repo
stringlengths
1
99
file
stringlengths
13
215
code
stringlengths
12
59.2M
file_length
int64
12
59.2M
avg_line_length
float64
3.82
1.48M
max_line_length
int64
12
2.51M
extension_type
stringclasses
1 value
LongTailCXR
LongTailCXR-main/src/datasets.py
import os import cv2 import numpy as np import pandas as pd import torch import torchvision class NIH_CXR_Dataset(torch.utils.data.Dataset): def __init__(self, data_dir, label_dir, split): self.data_dir = data_dir self.split = split self.CLASSES = [ 'No Finding', 'Infiltration', 'Atelectasis', 'Effusion', 'Nodule', 'Mass', 'Pneumothorax', 'Consolidation', 'Pleural_Thickening', 'Cardiomegaly', 'Fibrosis', 'Edema', 'Tortuous Aorta', 'Emphysema', 'Pneumonia', 'Calcification of the Aorta', 'Pneumoperitoneum', 'Hernia', 'Subcutaneous Emphysema', 'Pneumomediastinum' ] self.label_df = pd.read_csv(os.path.join(label_dir, f'nih-lt_single-label_{split}.csv')) self.img_paths = self.label_df['id'].apply(lambda x: os.path.join(data_dir, x)).values.tolist() self.labels = self.label_df[self.CLASSES].idxmax(axis=1).apply(lambda x: self.CLASSES.index(x)).values self.cls_num_list = self.label_df[self.CLASSES].sum(0).values.tolist() if self.split == 'train': self.transform = torchvision.transforms.Compose([ torchvision.transforms.ToPILImage(), torchvision.transforms.RandomHorizontalFlip(), torchvision.transforms.RandomRotation(15), torchvision.transforms.ToTensor(), torchvision.transforms.Normalize(mean=(0.485, 0.456, 0.406), std=(0.229, 0.224, 0.225) ) ]) else: self.transform = torchvision.transforms.Compose([ torchvision.transforms.ToPILImage(), torchvision.transforms.ToTensor(), torchvision.transforms.Normalize(mean=(0.485, 0.456, 0.406), std=(0.229, 0.224, 0.225) ) ]) def __len__(self): return len(self.img_paths) def __getitem__(self, idx): x = cv2.imread(self.img_paths[idx]) x = cv2.resize(x, (256, 256), interpolation=cv2.INTER_AREA) x = self.transform(x) y = np.array(self.labels[idx]) return x.float(), torch.from_numpy(y).long() class MIMIC_CXR_Dataset(torch.utils.data.Dataset): def __init__(self, data_dir, label_dir, split): self.split = split self.CLASSES = [ 'No Finding', 'Lung Opacity', 'Cardiomegaly', 'Atelectasis', 'Pleural Effusion', 'Support Devices', 'Edema', 'Pneumonia', 'Pneumothorax', 'Lung Lesion', 'Fracture', 'Enlarged Cardiomediastinum', 'Consolidation', 'Pleural Other', 'Calcification of the Aorta', 'Tortuous Aorta', 'Pneumoperitoneum', 'Subcutaneous Emphysema', 'Pneumomediastinum' ] self.label_df = pd.read_csv(os.path.join(label_dir, f'mimic-lt_single-label_{split}.csv')) self.img_paths = self.label_df['path'].apply(lambda x: os.path.join(data_dir, x)).values.tolist() self.labels = self.label_df[self.CLASSES].idxmax(axis=1).apply(lambda x: self.CLASSES.index(x)).values self.cls_num_list = self.label_df[self.CLASSES].sum(0).values.tolist() if self.split == 'train': self.transform = torchvision.transforms.Compose([ torchvision.transforms.ToPILImage(), torchvision.transforms.RandomHorizontalFlip(), torchvision.transforms.RandomRotation(15), torchvision.transforms.ToTensor(), torchvision.transforms.Normalize(mean=(0.485, 0.456, 0.406), std=(0.229, 0.224, 0.225) ) ]) else: self.transform = torchvision.transforms.Compose([ torchvision.transforms.ToPILImage(), torchvision.transforms.ToTensor(), torchvision.transforms.Normalize(mean=(0.485, 0.456, 0.406), std=(0.229, 0.224, 0.225) ) ]) def __len__(self): return len(self.img_paths) def __getitem__(self, idx): x = cv2.imread(self.img_paths[idx]) x = cv2.resize(x, (256, 256), interpolation=cv2.INTER_AREA) x = self.transform(x) y = np.array(self.labels[idx]) return x.float(), torch.from_numpy(y).long() ## CREDIT TO https://github.com/agaldran/balanced_mixup ## # pytorch-wrapping-multi-dataloaders/blob/master/wrapping_multi_dataloaders.py class ComboIter(object): """An iterator.""" def __init__(self, my_loader): self.my_loader = my_loader self.loader_iters = [iter(loader) for loader in self.my_loader.loaders] def __iter__(self): return self def __next__(self): # When the shortest loader (the one with minimum number of batches) # terminates, this iterator will terminates. # The `StopIteration` raised inside that shortest loader's `__next__` # method will in turn gets out of this `__next__` method. batches = [loader_iter.next() for loader_iter in self.loader_iters] return self.my_loader.combine_batch(batches) def __len__(self): return len(self.my_loader) class ComboLoader(object): """This class wraps several pytorch DataLoader objects, allowing each time taking a batch from each of them and then combining these several batches into one. This class mimics the `for batch in loader:` interface of pytorch `DataLoader`. Args: loaders: a list or tuple of pytorch DataLoader objects """ def __init__(self, loaders): self.loaders = loaders def __iter__(self): return ComboIter(self) def __len__(self): return min([len(loader) for loader in self.loaders]) # Customize the behavior of combining batches here. def combine_batch(self, batches): return batches
5,736
38.294521
110
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/test.py
import torch import torch.nn as nn from torchtext import data import spacy import pandas as pd import numpy as np from sklearn.metrics import accuracy_score from scipy import spatial from sklearn.metrics.pairwise import cosine_similarity import numpy as np from sklearn.metrics.pairwise import cosine_similarity # vectors import numpy as np x=np.random.rand(60,1) xx= np.squeeze(x, axis = 1) print(x) print(xx) xx=xx.tolist() print(xx) ''' x = torch.randn(32,2) print(x) predicted = torch.max(x.cpu().data, 1)[1] print(predicted) a = np.array([500.0005259037134237587]) b = np.array([5.3373973969428334]) # manually compute cosine similarity dot = np.dot(a, b) norma = np.linalg.norm(a) normb = np.linalg.norm(b) cos = dot / (norma * normb) # use library, operates on sets of vectors aa = a.reshape(1, 1) ba = b.reshape(1, 1) cos_lib = cosine_similarity(aa, ba) print( cos, cos_lib[0][0] ) ''' ''' import numpy as np x=np.random.rand(3,5,3) print(x) xx=x[:1,:3,:] yy=np.zeros((1,2,3)) #yy=x[:,3:,:] z=np.concatenate((xx,yy),axis=1) print(z) ''' ''' Question = [0.0005259037134237587, 0.0006161991623230278, -0.000441926735220477, 0.00023349127150140703, -0.00022218863887246698, -0.00020559232507366687, -0.00030536335543729365, -0.0004559644148685038, -0.0005555280367843807, -0.0005481719854287803, -0.0004468941770028323, -0.0003165467642247677, -0.00022572517627850175, -0.00026030224398709834, -0.0003966140793636441, -0.0005340067436918616, -0.0006258487701416016, -0.0006679900689050555, -0.0005561892176046968, -0.0004732513625640422, -0.00043623606325127184, -0.0004072698066011071, -0.0003713608020916581, -0.000308596296235919, -0.0002081076381728053, -0.00011787891708081588, -7.756550985504873e-06, 0.00011763573274947703, 0.00026371877174824476, 0.00037933350540697575, 0.00048683484783396125, 0.0005455493810586631, 0.0005029932945035398, 0.00043106399243697524, 0.00038869859417900443, 0.00042221706826239824, 0.000481904367916286, 0.0005186319467611611, 0.0005151367513462901, 0.0004962238017469645, 0.000517042470164597, 0.0005748764961026609, 0.0006418864359147847, 0.0007038799813017249, 0.0007023453945294023, 0.0006014808313921094, 0.0004530151782091707, 0.0004313945828471333, 0.0005077203386463225, 0.0006168206455186009] Answer = [-0.0007407172815874219, 0.0003912162792403251, 0.000783729599788785, 0.0005963357398286462, 0.0003820427227765322, 0.00016249656619038433, 0.00017274539277423173, 0.000946180836763233, 0.0002916924131568521, -0.00038191478233784437, -5.3373973969428334e-06, -0.00035996915539726615, -0.0002821063972078264, -0.00024768829462118447, -0.00030805906862951815, -0.0004250049823895097, -0.0005145525792613626, -0.0005189307848922908, -0.00045824371045455337, -0.00039178848965093493, -0.0003628349513746798, -0.00037580489879474044, -0.00038543384289368987, -0.0003000291180796921, -0.00017051061149686575, -3.2140414987225085e-05, 7.280190766323358e-05, 0.00016395568673033267, 0.00020775476878043264, 0.00026425361284054816, 0.0003404776216484606, 0.00042201997712254524, 0.00046484629274345934, 0.0004480171191971749, 0.0003900114679709077, 0.00033688865369185805, 0.0003283977566752583, 0.00037086804513819516, 0.00043829443166032434, 0.00048064233851619065, 0.00047680697753094137, 0.0004650719929486513, 0.00046278160880319774, 0.00047989209997467697, 0.0004961331724189222, 0.000502545852214098, 0.0004694652743637562, 0.00045421600225381553, 0.0005006440333090723, 0.000588912982493639] x=[] for i in range(0,5): res=[] for j in range(0,12): #Answer[j] = '{:.16f}'.format(Answer[j]) dist=abs(Question[i]-Answer[j]) res.append(dist) x.append(res) #Answer[10]='{:.16f}'.format(Answer[10]) for i in x: print(i) ''' #print(x) #print(cosine_similarity(Question, Answer)) ''' glove_file = ('../WordVec/paragram_300.txt') tmp_file = get_tmpfile("test_word2vec.txt") _ = glove2word2vec(glove_file, tmp_file) model = KeyedVectors.load_word2vec_format(tmp_file,encoding = "ISO-8859-1") model.save("paragram_300.txt") print(model.vectors) ''' ''' x = torch.randn(5, 2, 3) print(x) y=torch.mean(x,2) print(y) y=torch.mean(y,1,keepdim=True) xx = torch.randn(5, 2, 3) print(xx) yy=torch.mean(xx,2) print(yy) yy=torch.mean(yy,1,keepdim=True) print("result") print(y) print(yy) #predicted = torch.max(x.cpu().data, 1)[0] #print(predicted) cos = nn.CosineSimilarity(dim=1, eps=1e-8) output = cos(y, yy) print(output) ''' ''' m = nn.MaxPool2d((4,1), stride=1) # pool of non-square window #m = nn.MaxPool3d((3, 2, 2), stride=(2, 1, 2)) input = torch.randn(5, 4, 4) output = m(input) print(input.size(0)) #b=output.view(4,-1) #print(b) ''' ''' tensor([[[-1.1660, -0.8757], [-0.7303, -0.4677]], [[-0.1674, 0.7608], [-0.9821, 0.7488]]]) tensor([[-0.9482, -0.6717], [-0.5748, 0.7548]]) tensor([[-0.7303, -0.4677], [-0.1674, 0.7608]]) '''
4,903
31.476821
1,199
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/model_blstm.py
# model.py import torch from copy import deepcopy from torch import nn import numpy as np from torch.nn import functional as F from Pytorch.Model_Transformer.utils import * from Pytorch.Model_Transformer.train import return_emb1,return_emb2 class TextRNN(nn.Module): def __init__(self, config, vocab_size1,vocab_size2, word_embeddings1, word_embeddings2): super(TextRNN, self).__init__() self.config = config # Embedding Layer self.embeddings1 = nn.Embedding(vocab_size1, self.config.embed_size) self.embeddings1.weight = nn.Parameter(word_embeddings1, requires_grad=False) self.embeddings2 = nn.Embedding(vocab_size2, self.config.embed_size) self.embeddings2.weight = nn.Parameter(word_embeddings2, requires_grad=False) self.lstm1 = nn.LSTM(input_size=self.config.embed_size, hidden_size=self.config.hidden_size, num_layers=self.config.hidden_layers, dropout=self.config.dropout_keep, bidirectional=self.config.bidirectional) self.lstm2 = nn.LSTM(input_size=self.config.embed_size, hidden_size=self.config.hidden_size, num_layers=self.config.hidden_layers, dropout=self.config.dropout_keep, bidirectional=self.config.bidirectional) self.dropout = nn.Dropout(self.config.dropout_keep) # Fully-Connected Layer self.fc = nn.Linear( self.config.hidden_size * self.config.hidden_layers * (1 + self.config.bidirectional), self.config.output_size ) # Softmax non-linearity self.softmax = nn.Softmax() self.cos = nn.CosineSimilarity(dim=1, eps=1e-1) def forward(self, x, y, idx): # x.shape = (max_sen_len, batch_size) #embedded_e_sent1= self.embeddings1(x) #embedded_sent2 = self.embeddings2(y) idx = idx.data.cpu().numpy() embedded_sents1 = return_emb1(int(idx[0]), idx.size) embedded_sents2 = return_emb2(int(idx[0]), idx.size) #embedded_sents1 = torch.from_numpy(embedded_sents1).float().cuda() #embedded_sents2 = torch.from_numpy(embedded_sents2).float().cuda() #print(embedded_e_sent1.size()) #print(embedded_sents2.size()) embedded_sents1 = embedded_sents1.swapaxes(1, 0)#, 2) embedded_sents2 = embedded_sents2.swapaxes(1, 0)#, 2) embedded_sents1 = torch.from_numpy(embedded_sents1).float().cuda() embedded_sents2 = torch.from_numpy(embedded_sents2).float().cuda() #print(embedded_sents2.shape) # embedded_sent.shape = (max_sen_len=20, batch_size=64,embed_size=300) lstm_out1, (h_1n, c1_n) = self.lstm1(embedded_sents1) lstm_out2, (h_2n, c2_n) = self.lstm2(embedded_sents2) final_feature_map1 = self.dropout(h_1n) # shape=(num_layers * num_directions, 64, hidden_size) final_feature_map2 = self.dropout(h_2n) #final_feature_map1=lstm_out1 #final_feature_map2=lstm_out2 #print(lstm_out1.size()) # Convert input to (64, hidden_size * hidden_layers * num_directions) for linear layer final_feature_map1 = torch.cat([final_feature_map1[i, :, :] for i in range(final_feature_map1.shape[0])], dim=1) final_feature_map2 = torch.cat([final_feature_map2[i, :, :] for i in range(final_feature_map2.shape[0])], dim=1) #print(final_feature_map1.size()) #final_feature_map1=torch.mean(final_feature_map1,1) #final_feature_map2=torch.mean(final_feature_map2,1) #final_feature_map1 = torch.mean(final_feature_map1,0) #final_feature_map2 = torch.mean(final_feature_map2,0) #print(final_feature_map1) #print(final_feature_map2) #print(final_feature_map1.shape) #print(output) final_out1 = self.fc(final_feature_map1) final_out2 = self.fc(final_feature_map2) #final_out1 = final_out1.squeeze() #final_out2 = final_out2.squeeze() #print(final_out1.shape) output = self.cos(final_out1 , final_out2 ) #return self.softmax(final_out) return output def add_optimizer(self, optimizer): self.optimizer = optimizer def add_loss_op(self, loss_op): self.loss_op = loss_op def reduce_lr(self): print("Reducing LR") for g in self.optimizer.param_groups: g['lr'] = g['lr'] / 2 def run_epoch(self, train_iterator, val_iterator, test_iterator, epoch): train_losses = [] val_accuracies = [] losses = [] # Reduce learning rate as number of epochs increase if (epoch == int(self.config.max_epochs / 3)) or (epoch == int(2 * self.config.max_epochs / 3)): self.reduce_lr() self.train() for i, batch in enumerate(train_iterator): self.optimizer.zero_grad() if torch.cuda.is_available(): x1 = batch.text1.cuda() x2 = batch.text2.cuda() idx = (batch.index).type(torch.cuda.FloatTensor) y = (batch.label).type(torch.cuda.FloatTensor) else: #x = batch.text1 y = (batch.label).type(torch.FloatTensor) y_pred = self.__call__(x1,x2,idx) loss = self.loss_op(y_pred, y) loss.backward() losses.append(loss.data.cpu().numpy()) self.optimizer.step() if i % 100 == 0: print("Iter: {}".format(i + 1)) avg_train_loss = np.mean(losses) train_losses.append(avg_train_loss) print("\tAverage training loss: {:.5f}".format(avg_train_loss)) losses = [] # Evalute Accuracy on validation set #val_accuracy = evaluate_model(self, val_iterator) #print("\tVal Accuracy: {:.4f}".format(val_accuracy)) self.train() #trainfilename, testfilename, validfilename = '../data/Trec_valid_not_aligned.txt' val_map,val_mrr=evaluate_model(self,val_iterator,validfilename) return train_losses, val_map,val_mrr
6,293
41.816327
120
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/utils_SA.py
# utils.py import torch #import gensim #from gensim.test.utils import datapath, get_tmpfile #from gensim.models import KeyedVectors #from gensim.scripts.glove2word2vec import glove2word2vec from torchtext import data import spacy import pandas as pd from Pytorch.Model_Transformer.config import Config import numpy as np from sklearn.metrics import accuracy_score,f1_score from Pytorch.Model_Transformer.imap_qa import calc_one_map from Pytorch.Model_Transformer.imap_qa import calc_map1,calc_mrr1 class Dataset(object): def __init__(self, config): self.config = config self.train_iterator = None self.test_iterator = None self.val_iterator = None self.vocab = [] self.vocab1 = [] self.vocab2 = [] self.word_embeddings = {} self.weights= [] def parse_label(self, label): ''' Get the actual labels from label string Input: label (string) : labels of the form '__label__2' Returns: label (int) : integer value corresponding to label string ''' return int(label.strip()[-1]) def read_data(self, filename): with open(filename, 'r') as datafile: res = [] for line in datafile: line = line.strip().split('\t') lines = [] length = len(line) if (length < 3): lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) res.append([lines[0], lines[1], float(lines[2])]) return res def get_pandas_df(self, filename): ''' Load the data into Pandas.DataFrame object This will be used to convert data to torchtext object ''' val=0 with open(filename, 'r',encoding="utf8") as datafile: res = [] val=val for line in datafile: line = line.strip().split('\t') lines = [] length = len(line) #print(line) if (length < 2): lines.append(str(val)) # lines.append(line[0]) # lines.append(line[1]) # lines.append(line[2]) lines.append(line[0]) lines.append(line[1]) else: lines.append(str(val)) #lines.append(line[0]) #lines.append(line[1]) #lines.append(line[2]) lines.append(line[0]) lines.append(line[1]) #print(lines) val += 1 #res.append([int(lines[0]),lines[1], lines[2], float(lines[3])]) res.append([int(lines[0]), lines[1], float(lines[2])]) #return res #tempdata=[] #for line in datafile: # tempdata = line.split('\t') # data.append([tempdata[0],tempdata[1],tempdata[2]]) data=res #print(data) data_index = list(map(lambda x: int(x[0]), data)) #data_text1 = list(map(lambda x: x[1], data)) #data_text2 = list(map(lambda x: x[2], data)) data_text = list(map(lambda x: x[1], data)) #data_label = list(map(lambda x: int(x[3]), data)) data_label = list(map(lambda x: int(x[2]), data)) #full_df = pd.DataFrame({"index":data_index,"text1":data_text1, "text2":data_text2, "label":data_label}) full_df = pd.DataFrame({"index": data_index, "text": data_text, "label": data_label}) return full_df ''' def get_pandas_df(self, filename): #Load the data into Pandas.DataFrame object #This will be used to convert data to torchtext object with open(filename, 'r') as datafile: res = [] val = 0 for line in datafile: line = line.strip().split('\t') lines = [] length = len(line) val+=1 if (length < 3): lines.append(str(val)) lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(str(val)) lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) res.append([int(lines[0]),lines[1], lines[2], float(lines[3])]) #return res #tempdata=[] #for line in datafile: # tempdata = line.split('\t') # data.append([tempdata[0],tempdata[1],tempdata[2]]) data=res #print(data) data_index = list(map(lambda x: int(x[0]), data)) data_text1 = list(map(lambda x: x[1], data)) data_text2 = list(map(lambda x: x[2], data)) data_label = list(map(lambda x: int(x[3]), data)) full_df = pd.DataFrame({"index":data_index,"text1":data_text1, "text2":data_text2, "label":data_label}) return full_df ''' def load_data(self, train_file, test_file=None, val_file=None): ''' Loads the data from files Sets up iterators for training, validation and test data Also create vocabulary and word embeddings based on the data Inputs: train_file (String): path to training file test_file (String): path to test file val_file (String): path to validation file ''' NLP = spacy.load('en') tokenizer = lambda sent: [x.text for x in NLP.tokenizer(sent) if x.text != " "] from nltk.tokenize import sent_tokenize, word_tokenize from nltk.corpus import stopwords stopWords = set(stopwords.words('english')) # Creating Field for data #TEXT1 = data.Field(sequential=True, tokenize=tokenizer, lower=True, fix_length=self.config.max_sen_len) #TEXT2 = data.Field(sequential=True, tokenize=tokenizer, lower=True, fix_length=self.config.max_sen_len) TEXT = data.Field(sequential=True, tokenize=tokenizer, lower=True, fix_length=self.config.max_sen_len) LABEL = data.Field(sequential=False, use_vocab=False) INDEX = data.Field(sequential=False, use_vocab=False) #datafields = [("index",INDEX),("text1",TEXT1),("text2",TEXT2),("label",LABEL)] datafields = [("index", INDEX), ("text", TEXT), ("label", LABEL)] # Load data from pd.DataFrame into torchtext.data.Dataset train_df = self.get_pandas_df(train_file) #print(train_df['label']) train_examples = [data.Example.fromlist(i, datafields) for i in train_df.values.tolist()] train_data = data.Dataset(train_examples, datafields) test_df = self.get_pandas_df(test_file) test_examples = [data.Example.fromlist(i, datafields) for i in test_df.values.tolist()] test_data = data.Dataset(test_examples, datafields) #print(test_data[0].__dict__.keys()) # If validation file exists, load it. Otherwise get validation data from training data if val_file: print("val_file exists") val_df = self.get_pandas_df(val_file) val_examples = [data.Example.fromlist(i, datafields) for i in val_df.values.tolist()] val_data = data.Dataset(val_examples, datafields) else: train_data, val_data = train_data.split(split_ratio=0.8) #TEXT1.build_vocab(train_data, vectors="glove.6B.300d") # fasttext.en.300d #glove.840B.300d #TEXT2.build_vocab(train_data, vectors="glove.6B.300d") TEXT.build_vocab(train_data, vectors="glove.6B.300d") self.word_embeddings = TEXT.vocab.vectors from torchtext import vocab #vec = vocab.Vectors('paragram_300.txt', '../WordVec/') #glove_file = ('../WordVec/paragram_300.txt') #tmp_file = get_tmpfile("paragram_word2vec.txt") #_ = glove2word2vec(glove_file, tmp_file) #emb = KeyedVectors.load_word2vec_format(tmp_file,encoding = "ISO-8859-1") #emb.save("paragram_300.txt") #self.weights = torch.FloatTensor(emb.vectors) #self.vocab1 = TEXT1.vocab #self.vocab2 = TEXT2.vocab #print(self.vocab1) self.vocab=TEXT.vocab #you can also write TEXT.vocab self.train_iterator = data.BucketIterator( (train_data), batch_size=self.config.batch_size, #sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), #sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) #should check by making it TRUE self.test_iterator = data.BucketIterator( (test_data), batch_size=self.config.batch_size, # sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), #sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) self.val_iterator= data.BucketIterator( (val_data), batch_size=self.config.batch_size, #sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), #sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) '''''' print ("Loaded {} training examples".format(len(train_data))) print ("Loaded {} test examples".format(len(test_data))) print ("Loaded {} validation examples".format(len(val_data))) def evaluate_model(model, iterator): all_preds = [] all_y = [] for idx,batch in enumerate(iterator): if torch.cuda.is_available(): x = batch.text.cuda() else: x = batch.text y_pred = model(x) predicted = torch.max(y_pred.cpu().data, 1)[1] all_preds.extend(predicted.numpy()) all_y.extend(batch.label.numpy()) score = accuracy_score(all_y, np.array(all_preds).flatten()) return score ''' def evaluate_model(model, iterator, filename, type="default"): all_preds = [] all_y = [] model.eval() with torch.no_grad(): for idx, batch in enumerate(iterator): if torch.cuda.is_available(): #x1 = batch.text1.cuda() #x2 = batch.text2.cuda() x=batch.text.cuda() idx = batch.index.cuda() #print(x2) #else: #x1 = batch.text1() #x2 = batch.text2() y_pred = model(x,x,idx,type) #print(y_pred.data) config = Config() #if (config.output_size >= 2): y_pred=torch.max(y_pred.cpu().data, 1)[1] #[1] for Paraphrase detection #y_pred = torch.max(y_pred.cpu().data, 1)[0] #print(y_pred) #y_pred = y_pred[:, 1:] predicted = y_pred.cpu().data.numpy() #print(predicted) #if(config.acc==1): # predicted= predicted.round() if (config.acc == 1): j = 0 for i in predicted: if (predicted[j] < 0.50): predicted[j] = 0.0 else: predicted[j] = 1.0 j = j + 1 #print(predicted) #torch.max(y_pred.cpu().data, 1)[1]+1 all_preds.extend(predicted) all_y.extend(batch.label.numpy()) #preds=np.concatenate((all_preds,all_y),axis=1) #print(filename) #print(all_y) #print("ok") config = Config() datasets=Dataset(config) t_f = datasets.read_data(filename=filename) #score = calc_map1(t_f, all_preds) config=Config() if(config.acc==1): score = accuracy_score(all_y, all_preds) #newscore= f1_score(all_y, all_preds) #print("F1: "+str(newscore*100)) else: #print(all_preds) score = calc_map1(t_f, all_preds) score2 = calc_mrr1(t_f, all_preds) print("MRR: " + str(score2 * 100)) return score '''
12,643
37.785276
112
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/comment_model.py
# Model.py import torch import torch.nn as nn from copy import deepcopy from train_utils import Embeddings, PositionalEncoding from attention import MultiHeadedAttention from encoder import EncoderLayer, Encoder from encoder_cross import EncoderCross, EncoderLayerCross from feed_forward import PositionwiseFeedForward # from Pytorch.Model_Transformer.imap_qa import calc_one_map # from Pytorch.Model_Transformer.utils import Dataset from utils import * from train import return_file_name, return_emb1, return_emb2 import numpy as np from config import Config config = Config() # EmbeddingType="Contextualized" #for CETE # Type="Baseline" #for GloVe class Transformer(nn.Module): def __init__(self, config, src_vocab, target_vocab, s_v, t_v, u): super(Transformer, self).__init__() self.config = config h, N, dropout = self.config.h, self.config.N, self.config.dropout d_model, d_ff = self.config.d_model, self.config.d_ff attn = MultiHeadedAttention(h, d_model) ff = PositionwiseFeedForward(d_model, d_ff, dropout) position = PositionalEncoding(d_model, dropout) attncross = MultiHeadedAttention(h, d_model * 2) ffcross = PositionwiseFeedForward(d_model * 2, d_ff, dropout) positioncross = PositionalEncoding(d_model * 2, dropout) self.encoder = Encoder(EncoderLayer(config.d_model, deepcopy(attn), deepcopy(ff), dropout), N) self.encoder_cross = EncoderCross( EncoderLayerCross((config.d_model) * 2, deepcopy(attncross), deepcopy(ffcross), dropout), N) self.src_embed = nn.Sequential(Embeddings(config.d_model, src_vocab, s_v, u), deepcopy(position)) # Embeddings followed by PE # self.src_embed.weight.data.copy_(src_vocab.vectors) self.target_embed = nn.Sequential(Embeddings(config.d_model, target_vocab, t_v, u), deepcopy(position)) # self.target_embed.weight.data.copy_(target_vocab.vectors) # Fully-Connected Layer self.fc = nn.Linear( self.config.d_model, self.config.output_size ) self.sigmoid = nn.Sigmoid() self.cos = nn.CosineSimilarity(dim=1, eps=1e-6) self.softmax = nn.Softmax() # Softmax non-linearity def forward(self, x1, x2, idx, type="default"): # print(x1) # print(idx+1) # print(label) idx = idx.data.cpu().numpy() if config.EmbeddingType == "Contextualized": embedded_sents1 = return_emb1(int(idx[0]), idx.size) embedded_sents2 = return_emb2(int(idx[0]), idx.size) embedded_sents1 = torch.from_numpy(embedded_sents1).float().cuda() embedded_sents2 = torch.from_numpy(embedded_sents2).float().cuda() else: embedded_sents1 = self.src_embed(x1.permute(1, 0)) # shape = (batch_size, sen_len, d_model) embedded_sents2 = self.target_embed(x2.permute(1, 0)) # shape = (batch_size, sen_len, d_model) # embedded_sents1= torch.from_numpy(embedded_sents1).float().cuda() # embedded_sents2 = torch.from_numpy(embedded_sents2).float().cuda() encoded_sents1 = self.encoder(embedded_sents1, embedded_sents1) encoded_sents2 = self.encoder(embedded_sents2, embedded_sents2) # encoded_e_sents1 = self.encoder(encoded_sents1, encoded_sents2) # encoded_e_sents2 = self.encoder(encoded_sents2, encoded_sents1) j = 0 # for i in range(0,len(label)): # if(int(label[i])==1): # j=j+1 # encoded_sents1[i]=encoded_e_sents1[i] # encoded_sents2[i]=encoded_e_sents2[i] # print(j) # embedded_e_sents1=torch.mean(embedded_sents1,1) # embedded_e_sents2=torch.mean(embedded_sents2,1) # comp=self.cos(embedded_e_sents1,embedded_e_sents2) # encoded_sents2 = self.encoder(encoded_sents2, encoded_sents1) # print(embedded_sents1.size()) # print(embedded_sents1) # Convert input to (batch_size, d_model) for linear layer # print(encoded_sents2.size()) ''' final_feature_map1 = encoded_sents1[:,-1,:] final_out1 = self.fc(final_feature_map1) final_feature_map2 = encoded_sents2[:, -1, :] final_out2 = self.fc(final_feature_map2) ''' # torch.mean(a, 1) # print(encoded_sents1.size()) # final_feature_map1 = encoded_sents1[:, -1, :] # final_feature_map1 = self.fc(final_feature_map1) final_feature_map1 = torch.mean(encoded_sents1, 1) final_feature_map2 = torch.mean(encoded_sents2, 1) # print(final_feature_map1.size()) # word_val1 = torch.sum(encoded_sents1,2) # word_val2 = torch.sum(encoded_sents2, 2) j = 0 ''' if (type == "test"): f=open("Comparison.txt","a+") for i in word_val1: x = int(idx[0]) f.write(str(x + j + 1)+"\n") f.write("Question\n") f.write(str(word_val1[j].tolist())+"\n") f.write("Answer\n") f.write(str(word_val2[j].tolist())+"\n") j = j + 1 ''' # idx = idx.data.cpu().numpy() ''' if (type == "testy"): f = open("ComparisonNewest.txt", "a+") for i in range(0,int(idx.size)): #f.write(str(i+1)+" ") #f.write("Example: \n") x = int(idx[0]) f.write("Example "+str(x + i + 1) + " \n") for j in range(0,20): f.write("Question\n") f.write(str(j+1)) f.write("\n") #f.write(str(word_val1[j].tolist()) + "\n") l = [] for k in range(0,20): w_output = self.cos(encoded_sents1[i:i+1,j:j+1,:], encoded_sents2[i:i+1,k:k+1,:]) w_mean_output = torch.mean(w_output,1) #print(w_mean_output.shape) w_mean_output=w_mean_output.data.cpu().numpy() w_mean_output = float(w_mean_output[0]) #print(w_mean_output) l.append(w_mean_output) #f.write("Answer\n") #f.write(str(w_mean_output) + "\n") l=np.array(l) f.write("Answer\n") f.write(str(l.tolist())) f.write("\n") ''' # print(idx) # print(final_feature_map1.size()) # final_feature_map1 = encoded_sents1[:, -1, :] # torch.mean(encoded_sents1,1) # final_out1 = torch.mean(final_feature_map1,1,keepdim=True) # final_feature_map2 = encoded_sents2[:, -1, :] # torch.mean(encoded_sents2, 1) # final_out2 = torch.mean(final_feature_map2,1,keepdim=True) # print(final_feature_map1.size()) # final_out1=torch.mean(final_feature_map1,1) # print(final_out1.size()) # final_out2=final_feature_map2 # final_feature_map3 = torch.cat((encoded_sents1, encoded_sents2), 2) ''' encoded_sents3 = self.encoder_cross(final_feature_map3, final_feature_map3) m = nn.AvgPool2d((final_feature_map2.size(1), 1), stride=1) # pool of non-square window # m = nn.MaxPool3d((3, 2, 2), stride=(2, 1, 2)) final_out1 = m(final_feature_map1) final_out2 = m(final_feature_map2) final_out1 = final_out1.view(final_out1.size(0), -1) final_out2 = final_out2.view(final_out2.size(0), -1) #print(final_feature_map3.size()) #final_out2 = final_feature_map2 #torch.mean(final_feature_map2, 1) #print(final_out1.size()) ''' # output=final_out1 final_out1 = final_feature_map1 final_out2 = final_feature_map2 # print(final_out1.shape) # output=self.softmax(final_out1) output = self.cos(final_out1, final_out2) # if (type == "testy"): # f = open("predicted_value.txt", "a+") # for i in output: # f.write(str(i) + "\n") # output = torch.exp(-torch.norm((final_out1 - final_out2), 1, 1)) # print(output.size()) # output = self.fc(output) # m = nn.MaxPool1d(3, stride=2) # output = m( final_feature_map3 ) # print(output.size()) # output= self.softmax(output) # output=self.sigmoid(output) # output=torch.mean(encoded_sents3, 1) # output = torch.mean(output, 1) # print(output) # print(output.size()) j = 0 # for i in output: # output[j]=comp[j] # j=j+1 # return comp return output def add_optimizer(self, optimizer): self.optimizer = optimizer def add_loss_op(self, loss_op): self.loss_op = loss_op def reduce_lr(self): print("Reducing LR") for g in self.optimizer.param_groups: g['lr'] = g['lr'] / 2 def run_epoch(self, train_iterator, val_iterator, test_iterator, epoch): train_losses = [] val_accuracies = [] losses = [] self.train() # Reduce learning rate as number of epochs increase if (epoch == int(self.config.max_epochs / 3)) or (epoch == int(2 * self.config.max_epochs / 3)): self.reduce_lr() for i, batch in enumerate(train_iterator): # print(i) # print(batch) self.optimizer.zero_grad() if torch.cuda.is_available(): x1 = batch.text1.cuda() x2 = batch.text2.cuda() # x=batch.text.cuda() y = (batch.label).type(torch.cuda.FloatTensor) idx = (batch.index).type(torch.cuda.FloatTensor) # else: # x1 = batch.text1() # x2 = batch.text2() # y = (batch.label ).type(torch.FloatTensor) # print(x2) y_pred = self.__call__(x1, x2, idx, y) # print(y) # # if(self.config.output_size>=2): # y_pred=torch.max(y_pred, 1)[0] # y_pred = torch.max(y_pred, 1)[0] # y_pred=y_pred.to(torch.float32) # print(y_pred) # print(y) loss = self.loss_op(y_pred, y) loss.backward() losses.append(loss.data.cpu().numpy()) self.optimizer.step() if i % 100 == 0: # print("Iter: {}".format(i+1)) avg_train_loss = np.mean(losses) train_losses.append(avg_train_loss) # print("\tAverage training loss: {:.5f}".format(avg_train_loss)) losses = [] trainfilename, testfilename, validfilename = return_file_name() print("Evaluating Epoch") ''' val_map = evaluate_model(self, val_iterator, filename = validfilename) train_map = evaluate_model(self, train_iterator, filename = trainfilename) print("val map \t" + str(val_map)) print("train map \t" + str(train_map)) return train_losses, val_map ''' config = Config() val_accuracy, v_c = evaluate_model(self, val_iterator, filename=validfilename) # train_accuracy = evaluate_model(self, train_iterator, filename = trainfilename) test_accuracy, t_c = evaluate_model(self, test_iterator, filename=testfilename) print("validation \t" + str(val_accuracy * config.multiplyby)) # print("training \t" + str(train_accuracy*config.multiplyby)) print("test \t" + str(test_accuracy * config.multiplyby)) return train_losses, val_accuracy, v_c
12,031
39.92517
113
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/x.py
#from Pytorch.Model_Transformer.imap_qa import calc_map1,calc_mrr1 from Pytorch.Model_Transformer.imap_qa_test import calc_map1,calc_mrr1 def read_data(filename): with open(filename, 'r') as datafile: res = [] for line in datafile: line = line.strip().split('\t') lines = [] length = len(line) if (length < 3): lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) res.append([lines[0], lines[1], float(lines[2])]) return res if __name__=='__main__': filename='../data/Trec_test_not_aligned.txt' t_f = read_data(filename=filename) print(t_f) f=open("../data/my_pred_result.txt","r") r=[] for i in f: x=float(i[1:len(i)-2]) r.append(x) #print(r.size) res1=calc_map1('../data/Trec_test_not_aligned.txt',r) res2 = calc_mrr1('../data/Trec_test_not_aligned.txt', r) print(res1) print(res2) ''' harvest = np.array([[0.294921875, 0.21875, 0.228515625, 0.255859375, 0.09765625, 0.173828125, 0.435546875, 0.4140625, 0.33984375, 0.306640625, 0.435546875, 0.3984375], [0.251953125, 0.1640625, 0.146484375, 0.208984375, 0.02734375, 0.123046875, 0.384765625, 0.37890625, 0.29296875, 0.369140625, 0.474609375, 0.41015625], [0.38671875, 0.212890625, 0.19140625, 0.23046875, 0.076171875, 0.13671875, 0.33203125, 0.380859375, 0.310546875, 0.32421875, 0.3828125, 0.376953125], [0.29296875, 0.251953125, 0.24609375, 0.2890625, 0.095703125, 0.17578125, 0.375, 0.341796875, 0.330078125, 0.36328125, 0.421875, 0.400390625], [0.3248561918735504, 0.2834951877593994, 0.28172990679740906, 0.32452136278152466, 0.16661545634269714, 0.23046875, 0.35596179962158203, 0.3496513366699219, 0.32236331701278687, 0.36395910382270813, 0.3637075424194336, 0.3341403007507324]])*2 ''' ''' harvest = np.array([[0.22265625, 0.23828125, 0.19140625, 0.22265625, 0.119140625, 0.12890625, 0.365234375, 0.298828125, 0.333984375, 0.3359375, 0.390625, 0.25], [0.26953125, 0.26171875, 0.18359375, 0.2421875, 0.126953125, 0.1640625, 0.318359375, 0.287109375, 0.341796875, 0.35546875, 0.3984375, 0.26953125], [0.4375, 0.29296875, 0.24609375, 0.24609375, 0.18244454264640808, 0.18359375, 0.279296875, 0.287109375, 0.291015625, 0.2421875, 0.3125, 0.28515625], [0.318359375, 0.310546875, 0.255859375, 0.291015625, 0.17578125, 0.177734375, 0.32421875, 0.2578125, 0.33203125, 0.251953125, 0.267578125, 0.271484375], [0.390625, 0.34375, 0.3125, 0.27734375, 0.216796875, 0.234375, 0.291015625, 0.271484375, 0.326171875, 0.25390625, 0.25, 0.26171875] ])*2 ''' ''' [0.294921875, 0.21875, 0.228515625, 0.255859375, 0.09765625, 0.173828125, 0.435546875, 0.4140625, 0.33984375, 0.306640625, 0.435546875, 0.3984375], [0.251953125, 0.1640625, 0.146484375, 0.208984375, 0.02734375, 0.123046875, 0.384765625, 0.37890625, 0.29296875, 0.369140625, 0.474609375, 0.41015625], [0.38671875, 0.212890625, 0.19140625, 0.23046875, 0.076171875, 0.13671875, 0.33203125, 0.380859375, 0.310546875, 0.32421875, 0.3828125, 0.376953125], [0.29296875, 0.251953125, 0.24609375, 0.2890625, 0.095703125, 0.17578125, 0.375, 0.341796875, 0.330078125, 0.36328125, 0.421875, 0.400390625], [0.3248561918735504, 0.2834951877593994, 0.28172990679740906, 0.32452136278152466, 0.16661545634269714, 0.23046875, 0.35596179962158203, 0.3496513366699219, 0.32236331701278687, 0.36395910382270813, 0.3637075424194336, 0.3341403007507324] '''
3,679
56.5
246
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/utils.py
# utils.py import torch # import gensim # from gensim.test.utils import datapath, get_tmpfile # from gensim.models import KeyedVectors # from gensim.scripts.glove2word2vec import glove2word2vec from torchtext import data import spacy import pandas as pd from config import Config import numpy as np from sklearn.metrics import accuracy_score, f1_score from imap_qa import calc_one_map from imap_qa import calc_map1, calc_mrr1 from train import return_file_name val = 0 class Dataset(object): def __init__(self, config): self.config = config self.train_iterator = None self.test_iterator = None self.val_iterator = None self.vocab = [] self.vocab1 = [] self.vocab2 = [] self.word_embeddings = {} self.weights = [] def parse_label(self, label): ''' Get the actual labels from label string Input: label (string) : labels of the form '__label__2' Returns: label (int) : integer value corresponding to label string ''' return int(label.strip()[-1]) def read_data(self, filename): with open(filename, 'r') as datafile: res = [] count = 0 for line in datafile: count = count + 1 if (count == 1): continue line = line.strip().split('\t') lines = [] length = len(line) if (length < 3): lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) res.append([lines[0], lines[1], float(lines[2])]) return res def get_pandas_df(self, filename): ''' Load the data into Pandas.DataFrame object This will be used to convert data to torchtext object ''' global val with open(filename, 'r', encoding="utf8") as datafile: res = [] count=0 #val = val for line in datafile: count=count+1 if(count==1): continue line = line.strip().split('\t') lines = [] length = len(line) if (length < 3): lines.append(str(val)) lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(str(val)) lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) val += 1 #print(line) res.append([int(lines[0]), lines[1], lines[2], float(lines[3])]) # return res # tempdata=[] # for line in datafile: # tempdata = line.split('\t') # data.append([tempdata[0],tempdata[1],tempdata[2]]) data = res # print(data) data_index = list(map(lambda x: int(x[0]), data)) data_text1 = list(map(lambda x: x[1], data)) data_text2 = list(map(lambda x: x[2], data)) data_label = list(map(lambda x: int(x[3]), data)) full_df = pd.DataFrame({"index": data_index, "text1": data_text1, "text2": data_text2, "label": data_label}) return full_df ''' def get_pandas_df(self, filename): #Load the data into Pandas.DataFrame object #This will be used to convert data to torchtext object with open(filename, 'r') as datafile: res = [] val = 0 for line in datafile: line = line.strip().split('\t') lines = [] length = len(line) val+=1 if (length < 3): lines.append(str(val)) lines.append(line[0]) lines.append("question") lines.append(line[1]) else: lines.append(str(val)) lines.append(line[0]) lines.append(line[1]) lines.append(line[2]) res.append([int(lines[0]),lines[1], lines[2], float(lines[3])]) #return res #tempdata=[] #for line in datafile: # tempdata = line.split('\t') # data.append([tempdata[0],tempdata[1],tempdata[2]]) data=res #print(data) data_index = list(map(lambda x: int(x[0]), data)) data_text1 = list(map(lambda x: x[1], data)) data_text2 = list(map(lambda x: x[2], data)) data_label = list(map(lambda x: int(x[3]), data)) full_df = pd.DataFrame({"index":data_index,"text1":data_text1, "text2":data_text2, "label":data_label}) return full_df ''' def load_data(self, train_file, test_file=None, val_file=None): ''' Loads the data from files Sets up iterators for training, validation and test data Also create vocabulary and word embeddings based on the data Inputs: train_file (String): path to training file test_file (String): path to test file val_file (String): path to validation file ''' NLP = spacy.load('en') tokenizer = lambda sent: [x.text for x in NLP.tokenizer(sent) if x.text != " "] from nltk.tokenize import sent_tokenize, word_tokenize from nltk.corpus import stopwords stopWords = set(stopwords.words('english')) # Creating Field for data TEXT1 = data.Field(sequential=True, tokenize=tokenizer, lower=True, fix_length=self.config.max_sen_len) TEXT2 = data.Field(sequential=True, tokenize=tokenizer, lower=True, fix_length=self.config.max_sen_len) LABEL = data.Field(sequential=False, use_vocab=False) INDEX = data.Field(sequential=False, use_vocab=False) datafields = [("index", INDEX), ("text1", TEXT1), ("text2", TEXT2), ("label", LABEL)] # Load data from pd.DataFrame into torchtext.data.Dataset train_df = self.get_pandas_df(train_file) # print(train_df['label']) train_examples = [data.Example.fromlist(i, datafields) for i in train_df.values.tolist()] train_data = data.Dataset(train_examples, datafields) test_df = self.get_pandas_df(test_file) test_examples = [data.Example.fromlist(i, datafields) for i in test_df.values.tolist()] test_data = data.Dataset(test_examples, datafields) # print(test_data[0].__dict__.keys()) # If validation file exists, load it. Otherwise get validation data from training data if val_file: print("val_file exists") val_df = self.get_pandas_df(val_file) val_examples = [data.Example.fromlist(i, datafields) for i in val_df.values.tolist()] val_data = data.Dataset(val_examples, datafields) else: train_data, val_data = train_data.split(split_ratio=0.8) TEXT1.build_vocab(train_data, vectors="glove.6B.300d") # fasttext.en.300d #glove.840B.300d TEXT2.build_vocab(train_data, vectors="glove.6B.300d") from torchtext import vocab # vec = vocab.Vectors('paragram_300.txt', '../WordVec/') # glove_file = ('../WordVec/paragram_300.txt') # tmp_file = get_tmpfile("paragram_word2vec.txt") # _ = glove2word2vec(glove_file, tmp_file) # emb = KeyedVectors.load_word2vec_format(tmp_file,encoding = "ISO-8859-1") # emb.save("paragram_300.txt") # self.weights = torch.FloatTensor(emb.vectors) self.vocab1 = TEXT1.vocab self.vocab2 = TEXT2.vocab self.word_embeddings1 = TEXT1.vocab.vectors self.word_embeddings2 = TEXT2.vocab.vectors #print(self.vocab1) # you can also write TEXT.vocab self.train_iterator = data.BucketIterator( (train_data), batch_size=self.config.batch_size, # sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), # sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) # should check by making it TRUE self.test_iterator = data.BucketIterator( (test_data), batch_size=self.config.batch_size, # sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), # sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) self.val_iterator = data.BucketIterator( (val_data), batch_size=self.config.batch_size, # sort_key=lambda x: len(x.text), sort_key=lambda x: data.sort_keys(x.index), # sort_key=lambda x: data.interleave_keys(len(x.text1), len(x.text2)), repeat=False, shuffle=False) '''''' print("Loaded {} training examples".format(len(train_data))) print("Loaded {} test examples".format(len(test_data))) print("Loaded {} validation examples".format(len(val_data))) def evaluate_model(model, iterator, filename): all_preds = [] all_y = [] model.eval() with torch.no_grad(): for idx, batch in enumerate(iterator): if torch.cuda.is_available(): x1 = batch.text1.cuda() x2 = batch.text2.cuda() idx = batch.index.cuda() label = batch.label.cuda() # print(x2) else: x1 = batch.text1() x2 = batch.text2() y_pred = model(x1, x2, idx) # print(y_pred.data) config = Config() #if (config.output_size >= 2): # y_pred = torch.max(y_pred.cpu().data, 1)[0] # [0] for value, 1 for index # print(y_pred) predicted = y_pred.cpu().data.numpy() #print(predicted) # if(config.acc==1): # predicted= predicted.round() if (config.acc == 1): j = 0 for i in predicted: if (predicted[j] < 0.50): predicted[j] = 0.0 else: predicted[j] = 1.0 j = j + 1 # print(predicted) # torch.max(y_pred.cpu().data, 1)[1]+1 all_preds.extend(predicted) all_y.extend(batch.label.numpy()) # preds=np.concatenate((all_preds,all_y),axis=1) # print(filename) # print(all_y) # print("ok") config = Config() datasets = Dataset(config) t_f = datasets.read_data(filename=filename) #t_f="hi" # score = calc_map1(t_f, all_preds) config = Config() if (config.acc == 1): score = accuracy_score(all_y, all_preds) score2 = f1_score(all_y, all_preds) print("ACC: " + str(score * 100)) print("F1: " + str(score2 * 100)) else: # print(all_preds) #print(all_preds) score = calc_map1(t_f, all_preds) score2 = calc_mrr1(t_f, all_preds) print(filename + " MAP: " + str(score * 1)) print(filename+" MRR: " + str(score2 * 1)) return score,score2 ''' def evaluate_model(model, iterator): all_preds = [] all_y = [] for idx,batch in enumerate(iterator): if torch.cuda.is_available(): x = batch.text.cuda() else: x = batch.text y_pred = model(x) predicted = torch.max(y_pred.cpu().data, 1)[1] all_preds.extend(predicted.numpy()) all_y.extend(batch.label.numpy()) score = accuracy_score(all_y, np.array(all_preds).flatten()) return score def evaluate_model(model, iterator, filename, type="default"): all_preds = [] all_y = [] model.eval() with torch.no_grad(): for idx, batch in enumerate(iterator): if torch.cuda.is_available(): #x1 = batch.text1.cuda() #x2 = batch.text2.cuda() x=batch.text.cuda() idx = batch.index.cuda() #print(x2) #else: #x1 = batch.text1() #x2 = batch.text2() y_pred = model(x,x,idx,type) #print(y_pred.data) config = Config() #if (config.output_size >= 2): y_pred=torch.max(y_pred.cpu().data, 1)[1] #[1] for Paraphrase detection #y_pred = torch.max(y_pred.cpu().data, 1)[0] #print(y_pred) #y_pred = y_pred[:, 1:] predicted = y_pred.cpu().data.numpy() #print(predicted) #if(config.acc==1): # predicted= predicted.round() if (config.acc == 1): j = 0 for i in predicted: if (predicted[j] < 0.50): predicted[j] = 0.0 else: predicted[j] = 1.0 j = j + 1 #print(predicted) #torch.max(y_pred.cpu().data, 1)[1]+1 all_preds.extend(predicted) all_y.extend(batch.label.numpy()) #preds=np.concatenate((all_preds,all_y),axis=1) #print(filename) #print(all_y) #print("ok") config = Config() datasets=Dataset(config) t_f = datasets.read_data(filename=filename) #score = calc_map1(t_f, all_preds) config=Config() if(config.acc==1): score = accuracy_score(all_y, all_preds) #newscore= f1_score(all_y, all_preds) #print("F1: "+str(newscore*100)) else: #print(all_preds) score = calc_map1(t_f, all_preds) score2 = calc_mrr1(t_f, all_preds) print("MRR: " + str(score2 * 100)) return score '''
14,352
36.183938
116
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/model.py
# Model.py import torch import torch.nn as nn from copy import deepcopy from train_utils import Embeddings,PositionalEncoding from attention import MultiHeadedAttention from encoder import EncoderLayer, Encoder from encoder_cross import EncoderCross, EncoderLayerCross from feed_forward import PositionwiseFeedForward #from Pytorch.Model_Transformer.imap_qa import calc_one_map #from Pytorch.Model_Transformer.utils import Dataset from utils import * from train import return_file_name, return_emb1,return_emb2 import numpy as np from config import Config config=Config() #EmbeddingType="Contextualized" #for CETE #Type="Baseline" #for GloVe class Transformer(nn.Module): def __init__(self, config, src_vocab, target_vocab,s_v,t_v, u): super(Transformer, self).__init__() self.config = config h, N, dropout = self.config.h, self.config.N, self.config.dropout d_model, d_ff = self.config.d_model, self.config.d_ff attn = MultiHeadedAttention(h, d_model) ff = PositionwiseFeedForward(d_model, d_ff, dropout) position = PositionalEncoding(d_model, dropout) attncross = MultiHeadedAttention(h, d_model*2) ffcross = PositionwiseFeedForward(d_model*2, d_ff, dropout) positioncross = PositionalEncoding(d_model*2, dropout) self.encoder = Encoder(EncoderLayer(config.d_model, deepcopy(attn), deepcopy(ff), dropout), N) self.encoder_cross = EncoderCross(EncoderLayerCross((config.d_model)*2, deepcopy(attncross), deepcopy(ffcross), dropout), N) self.src_embed = nn.Sequential(Embeddings(config.d_model, src_vocab, s_v, u), deepcopy(position)) #Embeddings followed by PE #self.src_embed.weight.data.copy_(src_vocab.vectors) self.target_embed = nn.Sequential(Embeddings(config.d_model, target_vocab,t_v, u), deepcopy(position)) #self.target_embed.weight.data.copy_(target_vocab.vectors) # Fully-Connected Layer self.fc = nn.Linear( self.config.d_model, self.config.output_size ) self.sigmoid=nn.Sigmoid() self.cos = nn.CosineSimilarity(dim=1, eps=1e-6) self.softmax = nn.Softmax() # Softmax non-linearity def forward(self, x1, x2, idx, type="default"): #print(x1) #print(idx+1) #print(label) idx=idx.data.cpu().numpy() if config.EmbeddingType=="Contextualized": embedded_sents1 = return_emb1(int(idx[0]),idx.size) embedded_sents2 = return_emb2(int(idx[0]),idx.size) embedded_sents1= torch.from_numpy(embedded_sents1).float().cuda() embedded_sents2 = torch.from_numpy(embedded_sents2).float().cuda() else: embedded_sents1 = self.src_embed(x1.permute(1, 0)) # shape = (batch_size, sen_len, d_model) embedded_sents2 = self.target_embed(x2.permute(1, 0)) # shape = (batch_size, sen_len, d_model) encoded_sents1 = self.encoder(embedded_sents1, embedded_sents1) encoded_sents2 = self.encoder(embedded_sents2, embedded_sents2) final_feature_map1 = torch.mean(encoded_sents1, 1) final_feature_map2 = torch.mean(encoded_sents2, 1) final_out1 = final_feature_map1 final_out2 = final_feature_map2 output=self.cos(final_out1 , final_out2) # for Ablation studies, uncomment the following (line 88 to 99) #final_feature_map1 = torch.mean(embedded_sents1, 1) #final_feature_map2 = torch.mean(embedded_sents2, 1) #final_out1 = final_feature_map1 #final_out2 = final_feature_map2 #comp = self.cos(final_out1, final_out2) #j=0 #print(output.size(),"output") #print(comp.size(),"comp") #for i in comp: # output[j] = comp[j] # j = j + 1 ''' ''' return output def add_optimizer(self, optimizer): self.optimizer = optimizer def add_loss_op(self, loss_op): self.loss_op = loss_op def reduce_lr(self): print("Reducing LR") for g in self.optimizer.param_groups: g['lr'] = g['lr'] / 2 def run_epoch(self, train_iterator, val_iterator, test_iterator, epoch): train_losses = [] val_accuracies = [] losses = [] self.train() # Reduce learning rate as number of epochs increase if (epoch == int(self.config.max_epochs/3)) or (epoch == int(2*self.config.max_epochs/3)): self.reduce_lr() for i, batch in enumerate(train_iterator): #print(i) #print(batch) self.optimizer.zero_grad() if torch.cuda.is_available(): x1 = batch.text1.cuda() x2 = batch.text2.cuda() #x=batch.text.cuda() y = (batch.label ).type(torch.cuda.FloatTensor) idx = (batch.index).type(torch.cuda.FloatTensor) #else: #x1 = batch.text1() #x2 = batch.text2() #y = (batch.label ).type(torch.FloatTensor) #print(x2) y_pred = self.__call__(x1, x2, idx, y) #print(y) # #if(self.config.output_size>=2): # y_pred=torch.max(y_pred, 1)[0] #y_pred = torch.max(y_pred, 1)[0] #y_pred=y_pred.to(torch.float32) #print(y_pred) #print(y) loss = self.loss_op(y_pred, y) loss.backward() losses.append(loss.data.cpu().numpy()) self.optimizer.step() if i % 100 == 0: #print("Iter: {}".format(i+1)) avg_train_loss = np.mean(losses) train_losses.append(avg_train_loss) #print("\tAverage training loss: {:.5f}".format(avg_train_loss)) losses = [] trainfilename,testfilename,validfilename = return_file_name() print("Evaluating Epoch") ''' val_map = evaluate_model(self, val_iterator, filename = validfilename) train_map = evaluate_model(self, train_iterator, filename = trainfilename) print("val map \t" + str(val_map)) print("train map \t" + str(train_map)) return train_losses, val_map ''' config=Config() val_accuracy,v_c = evaluate_model(self, val_iterator, filename = validfilename) #train_accuracy = evaluate_model(self, train_iterator, filename = trainfilename) test_accuracy,t_c = evaluate_model(self, test_iterator, filename = testfilename) print("validation \t"+str(val_accuracy*config.multiplyby)) #print("training \t" + str(train_accuracy*config.multiplyby)) print("test \t" + str(test_accuracy*config.multiplyby)) return train_losses, val_accuracy, v_c
6,889
36.857143
132
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/encoder.py
# encoder.py from torch import nn from train_utils import clones from sublayer import LayerNorm, SublayerOutput class Encoder(nn.Module): ''' Transformer Encoder It is a stack of N layers. ''' def __init__(self, layer, N): super(Encoder, self).__init__() self.layers = clones(layer, N) self.norm = LayerNorm(layer.size) def forward(self, x, mask=None): for layer in self.layers: x = layer(x, mask) return self.norm(x) class EncoderLayer(nn.Module): ''' An encoder layer Made up of self-attention and a feed forward layer. Each of these sublayers have residual and layer norm, implemented by SublayerOutput. ''' def __init__(self, size, self_attn, feed_forward, dropout): super(EncoderLayer, self).__init__() self.self_attn = self_attn self.feed_forward = feed_forward self.sublayer_output = clones(SublayerOutput(size, dropout), 2) self.size = size def forward(self, x, y, mask=None): "Transformer Encoder" #x = self.self_attn(x, x, x, mask) #y = self.self_attn(y, y, y, mask) #x = self.self_attn(x, y, x, mask) #print(y.shape) x = self.sublayer_output[0](x, lambda x: self.self_attn(x, y, x, mask)) # Encoder self-attention return self.sublayer_output[1](x, self.feed_forward)
1,404
30.931818
104
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/feed_forward.py
# feed_forward.py from torch import nn import torch.nn.functional as F class PositionwiseFeedForward(nn.Module): "Positionwise feed-forward network." def __init__(self, d_model, d_ff, dropout=0.1): super(PositionwiseFeedForward, self).__init__() self.w_1 = nn.Linear(d_model, d_ff) self.w_2 = nn.Linear(d_ff, d_model) self.dropout = nn.Dropout(dropout) def forward(self, x): "Implements FFN equation." return self.w_2(self.dropout(F.relu(self.w_1(x))))
515
31.25
58
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/sublayer.py
# sublayer.py import torch from torch import nn class LayerNorm(nn.Module): "Construct a layer normalization module." def __init__(self, features, eps=1e-6): super(LayerNorm, self).__init__() self.a_2 = nn.Parameter(torch.ones(features)) self.b_2 = nn.Parameter(torch.zeros(features)) self.eps = eps def forward(self, x): mean = x.mean(-1, keepdim=True) std = x.std(-1, keepdim=True) return self.a_2 * (x - mean) / (std + self.eps) + self.b_2 class SublayerOutput(nn.Module): ''' A residual connection followed by a layer norm. ''' def __init__(self, size, dropout): super(SublayerOutput, self).__init__() self.norm = LayerNorm(size) self.dropout = nn.Dropout(dropout) def forward(self, x, sublayer): "Apply residual connection to any sublayer with the same size." return x + self.dropout(sublayer(self.norm(x)))
950
29.677419
71
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/train_utils.py
# train_utils.py import torch from torch import nn from torch.autograd import Variable import copy import math #from Pytorch.Model_Transformer.utils import Dataset as utils #from Pytorch.Model_Transformer.config import Config def clones(module, N): "Produce N identical layers." return nn.ModuleList([copy.deepcopy(module) for _ in range(N)]) class Embeddings(nn.Module): ''' Usual Embedding layer with weights multiplied by sqrt(d_model) ''' def __init__(self, d_model, vocab, v, u): super(Embeddings, self).__init__() #self.lut = nn.Embedding(vocab, d_model) #v.vectors= #config=Config() #u = utils(config) #print(u) self.lut = nn.Embedding(vocab, d_model).from_pretrained(v.vectors) #(v.vectors) #self.lut.weight.data.copy_(vocab.vectors) self.d_model = d_model def forward(self, x): return self.lut(x) * math.sqrt(self.d_model) class PositionalEncoding(nn.Module): "Implement the PE function." def __init__(self, d_model, dropout, max_len=5000): super(PositionalEncoding, self).__init__() self.dropout = nn.Dropout(p=dropout) # Compute the positional encodings once in log space. pe = torch.zeros(max_len, d_model) position = torch.arange(0, max_len).unsqueeze(1) div_term = torch.exp(torch.arange(0, d_model, 2).float() * -(math.log(10000.0) / d_model)) pe[:, 0::2] = torch.sin(torch.as_tensor(position.numpy() * div_term.unsqueeze(0).numpy())) pe[:, 1::2] = torch.cos(torch.as_tensor(position.numpy() * div_term.unsqueeze(0).numpy()))#torch.cos(position * div_term) pe = pe.unsqueeze(0) self.register_buffer('pe', pe) def forward(self, x): x = x + Variable(self.pe[:, :x.size(1)], requires_grad=False) return self.dropout(x)
1,941
34.962963
129
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/encoder_cross.py
# encoder.py from torch import nn from train_utils import clones from sublayer import LayerNorm, SublayerOutput class EncoderCross(nn.Module): ''' Transformer Encoder It is a stack of N layers. ''' def __init__(self, layer, N): super(EncoderCross, self).__init__() self.layers = clones(layer, N) self.norm = LayerNorm(layer.size) def forward(self, x, mask=None): for layer in self.layers: x = layer(x, mask) return self.norm(x) class EncoderLayerCross(nn.Module): ''' An encoder layer Made up of self-attention and a feed forward layer. Each of these sublayers have residual and layer norm, implemented by SublayerOutput. ''' def __init__(self, size, self_attn, feed_forward, dropout): super(EncoderLayerCross, self).__init__() self.self_attn = self_attn self.feed_forward = feed_forward self.sublayer_output = clones(SublayerOutput(size, dropout), 2) self.size = size def forward(self, x, y, mask=None): "Transformer Encoder" #x = self.self_attn(x, x, x, mask) #y = self.self_attn(y, y, y, mask) #x = self.self_attn(x, y, x, mask) x = self.sublayer_output[0](x, lambda x: self.self_attn(x, x, x, mask)) # Encoder self-attention return self.sublayer_output[1](x, self.feed_forward)
1,400
31.581395
104
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/attention.py
