing speech and corresponding transcription. Args: aud_paths: (List[str]): A list of str with paths to audio files. aud_durations_ms (List[int]): A list of int containing the durations of audio files. tgt (List[torch.LongTensor]): A list of LongTensors containing the indices of target transcriptions. tgt_dict (~fairseq.data.Dictionary): target vocabulary. ids (List[str]): A list of utterance IDs. speakers (List[str]): A list of speakers corresponding to utterances. num_mel_bins (int): Number of triangular mel-frequency bins (default: 80) frame_length (float): Frame length in milliseconds (default: 25.0) frame_shift (float): Frame shift in milliseconds (default: 10.0) """ def __init__( self, aud_paths, aud_durations_ms, tgt, tgt_dict, ids, speakers, num_mel_bins=80, frame_length=25.0, frame_shift=10.0, ): assert frame_length > 0 assert frame_shift > 0 assert all(x > frame_length for x in aud_durations_ms) self.frame_sizes = [ int(1 + (d - frame_length) / frame_shift) for d in aud_durations_ms ] assert len(aud_paths) > 0 assert len(aud_paths) == len(aud_durations_ms) assert len(aud_paths) == len(tgt) assert len(aud_paths) == len(ids) assert len(aud_paths) == len(speakers) self.aud_paths = aud_paths self.tgt_dict = tgt_dict self.tgt = tgt self.ids = ids self.speakers = speakers self.num_mel_bins = num_mel_bins self.frame_length = frame_length self.frame_shift = frame_shift self.s2s_collater = Seq2SeqCollater( 0, 1, pad_index=self.tgt_dict.pad(), eos_index=self.tgt_dict.eos(), move_eos_to_beginning=True, ) def __getitem__(self, index): import torchaudio import torchaudio.compliance.kaldi as kaldi tgt_item = self.tgt[index] if self.tgt is not None else None path = self.aud_paths[index] if not os.path.exists(path): raise FileNotFoundError("Audio file not found: {}".format(path)) sound, sample_rate = torchaudio.load_wav(path) output = kaldi.fbank( sound, num_mel_bins=self.num_mel_bins, frame_length=self.frame_length, frame_shift=self.frame_shift, ) output_cmvn = data_utils.apply_mv_norm(output) return {"id": index, "data": [output_cmvn.detach(), tgt_item]} def __len__(self): return len(self.aud_paths) def collater(self, samples): """Merge a list of samples to form a mini-batch. Args: samples (List[int]): sample indices to collate Returns: dict: a mini-batch suitable for forwarding with a Model """ return self.s2s_collater.collate(samples) def num_tokens(self, index): return self.frame_sizes[index] def size(self, index): """Return an example's size as a float or tuple. This value is used when filtering a dataset with ``--max-positions``.""" return ( self.frame_sizes[index], len(self.tgt[index]) if self.tgt is not None else 0, ) def ordered_indices(self): """Return an ordered list of indices. Batches will be constructed based on this order.""" return np.arange(len(self))
3,955
31.162602
82
py
rej-summ
rej-summ-main/examples/speech_recognition/tasks/speech_recognition.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import json import os import re import sys import torch from examples.speech_recognition.data import AsrDataset from examples.speech_recognition.data.replabels import replabel_symbol from fairseq.data import Dictionary from fairseq.tasks import LegacyFairseqTask, register_task def get_asr_dataset_from_json(data_json_path, tgt_dict): """ Parse data json and create dataset. See scripts/asr_prep_json.py which pack json from raw files Json example: { "utts": { "4771-29403-0025": { "input": { "length_ms": 170, "path": "/tmp/file1.flac" }, "output": { "text": "HELLO \n", "token": "HE LLO", "tokenid": "4815, 861" } }, "1564-142299-0096": { ... } } """ if not os.path.isfile(data_json_path): raise FileNotFoundError("Dataset not found: {}".format(data_json_path)) with open(data_json_path, "rb") as f: data_samples = json.load(f)["utts"] assert len(data_samples) != 0 sorted_samples = sorted( data_samples.items(), key=lambda sample: int(sample[1]["input"]["length_ms"]), reverse=True, ) aud_paths = [s[1]["input"]["path"] for s in sorted_samples] ids = [s[0] for s in sorted_samples] speakers = [] for s in sorted_samples: m = re.search("(.+?)-(.+?)-(.+?)", s[0]) speakers.append(m.group(1) + "_" + m.group(2)) frame_sizes = [s[1]["input"]["length_ms"] for s in sorted_samples] tgt = [ [int(i) for i in s[1]["output"]["tokenid"].split(", ")] for s in sorted_samples ] # append eos tgt = [[*t, tgt_dict.eos()] for t in tgt] return AsrDataset(aud_paths, frame_sizes, tgt, tgt_dict, ids, speakers) @register_task("speech_recognition") class SpeechRecognitionTask(LegacyFairseqTask): """ Task for training speech recognition model. """ @staticmethod def add_args(parser): """Add task-specific arguments to the parser.""" parser.add_argument("data", help="path to data directory") parser.add_argument( "--silence-token", default="\u2581", help="token for silence (used by w2l)" ) parser.add_argument( "--max-source-positions", default=sys.maxsize, type=int, metavar="N", help="max number of frames in the source sequence", ) parser.add_argument( "--max-target-positions", default=1024, type=int, metavar="N", help="max number of tokens in the target sequence", ) def __init__(self, args, tgt_dict): super().__init__(args) self.tgt_dict = tgt_dict @classmethod def setup_task(cls, args, **kwargs): """Setup the task (e.g., load dictionaries).""" dict_path = os.path.join(args.data, "dict.txt") if not os.path.isfile(dict_path): raise FileNotFoundError("Dict not found: {}".format(dict_path)) tgt_dict = Dictionary.load(dict_path) if args.criterion == "ctc_loss": tgt_dict.add_symbol("<ctc_blank>") elif args.criterion == "asg_loss": for i in range(1, args.max_replabel + 1): tgt_dict.add_symbol(replabel_symbol(i)) print("| dictionary: {} types".format(len(tgt_dict))) return cls(args, tgt_dict) def load_dataset(self, split, combine=False, **kwargs): """Load a given dataset split. Args: split (str): name of the split (e.g., train, valid, test) """ data_json_path = os.path.join(self.args.data, "{}.json".format(split)) self.datasets[split] = get_asr_dataset_from_json(data_json_path, self.tgt_dict) def build_generator(self, models, args, **unused): w2l_decoder = getattr(args, "w2l_decoder", None) if w2l_decoder == "viterbi": from examples.speech_recognition.w2l_decoder import W2lViterbiDecoder return W2lViterbiDecoder(args, self.target_dictionary) elif w2l_decoder == "kenlm": from examples.speech_recognition.w2l_decoder import W2lKenLMDecoder return W2lKenLMDecoder(args, self.target_dictionary) elif w2l_decoder == "fairseqlm": from examples.speech_recognition.w2l_decoder import W2lFairseqLMDecoder return W2lFairseqLMDecoder(args, self.target_dictionary) else: return super().build_generator(models, args) @property def target_dictionary(self): """Return the :class:`~fairseq.data.Dictionary` for the language model.""" return self.tgt_dict @property def source_dictionary(self): """Return the source :class:`~fairseq.data.Dictionary` (if applicable for this task).""" return None def max_positions(self): """Return the max speech and sentence length allowed by the task.""" return (self.args.max_source_positions, self.args.max_target_positions)
5,397
33.164557
87
py
rej-summ
rej-summ-main/examples/speech_synthesis/generate_waveform.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import ast import logging import matplotlib.pyplot as plt import numpy as np from pathlib import Path import soundfile as sf import sys import torch import torchaudio from fairseq import checkpoint_utils, options, tasks, utils from fairseq.logging import progress_bar from fairseq.tasks.text_to_speech import plot_tts_output from fairseq.data.audio.text_to_speech_dataset import TextToSpeechDataset logging.basicConfig() logging.root.setLevel(logging.INFO) logging.basicConfig(level=logging.INFO) logger = logging.getLogger(__name__) def make_parser(): parser = options.get_speech_generation_parser() parser.add_argument("--dump-features", action="store_true") parser.add_argument("--dump-waveforms", action="store_true") parser.add_argument("--dump-attentions", action="store_true") parser.add_argument("--dump-eos-probs", action="store_true") parser.add_argument("--dump-plots", action="store_true") parser.add_argument("--dump-target", action="store_true") parser.add_argument("--output-sample-rate", default=22050, type=int) parser.add_argument("--teacher-forcing", action="store_true") parser.add_argument( "--audio-format", type=str, default="wav", choices=["wav", "flac"] ) return parser def postprocess_results( dataset: TextToSpeechDataset, sample, hypos, resample_fn, dump_target ): def to_np(x): return None if x is None else x.detach().cpu().numpy() sample_ids = [dataset.ids[i] for i in sample["id"].tolist()] texts = sample["src_texts"] if "src_texts" in sample else [""] * len(hypos) attns = [to_np(hypo["attn"]) for hypo in hypos] eos_probs = [to_np(hypo.get("eos_prob", None)) for hypo in hypos] feat_preds = [to_np(hypo["feature"]) for hypo in hypos] wave_preds = [to_np(resample_fn(h["waveform"])) for h in hypos] if dump_target: feat_targs = [to_np(hypo["targ_feature"]) for hypo in hypos] wave_targs = [to_np(resample_fn(h["targ_waveform"])) for h in hypos] else: feat_targs = [None for _ in hypos] wave_targs = [None for _ in hypos] return zip(sample_ids, texts, attns, eos_probs, feat_preds, wave_preds, feat_targs, wave_targs) def dump_result( is_na_model, args, vocoder, sample_id, text, attn, eos_prob, feat_pred, wave_pred, feat_targ, wave_targ, ): sample_rate = args.output_sample_rate out_root = Path(args.results_path) if args.dump_features: feat_dir = out_root / "feat" feat_dir.mkdir(exist_ok=True, parents=True) np.save(feat_dir / f"{sample_id}.npy", feat_pred) if args.dump_target: feat_tgt_dir = out_root / "feat_tgt" feat_tgt_dir.mkdir(exist_ok=True, parents=True) np.save(feat_tgt_dir / f"{sample_id}.npy", feat_targ) if args.dump_attentions: attn_dir = out_root / "attn" attn_dir.mkdir(exist_ok=True, parents=True) np.save(attn_dir / f"{sample_id}.npy", attn.numpy()) if args.dump_eos_probs and not is_na_model: eos_dir = out_root / "eos" eos_dir.mkdir(exist_ok=True, parents=True) np.save(eos_dir / f"{sample_id}.npy", eos_prob) if args.dump_plots: images = [feat_pred.T] if is_na_model else [feat_pred.T, attn] names = ["output"] if is_na_model else ["output", "alignment"] if feat_targ is not None: images = [feat_targ.T] + images names = [f"target (idx={sample_id})"] + names if is_na_model: plot_tts_output(images, names, attn, "alignment", suptitle=text) else: plot_tts_output(images, names, eos_prob, "eos prob", suptitle=text) plot_dir = out_root / "plot" plot_dir.mkdir(exist_ok=True, parents=True) plt.savefig(plot_dir / f"{sample_id}.png") plt.close() if args.dump_waveforms: ext = args.audio_format if wave_pred is not None: wav_dir = out_root / f"{ext}_{sample_rate}hz_{vocoder}" wav_dir.mkdir(exist_ok=True, parents=True) sf.write(wav_dir / f"{sample_id}.{ext}", wave_pred, sample_rate) if args.dump_target and wave_targ is not None: wav_tgt_dir = out_root / f"{ext}_{sample_rate}hz_{vocoder}_tgt" wav_tgt_dir.mkdir(exist_ok=True, parents=True) sf.write(wav_tgt_dir / f"{sample_id}.{ext}", wave_targ, sample_rate) def main(args): assert(args.dump_features or args.dump_waveforms or args.dump_attentions or args.dump_eos_probs or args.dump_plots) if args.max_tokens is None and args.batch_size is None: args.max_tokens = 8000 logger.info(args) use_cuda = torch.cuda.is_available() and not args.cpu task = tasks.setup_task(args) models, saved_cfg, task = checkpoint_utils.load_model_ensemble_and_task( [args.path], task=task, arg_overrides=ast.literal_eval(args.model_overrides), ) model = models[0].cuda() if use_cuda else models[0] # use the original n_frames_per_step task.args.n_frames_per_step = saved_cfg.task.n_frames_per_step task.load_dataset(args.gen_subset, task_cfg=saved_cfg.task) data_cfg = task.data_cfg sample_rate = data_cfg.config.get("features", {}).get("sample_rate", 22050) resample_fn = { False: lambda x: x, True: lambda x: torchaudio.sox_effects.apply_effects_tensor( x.detach().cpu().unsqueeze(0), sample_rate, [['rate', str(args.output_sample_rate)]] )[0].squeeze(0) }.get(args.output_sample_rate != sample_rate) if args.output_sample_rate != sample_rate: logger.info(f"resampling to {args.output_sample_rate}Hz") generator = task.build_generator([model], args) itr = task.get_batch_iterator( dataset=task.dataset(args.gen_subset), max_tokens=args.max_tokens, max_sentences=args.batch_size, max_positions=(sys.maxsize, sys.maxsize), ignore_invalid_inputs=args.skip_invalid_size_inputs_valid_test, required_batch_size_multiple=args.required_batch_size_multiple, num_shards=args.num_shards, shard_id=args.shard_id, num_workers=args.num_workers, data_buffer_size=args.data_buffer_size, ).next_epoch_itr(shuffle=False) Path(args.results_path).mkdir(exist_ok=True, parents=True) is_na_model = getattr(model, "NON_AUTOREGRESSIVE", False) dataset = task.dataset(args.gen_subset) vocoder = task.args.vocoder with progress_bar.build_progress_bar(args, itr) as t: for sample in t: sample = utils.move_to_cuda(sample) if use_cuda else sample hypos = generator.generate(model, sample, has_targ=args.dump_target) for result in postprocess_results( dataset, sample, hypos, resample_fn, args.dump_target ): dump_result(is_na_model, args, vocoder, *result) def cli_main(): parser = make_parser() args = options.parse_args_and_arch(parser) main(args) if __name__ == "__main__": cli_main()
7,339
37.031088
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import numpy as np import torch from scipy.interpolate import interp1d import torchaudio from fairseq.tasks.text_to_speech import ( batch_compute_distortion, compute_rms_dist ) def batch_mel_spectral_distortion( y1, y2, sr, normalize_type="path", mel_fn=None ): """ https://arxiv.org/pdf/2011.03568.pdf Same as Mel Cepstral Distortion, but computed on log-mel spectrograms. """ if mel_fn is None or mel_fn.sample_rate != sr: mel_fn = torchaudio.transforms.MelSpectrogram( sr, n_fft=int(0.05 * sr), win_length=int(0.05 * sr), hop_length=int(0.0125 * sr), f_min=20, n_mels=80, window_fn=torch.hann_window ).to(y1[0].device) offset = 1e-6 return batch_compute_distortion( y1, y2, sr, lambda y: torch.log(mel_fn(y) + offset).transpose(-1, -2), compute_rms_dist, normalize_type ) # This code is based on # "https://github.com/bastibe/MAPS-Scripts/blob/master/helper.py" def _same_t_in_true_and_est(func): def new_func(true_t, true_f, est_t, est_f): assert type(true_t) is np.ndarray assert type(true_f) is np.ndarray assert type(est_t) is np.ndarray assert type(est_f) is np.ndarray interpolated_f = interp1d( est_t, est_f, bounds_error=False, kind='nearest', fill_value=0 )(true_t) return func(true_t, true_f, true_t, interpolated_f) return new_func @_same_t_in_true_and_est def gross_pitch_error(true_t, true_f, est_t, est_f): """The relative frequency in percent of pitch estimates that are outside a threshold around the true pitch. Only frames that are considered pitched by both the ground truth and the estimator (if applicable) are considered. """ correct_frames = _true_voiced_frames(true_t, true_f, est_t, est_f) gross_pitch_error_frames = _gross_pitch_error_frames( true_t, true_f, est_t, est_f ) return np.sum(gross_pitch_error_frames) / np.sum(correct_frames) def _gross_pitch_error_frames(true_t, true_f, est_t, est_f, eps=1e-8): voiced_frames = _true_voiced_frames(true_t, true_f, est_t, est_f) true_f_p_eps = [x + eps for x in true_f] pitch_error_frames = np.abs(est_f / true_f_p_eps - 1) > 0.2 return voiced_frames & pitch_error_frames def _true_voiced_frames(true_t, true_f, est_t, est_f): return (est_f != 0) & (true_f != 0) def _voicing_decision_error_frames(true_t, true_f, est_t, est_f): return (est_f != 0) != (true_f != 0) @_same_t_in_true_and_est def f0_frame_error(true_t, true_f, est_t, est_f): gross_pitch_error_frames = _gross_pitch_error_frames( true_t, true_f, est_t, est_f ) voicing_decision_error_frames = _voicing_decision_error_frames( true_t, true_f, est_t, est_f ) return (np.sum(gross_pitch_error_frames) + np.sum(voicing_decision_error_frames)) / (len(true_t)) @_same_t_in_true_and_est def voicing_decision_error(true_t, true_f, est_t, est_f): voicing_decision_error_frames = _voicing_decision_error_frames( true_t, true_f, est_t, est_f ) return np.sum(voicing_decision_error_frames) / (len(true_t))
3,357
31.921569
78
py
rej-summ
rej-summ-main/examples/speech_synthesis/data_utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import io import os from pathlib import Path from typing import Optional, List, Dict import zipfile import tempfile from dataclasses import dataclass from itertools import groupby import torch import torch.nn.functional as F import numpy as np from tqdm import tqdm from examples.speech_to_text.data_utils import load_tsv_to_dicts from fairseq.data.audio.audio_utils import ( TTSSpectrogram, TTSMelScale, parse_path, read_from_stored_zip, is_npy_data ) def trim_or_pad_to_target_length( data_1d_or_2d: np.ndarray, target_length: int ) -> np.ndarray: assert len(data_1d_or_2d.shape) in {1, 2} delta = data_1d_or_2d.shape[0] - target_length if delta >= 0: # trim if being longer data_1d_or_2d = data_1d_or_2d[: target_length] else: # pad if being shorter if len(data_1d_or_2d.shape) == 1: data_1d_or_2d = np.concatenate( [data_1d_or_2d, np.zeros(-delta)], axis=0 ) else: data_1d_or_2d = np.concatenate( [data_1d_or_2d, np.zeros((-delta, data_1d_or_2d.shape[1]))], axis=0 ) return data_1d_or_2d def extract_logmel_spectrogram( waveform: torch.Tensor, sample_rate: int, output_path: Optional[Path] = None, win_length: int = 1024, hop_length: int = 256, n_fft: int = 1024, win_fn: callable = torch.hann_window, n_mels: int = 80, f_min: float = 0., f_max: float = 8000, eps: float = 1e-5, overwrite: bool = False, target_length: Optional[int] = None ): if output_path is not None and output_path.is_file() and not overwrite: return spectrogram_transform = TTSSpectrogram( n_fft=n_fft, win_length=win_length, hop_length=hop_length, window_fn=win_fn ) mel_scale_transform = TTSMelScale( n_mels=n_mels, sample_rate=sample_rate, f_min=f_min, f_max=f_max, n_stft=n_fft // 2 + 1 ) spectrogram = spectrogram_transform(waveform) mel_spec = mel_scale_transform(spectrogram) logmel_spec = torch.clamp(mel_spec, min=eps).log() assert len(logmel_spec.shape) == 3 and logmel_spec.shape[0] == 1 logmel_spec = logmel_spec.squeeze().t() # D x T -> T x D if target_length is not None: logmel_spec = trim_or_pad_to_target_length(logmel_spec, target_length) if output_path is not None: np.save(output_path.as_posix(), logmel_spec) else: return logmel_spec def extract_pitch( waveform: torch.Tensor, sample_rate: int, output_path: Optional[Path] = None, hop_length: int = 256, log_scale: bool = True, phoneme_durations: Optional[List[int]] = None ): if output_path is not None and output_path.is_file(): return try: import pyworld except ImportError: raise ImportError("Please install PyWORLD: pip install pyworld") _waveform = waveform.squeeze(0).double().numpy() pitch, t = pyworld.dio( _waveform, sample_rate, frame_period=hop_length / sample_rate * 1000 ) pitch = pyworld.stonemask(_waveform, pitch, t, sample_rate) if phoneme_durations is not None: pitch = trim_or_pad_to_target_length(pitch, sum(phoneme_durations)) try: from scipy.interpolate import interp1d except ImportError: raise ImportError("Please install SciPy: pip install scipy") nonzero_ids = np.where(pitch != 0)[0] if len(nonzero_ids) == 0: print((f"{output_path} has all empty values in the pitch contour")) return elif len(nonzero_ids) == 1: print((f"{output_path} has only one non-zero values in the pitch contour")) return else: interp_fn = interp1d( nonzero_ids, pitch[nonzero_ids], fill_value=(pitch[nonzero_ids[0]], pitch[nonzero_ids[-1]]), bounds_error=False, ) pitch = interp_fn(np.arange(0, len(pitch))) d_cumsum = np.cumsum(np.concatenate([np.array([0]), phoneme_durations])) pitch = np.array( [ np.mean(pitch[d_cumsum[i-1]: d_cumsum[i]]) for i in range(1, len(d_cumsum)) ] ) assert len(pitch) == len(phoneme_durations) if log_scale: pitch = np.log(pitch + 1) if output_path is not None: np.save(output_path.as_posix(), pitch) else: return pitch def extract_energy( waveform: torch.Tensor, output_path: Optional[Path] = None, hop_length: int = 256, n_fft: int = 1024, log_scale: bool = True, phoneme_durations: Optional[List[int]] = None ): if output_path is not None and output_path.is_file(): return assert len(waveform.shape) == 2 and waveform.shape[0] == 1 waveform = waveform.view(1, 1, waveform.shape[1]) waveform = F.pad( waveform.unsqueeze(1), [n_fft // 2, n_fft // 2, 0, 0], mode="reflect" ) waveform = waveform.squeeze(1) fourier_basis = np.fft.fft(np.eye(n_fft)) cutoff = int((n_fft / 2 + 1)) fourier_basis = np.vstack( [np.real(fourier_basis[:cutoff, :]), np.imag(fourier_basis[:cutoff, :])] ) forward_basis = torch.FloatTensor(fourier_basis[:, None, :]) forward_transform = F.conv1d( waveform, forward_basis, stride=hop_length, padding=0 ) real_part = forward_transform[:, :cutoff, :] imag_part = forward_transform[:, cutoff:, :] magnitude = torch.sqrt(real_part ** 2 + imag_part ** 2) energy = torch.norm(magnitude, dim=1).squeeze(0).numpy() if phoneme_durations is not None: energy = trim_or_pad_to_target_length(energy, sum(phoneme_durations)) d_cumsum = np.cumsum(np.concatenate([np.array([0]), phoneme_durations])) energy = np.array( [ np.mean(energy[d_cumsum[i - 1]: d_cumsum[i]]) for i in range(1, len(d_cumsum)) ] ) assert len(energy) == len(phoneme_durations) if log_scale: energy = np.log(energy + 1) if output_path is not None: np.save(output_path.as_posix(), energy) else: return energy def get_global_cmvn(feature_root: Path, output_path: Optional[Path] = None): mean_x, mean_x2, n_frames = None, None, 0 feature_paths = feature_root.glob("*.npy") for p in tqdm(feature_paths): with open(p, 'rb') as f: frames = np.load(f).squeeze() n_frames += frames.shape[0] cur_mean_x = frames.sum(axis=0) if mean_x is None: mean_x = cur_mean_x else: mean_x += cur_mean_x cur_mean_x2 = (frames ** 2).sum(axis=0) if mean_x2 is None: mean_x2 = cur_mean_x2 else: mean_x2 += cur_mean_x2 mean_x /= n_frames mean_x2 /= n_frames var_x = mean_x2 - mean_x ** 2 std_x = np.sqrt(np.maximum(var_x, 1e-10)) if output_path is not None: with open(output_path, 'wb') as f: np.savez(f, mean=mean_x, std=std_x) else: return {"mean": mean_x, "std": std_x} def ipa_phonemize(text, lang="en-us", use_g2p=False): if use_g2p: assert lang == "en-us", "g2pE phonemizer only works for en-us" try: from g2p_en import G2p g2p = G2p() return " ".join("|" if p == " " else p for p in g2p(text)) except ImportError: raise ImportError( "Please install phonemizer: pip install g2p_en" ) else: try: from phonemizer import phonemize from phonemizer.separator import Separator return phonemize( text, backend='espeak', language=lang, separator=Separator(word="| ", phone=" ") ) except ImportError: raise ImportError( "Please install phonemizer: pip install phonemizer" ) @dataclass class ForceAlignmentInfo(object): tokens: List[str] frame_durations: List[int] start_sec: Optional[float] end_sec: Optional[float] def get_mfa_alignment_by_sample_id( textgrid_zip_path: str, sample_id: str, sample_rate: int, hop_length: int, silence_phones: List[str] = ("sil", "sp", "spn") ) -> ForceAlignmentInfo: try: import tgt except ImportError: raise ImportError("Please install TextGridTools: pip install tgt") filename = f"{sample_id}.TextGrid" out_root = Path(tempfile.gettempdir()) tgt_path = out_root / filename with zipfile.ZipFile(textgrid_zip_path) as f_zip: f_zip.extract(filename, path=out_root) textgrid = tgt.io.read_textgrid(tgt_path.as_posix()) os.remove(tgt_path) phones, frame_durations = [], [] start_sec, end_sec, end_idx = 0, 0, 0 for t in textgrid.get_tier_by_name("phones")._objects: s, e, p = t.start_time, t.end_time, t.text # Trim leading silences if len(phones) == 0: if p in silence_phones: continue else: start_sec = s phones.append(p) if p not in silence_phones: end_sec = e end_idx = len(phones) r = sample_rate / hop_length frame_durations.append(int(np.round(e * r) - np.round(s * r))) # Trim tailing silences phones = phones[:end_idx] frame_durations = frame_durations[:end_idx] return ForceAlignmentInfo( tokens=phones, frame_durations=frame_durations, start_sec=start_sec, end_sec=end_sec ) def get_mfa_alignment( textgrid_zip_path: str, sample_ids: List[str], sample_rate: int, hop_length: int ) -> Dict[str, ForceAlignmentInfo]: return { i: get_mfa_alignment_by_sample_id( textgrid_zip_path, i, sample_rate, hop_length ) for i in tqdm(sample_ids) } def get_unit_alignment( id_to_unit_tsv_path: str, sample_ids: List[str] ) -> Dict[str, ForceAlignmentInfo]: id_to_units = { e["id"]: e["units"] for e in load_tsv_to_dicts(id_to_unit_tsv_path) } id_to_units = {i: id_to_units[i].split() for i in sample_ids} id_to_units_collapsed = { i: [uu for uu, _ in groupby(u)] for i, u in id_to_units.items() } id_to_durations = { i: [len(list(g)) for _, g in groupby(u)] for i, u in id_to_units.items() } return { i: ForceAlignmentInfo( tokens=id_to_units_collapsed[i], frame_durations=id_to_durations[i], start_sec=None, end_sec=None ) for i in sample_ids } def get_feature_value_min_max(feature_paths: List[str]): v_min, v_max = 1e-8, -1e-8 for p in tqdm(feature_paths): _path, slice_ptr = parse_path(p) assert len(slice_ptr) == 2 byte_data = read_from_stored_zip(_path, slice_ptr[0], slice_ptr[1]) assert is_npy_data(byte_data) path_or_fp = io.BytesIO(byte_data) features = np.load(path_or_fp).squeeze() v_min = min(v_min, features.min().item()) v_max = max(v_max, features.max().item()) return v_min, v_max
11,364
31.942029
87
py
rej-summ
rej-summ-main/examples/speech_synthesis/evaluation/eval_sp.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Signal processing-based evaluation using waveforms """ import csv import numpy as np import os.path as op import torch import tqdm from tabulate import tabulate import torchaudio from examples.speech_synthesis.utils import batch_mel_spectral_distortion from fairseq.tasks.text_to_speech import batch_mel_cepstral_distortion def load_eval_spec(path): with open(path) as f: reader = csv.DictReader(f, delimiter='\t') samples = list(reader) return samples def eval_distortion(samples, distortion_fn, device="cuda"): nmiss = 0 results = [] for sample in tqdm.tqdm(samples): if not op.isfile(sample["ref"]) or not op.isfile(sample["syn"]): nmiss += 1 results.append(None) continue # assume single channel yref, sr = torchaudio.load(sample["ref"]) ysyn, _sr = torchaudio.load(sample["syn"]) yref, ysyn = yref[0].to(device), ysyn[0].to(device) assert sr == _sr, f"{sr} != {_sr}" distortion, extra = distortion_fn([yref], [ysyn], sr, None)[0] _, _, _, _, _, pathmap = extra nins = torch.sum(pathmap.sum(dim=1) - 1) # extra frames in syn ndel = torch.sum(pathmap.sum(dim=0) - 1) # missing frames from syn results.append( (distortion.item(), # path distortion pathmap.size(0), # yref num frames pathmap.size(1), # ysyn num frames pathmap.sum().item(), # path length nins.item(), # insertion ndel.item(), # deletion ) ) return results def eval_mel_cepstral_distortion(samples, device="cuda"): return eval_distortion(samples, batch_mel_cepstral_distortion, device) def eval_mel_spectral_distortion(samples, device="cuda"): return eval_distortion(samples, batch_mel_spectral_distortion, device) def print_results(results, show_bin): results = np.array(list(filter(lambda x: x is not None, results))) np.set_printoptions(precision=3) def _print_result(results): dist, dur_ref, dur_syn, dur_ali, nins, ndel = results.sum(axis=0) res = { "nutt": len(results), "dist": dist, "dur_ref": int(dur_ref), "dur_syn": int(dur_syn), "dur_ali": int(dur_ali), "dist_per_ref_frm": dist/dur_ref, "dist_per_syn_frm": dist/dur_syn, "dist_per_ali_frm": dist/dur_ali, "ins": nins/dur_ref, "del": ndel/dur_ref, } print(tabulate( [res.values()], res.keys(), floatfmt=".4f" )) print(">>>> ALL") _print_result(results) if show_bin: edges = [0, 200, 400, 600, 800, 1000, 2000, 4000] for i in range(1, len(edges)): mask = np.logical_and(results[:, 1] >= edges[i-1], results[:, 1] < edges[i]) if not mask.any(): continue bin_results = results[mask] print(f">>>> ({edges[i-1]}, {edges[i]})") _print_result(bin_results) def main(eval_spec, mcd, msd, show_bin): samples = load_eval_spec(eval_spec) device = "cpu" if mcd: print("===== Evaluate Mean Cepstral Distortion =====") results = eval_mel_cepstral_distortion(samples, device) print_results(results, show_bin) if msd: print("===== Evaluate Mean Spectral Distortion =====") results = eval_mel_spectral_distortion(samples, device) print_results(results, show_bin) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("eval_spec") parser.add_argument("--mcd", action="store_true") parser.add_argument("--msd", action="store_true") parser.add_argument("--show-bin", action="store_true") args = parser.parse_args() main(args.eval_spec, args.mcd, args.msd, args.show_bin)
4,149
30.439394
75
py
rej-summ
rej-summ-main/examples/speech_synthesis/evaluation/eval_f0.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Signal processing-based evaluation using waveforms """ import numpy as np import os.path as op import torchaudio import tqdm from tabulate import tabulate from examples.speech_synthesis.utils import ( gross_pitch_error, voicing_decision_error, f0_frame_error ) from examples.speech_synthesis.evaluation.eval_sp import load_eval_spec def difference_function(x, n, tau_max): """ Compute difference function of data x. This solution is implemented directly with Numpy fft. :param x: audio data :param n: length of data :param tau_max: integration window size :return: difference function :rtype: list """ x = np.array(x, np.float64) w = x.size tau_max = min(tau_max, w) x_cumsum = np.concatenate((np.array([0.]), (x * x).cumsum())) size = w + tau_max p2 = (size // 32).bit_length() nice_numbers = (16, 18, 20, 24, 25, 27, 30, 32) size_pad = min(x * 2 ** p2 for x in nice_numbers if x * 2 ** p2 >= size) fc = np.fft.rfft(x, size_pad) conv = np.fft.irfft(fc * fc.conjugate())[:tau_max] return x_cumsum[w:w - tau_max:-1] + x_cumsum[w] - x_cumsum[:tau_max] - \ 2 * conv def cumulative_mean_normalized_difference_function(df, n): """ Compute cumulative mean normalized difference function (CMND). :param df: Difference function :param n: length of data :return: cumulative mean normalized difference function :rtype: list """ # scipy method cmn_df = df[1:] * range(1, n) / np.cumsum(df[1:]).astype(float) return np.insert(cmn_df, 0, 1) def get_pitch(cmdf, tau_min, tau_max, harmo_th=0.1): """ Return fundamental period of a frame based on CMND function. :param cmdf: Cumulative Mean Normalized Difference function :param tau_min: minimum period for speech :param tau_max: maximum period for speech :param harmo_th: harmonicity threshold to determine if it is necessary to compute pitch frequency :return: fundamental period if there is values under threshold, 0 otherwise :rtype: float """ tau = tau_min while tau < tau_max: if cmdf[tau] < harmo_th: while tau + 1 < tau_max and cmdf[tau + 1] < cmdf[tau]: tau += 1 return tau tau += 1 return 0 # if unvoiced def compute_yin(sig, sr, w_len=512, w_step=256, f0_min=100, f0_max=500, harmo_thresh=0.1): """ Compute the Yin Algorithm. Return fundamental frequency and harmonic rate. https://github.com/NVIDIA/mellotron adaption of https://github.com/patriceguyot/Yin :param sig: Audio signal (list of float) :param sr: sampling rate (int) :param w_len: size of the analysis window (samples) :param w_step: size of the lag between two consecutives windows (samples) :param f0_min: Minimum fundamental frequency that can be detected (hertz) :param f0_max: Maximum fundamental frequency that can be detected (hertz) :param harmo_thresh: Threshold of detection. The yalgorithmù return the first minimum of the CMND function below this threshold. :returns: * pitches: list of fundamental frequencies, * harmonic_rates: list of harmonic rate values for each fundamental frequency value (= confidence value) * argmins: minimums of the Cumulative Mean Normalized DifferenceFunction * times: list of time of each estimation :rtype: tuple """ tau_min = int(sr / f0_max) tau_max = int(sr / f0_min) # time values for each analysis window time_scale = range(0, len(sig) - w_len, w_step) times = [t/float(sr) for t in time_scale] frames = [sig[t:t + w_len] for t in time_scale] pitches = [0.0] * len(time_scale) harmonic_rates = [0.0] * len(time_scale) argmins = [0.0] * len(time_scale) for i, frame in enumerate(frames): # Compute YIN df = difference_function(frame, w_len, tau_max) cm_df = cumulative_mean_normalized_difference_function(df, tau_max) p = get_pitch(cm_df, tau_min, tau_max, harmo_thresh) # Get results if np.argmin(cm_df) > tau_min: argmins[i] = float(sr / np.argmin(cm_df)) if p != 0: # A pitch was found pitches[i] = float(sr / p) harmonic_rates[i] = cm_df[p] else: # No pitch, but we compute a value of the harmonic rate harmonic_rates[i] = min(cm_df) return pitches, harmonic_rates, argmins, times def extract_f0(samples): f0_samples = [] for sample in tqdm.tqdm(samples): if not op.isfile(sample["ref"]) or not op.isfile(sample["syn"]): f0_samples.append(None) continue # assume single channel yref, sr = torchaudio.load(sample["ref"]) ysyn, _sr = torchaudio.load(sample["syn"]) yref, ysyn = yref[0], ysyn[0] assert sr == _sr, f"{sr} != {_sr}" yref_f0 = compute_yin(yref, sr) ysyn_f0 = compute_yin(ysyn, sr) f0_samples += [ { "ref": yref_f0, "syn": ysyn_f0 } ] return f0_samples def eval_f0_error(samples, distortion_fn): results = [] for sample in tqdm.tqdm(samples): if sample is None: results.append(None) continue # assume single channel yref_f, _, _, yref_t = sample["ref"] ysyn_f, _, _, ysyn_t = sample["syn"] yref_f = np.array(yref_f) yref_t = np.array(yref_t) ysyn_f = np.array(ysyn_f) ysyn_t = np.array(ysyn_t) distortion = distortion_fn(yref_t, yref_f, ysyn_t, ysyn_f) results.append((distortion.item(), len(yref_f), len(ysyn_f) )) return results def eval_gross_pitch_error(samples): return eval_f0_error(samples, gross_pitch_error) def eval_voicing_decision_error(samples): return eval_f0_error(samples, voicing_decision_error) def eval_f0_frame_error(samples): return eval_f0_error(samples, f0_frame_error) def print_results(results, show_bin): results = np.array(list(filter(lambda x: x is not None, results))) np.set_printoptions(precision=3) def _print_result(results): res = { "nutt": len(results), "error": results[:, 0].mean(), "std": results[:, 0].std(), "dur_ref": int(results[:, 1].sum()), "dur_syn": int(results[:, 2].sum()), } print(tabulate([res.values()], res.keys(), floatfmt=".4f")) print(">>>> ALL") _print_result(results) if show_bin: edges = [0, 200, 400, 600, 800, 1000, 2000, 4000] for i in range(1, len(edges)): mask = np.logical_and(results[:, 1] >= edges[i-1], results[:, 1] < edges[i]) if not mask.any(): continue bin_results = results[mask] print(f">>>> ({edges[i-1]}, {edges[i]})") _print_result(bin_results) def main(eval_f0, gpe, vde, ffe, show_bin): samples = load_eval_spec(eval_f0) if gpe or vde or ffe: f0_samples = extract_f0(samples) if gpe: print("===== Evaluate Gross Pitch Error =====") results = eval_gross_pitch_error(f0_samples) print_results(results, show_bin) if vde: print("===== Evaluate Voicing Decision Error =====") results = eval_voicing_decision_error(f0_samples) print_results(results, show_bin) if ffe: print("===== Evaluate F0 Frame Error =====") results = eval_f0_frame_error(f0_samples) print_results(results, show_bin) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("eval_f0") parser.add_argument("--gpe", action="store_true") parser.add_argument("--vde", action="store_true") parser.add_argument("--ffe", action="store_true") parser.add_argument("--show-bin", action="store_true") args = parser.parse_args() main(args.eval_f0, args.gpe, args.vde, args.ffe, args.show_bin)
8,333
30.213483