# attention.py import torch from torch import nn import math import torch.nn.functional as F from train_utils import clones def attention(query, key, value, mask=None, dropout=None): "Implementation of Scaled dot product attention" d_k = query.size(-1) #print("printing") #print(key.shape) #print("printed") scores = torch.matmul(query, key.transpose(-2, -1)) / math.sqrt(d_k) if mask is not None: scores = scores.masked_fill(mask == 0, -1e9) p_attn = F.softmax(scores, dim = -1) if dropout is not None: p_attn = dropout(p_attn) return torch.matmul(p_attn, value), p_attn class MultiHeadedAttention(nn.Module): def __init__(self, h, d_model, dropout=0.1): "Take in model size and number of heads." super(MultiHeadedAttention, self).__init__() assert d_model % h == 0 # We assume d_v always equals d_k self.d_k = d_model // h self.h = h self.linears = clones(nn.Linear(d_model, d_model), 4) self.attn = None self.dropout = nn.Dropout(p=dropout) def forward(self, query, key, value, mask=None): "Implements Multi-head attention" if mask is not None: # Same mask applied to all h heads. mask = mask.unsqueeze(1) nbatches = query.size(0) # 1) Do all the linear projections in batch from d_model => h x d_k query, key, value = \ [l(x).view(nbatches, -1, self.h, self.d_k).transpose(1, 2) for l, x in zip(self.linears, (query, key, value))] # 2) Apply attention on all the projected vectors in batch. x, self.attn = attention(query, key, value, mask=mask, dropout=self.dropout) # 3) "Concat" using a view and apply a final linear. x = x.transpose(1, 2).contiguous() \ .view(nbatches, -1, self.h * self.d_k) return self.linears[-1](x)
1,982
35.054545
76
py
CETE-LREC
CETE-LREC-master/CETE Feature-Based/Model_Transformer/train.py
# train.py #from Pytorch.Model_Transformer.utils import * import h5py from model import * #from Pytorch.Model_Transformer.model_blstm import * import numpy as np from config import Config import sys import torch.optim as optim from torch import nn import torch def return_file_name(): config = Config() train_file = '../data/' + config.data + '_train.tsv' test_file = '../data/' + config.data + '_test.tsv' valid_file = '../data/' + config.data + '_valid.tsv' return train_file,test_file,valid_file def return_emb1(k, j): config = Config() outfile = config.emb + config.data + "1" hf = h5py.File(outfile + ".h5", 'r') kk = k if (k % 32 != 0): k = k - (k % 32) n1 = hf.get('dataset_' + str(k)) n1 = np.array(n1) if ((kk % 32) + j > 32): n2 = hf.get('dataset_' + str(k + 32)) n2 = np.array(n2) n1 = np.concatenate((n1[kk % 32:32], n2[0:(j - (32 - (kk % 32)))]), axis=0) # print(n1.shape) else: n1 = n1[kk % 32:(kk % 32) + j] return n1 def return_emb2(k, j): config = Config() outfile = config.emb + config.data + "2" hf = h5py.File(outfile + ".h5", 'r') kk = k if (k % 32 != 0): k = k - (k % 32) n1 = hf.get('dataset_' + str(k)) n1 = np.array(n1) if ((kk % 32) + j > 32): n2 = hf.get('dataset_' + str(k + 32)) n2 = np.array(n2) n1 = np.concatenate((n1[kk % 32:32], n2[0:(j - (32 - (kk % 32)))]), axis=0) else: n1 = n1[kk % 32:(kk % 32) + j] return n1 if __name__=='__main__': config = Config() train_file = '../data/quoraTrain.txt' valid_file = '../data/quoraValid.txt' test_file = '../data/quoraTest.txt' train_file = '../data/msrp_train_new.txt' test_file = '../data/msrp_test_new.txt' valid_file = '../data/msrp_valid_new.txt' train_file = '../data/Trec_train_not_aligned.txt' test_file = '../data/Trec_test_not_aligned.txt' valid_file = '../data/Trec_valid_not_aligned.txt' train_file = '../data/wikitrainnewline.txt' test_file = '../data/wikitestnewline.txt' valid_file = '../data/wikidevnewline.txt' #if len(sys.argv) > 2: # train_file = sys.argv[1] #if len(sys.argv) > 3: # test_file = sys.argv[2] f = open("predicted_value.txt", "w+") f.close() train_file,test_file,valid_file=return_file_name() dataset = Dataset(config) dataset.load_data(train_file, test_file, valid_file) # Create Model with specified optimizer and loss function ############################################################## #model = Transformer(config, len(dataset.vocab1), len(dataset.vocab2), dataset.vocab1, dataset.vocab2, dataset.weights) if(config.model==0): model = Transformer(config, len(dataset.vocab1), len(dataset.vocab2), dataset.vocab1, dataset.vocab2, dataset.weights) else: model = TextRNN(config, len(dataset.vocab1), len(dataset.vocab2), dataset.word_embeddings1, dataset.word_embeddings2) if torch.cuda.is_available(): model.cuda() model.train() #optimizer = optim.SGD(model.parameters(), lr=config.lr) #NLLLoss = nn.NLLLoss() #model.add_optimizer(optimizer) #model.add_loss_op(NLLLoss) optimizer = optim.Adam(model.parameters(), lr=config.lr) MSELoss = nn.MSELoss() model.add_optimizer(optimizer) model.add_loss_op(MSELoss) ############################################################## train_losses = [] val_accuracies = [] val_map=0 max_val=0 for i in range(config.max_epochs): print ("Epoch: {}".format(i)) train_loss,val_map,val_mrr= model.run_epoch(dataset.train_iterator, dataset.val_iterator, dataset.test_iterator, i) #i train_losses.append(train_loss) if(val_map>=max_val): max_val=val_map best_model = deepcopy(model) val_accuracies.append(val_map) #train_acc,tr_acc = evaluate_model(best_model, dataset.train_iterator, filename = train_file) #val_acc,v_acc = evaluate_model(best_model, dataset.val_iterator, filename = valid_file) test_acc,t_acc = evaluate_model(best_model, dataset.test_iterator, filename = test_file) #print('Final Training' + "\t" + str(train_acc*config.multiplyby)) #print('Final Validation' + "\t" + str(val_acc*config.multiplyby)) print('#Final Test MAP' + "\t" + str(test_acc*config.multiplyby)) print('#Final Test MRR' + "\t" + str(t_acc * config.multiplyby)) ''' print ('Final Training Accuracy'+"\t" + str(train_acc * 100)) print ('Final Validation Accuracy'+"\t" + str(val_acc * 100)) print ('Final Test Accuracy'+"\t" + str(test_acc * 100)) '''
4,708
32.635714
126
py
CETE-LREC
CETE-LREC-master/GenerateContextualizedEmbeddings/BERT.py
import numpy as np import h5py import mxnet as mx from bert_embedding import BertEmbedding #https://github.com/imgarylai/bert-embedding f1= open("bertS16size1.txt","w+") f2= open("bertS16size2.txt","w+") def read_data(filename): with open(filename, 'r',encoding="utf8") as datafile: res = [] for line in datafile: line = line.strip().split('\t') lines = line length = len(line) track=0 for x in lines[0]: if(x!=' '): track+=1 if(track==0): print(lines) lines[0]= "blank1" track = 0 for x in lines[1]: if (x != ' '): track += 1 if (track == 0): print(lines) lines[1] = "blank2" if (length != 3): print(lines) lines.append(line[0].lower()) lines.append("<pad>") lines.append(line[1]) else: lines.append(line[0].lower()) lines.append(line[1].lower()) lines.append(line[2]) res.append([lines[0].lower(), lines[1].lower(), float(lines[2])]) #res.append([lines[3], lines[4], float(lines[0])]) return res x=read_data("trec_all_raw.txt") #for i in x: # print(i) d_model=768 str1="" str2="" j=0 for i in x: #r=["<pad>"]*(35) i[0] = i[0].split() i[1] = i[1].split() #i[0] = i[0]+r #i[1] = i[1]+r #i[0] = i[0][:30] #i[0] = i[1][:30] separator=' ' temp1 = separator.join(i[0]) temp2 = separator.join(i[1]) str1+=temp1+"\n" str2+=temp2+"\n" str1 = str1.split('\n') str2 = str2.split('\n') print(len(str1)) ctx = mx.gpu(0) bert_embedding = BertEmbedding(ctx=ctx) #bert_embedding = BertEmbedding(ctx=ctx, model='bert_24_1024_16', dataset_name='book_corpus_wiki_en_uncased') j=0 hf1=h5py.File('berttrecr1.h5','w') ii=0 for i in range(0,56082,32): result = bert_embedding(str1[i:min(i+32,56082)]) length = len(result) #print(length) for j in range(0,length): r=result[j][1:] r=np.array(r) val = 25 - int((r.size) / d_model) y = np.zeros((1, val, d_model)) yy = r xx=np.append(yy, y, axis=1) if(j==0): x=xx else: x = np.append(x, xx, axis=0) hf1.create_dataset('dataset_' + str(i), data=x) f1.write(str(ii) + " " + str(i) + "\n") ii=ii+1 j=0 hf1.close() ii=0 j=0 hf2 = h5py.File('berttrecr2.h5', 'w') for i in range(0,56082,32): result = bert_embedding(str2[i:min(i+32,56082)]) length = len(result) for j in range(0,length): r=result[j][1:] r=np.array(r) val = 25 - int((r.size) / d_model) y = np.zeros((1, val, d_model)) yy = r xx = np.append(yy, y, axis=1) if(j==0): x=xx else: x = np.append(x, xx, axis=0) hf2.create_dataset('dataset_' + str(i), data=x) f2.write(str(ii)+" "+str(i)+"\n") ii=ii+1 hf2.close()
3,110
24.710744
109
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/setup.py
""" Simple check list from AllenNLP repo: https://github.com/allenai/allennlp/blob/master/setup.py To create the package for pypi. 1. Change the version in __init__.py and setup.py. 2. Commit these changes with the message: "Release: VERSION" 3. Add a tag in git to mark the release: "git tag VERSION -m'Adds tag VERSION for pypi' " Push the tag to git: git push --tags origin master 4. Build both the sources and the wheel. Do not change anything in setup.py between creating the wheel and the source distribution (obviously). For the wheel, run: "python setup.py bdist_wheel" in the top level allennlp directory. (this will build a wheel for the python version you use to build it - make sure you use python 3.x). For the sources, run: "python setup.py sdist" You should now have a /dist directory with both .whl and .tar.gz source versions of allennlp. 5. Check that everything looks correct by uploading the package to the pypi test server: twine upload dist/* -r pypitest (pypi suggest using twine as other methods upload files via plaintext.) Check that you can install it in a virtualenv by running: pip install -i https://testpypi.python.org/pypi pytorch-transformers 6. Upload the final version to actual pypi: twine upload dist/* -r pypi 7. Copy the release notes from RELEASE.md to the tag in github once everything is looking hunky-dory. """ from io import open from setuptools import find_packages, setup setup( name="pytorch_transformers", version="1.2.0", author="Thomas Wolf, Lysandre Debut, Victor Sanh, Julien Chaumond, Google AI Language Team Authors, Open AI team Authors", author_email="thomas@huggingface.co", description="Repository of pre-trained NLP Transformer models: BERT & RoBERTa, GPT & GPT-2, Transformer-XL, XLNet and XLM", long_description=open("README.md", "r", encoding='utf-8').read(), long_description_content_type="text/markdown", keywords='NLP deep learning transformer pytorch BERT GPT GPT-2 google openai CMU', license='Apache', url="https://github.com/huggingface/pytorch-transformers", packages=find_packages(exclude=["*.tests", "*.tests.*", "tests.*", "tests"]), install_requires=['torch>=1.0.0', 'numpy', 'boto3', 'requests', 'tqdm', 'regex', 'sentencepiece', 'sacremoses'], entry_points={ 'console_scripts': [ "pytorch_transformers=pytorch_transformers.__main__:main", ] }, # python_requires='>=3.5.0', tests_require=['pytest'], classifiers=[ 'Intended Audience :: Science/Research', 'License :: OSI Approved :: Apache Software License', 'Programming Language :: Python :: 3', 'Topic :: Scientific/Engineering :: Artificial Intelligence', ], )
2,959
39
127
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/hubconf.py
from pytorch_transformers import ( AutoTokenizer, AutoConfig, AutoModel, AutoModelWithLMHead, AutoModelForSequenceClassification, AutoModelForQuestionAnswering ) from pytorch_transformers.file_utils import add_start_docstrings dependencies = ['torch', 'tqdm', 'boto3', 'requests', 'regex', 'sentencepiece', 'sacremoses'] @add_start_docstrings(AutoConfig.__doc__) def config(*args, **kwargs): r""" # Using torch.hub ! import torch config = torch.hub.load('huggingface/pytorch-transformers', 'config', 'bert-base-uncased') # Download configuration from S3 and cache. config = torch.hub.load('huggingface/pytorch-transformers', 'config', './test/bert_saved_model/') # E.g. config (or model) was saved using `save_pretrained('./test/saved_model/')` config = torch.hub.load('huggingface/pytorch-transformers', 'config', './test/bert_saved_model/my_configuration.json') config = torch.hub.load('huggingface/pytorch-transformers', 'config', 'bert-base-uncased', output_attention=True, foo=False) assert config.output_attention == True config, unused_kwargs = torch.hub.load('huggingface/pytorch-transformers', 'config', 'bert-base-uncased', output_attention=True, foo=False, return_unused_kwargs=True) assert config.output_attention == True assert unused_kwargs == {'foo': False} """ return AutoConfig.from_pretrained(*args, **kwargs) @add_start_docstrings(AutoTokenizer.__doc__) def tokenizer(*args, **kwargs): r""" # Using torch.hub ! import torch tokenizer = torch.hub.load('huggingface/pytorch-transformers', 'tokenizer', 'bert-base-uncased') # Download vocabulary from S3 and cache. tokenizer = torch.hub.load('huggingface/pytorch-transformers', 'tokenizer', './test/bert_saved_model/') # E.g. tokenizer was saved using `save_pretrained('./test/saved_model/')` """ return AutoTokenizer.from_pretrained(*args, **kwargs) @add_start_docstrings(AutoModel.__doc__) def model(*args, **kwargs): r""" # Using torch.hub ! import torch model = torch.hub.load('huggingface/pytorch-transformers', 'model', 'bert-base-uncased') # Download model and configuration from S3 and cache. model = torch.hub.load('huggingface/pytorch-transformers', 'model', './test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = torch.hub.load('huggingface/pytorch-transformers', 'model', 'bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = torch.hub.load('huggingface/pytorch-transformers', 'model', './tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ return AutoModel.from_pretrained(*args, **kwargs) @add_start_docstrings(AutoModelWithLMHead.__doc__) def modelWithLMHead(*args, **kwargs): r""" # Using torch.hub ! import torch model = torch.hub.load('huggingface/pytorch-transformers', 'modelWithLMHead', 'bert-base-uncased') # Download model and configuration from S3 and cache. model = torch.hub.load('huggingface/pytorch-transformers', 'modelWithLMHead', './test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = torch.hub.load('huggingface/pytorch-transformers', 'modelWithLMHead', 'bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = torch.hub.load('huggingface/pytorch-transformers', 'modelWithLMHead', './tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ return AutoModelWithLMHead.from_pretrained(*args, **kwargs) @add_start_docstrings(AutoModelForSequenceClassification.__doc__) def modelForSequenceClassification(*args, **kwargs): r""" # Using torch.hub ! import torch model = torch.hub.load('huggingface/pytorch-transformers', 'modelForSequenceClassification', 'bert-base-uncased') # Download model and configuration from S3 and cache. model = torch.hub.load('huggingface/pytorch-transformers', 'modelForSequenceClassification', './test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = torch.hub.load('huggingface/pytorch-transformers', 'modelForSequenceClassification', 'bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = torch.hub.load('huggingface/pytorch-transformers', 'modelForSequenceClassification', './tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ return AutoModelForSequenceClassification.from_pretrained(*args, **kwargs) @add_start_docstrings(AutoModelForQuestionAnswering.__doc__) def modelForQuestionAnswering(*args, **kwargs): r""" # Using torch.hub ! import torch model = torch.hub.load('huggingface/pytorch-transformers', 'modelForQuestionAnswering', 'bert-base-uncased') # Download model and configuration from S3 and cache. model = torch.hub.load('huggingface/pytorch-transformers', 'modelForQuestionAnswering', './test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = torch.hub.load('huggingface/pytorch-transformers', 'modelForQuestionAnswering', 'bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = torch.hub.load('huggingface/pytorch-transformers', 'modelForQuestionAnswering', './tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ return AutoModelForQuestionAnswering.from_pretrained(*args, **kwargs)
6,689
58.20354
197
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_lm_finetuning.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Fine-tuning the library models for language modeling on a text file (GPT, GPT-2, BERT, RoBERTa). GPT and GPT-2 are fine-tuned using a causal language modeling (CLM) loss while BERT and RoBERTa are fine-tuned using a masked language modeling (MLM) loss. """ from __future__ import absolute_import, division, print_function import argparse import glob import logging import os import pickle import random import numpy as np import torch from torch.utils.data import DataLoader, Dataset, SequentialSampler, RandomSampler from torch.utils.data.distributed import DistributedSampler from tensorboardX import SummaryWriter from tqdm import tqdm, trange from pytorch_transformers import (WEIGHTS_NAME, AdamW, WarmupLinearSchedule, BertConfig, BertForMaskedLM, BertTokenizer, GPT2Config, GPT2LMHeadModel, GPT2Tokenizer, OpenAIGPTConfig, OpenAIGPTLMHeadModel, OpenAIGPTTokenizer, RobertaConfig, RobertaForMaskedLM, RobertaTokenizer) logger = logging.getLogger(__name__) MODEL_CLASSES = { 'gpt2': (GPT2Config, GPT2LMHeadModel, GPT2Tokenizer), 'openai-gpt': (OpenAIGPTConfig, OpenAIGPTLMHeadModel, OpenAIGPTTokenizer), 'bert': (BertConfig, BertForMaskedLM, BertTokenizer), 'roberta': (RobertaConfig, RobertaForMaskedLM, RobertaTokenizer) } class TextDataset(Dataset): def __init__(self, tokenizer, file_path='train', block_size=512): assert os.path.isfile(file_path) directory, filename = os.path.split(file_path) cached_features_file = os.path.join(directory, f'cached_lm_{block_size}_{filename}') if os.path.exists(cached_features_file): logger.info("Loading features from cached file %s", cached_features_file) with open(cached_features_file, 'rb') as handle: self.examples = pickle.load(handle) else: logger.info("Creating features from dataset file at %s", directory) self.examples = [] with open(file_path, encoding="utf-8") as f: text = f.read() tokenized_text = tokenizer.convert_tokens_to_ids(tokenizer.tokenize(text)) while len(tokenized_text) >= block_size: # Truncate in block of block_size self.examples.append(tokenizer.add_special_tokens_single_sentence(tokenized_text[:block_size])) tokenized_text = tokenized_text[block_size:] # Note that we are loosing the last truncated example here for the sake of simplicity (no padding) # If your dataset is small, first you should loook for a bigger one :-) and second you # can change this behavior by adding (model specific) padding. logger.info("Saving features into cached file %s", cached_features_file) with open(cached_features_file, 'wb') as handle: pickle.dump(self.examples, handle, protocol=pickle.HIGHEST_PROTOCOL) def __len__(self): return len(self.examples) def __getitem__(self, item): return torch.tensor(self.examples[item]) def load_and_cache_examples(args, tokenizer, evaluate=False): dataset = TextDataset(tokenizer, file_path=args.eval_data_file if evaluate else args.train_data_file, block_size=args.block_size) return dataset def set_seed(args): random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if args.n_gpu > 0: torch.cuda.manual_seed_all(args.seed) def mask_tokens(inputs, tokenizer, args): """ Prepare masked tokens inputs/labels for masked language modeling: 80% MASK, 10% random, 10% original. """ labels = inputs.clone() # We sample a few tokens in each sequence for masked-LM training (with probability args.mlm_probability defaults to 0.15 in Bert/RoBERTa) masked_indices = torch.bernoulli(torch.full(labels.shape, args.mlm_probability)).bool() labels[~masked_indices] = -1 # We only compute loss on masked tokens # 80% of the time, we replace masked input tokens with tokenizer.mask_token ([MASK]) indices_replaced = torch.bernoulli(torch.full(labels.shape, 0.8)).bool() & masked_indices inputs[indices_replaced] = tokenizer.convert_tokens_to_ids(tokenizer.mask_token) # 10% of the time, we replace masked input tokens with random word indices_random = torch.bernoulli(torch.full(labels.shape, 0.5)).bool() & masked_indices & ~indices_replaced random_words = torch.randint(len(tokenizer), labels.shape, dtype=torch.long) inputs[indices_random] = random_words[indices_random] # The rest of the time (10% of the time) we keep the masked input tokens unchanged return inputs, labels def train(args, train_dataset, model, tokenizer): """ Train the model """ if args.local_rank in [-1, 0]: tb_writer = SummaryWriter() args.train_batch_size = args.per_gpu_train_batch_size * max(1, args.n_gpu) train_sampler = RandomSampler(train_dataset) if args.local_rank == -1 else DistributedSampler(train_dataset) train_dataloader = DataLoader(train_dataset, sampler=train_sampler, batch_size=args.train_batch_size) if args.max_steps > 0: t_total = args.max_steps args.num_train_epochs = args.max_steps // (len(train_dataloader) // args.gradient_accumulation_steps) + 1 else: t_total = len(train_dataloader) // args.gradient_accumulation_steps * args.num_train_epochs # Prepare optimizer and schedule (linear warmup and decay) no_decay = ['bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in model.named_parameters() if not any(nd in n for nd in no_decay)], 'weight_decay': args.weight_decay}, {'params': [p for n, p in model.named_parameters() if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=t_total) if args.fp16: try: from apex import amp except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use fp16 training.") model, optimizer = amp.initialize(model, optimizer, opt_level=args.fp16_opt_level) # multi-gpu training (should be after apex fp16 initialization) if args.n_gpu > 1: model = torch.nn.DataParallel(model) # Distributed training (should be after apex fp16 initialization) if args.local_rank != -1: model = torch.nn.parallel.DistributedDataParallel(model, device_ids=[args.local_rank], output_device=args.local_rank, find_unused_parameters=True) # Train! logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_dataset)) logger.info(" Num Epochs = %d", args.num_train_epochs) logger.info(" Instantaneous batch size per GPU = %d", args.per_gpu_train_batch_size) logger.info(" Total train batch size (w. parallel, distributed & accumulation) = %d", args.train_batch_size * args.gradient_accumulation_steps * (torch.distributed.get_world_size() if args.local_rank != -1 else 1)) logger.info(" Gradient Accumulation steps = %d", args.gradient_accumulation_steps) logger.info(" Total optimization steps = %d", t_total) global_step = 0 tr_loss, logging_loss = 0.0, 0.0 model.zero_grad() train_iterator = trange(int(args.num_train_epochs), desc="Epoch", disable=args.local_rank not in [-1, 0]) set_seed(args) # Added here for reproducibility (even between python 2 and 3) for _ in train_iterator: epoch_iterator = tqdm(train_dataloader, desc="Iteration", disable=args.local_rank not in [-1, 0]) for step, batch in enumerate(epoch_iterator): inputs, labels = mask_tokens(batch, tokenizer, args) if args.mlm else (batch, batch) inputs = inputs.to(args.device) labels = labels.to(args.device) model.train() outputs = model(inputs, masked_lm_labels=labels) if args.mlm else model(inputs, labels=labels) loss = outputs[0] # model outputs are always tuple in pytorch-transformers (see doc) if args.n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu parallel training if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: with amp.scale_loss(loss, optimizer) as scaled_loss: scaled_loss.backward() else: loss.backward() tr_loss += loss.item() if (step + 1) % args.gradient_accumulation_steps == 0: if args.fp16: torch.nn.utils.clip_grad_norm_(amp.master_params(optimizer), args.max_grad_norm) else: torch.nn.utils.clip_grad_norm_(model.parameters(), args.max_grad_norm) optimizer.step() scheduler.step() # Update learning rate schedule model.zero_grad() global_step += 1 if args.local_rank in [-1, 0] and args.logging_steps > 0 and global_step % args.logging_steps == 0: # Log metrics if args.local_rank == -1 and args.evaluate_during_training: # Only evaluate when single GPU otherwise metrics may not average well results = evaluate(args, model, tokenizer) for key, value in results.items(): tb_writer.add_scalar('eval_{}'.format(key), value, global_step) tb_writer.add_scalar('lr', scheduler.get_lr()[0], global_step) tb_writer.add_scalar('loss', (tr_loss - logging_loss)/args.logging_steps, global_step) logging_loss = tr_loss if args.local_rank in [-1, 0] and args.save_steps > 0 and global_step % args.save_steps == 0: # Save model checkpoint output_dir = os.path.join(args.output_dir, 'checkpoint-{}'.format(global_step)) if not os.path.exists(output_dir): os.makedirs(output_dir) model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(output_dir) torch.save(args, os.path.join(output_dir, 'training_args.bin')) logger.info("Saving model checkpoint to %s", output_dir) if args.max_steps > 0 and global_step > args.max_steps: epoch_iterator.close() break if args.max_steps > 0 and global_step > args.max_steps: train_iterator.close() break if args.local_rank in [-1, 0]: tb_writer.close() return global_step, tr_loss / global_step def evaluate(args, model, tokenizer, prefix=""): # Loop to handle MNLI double evaluation (matched, mis-matched) eval_output_dir = args.output_dir eval_dataset = load_and_cache_examples(args, tokenizer, evaluate=True) if not os.path.exists(eval_output_dir) and args.local_rank in [-1, 0]: os.makedirs(eval_output_dir) args.eval_batch_size = args.per_gpu_eval_batch_size * max(1, args.n_gpu) # Note that DistributedSampler samples randomly eval_sampler = SequentialSampler(eval_dataset) if args.local_rank == -1 else DistributedSampler(eval_dataset) eval_dataloader = DataLoader(eval_dataset, sampler=eval_sampler, batch_size=args.eval_batch_size) # Eval! logger.info("***** Running evaluation {} *****".format(prefix)) logger.info(" Num examples = %d", len(eval_dataset)) logger.info(" Batch size = %d", args.eval_batch_size) eval_loss = 0.0 nb_eval_steps = 0 model.eval() for batch in tqdm(eval_dataloader, desc="Evaluating"): batch = batch.to(args.device) with torch.no_grad(): outputs = model(batch, masked_lm_labels=batch) if args.mlm else model(batch, labels=batch) lm_loss = outputs[0] eval_loss += lm_loss.mean().item() nb_eval_steps += 1 eval_loss = eval_loss / nb_eval_steps perplexity = torch.exp(torch.tensor(eval_loss)) result = { "perplexity": perplexity } output_eval_file = os.path.join(eval_output_dir, "eval_results.txt") with open(output_eval_file, "w") as writer: logger.info("***** Eval results {} *****".format(prefix)) for key in sorted(result.keys()): logger.info(" %s = %s", key, str(result[key])) writer.write("%s = %s\n" % (key, str(result[key]))) return result def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--train_data_file", default=None, type=str, required=True, help="The input training data file (a text file).") parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model predictions and checkpoints will be written.") ## Other parameters parser.add_argument("--eval_data_file", default=None, type=str, help="An optional input evaluation data file to evaluate the perplexity on (a text file).") parser.add_argument("--model_type", default="bert", type=str, help="The model architecture to be fine-tuned.") parser.add_argument("--model_name_or_path", default="bert-base-cased", type=str, help="The model checkpoint for weights initialization.") parser.add_argument("--mlm", action='store_true', help="Train with masked-language modeling loss instead of language modeling.") parser.add_argument("--mlm_probability", type=float, default=0.15, help="Ratio of tokens to mask for masked language modeling loss") parser.add_argument("--config_name", default="", type=str, help="Optional pretrained config name or path if not the same as model_name_or_path") parser.add_argument("--tokenizer_name", default="", type=str, help="Optional pretrained tokenizer name or path if not the same as model_name_or_path") parser.add_argument("--cache_dir", default="", type=str, help="Optional directory to store the pre-trained models downloaded from s3 (instread of the default one)") parser.add_argument("--block_size", default=-1, type=int, help="Optional input sequence length after tokenization." "The training dataset will be truncated in block of this size for training." "Default to the model max input length for single sentence inputs (take into account special tokens).") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--evaluate_during_training", action='store_true', help="Run evaluation during training at each logging step.") parser.add_argument("--do_lower_case", action='store_true', help="Set this flag if you are using an uncased model.") parser.add_argument("--per_gpu_train_batch_size", default=4, type=int, help="Batch size per GPU/CPU for training.") parser.add_argument("--per_gpu_eval_batch_size", default=4, type=int, help="Batch size per GPU/CPU for evaluation.") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument("--learning_rate", default=5e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument("--weight_decay", default=0.0, type=float, help="Weight deay if we apply some.") parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--max_grad_norm", default=1.0, type=float, help="Max gradient norm.") parser.add_argument("--num_train_epochs", default=1.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--max_steps", default=-1, type=int, help="If > 0: set total number of training steps to perform. Override num_train_epochs.") parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument('--logging_steps', type=int, default=50, help="Log every X updates steps.") parser.add_argument('--save_steps', type=int, default=50, help="Save checkpoint every X updates steps.") parser.add_argument("--eval_all_checkpoints", action='store_true', help="Evaluate all checkpoints starting with the same prefix as model_name_or_path ending and ending with step number") parser.add_argument("--no_cuda", action='store_true', help="Avoid using CUDA when available") parser.add_argument('--overwrite_output_dir', action='store_true', help="Overwrite the content of the output directory") parser.add_argument('--overwrite_cache', action='store_true', help="Overwrite the cached training and evaluation sets") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit (mixed) precision (through NVIDIA apex) instead of 32-bit") parser.add_argument('--fp16_opt_level', type=str, default='O1', help="For fp16: Apex AMP optimization level selected in ['O0', 'O1', 'O2', and 'O3']." "See details at https://nvidia.github.io/apex/amp.html") parser.add_argument("--local_rank", type=int, default=-1, help="For distributed training: local_rank") parser.add_argument('--server_ip', type=str, default='', help="For distant debugging.") parser.add_argument('--server_port', type=str, default='', help="For distant debugging.") args = parser.parse_args() if args.model_type in ["bert", "roberta"] and not args.mlm: raise ValueError("BERT and RoBERTa do not have LM heads but masked LM heads. They must be run using the --mlm " "flag (masked language modeling).") if args.eval_data_file is None and args.do_eval: raise ValueError("Cannot do evaluation without an evaluation data file. Either supply a file to --eval_data_file " "or remove the --do_eval argument.") if os.path.exists(args.output_dir) and os.listdir(args.output_dir) and args.do_train and not args.overwrite_output_dir: raise ValueError("Output directory ({}) already exists and is not empty. Use --overwrite_output_dir to overcome.".format(args.output_dir)) # Setup distant debugging if needed if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() # Setup CUDA, GPU & distributed training if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") args.n_gpu = torch.cuda.device_count() else: # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) torch.distributed.init_process_group(backend='nccl') args.n_gpu = 1 args.device = device # Setup logging logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO if args.local_rank in [-1, 0] else logging.WARN) logger.warning("Process rank: %s, device: %s, n_gpu: %s, distributed training: %s, 16-bits training: %s", args.local_rank, device, args.n_gpu, bool(args.local_rank != -1), args.fp16) # Set seed set_seed(args) # Load pretrained model and tokenizer if args.local_rank not in [-1, 0]: torch.distributed.barrier() # Barrier to make sure only the first process in distributed training download model & vocab config_class, model_class, tokenizer_class = MODEL_CLASSES[args.model_type] config = config_class.from_pretrained(args.config_name if args.config_name else args.model_name_or_path) tokenizer = tokenizer_class.from_pretrained(args.tokenizer_name if args.tokenizer_name else args.model_name_or_path, do_lower_case=args.do_lower_case) if args.block_size <= 0: args.block_size = tokenizer.max_len_single_sentence # Our input block size will be the max possible for the model args.block_size = min(args.block_size, tokenizer.max_len_single_sentence) model = model_class.from_pretrained(args.model_name_or_path, from_tf=bool('.ckpt' in args.model_name_or_path), config=config) model.to(args.device) if args.local_rank == 0: torch.distributed.barrier() # End of barrier to make sure only the first process in distributed training download model & vocab logger.info("Training/evaluation parameters %s", args) # Training if args.do_train: if args.local_rank not in [-1, 0]: torch.distributed.barrier() # Barrier to make sure only the first process in distributed training process the dataset, and the others will use the cache train_dataset = load_and_cache_examples(args, tokenizer, evaluate=False) if args.local_rank == 0: torch.distributed.barrier() global_step, tr_loss = train(args, train_dataset, model, tokenizer) logger.info(" global_step = %s, average loss = %s", global_step, tr_loss) # Saving best-practices: if you use save_pretrained for the model and tokenizer, you can reload them using from_pretrained() if args.do_train and (args.local_rank == -1 or torch.distributed.get_rank() == 0): # Create output directory if needed if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]: os.makedirs(args.output_dir) logger.info("Saving model checkpoint to %s", args.output_dir) # Save a trained model, configuration and tokenizer using `save_pretrained()`. # They can then be reloaded using `from_pretrained()` model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(args.output_dir) tokenizer.save_pretrained(args.output_dir) # Good practice: save your training arguments together with the trained model torch.save(args, os.path.join(args.output_dir, 'training_args.bin')) # Load a trained model and vocabulary that you have fine-tuned model = model_class.from_pretrained(args.output_dir) tokenizer = tokenizer_class.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) model.to(args.device) # Evaluation results = {} if args.do_eval and args.local_rank in [-1, 0]: checkpoints = [args.output_dir] if args.eval_all_checkpoints: checkpoints = list(os.path.dirname(c) for c in sorted(glob.glob(args.output_dir + '/**/' + WEIGHTS_NAME, recursive=True))) logging.getLogger("pytorch_transformers.modeling_utils").setLevel(logging.WARN) # Reduce logging logger.info("Evaluate the following checkpoints: %s", checkpoints) for checkpoint in checkpoints: global_step = checkpoint.split('-')[-1] if len(checkpoints) > 1 else "" model = model_class.from_pretrained(checkpoint) model.to(args.device) result = evaluate(args, model, tokenizer, prefix=global_step) result = dict((k + '_{}'.format(global_step), v) for k, v in result.items()) results.update(result) return results if __name__ == "__main__": main()
25,840
50.993964
165
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_squad.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Finetuning the library models for question-answering on SQuAD (Bert, XLM, XLNet).""" from __future__ import absolute_import, division, print_function import argparse import logging import os import random import glob import numpy as np import torch from torch.utils.data import (DataLoader, RandomSampler, SequentialSampler, TensorDataset) from torch.utils.data.distributed import DistributedSampler from tqdm import tqdm, trange from tensorboardX import SummaryWriter from pytorch_transformers import (WEIGHTS_NAME, BertConfig, BertForQuestionAnswering, BertTokenizer, XLMConfig, XLMForQuestionAnswering, XLMTokenizer, XLNetConfig, XLNetForQuestionAnswering, XLNetTokenizer) from pytorch_transformers import AdamW, WarmupLinearSchedule from utils_squad import (read_squad_examples, convert_examples_to_features, RawResult, write_predictions, RawResultExtended, write_predictions_extended) # The follwing import is the official SQuAD evaluation script (2.0). # You can remove it from the dependencies if you are using this script outside of the library # We've added it here for automated tests (see examples/test_examples.py file) from utils_squad_evaluate import EVAL_OPTS, main as evaluate_on_squad logger = logging.getLogger(__name__) ALL_MODELS = sum((tuple(conf.pretrained_config_archive_map.keys()) \ for conf in (BertConfig, XLNetConfig, XLMConfig)), ()) MODEL_CLASSES = { 'bert': (BertConfig, BertForQuestionAnswering, BertTokenizer), 'xlnet': (XLNetConfig, XLNetForQuestionAnswering, XLNetTokenizer), 'xlm': (XLMConfig, XLMForQuestionAnswering, XLMTokenizer), } def set_seed(args): random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if args.n_gpu > 0: torch.cuda.manual_seed_all(args.seed) def to_list(tensor): return tensor.detach().cpu().tolist() def train(args, train_dataset, model, tokenizer): """ Train the model """ if args.local_rank in [-1, 0]: tb_writer = SummaryWriter() args.train_batch_size = args.per_gpu_train_batch_size * max(1, args.n_gpu) train_sampler = RandomSampler(train_dataset) if args.local_rank == -1 else DistributedSampler(train_dataset) train_dataloader = DataLoader(train_dataset, sampler=train_sampler, batch_size=args.train_batch_size) if args.max_steps > 0: t_total = args.max_steps args.num_train_epochs = args.max_steps // (len(train_dataloader) // args.gradient_accumulation_steps) + 1 else: t_total = len(train_dataloader) // args.gradient_accumulation_steps * args.num_train_epochs # Prepare optimizer and schedule (linear warmup and decay) no_decay = ['bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in model.named_parameters() if not any(nd in n for nd in no_decay)], 'weight_decay': args.weight_decay}, {'params': [p for n, p in model.named_parameters() if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=t_total) if args.fp16: try: from apex import amp except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use fp16 training.") model, optimizer = amp.initialize(model, optimizer, opt_level=args.fp16_opt_level) # multi-gpu training (should be after apex fp16 initialization) if args.n_gpu > 1: model = torch.nn.DataParallel(model) # Distributed training (should be after apex fp16 initialization) if args.local_rank != -1: model = torch.nn.parallel.DistributedDataParallel(model, device_ids=[args.local_rank], output_device=args.local_rank, find_unused_parameters=True) # Train! logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_dataset)) logger.info(" Num Epochs = %d", args.num_train_epochs) logger.info(" Instantaneous batch size per GPU = %d", args.per_gpu_train_batch_size) logger.info(" Total train batch size (w. parallel, distributed & accumulation) = %d", args.train_batch_size * args.gradient_accumulation_steps * (torch.distributed.get_world_size() if args.local_rank != -1 else 1)) logger.info(" Gradient Accumulation steps = %d", args.gradient_accumulation_steps) logger.info(" Total optimization steps = %d", t_total) global_step = 0 tr_loss, logging_loss = 0.0, 0.0 model.zero_grad() train_iterator = trange(int(args.num_train_epochs), desc="Epoch", disable=args.local_rank not in [-1, 0]) set_seed(args) # Added here for reproductibility (even between python 2 and 3) for _ in train_iterator: epoch_iterator = tqdm(train_dataloader, desc="Iteration", disable=args.local_rank not in [-1, 0]) for step, batch in enumerate(epoch_iterator): model.train() batch = tuple(t.to(args.device) for t in batch) inputs = {'input_ids': batch[0], 'attention_mask': batch[1], 'token_type_ids': None if args.model_type == 'xlm' else batch[2], 'start_positions': batch[3], 'end_positions': batch[4]} if args.model_type in ['xlnet', 'xlm']: inputs.update({'cls_index': batch[5], 'p_mask': batch[6]}) outputs = model(**inputs) loss = outputs[0] # model outputs are always tuple in pytorch-transformers (see doc) if args.n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu parallel (not distributed) training if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: with amp.scale_loss(loss, optimizer) as scaled_loss: scaled_loss.backward() torch.nn.utils.clip_grad_norm_(amp.master_params(optimizer), args.max_grad_norm) else: loss.backward() torch.nn.utils.clip_grad_norm_(model.parameters(), args.max_grad_norm) tr_loss += loss.item() if (step + 1) % args.gradient_accumulation_steps == 0: optimizer.step() scheduler.step() # Update learning rate schedule model.zero_grad() global_step += 1 if args.local_rank in [-1, 0] and args.logging_steps > 0 and global_step % args.logging_steps == 0: # Log metrics if args.local_rank == -1 and args.evaluate_during_training: # Only evaluate when single GPU otherwise metrics may not average well results = evaluate(args, model, tokenizer) for key, value in results.items(): tb_writer.add_scalar('eval_{}'.format(key), value, global_step) tb_writer.add_scalar('lr', scheduler.get_lr()[0], global_step) tb_writer.add_scalar('loss', (tr_loss - logging_loss)/args.logging_steps, global_step) logging_loss = tr_loss if args.local_rank in [-1, 0] and args.save_steps > 0 and global_step % args.save_steps == 0: # Save model checkpoint output_dir = os.path.join(args.output_dir, 'checkpoint-{}'.format(global_step)) if not os.path.exists(output_dir): os.makedirs(output_dir) model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(output_dir) torch.save(args, os.path.join(output_dir, 'training_args.bin')) logger.info("Saving model checkpoint to %s", output_dir) if args.max_steps > 0 and global_step > args.max_steps: epoch_iterator.close() break if args.max_steps > 0 and global_step > args.max_steps: train_iterator.close() break if args.local_rank in [-1, 0]: tb_writer.close() return global_step, tr_loss / global_step def evaluate(args, model, tokenizer, prefix=""): dataset, examples, features = load_and_cache_examples(args, tokenizer, evaluate=True, output_examples=True) if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]: os.makedirs(args.output_dir) args.eval_batch_size = args.per_gpu_eval_batch_size * max(1, args.n_gpu) # Note that DistributedSampler samples randomly eval_sampler = SequentialSampler(dataset) if args.local_rank == -1 else DistributedSampler(dataset) eval_dataloader = DataLoader(dataset, sampler=eval_sampler, batch_size=args.eval_batch_size) # Eval! logger.info("***** Running evaluation {} *****".format(prefix)) logger.info(" Num examples = %d", len(dataset)) logger.info(" Batch size = %d", args.eval_batch_size) all_results = [] for batch in tqdm(eval_dataloader, desc="Evaluating"): model.eval() batch = tuple(t.to(args.device) for t in batch) with torch.no_grad(): inputs = {'input_ids': batch[0], 'attention_mask': batch[1], 'token_type_ids': None if args.model_type == 'xlm' else batch[2] # XLM don't use segment_ids } example_indices = batch[3] if args.model_type in ['xlnet', 'xlm']: inputs.update({'cls_index': batch[4], 'p_mask': batch[5]}) outputs = model(**inputs) for i, example_index in enumerate(example_indices): eval_feature = features[example_index.item()] unique_id = int(eval_feature.unique_id) if args.model_type in ['xlnet', 'xlm']: # XLNet uses a more complex post-processing procedure result = RawResultExtended(unique_id = unique_id, start_top_log_probs = to_list(outputs[0][i]), start_top_index = to_list(outputs[1][i]), end_top_log_probs = to_list(outputs[2][i]), end_top_index = to_list(outputs[3][i]), cls_logits = to_list(outputs[4][i])) else: result = RawResult(unique_id = unique_id, start_logits = to_list(outputs[0][i]), end_logits = to_list(outputs[1][i])) all_results.append(result) # Compute predictions output_prediction_file = os.path.join(args.output_dir, "predictions_{}.json".format(prefix)) output_nbest_file = os.path.join(args.output_dir, "nbest_predictions_{}.json".format(prefix)) if args.version_2_with_negative: output_null_log_odds_file = os.path.join(args.output_dir, "null_odds_{}.json".format(prefix)) else: output_null_log_odds_file = None if args.model_type in ['xlnet', 'xlm']: # XLNet uses a more complex post-processing procedure write_predictions_extended(examples, features, all_results, args.n_best_size, args.max_answer_length, output_prediction_file, output_nbest_file, output_null_log_odds_file, args.predict_file, model.config.start_n_top, model.config.end_n_top, args.version_2_with_negative, tokenizer, args.verbose_logging) else: write_predictions(examples, features, all_results, args.n_best_size, args.max_answer_length, args.do_lower_case, output_prediction_file, output_nbest_file, output_null_log_odds_file, args.verbose_logging, args.version_2_with_negative, args.null_score_diff_threshold) # Evaluate with the official SQuAD script evaluate_options = EVAL_OPTS(data_file=args.predict_file, pred_file=output_prediction_file, na_prob_file=output_null_log_odds_file) results = evaluate_on_squad(evaluate_options) return results def load_and_cache_examples(args, tokenizer, evaluate=False, output_examples=False): if args.local_rank not in [-1, 0] and not evaluate: torch.distributed.barrier() # Make sure only the first process in distributed training process the dataset, and the others will use the cache # Load data features from cache or dataset file input_file = args.predict_file if evaluate else args.train_file cached_features_file = os.path.join(os.path.dirname(input_file), 'cached_{}_{}_{}'.format( 'dev' if evaluate else 'train', list(filter(None, args.model_name_or_path.split('/'))).pop(), str(args.max_seq_length))) if os.path.exists(cached_features_file) and not args.overwrite_cache and not output_examples: logger.info("Loading features from cached file %s", cached_features_file) features = torch.load(cached_features_file) else: logger.info("Creating features from dataset file at %s", input_file) examples = read_squad_examples(input_file=input_file, is_training=not evaluate, version_2_with_negative=args.version_2_with_negative) features = convert_examples_to_features(examples=examples, tokenizer=tokenizer, max_seq_length=args.max_seq_length, doc_stride=args.doc_stride, max_query_length=args.max_query_length, is_training=not evaluate) if args.local_rank in [-1, 0]: logger.info("Saving features into cached file %s", cached_features_file) torch.save(features, cached_features_file) if args.local_rank == 0 and not evaluate: torch.distributed.barrier() # Make sure only the first process in distributed training process the dataset, and the others will use the cache # Convert to Tensors and build dataset all_input_ids = torch.tensor([f.input_ids for f in features], dtype=torch.long) all_input_mask = torch.tensor([f.input_mask for f in features], dtype=torch.long) all_segment_ids = torch.tensor([f.segment_ids for f in features], dtype=torch.long) all_cls_index = torch.tensor([f.cls_index for f in features], dtype=torch.long) all_p_mask = torch.tensor([f.p_mask for f in features], dtype=torch.float) if evaluate: all_example_index = torch.arange(all_input_ids.size(0), dtype=torch.long) dataset = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_example_index, all_cls_index, all_p_mask) else: all_start_positions = torch.tensor([f.start_position for f in features], dtype=torch.long) all_end_positions = torch.tensor([f.end_position for f in features], dtype=torch.long) dataset = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_start_positions, all_end_positions, all_cls_index, all_p_mask) if output_examples: return dataset, examples, features return dataset def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--train_file", default=None, type=str, required=True, help="SQuAD json for training. E.g., train-v1.1.json") parser.add_argument("--predict_file", default=None, type=str, required=True, help="SQuAD json for predictions. E.g., dev-v1.1.json or test-v1.1.json") parser.add_argument("--model_type", default=None, type=str, required=True, help="Model type selected in the list: " + ", ".join(MODEL_CLASSES.keys())) parser.add_argument("--model_name_or_path", default=None, type=str, required=True, help="Path to pre-trained model or shortcut name selected in the list: " + ", ".join(ALL_MODELS)) parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model checkpoints and predictions will be written.") ## Other parameters parser.add_argument("--config_name", default="", type=str, help="Pretrained config name or path if not the same as model_name") parser.add_argument("--tokenizer_name", default="", type=str, help="Pretrained tokenizer name or path if not the same as model_name") parser.add_argument("--cache_dir", default="", type=str, help="Where do you want to store the pre-trained models downloaded from s3") parser.add_argument('--version_2_with_negative', action='store_true', help='If true, the SQuAD examples contain some that do not have an answer.') parser.add_argument('--null_score_diff_threshold', type=float, default=0.0, help="If null_score - best_non_null is greater than the threshold predict null.") parser.add_argument("--max_seq_length", default=384, type=int, help="The maximum total input sequence length after WordPiece tokenization. Sequences " "longer than this will be truncated, and sequences shorter than this will be padded.") parser.add_argument("--doc_stride", default=128, type=int, help="When splitting up a long document into chunks, how much stride to take between chunks.") parser.add_argument("--max_query_length", default=64, type=int, help="The maximum number of tokens for the question. Questions longer than this will " "be truncated to this length.") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--evaluate_during_training", action='store_true', help="Rul evaluation during training at each logging step.") parser.add_argument("--do_lower_case", action='store_true', help="Set this flag if you are using an uncased model.") parser.add_argument("--per_gpu_train_batch_size", default=8, type=int, help="Batch size per GPU/CPU for training.") parser.add_argument("--per_gpu_eval_batch_size", default=8, type=int, help="Batch size per GPU/CPU for evaluation.") parser.add_argument("--learning_rate", default=5e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument("--weight_decay", default=0.0, type=float, help="Weight deay if we apply some.") parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--max_grad_norm", default=1.0, type=float, help="Max gradient norm.") parser.add_argument("--num_train_epochs", default=3.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--max_steps", default=-1, type=int, help="If > 0: set total number of training steps to perform. Override num_train_epochs.") parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument("--n_best_size", default=20, type=int, help="The total number of n-best predictions to generate in the nbest_predictions.json output file.") parser.add_argument("--max_answer_length", default=30, type=int, help="The maximum length of an answer that can be generated. This is needed because the start " "and end predictions are not conditioned on one another.") parser.add_argument("--verbose_logging", action='store_true', help="If true, all of the warnings related to data processing will be printed. " "A number of warnings are expected for a normal SQuAD evaluation.") parser.add_argument('--logging_steps', type=int, default=50, help="Log every X updates steps.") parser.add_argument('--save_steps', type=int, default=50, help="Save checkpoint every X updates steps.") parser.add_argument("--eval_all_checkpoints", action='store_true', help="Evaluate all checkpoints starting with the same prefix as model_name ending and ending with step number") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument('--overwrite_output_dir', action='store_true', help="Overwrite the content of the output directory") parser.add_argument('--overwrite_cache', action='store_true', help="Overwrite the cached training and evaluation sets") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit (mixed) precision (through NVIDIA apex) instead of 32-bit") parser.add_argument('--fp16_opt_level', type=str, default='O1', help="For fp16: Apex AMP optimization level selected in ['O0', 'O1', 'O2', and 'O3']." "See details at https://nvidia.github.io/apex/amp.html") parser.add_argument('--server_ip', type=str, default='', help="Can be used for distant debugging.") parser.add_argument('--server_port', type=str, default='', help="Can be used for distant debugging.") args = parser.parse_args() if os.path.exists(args.output_dir) and os.listdir(args.output_dir) and args.do_train and not args.overwrite_output_dir: raise ValueError("Output directory ({}) already exists and is not empty. Use --overwrite_output_dir to overcome.".format(args.output_dir)) # Setup distant debugging if needed if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() # Setup CUDA, GPU & distributed training if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") args.n_gpu = torch.cuda.device_count() else: # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) torch.distributed.init_process_group(backend='nccl') args.n_gpu = 1 args.device = device # Setup logging logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO if args.local_rank in [-1, 0] else logging.WARN) logger.warning("Process rank: %s, device: %s, n_gpu: %s, distributed training: %s, 16-bits training: %s", args.local_rank, device, args.n_gpu, bool(args.local_rank != -1), args.fp16) # Set seed set_seed(args) # Load pretrained model and tokenizer if args.local_rank not in [-1, 0]: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab args.model_type = args.model_type.lower() config_class, model_class, tokenizer_class = MODEL_CLASSES[args.model_type] config = config_class.from_pretrained(args.config_name if args.config_name else args.model_name_or_path) tokenizer = tokenizer_class.from_pretrained(args.tokenizer_name if args.tokenizer_name else args.model_name_or_path, do_lower_case=args.do_lower_case) model = model_class.from_pretrained(args.model_name_or_path, from_tf=bool('.ckpt' in args.model_name_or_path), config=config) if args.local_rank == 0: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab model.to(args.device) logger.info("Training/evaluation parameters %s", args) # Training if args.do_train: train_dataset = load_and_cache_examples(args, tokenizer, evaluate=False, output_examples=False) global_step, tr_loss = train(args, train_dataset, model, tokenizer) logger.info(" global_step = %s, average loss = %s", global_step, tr_loss) # Save the trained model and the tokenizer if args.do_train and (args.local_rank == -1 or torch.distributed.get_rank() == 0): # Create output directory if needed if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]: os.makedirs(args.output_dir) logger.info("Saving model checkpoint to %s", args.output_dir) # Save a trained model, configuration and tokenizer using `save_pretrained()`. # They can then be reloaded using `from_pretrained()` model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(args.output_dir) tokenizer.save_pretrained(args.output_dir) # Good practice: save your training arguments together with the trained model torch.save(args, os.path.join(args.output_dir, 'training_args.bin')) # Load a trained model and vocabulary that you have fine-tuned model = model_class.from_pretrained(args.output_dir) tokenizer = tokenizer_class.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) model.to(args.device) # Evaluation - we can ask to evaluate all the checkpoints (sub-directories) in a directory results = {} if args.do_eval and args.local_rank in [-1, 0]: checkpoints = [args.output_dir] if args.eval_all_checkpoints: checkpoints = list(os.path.dirname(c) for c in sorted(glob.glob(args.output_dir + '/**/' + WEIGHTS_NAME, recursive=True))) logging.getLogger("pytorch_transformers.modeling_utils").setLevel(logging.WARN) # Reduce model loading logs logger.info("Evaluate the following checkpoints: %s", checkpoints) for checkpoint in checkpoints: # Reload the model global_step = checkpoint.split('-')[-1] if len(checkpoints) > 1 else "" model = model_class.from_pretrained(checkpoint) model.to(args.device) # Evaluate result = evaluate(args, model, tokenizer, prefix=global_step) result = dict((k + ('_{}'.format(global_step) if global_step else ''), v) for k, v in result.items()) results.update(result) logger.info("Results: {}".format(results)) return results if __name__ == "__main__": main()
29,378
54.016854
154
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_classifier.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """BERT finetuning runner.""" from __future__ import absolute_import, division, print_function import argparse import csv import logging import os import random import sys import copy import numpy as np import torch from torch.utils.data import (DataLoader, RandomSampler, SequentialSampler, TensorDataset) from torch.utils.data.distributed import DistributedSampler from tqdm import tqdm, trange from torch.nn import CrossEntropyLoss, MSELoss from scipy.stats import pearsonr, spearmanr from sklearn.metrics import matthews_corrcoef, f1_score, precision_score, recall_score from pytorch_pretrained_bert.file_utils import PYTORCH_PRETRAINED_BERT_CACHE, WEIGHTS_NAME, CONFIG_NAME from pytorch_pretrained_bert.modeling import BertForSequenceClassification, BertConfig from pytorch_pretrained_bert.tokenization import BertTokenizer from pytorch_pretrained_bert.optimization import BertAdam, WarmupLinearSchedule from imap_qa import calc_map1,calc_mrr1,read_data logger = logging.getLogger(__name__) class InputExample(object): """A single training/test example for simple sequence classification.""" def __init__(self, guid, text_a, text_b=None, label=None): """Constructs a InputExample. Args: guid: Unique id for the example. text_a: string. The untokenized text of the first sequence. For single sequence tasks, only this sequence must be specified. text_b: (Optional) string. The untokenized text of the second sequence. Only must be specified for sequence pair tasks. label: (Optional) string. The label of the example. This should be specified for train and dev examples, but not for test examples. """ self.guid = guid self.text_a = text_a self.text_b = text_b self.label = label class InputFeatures(object): """A single set of features of data.""" def __init__(self, input_ids, input_mask, segment_ids, label_id): self.input_ids = input_ids self.input_mask = input_mask self.segment_ids = segment_ids self.label_id = label_id class DataProcessor(object): """Base class for data converters for sequence classification data sets.""" def get_train_examples(self, data_dir): """Gets a collection of `InputExample`s for the train set.""" raise NotImplementedError() def get_dev_examples(self, data_dir): """Gets a collection of `InputExample`s for the dev set.""" raise NotImplementedError() def get_labels(self): """Gets the list of labels for this data set.""" raise NotImplementedError() @classmethod def _read_tsv(cls, input_file, quotechar=None): """Reads a tab separated value file.""" with open(input_file, "r", encoding="utf-8") as f: reader = csv.reader(f, delimiter="\t", quotechar=quotechar) lines = [] for line in reader: if sys.version_info[0] == 2: line = list(unicode(cell, 'utf-8') for cell in line) lines.append(line) return lines class LrecMedicalConditionProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "train_medical_condition.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "test_medical_condition.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "Trec_test_not_aligned.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1", "2"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] label = line[1] examples.append( InputExample(guid=guid, text_a=text_a, label=label)) return examples class LrecMedicationProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "train_medication.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "test_medication.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "Trec_test_not_aligned.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1" ,"2"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] label = line[1] examples.append( InputExample(guid=guid, text_a=text_a, label=label)) return examples class TrecProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "Trec_train_not_aligned.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "Trec_valid_not_aligned.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "Trec_test_not_aligned.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class Semeval2016Processor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_train_2016.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_dev_2016.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_test_2016.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class Semeval2017Processor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_train_2017.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_dev_2017.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "semeval_test_2017.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class YahooProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "yahoo_train.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "yahoo_dev.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "yahoo_test.tsv")), "test") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class WikiProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "wikitrainnewline.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "wikidevnewline.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "wikitestnewline.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class MrpcProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "train.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "dev.tsv")), "dev") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[3] text_b = line[4] label = line[0] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples class LrecProcessor(DataProcessor): """Processor for the MRPC data set (GLUE version).""" def get_train_examples(self, data_dir): """See base class.""" logger.info("LOOKING AT {}".format(os.path.join(data_dir, "train.tsv"))) return self._create_examples( self._read_tsv(os.path.join(data_dir, "lrec_train.tsv")), "train") def get_dev_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "lrec_dev.tsv")), "dev") def get_test_examples(self, data_dir): """See base class.""" return self._create_examples( self._read_tsv(os.path.join(data_dir, "lrec_test.tsv")), "test") def get_labels(self): """See base class.""" return ["0", "1"] def _create_examples(self, lines, set_type): """Creates examples for the training and dev sets.""" examples = [] for (i, line) in enumerate(lines): if i == 0: continue guid = "%s-%s" % (set_type, i) text_a = line[0] text_b = line[1] label = line[2][0:1] examples.append( InputExample(guid=guid, text_a=text_a, text_b=text_b, label=label)) return examples def convert_examples_to_features(examples, label_list, max_seq_length, tokenizer, output_mode): """Loads a data file into a list of `InputBatch`s.""" label_map = {label : i for i, label in enumerate(label_list)} features = [] for (ex_index, example) in enumerate(examples): if ex_index % 10000 == 0: logger.info("Writing example %d of %d" % (ex_index, len(examples))) tokens_a = tokenizer.tokenize(example.text_a) tokens_b = None if example.text_b: tokens_b = tokenizer.tokenize(example.text_b) # Modifies `tokens_a` and `tokens_b` in place so that the total # length is less than the specified length. # Account for [CLS], [SEP], [SEP] with "- 3" _truncate_seq_pair(tokens_a, tokens_b, max_seq_length - 3) else: # Account for [CLS] and [SEP] with "- 2" if len(tokens_a) > max_seq_length - 2: tokens_a = tokens_a[:(max_seq_length - 2)] # The convention in BERT is: # (a) For sequence pairs: # tokens: [CLS] is this jack ##son ##ville ? [SEP] no it is not . [SEP] # type_ids: 0 0 0 0 0 0 0 0 1 1 1 1 1 1 # (b) For single sequences: # tokens: [CLS] the dog is hairy . [SEP] # type_ids: 0 0 0 0 0 0 0 # # Where "type_ids" are used to indicate whether this is the first # sequence or the second sequence. The embedding vectors for `type=0` and # `type=1` were learned during pre-training and are added to the wordpiece # embedding vector (and position vector). This is not *strictly* necessary # since the [SEP] token unambiguously separates the sequences, but it makes # it easier for the model to learn the concept of sequences. # # For classification tasks, the first vector (corresponding to [CLS]) is # used as as the "sentence vector". Note that this only makes sense because # the entire model is fine-tuned. tokens = ["[CLS]"] + tokens_a + ["[SEP]"] segment_ids = [0] * len(tokens) if tokens_b: tokens += tokens_b + ["[SEP]"] segment_ids += [1] * (len(tokens_b) + 1) input_ids = tokenizer.convert_tokens_to_ids(tokens) # The mask has 1 for real tokens and 0 for padding tokens. Only real # tokens are attended to. input_mask = [1] * len(input_ids) # Zero-pad up to the sequence length. padding = [0] * (max_seq_length - len(input_ids)) input_ids += padding input_mask += padding segment_ids += padding assert len(input_ids) == max_seq_length assert len(input_mask) == max_seq_length assert len(segment_ids) == max_seq_length if output_mode == "classification": label_id = label_map[example.label] elif output_mode == "regression": label_id = float(example.label) else: raise KeyError(output_mode) if ex_index < 5: logger.info("*** Example ***") logger.info("guid: %s" % (example.guid)) logger.info("tokens: %s" % " ".join( [str(x) for x in tokens])) logger.info("input_ids: %s" % " ".join([str(x) for x in input_ids])) logger.info("input_mask: %s" % " ".join([str(x) for x in input_mask])) logger.info( "segment_ids: %s" % " ".join([str(x) for x in segment_ids])) logger.info("label: %s (id = %d)" % (example.label, label_id)) features.append( InputFeatures(input_ids=input_ids, input_mask=input_mask, segment_ids=segment_ids, label_id=label_id)) return features def _truncate_seq_pair(tokens_a, tokens_b, max_length): """Truncates a sequence pair in place to the maximum length.""" # This is a simple heuristic which will always truncate the longer sequence # one token at a time. This makes more sense than truncating an equal percent # of tokens from each, since if one sequence is very short then each token # that's truncated likely contains more information than a longer sequence. while True: total_length = len(tokens_a) + len(tokens_b) if total_length <= max_length: break if len(tokens_a) > len(tokens_b): tokens_a.pop() else: tokens_b.pop() def simple_accuracy(preds, labels): return (preds == labels).mean() def acc_and_f1(preds, labels): acc = simple_accuracy(preds, labels) f1 = f1_score(y_true=labels, y_pred=preds) return { "acc": acc, "f1": f1, "acc_and_f1": (acc + f1) / 2, } def map_and_mrr(preds, labels, tf): map_val = calc_map1(tf,preds) mrr_val = calc_mrr1(tf,preds) return { "map_val": map_val, "mrr_val": mrr_val, } def pearson_and_spearman(preds, labels): pearson_corr = pearsonr(preds, labels)[0] spearman_corr = spearmanr(preds, labels)[0] return { "pearson": pearson_corr, "spearmanr": spearman_corr, "corr": (pearson_corr + spearman_corr) / 2, } def precision_recall_f1(preds, labels): precision = precision_score(preds, labels, average="weighted") recall = recall_score(preds, labels, average="weighted") f1 = f1_score(preds,labels, average="weighted") acc = simple_accuracy(preds,labels) return { "precision": precision , "recall": recall, "f1": f1, "acc" : acc, } def compute_metrics(task_name, preds, labels, type): assert len(preds) == len(labels) if task_name == "cola": return {"mcc": matthews_corrcoef(labels, preds)} elif task_name == "sst-2": return {"acc": simple_accuracy(preds, labels)} elif task_name == "mrpc": return acc_and_f1(preds, labels) elif task_name == "sts-b": return pearson_and_spearman(preds, labels) elif task_name == "qqp": return acc_and_f1(preds, labels) elif task_name == "mnli": return {"acc": simple_accuracy(preds, labels)} elif task_name == "mnli-mm": return {"acc": simple_accuracy(preds, labels)} elif task_name == "qnli": return {"acc": simple_accuracy(preds, labels)} elif task_name == "rte": return {"acc": simple_accuracy(preds, labels)} elif task_name == "wnli": return {"acc": simple_accuracy(preds, labels)} elif task_name == "trec": if(type=="test"): filename="/content/gdrive/My Drive/PyTorchBert/examples/Trec_test_not_aligned.txt" else: filename = "/content/gdrive/My Drive/PyTorchBert/examples/Trec_valid_not_aligned.txt" t_f=read_data(filename=filename) return map_and_mrr(preds, labels, t_f) elif task_name == "wiki": if type=="test": filename="/content/gdrive/My Drive/PyTorchBert/examples/wikitestnewline.txt" else: filename = "/content/gdrive/My Drive/PyTorchBert/examples/wikidevnewline.txt" t_f=read_data(filename=filename) return map_and_mrr(preds, labels, t_f) elif task_name == "yahoo": if type=="test": filename="/content/gdrive/My Drive/PyTorchBert/examples/yahoo_test.tsv" else: filename = "/content/gdrive/My Drive/PyTorchBert/examples/yahoo_dev.tsv" t_f=read_data(filename=filename) return map_and_mrr(preds, labels, t_f) elif task_name == "semeval2016": if type=="test": filename="/content/gdrive/My Drive/PyTorchBert/examples/semeval_test_2016.tsv" else: filename = "/content/gdrive/My Drive/PyTorchBert/examples/semeval_dev_2016.tsv" t_f=read_data(filename=filename) return map_and_mrr(preds, labels, t_f) elif task_name == "semeval2017": if type=="test": filename="/content/gdrive/My Drive/PyTorchBert/examples/semeval_test_2017.tsv" else: filename="/content/gdrive/My Drive/PyTorchBert/examples/semeval_dev_2017.tsv" t_f=read_data(filename=filename) return map_and_mrr(preds, labels, t_f) elif task_name == "lrecmc": return precision_recall_f1(preds,labels) elif task_name == "lrecm": return precision_recall_f1(preds,labels) elif task_name == "lrec": return {"acc": simple_accuracy(preds, labels)} else: raise KeyError(task_name) global_step = 0 def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--data_dir", default=None, type=str, required=True, help="The input data dir. Should contain the .tsv files (or other data files) for the task.") parser.add_argument("--bert_model", default=None, type=str, required=True, help="Bert pre-trained model selected in the list: bert-base-uncased, " "bert-large-uncased, bert-base-cased, bert-large-cased, bert-base-multilingual-uncased, " "bert-base-multilingual-cased, bert-base-chinese.") parser.add_argument("--task_name", default=None, type=str, required=True, help="The name of the task to train.") parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model predictions and checkpoints will be written.") ## Other parameters parser.add_argument("--cache_dir", default="", type=str, help="Where do you want to store the pre-trained models downloaded from s3") parser.add_argument("--max_seq_length", default=128, type=int, help="The maximum total input sequence length after WordPiece tokenization. \n" "Sequences longer than this will be truncated, and sequences shorter \n" "than this will be padded.") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--do_lower_case", action='store_true', help="Set this flag if you are using an uncased model.") parser.add_argument("--train_batch_size", default=32, type=int, help="Total batch size for training.") parser.add_argument("--eval_batch_size", default=8, type=int, help="Total batch size for eval.") parser.add_argument("--learning_rate", default=5e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument("--num_train_epochs", default=3.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--warmup_proportion", default=0.1, type=float, help="Proportion of training to perform linear learning rate warmup for. " "E.g., 0.1 = 10%% of training.") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit float precision instead of 32-bit") parser.add_argument('--loss_scale', type=float, default=0, help="Loss scaling to improve fp16 numeric stability. Only used when fp16 set to True.\n" "0 (default value): dynamic loss scaling.\n" "Positive power of 2: static loss scaling value.\n") parser.add_argument('--server_ip', type=str, default='', help="Can be used for distant debugging.") parser.add_argument('--server_port', type=str, default='', help="Can be used for distant debugging.") args = parser.parse_args() if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() processors = { "mrpc": MrpcProcessor, "yahoo": YahooProcessor, "semeval2016": Semeval2016Processor, "semeval2017": Semeval2017Processor, "trec":TrecProcessor, "wiki":WikiProcessor, "lrecmc":LrecMedicalConditionProcessor, "lrecm": LrecMedicationProcessor, "lrec": LrecProcessor } output_modes = { "mrpc": "classification", "trec": "classification", "semeval2016": "classification", "semeval2017": "classification", "wiki": "classification", "yahoo": "classification", "lrecmc": "classification", "lrecm": "classification", "lrec": "classification" } if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") n_gpu = torch.cuda.device_count() else: torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) n_gpu = 1 # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.distributed.init_process_group(backend='nccl') logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO if args.local_rank in [-1, 0] else logging.WARN) logger.info("device: {} n_gpu: {}, distributed training: {}, 16-bits training: {}".format( device, n_gpu, bool(args.local_rank != -1), args.fp16)) if args.gradient_accumulation_steps < 1: raise ValueError("Invalid gradient_accumulation_steps parameter: {}, should be >= 1".format( args.gradient_accumulation_steps)) args.train_batch_size = args.train_batch_size // args.gradient_accumulation_steps random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if n_gpu > 0: torch.cuda.manual_seed_all(args.seed) if not args.do_train and not args.do_eval: raise ValueError("At least one of `do_train` or `do_eval` must be True.") if os.path.exists(args.output_dir) and os.listdir(args.output_dir) and args.do_train: raise ValueError("Output directory ({}) already exists and is not empty.".format(args.output_dir)) if not os.path.exists(args.output_dir): os.makedirs(args.output_dir) task_name = args.task_name.lower() if task_name not in processors: raise ValueError("Task not found: %s" % (task_name)) processor = processors[task_name]() output_mode = output_modes[task_name] label_list = processor.get_labels() num_labels = len(label_list) tokenizer = BertTokenizer.from_pretrained(args.bert_model, do_lower_case=args.do_lower_case) train_examples = None num_train_optimization_steps = None if args.do_train: train_examples = processor.get_train_examples(args.data_dir) num_train_optimization_steps = int( len(train_examples) / args.train_batch_size / args.gradient_accumulation_steps) * args.num_train_epochs if args.local_rank != -1: num_train_optimization_steps = num_train_optimization_steps // torch.distributed.get_world_size() # Prepare model cache_dir = args.cache_dir if args.cache_dir else os.path.join(str(PYTORCH_PRETRAINED_BERT_CACHE), 'distributed_{}'.format(args.local_rank)) model = BertForSequenceClassification.from_pretrained(args.bert_model, cache_dir=cache_dir, num_labels=num_labels) if args.fp16: model.half() model.to(device) if args.local_rank != -1: try: from apex.parallel import DistributedDataParallel as DDP except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") model = DDP(model) elif n_gpu > 1: model = torch.nn.DataParallel(model) # Prepare optimizer param_optimizer = list(model.named_parameters()) no_decay = ['bias', 'LayerNorm.bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in param_optimizer if not any(nd in n for nd in no_decay)], 'weight_decay': 0.01}, {'params': [p for n, p in param_optimizer if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] if args.fp16: try: from apex.optimizers import FP16_Optimizer from apex.optimizers import FusedAdam except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") optimizer = FusedAdam(optimizer_grouped_parameters, lr=args.learning_rate, bias_correction=False, max_grad_norm=1.0) if args.loss_scale == 0: optimizer = FP16_Optimizer(optimizer, dynamic_loss_scale=True) else: optimizer = FP16_Optimizer(optimizer, static_loss_scale=args.loss_scale) warmup_linear = WarmupLinearSchedule(warmup=args.warmup_proportion, t_total=num_train_optimization_steps) else: optimizer = BertAdam(optimizer_grouped_parameters, lr=args.learning_rate, warmup=args.warmup_proportion, t_total=num_train_optimization_steps) nb_tr_steps = 0 tr_loss = 0 #if args.do_train: def save_train(model,tokenizer): # Save a trained model, configuration and tokenizer model_to_save = model.module if hasattr(model, 'module') else model # Only save the model it-self # If we save using the predefined names, we can load using `from_pretrained` output_model_file = os.path.join(args.output_dir, WEIGHTS_NAME) output_config_file = os.path.join(args.output_dir, CONFIG_NAME) torch.save(model_to_save.state_dict(), output_model_file) model_to_save.config.to_json_file(output_config_file) tokenizer.save_vocabulary(args.output_dir) # Load a trained model and vocabulary that you have fine-tuned model = BertForSequenceClassification.from_pretrained(args.output_dir, num_labels=num_labels) tokenizer = BertTokenizer.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) #else: # model = BertForSequenceClassification.from_pretrained(args.bert_model, num_labels=num_labels) #model.to(device) def model_evaluate(model,type): if(type=="dev"): eval_examples = processor.get_dev_examples(args.data_dir) elif(type=="test"): eval_examples = processor.get_test_examples(args.data_dir) eval_features = convert_examples_to_features( eval_examples, label_list, args.max_seq_length, tokenizer, output_mode) logger.info("***** Running evaluation *****") logger.info(" Num examples = %d", len(eval_examples)) logger.info(" Batch size = %d", args.eval_batch_size) all_input_ids = torch.tensor([f.input_ids for f in eval_features], dtype=torch.long) all_input_mask = torch.tensor([f.input_mask for f in eval_features], dtype=torch.long) all_segment_ids = torch.tensor([f.segment_ids for f in eval_features], dtype=torch.long) if output_mode == "classification": all_label_ids = torch.tensor([f.label_id for f in eval_features], dtype=torch.long) elif output_mode == "regression": all_label_ids = torch.tensor([f.label_id for f in eval_features], dtype=torch.float) eval_data = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_label_ids) # Run prediction for full data eval_sampler = SequentialSampler(eval_data) eval_dataloader = DataLoader(eval_data, sampler=eval_sampler, batch_size=args.eval_batch_size) model.eval() eval_loss = 0 nb_eval_steps = 0 preds = [] filename = open("logits.txt", "w+") for input_ids, input_mask, segment_ids, label_ids in tqdm(eval_dataloader, desc="Evaluating"): input_ids = input_ids.to(device) input_mask = input_mask.to(device) segment_ids = segment_ids.to(device) label_ids = label_ids.to(device) with torch.no_grad(): logits = model(input_ids, segment_ids, input_mask, labels=None) filename.write(str(logits)) # create eval loss and other metric required by the task if output_mode == "classification": loss_fct = CrossEntropyLoss() tmp_eval_loss = loss_fct(logits.view(-1, num_labels), label_ids.view(-1)) elif output_mode == "regression": loss_fct = MSELoss() tmp_eval_loss = loss_fct(logits.view(-1), label_ids.view(-1)) eval_loss += tmp_eval_loss.mean().item() nb_eval_steps += 1 if len(preds) == 0: preds.append(logits.detach().cpu().numpy()) else: preds[0] = np.append( preds[0], logits.detach().cpu().numpy(), axis=0) eval_loss = eval_loss / nb_eval_steps preds = preds[0] f1 = open("pred_result.txt", "w+") f2 = open("all_labels.txt", "w+") f3 = open("label_result.txt", "w+") f4 = open("my_pred_result.txt", "w+") for i in preds: f1.write(str(i) + "\n") for i in all_label_ids: f2.write(str(i) + "\n") if output_mode == "classification": preds2 = np.argmax(preds, axis=1) # axis=0 for value, axis=1 for index preds = preds[:, 1:] elif output_mode == "regression": preds = np.squeeze(preds) for i in preds2: f3.write(str(i) + "\n") for i in preds: f4.write(str(i) + "\n") result = compute_metrics(task_name, preds, all_label_ids.numpy(), type) loss = tr_loss / global_step if args.do_train else None result['eval_loss'] = eval_loss result['global_step'] = global_step result['loss'] = loss output_eval_file = os.path.join(args.output_dir, "eval_results.txt") with open(output_eval_file, "w") as writer: logger.info("***** Eval results *****") for key in sorted(result.keys()): logger.info(" %s = %s", key, str(result[key])) writer.write("%s = %s\n" % (key, str(result[key]))) return result['map_val'] def model_train(): global global_step max_val=0 train_features = convert_examples_to_features( train_examples, label_list, args.max_seq_length, tokenizer, output_mode) logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_examples)) logger.info(" Batch size = %d", args.train_batch_size) logger.info(" Num steps = %d", num_train_optimization_steps) all_input_ids = torch.tensor([f.input_ids for f in train_features], dtype=torch.long) all_input_mask = torch.tensor([f.input_mask for f in train_features], dtype=torch.long) all_segment_ids = torch.tensor([f.segment_ids for f in train_features], dtype=torch.long) if output_mode == "classification": all_label_ids = torch.tensor([f.label_id for f in train_features], dtype=torch.long) elif output_mode == "regression": all_label_ids = torch.tensor([f.label_id for f in train_features], dtype=torch.float) train_data = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_label_ids) if args.local_rank == -1: train_sampler = RandomSampler(train_data) else: train_sampler = DistributedSampler(train_data) train_dataloader = DataLoader(train_data, sampler=train_sampler, batch_size=args.train_batch_size) model.train() for _ in trange(int(args.num_train_epochs), desc="Epoch"): tr_loss = 0 nb_tr_examples, nb_tr_steps = 0, 0 for step, batch in enumerate(tqdm(train_dataloader, desc="Iteration")): batch = tuple(t.to(device) for t in batch) input_ids, input_mask, segment_ids, label_ids = batch # define a new function to compute loss values for both output_modes logits = model(input_ids, segment_ids, input_mask, labels=None) if output_mode == "classification": loss_fct = CrossEntropyLoss() loss = loss_fct(logits.view(-1, num_labels), label_ids.view(-1)) elif output_mode == "regression": loss_fct = MSELoss() loss = loss_fct(logits.view(-1), label_ids.view(-1)) if n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu. if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: optimizer.backward(loss) else: loss.backward() tr_loss += loss.item() nb_tr_examples += input_ids.size(0) nb_tr_steps += 1 if (step + 1) % args.gradient_accumulation_steps == 0: if args.fp16: # modify learning rate with special warm up BERT uses # if args.fp16 is False, BertAdam is used that handles this automatically lr_this_step = args.learning_rate * warmup_linear.get_lr(global_step/num_train_optimization_steps, args.warmup_proportion) for param_group in optimizer.param_groups: param_group['lr'] = lr_this_step optimizer.step() optimizer.zero_grad() global_step += 1 val_accuracy=model_evaluate(model,"dev") if (val_accuracy >= max_val): max_val = val_accuracy best_model = copy.deepcopy(model) save_train(best_model,tokenizer) return best_model # if args.do_train and (args.local_rank == -1 or torch.distributed.get_rank() == 0): # if args.do_eval and (args.local_rank == -1 or torch.distributed.get_rank() == 0): model=model_train() #model_evaluate(model,"dev") model_evaluate(model,"test") if __name__ == "__main__": main()
44,356
39.105787
144
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_glue.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Finetuning the library models for sequence classification on GLUE (Bert, XLM, XLNet, RoBERTa).""" from __future__ import absolute_import, division, print_function import argparse import glob import logging import os import random from imap_qa import calc_map1, calc_mrr1, read_data import numpy as np import torch from torch.utils.data import (DataLoader, RandomSampler, SequentialSampler, TensorDataset) from torch.utils.data.distributed import DistributedSampler from tensorboardX import SummaryWriter from tqdm import tqdm, trange from pytorch_transformers import (WEIGHTS_NAME, BertConfig, BertForSequenceClassification, BertTokenizer, RobertaConfig, RobertaForSequenceClassification, RobertaTokenizer, XLMConfig, XLMForSequenceClassification, XLMTokenizer, XLNetConfig, XLNetForSequenceClassification, XLNetTokenizer) from pytorch_transformers import AdamW, WarmupLinearSchedule from utils_glue import (compute_metrics, convert_examples_to_features, output_modes, processors) logger = logging.getLogger(__name__) ALL_MODELS = sum( (tuple(conf.pretrained_config_archive_map.keys()) for conf in (BertConfig, XLNetConfig, XLMConfig, RobertaConfig)), ()) MODEL_CLASSES = { 'bert': (BertConfig, BertForSequenceClassification, BertTokenizer), 'xlnet': (XLNetConfig, XLNetForSequenceClassification, XLNetTokenizer), 'xlm': (XLMConfig, XLMForSequenceClassification, XLMTokenizer), 'roberta': (RobertaConfig, RobertaForSequenceClassification, RobertaTokenizer), } def set_seed(args): random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if args.n_gpu > 0: torch.cuda.manual_seed_all(args.seed) def train(args, train_dataset, model, tokenizer): """ Train the model """ if args.local_rank in [-1, 0]: tb_writer = SummaryWriter() args.train_batch_size = args.per_gpu_train_batch_size * max(1, args.n_gpu) train_sampler = RandomSampler(train_dataset) if args.local_rank == -1 else DistributedSampler(train_dataset) train_dataloader = DataLoader(train_dataset, sampler=train_sampler, batch_size=args.train_batch_size) if args.max_steps > 0: t_total = args.max_steps args.num_train_epochs = args.max_steps // (len(train_dataloader) // args.gradient_accumulation_steps) + 1 else: t_total = len(train_dataloader) // args.gradient_accumulation_steps * args.num_train_epochs # Prepare optimizer and schedule (linear warmup and decay) no_decay = ['bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in model.named_parameters() if not any(nd in n for nd in no_decay)], 'weight_decay': args.weight_decay}, {'params': [p for n, p in model.named_parameters() if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=t_total) if args.fp16: try: from apex import amp except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use fp16 training.") model, optimizer = amp.initialize(model, optimizer, opt_level=args.fp16_opt_level) # multi-gpu training (should be after apex fp16 initialization) if args.n_gpu > 1: model = torch.nn.DataParallel(model) # Distributed training (should be after apex fp16 initialization) if args.local_rank != -1: model = torch.nn.parallel.DistributedDataParallel(model, device_ids=[args.local_rank], output_device=args.local_rank, find_unused_parameters=True) # Train! logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_dataset)) logger.info(" Num Epochs = %d", args.num_train_epochs) logger.info(" Instantaneous batch size per GPU = %d", args.per_gpu_train_batch_size) logger.info(" Total train batch size (w. parallel, distributed & accumulation) = %d", args.train_batch_size * args.gradient_accumulation_steps * ( torch.distributed.get_world_size() if args.local_rank != -1 else 1)) logger.info(" Gradient Accumulation steps = %d", args.gradient_accumulation_steps) logger.info(" Total optimization steps = %d", t_total) global_step = 0 tr_loss, logging_loss = 0.0, 0.0 model.zero_grad() train_iterator = trange(int(args.num_train_epochs), desc="Epoch", disable=args.local_rank not in [-1, 0]) set_seed(args) # Added here for reproductibility (even between python 2 and 3) for _ in train_iterator: epoch_iterator = tqdm(train_dataloader, desc="Iteration", disable=args.local_rank not in [-1, 0]) for step, batch in enumerate(epoch_iterator): model.train() batch = tuple(t.to(args.device) for t in batch) inputs = {'input_ids': batch[0], 'attention_mask': batch[1], 'token_type_ids': batch[2] if args.model_type in ['bert', 'xlnet'] else None, # XLM and RoBERTa don't use segment_ids 'labels': batch[3]} outputs = model(**inputs) loss = outputs[0] # model outputs are always tuple in pytorch-transformers (see doc) if args.n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu parallel training if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: with amp.scale_loss(loss, optimizer) as scaled_loss: scaled_loss.backward() torch.nn.utils.clip_grad_norm_(amp.master_params(optimizer), args.max_grad_norm) else: loss.backward() torch.nn.utils.clip_grad_norm_(model.parameters(), args.max_grad_norm) tr_loss += loss.item() if (step + 1) % args.gradient_accumulation_steps == 0: scheduler.step() # Update learning rate schedule optimizer.step() model.zero_grad() global_step += 1 if args.local_rank in [-1, 0] and args.logging_steps > 0 and global_step % args.logging_steps == 0: # Log metrics if args.local_rank == -1 and args.evaluate_during_training: # Only evaluate when single GPU otherwise metrics may not average well results = evaluate(args, model, tokenizer) for key, value in results.items(): tb_writer.add_scalar('eval_{}'.format(key), value, global_step) tb_writer.add_scalar('lr', scheduler.get_lr()[0], global_step) tb_writer.add_scalar('loss', (tr_loss - logging_loss) / args.logging_steps, global_step) logging_loss = tr_loss if args.local_rank in [-1, 0] and args.save_steps > 0 and global_step % args.save_steps == 0: # Save model checkpoint output_dir = os.path.join(args.output_dir, 'checkpoint-{}'.format(global_step)) if not os.path.exists(output_dir): os.makedirs(output_dir) model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(output_dir) torch.save(args, os.path.join(output_dir, 'training_args.bin')) logger.info("Saving model checkpoint to %s", output_dir) if args.max_steps > 0 and global_step > args.max_steps: epoch_iterator.close() break if args.max_steps > 0 and global_step > args.max_steps: train_iterator.close() break if args.local_rank in [-1, 0]: tb_writer.close() return global_step, tr_loss / global_step def evaluate(args, model, tokenizer, prefix=""): # Loop to handle MNLI double evaluation (matched, mis-matched) eval_task_names = ("mnli", "mnli-mm") if args.task_name == "mnli" else (args.task_name,) eval_outputs_dirs = (args.output_dir, args.output_dir + '-MM') if args.task_name == "mnli" else (args.output_dir,) results = {} for eval_task, eval_output_dir in zip(eval_task_names, eval_outputs_dirs): eval_dataset = load_and_cache_examples(args, eval_task, tokenizer, evaluate=True) if not os.path.exists(eval_output_dir) and args.local_rank in [-1, 0]: os.makedirs(eval_output_dir) args.eval_batch_size = args.per_gpu_eval_batch_size * max(1, args.n_gpu) # Note that DistributedSampler samples randomly eval_sampler = SequentialSampler(eval_dataset) if args.local_rank == -1 else DistributedSampler(eval_dataset) eval_dataloader = DataLoader(eval_dataset, sampler=eval_sampler, batch_size=args.eval_batch_size) # Eval! logger.info("***** Running evaluation {} *****".format(prefix)) logger.info(" Num examples = %d", len(eval_dataset)) logger.info(" Batch size = %d", args.eval_batch_size) eval_loss = 0.0 nb_eval_steps = 0 preds = None out_label_ids = None for batch in tqdm(eval_dataloader, desc="Evaluating"): model.eval() batch = tuple(t.to(args.device) for t in batch) with torch.no_grad(): inputs = {'input_ids': batch[0], 'attention_mask': batch[1], 'token_type_ids': batch[2] if args.model_type in ['bert', 'xlnet'] else None, # XLM and RoBERTa don't use segment_ids 'labels': batch[3]} outputs = model(**inputs) tmp_eval_loss, logits = outputs[:2] eval_loss += tmp_eval_loss.mean().item() nb_eval_steps += 1 if preds is None: preds = logits.detach().cpu().numpy() out_label_ids = inputs['labels'].detach().cpu().numpy() else: preds = np.append(preds, logits.detach().cpu().numpy(), axis=0) out_label_ids = np.append(out_label_ids, inputs['labels'].detach().cpu().numpy(), axis=0) eval_loss = eval_loss / nb_eval_steps if args.output_mode == "classification": # print(preds) f = open("out1.txt", "w+") for i in preds: f.write(str(i) + " \n") preds2 = preds[:, 1:] preds = np.argmax(preds, axis=1) ff = open("out2.txt", "w+") fff = open("out3.txt", "w+") ffff = open("out4.txt", "w+") for i in preds: ff.write(str(i) + " \n") for i in preds2: fff.write(str(i) + " \n") for i in out_label_ids: ffff.write(str(i) + "\n") # print(preds) # print(preds2) elif args.output_mode == "regression": preds = np.squeeze(preds) print(args.task_name) ''' result = compute_metrics(eval_task, preds, out_label_ids) results.update(result) output_eval_file = os.path.join(eval_output_dir, "eval_results.txt") with open(output_eval_file, "w") as writer: logger.info("***** Eval results {} *****".format(prefix)) for key in sorted(result.keys()): logger.info(" %s = %s", key, str(result[key])) writer.write("%s = %s\n" % (key, str(result[key]))) ''' return results, preds2 def load_and_cache_examples(args, task, tokenizer, evaluate=False): if args.local_rank not in [-1, 0] and not evaluate: torch.distributed.barrier() # Make sure only the first process in distributed training process the dataset, and the others will use the cache processor = processors[task]() output_mode = output_modes[task] # Load data features from cache or dataset file cached_features_file = os.path.join(args.data_dir, 'cached_{}_{}_{}_{}'.format( 'dev' if evaluate else 'train', list(filter(None, args.model_name_or_path.split('/'))).pop(), str(args.max_seq_length), str(task))) if os.path.exists(cached_features_file): logger.info("Loading features from cached file %s", cached_features_file) features = torch.load(cached_features_file) else: logger.info("Creating features from dataset file at %s", args.data_dir) label_list = processor.get_labels() if task in ['mnli', 'mnli-mm'] and args.model_type in ['roberta']: # HACK(label indices are swapped in RoBERTa pretrained model) label_list[1], label_list[2] = label_list[2], label_list[1] examples = processor.get_dev_examples(args.data_dir) if evaluate else processor.get_train_examples( args.data_dir) features = convert_examples_to_features(examples, label_list, args.max_seq_length, tokenizer, output_mode, cls_token_at_end=bool(args.model_type in ['xlnet']), # xlnet has a cls token at the end cls_token=tokenizer.cls_token, cls_token_segment_id=2 if args.model_type in ['xlnet'] else 0, sep_token=tokenizer.sep_token, sep_token_extra=bool(args.model_type in ['roberta']), # roberta uses an extra separator b/w pairs of sentences, cf. github.com/pytorch/fairseq/commit/1684e166e3da03f5b600dbb7855cb98ddfcd0805 pad_on_left=bool(args.model_type in ['xlnet']), # pad on the left for xlnet pad_token=tokenizer.convert_tokens_to_ids([tokenizer.pad_token])[0], pad_token_segment_id=4 if args.model_type in ['xlnet'] else 0, ) if args.local_rank in [-1, 0]: logger.info("Saving features into cached file %s", cached_features_file) torch.save(features, cached_features_file) if args.local_rank == 0 and not evaluate: torch.distributed.barrier() # Make sure only the first process in distributed training process the dataset, and the others will use the cache # Convert to Tensors and build dataset all_input_ids = torch.tensor([f.input_ids for f in features], dtype=torch.long) all_input_mask = torch.tensor([f.input_mask for f in features], dtype=torch.long) all_segment_ids = torch.tensor([f.segment_ids for f in features], dtype=torch.long) if output_mode == "classification": all_label_ids = torch.tensor([f.label_id for f in features], dtype=torch.long) elif output_mode == "regression": all_label_ids = torch.tensor([f.label_id for f in features], dtype=torch.float) dataset = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_label_ids) return dataset def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--data_dir", default=None, type=str, required=True, help="The input data dir. Should contain the .tsv files (or other data files) for the task.") parser.add_argument("--model_type", default=None, type=str, required=True, help="Model type selected in the list: " + ", ".join(MODEL_CLASSES.keys())) parser.add_argument("--model_name_or_path", default=None, type=str, required=True, help="Path to pre-trained model or shortcut name selected in the list: " + ", ".join( ALL_MODELS)) parser.add_argument("--task_name", default=None, type=str, required=True, help="The name of the task to train selected in the list: " + ", ".join(processors.keys())) parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model predictions and checkpoints will be written.") ## Other parameters parser.add_argument("--config_name", default="", type=str, help="Pretrained config name or path if not the same as model_name") parser.add_argument("--tokenizer_name", default="", type=str, help="Pretrained tokenizer name or path if not the same as model_name") parser.add_argument("--cache_dir", default="", type=str, help="Where do you want to store the pre-trained models downloaded from s3") parser.add_argument("--max_seq_length", default=128, type=int, help="The maximum total input sequence length after tokenization. Sequences longer " "than this will be truncated, sequences shorter will be padded.") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--evaluate_during_training", action='store_true', help="Rul evaluation during training at each logging step.") parser.add_argument("--do_lower_case", action='store_true', help="Set this flag if you are using an uncased model.") parser.add_argument("--per_gpu_train_batch_size", default=8, type=int, help="Batch size per GPU/CPU for training.") parser.add_argument("--per_gpu_eval_batch_size", default=8, type=int, help="Batch size per GPU/CPU for evaluation.") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument("--learning_rate", default=5e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument("--weight_decay", default=0.0, type=float, help="Weight deay if we apply some.") parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--max_grad_norm", default=1.0, type=float, help="Max gradient norm.") parser.add_argument("--num_train_epochs", default=3.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--max_steps", default=-1, type=int, help="If > 0: set total number of training steps to perform. Override num_train_epochs.") parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument('--logging_steps', type=int, default=50, help="Log every X updates steps.") parser.add_argument('--save_steps', type=int, default=50, help="Save checkpoint every X updates steps.") parser.add_argument("--eval_all_checkpoints", action='store_true', help="Evaluate all checkpoints starting with the same prefix as model_name ending and ending with step number") parser.add_argument("--no_cuda", action='store_true', help="Avoid using CUDA when available") parser.add_argument('--overwrite_output_dir', action='store_true', help="Overwrite the content of the output directory") parser.add_argument('--overwrite_cache', action='store_true', help="Overwrite the cached training and evaluation sets") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit (mixed) precision (through NVIDIA apex) instead of 32-bit") parser.add_argument('--fp16_opt_level', type=str, default='O1', help="For fp16: Apex AMP optimization level selected in ['O0', 'O1', 'O2', and 'O3']." "See details at https://nvidia.github.io/apex/amp.html") parser.add_argument("--local_rank", type=int, default=-1, help="For distributed training: local_rank") parser.add_argument('--server_ip', type=str, default='', help="For distant debugging.") parser.add_argument('--server_port', type=str, default='', help="For distant debugging.") args = parser.parse_args() if os.path.exists(args.output_dir) and os.listdir( args.output_dir) and args.do_train and not args.overwrite_output_dir: raise ValueError( "Output directory ({}) already exists and is not empty. Use --overwrite_output_dir to overcome.".format( args.output_dir)) # Setup distant debugging if needed if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() # Setup CUDA, GPU & distributed training if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") args.n_gpu = torch.cuda.device_count() else: # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) torch.distributed.init_process_group(backend='nccl') args.n_gpu = 1 args.device = device # Setup logging logging.basicConfig(format='%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt='%m/%d/%Y %H:%M:%S', level=logging.INFO if args.local_rank in [-1, 0] else logging.WARN) logger.warning("Process rank: %s, device: %s, n_gpu: %s, distributed training: %s, 16-bits training: %s", args.local_rank, device, args.n_gpu, bool(args.local_rank != -1), args.fp16) # Set seed set_seed(args) # Prepare GLUE task args.task_name = args.task_name.lower() if args.task_name not in processors: print(args.task_name) raise ValueError("Task not found: %s" % (args.task_name)) processor = processors[args.task_name]() args.output_mode = output_modes[args.task_name] label_list = processor.get_labels() num_labels = len(label_list) # Load pretrained model and tokenizer if args.local_rank not in [-1, 0]: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab args.model_type = args.model_type.lower() config_class, model_class, tokenizer_class = MODEL_CLASSES[args.model_type] config = config_class.from_pretrained(args.config_name if args.config_name else args.model_name_or_path, num_labels=num_labels, finetuning_task=args.task_name) tokenizer = tokenizer_class.from_pretrained(args.tokenizer_name if args.tokenizer_name else args.model_name_or_path, do_lower_case=args.do_lower_case) model = model_class.from_pretrained(args.model_name_or_path, from_tf=bool('.ckpt' in args.model_name_or_path), config=config) if args.local_rank == 0: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab model.to(args.device) logger.info("Training/evaluation parameters %s", args) # Training if args.do_train: train_dataset = load_and_cache_examples(args, args.task_name, tokenizer, evaluate=False) global_step, tr_loss = train(args, train_dataset, model, tokenizer) logger.info(" global_step = %s, average loss = %s", global_step, tr_loss) # Saving best-practices: if you use defaults names for the model, you can reload it using from_pretrained() if args.do_train and (args.local_rank == -1 or torch.distributed.get_rank() == 0): # Create output directory if needed if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]: os.makedirs(args.output_dir) logger.info("Saving model checkpoint to %s", args.output_dir) # Save a trained model, configuration and tokenizer using `save_pretrained()`. # They can then be reloaded using `from_pretrained()` model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(args.output_dir) tokenizer.save_pretrained(args.output_dir) # Good practice: save your training arguments together with the trained model torch.save(args, os.path.join(args.output_dir, 'training_args.bin')) # Load a trained model and vocabulary that you have fine-tuned model = model_class.from_pretrained(args.output_dir) tokenizer = tokenizer_class.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) model.to(args.device) # Evaluation results = {} preds = [] if args.do_eval and args.local_rank in [-1, 0]: tokenizer = tokenizer_class.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) checkpoints = [args.output_dir] if args.eval_all_checkpoints: checkpoints = list( os.path.dirname(c) for c in sorted(glob.glob(args.output_dir + '/**/' + WEIGHTS_NAME, recursive=True))) logging.getLogger("pytorch_transformers.modeling_utils").setLevel(logging.WARN) # Reduce logging logger.info("Evaluate the following checkpoints: %s", checkpoints) for checkpoint in checkpoints: global_step = checkpoint.split('-')[-1] if len(checkpoints) > 1 else "" model = model_class.from_pretrained(checkpoint) model.to(args.device) result, preds = evaluate(args, model, tokenizer, prefix=global_step) result = dict((k + '_{}'.format(global_step), v) for k, v in result.items()) results.update(result) evaluation_type="valid" #else test if(evaluation_type=="valid"): filename = args.data_dir+ "/" + args.task_name + "_valid.tsv" else: filename = args.data_dir + "/" + args.task_name + "_test.tsv" t_f = read_data(filename=filename) map_val = calc_map1(t_f, preds) mrr_val = calc_mrr1(t_f, preds) print("MAP: " + str(map_val)) print("MRR: " + str(mrr_val)) return results if __name__ == "__main__": main()
28,656
51.198543
184
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_bertology.py
#!/usr/bin/env python3 # Copyright 2018 CMU and The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Bertology: this script shows how you can explore the internals of the models in the library to: - compute the entropy of the head attentions - compute the importance of each head - prune (remove) the low importance head. Some parts of this script are adapted from the code of Michel et al. (http://arxiv.org/abs/1905.10650) which is available at https://github.com/pmichel31415/are-16-heads-really-better-than-1 """ import os import argparse import logging from datetime import timedelta, datetime from tqdm import tqdm import numpy as np import torch from torch.utils.data import DataLoader, SequentialSampler, TensorDataset, Subset from torch.utils.data.distributed import DistributedSampler from torch.nn import CrossEntropyLoss, MSELoss from pytorch_transformers import (WEIGHTS_NAME, BertConfig, BertForSequenceClassification, BertTokenizer, XLMConfig, XLMForSequenceClassification, XLMTokenizer, XLNetConfig, XLNetForSequenceClassification, XLNetTokenizer) from run_glue import set_seed, load_and_cache_examples, ALL_MODELS, MODEL_CLASSES from utils_glue import (compute_metrics, convert_examples_to_features, output_modes, processors) logger = logging.getLogger(__name__) def entropy(p): """ Compute the entropy of a probability distribution """ plogp = p * torch.log(p) plogp[p == 0] = 0 return -plogp.sum(dim=-1) def print_2d_tensor(tensor): """ Print a 2D tensor """ logger.info("lv, h >\t" + "\t".join(f"{x + 1}" for x in range(len(tensor)))) for row in range(len(tensor)): if tensor.dtype != torch.long: logger.info(f"layer {row + 1}:\t" + "\t".join(f"{x:.5f}" for x in tensor[row].cpu().data)) else: logger.info(f"layer {row + 1}:\t" + "\t".join(f"{x:d}" for x in tensor[row].cpu().data)) def compute_heads_importance(args, model, eval_dataloader, compute_entropy=True, compute_importance=True, head_mask=None): """ This method shows how to compute: - head attention entropy - head importance scores according to http://arxiv.org/abs/1905.10650 """ # Prepare our tensors n_layers, n_heads = model.bert.config.num_hidden_layers, model.bert.config.num_attention_heads head_importance = torch.zeros(n_layers, n_heads).to(args.device) attn_entropy = torch.zeros(n_layers, n_heads).to(args.device) if head_mask is None: head_mask = torch.ones(n_layers, n_heads).to(args.device) head_mask.requires_grad_(requires_grad=True) preds = None labels = None tot_tokens = 0.0 for step, batch in enumerate(tqdm(eval_dataloader, desc="Iteration", disable=args.local_rank not in [-1, 0])): batch = tuple(t.to(args.device) for t in batch) input_ids, input_mask, segment_ids, label_ids = batch # Do a forward pass (not with torch.no_grad() since we need gradients for importance score - see below) outputs = model(input_ids, token_type_ids=segment_ids, attention_mask=input_mask, labels=label_ids, head_mask=head_mask) loss, logits, all_attentions = outputs[0], outputs[1], outputs[-1] # Loss and logits are the first, attention the last loss.backward() # Backpropagate to populate the gradients in the head mask if compute_entropy: for layer, attn in enumerate(all_attentions): masked_entropy = entropy(attn.detach()) * input_mask.float().unsqueeze(1) attn_entropy[layer] += masked_entropy.sum(-1).sum(0).detach() if compute_importance: head_importance += head_mask.grad.abs().detach() # Also store our logits/labels if we want to compute metrics afterwards if preds is None: preds = logits.detach().cpu().numpy() labels = label_ids.detach().cpu().numpy() else: preds = np.append(preds, logits.detach().cpu().numpy(), axis=0) labels = np.append(labels, label_ids.detach().cpu().numpy(), axis=0) tot_tokens += input_mask.float().detach().sum().data # Normalize attn_entropy /= tot_tokens head_importance /= tot_tokens # Layerwise importance normalization if not args.dont_normalize_importance_by_layer: exponent = 2 norm_by_layer = torch.pow(torch.pow(head_importance, exponent).sum(-1), 1/exponent) head_importance /= norm_by_layer.unsqueeze(-1) + 1e-20 if not args.dont_normalize_global_importance: head_importance = (head_importance - head_importance.min()) / (head_importance.max() - head_importance.min()) # Print/save matrices np.save(os.path.join(args.output_dir, 'attn_entropy.npy'), attn_entropy.detach().cpu().numpy()) np.save(os.path.join(args.output_dir, 'head_importance.npy'), head_importance.detach().cpu().numpy()) logger.info("Attention entropies") print_2d_tensor(attn_entropy) logger.info("Head importance scores") print_2d_tensor(head_importance) logger.info("Head ranked by importance scores") head_ranks = torch.zeros(head_importance.numel(), dtype=torch.long, device=args.device) head_ranks[head_importance.view(-1).sort(descending=True)[1]] = torch.arange(head_importance.numel(), device=args.device) head_ranks = head_ranks.view_as(head_importance) print_2d_tensor(head_ranks) return attn_entropy, head_importance, preds, labels def mask_heads(args, model, eval_dataloader): """ This method shows how to mask head (set some heads to zero), to test the effect on the network, based on the head importance scores, as described in Michel et al. (http://arxiv.org/abs/1905.10650) """ _, head_importance, preds, labels = compute_heads_importance(args, model, eval_dataloader, compute_entropy=False) preds = np.argmax(preds, axis=1) if args.output_mode == "classification" else np.squeeze(preds) original_score = compute_metrics(args.task_name, preds, labels)[args.metric_name] logger.info("Pruning: original score: %f, threshold: %f", original_score, original_score * args.masking_threshold) new_head_mask = torch.ones_like(head_importance) num_to_mask = max(1, int(new_head_mask.numel() * args.masking_amount)) current_score = original_score while current_score >= original_score * args.masking_threshold: head_mask = new_head_mask.clone() # save current head mask # heads from least important to most - keep only not-masked heads head_importance[head_mask == 0.0] = float('Inf') current_heads_to_mask = head_importance.view(-1).sort()[1] if len(current_heads_to_mask) <= num_to_mask: break # mask heads current_heads_to_mask = current_heads_to_mask[:num_to_mask] logger.info("Heads to mask: %s", str(current_heads_to_mask.tolist())) new_head_mask = new_head_mask.view(-1) new_head_mask[current_heads_to_mask] = 0.0 new_head_mask = new_head_mask.view_as(head_mask) print_2d_tensor(new_head_mask) # Compute metric and head importance again _, head_importance, preds, labels = compute_heads_importance(args, model, eval_dataloader, compute_entropy=False, head_mask=new_head_mask) preds = np.argmax(preds, axis=1) if args.output_mode == "classification" else np.squeeze(preds) current_score = compute_metrics(args.task_name, preds, labels)[args.metric_name] logger.info("Masking: current score: %f, remaning heads %d (%.1f percents)", current_score, new_head_mask.sum(), new_head_mask.sum()/new_head_mask.numel() * 100) logger.info("Final head mask") print_2d_tensor(head_mask) np.save(os.path.join(args.output_dir, 'head_mask.npy'), head_mask.detach().cpu().numpy()) return head_mask def prune_heads(args, model, eval_dataloader, head_mask): """ This method shows how to prune head (remove heads weights) based on the head importance scores as described in Michel et al. (http://arxiv.org/abs/1905.10650) """ # Try pruning and test time speedup # Pruning is like masking but we actually remove the masked weights before_time = datetime.now() _, _, preds, labels = compute_heads_importance(args, model, eval_dataloader, compute_entropy=False, compute_importance=False, head_mask=head_mask) preds = np.argmax(preds, axis=1) if args.output_mode == "classification" else np.squeeze(preds) score_masking = compute_metrics(args.task_name, preds, labels)[args.metric_name] original_time = datetime.now() - before_time original_num_params = sum(p.numel() for p in model.parameters()) heads_to_prune = dict((layer, (1 - head_mask[layer].long()).nonzero().tolist()) for layer in range(len(head_mask))) assert sum(len(h) for h in heads_to_prune.values()) == (1 - head_mask.long()).sum().item() model.prune_heads(heads_to_prune) pruned_num_params = sum(p.numel() for p in model.parameters()) before_time = datetime.now() _, _, preds, labels = compute_heads_importance(args, model, eval_dataloader, compute_entropy=False, compute_importance=False, head_mask=None) preds = np.argmax(preds, axis=1) if args.output_mode == "classification" else np.squeeze(preds) score_pruning = compute_metrics(args.task_name, preds, labels)[args.metric_name] new_time = datetime.now() - before_time logger.info("Pruning: original num of params: %.2e, after pruning %.2e (%.1f percents)", original_num_params, pruned_num_params, pruned_num_params/original_num_params * 100) logger.info("Pruning: score with masking: %f score with pruning: %f", score_masking, score_pruning) logger.info("Pruning: speed ratio (new timing / original timing): %f percents", original_time/new_time * 100) def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--data_dir", default=None, type=str, required=True, help="The input data dir. Should contain the .tsv files (or other data files) for the task.") parser.add_argument("--model_name_or_path", default=None, type=str, required=True, help="Path to pre-trained model or shortcut name selected in the list: " + ", ".join( ALL_MODELS)) parser.add_argument("--task_name", default=None, type=str, required=True, help="The name of the task to train selected in the list: " + ", ".join(processors.keys())) parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model predictions and checkpoints will be written.") ## Other parameters parser.add_argument("--config_name", default="", type=str, help="Pretrained config name or path if not the same as model_name_or_path") parser.add_argument("--tokenizer_name", default="", type=str, help="Pretrained tokenizer name or path if not the same as model_name_or_path") parser.add_argument("--cache_dir", default="", type=str, help="Where do you want to store the pre-trained models downloaded from s3") parser.add_argument("--data_subset", type=int, default=-1, help="If > 0: limit the data to a subset of data_subset instances.") parser.add_argument("--overwrite_output_dir", action='store_true', help="Whether to overwrite data in output directory") parser.add_argument("--dont_normalize_importance_by_layer", action='store_true', help="Don't normalize importance score by layers") parser.add_argument("--dont_normalize_global_importance", action='store_true', help="Don't normalize all importance scores between 0 and 1") parser.add_argument("--try_masking", action='store_true', help="Whether to try to mask head until a threshold of accuracy.") parser.add_argument("--masking_threshold", default=0.9, type=float, help="masking threshold in term of metrics (stop masking when metric < threshold * original metric value).") parser.add_argument("--masking_amount", default=0.1, type=float, help="Amount to heads to masking at each masking step.") parser.add_argument("--metric_name", default="acc", type=str, help="Metric to use for head masking.") parser.add_argument("--max_seq_length", default=128, type=int, help="The maximum total input sequence length after WordPiece tokenization. \n" "Sequences longer than this will be truncated, sequences shorter padded.") parser.add_argument("--batch_size", default=1, type=int, help="Batch size.") parser.add_argument("--seed", type=int, default=42) parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument('--server_ip', type=str, default='', help="Can be used for distant debugging.") parser.add_argument('--server_port', type=str, default='', help="Can be used for distant debugging.") args = parser.parse_args() if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() # Setup devices and distributed training if args.local_rank == -1 or args.no_cuda: args.device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") args.n_gpu = torch.cuda.device_count() else: torch.cuda.set_device(args.local_rank) args.device = torch.device("cuda", args.local_rank) args.n_gpu = 1 torch.distributed.init_process_group(backend='nccl') # Initializes the distributed backend # Setup logging logging.basicConfig(level = logging.INFO if args.local_rank in [-1, 0] else logging.WARN) logger.info("device: {} n_gpu: {}, distributed: {}".format(args.device, args.n_gpu, bool(args.local_rank != -1))) # Set seeds set_seed(args) # Prepare GLUE task args.task_name = args.task_name.lower() if args.task_name not in processors: raise ValueError("Task not found: %s" % (args.task_name)) processor = processors[args.task_name]() args.output_mode = output_modes[args.task_name] label_list = processor.get_labels() num_labels = len(label_list) # Load pretrained model and tokenizer if args.local_rank not in [-1, 0]: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab args.model_type = "" for key in MODEL_CLASSES: if key in args.model_name_or_path.lower(): args.model_type = key # take the first match in model types break config_class, model_class, tokenizer_class = MODEL_CLASSES[args.model_type] config = config_class.from_pretrained(args.config_name if args.config_name else args.model_name_or_path, num_labels=num_labels, finetuning_task=args.task_name, output_attentions=True) tokenizer = tokenizer_class.from_pretrained(args.tokenizer_name if args.tokenizer_name else args.model_name_or_path) model = model_class.from_pretrained(args.model_name_or_path, from_tf=bool('.ckpt' in args.model_name_or_path), config=config) if args.local_rank == 0: torch.distributed.barrier() # Make sure only the first process in distributed training will download model & vocab # Distributed and parallel training model.to(args.device) if args.local_rank != -1: model = torch.nn.parallel.DistributedDataParallel(model, device_ids=[args.local_rank], output_device=args.local_rank, find_unused_parameters=True) elif args.n_gpu > 1: model = torch.nn.DataParallel(model) # Print/save training arguments torch.save(args, os.path.join(args.output_dir, 'run_args.bin')) logger.info("Training/evaluation parameters %s", args) # Prepare dataset for the GLUE task eval_data = load_and_cache_examples(args, args.task_name, tokenizer, evaluate=True) if args.data_subset > 0: eval_data = Subset(eval_data, list(range(min(args.data_subset, len(eval_data))))) eval_sampler = SequentialSampler(eval_data) if args.local_rank == -1 else DistributedSampler(eval_data) eval_dataloader = DataLoader(eval_data, sampler=eval_sampler, batch_size=args.batch_size) # Compute head entropy and importance score compute_heads_importance(args, model, eval_dataloader) # Try head masking (set heads to zero until the score goes under a threshole) # and head pruning (remove masked heads and see the effect on the network) if args.try_masking and args.masking_threshold > 0.0 and args.masking_threshold < 1.0: head_mask = mask_heads(args, model, eval_dataloader) prune_heads(args, model, eval_dataloader, head_mask) if __name__ == '__main__': main()