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/get_feature_manifest.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging from pathlib import Path import shutil from tempfile import NamedTemporaryFile from collections import Counter, defaultdict import pandas as pd import torchaudio from tqdm import tqdm from fairseq.data.audio.audio_utils import convert_waveform from examples.speech_to_text.data_utils import ( create_zip, gen_config_yaml, gen_vocab, get_zip_manifest, load_tsv_to_dicts, save_df_to_tsv ) from examples.speech_synthesis.data_utils import ( extract_logmel_spectrogram, extract_pitch, extract_energy, get_global_cmvn, ipa_phonemize, get_mfa_alignment, get_unit_alignment, get_feature_value_min_max ) log = logging.getLogger(__name__) def process(args): assert "train" in args.splits out_root = Path(args.output_root).absolute() out_root.mkdir(exist_ok=True) print("Fetching data...") audio_manifest_root = Path(args.audio_manifest_root).absolute() samples = [] for s in args.splits: for e in load_tsv_to_dicts(audio_manifest_root / f"{s}.audio.tsv"): e["split"] = s samples.append(e) sample_ids = [s["id"] for s in samples] # Get alignment info id_to_alignment = None if args.textgrid_zip is not None: assert args.id_to_units_tsv is None id_to_alignment = get_mfa_alignment( args.textgrid_zip, sample_ids, args.sample_rate, args.hop_length ) elif args.id_to_units_tsv is not None: # assume identical hop length on the unit sequence id_to_alignment = get_unit_alignment(args.id_to_units_tsv, sample_ids) # Extract features and pack features into ZIP feature_name = "logmelspec80" zip_path = out_root / f"{feature_name}.zip" pitch_zip_path = out_root / "pitch.zip" energy_zip_path = out_root / "energy.zip" gcmvn_npz_path = out_root / "gcmvn_stats.npz" if zip_path.exists() and gcmvn_npz_path.exists(): print(f"{zip_path} and {gcmvn_npz_path} exist.") else: feature_root = out_root / feature_name feature_root.mkdir(exist_ok=True) pitch_root = out_root / "pitch" energy_root = out_root / "energy" if args.add_fastspeech_targets: pitch_root.mkdir(exist_ok=True) energy_root.mkdir(exist_ok=True) print("Extracting Mel spectrogram features...") for sample in tqdm(samples): waveform, sample_rate = torchaudio.load(sample["audio"]) waveform, sample_rate = convert_waveform( waveform, sample_rate, normalize_volume=args.normalize_volume, to_sample_rate=args.sample_rate ) sample_id = sample["id"] target_length = None if id_to_alignment is not None: a = id_to_alignment[sample_id] target_length = sum(a.frame_durations) if a.start_sec is not None and a.end_sec is not None: start_frame = int(a.start_sec * sample_rate) end_frame = int(a.end_sec * sample_rate) waveform = waveform[:, start_frame: end_frame] extract_logmel_spectrogram( waveform, sample_rate, feature_root / f"{sample_id}.npy", win_length=args.win_length, hop_length=args.hop_length, n_fft=args.n_fft, n_mels=args.n_mels, f_min=args.f_min, f_max=args.f_max, target_length=target_length ) if args.add_fastspeech_targets: assert id_to_alignment is not None extract_pitch( waveform, sample_rate, pitch_root / f"{sample_id}.npy", hop_length=args.hop_length, log_scale=True, phoneme_durations=id_to_alignment[sample_id].frame_durations ) extract_energy( waveform, energy_root / f"{sample_id}.npy", hop_length=args.hop_length, n_fft=args.n_fft, log_scale=True, phoneme_durations=id_to_alignment[sample_id].frame_durations ) print("ZIPing features...") create_zip(feature_root, zip_path) get_global_cmvn(feature_root, gcmvn_npz_path) shutil.rmtree(feature_root) if args.add_fastspeech_targets: create_zip(pitch_root, pitch_zip_path) shutil.rmtree(pitch_root) create_zip(energy_root, energy_zip_path) shutil.rmtree(energy_root) print("Fetching ZIP manifest...") audio_paths, audio_lengths = get_zip_manifest(zip_path) pitch_paths, pitch_lengths, energy_paths, energy_lengths = [None] * 4 if args.add_fastspeech_targets: pitch_paths, pitch_lengths = get_zip_manifest(pitch_zip_path) energy_paths, energy_lengths = get_zip_manifest(energy_zip_path) # Generate TSV manifest print("Generating manifest...") id_to_cer = None if args.cer_threshold is not None: assert Path(args.cer_tsv_path).is_file() id_to_cer = { x["id"]: x["uer"] for x in load_tsv_to_dicts(args.cer_tsv_path) } manifest_by_split = {split: defaultdict(list) for split in args.splits} for sample in tqdm(samples): sample_id, split = sample["id"], sample["split"] if args.snr_threshold is not None and "snr" in sample \ and sample["snr"] < args.snr_threshold: continue if args.cer_threshold is not None \ and id_to_cer[sample_id] > args.cer_threhold: continue normalized_utt = sample["tgt_text"] if id_to_alignment is not None: normalized_utt = " ".join(id_to_alignment[sample_id].tokens) elif args.ipa_vocab: normalized_utt = ipa_phonemize( normalized_utt, lang=args.lang, use_g2p=args.use_g2p ) manifest_by_split[split]["id"].append(sample_id) manifest_by_split[split]["audio"].append(audio_paths[sample_id]) manifest_by_split[split]["n_frames"].append(audio_lengths[sample_id]) manifest_by_split[split]["tgt_text"].append(normalized_utt) manifest_by_split[split]["speaker"].append(sample["speaker"]) manifest_by_split[split]["src_text"].append(sample["src_text"]) if args.add_fastspeech_targets: assert id_to_alignment is not None duration = " ".join( str(d) for d in id_to_alignment[sample_id].frame_durations ) manifest_by_split[split]["duration"].append(duration) manifest_by_split[split]["pitch"].append(pitch_paths[sample_id]) manifest_by_split[split]["energy"].append(energy_paths[sample_id]) for split in args.splits: save_df_to_tsv( pd.DataFrame.from_dict(manifest_by_split[split]), out_root / f"{split}.tsv" ) # Generate vocab vocab_name, spm_filename = None, None if id_to_alignment is not None or args.ipa_vocab: vocab = Counter() for t in manifest_by_split["train"]["tgt_text"]: vocab.update(t.split(" ")) vocab_name = "vocab.txt" with open(out_root / vocab_name, "w") as f: for s, c in vocab.most_common(): f.write(f"{s} {c}\n") else: spm_filename_prefix = "spm_char" spm_filename = f"{spm_filename_prefix}.model" with NamedTemporaryFile(mode="w") as f: for t in manifest_by_split["train"]["tgt_text"]: f.write(t + "\n") f.flush() # needed to ensure gen_vocab sees dumped text gen_vocab(Path(f.name), out_root / spm_filename_prefix, "char") # Generate speaker list speakers = sorted({sample["speaker"] for sample in samples}) speakers_path = out_root / "speakers.txt" with open(speakers_path, "w") as f: for speaker in speakers: f.write(f"{speaker}\n") # Generate config YAML win_len_t = args.win_length / args.sample_rate hop_len_t = args.hop_length / args.sample_rate extra = { "sample_rate": args.sample_rate, "features": { "type": "spectrogram+melscale+log", "eps": 1e-5, "n_mels": args.n_mels, "n_fft": args.n_fft, "window_fn": "hann", "win_length": args.win_length, "hop_length": args.hop_length, "sample_rate": args.sample_rate, "win_len_t": win_len_t, "hop_len_t": hop_len_t, "f_min": args.f_min, "f_max": args.f_max, "n_stft": args.n_fft // 2 + 1 } } if len(speakers) > 1: extra["speaker_set_filename"] = "speakers.txt" if args.add_fastspeech_targets: pitch_min, pitch_max = get_feature_value_min_max( [(out_root / n).as_posix() for n in pitch_paths.values()] ) energy_min, energy_max = get_feature_value_min_max( [(out_root / n).as_posix() for n in energy_paths.values()] ) extra["features"]["pitch_min"] = pitch_min extra["features"]["pitch_max"] = pitch_max extra["features"]["energy_min"] = energy_min extra["features"]["energy_max"] = energy_max gen_config_yaml( out_root, spm_filename=spm_filename, vocab_name=vocab_name, audio_root=out_root.as_posix(), input_channels=None, input_feat_per_channel=None, specaugment_policy=None, cmvn_type="global", gcmvn_path=gcmvn_npz_path, extra=extra ) def main(): parser = argparse.ArgumentParser() parser.add_argument("--audio-manifest-root", "-m", required=True, type=str) parser.add_argument("--output-root", "-o", required=True, type=str) parser.add_argument("--splits", "-s", type=str, nargs="+", default=["train", "dev", "test"]) parser.add_argument("--ipa-vocab", action="store_true") parser.add_argument("--use-g2p", action="store_true") parser.add_argument("--lang", type=str, default="en-us") parser.add_argument("--win-length", type=int, default=1024) parser.add_argument("--hop-length", type=int, default=256) parser.add_argument("--n-fft", type=int, default=1024) parser.add_argument("--n-mels", type=int, default=80) parser.add_argument("--f-min", type=int, default=20) parser.add_argument("--f-max", type=int, default=8000) parser.add_argument("--sample-rate", type=int, default=22050) parser.add_argument("--normalize-volume", "-n", action="store_true") parser.add_argument("--textgrid-zip", type=str, default=None) parser.add_argument("--id-to-units-tsv", type=str, default=None) parser.add_argument("--add-fastspeech-targets", action="store_true") parser.add_argument("--snr-threshold", type=float, default=None) parser.add_argument("--cer-threshold", type=float, default=None) parser.add_argument("--cer-tsv-path", type=str, default="") args = parser.parse_args() process(args) if __name__ == "__main__": main()
11,171
41.479087
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/get_common_voice_audio_manifest.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging from pathlib import Path from collections import defaultdict from typing import List, Dict, Tuple import pandas as pd import numpy as np import torchaudio from tqdm import tqdm from examples.speech_to_text.data_utils import load_df_from_tsv, save_df_to_tsv log = logging.getLogger(__name__) SPLITS = ["train", "dev", "test"] def get_top_n( root: Path, n_speakers: int = 10, min_n_tokens: int = 5 ) -> pd.DataFrame: df = load_df_from_tsv(root / "validated.tsv") df["n_tokens"] = [len(s.split()) for s in df["sentence"]] df = df[df["n_tokens"] >= min_n_tokens] df["n_frames"] = [ torchaudio.info((root / "clips" / p).as_posix()).num_frames for p in tqdm(df["path"]) ] df["id"] = [Path(p).stem for p in df["path"]] total_duration_ms = df.groupby("client_id")["n_frames"].agg(["sum"]) total_duration_ms = total_duration_ms.sort_values("sum", ascending=False) top_n_total_duration_ms = total_duration_ms.head(n_speakers) top_n_client_ids = set(top_n_total_duration_ms.index.tolist()) df_top_n = df[df["client_id"].isin(top_n_client_ids)] return df_top_n def get_splits( df, train_split_ratio=0.99, speaker_in_all_splits=False, rand_seed=0 ) -> Tuple[Dict[str, str], List[str]]: np.random.seed(rand_seed) dev_split_ratio = (1. - train_split_ratio) / 3 grouped = list(df.groupby("client_id")) id_to_split = {} for _, cur_df in tqdm(grouped): cur_n_examples = len(cur_df) if speaker_in_all_splits and cur_n_examples < 3: continue cur_n_train = int(cur_n_examples * train_split_ratio) cur_n_dev = int(cur_n_examples * dev_split_ratio) cur_n_test = cur_n_examples - cur_n_dev - cur_n_train if speaker_in_all_splits and cur_n_dev * cur_n_test == 0: cur_n_dev, cur_n_test = 1, 1 cur_n_train = cur_n_examples - cur_n_dev - cur_n_test cur_indices = cur_df.index.tolist() cur_shuffled_indices = np.random.permutation(cur_n_examples) cur_shuffled_indices = [cur_indices[i] for i in cur_shuffled_indices] cur_indices_by_split = { "train": cur_shuffled_indices[:cur_n_train], "dev": cur_shuffled_indices[cur_n_train: cur_n_train + cur_n_dev], "test": cur_shuffled_indices[cur_n_train + cur_n_dev:] } for split in SPLITS: for i in cur_indices_by_split[split]: id_ = df["id"].loc[i] id_to_split[id_] = split return id_to_split, sorted(df["client_id"].unique()) def convert_to_wav(root: Path, filenames: List[str], target_sr=16_000): out_root = root / "wav" out_root.mkdir(exist_ok=True, parents=True) print("Converting to WAV...") for n in tqdm(filenames): in_path = (root / "clips" / n).as_posix() waveform, sr = torchaudio.load(in_path) converted, converted_sr = torchaudio.sox_effects.apply_effects_tensor( waveform, sr, [["rate", str(target_sr)], ["channels", "1"]] ) out_path = (out_root / Path(n).with_suffix(".wav").name).as_posix() torchaudio.save(out_path, converted, converted_sr, encoding="PCM_S", bits_per_sample=16) def process(args): data_root = Path(args.data_root).absolute() / args.lang # Generate TSV manifest print("Generating manifest...") df_top_n = get_top_n(data_root) id_to_split, speakers = get_splits(df_top_n) if args.convert_to_wav: convert_to_wav(data_root, df_top_n["path"].tolist()) manifest_by_split = {split: defaultdict(list) for split in SPLITS} for sample in tqdm(df_top_n.to_dict(orient="index").values()): sample_id = sample["id"] split = id_to_split[sample_id] manifest_by_split[split]["id"].append(sample_id) if args.convert_to_wav: audio_path = data_root / "wav" / f"{sample_id}.wav" else: audio_path = data_root / "clips" / f"{sample_id}.mp3" manifest_by_split[split]["audio"].append(audio_path.as_posix()) manifest_by_split[split]["n_frames"].append(sample["n_frames"]) manifest_by_split[split]["tgt_text"].append(sample["sentence"]) manifest_by_split[split]["speaker"].append(sample["client_id"]) manifest_by_split[split]["src_text"].append(sample["sentence"]) output_root = Path(args.output_manifest_root).absolute() output_root.mkdir(parents=True, exist_ok=True) for split in SPLITS: save_df_to_tsv( pd.DataFrame.from_dict(manifest_by_split[split]), output_root / f"{split}.audio.tsv" ) def main(): parser = argparse.ArgumentParser() parser.add_argument("--data-root", "-d", required=True, type=str) parser.add_argument("--output-manifest-root", "-m", required=True, type=str) parser.add_argument("--lang", "-l", required=True, type=str) parser.add_argument("--convert-to-wav", action="store_true") args = parser.parse_args() process(args) if __name__ == "__main__": main()
5,277
36.432624
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/denoise_and_vad_audio.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging import os import csv import tempfile from collections import defaultdict from pathlib import Path import torchaudio try: import webrtcvad except ImportError: raise ImportError("Please install py-webrtcvad: pip install webrtcvad") import pandas as pd from tqdm import tqdm from examples.speech_synthesis.preprocessing.denoiser.pretrained import master64 import examples.speech_synthesis.preprocessing.denoiser.utils as utils from examples.speech_synthesis.preprocessing.vad import ( frame_generator, vad_collector, read_wave, write_wave, FS_MS, THRESHOLD, SCALE ) from examples.speech_to_text.data_utils import save_df_to_tsv log = logging.getLogger(__name__) PATHS = ["after_denoise", "after_vad"] MIN_T = 0.05 def generate_tmp_filename(extension="txt"): return tempfile._get_default_tempdir() + "/" + \ next(tempfile._get_candidate_names()) + "." + extension def convert_sr(inpath, sr, output_path=None): if not output_path: output_path = generate_tmp_filename("wav") cmd = f"sox {inpath} -r {sr} {output_path}" os.system(cmd) return output_path def apply_vad(vad, inpath): audio, sample_rate = read_wave(inpath) frames = frame_generator(FS_MS, audio, sample_rate) frames = list(frames) segments = vad_collector(sample_rate, FS_MS, 300, vad, frames) merge_segments = list() timestamp_start = 0.0 timestamp_end = 0.0 # removing start, end, and long sequences of sils for i, segment in enumerate(segments): merge_segments.append(segment[0]) if i and timestamp_start: sil_duration = segment[1] - timestamp_end if sil_duration > THRESHOLD: merge_segments.append(int(THRESHOLD / SCALE) * (b'\x00')) else: merge_segments.append(int((sil_duration / SCALE)) * (b'\x00')) timestamp_start = segment[1] timestamp_end = segment[2] segment = b''.join(merge_segments) return segment, sample_rate def write(wav, filename, sr=16_000): # Normalize audio if it prevents clipping wav = wav / max(wav.abs().max().item(), 1) torchaudio.save(filename, wav.cpu(), sr, encoding="PCM_S", bits_per_sample=16) def process(args): # making sure we are requested either denoise or vad if not args.denoise and not args.vad: log.error("No denoise or vad is requested.") return log.info("Creating out directories...") if args.denoise: out_denoise = Path(args.output_dir).absolute().joinpath(PATHS[0]) out_denoise.mkdir(parents=True, exist_ok=True) if args.vad: out_vad = Path(args.output_dir).absolute().joinpath(PATHS[1]) out_vad.mkdir(parents=True, exist_ok=True) log.info("Loading pre-trained speech enhancement model...") model = master64().to(args.device) log.info("Building the VAD model...") vad = webrtcvad.Vad(int(args.vad_agg_level)) # preparing the output dict output_dict = defaultdict(list) log.info(f"Parsing input manifest: {args.audio_manifest}") with open(args.audio_manifest, "r") as f: manifest_dict = csv.DictReader(f, delimiter="\t") for row in tqdm(manifest_dict): filename = str(row["audio"]) final_output = filename keep_sample = True n_frames = row["n_frames"] snr = -1 if args.denoise: output_path_denoise = out_denoise.joinpath(Path(filename).name) # convert to 16khz in case we use a differet sr tmp_path = convert_sr(final_output, 16000) # loading audio file and generating the enhanced version out, sr = torchaudio.load(tmp_path) out = out.to(args.device) estimate = model(out) estimate = (1 - args.dry_wet) * estimate + args.dry_wet * out write(estimate[0], str(output_path_denoise), sr) snr = utils.cal_snr(out, estimate) snr = snr.cpu().detach().numpy()[0][0] final_output = str(output_path_denoise) if args.vad: output_path_vad = out_vad.joinpath(Path(filename).name) sr = torchaudio.info(final_output).sample_rate if sr in [16000, 32000, 48000]: tmp_path = final_output elif sr < 16000: tmp_path = convert_sr(final_output, 16000) elif sr < 32000: tmp_path = convert_sr(final_output, 32000) else: tmp_path = convert_sr(final_output, 48000) # apply VAD segment, sample_rate = apply_vad(vad, tmp_path) if len(segment) < sample_rate * MIN_T: keep_sample = False print(( f"WARNING: skip {filename} because it is too short " f"after VAD ({len(segment) / sample_rate} < {MIN_T})" )) else: if sample_rate != sr: tmp_path = generate_tmp_filename("wav") write_wave(tmp_path, segment, sample_rate) convert_sr(tmp_path, sr, output_path=str(output_path_vad)) else: write_wave(str(output_path_vad), segment, sample_rate) final_output = str(output_path_vad) segment, _ = torchaudio.load(final_output) n_frames = segment.size(1) if keep_sample: output_dict["id"].append(row["id"]) output_dict["audio"].append(final_output) output_dict["n_frames"].append(n_frames) output_dict["tgt_text"].append(row["tgt_text"]) output_dict["speaker"].append(row["speaker"]) output_dict["src_text"].append(row["src_text"]) output_dict["snr"].append(snr) out_tsv_path = Path(args.output_dir) / Path(args.audio_manifest).name log.info(f"Saving manifest to {out_tsv_path.as_posix()}") save_df_to_tsv(pd.DataFrame.from_dict(output_dict), out_tsv_path) def main(): parser = argparse.ArgumentParser() parser.add_argument("--audio-manifest", "-i", required=True, type=str, help="path to the input manifest.") parser.add_argument( "--output-dir", "-o", required=True, type=str, help="path to the output dir. it will contain files after denoising and" " vad" ) parser.add_argument("--vad-agg-level", "-a", type=int, default=2, help="the aggresive level of the vad [0-3].") parser.add_argument( "--dry-wet", "-dw", type=float, default=0.01, help="the level of linear interpolation between noisy and enhanced " "files." ) parser.add_argument( "--device", "-d", type=str, default="cpu", help="the device to be used for the speech enhancement model: " "cpu | cuda." ) parser.add_argument("--denoise", action="store_true", help="apply a denoising") parser.add_argument("--vad", action="store_true", help="apply a VAD") args = parser.parse_args() process(args) if __name__ == "__main__": main()
7,655
36.346341
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/get_ljspeech_audio_manifest.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging from pathlib import Path from collections import defaultdict import pandas as pd from torchaudio.datasets import LJSPEECH from tqdm import tqdm from examples.speech_to_text.data_utils import save_df_to_tsv log = logging.getLogger(__name__) SPLITS = ["train", "dev", "test"] def process(args): out_root = Path(args.output_data_root).absolute() out_root.mkdir(parents=True, exist_ok=True) # Generate TSV manifest print("Generating manifest...") # following FastSpeech's splits dataset = LJSPEECH(out_root.as_posix(), download=True) id_to_split = {} for x in dataset._flist: id_ = x[0] speaker = id_.split("-")[0] id_to_split[id_] = { "LJ001": "test", "LJ002": "test", "LJ003": "dev" }.get(speaker, "train") manifest_by_split = {split: defaultdict(list) for split in SPLITS} progress = tqdm(enumerate(dataset), total=len(dataset)) for i, (waveform, _, utt, normalized_utt) in progress: sample_id = dataset._flist[i][0] split = id_to_split[sample_id] manifest_by_split[split]["id"].append(sample_id) audio_path = f"{dataset._path}/{sample_id}.wav" manifest_by_split[split]["audio"].append(audio_path) manifest_by_split[split]["n_frames"].append(len(waveform[0])) manifest_by_split[split]["tgt_text"].append(normalized_utt) manifest_by_split[split]["speaker"].append("ljspeech") manifest_by_split[split]["src_text"].append(utt) manifest_root = Path(args.output_manifest_root).absolute() manifest_root.mkdir(parents=True, exist_ok=True) for split in SPLITS: save_df_to_tsv( pd.DataFrame.from_dict(manifest_by_split[split]), manifest_root / f"{split}.audio.tsv" ) def main(): parser = argparse.ArgumentParser() parser.add_argument("--output-data-root", "-d", required=True, type=str) parser.add_argument("--output-manifest-root", "-m", required=True, type=str) args = parser.parse_args() process(args) if __name__ == "__main__": main()
2,288
31.239437
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/get_vctk_audio_manifest.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import logging import numpy as np import re from pathlib import Path from collections import defaultdict import pandas as pd from torchaudio.datasets import VCTK from tqdm import tqdm from examples.speech_to_text.data_utils import save_df_to_tsv log = logging.getLogger(__name__) SPLITS = ["train", "dev", "test"] def normalize_text(text): return re.sub(r"[^a-zA-Z.?!,'\- ]", '', text) def process(args): out_root = Path(args.output_data_root).absolute() out_root.mkdir(parents=True, exist_ok=True) # Generate TSV manifest print("Generating manifest...") dataset = VCTK(out_root.as_posix(), download=False) ids = list(dataset._walker) np.random.seed(args.seed) np.random.shuffle(ids) n_train = len(ids) - args.n_dev - args.n_test _split = ["train"] * n_train + ["dev"] * args.n_dev + ["test"] * args.n_test id_to_split = dict(zip(ids, _split)) manifest_by_split = {split: defaultdict(list) for split in SPLITS} progress = tqdm(enumerate(dataset), total=len(dataset)) for i, (waveform, _, text, speaker_id, _) in progress: sample_id = dataset._walker[i] _split = id_to_split[sample_id] audio_dir = Path(dataset._path) / dataset._folder_audio / speaker_id audio_path = audio_dir / f"{sample_id}.wav" text = normalize_text(text) manifest_by_split[_split]["id"].append(sample_id) manifest_by_split[_split]["audio"].append(audio_path.as_posix()) manifest_by_split[_split]["n_frames"].append(len(waveform[0])) manifest_by_split[_split]["tgt_text"].append(text) manifest_by_split[_split]["speaker"].append(speaker_id) manifest_by_split[_split]["src_text"].append(text) manifest_root = Path(args.output_manifest_root).absolute() manifest_root.mkdir(parents=True, exist_ok=True) for _split in SPLITS: save_df_to_tsv( pd.DataFrame.from_dict(manifest_by_split[_split]), manifest_root / f"{_split}.audio.tsv" ) def main(): parser = argparse.ArgumentParser() parser.add_argument("--output-data-root", "-d", required=True, type=str) parser.add_argument("--output-manifest-root", "-m", required=True, type=str) parser.add_argument("--n-dev", default=50, type=int) parser.add_argument("--n-test", default=100, type=int) parser.add_argument("--seed", "-s", default=1234, type=int) args = parser.parse_args() process(args) if __name__ == "__main__": main()
2,685
32.575
80
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/get_speaker_embedding.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse from collections import defaultdict from itertools import chain from pathlib import Path import numpy as np import torchaudio import torchaudio.sox_effects as ta_sox import yaml from tqdm import tqdm from examples.speech_to_text.data_utils import load_tsv_to_dicts from examples.speech_synthesis.preprocessing.speaker_embedder import SpkrEmbedder def extract_embedding(audio_path, embedder): wav, sr = torchaudio.load(audio_path) # 2D if sr != embedder.RATE: wav, sr = ta_sox.apply_effects_tensor( wav, sr, [["rate", str(embedder.RATE)]] ) try: emb = embedder([wav[0].cuda().float()]).cpu().numpy() except RuntimeError: emb = None return emb def process(args): print("Fetching data...") raw_manifest_root = Path(args.raw_manifest_root).absolute() samples = [load_tsv_to_dicts(raw_manifest_root / (s + ".tsv")) for s in args.splits] samples = list(chain(*samples)) with open(args.config, "r") as f: config = yaml.load(f, Loader=yaml.FullLoader) with open(f"{config['audio_root']}/{config['speaker_set_filename']}") as f: speaker_to_id = {r.strip(): i for i, r in enumerate(f)} embedder = SpkrEmbedder(args.ckpt).cuda() speaker_to_cnt = defaultdict(float) speaker_to_emb = defaultdict(float) for sample in tqdm(samples, desc="extract emb"): emb = extract_embedding(sample["audio"], embedder) if emb is not None: speaker_to_cnt[sample["speaker"]] += 1 speaker_to_emb[sample["speaker"]] += emb if len(speaker_to_emb) != len(speaker_to_id): missed = set(speaker_to_id) - set(speaker_to_emb.keys()) print( f"WARNING: missing embeddings for {len(missed)} speaker:\n{missed}" ) speaker_emb_mat = np.zeros((len(speaker_to_id), len(emb)), float) for speaker in speaker_to_emb: idx = speaker_to_id[speaker] emb = speaker_to_emb[speaker] cnt = speaker_to_cnt[speaker] speaker_emb_mat[idx, :] = emb / cnt speaker_emb_name = "speaker_emb.npy" speaker_emb_path = f"{config['audio_root']}/{speaker_emb_name}" np.save(speaker_emb_path, speaker_emb_mat) config["speaker_emb_filename"] = speaker_emb_name with open(args.new_config, "w") as f: yaml.dump(config, f) def main(): parser = argparse.ArgumentParser() parser.add_argument("--raw-manifest-root", "-m", required=True, type=str) parser.add_argument("--splits", "-s", type=str, nargs="+", default=["train"]) parser.add_argument("--config", "-c", required=True, type=str) parser.add_argument("--new-config", "-n", required=True, type=str) parser.add_argument("--ckpt", required=True, type=str, help="speaker embedder checkpoint") args = parser.parse_args() process(args) if __name__ == "__main__": main()
3,116
33.633333
81
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/denoiser/resample.py
# Copyright (c) Facebook, Inc. and its affiliates. # All rights reserved. # # This source code is licensed under the license found in the # LICENSE file in the root directory of this source tree. # author: adefossez import math import torch as th from torch.nn import functional as F def sinc(t): """sinc. :param t: the input tensor """ return th.where(t == 0, th.tensor(1., device=t.device, dtype=t.dtype), th.sin(t) / t) def kernel_upsample2(zeros=56): """kernel_upsample2. """ win = th.hann_window(4 * zeros + 1, periodic=False) winodd = win[1::2] t = th.linspace(-zeros + 0.5, zeros - 0.5, 2 * zeros) t *= math.pi kernel = (sinc(t) * winodd).view(1, 1, -1) return kernel def upsample2(x, zeros=56): """ Upsampling the input by 2 using sinc interpolation. Smith, Julius, and Phil Gossett. "A flexible sampling-rate conversion method." ICASSP'84. IEEE International Conference on Acoustics, Speech, and Signal Processing. Vol. 9. IEEE, 1984. """ *other, time = x.shape kernel = kernel_upsample2(zeros).to(x) out = F.conv1d(x.view(-1, 1, time), kernel, padding=zeros)[..., 1:].view( *other, time ) y = th.stack([x, out], dim=-1) return y.view(*other, -1) def kernel_downsample2(zeros=56): """kernel_downsample2. """ win = th.hann_window(4 * zeros + 1, periodic=False) winodd = win[1::2] t = th.linspace(-zeros + 0.5, zeros - 0.5, 2 * zeros) t.mul_(math.pi) kernel = (sinc(t) * winodd).view(1, 1, -1) return kernel def downsample2(x, zeros=56): """ Downsampling the input by 2 using sinc interpolation. Smith, Julius, and Phil Gossett. "A flexible sampling-rate conversion method." ICASSP'84. IEEE International Conference on Acoustics, Speech, and Signal Processing. Vol. 9. IEEE, 1984. """ if x.shape[-1] % 2 != 0: x = F.pad(x, (0, 1)) xeven = x[..., ::2] xodd = x[..., 1::2] *other, time = xodd.shape kernel = kernel_downsample2(zeros).to(x) out = xeven + F.conv1d( xodd.view(-1, 1, time), kernel, padding=zeros )[..., :-1].view(*other, time) return out.view(*other, -1).mul(0.5)
2,226
26.8375
89
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/denoiser/demucs.py
# Copyright (c) Facebook, Inc. and its affiliates. # All rights reserved. # # This source code is licensed under the license found in the # LICENSE file in the root directory of this source tree. # author: adefossez import math import time import torch as th from torch import nn from torch.nn import functional as F from .resample import downsample2, upsample2 from .utils import capture_init class BLSTM(nn.Module): def __init__(self, dim, layers=2, bi=True): super().__init__() klass = nn.LSTM self.lstm = klass( bidirectional=bi, num_layers=layers, hidden_size=dim, input_size=dim ) self.linear = None if bi: self.linear = nn.Linear(2 * dim, dim) def forward(self, x, hidden=None): x, hidden = self.lstm(x, hidden) if self.linear: x = self.linear(x) return x, hidden def rescale_conv(conv, reference): std = conv.weight.std().detach() scale = (std / reference)**0.5 conv.weight.data /= scale if conv.bias is not None: conv.bias.data /= scale def rescale_module(module, reference): for sub in module.modules(): if isinstance(sub, (nn.Conv1d, nn.ConvTranspose1d)): rescale_conv(sub, reference) class Demucs(nn.Module): """ Demucs speech enhancement model. Args: - chin (int): number of input channels. - chout (int): number of output channels. - hidden (int): number of initial hidden channels. - depth (int): number of layers. - kernel_size (int): kernel size for each layer. - stride (int): stride for each layer. - causal (bool): if false, uses BiLSTM instead of LSTM. - resample (int): amount of resampling to apply to the input/output. Can be one of 1, 2 or 4. - growth (float): number of channels is multiplied by this for every layer. - max_hidden (int): maximum number of channels. Can be useful to control the size/speed of the model. - normalize (bool): if true, normalize the input. - glu (bool): if true uses GLU instead of ReLU in 1x1 convolutions. - rescale (float): controls custom weight initialization. See https://arxiv.org/abs/1911.13254. - floor (float): stability flooring when normalizing. """ @capture_init def __init__(self, chin=1, chout=1, hidden=48, depth=5, kernel_size=8, stride=4, causal=True, resample=4, growth=2, max_hidden=10_000, normalize=True, glu=True, rescale=0.1, floor=1e-3): super().__init__() if resample not in [1, 2, 4]: raise ValueError("Resample should be 1, 2 or 4.") self.chin = chin self.chout = chout self.hidden = hidden self.depth = depth self.kernel_size = kernel_size self.stride = stride self.causal = causal self.floor = floor self.resample = resample self.normalize = normalize self.encoder = nn.ModuleList() self.decoder = nn.ModuleList() activation = nn.GLU(1) if glu else nn.ReLU() ch_scale = 2 if glu else 1 for index in range(depth): encode = [] encode += [ nn.Conv1d(chin, hidden, kernel_size, stride), nn.ReLU(), nn.Conv1d(hidden, hidden * ch_scale, 1), activation, ] self.encoder.append(nn.Sequential(*encode)) decode = [] decode += [ nn.Conv1d(hidden, ch_scale * hidden, 1), activation, nn.ConvTranspose1d(hidden, chout, kernel_size, stride), ] if index > 0: decode.append(nn.ReLU()) self.decoder.insert(0, nn.Sequential(*decode)) chout = hidden chin = hidden hidden = min(int(growth * hidden), max_hidden) self.lstm = BLSTM(chin, bi=not causal) if rescale: rescale_module(self, reference=rescale) def valid_length(self, length): """ Return the nearest valid length to use with the model so that there is no time steps left over in a convolutions, e.g. for all layers, size of the input - kernel_size % stride = 0. If the mixture has a valid length, the estimated sources will have exactly the same length. """ length = math.ceil(length * self.resample) for _ in range(self.depth): length = math.ceil((length - self.kernel_size) / self.stride) + 1 length = max(length, 1) for _ in range(self.depth): length = (length - 1) * self.stride + self.kernel_size length = int(math.ceil(length / self.resample)) return int(length) @property def total_stride(self): return self.stride ** self.depth // self.resample def forward(self, mix): if mix.dim() == 2: mix = mix.unsqueeze(1) if self.normalize: mono = mix.mean(dim=1, keepdim=True) std = mono.std(dim=-1, keepdim=True) mix = mix / (self.floor + std) else: std = 1 length = mix.shape[-1] x = mix x = F.pad(x, (0, self.valid_length(length) - length)) if self.resample == 2: x = upsample2(x) elif self.resample == 4: x = upsample2(x) x = upsample2(x) skips = [] for encode in self.encoder: x = encode(x) skips.append(x) x = x.permute(2, 0, 1) x, _ = self.lstm(x) x = x.permute(1, 2, 0) for decode in self.decoder: skip = skips.pop(-1) x = x + skip[..., :x.shape[-1]] x = decode(x) if self.resample == 2: x = downsample2(x) elif self.resample == 4: x = downsample2(x) x = downsample2(x) x = x[..., :length] return std * x def fast_conv(conv, x): """ Faster convolution evaluation if either kernel size is 1 or length of sequence is 1. """ batch, chin, length = x.shape chout, chin, kernel = conv.weight.shape assert batch == 1 if kernel == 1: x = x.view(chin, length) out = th.addmm(conv.bias.view(-1, 1), conv.weight.view(chout, chin), x) elif length == kernel: x = x.view(chin * kernel, 1) out = th.addmm(conv.bias.view(-1, 1), conv.weight.view(chout, chin * kernel), x) else: out = conv(x) return out.view(batch, chout, -1) class DemucsStreamer: """ Streaming implementation for Demucs. It supports being fed with any amount of audio at a time. You will get back as much audio as possible at that point. Args: - demucs (Demucs): Demucs model. - dry (float): amount of dry (e.g. input) signal to keep. 0 is maximum noise removal, 1 just returns the input signal. Small values > 0 allows to limit distortions. - num_frames (int): number of frames to process at once. Higher values will increase overall latency but improve the real time factor. - resample_lookahead (int): extra lookahead used for the resampling. - resample_buffer (int): size of the buffer of previous inputs/outputs kept for resampling. """ def __init__(self, demucs, dry=0, num_frames=1, resample_lookahead=64, resample_buffer=256): device = next(iter(demucs.parameters())).device self.demucs = demucs self.lstm_state = None self.conv_state = None self.dry = dry self.resample_lookahead = resample_lookahead resample_buffer = min(demucs.total_stride, resample_buffer) self.resample_buffer = resample_buffer self.frame_length = demucs.valid_length(1) + \ demucs.total_stride * (num_frames - 1) self.total_length = self.frame_length + self.resample_lookahead self.stride = demucs.total_stride * num_frames self.resample_in = th.zeros(demucs.chin, resample_buffer, device=device) self.resample_out = th.zeros( demucs.chin, resample_buffer, device=device ) self.frames = 0 self.total_time = 0 self.variance = 0 self.pending = th.zeros(demucs.chin, 0, device=device) bias = demucs.decoder[0][2].bias weight = demucs.decoder[0][2].weight chin, chout, kernel = weight.shape self._bias = bias.view(-1, 1).repeat(1, kernel).view(-1, 1) self._weight = weight.permute(1, 2, 0).contiguous() def reset_time_per_frame(self): self.total_time = 0 self.frames = 0 @property def time_per_frame(self): return self.total_time / self.frames def flush(self): """ Flush remaining audio by padding it with zero. Call this when you have no more input and want to get back the last chunk of audio. """ pending_length = self.pending.shape[1] padding = th.zeros( self.demucs.chin, self.total_length, device=self.pending.device ) out = self.feed(padding) return out[:, :pending_length] def feed(self, wav): """ Apply the model to mix using true real time evaluation. Normalization is done online as is the resampling. """ begin = time.time() demucs = self.demucs resample_buffer = self.resample_buffer stride = self.stride resample = demucs.resample if wav.dim() != 2: raise ValueError("input wav should be two dimensional.") chin, _ = wav.shape if chin != demucs.chin: raise ValueError(f"Expected {demucs.chin} channels, got {chin}") self.pending = th.cat([self.pending, wav], dim=1) outs = [] while self.pending.shape[1] >= self.total_length: self.frames += 1 frame = self.pending[:, :self.total_length] dry_signal = frame[:, :stride] if demucs.normalize: mono = frame.mean(0) variance = (mono**2).mean() self.variance = variance / self.frames + \ (1 - 1 / self.frames) * self.variance frame = frame / (demucs.floor + math.sqrt(self.variance)) frame = th.cat([self.resample_in, frame], dim=-1) self.resample_in[:] = frame[:, stride - resample_buffer:stride] if resample == 4: frame = upsample2(upsample2(frame)) elif resample == 2: frame = upsample2(frame) # remove pre sampling buffer frame = frame[:, resample * resample_buffer:] # remove extra samples after window frame = frame[:, :resample * self.frame_length] out, extra = self._separate_frame(frame) padded_out = th.cat([self.resample_out, out, extra], 1) self.resample_out[:] = out[:, -resample_buffer:] if resample == 4: out = downsample2(downsample2(padded_out)) elif resample == 2: out = downsample2(padded_out) else: out = padded_out out = out[:, resample_buffer // resample:] out = out[:, :stride] if demucs.normalize: out *= math.sqrt(self.variance) out = self.dry * dry_signal + (1 - self.dry) * out outs.append(out) self.pending = self.pending[:, stride:] self.total_time += time.time() - begin if outs: out = th.cat(outs, 1) else: out = th.zeros(chin, 0, device=wav.device) return out def _separate_frame(self, frame): demucs = self.demucs skips = [] next_state = [] first = self.conv_state is None stride = self.stride * demucs.resample x = frame[None] for idx, encode in enumerate(demucs.encoder): stride //= demucs.stride length = x.shape[2] if idx == demucs.depth - 1: # This is sligthly faster for the last conv x = fast_conv(encode[0], x) x = encode[1](x) x = fast_conv(encode[2], x) x = encode[3](x) else: if not first: prev = self.conv_state.pop(0) prev = prev[..., stride:] tgt = (length - demucs.kernel_size) // demucs.stride + 1 missing = tgt - prev.shape[-1] offset = length - demucs.kernel_size - \ demucs.stride * (missing - 1) x = x[..., offset:] x = encode[1](encode[0](x)) x = fast_conv(encode[2], x) x = encode[3](x) if not first: x = th.cat([prev, x], -1) next_state.append(x) skips.append(x) x = x.permute(2, 0, 1) x, self.lstm_state = demucs.lstm(x, self.lstm_state) x = x.permute(1, 2, 0) # In the following, x contains only correct samples, i.e. the one # for which each time position is covered by two window of the upper # layer. extra contains extra samples to the right, and is used only as # a better padding for the online resampling. extra = None for idx, decode in enumerate(demucs.decoder): skip = skips.pop(-1) x += skip[..., :x.shape[-1]] x = fast_conv(decode[0], x) x = decode[1](x) if extra is not None: skip = skip[..., x.shape[-1]:] extra += skip[..., :extra.shape[-1]] extra = decode[2](decode[1](decode[0](extra))) x = decode[2](x) next_state.append( x[..., -demucs.stride:] - decode[2].bias.view(-1, 1) ) if extra is None: extra = x[..., -demucs.stride:] else: extra[..., :demucs.stride] += next_state[-1] x = x[..., :-demucs.stride] if not first: prev = self.conv_state.pop(0) x[..., :demucs.stride] += prev if idx != demucs.depth - 1: x = decode[3](x) extra = decode[3](extra) self.conv_state = next_state return x[0], extra[0] def test(): import argparse parser = argparse.ArgumentParser( "denoiser.demucs", description="Benchmark the streaming Demucs implementation, as well as " "checking the delta with the offline implementation.") parser.add_argument("--depth", default=5, type=int) parser.add_argument("--resample", default=4, type=int) parser.add_argument("--hidden", default=48, type=int) parser.add_argument("--sample_rate", default=16000, type=float) parser.add_argument("--device", default="cpu") parser.add_argument("-t", "--num_threads", type=int) parser.add_argument("-f", "--num_frames", type=int, default=1) args = parser.parse_args() if args.num_threads: th.set_num_threads(args.num_threads) sr = args.sample_rate sr_ms = sr / 1000 demucs = Demucs( depth=args.depth, hidden=args.hidden, resample=args.resample ).to(args.device) x = th.randn(1, int(sr * 4)).to(args.device) out = demucs(x[None])[0] streamer = DemucsStreamer(demucs, num_frames=args.num_frames) out_rt = [] frame_size = streamer.total_length with th.no_grad(): while x.shape[1] > 0: out_rt.append(streamer.feed(x[:, :frame_size])) x = x[:, frame_size:] frame_size = streamer.demucs.total_stride out_rt.append(streamer.flush()) out_rt = th.cat(out_rt, 1) model_size = sum(p.numel() for p in demucs.parameters()) * 4 / 2**20 initial_lag = streamer.total_length / sr_ms tpf = 1000 * streamer.time_per_frame print(f"model size: {model_size:.1f}MB, ", end='') print(f"delta batch/streaming: {th.norm(out - out_rt) / th.norm(out):.2%}") print(f"initial lag: {initial_lag:.1f}ms, ", end='') print(f"stride: {streamer.stride * args.num_frames / sr_ms:.1f}ms") print(f"time per frame: {tpf:.1f}ms, ", end='') rtf = (1000 * streamer.time_per_frame) / (streamer.stride / sr_ms) print(f"RTF: {rtf:.2f}") print(f"Total lag with computation: {initial_lag + tpf:.1f}ms") if __name__ == "__main__": test()
16,989