18,289
51.406877
177
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/run_generation.py
#!/usr/bin/env python3 # coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Conditional text generation with the auto-regressive models of the library (GPT/GPT-2/Transformer-XL/XLNet) """ from __future__ import absolute_import, division, print_function, unicode_literals import argparse import logging from tqdm import trange import torch import torch.nn.functional as F import numpy as np from pytorch_transformers import GPT2Config, OpenAIGPTConfig, XLNetConfig, TransfoXLConfig from pytorch_transformers import GPT2LMHeadModel, GPT2Tokenizer from pytorch_transformers import OpenAIGPTLMHeadModel, OpenAIGPTTokenizer from pytorch_transformers import XLNetLMHeadModel, XLNetTokenizer from pytorch_transformers import TransfoXLLMHeadModel, TransfoXLTokenizer logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO) logger = logging.getLogger(__name__) MAX_LENGTH = int(10000) # Hardcoded max length to avoid infinite loop ALL_MODELS = sum((tuple(conf.pretrained_config_archive_map.keys()) for conf in (GPT2Config, OpenAIGPTConfig, XLNetConfig, TransfoXLConfig)), ()) MODEL_CLASSES = { 'gpt2': (GPT2LMHeadModel, GPT2Tokenizer), 'openai-gpt': (OpenAIGPTLMHeadModel, OpenAIGPTTokenizer), 'xlnet': (XLNetLMHeadModel, XLNetTokenizer), 'transfo-xl': (TransfoXLLMHeadModel, TransfoXLTokenizer), } # Padding text to help Transformer-XL and XLNet with short prompts as proposed by Aman Rusia # in https://github.com/rusiaaman/XLNet-gen#methodology # and https://medium.com/@amanrusia/xlnet-speaks-comparison-to-gpt-2-ea1a4e9ba39e PADDING_TEXT = """ In 1991, the remains of Russian Tsar Nicholas II and his family (except for Alexei and Maria) are discovered. The voice of Nicholas's young son, Tsarevich Alexei Nikolaevich, narrates the remainder of the story. 1883 Western Siberia, a young Grigori Rasputin is asked by his father and a group of men to perform magic. Rasputin has a vision and denounces one of the men as a horse thief. Although his father initially slaps him for making such an accusation, Rasputin watches as the man is chased outside and beaten. Twenty years later, Rasputin sees a vision of the Virgin Mary, prompting him to become a priest. Rasputin quickly becomes famous, with people, even a bishop, begging for his blessing. <eod> </s> <eos>""" def set_seed(args): np.random.seed(args.seed) torch.manual_seed(args.seed) if args.n_gpu > 0: torch.cuda.manual_seed_all(args.seed) def top_k_top_p_filtering(logits, top_k=0, top_p=0.0, filter_value=-float('Inf')): """ Filter a distribution of logits using top-k and/or nucleus (top-p) filtering Args: logits: logits distribution shape (vocabulary size) top_k > 0: keep only top k tokens with highest probability (top-k filtering). top_p > 0.0: keep the top tokens with cumulative probability >= top_p (nucleus filtering). Nucleus filtering is described in Holtzman et al. (http://arxiv.org/abs/1904.09751) From: https://gist.github.com/thomwolf/1a5a29f6962089e871b94cbd09daf317 """ assert logits.dim() == 1 # batch size 1 for now - could be updated for more but the code would be less clear top_k = min(top_k, logits.size(-1)) # Safety check if top_k > 0: # Remove all tokens with a probability less than the last token of the top-k indices_to_remove = logits < torch.topk(logits, top_k)[0][..., -1, None] logits[indices_to_remove] = filter_value if top_p > 0.0: sorted_logits, sorted_indices = torch.sort(logits, descending=True) cumulative_probs = torch.cumsum(F.softmax(sorted_logits, dim=-1), dim=-1) # Remove tokens with cumulative probability above the threshold sorted_indices_to_remove = cumulative_probs > top_p # Shift the indices to the right to keep also the first token above the threshold sorted_indices_to_remove[..., 1:] = sorted_indices_to_remove[..., :-1].clone() sorted_indices_to_remove[..., 0] = 0 indices_to_remove = sorted_indices[sorted_indices_to_remove] logits[indices_to_remove] = filter_value return logits def sample_sequence(model, length, context, num_samples=1, temperature=1, top_k=0, top_p=0.0, is_xlnet=False, device='cpu'): context = torch.tensor(context, dtype=torch.long, device=device) context = context.unsqueeze(0).repeat(num_samples, 1) generated = context with torch.no_grad(): for _ in trange(length): inputs = {'input_ids': generated} if is_xlnet: # XLNet is a direct (predict same token, not next token) and bi-directional model by default # => need one additional dummy token in the input (will be masked), attention mask and target mapping (see model docstring) input_ids = torch.cat((generated, torch.zeros((1, 1), dtype=torch.long, device=device)), dim=1) perm_mask = torch.zeros((1, input_ids.shape[1], input_ids.shape[1]), dtype=torch.float, device=device) perm_mask[:, :, -1] = 1.0 # Previous tokens don't see last token target_mapping = torch.zeros((1, 1, input_ids.shape[1]), dtype=torch.float, device=device) target_mapping[0, 0, -1] = 1.0 # predict last token inputs = {'input_ids': input_ids, 'perm_mask': perm_mask, 'target_mapping': target_mapping} outputs = model(**inputs) # Note: we could also use 'past' with GPT-2/Transfo-XL/XLNet (cached hidden-states) next_token_logits = outputs[0][0, -1, :] / temperature filtered_logits = top_k_top_p_filtering(next_token_logits, top_k=top_k, top_p=top_p) next_token = torch.multinomial(F.softmax(filtered_logits, dim=-1), num_samples=1) generated = torch.cat((generated, next_token.unsqueeze(0)), dim=1) return generated def main(): parser = argparse.ArgumentParser() parser.add_argument("--model_type", default=None, type=str, required=True, help="Model type selected in the list: " + ", ".join(MODEL_CLASSES.keys())) parser.add_argument("--model_name_or_path", default=None, type=str, required=True, help="Path to pre-trained model or shortcut name selected in the list: " + ", ".join(ALL_MODELS)) parser.add_argument("--prompt", type=str, default="") parser.add_argument("--padding_text", type=str, default="") parser.add_argument("--length", type=int, default=20) parser.add_argument("--temperature", type=float, default=1.0) parser.add_argument("--top_k", type=int, default=0) parser.add_argument("--top_p", type=float, default=0.9) parser.add_argument("--no_cuda", action='store_true', help="Avoid using CUDA when available") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") args = parser.parse_args() args.device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") args.n_gpu = torch.cuda.device_count() set_seed(args) args.model_type = args.model_type.lower() model_class, tokenizer_class = MODEL_CLASSES[args.model_type] tokenizer = tokenizer_class.from_pretrained(args.model_name_or_path) model = model_class.from_pretrained(args.model_name_or_path) model.to(args.device) model.eval() if args.length < 0 and model.config.max_position_embeddings > 0: args.length = model.config.max_position_embeddings elif 0 < model.config.max_position_embeddings < args.length: args.length = model.config.max_position_embeddings # No generation bigger than model size elif args.length < 0: args.length = MAX_LENGTH # avoid infinite loop print(args) while True: raw_text = args.prompt if args.prompt else input("Model prompt >>> ") if args.model_type in ["transfo-xl", "xlnet"]: # Models with memory likes to have a long prompt for short inputs. raw_text = (args.padding_text if args.padding_text else PADDING_TEXT) + raw_text context_tokens = tokenizer.encode(raw_text) out = sample_sequence( model=model, context=context_tokens, length=args.length, temperature=args.temperature, top_k=args.top_k, top_p=args.top_p, device=args.device, is_xlnet=bool(args.model_type == "xlnet"), ) out = out[0, len(context_tokens):].tolist() text = tokenizer.decode(out, clean_up_tokenization_spaces=True) print(text) if args.prompt: break return text if __name__ == '__main__': main()
9,558
47.770408
144
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/utils_squad.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Load SQuAD dataset. """ from __future__ import absolute_import, division, print_function import json import logging import math import collections from io import open from pytorch_transformers.tokenization_bert import BasicTokenizer, whitespace_tokenize # Required by XLNet evaluation method to compute optimal threshold (see write_predictions_extended() method) from utils_squad_evaluate import find_all_best_thresh_v2, make_qid_to_has_ans, get_raw_scores logger = logging.getLogger(__name__) class SquadExample(object): """ A single training/test example for the Squad dataset. For examples without an answer, the start and end position are -1. """ def __init__(self, qas_id, question_text, doc_tokens, orig_answer_text=None, start_position=None, end_position=None, is_impossible=None): self.qas_id = qas_id self.question_text = question_text self.doc_tokens = doc_tokens self.orig_answer_text = orig_answer_text self.start_position = start_position self.end_position = end_position self.is_impossible = is_impossible def __str__(self): return self.__repr__() def __repr__(self): s = "" s += "qas_id: %s" % (self.qas_id) s += ", question_text: %s" % ( self.question_text) s += ", doc_tokens: [%s]" % (" ".join(self.doc_tokens)) if self.start_position: s += ", start_position: %d" % (self.start_position) if self.end_position: s += ", end_position: %d" % (self.end_position) if self.is_impossible: s += ", is_impossible: %r" % (self.is_impossible) return s class InputFeatures(object): """A single set of features of data.""" def __init__(self, unique_id, example_index, doc_span_index, tokens, token_to_orig_map, token_is_max_context, input_ids, input_mask, segment_ids, cls_index, p_mask, paragraph_len, start_position=None, end_position=None, is_impossible=None): self.unique_id = unique_id self.example_index = example_index self.doc_span_index = doc_span_index self.tokens = tokens self.token_to_orig_map = token_to_orig_map self.token_is_max_context = token_is_max_context self.input_ids = input_ids self.input_mask = input_mask self.segment_ids = segment_ids self.cls_index = cls_index self.p_mask = p_mask self.paragraph_len = paragraph_len self.start_position = start_position self.end_position = end_position self.is_impossible = is_impossible def read_squad_examples(input_file, is_training, version_2_with_negative): """Read a SQuAD json file into a list of SquadExample.""" with open(input_file, "r", encoding='utf-8') as reader: input_data = json.load(reader)["data"] def is_whitespace(c): if c == " " or c == "\t" or c == "\r" or c == "\n" or ord(c) == 0x202F: return True return False examples = [] for entry in input_data: for paragraph in entry["paragraphs"]: paragraph_text = paragraph["context"] doc_tokens = [] char_to_word_offset = [] prev_is_whitespace = True for c in paragraph_text: if is_whitespace(c): prev_is_whitespace = True else: if prev_is_whitespace: doc_tokens.append(c) else: doc_tokens[-1] += c prev_is_whitespace = False char_to_word_offset.append(len(doc_tokens) - 1) for qa in paragraph["qas"]: qas_id = qa["id"] question_text = qa["question"] start_position = None end_position = None orig_answer_text = None is_impossible = False if is_training: if version_2_with_negative: is_impossible = qa["is_impossible"] if (len(qa["answers"]) != 1) and (not is_impossible): raise ValueError( "For training, each question should have exactly 1 answer.") if not is_impossible: answer = qa["answers"][0] orig_answer_text = answer["text"] answer_offset = answer["answer_start"] answer_length = len(orig_answer_text) start_position = char_to_word_offset[answer_offset] end_position = char_to_word_offset[answer_offset + answer_length - 1] # Only add answers where the text can be exactly recovered from the # document. If this CAN'T happen it's likely due to weird Unicode # stuff so we will just skip the example. # # Note that this means for training mode, every example is NOT # guaranteed to be preserved. actual_text = " ".join(doc_tokens[start_position:(end_position + 1)]) cleaned_answer_text = " ".join( whitespace_tokenize(orig_answer_text)) if actual_text.find(cleaned_answer_text) == -1: logger.warning("Could not find answer: '%s' vs. '%s'", actual_text, cleaned_answer_text) continue else: start_position = -1 end_position = -1 orig_answer_text = "" example = SquadExample( qas_id=qas_id, question_text=question_text, doc_tokens=doc_tokens, orig_answer_text=orig_answer_text, start_position=start_position, end_position=end_position, is_impossible=is_impossible) examples.append(example) return examples def convert_examples_to_features(examples, tokenizer, max_seq_length, doc_stride, max_query_length, is_training, cls_token_at_end=False, cls_token='[CLS]', sep_token='[SEP]', pad_token=0, sequence_a_segment_id=0, sequence_b_segment_id=1, cls_token_segment_id=0, pad_token_segment_id=0, mask_padding_with_zero=True): """Loads a data file into a list of `InputBatch`s.""" unique_id = 1000000000 # cnt_pos, cnt_neg = 0, 0 # max_N, max_M = 1024, 1024 # f = np.zeros((max_N, max_M), dtype=np.float32) features = [] for (example_index, example) in enumerate(examples): # if example_index % 100 == 0: # logger.info('Converting %s/%s pos %s neg %s', example_index, len(examples), cnt_pos, cnt_neg) query_tokens = tokenizer.tokenize(example.question_text) if len(query_tokens) > max_query_length: query_tokens = query_tokens[0:max_query_length] tok_to_orig_index = [] orig_to_tok_index = [] all_doc_tokens = [] for (i, token) in enumerate(example.doc_tokens): orig_to_tok_index.append(len(all_doc_tokens)) sub_tokens = tokenizer.tokenize(token) for sub_token in sub_tokens: tok_to_orig_index.append(i) all_doc_tokens.append(sub_token) tok_start_position = None tok_end_position = None if is_training and example.is_impossible: tok_start_position = -1 tok_end_position = -1 if is_training and not example.is_impossible: tok_start_position = orig_to_tok_index[example.start_position] if example.end_position < len(example.doc_tokens) - 1: tok_end_position = orig_to_tok_index[example.end_position + 1] - 1 else: tok_end_position = len(all_doc_tokens) - 1 (tok_start_position, tok_end_position) = _improve_answer_span( all_doc_tokens, tok_start_position, tok_end_position, tokenizer, example.orig_answer_text) # The -3 accounts for [CLS], [SEP] and [SEP] max_tokens_for_doc = max_seq_length - len(query_tokens) - 3 # We can have documents that are longer than the maximum sequence length. # To deal with this we do a sliding window approach, where we take chunks # of the up to our max length with a stride of `doc_stride`. _DocSpan = collections.namedtuple( # pylint: disable=invalid-name "DocSpan", ["start", "length"]) doc_spans = [] start_offset = 0 while start_offset < len(all_doc_tokens): length = len(all_doc_tokens) - start_offset if length > max_tokens_for_doc: length = max_tokens_for_doc doc_spans.append(_DocSpan(start=start_offset, length=length)) if start_offset + length == len(all_doc_tokens): break start_offset += min(length, doc_stride) for (doc_span_index, doc_span) in enumerate(doc_spans): tokens = [] token_to_orig_map = {} token_is_max_context = {} segment_ids = [] # p_mask: mask with 1 for token than cannot be in the answer (0 for token which can be in an answer) # Original TF implem also keep the classification token (set to 0) (not sure why...) p_mask = [] # CLS token at the beginning if not cls_token_at_end: tokens.append(cls_token) segment_ids.append(cls_token_segment_id) p_mask.append(0) cls_index = 0 # Query for token in query_tokens: tokens.append(token) segment_ids.append(sequence_a_segment_id) p_mask.append(1) # SEP token tokens.append(sep_token) segment_ids.append(sequence_a_segment_id) p_mask.append(1) # Paragraph for i in range(doc_span.length): split_token_index = doc_span.start + i token_to_orig_map[len(tokens)] = tok_to_orig_index[split_token_index] is_max_context = _check_is_max_context(doc_spans, doc_span_index, split_token_index) token_is_max_context[len(tokens)] = is_max_context tokens.append(all_doc_tokens[split_token_index]) segment_ids.append(sequence_b_segment_id) p_mask.append(0) paragraph_len = doc_span.length # SEP token tokens.append(sep_token) segment_ids.append(sequence_b_segment_id) p_mask.append(1) # CLS token at the end if cls_token_at_end: tokens.append(cls_token) segment_ids.append(cls_token_segment_id) p_mask.append(0) cls_index = len(tokens) - 1 # Index of classification token input_ids = tokenizer.convert_tokens_to_ids(tokens) # The mask has 1 for real tokens and 0 for padding tokens. Only real # tokens are attended to. input_mask = [1 if mask_padding_with_zero else 0] * len(input_ids) # Zero-pad up to the sequence length. while len(input_ids) < max_seq_length: input_ids.append(pad_token) input_mask.append(0 if mask_padding_with_zero else 1) segment_ids.append(pad_token_segment_id) p_mask.append(1) assert len(input_ids) == max_seq_length assert len(input_mask) == max_seq_length assert len(segment_ids) == max_seq_length span_is_impossible = example.is_impossible start_position = None end_position = None if is_training and not span_is_impossible: # For training, if our document chunk does not contain an annotation # we throw it out, since there is nothing to predict. doc_start = doc_span.start doc_end = doc_span.start + doc_span.length - 1 out_of_span = False if not (tok_start_position >= doc_start and tok_end_position <= doc_end): out_of_span = True if out_of_span: start_position = 0 end_position = 0 span_is_impossible = True else: doc_offset = len(query_tokens) + 2 start_position = tok_start_position - doc_start + doc_offset end_position = tok_end_position - doc_start + doc_offset if is_training and span_is_impossible: start_position = cls_index end_position = cls_index if example_index < 20: logger.info("*** Example ***") logger.info("unique_id: %s" % (unique_id)) logger.info("example_index: %s" % (example_index)) logger.info("doc_span_index: %s" % (doc_span_index)) logger.info("tokens: %s" % " ".join(tokens)) logger.info("token_to_orig_map: %s" % " ".join([ "%d:%d" % (x, y) for (x, y) in token_to_orig_map.items()])) logger.info("token_is_max_context: %s" % " ".join([ "%d:%s" % (x, y) for (x, y) in token_is_max_context.items() ])) logger.info("input_ids: %s" % " ".join([str(x) for x in input_ids])) logger.info( "input_mask: %s" % " ".join([str(x) for x in input_mask])) logger.info( "segment_ids: %s" % " ".join([str(x) for x in segment_ids])) if is_training and span_is_impossible: logger.info("impossible example") if is_training and not span_is_impossible: answer_text = " ".join(tokens[start_position:(end_position + 1)]) logger.info("start_position: %d" % (start_position)) logger.info("end_position: %d" % (end_position)) logger.info( "answer: %s" % (answer_text)) features.append( InputFeatures( unique_id=unique_id, example_index=example_index, doc_span_index=doc_span_index, tokens=tokens, token_to_orig_map=token_to_orig_map, token_is_max_context=token_is_max_context, input_ids=input_ids, input_mask=input_mask, segment_ids=segment_ids, cls_index=cls_index, p_mask=p_mask, paragraph_len=paragraph_len, start_position=start_position, end_position=end_position, is_impossible=span_is_impossible)) unique_id += 1 return features def _improve_answer_span(doc_tokens, input_start, input_end, tokenizer, orig_answer_text): """Returns tokenized answer spans that better match the annotated answer.""" # The SQuAD annotations are character based. We first project them to # whitespace-tokenized words. But then after WordPiece tokenization, we can # often find a "better match". For example: # # Question: What year was John Smith born? # Context: The leader was John Smith (1895-1943). # Answer: 1895 # # The original whitespace-tokenized answer will be "(1895-1943).". However # after tokenization, our tokens will be "( 1895 - 1943 ) .". So we can match # the exact answer, 1895. # # However, this is not always possible. Consider the following: # # Question: What country is the top exporter of electornics? # Context: The Japanese electronics industry is the lagest in the world. # Answer: Japan # # In this case, the annotator chose "Japan" as a character sub-span of # the word "Japanese". Since our WordPiece tokenizer does not split # "Japanese", we just use "Japanese" as the annotation. This is fairly rare # in SQuAD, but does happen. tok_answer_text = " ".join(tokenizer.tokenize(orig_answer_text)) for new_start in range(input_start, input_end + 1): for new_end in range(input_end, new_start - 1, -1): text_span = " ".join(doc_tokens[new_start:(new_end + 1)]) if text_span == tok_answer_text: return (new_start, new_end) return (input_start, input_end) def _check_is_max_context(doc_spans, cur_span_index, position): """Check if this is the 'max context' doc span for the token.""" # Because of the sliding window approach taken to scoring documents, a single # token can appear in multiple documents. E.g. # Doc: the man went to the store and bought a gallon of milk # Span A: the man went to the # Span B: to the store and bought # Span C: and bought a gallon of # ... # # Now the word 'bought' will have two scores from spans B and C. We only # want to consider the score with "maximum context", which we define as # the *minimum* of its left and right context (the *sum* of left and # right context will always be the same, of course). # # In the example the maximum context for 'bought' would be span C since # it has 1 left context and 3 right context, while span B has 4 left context # and 0 right context. best_score = None best_span_index = None for (span_index, doc_span) in enumerate(doc_spans): end = doc_span.start + doc_span.length - 1 if position < doc_span.start: continue if position > end: continue num_left_context = position - doc_span.start num_right_context = end - position score = min(num_left_context, num_right_context) + 0.01 * doc_span.length if best_score is None or score > best_score: best_score = score best_span_index = span_index return cur_span_index == best_span_index RawResult = collections.namedtuple("RawResult", ["unique_id", "start_logits", "end_logits"]) def write_predictions(all_examples, all_features, all_results, n_best_size, max_answer_length, do_lower_case, output_prediction_file, output_nbest_file, output_null_log_odds_file, verbose_logging, version_2_with_negative, null_score_diff_threshold): """Write final predictions to the json file and log-odds of null if needed.""" logger.info("Writing predictions to: %s" % (output_prediction_file)) logger.info("Writing nbest to: %s" % (output_nbest_file)) example_index_to_features = collections.defaultdict(list) for feature in all_features: example_index_to_features[feature.example_index].append(feature) unique_id_to_result = {} for result in all_results: unique_id_to_result[result.unique_id] = result _PrelimPrediction = collections.namedtuple( # pylint: disable=invalid-name "PrelimPrediction", ["feature_index", "start_index", "end_index", "start_logit", "end_logit"]) all_predictions = collections.OrderedDict() all_nbest_json = collections.OrderedDict() scores_diff_json = collections.OrderedDict() for (example_index, example) in enumerate(all_examples): features = example_index_to_features[example_index] prelim_predictions = [] # keep track of the minimum score of null start+end of position 0 score_null = 1000000 # large and positive min_null_feature_index = 0 # the paragraph slice with min null score null_start_logit = 0 # the start logit at the slice with min null score null_end_logit = 0 # the end logit at the slice with min null score for (feature_index, feature) in enumerate(features): result = unique_id_to_result[feature.unique_id] start_indexes = _get_best_indexes(result.start_logits, n_best_size) end_indexes = _get_best_indexes(result.end_logits, n_best_size) # if we could have irrelevant answers, get the min score of irrelevant if version_2_with_negative: feature_null_score = result.start_logits[0] + result.end_logits[0] if feature_null_score < score_null: score_null = feature_null_score min_null_feature_index = feature_index null_start_logit = result.start_logits[0] null_end_logit = result.end_logits[0] for start_index in start_indexes: for end_index in end_indexes: # We could hypothetically create invalid predictions, e.g., predict # that the start of the span is in the question. We throw out all # invalid predictions. if start_index >= len(feature.tokens): continue if end_index >= len(feature.tokens): continue if start_index not in feature.token_to_orig_map: continue if end_index not in feature.token_to_orig_map: continue if not feature.token_is_max_context.get(start_index, False): continue if end_index < start_index: continue length = end_index - start_index + 1 if length > max_answer_length: continue prelim_predictions.append( _PrelimPrediction( feature_index=feature_index, start_index=start_index, end_index=end_index, start_logit=result.start_logits[start_index], end_logit=result.end_logits[end_index])) if version_2_with_negative: prelim_predictions.append( _PrelimPrediction( feature_index=min_null_feature_index, start_index=0, end_index=0, start_logit=null_start_logit, end_logit=null_end_logit)) prelim_predictions = sorted( prelim_predictions, key=lambda x: (x.start_logit + x.end_logit), reverse=True) _NbestPrediction = collections.namedtuple( # pylint: disable=invalid-name "NbestPrediction", ["text", "start_logit", "end_logit"]) seen_predictions = {} nbest = [] for pred in prelim_predictions: if len(nbest) >= n_best_size: break feature = features[pred.feature_index] if pred.start_index > 0: # this is a non-null prediction tok_tokens = feature.tokens[pred.start_index:(pred.end_index + 1)] orig_doc_start = feature.token_to_orig_map[pred.start_index] orig_doc_end = feature.token_to_orig_map[pred.end_index] orig_tokens = example.doc_tokens[orig_doc_start:(orig_doc_end + 1)] tok_text = " ".join(tok_tokens) # De-tokenize WordPieces that have been split off. tok_text = tok_text.replace(" ##", "") tok_text = tok_text.replace("##", "") # Clean whitespace tok_text = tok_text.strip() tok_text = " ".join(tok_text.split()) orig_text = " ".join(orig_tokens) final_text = get_final_text(tok_text, orig_text, do_lower_case, verbose_logging) if final_text in seen_predictions: continue seen_predictions[final_text] = True else: final_text = "" seen_predictions[final_text] = True nbest.append( _NbestPrediction( text=final_text, start_logit=pred.start_logit, end_logit=pred.end_logit)) # if we didn't include the empty option in the n-best, include it if version_2_with_negative: if "" not in seen_predictions: nbest.append( _NbestPrediction( text="", start_logit=null_start_logit, end_logit=null_end_logit)) # In very rare edge cases we could only have single null prediction. # So we just create a nonce prediction in this case to avoid failure. if len(nbest)==1: nbest.insert(0, _NbestPrediction(text="empty", start_logit=0.0, end_logit=0.0)) # In very rare edge cases we could have no valid predictions. So we # just create a nonce prediction in this case to avoid failure. if not nbest: nbest.append( _NbestPrediction(text="empty", start_logit=0.0, end_logit=0.0)) assert len(nbest) >= 1 total_scores = [] best_non_null_entry = None for entry in nbest: total_scores.append(entry.start_logit + entry.end_logit) if not best_non_null_entry: if entry.text: best_non_null_entry = entry probs = _compute_softmax(total_scores) nbest_json = [] for (i, entry) in enumerate(nbest): output = collections.OrderedDict() output["text"] = entry.text output["probability"] = probs[i] output["start_logit"] = entry.start_logit output["end_logit"] = entry.end_logit nbest_json.append(output) assert len(nbest_json) >= 1 if not version_2_with_negative: all_predictions[example.qas_id] = nbest_json[0]["text"] else: # predict "" iff the null score - the score of best non-null > threshold score_diff = score_null - best_non_null_entry.start_logit - ( best_non_null_entry.end_logit) scores_diff_json[example.qas_id] = score_diff if score_diff > null_score_diff_threshold: all_predictions[example.qas_id] = "" else: all_predictions[example.qas_id] = best_non_null_entry.text all_nbest_json[example.qas_id] = nbest_json with open(output_prediction_file, "w") as writer: writer.write(json.dumps(all_predictions, indent=4) + "\n") with open(output_nbest_file, "w") as writer: writer.write(json.dumps(all_nbest_json, indent=4) + "\n") if version_2_with_negative: with open(output_null_log_odds_file, "w") as writer: writer.write(json.dumps(scores_diff_json, indent=4) + "\n") return all_predictions # For XLNet (and XLM which uses the same head) RawResultExtended = collections.namedtuple("RawResultExtended", ["unique_id", "start_top_log_probs", "start_top_index", "end_top_log_probs", "end_top_index", "cls_logits"]) def write_predictions_extended(all_examples, all_features, all_results, n_best_size, max_answer_length, output_prediction_file, output_nbest_file, output_null_log_odds_file, orig_data_file, start_n_top, end_n_top, version_2_with_negative, tokenizer, verbose_logging): """ XLNet write prediction logic (more complex than Bert's). Write final predictions to the json file and log-odds of null if needed. Requires utils_squad_evaluate.py """ _PrelimPrediction = collections.namedtuple( # pylint: disable=invalid-name "PrelimPrediction", ["feature_index", "start_index", "end_index", "start_log_prob", "end_log_prob"]) _NbestPrediction = collections.namedtuple( # pylint: disable=invalid-name "NbestPrediction", ["text", "start_log_prob", "end_log_prob"]) logger.info("Writing predictions to: %s", output_prediction_file) # logger.info("Writing nbest to: %s" % (output_nbest_file)) example_index_to_features = collections.defaultdict(list) for feature in all_features: example_index_to_features[feature.example_index].append(feature) unique_id_to_result = {} for result in all_results: unique_id_to_result[result.unique_id] = result all_predictions = collections.OrderedDict() all_nbest_json = collections.OrderedDict() scores_diff_json = collections.OrderedDict() for (example_index, example) in enumerate(all_examples): features = example_index_to_features[example_index] prelim_predictions = [] # keep track of the minimum score of null start+end of position 0 score_null = 1000000 # large and positive for (feature_index, feature) in enumerate(features): result = unique_id_to_result[feature.unique_id] cur_null_score = result.cls_logits # if we could have irrelevant answers, get the min score of irrelevant score_null = min(score_null, cur_null_score) for i in range(start_n_top): for j in range(end_n_top): start_log_prob = result.start_top_log_probs[i] start_index = result.start_top_index[i] j_index = i * end_n_top + j end_log_prob = result.end_top_log_probs[j_index] end_index = result.end_top_index[j_index] # We could hypothetically create invalid predictions, e.g., predict # that the start of the span is in the question. We throw out all # invalid predictions. if start_index >= feature.paragraph_len - 1: continue if end_index >= feature.paragraph_len - 1: continue if not feature.token_is_max_context.get(start_index, False): continue if end_index < start_index: continue length = end_index - start_index + 1 if length > max_answer_length: continue prelim_predictions.append( _PrelimPrediction( feature_index=feature_index, start_index=start_index, end_index=end_index, start_log_prob=start_log_prob, end_log_prob=end_log_prob)) prelim_predictions = sorted( prelim_predictions, key=lambda x: (x.start_log_prob + x.end_log_prob), reverse=True) seen_predictions = {} nbest = [] for pred in prelim_predictions: if len(nbest) >= n_best_size: break feature = features[pred.feature_index] # XLNet un-tokenizer # Let's keep it simple for now and see if we need all this later. # # tok_start_to_orig_index = feature.tok_start_to_orig_index # tok_end_to_orig_index = feature.tok_end_to_orig_index # start_orig_pos = tok_start_to_orig_index[pred.start_index] # end_orig_pos = tok_end_to_orig_index[pred.end_index] # paragraph_text = example.paragraph_text # final_text = paragraph_text[start_orig_pos: end_orig_pos + 1].strip() # Previously used Bert untokenizer tok_tokens = feature.tokens[pred.start_index:(pred.end_index + 1)] orig_doc_start = feature.token_to_orig_map[pred.start_index] orig_doc_end = feature.token_to_orig_map[pred.end_index] orig_tokens = example.doc_tokens[orig_doc_start:(orig_doc_end + 1)] tok_text = tokenizer.convert_tokens_to_string(tok_tokens) # Clean whitespace tok_text = tok_text.strip() tok_text = " ".join(tok_text.split()) orig_text = " ".join(orig_tokens) final_text = get_final_text(tok_text, orig_text, tokenizer.do_lower_case, verbose_logging) if final_text in seen_predictions: continue seen_predictions[final_text] = True nbest.append( _NbestPrediction( text=final_text, start_log_prob=pred.start_log_prob, end_log_prob=pred.end_log_prob)) # In very rare edge cases we could have no valid predictions. So we # just create a nonce prediction in this case to avoid failure. if not nbest: nbest.append( _NbestPrediction(text="", start_log_prob=-1e6, end_log_prob=-1e6)) total_scores = [] best_non_null_entry = None for entry in nbest: total_scores.append(entry.start_log_prob + entry.end_log_prob) if not best_non_null_entry: best_non_null_entry = entry probs = _compute_softmax(total_scores) nbest_json = [] for (i, entry) in enumerate(nbest): output = collections.OrderedDict() output["text"] = entry.text output["probability"] = probs[i] output["start_log_prob"] = entry.start_log_prob output["end_log_prob"] = entry.end_log_prob nbest_json.append(output) assert len(nbest_json) >= 1 assert best_non_null_entry is not None score_diff = score_null scores_diff_json[example.qas_id] = score_diff # note(zhiliny): always predict best_non_null_entry # and the evaluation script will search for the best threshold all_predictions[example.qas_id] = best_non_null_entry.text all_nbest_json[example.qas_id] = nbest_json with open(output_prediction_file, "w") as writer: writer.write(json.dumps(all_predictions, indent=4) + "\n") with open(output_nbest_file, "w") as writer: writer.write(json.dumps(all_nbest_json, indent=4) + "\n") if version_2_with_negative: with open(output_null_log_odds_file, "w") as writer: writer.write(json.dumps(scores_diff_json, indent=4) + "\n") with open(orig_data_file, "r", encoding='utf-8') as reader: orig_data = json.load(reader)["data"] qid_to_has_ans = make_qid_to_has_ans(orig_data) has_ans_qids = [k for k, v in qid_to_has_ans.items() if v] no_ans_qids = [k for k, v in qid_to_has_ans.items() if not v] exact_raw, f1_raw = get_raw_scores(orig_data, all_predictions) out_eval = {} find_all_best_thresh_v2(out_eval, all_predictions, exact_raw, f1_raw, scores_diff_json, qid_to_has_ans) return out_eval def get_final_text(pred_text, orig_text, do_lower_case, verbose_logging=False): """Project the tokenized prediction back to the original text.""" # When we created the data, we kept track of the alignment between original # (whitespace tokenized) tokens and our WordPiece tokenized tokens. So # now `orig_text` contains the span of our original text corresponding to the # span that we predicted. # # However, `orig_text` may contain extra characters that we don't want in # our prediction. # # For example, let's say: # pred_text = steve smith # orig_text = Steve Smith's # # We don't want to return `orig_text` because it contains the extra "'s". # # We don't want to return `pred_text` because it's already been normalized # (the SQuAD eval script also does punctuation stripping/lower casing but # our tokenizer does additional normalization like stripping accent # characters). # # What we really want to return is "Steve Smith". # # Therefore, we have to apply a semi-complicated alignment heuristic between # `pred_text` and `orig_text` to get a character-to-character alignment. This # can fail in certain cases in which case we just return `orig_text`. def _strip_spaces(text): ns_chars = [] ns_to_s_map = collections.OrderedDict() for (i, c) in enumerate(text): if c == " ": continue ns_to_s_map[len(ns_chars)] = i ns_chars.append(c) ns_text = "".join(ns_chars) return (ns_text, ns_to_s_map) # We first tokenize `orig_text`, strip whitespace from the result # and `pred_text`, and check if they are the same length. If they are # NOT the same length, the heuristic has failed. If they are the same # length, we assume the characters are one-to-one aligned. tokenizer = BasicTokenizer(do_lower_case=do_lower_case) tok_text = " ".join(tokenizer.tokenize(orig_text)) start_position = tok_text.find(pred_text) if start_position == -1: if verbose_logging: logger.info( "Unable to find text: '%s' in '%s'" % (pred_text, orig_text)) return orig_text end_position = start_position + len(pred_text) - 1 (orig_ns_text, orig_ns_to_s_map) = _strip_spaces(orig_text) (tok_ns_text, tok_ns_to_s_map) = _strip_spaces(tok_text) if len(orig_ns_text) != len(tok_ns_text): if verbose_logging: logger.info("Length not equal after stripping spaces: '%s' vs '%s'", orig_ns_text, tok_ns_text) return orig_text # We then project the characters in `pred_text` back to `orig_text` using # the character-to-character alignment. tok_s_to_ns_map = {} for (i, tok_index) in tok_ns_to_s_map.items(): tok_s_to_ns_map[tok_index] = i orig_start_position = None if start_position in tok_s_to_ns_map: ns_start_position = tok_s_to_ns_map[start_position] if ns_start_position in orig_ns_to_s_map: orig_start_position = orig_ns_to_s_map[ns_start_position] if orig_start_position is None: if verbose_logging: logger.info("Couldn't map start position") return orig_text orig_end_position = None if end_position in tok_s_to_ns_map: ns_end_position = tok_s_to_ns_map[end_position] if ns_end_position in orig_ns_to_s_map: orig_end_position = orig_ns_to_s_map[ns_end_position] if orig_end_position is None: if verbose_logging: logger.info("Couldn't map end position") return orig_text output_text = orig_text[orig_start_position:(orig_end_position + 1)] return output_text def _get_best_indexes(logits, n_best_size): """Get the n-best logits from a list.""" index_and_score = sorted(enumerate(logits), key=lambda x: x[1], reverse=True) best_indexes = [] for i in range(len(index_and_score)): if i >= n_best_size: break best_indexes.append(index_and_score[i][0]) return best_indexes def _compute_softmax(scores): """Compute softmax probability over raw logits.""" if not scores: return [] max_score = None for score in scores: if max_score is None or score > max_score: max_score = score exp_scores = [] total_sum = 0.0 for score in scores: x = math.exp(score - max_score) exp_scores.append(x) total_sum += x probs = [] for score in exp_scores: probs.append(score / total_sum) return probs
41,529
40.654965
112
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/single_model_scripts/run_transfo_xl.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ PyTorch Transformer XL model evaluation script. Adapted from https://github.com/kimiyoung/transformer-xl. In particular https://github.com/kimiyoung/transformer-xl/blob/master/pytorch/eval.py This script with default values evaluates a pretrained Transformer-XL on WikiText 103 """ from __future__ import absolute_import, division, print_function, unicode_literals import argparse import logging import time import math import torch from pytorch_transformers import TransfoXLLMHeadModel, TransfoXLCorpus, TransfoXLTokenizer logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO) logger = logging.getLogger(__name__) def main(): parser = argparse.ArgumentParser(description='PyTorch Transformer Language Model') parser.add_argument('--model_name', type=str, default='transfo-xl-wt103', help='pretrained model name') parser.add_argument('--split', type=str, default='test', choices=['all', 'valid', 'test'], help='which split to evaluate') parser.add_argument('--batch_size', type=int, default=10, help='batch size') parser.add_argument('--tgt_len', type=int, default=128, help='number of tokens to predict') parser.add_argument('--ext_len', type=int, default=0, help='length of the extended context') parser.add_argument('--mem_len', type=int, default=1600, help='length of the retained previous heads') parser.add_argument('--clamp_len', type=int, default=1000, help='max positional embedding index') parser.add_argument('--no_cuda', action='store_true', help='Do not use CUDA even though CUA is available') parser.add_argument('--work_dir', type=str, required=True, help='path to the work_dir') parser.add_argument('--no_log', action='store_true', help='do not log the eval result') parser.add_argument('--same_length', action='store_true', help='set same length attention with masking') parser.add_argument('--server_ip', type=str, default='', help="Can be used for distant debugging.") parser.add_argument('--server_port', type=str, default='', help="Can be used for distant debugging.") args = parser.parse_args() assert args.ext_len >= 0, 'extended context length must be non-negative' if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") logger.info("device: {}".format(device)) # Load a pre-processed dataset # You can also build the corpus yourself using TransfoXLCorpus methods # The pre-processing involve computing word frequencies to prepare the Adaptive input and SoftMax # and tokenizing the dataset # The pre-processed corpus is a convertion (using the conversion script ) tokenizer = TransfoXLTokenizer.from_pretrained(args.model_name) corpus = TransfoXLCorpus.from_pretrained(args.model_name) ntokens = len(corpus.vocab) va_iter = corpus.get_iterator('valid', args.batch_size, args.tgt_len, device=device, ext_len=args.ext_len) te_iter = corpus.get_iterator('test', args.batch_size, args.tgt_len, device=device, ext_len=args.ext_len) # Load a pre-trained model model = TransfoXLLMHeadModel.from_pretrained(args.model_name) model = model.to(device) logger.info('Evaluating with bsz {} tgt_len {} ext_len {} mem_len {} clamp_len {}'.format( args.batch_size, args.tgt_len, args.ext_len, args.mem_len, args.clamp_len)) model.reset_length(args.tgt_len, args.ext_len, args.mem_len) if args.clamp_len > 0: model.clamp_len = args.clamp_len if args.same_length: model.same_length = True ############################################################################### # Evaluation code ############################################################################### def evaluate(eval_iter): # Turn on evaluation mode which disables dropout. model.eval() total_len, total_loss = 0, 0. start_time = time.time() with torch.no_grad(): mems = None for idx, (data, target, seq_len) in enumerate(eval_iter): ret = model(data, target, mems) loss, _, mems = ret loss = loss.mean() total_loss += seq_len * loss.item() total_len += seq_len total_time = time.time() - start_time logger.info('Time : {:.2f}s, {:.2f}ms/segment'.format( total_time, 1000 * total_time / (idx+1))) return total_loss / total_len # Run on test data. if args.split == 'all': test_loss = evaluate(te_iter) valid_loss = evaluate(va_iter) elif args.split == 'valid': valid_loss = evaluate(va_iter) test_loss = None elif args.split == 'test': test_loss = evaluate(te_iter) valid_loss = None def format_log(loss, split): log_str = '| {0} loss {1:5.2f} | {0} ppl {2:9.3f} '.format( split, loss, math.exp(loss)) return log_str log_str = '' if valid_loss is not None: log_str += format_log(valid_loss, 'valid') if test_loss is not None: log_str += format_log(test_loss, 'test') logger.info('=' * 100) logger.info(log_str) logger.info('=' * 100) if __name__ == '__main__': main()
6,735
42.74026
111
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/single_model_scripts/run_swag.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """BERT finetuning runner.""" from __future__ import absolute_import import argparse import csv import logging import os import random import sys from io import open import numpy as np import torch from torch.utils.data import (DataLoader, RandomSampler, SequentialSampler, TensorDataset) from torch.utils.data.distributed import DistributedSampler from tqdm import tqdm, trange from pytorch_transformers.file_utils import PYTORCH_PRETRAINED_BERT_CACHE, WEIGHTS_NAME, CONFIG_NAME from pytorch_transformers.modeling_bert import BertForMultipleChoice, BertConfig from pytorch_transformers.optimization import AdamW, WarmupLinearSchedule from pytorch_transformers.tokenization_bert import BertTokenizer logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO) logger = logging.getLogger(__name__) class SwagExample(object): """A single training/test example for the SWAG dataset.""" def __init__(self, swag_id, context_sentence, start_ending, ending_0, ending_1, ending_2, ending_3, label = None): self.swag_id = swag_id self.context_sentence = context_sentence self.start_ending = start_ending self.endings = [ ending_0, ending_1, ending_2, ending_3, ] self.label = label def __str__(self): return self.__repr__() def __repr__(self): l = [ "swag_id: {}".format(self.swag_id), "context_sentence: {}".format(self.context_sentence), "start_ending: {}".format(self.start_ending), "ending_0: {}".format(self.endings[0]), "ending_1: {}".format(self.endings[1]), "ending_2: {}".format(self.endings[2]), "ending_3: {}".format(self.endings[3]), ] if self.label is not None: l.append("label: {}".format(self.label)) return ", ".join(l) class InputFeatures(object): def __init__(self, example_id, choices_features, label ): self.example_id = example_id self.choices_features = [ { 'input_ids': input_ids, 'input_mask': input_mask, 'segment_ids': segment_ids } for _, input_ids, input_mask, segment_ids in choices_features ] self.label = label def read_swag_examples(input_file, is_training): with open(input_file, 'r', encoding='utf-8') as f: reader = csv.reader(f) lines = [] for line in reader: if sys.version_info[0] == 2: line = list(unicode(cell, 'utf-8') for cell in line) lines.append(line) if is_training and lines[0][-1] != 'label': raise ValueError( "For training, the input file must contain a label column." ) examples = [ SwagExample( swag_id = line[2], context_sentence = line[4], start_ending = line[5], # in the swag dataset, the # common beginning of each # choice is stored in "sent2". ending_0 = line[7], ending_1 = line[8], ending_2 = line[9], ending_3 = line[10], label = int(line[11]) if is_training else None ) for line in lines[1:] # we skip the line with the column names ] return examples def convert_examples_to_features(examples, tokenizer, max_seq_length, is_training): """Loads a data file into a list of `InputBatch`s.""" # Swag is a multiple choice task. To perform this task using Bert, # we will use the formatting proposed in "Improving Language # Understanding by Generative Pre-Training" and suggested by # @jacobdevlin-google in this issue # https://github.com/google-research/bert/issues/38. # # Each choice will correspond to a sample on which we run the # inference. For a given Swag example, we will create the 4 # following inputs: # - [CLS] context [SEP] choice_1 [SEP] # - [CLS] context [SEP] choice_2 [SEP] # - [CLS] context [SEP] choice_3 [SEP] # - [CLS] context [SEP] choice_4 [SEP] # The model will output a single value for each input. To get the # final decision of the model, we will run a softmax over these 4 # outputs. features = [] for example_index, example in enumerate(examples): context_tokens = tokenizer.tokenize(example.context_sentence) start_ending_tokens = tokenizer.tokenize(example.start_ending) choices_features = [] for ending_index, ending in enumerate(example.endings): # We create a copy of the context tokens in order to be # able to shrink it according to ending_tokens context_tokens_choice = context_tokens[:] ending_tokens = start_ending_tokens + tokenizer.tokenize(ending) # Modifies `context_tokens_choice` and `ending_tokens` in # place so that the total length is less than the # specified length. Account for [CLS], [SEP], [SEP] with # "- 3" _truncate_seq_pair(context_tokens_choice, ending_tokens, max_seq_length - 3) tokens = ["[CLS]"] + context_tokens_choice + ["[SEP]"] + ending_tokens + ["[SEP]"] segment_ids = [0] * (len(context_tokens_choice) + 2) + [1] * (len(ending_tokens) + 1) input_ids = tokenizer.convert_tokens_to_ids(tokens) input_mask = [1] * len(input_ids) # Zero-pad up to the sequence length. padding = [0] * (max_seq_length - len(input_ids)) input_ids += padding input_mask += padding segment_ids += padding assert len(input_ids) == max_seq_length assert len(input_mask) == max_seq_length assert len(segment_ids) == max_seq_length choices_features.append((tokens, input_ids, input_mask, segment_ids)) label = example.label if example_index < 5: logger.info("*** Example ***") logger.info("swag_id: {}".format(example.swag_id)) for choice_idx, (tokens, input_ids, input_mask, segment_ids) in enumerate(choices_features): logger.info("choice: {}".format(choice_idx)) logger.info("tokens: {}".format(' '.join(tokens))) logger.info("input_ids: {}".format(' '.join(map(str, input_ids)))) logger.info("input_mask: {}".format(' '.join(map(str, input_mask)))) logger.info("segment_ids: {}".format(' '.join(map(str, segment_ids)))) if is_training: logger.info("label: {}".format(label)) features.append( InputFeatures( example_id = example.swag_id, choices_features = choices_features, label = label ) ) return features def _truncate_seq_pair(tokens_a, tokens_b, max_length): """Truncates a sequence pair in place to the maximum length.""" # This is a simple heuristic which will always truncate the longer sequence # one token at a time. This makes more sense than truncating an equal percent # of tokens from each, since if one sequence is very short then each token # that's truncated likely contains more information than a longer sequence. while True: total_length = len(tokens_a) + len(tokens_b) if total_length <= max_length: break if len(tokens_a) > len(tokens_b): tokens_a.pop() else: tokens_b.pop() def accuracy(out, labels): outputs = np.argmax(out, axis=1) return np.sum(outputs == labels) def select_field(features, field): return [ [ choice[field] for choice in feature.choices_features ] for feature in features ] def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--data_dir", default=None, type=str, required=True, help="The input data dir. Should contain the .csv files (or other data files) for the task.") parser.add_argument("--bert_model", default=None, type=str, required=True, help="Bert pre-trained model selected in the list: bert-base-uncased, " "bert-large-uncased, bert-base-cased, bert-large-cased, bert-base-multilingual-uncased, " "bert-base-multilingual-cased, bert-base-chinese.") parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model checkpoints will be written.") ## Other parameters parser.add_argument("--max_seq_length", default=128, type=int, help="The maximum total input sequence length after WordPiece tokenization. \n" "Sequences longer than this will be truncated, and sequences shorter \n" "than this will be padded.") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--do_lower_case", action='store_true', help="Set this flag if you are using an uncased model.") parser.add_argument("--train_batch_size", default=32, type=int, help="Total batch size for training.") parser.add_argument("--eval_batch_size", default=8, type=int, help="Total batch size for eval.") parser.add_argument("--learning_rate", default=5e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument("--num_train_epochs", default=3.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--warmup_proportion", default=0.1, type=float, help="Proportion of training to perform linear learning rate warmup for. " "E.g., 0.1 = 10%% of training.") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit float precision instead of 32-bit") parser.add_argument('--loss_scale', type=float, default=0, help="Loss scaling to improve fp16 numeric stability. Only used when fp16 set to True.\n" "0 (default value): dynamic loss scaling.\n" "Positive power of 2: static loss scaling value.\n") args = parser.parse_args() if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") n_gpu = torch.cuda.device_count() else: torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) n_gpu = 1 # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.distributed.init_process_group(backend='nccl') logger.info("device: {} n_gpu: {}, distributed training: {}, 16-bits training: {}".format( device, n_gpu, bool(args.local_rank != -1), args.fp16)) if args.gradient_accumulation_steps < 1: raise ValueError("Invalid gradient_accumulation_steps parameter: {}, should be >= 1".format( args.gradient_accumulation_steps)) args.train_batch_size = args.train_batch_size // args.gradient_accumulation_steps random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if n_gpu > 0: torch.cuda.manual_seed_all(args.seed) if not args.do_train and not args.do_eval: raise ValueError("At least one of `do_train` or `do_eval` must be True.") if os.path.exists(args.output_dir) and os.listdir(args.output_dir): raise ValueError("Output directory ({}) already exists and is not empty.".format(args.output_dir)) if not os.path.exists(args.output_dir): os.makedirs(args.output_dir) tokenizer = BertTokenizer.from_pretrained(args.bert_model, do_lower_case=args.do_lower_case) # Prepare model model = BertForMultipleChoice.from_pretrained(args.bert_model, cache_dir=os.path.join(str(PYTORCH_PRETRAINED_BERT_CACHE), 'distributed_{}'.format(args.local_rank)), num_choices=4) if args.fp16: model.half() model.to(device) if args.local_rank != -1: try: from apex.parallel import DistributedDataParallel as DDP except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") model = DDP(model) elif n_gpu > 1: model = torch.nn.DataParallel(model) if args.do_train: # Prepare data loader train_examples = read_swag_examples(os.path.join(args.data_dir, 'train.csv'), is_training = True) train_features = convert_examples_to_features( train_examples, tokenizer, args.max_seq_length, True) all_input_ids = torch.tensor(select_field(train_features, 'input_ids'), dtype=torch.long) all_input_mask = torch.tensor(select_field(train_features, 'input_mask'), dtype=torch.long) all_segment_ids = torch.tensor(select_field(train_features, 'segment_ids'), dtype=torch.long) all_label = torch.tensor([f.label for f in train_features], dtype=torch.long) train_data = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_label) if args.local_rank == -1: train_sampler = RandomSampler(train_data) else: train_sampler = DistributedSampler(train_data) train_dataloader = DataLoader(train_data, sampler=train_sampler, batch_size=args.train_batch_size) num_train_optimization_steps = len(train_dataloader) // args.gradient_accumulation_steps * args.num_train_epochs if args.local_rank != -1: num_train_optimization_steps = num_train_optimization_steps // torch.distributed.get_world_size() # Prepare optimizer param_optimizer = list(model.named_parameters()) # hack to remove pooler, which is not used # thus it produce None grad that break apex param_optimizer = [n for n in param_optimizer] no_decay = ['bias', 'LayerNorm.bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in param_optimizer if not any(nd in n for nd in no_decay)], 'weight_decay': 0.01}, {'params': [p for n, p in param_optimizer if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] if args.fp16: try: from apex.optimizers import FP16_Optimizer from apex.optimizers import FusedAdam except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") optimizer = FusedAdam(optimizer_grouped_parameters, lr=args.learning_rate, bias_correction=False, max_grad_norm=1.0) if args.loss_scale == 0: optimizer = FP16_Optimizer(optimizer, dynamic_loss_scale=True) else: optimizer = FP16_Optimizer(optimizer, static_loss_scale=args.loss_scale) warmup_linear = WarmupLinearSchedule(warmup=args.warmup_proportion, t_total=num_train_optimization_steps) else: optimizer = BertAdam(optimizer_grouped_parameters, lr=args.learning_rate, warmup=args.warmup_proportion, t_total=num_train_optimization_steps) global_step = 0 logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_examples)) logger.info(" Batch size = %d", args.train_batch_size) logger.info(" Num steps = %d", num_train_optimization_steps) model.train() for _ in trange(int(args.num_train_epochs), desc="Epoch"): tr_loss = 0 nb_tr_examples, nb_tr_steps = 0, 0 for step, batch in enumerate(tqdm(train_dataloader, desc="Iteration")): batch = tuple(t.to(device) for t in batch) input_ids, input_mask, segment_ids, label_ids = batch loss = model(input_ids, segment_ids, input_mask, label_ids) if n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu. if args.fp16 and args.loss_scale != 1.0: # rescale loss for fp16 training # see https://docs.nvidia.com/deeplearning/sdk/mixed-precision-training/index.html loss = loss * args.loss_scale if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps tr_loss += loss.item() nb_tr_examples += input_ids.size(0) nb_tr_steps += 1 if args.fp16: optimizer.backward(loss) else: loss.backward() if (step + 1) % args.gradient_accumulation_steps == 0: if args.fp16: # modify learning rate with special warm up BERT uses # if args.fp16 is False, BertAdam is used that handles this automatically lr_this_step = args.learning_rate * warmup_linear.get_lr(global_step, args.warmup_proportion) for param_group in optimizer.param_groups: param_group['lr'] = lr_this_step optimizer.step() optimizer.zero_grad() global_step += 1 if args.do_train: # Save a trained model, configuration and tokenizer model_to_save = model.module if hasattr(model, 'module') else model # Only save the model it-self # If we save using the predefined names, we can load using `from_pretrained` output_model_file = os.path.join(args.output_dir, WEIGHTS_NAME) output_config_file = os.path.join(args.output_dir, CONFIG_NAME) torch.save(model_to_save.state_dict(), output_model_file) model_to_save.config.to_json_file(output_config_file) tokenizer.save_vocabulary(args.output_dir) # Load a trained model and vocabulary that you have fine-tuned model = BertForMultipleChoice.from_pretrained(args.output_dir, num_choices=4) tokenizer = BertTokenizer.from_pretrained(args.output_dir, do_lower_case=args.do_lower_case) else: model = BertForMultipleChoice.from_pretrained(args.bert_model, num_choices=4) model.to(device) if args.do_eval and (args.local_rank == -1 or torch.distributed.get_rank() == 0): eval_examples = read_swag_examples(os.path.join(args.data_dir, 'val.csv'), is_training = True) eval_features = convert_examples_to_features( eval_examples, tokenizer, args.max_seq_length, True) logger.info("***** Running evaluation *****") logger.info(" Num examples = %d", len(eval_examples)) logger.info(" Batch size = %d", args.eval_batch_size) all_input_ids = torch.tensor(select_field(eval_features, 'input_ids'), dtype=torch.long) all_input_mask = torch.tensor(select_field(eval_features, 'input_mask'), dtype=torch.long) all_segment_ids = torch.tensor(select_field(eval_features, 'segment_ids'), dtype=torch.long) all_label = torch.tensor([f.label for f in eval_features], dtype=torch.long) eval_data = TensorDataset(all_input_ids, all_input_mask, all_segment_ids, all_label) # Run prediction for full data eval_sampler = SequentialSampler(eval_data) eval_dataloader = DataLoader(eval_data, sampler=eval_sampler, batch_size=args.eval_batch_size) model.eval() eval_loss, eval_accuracy = 0, 0 nb_eval_steps, nb_eval_examples = 0, 0 for input_ids, input_mask, segment_ids, label_ids in tqdm(eval_dataloader, desc="Evaluating"): input_ids = input_ids.to(device) input_mask = input_mask.to(device) segment_ids = segment_ids.to(device) label_ids = label_ids.to(device) with torch.no_grad(): tmp_eval_loss = model(input_ids, segment_ids, input_mask, label_ids) logits = model(input_ids, segment_ids, input_mask) logits = logits.detach().cpu().numpy() label_ids = label_ids.to('cpu').numpy() tmp_eval_accuracy = accuracy(logits, label_ids) eval_loss += tmp_eval_loss.mean().item() eval_accuracy += tmp_eval_accuracy nb_eval_examples += input_ids.size(0) nb_eval_steps += 1 eval_loss = eval_loss / nb_eval_steps eval_accuracy = eval_accuracy / nb_eval_examples result = {'eval_loss': eval_loss, 'eval_accuracy': eval_accuracy, 'global_step': global_step, 'loss': tr_loss/global_step} output_eval_file = os.path.join(args.output_dir, "eval_results.txt") with open(output_eval_file, "w") as writer: logger.info("***** Eval results *****") for key in sorted(result.keys()): logger.info(" %s = %s", key, str(result[key])) writer.write("%s = %s\n" % (key, str(result[key]))) if __name__ == "__main__": main()
24,318
42.739209
134
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/single_model_scripts/run_openai_gpt.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ OpenAI GPT model fine-tuning script. Adapted from https://github.com/huggingface/pytorch-openai-transformer-lm/blob/master/train.py It self adapted from https://github.com/openai/finetune-transformer-lm/blob/master/train.py This script with default values fine-tunes and evaluate a pretrained OpenAI GPT on the RocStories dataset: python run_openai_gpt.py \ --model_name openai-gpt \ --do_train \ --do_eval \ --train_dataset $ROC_STORIES_DIR/cloze_test_val__spring2016\ -\ cloze_test_ALL_val.csv \ --eval_dataset $ROC_STORIES_DIR/cloze_test_test__spring2016\ -\ cloze_test_ALL_test.csv \ --output_dir ../log \ --train_batch_size 16 \ """ import argparse import os import csv import random import logging from tqdm import tqdm, trange import numpy as np import torch from torch.utils.data import (DataLoader, RandomSampler, SequentialSampler, TensorDataset) from pytorch_transformers import (OpenAIGPTDoubleHeadsModel, OpenAIGPTTokenizer, AdamW, cached_path, WEIGHTS_NAME, CONFIG_NAME, WarmupLinearSchedule) ROCSTORIES_URL = "https://s3.amazonaws.com/datasets.huggingface.co/ROCStories.tar.gz" logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO) logger = logging.getLogger(__name__) def accuracy(out, labels): outputs = np.argmax(out, axis=1) return np.sum(outputs == labels) def load_rocstories_dataset(dataset_path): """ Output a list of tuples(story, 1st continuation, 2nd continuation, label) """ with open(dataset_path, encoding='utf_8') as f: f = csv.reader(f) output = [] next(f) # skip the first line for line in tqdm(f): output.append((' '.join(line[1:5]), line[5], line[6], int(line[-1])-1)) return output def pre_process_datasets(encoded_datasets, input_len, cap_length, start_token, delimiter_token, clf_token): """ Pre-process datasets containing lists of tuples(story, 1st continuation, 2nd continuation, label) To Transformer inputs of shape (n_batch, n_alternative, length) comprising for each batch, continuation: input_ids[batch, alternative, :] = [start_token] + story[:cap_length] + [delimiter_token] + cont1[:cap_length] + [clf_token] """ tensor_datasets = [] for dataset in encoded_datasets: n_batch = len(dataset) input_ids = np.zeros((n_batch, 2, input_len), dtype=np.int64) mc_token_ids = np.zeros((n_batch, 2), dtype=np.int64) lm_labels = np.full((n_batch, 2, input_len), fill_value=-1, dtype=np.int64) mc_labels = np.zeros((n_batch,), dtype=np.int64) for i, (story, cont1, cont2, mc_label), in enumerate(dataset): with_cont1 = [start_token] + story[:cap_length] + [delimiter_token] + cont1[:cap_length] + [clf_token] with_cont2 = [start_token] + story[:cap_length] + [delimiter_token] + cont2[:cap_length] + [clf_token] input_ids[i, 0, :len(with_cont1)] = with_cont1 input_ids[i, 1, :len(with_cont2)] = with_cont2 mc_token_ids[i, 0] = len(with_cont1) - 1 mc_token_ids[i, 1] = len(with_cont2) - 1 lm_labels[i, 0, :len(with_cont1)] = with_cont1 lm_labels[i, 1, :len(with_cont2)] = with_cont2 mc_labels[i] = mc_label all_inputs = (input_ids, mc_token_ids, lm_labels, mc_labels) tensor_datasets.append(tuple(torch.tensor(t) for t in all_inputs)) return tensor_datasets def main(): parser = argparse.ArgumentParser() parser.add_argument('--model_name', type=str, default='openai-gpt', help='pretrained model name') parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--do_eval", action='store_true', help="Whether to run eval on the dev set.") parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model predictions and checkpoints will be written.") parser.add_argument('--train_dataset', type=str, default='') parser.add_argument('--eval_dataset', type=str, default='') parser.add_argument('--seed', type=int, default=42) parser.add_argument('--num_train_epochs', type=int, default=3) parser.add_argument('--train_batch_size', type=int, default=8) parser.add_argument('--eval_batch_size', type=int, default=16) parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument('--max_grad_norm', type=int, default=1) parser.add_argument("--max_steps", default=-1, type=int, help="If > 0: set total number of training \ steps to perform. Override num_train_epochs.") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before\ performing a backward/update pass.") parser.add_argument('--learning_rate', type=float, default=6.25e-5) parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument('--lr_schedule', type=str, default='warmup_linear') parser.add_argument('--weight_decay', type=float, default=0.01) parser.add_argument('--lm_coef', type=float, default=0.9) parser.add_argument('--n_valid', type=int, default=374) parser.add_argument('--server_ip', type=str, default='', help="Can be used for distant debugging.") parser.add_argument('--server_port', type=str, default='', help="Can be used for distant debugging.") args = parser.parse_args() print(args) if args.server_ip and args.server_port: # Distant debugging - see https://code.visualstudio.com/docs/python/debugging#_attach-to-a-local-script import ptvsd print("Waiting for debugger attach") ptvsd.enable_attach(address=(args.server_ip, args.server_port), redirect_output=True) ptvsd.wait_for_attach() random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) torch.cuda.manual_seed_all(args.seed) device = torch.device("cuda" if torch.cuda.is_available() else "cpu") n_gpu = torch.cuda.device_count() logger.info("device: {}, n_gpu {}".format(device, n_gpu)) if not args.do_train and not args.do_eval: raise ValueError("At least one of `do_train` or `do_eval` must be True.") if not os.path.exists(args.output_dir): os.makedirs(args.output_dir) # Load tokenizer and model # This loading functions also add new tokens and embeddings called `special tokens` # These new embeddings will be fine-tuned on the RocStories dataset special_tokens = ['_start_', '_delimiter_', '_classify_'] tokenizer = OpenAIGPTTokenizer.from_pretrained(args.model_name, special_tokens=special_tokens) special_tokens_ids = list(tokenizer.convert_tokens_to_ids(token) for token in special_tokens) model = OpenAIGPTDoubleHeadsModel.from_pretrained(args.model_name, num_special_tokens=len(special_tokens)) model.to(device) # Load and encode the datasets if not args.train_dataset and not args.eval_dataset: roc_stories = cached_path(ROCSTORIES_URL) def tokenize_and_encode(obj): """ Tokenize and encode a nested object """ if isinstance(obj, str): return tokenizer.convert_tokens_to_ids(tokenizer.tokenize(obj)) elif isinstance(obj, int): return obj return list(tokenize_and_encode(o) for o in obj) logger.info("Encoding dataset...") train_dataset = load_rocstories_dataset(args.train_dataset) eval_dataset = load_rocstories_dataset(args.eval_dataset) datasets = (train_dataset, eval_dataset) encoded_datasets = tokenize_and_encode(datasets) # Compute the max input length for the Transformer max_length = model.config.n_positions // 2 - 2 input_length = max(len(story[:max_length]) + max(len(cont1[:max_length]), len(cont2[:max_length])) + 3 \ for dataset in encoded_datasets for story, cont1, cont2, _ in dataset) input_length = min(input_length, model.config.n_positions) # Max size of input for the pre-trained model # Prepare inputs tensors and dataloaders tensor_datasets = pre_process_datasets(encoded_datasets, input_length, max_length, *special_tokens_ids) train_tensor_dataset, eval_tensor_dataset = tensor_datasets[0], tensor_datasets[1] train_data = TensorDataset(*train_tensor_dataset) train_sampler = RandomSampler(train_data) train_dataloader = DataLoader(train_data, sampler=train_sampler, batch_size=args.train_batch_size) eval_data = TensorDataset(*eval_tensor_dataset) eval_sampler = SequentialSampler(eval_data) eval_dataloader = DataLoader(eval_data, sampler=eval_sampler, batch_size=args.eval_batch_size) # Prepare optimizer if args.do_train: if args.max_steps > 0: t_total = args.max_steps args.num_train_epochs = args.max_steps //\ (len(train_dataloader) // args.gradient_accumulation_steps) + 1 else: t_total = len(train_dataloader)\ // args.gradient_accumulation_steps * args.num_train_epochs param_optimizer = list(model.named_parameters()) no_decay = ['bias', 'LayerNorm.bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in param_optimizer if not any(nd in n for nd in no_decay)], 'weight_decay': args.weight_decay}, {'params': [p for n, p in param_optimizer if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=t_total) if args.do_train: nb_tr_steps, tr_loss, exp_average_loss = 0, 0, None model.train() for _ in trange(int(args.num_train_epochs), desc="Epoch"): tr_loss = 0 nb_tr_steps = 0 tqdm_bar = tqdm(train_dataloader, desc="Training") for step, batch in enumerate(tqdm_bar): batch = tuple(t.to(device) for t in batch) input_ids, mc_token_ids, lm_labels, mc_labels = batch losses = model(input_ids, mc_token_ids, lm_labels, mc_labels) loss = args.lm_coef * losses[0] + losses[1] loss.backward() scheduler.step() optimizer.step() optimizer.zero_grad() tr_loss += loss.item() exp_average_loss = loss.item() if exp_average_loss is None else 0.7*exp_average_loss+0.3*loss.item() nb_tr_steps += 1 tqdm_bar.desc = "Training loss: {:.2e} lr: {:.2e}".format(exp_average_loss, scheduler.get_lr()[0]) # Save a trained model if args.do_train: # Save a trained model, configuration and tokenizer model_to_save = model.module if hasattr(model, 'module') else model # Only save the model it-self # If we save using the predefined names, we can load using `from_pretrained` output_model_file = os.path.join(args.output_dir, WEIGHTS_NAME) output_config_file = os.path.join(args.output_dir, CONFIG_NAME) torch.save(model_to_save.state_dict(), output_model_file) model_to_save.config.to_json_file(output_config_file) tokenizer.save_vocabulary(args.output_dir) # Load a trained model and vocabulary that you have fine-tuned model = OpenAIGPTDoubleHeadsModel.from_pretrained(args.output_dir) tokenizer = OpenAIGPTTokenizer.from_pretrained(args.output_dir) model.to(device) if args.do_eval: model.eval() eval_loss, eval_accuracy = 0, 0 nb_eval_steps, nb_eval_examples = 0, 0 for batch in tqdm(eval_dataloader, desc="Evaluating"): batch = tuple(t.to(device) for t in batch) input_ids, mc_token_ids, lm_labels, mc_labels = batch with torch.no_grad(): _, mc_loss, _, mc_logits = model(input_ids, mc_token_ids, lm_labels, mc_labels) mc_logits = mc_logits.detach().cpu().numpy() mc_labels = mc_labels.to('cpu').numpy() tmp_eval_accuracy = accuracy(mc_logits, mc_labels) eval_loss += mc_loss.mean().item() eval_accuracy += tmp_eval_accuracy nb_eval_examples += input_ids.size(0) nb_eval_steps += 1 eval_loss = eval_loss / nb_eval_steps eval_accuracy = eval_accuracy / nb_eval_examples train_loss = tr_loss/nb_tr_steps if args.do_train else None result = {'eval_loss': eval_loss, 'eval_accuracy': eval_accuracy, 'train_loss': train_loss} output_eval_file = os.path.join(args.output_dir, "eval_results.txt") with open(output_eval_file, "w") as writer: logger.info("***** Eval results *****") for key in sorted(result.keys()): logger.info(" %s = %s", key, str(result[key])) writer.write("%s = %s\n" % (key, str(result[key]))) if __name__ == '__main__': main()
14,382
48.768166
132
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/lm_finetuning/simple_lm_finetuning.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """BERT finetuning runner.""" from __future__ import absolute_import, division, print_function, unicode_literals import argparse import logging import os import random from io import open import numpy as np import torch from torch.utils.data import DataLoader, Dataset, RandomSampler from torch.utils.data.distributed import DistributedSampler from tqdm import tqdm, trange from pytorch_transformers import WEIGHTS_NAME, CONFIG_NAME from pytorch_transformers.modeling_bert import BertForPreTraining from pytorch_transformers.tokenization_bert import BertTokenizer from pytorch_transformers.optimization import AdamW, WarmupLinearSchedule logging.basicConfig(format='%(asctime)s - %(levelname)s - %(name)s - %(message)s', datefmt='%m/%d/%Y %H:%M:%S', level=logging.INFO) logger = logging.getLogger(__name__) class BERTDataset(Dataset): def __init__(self, corpus_path, tokenizer, seq_len, encoding="utf-8", corpus_lines=None, on_memory=True): self.vocab = tokenizer.vocab self.tokenizer = tokenizer self.seq_len = seq_len self.on_memory = on_memory self.corpus_lines = corpus_lines # number of non-empty lines in input corpus self.corpus_path = corpus_path self.encoding = encoding self.current_doc = 0 # to avoid random sentence from same doc # for loading samples directly from file self.sample_counter = 0 # used to keep track of full epochs on file self.line_buffer = None # keep second sentence of a pair in memory and use as first sentence in next pair # for loading samples in memory self.current_random_doc = 0 self.num_docs = 0 self.sample_to_doc = [] # map sample index to doc and line # load samples into memory if on_memory: self.all_docs = [] doc = [] self.corpus_lines = 0 with open(corpus_path, "r", encoding=encoding) as f: for line in tqdm(f, desc="Loading Dataset", total=corpus_lines): line = line.strip() if line == "": self.all_docs.append(doc) doc = [] #remove last added sample because there won't be a subsequent line anymore in the doc self.sample_to_doc.pop() else: #store as one sample sample = {"doc_id": len(self.all_docs), "line": len(doc)} self.sample_to_doc.append(sample) doc.append(line) self.corpus_lines = self.corpus_lines + 1 # if last row in file is not empty if self.all_docs[-1] != doc: self.all_docs.append(doc) self.sample_to_doc.pop() self.num_docs = len(self.all_docs) # load samples later lazily from disk else: if self.corpus_lines is None: with open(corpus_path, "r", encoding=encoding) as f: self.corpus_lines = 0 for line in tqdm(f, desc="Loading Dataset", total=corpus_lines): if line.strip() == "": self.num_docs += 1 else: self.corpus_lines += 1 # if doc does not end with empty line if line.strip() != "": self.num_docs += 1 self.file = open(corpus_path, "r", encoding=encoding) self.random_file = open(corpus_path, "r", encoding=encoding) def __len__(self): # last line of doc won't be used, because there's no "nextSentence". Additionally, we start counting at 0. return self.corpus_lines - self.num_docs - 1 def __getitem__(self, item): cur_id = self.sample_counter self.sample_counter += 1 if not self.on_memory: # after one epoch we start again from beginning of file if cur_id != 0 and (cur_id % len(self) == 0): self.file.close() self.file = open(self.corpus_path, "r", encoding=self.encoding) t1, t2, is_next_label = self.random_sent(item) # tokenize tokens_a = self.tokenizer.tokenize(t1) tokens_b = self.tokenizer.tokenize(t2) # combine to one sample cur_example = InputExample(guid=cur_id, tokens_a=tokens_a, tokens_b=tokens_b, is_next=is_next_label) # transform sample to features cur_features = convert_example_to_features(cur_example, self.seq_len, self.tokenizer) cur_tensors = (torch.tensor(cur_features.input_ids), torch.tensor(cur_features.input_mask), torch.tensor(cur_features.segment_ids), torch.tensor(cur_features.lm_label_ids), torch.tensor(cur_features.is_next)) return cur_tensors def random_sent(self, index): """ Get one sample from corpus consisting of two sentences. With prob. 50% these are two subsequent sentences from one doc. With 50% the second sentence will be a random one from another doc. :param index: int, index of sample. :return: (str, str, int), sentence 1, sentence 2, isNextSentence Label """ t1, t2 = self.get_corpus_line(index) if random.random() > 0.5: label = 0 else: t2 = self.get_random_line() label = 1 assert len(t1) > 0 assert len(t2) > 0 return t1, t2, label def get_corpus_line(self, item): """ Get one sample from corpus consisting of a pair of two subsequent lines from the same doc. :param item: int, index of sample. :return: (str, str), two subsequent sentences from corpus """ t1 = "" t2 = "" assert item < self.corpus_lines if self.on_memory: sample = self.sample_to_doc[item] t1 = self.all_docs[sample["doc_id"]][sample["line"]] t2 = self.all_docs[sample["doc_id"]][sample["line"]+1] # used later to avoid random nextSentence from same doc self.current_doc = sample["doc_id"] return t1, t2 else: if self.line_buffer is None: # read first non-empty line of file while t1 == "" : t1 = next(self.file).strip() t2 = next(self.file).strip() else: # use t2 from previous iteration as new t1 t1 = self.line_buffer t2 = next(self.file).strip() # skip empty rows that are used for separating documents and keep track of current doc id while t2 == "" or t1 == "": t1 = next(self.file).strip() t2 = next(self.file).strip() self.current_doc = self.current_doc+1 self.line_buffer = t2 assert t1 != "" assert t2 != "" return t1, t2 def get_random_line(self): """ Get random line from another document for nextSentence task. :return: str, content of one line """ # Similar to original tf repo: This outer loop should rarely go for more than one iteration for large # corpora. However, just to be careful, we try to make sure that # the random document is not the same as the document we're processing. for _ in range(10): if self.on_memory: rand_doc_idx = random.randint(0, len(self.all_docs)-1) rand_doc = self.all_docs[rand_doc_idx] line = rand_doc[random.randrange(len(rand_doc))] else: rand_index = random.randint(1, self.corpus_lines if self.corpus_lines < 1000 else 1000) #pick random line for _ in range(rand_index): line = self.get_next_line() #check if our picked random line is really from another doc like we want it to be if self.current_random_doc != self.current_doc: break return line def get_next_line(self): """ Gets next line of random_file and starts over when reaching end of file""" try: line = next(self.random_file).strip() #keep track of which document we are currently looking at to later avoid having the same doc as t1 if line == "": self.current_random_doc = self.current_random_doc + 1 line = next(self.random_file).strip() except StopIteration: self.random_file.close() self.random_file = open(self.corpus_path, "r", encoding=self.encoding) line = next(self.random_file).strip() return line class InputExample(object): """A single training/test example for the language model.""" def __init__(self, guid, tokens_a, tokens_b=None, is_next=None, lm_labels=None): """Constructs a InputExample. Args: guid: Unique id for the example. tokens_a: string. The untokenized text of the first sequence. For single sequence tasks, only this sequence must be specified. tokens_b: (Optional) string. The untokenized text of the second sequence. Only must be specified for sequence pair tasks. label: (Optional) string. The label of the example. This should be specified for train and dev examples, but not for test examples. """ self.guid = guid self.tokens_a = tokens_a self.tokens_b = tokens_b self.is_next = is_next # nextSentence self.lm_labels = lm_labels # masked words for language model class InputFeatures(object): """A single set of features of data.""" def __init__(self, input_ids, input_mask, segment_ids, is_next, lm_label_ids): self.input_ids = input_ids self.input_mask = input_mask self.segment_ids = segment_ids self.is_next = is_next self.lm_label_ids = lm_label_ids def random_word(tokens, tokenizer): """ Masking some random tokens for Language Model task with probabilities as in the original BERT paper. :param tokens: list of str, tokenized sentence. :param tokenizer: Tokenizer, object used for tokenization (we need it's vocab here) :return: (list of str, list of int), masked tokens and related labels for LM prediction """ output_label = [] for i, token in enumerate(tokens): prob = random.random() # mask token with 15% probability if prob < 0.15: prob /= 0.15 # 80% randomly change token to mask token if prob < 0.8: tokens[i] = "[MASK]" # 10% randomly change token to random token elif prob < 0.9: tokens[i] = random.choice(list(tokenizer.vocab.items()))[0] # -> rest 10% randomly keep current token # append current token to output (we will predict these later) try: output_label.append(tokenizer.vocab[token]) except KeyError: # For unknown words (should not occur with BPE vocab) output_label.append(tokenizer.vocab["[UNK]"]) logger.warning("Cannot find token '{}' in vocab. Using [UNK] insetad".format(token)) else: # no masking token (will be ignored by loss function later) output_label.append(-1) return tokens, output_label def convert_example_to_features(example, max_seq_length, tokenizer): """ Convert a raw sample (pair of sentences as tokenized strings) into a proper training sample with IDs, LM labels, input_mask, CLS and SEP tokens etc. :param example: InputExample, containing sentence input as strings and is_next label :param max_seq_length: int, maximum length of sequence. :param tokenizer: Tokenizer :return: InputFeatures, containing all inputs and labels of one sample as IDs (as used for model training) """ tokens_a = example.tokens_a tokens_b = example.tokens_b # Modifies `tokens_a` and `tokens_b` in place so that the total # length is less than the specified length. # Account for [CLS], [SEP], [SEP] with "- 3" _truncate_seq_pair(tokens_a, tokens_b, max_seq_length - 3) tokens_a, t1_label = random_word(tokens_a, tokenizer) tokens_b, t2_label = random_word(tokens_b, tokenizer) # concatenate lm labels and account for CLS, SEP, SEP lm_label_ids = ([-1] + t1_label + [-1] + t2_label + [-1]) # The convention in BERT is: # (a) For sequence pairs: # tokens: [CLS] is this jack ##son ##ville ? [SEP] no it is not . [SEP] # type_ids: 0 0 0 0 0 0 0 0 1 1 1 1 1 1 # (b) For single sequences: # tokens: [CLS] the dog is hairy . [SEP] # type_ids: 0 0 0 0 0 0 0 # # Where "type_ids" are used to indicate whether this is the first # sequence or the second sequence. The embedding vectors for `type=0` and # `type=1` were learned during pre-training and are added to the wordpiece # embedding vector (and position vector). This is not *strictly* necessary # since the [SEP] token unambigiously separates the sequences, but it makes # it easier for the model to learn the concept of sequences. # # For classification tasks, the first vector (corresponding to [CLS]) is # used as as the "sentence vector". Note that this only makes sense because # the entire model is fine-tuned. tokens = [] segment_ids = [] tokens.append("[CLS]") segment_ids.append(0) for token in tokens_a: tokens.append(token) segment_ids.append(0) tokens.append("[SEP]") segment_ids.append(0) assert len(tokens_b) > 0 for token in tokens_b: tokens.append(token) segment_ids.append(1) tokens.append("[SEP]") segment_ids.append(1) input_ids = tokenizer.convert_tokens_to_ids(tokens) # The mask has 1 for real tokens and 0 for padding tokens. Only real # tokens are attended to. input_mask = [1] * len(input_ids) # Zero-pad up to the sequence length. while len(input_ids) < max_seq_length: input_ids.append(0) input_mask.append(0) segment_ids.append(0) lm_label_ids.append(-1) assert len(input_ids) == max_seq_length assert len(input_mask) == max_seq_length assert len(segment_ids) == max_seq_length assert len(lm_label_ids) == max_seq_length if example.guid < 5: logger.info("*** Example ***") logger.info("guid: %s" % (example.guid)) logger.info("tokens: %s" % " ".join( [str(x) for x in tokens])) logger.info("input_ids: %s" % " ".join([str(x) for x in input_ids])) logger.info("input_mask: %s" % " ".join([str(x) for x in input_mask])) logger.info( "segment_ids: %s" % " ".join([str(x) for x in segment_ids])) logger.info("LM label: %s " % (lm_label_ids)) logger.info("Is next sentence label: %s " % (example.is_next)) features = InputFeatures(input_ids=input_ids, input_mask=input_mask, segment_ids=segment_ids, lm_label_ids=lm_label_ids, is_next=example.is_next) return features def main(): parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--train_corpus", default=None, type=str, required=True, help="The input train corpus.") parser.add_argument("--bert_model", default=None, type=str, required=True, help="Bert pre-trained model selected in the list: bert-base-uncased, " "bert-large-uncased, bert-base-cased, bert-base-multilingual, bert-base-chinese.") parser.add_argument("--output_dir", default=None, type=str, required=True, help="The output directory where the model checkpoints will be written.") ## Other parameters parser.add_argument("--max_seq_length", default=128, type=int, help="The maximum total input sequence length after WordPiece tokenization. \n" "Sequences longer than this will be truncated, and sequences shorter \n" "than this will be padded.") parser.add_argument("--do_train", action='store_true', help="Whether to run training.") parser.add_argument("--train_batch_size", default=32, type=int, help="Total batch size for training.") parser.add_argument("--learning_rate", default=3e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--num_train_epochs", default=3.0, type=float, help="Total number of training epochs to perform.") parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument("--on_memory", action='store_true', help="Whether to load train samples into memory or use disk") parser.add_argument("--do_lower_case", action='store_true', help="Whether to lower case the input text. True for uncased models, False for cased models.") parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumualte before performing a backward/update pass.") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit float precision instead of 32-bit") parser.add_argument('--loss_scale', type = float, default = 0, help = "Loss scaling to improve fp16 numeric stability. Only used when fp16 set to True.\n" "0 (default value): dynamic loss scaling.\n" "Positive power of 2: static loss scaling value.\n") args = parser.parse_args() if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") n_gpu = torch.cuda.device_count() else: torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) n_gpu = 1 # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.distributed.init_process_group(backend='nccl') logger.info("device: {} n_gpu: {}, distributed training: {}, 16-bits training: {}".format( device, n_gpu, bool(args.local_rank != -1), args.fp16)) if args.gradient_accumulation_steps < 1: raise ValueError("Invalid gradient_accumulation_steps parameter: {}, should be >= 1".format( args.gradient_accumulation_steps)) args.train_batch_size = args.train_batch_size // args.gradient_accumulation_steps random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if n_gpu > 0: torch.cuda.manual_seed_all(args.seed) if not args.do_train: raise ValueError("Training is currently the only implemented execution option. Please set `do_train`.") if os.path.exists(args.output_dir) and os.listdir(args.output_dir): raise ValueError("Output directory ({}) already exists and is not empty.".format(args.output_dir)) if not os.path.exists(args.output_dir) and (args.local_rank == -1 or torch.distributed.get_rank() == 0): os.makedirs(args.output_dir) tokenizer = BertTokenizer.from_pretrained(args.bert_model, do_lower_case=args.do_lower_case) #train_examples = None num_train_optimization_steps = None if args.do_train: print("Loading Train Dataset", args.train_corpus) train_dataset = BERTDataset(args.train_corpus, tokenizer, seq_len=args.max_seq_length, corpus_lines=None, on_memory=args.on_memory) num_train_optimization_steps = int( len(train_dataset) / args.train_batch_size / args.gradient_accumulation_steps) * args.num_train_epochs if args.local_rank != -1: num_train_optimization_steps = num_train_optimization_steps // torch.distributed.get_world_size() # Prepare model model = BertForPreTraining.from_pretrained(args.bert_model) if args.fp16: model.half() model.to(device) if args.local_rank != -1: try: from apex.parallel import DistributedDataParallel as DDP except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") model = DDP(model) elif n_gpu > 1: model = torch.nn.DataParallel(model) # Prepare optimizer if args.do_train: param_optimizer = list(model.named_parameters()) no_decay = ['bias', 'LayerNorm.bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in param_optimizer if not any(nd in n for nd in no_decay)], 'weight_decay': 0.01}, {'params': [p for n, p in param_optimizer if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] if args.fp16: try: from apex.optimizers import FP16_Optimizer from apex.optimizers import FusedAdam except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") optimizer = FusedAdam(optimizer_grouped_parameters, lr=args.learning_rate, bias_correction=False, max_grad_norm=1.0) if args.loss_scale == 0: optimizer = FP16_Optimizer(optimizer, dynamic_loss_scale=True) else: optimizer = FP16_Optimizer(optimizer, static_loss_scale=args.loss_scale) else: optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=num_train_optimization_steps) global_step = 0 if args.do_train: logger.info("***** Running training *****") logger.info(" Num examples = %d", len(train_dataset)) logger.info(" Batch size = %d", args.train_batch_size) logger.info(" Num steps = %d", num_train_optimization_steps) if args.local_rank == -1: train_sampler = RandomSampler(train_dataset) else: #TODO: check if this works with current data generator from disk that relies on next(file) # (it doesn't return item back by index) train_sampler = DistributedSampler(train_dataset) train_dataloader = DataLoader(train_dataset, sampler=train_sampler, batch_size=args.train_batch_size) model.train() for _ in trange(int(args.num_train_epochs), desc="Epoch"): tr_loss = 0 nb_tr_examples, nb_tr_steps = 0, 0 for step, batch in enumerate(tqdm(train_dataloader, desc="Iteration")): batch = tuple(t.to(device) for t in batch) input_ids, input_mask, segment_ids, lm_label_ids, is_next = batch outputs = model(input_ids, segment_ids, input_mask, lm_label_ids, is_next) loss = outputs[0] if n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu. if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: optimizer.backward(loss) else: loss.backward() tr_loss += loss.item() nb_tr_examples += input_ids.size(0) nb_tr_steps += 1 if (step + 1) % args.gradient_accumulation_steps == 0: optimizer.step() scheduler.step() # Update learning rate schedule optimizer.zero_grad() global_step += 1 # Save a trained model if args.do_train and (args.local_rank == -1 or torch.distributed.get_rank() == 0): logger.info("** ** * Saving fine - tuned model ** ** * ") model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(args.output_dir) tokenizer.save_pretrained(args.output_dir) def _truncate_seq_pair(tokens_a, tokens_b, max_length): """Truncates a sequence pair in place to the maximum length.""" # This is a simple heuristic which will always truncate the longer sequence # one token at a time. This makes more sense than truncating an equal percent # of tokens from each, since if one sequence is very short then each token # that's truncated likely contains more information than a longer sequence. while True: total_length = len(tokens_a) + len(tokens_b) if total_length <= max_length: break if len(tokens_a) > len(tokens_b): tokens_a.pop() else: tokens_b.pop() def accuracy(out, labels): outputs = np.argmax(out, axis=1) return np.sum(outputs == labels) if __name__ == "__main__": main()
27,841
42.367601
134
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/lm_finetuning/finetune_on_pregenerated.py
from argparse import ArgumentParser from pathlib import Path import os import torch import logging import json import random import numpy as np from collections import namedtuple from tempfile import TemporaryDirectory from torch.utils.data import DataLoader, Dataset, RandomSampler from torch.utils.data.distributed import DistributedSampler from tqdm import tqdm from pytorch_transformers import WEIGHTS_NAME, CONFIG_NAME from pytorch_transformers.modeling_bert import BertForPreTraining from pytorch_transformers.tokenization_bert import BertTokenizer from pytorch_transformers.optimization import AdamW, WarmupLinearSchedule InputFeatures = namedtuple("InputFeatures", "input_ids input_mask segment_ids lm_label_ids is_next") log_format = '%(asctime)-10s: %(message)s' logging.basicConfig(level=logging.INFO, format=log_format) def convert_example_to_features(example, tokenizer, max_seq_length): tokens = example["tokens"] segment_ids = example["segment_ids"] is_random_next = example["is_random_next"] masked_lm_positions = example["masked_lm_positions"] masked_lm_labels = example["masked_lm_labels"] assert len(tokens) == len(segment_ids) <= max_seq_length # The preprocessed data should be already truncated input_ids = tokenizer.convert_tokens_to_ids(tokens) masked_label_ids = tokenizer.convert_tokens_to_ids(masked_lm_labels) input_array = np.zeros(max_seq_length, dtype=np.int) input_array[:len(input_ids)] = input_ids mask_array = np.zeros(max_seq_length, dtype=np.bool) mask_array[:len(input_ids)] = 1 segment_array = np.zeros(max_seq_length, dtype=np.bool) segment_array[:len(segment_ids)] = segment_ids lm_label_array = np.full(max_seq_length, dtype=np.int, fill_value=-1) lm_label_array[masked_lm_positions] = masked_label_ids features = InputFeatures(input_ids=input_array, input_mask=mask_array, segment_ids=segment_array, lm_label_ids=lm_label_array, is_next=is_random_next) return features class PregeneratedDataset(Dataset): def __init__(self, training_path, epoch, tokenizer, num_data_epochs, reduce_memory=False): self.vocab = tokenizer.vocab self.tokenizer = tokenizer self.epoch = epoch self.data_epoch = epoch % num_data_epochs data_file = training_path / f"epoch_{self.data_epoch}.json" metrics_file = training_path / f"epoch_{self.data_epoch}_metrics.json" assert data_file.is_file() and metrics_file.is_file() metrics = json.loads(metrics_file.read_text()) num_samples = metrics['num_training_examples'] seq_len = metrics['max_seq_len'] self.temp_dir = None self.working_dir = None if reduce_memory: self.temp_dir = TemporaryDirectory() self.working_dir = Path(self.temp_dir.name) input_ids = np.memmap(filename=self.working_dir/'input_ids.memmap', mode='w+', dtype=np.int32, shape=(num_samples, seq_len)) input_masks = np.memmap(filename=self.working_dir/'input_masks.memmap', shape=(num_samples, seq_len), mode='w+', dtype=np.bool) segment_ids = np.memmap(filename=self.working_dir/'segment_ids.memmap', shape=(num_samples, seq_len), mode='w+', dtype=np.bool) lm_label_ids = np.memmap(filename=self.working_dir/'lm_label_ids.memmap', shape=(num_samples, seq_len), mode='w+', dtype=np.int32) lm_label_ids[:] = -1 is_nexts = np.memmap(filename=self.working_dir/'is_nexts.memmap', shape=(num_samples,), mode='w+', dtype=np.bool) else: input_ids = np.zeros(shape=(num_samples, seq_len), dtype=np.int32) input_masks = np.zeros(shape=(num_samples, seq_len), dtype=np.bool) segment_ids = np.zeros(shape=(num_samples, seq_len), dtype=np.bool) lm_label_ids = np.full(shape=(num_samples, seq_len), dtype=np.int32, fill_value=-1) is_nexts = np.zeros(shape=(num_samples,), dtype=np.bool) logging.info(f"Loading training examples for epoch {epoch}") with data_file.open() as f: for i, line in enumerate(tqdm(f, total=num_samples, desc="Training examples")): line = line.strip() example = json.loads(line) features = convert_example_to_features(example, tokenizer, seq_len) input_ids[i] = features.input_ids segment_ids[i] = features.segment_ids input_masks[i] = features.input_mask lm_label_ids[i] = features.lm_label_ids is_nexts[i] = features.is_next assert i == num_samples - 1 # Assert that the sample count metric was true logging.info("Loading complete!") self.num_samples = num_samples self.seq_len = seq_len self.input_ids = input_ids self.input_masks = input_masks self.segment_ids = segment_ids self.lm_label_ids = lm_label_ids self.is_nexts = is_nexts def __len__(self): return self.num_samples def __getitem__(self, item): return (torch.tensor(self.input_ids[item].astype(np.int64)), torch.tensor(self.input_masks[item].astype(np.int64)), torch.tensor(self.segment_ids[item].astype(np.int64)), torch.tensor(self.lm_label_ids[item].astype(np.int64)), torch.tensor(self.is_nexts[item].astype(np.int64))) def main(): parser = ArgumentParser() parser.add_argument('--pregenerated_data', type=Path, required=True) parser.add_argument('--output_dir', type=Path, required=True) parser.add_argument("--bert_model", type=str, required=True, help="Bert pre-trained model selected in the list: bert-base-uncased, " "bert-large-uncased, bert-base-cased, bert-base-multilingual, bert-base-chinese.") parser.add_argument("--do_lower_case", action="store_true") parser.add_argument("--reduce_memory", action="store_true", help="Store training data as on-disc memmaps to massively reduce memory usage") parser.add_argument("--epochs", type=int, default=3, help="Number of epochs to train for") parser.add_argument("--local_rank", type=int, default=-1, help="local_rank for distributed training on gpus") parser.add_argument("--no_cuda", action='store_true', help="Whether not to use CUDA when available") parser.add_argument('--gradient_accumulation_steps', type=int, default=1, help="Number of updates steps to accumulate before performing a backward/update pass.") parser.add_argument("--train_batch_size", default=32, type=int, help="Total batch size for training.") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit float precision instead of 32-bit") parser.add_argument('--loss_scale', type=float, default=0, help="Loss scaling to improve fp16 numeric stability. Only used when fp16 set to True.\n" "0 (default value): dynamic loss scaling.\n" "Positive power of 2: static loss scaling value.\n") parser.add_argument("--warmup_steps", default=0, type=int, help="Linear warmup over warmup_steps.") parser.add_argument("--adam_epsilon", default=1e-8, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--learning_rate", default=3e-5, type=float, help="The initial learning rate for Adam.") parser.add_argument('--seed', type=int, default=42, help="random seed for initialization") args = parser.parse_args() assert args.pregenerated_data.is_dir(), \ "--pregenerated_data should point to the folder of files made by pregenerate_training_data.py!" samples_per_epoch = [] for i in range(args.epochs): epoch_file = args.pregenerated_data / f"epoch_{i}.json" metrics_file = args.pregenerated_data / f"epoch_{i}_metrics.json" if epoch_file.is_file() and metrics_file.is_file(): metrics = json.loads(metrics_file.read_text()) samples_per_epoch.append(metrics['num_training_examples']) else: if i == 0: exit("No training data was found!") print(f"Warning! There are fewer epochs of pregenerated data ({i}) than training epochs ({args.epochs}).") print("This script will loop over the available data, but training diversity may be negatively impacted.") num_data_epochs = i break else: num_data_epochs = args.epochs if args.local_rank == -1 or args.no_cuda: device = torch.device("cuda" if torch.cuda.is_available() and not args.no_cuda else "cpu") n_gpu = torch.cuda.device_count() else: torch.cuda.set_device(args.local_rank) device = torch.device("cuda", args.local_rank) n_gpu = 1 # Initializes the distributed backend which will take care of sychronizing nodes/GPUs torch.distributed.init_process_group(backend='nccl') logging.info("device: {} n_gpu: {}, distributed training: {}, 16-bits training: {}".format( device, n_gpu, bool(args.local_rank != -1), args.fp16)) if args.gradient_accumulation_steps < 1: raise ValueError("Invalid gradient_accumulation_steps parameter: {}, should be >= 1".format( args.gradient_accumulation_steps)) args.train_batch_size = args.train_batch_size // args.gradient_accumulation_steps random.seed(args.seed) np.random.seed(args.seed) torch.manual_seed(args.seed) if n_gpu > 0: torch.cuda.manual_seed_all(args.seed) if args.output_dir.is_dir() and list(args.output_dir.iterdir()): logging.warning(f"Output directory ({args.output_dir}) already exists and is not empty!") args.output_dir.mkdir(parents=True, exist_ok=True) tokenizer = BertTokenizer.from_pretrained(args.bert_model, do_lower_case=args.do_lower_case) total_train_examples = 0 for i in range(args.epochs): # The modulo takes into account the fact that we may loop over limited epochs of data total_train_examples += samples_per_epoch[i % len(samples_per_epoch)] num_train_optimization_steps = int( total_train_examples / args.train_batch_size / args.gradient_accumulation_steps) if args.local_rank != -1: num_train_optimization_steps = num_train_optimization_steps // torch.distributed.get_world_size() # Prepare model model = BertForPreTraining.from_pretrained(args.bert_model) # We don't need to manually call model.half() following Apex's recommend # if args.fp16: # model.half() model.to(device) if args.local_rank != -1: try: from apex.parallel import DistributedDataParallel as DDP except ImportError: raise ImportError( "Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") model = DDP(model) elif n_gpu > 1: model = torch.nn.DataParallel(model) # Prepare optimizer param_optimizer = list(model.named_parameters()) no_decay = ['bias', 'LayerNorm.bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in param_optimizer if not any(nd in n for nd in no_decay)], 'weight_decay': 0.01}, {'params': [p for n, p in param_optimizer if any(nd in n for nd in no_decay)], 'weight_decay': 0.0} ] optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=num_train_optimization_steps) if args.fp16: try: # from apex.optimizers import FP16_Optimizer # from apex.optimizers import FusedAdam from apex import amp except ImportError: raise ImportError( "Please install apex from https://www.github.com/nvidia/apex to use distributed and fp16 training.") # This below line of code is the main upgrade of Apex Fp16 implementation. I chose opt_leve="01" # because it's recommended for typical use by Apex. We can make it configured model, optimizer = amp.initialize(model, optimizer, opt_level="O1") # We don't need to use FP16_Optimizer wrapping over FusedAdam as well. Now Apex supports all Pytorch Optimizer # optimizer = FusedAdam(optimizer_grouped_parameters, # lr=args.learning_rate, # bias_correction=False, # max_grad_norm=1.0) # if args.loss_scale == 0: # optimizer = FP16_Optimizer(optimizer, dynamic_loss_scale=True) # else: # optimizer = FP16_Optimizer(optimizer, static_loss_scale=args.loss_scale) # else: # optimizer = AdamW(optimizer_grouped_parameters, lr=args.learning_rate, eps=args.adam_epsilon) # scheduler = WarmupLinearSchedule(optimizer, warmup_steps=args.warmup_steps, t_total=num_train_optimization_steps) global_step = 0 logging.info("***** Running training *****") logging.info(f" Num examples = {total_train_examples}") logging.info(" Batch size = %d", args.train_batch_size) logging.info(" Num steps = %d", num_train_optimization_steps) model.train() for epoch in range(args.epochs): epoch_dataset = PregeneratedDataset(epoch=epoch, training_path=args.pregenerated_data, tokenizer=tokenizer, num_data_epochs=num_data_epochs, reduce_memory=args.reduce_memory) if args.local_rank == -1: train_sampler = RandomSampler(epoch_dataset) else: train_sampler = DistributedSampler(epoch_dataset) train_dataloader = DataLoader(epoch_dataset, sampler=train_sampler, batch_size=args.train_batch_size) tr_loss = 0 nb_tr_examples, nb_tr_steps = 0, 0 with tqdm(total=len(train_dataloader), desc=f"Epoch {epoch}") as pbar: for step, batch in enumerate(train_dataloader): batch = tuple(t.to(device) for t in batch) input_ids, input_mask, segment_ids, lm_label_ids, is_next = batch outputs = model(input_ids, segment_ids, input_mask, lm_label_ids, is_next) loss = outputs[0] if n_gpu > 1: loss = loss.mean() # mean() to average on multi-gpu. if args.gradient_accumulation_steps > 1: loss = loss / args.gradient_accumulation_steps if args.fp16: # I depricate FP16_Optimizer's backward func and replace as Apex document # optimizer.backward(loss) with amp.scale_loss(loss, optimizer) as scaled_loss: scaled_loss.backward() else: loss.backward() tr_loss += loss.item() nb_tr_examples += input_ids.size(0) nb_tr_steps += 1 pbar.update(1) mean_loss = tr_loss * args.gradient_accumulation_steps / nb_tr_steps pbar.set_postfix_str(f"Loss: {mean_loss:.5f}") if (step + 1) % args.gradient_accumulation_steps == 0: optimizer.step() scheduler.step() # Update learning rate schedule optimizer.zero_grad() global_step += 1 # Save a trained model if args.local_rank == -1 or torch.distributed.get_rank() == 0: logging.info("** ** * Saving fine-tuned model ** ** * ") model_to_save = model.module if hasattr(model, 'module') else model # Take care of distributed/parallel training model_to_save.save_pretrained(args.output_dir) tokenizer.save_pretrained(args.output_dir) if __name__ == '__main__': main()
16,878
47.642651
136
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/lm_finetuning/pregenerate_training_data.py
from argparse import ArgumentParser from pathlib import Path from tqdm import tqdm, trange from tempfile import TemporaryDirectory import shelve from multiprocessing import Pool from random import random, randrange, randint, shuffle, choice from pytorch_transformers.tokenization_bert import BertTokenizer import numpy as np import json import collections class DocumentDatabase: def __init__(self, reduce_memory=False): if reduce_memory: self.temp_dir = TemporaryDirectory() self.working_dir = Path(self.temp_dir.name) self.document_shelf_filepath = self.working_dir / 'shelf.db' self.document_shelf = shelve.open(str(self.document_shelf_filepath), flag='n', protocol=-1) self.documents = None else: self.documents = [] self.document_shelf = None self.document_shelf_filepath = None self.temp_dir = None self.doc_lengths = [] self.doc_cumsum = None self.cumsum_max = None self.reduce_memory = reduce_memory def add_document(self, document): if not document: return if self.reduce_memory: current_idx = len(self.doc_lengths) self.document_shelf[str(current_idx)] = document else: self.documents.append(document) self.doc_lengths.append(len(document)) def _precalculate_doc_weights(self): self.doc_cumsum = np.cumsum(self.doc_lengths) self.cumsum_max = self.doc_cumsum[-1] def sample_doc(self, current_idx, sentence_weighted=True): # Uses the current iteration counter to ensure we don't sample the same doc twice if sentence_weighted: # With sentence weighting, we sample docs proportionally to their sentence length if self.doc_cumsum is None or len(self.doc_cumsum) != len(self.doc_lengths): self._precalculate_doc_weights() rand_start = self.doc_cumsum[current_idx] rand_end = rand_start + self.cumsum_max - self.doc_lengths[current_idx] sentence_index = randrange(rand_start, rand_end) % self.cumsum_max sampled_doc_index = np.searchsorted(self.doc_cumsum, sentence_index, side='right') else: # If we don't use sentence weighting, then every doc has an equal chance to be chosen sampled_doc_index = (current_idx + randrange(1, len(self.doc_lengths))) % len(self.doc_lengths) assert sampled_doc_index != current_idx if self.reduce_memory: return self.document_shelf[str(sampled_doc_index)] else: return self.documents[sampled_doc_index] def __len__(self): return len(self.doc_lengths) def __getitem__(self, item): if self.reduce_memory: return self.document_shelf[str(item)] else: return self.documents[item] def __enter__(self): return self def __exit__(self, exc_type, exc_val, traceback): if self.document_shelf is not None: self.document_shelf.close() if self.temp_dir is not None: self.temp_dir.cleanup() def truncate_seq_pair(tokens_a, tokens_b, max_num_tokens): """Truncates a pair of sequences to a maximum sequence length. Lifted from Google's BERT repo.""" while True: total_length = len(tokens_a) + len(tokens_b) if total_length <= max_num_tokens: break trunc_tokens = tokens_a if len(tokens_a) > len(tokens_b) else tokens_b assert len(trunc_tokens) >= 1 # We want to sometimes truncate from the front and sometimes from the # back to add more randomness and avoid biases. if random() < 0.5: del trunc_tokens[0] else: trunc_tokens.pop() MaskedLmInstance = collections.namedtuple("MaskedLmInstance", ["index", "label"]) def create_masked_lm_predictions(tokens, masked_lm_prob, max_predictions_per_seq, whole_word_mask, vocab_list): """Creates the predictions for the masked LM objective. This is mostly copied from the Google BERT repo, but with several refactors to clean it up and remove a lot of unnecessary variables.""" cand_indices = [] for (i, token) in enumerate(tokens): if token == "[CLS]" or token == "[SEP]": continue # Whole Word Masking means that if we mask all of the wordpieces # corresponding to an original word. When a word has been split into # WordPieces, the first token does not have any marker and any subsequence # tokens are prefixed with ##. So whenever we see the ## token, we # append it to the previous set of word indexes. # # Note that Whole Word Masking does *not* change the training code # at all -- we still predict each WordPiece independently, softmaxed # over the entire vocabulary. if (whole_word_mask and len(cand_indices) >= 1 and token.startswith("##")): cand_indices[-1].append(i) else: cand_indices.append([i]) num_to_mask = min(max_predictions_per_seq, max(1, int(round(len(tokens) * masked_lm_prob)))) shuffle(cand_indices) masked_lms = [] covered_indexes = set() for index_set in cand_indices: if len(masked_lms) >= num_to_mask: break # If adding a whole-word mask would exceed the maximum number of # predictions, then just skip this candidate. if len(masked_lms) + len(index_set) > num_to_mask: continue is_any_index_covered = False for index in index_set: if index in covered_indexes: is_any_index_covered = True break if is_any_index_covered: continue for index in index_set: covered_indexes.add(index) masked_token = None # 80% of the time, replace with [MASK] if random() < 0.8: masked_token = "[MASK]" else: # 10% of the time, keep original if random() < 0.5: masked_token = tokens[index] # 10% of the time, replace with random word else: masked_token = choice(vocab_list) masked_lms.append(MaskedLmInstance(index=index, label=tokens[index])) tokens[index] = masked_token assert len(masked_lms) <= num_to_mask masked_lms = sorted(masked_lms, key=lambda x: x.index) mask_indices = [p.index for p in masked_lms] masked_token_labels = [p.label for p in masked_lms] return tokens, mask_indices, masked_token_labels def create_instances_from_document( doc_database, doc_idx, max_seq_length, short_seq_prob, masked_lm_prob, max_predictions_per_seq, whole_word_mask, vocab_list): """This code is mostly a duplicate of the equivalent function from Google BERT's repo. However, we make some changes and improvements. Sampling is improved and no longer requires a loop in this function. Also, documents are sampled proportionally to the number of sentences they contain, which means each sentence (rather than each document) has an equal chance of being sampled as a false example for the NextSentence task.""" document = doc_database[doc_idx] # Account for [CLS], [SEP], [SEP] max_num_tokens = max_seq_length - 3 # We *usually* want to fill up the entire sequence since we are padding # to `max_seq_length` anyways, so short sequences are generally wasted # computation. However, we *sometimes* # (i.e., short_seq_prob == 0.1 == 10% of the time) want to use shorter # sequences to minimize the mismatch between pre-training and fine-tuning. # The `target_seq_length` is just a rough target however, whereas # `max_seq_length` is a hard limit. target_seq_length = max_num_tokens if random() < short_seq_prob: target_seq_length = randint(2, max_num_tokens) # We DON'T just concatenate all of the tokens from a document into a long # sequence and choose an arbitrary split point because this would make the # next sentence prediction task too easy. Instead, we split the input into # segments "A" and "B" based on the actual "sentences" provided by the user # input. instances = [] current_chunk = [] current_length = 0 i = 0 while i < len(document): segment = document[i] current_chunk.append(segment) current_length += len(segment) if i == len(document) - 1 or current_length >= target_seq_length: if current_chunk: # `a_end` is how many segments from `current_chunk` go into the `A` # (first) sentence. a_end = 1 if len(current_chunk) >= 2: a_end = randrange(1, len(current_chunk)) tokens_a = [] for j in range(a_end): tokens_a.extend(current_chunk[j]) tokens_b = [] # Random next if len(current_chunk) == 1 or random() < 0.5: is_random_next = True target_b_length = target_seq_length - len(tokens_a) # Sample a random document, with longer docs being sampled more frequently random_document = doc_database.sample_doc(current_idx=doc_idx, sentence_weighted=True) random_start = randrange(0, len(random_document)) for j in range(random_start, len(random_document)): tokens_b.extend(random_document[j]) if len(tokens_b) >= target_b_length: break # We didn't actually use these segments so we "put them back" so # they don't go to waste. num_unused_segments = len(current_chunk) - a_end i -= num_unused_segments # Actual next else: is_random_next = False for j in range(a_end, len(current_chunk)): tokens_b.extend(current_chunk[j]) truncate_seq_pair(tokens_a, tokens_b, max_num_tokens) assert len(tokens_a) >= 1 assert len(tokens_b) >= 1 tokens = ["[CLS]"] + tokens_a + ["[SEP]"] + tokens_b + ["[SEP]"] # The segment IDs are 0 for the [CLS] token, the A tokens and the first [SEP] # They are 1 for the B tokens and the final [SEP] segment_ids = [0 for _ in range(len(tokens_a) + 2)] + [1 for _ in range(len(tokens_b) + 1)] tokens, masked_lm_positions, masked_lm_labels = create_masked_lm_predictions( tokens, masked_lm_prob, max_predictions_per_seq, whole_word_mask, vocab_list) instance = { "tokens": tokens, "segment_ids": segment_ids, "is_random_next": is_random_next, "masked_lm_positions": masked_lm_positions, "masked_lm_labels": masked_lm_labels} instances.append(instance) current_chunk = [] current_length = 0 i += 1 return instances def create_training_file(docs, vocab_list, args, epoch_num): epoch_filename = args.output_dir / "epoch_{}.json".format(epoch_num) num_instances = 0 with epoch_filename.open('w') as epoch_file: for doc_idx in trange(len(docs), desc="Document"): doc_instances = create_instances_from_document( docs, doc_idx, max_seq_length=args.max_seq_len, short_seq_prob=args.short_seq_prob, masked_lm_prob=args.masked_lm_prob, max_predictions_per_seq=args.max_predictions_per_seq, whole_word_mask=args.do_whole_word_mask, vocab_list=vocab_list) doc_instances = [json.dumps(instance) for instance in doc_instances] for instance in doc_instances: epoch_file.write(instance + '\n') num_instances += 1 metrics_file = args.output_dir / "epoch_{}_metrics.json".format(epoch_num) with metrics_file.open('w') as metrics_file: metrics = { "num_training_examples": num_instances, "max_seq_len": args.max_seq_len } metrics_file.write(json.dumps(metrics)) def main(): parser = ArgumentParser() parser.add_argument('--train_corpus', type=Path, required=True) parser.add_argument("--output_dir", type=Path, required=True) parser.add_argument("--bert_model", type=str, required=True, choices=["bert-base-uncased", "bert-large-uncased", "bert-base-cased", "bert-base-multilingual-uncased", "bert-base-chinese", "bert-base-multilingual-cased"]) parser.add_argument("--do_lower_case", action="store_true") parser.add_argument("--do_whole_word_mask", action="store_true", help="Whether to use whole word masking rather than per-WordPiece masking.") parser.add_argument("--reduce_memory", action="store_true", help="Reduce memory usage for large datasets by keeping data on disc rather than in memory") parser.add_argument("--num_workers", type=int, default=1, help="The number of workers to use to write the files") parser.add_argument("--epochs_to_generate", type=int, default=3, help="Number of epochs of data to pregenerate") parser.add_argument("--max_seq_len", type=int, default=128) parser.add_argument("--short_seq_prob", type=float, default=0.1, help="Probability of making a short sentence as a training example") parser.add_argument("--masked_lm_prob", type=float, default=0.15, help="Probability of masking each token for the LM task") parser.add_argument("--max_predictions_per_seq", type=int, default=20, help="Maximum number of tokens to mask in each sequence") args = parser.parse_args() if args.num_workers > 1 and args.reduce_memory: raise ValueError("Cannot use multiple workers while reducing memory") tokenizer = BertTokenizer.from_pretrained(args.bert_model, do_lower_case=args.do_lower_case) vocab_list = list(tokenizer.vocab.keys()) with DocumentDatabase(reduce_memory=args.reduce_memory) as docs: with args.train_corpus.open() as f: doc = [] for line in tqdm(f, desc="Loading Dataset", unit=" lines"): line = line.strip() if line == "": docs.add_document(doc) doc = [] else: tokens = tokenizer.tokenize(line) if tokens: doc.append(tokens) if doc: docs.add_document(doc) # If the last doc didn't end on a newline, make sure it still gets added if len(docs) <= 1: exit("ERROR: No document breaks were found in the input file! These are necessary to allow the script to " "ensure that random NextSentences are not sampled from the same document. Please add blank lines to " "indicate breaks between documents in your input file. If your dataset does not contain multiple " "documents, blank lines can be inserted at any natural boundary, such as the ends of chapters, " "sections or paragraphs.") args.output_dir.mkdir(exist_ok=True) if args.num_workers > 1: writer_workers = Pool(min(args.num_workers, args.epochs_to_generate)) arguments = [(docs, vocab_list, args, idx) for idx in range(args.epochs_to_generate)] writer_workers.starmap(create_training_file, arguments) else: for epoch in trange(args.epochs_to_generate, desc="Epoch"): create_training_file(docs, vocab_list, args, epoch) if __name__ == '__main__': main()