34.843882
83
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/denoiser/utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # All rights reserved. # # This source code is licensed under the license found in the # LICENSE file in the root directory of this source tree. # author: adefossez import functools import logging from contextlib import contextmanager import inspect import time logger = logging.getLogger(__name__) EPS = 1e-8 def capture_init(init): """capture_init. Decorate `__init__` with this, and you can then recover the *args and **kwargs passed to it in `self._init_args_kwargs` """ @functools.wraps(init) def __init__(self, *args, **kwargs): self._init_args_kwargs = (args, kwargs) init(self, *args, **kwargs) return __init__ def deserialize_model(package, strict=False): """deserialize_model. """ klass = package['class'] if strict: model = klass(*package['args'], **package['kwargs']) else: sig = inspect.signature(klass) kw = package['kwargs'] for key in list(kw): if key not in sig.parameters: logger.warning("Dropping inexistant parameter %s", key) del kw[key] model = klass(*package['args'], **kw) model.load_state_dict(package['state']) return model def copy_state(state): return {k: v.cpu().clone() for k, v in state.items()} def serialize_model(model): args, kwargs = model._init_args_kwargs state = copy_state(model.state_dict()) return {"class": model.__class__, "args": args, "kwargs": kwargs, "state": state} @contextmanager def swap_state(model, state): """ Context manager that swaps the state of a model, e.g: # model is in old state with swap_state(model, new_state): # model in new state # model back to old state """ old_state = copy_state(model.state_dict()) model.load_state_dict(state) try: yield finally: model.load_state_dict(old_state) def pull_metric(history, name): out = [] for metrics in history: if name in metrics: out.append(metrics[name]) return out class LogProgress: """ Sort of like tqdm but using log lines and not as real time. Args: - logger: logger obtained from `logging.getLogger`, - iterable: iterable object to wrap - updates (int): number of lines that will be printed, e.g. if `updates=5`, log every 1/5th of the total length. - total (int): length of the iterable, in case it does not support `len`. - name (str): prefix to use in the log. - level: logging level (like `logging.INFO`). """ def __init__(self, logger, iterable, updates=5, total=None, name="LogProgress", level=logging.INFO): self.iterable = iterable self.total = total or len(iterable) self.updates = updates self.name = name self.logger = logger self.level = level def update(self, **infos): self._infos = infos def __iter__(self): self._iterator = iter(self.iterable) self._index = -1 self._infos = {} self._begin = time.time() return self def __next__(self): self._index += 1 try: value = next(self._iterator) except StopIteration: raise else: return value finally: log_every = max(1, self.total // self.updates) # logging is delayed by 1 it, in order to have the metrics from update if self._index >= 1 and self._index % log_every == 0: self._log() def _log(self): self._speed = (1 + self._index) / (time.time() - self._begin) infos = " | ".join(f"{k.capitalize()} {v}" for k, v in self._infos.items()) if self._speed < 1e-4: speed = "oo sec/it" elif self._speed < 0.1: speed = f"{1/self._speed:.1f} sec/it" else: speed = f"{self._speed:.1f} it/sec" out = f"{self.name} | {self._index}/{self.total} | {speed}" if infos: out += " | " + infos self.logger.log(self.level, out) def colorize(text, color): """ Display text with some ANSI color in the terminal. """ code = f"\033[{color}m" restore = "\033[0m" return "".join([code, text, restore]) def bold(text): """ Display text in bold in the terminal. """ return colorize(text, "1") def cal_snr(lbl, est): import torch y = 10.0 * torch.log10( torch.sum(lbl**2, dim=-1) / (torch.sum((est-lbl)**2, dim=-1) + EPS) + EPS ) return y
4,770
25.954802
85
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/denoiser/pretrained.py
# Copyright (c) Facebook, Inc. and its affiliates. # All rights reserved. # # This source code is licensed under the license found in the # LICENSE file in the root directory of this source tree. # author: adefossez import logging import torch.hub from .demucs import Demucs from .utils import deserialize_model logger = logging.getLogger(__name__) ROOT = "https://dl.fbaipublicfiles.com/adiyoss/denoiser/" DNS_48_URL = ROOT + "dns48-11decc9d8e3f0998.th" DNS_64_URL = ROOT + "dns64-a7761ff99a7d5bb6.th" MASTER_64_URL = ROOT + "master64-8a5dfb4bb92753dd.th" def _demucs(pretrained, url, **kwargs): model = Demucs(**kwargs) if pretrained: state_dict = torch.hub.load_state_dict_from_url(url, map_location='cpu') model.load_state_dict(state_dict) return model def dns48(pretrained=True): return _demucs(pretrained, DNS_48_URL, hidden=48) def dns64(pretrained=True): return _demucs(pretrained, DNS_64_URL, hidden=64) def master64(pretrained=True): return _demucs(pretrained, MASTER_64_URL, hidden=64) def add_model_flags(parser): group = parser.add_mutually_exclusive_group(required=False) group.add_argument( "-m", "--model_path", help="Path to local trained model." ) group.add_argument( "--dns48", action="store_true", help="Use pre-trained real time H=48 model trained on DNS." ) group.add_argument( "--dns64", action="store_true", help="Use pre-trained real time H=64 model trained on DNS." ) group.add_argument( "--master64", action="store_true", help="Use pre-trained real time H=64 model trained on DNS and Valentini." ) def get_model(args): """ Load local model package or torchhub pre-trained model. """ if args.model_path: logger.info("Loading model from %s", args.model_path) pkg = torch.load(args.model_path) model = deserialize_model(pkg) elif args.dns64: logger.info("Loading pre-trained real time H=64 model trained on DNS.") model = dns64() elif args.master64: logger.info( "Loading pre-trained real time H=64 model trained on DNS and Valentini." ) model = master64() else: logger.info("Loading pre-trained real time H=48 model trained on DNS.") model = dns48() logger.debug(model) return model
2,384
28.085366
84
py
rej-summ
rej-summ-main/examples/speech_synthesis/preprocessing/speaker_embedder/__init__.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import librosa import torch import torch.nn as nn import torch.nn.functional as F import torch.utils.data import torchaudio EMBEDDER_PARAMS = { 'num_mels': 40, 'n_fft': 512, 'emb_dim': 256, 'lstm_hidden': 768, 'lstm_layers': 3, 'window': 80, 'stride': 40, } def set_requires_grad(nets, requires_grad=False): """Set requies_grad=Fasle for all the networks to avoid unnecessary computations Parameters: nets (network list) -- a list of networks requires_grad (bool) -- whether the networks require gradients or not """ if not isinstance(nets, list): nets = [nets] for net in nets: if net is not None: for param in net.parameters(): param.requires_grad = requires_grad class LinearNorm(nn.Module): def __init__(self, hp): super(LinearNorm, self).__init__() self.linear_layer = nn.Linear(hp["lstm_hidden"], hp["emb_dim"]) def forward(self, x): return self.linear_layer(x) class SpeechEmbedder(nn.Module): def __init__(self, hp): super(SpeechEmbedder, self).__init__() self.lstm = nn.LSTM(hp["num_mels"], hp["lstm_hidden"], num_layers=hp["lstm_layers"], batch_first=True) self.proj = LinearNorm(hp) self.hp = hp def forward(self, mel): # (num_mels, T) -> (num_mels, T', window) mels = mel.unfold(1, self.hp["window"], self.hp["stride"]) mels = mels.permute(1, 2, 0) # (T', window, num_mels) x, _ = self.lstm(mels) # (T', window, lstm_hidden) x = x[:, -1, :] # (T', lstm_hidden), use last frame only x = self.proj(x) # (T', emb_dim) x = x / torch.norm(x, p=2, dim=1, keepdim=True) # (T', emb_dim) x = x.mean(dim=0) if x.norm(p=2) != 0: x = x / x.norm(p=2) return x class SpkrEmbedder(nn.Module): RATE = 16000 def __init__( self, embedder_path, embedder_params=EMBEDDER_PARAMS, rate=16000, hop_length=160, win_length=400, pad=False, ): super(SpkrEmbedder, self).__init__() embedder_pt = torch.load(embedder_path, map_location="cpu") self.embedder = SpeechEmbedder(embedder_params) self.embedder.load_state_dict(embedder_pt) self.embedder.eval() set_requires_grad(self.embedder, requires_grad=False) self.embedder_params = embedder_params self.register_buffer('mel_basis', torch.from_numpy( librosa.filters.mel( sr=self.RATE, n_fft=self.embedder_params["n_fft"], n_mels=self.embedder_params["num_mels"]) ) ) self.resample = None if rate != self.RATE: self.resample = torchaudio.transforms.Resample(rate, self.RATE) self.hop_length = hop_length self.win_length = win_length self.pad = pad def get_mel(self, y): if self.pad and y.shape[-1] < 14000: y = F.pad(y, (0, 14000 - y.shape[-1])) window = torch.hann_window(self.win_length).to(y) y = torch.stft(y, n_fft=self.embedder_params["n_fft"], hop_length=self.hop_length, win_length=self.win_length, window=window) magnitudes = torch.norm(y, dim=-1, p=2) ** 2 mel = torch.log10(self.mel_basis @ magnitudes + 1e-6) return mel def forward(self, inputs): dvecs = [] for wav in inputs: mel = self.get_mel(wav) if mel.dim() == 3: mel = mel.squeeze(0) dvecs += [self.embedder(mel)] dvecs = torch.stack(dvecs) dvec = torch.mean(dvecs, dim=0) dvec = dvec / torch.norm(dvec) return dvec
4,103
29.176471
78
py
rej-summ
rej-summ-main/examples/byte_level_bpe/gru_transformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch.nn as nn import torch.nn.functional as F from fairseq.models import register_model, register_model_architecture from fairseq.models.transformer import TransformerEncoder, TransformerModel @register_model("gru_transformer") class GRUTransformerModel(TransformerModel): @classmethod def build_encoder(cls, args, src_dict, embed_tokens): return GRUTransformerEncoder(args, src_dict, embed_tokens) class GRUTransformerEncoder(TransformerEncoder): def __init__(self, args, dictionary, embed_tokens): super().__init__(args, dictionary, embed_tokens) self.emb_ctx = nn.GRU( input_size=embed_tokens.embedding_dim, hidden_size=embed_tokens.embedding_dim // 2, num_layers=1, bidirectional=True, ) def forward_embedding(self, src_tokens): # embed tokens and positions x = embed = self.embed_scale * self.embed_tokens(src_tokens) if self.embed_positions is not None: x = embed + self.embed_positions(src_tokens) # contextualize embeddings x = x.transpose(0, 1) x = self.dropout_module(x) x, _ = self.emb_ctx.forward(x) x = x.transpose(0, 1) if self.layernorm_embedding is not None: x = self.layernorm_embedding(x) x = self.dropout_module(x) return x, embed @register_model_architecture("gru_transformer", "gru_transformer") def gru_transformer_base_architecture(args): args.encoder_embed_path = getattr(args, "encoder_embed_path", None) args.encoder_embed_dim = getattr(args, "encoder_embed_dim", 512) args.encoder_ffn_embed_dim = getattr(args, "encoder_ffn_embed_dim", 2048) args.encoder_layers = getattr(args, "encoder_layers", 6) args.encoder_attention_heads = getattr(args, "encoder_attention_heads", 8) args.encoder_normalize_before = getattr(args, "encoder_normalize_before", False) args.encoder_learned_pos = getattr(args, "encoder_learned_pos", False) args.decoder_embed_path = getattr(args, "decoder_embed_path", None) args.decoder_embed_dim = getattr(args, "decoder_embed_dim", args.encoder_embed_dim) args.decoder_ffn_embed_dim = getattr( args, "decoder_ffn_embed_dim", args.encoder_ffn_embed_dim ) args.decoder_layers = getattr(args, "decoder_layers", 6) args.decoder_attention_heads = getattr(args, "decoder_attention_heads", 8) args.decoder_normalize_before = getattr(args, "decoder_normalize_before", False) args.decoder_learned_pos = getattr(args, "decoder_learned_pos", False) args.attention_dropout = getattr(args, "attention_dropout", 0.0) args.activation_dropout = getattr(args, "activation_dropout", 0.0) args.activation_fn = getattr(args, "activation_fn", "relu") args.dropout = getattr(args, "dropout", 0.1) args.adaptive_softmax_cutoff = getattr(args, "adaptive_softmax_cutoff", None) args.adaptive_softmax_dropout = getattr(args, "adaptive_softmax_dropout", 0) args.share_decoder_input_output_embed = getattr( args, "share_decoder_input_output_embed", False ) args.share_all_embeddings = getattr(args, "share_all_embeddings", False) args.no_token_positional_embeddings = getattr( args, "no_token_positional_embeddings", False ) args.adaptive_input = getattr(args, "adaptive_input", False) args.no_cross_attention = getattr(args, "no_cross_attention", False) args.cross_self_attention = getattr(args, "cross_self_attention", False) args.layer_wise_attention = getattr(args, "layer_wise_attention", False) args.decoder_output_dim = getattr( args, "decoder_output_dim", args.decoder_embed_dim ) args.decoder_input_dim = getattr(args, "decoder_input_dim", args.decoder_embed_dim) args.no_scale_embedding = getattr(args, "no_scale_embedding", False) args.layernorm_embedding = getattr(args, "layernorm_embedding", False) @register_model_architecture("gru_transformer", "gru_transformer_big") def gru_transformer_big(args): args.encoder_embed_dim = getattr(args, "encoder_embed_dim", 1024) args.encoder_ffn_embed_dim = getattr(args, "encoder_ffn_embed_dim", 4096) args.encoder_attention_heads = getattr(args, "encoder_attention_heads", 16) args.encoder_normalize_before = getattr(args, "encoder_normalize_before", False) args.decoder_embed_dim = getattr(args, "decoder_embed_dim", 1024) args.decoder_ffn_embed_dim = getattr(args, "decoder_ffn_embed_dim", 4096) args.decoder_attention_heads = getattr(args, "decoder_attention_heads", 16) args.dropout = getattr(args, "dropout", 0.3) gru_transformer_base_architecture(args)
5,027
45.555556
87
py
rej-summ
rej-summ-main/examples/simultaneous_translation/modules/monotonic_multihead_attention.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import math import torch from torch import Tensor import torch.nn as nn from examples.simultaneous_translation.utils.p_choose_strategy import ( learnable_p_choose, waitk_p_choose ) from examples.simultaneous_translation.utils.monotonic_attention import ( expected_alignment_from_p_choose, expected_soft_attention, mass_preservation, ) from fairseq.modules import MultiheadAttention from . import register_monotonic_attention from typing import Dict, Optional @register_monotonic_attention("hard_aligned") class MonotonicAttention(MultiheadAttention): """ Abstract class of monotonic attentions """ k_in_proj: Dict[str, nn.Linear] q_in_proj: Dict[str, nn.Linear] def __init__(self, args): super().__init__( embed_dim=args.decoder_embed_dim, num_heads=args.decoder_attention_heads, kdim=getattr(args, "encoder_embed_dim", None), vdim=getattr(args, "encoder_embed_dim", None), dropout=args.attention_dropout, encoder_decoder_attention=True, ) self.soft_attention = False self.eps = getattr(args, "attention_eps", True) self.mass_preservation = getattr(args, "mass_preservation", True) self.noise_type = args.noise_type self.noise_mean = args.noise_mean self.noise_var = args.noise_var self.energy_bias_init = args.energy_bias_init self.energy_bias = ( nn.Parameter(self.energy_bias_init * torch.ones([1])) if args.energy_bias is True else 0 ) self.k_in_proj = {"monotonic": self.k_proj} self.q_in_proj = {"monotonic": self.q_proj} self.chunk_size = None @staticmethod def add_args(parser): # fmt: off parser.add_argument('--no-mass-preservation', action="store_false", dest="mass_preservation", help='Do not stay on the last token when decoding') parser.add_argument('--mass-preservation', action="store_true", dest="mass_preservation", help='Stay on the last token when decoding') parser.set_defaults(mass_preservation=True) parser.add_argument('--noise-var', type=float, default=1.0, help='Variance of discretness noise') parser.add_argument('--noise-mean', type=float, default=0.0, help='Mean of discretness noise') parser.add_argument('--noise-type', type=str, default="flat", help='Type of discretness noise') parser.add_argument('--energy-bias', action="store_true", default=False, help='Bias for energy') parser.add_argument('--energy-bias-init', type=float, default=-2.0, help='Initial value of the bias for energy') parser.add_argument('--attention-eps', type=float, default=1e-6, help='Epsilon when calculating expected attention') def energy_from_qk( self, query: Tensor, key: Tensor, energy_type: str, key_padding_mask: Optional[Tensor] = None, bias: int = 0 ): """ Compute energy from query and key q_func_value is a tuple looks like (q_proj_func, q_tensor) q_tensor size: bsz, tgt_len, emb_dim k_tensor size: bsz, src_len, emb_dim key_padding_mask size: bsz, src_len attn_mask: bsz, src_len """ length, bsz, _ = query.size() q = self.q_in_proj[energy_type].forward(query) q = ( q.contiguous() .view(length, bsz * self.num_heads, self.head_dim) .transpose(0, 1) ) q = q * self.scaling length, bsz, _ = key.size() k = self.k_in_proj[energy_type].forward(key) k = ( k.contiguous() .view(length, bsz * self.num_heads, self.head_dim) .transpose(0, 1) ) energy = torch.bmm(q, k.transpose(1, 2)) + bias if key_padding_mask is not None: energy = energy.masked_fill( key_padding_mask.unsqueeze(1).to(torch.bool), - float("inf") ) return energy def p_choose_from_qk(self, query, key, key_padding_mask, incremental_states=None): monotonic_energy = self.energy_from_qk( query, key, "monotonic", key_padding_mask=key_padding_mask, bias=self.energy_bias, ) p_choose = learnable_p_choose( monotonic_energy, self.noise_mean, self.noise_var, self.training ) return p_choose def p_choose(self, query, key, key_padding_mask, incremental_states=None): return self.p_choose_from_qk(self, query, key, key_padding_mask) def monotonic_attention_process_infer( self, query: Optional[Tensor], key: Optional[Tensor], incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]], ): """ Monotonic attention at inference time Notice that this function is designed for simuleval not sequence_generator """ assert query is not None assert key is not None if query.size(1) != 1: raise RuntimeError( "Simultaneous translation models don't support batch decoding." ) # 1. compute stepwise probability p_choose = self.p_choose( query, key, None, incremental_state ).squeeze(1) # 2. Compute the alpha src_len = key.size(0) # Maximum steps allows in this iteration max_steps = src_len - 1 if self.mass_preservation else src_len monotonic_cache = self._get_monotonic_buffer(incremental_state) # Step for each head monotonic_step = monotonic_cache.get( 'head_step', p_choose.new_zeros(1, self.num_heads).long() ) assert monotonic_step is not None finish_read = monotonic_step.eq(max_steps) p_choose_i = torch.tensor(1) while finish_read.sum().item() < self.num_heads: # p_choose: self.num_heads, src_len # only choose the p at monotonic steps # p_choose_i: 1, self.num_heads p_choose_i = ( p_choose.gather( 1, monotonic_step .clamp(0, src_len - 1), ) ) read_one_step = ( (p_choose_i < 0.5) .type_as(monotonic_step) .masked_fill(finish_read, 0) ) # 1 x bsz # sample actions on unfinished seq # 0 means stay, finish reading # 1 means leave, continue reading monotonic_step += read_one_step finish_read = monotonic_step.eq(max_steps) | (read_one_step == 0) # p_choose at last steps p_choose_i = ( p_choose.gather( 1, monotonic_step .clamp(0, src_len - 1), ) ) monotonic_cache["head_step"] = monotonic_step # Whether a head is looking for new input monotonic_cache["head_read"] = ( monotonic_step.eq(max_steps) & (p_choose_i < 0.5) ) self._set_monotonic_buffer(incremental_state, monotonic_cache) # 2. Update alpha alpha = ( p_choose .new_zeros([self.num_heads, src_len]) .scatter( 1, (monotonic_step) .view(self.num_heads, 1).clamp(0, src_len - 1), 1 ) ) if not self.mass_preservation: alpha = alpha.masked_fill( (monotonic_step == max_steps) .view(self.num_heads, 1), 0 ) # 4. Compute Beta if self.soft_attention: monotonic_step = monotonic_step.t() beta_mask = torch.arange(src_len).expand_as(alpha).gt(monotonic_step).unsqueeze(1) # If it's soft attention just do softmax on current context soft_energy = self.energy_from_qk( query, key, "soft" ) beta = torch.nn.functional.softmax( soft_energy.masked_fill(beta_mask, -float("inf")), dim=-1 ) # It could happen that a head doesn't move at all beta = beta.masked_fill(monotonic_step.eq(0).unsqueeze(1), 0) else: # If it's hard attention just select the last state beta = alpha return p_choose, alpha, beta def monotonic_attention_process_train( self, query: Optional[Tensor], key: Optional[Tensor], key_padding_mask: Optional[Tensor] = None, ): """ Calculating monotonic attention process for training Including: stepwise probability: p_choose expected hard alignment: alpha expected soft attention: beta """ assert query is not None assert key is not None # 1. compute stepwise probability p_choose = self.p_choose_from_qk(query, key, key_padding_mask) # 2. compute expected_alignment alpha = expected_alignment_from_p_choose( p_choose, key_padding_mask, eps=self.eps, ) if self.mass_preservation: alpha = mass_preservation( alpha, key_padding_mask ) # 3. compute expected soft attention (soft aligned model only) if self.soft_attention: soft_energy = self.energy_from_qk( query, key, "soft", key_padding_mask=None, ) beta = expected_soft_attention( alpha, soft_energy, padding_mask=key_padding_mask, chunk_size=self.chunk_size, eps=self.eps, ) else: beta = alpha soft_energy = alpha return p_choose, alpha, beta, soft_energy def forward( self, query: Optional[Tensor], key: Optional[Tensor], value: Optional[Tensor], key_padding_mask: Optional[Tensor] = None, attn_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, need_weights: bool = True, static_kv: bool = False, need_head_weights: bool = False, ): """ query: tgt_len, bsz, embed_dim key: src_len, bsz, embed_dim value: src_len, bsz, embed_dim """ assert attn_mask is None assert query is not None assert key is not None assert value is not None tgt_len, bsz, embed_dim = query.size() src_len = value.size(0) if key_padding_mask is not None: assert not key_padding_mask[:, 0].any(), ( "Only right padding is supported." ) key_padding_mask = ( key_padding_mask .unsqueeze(1) .expand([bsz, self.num_heads, src_len]) .contiguous() .view(-1, src_len) ) if incremental_state is not None: # Inference ( p_choose, alpha, beta ) = self.monotonic_attention_process_infer( query, key, incremental_state ) soft_energy = beta else: # Train ( p_choose, alpha, beta, soft_energy ) = self.monotonic_attention_process_train( query, key, key_padding_mask ) v = self.v_proj(value) length, bsz, _ = v.size() v = ( v.contiguous() .view(length, bsz * self.num_heads, self.head_dim) .transpose(0, 1) ) attn = torch.bmm(beta.type_as(v), v) attn = attn.transpose(0, 1).contiguous().view(tgt_len, bsz, embed_dim) attn = self.out_proj(attn) p_choose = p_choose.view(bsz, self.num_heads, tgt_len, src_len) alpha = alpha.view(bsz, self.num_heads, tgt_len, src_len) beta = beta.view(bsz, self.num_heads, tgt_len, src_len) return attn, { "p_choose": p_choose, "alpha": alpha, "beta": beta, } def _get_monotonic_buffer(self, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]]): maybe_incremental_state = self.get_incremental_state( incremental_state, 'monotonic', ) if maybe_incremental_state is None: typed_empty_dict: Dict[str, Optional[Tensor]] = {} return typed_empty_dict else: return maybe_incremental_state def _set_monotonic_buffer(self, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]], buffer: Dict[str, Optional[Tensor]]): self.set_incremental_state( incremental_state, 'monotonic', buffer, ) @register_monotonic_attention("infinite_lookback") class MonotonicInfiniteLookbackAttention( MonotonicAttention ): def __init__(self, args): super().__init__(args) self.soft_attention = True self.init_soft_attention() def init_soft_attention(self): self.k_proj_soft = nn.Linear(self.kdim, self.embed_dim, bias=True) self.q_proj_soft = nn.Linear(self.embed_dim, self.embed_dim, bias=True) self.k_in_proj["soft"] = self.k_proj_soft self.q_in_proj["soft"] = self.q_proj_soft if self.qkv_same_dim: # Empirically observed the convergence to be much better with # the scaled initialization nn.init.xavier_uniform_( self.k_in_proj["soft"].weight, gain=1 / math.sqrt(2) ) nn.init.xavier_uniform_( self.q_in_proj["soft"].weight, gain=1 / math.sqrt(2) ) else: nn.init.xavier_uniform_(self.k_in_proj["soft"].weight) nn.init.xavier_uniform_(self.q_in_proj["soft"].weight) @register_monotonic_attention("waitk") class WaitKAttention( MonotonicInfiniteLookbackAttention ): """ STACL: Simultaneous Translation with Implicit Anticipation and Controllable Latency using Prefix-to-Prefix Framework https://www.aclweb.org/anthology/P19-1289/ """ def __init__(self, args): super().__init__(args) self.q_in_proj["soft"] = self.q_in_proj["monotonic"] self.k_in_proj["soft"] = self.k_in_proj["monotonic"] self.waitk_lagging = args.waitk_lagging assert self.waitk_lagging > 0, ( f"Lagging has to been larger than 0, get {self.waitk_lagging}." ) @staticmethod def add_args(parser): super( MonotonicInfiniteLookbackAttention, MonotonicInfiniteLookbackAttention ).add_args(parser) parser.add_argument( "--waitk-lagging", type=int, required=True, help="Wait K lagging" ) def p_choose_from_qk( self, query: Optional[Tensor], key: Optional[Tensor], key_padding_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, ): assert query is not None assert key is not None p_choose = waitk_p_choose( tgt_len=query.size(0), src_len=key.size(0), bsz=query.size(1) * self.num_heads, waitk_lagging=self.waitk_lagging, key_padding_mask=key_padding_mask, incremental_state=incremental_state, ) return p_choose.to(query) @register_monotonic_attention("chunkwise") class ChunkwiseAttention( MonotonicInfiniteLookbackAttention ): def __init__(self, args): super().__init__(args) self.chunk_size = args.mocha_chunk_size assert self.chunk_size > 1 @staticmethod def add_args(parser): super( MonotonicInfiniteLookbackAttention ).add_args(parser) parser.add_argument( "--mocha-chunk-size", type=int, required=True, help="Mocha chunk size" )
16,858
31.421154
142
py
rej-summ
rej-summ-main/examples/simultaneous_translation/modules/monotonic_transformer_layer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from fairseq.modules import TransformerDecoderLayer, TransformerEncoderLayer from . import build_monotonic_attention from typing import Dict, Optional, List from torch import Tensor import torch class TransformerMonotonicEncoderLayer(TransformerEncoderLayer): def forward(self, x, encoder_padding_mask): seq_len, _, _ = x.size() attn_mask = x.new_ones([seq_len, seq_len]).triu(1) attn_mask = attn_mask.masked_fill(attn_mask.bool(), float("-inf")) return super().forward(x, encoder_padding_mask, attn_mask) class TransformerMonotonicDecoderLayer(TransformerDecoderLayer): def __init__(self, args): super().__init__(args) assert args.simul_type is not None, "A --simul-type is needed." self.encoder_attn = build_monotonic_attention(args) def prune_incremental_state( self, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] ): input_buffer = self.self_attn._get_input_buffer(incremental_state) for key in ["prev_key", "prev_value"]: input_buffer_key = input_buffer[key] assert input_buffer_key is not None if input_buffer_key.size(2) > 1: input_buffer[key] = input_buffer_key[:, :, :-1, :] else: typed_empty_dict: Dict[str, Optional[Tensor]] = {} input_buffer = typed_empty_dict break assert incremental_state is not None self.self_attn._set_input_buffer(incremental_state, input_buffer) def forward( self, x, encoder_out: Optional[Tensor] = None, encoder_padding_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, prev_self_attn_state: Optional[List[Tensor]] = None, prev_attn_state: Optional[List[Tensor]] = None, self_attn_mask: Optional[Tensor] = None, self_attn_padding_mask: Optional[Tensor] = None, need_attn: bool = False, need_head_weights: bool = False, ): """ Args: x (Tensor): input to the layer of shape `(seq_len, batch, embed_dim)` encoder_padding_mask (ByteTensor, optional): binary ByteTensor of shape `(batch, src_len)` where padding elements are indicated by ``1``. need_attn (bool, optional): return attention weights need_head_weights (bool, optional): return attention weights for each head (default: return average over heads). Returns: encoded output of shape `(seq_len, batch, embed_dim)` """ if need_head_weights: need_attn = True residual = x if self.normalize_before: x = self.self_attn_layer_norm(x) if prev_self_attn_state is not None: prev_key, prev_value = prev_self_attn_state[:2] saved_state: Dict[str, Optional[Tensor]] = { "prev_key": prev_key, "prev_value": prev_value, } if len(prev_self_attn_state) >= 3: saved_state["prev_key_padding_mask"] = prev_self_attn_state[2] assert incremental_state is not None self.self_attn._set_input_buffer(incremental_state, saved_state) _self_attn_input_buffer = self.self_attn._get_input_buffer(incremental_state) if self.cross_self_attention and not ( incremental_state is not None and _self_attn_input_buffer is not None and "prev_key" in _self_attn_input_buffer ): if self_attn_mask is not None: assert encoder_out is not None self_attn_mask = torch.cat( (x.new_zeros(x.size(0), encoder_out.size(0)), self_attn_mask), dim=1 ) if self_attn_padding_mask is not None: if encoder_padding_mask is None: assert encoder_out is not None encoder_padding_mask = self_attn_padding_mask.new_zeros( encoder_out.size(1), encoder_out.size(0) ) self_attn_padding_mask = torch.cat( (encoder_padding_mask, self_attn_padding_mask), dim=1 ) assert encoder_out is not None y = torch.cat((encoder_out, x), dim=0) else: y = x x, attn = self.self_attn( query=x, key=y, value=y, key_padding_mask=self_attn_padding_mask, incremental_state=incremental_state, need_weights=False, attn_mask=self_attn_mask, ) x = self.dropout_module(x) x = self.residual_connection(x, residual) if not self.normalize_before: x = self.self_attn_layer_norm(x) assert self.encoder_attn is not None residual = x if self.normalize_before: x = self.encoder_attn_layer_norm(x) if prev_attn_state is not None: prev_key, prev_value = prev_attn_state[:2] saved_state: Dict[str, Optional[Tensor]] = { "prev_key": prev_key, "prev_value": prev_value, } if len(prev_attn_state) >= 3: saved_state["prev_key_padding_mask"] = prev_attn_state[2] assert incremental_state is not None self.encoder_attn._set_input_buffer(incremental_state, saved_state) x, attn = self.encoder_attn( query=x, key=encoder_out, value=encoder_out, key_padding_mask=encoder_padding_mask, incremental_state=incremental_state, static_kv=True, need_weights=need_attn or (not self.training and self.need_attn), need_head_weights=need_head_weights, ) x = self.dropout_module(x) x = self.residual_connection(x, residual) if not self.normalize_before: x = self.encoder_attn_layer_norm(x) residual = x if self.normalize_before: x = self.final_layer_norm(x) x = self.activation_fn(self.fc1(x)) x = self.activation_dropout_module(x) x = self.fc2(x) x = self.dropout_module(x) x = self.residual_connection(x, residual) if not self.normalize_before: x = self.final_layer_norm(x) if self.onnx_trace and incremental_state is not None: saved_state = self.self_attn._get_input_buffer(incremental_state) assert saved_state is not None if self_attn_padding_mask is not None: self_attn_state = [ saved_state["prev_key"], saved_state["prev_value"], saved_state["prev_key_padding_mask"], ] else: self_attn_state = [saved_state["prev_key"], saved_state["prev_value"]] return x, attn, self_attn_state return x, attn, None
7,265
38.704918
88
py
rej-summ
rej-summ-main/examples/simultaneous_translation/modules/fixed_pre_decision.py
from functools import partial import torch from torch import Tensor import math import torch.nn.functional as F from . import register_monotonic_attention from .monotonic_multihead_attention import ( MonotonicAttention, MonotonicInfiniteLookbackAttention, WaitKAttention ) from typing import Dict, Optional def fixed_pooling_monotonic_attention(monotonic_attention): def create_model(monotonic_attention, klass): class FixedStrideMonotonicAttention(monotonic_attention): def __init__(self, args): self.waitk_lagging = 0 self.num_heads = 0 self.noise_mean = 0.0 self.noise_var = 0.0 super().__init__(args) self.pre_decision_type = args.fixed_pre_decision_type self.pre_decision_ratio = args.fixed_pre_decision_ratio self.pre_decision_pad_threshold = args.fixed_pre_decision_pad_threshold assert self.pre_decision_ratio > 1 if args.fixed_pre_decision_type == "average": self.pooling_layer = torch.nn.AvgPool1d( kernel_size=self.pre_decision_ratio, stride=self.pre_decision_ratio, ceil_mode=True, ) elif args.fixed_pre_decision_type == "last": def last(key): if key.size(2) < self.pre_decision_ratio: return key else: k = key[ :, :, self.pre_decision_ratio - 1:: self.pre_decision_ratio, ].contiguous() if key.size(-1) % self.pre_decision_ratio != 0: k = torch.cat([k, key[:, :, -1:]], dim=-1).contiguous() return k self.pooling_layer = last else: raise NotImplementedError @staticmethod def add_args(parser): super( FixedStrideMonotonicAttention, FixedStrideMonotonicAttention ).add_args(parser) parser.add_argument( "--fixed-pre-decision-ratio", type=int, required=True, help=( "Ratio for the fixed pre-decision," "indicating how many encoder steps will start" "simultaneous decision making process." ), ) parser.add_argument( "--fixed-pre-decision-type", default="average", choices=["average", "last"], help="Pooling type", ) parser.add_argument( "--fixed-pre-decision-pad-threshold", type=float, default=0.3, help="If a part of the sequence has pad" ",the threshold the pooled part is a pad.", ) def insert_zeros(self, x): bsz_num_heads, tgt_len, src_len = x.size() stride = self.pre_decision_ratio weight = F.pad(torch.ones(1, 1, 1).to(x), (stride - 1, 0)) x_upsample = F.conv_transpose1d( x.view(-1, src_len).unsqueeze(1), weight, stride=stride, padding=0, ) return x_upsample.squeeze(1).view(bsz_num_heads, tgt_len, -1) def p_choose( self, query: Optional[Tensor], key: Optional[Tensor], key_padding_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, ): assert key is not None assert query is not None src_len = key.size(0) tgt_len = query.size(0) batch_size = query.size(1) key_pool = self.pooling_layer(key.transpose(0, 2)).transpose(0, 2) if key_padding_mask is not None: key_padding_mask_pool = ( self.pooling_layer(key_padding_mask.unsqueeze(0).float()) .squeeze(0) .gt(self.pre_decision_pad_threshold) ) # Make sure at least one element is not pad key_padding_mask_pool[:, 0] = 0 else: key_padding_mask_pool = None if incremental_state is not None: # The floor instead of ceil is used for inference # But make sure the length key_pool at least 1 if ( max(1, math.floor(key.size(0) / self.pre_decision_ratio)) ) < key_pool.size(0): key_pool = key_pool[:-1] if key_padding_mask_pool is not None: key_padding_mask_pool = key_padding_mask_pool[:-1] p_choose_pooled = self.p_choose_from_qk( query, key_pool, key_padding_mask_pool, incremental_state=incremental_state, ) # Upsample, interpolate zeros p_choose = self.insert_zeros(p_choose_pooled) if p_choose.size(-1) < src_len: # Append zeros if the upsampled p_choose is shorter than src_len p_choose = torch.cat( [ p_choose, torch.zeros( p_choose.size(0), tgt_len, src_len - p_choose.size(-1) ).to(p_choose) ], dim=2 ) else: # can be larger than src_len because we used ceil before p_choose = p_choose[:, :, :src_len] p_choose[:, :, -1] = p_choose_pooled[:, :, -1] assert list(p_choose.size()) == [ batch_size * self.num_heads, tgt_len, src_len, ] return p_choose FixedStrideMonotonicAttention.__name__ = klass.__name__ return FixedStrideMonotonicAttention return partial(create_model, monotonic_attention) @register_monotonic_attention("waitk_fixed_pre_decision") @fixed_pooling_monotonic_attention(WaitKAttention) class WaitKAttentionFixedStride: pass @register_monotonic_attention("hard_aligned_fixed_pre_decision") @fixed_pooling_monotonic_attention(MonotonicAttention) class MonotonicAttentionFixedStride: pass @register_monotonic_attention("infinite_lookback_fixed_pre_decision") @fixed_pooling_monotonic_attention(MonotonicInfiniteLookbackAttention) class MonotonicInfiniteLookbackAttentionFixedStride: pass