16,307
44.808989
120
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/utils.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team and Facebook, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Utils to train DistilBERT adapted in part from Facebook, Inc XLM model (https://github.com/facebookresearch/XLM) """ import git import json import os import socket import torch import numpy as np import logging logging.basicConfig(format = '%(asctime)s - %(levelname)s - %(name)s - PID: %(process)d - %(message)s', datefmt = '%m/%d/%Y %H:%M:%S', level = logging.INFO) logger = logging.getLogger(__name__) def git_log(folder_path: str): """ Log commit info. """ repo = git.Repo(search_parent_directories=True) repo_infos = { 'repo_id': str(repo), 'repo_sha': str(repo.head.object.hexsha), 'repo_branch': str(repo.active_branch) } with open(os.path.join(folder_path, 'git_log.json'), 'w') as f: json.dump(repo_infos, f, indent=4) def init_gpu_params(params): """ Handle single and multi-GPU / multi-node. """ if params.n_gpu <= 0: params.local_rank = 0 params.master_port = -1 params.is_master = True params.multi_gpu = False return assert torch.cuda.is_available() logger.info('Initializing GPUs') if params.n_gpu > 1: assert params.local_rank != -1 params.world_size = int(os.environ['WORLD_SIZE']) params.n_gpu_per_node = int(os.environ['N_GPU_NODE']) params.global_rank = int(os.environ['RANK']) # number of nodes / node ID params.n_nodes = params.world_size // params.n_gpu_per_node params.node_id = params.global_rank // params.n_gpu_per_node params.multi_gpu = True assert params.n_nodes == int(os.environ['N_NODES']) assert params.node_id == int(os.environ['NODE_RANK']) # local job (single GPU) else: assert params.local_rank == -1 params.n_nodes = 1 params.node_id = 0 params.local_rank = 0 params.global_rank = 0 params.world_size = 1 params.n_gpu_per_node = 1 params.multi_gpu = False # sanity checks assert params.n_nodes >= 1 assert 0 <= params.node_id < params.n_nodes assert 0 <= params.local_rank <= params.global_rank < params.world_size assert params.world_size == params.n_nodes * params.n_gpu_per_node # define whether this is the master process / if we are in multi-node distributed mode params.is_master = params.node_id == 0 and params.local_rank == 0 params.multi_node = params.n_nodes > 1 # summary PREFIX = f"--- Global rank: {params.global_rank} - " logger.info(PREFIX + "Number of nodes: %i" % params.n_nodes) logger.info(PREFIX + "Node ID : %i" % params.node_id) logger.info(PREFIX + "Local rank : %i" % params.local_rank) logger.info(PREFIX + "World size : %i" % params.world_size) logger.info(PREFIX + "GPUs per node : %i" % params.n_gpu_per_node) logger.info(PREFIX + "Master : %s" % str(params.is_master)) logger.info(PREFIX + "Multi-node : %s" % str(params.multi_node)) logger.info(PREFIX + "Multi-GPU : %s" % str(params.multi_gpu)) logger.info(PREFIX + "Hostname : %s" % socket.gethostname()) # set GPU device torch.cuda.set_device(params.local_rank) # initialize multi-GPU if params.multi_gpu: logger.info("Initializing PyTorch distributed") torch.distributed.init_process_group( init_method='env://', backend='nccl', ) def set_seed(args): """ Set the random seed. """ np.random.seed(args.seed) torch.manual_seed(args.seed) if args.n_gpu > 0: torch.cuda.manual_seed_all(args.seed)
4,308
32.146154
104
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/dataset.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team and Facebook, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Dataloaders to train DistilBERT adapted in part from Facebook, Inc XLM model (https://github.com/facebookresearch/XLM) """ from typing import List import math from itertools import chain from collections import Counter import numpy as np import torch from utils import logger class Dataset: def __init__(self, params, data): self.params = params self.tokens_per_batch = params.tokens_per_batch self.batch_size = params.batch_size self.shuffle = params.shuffle self.group_by_size = params.group_by_size self.token_ids = np.array(data) self.lengths = np.uint16([len(t) for t in data]) self.check() self.remove_long_sequences() self.remove_empty_sequences() self.check() self.print_statistics() def __len__(self): return len(self.lengths) def check(self): """ Some sanity checks """ assert len(self.token_ids) == len(self.lengths) def remove_long_sequences(self): """ Sequences that are too long are splitted by chunk of max_position_embeddings. """ indices = self.lengths >= self.params.max_position_embeddings logger.info(f'Splitting {sum(indices)} too long sequences.') def divide_chunks(l, n): return [l[i:i + n] for i in range(0, len(l), n)] new_tok_ids = [] new_lengths = [] cls_id, sep_id = self.params.special_tok_ids['cls_token'], self.params.special_tok_ids['sep_token'] max_len = self.params.max_position_embeddings for seq_, len_ in zip(self.token_ids, self.lengths): if len_ <= max_len: new_tok_ids.append(seq_) new_lengths.append(len_) else: sub_seqs = [] for sub_s in divide_chunks(seq_, max_len-2): if sub_s[0] != cls_id: sub_s = np.insert(sub_s, 0, cls_id) if sub_s[-1] != sep_id: sub_s = np.insert(sub_s, len(sub_s), cls_id) assert len(sub_s) <= max_len sub_seqs.append(sub_s) new_tok_ids.extend(sub_seqs) new_lengths.extend([len(l) for l in sub_seqs]) self.token_ids = np.array(new_tok_ids) self.lengths = np.array(new_lengths) def remove_empty_sequences(self): """ Too short sequences are simply removed. This could be tunedd. """ init_size = len(self) indices = self.lengths > 5 self.token_ids = self.token_ids[indices] self.lengths = self.lengths[indices] new_size = len(self) logger.info(f'Remove {init_size - new_size} too short (<=5 tokens) sequences.') def print_statistics(self): """ Print some statistics on the corpus. Only the master process. """ if not self.params.is_master: return logger.info(f'{len(self)} sequences') # data_len = sum(self.lengths) # nb_unique_tokens = len(Counter(list(chain(*self.token_ids)))) # logger.info(f'{data_len} tokens ({nb_unique_tokens} unique)') # unk_idx = self.params.special_tok_ids['unk_token'] # nb_unkown = sum([(t==unk_idx).sum() for t in self.token_ids]) # logger.info(f'{nb_unkown} unknown tokens (covering {100*nb_unkown/data_len:.2f}% of the data)') def select_data(self, a: int, b: int): """ Select a subportion of the data. """ n_sequences = len(self) assert 0 <= a < b <= n_sequences, ValueError(f'`0 <= a < b <= n_sequences` is not met with a={a} and b={b}') logger.info(f'Selecting sequences from {a} to {b} (excluded).') self.token_ids = self.token_ids[a:b] self.lengths = self.lengths[a:b] self.check() def split(self): """ Distributed training: split the data accross the processes. """ assert self.params.n_gpu > 1 logger.info('Splitting the data accross the processuses.') n_seq = len(self) n_seq_per_procesus = n_seq // self.params.world_size a = n_seq_per_procesus * self.params.global_rank b = a + n_seq_per_procesus self.select_data(a=a, b=b) def batch_sequences(self, token_ids: List[List[int]], lengths: List[int]): """ Do the padding and transform into torch.tensor. """ assert len(token_ids) == len(lengths) # Max for paddings max_seq_len_ = max(lengths) # Pad token ids pad_idx = self.params.special_tok_ids['pad_token'] tk_ = [list(t.astype(int)) + [pad_idx]*(max_seq_len_-len(t)) for t in token_ids] assert len(tk_) == len(token_ids) assert all(len(t) == max_seq_len_ for t in tk_) tk_t = torch.tensor(tk_) # (bs, max_seq_len_) lg_t = torch.tensor(lengths.astype(int)) # (bs) return tk_t, lg_t def get_batches_iterator(self, batches): """ Return an iterator over batches. """ for sequences_ids in batches: token_ids, lengths = self.batch_sequences(self.token_ids[sequences_ids], self.lengths[sequences_ids]) yield (token_ids, lengths) def get_iterator(self, seed: int = None): """ Return a data iterator. """ rng = np.random.RandomState(seed) n_sequences = len(self) indices = np.arange(n_sequences) if self.group_by_size: indices = indices[np.argsort(self.lengths[indices], kind='mergesort')] if self.tokens_per_batch == -1: batches = np.array_split(indices, math.ceil(len(indices) * 1. / self.batch_size)) else: assert self.tokens_per_batch > 0 batch_ids = np.cumsum(self.lengths[indices]) // self.tokens_per_batch _, bounds = np.unique(batch_ids, return_index=True) batches = [indices[bounds[i]:bounds[i + 1]] for i in range(len(bounds) - 1)] if bounds[-1] < len(indices): batches.append(indices[bounds[-1]:]) if self.shuffle: rng.shuffle(batches) assert n_sequences == sum([len(x) for x in batches]) assert self.lengths[indices].sum() == sum([self.lengths[x].sum() for x in batches]) return self.get_batches_iterator(batches=batches)
7,257
34.930693
116
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/train.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Training DistilBERT. """ import os import argparse import pickle import json import shutil import numpy as np import torch from pytorch_transformers import BertTokenizer, BertForMaskedLM from pytorch_transformers import DistilBertForMaskedLM, DistilBertConfig from distiller import Distiller from utils import git_log, logger, init_gpu_params, set_seed from dataset import Dataset def main(): parser = argparse.ArgumentParser(description="Training") parser.add_argument("--dump_path", type=str, required=True, help="The output directory (log, checkpoints, parameters, etc.)") parser.add_argument("--data_file", type=str, required=True, help="The binarized file (tokenized + tokens_to_ids) and grouped by sequence.") parser.add_argument("--token_counts", type=str, required=True, help="The token counts in the data_file for MLM.") parser.add_argument("--force", action='store_true', help="Overwrite dump_path if it already exists.") parser.add_argument("--vocab_size", default=30522, type=int, help="The vocabulary size.") parser.add_argument("--max_position_embeddings", default=512, type=int, help="Maximum sequence length we can model (including [CLS] and [SEP]).") parser.add_argument("--sinusoidal_pos_embds", action='store_false', help="If true, the position embeddings are simply fixed with sinusoidal embeddings.") parser.add_argument("--n_layers", default=6, type=int, help="Number of Transformer blocks.") parser.add_argument("--n_heads", default=12, type=int, help="Number of heads in the self-attention module.") parser.add_argument("--dim", default=768, type=int, help="Dimension through the network. Must be divisible by n_heads") parser.add_argument("--hidden_dim", default=3072, type=int, help="Intermediate dimension in the FFN.") parser.add_argument("--dropout", default=0.1, type=float, help="Dropout.") parser.add_argument("--attention_dropout", default=0.1, type=float, help="Dropout in self-attention.") parser.add_argument("--activation", default='gelu', type=str, help="Activation to use in self-attention") parser.add_argument("--tie_weights_", action='store_false', help="If true, we tie the embeddings matrix with the projection over the vocabulary matrix. Default is true.") parser.add_argument("--from_pretrained_weights", default=None, type=str, help="Load student initialization checkpoint.") parser.add_argument("--from_pretrained_config", default=None, type=str, help="Load student initialization architecture config.") parser.add_argument("--bert_model", default='bert-base-uncased', type=str, help="The teacher BERT model.") parser.add_argument("--temperature", default=2., type=float, help="Temperature for the softmax temperature.") parser.add_argument("--alpha_ce", default=0.5, type=float, help="Linear weight for the distillation loss. Must be >=0.") parser.add_argument("--alpha_mlm", default=0.5, type=float, help="Linear weight for the MLM loss. Must be >=0.") parser.add_argument("--alpha_mse", default=0.0, type=float, help="Linear weight of the MSE loss. Must be >=0.") parser.add_argument("--mlm_mask_prop", default=0.15, type=float, help="Proportion of tokens for which we need to make a prediction.") parser.add_argument("--word_mask", default=0.8, type=float, help="Proportion of tokens to mask out.") parser.add_argument("--word_keep", default=0.1, type=float, help="Proportion of tokens to keep.") parser.add_argument("--word_rand", default=0.1, type=float, help="Proportion of tokens to randomly replace.") parser.add_argument("--mlm_smoothing", default=0.7, type=float, help="Smoothing parameter to emphasize more rare tokens (see XLM, similar to word2vec).") parser.add_argument("--restrict_ce_to_mask", action='store_true', help="If true, compute the distilation loss only the [MLM] prediction distribution.") parser.add_argument("--n_epoch", type=int, default=3, help="Number of pass on the whole dataset.") parser.add_argument("--batch_size", type=int, default=5, help="Batch size (for each process).") parser.add_argument("--tokens_per_batch", type=int, default=-1, help="If specified, modify the batches so that they have approximately this number of tokens.") parser.add_argument("--shuffle", action='store_false', help="If true, shuffle the sequence order. Default is true.") parser.add_argument("--group_by_size", action='store_false', help="If true, group sequences that have similar length into the same batch. Default is true.") parser.add_argument("--gradient_accumulation_steps", type=int, default=50, help="Gradient accumulation for larger training batches.") parser.add_argument("--warmup_prop", default=0.05, type=float, help="Linear warmup proportion.") parser.add_argument("--weight_decay", default=0.0, type=float, help="Weight deay if we apply some.") parser.add_argument("--learning_rate", default=5e-4, type=float, help="The initial learning rate for Adam.") parser.add_argument("--adam_epsilon", default=1e-6, type=float, help="Epsilon for Adam optimizer.") parser.add_argument("--max_grad_norm", default=5.0, type=float, help="Max gradient norm.") parser.add_argument("--initializer_range", default=0.02, type=float, help="Random initialization range.") parser.add_argument('--fp16', action='store_true', help="Whether to use 16-bit (mixed) precision (through NVIDIA apex) instead of 32-bit") parser.add_argument('--fp16_opt_level', type=str, default='O1', help="For fp16: Apex AMP optimization level selected in ['O0', 'O1', 'O2', and 'O3']." "See details at https://nvidia.github.io/apex/amp.html") parser.add_argument("--n_gpu", type=int, default=1, help="Number of GPUs in the node.") parser.add_argument("--local_rank", type=int, default=-1, help="Distributed training - Local rank") parser.add_argument("--seed", type=int, default=56, help="Random seed") parser.add_argument("--log_interval", type=int, default=500, help="Tensorboard logging interval.") parser.add_argument("--checkpoint_interval", type=int, default=4000, help="Checkpoint interval.") args = parser.parse_args() ## ARGS ## init_gpu_params(args) set_seed(args) if args.is_master: if os.path.exists(args.dump_path): if not args.force: raise ValueError(f'Serialization dir {args.dump_path} already exists, but you have not precised wheter to overwrite it' 'Use `--force` if you want to overwrite it') else: shutil.rmtree(args.dump_path) if not os.path.exists(args.dump_path): os.makedirs(args.dump_path) logger.info(f'Experiment will be dumped and logged in {args.dump_path}') ### SAVE PARAMS ### logger.info(f'Param: {args}') with open(os.path.join(args.dump_path, 'parameters.json'), 'w') as f: json.dump(vars(args), f, indent=4) git_log(args.dump_path) assert (args.from_pretrained_weights is None and args.from_pretrained_config is None) or \ (args.from_pretrained_weights is not None and args.from_pretrained_config is not None) ### TOKENIZER ### bert_tokenizer = BertTokenizer.from_pretrained(args.bert_model) special_tok_ids = {} for tok_name, tok_symbol in bert_tokenizer.special_tokens_map.items(): idx = bert_tokenizer.all_special_tokens.index(tok_symbol) special_tok_ids[tok_name] = bert_tokenizer.all_special_ids[idx] logger.info(f'Special tokens {special_tok_ids}') args.special_tok_ids = special_tok_ids ## DATA LOADER ## logger.info(f'Loading data from {args.data_file}') with open(args.data_file, 'rb') as fp: data = pickle.load(fp) assert os.path.isfile(args.token_counts) logger.info(f'Loading token counts from {args.token_counts} (already pre-computed)') with open(args.token_counts, 'rb') as fp: counts = pickle.load(fp) assert len(counts) == args.vocab_size token_probs = np.maximum(counts, 1) ** -args.mlm_smoothing for idx in special_tok_ids.values(): token_probs[idx] = 0. # do not predict special tokens token_probs = torch.from_numpy(token_probs) train_dataloader = Dataset(params=args, data=data) logger.info(f'Data loader created.') ## STUDENT ## if args.from_pretrained_weights is not None: assert os.path.isfile(os.path.join(args.from_pretrained_weights)) assert os.path.isfile(os.path.join(args.from_pretrained_config)) logger.info(f'Loading pretrained weights from {args.from_pretrained_weights}') logger.info(f'Loading pretrained config from {args.from_pretrained_config}') stu_architecture_config = DistilBertConfig.from_json_file(args.from_pretrained_config) student = DistilBertForMaskedLM.from_pretrained(args.from_pretrained_weights, config=stu_architecture_config) else: args.vocab_size_or_config_json_file = args.vocab_size stu_architecture_config = DistilBertConfig(**vars(args)) student = DistilBertForMaskedLM(stu_architecture_config) if args.n_gpu > 0: student.to(f'cuda:{args.local_rank}') logger.info(f'Student loaded.') ## TEACHER ## teacher = BertForMaskedLM.from_pretrained(args.bert_model) if args.n_gpu > 0: teacher.to(f'cuda:{args.local_rank}') logger.info(f'Teacher loaded from {args.bert_model}.') ## DISTILLER ## torch.cuda.empty_cache() distiller = Distiller(params=args, dataloader=train_dataloader, token_probs=token_probs, student=student, teacher=teacher) distiller.train() logger.info("Let's go get some drinks.") if __name__ == "__main__": main()
11,687
48.316456
135
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/distiller.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team and Facebook, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ The distiller to distil DistilBERT adapted in part from Facebook, Inc XLM model (https://github.com/facebookresearch/XLM) """ import os import math import psutil from tensorboardX import SummaryWriter from tqdm import trange, tqdm import numpy as np import torch import torch.nn as nn import torch.nn.functional as F from pytorch_transformers import AdamW, WarmupLinearSchedule from utils import logger from dataset import Dataset class Distiller: def __init__(self, params: dict, dataloader: Dataset, token_probs: torch.tensor, student: nn.Module, teacher: nn.Module): logger.info('Initializing Distiller') self.params = params self.dump_path = params.dump_path self.multi_gpu = params.multi_gpu self.fp16 = params.fp16 self.student = student self.teacher = teacher self.dataloader = dataloader if self.params.n_gpu > 1: self.dataloader.split() self.get_iterator(seed=params.seed) self.temperature = params.temperature assert self.temperature > 0. self.alpha_ce = params.alpha_ce self.alpha_mlm = params.alpha_mlm self.alpha_mse = params.alpha_mse assert self.alpha_ce >= 0. assert self.alpha_mlm >= 0. assert self.alpha_mse >= 0. assert self.alpha_ce + self.alpha_mlm + self.alpha_mse > 0. self.mlm_mask_prop = params.mlm_mask_prop assert 0.0 <= self.mlm_mask_prop <= 1.0 assert params.word_mask + params.word_keep + params.word_rand == 1.0 self.pred_probs = torch.FloatTensor([params.word_mask, params.word_keep, params.word_rand]) self.pred_probs = self.pred_probs.to(f'cuda:{params.local_rank}') if params.n_gpu > 0 else self.pred_probs self.token_probs = token_probs.to(f'cuda:{params.local_rank}') if params.n_gpu > 0 else token_probs if self.fp16: self.pred_probs = self.pred_probs.half() self.token_probs = self.token_probs.half() self.epoch = 0 self.n_iter = 0 self.n_total_iter = 0 self.n_sequences_epoch = 0 self.total_loss_epoch = 0 self.last_loss = 0 self.last_loss_ce = 0 self.last_loss_mlm = 0 self.last_loss_mse = 0 self.ce_loss_fct = nn.KLDivLoss(reduction='batchmean') self.mlm_loss_fct = nn.CrossEntropyLoss(ignore_index=-1) self.mse_loss_fct = nn.MSELoss(reduction='sum') logger.info('--- Initializing model optimizer') assert params.gradient_accumulation_steps >= 1 self.num_steps_epoch = int(len(self.dataloader) / params.batch_size) + 1 num_train_optimization_steps = int(self.num_steps_epoch / params.gradient_accumulation_steps * params.n_epoch) + 1 warmup_steps = math.ceil(num_train_optimization_steps * params.warmup_prop) no_decay = ['bias', 'LayerNorm.weight'] optimizer_grouped_parameters = [ {'params': [p for n, p in student.named_parameters() if not any(nd in n for nd in no_decay) and p.requires_grad], 'weight_decay': params.weight_decay}, {'params': [p for n, p in student.named_parameters() if any(nd in n for nd in no_decay) and p.requires_grad], 'weight_decay': 0.0} ] logger.info("------ Number of trainable parameters (student): %i" % sum([p.numel() for p in self.student.parameters() if p.requires_grad])) logger.info("------ Number of parameters (student): %i" % sum([p.numel() for p in self.student.parameters()])) self.optimizer = AdamW(optimizer_grouped_parameters, lr=params.learning_rate, eps=params.adam_epsilon, betas=(0.9, 0.98)) self.scheduler = WarmupLinearSchedule(self.optimizer, warmup_steps=warmup_steps, t_total=num_train_optimization_steps) if self.fp16: try: from apex import amp except ImportError: raise ImportError("Please install apex from https://www.github.com/nvidia/apex to use fp16 training.") logger.info(f"Using fp16 training: {self.params.fp16_opt_level} level") self.student, self.optimizer = amp.initialize(self.student, self.optimizer, opt_level=self.params.fp16_opt_level) self.teacher = self.teacher.half() if self.multi_gpu: if self.fp16: from apex.parallel import DistributedDataParallel logger.info("Using apex.parallel.DistributedDataParallel for distributed training.") self.student = DistributedDataParallel(self.student) else: from torch.nn.parallel import DistributedDataParallel logger.info("Using nn.parallel.DistributedDataParallel for distributed training.") self.student = DistributedDataParallel(self.student, device_ids=[params.local_rank], output_device=params.local_rank) self.is_master = params.is_master if self.is_master: logger.info('--- Initializing Tensorboard') self.tensorboard = SummaryWriter(log_dir=os.path.join(self.dump_path, 'log', 'train')) self.tensorboard.add_text(tag='config', text_string=str(self.params), global_step=0) def get_iterator(self, seed: int = None): """ Initialize the data iterator. Each process has its own data iterator (iterating on his own random portion of the dataset). Input: ------ seed: `int` - The random seed. """ logger.info('--- Initializing Data Iterator') self.data_iterator = self.dataloader.get_iterator(seed=seed) def get_batch(self): """ Call the data iterator to output a new batch. If the data iterator went through the whole dataset, create a new iterator. """ assert hasattr(self, 'data_iterator') try: x = next(self.data_iterator) except StopIteration: logger.warning('--- Went through the whole dataset. Creating new data iterator.') self.data_iterator = self.dataloader.get_iterator() x = next(self.data_iterator) return x def prepare_batch(self, batch): """ Prepare the batch: from the token_ids and the lenghts, compute the attention mask and the masked label for MLM. Input: ------ batch: `Tuple` token_ids: `torch.tensor(bs, seq_length)` - The token ids for each of the sequence. It is padded. lengths: `torch.tensor(bs)` - The lengths of each of the sequences in the batch. Output: ------- token_ids: `torch.tensor(bs, seq_length)` - The token ids after the modifications for MLM. attn_mask: `torch.tensor(bs, seq_length)` - The attention mask for the self-attention. mlm_labels: `torch.tensor(bs, seq_length)` - The masked languge modeling labels. There is a -1 where there is nothing to predict. """ token_ids, lengths = batch token_ids, lengths = self.round_batch(x=token_ids, lengths=lengths) assert token_ids.size(0) == lengths.size(0) attn_mask = (torch.arange(token_ids.size(1), dtype=torch.long, device=lengths.device) < lengths[:, None]) bs, max_seq_len = token_ids.size() mlm_labels = token_ids.new(token_ids.size()).copy_(token_ids) x_prob = self.token_probs[token_ids.flatten()] n_tgt = math.ceil(self.mlm_mask_prop * lengths.sum().item()) tgt_ids = torch.multinomial(x_prob / x_prob.sum(), n_tgt, replacement=False) pred_mask = torch.zeros(bs * max_seq_len, dtype=torch.bool, device=token_ids.device) # previously `dtype=torch.uint8`, cf pytorch 1.2.0 compatibility pred_mask[tgt_ids] = 1 pred_mask = pred_mask.view(bs, max_seq_len) pred_mask[token_ids == self.params.special_tok_ids['pad_token']] = 0 # mask a number of words == 0 [8] (faster with fp16) if self.fp16: n1 = pred_mask.sum().item() if n1 > 8: pred_mask = pred_mask.view(-1) n2 = max(n1 % 8, 8 * (n1 // 8)) if n2 != n1: pred_mask[torch.nonzero(pred_mask).view(-1)[:n1-n2]] = 0 pred_mask = pred_mask.view(bs, max_seq_len) assert pred_mask.sum().item() % 8 == 0, pred_mask.sum().item() _token_ids_real = token_ids[pred_mask] _token_ids_rand = _token_ids_real.clone().random_(self.params.vocab_size) _token_ids_mask = _token_ids_real.clone().fill_(self.params.special_tok_ids['mask_token']) probs = torch.multinomial(self.pred_probs, len(_token_ids_real), replacement=True) _token_ids = _token_ids_mask * (probs == 0).long() + _token_ids_real * (probs == 1).long() + _token_ids_rand * (probs == 2).long() token_ids = token_ids.masked_scatter(pred_mask, _token_ids) mlm_labels[~pred_mask] = -1 # previously `mlm_labels[1-pred_mask] = -1`, cf pytorch 1.2.0 compatibility return token_ids, attn_mask, mlm_labels def round_batch(self, x: torch.tensor, lengths: torch.tensor): """ For float16 only. Sub-sample sentences in a batch, and add padding, so that each dimension is a multiple of 8. Input: ------ x: `torch.tensor(bs, seq_length)` - The token ids. lengths: `torch.tensor(bs, seq_length)` - The lengths of each of the sequence in the batch. Output: ------- x: `torch.tensor(new_bs, new_seq_length)` - The updated token ids. lengths: `torch.tensor(new_bs, new_seq_length)` - The updated lengths. """ if not self.fp16 or len(lengths) < 8: return x, lengths # number of sentences == 0 [8] bs1 = len(lengths) bs2 = 8 * (bs1 // 8) assert bs2 > 0 and bs2 % 8 == 0 if bs1 != bs2: idx = torch.randperm(bs1)[:bs2] lengths = lengths[idx] slen = lengths.max().item() x = x[idx, :slen] else: idx = None # sequence length == 0 [8] ml1 = x.size(1) if ml1 % 8 != 0: pad = 8 - (ml1 % 8) ml2 = ml1 + pad pad_id = self.params.special_tok_ids['pad_token'] padding_tensor = torch.zeros(bs2, pad, dtype=torch.long, device=x.device).fill_(pad_id) x = torch.cat([x, padding_tensor], 1) assert x.size() == (bs2, ml2) assert x.size(0) % 8 == 0 assert x.size(1) % 8 == 0 return x, lengths def train(self): """ The real training loop. """ if self.is_master: logger.info('Starting training') self.student.train() self.teacher.eval() for _ in range(self.params.n_epoch): if self.is_master: logger.info(f'--- Starting epoch {self.epoch}/{self.params.n_epoch-1}') iter_bar = trange(self.num_steps_epoch, desc="-Iter", disable=self.params.local_rank not in [-1, 0]) for __ in range(self.num_steps_epoch): batch = self.get_batch() if self.params.n_gpu > 0: batch = tuple(t.to(f'cuda:{self.params.local_rank}') for t in batch) token_ids, attn_mask, mlm_labels = self.prepare_batch(batch=batch) self.step(input_ids=token_ids, attention_mask=attn_mask, mlm_labels=mlm_labels) iter_bar.update() iter_bar.set_postfix({'Last_loss': f'{self.last_loss:.2f}', 'Avg_cum_loss': f'{self.total_loss_epoch/self.n_iter:.2f}'}) iter_bar.close() if self.is_master: logger.info(f'--- Ending epoch {self.epoch}/{self.params.n_epoch-1}') self.end_epoch() if self.is_master: logger.info(f'Save very last checkpoint as `pytorch_model.bin`.') self.save_checkpoint(checkpoint_name=f'pytorch_model.bin') logger.info('Training is finished') def step(self, input_ids: torch.tensor, attention_mask: torch.tensor, mlm_labels: torch.tensor): """ One optimization step: forward of student AND teacher, backward on the loss (for gradient accumulation), and possibly a parameter update (depending on the gradient accumulation). Input: ------ input_ids: `torch.tensor(bs, seq_length)` - The token ids. attention_mask: `torch.tensor(bs, seq_length)` - The attention mask for self attention. mlm_labels: `torch.tensor(bs, seq_length)` - The masked language modeling labels. """ s_logits = self.student(input_ids=input_ids, attention_mask=attention_mask)[0] # (bs, seq_length, voc_size) with torch.no_grad(): t_logits = self.teacher(input_ids=input_ids, attention_mask=attention_mask)[0] # (bs, seq_length, voc_size) assert s_logits.size() == t_logits.size() #https://github.com/peterliht/knowledge-distillation-pytorch/blob/master/model/net.py#L100 #https://github.com/peterliht/knowledge-distillation-pytorch/issues/2 if self.params.restrict_ce_to_mask: mask = (mlm_labels>-1).unsqueeze(-1).expand_as(s_logits) # (bs, seq_lenth, voc_size) else: mask = attention_mask.unsqueeze(-1).expand_as(s_logits) # (bs, seq_lenth, voc_size) s_logits_slct = torch.masked_select(s_logits, mask) # (bs * seq_length * voc_size) modulo the 1s in mask s_logits_slct = s_logits_slct.view(-1, s_logits.size(-1)) # (bs * seq_length, voc_size) modulo the 1s in mask t_logits_slct = torch.masked_select(t_logits, mask) # (bs * seq_length * voc_size) modulo the 1s in mask t_logits_slct = t_logits_slct.view(-1, s_logits.size(-1)) # (bs * seq_length, voc_size) modulo the 1s in mask assert t_logits_slct.size() == s_logits_slct.size() loss_ce = self.ce_loss_fct(F.log_softmax(s_logits_slct/self.temperature, dim=-1), F.softmax(t_logits_slct/self.temperature, dim=-1)) * (self.temperature)**2 loss = self.alpha_ce*loss_ce if self.alpha_mlm > 0.: loss_mlm = self.mlm_loss_fct(s_logits.view(-1, s_logits.size(-1)), mlm_labels.view(-1)) loss += self.alpha_mlm * loss_mlm if self.alpha_mse > 0.: loss_mse = self.mse_loss_fct(s_logits_slct, t_logits_slct)/s_logits_slct.size(0) # Reproducing batchmean reduction loss += self.alpha_mse * loss_mse self.total_loss_epoch += loss.item() self.last_loss = loss.item() self.last_loss_ce = loss_ce.item() if self.alpha_mlm > 0.: self.last_loss_mlm = loss_mlm.item() if self.alpha_mse > 0.: self.last_loss_mse = loss_mse.item() self.optimize(loss) self.n_sequences_epoch += input_ids.size(0) def optimize(self, loss): """ Normalization on the loss (gradient accumulation or distributed training), followed by backward pass on the loss, possibly followed by a parameter update (depending on the gradient accumulation). Also update the metrics for tensorboard. """ # Check for NaN if (loss != loss).data.any(): logger.error('NaN detected') exit() if self.multi_gpu: loss = loss.mean() if self.params.gradient_accumulation_steps > 1: loss = loss / self.params.gradient_accumulation_steps if self.fp16: from apex import amp with amp.scale_loss(loss, self.optimizer) as scaled_loss: scaled_loss.backward() else: loss.backward() self.iter() if self.n_iter % self.params.gradient_accumulation_steps == 0: if self.fp16: torch.nn.utils.clip_grad_norm_(amp.master_params(self.optimizer), self.params.max_grad_norm) else: torch.nn.utils.clip_grad_norm_(self.student.parameters(), self.params.max_grad_norm) self.optimizer.step() self.optimizer.zero_grad() self.scheduler.step() def iter(self): """ Update global counts, write to tensorboard and save checkpoint. """ self.n_iter += 1 self.n_total_iter += 1 if self.n_total_iter % self.params.log_interval == 0: self.log_tensorboard() if self.n_total_iter % self.params.checkpoint_interval == 0: self.save_checkpoint() def log_tensorboard(self): """ Log into tensorboard. Only by the master process. """ if not self.is_master: return for param_name, param in self.student.named_parameters(): self.tensorboard.add_scalar(tag='parameter_mean/' + param_name, scalar_value=param.data.mean(), global_step=self.n_total_iter) self.tensorboard.add_scalar(tag='parameter_std/' + param_name, scalar_value=param.data.std(), global_step=self.n_total_iter) if param.grad is None: continue self.tensorboard.add_scalar(tag="grad_mean/" + param_name, scalar_value=param.grad.data.mean(),global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="grad_std/" + param_name, scalar_value=param.grad.data.std(), global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="losses/cum_avg_loss_epoch", scalar_value=self.total_loss_epoch/self.n_iter, global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="losses/loss", scalar_value=self.last_loss, global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="losses/loss_ce", scalar_value=self.last_loss_ce, global_step=self.n_total_iter) if self.alpha_mlm > 0.: self.tensorboard.add_scalar(tag="losses/loss_mlm", scalar_value=self.last_loss_mlm, global_step=self.n_total_iter) if self.alpha_mse > 0.: self.tensorboard.add_scalar(tag="losses/loss_mse", scalar_value=self.last_loss_mse, global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="learning_rate/lr", scalar_value=self.scheduler.get_lr()[0], global_step=self.n_total_iter) self.tensorboard.add_scalar(tag="global/memory_usage", scalar_value=psutil.virtual_memory()._asdict()['used']/1_000_000, global_step=self.n_total_iter) def end_epoch(self): """ Finally arrived at the end of epoch (full pass on dataset). Do some tensorboard logging and checkpoint saving. """ logger.info(f'{self.n_sequences_epoch} sequences have been trained during this epoch.') if self.is_master: self.save_checkpoint(checkpoint_name=f'model_epoch_{self.epoch}.pth') self.tensorboard.add_scalar(tag='epoch/loss', scalar_value=self.total_loss_epoch/self.n_iter, global_step=self.epoch) self.epoch += 1 self.n_sequences_epoch = 0 self.n_iter = 0 self.total_loss_epoch = 0 def save_checkpoint(self, checkpoint_name: str = 'checkpoint.pth'): """ Save the current state. Only by the master process. """ if not self.is_master: return mdl_to_save = self.student.module if hasattr(self.student, 'module') else self.student mdl_to_save.config.save_pretrained(self.dump_path) state_dict = mdl_to_save.state_dict() torch.save(state_dict, os.path.join(self.dump_path, checkpoint_name))
20,865
44.859341
163
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/scripts/extract_for_distil.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Preprocessing script before training DistilBERT. """ from pytorch_transformers import BertForPreTraining import torch import argparse if __name__ == '__main__': parser = argparse.ArgumentParser(description="Extraction some layers of the full BertForPreTraining for Transfer Learned Distillation") parser.add_argument("--bert_model", default='bert-base-uncased', type=str) parser.add_argument("--dump_checkpoint", default='serialization_dir/transfer_learning_checkpoint_0247911.pth', type=str) parser.add_argument("--vocab_transform", action='store_true') args = parser.parse_args() model = BertForPreTraining.from_pretrained(args.bert_model) state_dict = model.state_dict() compressed_sd = {} for w in ['word_embeddings', 'position_embeddings']: compressed_sd[f'distilbert.embeddings.{w}.weight'] = \ state_dict[f'bert.embeddings.{w}.weight'] for w in ['weight', 'bias']: compressed_sd[f'distilbert.embeddings.LayerNorm.{w}'] = \ state_dict[f'bert.embeddings.LayerNorm.{w}'] std_idx = 0 for teacher_idx in [0, 2, 4, 7, 9, 11]: for w in ['weight', 'bias']: compressed_sd[f'distilbert.transformer.layer.{std_idx}.attention.q_lin.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.attention.self.query.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.attention.k_lin.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.attention.self.key.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.attention.v_lin.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.attention.self.value.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.attention.out_lin.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.attention.output.dense.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.sa_layer_norm.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.attention.output.LayerNorm.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.ffn.lin1.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.intermediate.dense.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.ffn.lin2.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.output.dense.{w}'] compressed_sd[f'distilbert.transformer.layer.{std_idx}.output_layer_norm.{w}'] = \ state_dict[f'bert.encoder.layer.{teacher_idx}.output.LayerNorm.{w}'] std_idx += 1 compressed_sd[f'vocab_projector.weight'] = state_dict[f'cls.predictions.decoder.weight'] compressed_sd[f'vocab_projector.bias'] = state_dict[f'cls.predictions.bias'] if args.vocab_transform: for w in ['weight', 'bias']: compressed_sd[f'vocab_transform.{w}'] = state_dict[f'cls.predictions.transform.dense.{w}'] compressed_sd[f'vocab_layer_norm.{w}'] = state_dict[f'cls.predictions.transform.LayerNorm.{w}'] print(f'N layers selected for distillation: {std_idx}') print(f'Number of params transfered for distillation: {len(compressed_sd.keys())}') print(f'Save transfered checkpoint to {args.dump_checkpoint}.') torch.save(compressed_sd, args.dump_checkpoint)
3,957
50.402597
139
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/examples/distillation/scripts/binarized_data.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Preprocessing script before training DistilBERT. """ import argparse import pickle import random import time import numpy as np from pytorch_transformers import BertTokenizer from examples.distillation.utils import logger def main(): parser = argparse.ArgumentParser(description="Preprocess the data to avoid re-doing it several times by (tokenization + token_to_ids).") parser.add_argument('--file_path', type=str, default='data/dump.txt', help='The path to the data.') parser.add_argument('--bert_tokenizer', type=str, default='bert-base-uncased', help="The tokenizer to use.") parser.add_argument('--dump_file', type=str, default='data/dump', help='The dump file prefix.') args = parser.parse_args() logger.info(f'Loading Tokenizer ({args.bert_tokenizer})') bert_tokenizer = BertTokenizer.from_pretrained(args.bert_tokenizer) logger.info(f'Loading text from {args.file_path}') with open(args.file_path, 'r', encoding='utf8') as fp: data = fp.readlines() logger.info(f'Start encoding') logger.info(f'{len(data)} examples to process.') rslt = [] iter = 0 interval = 10000 start = time.time() for text in data: text = f'[CLS] {text.strip()} [SEP]' token_ids = bert_tokenizer.encode(text) rslt.append(token_ids) iter += 1 if iter % interval == 0: end = time.time() logger.info(f'{iter} examples processed. - {(end-start)/interval:.2f}s/expl') start = time.time() logger.info('Finished binarization') logger.info(f'{len(data)} examples processed.') dp_file = f'{args.dump_file}.{args.bert_tokenizer}.pickle' rslt_ = [np.uint16(d) for d in rslt] random.shuffle(rslt_) logger.info(f'Dump to {dp_file}') with open(dp_file, 'wb') as handle: pickle.dump(rslt_, handle, protocol=pickle.HIGHEST_PROTOCOL) if __name__ == "__main__": main()
2,621
33.051948
140
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/docs/source/conf.py
# -*- coding: utf-8 -*- # # Configuration file for the Sphinx documentation builder. # # This file does only contain a selection of the most common options. For a # full list see the documentation: # http://www.sphinx-doc.org/en/master/config # -- Path setup -------------------------------------------------------------- # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # import os import sys sys.path.insert(0, os.path.abspath('../..')) # -- Project information ----------------------------------------------------- project = u'pytorch-transformers' copyright = u'2019, huggingface' author = u'huggingface' # The short X.Y version version = u'' # The full version, including alpha/beta/rc tags release = u'1.2.0' # -- General configuration --------------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.coverage', 'sphinx.ext.napoleon', 'recommonmark', 'sphinx.ext.viewcode', 'sphinx_markdown_tables' ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix(es) of source filenames. # You can specify multiple suffix as a list of string: # source_suffix = ['.rst', '.md'] # source_suffix = '.rst' # The master toctree document. master_doc = 'index' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This pattern also affects html_static_path and html_extra_path. exclude_patterns = [u'_build', 'Thumbs.db', '.DS_Store'] # The name of the Pygments (syntax highlighting) style to use. pygments_style = None # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'sphinx_rtd_theme' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. # html_theme_options = { 'analytics_id': 'UA-83738774-2' } # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # Custom sidebar templates, must be a dictionary that maps document names # to template names. # # The default sidebars (for documents that don't match any pattern) are # defined by theme itself. Builtin themes are using these templates by # default: ``['localtoc.html', 'relations.html', 'sourcelink.html', # 'searchbox.html']``. # # html_sidebars = {} # -- Options for HTMLHelp output --------------------------------------------- # Output file base name for HTML help builder. htmlhelp_basename = 'pytorch-transformersdoc' # -- Options for LaTeX output ------------------------------------------------ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ (master_doc, 'pytorch-transformers.tex', u'pytorch-transformers Documentation', u'huggingface', 'manual'), ] # -- Options for manual page output ------------------------------------------ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'pytorch-transformers', u'pytorch-transformers Documentation', [author], 1) ] # -- Options for Texinfo output ---------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'pytorch-transformers', u'pytorch-transformers Documentation', author, 'pytorch-transformers', 'One line description of project.', 'Miscellaneous'), ] # -- Options for Epub output ------------------------------------------------- # Bibliographic Dublin Core info. epub_title = project # The unique identifier of the text. This can be a ISBN number # or the project homepage. # # epub_identifier = '' # A unique identification for the text. # # epub_uid = '' # A list of files that should not be packed into the epub file. epub_exclude_files = ['search.html'] def setup(app): app.add_stylesheet('css/huggingface.css') app.add_stylesheet('css/code-snippets.css') app.add_js_file('js/custom.js') # -- Extension configuration -------------------------------------------------
5,681
29.063492
83
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/optimization.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch optimization for BERT model.""" import logging import math import torch from torch.optim import Optimizer from torch.optim.lr_scheduler import LambdaLR logger = logging.getLogger(__name__) class ConstantLRSchedule(LambdaLR): """ Constant learning rate schedule. """ def __init__(self, optimizer, last_epoch=-1): super(ConstantLRSchedule, self).__init__(optimizer, lambda _: 1.0, last_epoch=last_epoch) class WarmupConstantSchedule(LambdaLR): """ Linear warmup and then constant. Linearly increases learning rate schedule from 0 to 1 over `warmup_steps` training steps. Keeps learning rate schedule equal to 1. after warmup_steps. """ def __init__(self, optimizer, warmup_steps, last_epoch=-1): self.warmup_steps = warmup_steps super(WarmupConstantSchedule, self).__init__(optimizer, self.lr_lambda, last_epoch=last_epoch) def lr_lambda(self, step): if step < self.warmup_steps: return float(step) / float(max(1.0, self.warmup_steps)) return 1. class WarmupLinearSchedule(LambdaLR): """ Linear warmup and then linear decay. Linearly increases learning rate from 0 to 1 over `warmup_steps` training steps. Linearly decreases learning rate from 1. to 0. over remaining `t_total - warmup_steps` steps. """ def __init__(self, optimizer, warmup_steps, t_total, last_epoch=-1): self.warmup_steps = warmup_steps self.t_total = t_total super(WarmupLinearSchedule, self).__init__(optimizer, self.lr_lambda, last_epoch=last_epoch) def lr_lambda(self, step): if step < self.warmup_steps: return float(step) / float(max(1, self.warmup_steps)) return max(0.0, float(self.t_total - step) / float(max(1.0, self.t_total - self.warmup_steps))) class WarmupCosineSchedule(LambdaLR): """ Linear warmup and then cosine decay. Linearly increases learning rate from 0 to 1 over `warmup_steps` training steps. Decreases learning rate from 1. to 0. over remaining `t_total - warmup_steps` steps following a cosine curve. If `cycles` (default=0.5) is different from default, learning rate follows cosine function after warmup. """ def __init__(self, optimizer, warmup_steps, t_total, cycles=.5, last_epoch=-1): self.warmup_steps = warmup_steps self.t_total = t_total self.cycles = cycles super(WarmupCosineSchedule, self).__init__(optimizer, self.lr_lambda, last_epoch=last_epoch) def lr_lambda(self, step): if step < self.warmup_steps: return float(step) / float(max(1.0, self.warmup_steps)) # progress after warmup progress = float(step - self.warmup_steps) / float(max(1, self.t_total - self.warmup_steps)) return max(0.0, 0.5 * (1. + math.cos(math.pi * float(self.cycles) * 2.0 * progress))) class WarmupCosineWithHardRestartsSchedule(LambdaLR): """ Linear warmup and then cosine cycles with hard restarts. Linearly increases learning rate from 0 to 1 over `warmup_steps` training steps. If `cycles` (default=1.) is different from default, learning rate follows `cycles` times a cosine decaying learning rate (with hard restarts). """ def __init__(self, optimizer, warmup_steps, t_total, cycles=1., last_epoch=-1): self.warmup_steps = warmup_steps self.t_total = t_total self.cycles = cycles super(WarmupCosineWithHardRestartsSchedule, self).__init__(optimizer, self.lr_lambda, last_epoch=last_epoch) def lr_lambda(self, step): if step < self.warmup_steps: return float(step) / float(max(1, self.warmup_steps)) # progress after warmup progress = float(step - self.warmup_steps) / float(max(1, self.t_total - self.warmup_steps)) if progress >= 1.0: return 0.0 return max(0.0, 0.5 * (1. + math.cos(math.pi * ((float(self.cycles) * progress) % 1.0)))) class AdamW(Optimizer): """ Implements Adam algorithm with weight decay fix. Parameters: lr (float): learning rate. Default 1e-3. betas (tuple of 2 floats): Adams beta parameters (b1, b2). Default: (0.9, 0.999) eps (float): Adams epsilon. Default: 1e-6 weight_decay (float): Weight decay. Default: 0.0 correct_bias (bool): can be set to False to avoid correcting bias in Adam (e.g. like in Bert TF repository). Default True. """ def __init__(self, params, lr=1e-3, betas=(0.9, 0.999), eps=1e-6, weight_decay=0.0, correct_bias=True): if lr < 0.0: raise ValueError("Invalid learning rate: {} - should be >= 0.0".format(lr)) if not 0.0 <= betas[0] < 1.0: raise ValueError("Invalid beta parameter: {} - should be in [0.0, 1.0[".format(betas[0])) if not 0.0 <= betas[1] < 1.0: raise ValueError("Invalid beta parameter: {} - should be in [0.0, 1.0[".format(betas[1])) if not 0.0 <= eps: raise ValueError("Invalid epsilon value: {} - should be >= 0.0".format(eps)) defaults = dict(lr=lr, betas=betas, eps=eps, weight_decay=weight_decay, correct_bias=correct_bias) super(AdamW, self).__init__(params, defaults) def step(self, closure=None): """Performs a single optimization step. Arguments: closure (callable, optional): A closure that reevaluates the model and returns the loss. """ loss = None if closure is not None: loss = closure() for group in self.param_groups: for p in group['params']: if p.grad is None: continue grad = p.grad.data if grad.is_sparse: raise RuntimeError('Adam does not support sparse gradients, please consider SparseAdam instead') state = self.state[p] # State initialization if len(state) == 0: state['step'] = 0 # Exponential moving average of gradient values state['exp_avg'] = torch.zeros_like(p.data) # Exponential moving average of squared gradient values state['exp_avg_sq'] = torch.zeros_like(p.data) exp_avg, exp_avg_sq = state['exp_avg'], state['exp_avg_sq'] beta1, beta2 = group['betas'] state['step'] += 1 # Decay the first and second moment running average coefficient # In-place operations to update the averages at the same time exp_avg.mul_(beta1).add_(1.0 - beta1, grad) exp_avg_sq.mul_(beta2).addcmul_(1.0 - beta2, grad, grad) denom = exp_avg_sq.sqrt().add_(group['eps']) step_size = group['lr'] if group['correct_bias']: # No bias correction for Bert bias_correction1 = 1.0 - beta1 ** state['step'] bias_correction2 = 1.0 - beta2 ** state['step'] step_size = step_size * math.sqrt(bias_correction2) / bias_correction1 p.data.addcdiv_(-step_size, exp_avg, denom) # Just adding the square of the weights to the loss function is *not* # the correct way of using L2 regularization/weight decay with Adam, # since that will interact with the m and v parameters in strange ways. # # Instead we want to decay the weights in a manner that doesn't interact # with the m/v parameters. This is equivalent to adding the square # of the weights to the loss with plain (non-momentum) SGD. # Add weight decay at the end (fixed version) if group['weight_decay'] > 0.0: p.data.add_(-group['lr'] * group['weight_decay'], p.data) return loss
8,635
44.452632
130
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/__main__.py
# coding: utf8 def main(): import sys if (len(sys.argv) < 4 or len(sys.argv) > 6) or sys.argv[1] not in ["bert", "gpt", "transfo_xl", "gpt2", "xlnet", "xlm"]: print( "Should be used as one of: \n" ">> pytorch_transformers bert TF_CHECKPOINT TF_CONFIG PYTORCH_DUMP_OUTPUT, \n" ">> pytorch_transformers gpt OPENAI_GPT_CHECKPOINT_FOLDER_PATH PYTORCH_DUMP_OUTPUT [OPENAI_GPT_CONFIG], \n" ">> pytorch_transformers transfo_xl TF_CHECKPOINT_OR_DATASET PYTORCH_DUMP_OUTPUT [TF_CONFIG] or \n" ">> pytorch_transformers gpt2 TF_CHECKPOINT PYTORCH_DUMP_OUTPUT [GPT2_CONFIG] or \n" ">> pytorch_transformers xlnet TF_CHECKPOINT TF_CONFIG PYTORCH_DUMP_OUTPUT [FINETUNING_TASK_NAME] or \n" ">> pytorch_transformers xlm XLM_CHECKPOINT_PATH PYTORCH_DUMP_OUTPUT") else: if sys.argv[1] == "bert": try: from .convert_tf_checkpoint_to_pytorch import convert_tf_checkpoint_to_pytorch except ImportError: print("pytorch_transformers can only be used from the commandline to convert TensorFlow models in PyTorch, " "In that case, it requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise if len(sys.argv) != 5: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers bert TF_CHECKPOINT TF_CONFIG PYTORCH_DUMP_OUTPUT`") else: PYTORCH_DUMP_OUTPUT = sys.argv.pop() TF_CONFIG = sys.argv.pop() TF_CHECKPOINT = sys.argv.pop() convert_tf_checkpoint_to_pytorch(TF_CHECKPOINT, TF_CONFIG, PYTORCH_DUMP_OUTPUT) elif sys.argv[1] == "gpt": from .convert_openai_checkpoint_to_pytorch import convert_openai_checkpoint_to_pytorch if len(sys.argv) < 4 or len(sys.argv) > 5: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers gpt OPENAI_GPT_CHECKPOINT_FOLDER_PATH PYTORCH_DUMP_OUTPUT [OPENAI_GPT_CONFIG]`") else: OPENAI_GPT_CHECKPOINT_FOLDER_PATH = sys.argv[2] PYTORCH_DUMP_OUTPUT = sys.argv[3] if len(sys.argv) == 5: OPENAI_GPT_CONFIG = sys.argv[4] else: OPENAI_GPT_CONFIG = "" convert_openai_checkpoint_to_pytorch(OPENAI_GPT_CHECKPOINT_FOLDER_PATH, OPENAI_GPT_CONFIG, PYTORCH_DUMP_OUTPUT) elif sys.argv[1] == "transfo_xl": try: from .convert_transfo_xl_checkpoint_to_pytorch import convert_transfo_xl_checkpoint_to_pytorch except ImportError: print("pytorch_transformers can only be used from the commandline to convert TensorFlow models in PyTorch, " "In that case, it requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise if len(sys.argv) < 4 or len(sys.argv) > 5: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers transfo_xl TF_CHECKPOINT/TF_DATASET_FILE PYTORCH_DUMP_OUTPUT [TF_CONFIG]`") else: if 'ckpt' in sys.argv[2].lower(): TF_CHECKPOINT = sys.argv[2] TF_DATASET_FILE = "" else: TF_DATASET_FILE = sys.argv[2] TF_CHECKPOINT = "" PYTORCH_DUMP_OUTPUT = sys.argv[3] if len(sys.argv) == 5: TF_CONFIG = sys.argv[4] else: TF_CONFIG = "" convert_transfo_xl_checkpoint_to_pytorch(TF_CHECKPOINT, TF_CONFIG, PYTORCH_DUMP_OUTPUT, TF_DATASET_FILE) elif sys.argv[1] == "gpt2": try: from .convert_gpt2_checkpoint_to_pytorch import convert_gpt2_checkpoint_to_pytorch except ImportError: print("pytorch_transformers can only be used from the commandline to convert TensorFlow models in PyTorch, " "In that case, it requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise if len(sys.argv) < 4 or len(sys.argv) > 5: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers gpt2 TF_CHECKPOINT PYTORCH_DUMP_OUTPUT [TF_CONFIG]`") else: TF_CHECKPOINT = sys.argv[2] PYTORCH_DUMP_OUTPUT = sys.argv[3] if len(sys.argv) == 5: TF_CONFIG = sys.argv[4] else: TF_CONFIG = "" convert_gpt2_checkpoint_to_pytorch(TF_CHECKPOINT, TF_CONFIG, PYTORCH_DUMP_OUTPUT) elif sys.argv[1] == "xlnet": try: from .convert_xlnet_checkpoint_to_pytorch import convert_xlnet_checkpoint_to_pytorch except ImportError: print("pytorch_transformers can only be used from the commandline to convert TensorFlow models in PyTorch, " "In that case, it requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise if len(sys.argv) < 5 or len(sys.argv) > 6: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers xlnet TF_CHECKPOINT TF_CONFIG PYTORCH_DUMP_OUTPUT [FINETUNING_TASK_NAME]`") else: TF_CHECKPOINT = sys.argv[2] TF_CONFIG = sys.argv[3] PYTORCH_DUMP_OUTPUT = sys.argv[4] if len(sys.argv) == 6: FINETUNING_TASK = sys.argv[5] else: FINETUNING_TASK = None convert_xlnet_checkpoint_to_pytorch(TF_CHECKPOINT, TF_CONFIG, PYTORCH_DUMP_OUTPUT, FINETUNING_TASK) elif sys.argv[1] == "xlm": from .convert_xlm_checkpoint_to_pytorch import convert_xlm_checkpoint_to_pytorch if len(sys.argv) != 4: # pylint: disable=line-too-long print("Should be used as `pytorch_transformers xlm XLM_CHECKPOINT_PATH PYTORCH_DUMP_OUTPUT`") else: XLM_CHECKPOINT_PATH = sys.argv[2] PYTORCH_DUMP_OUTPUT = sys.argv[3] convert_xlm_checkpoint_to_pytorch(XLM_CHECKPOINT_PATH, PYTORCH_DUMP_OUTPUT) if __name__ == '__main__': main()
7,021
53.434109
143
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_gpt2_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert OpenAI GPT checkpoint.""" from __future__ import absolute_import, division, print_function import argparse from io import open import torch from pytorch_transformers import (CONFIG_NAME, WEIGHTS_NAME, GPT2Config, GPT2Model, load_tf_weights_in_gpt2) import logging logging.basicConfig(level=logging.INFO) def convert_gpt2_checkpoint_to_pytorch(gpt2_checkpoint_path, gpt2_config_file, pytorch_dump_folder_path): # Construct model if gpt2_config_file == "": config = GPT2Config() else: config = GPT2Config.from_json_file(gpt2_config_file) model = GPT2Model(config) # Load weights from numpy load_tf_weights_in_gpt2(model, config, gpt2_checkpoint_path) # Save pytorch-model pytorch_weights_dump_path = pytorch_dump_folder_path + '/' + WEIGHTS_NAME pytorch_config_dump_path = pytorch_dump_folder_path + '/' + CONFIG_NAME print("Save PyTorch model to {}".format(pytorch_weights_dump_path)) torch.save(model.state_dict(), pytorch_weights_dump_path) print("Save configuration file to {}".format(pytorch_config_dump_path)) with open(pytorch_config_dump_path, "w", encoding="utf-8") as f: f.write(config.to_json_string()) if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--gpt2_checkpoint_path", default = None, type = str, required = True, help = "Path to the TensorFlow checkpoint path.") parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the output PyTorch model.") parser.add_argument("--gpt2_config_file", default = "", type = str, help = "An optional config json file corresponding to the pre-trained OpenAI model. \n" "This specifies the model architecture.") args = parser.parse_args() convert_gpt2_checkpoint_to_pytorch(args.gpt2_checkpoint_path, args.gpt2_config_file, args.pytorch_dump_folder_path)