7,370
37.591623
91
py
rej-summ
rej-summ-main/examples/simultaneous_translation/eval/agents/simul_t2t_enja.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os from fairseq import checkpoint_utils, tasks import sentencepiece as spm import torch try: from simuleval import READ_ACTION, WRITE_ACTION, DEFAULT_EOS from simuleval.agents import TextAgent except ImportError: print("Please install simuleval 'pip install simuleval'") BOS_PREFIX = "\u2581" class SimulTransTextAgentJA(TextAgent): """ Simultaneous Translation Text agent for Japanese """ def __init__(self, args): # Whether use gpu self.gpu = getattr(args, "gpu", False) # Max len self.max_len = args.max_len # Load Model self.load_model_vocab(args) # build word splitter self.build_word_splitter(args) self.eos = DEFAULT_EOS def initialize_states(self, states): states.incremental_states = dict() states.incremental_states["online"] = dict() def to_device(self, tensor): if self.gpu: return tensor.cuda() else: return tensor.cpu() def load_model_vocab(self, args): filename = args.model_path if not os.path.exists(filename): raise IOError("Model file not found: {}".format(filename)) state = checkpoint_utils.load_checkpoint_to_cpu(filename) task_args = state["cfg"]["task"] task_args.data = args.data_bin task = tasks.setup_task(task_args) # build model for ensemble state["cfg"]["model"].load_pretrained_encoder_from = None state["cfg"]["model"].load_pretrained_decoder_from = None self.model = task.build_model(state["cfg"]["model"]) self.model.load_state_dict(state["model"], strict=True) self.model.eval() self.model.share_memory() if self.gpu: self.model.cuda() # Set dictionary self.dict = {} self.dict["tgt"] = task.target_dictionary self.dict["src"] = task.source_dictionary @staticmethod def add_args(parser): # fmt: off parser.add_argument('--model-path', type=str, required=True, help='path to your pretrained model.') parser.add_argument("--data-bin", type=str, required=True, help="Path of data binary") parser.add_argument("--max-len", type=int, default=100, help="Max length of translation") parser.add_argument("--tgt-splitter-type", type=str, default="SentencePiece", help="Subword splitter type for target text.") parser.add_argument("--tgt-splitter-path", type=str, default=None, help="Subword splitter model path for target text.") parser.add_argument("--src-splitter-type", type=str, default="SentencePiece", help="Subword splitter type for source text.") parser.add_argument("--src-splitter-path", type=str, default=None, help="Subword splitter model path for source text.") # fmt: on return parser def build_word_splitter(self, args): self.spm = {} for lang in ['src', 'tgt']: if getattr(args, f'{lang}_splitter_type', None): path = getattr(args, f'{lang}_splitter_path', None) if path: self.spm[lang] = spm.SentencePieceProcessor() self.spm[lang].Load(path) def segment_to_units(self, segment, states): # Split a full word (segment) into subwords (units) return self.spm['src'].EncodeAsPieces(segment) def update_model_encoder(self, states): if len(states.units.source) == 0: return src_indices = [ self.dict['src'].index(x) for x in states.units.source.value ] if states.finish_read(): # Append the eos index when the prediction is over src_indices += [self.dict["tgt"].eos_index] src_indices = self.to_device( torch.LongTensor(src_indices).unsqueeze(0) ) src_lengths = self.to_device( torch.LongTensor([src_indices.size(1)]) ) states.encoder_states = self.model.encoder(src_indices, src_lengths) torch.cuda.empty_cache() def update_states_read(self, states): # Happens after a read action. self.update_model_encoder(states) def units_to_segment(self, units, states): # Merge sub words (units) to full word (segment). # For Japanese, we can directly send # the untokenized token to server except the BOS token # with following option # --sacrebleu-tokenizer MeCab # --eval-latency-unit char # --no-space token = units.value.pop() if ( token == self.dict["tgt"].eos_word or len(states.segments.target) > self.max_len ): return DEFAULT_EOS if BOS_PREFIX == token: return None if token[0] == BOS_PREFIX: return token[1:] else: return token def policy(self, states): if not getattr(states, "encoder_states", None): # No encoder states, read a token first return READ_ACTION # encode previous predicted target tokens tgt_indices = self.to_device( torch.LongTensor( [self.model.decoder.dictionary.eos()] + [ self.dict['tgt'].index(x) for x in states.units.target.value if x is not None ] ).unsqueeze(0) ) # Current steps states.incremental_states["steps"] = { "src": states.encoder_states["encoder_out"][0].size(0), "tgt": 1 + len(states.units.target), } # Online only means the reading is not finished states.incremental_states["online"]["only"] = ( torch.BoolTensor([not states.finish_read()]) ) x, outputs = self.model.decoder.forward( prev_output_tokens=tgt_indices, encoder_out=states.encoder_states, incremental_state=states.incremental_states, ) states.decoder_out = x torch.cuda.empty_cache() if outputs.action == 0: return READ_ACTION else: return WRITE_ACTION def predict(self, states): # Predict target token from decoder states decoder_states = states.decoder_out lprobs = self.model.get_normalized_probs( [decoder_states[:, -1:]], log_probs=True ) index = lprobs.argmax(dim=-1)[0, 0].item() if index != self.dict['tgt'].eos_index: token = self.dict['tgt'].string([index]) else: token = self.dict['tgt'].eos_word return token
7,099
30.277533
85
py
rej-summ
rej-summ-main/examples/simultaneous_translation/models/transformer_monotonic_attention.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Dict, List, NamedTuple, Optional import torch import torch.nn as nn from examples.simultaneous_translation.modules.monotonic_transformer_layer import ( TransformerMonotonicDecoderLayer, TransformerMonotonicEncoderLayer, ) from fairseq.models import ( register_model, register_model_architecture, ) from fairseq.models.transformer import ( TransformerModel, TransformerEncoder, TransformerDecoder, base_architecture, transformer_iwslt_de_en, transformer_vaswani_wmt_en_de_big, tiny_architecture ) from torch import Tensor DEFAULT_MAX_SOURCE_POSITIONS = 1024 DEFAULT_MAX_TARGET_POSITIONS = 1024 READ_ACTION = 0 WRITE_ACTION = 1 TransformerMonotonicDecoderOut = NamedTuple( "TransformerMonotonicDecoderOut", [ ("action", int), ("p_choose", Optional[Tensor]), ("attn_list", Optional[List[Optional[Dict[str, Tensor]]]]), ("encoder_out", Optional[Dict[str, List[Tensor]]]), ("encoder_padding_mask", Optional[Tensor]), ], ) @register_model("transformer_unidirectional") class TransformerUnidirectionalModel(TransformerModel): @classmethod def build_encoder(cls, args, src_dict, embed_tokens): return TransformerMonotonicEncoder(args, src_dict, embed_tokens) @register_model("transformer_monotonic") class TransformerModelSimulTrans(TransformerModel): @classmethod def build_encoder(cls, args, src_dict, embed_tokens): return TransformerMonotonicEncoder(args, src_dict, embed_tokens) @classmethod def build_decoder(cls, args, tgt_dict, embed_tokens): return TransformerMonotonicDecoder(args, tgt_dict, embed_tokens) class TransformerMonotonicEncoder(TransformerEncoder): def __init__(self, args, dictionary, embed_tokens): super().__init__(args, dictionary, embed_tokens) self.dictionary = dictionary self.layers = nn.ModuleList([]) self.layers.extend( [ TransformerMonotonicEncoderLayer(args) for i in range(args.encoder_layers) ] ) class TransformerMonotonicDecoder(TransformerDecoder): """ Transformer decoder consisting of *args.decoder_layers* layers. Each layer is a :class:`TransformerDecoderLayer`. Args: args (argparse.Namespace): parsed command-line arguments dictionary (~fairseq.data.Dictionary): decoding dictionary embed_tokens (torch.nn.Embedding): output embedding no_encoder_attn (bool, optional): whether to attend to encoder outputs (default: False). """ def __init__(self, args, dictionary, embed_tokens, no_encoder_attn=False): super().__init__(args, dictionary, embed_tokens, no_encoder_attn=False) self.dictionary = dictionary self.layers = nn.ModuleList([]) self.layers.extend( [ TransformerMonotonicDecoderLayer(args) for _ in range(args.decoder_layers) ] ) self.policy_criterion = getattr(args, "policy_criterion", "any") self.num_updates = None def set_num_updates(self, num_updates): self.num_updates = num_updates def pre_attention( self, prev_output_tokens, encoder_out_dict: Dict[str, List[Tensor]], incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, ): positions = ( self.embed_positions( prev_output_tokens, incremental_state=incremental_state, ) if self.embed_positions is not None else None ) if incremental_state is not None: prev_output_tokens = prev_output_tokens[:, -1:] if positions is not None: positions = positions[:, -1:] # embed tokens and positions x = self.embed_scale * self.embed_tokens(prev_output_tokens) if self.project_in_dim is not None: x = self.project_in_dim(x) if positions is not None: x += positions x = self.dropout_module(x) # B x T x C -> T x B x C x = x.transpose(0, 1) encoder_out = encoder_out_dict["encoder_out"][0] if "encoder_padding_mask" in encoder_out_dict: encoder_padding_mask = ( encoder_out_dict["encoder_padding_mask"][0] if encoder_out_dict["encoder_padding_mask"] and len(encoder_out_dict["encoder_padding_mask"]) > 0 else None ) else: encoder_padding_mask = None return x, encoder_out, encoder_padding_mask def post_attention(self, x): if self.layer_norm is not None: x = self.layer_norm(x) # T x B x C -> B x T x C x = x.transpose(0, 1) if self.project_out_dim is not None: x = self.project_out_dim(x) return x def clean_cache( self, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]], end_id: Optional[int] = None, ): """ Clean cache in the monotonic layers. The cache is generated because of a forward pass of decoder has run but no prediction, so that the self attention key value in decoder is written in the incremental state. end_id is the last idx of the layers """ if end_id is None: end_id = len(self.layers) for index, layer in enumerate(self.layers): if index < end_id: layer.prune_incremental_state(incremental_state) def extract_features( self, prev_output_tokens, encoder_out: Optional[Dict[str, List[Tensor]]], incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, full_context_alignment: bool = False, # unused alignment_layer: Optional[int] = None, # unused alignment_heads: Optional[int] = None, # unsed ): """ Similar to *forward* but only return features. Returns: tuple: - the decoder's features of shape `(batch, tgt_len, embed_dim)` - a dictionary with any model-specific outputs """ # incremental_state = None assert encoder_out is not None (x, encoder_outs, encoder_padding_mask) = self.pre_attention( prev_output_tokens, encoder_out, incremental_state ) attn = None inner_states = [x] attn_list: List[Optional[Dict[str, Tensor]]] = [] p_choose = torch.tensor([1.0]) for i, layer in enumerate(self.layers): x, attn, _ = layer( x=x, encoder_out=encoder_outs, encoder_padding_mask=encoder_padding_mask, incremental_state=incremental_state, self_attn_mask=self.buffered_future_mask(x) if incremental_state is None else None, ) inner_states.append(x) attn_list.append(attn) if incremental_state is not None: if_online = incremental_state["online"]["only"] assert if_online is not None if if_online.to(torch.bool): # Online indicates that the encoder states are still changing assert attn is not None if self.policy_criterion == "any": # Any head decide to read than read head_read = layer.encoder_attn._get_monotonic_buffer(incremental_state)["head_read"] assert head_read is not None if head_read.any(): # We need to prune the last self_attn saved_state # if model decide not to read # otherwise there will be duplicated saved_state self.clean_cache(incremental_state, i + 1) return x, TransformerMonotonicDecoderOut( action=0, p_choose=p_choose, attn_list=None, encoder_out=None, encoder_padding_mask=None, ) x = self.post_attention(x) return x, TransformerMonotonicDecoderOut( action=1, p_choose=p_choose, attn_list=attn_list, encoder_out=encoder_out, encoder_padding_mask=encoder_padding_mask, ) @register_model_architecture("transformer_monotonic", "transformer_monotonic") def base_monotonic_architecture(args): base_architecture(args) args.encoder_unidirectional = getattr(args, "encoder_unidirectional", False) @register_model_architecture( "transformer_monotonic", "transformer_monotonic_iwslt_de_en" ) def transformer_monotonic_iwslt_de_en(args): transformer_iwslt_de_en(args) base_monotonic_architecture(args) # parameters used in the "Attention Is All You Need" paper (Vaswani et al., 2017) @register_model_architecture( "transformer_monotonic", "transformer_monotonic_vaswani_wmt_en_de_big" ) def transformer_monotonic_vaswani_wmt_en_de_big(args): transformer_vaswani_wmt_en_de_big(args) @register_model_architecture( "transformer_monotonic", "transformer_monotonic_vaswani_wmt_en_fr_big" ) def transformer_monotonic_vaswani_wmt_en_fr_big(args): transformer_monotonic_vaswani_wmt_en_fr_big(args) @register_model_architecture( "transformer_unidirectional", "transformer_unidirectional_iwslt_de_en" ) def transformer_unidirectional_iwslt_de_en(args): transformer_iwslt_de_en(args) @register_model_architecture("transformer_monotonic", "transformer_monotonic_tiny") def monotonic_tiny_architecture(args): tiny_architecture(args) base_monotonic_architecture(args)
10,185
32.617162
108
py
rej-summ
rej-summ-main/examples/simultaneous_translation/models/convtransformer_simul_trans.py
# Copyright (c) 2017-present, Facebook, Inc. # All rights reserved. # # This source code is licensed under the license found in the LICENSE file in # the root directory of this source tree. An additional grant of patent rights # can be found in the PATENTS file in the same directory. from fairseq import checkpoint_utils from fairseq.models import ( register_model, register_model_architecture, ) from fairseq.models.speech_to_text import ( ConvTransformerModel, convtransformer_espnet, ConvTransformerEncoder, ) from fairseq.models.speech_to_text.modules.augmented_memory_attention import ( augmented_memory, SequenceEncoder, AugmentedMemoryConvTransformerEncoder, ) from torch import nn, Tensor from typing import Dict, List from fairseq.models.speech_to_text.modules.emformer import NoSegAugmentedMemoryTransformerEncoderLayer @register_model("convtransformer_simul_trans") class SimulConvTransformerModel(ConvTransformerModel): """ Implementation of the paper: SimulMT to SimulST: Adapting Simultaneous Text Translation to End-to-End Simultaneous Speech Translation https://www.aclweb.org/anthology/2020.aacl-main.58.pdf """ @staticmethod def add_args(parser): super(SimulConvTransformerModel, SimulConvTransformerModel).add_args(parser) parser.add_argument( "--train-monotonic-only", action="store_true", default=False, help="Only train monotonic attention", ) @classmethod def build_decoder(cls, args, task, embed_tokens): tgt_dict = task.tgt_dict from examples.simultaneous_translation.models.transformer_monotonic_attention import ( TransformerMonotonicDecoder, ) decoder = TransformerMonotonicDecoder(args, tgt_dict, embed_tokens) if getattr(args, "load_pretrained_decoder_from", None): decoder = checkpoint_utils.load_pretrained_component_from_model( component=decoder, checkpoint=args.load_pretrained_decoder_from ) return decoder @register_model_architecture( "convtransformer_simul_trans", "convtransformer_simul_trans_espnet" ) def convtransformer_simul_trans_espnet(args): convtransformer_espnet(args) @register_model("convtransformer_augmented_memory") @augmented_memory class AugmentedMemoryConvTransformerModel(SimulConvTransformerModel): @classmethod def build_encoder(cls, args): encoder = SequenceEncoder(args, AugmentedMemoryConvTransformerEncoder(args)) if getattr(args, "load_pretrained_encoder_from", None) is not None: encoder = checkpoint_utils.load_pretrained_component_from_model( component=encoder, checkpoint=args.load_pretrained_encoder_from ) return encoder @register_model_architecture( "convtransformer_augmented_memory", "convtransformer_augmented_memory" ) def augmented_memory_convtransformer_espnet(args): convtransformer_espnet(args) # ============================================================================ # # Convtransformer # with monotonic attention decoder # with emformer encoder # ============================================================================ # class ConvTransformerEmformerEncoder(ConvTransformerEncoder): def __init__(self, args): super().__init__(args) stride = self.conv_layer_stride(args) trf_left_context = args.segment_left_context // stride trf_right_context = args.segment_right_context // stride context_config = [trf_left_context, trf_right_context] self.transformer_layers = nn.ModuleList( [ NoSegAugmentedMemoryTransformerEncoderLayer( input_dim=args.encoder_embed_dim, num_heads=args.encoder_attention_heads, ffn_dim=args.encoder_ffn_embed_dim, num_layers=args.encoder_layers, dropout_in_attn=args.dropout, dropout_on_attn=args.dropout, dropout_on_fc1=args.dropout, dropout_on_fc2=args.dropout, activation_fn=args.activation_fn, context_config=context_config, segment_size=args.segment_length, max_memory_size=args.max_memory_size, scaled_init=True, # TODO: use constant for now. tanh_on_mem=args.amtrf_tanh_on_mem, ) ] ) self.conv_transformer_encoder = ConvTransformerEncoder(args) def forward(self, src_tokens, src_lengths): encoder_out: Dict[str, List[Tensor]] = self.conv_transformer_encoder(src_tokens, src_lengths.to(src_tokens.device)) output = encoder_out["encoder_out"][0] encoder_padding_masks = encoder_out["encoder_padding_mask"] return { "encoder_out": [output], # This is because that in the original implementation # the output didn't consider the last segment as right context. "encoder_padding_mask": [encoder_padding_masks[0][:, : output.size(0)]] if len(encoder_padding_masks) > 0 else [], "encoder_embedding": [], "encoder_states": [], "src_tokens": [], "src_lengths": [], } @staticmethod def conv_layer_stride(args): # TODO: make it configurable from the args return 4 @register_model("convtransformer_emformer") class ConvtransformerEmformer(SimulConvTransformerModel): @staticmethod def add_args(parser): super(ConvtransformerEmformer, ConvtransformerEmformer).add_args(parser) parser.add_argument( "--segment-length", type=int, metavar="N", help="length of each segment (not including left context / right context)", ) parser.add_argument( "--segment-left-context", type=int, help="length of left context in a segment", ) parser.add_argument( "--segment-right-context", type=int, help="length of right context in a segment", ) parser.add_argument( "--max-memory-size", type=int, default=-1, help="Right context for the segment.", ) parser.add_argument( "--amtrf-tanh-on-mem", default=False, action="store_true", help="whether to use tanh on memory vector", ) @classmethod def build_encoder(cls, args): encoder = ConvTransformerEmformerEncoder(args) if getattr(args, "load_pretrained_encoder_from", None): encoder = checkpoint_utils.load_pretrained_component_from_model( component=encoder, checkpoint=args.load_pretrained_encoder_from ) return encoder @register_model_architecture( "convtransformer_emformer", "convtransformer_emformer", ) def convtransformer_emformer_base(args): convtransformer_espnet(args)
7,162
33.941463
123
py
rej-summ
rej-summ-main/examples/simultaneous_translation/tests/test_text_models.py
import argparse import unittest from typing import Any, Dict import torch from examples.simultaneous_translation.models import ( transformer_monotonic_attention ) from tests.test_roberta import FakeTask DEFAULT_CONFIG = { "attention_eps": 1e-6, "mass_preservation": True, "noise_type": "flat", "noise_mean": 0.0, "noise_var": 1.0, "energy_bias_init": -2, "energy_bias": True } PAD_INDEX = 1 def generate_config(overrides_kv): new_dict = {key: value for key, value in DEFAULT_CONFIG.items()} for key, value in overrides_kv.items(): new_dict[key] = value return new_dict def make_sample_with_padding(longer_src=False) -> Dict[str, Any]: tokens_1 = torch.LongTensor( [ [2, 10, 11, 12, 13, 14, 15, 10, 11, 12, 13, 14, 15, 2], [ 2, 11, 12, 14, 15, 10, 11, 12, 13, 14, 15, 2, PAD_INDEX, PAD_INDEX ], ] ) tokens_2 = torch.LongTensor( [ [2, 11, 12, 13, 14, 2, PAD_INDEX, PAD_INDEX], [2, 11, 22, 33, 2, PAD_INDEX, PAD_INDEX, PAD_INDEX] ] ) if longer_src: src_tokens = tokens_1[:, 1:] prev_output_tokens = tokens_2 else: src_tokens = tokens_2[:, 1:8] prev_output_tokens = tokens_1 src_lengths = src_tokens.ne(PAD_INDEX).sum(dim=1).long() sample = { "net_input": { "src_tokens": src_tokens, "prev_output_tokens": prev_output_tokens, "src_lengths": src_lengths, }, "target": prev_output_tokens[:, 1:], } return sample def build_transformer_monotonic_attention(**extra_args: Any): overrides = { # Use characteristics dimensions "encoder_embed_dim": 12, "encoder_ffn_embed_dim": 14, "decoder_embed_dim": 12, "decoder_ffn_embed_dim": 14, # Disable dropout so we have comparable tests. "dropout": 0, "attention_dropout": 0, "activation_dropout": 0, "encoder_layerdrop": 0, } overrides.update(extra_args) # Overrides the defaults from the parser args = argparse.Namespace(**overrides) transformer_monotonic_attention.monotonic_tiny_architecture(args) torch.manual_seed(0) task = FakeTask(args) return ( transformer_monotonic_attention .TransformerModelSimulTrans .build_model(args, task) ) def expected_alignment_formula( p_choose, mass_perservation=True, padding_mask=None ): # Online and Linear-Time Attention by Enforcing Monotonic Alignments # https://arxiv.org/pdf/1704.00784.pdf # Eq 18, 19 bsz, tgt_len, src_len = p_choose.size() alpha = torch.zeros_like(p_choose) if padding_mask is not None: bsz_pad = padding_mask.size(0) num_heads = int(bsz / bsz_pad) padding_mask = ( padding_mask .unsqueeze(1) .expand([bsz_pad, num_heads, src_len]) .contiguous() .view(-1, src_len) ) p_choose = p_choose.masked_fill(padding_mask.unsqueeze(1), 0) for bsz_i in range(bsz): for i in range(tgt_len): for j in range(src_len): if i == 0: if j == 0: # First source token alpha[bsz_i, i, j] = p_choose[bsz_i, i, j] else: # First target token alpha[bsz_i, i, j] = ( p_choose[bsz_i, i, j] * torch.prod( 1 - p_choose[bsz_i, i, :j] ) ) else: alpha[bsz_i, i, j] = alpha[bsz_i, i - 1, j] for k in range(j): alpha[bsz_i, i, j] += ( alpha[bsz_i, i - 1, k] * torch.prod( 1 - p_choose[bsz_i, i, k:j] ) ) alpha[bsz_i, i, j] *= p_choose[bsz_i, i, j] alpha = alpha.masked_fill(padding_mask.unsqueeze(1), 0) if mass_perservation: alpha = mass_perservation_formula(alpha, False, padding_mask) return alpha def mass_perservation_formula(alpha, left_padding=False, padding_mask=None): if padding_mask is None or alpha.size(-1) == 1: if alpha.size(-1) > 1: alpha[:, :, -1] = 1 - alpha[:, :, :-1].sum(dim=-1) return alpha src_lens = (padding_mask.logical_not()).sum(dim=1).long() bsz, tgt_len, src_len = alpha.size() assert ( not left_padding or (left_padding and (not padding_mask[:, 0].any())) ) alpha = alpha.masked_fill(padding_mask.unsqueeze(1), 0) for bsz_i in range(bsz): if left_padding: alpha[bsz_i, :, -1] = ( 1 - alpha[bsz_i, :, :-1].sum(dim=-1) ) else: alpha[bsz_i, :, src_lens[bsz_i] - 1] = ( 1 - alpha[bsz_i, :, :src_lens[bsz_i] - 1].sum(dim=-1) ) return alpha def expected_soft_attention_formula( alpha, soft_energy, padding_mask=None, chunksize=1e10, ): # Monotonic Infinite Lookback Attention for Simultaneous Machine Translation # https://arxiv.org/pdf/1906.05218.pdf # Eq 14 # Monotonic Chunkwise Attention # https://arxiv.org/abs/1712.05382 # Eq 17 bsz, tgt_len, src_len = alpha.size() beta = torch.zeros_like(alpha) if padding_mask is not None: bsz_pad = padding_mask.size(0) num_heads = int(bsz / bsz_pad) # Expanding for potential head dimension padding_mask = ( padding_mask .unsqueeze(1) .expand([bsz_pad, num_heads, src_len]) .contiguous() .view(-1, src_len) ) soft_energy = soft_energy.masked_fill(padding_mask.unsqueeze(1), float('-inf')) for bsz_i in range(bsz): for i in range(tgt_len): for j in range(src_len): for k in range(j, min([src_len, j + chunksize])): if not padding_mask[bsz_i, j]: beta[bsz_i, i, j] += ( alpha[bsz_i, i, k] * torch.exp(soft_energy[bsz_i, i, j]) / torch.sum(torch.exp(soft_energy[bsz_i, i, max([0, k - chunksize + 1]):k + 1])) ) return beta class MonotonicAttentionTestAbstractClass(object): def test_forward(self): sample = make_sample_with_padding() out, _ = self.model.forward(**sample["net_input"]) loss = out.sum() loss.backward() def test_p_choose(self): sample = make_sample_with_padding() _, extra_out = self.model.forward(**sample["net_input"]) for item in extra_out.attn_list: p_choose = item["p_choose"] self.assertTrue(p_choose.le(1.0).all()) self.assertTrue(p_choose.ge(0.0).all()) def test_expected_alignment(self): for longer_src in [True, False]: sample = make_sample_with_padding(longer_src) _, extra_out = self.model.forward(**sample["net_input"]) for item in extra_out.attn_list: p_choose = item["p_choose"] alpha_system = item["alpha"] self.assertTrue(p_choose.size() == alpha_system.size()) bsz, num_head, tgt_len, src_len = alpha_system.size() alpha_system = alpha_system.view(-1, tgt_len, src_len) p_choose = p_choose.view(-1, tgt_len, src_len) alpha_real = expected_alignment_formula( p_choose, self.model.decoder.layers[0].encoder_attn.mass_preservation, sample["net_input"]["src_tokens"].eq(PAD_INDEX) ) self.assertTrue( torch.abs(alpha_system - alpha_real).le(5e-5).all(), ) class HardMonotonicAttentionTestCase( unittest.TestCase, MonotonicAttentionTestAbstractClass ): def setUp(self): self.model = build_transformer_monotonic_attention( **generate_config({"simul_type": "hard_aligned"}) ) class InfiniteLookbackTestCase( unittest.TestCase, MonotonicAttentionTestAbstractClass ): def setUp(self): self.model = build_transformer_monotonic_attention( **generate_config( { "simul_type": "infinite_lookback" } ) ) self.model.train() def test_fp16_for_long_input(self): sample = { "net_input": { "src_tokens": torch.LongTensor([7] * 1000 + [2]).cuda().unsqueeze(0), "prev_output_tokens": torch.LongTensor([7] * 1000 + [2]).cuda().unsqueeze(0), "src_lengths": torch.LongTensor([1000]).cuda(), }, "target": torch.LongTensor([2] + [7] * 1000).unsqueeze(0).cuda() } self.model.cuda().half() _, extra_out = self.model.forward(**sample["net_input"]) for item in extra_out.attn_list: for key in ["p_choose", "alpha", "beta", "soft_energy"]: self.assertFalse(torch.isnan(item[key]).any()) def test_expected_attention(self): for longer_src in [True, False]: sample = make_sample_with_padding(longer_src) _, extra_out = self.model.forward(**sample["net_input"]) for item in extra_out.attn_list: p_choose = item["p_choose"] alpha_system = item["alpha"] beta_system = item["beta"] soft_energy_system = item["soft_energy"] self.assertTrue(beta_system.size() == alpha_system.size()) self.assertTrue(p_choose.size() == alpha_system.size()) bsz, num_head, tgt_len, src_len = alpha_system.size() alpha_system = alpha_system.view(-1, tgt_len, src_len) beta_system = beta_system.view(-1, tgt_len, src_len) p_choose = p_choose.view(-1, tgt_len, src_len) soft_energy_system = soft_energy_system.view(-1, tgt_len, src_len) alpha_real = expected_alignment_formula( p_choose, self.model.decoder.layers[0].encoder_attn.mass_preservation, sample["net_input"]["src_tokens"].eq(PAD_INDEX) ) beta_real = expected_soft_attention_formula( alpha_real, soft_energy_system, sample["net_input"]["src_tokens"].eq(PAD_INDEX), chunksize=getattr( self.model.decoder.layers[0].encoder_attn, "chunk_size", int(1e10) ) ) self.assertTrue( torch.abs(beta_system - beta_real).le(1e-5).all(), ) class ChunkwiswTestCase( InfiniteLookbackTestCase ): def setUp(self): self.model = build_transformer_monotonic_attention( **generate_config( { "simul_type": "chunkwise", "mocha_chunk_size": 3 } ) ) class WaitkTestCase(InfiniteLookbackTestCase): def setUp(self): self.model = build_transformer_monotonic_attention( **generate_config( { "simul_type": "waitk", "waitk_lagging": 3, } ) ) def check_waitk(self, p_choose, lagging, padding_mask): bsz, tgt_len, src_len = p_choose.size() for bsz_i in range(bsz): for i in range(tgt_len): for j in range(src_len): if not padding_mask[bsz_i, j]: if j - i == lagging - 1: self.assertTrue(p_choose[bsz_i, i, j] == 1) else: self.assertTrue(p_choose[bsz_i, i, j] == 0) def test_waitk_p_choose(self): for longer_src in [True, False]: for k in [1, 3, 10, 20, 100]: sample = make_sample_with_padding(longer_src) model = build_transformer_monotonic_attention( **generate_config( { "simul_type": "waitk", "waitk_lagging": k, } ) ) model.train() _, extra_out = model.forward(**sample["net_input"]) for item in extra_out.attn_list: p_choose = item["p_choose"] bsz, num_heads, tgt_len, src_len = p_choose.size() padding_mask = sample["net_input"]["src_tokens"].eq(PAD_INDEX) padding_mask = ( padding_mask .unsqueeze(1) .expand([bsz, num_heads, src_len]) .contiguous() .view(-1, src_len) ) p_choose = p_choose.view(bsz * num_heads, tgt_len, src_len) self.check_waitk(p_choose, k, padding_mask)
13,524
32.14951
108
py
rej-summ
rej-summ-main/examples/simultaneous_translation/tests/test_alignment_train.py
import unittest import numpy as np import torch import hypothesis.strategies as st from hypothesis import assume, given, settings from torch.testing._internal.common_utils import TestCase from examples.simultaneous_translation.utils.functions import exclusive_cumprod TEST_CUDA = torch.cuda.is_available() class AlignmentTrainTest(TestCase): def _test_custom_alignment_train_ref(self, p_choose, eps): cumprod_1mp = exclusive_cumprod(1 - p_choose, dim=2, eps=eps) cumprod_1mp_clamp = torch.clamp(cumprod_1mp, eps, 1.0) bsz = p_choose.size(0) tgt_len = p_choose.size(1) src_len = p_choose.size(2) alpha_0 = p_choose.new_zeros([bsz, 1, src_len]) alpha_0[:, :, 0] = 1.0 previous_alpha = [alpha_0] for i in range(tgt_len): # p_choose: bsz , tgt_len, src_len # cumprod_1mp_clamp : bsz, tgt_len, src_len # previous_alpha[i]: bsz, 1, src_len # alpha_i: bsz, src_len alpha_i = ( p_choose[:, i] * cumprod_1mp[:, i] * torch.cumsum( previous_alpha[i][:, 0] / cumprod_1mp_clamp[:, i], dim=1 ) ).clamp(0, 1.0) previous_alpha.append(alpha_i.unsqueeze(1)) # alpha: bsz * num_heads, tgt_len, src_len alpha = torch.cat(previous_alpha[1:], dim=1) return alpha def _test_custom_alignment_train_impl(self, p_choose, alpha, eps): if p_choose.is_cuda: from alignment_train_cuda_binding import alignment_train_cuda # @manual=//deeplearning/projects/fairseq-py:alignment_train_cuda_binding alignment_train_cuda(p_choose, alpha, eps) else: from alignment_train_cpu_binding import alignment_train_cpu # @manual=//deeplearning/projects/fairseq-py:alignment_train_cpu_binding alignment_train_cpu(p_choose, alpha, eps) @settings(deadline=None) @given( bsz=st.integers(1, 100), tgt_len=st.integers(1, 100), src_len=st.integers(1, 550), device=st.sampled_from(["cpu", "cuda"]), ) def test_alignment_train(self, bsz, tgt_len, src_len, device): eps = 1e-6 assume(device == "cpu" or TEST_CUDA) p_choose = torch.rand(bsz, tgt_len, src_len, device=device) # run the alignment with the custom operator alpha_act = p_choose.new_zeros([bsz, tgt_len, src_len]) self._test_custom_alignment_train_impl(p_choose, alpha_act, eps) # runu the alignment with the ref implementation alpha_ref = self._test_custom_alignment_train_ref(p_choose, eps) # verify the results alpha_act = alpha_act.cpu().detach().numpy() alpha_ref = alpha_ref.cpu().detach().numpy() np.testing.assert_allclose( alpha_act, alpha_ref, atol=1e-3, rtol=1e-3, ) if __name__ == "__main__": unittest.main()
2,989
32.595506
148
py
rej-summ
rej-summ-main/examples/simultaneous_translation/utils/monotonic_attention.py
from typing import Optional import torch from torch import Tensor from examples.simultaneous_translation.utils.functions import ( exclusive_cumprod, prob_check, moving_sum, ) def expected_alignment_from_p_choose( p_choose: Tensor, padding_mask: Optional[Tensor] = None, eps: float = 1e-6 ): """ Calculating expected alignment for from stepwise probability Reference: Online and Linear-Time Attention by Enforcing Monotonic Alignments https://arxiv.org/pdf/1704.00784.pdf q_ij = (1 − p_{ij−1})q_{ij−1} + a+{i−1j} a_ij = p_ij q_ij Parallel solution: ai = p_i * cumprod(1 − pi) * cumsum(a_i / cumprod(1 − pi)) ============================================================ Expected input size p_choose: bsz, tgt_len, src_len """ prob_check(p_choose) # p_choose: bsz, tgt_len, src_len bsz, tgt_len, src_len = p_choose.size() dtype = p_choose.dtype p_choose = p_choose.float() if padding_mask is not None: p_choose = p_choose.masked_fill(padding_mask.unsqueeze(1), 0.0) if p_choose.is_cuda: p_choose = p_choose.contiguous() from alignment_train_cuda_binding import alignment_train_cuda as alignment_train else: from alignment_train_cpu_binding import alignment_train_cpu as alignment_train alpha = p_choose.new_zeros([bsz, tgt_len, src_len]) alignment_train(p_choose, alpha, eps) # Mix precision to prevent overflow for fp16 alpha = alpha.type(dtype) prob_check(alpha) return alpha def expected_soft_attention( alpha: Tensor, soft_energy: Tensor, padding_mask: Optional[Tensor] = None, chunk_size: Optional[int] = None, eps: float = 1e-10 ): """ Function to compute expected soft attention for monotonic infinite lookback attention from expected alignment and soft energy. Reference: Monotonic Chunkwise Attention https://arxiv.org/abs/1712.05382 Monotonic Infinite Lookback Attention for Simultaneous Machine Translation https://arxiv.org/abs/1906.05218 alpha: bsz, tgt_len, src_len soft_energy: bsz, tgt_len, src_len padding_mask: bsz, src_len left_padding: bool """ if padding_mask is not None: alpha = alpha.masked_fill(padding_mask.unsqueeze(1), 0.0) soft_energy = soft_energy.masked_fill( padding_mask.unsqueeze(1), -float("inf") ) prob_check(alpha) dtype = alpha.dtype alpha = alpha.float() soft_energy = soft_energy.float() soft_energy = soft_energy - soft_energy.max(dim=2, keepdim=True)[0] exp_soft_energy = torch.exp(soft_energy) + eps if chunk_size is not None: # Chunkwise beta = ( exp_soft_energy * moving_sum( alpha / (eps + moving_sum(exp_soft_energy, chunk_size, 1)), 1, chunk_size ) ) else: # Infinite lookback # Notice that infinite lookback is a special case of chunkwise # where chunksize = inf inner_items = alpha / (eps + torch.cumsum(exp_soft_energy, dim=2)) beta = ( exp_soft_energy * torch.cumsum(inner_items.flip(dims=[2]), dim=2) .flip(dims=[2]) ) if padding_mask is not None: beta = beta.masked_fill( padding_mask.unsqueeze(1).to(torch.bool), 0.0) # Mix precision to prevent overflow for fp16 beta = beta.type(dtype) beta = beta.clamp(0, 1) prob_check(beta) return beta def mass_preservation( alpha: Tensor, padding_mask: Optional[Tensor] = None, left_padding: bool = False ): """ Function to compute the mass perservation for alpha. This means that the residual weights of alpha will be assigned to the last token. Reference: Monotonic Infinite Lookback Attention for Simultaneous Machine Translation https://arxiv.org/abs/1906.05218 alpha: bsz, tgt_len, src_len padding_mask: bsz, src_len left_padding: bool """ prob_check(alpha) if padding_mask is not None: if not left_padding: assert not padding_mask[:, 0].any(), ( "Find padding on the beginning of the sequence." ) alpha = alpha.masked_fill(padding_mask.unsqueeze(1), 0.0) if left_padding or padding_mask is None: residuals = 1 - alpha[:, :, :-1].sum(dim=-1).clamp(0, 1) alpha[:, :, -1] = residuals else: # right padding _, tgt_len, src_len = alpha.size() residuals = 1 - alpha.sum(dim=-1, keepdim=True).clamp(0, 1) src_lens = src_len - padding_mask.sum(dim=1, keepdim=True) src_lens = src_lens.expand(-1, tgt_len).contiguous() # add back the last value residuals += alpha.gather(2, src_lens.unsqueeze(2) - 1) alpha = alpha.scatter(2, src_lens.unsqueeze(2) - 1, residuals) prob_check(alpha) return alpha
4,975
26.491713
88
py
rej-summ
rej-summ-main/examples/simultaneous_translation/utils/p_choose_strategy.py
from typing import Optional, Dict from torch import Tensor import torch def waitk_p_choose( tgt_len: int, src_len: int, bsz: int, waitk_lagging: int, key_padding_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None ): max_src_len = src_len if incremental_state is not None: # Retrieve target length from incremental states # For inference the length of query is always 1 max_tgt_len = incremental_state["steps"]["tgt"] assert max_tgt_len is not None max_tgt_len = int(max_tgt_len) else: max_tgt_len = tgt_len if max_src_len < waitk_lagging: if incremental_state is not None: max_tgt_len = 1 return torch.zeros( bsz, max_tgt_len, max_src_len ) # Assuming the p_choose looks like this for wait k=3 # src_len = 6, max_tgt_len = 5 # [0, 0, 1, 0, 0, 0, 0] # [0, 0, 0, 1, 0, 0, 0] # [0, 0, 0, 0, 1, 0, 0] # [0, 0, 0, 0, 0, 1, 0] # [0, 0, 0, 0, 0, 0, 1] # linearize the p_choose matrix: # [0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0...] # The indices of linearized matrix that equals 1 is # 2 + 6 * 0 # 3 + 6 * 1 # ... # n + src_len * n + k - 1 = n * (src_len + 1) + k - 1 # n from 0 to max_tgt_len - 1 # # First, generate the indices (activate_indices_offset: bsz, max_tgt_len) # Second, scatter a zeros tensor (bsz, max_tgt_len * src_len) # with activate_indices_offset # Third, resize the tensor to (bsz, max_tgt_len, src_len) activate_indices_offset = ( ( torch.arange(max_tgt_len) * (max_src_len + 1) + waitk_lagging - 1 ) .unsqueeze(0) .expand(bsz, max_tgt_len) .long() ) if key_padding_mask is not None: if key_padding_mask[:, 0].any(): # Left padding activate_indices_offset += ( key_padding_mask.sum(dim=1, keepdim=True) ) # Need to clamp the indices that are too large activate_indices_offset = ( activate_indices_offset .clamp( 0, min( [ max_tgt_len, max_src_len - waitk_lagging + 1 ] ) * max_src_len - 1 ) ) p_choose = torch.zeros(bsz, max_tgt_len * max_src_len) p_choose = p_choose.scatter( 1, activate_indices_offset, 1.0 ).view(bsz, max_tgt_len, max_src_len) if key_padding_mask is not None: p_choose = p_choose.to(key_padding_mask) p_choose = p_choose.masked_fill(key_padding_mask.unsqueeze(1), 0) if incremental_state is not None: p_choose = p_choose[:, -1:] return p_choose.float() def learnable_p_choose( energy, noise_mean: float = 0.0, noise_var: float = 0.0, training: bool = True ): """ Calculating step wise prob for reading and writing 1 to read, 0 to write energy: bsz, tgt_len, src_len """ noise = 0 if training: # add noise here to encourage discretness noise = ( torch.normal(noise_mean, noise_var, energy.size()) .type_as(energy) .to(energy.device) ) p_choose = torch.sigmoid(energy + noise) # p_choose: bsz * self.num_heads, tgt_len, src_len return p_choose
3,445
26.133858
78
py
rej-summ
rej-summ-main/examples/simultaneous_translation/utils/functions.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch def prob_check(tensor, eps=1e-10): assert not torch.isnan(tensor).any(), ( "Nan in a probability tensor." ) # Add the eps here to prevent errors introduced by precision assert tensor.le(1.0 + eps).all() and tensor.ge(0.0 - eps).all(), ( "Incorrect values in a probability tensor" ", 0.0 <= tensor <= 1.0" ) def exclusive_cumprod(tensor, dim: int, eps: float = 1e-10): """ Implementing exclusive cumprod. There is cumprod in pytorch, however there is no exclusive mode. cumprod(x) = [x1, x1x2, x2x3x4, ..., prod_{i=1}^n x_i] exclusive means cumprod(x) = [1, x1, x1x2, x1x2x3, ..., prod_{i=1}^{n-1} x_i] """ tensor_size = list(tensor.size()) tensor_size[dim] = 1 return_tensor = safe_cumprod( torch.cat([torch.ones(tensor_size).type_as(tensor), tensor], dim=dim), dim=dim, eps=eps, ) if dim == 0: return return_tensor[:-1] elif dim == 1: return return_tensor[:, :-1] elif dim == 2: return return_tensor[:, :, :-1] else: raise RuntimeError( "Cumprod on dimension 3 and more is not implemented" ) def safe_cumprod(tensor, dim: int, eps: float = 1e-10): """ An implementation of cumprod to prevent precision issue. cumprod(x) = [x1, x1x2, x1x2x3, ....] = [exp(log(x1)), exp(log(x1) + log(x2)), exp(log(x1) + log(x2) + log(x3)), ...] = exp(cumsum(log(x))) """ if (tensor + eps < 0).any().item(): raise RuntimeError( "Safe cumprod can only take non-negative tensors as input." "Consider use torch.cumprod if you want to calculate negative values." ) log_tensor = torch.log(tensor + eps) cumsum_log_tensor = torch.cumsum(log_tensor, dim) exp_cumsum_log_tensor = torch.exp(cumsum_log_tensor) return exp_cumsum_log_tensor def moving_sum(x, start_idx: int, end_idx: int): """ From MONOTONIC CHUNKWISE ATTENTION https://arxiv.org/pdf/1712.05382.pdf Equation (18) x = [x_1, x_2, ..., x_N] MovingSum(x, start_idx, end_idx)_n = Sigma_{m=n−(start_idx−1)}^{n+end_idx-1} x_m for n in {1, 2, 3, ..., N} x : src_len, batch_size start_idx : start idx end_idx : end idx Example src_len = 5 batch_size = 3 x = [[ 0, 5, 10], [ 1, 6, 11], [ 2, 7, 12], [ 3, 8, 13], [ 4, 9, 14]] MovingSum(x, 3, 1) = [[ 0, 5, 10], [ 1, 11, 21], [ 3, 18, 33], [ 6, 21, 36], [ 9, 24, 39]] MovingSum(x, 1, 3) = [[ 3, 18, 33], [ 6, 21, 36], [ 9, 24, 39], [ 7, 17, 27], [ 4, 9, 14]] """ # TODO: Make dimension configurable assert start_idx > 0 and end_idx > 0 batch_size, tgt_len, src_len = x.size() x = x.view(-1, src_len).unsqueeze(1) # batch_size, 1, src_len moving_sum_weight = torch.ones([1, 1, end_idx + start_idx - 1]).type_as(x) moving_sum = torch.nn.functional.conv1d( x, moving_sum_weight, padding=start_idx + end_idx - 1 ).squeeze(1) moving_sum = moving_sum[:, end_idx:-start_idx] assert src_len == moving_sum.size(1) assert batch_size * tgt_len == moving_sum.size(0) moving_sum = moving_sum.view(batch_size, tgt_len, src_len) return moving_sum
3,535
27.063492
84
py
rej-summ
rej-summ-main/examples/fast_noisy_channel/noisy_channel_translation.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from fairseq.tasks.translation import TranslationTask from fairseq.tasks.language_modeling import LanguageModelingTask from fairseq import checkpoint_utils import argparse from fairseq.tasks import register_task import torch @register_task("noisy_channel_translation") class NoisyChannelTranslation(TranslationTask): """ Rescore the top k candidates from each beam using noisy channel modeling """ @staticmethod def add_args(parser): """Add task-specific arguments to the parser.""" TranslationTask.add_args(parser) # fmt: off parser.add_argument('--channel-model', metavar='FILE', help='path to P(S|T) model. P(S|T) and P(T|S) must share source and target dictionaries.') parser.add_argument('--combine-method', default='lm_only', choices=['lm_only', 'noisy_channel'], help="""method for combining direct and channel model scores. lm_only: decode with P(T|S)P(T) noisy_channel: decode with 1/t P(T|S) + 1/s(P(S|T)P(T))""") parser.add_argument('--normalize-lm-scores-by-tgt-len', action='store_true', default=False, help='normalize lm score by target length instead of source length') parser.add_argument('--channel-scoring-type', default='log_norm', choices=['unnormalized', 'log_norm', 'k2_separate', 'src_vocab', 'src_vocab_batched'], help="Normalize bw scores with log softmax or return bw scores without log softmax") parser.add_argument('--top-k-vocab', default=0, type=int, help='top k vocab IDs to use with `src_vocab` in channel model scoring') parser.add_argument('--k2', default=50, type=int, help='the top k2 candidates to rescore with the noisy channel model for each beam') parser.add_argument('--ch-wt', default=1, type=float, help='weight for the channel model') parser.add_argument('--lm-model', metavar='FILE', help='path to lm model file, to model P(T). P(T) must share the same vocab as the direct model on the target side') parser.add_argument('--lm-data', metavar='FILE', help='path to lm model training data for target language, used to properly load LM with correct dictionary') parser.add_argument('--lm-wt', default=1, type=float, help='the weight of the lm in joint decoding') # fmt: on def build_generator( self, models, args, seq_gen_cls=None, extra_gen_cls_kwargs=None ): if getattr(args, "score_reference", False): raise NotImplementedError() else: from .noisy_channel_sequence_generator import NoisyChannelSequenceGenerator use_cuda = torch.cuda.is_available() and not self.args.cpu assert self.args.lm_model is not None, '--lm-model required for noisy channel generation!' assert self.args.lm_data is not None, '--lm-data required for noisy channel generation to map between LM and bitext vocabs' if self.args.channel_model is not None: import copy ch_args_task = copy.deepcopy(self.args) tmp = ch_args_task.source_lang ch_args_task.source_lang = ch_args_task.target_lang ch_args_task.target_lang = tmp ch_args_task._name = 'translation' channel_task = TranslationTask.setup_task(ch_args_task) arg_dict = {} arg_dict['task'] = 'language_modeling' arg_dict['sample_break_mode'] = 'eos' arg_dict['data'] = self.args.lm_data arg_dict['output_dictionary_size'] = -1 lm_args = argparse.Namespace(**arg_dict) lm_task = LanguageModelingTask.setup_task(lm_args) lm_dict = lm_task.output_dictionary if self.args.channel_model is not None: channel_models, _ = checkpoint_utils.load_model_ensemble(self.args.channel_model.split(':'), task=channel_task) for model in channel_models: model.make_generation_fast_( beamable_mm_beam_size=None if args.no_beamable_mm else args.beam, need_attn=args.print_alignment, ) if self.args.fp16: model.half() if use_cuda: model.cuda() else: channel_models = None lm_models, _ = checkpoint_utils.load_model_ensemble(self.args.lm_model.split(':'), task=lm_task) for model in lm_models: model.make_generation_fast_( beamable_mm_beam_size=None if args.no_beamable_mm else args.beam, need_attn=args.print_alignment, ) if self.args.fp16: model.half() if use_cuda: model.cuda() return NoisyChannelSequenceGenerator( combine_method=self.args.combine_method, tgt_dict=self.target_dictionary, src_dict=self.source_dictionary, beam_size=getattr(args, 'beam', 5), max_len_a=getattr(args, 'max_len_a', 0), max_len_b=getattr(args, 'max_len_b', 200), min_len=getattr(args, 'min_len', 1), len_penalty=getattr(args, 'lenpen', 1), unk_penalty=getattr(args, 'unkpen', 0), temperature=getattr(args, 'temperature', 1.), match_source_len=getattr(args, 'match_source_len', False), no_repeat_ngram_size=getattr(args, 'no_repeat_ngram_size', 0), normalize_scores=(not getattr(args, 'unnormalized', False)), channel_models=channel_models, k2=getattr(self.args, 'k2', 50), ch_weight=getattr(self.args, 'ch_wt', 1), channel_scoring_type=self.args.channel_scoring_type, top_k_vocab=self.args.top_k_vocab, lm_models=lm_models, lm_dict=lm_dict, lm_weight=getattr(self.args, 'lm_wt', 1), normalize_lm_scores_by_tgt_len=getattr(self.args, 'normalize_lm_scores_by_tgt_len', False), )
6,709
51.421875
160
py
rej-summ
rej-summ-main/examples/fast_noisy_channel/noisy_channel_beam_search.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from fairseq.search import Search class NoisyChannelBeamSearch(Search): def __init__(self, tgt_dict): super().__init__(tgt_dict) self.fw_scores_buf = None self.lm_scores_buf = None def _init_buffers(self, t): # super()._init_buffers(t) if self.fw_scores_buf is None: self.scores_buf = t.new() self.indices_buf = torch.LongTensor().to(device=t.device) self.beams_buf = torch.LongTensor().to(device=t.device) self.fw_scores_buf = t.new() self.lm_scores_buf = t.new() def combine_fw_bw(self, combine_method, fw_cum, bw, step): if combine_method == "noisy_channel": fw_norm = fw_cum.div(step + 1) lprobs = bw + fw_norm elif combine_method == "lm_only": lprobs = bw + fw_cum return lprobs def step(self, step, fw_lprobs, scores, bw_lprobs, lm_lprobs, combine_method): self._init_buffers(fw_lprobs) bsz, beam_size, vocab_size = fw_lprobs.size() if step == 0: # at the first step all hypotheses are equally likely, so use # only the first beam fw_lprobs = fw_lprobs[:, ::beam_size, :].contiguous() bw_lprobs = bw_lprobs[:, ::beam_size, :].contiguous() # nothing to add since we are at the first step fw_lprobs_cum = fw_lprobs else: # make probs contain cumulative scores for each hypothesis raw_scores = (scores[:, :, step - 1].unsqueeze(-1)) fw_lprobs_cum = (fw_lprobs.add(raw_scores)) combined_lprobs = self.combine_fw_bw(combine_method, fw_lprobs_cum, bw_lprobs, step) # choose the top k according to the combined noisy channel model score torch.topk( combined_lprobs.view(bsz, -1), k=min( # Take the best 2 x beam_size predictions. We'll choose the first # beam_size of these which don't predict eos to continue with. beam_size * 2, combined_lprobs.view(bsz, -1).size(1) - 1, # -1 so we never select pad ), out=(self.scores_buf, self.indices_buf), ) # save corresponding fw and lm scores self.fw_scores_buf = torch.gather(fw_lprobs_cum.view(bsz, -1), 1, self.indices_buf) self.lm_scores_buf = torch.gather(lm_lprobs.view(bsz, -1), 1, self.indices_buf) # Project back into relative indices and beams self.beams_buf = self.indices_buf // vocab_size self.indices_buf.fmod_(vocab_size) return self.scores_buf, self.fw_scores_buf, self.lm_scores_buf, self.indices_buf, self.beams_buf
2,895
39.222222
104
py
rej-summ
rej-summ-main/examples/fast_noisy_channel/noisy_channel_sequence_generator.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Dict, List, Optional import math import numpy as np import torch import torch.nn.functional as F from torch import Tensor from .noisy_channel_beam_search import NoisyChannelBeamSearch from fairseq.sequence_generator import EnsembleModel class NoisyChannelSequenceGenerator(object): def __init__( self, combine_method, tgt_dict, src_dict=None, beam_size=1, max_len_a=0, max_len_b=200, min_len=1, len_penalty=1.0, unk_penalty=0.0, retain_dropout=False, temperature=1.0, match_source_len=False, no_repeat_ngram_size=0, normalize_scores=True, channel_models=None, k2=10, ch_weight=1.0, channel_scoring_type='log_norm', top_k_vocab=0, lm_models=None, lm_dict=None, lm_weight=1.0, normalize_lm_scores_by_tgt_len=False, ): """Generates translations of a given source sentence, using beam search with noisy channel decoding. Args: combine_method (string, optional): Method to combine direct, LM and channel model scores (default: None) tgt_dict (~fairseq.data.Dictionary): target dictionary src_dict (~fairseq.data.Dictionary): source dictionary beam_size (int, optional): beam width (default: 1) max_len_a/b (int, optional): generate sequences of maximum length ax + b, where x is the source length min_len (int, optional): the minimum length of the generated output (not including end-of-sentence) len_penalty (float, optional): length penalty, where <1.0 favors shorter, >1.0 favors longer sentences (default: 1.0) unk_penalty (float, optional): unknown word penalty, where <0 produces more unks, >0 produces fewer (default: 0.0) retain_dropout (bool, optional): use dropout when generating (default: False) temperature (float, optional): temperature, where values >1.0 produce more uniform samples and values <1.0 produce sharper samples (default: 1.0) match_source_len (bool, optional): outputs should match the source length (default: False) no_repeat_ngram_size (int, optional): Size of n-grams that we avoid repeating in the generation (default: 0) normalize_scores (bool, optional): normalize scores by the length of the output (default: True) channel_models (List[~fairseq.models.FairseqModel]): ensemble of models translating from the target to the source k2 (int, optional): Top K2 candidates to score per beam at each step (default:10) ch_weight (int, optional): Weight associated with the channel model score assuming that the direct model score has weight 1.0 (default: 1.0) channel_scoring_type (str, optional): String specifying how to score the channel model (default: 'log_norm') top_k_vocab (int, optional): If `channel_scoring_type` is `'src_vocab'` or `'src_vocab_batched'`, then this parameter specifies the number of most frequent tokens to include in the channel model output vocabulary, in addition to the source tokens in the input batch (default: 0) lm_models (List[~fairseq.models.FairseqModel]): ensemble of models generating text in the target language lm_dict (~fairseq.data.Dictionary): LM Model dictionary lm_weight (int, optional): Weight associated with the LM model score assuming that the direct model score has weight 1.0 (default: 1.0) normalize_lm_scores_by_tgt_len (bool, optional): Should we normalize LM scores by the target length? By default, we normalize the combination of LM and channel model scores by the source length """ self.pad = tgt_dict.pad() self.unk = tgt_dict.unk() self.eos = tgt_dict.eos() self.vocab_size = len(tgt_dict) self.beam_size = beam_size # the max beam size is the dictionary size - 1, since we never select pad self.beam_size = min(beam_size, self.vocab_size - 1) self.max_len_a = max_len_a self.max_len_b = max_len_b self.min_len = min_len self.normalize_scores = normalize_scores self.len_penalty = len_penalty self.unk_penalty = unk_penalty self.retain_dropout = retain_dropout self.temperature = temperature self.match_source_len = match_source_len self.no_repeat_ngram_size = no_repeat_ngram_size self.channel_models = channel_models self.src_dict = src_dict self.tgt_dict = tgt_dict self.combine_method = combine_method self.k2 = k2 self.ch_weight = ch_weight self.channel_scoring_type = channel_scoring_type self.top_k_vocab = top_k_vocab self.lm_models = lm_models self.lm_dict = lm_dict self.lm_weight = lm_weight self.log_softmax_fn = torch.nn.LogSoftmax(dim=1) self.normalize_lm_scores_by_tgt_len = normalize_lm_scores_by_tgt_len self.share_tgt_dict = (self.lm_dict == self.tgt_dict) self.tgt_to_lm = make_dict2dict(tgt_dict, lm_dict) self.ch_scoring_bsz = 3072 assert temperature > 0, '--temperature must be greater than 0' self.search = NoisyChannelBeamSearch(tgt_dict) @torch.no_grad() def generate( self, models, sample, prefix_tokens=None, bos_token=None, **kwargs ): """Generate a batch of translations. Args: models (List[~fairseq.models.FairseqModel]): ensemble of models sample (dict): batch prefix_tokens (torch.LongTensor, optional): force decoder to begin with these tokens """ model = EnsembleModel(models) incremental_states = torch.jit.annotate( List[Dict[str, Dict[str, Optional[Tensor]]]], [ torch.jit.annotate(Dict[str, Dict[str, Optional[Tensor]]], {}) for i in range(model.models_size) ], ) if not self.retain_dropout: model.eval() # model.forward normally channels prev_output_tokens into the decoder # separately, but SequenceGenerator directly calls model.encoder encoder_input = { k: v for k, v in sample['net_input'].items() if k != 'prev_output_tokens' } src_tokens = encoder_input['src_tokens'] src_lengths_no_eos = (src_tokens.ne(self.eos) & src_tokens.ne(self.pad)).long().sum(dim=1) input_size = src_tokens.size() # batch dimension goes first followed by source lengths bsz = input_size[0] src_len = input_size[1] beam_size = self.beam_size if self.match_source_len: max_len = src_lengths_no_eos.max().item() else: max_len = min( int(self.max_len_a * src_len + self.max_len_b), # exclude the EOS marker model.max_decoder_positions() - 1, ) # compute the encoder output for each beam encoder_outs = model.forward_encoder(encoder_input) new_order = torch.arange(bsz).view(-1, 1).repeat(1, beam_size).view(-1) new_order = new_order.to(src_tokens.device).long() encoder_outs = model.reorder_encoder_out(encoder_outs, new_order) src_lengths = encoder_input['src_lengths'] # initialize buffers scores = src_tokens.new(bsz * beam_size, max_len + 1).float().fill_(0) lm_prefix_scores = src_tokens.new(bsz * beam_size).float().fill_(0) scores_buf = scores.clone() tokens = src_tokens.new(bsz * beam_size, max_len + 2).long().fill_(self.pad) tokens_buf = tokens.clone() tokens[:, 0] = self.eos if bos_token is None else bos_token # reorder source tokens so they may be used as a reference in generating P(S|T) src_tokens = reorder_all_tokens(src_tokens, src_lengths, self.src_dict.eos_index) src_tokens = src_tokens.repeat(1, beam_size).view(-1, src_len) src_lengths = src_lengths.view(bsz, -1).repeat(1, beam_size).view(bsz*beam_size, -1) attn, attn_buf = None, None nonpad_idxs = None # The cands_to_ignore indicates candidates that should be ignored. # For example, suppose we're sampling and have already finalized 2/5 # samples. Then the cands_to_ignore would mark 2 positions as being ignored, # so that we only finalize the remaining 3 samples. cands_to_ignore = src_tokens.new_zeros(bsz, beam_size).eq(-1) # forward and backward-compatible False mask # list of completed sentences finalized = [[] for i in range(bsz)] finished = [False for i in range(bsz)] num_remaining_sent = bsz # number of candidate hypos per step cand_size = 2 * beam_size # 2 x beam size in case half are EOS # offset arrays for converting between different indexing schemes bbsz_offsets = (torch.arange(0, bsz) * beam_size).unsqueeze(1).type_as(tokens) cand_offsets = torch.arange(0, cand_size).type_as(tokens) # helper function for allocating buffers on the fly buffers = {} def buffer(name, type_of=tokens): # noqa if name not in buffers: buffers[name] = type_of.new() return buffers[name] def is_finished(sent, step, unfin_idx): """ Check whether we've finished generation for a given sentence, by comparing the worst score among finalized hypotheses to the best possible score among unfinalized hypotheses. """ assert len(finalized[sent]) <= beam_size if len(finalized[sent]) == beam_size: return True return False def finalize_hypos(step, bbsz_idx, eos_scores, combined_noisy_channel_eos_scores): """ Finalize the given hypotheses at this step, while keeping the total number of finalized hypotheses per sentence <= beam_size. Note: the input must be in the desired finalization order, so that hypotheses that appear earlier in the input are preferred to those that appear later. Args: step: current time step bbsz_idx: A vector of indices in the range [0, bsz*beam_size), indicating which hypotheses to finalize eos_scores: A vector of the same size as bbsz_idx containing fw scores for each hypothesis combined_noisy_channel_eos_scores: A vector of the same size as bbsz_idx containing combined noisy channel scores for each hypothesis """ assert bbsz_idx.numel() == eos_scores.numel() # clone relevant token and attention tensors tokens_clone = tokens.index_select(0, bbsz_idx) tokens_clone = tokens_clone[:, 1:step + 2] # skip the first index, which is EOS assert not tokens_clone.eq(self.eos).any() tokens_clone[:, step] = self.eos attn_clone = attn.index_select(0, bbsz_idx)[:, :, 1:step+2] if attn is not None else None # compute scores per token position pos_scores = scores.index_select(0, bbsz_idx)[:, :step+1] pos_scores[:, step] = eos_scores # convert from cumulative to per-position scores pos_scores[:, 1:] = pos_scores[:, 1:] - pos_scores[:, :-1] # normalize sentence-level scores if self.normalize_scores: combined_noisy_channel_eos_scores /= (step + 1) ** self.len_penalty cum_unfin = [] prev = 0 for f in finished: if f: prev += 1 else: cum_unfin.append(prev) sents_seen = set() for i, (idx, score) in enumerate(zip(bbsz_idx.tolist(), combined_noisy_channel_eos_scores.tolist())): unfin_idx = idx // beam_size sent = unfin_idx + cum_unfin[unfin_idx] sents_seen.add((sent, unfin_idx)) if self.match_source_len and step > src_lengths_no_eos[unfin_idx]: score = -math.inf def get_hypo(): if attn_clone is not None: # remove padding tokens from attn scores hypo_attn = attn_clone[i][nonpad_idxs[sent]] _, alignment = hypo_attn.max(dim=0) else: hypo_attn = None alignment = None return { 'tokens': tokens_clone[i], 'score': score, 'attention': hypo_attn, # src_len x tgt_len 'alignment': alignment, 'positional_scores': pos_scores[i], } if len(finalized[sent]) < beam_size: finalized[sent].append(get_hypo()) newly_finished = [] for sent, unfin_idx in sents_seen: # check termination conditions for this sentence if not finished[sent] and is_finished(sent, step, unfin_idx): finished[sent] = True newly_finished.append(unfin_idx) return newly_finished def noisy_channel_rescoring(lprobs, beam_size, bsz, src_tokens, tokens, k): """Rescore the top k hypothesis from each beam using noisy channel modeling Returns: new_fw_lprobs: the direct model probabilities after pruning the top k new_ch_lm_lprobs: the combined channel and language model probabilities new_lm_lprobs: the language model probabilities after pruning the top k """ with torch.no_grad(): lprobs_size = lprobs.size() if prefix_tokens is not None and step < prefix_tokens.size(1): probs_slice = lprobs.view(bsz, -1, lprobs.size(-1))[:, 0, :] cand_scores = torch.gather( probs_slice, dim=1, index=prefix_tokens[:, step].view(-1, 1).data ).expand(-1, beam_size).contiguous().view(bsz*beam_size, 1) cand_indices = prefix_tokens[:, step].view(-1, 1).expand(bsz, beam_size).data.contiguous().view(bsz*beam_size, 1) # need to calculate and save fw and lm probs for prefix tokens fw_top_k = cand_scores fw_top_k_idx = cand_indices k = 1 else: # take the top k best words for every sentence in batch*beam fw_top_k, fw_top_k_idx = torch.topk(lprobs.view(beam_size*bsz, -1), k=k) eos_idx = torch.nonzero(fw_top_k_idx.view(bsz*beam_size*k, -1) == self.eos)[:, 0] ch_scores = fw_top_k.new_full((beam_size*bsz*k, ), 0) src_size = torch.sum(src_tokens[:, :] != self.src_dict.pad_index, dim=1, keepdim=True, dtype=fw_top_k.dtype) if self.combine_method != "lm_only": temp_src_tokens_full = src_tokens[:, :].repeat(1, k).view(bsz*beam_size*k, -1) not_padding = temp_src_tokens_full[:, 1:] != self.src_dict.pad_index cur_tgt_size = step+2 # add eos to all candidate sentences except those that already end in eos eos_tokens = tokens[:, 0].repeat(1, k).view(-1, 1) eos_tokens[eos_idx] = self.tgt_dict.pad_index if step == 0: channel_input = torch.cat((fw_top_k_idx.view(-1, 1), eos_tokens), 1) else: # move eos from beginning to end of target sentence channel_input = torch.cat((tokens[:, 1:step + 1].repeat(1, k).view(-1, step), fw_top_k_idx.view(-1, 1), eos_tokens), 1) ch_input_lengths = torch.tensor(np.full(channel_input.size(0), cur_tgt_size)) ch_input_lengths[eos_idx] = cur_tgt_size-1 if self.channel_scoring_type == "unnormalized": ch_encoder_output = channel_model.encoder(channel_input, src_lengths=ch_input_lengths) ch_decoder_output, _ = channel_model.decoder(temp_src_tokens_full, encoder_out=ch_encoder_output, features_only=True) del ch_encoder_output ch_intermed_scores = channel_model.decoder.unnormalized_scores_given_target(ch_decoder_output, target_ids=temp_src_tokens_full[:, 1:]) ch_intermed_scores = ch_intermed_scores.float() ch_intermed_scores *= not_padding.float() ch_scores = torch.sum(ch_intermed_scores, dim=1) elif self.channel_scoring_type == "k2_separate": for k_idx in range(k): k_eos_tokens = eos_tokens[k_idx::k, :] if step == 0: k_ch_input = torch.cat((fw_top_k_idx[:, k_idx:k_idx+1], k_eos_tokens), 1) else: # move eos from beginning to end of target sentence k_ch_input = torch.cat((tokens[:, 1:step + 1], fw_top_k_idx[:, k_idx:k_idx+1], k_eos_tokens), 1) k_ch_input_lengths = ch_input_lengths[k_idx::k] k_ch_output = channel_model(k_ch_input, k_ch_input_lengths, src_tokens) k_ch_lprobs = channel_model.get_normalized_probs(k_ch_output, log_probs=True) k_ch_intermed_scores = torch.gather(k_ch_lprobs[:, :-1, :], 2, src_tokens[:, 1:].unsqueeze(2)).squeeze(2) k_ch_intermed_scores *= not_padding.float() ch_scores[k_idx::k] = torch.sum(k_ch_intermed_scores, dim=1) elif self.channel_scoring_type == "src_vocab": ch_encoder_output = channel_model.encoder(channel_input, src_lengths=ch_input_lengths) ch_decoder_output, _ = channel_model.decoder(temp_src_tokens_full, encoder_out=ch_encoder_output, features_only=True) del ch_encoder_output ch_lprobs = normalized_scores_with_batch_vocab( channel_model.decoder, ch_decoder_output, src_tokens, k, bsz, beam_size, self.src_dict.pad_index, top_k=self.top_k_vocab) ch_scores = torch.sum(ch_lprobs, dim=1) elif self.channel_scoring_type == "src_vocab_batched": ch_bsz_size = temp_src_tokens_full.shape[0] ch_lprobs_list = [None] * len(range(0, ch_bsz_size, self.ch_scoring_bsz)) for i, start_idx in enumerate(range(0, ch_bsz_size, self.ch_scoring_bsz)): end_idx = min(start_idx + self.ch_scoring_bsz, ch_bsz_size) temp_src_tokens_full_batch = temp_src_tokens_full[start_idx:end_idx, :] channel_input_batch = channel_input[start_idx:end_idx, :] ch_input_lengths_batch = ch_input_lengths[start_idx:end_idx] ch_encoder_output_batch = channel_model.encoder(channel_input_batch, src_lengths=ch_input_lengths_batch) ch_decoder_output_batch, _ = channel_model.decoder(temp_src_tokens_full_batch, encoder_out=ch_encoder_output_batch, features_only=True) ch_lprobs_list[i] = normalized_scores_with_batch_vocab( channel_model.decoder, ch_decoder_output_batch, src_tokens, k, bsz, beam_size, self.src_dict.pad_index, top_k=self.top_k_vocab, start_idx=start_idx, end_idx=end_idx) ch_lprobs = torch.cat(ch_lprobs_list, dim=0) ch_scores = torch.sum(ch_lprobs, dim=1) else: ch_output = channel_model(channel_input, ch_input_lengths, temp_src_tokens_full) ch_lprobs = channel_model.get_normalized_probs(ch_output, log_probs=True) ch_intermed_scores = torch.gather(ch_lprobs[:, :-1, :], 2, temp_src_tokens_full[:, 1:].unsqueeze(2)).squeeze().view(bsz*beam_size*k, -1) ch_intermed_scores *= not_padding.float() ch_scores = torch.sum(ch_intermed_scores, dim=1) else: cur_tgt_size = 0 ch_scores = ch_scores.view(bsz*beam_size, k) expanded_lm_prefix_scores = lm_prefix_scores.unsqueeze(1).expand(-1, k).flatten() if self.share_tgt_dict: lm_scores = get_lm_scores(lm, tokens[:, :step + 1].view(-1, step+1), lm_incremental_states, fw_top_k_idx.view(-1, 1), torch.tensor(np.full(tokens.size(0), step+1)), k) else: new_lm_input = dict2dict(tokens[:, :step + 1].view(-1, step+1), self.tgt_to_lm) new_cands = dict2dict(fw_top_k_idx.view(-1, 1), self.tgt_to_lm) lm_scores = get_lm_scores(lm, new_lm_input, lm_incremental_states, new_cands, torch.tensor(np.full(tokens.size(0), step+1)), k) lm_scores.add_(expanded_lm_prefix_scores) ch_lm_scores = combine_ch_lm(self.combine_method, ch_scores, lm_scores, src_size, cur_tgt_size) # initialize all as min value new_fw_lprobs = ch_scores.new(lprobs_size).fill_(-1e17).view(bsz*beam_size, -1) new_ch_lm_lprobs = ch_scores.new(lprobs_size).fill_(-1e17).view(bsz*beam_size, -1) new_lm_lprobs = ch_scores.new(lprobs_size).fill_(-1e17).view(bsz*beam_size, -1) new_fw_lprobs[:, self.pad] = -math.inf new_ch_lm_lprobs[:, self.pad] = -math.inf new_lm_lprobs[:, self.pad] = -math.inf new_fw_lprobs.scatter_(1, fw_top_k_idx, fw_top_k) new_ch_lm_lprobs.scatter_(1, fw_top_k_idx, ch_lm_scores) new_lm_lprobs.scatter_(1, fw_top_k_idx, lm_scores.view(-1, k)) return new_fw_lprobs, new_ch_lm_lprobs, new_lm_lprobs def combine_ch_lm(combine_type, ch_scores, lm_scores1, src_size, tgt_size): if self.channel_scoring_type == "unnormalized": ch_scores = self.log_softmax_fn( ch_scores.view(-1, self.beam_size * self.k2) ).view(ch_scores.shape) ch_scores = ch_scores * self.ch_weight lm_scores1 = lm_scores1 * self.lm_weight if combine_type == "lm_only": # log P(T|S) + log P(T) ch_scores = lm_scores1.view(ch_scores.size()) elif combine_type == "noisy_channel": # 1/t log P(T|S) + 1/s log P(S|T) + 1/t log P(T) if self.normalize_lm_scores_by_tgt_len: ch_scores.div_(src_size) lm_scores_norm = lm_scores1.view(ch_scores.size()).div(tgt_size) ch_scores.add_(lm_scores_norm) # 1/t log P(T|S) + 1/s log P(S|T) + 1/s log P(T) else: ch_scores.add_(lm_scores1.view(ch_scores.size())) ch_scores.div_(src_size) return ch_scores if self.channel_models is not None: channel_model = self.channel_models[0] # assume only one channel_model model else: channel_model = None lm = EnsembleModel(self.lm_models) lm_incremental_states = torch.jit.annotate( List[Dict[str, Dict[str, Optional[Tensor]]]], [ torch.jit.annotate(Dict[str, Dict[str, Optional[Tensor]]], {}) for i in range(lm.models_size) ], ) reorder_state = None batch_idxs = None for step in range(max_len + 1): # one extra step for EOS marker # reorder decoder internal states based on the prev choice of beams if reorder_state is not None: if batch_idxs is not None: # update beam indices to take into account removed sentences corr = batch_idxs - torch.arange(batch_idxs.numel()).type_as(batch_idxs) reorder_state.view(-1, beam_size).add_(corr.unsqueeze(-1) * beam_size) model.reorder_incremental_state(incremental_states, reorder_state) encoder_outs = model.reorder_encoder_out(encoder_outs, reorder_state) lm.reorder_incremental_state(lm_incremental_states, reorder_state) fw_lprobs, avg_attn_scores = model.forward_decoder( tokens[:, :step + 1], encoder_outs, incremental_states, temperature=self.temperature, ) fw_lprobs[:, self.pad] = -math.inf # never select pad fw_lprobs[:, self.unk] -= self.unk_penalty # apply unk penalty fw_lprobs, ch_lm_lprobs, lm_lprobs = noisy_channel_rescoring(fw_lprobs, beam_size, bsz, src_tokens, tokens, self.k2) # handle min and max length constraints if step >= max_len: fw_lprobs[:, :self.eos] = -math.inf fw_lprobs[:, self.eos + 1:] = -math.inf elif step < self.min_len: fw_lprobs[:, self.eos] = -math.inf # handle prefix tokens (possibly with different lengths) if prefix_tokens is not None and step < prefix_tokens.size(1): prefix_toks = prefix_tokens[:, step].unsqueeze(-1).repeat(1, beam_size).view(-1) prefix_mask = prefix_toks.ne(self.pad) prefix_fw_lprobs = fw_lprobs.gather(-1, prefix_toks.unsqueeze(-1)) fw_lprobs[prefix_mask] = -math.inf fw_lprobs[prefix_mask] = fw_lprobs[prefix_mask].scatter_( -1, prefix_toks[prefix_mask].unsqueeze(-1), prefix_fw_lprobs ) prefix_ch_lm_lprobs = ch_lm_lprobs.gather(-1, prefix_toks.unsqueeze(-1)) ch_lm_lprobs[prefix_mask] = -math.inf ch_lm_lprobs[prefix_mask] = ch_lm_lprobs[prefix_mask].scatter_( -1, prefix_toks[prefix_mask].unsqueeze(-1), prefix_ch_lm_lprobs ) prefix_lm_lprobs = lm_lprobs.gather(-1, prefix_toks.unsqueeze(-1)) lm_lprobs[prefix_mask] = -math.inf lm_lprobs[prefix_mask] = lm_lprobs[prefix_mask].scatter_( -1, prefix_toks[prefix_mask].unsqueeze(-1), prefix_lm_lprobs ) # if prefix includes eos, then we should make sure tokens and # scores are the same across all beams eos_mask = prefix_toks.eq(self.eos) if eos_mask.any(): # validate that the first beam matches the prefix first_beam = tokens[eos_mask].view(-1, beam_size, tokens.size(-1))[:, 0, 1:step + 1] eos_mask_batch_dim = eos_mask.view(-1, beam_size)[:, 0] target_prefix = prefix_tokens[eos_mask_batch_dim][:, :step] assert (first_beam == target_prefix).all() def replicate_first_beam(tensor, mask): tensor = tensor.view(-1, beam_size, tensor.size(-1)) tensor[mask] = tensor[mask][:, :1, :] return tensor.view(-1, tensor.size(-1)) # copy tokens, scores and lprobs from the first beam to all beams tokens = replicate_first_beam(tokens, eos_mask_batch_dim) scores = replicate_first_beam(scores, eos_mask_batch_dim) fw_lprobs = replicate_first_beam(fw_lprobs, eos_mask_batch_dim) ch_lm_lprobs = replicate_first_beam(ch_lm_lprobs, eos_mask_batch_dim) lm_lprobs = replicate_first_beam(lm_lprobs, eos_mask_batch_dim) if self.no_repeat_ngram_size > 0: # for each beam and batch sentence, generate a list of previous ngrams gen_ngrams = [{} for bbsz_idx in range(bsz * beam_size)] for bbsz_idx in range(bsz * beam_size): gen_tokens = tokens[bbsz_idx].tolist() for ngram in zip(*[gen_tokens[i:] for i in range(self.no_repeat_ngram_size)]): gen_ngrams[bbsz_idx][tuple(ngram[:-1])] = \ gen_ngrams[bbsz_idx].get(tuple(ngram[:-1]), []) + [ngram[-1]] # Record attention scores if avg_attn_scores is not None: if attn is None: attn = scores.new(bsz * beam_size, src_tokens.size(1), max_len + 2) attn_buf = attn.clone() nonpad_idxs = src_tokens.ne(self.pad) attn[:, :, step + 1].copy_(avg_attn_scores) scores = scores.type_as(fw_lprobs) scores_buf = scores_buf.type_as(fw_lprobs) self.search.set_src_lengths(src_lengths_no_eos) if self.no_repeat_ngram_size > 0: def calculate_banned_tokens(bbsz_idx): # before decoding the next token, prevent decoding of ngrams that have already appeared ngram_index = tuple(tokens[bbsz_idx, step + 2 - self.no_repeat_ngram_size:step + 1].tolist()) return gen_ngrams[bbsz_idx].get(ngram_index, []) if step + 2 - self.no_repeat_ngram_size >= 0: # no banned tokens if we haven't generated no_repeat_ngram_size tokens yet banned_tokens = [calculate_banned_tokens(bbsz_idx) for bbsz_idx in range(bsz * beam_size)] else: banned_tokens = [[] for bbsz_idx in range(bsz * beam_size)] for bbsz_idx in range(bsz * beam_size): fw_lprobs[bbsz_idx, banned_tokens[bbsz_idx]] = -math.inf combined_noisy_channel_scores, fw_lprobs_top_k, lm_lprobs_top_k, cand_indices, cand_beams = self.search.step( step, fw_lprobs.view(bsz, -1, self.vocab_size), scores.view(bsz, beam_size, -1)[:, :, :step], ch_lm_lprobs.view(bsz, -1, self.vocab_size), lm_lprobs.view(bsz, -1, self.vocab_size), self.combine_method ) # cand_bbsz_idx contains beam indices for the top candidate # hypotheses, with a range of values: [0, bsz*beam_size), # and dimensions: [bsz, cand_size] cand_bbsz_idx = cand_beams.add(bbsz_offsets) # finalize hypotheses that end in eos (except for candidates to be ignored) eos_mask = cand_indices.eq(self.eos) eos_mask[:, :beam_size] &= ~cands_to_ignore # only consider eos when it's among the top beam_size indices eos_bbsz_idx = torch.masked_select( cand_bbsz_idx[:, :beam_size], mask=eos_mask[:, :beam_size] ) finalized_sents = set() if eos_bbsz_idx.numel() > 0: eos_scores = torch.masked_select( fw_lprobs_top_k[:, :beam_size], mask=eos_mask[:, :beam_size] ) combined_noisy_channel_eos_scores = torch.masked_select( combined_noisy_channel_scores[:, :beam_size], mask=eos_mask[:, :beam_size], ) # finalize hypo using channel model score finalized_sents = finalize_hypos( step, eos_bbsz_idx, eos_scores, combined_noisy_channel_eos_scores) num_remaining_sent -= len(finalized_sents) assert num_remaining_sent >= 0 if num_remaining_sent == 0: break if len(finalized_sents) > 0: new_bsz = bsz - len(finalized_sents) # construct batch_idxs which holds indices of batches to keep for the next pass batch_mask = cand_indices.new_ones(bsz) batch_mask[cand_indices.new(finalized_sents)] = 0 batch_idxs = torch.nonzero(batch_mask).squeeze(-1) eos_mask = eos_mask[batch_idxs] cand_beams = cand_beams[batch_idxs] bbsz_offsets.resize_(new_bsz, 1) cand_bbsz_idx = cand_beams.add(bbsz_offsets) lm_lprobs_top_k = lm_lprobs_top_k[batch_idxs] fw_lprobs_top_k = fw_lprobs_top_k[batch_idxs] cand_indices = cand_indices[batch_idxs] if prefix_tokens is not None: prefix_tokens = prefix_tokens[batch_idxs] src_lengths_no_eos = src_lengths_no_eos[batch_idxs] cands_to_ignore = cands_to_ignore[batch_idxs] scores = scores.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, -1) scores_buf.resize_as_(scores) tokens = tokens.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, -1) tokens_buf.resize_as_(tokens) src_tokens = src_tokens.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, -1) src_lengths = src_lengths.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, -1) lm_prefix_scores = lm_prefix_scores.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, -1).squeeze() if attn is not None: attn = attn.view(bsz, -1)[batch_idxs].view(new_bsz * beam_size, attn.size(1), -1) attn_buf.resize_as_(attn) bsz = new_bsz else: batch_idxs = None # Set active_mask so that values > cand_size indicate eos or # ignored hypos and values < cand_size indicate candidate # active hypos. After this, the min values per row are the top # candidate active hypos. eos_mask[:, :beam_size] |= cands_to_ignore active_mask = torch.add( eos_mask.type_as(cand_offsets) * cand_size, cand_offsets[: eos_mask.size(1)], ) # get the top beam_size active hypotheses, which are just the hypos # with the smallest values in active_mask active_hypos, new_cands_to_ignore = buffer('active_hypos'), buffer('new_cands_to_ignore') torch.topk( active_mask, k=beam_size, dim=1, largest=False, out=(new_cands_to_ignore, active_hypos) ) # update cands_to_ignore to ignore any finalized hypos cands_to_ignore = new_cands_to_ignore.ge(cand_size)[:, :beam_size] assert (~cands_to_ignore).any(dim=1).all() active_bbsz_idx = buffer('active_bbsz_idx') torch.gather( cand_bbsz_idx, dim=1, index=active_hypos, out=active_bbsz_idx, ) active_scores = torch.gather( fw_lprobs_top_k, dim=1, index=active_hypos, out=scores[:, step].view(bsz, beam_size), ) active_bbsz_idx = active_bbsz_idx.view(-1) active_scores = active_scores.view(-1) # copy tokens and scores for active hypotheses torch.index_select( tokens[:, :step + 1], dim=0, index=active_bbsz_idx, out=tokens_buf[:, :step + 1], ) torch.gather( cand_indices, dim=1, index=active_hypos, out=tokens_buf.view(bsz, beam_size, -1)[:, :, step + 1], ) if step > 0: torch.index_select( scores[:, :step], dim=0, index=active_bbsz_idx, out=scores_buf[:, :step], ) torch.gather( fw_lprobs_top_k, dim=1, index=active_hypos, out=scores_buf.view(bsz, beam_size, -1)[:, :, step], ) torch.gather( lm_lprobs_top_k, dim=1, index=active_hypos, out=lm_prefix_scores.view(bsz, beam_size) ) # copy attention for active hypotheses if attn is not None: torch.index_select( attn[:, :, :step + 2], dim=0, index=active_bbsz_idx, out=attn_buf[:, :, :step + 2], ) # swap buffers tokens, tokens_buf = tokens_buf, tokens scores, scores_buf = scores_buf, scores if attn is not None: attn, attn_buf = attn_buf, attn # reorder incremental state in decoder reorder_state = active_bbsz_idx # sort by score descending for sent in range(len(finalized)): finalized[sent] = sorted(finalized[sent], key=lambda r: r['score'], reverse=True) return finalized def get_lm_scores(model, input_tokens, incremental_states, cand_tokens, input_len, k): with torch.no_grad(): lm_lprobs, avg_attn_scores = model.forward_decoder( input_tokens, encoder_outs=None, incremental_states=incremental_states, ) lm_lprobs_size = lm_lprobs.size(0) probs_next_wrd = torch.gather(lm_lprobs.repeat(1, k).view(lm_lprobs_size*k, -1), 1, cand_tokens).squeeze().view(-1) return probs_next_wrd def make_dict2dict(old_dict, new_dict): dict2dict_map = {} for sym in old_dict.symbols: dict2dict_map[old_dict.index(sym)] = new_dict.index(sym) return dict2dict_map def dict2dict(tokens, dict2dict_map): if tokens.device == torch.device('cpu'): tokens_tmp = tokens else: tokens_tmp = tokens.cpu() return tokens_tmp.map_( tokens_tmp, lambda _, val, dict2dict_map=dict2dict_map : dict2dict_map[float(val)] ).to(tokens.device) def reorder_tokens(tokens, lengths, eos): # reorder source tokens so they may be used as reference for P(S|T) return torch.cat((tokens.new([eos]), tokens[-lengths:-1], tokens[:-lengths]), 0) def reorder_all_tokens(tokens, lengths, eos): # used to reorder src tokens from [<pad> <w1> <w2> .. <eos>] to [<eos> <w1> <w2>...<pad>] # so source tokens can be used to predict P(S|T) return torch.stack([reorder_tokens(token, length, eos) for token, length in zip(tokens, lengths)]) def normalized_scores_with_batch_vocab( model_decoder, features, target_ids, k, bsz, beam_size, pad_idx, top_k=0, vocab_size_meter=None, start_idx=None, end_idx=None, **kwargs): """ Get normalized probabilities (or log probs) from a net's output w.r.t. vocab consisting of target IDs in the batch """ if model_decoder.adaptive_softmax is None: weight = model_decoder.output_projection.weight vocab_ids = torch.unique( torch.cat( (torch.unique(target_ids), torch.arange(top_k, device=target_ids.device)) ) ) id_map = dict(zip(vocab_ids.tolist(), range(len(vocab_ids)))) mapped_target_ids = target_ids.cpu().apply_( lambda x, id_map=id_map: id_map[x] ).to(target_ids.device) expanded_target_ids = mapped_target_ids[:, :].repeat(1, k).view(bsz*beam_size*k, -1) if start_idx is not None and end_idx is not None: expanded_target_ids = expanded_target_ids[start_idx:end_idx, :] logits = F.linear(features, weight[vocab_ids, :]) log_softmax = F.log_softmax(logits, dim=-1, dtype=torch.float32) intermed_scores = torch.gather( log_softmax[:, :-1, :], 2, expanded_target_ids[:, 1:].unsqueeze(2), ).squeeze() not_padding = expanded_target_ids[:, 1:] != pad_idx intermed_scores *= not_padding.float() return intermed_scores else: raise ValueError("adaptive softmax doesn't work with " + "`normalized_scores_with_batch_vocab()`")
41,200
47.874259
187
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/speech_to_text_head_selection.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from fairseq.optim.amp_optimizer import AMPOptimizer from fairseq.tasks import register_task from fairseq.tasks.speech_to_text import SpeechToTextTask from .data.speech_to_text_dataset_with_domain import SpeechToTextDatasetCreatorWithDomain from .loss.attention_head_selection import HeadSelectionLoss @register_task("speech_to_text_head_selection") class SpeechToTextHeadSelectionTask(SpeechToTextTask): @classmethod def add_args(cls, parser): SpeechToTextTask.add_args(parser) parser.add_argument( "--task-type", type=str, default="lang", help="task type for head selection, lang or domain" ) parser.add_argument( "--kl-weight", type=float, default=0.0, help="the weight of KL loss" ) def __init__(self, args, tgt_dict): super().__init__(args, tgt_dict) self.task_type = args.task_type assert self.task_type in ["lang", "domain"], "invalid task_type: {}, should be either lang or domain".format(self.task_type) self.map_task_to_id(args.train_subset) self.encoder_head_prior = float(args.decoder_attention_heads) / args.total_decoder_attention_heads self.decoder_head_prior = float(args.encoder_attention_heads) / args.total_encoder_attention_heads self.kl_loss = HeadSelectionLoss(args) def map_task_to_id(self, train_subset): src_lang_set, tgt_lang_set, domain_set = set(), set(), set() for split in train_subset.split(","): seq = split.split("_") assert len(seq) == 4, "subset {} should be in the format of train_src_tgt_domain".format(split) _, src_lang, tgt_lang, domain = seq src_lang_set.add(src_lang) tgt_lang_set.add(tgt_lang) domain_set.add(domain) src_langs = sorted(src_lang_set) tgt_langs = sorted(tgt_lang_set) domains = sorted(domain_set) self.src_lang_map = {src_lang: i for (i, src_lang) in enumerate(src_langs)} self.tgt_lang_map = {tgt_lang: i for (i, tgt_lang) in enumerate(tgt_langs)} self.domain_map = {domain: i for (i, domain) in enumerate(domains)} if self.task_type == "lang": self.encoder_tasks = len(self.src_lang_map) self.decoder_tasks = len(self.tgt_lang_map) elif self.task_type == "domain": self.encoder_tasks = len(self.domain_map) self.decoder_tasks = len(self.domain_map) def load_dataset(self, split, epoch=1, combine=False, **kwargs): is_train_split = split.startswith("train") pre_tokenizer = self.build_tokenizer(self.args) bpe_tokenizer = self.build_bpe(self.args) self.datasets[split] = SpeechToTextDatasetCreatorWithDomain.from_tsv( self.args.data, self.data_cfg, split, self.tgt_dict, pre_tokenizer, bpe_tokenizer, is_train_split=is_train_split, epoch=epoch, seed=self.args.seed, src_lang_map=self.src_lang_map, tgt_lang_map=self.tgt_lang_map, domain_map=self.domain_map, speaker_to_id=self.speaker_to_id ) def build_model(self, args): args.encoder_tasks = self.encoder_tasks args.decoder_tasks = self.decoder_tasks return super(SpeechToTextHeadSelectionTask, self).build_model(args) def get_sample_sizes(self, sample, task_ids, num_tasks): """ task_ids: (bsz,) get sample sizes for each task """ bsz = task_ids.size(0) mat = torch.zeros((num_tasks, bsz), device=task_ids.device) mat[task_ids, torch.arange(bsz)] = 1.0 ntokens = torch.sum(sample['target'] != 1, dim=-1) sample_sizes = torch.matmul(mat, ntokens.float()) return sample_sizes def train_step( self, sample, model, criterion, optimizer, update_num, ignore_grad=False ): model.train() model.set_num_updates(update_num) # task ids if self.task_type == "lang": encoder_task_ids = sample["src_lang_ids"] decoder_task_ids = sample["tgt_lang_ids"] elif self.task_type == "domain": encoder_task_ids = sample["domain_ids"] decoder_task_ids = sample["domain_ids"] model.encoder.set_task_ids(encoder_task_ids) model.decoder.set_task_ids(decoder_task_ids) with torch.autograd.profiler.record_function("forward"): with torch.cuda.amp.autocast(enabled=(isinstance(optimizer, AMPOptimizer))): loss, sample_size, logging_output = criterion(model, sample) # KL loss if self.args.encoder_attn_head_select: sample_sizes = self.get_sample_sizes(sample, encoder_task_ids, self.encoder_tasks) loss += self.kl_loss( model.encoder.attn_head_selector.head_samples, sample_sizes, self.encoder_head_prior ) if self.args.decoder_self_attn_head_select: sample_sizes = self.get_sample_sizes(sample, decoder_task_ids, self.decoder_tasks) loss += self.kl_loss( model.decoder.self_attn_head_selector.head_samples, sample_sizes, self.decoder_head_prior ) if self.args.dec_enc_attn_head_select: sample_sizes = self.get_sample_sizes(sample, decoder_task_ids, self.decoder_tasks) loss += self.kl_loss( model.decoder.enc_attn_head_selector.head_sampes, sample_sizes, self.decoder_head_prior ) if ignore_grad: loss *= 0 with torch.autograd.profiler.record_function("backward"): optimizer.backward(loss) return loss, sample_size, logging_output def valid_step(self, sample, model, criterion): model.eval() # task ids if self.task_type == "lang": encoder_task_ids = sample["src_lang_ids"] decoder_task_ids = sample["tgt_lang_ids"] elif self.task_type == "domain": encoder_task_ids = sample["domain_ids"] decoder_task_ids = sample["domain_ids"] model.encoder.set_task_ids(encoder_task_ids) model.decoder.set_task_ids(decoder_task_ids) with torch.no_grad(): loss, sample_size, logging_output = criterion(model, sample) return loss, sample_size, logging_output def inference_step( self, generator, models, sample, prefix_tokens=None, constraints=None ): with torch.no_grad(): # task ids if self.task_type == "lang": encoder_task_ids = sample["src_lang_ids"][:1] decoder_task_ids = sample["tgt_lang_ids"][:1] elif self.task_type == "domain": encoder_task_ids = sample["domain_ids"][:1] decoder_task_ids = sample["domain_ids"][:1] for model in models: model.encoder.set_task_ids(encoder_task_ids) model.decoder.set_task_ids(decoder_task_ids) return generator.generate( models, sample, prefix_tokens=prefix_tokens, constraints=constraints )
7,727
41.696133
132
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/modules/multihead_functional.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Optional, Tuple import torch from torch import Tensor from torch.nn.functional import ( linear, softmax, dropout, pad, has_torch_function, handle_torch_function, _in_projection_packed, ) import math import warnings def _scaled_dot_product_attention( q: Tensor, k: Tensor, v: Tensor, attn_mask: Optional[Tensor] = None, dropout_p: float = 0.0, bsz: int = 1, subset_heads: Optional[Tensor] = None, subset_weights: Optional[Tensor] = None, ) -> Tuple[Tensor, Tensor]: B, Nt, E = q.shape q = q / math.sqrt(E) # B: bsz * total_num_heads # (B, Nt, E) x (B, E, Ns) -> (B, Nt, Ns) attn = torch.bmm(q, k.transpose(-2, -1)) if attn_mask is not None: attn += attn_mask attn = softmax(attn, dim=-1) if dropout_p > 0.0: attn = dropout(attn, p=dropout_p) if subset_heads is None: # (B, Nt, Ns) x (B, Ns, E) -> (B, Nt, E) output = torch.bmm(attn, v) else: mixed_output = torch.bmm(attn, v).contiguous().view(bsz, -1, Nt, E) output = torch.stack( [mixed_output[torch.arange(bsz), subset_heads[:, col], :, :] for col in range(subset_heads.size(1))], dim=1 ) output = output * subset_weights.unsqueeze(2).unsqueeze(3) output = output.contiguous().view(-1, Nt, E) if subset_heads is not None: _, Nt, Ns = attn.size() mixed_attn = attn.view(bsz, -1, Nt, Ns) attn = torch.stack( [mixed_attn[torch.arange(bsz), subset_heads[:, col], :, :] for col in range(subset_heads.size(1))], dim=1 ) return output, attn def _in_projection( q: Tensor, k: Tensor, v: Tensor, w_q: Tensor, w_k: Tensor, w_v: Tensor, b_q: Optional[Tensor] = None, b_k: Optional[Tensor] = None, b_v: Optional[Tensor] = None, ) -> Tuple[Tensor, Tensor, Tensor]: return linear(q, w_q, b_q), linear(k, w_k, b_k), linear(v, w_v, b_v) def multi_head_attention_forward( query: Tensor, key: Tensor, value: Tensor, embed_dim_to_check: int, total_num_heads: int, num_heads: int, in_proj_weight: Tensor, in_proj_bias: Optional[Tensor], bias_k: Optional[Tensor], bias_v: Optional[Tensor], add_zero_attn: bool, dropout_p: float, out_proj_weight: Tensor, out_proj_bias: Optional[Tensor], training: bool = True, key_padding_mask: Optional[Tensor] = None, need_weights: bool = True, attn_mask: Optional[Tensor] = None, use_separate_proj_weight: bool = False, q_proj_weight: Optional[Tensor] = None, k_proj_weight: Optional[Tensor] = None, v_proj_weight: Optional[Tensor] = None, static_k: Optional[Tensor] = None, static_v: Optional[Tensor] = None, subset_heads: Optional[Tensor] = None, subset_weights: Optional[Tensor] = None, ): tens_ops = (query, key, value, in_proj_weight, in_proj_bias, bias_k, bias_v, out_proj_weight, out_proj_bias) if has_torch_function(tens_ops): return handle_torch_function( multi_head_attention_forward, tens_ops, query, key, value, embed_dim_to_check, total_num_heads, num_heads, in_proj_weight, in_proj_bias, bias_k, bias_v, add_zero_attn, dropout_p, out_proj_weight, out_proj_bias, training=training, key_padding_mask=key_padding_mask, need_weights=need_weights, attn_mask=attn_mask, use_separate_proj_weight=use_separate_proj_weight, q_proj_weight=q_proj_weight, k_proj_weight=k_proj_weight, v_proj_weight=v_proj_weight, static_k=static_k, static_v=static_v, subset_heads=subset_heads, subset_weights=subset_weights ) # set up shape vars tgt_len, bsz, embed_dim = query.shape src_len, _, _ = key.shape assert embed_dim == embed_dim_to_check, \ f"was expecting embedding dimension of {embed_dim_to_check}, but got {embed_dim}" if isinstance(embed_dim, torch.Tensor): # embed_dim can be a tensor when JIT tracing head_dim = embed_dim.div(num_heads, rounding_mode='trunc') else: head_dim = embed_dim // num_heads assert head_dim * num_heads == embed_dim, f"embed_dim {embed_dim} not divisible by num_heads {num_heads}" if use_separate_proj_weight: # allow MHA to have different embedding dimensions when separate projection weights are used assert key.shape[:2] == value.shape[:2], \ f"key's sequence and batch dims {key.shape[:2]} do not match value's {value.shape[:2]}" else: assert key.shape == value.shape, f"key shape {key.shape} does not match value shape {value.shape}" # # compute in-projection # if not use_separate_proj_weight: q, k, v = _in_projection_packed(query, key, value, in_proj_weight, in_proj_bias) else: assert q_proj_weight is not None, "use_separate_proj_weight is True but q_proj_weight is None" assert k_proj_weight is not None, "use_separate_proj_weight is True but k_proj_weight is None" assert v_proj_weight is not None, "use_separate_proj_weight is True but v_proj_weight is None" if in_proj_bias is None: b_q = b_k = b_v = None else: b_q, b_k, b_v = in_proj_bias.chunk(3) q, k, v = _in_projection(query, key, value, q_proj_weight, k_proj_weight, v_proj_weight, b_q, b_k, b_v) # prep attention mask if attn_mask is not None: if attn_mask.dtype == torch.uint8: warnings.warn("Byte tensor for attn_mask in nn.MultiheadAttention is deprecated. Use bool tensor instead.") attn_mask = attn_mask.to(torch.bool) else: assert attn_mask.is_floating_point() or attn_mask.dtype == torch.bool, \ f"Only float, byte, and bool types are supported for attn_mask, not {attn_mask.dtype}" # ensure attn_mask's dim is 3 if attn_mask.dim() == 2: correct_2d_size = (tgt_len, src_len) if attn_mask.shape != correct_2d_size: raise RuntimeError(f"The shape of the 2D attn_mask is {attn_mask.shape}, but should be {correct_2d_size}.") attn_mask = attn_mask.unsqueeze(0) elif attn_mask.dim() == 3: correct_3d_size = (bsz * total_num_heads, tgt_len, src_len) if attn_mask.shape != correct_3d_size: raise RuntimeError(f"The shape of the 3D attn_mask is {attn_mask.shape}, but should be {correct_3d_size}.") else: raise RuntimeError(f"attn_mask's dimension {attn_mask.dim()} is not supported") # prep key padding mask if key_padding_mask is not None and key_padding_mask.dtype == torch.uint8: warnings.warn("Byte tensor for key_padding_mask in nn.MultiheadAttention is deprecated. Use bool tensor instead.") key_padding_mask = key_padding_mask.to(torch.bool) # add bias along batch dimension (currently second) if bias_k is not None and bias_v is not None: assert static_k is None, "bias cannot be added to static key." assert static_v is None, "bias cannot be added to static value." k = torch.cat([k, bias_k.repeat(1, bsz, 1)]) v = torch.cat([v, bias_v.repeat(1, bsz, 1)]) if attn_mask is not None: attn_mask = pad(attn_mask, (0, 1)) if key_padding_mask is not None: key_padding_mask = pad(key_padding_mask, (0, 1)) else: assert bias_k is None assert bias_v is None # # reshape q, k, v for multihead attention and make em batch first # q = q.contiguous().view(tgt_len, bsz * total_num_heads, head_dim).transpose(0, 1) if static_k is None: k = k.contiguous().view(k.shape[0], bsz * total_num_heads, head_dim).transpose(0, 1) else: # TODO finish disentangling control flow so we don't do in-projections when statics are passed assert static_k.size(0) == bsz * total_num_heads, \ f"expecting static_k.size(0) of {bsz * total_num_heads}, but got {static_k.size(0)}" assert static_k.size(2) == head_dim, \ f"expecting static_k.size(2) of {head_dim}, but got {static_k.size(2)}" k = static_k if static_v is None: v = v.contiguous().view(v.shape[0], bsz * total_num_heads, head_dim).transpose(0, 1) else: # TODO finish disentangling control flow so we don't do in-projections when statics are passed assert static_v.size(0) == bsz * total_num_heads, \ f"expecting static_v.size(0) of {bsz * total_num_heads}, but got {static_v.size(0)}" assert static_v.size(2) == head_dim, \ f"expecting static_v.size(2) of {head_dim}, but got {static_v.size(2)}" v = static_v # add zero attention along batch dimension (now first) if add_zero_attn: zero_attn_shape = (bsz * total_num_heads, 1, head_dim) k = torch.cat([k, torch.zeros(zero_attn_shape, dtype=k.dtype, device=k.device)], dim=1) v = torch.cat([v, torch.zeros(zero_attn_shape, dtype=v.dtype, device=v.device)], dim=1) if attn_mask is not None: attn_mask = pad(attn_mask, (0, 1)) if key_padding_mask is not None: key_padding_mask = pad(key_padding_mask, (0, 1)) # update source sequence length after adjustments src_len = k.size(1) # merge key padding and attention masks if key_padding_mask is not None: assert key_padding_mask.shape == (bsz, src_len), \ f"expecting key_padding_mask shape of {(bsz, src_len)}, but got {key_padding_mask.shape}" key_padding_mask = key_padding_mask.view(bsz, 1, 1, src_len). \ expand(-1, total_num_heads, -1, -1).reshape(bsz * total_num_heads, 1, src_len) if attn_mask is None: attn_mask = key_padding_mask elif attn_mask.dtype == torch.bool: attn_mask = attn_mask.logical_or(key_padding_mask) else: attn_mask = attn_mask.masked_fill(key_padding_mask, float("-inf")) # convert mask to float if attn_mask is not None and attn_mask.dtype == torch.bool: new_attn_mask = torch.zeros_like(attn_mask, dtype=torch.float) new_attn_mask.masked_fill_(attn_mask, float("-inf")) attn_mask = new_attn_mask # adjust dropout probability if not training: dropout_p = 0.0 # # (deep breath) calculate attention and out projection # attn_output, attn_output_weights = _scaled_dot_product_attention(q, k, v, attn_mask, dropout_p, bsz, subset_heads, subset_weights) attn_output = attn_output.transpose(0, 1).contiguous().view(tgt_len, bsz, embed_dim) attn_output = linear(attn_output, out_proj_weight, out_proj_bias) if need_weights: # average attention weights over heads attn_output_weights = attn_output_weights.view(bsz, num_heads, tgt_len, src_len) return attn_output, attn_output_weights.sum(dim=1) / num_heads else: return attn_output, None
11,418
39.928315
134
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/modules/multihead_attention_selection.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Dict, Optional, Tuple import torch from fairseq import utils from fairseq.modules.quant_noise import quant_noise from torch import Tensor, nn from torch.nn import Parameter from fairseq.modules.multihead_attention import MultiheadAttention from ..modules.multihead_functional import multi_head_attention_forward class MultiheadAttentionSelection(MultiheadAttention): def __init__( self, embed_dim, total_num_heads, num_heads, kdim=None, vdim=None, dropout=0.0, bias=True, add_bias_kv=False, add_zero_attn=False, self_attention=False, encoder_decoder_attention=False, q_noise=0.0, qn_block_size=8, layer_idx=0, attn_head_selector=None ): super().__init__( embed_dim, num_heads, kdim=kdim, vdim=vdim, dropout=dropout, bias=bias, add_bias_kv=add_bias_kv, add_zero_attn=add_zero_attn, self_attention=self_attention, encoder_decoder_attention=encoder_decoder_attention, q_noise=q_noise, qn_block_size=qn_block_size, ) self.layer_idx = layer_idx self.attn_head_selector = attn_head_selector self.total_num_heads = total_num_heads self.total_embed_dim = self.head_dim * total_num_heads self.k_proj = quant_noise( nn.Linear(self.kdim, self.total_embed_dim, bias=bias), q_noise, qn_block_size ) self.v_proj = quant_noise( nn.Linear(self.vdim, self.total_embed_dim, bias=bias), q_noise, qn_block_size ) self.q_proj = quant_noise( nn.Linear(embed_dim, self.total_embed_dim, bias=bias), q_noise, qn_block_size ) if add_bias_kv: self.bias_k = Parameter(torch.Tensor(1, 1, self.total_embed_dim)) self.bias_v = Parameter(torch.Tensor(1, 1, self.total_embed_dim)) else: self.bias_k = self.bias_v = None self.reset_parameters() def forward( self, query, key: Optional[Tensor], value: Optional[Tensor], key_padding_mask: Optional[Tensor] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, need_weights: bool = True, static_kv: bool = False, attn_mask: Optional[Tensor] = None, before_softmax: bool = False, need_head_weights: bool = False, # subset_heads: Optional[Tensor] = None, # subset_weights: Optional[Tensor] = None ) -> Tuple[Tensor, Optional[Tensor]]: if need_head_weights: need_weights = True is_tpu = query.device.type == "xla" subset_heads, subset_weights = self.attn_head_selector(self.layer_idx) tgt_len, bsz, embed_dim = query.size() src_len = tgt_len assert list(query.size()) == [tgt_len, bsz, self.embed_dim] if key is not None: src_len, key_bsz, _ = key.size() if not torch.jit.is_scripting(): assert key_bsz == bsz assert value is not None assert src_len, bsz == value.shape[:2] if ( not self.onnx_trace and not is_tpu # don't use PyTorch version on TPUs and incremental_state is None and not static_kv # A workaround for quantization to work. Otherwise JIT compilation # treats bias in linear module as method. and not torch.jit.is_scripting() ): assert key is not None and value is not None return multi_head_attention_forward( query, key, value, self.embed_dim, self.total_num_heads, self.num_heads, torch.empty([0]), torch.cat((self.q_proj.bias, self.k_proj.bias, self.v_proj.bias)), self.bias_k, self.bias_v, self.add_zero_attn, self.dropout_module.p, self.out_proj.weight, self.out_proj.bias, self.training or self.dropout_module.apply_during_inference, key_padding_mask, need_weights, attn_mask, use_separate_proj_weight=True, q_proj_weight=self.q_proj.weight, k_proj_weight=self.k_proj.weight, v_proj_weight=self.v_proj.weight, subset_heads=subset_heads, subset_weights=subset_weights ) if incremental_state is not None: saved_state = self._get_input_buffer(incremental_state) if saved_state is not None and "prev_key" in saved_state: # previous time steps are cached - no need to recompute # key and value if they are static if static_kv: assert self.encoder_decoder_attention and not self.self_attention key = value = None else: saved_state = None if self.self_attention: q = self.q_proj(query) k = self.k_proj(query) v = self.v_proj(query) elif self.encoder_decoder_attention: # encoder-decoder attention q = self.q_proj(query) if key is None: assert value is None k = v = None else: k = self.k_proj(key) v = self.v_proj(key) else: assert key is not None and value is not None q = self.q_proj(query) k = self.k_proj(key) v = self.v_proj(value) q *= self.scaling if self.bias_k is not None: assert self.bias_v is not None k = torch.cat([k, self.bias_k.repeat(1, bsz, 1)]) v = torch.cat([v, self.bias_v.repeat(1, bsz, 1)]) if attn_mask is not None: attn_mask = torch.cat( [attn_mask, attn_mask.new_zeros(attn_mask.size(0), 1)], dim=1 ) if key_padding_mask is not None: key_padding_mask = torch.cat( [ key_padding_mask, key_padding_mask.new_zeros(key_padding_mask.size(0), 1), ], dim=1, ) q = ( q.contiguous() .view(tgt_len, bsz * self.total_num_heads, self.head_dim) .transpose(0, 1) ) if k is not None: k = ( k.contiguous() .view(-1, bsz * self.total_num_heads, self.head_dim) .transpose(0, 1) ) if v is not None: v = ( v.contiguous() .view(-1, bsz * self.total_num_heads, self.head_dim) .transpose(0, 1) ) if saved_state is not None: # saved states are stored with shape (bsz, num_heads, seq_len, head_dim) if "prev_key" in saved_state: _prev_key = saved_state["prev_key"] assert _prev_key is not None prev_key = _prev_key.view(bsz * self.total_num_heads, -1, self.head_dim) if static_kv: k = prev_key else: assert k is not None k = torch.cat([prev_key, k], dim=1) src_len = k.size(1) if "prev_value" in saved_state: _prev_value = saved_state["prev_value"] assert _prev_value is not None prev_value = _prev_value.view(bsz * self.total_num_heads, -1, self.head_dim) if static_kv: v = prev_value else: assert v is not None v = torch.cat([prev_value, v], dim=1) prev_key_padding_mask: Optional[Tensor] = None if "prev_key_padding_mask" in saved_state: prev_key_padding_mask = saved_state["prev_key_padding_mask"] assert k is not None and v is not None key_padding_mask = MultiheadAttention._append_prev_key_padding_mask( key_padding_mask=key_padding_mask, prev_key_padding_mask=prev_key_padding_mask, batch_size=bsz, src_len=k.size(1), static_kv=static_kv, ) saved_state["prev_key"] = k.view(bsz, self.total_num_heads, -1, self.head_dim) saved_state["prev_value"] = v.view(bsz, self.total_num_heads, -1, self.head_dim) saved_state["prev_key_padding_mask"] = key_padding_mask # In this branch incremental_state is never None assert incremental_state is not None incremental_state = self._set_input_buffer(incremental_state, saved_state) assert k is not None assert k.size(1) == src_len # This is part of a workaround to get around fork/join parallelism # not supporting Optional types. if key_padding_mask is not None and key_padding_mask.dim() == 0: key_padding_mask = None if key_padding_mask is not None: assert key_padding_mask.size(0) == bsz assert key_padding_mask.size(1) == src_len if self.add_zero_attn: assert v is not None src_len += 1 k = torch.cat([k, k.new_zeros((k.size(0), 1) + k.size()[2:])], dim=1) v = torch.cat([v, v.new_zeros((v.size(0), 1) + v.size()[2:])], dim=1) if attn_mask is not None: attn_mask = torch.cat( [attn_mask, attn_mask.new_zeros(attn_mask.size(0), 1)], dim=1 ) if key_padding_mask is not None: key_padding_mask = torch.cat( [ key_padding_mask, torch.zeros(key_padding_mask.size(0), 1).type_as( key_padding_mask ), ], dim=1, ) attn_weights = torch.bmm(q, k.transpose(1, 2)) attn_weights = self.apply_sparse_mask(attn_weights, tgt_len, src_len, bsz) assert list(attn_weights.size()) == [bsz * self.total_num_heads, tgt_len, src_len] if attn_mask is not None: attn_mask = attn_mask.unsqueeze(0) if self.onnx_trace: attn_mask = attn_mask.repeat(attn_weights.size(0), 1, 1) attn_weights += attn_mask if key_padding_mask is not None: # don't attend to padding symbols attn_weights = attn_weights.view(bsz, self.total_num_heads, tgt_len, src_len) if not is_tpu: attn_weights = attn_weights.masked_fill( key_padding_mask.unsqueeze(1).unsqueeze(2).to(torch.bool), float("-inf"), ) else: attn_weights = attn_weights.transpose(0, 2) attn_weights = attn_weights.masked_fill(key_padding_mask, float("-inf")) attn_weights = attn_weights.transpose(0, 2) attn_weights = attn_weights.view(bsz * self.num_heads, tgt_len, src_len) if before_softmax: return attn_weights, v attn_weights_float = utils.softmax( attn_weights, dim=-1, onnx_trace=self.onnx_trace ) attn_weights = attn_weights_float.type_as(attn_weights) attn_probs = self.dropout_module(attn_weights) assert v is not None # evaluation if subset_heads is not None and subset_heads.numel() == 1: subset_heads = subset_heads.repeat(bsz) subset_weights = subset_weights.repeat(bsz) if subset_heads is None: attn = torch.bmm(attn_probs, v) else: # training with head selection mixed_attn = torch.bmm(attn_probs, v).contiguous().view(bsz, self.total_num_heads, tgt_len, self.head_dim) attn = torch.stack( [mixed_attn[torch.arange(bsz), subset_heads[:, col], :, :] for col in range(subset_heads.size(1))], dim=1 ) attn = attn * subset_weights.unsqueeze(2).unsqueeze(3) attn = attn.contiguous().view(bsz * self.num_heads, tgt_len, self.head_dim) assert list(attn.size()) == [bsz * self.num_heads, tgt_len, self.head_dim] if self.onnx_trace and attn.size(1) == 1: # when ONNX tracing a single decoder step (sequence length == 1) # the transpose is a no-op copy before view, thus unnecessary attn = attn.contiguous().view(tgt_len, bsz, embed_dim) else: attn = attn.transpose(0, 1).contiguous().view(tgt_len, bsz, embed_dim) attn = self.out_proj(attn) attn_weights: Optional[Tensor] = None if need_weights: if subset_heads is None: attn_weights = attn_weights_float.view( bsz, self.num_heads, tgt_len, src_len ).transpose(1, 0) else: mixed_attn_weights = attn_weights_float.view( bsz, self.total_num_heads, tgt_len, src_len ) attn_weights = torch.stack( [mixed_attn_weights[torch.arange(bsz), subset_heads[:, col], :, :] for col in range(subset_heads.size(1))], dim=1 ).transpose(1, 0) if not need_head_weights: # average attention weights over heads attn_weights = attn_weights.mean(dim=0) return attn, attn_weights
14,046
38.457865
133
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/modules/attn_head_selector.py
# This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import torch.nn as nn import math class AttnHeadSelector(nn.Module): """ Latent variable modeling of attention head selection """ def __init__( self, num_tasks, num_layers, total_num_heads, num_heads, select_strategy="group", head_select_temp=5.0 ): super(AttnHeadSelector, self).__init__() self.num_tasks = num_tasks self.num_layers = num_layers self.total_num_heads = total_num_heads self.num_heads = num_heads self.select_strategy = select_strategy self.temp = head_select_temp self.head_logits = torch.nn.Parameter( torch.Tensor(self.num_tasks, self.num_layers, total_num_heads), requires_grad=True ) nn.init.uniform_( self.head_logits, a=math.log(0.01), b=math.log(1.0) ) def gumbel_sample(self, logits, tau=1.0): gumbels1 = -torch.empty_like(logits, memory_format=torch.legacy_contiguous_format).exponential_().log() gumbels2 = -torch.empty_like(logits, memory_format=torch.legacy_contiguous_format).exponential_().log() gumbels1 = (logits + gumbels1 - gumbels2) / tau y_soft = gumbels1.sigmoid() return y_soft def subset_select(self, y_soft, topk, dim=-1): top_values, top_inds = torch.topk(y_soft, k=topk, dim=dim) top_ret = 1.0 - top_values.detach() + top_values return top_inds.detach(), top_ret def group_selet(self, y_soft, topk, dim=-1): # top_values: (num_tasks, num_layers, topk) top_values, top_inds = torch.max( y_soft.view(self.num_tasks, self.num_layers, -1, topk), dim=2 ) top_inds = top_inds * topk + torch.arange(topk, device=top_inds.device).unsqueeze(0).unsqueeze(1) top_ret = 1.0 - top_values.detach() + top_values return top_inds.detach(), top_ret def head_select(self, task_ids=None): # gumbel_sample self.head_samples = self.gumbel_sample(self.head_logits, tau=self.temp) # head select if self.select_strategy == "subset": self.subset_heads, self.subset_weights = self.subset_select( self.head_samples, topk=self.num_heads, ) elif self.select_strategy == "group": self.subset_heads, self.subset_weights = self.group_selet( self.head_samples, topk=self.num_heads, ) else: raise ValueError("{} is not supported".format(self.select_strategy)) self.batch_subset = self.subset_heads[task_ids, :, :] self.batch_weights = self.subset_weights[task_ids, :, :] def forward(self, layer_idx): assert layer_idx is not None batch_subset = self.batch_subset[:, layer_idx, :] batch_weights = self.batch_weights[:, layer_idx, :] return batch_subset, batch_weights
3,074
36.5
111
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/models/head_selection_s2t_transformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging from typing import Dict, List, Optional from pathlib import Path import torch.nn as nn from torch import Tensor from fairseq import checkpoint_utils from fairseq.models import register_model, register_model_architecture from fairseq.utils import safe_hasattr from fairseq.models.speech_to_text.s2t_transformer import ( S2TTransformerModel, S2TTransformerEncoder, TransformerDecoderScriptable ) from fairseq.models.speech_to_text.s2t_transformer import base_architecture as s2t_base_architecture from ..modules.attn_head_selector import AttnHeadSelector from ..modules.head_selection_transformer_layer import HeadSelectionTransformerEncoderLayer from .head_selection_transformer import HeadSelectionTransformerDecoder logger = logging.getLogger(__name__) @register_model("head_selection_s2t_transformer") class HeadSelectionS2TTransformerModel(S2TTransformerModel): """ Head selection implemented in S2TTransformer """ def __init__(self, encoder, decoder): super().__init__(encoder, decoder) @staticmethod def add_args(parser): S2TTransformerModel.add_args(parser) # encoder head selection parser.add_argument( "--encoder-attn-head-select", action="store_true", default=False, help="encoder head selection" ) parser.add_argument( "--total-encoder-attention-heads", type=int, help="total number of encoder attention heads" ) # decoder self attention selection parser.add_argument( "--decoder-self-attn-head-select", action="store_true", default=False, help="decoder self-attention head selection" ) # decoder-encoder attention selection parser.add_argument( "--dec-enc-attn-head-select", action="store_true", default=False, help="decoder-encoder attention head selection" ) parser.add_argument( "--total-decoder-attention-heads", type=int, help="total number of decoder attention heads" ) # selection strategy parser.add_argument( "--attn-head-select-strategy", type=str, help="attention head selection strategy, subset or group" ) @classmethod def build_encoder(cls, args): if safe_hasattr(args, "encoder_attn_head_select") and args.encoder_attn_head_select: encoder = HeadSelectionS2TTransformerEncoder(args) else: encoder = S2TTransformerEncoder(args) pretraining_path = getattr(args, "load_pretrained_encoder_from", None) if pretraining_path is not None: if not Path(pretraining_path).exists(): logger.warning( f"skipped pretraining because {pretraining_path} does not exist" ) else: encoder = checkpoint_utils.load_pretrained_component_from_model( component=encoder, checkpoint=pretraining_path ) logger.info(f"loaded pretrained encoder from: {pretraining_path}") return encoder @classmethod def build_decoder(cls, args, task, embed_tokens): if (safe_hasattr(args, "decoder_self_attn_head_select") and args.decoder_self_attn_head_select) or (safe_hasattr(args, "dec_enc_attn_head_select") and args.dec_enc_attn_head_select): return HeadSelectionTransformerDecoderScriptable(args, task.target_dictionary, embed_tokens) else: return TransformerDecoderScriptable(args, task.target_dictionary, embed_tokens) class HeadSelectionS2TTransformerEncoder(S2TTransformerEncoder): def __init__(self, args): super().__init__(args) self.attn_head_selector = AttnHeadSelector( args.encoder_tasks, args.encoder_layers, args.total_encoder_attention_heads, args.encoder_attention_heads, args.attn_head_select_strategy, ) self.task_ids = None self.transformer_layers = nn.ModuleList([ HeadSelectionTransformerEncoderLayer(args, layer_idx, attn_head_selector=self.attn_head_selector) for layer_idx in range(args.encoder_layers) ]) def set_task_ids(self, task_ids): self.task_ids = task_ids def _forward(self, src_tokens, src_lengths, return_all_hiddens=False): self.attn_head_selector.head_select(self.task_ids) return super()._forward(src_tokens, src_lengths, return_all_hiddens) class HeadSelectionTransformerDecoderScriptable(HeadSelectionTransformerDecoder): def extract_features( self, prev_output_tokens, encoder_out: Optional[Dict[str, List[Tensor]]] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, full_context_alignment: bool = False, alignment_layer: Optional[int] = None, alignment_heads: Optional[int] = None, ): # call scriptable method from parent class x, _ = self.extract_features_scriptable( prev_output_tokens, encoder_out, incremental_state, full_context_alignment, alignment_layer, alignment_heads, ) return x, None @register_model_architecture(model_name="head_selection_s2t_transformer", arch_name="head_selection_s2t_transformer") def base_architecture(args): s2t_base_architecture(args) args.encoder_attn_head_select = getattr(args, "encoder_attn_head_select", False) args.decoder_self_attn_head_select = getattr(args, "decoder_self_attn_head_select", False) args.dec_enc_attn_head_select = getattr(args, "dec_enc_attn_head_select", False) args.total_encoder_attention_heads = getattr(args, "total_encoder_attention_heads", 8) args.total_decoder_attention_heads = getattr(args, "total_decoder_attention_heads", 8) args.attn_head_select_strategy = getattr(args, "attn_head_select_strategy", "group") @register_model_architecture("head_selection_s2t_transformer", "head_selection_s2t_transformer_s") def head_selection_s2t_transformer_s(args): args.encoder_embed_dim = getattr(args, "encoder_embed_dim", 256) args.encoder_ffn_embed_dim = getattr(args, "encoder_ffn_embed_dim", 256 * 8) args.encoder_attention_heads = getattr(args, "encoder_attention_heads", 4) args.decoder_attention_heads = getattr(args, "decoder_attention_heads", 4) args.dropout = getattr(args, "dropout", 0.1) base_architecture(args)
6,831
38.953216
190
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/models/head_selection_transformer.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Any, List, Dict, Optional import torch import torch.nn as nn from torch import Tensor from fairseq.utils import safe_hasattr from fairseq.models.transformer import ( TransformerModel, TransformerEncoder, TransformerDecoder ) from ..modules.attn_head_selector import AttnHeadSelector from ..modules.head_selection_transformer_layer import ( HeadSelectionTransformerEncoderLayer, HeadSelectionTransformerDecoderLayer ) class HeadSelectionTransformerModel(TransformerModel): def __init__(self, args, encoder, decoder): super().__init__(args, encoder, decoder) @staticmethod def add_args(parser): TransformerModel.add_args(parser) # encoder head selection parser.add_argument( "--encoder-attn-head-select", action="store_true", default=False, help="encoder head selection" ) parser.add_argument( "--total-encoder-attention-heads", type=int, help="total number of encoder attention heads" ) # decoder self attention parser.add_argument( "--decoder-self-attn-head-select", action="store_true", default=False, help="decoder self-attention head selection" ) # decoder-encoder attention parser.add_argument( "--dec-enc-attn-head-select", action="store_true", default=False, help="decoder-encoder attention head selection" ) parser.add_argument( "--total-decoder-attention-heads", type=int, help="total number of decoder attention heads" ) # selection strategy parser.add_argument( "--attn-head-select-strategy", type=str, help="attention head selection strategy, subset or group" ) @classmethod def build_encoder(cls, args, src_dict, embed_tokens): if safe_hasattr(args, "encoder_attn_head_select") and args.encoder_attn_head_select: return HeadSelectionTransformerEncoder( args, src_dict, embed_tokens ) else: return TransformerEncoder(args, src_dict, embed_tokens) @classmethod def build_decoder(cls, args, tgt_dict, embed_tokens): if (safe_hasattr(args, "decoder_self_attn_head_select") and args.decoder_self_attn_head_select) or (safe_hasattr(args, "dec_enc_attn_head_select") and args.dec_enc_attn_head_select): return HeadSelectionTransformerDecoder( args, tgt_dict, embed_tokens ) else: return TransformerDecoder(args, tgt_dict, embed_tokens) class HeadSelectionTransformerEncoder(TransformerEncoder): def __init__(self, args, dictionary, embed_tokens): self.num_tasks = args.encoder_tasks self.num_layers = args.encoder_layers self.total_num_heads = args.total_encoder_attention_heads self.num_heads = args.encoder_attention_heads self.select_strategy = args.attn_head_select_strategy super().__init__(args, dictionary, embed_tokens) self.attn_head_selector = AttnHeadSelector( self.num_tasks, self.num_layers, self.total_num_heads, self.num_heads, self.select_strategy ) self.task_ids = None self.layers = nn.ModuleList( [self.build_encoder_layer(args, i) for i in range(args.encoder_layers)] ) def set_task_ids(self, task_ids): self.task_ids = task_ids def build_encoder_layer(self, args, layer_idx=None): return HeadSelectionTransformerEncoderLayer( args, layer_idx, attn_head_selector=self.attn_head_selector ) def forward( self, src_tokens, src_lengths: Optional[torch.Tensor] = None, return_all_hiddens: bool = False, token_embeddings: Optional[torch.Tensor] = None, ): self.attn_head_selector.head_select(self.task_ids) return super().forward(src_tokens, src_lengths, return_all_hiddens, token_embeddings) class HeadSelectionTransformerDecoder(TransformerDecoder): def __init__( self, args, dictionary, embed_tokens, no_encoder_attn=False, output_projection=None, ): self.num_tasks = args.decoder_tasks self.num_layers = args.decoder_layers self.total_num_heads = args.total_decoder_attention_heads self.num_heads = args.decoder_attention_heads self.select_strategy = args.attn_head_select_strategy super().__init__( args, dictionary, embed_tokens, no_encoder_attn=no_encoder_attn, output_projection=output_projection ) self.self_attn_head_selector = None self.enc_attn_head_selector = None if safe_hasattr(args, "decoder_self_attn_head_select") and args.decoder_self_attn_head_select: self.self_attn_head_selector = AttnHeadSelector( self.num_tasks, self.num_layers, self.total_num_heads, self.num_heads, self.select_strategy ) if safe_hasattr(args, "dec_enc_attn_head_select") and args.dec_enc_attn_head_select: self.enc_attn_head_selector = AttnHeadSelector( self.num_tasks, self.num_layers, self.total_num_heads, self.num_heads, self.select_strategy ) self.task_ids = None self.layers = nn.ModuleList( [ self.build_head_selection_decoder_layer(args, no_encoder_attn, idx) for idx in range(args.decoder_layers) ] ) def set_task_ids(self, task_ids): self.task_ids = task_ids def build_head_selection_decoder_layer(self, args, no_encoder_attn=False, layer_idx=None): return HeadSelectionTransformerDecoderLayer( args, layer_idx, self.self_attn_head_selector, self.enc_attn_head_selector, no_encoder_attn=no_encoder_attn ) def forward( self, prev_output_tokens, encoder_out: Optional[Dict[str, List[Tensor]]] = None, incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None, features_only: bool = False, full_context_alignment: bool = False, alignment_layer: Optional[int] = None, alignment_heads: Optional[int] = None, src_lengths: Optional[Any] = None, return_all_hiddens: bool = False, ): if self.self_attn_head_selector is not None: self.self_attn_head_selector.head_select(self.task_ids) if self.enc_attn_head_selector is not None: self.enc_attn_head_selector.head_select(self.task_ids) return super().forward( prev_output_tokens=prev_output_tokens, encoder_out=encoder_out, incremental_state=incremental_state, features_only=features_only, full_context_alignment=full_context_alignment, alignment_layer=alignment_layer, alignment_heads=alignment_heads, src_lengths=src_lengths, return_all_hiddens=return_all_hiddens )
7,637
34.361111
190
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/loss/attention_head_selection.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import math import torch from torch.nn.modules.loss import _Loss class HeadSelectionLoss(_Loss): def __init__(self, args): super().__init__() self.args = args self.kl_weight = getattr(args, "kl_weight", 0.0) def forward(self, head_samples, sample_sizes, prior=0.5, eps=1e-7): """ head_scores: (num_tasks, num_layers, num_heads) sample_sizes: (num_tasks, ) """ kl_loss = (head_samples * (torch.log(head_samples + eps) - math.log(prior))).sum(-1).sum(-1) kl_loss /= (torch.numel(head_samples) / head_samples.size(0)) kl_loss = self.kl_weight * torch.matmul(kl_loss, sample_sizes) return kl_loss
872
30.178571
100
py
rej-summ
rej-summ-main/examples/attention_head_selection/src/data/speech_to_text_dataset_with_domain.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging from pathlib import Path from typing import Dict, List, Optional from dataclasses import dataclass import torch from fairseq.data import ( ConcatDataset, Dictionary, FairseqDataset, ResamplingDataset ) from fairseq.data.audio.data_cfg import S2TDataConfig from fairseq.data.audio.speech_to_text_dataset import ( SpeechToTextDatasetItem, SpeechToTextDataset, SpeechToTextDatasetCreator ) logger = logging.getLogger(__name__) @dataclass class SpeechToTextDatasetItemWithDomain(SpeechToTextDatasetItem): src_lang_id: Optional[torch.Tensor] = None tgt_lang_id: Optional[torch.Tensor] = None domain_id: Optional[torch.Tensor] = None class SpeechToTextDatasetWithDomain(SpeechToTextDataset): def __init__( self, split: str, is_train_split: bool, cfg: S2TDataConfig, audio_paths: List[str], n_frames: List[int], src_texts: Optional[List[str]] = None, tgt_texts: Optional[List[str]] = None, speakers: Optional[List[str]] = None, src_langs: Optional[List[str]] = None, tgt_langs: Optional[List[str]] = None, ids: Optional[List[str]] = None, tgt_dict: Optional[Dictionary] = None, pre_tokenizer=None, bpe_tokenizer=None, n_frames_per_step=1, speaker_to_id=None, src_lang_ids: Optional[List[int]] = None, tgt_lang_ids: Optional[List[int]] = None, domain_ids: Optional[List[int]] = None ): super().__init__( split, is_train_split, cfg, audio_paths, n_frames, src_texts, tgt_texts, speakers, src_langs, tgt_langs, ids, tgt_dict, pre_tokenizer, bpe_tokenizer, n_frames_per_step, speaker_to_id ) assert src_lang_ids is None or len(src_lang_ids) == self.n_samples assert tgt_lang_ids is None or len(tgt_lang_ids) == self.n_samples assert domain_ids is None or len(domain_ids) == self.n_samples self.src_lang_ids = src_lang_ids self.tgt_lang_ids = tgt_lang_ids self.domain_ids = domain_ids def __getitem__(self, index: int) -> SpeechToTextDatasetItemWithDomain: item = super().__getitem__(index) src_lang_id = self.src_lang_ids[index] tgt_lang_id = self.tgt_lang_ids[index] domain_id = self.domain_ids[index] return SpeechToTextDatasetItemWithDomain( index=item.index, source=item.source, target=item.target, speaker_id=item.speaker_id, src_lang_id=src_lang_id, tgt_lang_id=tgt_lang_id, domain_id=domain_id ) def collater( self, samples: List[SpeechToTextDatasetItem], return_order: bool = False ) -> Dict: if len(samples) == 0: return {} out = super().collater(samples, return_order=True) order = out["order"] src_lang_ids = torch.tensor([x.src_lang_id for x in samples], dtype=torch.long).index_select(0, order) tgt_lang_ids = torch.tensor([x.tgt_lang_id for x in samples], dtype=torch.long).index_select(0, order) domain_ids = torch.tensor([x.domain_id for x in samples], dtype=torch.long).index_select(0, order) out["src_lang_ids"] = src_lang_ids out["tgt_lang_ids"] = tgt_lang_ids out["domain_ids"] = domain_ids if not return_order: del out["order"] return out class SpeechToTextDatasetCreatorWithDomain(SpeechToTextDatasetCreator): KEY_SRC_LANG_ID, KEY_TGT_LANG_ID = "src_lang_id", "tgt_lang_id" KEY_DOMAIN_ID = "domain_id" # default values DEFAULT_SRC_LANG_ID, DEFAULT_TGT_LANG_ID, DEFAULT_DOMAIN_ID = 0, 0, 0 @classmethod def _from_list( cls, split_name: str, is_train_split, samples: List[Dict], cfg: S2TDataConfig, tgt_dict, pre_tokenizer, bpe_tokenizer, n_frames_per_step, speaker_to_id ) -> SpeechToTextDatasetWithDomain: audio_root = Path(cfg.audio_root) ids = [s[cls.KEY_ID] for s in samples] audio_paths = [(audio_root / s[cls.KEY_AUDIO]).as_posix() for s in samples] n_frames = [int(s[cls.KEY_N_FRAMES]) for s in samples] tgt_texts = [s[cls.KEY_TGT_TEXT] for s in samples] src_texts = [s.get(cls.KEY_SRC_TEXT, cls.DEFAULT_SRC_TEXT) for s in samples] speakers = [s.get(cls.KEY_SPEAKER, cls.DEFAULT_SPEAKER) for s in samples] src_langs = [s.get(cls.KEY_SRC_LANG, cls.DEFAULT_LANG) for s in samples] tgt_langs = [s.get(cls.KEY_TGT_LANG, cls.DEFAULT_LANG) for s in samples] src_lang_ids = [s.get(cls.KEY_SRC_LANG_ID, cls.DEFAULT_SRC_LANG_ID) for s in samples] tgt_lang_ids = [s.get(cls.KEY_TGT_LANG_ID, cls.DEFAULT_TGT_LANG_ID) for s in samples] domain_ids = [s.get(cls.KEY_DOMAIN_ID, cls.DEFAULT_DOMAIN_ID) for s in samples] return SpeechToTextDatasetWithDomain( split_name, is_train_split, cfg, audio_paths, n_frames, src_texts=src_texts, tgt_texts=tgt_texts, speakers=speakers, src_langs=src_langs, tgt_langs=tgt_langs, ids=ids, tgt_dict=tgt_dict, pre_tokenizer=pre_tokenizer, bpe_tokenizer=bpe_tokenizer, n_frames_per_step=n_frames_per_step, speaker_to_id=speaker_to_id, src_lang_ids=src_lang_ids, tgt_lang_ids=tgt_lang_ids, domain_ids=domain_ids ) @classmethod def _load_samples_from_tsv( cls, root: str, split: str, src_lang_map, tgt_lang_map, domain_map ): # metadata from split _, src_lang, tgt_lang, domain = split.split("_") src_lang_id = src_lang_map[src_lang] tgt_lang_id = tgt_lang_map[tgt_lang] domain_id = domain_map[domain] samples = SpeechToTextDatasetCreator._load_samples_from_tsv(root, split) for s in samples: s.update({ cls.KEY_SRC_LANG_ID: src_lang_id, cls.KEY_TGT_LANG_ID: tgt_lang_id, cls.KEY_DOMAIN_ID: domain_id }) return samples @classmethod def _from_tsv( cls, root: str, cfg: S2TDataConfig, split: str, tgt_dict, is_train_split: bool, pre_tokenizer, bpe_tokenizer, n_frames_per_step, speaker_to_id, src_lang_map: Dict[str, int], tgt_lang_map: Dict[str, int], domain_map: Dict[str, int] ) -> SpeechToTextDatasetItemWithDomain: samples = cls._load_samples_from_tsv( root, split, src_lang_map, tgt_lang_map, domain_map ) return cls._from_list( split, is_train_split, samples, cfg, tgt_dict, pre_tokenizer, bpe_tokenizer, n_frames_per_step, speaker_to_id ) @classmethod def from_tsv( cls, root: str, cfg: S2TDataConfig, splits: str, tgt_dict, pre_tokenizer, bpe_tokenizer, is_train_split: bool, epoch: int, seed: int, src_lang_map: Dict[str, int], tgt_lang_map: Dict[str, int], domain_map: Dict[str, int], n_frames_per_step: int = 1, speaker_to_id=None ) -> SpeechToTextDatasetWithDomain: datasets = [ cls._from_tsv( root, cfg, split, tgt_dict, is_train_split, pre_tokenizer, bpe_tokenizer, n_frames_per_step, speaker_to_id, src_lang_map, tgt_lang_map, domain_map ) for split in splits.split(",") ] if is_train_split and len(datasets) > 1 and cfg.sampling_alpha != 1.0: # temperature-based sampling size_ratios = cls.get_size_ratios(datasets, alpha=cfg.sampling_alpha) datasets = [ ResamplingDataset( d, size_ratio=r, seed=seed, epoch=epoch, replace=(r >= 1.0) ) for r, d in zip(size_ratios, datasets) ] return ConcatDataset(datasets) if len(datasets) > 1 else datasets[0]
8,439
33.73251
162
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/generate_waveform.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import ast import argparse import json import logging from pathlib import Path import soundfile as sf import torch from tqdm import tqdm from fairseq import utils from fairseq.models.text_to_speech.vocoder import CodeHiFiGANVocoder logging.basicConfig() logging.root.setLevel(logging.INFO) logging.basicConfig(level=logging.INFO) logger = logging.getLogger(__name__) def dump_result(args, data, sample_id, pred_wav): assert "audio" in data or args.results_path is not None if args.results_path: fname = Path(data["audio"]).name if "audio" in data else f"{sample_id}_pred.wav" out_file = Path(args.results_path) / fname sf.write( out_file.as_posix(), pred_wav.detach().cpu().numpy(), args.sample_rate, ) def load_data(in_file): with open(in_file) as f: data = [ast.literal_eval(line.strip()) for line in f] return data def get_f0_upsample_ratio(code_hop_size, f_hop_size): ratio = (code_hop_size // 160) // (f_hop_size // 256) * 2 return ratio def main(args): logger.info(args) use_cuda = torch.cuda.is_available() and not args.cpu with open(args.vocoder_cfg) as f: vocoder_cfg = json.load(f) vocoder = CodeHiFiGANVocoder(args.vocoder, vocoder_cfg) if use_cuda: vocoder = vocoder.cuda() data = load_data(args.in_file) if args.results_path: Path(args.results_path).mkdir(exist_ok=True, parents=True) for i, d in tqdm(enumerate(data), total=len(data)): code_key = "cpc_km100" if "cpc_km100" in d else "hubert" code = list(map(int, d[code_key].split())) x = { "code": torch.LongTensor(code).view(1, -1), "f0": torch.Tensor(d["f0"]).view(1, -1), } f0_up_ratio = get_f0_upsample_ratio( vocoder_cfg["code_hop_size"], vocoder_cfg["hop_size"] ) if f0_up_ratio > 1: bsz, cond_length = x["f0"].size() x["f0"] = x["f0"].unsqueeze(2).repeat(1, 1, f0_up_ratio).view(bsz, -1) x = utils.move_to_cuda(x) if use_cuda else x wav = vocoder(x) dump_result(args, d, i, wav) def cli_main(): parser = argparse.ArgumentParser() parser.add_argument( "--in-file", type=str, required=True, help="Input file following the same format of the output from sample.py ('f0' and 'cpc_km100/hubert' are required fields)", ) parser.add_argument( "--vocoder", type=str, required=True, help="path to the vocoder" ) parser.add_argument( "--vocoder-cfg", type=str, required=True, help="path to the vocoder config", ) parser.add_argument("--sample-rate", type=int, default=16_000) parser.add_argument( "--results-path", type=str, default=None, help="Output directory. If not set, the audios will be stored following the 'audio' field specified in the input file.", ) parser.add_argument("--cpu", action="store_true", help="run on CPU") args = parser.parse_args() main(args) if __name__ == "__main__": cli_main()
3,312
26.380165
131
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/inference_dataset.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch class InferenceDataset: def __init__( self, dataset, prefix, only_prefix=True, presort_by_length=True, filter_short=False, min_length=None, ): self.dataset = dataset self.collater = self.dataset.collater self.prefix = prefix self.only_prefix = only_prefix self.filter_short = filter_short self.remapping = list(range(len(self.dataset))) if min_length: assert min_length >= prefix + 1 length_thr = prefix + 1 if not min_length else min_length if filter_short: self.remapping = list( filter( lambda i: self.dataset[i]["dur_source"].sum() > length_thr, self.remapping, ) ) print( f"# the initial dataset of {len(self.dataset)} examples became {len(self.remapping)} after filtering" f" examples shorter than {length_thr} (in duration units)" ) if presort_by_length: lengths = {index: dataset.size(index) for index in self.remapping} self.remapping.sort(key=lambda i: lengths[i]) @property def pads(self): return self.dataset.pads def __len__(self): return len(self.remapping) def original_size(self, k): k = self.remapping[k] return self.dataset.size(k) def __getitem__(self, k): k = self.remapping[k] channels = self.dataset[k] if self.prefix and self.only_prefix: dur_channel = channels["dur_source"] assert dur_channel.sum() >= self.prefix token_times = dur_channel.cumsum(dim=-1) cut_after = torch.searchsorted(token_times, torch.tensor(self.prefix)) r = {} for channel_name, value in channels.items(): if isinstance(value, torch.Tensor) and "source" in channel_name: # if self.filter_short: assert value.size(0) >= self.prefix r[channel_name] = value[: cut_after + 1] else: r[channel_name] = value r["prefix"] = cut_after + 1 else: r = channels return r def explode_batch(batch, times): if times == 1: return batch new_batch = {} for key, value in batch.items(): if isinstance(value, torch.Tensor): assert value.size(0) == 1 new_batch[key] = torch.cat([value] * times) elif key in ["ntokens", "nsentences"]: new_batch[key] = value * times elif key in ["prefix", "filename"]: new_batch[key] = value elif key == "net_input": new_batch[key] = explode_batch(value, times) else: assert False, key return new_batch
3,068
28.509615
117
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/quantize_f0.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from collections import defaultdict from functools import partial import numpy as np import torch from tqdm import tqdm from data_utils import dump_speaker_f0_stat, F0Stat, load_audio_path, load_f0 def load_speaker(path): speakers = [] with open(path) as f: for line in f.readlines(): sample = eval(line.strip()) assert "speaker" in sample speakers.append(sample["speaker"]) return speakers def quantize_f0(speaker_to_f0, f0_stats, nbins, normalize, log): f0_all = [] for speaker, f0 in speaker_to_f0.items(): f0 = f0.raw_data if log: f0 = f0.log() mean = f0_stats[speaker]["logf0_mean"] if log else f0_stats[speaker]["f0_mean"] std = f0_stats[speaker]["logf0_std"] if log else f0_stats[speaker]["f0_std"] if normalize == "mean": f0 = f0 - mean elif normalize == "meanstd": f0 = (f0 - mean) / std f0_all.extend(f0.tolist()) hist, bin_x = np.histogram(f0_all, 100000) cum_hist = np.cumsum(hist) / len(f0_all) * 100 f0_bin = {} for num_bin in nbins: bin_offset = [] bin_size = 100 / num_bin threshold = bin_size for i in range(num_bin - 1): index = (np.abs(cum_hist - threshold)).argmin() bin_offset.append(bin_x[index]) threshold += bin_size f0_bin[num_bin] = np.array(bin_offset) return f0_bin def main(file_path, f0_dir, out_dir, out_prefix, nbins, nshards, normalize, log): audio_paths = load_audio_path(file_path) path_to_f0 = load_f0(f0_dir, nshards) speakers = load_speaker(file_path) speaker_to_f0 = defaultdict(partial(F0Stat, True)) # speaker f0 stats for audio_path, speaker in tqdm(zip(audio_paths, speakers)): f0 = path_to_f0[audio_path] speaker_to_f0[speaker].update(f0) f0_stats = dump_speaker_f0_stat(speaker_to_f0, f"{out_dir}/{out_prefix}") # quantize f0_bin = quantize_f0(speaker_to_f0, f0_stats, nbins, normalize, log) log_suffix = "_log" if log else "" f0_bin_out_file = f"{out_dir}/{out_prefix}_{normalize}_norm{log_suffix}_f0_bin.th" torch.save(f0_bin, f0_bin_out_file) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("file_path") parser.add_argument("f0_dir", help="out_dir from preprocess_f0") parser.add_argument("out_dir") parser.add_argument("out_prefix") parser.add_argument("--nbins", nargs="+", type=int, default=[32]) parser.add_argument("--nshards", type=int, default=20, help="number of f0 shards") parser.add_argument( "--normalize", type=str, choices=["meanstd", "mean", "none"], default="mean" ) parser.add_argument("--log", action="store_true") args = parser.parse_args() print(args) main(**vars(args))
3,064
31.263158
87
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/naive_decoder.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import warnings class Naive_F0_Decoder(torch.nn.Module): def __init__(self, bounds_path, n_units=32): super().__init__() bounds = torch.load(bounds_path) bounds = torch.from_numpy(bounds[n_units]) assert bounds.ndim == 1 pad = torch.tensor([-5.0, -5.0]) # bos, eos, pad are in the dictionary centers = torch.cat( [bounds[0:1], 0.5 * (bounds[1:] + bounds[:-1]), bounds[-1:], pad[:]] ) self.embedding = torch.nn.Embedding.from_pretrained( centers.unsqueeze(-1), freeze=True ) self.max_n = self.embedding.weight.numel() def forward(self, discrete_f0: torch.Tensor): in_bounds = (0 <= discrete_f0).all() and (discrete_f0 < self.max_n).all() if not in_bounds: warnings.warn( f"F0 contains some weird outputs: discrete_f0.max().item()={discrete_f0.max().item()} discrete_f0.min().item()={discrete_f0.min().item()}; " f"while we have embeddings for {self.max_n} values. " "Assuming this is a no-prosody model -- but be careful!" ) mask = discrete_f0 >= self.max_n discrete_f0 = discrete_f0.masked_fill(mask, self.max_n - 1) return self.embedding(discrete_f0).squeeze(-1)
1,495
35.487805
156
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/data_utils.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os import torch from tqdm import tqdm class Stat: def __init__(self, keep_raw=False): self.x = 0.0 self.x2 = 0.0 self.z = 0.0 # z = logx self.z2 = 0.0 self.n = 0.0 self.u = 0.0 self.keep_raw = keep_raw self.raw = [] def update(self, new_x): new_z = new_x.log() self.x += new_x.sum() self.x2 += (new_x**2).sum() self.z += new_z.sum() self.z2 += (new_z**2).sum() self.n += len(new_x) self.u += 1 if self.keep_raw: self.raw.append(new_x) @property def mean(self): return self.x / self.n @property def std(self): return (self.x2 / self.n - self.mean**2) ** 0.5 @property def mean_log(self): return self.z / self.n @property def std_log(self): return (self.z2 / self.n - self.mean_log**2) ** 0.5 @property def n_frms(self): return self.n @property def n_utts(self): return self.u @property def raw_data(self): assert self.keep_raw, "does not support storing raw data!" return torch.cat(self.raw) class F0Stat(Stat): def update(self, new_x): # assume unvoiced frames are 0 and consider only voiced frames if new_x is not None: super().update(new_x[new_x != 0]) def dump_speaker_f0_stat(speaker_to_f0_stat, out_prefix): path = f"{out_prefix}.f0_stat.pt" assert not os.path.exists(path) d = { speaker: { "f0_mean": speaker_to_f0_stat[speaker].mean, "f0_std": speaker_to_f0_stat[speaker].std, "logf0_mean": speaker_to_f0_stat[speaker].mean_log, "logf0_std": speaker_to_f0_stat[speaker].std_log, } for speaker in speaker_to_f0_stat } torch.save(d, path) return d def load_audio_path(path): audio_paths = [] with open(path) as f: for line in f.readlines(): sample = eval(line.strip()) audio_paths.append(sample["audio"]) return audio_paths def load_f0(f0_dir, nshards): path_to_f0 = {} for rank in tqdm(range(1, nshards + 1), desc=f"load f0"): f0_shard_path = f"{f0_dir}/f0_{rank}_{nshards}.pt" shard_path_to_f0 = torch.load(f0_shard_path) path_to_f0.update(shard_path_to_f0) return path_to_f0
2,568
22.787037
70
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/preprocess_f0.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os import torch from tqdm import tqdm from data_utils import load_audio_path from fairseq.data.codedataset import get_f0_by_filename def process_one(path, sr): """ Args: path: audio file path sr: sampling rate """ try: # YAAPT throws errors in some rare cases f0 = get_f0_by_filename(path, sr) except Exception as e: print( f"WARNING: error when processing {path}. set f0 to zero. original error message:\n{e}" ) f0 = None return f0 def main(file_path, out_dir, nshards, rank, sampling_rate): # load data audio_paths = load_audio_path(file_path) # shard assert nshards <= len(audio_paths) and nshards > 0 shard_size = len(audio_paths) / nshards s = int(round((rank - 1) * shard_size)) e = int(round(rank * shard_size)) audio_paths = audio_paths[s:e] # process path_to_f0 = {} for i, audio_path in enumerate(tqdm(audio_paths)): f0 = process_one(audio_path, sampling_rate) path_to_f0[audio_path] = f0 print(f"finished processing {len(path_to_f0)} utterances ({s}-{e})") f0_path = f"{out_dir}/f0_{rank}_{nshards}.pt" os.makedirs(out_dir, exist_ok=True) torch.save(path_to_f0, f0_path) print(f"saved to {f0_path}") if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("file_path") parser.add_argument("out_dir") parser.add_argument("--nshards", type=int, default=20) parser.add_argument("--rank", type=int, default=1) parser.add_argument("--sampling_rate", type=int, default=16000) args = parser.parse_args() main(**vars(args))
1,872
27.378788
98
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/prepare_dataset.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from multiprocessing import Pool import os from collections import defaultdict from itertools import starmap import torch from npy_append_array import NpyAppendArray from tqdm import tqdm from data_utils import dump_speaker_f0_stat, F0Stat, load_f0 from fairseq.data.codedataset import ( ExpressiveCodeDataConfig, parse_manifest, F0_FRAME_SPACE, align_f0_to_durations, ) from fairseq.tasks.speech_ulm_task import UnitDictionary def load_meta(meta_path, split): config = ExpressiveCodeDataConfig(meta_path) manifest_path = config.manifests[split] dictionary = UnitDictionary(n_units=config.n_units) audio_paths, codes, durs, speakers = parse_manifest(manifest_path, dictionary) return config, audio_paths, codes, durs, speakers def _align_f0(f0, dur, ratio, frm_tol=5): if f0 is None: seg_f0 = torch.zeros_like(dur, dtype=torch.float) else: seg_f0 = align_f0_to_durations(f0, dur, ratio, tol=frm_tol * ratio) return seg_f0.numpy() # try a hacky stuff def align_f0(path_to_f0, audio_paths, durs, ratio, mp=False): chunk_size = 2000 num_procs = 40 iterable = ((path_to_f0[p], d, ratio) for p, d in zip(audio_paths, durs)) seg_f0s = [] if mp: with Pool(num_procs) as pool: iterator = tqdm( pool.istarmap(_align_f0, iterable, chunk_size), desc="align f0", total=len(durs), ) for seg_f0 in iterator: seg_f0s.append(torch.from_numpy(seg_f0).float()) else: iterator = tqdm(starmap(_align_f0, iterable), desc="align f0", total=len(durs)) for seg_f0 in iterator: seg_f0s.append(torch.from_numpy(seg_f0).float()) return seg_f0s def prepare_seg_data(config, audio_paths, codes, durs, speakers, path_to_f0): ratio = config.code_hop_size / (config.sampling_rate * F0_FRAME_SPACE) seg_f0s = align_f0(path_to_f0, audio_paths, durs, ratio) data = { "codes": codes, "duration": durs, "f0": seg_f0s, "speaker": speakers, "path": audio_paths, } return data def dump_seg_data(data, out_prefix): key_targs = { "codes": f"{out_prefix}.code.npy", "duration": f"{out_prefix}.dur.npy", "f0": f"{out_prefix}.f0.npy", } for key, targ in key_targs.items(): assert not os.path.exists(targ) npaa = NpyAppendArray(targ) for utt_data in tqdm(data[key], desc=f"dumping {key}"): npaa.append(utt_data.numpy()) assert not os.path.exists(f"{out_prefix}.path.txt") with open(f"{out_prefix}.path.txt", "w") as f: for x in data["path"]: f.write(f"{str(x)}\n") assert not os.path.exists(f"{out_prefix}.leng.txt") with open(f"{out_prefix}.leng.txt", "w") as f: for x in data["codes"]: f.write(f"{len(x)}\n") assert not os.path.exists(f"{out_prefix}.speaker.txt") with open(f"{out_prefix}.speaker.txt", "w") as f: for x in data["speaker"]: f.write(f"{str(x)}\n") print(f"wrote to files with prefix {out_prefix}") def main(meta_path, f0_dir, splits, nshards_list): speaker_to_stat = defaultdict(F0Stat) if len(nshards_list) == 1: nshards_list = nshards_list * len(splits) else: assert len(nshards_list) == len(splits) for split, nshards in zip(splits, nshards_list): config, audio_paths, codes, durs, speakers = load_meta(meta_path, split) path_to_f0 = load_f0(f"{f0_dir}/{split}", nshards) # segment-level data data = prepare_seg_data(config, audio_paths, codes, durs, speakers, path_to_f0) dump_seg_data(data, config.manifests[split]) # speaker f0 for audio_path, speaker in tqdm(zip(audio_paths, speakers)): f0 = path_to_f0[audio_path] speaker_to_stat[speaker].update(f0) dump_speaker_f0_stat(speaker_to_stat, config.manifests[split]) if __name__ == "__main__": import argparse parser = argparse.ArgumentParser() parser.add_argument("meta_path") parser.add_argument("f0_dir", help="out_dir from preprocess_f0") parser.add_argument("--splits", nargs="+", default=["train", "valid"]) parser.add_argument( "--nshards_list", type=int, nargs="+", default=[20], help="number of f0 shards" ) args = parser.parse_args() print(args) main(**vars(args))
4,623
31.111111
87
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/truncated_laplace.py
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch import warnings def truncated_laplace(mean, T, truncate_by_zero=False): """Generating a sample from a Laplace distribution, possible left-truncated at zero. A bit of explanation here https://stats.stackexchange.com/a/357598 . """ assert isinstance(mean, torch.Tensor) if not truncate_by_zero: percentile = 0.0 else: if not (mean >= 0.0).all(): warnings.warn(f"means are supposed to be non-negative, but got {mean}") mean = torch.clamp_min(mean, 0.0) lower_bound = mean.new_tensor([0.0]) percentile = 0.5 + 0.5 * torch.sign(lower_bound - mean) * ( 1.0 - torch.exp(-1.0 / T * torch.abs(mean - lower_bound)) ) p = torch.empty_like(mean).uniform_() * (1.0 - percentile) + percentile return mean - T * torch.sign(p - 0.5) * torch.log(1 - 2 * torch.abs(p - 0.5))
1,060
34.366667
88
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/sample/sample.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os import torch.multiprocessing as mp import numpy as np import json import torch from torch.distributions.categorical import Categorical from fairseq import checkpoint_utils, options, utils from fairseq.data.codedataset import CodeDataset, ExpressiveCodeDataConfig from fairseq.dataclass.utils import convert_namespace_to_omegaconf from torch.utils.data import DataLoader, DistributedSampler from fairseq.utils import move_to_cuda import tqdm import random import pathlib import sys, pathlib sys.path.append(str(pathlib.Path(__file__).parent.parent)) from inference_dataset import InferenceDataset, explode_batch from naive_decoder import Naive_F0_Decoder from truncated_laplace import truncated_laplace CODETYPE_TO_FRAMETIME = {"cpc_km100": 0.01, "hubert": 0.02} # 10ms # 20ms class TemperatureDecoder: def __init__(self, Ts, discrete_dur=False, discrete_f0=False): self.T_token, self.T_dur, self.T_f0 = Ts self.discrete_dur = discrete_dur self.discrete_f0 = discrete_f0 def __call__(self, output): def sample_multinomial(key, T): logits = output[key][:, -1, :].float() return Categorical(logits=logits / T).sample().unsqueeze(-1) def sample_laplace(key, T, truncate_at_zero): mean = output[key][:, -1, :].float() return truncated_laplace(mean=mean, T=T, truncate_by_zero=truncate_at_zero) if self.T_token > 0: new_tokens = sample_multinomial("token", self.T_token) else: new_tokens = output["token"][:, -1, :].argmax(dim=-1, keepdim=True) if not self.discrete_dur and self.T_dur == 0: new_durations = output["duration"][:, -1].round().int() elif not self.discrete_dur and self.T_dur > 0: new_durations = ( sample_laplace("duration", self.T_dur, truncate_at_zero=True) .round() .int() ) elif self.discrete_dur and self.T_dur > 0: new_durations = sample_multinomial("duration", self.T_dur) elif self.discrete_dur and self.T_dur == 0: new_durations = output["duration"][:, -1, :].argmax(dim=-1, keepdim=True) else: assert False if not self.discrete_f0 and self.T_f0 == 0: new_f0 = output["f0"][:, -1] elif not self.discrete_f0 and self.T_f0 > 0: new_f0 = sample_laplace("f0", self.T_f0, truncate_at_zero=False) elif self.discrete_f0 and self.T_f0 > 0: new_f0 = sample_multinomial("f0", self.T_f0) elif self.discrete_f0 and self.T_f0 == 0: new_f0 = output["f0"][:, -1, :].argmax(dim=-1, keepdim=True) else: assert False return new_tokens, new_durations, new_f0 class FilterNamesDataset: def __init__(self, dataset, fnames_path): self.dataset = dataset with open(fnames_path, "r") as fin: fnames = set((eval(line)["audio"] for line in fin)) print(f"# will retrict the dataset for {len(fnames)} files") self.indexes = [] for i, datapoint in enumerate(dataset): if datapoint["filename"] in fnames: self.indexes.append(i) assert len(self.indexes) == len(fnames), f"{len(self.indexes)} {len(fnames)}" self.collater = self.dataset.collater self.discrete_dur = self.dataset.discrete_dur self.discrete_f0 = self.dataset.discrete_f0 def __len__(self): return len(self.indexes) def __getitem__(self, k): k = self.indexes[k] return self.dataset[k] def size(self, k): k = self.indexes[k] return self.dataset.size(k) @torch.no_grad() def do_sampling( model, batch, eos_token, decoder, autoregressive_steps=100, teacher_force_tokens=False, teacher_force_duration=False, teacher_force_f0=False, match_duration=False, ): def autoregressive_step_(output, autoregressive_steps): new_tokens, new_durations, new_f0 = decoder(output) n = output["token"].size(1) if output["token"].ndim == 3 else 1 if teacher_force_tokens: new_tokens = batch["target"][:, n - 1].unsqueeze(-1) if teacher_force_duration: new_durations = batch["dur_target"][:, n - 1].unsqueeze(-1) if teacher_force_f0: new_f0 = batch["f0_target"][:, n - 1].unsqueeze(-1) batch["net_input"]["src_tokens"] = torch.cat( [batch["net_input"]["src_tokens"], new_tokens], dim=1 ) batch["net_input"]["dur_src"] = torch.cat( [batch["net_input"]["dur_src"], new_durations], dim=1 ) batch["net_input"]["f0_src"] = torch.cat( [batch["net_input"]["f0_src"], new_f0], dim=1 ) outputs = [] if teacher_force_tokens or teacher_force_duration or teacher_force_f0: max_time = batch["target"].size(1) prefix_time = batch["net_input"]["src_tokens"].size(1) autoregressive_steps = max_time - prefix_time + 1 # should be 0 for _ in range(autoregressive_steps): output = model(**batch["net_input"]) last_steps = ( output["token"][:, -1, ...], output["duration"][:, -1, ...], output["f0"][:, -1, ...], ) outputs.append(last_steps) autoregressive_step_(output, autoregressive_steps) tokens, duration, f0 = ( batch["net_input"]["src_tokens"], batch["net_input"]["dur_src"], batch["net_input"]["f0_src"], ) if ( match_duration and (batch["dur_target"].sum(dim=-1) < duration.sum(dim=-1)).all() ): break return tokens, duration, f0, outputs def unroll_duration(token_stream, duration_stream): assert len(token_stream) == len( duration_stream ), f"{len(token_stream)} != {len(duration_stream)}" non_positive_durations = sum(d <= 0 for d in duration_stream) if non_positive_durations > 0: print( f"# {non_positive_durations} durations are non-positive, they will be capped to 1" ) result = [] duration_stream_rounded_capped = [max(1, int(round(x))) for x in duration_stream] for t, d in zip(token_stream, duration_stream_rounded_capped): result.extend([t] * d) return result def realign_shifted_streams(tokens, durations, F0s, shifts): """ Durations are shifted by 1, F0 by 2 >>> tokens = ["<s>", "t1", "t2", "t3", "</s>", "x", "x"] >>> durations = ["<0>", "<0>", "d1", "d2", "d3", "<0>", "x"] >>> F0s = ["<0>", "<0>", "<0>", "f1", "f2", "f3", "<0>"] >>> shifts = [1,2] >>> realign_shifted_streams(tokens, durations, F0s, shifts) (['<s>', 't1', 't2', 't3', '</s>'], ['<0>', 'd1', 'd2', 'd3', '<0>'], ['<0>', 'f1', 'f2', 'f3', '<0>']) """ max_shift = max(shifts) if max_shift > 0: shift_durations, shift_F0s = shifts tokens = tokens[:-max_shift] durations = durations[shift_durations:] if shift_durations < max_shift: durations = durations[: -(max_shift - shift_durations)] if F0s is not None: F0s = F0s[shift_F0s:] if shift_F0s < max_shift: F0s = F0s[: -(max_shift - shift_F0s)] assert len(tokens) == len(durations), f"{len(tokens)} =! {len(durations)}" if F0s is not None: assert len(tokens) == len(F0s), f"{len(tokens)} =! {len(F0s)}" return tokens, durations, F0s def maybe_cut_eos(produced_tokens, produced_duration, produced_f0, eos_idx): if eos_idx in produced_tokens: eos_index = produced_tokens.index(eos_idx) produced_tokens = produced_tokens[:eos_index] produced_duration = produced_duration[:eos_index] produced_f0 = produced_f0[:eos_index] return produced_tokens, produced_duration, produced_f0 def maybe_filter_pad(produced_tokens, produced_duration, produced_f0, pad_idx): if pad_idx not in produced_tokens: return produced_tokens, produced_duration, produced_f0 assert len(produced_tokens) == len(produced_duration) == len(produced_f0) print("<pad> is detected in the output!") filtered_tokens, filtered_duration, filtered_f0 = [], [], [] for t, d, f in zip(produced_tokens, produced_duration, produced_f0): if t != pad_idx: filtered_tokens.append(t) filtered_duration.append(d) filtered_f0.append(f) return filtered_tokens, filtered_duration, filtered_f0 def match_duration(produced_tokens, produced_duration, produced_f0, target_duration): """ >>> tokens = ['t'] * 4 >>> F0s = ['f0'] * 4 >>> produced_duration = [1, 10, 10, 10] >>> match_duration(tokens, produced_duration, F0s, target_duration=100) (['t', 't', 't', 't'], [1, 10, 10, 10], ['f0', 'f0', 'f0', 'f0']) >>> match_duration(tokens, produced_duration, F0s, target_duration=5) (['t', 't'], [1, 4], ['f0', 'f0']) """ if sum(produced_duration) <= target_duration: return produced_tokens, produced_duration, produced_f0 running_duration = 0 filtered_duration = [] for next_tok_duration in produced_duration: if running_duration + next_tok_duration < target_duration: filtered_duration.append(next_tok_duration) running_duration += next_tok_duration else: to_add = target_duration - running_duration assert to_add <= next_tok_duration filtered_duration.append(to_add) break produced_duration = filtered_duration assert sum(produced_duration) == target_duration n_tok = len(filtered_duration) return produced_tokens[:n_tok], produced_duration, produced_f0[:n_tok] def main(rank, world_size, args): if world_size > 1: torch.distributed.init_process_group( backend="gloo", init_method="env://", world_size=world_size, rank=rank ) torch.cuda.set_device(rank) raw_args = args args = convert_namespace_to_omegaconf(args) if args.common.seed is not None: random.seed(args.common.seed) np.random.seed(args.common.seed) utils.set_torch_seed(args.common.seed) models, model_args, task = checkpoint_utils.load_model_ensemble_and_task( [raw_args.path], arg_overrides={"data": args.task.data} ) tgt_dict = task.target_dictionary for model in models: model.prepare_for_inference_(args) model.cuda().eval() if raw_args.fp16: model = model.half() model = models[0] config = ExpressiveCodeDataConfig(args.task.data) dataset = CodeDataset( manifest=config.manifests[raw_args.subset], dictionary=task.source_dictionary, dur_dictionary=task.source_duration_dictionary, f0_dictionary=task.source_f0_dictionary, config=config, discrete_dur=task.cfg.discrete_duration, discrete_f0=task.cfg.discrete_f0, log_f0=task.cfg.log_f0, normalize_f0_mean=task.cfg.normalize_f0_mean, normalize_f0_std=task.cfg.normalize_f0_std, interpolate_f0=task.cfg.interpolate_f0, shifts=task.cfg.stream_shifts, return_filename=True, strip_filename=False, ) tgt_dict = task.target_dictionary shifts = dataset.shifts.dur, dataset.shifts.f0 max_shift = max(shifts) fname = raw_args.output if world_size > 1: fname += f"_{rank}" output_file = open(fname, "w") if raw_args.filter_names: dataset = FilterNamesDataset(dataset, raw_args.filter_names) dataset = InferenceDataset(dataset, raw_args.prefix_length, filter_short=True) print(f"Dataset size {len(dataset)}") sampler = ( None if world_size == 1 else DistributedSampler( dataset, num_replicas=world_size, rank=rank, shuffle=False ) ) dataloader = DataLoader( dataset, batch_size=1, shuffle=False, collate_fn=dataset.collater, sampler=sampler, ) Ts = raw_args.T_token, raw_args.T_duration, raw_args.T_f0 decoder = TemperatureDecoder( Ts, discrete_dur=task.cfg.discrete_duration, discrete_f0=task.cfg.discrete_f0 ) dataset_size = len(dataset) f0_decoder = None if raw_args.f0_discretization_bounds: assert task.cfg.discrete_f0 f0_decoder = Naive_F0_Decoder(raw_args.f0_discretization_bounds).cuda() pbar = ( tqdm.tqdm( total=dataset_size if raw_args.max_samples is None else min(raw_args.max_samples, dataset_size) ) if world_size == 1 else None ) samples_produced = 0 for batch in dataloader: if ( raw_args.max_samples is not None and samples_produced >= raw_args.max_samples ): break prefix = batch["prefix"][0] batch = explode_batch(batch, raw_args.batch_explosion_rate) batch = move_to_cuda(batch) if not raw_args.short_curcuit: produced_tokens, produced_durations, produced_f0, _ = do_sampling( models[0], batch, tgt_dict.eos(), decoder, autoregressive_steps=raw_args.max_length - prefix + max_shift, teacher_force_tokens=raw_args.teacher_force_tokens, match_duration=raw_args.match_duration, teacher_force_duration=raw_args.teacher_force_duration, teacher_force_f0=raw_args.teacher_force_f0, ) # stip entries corresponding to <s> produced_tokens = produced_tokens[:, 1:] produced_durations = produced_durations[:, 1:] produced_f0 = produced_f0[:, 1:] else: max_length = raw_args.max_length + max_shift produced_tokens, produced_durations, produced_f0 = ( batch["target"][:, :max_length], batch["dur_target"][:, :max_length], batch["f0_target"][:, :max_length], ) if f0_decoder is not None: produced_f0 = f0_decoder(produced_f0) produced_tokens, produced_durations, produced_f0 = ( produced_tokens.cpu().tolist(), produced_durations.cpu().tolist(), produced_f0.cpu().tolist(), ) bsz = batch["target"].size(0) assert bsz == raw_args.batch_explosion_rate for i in range(bsz): if ( raw_args.max_samples is not None and samples_produced >= raw_args.max_samples ): break produced_tokens_i = produced_tokens[i] produced_durations_i = produced_durations[i] produced_f0_i = produced_f0[i] ( produced_tokens_i, produced_durations_i, produced_f0_i, ) = realign_shifted_streams( produced_tokens_i, produced_durations_i, produced_f0_i, shifts ) produced_tokens_i, produced_durations_i, produced_f0_i = maybe_cut_eos( produced_tokens_i, produced_durations_i, produced_f0_i, tgt_dict.eos() ) produced_tokens_i, produced_durations_i, produced_f0_i = maybe_filter_pad( produced_tokens_i, produced_durations_i, produced_f0_i, tgt_dict.pad() ) if raw_args.match_duration: # NB: here we cheat a bit and use that padding has duration 0 # so no need to re-align and remove padding dur_target_i = batch["dur_target"][i, :].sum().item() produced_tokens_i, produced_durations_i, produced_f0_i = match_duration( produced_tokens_i, produced_durations_i, produced_f0_i, dur_target_i ) if raw_args.cut_prompt: produced_tokens_i, produced_durations_i, produced_f0_i = ( produced_tokens_i[prefix:], produced_durations_i[prefix:], produced_f0_i[prefix:], ) prompt_fname = batch["filename"][0] fname = str(pathlib.Path(prompt_fname).with_suffix("")) + f"__{i}.wav" token_stream = unroll_duration(produced_tokens_i, produced_durations_i) f0_stream = unroll_duration(produced_f0_i, produced_durations_i) output_line = json.dumps( { "audio": fname, "prompt": prompt_fname, raw_args.code_type: " ".join(map(str, token_stream)), "duration": round( sum(produced_durations_i) * CODETYPE_TO_FRAMETIME[raw_args.code_type], 3, ), "raw_duration": produced_durations_i, "raw_f0": produced_f0_i, "f0": [round(f0, 3) for f0 in f0_stream], } ) print(output_line, file=output_file) if pbar: pbar.update(1) samples_produced += 1 if raw_args.debug: break output_file.close() if world_size > 1: # important that everything is flushed before aggregating torch.distributed.barrier() if world_size > 1 and rank == 0: with open(raw_args.output, "w") as fout: for i in range(world_size): f = raw_args.output + f"_{i}" with open(f, "r") as fin: fout.write(fin.read()) os.remove(f) def cli_main(): parser = options.get_interactive_generation_parser() parser.add_argument( "--prefix-length", type=int, default=1, help="Prompt prefix length (including <s>)", ) parser.add_argument("--output", type=str, default=None, required=True) parser.add_argument( "--debug", action="store_true", help="Process only the first batch" ) parser.add_argument( "--ignore-durations", action="store_true", help="If set, the duration stream is ignored", ) parser.add_argument( "--max-length", type=int, default=200, help="Maximal produced length" ) parser.add_argument( "--code-type", choices=["cpc_km100", "hubert"], default="cpc_km100" ) parser.add_argument("--max-samples", type=int, default=None) parser.add_argument("--prompt-duration-scaler", type=float, default=1.0) parser.add_argument("--teacher-force-tokens", action="store_true", default=False) parser.add_argument("--teacher-force-duration", action="store_true", default=False) parser.add_argument("--teacher-force-f0", action="store_true", default=False) parser.add_argument("--filter-names", type=str, default=None) parser.add_argument( "--match-duration", action="store_true", help="Do not produce sequences longer that ground-truth", ) parser.add_argument( "--cut-prompt", action="store_true", help="Remove prompt from the produced audio", ) parser.add_argument( "--short-curcuit", action="store_true", help="Use 'target' as a sample" ) parser.add_argument("--f0-discretization-bounds", type=str, default=None) parser.add_argument("--batch-explosion-rate", type=int, default=1) parser.add_argument("--T-token", type=float, default=1.0) parser.add_argument("--T-duration", type=float, default=1.0) parser.add_argument("--T-f0", type=float, default=1.0) parser.add_argument( "--subset", type=str, default="valid", choices=["test", "valid"] ) args = options.parse_args_and_arch(parser) assert ( args.prefix_length >= 1 ), "Prefix length includes bos token <s>, hence the minimum is 1." assert all( t >= 0 for t in [args.T_token, args.T_f0, args.T_duration] ), "T must be non-negative!" world_size = torch.cuda.device_count() if world_size > 1: import random mp.set_start_method("spawn", force=True) os.environ["MASTER_ADDR"] = "localhost" os.environ["MASTER_PORT"] = str(random.randint(10_000, 50_000)) print(f"Using {world_size} devices, master port {os.environ['MASTER_PORT']}") mp.spawn( main, nprocs=world_size, args=( world_size, args, ), join=True, ) else: main(rank=0, world_size=world_size, args=args) if __name__ == "__main__": cli_main()
20,977
33.22186
107
py
rej-summ
rej-summ-main/examples/textless_nlp/pgslm/eval/cont_metrics.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import os import numpy as np import scipy import torch import torch.multiprocessing as mp from fairseq import checkpoint_utils, options from fairseq.data.codedataset import CodeDataset, ExpressiveCodeDataConfig from fairseq.dataclass.utils import convert_namespace_to_omegaconf from torch.utils.data import DataLoader, DistributedSampler from fairseq.utils import move_to_cuda from fairseq import utils from fairseq.criterions.speech_ulm_criterion import nll_loss, mae_loss import time from types import SimpleNamespace import sys, pathlib sys.path.append(str(pathlib.Path(__file__).parent.parent.resolve())) from naive_decoder import Naive_F0_Decoder from inference_dataset import InferenceDataset, explode_batch from sample.sample import do_sampling, TemperatureDecoder, FilterNamesDataset try: from nltk.translate.bleu_score import sentence_bleu except ImportError: print("Please install nltk: `pip install --user -U nltk`") raise @torch.no_grad() def teacher_force_everything( args, dataset, model, criterion, tgt_dict, rank, world_size ): prefix = args.prefix_length f0_decoder = None if args.dequantize_prosody: assert dataset.discrete_f0 print("Reporting MAE for a discrete model") f0_decoder = Naive_F0_Decoder( args.f0_discretization_bounds, dataset.config.f0_vq_n_units ).cuda() dataset = InferenceDataset( dataset, prefix=args.prefix_length, only_prefix=False, filter_short=True, presort_by_length=True, ) sampler = ( None if world_size == 1 else DistributedSampler( dataset, num_replicas=world_size, rank=rank, shuffle=False ) ) dataloader = DataLoader( dataset, args.batch_size, shuffle=False, collate_fn=dataset.collater, sampler=sampler, ) total_token_loss, total_duration_loss, total_f0_loss, total_tokens = ( 0.0, 0.0, 0.0, 0.0, ) i = 0 for batch in dataloader: i += 1 batch = move_to_cuda(batch) output = model(**batch["net_input"]) tokens, durations, f0 = output["token"], output["duration"], output["f0"] durations, f0 = durations.squeeze(), f0.squeeze() token_loss = nll_loss( tokens[:, prefix - 1 :], batch["target"][:, prefix - 1 :].contiguous(), batch["mask"][:, prefix - 1 :].contiguous(), reduce=True, ) if args.dequantize_prosody: durations = durations.argmax(dim=-1) duration_loss = mae_loss( durations[:, prefix - 1 :].contiguous().float(), batch["dur_target"][:, prefix - 1 :].contiguous().float(), batch["dur_mask"][:, prefix - 1 :].contiguous(), reduce=True, ) else: duration_loss = criterion.dur_loss_fn( durations[:, prefix - 1 :].contiguous(), batch["dur_target"][:, prefix - 1 :].contiguous(), batch["dur_mask"][:, prefix - 1 :].contiguous(), reduce=True, ) if f0_decoder: f0 = f0.argmax(dim=-1) f0 = f0_decoder(f0).squeeze(-1) f0_target = batch["raw_f0"] f0_loss = mae_loss( f0[:, prefix - 1 :].contiguous(), f0_target[:, prefix - 1 :].contiguous(), batch["f0_mask"][:, prefix - 1 :].contiguous(), reduce=True, ) else: f0_loss = criterion.f0_loss_fn( f0[:, prefix - 1 :].contiguous(), batch["f0_target"][:, prefix - 1 :].contiguous(), batch["f0_mask"][:, prefix - 1 :].contiguous(), reduce=True, ) n_tokens = (~batch["dur_mask"])[:, prefix - 1 :].sum() total_token_loss += token_loss.item() total_duration_loss += duration_loss.item() total_f0_loss += f0_loss.item() total_tokens += n_tokens.item() if args.debug and i > 5: break values = torch.tensor([total_token_loss, total_duration_loss, total_f0_loss]) normalizers = torch.tensor([total_tokens for _ in range(3)]) return values, normalizers def get_bleu(produced_tokens, target_tokens, tgt_dict): assert target_tokens.ndim == 1 assert produced_tokens.size(1) == target_tokens.size(0) # we can have padding due to shifted channels shift = 0 for token in reversed(target_tokens.cpu().tolist()): if token in [tgt_dict.pad(), tgt_dict.eos()]: shift += 1 else: break target_tokens = target_tokens[:-shift] produced_tokens = produced_tokens[:, :-shift] string_target = tgt_dict.string(target_tokens).split() string_candidates = [ tgt_dict.string(produced_tokens[i, :]).split() for i in range(produced_tokens.size(0)) ] bleu3 = sentence_bleu( references=string_candidates, hypothesis=string_target, weights=(1.0 / 3, 1.0 / 3, 1.0 / 3), ) return bleu3 @torch.no_grad() def continuation(args, dataset, model, criterion, tgt_dict, rank, world_size): is_discrete_duration = dataset.discrete_dur is_discrete_f0 = dataset.discrete_f0 f0_decoder = None if args.dequantize_prosody: assert dataset.discrete_f0 print("Reporting MAE F0 for a discrete model") f0_decoder = Naive_F0_Decoder( args.f0_discretization_bounds, dataset.config.f0_vq_n_units ).cuda() dataset = InferenceDataset( dataset, args.prefix_length, filter_short=True, presort_by_length=True ) sampler = ( None if world_size == 1 else DistributedSampler( dataset, num_replicas=world_size, rank=rank, shuffle=False ) ) dataloader = DataLoader( dataset, batch_size=1, shuffle=False, collate_fn=dataset.collater, sampler=sampler, ) Ts = args.T_token, args.T_duration, args.T_f0 decoder = TemperatureDecoder( Ts, discrete_dur=is_discrete_duration, discrete_f0=is_discrete_f0 ) running_stats = SimpleNamespace( token_bleu=0.0, duration_nll=0.0, duration_mae=0.0, f0_nll=0.0, f0_mae=0.0, n_tokens=0.0, n_sentences=0.0, f0_sum=0.0, f0_sum_sq=0.0, dur_sum=0.0, dur_sum_sq=0.0, ) for i, batch in enumerate(dataloader): batch = explode_batch(batch, args.batch_explosion_rate) bsz = batch["target"].size(0) batch = move_to_cuda(batch) prefix = batch["prefix"][0] max_length_to_unroll = batch["target"].size(1) prefix_length = batch["net_input"]["src_tokens"].size(1) steps = max_length_to_unroll - prefix_length + 1 assert steps > 0 produced_tokens, produced_durations, produced_f0, outputs = do_sampling( model, batch, tgt_dict.eos(), decoder, autoregressive_steps=steps, teacher_force_tokens=args.teacher_force_tokens, teacher_force_duration=args.teacher_force_duration, teacher_force_f0=args.teacher_force_f0, ) if args.teacher_force_tokens: assert (produced_tokens[:, 1:] == batch["target"]).all() if args.teacher_force_duration: assert (produced_durations[:, 1:] == batch["dur_target"]).all() if args.teacher_force_f0: assert (produced_f0[:, 1:] == batch["f0_target"]).all() dur_target = batch["dur_target"][:, prefix - 1 :].contiguous() f0_target = batch["f0_target"][:, prefix - 1 :].contiguous() f0_mask = batch["f0_mask"][:, prefix - 1 :].contiguous() dur_mask = batch["dur_mask"][:, prefix - 1 :].contiguous() duration_mae = mae_loss( produced_durations[:, prefix:].float(), dur_target.float(), dur_mask, reduce=False, ) min_duration_mae = duration_mae.view(bsz, -1).sum(dim=-1).min(dim=0)[0] running_stats.duration_mae += min_duration_mae running_stats.dur_sum += ( produced_durations[:, prefix:].float() * (~dur_mask) ).sum() / args.batch_explosion_rate running_stats.dur_sum_sq += ( produced_durations[:, prefix:].float() * (~dur_mask) ).pow(2.0).sum() / args.batch_explosion_rate if is_discrete_duration: duration_loss = criterion.dur_loss_fn( torch.stack([x[1] for x in outputs], dim=1), dur_target, dur_mask, reduce=False, ) min_duration_loss = duration_loss.view(bsz, -1).sum(dim=-1).min(dim=0)[0] running_stats.duration_nll += min_duration_loss if f0_decoder: # can only exist for discrete F0 models decoded_produced_f0 = f0_decoder(produced_f0[:, prefix:]) decoded_f0_target = batch["raw_f0"][:, prefix - 1 :].contiguous() if produced_f0.ndim == 3: decoded_produced_f0 = decoded_produced_f0.squeeze(2) decoded_f0_target = decoded_f0_target.squeeze(2) f0_mae = mae_loss( decoded_produced_f0, decoded_f0_target, f0_mask, reduce=False ) f0_mae = f0_mae.view(bsz, -1).sum(dim=-1).min(dim=0)[0] running_stats.f0_mae += f0_mae f0_loss = criterion.f0_loss_fn( torch.stack([x[2] for x in outputs], dim=1), f0_target.long(), f0_mask, reduce=False, ) f0_loss = f0_loss.view(bsz, -1).sum(dim=-1).min(dim=0)[0] running_stats.f0_nll += f0_loss running_stats.f0_sum += ( decoded_produced_f0 * (~f0_mask) ).sum() / args.batch_explosion_rate running_stats.f0_sum_sq += (decoded_produced_f0 * (~f0_mask)).pow( 2.0 ).sum() / args.batch_explosion_rate else: assert not is_discrete_duration f0_loss = mae_loss( produced_f0[:, prefix:], f0_target, f0_mask, reduce=False ) f0_loss = f0_loss.view(bsz, -1).sum(dim=-1).min(dim=0)[0] running_stats.f0_mae += f0_loss running_stats.f0_sum += ( produced_f0[:, prefix:].sum() / args.batch_explosion_rate ) running_stats.f0_sum_sq += ( produced_f0[:, prefix:].pow(2.0).sum() / args.batch_explosion_rate ) running_stats.n_tokens += (~dur_mask)[0, ...].sum() token_loss = get_bleu( produced_tokens[:, prefix:], batch["target"][0, prefix - 1 :], tgt_dict ) running_stats.token_bleu += token_loss running_stats.n_sentences += 1 if args.debug: break values = torch.tensor( [ running_stats.token_bleu, running_stats.duration_nll, running_stats.duration_mae, running_stats.f0_nll, running_stats.f0_mae, running_stats.f0_sum, running_stats.f0_sum_sq, running_stats.dur_sum, running_stats.dur_sum_sq, ] ) normalizers = torch.tensor( [running_stats.n_sentences] + [running_stats.n_tokens] * 8 ) return values, normalizers @torch.no_grad() def correlation(args, dataset, model, criterion, tgt_dict, rank, world_size): is_discrete_duration = dataset.discrete_dur is_discrete_f0 = dataset.discrete_f0 f0_decoder = None if is_discrete_f0: assert dataset.discrete_f0 f0_decoder = Naive_F0_Decoder( args.f0_discretization_bounds, dataset.config.f0_vq_n_units ).cuda() if is_discrete_f0: assert f0_decoder # correlation on tokens is meaningless dataset = InferenceDataset( dataset, args.prefix_length, filter_short=True, presort_by_length=True, min_length=args.min_length, ) sampler = ( None if world_size == 1 else DistributedSampler( dataset, num_replicas=world_size, rank=rank, shuffle=False ) ) dataloader = DataLoader( dataset, batch_size=1, shuffle=False, collate_fn=dataset.collater, sampler=sampler, ) Ts = args.T_token, args.T_duration, args.T_f0 decoder = TemperatureDecoder( Ts, discrete_dur=is_discrete_duration, discrete_f0=is_discrete_f0 ) mean_dur_prefix, mean_dur_cont = [], [] mean_f0_prefix, mean_f0_cont = [], [] for batch in dataloader: batch = explode_batch(batch, args.batch_explosion_rate) batch = move_to_cuda(batch) assert len(batch["prefix"]) == 1 if args.teacher_force_tokens: autoregressive_steps = batch["target"].size(1) - args.prefix_length - 1 else: autoregressive_steps = args.max_length - args.prefix_length # + max_shift? if args.copy_target: produced_durations, produced_f0 = batch["dur_target"], batch["f0_target"] else: _, produced_durations, produced_f0, outputs = do_sampling( model, batch, tgt_dict.eos(), decoder, autoregressive_steps=autoregressive_steps, teacher_force_tokens=args.teacher_force_tokens, teacher_force_duration=args.teacher_force_duration, teacher_force_f0=args.teacher_force_f0, ) # first tokens actually correspond to BOS produced_durations = produced_durations[:, 1:] produced_f0 = produced_f0[:, 1:] dur_target = batch["dur_target"] if is_discrete_duration: produced_durations = produced_durations.float() dur_target = dur_target.float() if is_discrete_f0: produced_f0 = f0_decoder(produced_f0).squeeze(-1) f0_target = batch["raw_f0"] else: f0_target = batch["f0_target"] # prefix values prefix = batch["prefix"][0] dur_prefix_mean = dur_target[:, :prefix].sum(dim=-1) / ( (~batch["dur_mask"][:, :prefix]).sum(dim=-1) ) non_voiced = f0_target[:, :prefix] == 0.0 f0_mask = batch["f0_mask"][:, :prefix].logical_or(non_voiced) f0_prefix_mean = f0_target[:, :prefix].sum(dim=-1) / ((~f0_mask).sum(dim=-1)) # continuation values dur_cont_mean = produced_durations[:, prefix:].sum(dim=-1) / ( (~batch["dur_mask"][:, prefix:]).sum(dim=-1) ) non_voiced = produced_f0[:, prefix:] == 0.0 f0_mask = non_voiced f0_cont_mean = produced_f0[:, prefix:].sum(dim=-1) / ((~f0_mask).sum(dim=-1)) assert not f0_cont_mean.isnan().any() mean_dur_prefix.append(dur_prefix_mean.cpu()) mean_dur_cont.append(dur_cont_mean.cpu()) mean_f0_prefix.append(f0_prefix_mean.cpu()) mean_f0_cont.append(f0_cont_mean.cpu()) if args.debug and len(mean_dur_prefix) > 10: break mean_dur_prefix, mean_dur_cont = torch.cat(mean_dur_prefix), torch.cat( mean_dur_cont ) mean_f0_prefix, mean_f0_cont = torch.cat(mean_f0_prefix), torch.cat(mean_f0_cont) return mean_dur_prefix, mean_dur_cont, mean_f0_prefix, mean_f0_cont def main(rank, world_size, args): start = time.time() if world_size > 1: torch.distributed.init_process_group( backend="gloo", init_method="env://", world_size=world_size, rank=rank ) torch.cuda.set_device(rank % torch.cuda.device_count()) raw_args = args args = convert_namespace_to_omegaconf(args) if args.common.seed is not None: np.random.seed(args.common.seed) utils.set_torch_seed(args.common.seed) models, model_args, task = checkpoint_utils.load_model_ensemble_and_task( [raw_args.path], arg_overrides={"data": args.task.data} ) tgt_dict = task.target_dictionary for model in models: model.prepare_for_inference_(args) model.cuda().eval() if raw_args.fp16: model = model.half() model = models[0] config = ExpressiveCodeDataConfig(args.task.data) dataset = CodeDataset( manifest=config.manifests[raw_args.eval_subset], dictionary=task.source_dictionary, dur_dictionary=task.source_duration_dictionary, f0_dictionary=task.source_f0_dictionary, config=config, discrete_dur=task.cfg.discrete_duration, discrete_f0=task.cfg.discrete_f0, log_f0=task.cfg.log_f0, normalize_f0_mean=task.cfg.normalize_f0_mean, normalize_f0_std=task.cfg.normalize_f0_std, interpolate_f0=task.cfg.interpolate_f0, shifts=task.cfg.stream_shifts, return_filename=True, strip_filename=False, return_continuous_f0=raw_args.dequantize_prosody, ) if raw_args.filter_names: dataset = FilterNamesDataset(dataset, raw_args.filter_names) criterion = task.build_criterion(model_args.criterion) name2metric = { "continuation": continuation, "teacher_force_everything": teacher_force_everything, "correlation": correlation, } name2keys = { "continuation": ( "Token BLEU3", "Duration NLL", "Duration MAE", "F0 NLL", "F0 MAE", "F0 sum", "F0 sum_sq", "Dur sum", "Dur sum_sq", ), "teacher_force_everything": ("token_loss", "duration_loss", "f0_loss"), "correlation": ("Duration corr", "F0 corr"), } metric_name = raw_args.metric metric = name2metric[metric_name] results = metric(raw_args, dataset, model, criterion, tgt_dict, rank, world_size) values = None if metric_name not in [ "correlation", ]: values, normalizers = results values = maybe_aggregate_normalize(values, normalizers, world_size) elif metric_name == "correlation": values = maybe_aggregate_correlations(results, world_size) else: assert False assert values is not None summary = dict(zip(name2keys[raw_args.metric], values.tolist())) if metric_name == "continuation": summary["F0 Std"] = np.sqrt(-summary["F0 sum"] ** 2 + summary["F0 sum_sq"]) summary["Dur Std"] = np.sqrt(-summary["Dur sum"] ** 2 + summary["Dur sum_sq"]) del summary["F0 sum"] del summary["F0 sum_sq"] del summary["Dur sum"] del summary["Dur sum_sq"] summary["metric"] = metric_name if rank == 0: print(summary) if raw_args.wandb: wandb_results(summary, raw_args) print("# finished in ", time.time() - start, "seconds") def wandb_results(summary, raw_args): import wandb run = wandb.init( project=raw_args.wandb_project_name, tags=raw_args.wandb_tags.split(",") ) run.config.metric = raw_args.metric run.config.model = raw_args.path run.config.data = raw_args.data if raw_args.wandb_run_name: run.name = raw_args.wandb_run_name run.save() wandb.log(summary) wandb.finish() def maybe_aggregate_normalize(values, normalizers, world_size): if world_size > 1: torch.distributed.barrier() torch.distributed.all_reduce_multigpu([values]) torch.distributed.all_reduce_multigpu([normalizers]) return values / normalizers def maybe_aggregate_correlations(results, world_size): if world_size > 1: output = [None for _ in range(world_size)] torch.distributed.all_gather_object(output, results) mean_dur_prefix, mean_dur_cont, mean_f0_prefix, mean_f0_cont = [ torch.cat([x[i] for x in output]) for i in range(4) ] else: mean_dur_prefix, mean_dur_cont, mean_f0_prefix, mean_f0_cont = results corr_dur = scipy.stats.pearsonr(mean_dur_prefix.numpy(), mean_dur_cont.numpy())[0] corr_f0 = scipy.stats.pearsonr(mean_f0_prefix.numpy(), mean_f0_cont.numpy())[0] values = torch.tensor([corr_dur, corr_f0]) return values def cli_main(): parser = options.get_interactive_generation_parser() parser.add_argument( "--prefix-length", type=int, default=1, help="Prompt prefix length (including <s>)", ) parser.add_argument( "--duration-scale", type=float, default=1, help="Multiply durations by the given scaler", ) parser.add_argument( "--debug", action="store_true", help="Process only the first batch" ) parser.add_argument("--n_hypotheses", type=int, default=1) parser.add_argument("--filter-names", type=str, default=None) parser.add_argument( "--max-length", type=int, default=200, help="Maximal produced length" ) parser.add_argument("--teacher-force-tokens", action="store_true", default=False) parser.add_argument("--teacher-force-duration", action="store_true", default=False) parser.add_argument("--teacher-force-f0", action="store_true", default=False) parser.add_argument("--copy-target", action="store_true", default=False) parser.add_argument("--min-length", type=int, default=None) parser.add_argument("--f0-discretization-bounds", type=str, default=None) parser.add_argument("--dequantize-prosody", action="store_true") parser.add_argument("--batch-explosion-rate", type=int, default=1) parser.add_argument( "--metric", choices=["continuation", "teacher_force_everything", "correlation"], required=True, ) parser.add_argument("--wandb", action="store_true") parser.add_argument("--wandb-project-name", type=str, default="eslm") parser.add_argument("--wandb-tags", type=str, default="") parser.add_argument("--wandb-run-name", type=str, default="") parser.add_argument("--T-token", type=float, default=1.0) parser.add_argument("--T-duration", type=float, default=1.0) parser.add_argument("--T-f0", type=float, default=1.0) parser.add_argument("--n-workers", type=int, default=1) parser.add_argument( "--eval-subset", type=str, default="valid", choices=["valid", "test"] ) args = options.parse_args_and_arch(parser) assert ( args.prefix_length >= 1 ), "Prefix length includes bos token <s>, hence the minimum is 1." assert args.temperature >= 0.0, "T must be non-negative!" if args.dequantize_prosody: assert args.f0_discretization_bounds world_size = args.n_workers or torch.cuda.device_count() if world_size > 1: import random mp.set_start_method("spawn", force=True) os.environ["MASTER_ADDR"] = "localhost" os.environ["MASTER_PORT"] = str(random.randint(10_000, 50_000)) mp.spawn( main, nprocs=world_size, args=( world_size, args, ), join=True, ) else: main(rank=0, world_size=world_size, args=args) if __name__ == "__main__": cli_main()
23,650
31.354309
87
py
rej-summ
rej-summ-main/examples/textless_nlp/gslm/ulm/sample.py
#!/usr/bin/env python3 -u # Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Sample from a trained LM; hacked fairseq-interactive """ from collections import namedtuple import os import ast import numpy as np from fairseq import checkpoint_utils, options, tasks, utils import tqdm Batch = namedtuple('Batch', 'ids src_tokens src_lengths') Translation = namedtuple('Translation', 'src_str hypos pos_scores alignments') def make_batches(lines, args, task, max_positions): tokens = [ task.source_dictionary.encode_line( src_str, add_if_not_exist=False ).long() for src_str in lines ] lengths = [t.numel() for t in tokens] itr = task.get_batch_iterator( dataset=task.build_dataset_for_inference(tokens, lengths), max_tokens=args.dataset.max_tokens, max_sentences=args.dataset.batch_size, max_positions=max_positions, ignore_invalid_inputs=args.dataset.skip_invalid_size_inputs_valid_test ).next_epoch_itr(shuffle=False) for batch in itr: yield Batch( ids=batch['id'], src_tokens=batch['net_input']['src_tokens'], src_lengths=batch['net_input']['src_lengths'], ) def main(args): arg_prompts = args.prompts arg_output = args.output arg_debug = args.debug arg_sample_size = args.samples_per_prompt try: from fairseq.dataclass.utils import convert_namespace_to_omegaconf args = convert_namespace_to_omegaconf(args) except: pass # if args.max_tokens is None and args.max_sentences is None: if args.common.seed is not None: np.random.seed(args.common.seed) utils.set_torch_seed(args.common.seed) if args.generation.sampling: args.generation.nbest = args.generation.beam = arg_sample_size task = tasks.setup_task(args.task) overrides = ast.literal_eval(args.common_eval.model_overrides) models, _model_args = checkpoint_utils.load_model_ensemble( args.common_eval.path.split(os.pathsep), arg_overrides=overrides, task=task, suffix=getattr(args, "checkpoint_suffix", ""), ) # Set dictionaries src_dict = task.source_dictionary tgt_dict = task.target_dictionary # Optimize ensemble for generation for model in models: model.prepare_for_inference_(args) model.cuda() # Load alignment dictionary for unknown word replacement # (None if no unknown word replacement, empty if no path to align dictionary) align_dict = utils.load_align_dict(args.generation.replace_unk) max_positions = utils.resolve_max_positions( task.max_positions(), *[model.max_positions() for model in models] ) output_file = open(arg_output, 'w') with open(arg_prompts, 'r') as fin: lines = fin.readlines() split = [x.split('|', 1) for x in lines] seq_id = [x[0] for x in split] prompts = [x[1] for x in split] if args.generation.prefix_size >= 0: prompts = [' '.join(l.split()[:args.generation.prefix_size]) for l in prompts] if arg_debug: prompts = prompts[:10] generator = task.build_generator(models, args.generation) start_id = 0 pbar = tqdm.tqdm(total=len(prompts)) for batch in make_batches(prompts, args, task, max_positions): src_tokens = batch.src_tokens src_lengths = batch.src_lengths src_tokens = src_tokens.cuda() src_lengths = src_lengths.cuda() sample = { 'net_input': { 'src_tokens': src_tokens, 'src_lengths': src_lengths, }, } results = [] translations = task.inference_step(generator, models, sample) for i, (id, hypos) in enumerate(zip(batch.ids.tolist(), translations)): src_tokens_i = utils.strip_pad(src_tokens[i], tgt_dict.pad()) results.append((i + start_id, src_tokens_i, hypos)) # sort output to match input order for id, src_tokens, hypos in sorted(results, key=lambda x: x[0]): if src_dict is not None: src_str = src_dict.string( src_tokens, args.common_eval.post_process) # Process top predictions for hypo_id, hypo in enumerate(hypos): _hypo_tokens, hypo_str, _alignment = utils.post_process_prediction( hypo_tokens=hypo['tokens'].int().cpu(), src_str=src_str, alignment=hypo['alignment'], align_dict=align_dict, tgt_dict=tgt_dict, remove_bpe=args.common_eval.post_process, ) detok_hypo_str = hypo_str utterance = detok_hypo_str print(f'{seq_id[id]}__{hypo_id}|{utterance}', file=output_file) pbar.update(1) start_id += len(results) # output_file.close() def cli_main(): parser = options.get_interactive_generation_parser() parser.add_argument('--prompts', type=str, default=None, required=True) parser.add_argument('--output', type=str, default=None, required=True) parser.add_argument('--debug', action='store_true') parser.add_argument('--samples-per-prompt', type=int, default=1) args = options.parse_args_and_arch(parser) np.random.seed(args.seed) utils.set_torch_seed(args.seed) main(args) if __name__ == '__main__': cli_main()
5,623
31.137143
103
py
rej-summ
rej-summ-main/examples/textless_nlp/gslm/tools/resynthesize_speech.py
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import argparse import gc import logging import os import joblib import soundfile as sf import torch from examples.textless_nlp.gslm.speech2unit.pretrained.utils import get_feature_reader from examples.textless_nlp.gslm.unit2speech.tts_data import TacotronInputDataset from examples.textless_nlp.gslm.unit2speech.utils import ( load_tacotron, load_waveglow, synthesize_audio, ) def get_logger(): log_format = "[%(asctime)s] [%(levelname)s]: %(message)s" logging.basicConfig(format=log_format, level=logging.INFO) logger = logging.getLogger(__name__) return logger def get_parser(): parser = argparse.ArgumentParser(description="GSLM U2S tool") parser.add_argument( "--feature_type", type=str, choices=["logmel", "hubert", "w2v2", "cpc"], default=None, required=True, help="Acoustic feature type", ) parser.add_argument( "--acoustic_model_path", type=str, help="Pretrained acoustic model checkpoint", ) parser.add_argument("--layer", type=int, help="Layer of acoustic model") parser.add_argument( "--kmeans_model_path", type=str, required=True, help="K-means model file path to use for inference", ) parser.add_argument( "--tts_model_path", type=str, help="TTS model file path to use for inference", ) parser.add_argument( "--code_dict_path", type=str, help="Code dict file path to use for inference", ) parser.add_argument( "--waveglow_path", type=str, help="Waveglow (vocoder) model file path to use for inference", ) parser.add_argument("--max_decoder_steps", type=int, default=2000) parser.add_argument("--denoiser_strength", type=float, default=0.1) return parser ################################################ def main(args, logger): # Acoustic Model logger.info(f"Loading acoustic model from {args.tts_model_path}...") feature_reader_cls = get_feature_reader(args.feature_type) reader = feature_reader_cls( checkpoint_path=args.acoustic_model_path, layer=args.layer ) # K-means Model logger.info(f"Loading K-means model from {args.kmeans_model_path} ...") kmeans_model = joblib.load(open(args.kmeans_model_path, "rb")) kmeans_model.verbose = False # TTS Model logger.info(f"Loading TTS model from {args.tts_model_path}...") tacotron_model, sample_rate, hparams = load_tacotron( tacotron_model_path=args.tts_model_path, max_decoder_steps=args.max_decoder_steps, ) # Waveglow Model logger.info(f"Loading Waveglow model from {args.waveglow_path}...") waveglow, denoiser = load_waveglow(waveglow_path=args.waveglow_path) # Dataset if not os.path.exists(hparams.code_dict): hparams.code_dict = args.code_dict_path tts_dataset = TacotronInputDataset(hparams) iters = 0 while True: in_file_path = input("Input: Enter the full file path of audio file...\n") out_file_path = input("Output: Enter the full file path of audio file...\n") feats = reader.get_feats(in_file_path).cpu().numpy() iters += 1 if iters == 1000: gc.collect() torch.cuda.empty_cache() quantized_units = kmeans_model.predict(feats) quantized_units_str = " ".join(map(str, quantized_units)) tts_input = tts_dataset.get_tensor(quantized_units_str) mel, aud, aud_dn, has_eos = synthesize_audio( tacotron_model, waveglow, denoiser, tts_input.unsqueeze(0), strength=args.denoiser_strength, ) sf.write(f"{out_file_path}", aud_dn[0].cpu().float().numpy(), sample_rate) logger.info("Resynthesis done!\n") if __name__ == "__main__": parser = get_parser() args = parser.parse_args() logger = get_logger() logger.info(args) main(args, logger)
4,183
30.458647
86
py