3,082
39.565789
111
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_openai_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert OpenAI GPT checkpoint.""" from __future__ import absolute_import, division, print_function import argparse from io import open import torch from pytorch_transformers import (CONFIG_NAME, WEIGHTS_NAME, OpenAIGPTConfig, OpenAIGPTModel, load_tf_weights_in_openai_gpt) import logging logging.basicConfig(level=logging.INFO) def convert_openai_checkpoint_to_pytorch(openai_checkpoint_folder_path, openai_config_file, pytorch_dump_folder_path): # Construct model if openai_config_file == "": config = OpenAIGPTConfig() else: config = OpenAIGPTConfig.from_json_file(openai_config_file) model = OpenAIGPTModel(config) # Load weights from numpy load_tf_weights_in_openai_gpt(model, config, openai_checkpoint_folder_path) # Save pytorch-model pytorch_weights_dump_path = pytorch_dump_folder_path + '/' + WEIGHTS_NAME pytorch_config_dump_path = pytorch_dump_folder_path + '/' + CONFIG_NAME print("Save PyTorch model to {}".format(pytorch_weights_dump_path)) torch.save(model.state_dict(), pytorch_weights_dump_path) print("Save configuration file to {}".format(pytorch_config_dump_path)) with open(pytorch_config_dump_path, "w", encoding="utf-8") as f: f.write(config.to_json_string()) if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--openai_checkpoint_folder_path", default = None, type = str, required = True, help = "Path to the TensorFlow checkpoint path.") parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the output PyTorch model.") parser.add_argument("--openai_config_file", default = "", type = str, help = "An optional config json file corresponding to the pre-trained OpenAI model. \n" "This specifies the model architecture.") args = parser.parse_args() convert_openai_checkpoint_to_pytorch(args.openai_checkpoint_folder_path, args.openai_config_file, args.pytorch_dump_folder_path)
3,169
40.710526
118
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/configuration_utils.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Configuration base class and utilities.""" from __future__ import (absolute_import, division, print_function, unicode_literals) import copy import json import logging import os from io import open from .file_utils import cached_path, CONFIG_NAME logger = logging.getLogger(__name__) class PretrainedConfig(object): r""" Base class for all configuration classes. Handles a few parameters common to all models' configurations as well as methods for loading/downloading/saving configurations. Note: A configuration file can be loaded and saved to disk. Loading the configuration file and using this file to initialize a model does **not** load the model weights. It only affects the model's configuration. Class attributes (overridden by derived classes): - ``pretrained_config_archive_map``: a python ``dict`` of with `short-cut-names` (string) as keys and `url` (string) of associated pretrained model configurations as values. Parameters: ``finetuning_task``: string, default `None`. Name of the task used to fine-tune the model. This can be used when converting from an original (TensorFlow or PyTorch) checkpoint. ``num_labels``: integer, default `2`. Number of classes to use when the model is a classification model (sequences/tokens) ``output_attentions``: boolean, default `False`. Should the model returns attentions weights. ``output_hidden_states``: string, default `False`. Should the model returns all hidden-states. ``torchscript``: string, default `False`. Is the model used with Torchscript. """ pretrained_config_archive_map = {} def __init__(self, **kwargs): self.finetuning_task = kwargs.pop('finetuning_task', None) self.num_labels = kwargs.pop('num_labels', 2) self.output_attentions = kwargs.pop('output_attentions', False) self.output_hidden_states = kwargs.pop('output_hidden_states', False) self.torchscript = kwargs.pop('torchscript', False) self.pruned_heads = kwargs.pop('pruned_heads', {}) def save_pretrained(self, save_directory): """ Save a configuration object to the directory `save_directory`, so that it can be re-loaded using the :func:`~pytorch_transformers.PretrainedConfig.from_pretrained` class method. """ assert os.path.isdir(save_directory), "Saving path should be a directory where the model and configuration can be saved" # If we save using the predefined names, we can load using `from_pretrained` output_config_file = os.path.join(save_directory, CONFIG_NAME) self.to_json_file(output_config_file) @classmethod def from_pretrained(cls, pretrained_model_name_or_path, **kwargs): r""" Instantiate a :class:`~pytorch_transformers.PretrainedConfig` (or a derived class) from a pre-trained model configuration. Parameters: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model configuration to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing a configuration file saved using the :func:`~pytorch_transformers.PretrainedConfig.save_pretrained` method, e.g.: ``./my_model_directory/``. - a path or url to a saved configuration JSON `file`, e.g.: ``./my_model_directory/configuration.json``. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. kwargs: (`optional`) dict: key/value pairs with which to update the configuration object after loading. - The values in kwargs of any keys which are configuration attributes will be used to override the loaded values. - Behavior concerning key/value pairs whose keys are *not* configuration attributes is controlled by the `return_unused_kwargs` keyword parameter. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. return_unused_kwargs: (`optional`) bool: - If False, then this function returns just the final configuration object. - If True, then this functions returns a tuple `(config, unused_kwargs)` where `unused_kwargs` is a dictionary consisting of the key/value pairs whose keys are not configuration attributes: ie the part of kwargs which has not been used to update `config` and is otherwise ignored. Examples:: # We can't instantiate directly the base class `PretrainedConfig` so let's show the examples on a # derived class: BertConfig config = BertConfig.from_pretrained('bert-base-uncased') # Download configuration from S3 and cache. config = BertConfig.from_pretrained('./test/saved_model/') # E.g. config (or model) was saved using `save_pretrained('./test/saved_model/')` config = BertConfig.from_pretrained('./test/saved_model/my_configuration.json') config = BertConfig.from_pretrained('bert-base-uncased', output_attention=True, foo=False) assert config.output_attention == True config, unused_kwargs = BertConfig.from_pretrained('bert-base-uncased', output_attention=True, foo=False, return_unused_kwargs=True) assert config.output_attention == True assert unused_kwargs == {'foo': False} """ cache_dir = kwargs.pop('cache_dir', None) force_download = kwargs.pop('force_download', False) proxies = kwargs.pop('proxies', None) return_unused_kwargs = kwargs.pop('return_unused_kwargs', False) if pretrained_model_name_or_path in cls.pretrained_config_archive_map: config_file = cls.pretrained_config_archive_map[pretrained_model_name_or_path] elif os.path.isdir(pretrained_model_name_or_path): config_file = os.path.join(pretrained_model_name_or_path, CONFIG_NAME) else: config_file = pretrained_model_name_or_path # redirect to the cache, if necessary try: resolved_config_file = cached_path(config_file, cache_dir=cache_dir, force_download=force_download, proxies=proxies) except EnvironmentError as e: if pretrained_model_name_or_path in cls.pretrained_config_archive_map: logger.error( "Couldn't reach server at '{}' to download pretrained model configuration file.".format( config_file)) else: logger.error( "Model name '{}' was not found in model name list ({}). " "We assumed '{}' was a path or url but couldn't find any file " "associated to this path or url.".format( pretrained_model_name_or_path, ', '.join(cls.pretrained_config_archive_map.keys()), config_file)) raise e if resolved_config_file == config_file: logger.info("loading configuration file {}".format(config_file)) else: logger.info("loading configuration file {} from cache at {}".format( config_file, resolved_config_file)) # Load config config = cls.from_json_file(resolved_config_file) if hasattr(config, 'pruned_heads'): config.pruned_heads = dict((int(key), set(value)) for key, value in config.pruned_heads.items()) # Update config with kwargs if needed to_remove = [] for key, value in kwargs.items(): if hasattr(config, key): setattr(config, key, value) to_remove.append(key) for key in to_remove: kwargs.pop(key, None) logger.info("Model config %s", config) if return_unused_kwargs: return config, kwargs else: return config @classmethod def from_dict(cls, json_object): """Constructs a `Config` from a Python dictionary of parameters.""" config = cls(vocab_size_or_config_json_file=-1) for key, value in json_object.items(): config.__dict__[key] = value return config @classmethod def from_json_file(cls, json_file): """Constructs a `BertConfig` from a json file of parameters.""" with open(json_file, "r", encoding='utf-8') as reader: text = reader.read() return cls.from_dict(json.loads(text)) def __eq__(self, other): return self.__dict__ == other.__dict__ def __repr__(self): return str(self.to_json_string()) def to_dict(self): """Serializes this instance to a Python dictionary.""" output = copy.deepcopy(self.__dict__) return output def to_json_string(self): """Serializes this instance to a JSON string.""" return json.dumps(self.to_dict(), indent=2, sort_keys=True) + "\n" def to_json_file(self, json_file_path): """ Save this instance to a json file.""" with open(json_file_path, "w", encoding='utf-8') as writer: writer.write(self.to_json_string())
10,499
49.970874
296
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_distilbert.py
# coding=utf-8 # Copyright 2019-present, the HuggingFace Inc. team, The Google AI Language Team and Facebook, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ PyTorch DistilBERT model adapted in part from Facebook, Inc XLM model (https://github.com/facebookresearch/XLM) and in part from HuggingFace PyTorch version of Google AI Bert model (https://github.com/google-research/bert) """ from __future__ import absolute_import, division, print_function, unicode_literals import json import logging import math import copy import sys from io import open import itertools import numpy as np import torch import torch.nn as nn from .modeling_utils import PreTrainedModel, prune_linear_layer from .configuration_distilbert import DistilBertConfig from .file_utils import add_start_docstrings import logging logger = logging.getLogger(__name__) DISTILBERT_PRETRAINED_MODEL_ARCHIVE_MAP = { 'distilbert-base-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/distilbert-base-uncased-pytorch_model.bin", 'distilbert-base-uncased-distilled-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/distilbert-base-uncased-distilled-squad-pytorch_model.bin" } ### UTILS AND BUILDING BLOCKS OF THE ARCHITECTURE ### def gelu(x): return 0.5 * x * (1.0 + torch.erf(x / math.sqrt(2.0))) def create_sinusoidal_embeddings(n_pos, dim, out): position_enc = np.array([ [pos / np.power(10000, 2 * (j // 2) / dim) for j in range(dim)] for pos in range(n_pos) ]) out[:, 0::2] = torch.FloatTensor(np.sin(position_enc[:, 0::2])) out[:, 1::2] = torch.FloatTensor(np.cos(position_enc[:, 1::2])) out.detach_() out.requires_grad = False class Embeddings(nn.Module): def __init__(self, config): super(Embeddings, self).__init__() self.word_embeddings = nn.Embedding(config.vocab_size, config.dim, padding_idx=0) self.position_embeddings = nn.Embedding(config.max_position_embeddings, config.dim) if config.sinusoidal_pos_embds: create_sinusoidal_embeddings(n_pos=config.max_position_embeddings, dim=config.dim, out=self.position_embeddings.weight) self.LayerNorm = nn.LayerNorm(config.dim, eps=1e-12) self.dropout = nn.Dropout(config.dropout) def forward(self, input_ids): """ Parameters ---------- input_ids: torch.tensor(bs, max_seq_length) The token ids to embed. Outputs ------- embeddings: torch.tensor(bs, max_seq_length, dim) The embedded tokens (plus position embeddings, no token_type embeddings) """ seq_length = input_ids.size(1) position_ids = torch.arange(seq_length, dtype=torch.long, device=input_ids.device) # (max_seq_length) position_ids = position_ids.unsqueeze(0).expand_as(input_ids) # (bs, max_seq_length) word_embeddings = self.word_embeddings(input_ids) # (bs, max_seq_length, dim) position_embeddings = self.position_embeddings(position_ids) # (bs, max_seq_length, dim) embeddings = word_embeddings + position_embeddings # (bs, max_seq_length, dim) embeddings = self.LayerNorm(embeddings) # (bs, max_seq_length, dim) embeddings = self.dropout(embeddings) # (bs, max_seq_length, dim) return embeddings class MultiHeadSelfAttention(nn.Module): def __init__(self, config): super(MultiHeadSelfAttention, self).__init__() self.n_heads = config.n_heads self.dim = config.dim self.dropout = nn.Dropout(p=config.attention_dropout) self.output_attentions = config.output_attentions assert self.dim % self.n_heads == 0 self.q_lin = nn.Linear(in_features=config.dim, out_features=config.dim) self.k_lin = nn.Linear(in_features=config.dim, out_features=config.dim) self.v_lin = nn.Linear(in_features=config.dim, out_features=config.dim) self.out_lin = nn.Linear(in_features=config.dim, out_features=config.dim) self.pruned_heads = set() def prune_heads(self, heads): attention_head_size = self.dim // self.n_heads if len(heads) == 0: return mask = torch.ones(self.n_heads, attention_head_size) heads = set(heads) - self.pruned_heads for head in heads: head -= sum(1 if h < head else 0 for h in self.pruned_heads) mask[head] = 0 mask = mask.view(-1).contiguous().eq(1) index = torch.arange(len(mask))[mask].long() # Prune linear layers self.q_lin = prune_linear_layer(self.q_lin, index) self.k_lin = prune_linear_layer(self.k_lin, index) self.v_lin = prune_linear_layer(self.v_lin, index) self.out_lin = prune_linear_layer(self.out_lin, index, dim=1) # Update hyper params self.n_heads = self.n_heads - len(heads) self.dim = attention_head_size * self.n_heads self.pruned_heads = self.pruned_heads.union(heads) def forward(self, query, key, value, mask, head_mask = None): """ Parameters ---------- query: torch.tensor(bs, seq_length, dim) key: torch.tensor(bs, seq_length, dim) value: torch.tensor(bs, seq_length, dim) mask: torch.tensor(bs, seq_length) Outputs ------- weights: torch.tensor(bs, n_heads, seq_length, seq_length) Attention weights context: torch.tensor(bs, seq_length, dim) Contextualized layer. Optional: only if `output_attentions=True` """ bs, q_length, dim = query.size() k_length = key.size(1) # assert dim == self.dim, 'Dimensions do not match: %s input vs %s configured' % (dim, self.dim) # assert key.size() == value.size() dim_per_head = self.dim // self.n_heads assert 2 <= mask.dim() <= 3 causal = (mask.dim() == 3) mask_reshp = (bs, 1, 1, k_length) def shape(x): """ separate heads """ return x.view(bs, -1, self.n_heads, dim_per_head).transpose(1, 2) def unshape(x): """ group heads """ return x.transpose(1, 2).contiguous().view(bs, -1, self.n_heads * dim_per_head) q = shape(self.q_lin(query)) # (bs, n_heads, q_length, dim_per_head) k = shape(self.k_lin(key)) # (bs, n_heads, k_length, dim_per_head) v = shape(self.v_lin(value)) # (bs, n_heads, k_length, dim_per_head) q = q / math.sqrt(dim_per_head) # (bs, n_heads, q_length, dim_per_head) scores = torch.matmul(q, k.transpose(2,3)) # (bs, n_heads, q_length, k_length) mask = (mask==0).view(mask_reshp).expand_as(scores) # (bs, n_heads, q_length, k_length) scores.masked_fill_(mask, -float('inf')) # (bs, n_heads, q_length, k_length) weights = nn.Softmax(dim=-1)(scores) # (bs, n_heads, q_length, k_length) weights = self.dropout(weights) # (bs, n_heads, q_length, k_length) # Mask heads if we want to if head_mask is not None: weights = weights * head_mask context = torch.matmul(weights, v) # (bs, n_heads, q_length, dim_per_head) context = unshape(context) # (bs, q_length, dim) context = self.out_lin(context) # (bs, q_length, dim) if self.output_attentions: return (context, weights) else: return (context,) class FFN(nn.Module): def __init__(self, config): super(FFN, self).__init__() self.dropout = nn.Dropout(p=config.dropout) self.lin1 = nn.Linear(in_features=config.dim, out_features=config.hidden_dim) self.lin2 = nn.Linear(in_features=config.hidden_dim, out_features=config.dim) assert config.activation in ['relu', 'gelu'], "activation ({}) must be in ['relu', 'gelu']".format(config.activation) self.activation = gelu if config.activation == 'gelu' else nn.ReLU() def forward(self, input): x = self.lin1(input) x = self.activation(x) x = self.lin2(x) x = self.dropout(x) return x class TransformerBlock(nn.Module): def __init__(self, config): super(TransformerBlock, self).__init__() self.n_heads = config.n_heads self.dim = config.dim self.hidden_dim = config.hidden_dim self.dropout = nn.Dropout(p=config.dropout) self.activation = config.activation self.output_attentions = config.output_attentions assert config.dim % config.n_heads == 0 self.attention = MultiHeadSelfAttention(config) self.sa_layer_norm = nn.LayerNorm(normalized_shape=config.dim, eps=1e-12) self.ffn = FFN(config) self.output_layer_norm = nn.LayerNorm(normalized_shape=config.dim, eps=1e-12) def forward(self, x, attn_mask=None, head_mask=None): """ Parameters ---------- x: torch.tensor(bs, seq_length, dim) attn_mask: torch.tensor(bs, seq_length) Outputs ------- sa_weights: torch.tensor(bs, n_heads, seq_length, seq_length) The attention weights ffn_output: torch.tensor(bs, seq_length, dim) The output of the transformer block contextualization. """ # Self-Attention sa_output = self.attention(query=x, key=x, value=x, mask=attn_mask, head_mask=head_mask) if self.output_attentions: sa_output, sa_weights = sa_output # (bs, seq_length, dim), (bs, n_heads, seq_length, seq_length) else: # To handle these `output_attention` or `output_hidden_states` cases returning tuples assert type(sa_output) == tuple sa_output = sa_output[0] sa_output = self.sa_layer_norm(sa_output + x) # (bs, seq_length, dim) # Feed Forward Network ffn_output = self.ffn(sa_output) # (bs, seq_length, dim) ffn_output = self.output_layer_norm(ffn_output + sa_output) # (bs, seq_length, dim) output = (ffn_output,) if self.output_attentions: output = (sa_weights,) + output return output class Transformer(nn.Module): def __init__(self, config): super(Transformer, self).__init__() self.n_layers = config.n_layers self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states layer = TransformerBlock(config) self.layer = nn.ModuleList([copy.deepcopy(layer) for _ in range(config.n_layers)]) def forward(self, x, attn_mask=None, head_mask=None): """ Parameters ---------- x: torch.tensor(bs, seq_length, dim) Input sequence embedded. attn_mask: torch.tensor(bs, seq_length) Attention mask on the sequence. Outputs ------- hidden_state: torch.tensor(bs, seq_length, dim) Sequence of hiddens states in the last (top) layer all_hidden_states: Tuple[torch.tensor(bs, seq_length, dim)] Tuple of length n_layers with the hidden states from each layer. Optional: only if output_hidden_states=True all_attentions: Tuple[torch.tensor(bs, n_heads, seq_length, seq_length)] Tuple of length n_layers with the attention weights from each layer Optional: only if output_attentions=True """ all_hidden_states = () all_attentions = () hidden_state = x for i, layer_module in enumerate(self.layer): if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_state,) layer_outputs = layer_module(x=hidden_state, attn_mask=attn_mask, head_mask=head_mask[i]) hidden_state = layer_outputs[-1] if self.output_attentions: assert len(layer_outputs) == 2 attentions = layer_outputs[0] all_attentions = all_attentions + (attentions,) else: assert len(layer_outputs) == 1 # Add last layer if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_state,) outputs = (hidden_state,) if self.output_hidden_states: outputs = outputs + (all_hidden_states,) if self.output_attentions: outputs = outputs + (all_attentions,) return outputs # last-layer hidden state, (all hidden states), (all attentions) ### INTERFACE FOR ENCODER AND TASK SPECIFIC MODEL ### class DistilBertPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for downloading and loading pretrained models. """ config_class = DistilBertConfig pretrained_model_archive_map = DISTILBERT_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = None base_model_prefix = "distilbert" def __init__(self, *inputs, **kwargs): super(DistilBertPreTrainedModel, self).__init__(*inputs, **kwargs) def _init_weights(self, module): """ Initialize the weights. """ if isinstance(module, nn.Embedding): if module.weight.requires_grad: module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) if isinstance(module, nn.Linear): module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) elif isinstance(module, nn.LayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) if isinstance(module, nn.Linear) and module.bias is not None: module.bias.data.zero_() DISTILBERT_START_DOCSTRING = r""" DistilBERT is a small, fast, cheap and light Transformer model trained by distilling Bert base. It has 40% less parameters than `bert-base-uncased`, runs 60% faster while preserving over 95% of Bert's performances as measured on the GLUE language understanding benchmark. Here are the differences between the interface of Bert and DistilBert: - DistilBert doesn't have `token_type_ids`, you don't need to indicate which token belongs to which segment. Just separate your segments with the separation token `tokenizer.sep_token` (or `[SEP]`) - DistilBert doesn't have options to select the input positions (`position_ids` input). This could be added if necessary though, just let's us know if you need this option. For more information on DistilBERT, please refer to our `detailed blog post`_ .. _`detailed blog post`: https://medium.com/huggingface/distilbert-8cf3380435b5 Parameters: config (:class:`~pytorch_transformers.DistilBertConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ DISTILBERT_INPUTS_DOCSTRING = r""" Inputs: **input_ids** ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. The input sequences should start with `[CLS]` and end with `[SEP]` tokens. For now, ONLY BertTokenizer(`bert-base-uncased`) is supported and you should use this tokenizer when using DistilBERT. **attention_mask**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare DistilBERT encoder/transformer outputing raw hidden-states without any specific head on top.", DISTILBERT_START_DOCSTRING, DISTILBERT_INPUTS_DOCSTRING) class DistilBertModel(DistilBertPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the output of the last layer of the model. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = DistilBertTokenizer.from_pretrained('distilbert-base-uncased') model = DistilBertModel.from_pretrained('distilbert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(DistilBertModel, self).__init__(config) self.embeddings = Embeddings(config) # Embeddings self.transformer = Transformer(config) # Encoder self.init_weights() def _resize_token_embeddings(self, new_num_tokens): old_embeddings = self.embeddings.word_embeddings new_embeddings = self._get_resized_embeddings(old_embeddings, new_num_tokens) self.embeddings.word_embeddings = new_embeddings return self.embeddings.word_embeddings def _prune_heads(self, heads_to_prune): """ Prunes heads of the model. heads_to_prune: dict of {layer_num: list of heads to prune in this layer} See base class PreTrainedModel """ for layer, heads in heads_to_prune.items(): self.transformer.layer[layer].attention.prune_heads(heads) def forward(self, input_ids, attention_mask=None, head_mask=None): if attention_mask is None: attention_mask = torch.ones_like(input_ids) # (bs, seq_length) # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # input head_mask has shape [num_heads] or [num_hidden_layers x num_heads] # and head_mask is converted to shape [num_hidden_layers x batch x num_heads x seq_length x seq_length] if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(-1).unsqueeze(-1) head_mask = head_mask.expand(self.config.num_hidden_layers, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(-1).unsqueeze(-1) # We can specify head_mask for each layer head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.config.num_hidden_layers embedding_output = self.embeddings(input_ids) # (bs, seq_length, dim) tfmr_output = self.transformer(x=embedding_output, attn_mask=attention_mask, head_mask=head_mask) hidden_state = tfmr_output[0] output = (hidden_state, ) + tfmr_output[1:] return output # last-layer hidden-state, (all hidden_states), (all attentions) @add_start_docstrings("""DistilBert Model with a `masked language modeling` head on top. """, DISTILBERT_START_DOCSTRING, DISTILBERT_INPUTS_DOCSTRING) class DistilBertForMaskedLM(DistilBertPreTrainedModel): r""" **masked_lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for computing the masked language modeling loss. Indices should be in ``[-1, 0, ..., config.vocab_size]`` (see ``input_ids`` docstring) Tokens with indices set to ``-1`` are ignored (masked), the loss is only computed for the tokens with labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``masked_lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Masked language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = DistilBertTokenizer.from_pretrained('distilbert-base-uncased') model = DistilBertForMaskedLM.from_pretrained('distilbert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids, masked_lm_labels=input_ids) loss, prediction_scores = outputs[:2] """ def __init__(self, config): super(DistilBertForMaskedLM, self).__init__(config) self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states self.distilbert = DistilBertModel(config) self.vocab_transform = nn.Linear(config.dim, config.dim) self.vocab_layer_norm = nn.LayerNorm(config.dim, eps=1e-12) self.vocab_projector = nn.Linear(config.dim, config.vocab_size) self.init_weights() self.tie_weights() self.mlm_loss_fct = nn.CrossEntropyLoss(ignore_index=-1) def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.vocab_projector, self.distilbert.embeddings.word_embeddings) def forward(self, input_ids, attention_mask=None, head_mask=None, masked_lm_labels=None): dlbrt_output = self.distilbert(input_ids=input_ids, attention_mask=attention_mask, head_mask=head_mask) hidden_states = dlbrt_output[0] # (bs, seq_length, dim) prediction_logits = self.vocab_transform(hidden_states) # (bs, seq_length, dim) prediction_logits = gelu(prediction_logits) # (bs, seq_length, dim) prediction_logits = self.vocab_layer_norm(prediction_logits) # (bs, seq_length, dim) prediction_logits = self.vocab_projector(prediction_logits) # (bs, seq_length, vocab_size) outputs = (prediction_logits, ) + dlbrt_output[1:] if masked_lm_labels is not None: mlm_loss = self.mlm_loss_fct(prediction_logits.view(-1, prediction_logits.size(-1)), masked_lm_labels.view(-1)) outputs = (mlm_loss,) + outputs return outputs # (mlm_loss), prediction_logits, (all hidden_states), (all attentions) @add_start_docstrings("""DistilBert Model transformer with a sequence classification/regression head on top (a linear layer on top of the pooled output) e.g. for GLUE tasks. """, DISTILBERT_START_DOCSTRING, DISTILBERT_INPUTS_DOCSTRING) class DistilBertForSequenceClassification(DistilBertPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the sequence classification/regression loss. Indices should be in ``[0, ..., config.num_labels - 1]``. If ``config.num_labels == 1`` a regression loss is computed (Mean-Square loss), If ``config.num_labels > 1`` a classification loss is computed (Cross-Entropy). Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification (or regression if config.num_labels==1) loss. **logits**: ``torch.FloatTensor`` of shape ``(batch_size, config.num_labels)`` Classification (or regression if config.num_labels==1) scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = DistilBertTokenizer.from_pretrained('distilbert-base-uncased') model = DistilBertForSequenceClassification.from_pretrained('distilbert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, logits = outputs[:2] """ def __init__(self, config): super(DistilBertForSequenceClassification, self).__init__(config) self.num_labels = config.num_labels self.distilbert = DistilBertModel(config) self.pre_classifier = nn.Linear(config.dim, config.dim) self.classifier = nn.Linear(config.dim, config.num_labels) self.dropout = nn.Dropout(config.seq_classif_dropout) self.init_weights() def forward(self, input_ids, attention_mask=None, head_mask=None, labels=None): distilbert_output = self.distilbert(input_ids=input_ids, attention_mask=attention_mask, head_mask=head_mask) hidden_state = distilbert_output[0] # (bs, seq_len, dim) pooled_output = hidden_state[:, 0] # (bs, dim) pooled_output = self.pre_classifier(pooled_output) # (bs, dim) pooled_output = nn.ReLU()(pooled_output) # (bs, dim) pooled_output = self.dropout(pooled_output) # (bs, dim) logits = self.classifier(pooled_output) # (bs, dim) outputs = (logits,) + distilbert_output[1:] if labels is not None: if self.num_labels == 1: loss_fct = nn.MSELoss() loss = loss_fct(logits.view(-1), labels.view(-1)) else: loss_fct = nn.CrossEntropyLoss() loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), logits, (hidden_states), (attentions) @add_start_docstrings("""DistilBert Model with a span classification head on top for extractive question-answering tasks like SQuAD (a linear layers on top of the hidden-states output to compute `span start logits` and `span end logits`). """, DISTILBERT_START_DOCSTRING, DISTILBERT_INPUTS_DOCSTRING) class DistilBertForQuestionAnswering(DistilBertPreTrainedModel): r""" **start_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the start of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **end_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the end of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Total span extraction loss is the sum of a Cross-Entropy for the start and end positions. **start_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-start scores (before SoftMax). **end_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-end scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = DistilBertTokenizer.from_pretrained('distilbert-base-uncased') model = DistilBertForQuestionAnswering.from_pretrained('distilbert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 start_positions = torch.tensor([1]) end_positions = torch.tensor([3]) outputs = model(input_ids, start_positions=start_positions, end_positions=end_positions) loss, start_scores, end_scores = outputs[:2] """ def __init__(self, config): super(DistilBertForQuestionAnswering, self).__init__(config) self.distilbert = DistilBertModel(config) self.qa_outputs = nn.Linear(config.dim, config.num_labels) assert config.num_labels == 2 self.dropout = nn.Dropout(config.qa_dropout) self.init_weights() def forward(self, input_ids, attention_mask=None, head_mask=None, start_positions=None, end_positions=None): distilbert_output = self.distilbert(input_ids=input_ids, attention_mask=attention_mask, head_mask=head_mask) hidden_states = distilbert_output[0] # (bs, max_query_len, dim) hidden_states = self.dropout(hidden_states) # (bs, max_query_len, dim) logits = self.qa_outputs(hidden_states) # (bs, max_query_len, 2) start_logits, end_logits = logits.split(1, dim=-1) start_logits = start_logits.squeeze(-1) # (bs, max_query_len) end_logits = end_logits.squeeze(-1) # (bs, max_query_len) outputs = (start_logits, end_logits,) + distilbert_output[1:] if start_positions is not None and end_positions is not None: # If we are on multi-GPU, split add a dimension if len(start_positions.size()) > 1: start_positions = start_positions.squeeze(-1) if len(end_positions.size()) > 1: end_positions = end_positions.squeeze(-1) # sometimes the start/end positions are outside our model inputs, we ignore these terms ignored_index = start_logits.size(1) start_positions.clamp_(0, ignored_index) end_positions.clamp_(0, ignored_index) loss_fct = nn.CrossEntropyLoss(ignore_index=ignored_index) start_loss = loss_fct(start_logits, start_positions) end_loss = loss_fct(end_logits, end_positions) total_loss = (start_loss + end_loss) / 2 outputs = (total_loss,) + outputs return outputs # (loss), start_logits, end_logits, (hidden_states), (attentions)
34,950
49.216954
201
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/configuration_bert.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ BERT model configuration """ from __future__ import absolute_import, division, print_function, unicode_literals import json import logging import sys from io import open from .configuration_utils import PretrainedConfig logger = logging.getLogger(__name__) BERT_PRETRAINED_CONFIG_ARCHIVE_MAP = { 'bert-base-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-uncased-config.json", 'bert-large-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-config.json", 'bert-base-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-config.json", 'bert-large-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-config.json", 'bert-base-multilingual-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-uncased-config.json", 'bert-base-multilingual-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-cased-config.json", 'bert-base-chinese': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-chinese-config.json", 'bert-base-german-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-german-cased-config.json", 'bert-large-uncased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-config.json", 'bert-large-cased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-config.json", 'bert-large-uncased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-finetuned-squad-config.json", 'bert-large-cased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-finetuned-squad-config.json", 'bert-base-cased-finetuned-mrpc': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-finetuned-mrpc-config.json", } class BertConfig(PretrainedConfig): r""" :class:`~pytorch_transformers.BertConfig` is the configuration class to store the configuration of a `BertModel`. Arguments: vocab_size_or_config_json_file: Vocabulary size of `inputs_ids` in `BertModel`. hidden_size: Size of the encoder layers and the pooler layer. num_hidden_layers: Number of hidden layers in the Transformer encoder. num_attention_heads: Number of attention heads for each attention layer in the Transformer encoder. intermediate_size: The size of the "intermediate" (i.e., feed-forward) layer in the Transformer encoder. hidden_act: The non-linear activation function (function or string) in the encoder and pooler. If string, "gelu", "relu" and "swish" are supported. hidden_dropout_prob: The dropout probabilitiy for all fully connected layers in the embeddings, encoder, and pooler. attention_probs_dropout_prob: The dropout ratio for the attention probabilities. max_position_embeddings: The maximum sequence length that this model might ever be used with. Typically set this to something large just in case (e.g., 512 or 1024 or 2048). type_vocab_size: The vocabulary size of the `token_type_ids` passed into `BertModel`. initializer_range: The sttdev of the truncated_normal_initializer for initializing all weight matrices. layer_norm_eps: The epsilon used by LayerNorm. """ pretrained_config_archive_map = BERT_PRETRAINED_CONFIG_ARCHIVE_MAP def __init__(self, vocab_size_or_config_json_file=30522, hidden_size=768, num_hidden_layers=12, num_attention_heads=12, intermediate_size=3072, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=2, initializer_range=0.02, layer_norm_eps=1e-12, **kwargs): super(BertConfig, self).__init__(**kwargs) if isinstance(vocab_size_or_config_json_file, str) or (sys.version_info[0] == 2 and isinstance(vocab_size_or_config_json_file, unicode)): with open(vocab_size_or_config_json_file, "r", encoding='utf-8') as reader: json_config = json.loads(reader.read()) for key, value in json_config.items(): self.__dict__[key] = value elif isinstance(vocab_size_or_config_json_file, int): self.vocab_size = vocab_size_or_config_json_file self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.hidden_act = hidden_act self.intermediate_size = intermediate_size self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.initializer_range = initializer_range self.layer_norm_eps = layer_norm_eps else: raise ValueError("First argument must be either a vocabulary size (int)" " or the path to a pretrained model config file (str)")
6,412
55.254386
181
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_utils.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch BERT model.""" from __future__ import (absolute_import, division, print_function, unicode_literals) import copy import json import logging import os from io import open import six import torch from torch import nn from torch.nn import CrossEntropyLoss from torch.nn import functional as F from .configuration_utils import PretrainedConfig from .file_utils import cached_path, WEIGHTS_NAME, TF_WEIGHTS_NAME logger = logging.getLogger(__name__) try: from torch.nn import Identity except ImportError: # Older PyTorch compatibility class Identity(nn.Module): r"""A placeholder identity operator that is argument-insensitive. """ def __init__(self, *args, **kwargs): super(Identity, self).__init__() def forward(self, input): return input class PreTrainedModel(nn.Module): r""" Base class for all models. :class:`~pytorch_transformers.PreTrainedModel` takes care of storing the configuration of the models and handles methods for loading/downloading/saving models as well as a few methods commons to all models to (i) resize the input embeddings and (ii) prune heads in the self-attention heads. Class attributes (overridden by derived classes): - ``config_class``: a class derived from :class:`~pytorch_transformers.PretrainedConfig` to use as configuration class for this model architecture. - ``pretrained_model_archive_map``: a python ``dict`` of with `short-cut-names` (string) as keys and `url` (string) of associated pretrained weights as values. - ``load_tf_weights``: a python ``method`` for loading a TensorFlow checkpoint in a PyTorch model, taking as arguments: - ``model``: an instance of the relevant subclass of :class:`~pytorch_transformers.PreTrainedModel`, - ``config``: an instance of the relevant subclass of :class:`~pytorch_transformers.PretrainedConfig`, - ``path``: a path (string) to the TensorFlow checkpoint. - ``base_model_prefix``: a string indicating the attribute associated to the base model in derived classes of the same architecture adding modules on top of the base model. """ config_class = None pretrained_model_archive_map = {} load_tf_weights = lambda model, config, path: None base_model_prefix = "" def __init__(self, config, *inputs, **kwargs): super(PreTrainedModel, self).__init__() if not isinstance(config, PretrainedConfig): raise ValueError( "Parameter config in `{}(config)` should be an instance of class `PretrainedConfig`. " "To create a model from a pretrained model use " "`model = {}.from_pretrained(PRETRAINED_MODEL_NAME)`".format( self.__class__.__name__, self.__class__.__name__ )) # Save config in model self.config = config def _get_resized_embeddings(self, old_embeddings, new_num_tokens=None): """ Build a resized Embedding Module from a provided token Embedding Module. Increasing the size will add newly initialized vectors at the end Reducing the size will remove vectors from the end Args: new_num_tokens: (`optional`) int New number of tokens in the embedding matrix. Increasing the size will add newly initialized vectors at the end Reducing the size will remove vectors from the end If not provided or None: return the provided token Embedding Module. Return: ``torch.nn.Embeddings`` Pointer to the resized Embedding Module or the old Embedding Module if new_num_tokens is None """ if new_num_tokens is None: return old_embeddings old_num_tokens, old_embedding_dim = old_embeddings.weight.size() if old_num_tokens == new_num_tokens: return old_embeddings # Build new embeddings new_embeddings = nn.Embedding(new_num_tokens, old_embedding_dim) new_embeddings.to(old_embeddings.weight.device) # initialize all new embeddings (in particular added tokens) self._init_weights(new_embeddings) # Copy word embeddings from the previous weights num_tokens_to_copy = min(old_num_tokens, new_num_tokens) new_embeddings.weight.data[:num_tokens_to_copy, :] = old_embeddings.weight.data[:num_tokens_to_copy, :] return new_embeddings def _tie_or_clone_weights(self, first_module, second_module): """ Tie or clone module weights depending of weither we are using TorchScript or not """ if self.config.torchscript: first_module.weight = nn.Parameter(second_module.weight.clone()) else: first_module.weight = second_module.weight if hasattr(first_module, 'bias') and first_module.bias is not None: first_module.bias.data = torch.nn.functional.pad( first_module.bias.data, (0, first_module.weight.shape[0] - first_module.bias.shape[0]), 'constant', 0 ) def resize_token_embeddings(self, new_num_tokens=None): """ Resize input token embeddings matrix of the model if new_num_tokens != config.vocab_size. Take care of tying weights embeddings afterwards if the model class has a `tie_weights()` method. Arguments: new_num_tokens: (`optional`) int: New number of tokens in the embedding matrix. Increasing the size will add newly initialized vectors at the end. Reducing the size will remove vectors from the end. If not provided or None: does nothing and just returns a pointer to the input tokens ``torch.nn.Embeddings`` Module of the model. Return: ``torch.nn.Embeddings`` Pointer to the input tokens Embeddings Module of the model """ base_model = getattr(self, self.base_model_prefix, self) # get the base model if needed model_embeds = base_model._resize_token_embeddings(new_num_tokens) if new_num_tokens is None: return model_embeds # Update base model and current model config self.config.vocab_size = new_num_tokens base_model.vocab_size = new_num_tokens # Tie weights again if needed if hasattr(self, 'tie_weights'): self.tie_weights() return model_embeds def init_weights(self): """ Initialize and prunes weights if needed. """ # Initialize weights self.apply(self._init_weights) # Prune heads if needed if self.config.pruned_heads: self.prune_heads(self.config.pruned_heads) def prune_heads(self, heads_to_prune): """ Prunes heads of the base model. Arguments: heads_to_prune: dict with keys being selected layer indices (`int`) and associated values being the list of heads to prune in said layer (list of `int`). E.g. {1: [0, 2], 2: [2, 3]} will prune heads 0 and 2 on layer 1 and heads 2 and 3 on layer 2. """ base_model = getattr(self, self.base_model_prefix, self) # get the base model if needed # save new sets of pruned heads as union of previously stored pruned heads and newly pruned heads for layer, heads in heads_to_prune.items(): union_heads = set(self.config.pruned_heads.get(layer, [])) | set(heads) self.config.pruned_heads[layer] = list(union_heads) # Unfortunately we have to store it as list for JSON base_model._prune_heads(heads_to_prune) def save_pretrained(self, save_directory): """ Save a model and its configuration file to a directory, so that it can be re-loaded using the `:func:`~pytorch_transformers.PreTrainedModel.from_pretrained`` class method. """ assert os.path.isdir(save_directory), "Saving path should be a directory where the model and configuration can be saved" # Only save the model it-self if we are using distributed training model_to_save = self.module if hasattr(self, 'module') else self # Save configuration file model_to_save.config.save_pretrained(save_directory) # If we save using the predefined names, we can load using `from_pretrained` output_model_file = os.path.join(save_directory, WEIGHTS_NAME) torch.save(model_to_save.state_dict(), output_model_file) @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *model_args, **kwargs): r"""Instantiate a pretrained pytorch model from a pre-trained model configuration. The model is set in evaluation mode by default using ``model.eval()`` (Dropout modules are deactivated) To train the model, you should first set it back in training mode with ``model.train()`` The warning ``Weights from XXX not initialized from pretrained model`` means that the weights of XXX do not come pre-trained with the rest of the model. It is up to you to train those weights with a downstream fine-tuning task. The warning ``Weights from XXX not used in YYY`` means that the layer XXX is not used by YYY, therefore those weights are discarded. Parameters: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing model weights saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained`, e.g.: ``./my_model_directory/``. - a path or url to a `tensorflow index checkpoint file` (e.g. `./tf_model/model.ckpt.index`). In this case, ``from_tf`` should be set to True and a configuration object should be provided as ``config`` argument. This loading path is slower than converting the TensorFlow checkpoint in a PyTorch model using the provided conversion scripts and loading the PyTorch model afterwards. model_args: (`optional`) Sequence of positional arguments: All remaning positional arguments will be passed to the underlying model's ``__init__`` method config: (`optional`) instance of a class derived from :class:`~pytorch_transformers.PretrainedConfig`: Configuration for the model to use instead of an automatically loaded configuation. Configuration can be automatically loaded when: - the model is a model provided by the library (loaded with the ``shortcut-name`` string of a pretrained model), or - the model was saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and is reloaded by suppling the save directory. - the model is loaded by suppling a local directory as ``pretrained_model_name_or_path`` and a configuration JSON file named `config.json` is found in the directory. state_dict: (`optional`) dict: an optional state dictionnary for the model to use instead of a state dictionary loaded from saved weights file. This option can be used if you want to create a model from a pretrained configuration but load your own weights. In this case though, you should check if using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and :func:`~pytorch_transformers.PreTrainedModel.from_pretrained` is not a simpler option. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. output_loading_info: (`optional`) boolean: Set to ``True`` to also return a dictionnary containing missing keys, unexpected keys and error messages. kwargs: (`optional`) Remaining dictionary of keyword arguments: Can be used to update the configuration object (after it being loaded) and initiate the model. (e.g. ``output_attention=True``). Behave differently depending on whether a `config` is provided or automatically loaded: - If a configuration is provided with ``config``, ``**kwargs`` will be directly passed to the underlying model's ``__init__`` method (we assume all relevant updates to the configuration have already been done) - If a configuration is not provided, ``kwargs`` will be first passed to the configuration class initialization function (:func:`~pytorch_transformers.PretrainedConfig.from_pretrained`). Each key of ``kwargs`` that corresponds to a configuration attribute will be used to override said attribute with the supplied ``kwargs`` value. Remaining keys that do not correspond to any configuration attribute will be passed to the underlying model's ``__init__`` function. Examples:: model = BertModel.from_pretrained('bert-base-uncased') # Download model and configuration from S3 and cache. model = BertModel.from_pretrained('./test/saved_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = BertModel.from_pretrained('bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = BertConfig.from_json_file('./tf_model/my_tf_model_config.json') model = BertModel.from_pretrained('./tf_model/my_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ config = kwargs.pop('config', None) state_dict = kwargs.pop('state_dict', None) cache_dir = kwargs.pop('cache_dir', None) from_tf = kwargs.pop('from_tf', False) force_download = kwargs.pop('force_download', False) proxies = kwargs.pop('proxies', None) output_loading_info = kwargs.pop('output_loading_info', False) # Load config if config is None: config, model_kwargs = cls.config_class.from_pretrained( pretrained_model_name_or_path, *model_args, cache_dir=cache_dir, return_unused_kwargs=True, force_download=force_download, **kwargs ) else: model_kwargs = kwargs # Load model if pretrained_model_name_or_path in cls.pretrained_model_archive_map: archive_file = cls.pretrained_model_archive_map[pretrained_model_name_or_path] elif os.path.isdir(pretrained_model_name_or_path): if from_tf: # Directly load from a TensorFlow checkpoint archive_file = os.path.join(pretrained_model_name_or_path, TF_WEIGHTS_NAME + ".index") else: archive_file = os.path.join(pretrained_model_name_or_path, WEIGHTS_NAME) else: if from_tf: # Directly load from a TensorFlow checkpoint archive_file = pretrained_model_name_or_path + ".index" else: archive_file = pretrained_model_name_or_path # redirect to the cache, if necessary try: resolved_archive_file = cached_path(archive_file, cache_dir=cache_dir, force_download=force_download, proxies=proxies) except EnvironmentError as e: if pretrained_model_name_or_path in cls.pretrained_model_archive_map: logger.error( "Couldn't reach server at '{}' to download pretrained weights.".format( archive_file)) else: logger.error( "Model name '{}' was not found in model name list ({}). " "We assumed '{}' was a path or url but couldn't find any file " "associated to this path or url.".format( pretrained_model_name_or_path, ', '.join(cls.pretrained_model_archive_map.keys()), archive_file)) raise e if resolved_archive_file == archive_file: logger.info("loading weights file {}".format(archive_file)) else: logger.info("loading weights file {} from cache at {}".format( archive_file, resolved_archive_file)) # Instantiate model. model = cls(config, *model_args, **model_kwargs) if state_dict is None and not from_tf: state_dict = torch.load(resolved_archive_file, map_location='cpu') if from_tf: # Directly load from a TensorFlow checkpoint return cls.load_tf_weights(model, config, resolved_archive_file[:-6]) # Remove the '.index' # Convert old format to new format if needed from a PyTorch state_dict old_keys = [] new_keys = [] for key in state_dict.keys(): new_key = None if 'gamma' in key: new_key = key.replace('gamma', 'weight') if 'beta' in key: new_key = key.replace('beta', 'bias') if new_key: old_keys.append(key) new_keys.append(new_key) for old_key, new_key in zip(old_keys, new_keys): state_dict[new_key] = state_dict.pop(old_key) # Load from a PyTorch state_dict missing_keys = [] unexpected_keys = [] error_msgs = [] # copy state_dict so _load_from_state_dict can modify it metadata = getattr(state_dict, '_metadata', None) state_dict = state_dict.copy() if metadata is not None: state_dict._metadata = metadata def load(module, prefix=''): local_metadata = {} if metadata is None else metadata.get(prefix[:-1], {}) module._load_from_state_dict( state_dict, prefix, local_metadata, True, missing_keys, unexpected_keys, error_msgs) for name, child in module._modules.items(): if child is not None: load(child, prefix + name + '.') # Make sure we are able to load base models as well as derived models (with heads) start_prefix = '' model_to_load = model if not hasattr(model, cls.base_model_prefix) and any(s.startswith(cls.base_model_prefix) for s in state_dict.keys()): start_prefix = cls.base_model_prefix + '.' if hasattr(model, cls.base_model_prefix) and not any(s.startswith(cls.base_model_prefix) for s in state_dict.keys()): model_to_load = getattr(model, cls.base_model_prefix) load(model_to_load, prefix=start_prefix) if len(missing_keys) > 0: logger.info("Weights of {} not initialized from pretrained model: {}".format( model.__class__.__name__, missing_keys)) if len(unexpected_keys) > 0: logger.info("Weights from pretrained model not used in {}: {}".format( model.__class__.__name__, unexpected_keys)) if len(error_msgs) > 0: raise RuntimeError('Error(s) in loading state_dict for {}:\n\t{}'.format( model.__class__.__name__, "\n\t".join(error_msgs))) if hasattr(model, 'tie_weights'): model.tie_weights() # make sure word embedding weights are still tied # Set model in evaluation mode to desactivate DropOut modules by default model.eval() if output_loading_info: loading_info = {"missing_keys": missing_keys, "unexpected_keys": unexpected_keys, "error_msgs": error_msgs} return model, loading_info return model class Conv1D(nn.Module): def __init__(self, nf, nx): """ Conv1D layer as defined by Radford et al. for OpenAI GPT (and also used in GPT-2) Basically works like a Linear layer but the weights are transposed """ super(Conv1D, self).__init__() self.nf = nf w = torch.empty(nx, nf) nn.init.normal_(w, std=0.02) self.weight = nn.Parameter(w) self.bias = nn.Parameter(torch.zeros(nf)) def forward(self, x): size_out = x.size()[:-1] + (self.nf,) x = torch.addmm(self.bias, x.view(-1, x.size(-1)), self.weight) x = x.view(*size_out) return x class PoolerStartLogits(nn.Module): """ Compute SQuAD start_logits from sequence hidden states. """ def __init__(self, config): super(PoolerStartLogits, self).__init__() self.dense = nn.Linear(config.hidden_size, 1) def forward(self, hidden_states, p_mask=None): """ Args: **p_mask**: (`optional`) ``torch.FloatTensor`` of shape `(batch_size, seq_len)` invalid position mask such as query and special symbols (PAD, SEP, CLS) 1.0 means token should be masked. """ x = self.dense(hidden_states).squeeze(-1) if p_mask is not None: x = x * (1 - p_mask) - 1e30 * p_mask return x class PoolerEndLogits(nn.Module): """ Compute SQuAD end_logits from sequence hidden states and start token hidden state. """ def __init__(self, config): super(PoolerEndLogits, self).__init__() self.dense_0 = nn.Linear(config.hidden_size * 2, config.hidden_size) self.activation = nn.Tanh() self.LayerNorm = nn.LayerNorm(config.hidden_size, eps=config.layer_norm_eps) self.dense_1 = nn.Linear(config.hidden_size, 1) def forward(self, hidden_states, start_states=None, start_positions=None, p_mask=None): """ Args: One of ``start_states``, ``start_positions`` should be not None. If both are set, ``start_positions`` overrides ``start_states``. **start_states**: ``torch.LongTensor`` of shape identical to hidden_states hidden states of the first tokens for the labeled span. **start_positions**: ``torch.LongTensor`` of shape ``(batch_size,)`` position of the first token for the labeled span: **p_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, seq_len)`` Mask of invalid position such as query and special symbols (PAD, SEP, CLS) 1.0 means token should be masked. """ assert start_states is not None or start_positions is not None, "One of start_states, start_positions should be not None" if start_positions is not None: slen, hsz = hidden_states.shape[-2:] start_positions = start_positions[:, None, None].expand(-1, -1, hsz) # shape (bsz, 1, hsz) start_states = hidden_states.gather(-2, start_positions) # shape (bsz, 1, hsz) start_states = start_states.expand(-1, slen, -1) # shape (bsz, slen, hsz) x = self.dense_0(torch.cat([hidden_states, start_states], dim=-1)) x = self.activation(x) x = self.LayerNorm(x) x = self.dense_1(x).squeeze(-1) if p_mask is not None: x = x * (1 - p_mask) - 1e30 * p_mask return x class PoolerAnswerClass(nn.Module): """ Compute SQuAD 2.0 answer class from classification and start tokens hidden states. """ def __init__(self, config): super(PoolerAnswerClass, self).__init__() self.dense_0 = nn.Linear(config.hidden_size * 2, config.hidden_size) self.activation = nn.Tanh() self.dense_1 = nn.Linear(config.hidden_size, 1, bias=False) def forward(self, hidden_states, start_states=None, start_positions=None, cls_index=None): """ Args: One of ``start_states``, ``start_positions`` should be not None. If both are set, ``start_positions`` overrides ``start_states``. **start_states**: ``torch.LongTensor`` of shape identical to ``hidden_states``. hidden states of the first tokens for the labeled span. **start_positions**: ``torch.LongTensor`` of shape ``(batch_size,)`` position of the first token for the labeled span. **cls_index**: torch.LongTensor of shape ``(batch_size,)`` position of the CLS token. If None, take the last token. note(Original repo): no dependency on end_feature so that we can obtain one single `cls_logits` for each sample """ hsz = hidden_states.shape[-1] assert start_states is not None or start_positions is not None, "One of start_states, start_positions should be not None" if start_positions is not None: start_positions = start_positions[:, None, None].expand(-1, -1, hsz) # shape (bsz, 1, hsz) start_states = hidden_states.gather(-2, start_positions).squeeze(-2) # shape (bsz, hsz) if cls_index is not None: cls_index = cls_index[:, None, None].expand(-1, -1, hsz) # shape (bsz, 1, hsz) cls_token_state = hidden_states.gather(-2, cls_index).squeeze(-2) # shape (bsz, hsz) else: cls_token_state = hidden_states[:, -1, :] # shape (bsz, hsz) x = self.dense_0(torch.cat([start_states, cls_token_state], dim=-1)) x = self.activation(x) x = self.dense_1(x).squeeze(-1) return x class SQuADHead(nn.Module): r""" A SQuAD head inspired by XLNet. Parameters: config (:class:`~pytorch_transformers.XLNetConfig`): Model configuration class with all the parameters of the model. Inputs: **hidden_states**: ``torch.FloatTensor`` of shape ``(batch_size, seq_len, hidden_size)`` hidden states of sequence tokens **start_positions**: ``torch.LongTensor`` of shape ``(batch_size,)`` position of the first token for the labeled span. **end_positions**: ``torch.LongTensor`` of shape ``(batch_size,)`` position of the last token for the labeled span. **cls_index**: torch.LongTensor of shape ``(batch_size,)`` position of the CLS token. If None, take the last token. **is_impossible**: ``torch.LongTensor`` of shape ``(batch_size,)`` Whether the question has a possible answer in the paragraph or not. **p_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, seq_len)`` Mask of invalid position such as query and special symbols (PAD, SEP, CLS) 1.0 means token should be masked. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned if both ``start_positions`` and ``end_positions`` are provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification loss as the sum of start token, end token (and is_impossible if provided) classification losses. **start_top_log_probs**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size, config.start_n_top)`` Log probabilities for the top config.start_n_top start token possibilities (beam-search). **start_top_index**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.LongTensor`` of shape ``(batch_size, config.start_n_top)`` Indices for the top config.start_n_top start token possibilities (beam-search). **end_top_log_probs**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size, config.start_n_top * config.end_n_top)`` Log probabilities for the top ``config.start_n_top * config.end_n_top`` end token possibilities (beam-search). **end_top_index**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.LongTensor`` of shape ``(batch_size, config.start_n_top * config.end_n_top)`` Indices for the top ``config.start_n_top * config.end_n_top`` end token possibilities (beam-search). **cls_logits**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size,)`` Log probabilities for the ``is_impossible`` label of the answers. """ def __init__(self, config): super(SQuADHead, self).__init__() self.start_n_top = config.start_n_top self.end_n_top = config.end_n_top self.start_logits = PoolerStartLogits(config) self.end_logits = PoolerEndLogits(config) self.answer_class = PoolerAnswerClass(config) def forward(self, hidden_states, start_positions=None, end_positions=None, cls_index=None, is_impossible=None, p_mask=None): outputs = () start_logits = self.start_logits(hidden_states, p_mask=p_mask) if start_positions is not None and end_positions is not None: # If we are on multi-GPU, let's remove the dimension added by batch splitting for x in (start_positions, end_positions, cls_index, is_impossible): if x is not None and x.dim() > 1: x.squeeze_(-1) # during training, compute the end logits based on the ground truth of the start position end_logits = self.end_logits(hidden_states, start_positions=start_positions, p_mask=p_mask) loss_fct = CrossEntropyLoss() start_loss = loss_fct(start_logits, start_positions) end_loss = loss_fct(end_logits, end_positions) total_loss = (start_loss + end_loss) / 2 if cls_index is not None and is_impossible is not None: # Predict answerability from the representation of CLS and START cls_logits = self.answer_class(hidden_states, start_positions=start_positions, cls_index=cls_index) loss_fct_cls = nn.BCEWithLogitsLoss() cls_loss = loss_fct_cls(cls_logits, is_impossible) # note(zhiliny): by default multiply the loss by 0.5 so that the scale is comparable to start_loss and end_loss total_loss += cls_loss * 0.5 outputs = (total_loss,) + outputs else: # during inference, compute the end logits based on beam search bsz, slen, hsz = hidden_states.size() start_log_probs = F.softmax(start_logits, dim=-1) # shape (bsz, slen) start_top_log_probs, start_top_index = torch.topk(start_log_probs, self.start_n_top, dim=-1) # shape (bsz, start_n_top) start_top_index_exp = start_top_index.unsqueeze(-1).expand(-1, -1, hsz) # shape (bsz, start_n_top, hsz) start_states = torch.gather(hidden_states, -2, start_top_index_exp) # shape (bsz, start_n_top, hsz) start_states = start_states.unsqueeze(1).expand(-1, slen, -1, -1) # shape (bsz, slen, start_n_top, hsz) hidden_states_expanded = hidden_states.unsqueeze(2).expand_as(start_states) # shape (bsz, slen, start_n_top, hsz) p_mask = p_mask.unsqueeze(-1) if p_mask is not None else None end_logits = self.end_logits(hidden_states_expanded, start_states=start_states, p_mask=p_mask) end_log_probs = F.softmax(end_logits, dim=1) # shape (bsz, slen, start_n_top) end_top_log_probs, end_top_index = torch.topk(end_log_probs, self.end_n_top, dim=1) # shape (bsz, end_n_top, start_n_top) end_top_log_probs = end_top_log_probs.view(-1, self.start_n_top * self.end_n_top) end_top_index = end_top_index.view(-1, self.start_n_top * self.end_n_top) start_states = torch.einsum("blh,bl->bh", hidden_states, start_log_probs) cls_logits = self.answer_class(hidden_states, start_states=start_states, cls_index=cls_index) outputs = (start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits) + outputs # return start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits # or (if labels are provided) (total_loss,) return outputs class SequenceSummary(nn.Module): r""" Compute a single vector summary of a sequence hidden states according to various possibilities: Args of the config class: summary_type: - 'last' => [default] take the last token hidden state (like XLNet) - 'first' => take the first token hidden state (like Bert) - 'mean' => take the mean of all tokens hidden states - 'cls_index' => supply a Tensor of classification token position (GPT/GPT-2) - 'attn' => Not implemented now, use multi-head attention summary_use_proj: Add a projection after the vector extraction summary_proj_to_labels: If True, the projection outputs to config.num_labels classes (otherwise to hidden_size). Default: False. summary_activation: 'tanh' => add a tanh activation to the output, Other => no activation. Default summary_first_dropout: Add a dropout before the projection and activation summary_last_dropout: Add a dropout after the projection and activation """ def __init__(self, config): super(SequenceSummary, self).__init__() self.summary_type = config.summary_type if hasattr(config, 'summary_use_proj') else 'last' if self.summary_type == 'attn': # We should use a standard multi-head attention module with absolute positional embedding for that. # Cf. https://github.com/zihangdai/xlnet/blob/master/modeling.py#L253-L276 # We can probably just use the multi-head attention module of PyTorch >=1.1.0 raise NotImplementedError self.summary = Identity() if hasattr(config, 'summary_use_proj') and config.summary_use_proj: if hasattr(config, 'summary_proj_to_labels') and config.summary_proj_to_labels and config.num_labels > 0: num_classes = config.num_labels else: num_classes = config.hidden_size self.summary = nn.Linear(config.hidden_size, num_classes) self.activation = Identity() if hasattr(config, 'summary_activation') and config.summary_activation == 'tanh': self.activation = nn.Tanh() self.first_dropout = Identity() if hasattr(config, 'summary_first_dropout') and config.summary_first_dropout > 0: self.first_dropout = nn.Dropout(config.summary_first_dropout) self.last_dropout = Identity() if hasattr(config, 'summary_last_dropout') and config.summary_last_dropout > 0: self.last_dropout = nn.Dropout(config.summary_last_dropout) def forward(self, hidden_states, cls_index=None): """ hidden_states: float Tensor in shape [bsz, seq_len, hidden_size], the hidden-states of the last layer. cls_index: [optional] position of the classification token if summary_type == 'cls_index', shape (bsz,) or more generally (bsz, ...) where ... are optional leading dimensions of hidden_states. if summary_type == 'cls_index' and cls_index is None: we take the last token of the sequence as classification token """ if self.summary_type == 'last': output = hidden_states[:, -1] elif self.summary_type == 'first': output = hidden_states[:, 0] elif self.summary_type == 'mean': output = hidden_states.mean(dim=1) elif self.summary_type == 'cls_index': if cls_index is None: cls_index = torch.full_like(hidden_states[..., :1, :], hidden_states.shape[-2]-1, dtype=torch.long) else: cls_index = cls_index.unsqueeze(-1).unsqueeze(-1) cls_index = cls_index.expand((-1,) * (cls_index.dim()-1) + (hidden_states.size(-1),)) # shape of cls_index: (bsz, XX, 1, hidden_size) where XX are optional leading dim of hidden_states output = hidden_states.gather(-2, cls_index).squeeze(-2) # shape (bsz, XX, hidden_size) elif self.summary_type == 'attn': raise NotImplementedError output = self.first_dropout(output) output = self.summary(output) output = self.activation(output) output = self.last_dropout(output) return output def prune_linear_layer(layer, index, dim=0): """ Prune a linear layer (a model parameters) to keep only entries in index. Return the pruned layer as a new layer with requires_grad=True. Used to remove heads. """ index = index.to(layer.weight.device) W = layer.weight.index_select(dim, index).clone().detach() if layer.bias is not None: if dim == 1: b = layer.bias.clone().detach() else: b = layer.bias[index].clone().detach() new_size = list(layer.weight.size()) new_size[dim] = len(index) new_layer = nn.Linear(new_size[1], new_size[0], bias=layer.bias is not None).to(layer.weight.device) new_layer.weight.requires_grad = False new_layer.weight.copy_(W.contiguous()) new_layer.weight.requires_grad = True if layer.bias is not None: new_layer.bias.requires_grad = False new_layer.bias.copy_(b.contiguous()) new_layer.bias.requires_grad = True return new_layer def prune_conv1d_layer(layer, index, dim=1): """ Prune a Conv1D layer (a model parameters) to keep only entries in index. A Conv1D work as a Linear layer (see e.g. BERT) but the weights are transposed. Return the pruned layer as a new layer with requires_grad=True. Used to remove heads. """ index = index.to(layer.weight.device) W = layer.weight.index_select(dim, index).clone().detach() if dim == 0: b = layer.bias.clone().detach() else: b = layer.bias[index].clone().detach() new_size = list(layer.weight.size()) new_size[dim] = len(index) new_layer = Conv1D(new_size[1], new_size[0]).to(layer.weight.device) new_layer.weight.requires_grad = False new_layer.weight.copy_(W.contiguous()) new_layer.weight.requires_grad = True new_layer.bias.requires_grad = False new_layer.bias.copy_(b.contiguous()) new_layer.bias.requires_grad = True return new_layer def prune_layer(layer, index, dim=None): """ Prune a Conv1D or nn.Linear layer (a model parameters) to keep only entries in index. Return the pruned layer as a new layer with requires_grad=True. Used to remove heads. """ if isinstance(layer, nn.Linear): return prune_linear_layer(layer, index, dim=0 if dim is None else dim) elif isinstance(layer, Conv1D): return prune_conv1d_layer(layer, index, dim=1 if dim is None else dim) else: raise ValueError("Can't prune layer of class {}".format(layer.__class__))
40,276
51.104787
480
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_bert.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch BERT model. """ from __future__ import absolute_import, division, print_function, unicode_literals import json import logging import math import os import sys from io import open import torch from torch import nn from torch.nn import CrossEntropyLoss, MSELoss from .modeling_utils import PreTrainedModel, prune_linear_layer from .configuration_bert import BertConfig from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) BERT_PRETRAINED_MODEL_ARCHIVE_MAP = { 'bert-base-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-uncased-pytorch_model.bin", 'bert-large-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-pytorch_model.bin", 'bert-base-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-pytorch_model.bin", 'bert-large-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-pytorch_model.bin", 'bert-base-multilingual-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-uncased-pytorch_model.bin", 'bert-base-multilingual-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-cased-pytorch_model.bin", 'bert-base-chinese': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-chinese-pytorch_model.bin", 'bert-base-german-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-german-cased-pytorch_model.bin", 'bert-large-uncased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-pytorch_model.bin", 'bert-large-cased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-pytorch_model.bin", 'bert-large-uncased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-finetuned-squad-pytorch_model.bin", 'bert-large-cased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-finetuned-squad-pytorch_model.bin", 'bert-base-cased-finetuned-mrpc': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-finetuned-mrpc-pytorch_model.bin", } def load_tf_weights_in_bert(model, config, tf_checkpoint_path): """ Load tf checkpoints in a pytorch model. """ try: import re import numpy as np import tensorflow as tf except ImportError: logger.error("Loading a TensorFlow model in PyTorch, requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise tf_path = os.path.abspath(tf_checkpoint_path) logger.info("Converting TensorFlow checkpoint from {}".format(tf_path)) # Load weights from TF model init_vars = tf.train.list_variables(tf_path) names = [] arrays = [] for name, shape in init_vars: logger.info("Loading TF weight {} with shape {}".format(name, shape)) array = tf.train.load_variable(tf_path, name) names.append(name) arrays.append(array) for name, array in zip(names, arrays): name = name.split('/') # adam_v and adam_m are variables used in AdamWeightDecayOptimizer to calculated m and v # which are not required for using pretrained model if any(n in ["adam_v", "adam_m", "global_step"] for n in name): logger.info("Skipping {}".format("/".join(name))) continue pointer = model for m_name in name: if re.fullmatch(r'[A-Za-z]+_\d+', m_name): l = re.split(r'_(\d+)', m_name) else: l = [m_name] if l[0] == 'kernel' or l[0] == 'gamma': pointer = getattr(pointer, 'weight') elif l[0] == 'output_bias' or l[0] == 'beta': pointer = getattr(pointer, 'bias') elif l[0] == 'output_weights': pointer = getattr(pointer, 'weight') elif l[0] == 'squad': pointer = getattr(pointer, 'classifier') else: try: pointer = getattr(pointer, l[0]) except AttributeError: logger.info("Skipping {}".format("/".join(name))) continue if len(l) >= 2: num = int(l[1]) pointer = pointer[num] if m_name[-11:] == '_embeddings': pointer = getattr(pointer, 'weight') elif m_name == 'kernel': array = np.transpose(array) try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise logger.info("Initialize PyTorch weight {}".format(name)) pointer.data = torch.from_numpy(array) return model def gelu(x): """Implementation of the gelu activation function. For information: OpenAI GPT's gelu is slightly different (and gives slightly different results): 0.5 * x * (1 + torch.tanh(math.sqrt(2 / math.pi) * (x + 0.044715 * torch.pow(x, 3)))) Also see https://arxiv.org/abs/1606.08415 """ return x * 0.5 * (1.0 + torch.erf(x / math.sqrt(2.0))) def swish(x): return x * torch.sigmoid(x) ACT2FN = {"gelu": gelu, "relu": torch.nn.functional.relu, "swish": swish} try: from apex.normalization.fused_layer_norm import FusedLayerNorm as BertLayerNorm except (ImportError, AttributeError) as e: logger.info("Better speed can be achieved with apex installed from https://www.github.com/nvidia/apex .") BertLayerNorm = torch.nn.LayerNorm class BertEmbeddings(nn.Module): """Construct the embeddings from word, position and token_type embeddings. """ def __init__(self, config): super(BertEmbeddings, self).__init__() self.word_embeddings = nn.Embedding(config.vocab_size, config.hidden_size, padding_idx=0) self.position_embeddings = nn.Embedding(config.max_position_embeddings, config.hidden_size) self.token_type_embeddings = nn.Embedding(config.type_vocab_size, config.hidden_size) # self.LayerNorm is not snake-cased to stick with TensorFlow model variable name and be able to load # any TensorFlow checkpoint file self.LayerNorm = BertLayerNorm(config.hidden_size, eps=config.layer_norm_eps) self.dropout = nn.Dropout(config.hidden_dropout_prob) def forward(self, input_ids, token_type_ids=None, position_ids=None): seq_length = input_ids.size(1) if position_ids is None: position_ids = torch.arange(seq_length, dtype=torch.long, device=input_ids.device) position_ids = position_ids.unsqueeze(0).expand_as(input_ids) if token_type_ids is None: token_type_ids = torch.zeros_like(input_ids) words_embeddings = self.word_embeddings(input_ids) position_embeddings = self.position_embeddings(position_ids) token_type_embeddings = self.token_type_embeddings(token_type_ids) embeddings = words_embeddings + position_embeddings + token_type_embeddings embeddings = self.LayerNorm(embeddings) embeddings = self.dropout(embeddings) return embeddings class BertSelfAttention(nn.Module): def __init__(self, config): super(BertSelfAttention, self).__init__() if config.hidden_size % config.num_attention_heads != 0: raise ValueError( "The hidden size (%d) is not a multiple of the number of attention " "heads (%d)" % (config.hidden_size, config.num_attention_heads)) self.output_attentions = config.output_attentions self.num_attention_heads = config.num_attention_heads self.attention_head_size = int(config.hidden_size / config.num_attention_heads) self.all_head_size = self.num_attention_heads * self.attention_head_size self.query = nn.Linear(config.hidden_size, self.all_head_size) self.key = nn.Linear(config.hidden_size, self.all_head_size) self.value = nn.Linear(config.hidden_size, self.all_head_size) self.dropout = nn.Dropout(config.attention_probs_dropout_prob) def transpose_for_scores(self, x): new_x_shape = x.size()[:-1] + (self.num_attention_heads, self.attention_head_size) x = x.view(*new_x_shape) return x.permute(0, 2, 1, 3) def forward(self, hidden_states, attention_mask, head_mask=None): mixed_query_layer = self.query(hidden_states) mixed_key_layer = self.key(hidden_states) mixed_value_layer = self.value(hidden_states) query_layer = self.transpose_for_scores(mixed_query_layer) key_layer = self.transpose_for_scores(mixed_key_layer) value_layer = self.transpose_for_scores(mixed_value_layer) # Take the dot product between "query" and "key" to get the raw attention scores. attention_scores = torch.matmul(query_layer, key_layer.transpose(-1, -2)) attention_scores = attention_scores / math.sqrt(self.attention_head_size) # Apply the attention mask is (precomputed for all layers in BertModel forward() function) attention_scores = attention_scores + attention_mask # Normalize the attention scores to probabilities. attention_probs = nn.Softmax(dim=-1)(attention_scores) # This is actually dropping out entire tokens to attend to, which might # seem a bit unusual, but is taken from the original Transformer paper. attention_probs = self.dropout(attention_probs) # Mask heads if we want to if head_mask is not None: attention_probs = attention_probs * head_mask context_layer = torch.matmul(attention_probs, value_layer) context_layer = context_layer.permute(0, 2, 1, 3).contiguous() new_context_layer_shape = context_layer.size()[:-2] + (self.all_head_size,) context_layer = context_layer.view(*new_context_layer_shape) outputs = (context_layer, attention_probs) if self.output_attentions else (context_layer,) return outputs class BertSelfOutput(nn.Module): def __init__(self, config): super(BertSelfOutput, self).__init__() self.dense = nn.Linear(config.hidden_size, config.hidden_size) self.LayerNorm = BertLayerNorm(config.hidden_size, eps=config.layer_norm_eps) self.dropout = nn.Dropout(config.hidden_dropout_prob) def forward(self, hidden_states, input_tensor): hidden_states = self.dense(hidden_states) hidden_states = self.dropout(hidden_states) hidden_states = self.LayerNorm(hidden_states + input_tensor) return hidden_states class BertAttention(nn.Module): def __init__(self, config): super(BertAttention, self).__init__() self.self = BertSelfAttention(config) self.output = BertSelfOutput(config) self.pruned_heads = set() def prune_heads(self, heads): if len(heads) == 0: return mask = torch.ones(self.self.num_attention_heads, self.self.attention_head_size) heads = set(heads) - self.pruned_heads # Convert to set and emove already pruned heads for head in heads: # Compute how many pruned heads are before the head and move the index accordingly head = head - sum(1 if h < head else 0 for h in self.pruned_heads) mask[head] = 0 mask = mask.view(-1).contiguous().eq(1) index = torch.arange(len(mask))[mask].long() # Prune linear layers self.self.query = prune_linear_layer(self.self.query, index) self.self.key = prune_linear_layer(self.self.key, index) self.self.value = prune_linear_layer(self.self.value, index) self.output.dense = prune_linear_layer(self.output.dense, index, dim=1) # Update hyper params and store pruned heads self.self.num_attention_heads = self.self.num_attention_heads - len(heads) self.self.all_head_size = self.self.attention_head_size * self.self.num_attention_heads self.pruned_heads = self.pruned_heads.union(heads) def forward(self, input_tensor, attention_mask, head_mask=None): self_outputs = self.self(input_tensor, attention_mask, head_mask) attention_output = self.output(self_outputs[0], input_tensor) outputs = (attention_output,) + self_outputs[1:] # add attentions if we output them return outputs class BertIntermediate(nn.Module): def __init__(self, config): super(BertIntermediate, self).__init__() self.dense = nn.Linear(config.hidden_size, config.intermediate_size) if isinstance(config.hidden_act, str) or (sys.version_info[0] == 2 and isinstance(config.hidden_act, unicode)): self.intermediate_act_fn = ACT2FN[config.hidden_act] else: self.intermediate_act_fn = config.hidden_act def forward(self, hidden_states): hidden_states = self.dense(hidden_states) hidden_states = self.intermediate_act_fn(hidden_states) return hidden_states class BertOutput(nn.Module): def __init__(self, config): super(BertOutput, self).__init__() self.dense = nn.Linear(config.intermediate_size, config.hidden_size) self.LayerNorm = BertLayerNorm(config.hidden_size, eps=config.layer_norm_eps) self.dropout = nn.Dropout(config.hidden_dropout_prob) def forward(self, hidden_states, input_tensor): hidden_states = self.dense(hidden_states) hidden_states = self.dropout(hidden_states) hidden_states = self.LayerNorm(hidden_states + input_tensor) return hidden_states class BertLayer(nn.Module): def __init__(self, config): super(BertLayer, self).__init__() self.attention = BertAttention(config) self.intermediate = BertIntermediate(config) self.output = BertOutput(config) def forward(self, hidden_states, attention_mask, head_mask=None): attention_outputs = self.attention(hidden_states, attention_mask, head_mask) attention_output = attention_outputs[0] intermediate_output = self.intermediate(attention_output) layer_output = self.output(intermediate_output, attention_output) outputs = (layer_output,) + attention_outputs[1:] # add attentions if we output them return outputs class BertEncoder(nn.Module): def __init__(self, config): super(BertEncoder, self).__init__() self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states self.layer = nn.ModuleList([BertLayer(config) for _ in range(config.num_hidden_layers)]) def forward(self, hidden_states, attention_mask, head_mask=None): all_hidden_states = () all_attentions = () for i, layer_module in enumerate(self.layer): if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states,) layer_outputs = layer_module(hidden_states, attention_mask, head_mask[i]) hidden_states = layer_outputs[0] if self.output_attentions: all_attentions = all_attentions + (layer_outputs[1],) # Add last layer if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states,) outputs = (hidden_states,) if self.output_hidden_states: outputs = outputs + (all_hidden_states,) if self.output_attentions: outputs = outputs + (all_attentions,) return outputs # last-layer hidden state, (all hidden states), (all attentions) class BertPooler(nn.Module): def __init__(self, config): super(BertPooler, self).__init__() self.dense = nn.Linear(config.hidden_size, config.hidden_size) self.activation = nn.Tanh() def forward(self, hidden_states): # We "pool" the model by simply taking the hidden state corresponding # to the first token. first_token_tensor = hidden_states[:, 0] pooled_output = self.dense(first_token_tensor) pooled_output = self.activation(pooled_output) return pooled_output class BertPredictionHeadTransform(nn.Module): def __init__(self, config): super(BertPredictionHeadTransform, self).__init__() self.dense = nn.Linear(config.hidden_size, config.hidden_size) if isinstance(config.hidden_act, str) or (sys.version_info[0] == 2 and isinstance(config.hidden_act, unicode)): self.transform_act_fn = ACT2FN[config.hidden_act] else: self.transform_act_fn = config.hidden_act self.LayerNorm = BertLayerNorm(config.hidden_size, eps=config.layer_norm_eps) def forward(self, hidden_states): hidden_states = self.dense(hidden_states) hidden_states = self.transform_act_fn(hidden_states) hidden_states = self.LayerNorm(hidden_states) return hidden_states class BertLMPredictionHead(nn.Module): def __init__(self, config): super(BertLMPredictionHead, self).__init__() self.transform = BertPredictionHeadTransform(config) # The output weights are the same as the input embeddings, but there is # an output-only bias for each token. self.decoder = nn.Linear(config.hidden_size, config.vocab_size, bias=False) self.bias = nn.Parameter(torch.zeros(config.vocab_size)) def forward(self, hidden_states): hidden_states = self.transform(hidden_states) hidden_states = self.decoder(hidden_states) + self.bias return hidden_states class BertOnlyMLMHead(nn.Module): def __init__(self, config): super(BertOnlyMLMHead, self).__init__() self.predictions = BertLMPredictionHead(config) def forward(self, sequence_output): prediction_scores = self.predictions(sequence_output) return prediction_scores class BertOnlyNSPHead(nn.Module): def __init__(self, config): super(BertOnlyNSPHead, self).__init__() self.seq_relationship = nn.Linear(config.hidden_size, 2) def forward(self, pooled_output): seq_relationship_score = self.seq_relationship(pooled_output) return seq_relationship_score class BertPreTrainingHeads(nn.Module): def __init__(self, config): super(BertPreTrainingHeads, self).__init__() self.predictions = BertLMPredictionHead(config) self.seq_relationship = nn.Linear(config.hidden_size, 2) def forward(self, sequence_output, pooled_output): prediction_scores = self.predictions(sequence_output) seq_relationship_score = self.seq_relationship(pooled_output) return prediction_scores, seq_relationship_score class BertPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = BertConfig pretrained_model_archive_map = BERT_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = load_tf_weights_in_bert base_model_prefix = "bert" def _init_weights(self, module): """ Initialize the weights """ if isinstance(module, (nn.Linear, nn.Embedding)): # Slightly different from the TF version which uses truncated_normal for initialization # cf https://github.com/pytorch/pytorch/pull/5617 module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) elif isinstance(module, BertLayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) if isinstance(module, nn.Linear) and module.bias is not None: module.bias.data.zero_() BERT_START_DOCSTRING = r""" The BERT model was proposed in `BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding`_ by Jacob Devlin, Ming-Wei Chang, Kenton Lee and Kristina Toutanova. It's a bidirectional transformer pre-trained using a combination of masked language modeling objective and next sentence prediction on a large corpus comprising the Toronto Book Corpus and Wikipedia. This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding`: https://arxiv.org/abs/1810.04805 .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.BertConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ BERT_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. To match pre-training, BERT input sequence should be formatted with [CLS] and [SEP] tokens as follows: (a) For sequence pairs: ``tokens: [CLS] is this jack ##son ##ville ? [SEP] no it is not . [SEP]`` ``token_type_ids: 0 0 0 0 0 0 0 0 1 1 1 1 1 1`` (b) For single sequences: ``tokens: [CLS] the dog is hairy . [SEP]`` ``token_type_ids: 0 0 0 0 0 0 0`` Bert is a model with absolute position embeddings so it's usually advised to pad the inputs on the right rather than the left. Indices can be obtained using :class:`pytorch_transformers.BertTokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Segment token indices to indicate first and second portions of the inputs. Indices are selected in ``[0, 1]``: ``0`` corresponds to a `sentence A` token, ``1`` corresponds to a `sentence B` token (see `BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding`_ for more details). **position_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of positions of each input sequence tokens in the position embeddings. Selected in the range ``[0, config.max_position_embeddings - 1]``. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare Bert Model transformer outputing raw hidden-states without any specific head on top.", BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertModel(BertPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the output of the last layer of the model. **pooler_output**: ``torch.FloatTensor`` of shape ``(batch_size, hidden_size)`` Last layer hidden-state of the first token of the sequence (classification token) further processed by a Linear layer and a Tanh activation function. The Linear layer weights are trained from the next sentence prediction (classification) objective during Bert pretraining. This output is usually *not* a good summary of the semantic content of the input, you're often better with averaging or pooling the sequence of hidden-states for the whole input sequence. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertModel.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(BertModel, self).__init__(config) self.embeddings = BertEmbeddings(config) self.encoder = BertEncoder(config) self.pooler = BertPooler(config) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): old_embeddings = self.embeddings.word_embeddings new_embeddings = self._get_resized_embeddings(old_embeddings, new_num_tokens) self.embeddings.word_embeddings = new_embeddings return self.embeddings.word_embeddings def _prune_heads(self, heads_to_prune): """ Prunes heads of the model. heads_to_prune: dict of {layer_num: list of heads to prune in this layer} See base class PreTrainedModel """ for layer, heads in heads_to_prune.items(): self.encoder.layer[layer].attention.prune_heads(heads) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None): if attention_mask is None: attention_mask = torch.ones_like(input_ids) if token_type_ids is None: token_type_ids = torch.zeros_like(input_ids) # We create a 3D attention mask from a 2D tensor mask. # Sizes are [batch_size, 1, 1, to_seq_length] # So we can broadcast to [batch_size, num_heads, from_seq_length, to_seq_length] # this attention mask is more simple than the triangular masking of causal attention # used in OpenAI GPT, we just need to prepare the broadcast dimension here. extended_attention_mask = attention_mask.unsqueeze(1).unsqueeze(2) # Since attention_mask is 1.0 for positions we want to attend and 0.0 for # masked positions, this operation will create a tensor which is 0.0 for # positions we want to attend and -10000.0 for masked positions. # Since we are adding it to the raw scores before the softmax, this is # effectively the same as removing these entirely. extended_attention_mask = extended_attention_mask.to(dtype=next(self.parameters()).dtype) # fp16 compatibility extended_attention_mask = (1.0 - extended_attention_mask) * -10000.0 # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # input head_mask has shape [num_heads] or [num_hidden_layers x num_heads] # and head_mask is converted to shape [num_hidden_layers x batch x num_heads x seq_length x seq_length] if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(-1).unsqueeze(-1) head_mask = head_mask.expand(self.config.num_hidden_layers, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(-1).unsqueeze(-1) # We can specify head_mask for each layer head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.config.num_hidden_layers embedding_output = self.embeddings(input_ids, position_ids=position_ids, token_type_ids=token_type_ids) encoder_outputs = self.encoder(embedding_output, extended_attention_mask, head_mask=head_mask) sequence_output = encoder_outputs[0] pooled_output = self.pooler(sequence_output) outputs = (sequence_output, pooled_output,) + encoder_outputs[1:] # add hidden_states and attentions if they are here return outputs # sequence_output, pooled_output, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with two heads on top as done during the pre-training: a `masked language modeling` head and a `next sentence prediction (classification)` head. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForPreTraining(BertPreTrainedModel): r""" **masked_lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for computing the masked language modeling loss. Indices should be in ``[-1, 0, ..., config.vocab_size]`` (see ``input_ids`` docstring) Tokens with indices set to ``-1`` are ignored (masked), the loss is only computed for the tokens with labels in ``[0, ..., config.vocab_size]`` **next_sentence_label**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the next sequence prediction (classification) loss. Input should be a sequence pair (see ``input_ids`` docstring) Indices should be in ``[0, 1]``. ``0`` indicates sequence B is a continuation of sequence A, ``1`` indicates sequence B is a random sequence. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when both ``masked_lm_labels`` and ``next_sentence_label`` are provided) ``torch.FloatTensor`` of shape ``(1,)``: Total loss as the sum of the masked language modeling loss and the next sequence prediction (classification) loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **seq_relationship_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, 2)`` Prediction scores of the next sequence prediction (classification) head (scores of True/False continuation before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForPreTraining.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) prediction_scores, seq_relationship_scores = outputs[:2] """ def __init__(self, config): super(BertForPreTraining, self).__init__(config) self.bert = BertModel(config) self.cls = BertPreTrainingHeads(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.cls.predictions.decoder, self.bert.embeddings.word_embeddings) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, masked_lm_labels=None, next_sentence_label=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output, pooled_output = outputs[:2] prediction_scores, seq_relationship_score = self.cls(sequence_output, pooled_output) outputs = (prediction_scores, seq_relationship_score,) + outputs[2:] # add hidden states and attention if they are here if masked_lm_labels is not None and next_sentence_label is not None: loss_fct = CrossEntropyLoss(ignore_index=-1) masked_lm_loss = loss_fct(prediction_scores.view(-1, self.config.vocab_size), masked_lm_labels.view(-1)) next_sentence_loss = loss_fct(seq_relationship_score.view(-1, 2), next_sentence_label.view(-1)) total_loss = masked_lm_loss + next_sentence_loss outputs = (total_loss,) + outputs return outputs # (loss), prediction_scores, seq_relationship_score, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with a `language modeling` head on top. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForMaskedLM(BertPreTrainedModel): r""" **masked_lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for computing the masked language modeling loss. Indices should be in ``[-1, 0, ..., config.vocab_size]`` (see ``input_ids`` docstring) Tokens with indices set to ``-1`` are ignored (masked), the loss is only computed for the tokens with labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``masked_lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Masked language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForMaskedLM.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids, masked_lm_labels=input_ids) loss, prediction_scores = outputs[:2] """ def __init__(self, config): super(BertForMaskedLM, self).__init__(config) self.bert = BertModel(config) self.cls = BertOnlyMLMHead(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.cls.predictions.decoder, self.bert.embeddings.word_embeddings) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, masked_lm_labels=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output = outputs[0] prediction_scores = self.cls(sequence_output) outputs = (prediction_scores,) + outputs[2:] # Add hidden states and attention if they are here if masked_lm_labels is not None: loss_fct = CrossEntropyLoss(ignore_index=-1) masked_lm_loss = loss_fct(prediction_scores.view(-1, self.config.vocab_size), masked_lm_labels.view(-1)) outputs = (masked_lm_loss,) + outputs return outputs # (masked_lm_loss), prediction_scores, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with a `next sentence prediction (classification)` head on top. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForNextSentencePrediction(BertPreTrainedModel): r""" **next_sentence_label**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the next sequence prediction (classification) loss. Input should be a sequence pair (see ``input_ids`` docstring) Indices should be in ``[0, 1]``. ``0`` indicates sequence B is a continuation of sequence A, ``1`` indicates sequence B is a random sequence. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``next_sentence_label`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Next sequence prediction (classification) loss. **seq_relationship_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, 2)`` Prediction scores of the next sequence prediction (classification) head (scores of True/False continuation before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForNextSentencePrediction.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) seq_relationship_scores = outputs[0] """ def __init__(self, config): super(BertForNextSentencePrediction, self).__init__(config) self.bert = BertModel(config) self.cls = BertOnlyNSPHead(config) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, next_sentence_label=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) pooled_output = outputs[1] seq_relationship_score = self.cls(pooled_output) outputs = (seq_relationship_score,) + outputs[2:] # add hidden states and attention if they are here if next_sentence_label is not None: loss_fct = CrossEntropyLoss(ignore_index=-1) next_sentence_loss = loss_fct(seq_relationship_score.view(-1, 2), next_sentence_label.view(-1)) outputs = (next_sentence_loss,) + outputs return outputs # (next_sentence_loss), seq_relationship_score, (hidden_states), (attentions) @add_start_docstrings("""Bert Model transformer with a sequence classification/regression head on top (a linear layer on top of the pooled output) e.g. for GLUE tasks. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForSequenceClassification(BertPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the sequence classification/regression loss. Indices should be in ``[0, ..., config.num_labels - 1]``. If ``config.num_labels == 1`` a regression loss is computed (Mean-Square loss), If ``config.num_labels > 1`` a classification loss is computed (Cross-Entropy). Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification (or regression if config.num_labels==1) loss. **logits**: ``torch.FloatTensor`` of shape ``(batch_size, config.num_labels)`` Classification (or regression if config.num_labels==1) scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForSequenceClassification.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, logits = outputs[:2] """ def __init__(self, config): super(BertForSequenceClassification, self).__init__(config) self.num_labels = config.num_labels self.bert = BertModel(config) self.dropout = nn.Dropout(config.hidden_dropout_prob) self.classifier = nn.Linear(config.hidden_size, self.config.num_labels) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) pooled_output = outputs[1] pooled_output = self.dropout(pooled_output) logits = self.classifier(pooled_output) outputs = (logits,) + outputs[2:] # add hidden states and attention if they are here if labels is not None: if self.num_labels == 1: # We are doing regression loss_fct = MSELoss() loss = loss_fct(logits.view(-1), labels.view(-1)) else: loss_fct = CrossEntropyLoss() loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), logits, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with a multiple choice classification head on top (a linear layer on top of the pooled output and a softmax) e.g. for RocStories/SWAG tasks. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForMultipleChoice(BertPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the multiple choice classification loss. Indices should be in ``[0, ..., num_choices]`` where `num_choices` is the size of the second dimension of the input tensors. (see `input_ids` above) Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification loss. **classification_scores**: ``torch.FloatTensor`` of shape ``(batch_size, num_choices)`` where `num_choices` is the size of the second dimension of the input tensors. (see `input_ids` above). Classification scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForMultipleChoice.from_pretrained('bert-base-uncased') choices = ["Hello, my dog is cute", "Hello, my cat is amazing"] input_ids = torch.tensor([tokenizer.encode(s) for s in choices]).unsqueeze(0) # Batch size 1, 2 choices labels = torch.tensor(1).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, classification_scores = outputs[:2] """ def __init__(self, config): super(BertForMultipleChoice, self).__init__(config) self.bert = BertModel(config) self.dropout = nn.Dropout(config.hidden_dropout_prob) self.classifier = nn.Linear(config.hidden_size, 1) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): num_choices = input_ids.shape[1] input_ids = input_ids.view(-1, input_ids.size(-1)) attention_mask = attention_mask.view(-1, attention_mask.size(-1)) if attention_mask is not None else None token_type_ids = token_type_ids.view(-1, token_type_ids.size(-1)) if token_type_ids is not None else None position_ids = position_ids.view(-1, position_ids.size(-1)) if position_ids is not None else None outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) pooled_output = outputs[1] pooled_output = self.dropout(pooled_output) logits = self.classifier(pooled_output) reshaped_logits = logits.view(-1, num_choices) outputs = (reshaped_logits,) + outputs[2:] # add hidden states and attention if they are here if labels is not None: loss_fct = CrossEntropyLoss() loss = loss_fct(reshaped_logits, labels) outputs = (loss,) + outputs return outputs # (loss), reshaped_logits, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with a token classification head on top (a linear layer on top of the hidden-states output) e.g. for Named-Entity-Recognition (NER) tasks. """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForTokenClassification(BertPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for computing the token classification loss. Indices should be in ``[0, ..., config.num_labels - 1]``. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification loss. **scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.num_labels)`` Classification scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForTokenClassification.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1] * input_ids.size(1)).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, scores = outputs[:2] """ def __init__(self, config): super(BertForTokenClassification, self).__init__(config) self.num_labels = config.num_labels self.bert = BertModel(config) self.dropout = nn.Dropout(config.hidden_dropout_prob) self.classifier = nn.Linear(config.hidden_size, config.num_labels) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output = outputs[0] sequence_output = self.dropout(sequence_output) logits = self.classifier(sequence_output) outputs = (logits,) + outputs[2:] # add hidden states and attention if they are here if labels is not None: loss_fct = CrossEntropyLoss() # Only keep active parts of the loss if attention_mask is not None: active_loss = attention_mask.view(-1) == 1 active_logits = logits.view(-1, self.num_labels)[active_loss] active_labels = labels.view(-1)[active_loss] loss = loss_fct(active_logits, active_labels) else: loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), scores, (hidden_states), (attentions) @add_start_docstrings("""Bert Model with a span classification head on top for extractive question-answering tasks like SQuAD (a linear layers on top of the hidden-states output to compute `span start logits` and `span end logits`). """, BERT_START_DOCSTRING, BERT_INPUTS_DOCSTRING) class BertForQuestionAnswering(BertPreTrainedModel): r""" **start_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the start of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **end_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the end of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Total span extraction loss is the sum of a Cross-Entropy for the start and end positions. **start_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-start scores (before SoftMax). **end_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-end scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertForQuestionAnswering.from_pretrained('bert-base-uncased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 start_positions = torch.tensor([1]) end_positions = torch.tensor([3]) outputs = model(input_ids, start_positions=start_positions, end_positions=end_positions) loss, start_scores, end_scores = outputs[:2] """ def __init__(self, config): super(BertForQuestionAnswering, self).__init__(config) self.num_labels = config.num_labels self.bert = BertModel(config) self.qa_outputs = nn.Linear(config.hidden_size, config.num_labels) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, start_positions=None, end_positions=None): outputs = self.bert(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output = outputs[0] logits = self.qa_outputs(sequence_output) start_logits, end_logits = logits.split(1, dim=-1) start_logits = start_logits.squeeze(-1) end_logits = end_logits.squeeze(-1) outputs = (start_logits, end_logits,) + outputs[2:] if start_positions is not None and end_positions is not None: # If we are on multi-GPU, split add a dimension if len(start_positions.size()) > 1: start_positions = start_positions.squeeze(-1) if len(end_positions.size()) > 1: end_positions = end_positions.squeeze(-1) # sometimes the start/end positions are outside our model inputs, we ignore these terms ignored_index = start_logits.size(1) start_positions.clamp_(0, ignored_index) end_positions.clamp_(0, ignored_index) loss_fct = CrossEntropyLoss(ignore_index=ignored_index) start_loss = loss_fct(start_logits, start_positions) end_loss = loss_fct(end_logits, end_positions) total_loss = (start_loss + end_loss) / 2 outputs = (total_loss,) + outputs return outputs # (loss), start_logits, end_logits, (hidden_states), (attentions)
59,222
50.67801
187
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tokenization_auto.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Auto Model class. """ from __future__ import absolute_import, division, print_function, unicode_literals import logging from .tokenization_bert import BertTokenizer from .tokenization_openai import OpenAIGPTTokenizer from .tokenization_gpt2 import GPT2Tokenizer from .tokenization_transfo_xl import TransfoXLTokenizer from .tokenization_xlnet import XLNetTokenizer from .tokenization_xlm import XLMTokenizer from .tokenization_roberta import RobertaTokenizer from .tokenization_distilbert import DistilBertTokenizer logger = logging.getLogger(__name__) class AutoTokenizer(object): r""":class:`~pytorch_transformers.AutoTokenizer` is a generic tokenizer class that will be instantiated as one of the tokenizer classes of the library when created with the `AutoTokenizer.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method take care of returning the correct tokenizer class instance using pattern matching on the `pretrained_model_name_or_path` string. The tokenizer class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertTokenizer (DistilBert model) - contains `roberta`: RobertaTokenizer (RoBERTa model) - contains `bert`: BertTokenizer (Bert model) - contains `openai-gpt`: OpenAIGPTTokenizer (OpenAI GPT model) - contains `gpt2`: GPT2Tokenizer (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLTokenizer (Transformer-XL model) - contains `xlnet`: XLNetTokenizer (XLNet model) - contains `xlm`: XLMTokenizer (XLM model) This class cannot be instantiated using `__init__()` (throw an error). """ def __init__(self): raise EnvironmentError("AutoTokenizer is designed to be instantiated " "using the `AutoTokenizer.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *inputs, **kwargs): r""" Instantiate a one of the tokenizer classes of the library from a pre-trained model vocabulary. The tokenizer class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertTokenizer (DistilBert model) - contains `roberta`: RobertaTokenizer (XLM model) - contains `bert`: BertTokenizer (Bert model) - contains `openai-gpt`: OpenAIGPTTokenizer (OpenAI GPT model) - contains `gpt2`: GPT2Tokenizer (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLTokenizer (Transformer-XL model) - contains `xlnet`: XLNetTokenizer (XLNet model) - contains `xlm`: XLMTokenizer (XLM model) Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a predefined tokenizer to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing vocabulary files required by the tokenizer, for instance saved using the :func:`~pytorch_transformers.PreTrainedTokenizer.save_pretrained` method, e.g.: ``./my_model_directory/``. - (not applicable to all derived classes) a path or url to a single saved vocabulary file if and only if the tokenizer only requires a single vocabulary file (e.g. Bert, XLNet), e.g.: ``./my_model_directory/vocab.txt``. cache_dir: (`optional`) string: Path to a directory in which a downloaded predefined tokenizer vocabulary files should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the vocabulary files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. inputs: (`optional`) positional arguments: will be passed to the Tokenizer ``__init__`` method. kwargs: (`optional`) keyword arguments: will be passed to the Tokenizer ``__init__`` method. Can be used to set special tokens like ``bos_token``, ``eos_token``, ``unk_token``, ``sep_token``, ``pad_token``, ``cls_token``, ``mask_token``, ``additional_special_tokens``. See parameters in the doc string of :class:`~pytorch_transformers.PreTrainedTokenizer` for details. Examples:: tokenizer = AutoTokenizer.from_pretrained('bert-base-uncased') # Download vocabulary from S3 and cache. tokenizer = AutoTokenizer.from_pretrained('./test/bert_saved_model/') # E.g. tokenizer was saved using `save_pretrained('./test/saved_model/')` """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'roberta' in pretrained_model_name_or_path: return RobertaTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'openai-gpt' in pretrained_model_name_or_path: return OpenAIGPTTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'gpt2' in pretrained_model_name_or_path: return GPT2Tokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'transfo-xl' in pretrained_model_name_or_path: return TransfoXLTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'openai-gpt', 'gpt2', 'transfo-xl', 'xlnet', " "'xlm', 'roberta'".format(pretrained_model_name_or_path))
7,177
58.322314
380
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_gpt2.py
# coding=utf-8 # Copyright 2018 The OpenAI Team Authors and HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch OpenAI GPT-2 model.""" from __future__ import absolute_import, division, print_function, unicode_literals import collections import json import logging import math import os import sys from io import open import torch import torch.nn as nn from torch.nn import CrossEntropyLoss from torch.nn.parameter import Parameter from .modeling_utils import PreTrainedModel, Conv1D, prune_conv1d_layer, SequenceSummary from .configuration_gpt2 import GPT2Config from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) GPT2_PRETRAINED_MODEL_ARCHIVE_MAP = {"gpt2": "https://s3.amazonaws.com/models.huggingface.co/bert/gpt2-pytorch_model.bin", "gpt2-medium": "https://s3.amazonaws.com/models.huggingface.co/bert/gpt2-medium-pytorch_model.bin", "gpt2-large": "https://s3.amazonaws.com/models.huggingface.co/bert/gpt2-large-pytorch_model.bin"} def load_tf_weights_in_gpt2(model, config, gpt2_checkpoint_path): """ Load tf checkpoints in a pytorch model """ try: import re import numpy as np import tensorflow as tf except ImportError: logger.error("Loading a TensorFlow model in PyTorch, requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise tf_path = os.path.abspath(gpt2_checkpoint_path) logger.info("Converting TensorFlow checkpoint from {}".format(tf_path)) # Load weights from TF model init_vars = tf.train.list_variables(tf_path) names = [] arrays = [] for name, shape in init_vars: logger.info("Loading TF weight {} with shape {}".format(name, shape)) array = tf.train.load_variable(tf_path, name) names.append(name) arrays.append(array.squeeze()) for name, array in zip(names, arrays): name = name[6:] # skip "model/" name = name.split('/') pointer = model for m_name in name: if re.fullmatch(r'[A-Za-z]+\d+', m_name): l = re.split(r'(\d+)', m_name) else: l = [m_name] if l[0] == 'w' or l[0] == 'g': pointer = getattr(pointer, 'weight') elif l[0] == 'b': pointer = getattr(pointer, 'bias') elif l[0] == 'wpe' or l[0] == 'wte': pointer = getattr(pointer, l[0]) pointer = getattr(pointer, 'weight') else: pointer = getattr(pointer, l[0]) if len(l) >= 2: num = int(l[1]) pointer = pointer[num] try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise logger.info("Initialize PyTorch weight {}".format(name)) pointer.data = torch.from_numpy(array) return model def gelu(x): return 0.5 * x * (1 + torch.tanh(math.sqrt(2 / math.pi) * (x + 0.044715 * torch.pow(x, 3)))) class Attention(nn.Module): def __init__(self, nx, n_ctx, config, scale=False): super(Attention, self).__init__() self.output_attentions = config.output_attentions n_state = nx # in Attention: n_state=768 (nx=n_embd) # [switch nx => n_state from Block to Attention to keep identical to TF implem] assert n_state % config.n_head == 0 self.register_buffer("bias", torch.tril(torch.ones(n_ctx, n_ctx)).view(1, 1, n_ctx, n_ctx)) self.n_head = config.n_head self.split_size = n_state self.scale = scale self.c_attn = Conv1D(n_state * 3, nx) self.c_proj = Conv1D(n_state, nx) self.attn_dropout = nn.Dropout(config.attn_pdrop) self.resid_dropout = nn.Dropout(config.resid_pdrop) self.pruned_heads = set() def prune_heads(self, heads): if len(heads) == 0: return mask = torch.ones(self.n_head, self.split_size // self.n_head) heads = set(heads) - self.pruned_heads # Convert to set and emove already pruned heads for head in heads: # Compute how many pruned heads are before the head and move the index accordingly head = head - sum(1 if h < head else 0 for h in self.pruned_heads) mask[head] = 0 mask = mask.view(-1).contiguous().eq(1) index = torch.arange(len(mask))[mask].long() index_attn = torch.cat([index, index + self.split_size, index + (2*self.split_size)]) # Prune conv1d layers self.c_attn = prune_conv1d_layer(self.c_attn, index_attn, dim=1) self.c_proj = prune_conv1d_layer(self.c_proj, index, dim=0) # Update hyper params self.split_size = (self.split_size // self.n_head) * (self.n_head - len(heads)) self.n_head = self.n_head - len(heads) self.pruned_heads = self.pruned_heads.union(heads) def _attn(self, q, k, v, attention_mask=None, head_mask=None): w = torch.matmul(q, k) if self.scale: w = w / math.sqrt(v.size(-1)) nd, ns = w.size(-2), w.size(-1) b = self.bias[:, :, ns-nd:ns, :ns] w = w * b - 1e4 * (1 - b) if attention_mask is not None: # Apply the attention mask w = w + attention_mask w = nn.Softmax(dim=-1)(w) w = self.attn_dropout(w) # Mask heads if we want to if head_mask is not None: w = w * head_mask outputs = [torch.matmul(w, v)] if self.output_attentions: outputs.append(w) return outputs def merge_heads(self, x): x = x.permute(0, 2, 1, 3).contiguous() new_x_shape = x.size()[:-2] + (x.size(-2) * x.size(-1),) return x.view(*new_x_shape) # in Tensorflow implem: fct merge_states def split_heads(self, x, k=False): new_x_shape = x.size()[:-1] + (self.n_head, x.size(-1) // self.n_head) x = x.view(*new_x_shape) # in Tensorflow implem: fct split_states if k: return x.permute(0, 2, 3, 1) # (batch, head, head_features, seq_length) else: return x.permute(0, 2, 1, 3) # (batch, head, seq_length, head_features) def forward(self, x, layer_past=None, attention_mask=None, head_mask=None): x = self.c_attn(x) query, key, value = x.split(self.split_size, dim=2) query = self.split_heads(query) key = self.split_heads(key, k=True) value = self.split_heads(value) if layer_past is not None: past_key, past_value = layer_past[0].transpose(-2, -1), layer_past[1] # transpose back cf below key = torch.cat((past_key, key), dim=-1) value = torch.cat((past_value, value), dim=-2) present = torch.stack((key.transpose(-2, -1), value)) # transpose to have same shapes for stacking attn_outputs = self._attn(query, key, value, attention_mask, head_mask) a = attn_outputs[0] a = self.merge_heads(a) a = self.c_proj(a) a = self.resid_dropout(a) outputs = [a, present] + attn_outputs[1:] return outputs # a, present, (attentions) class MLP(nn.Module): def __init__(self, n_state, config): # in MLP: n_state=3072 (4 * n_embd) super(MLP, self).__init__() nx = config.n_embd self.c_fc = Conv1D(n_state, nx) self.c_proj = Conv1D(nx, n_state) self.act = gelu self.dropout = nn.Dropout(config.resid_pdrop) def forward(self, x): h = self.act(self.c_fc(x)) h2 = self.c_proj(h) return self.dropout(h2) class Block(nn.Module): def __init__(self, n_ctx, config, scale=False): super(Block, self).__init__() nx = config.n_embd self.ln_1 = nn.LayerNorm(nx, eps=config.layer_norm_epsilon) self.attn = Attention(nx, n_ctx, config, scale) self.ln_2 = nn.LayerNorm(nx, eps=config.layer_norm_epsilon) self.mlp = MLP(4 * nx, config) def forward(self, x, layer_past=None, attention_mask=None, head_mask=None): output_attn = self.attn(self.ln_1(x), layer_past=layer_past, attention_mask=attention_mask, head_mask=head_mask) a = output_attn[0] # output_attn: a, present, (attentions) x = x + a m = self.mlp(self.ln_2(x)) x = x + m outputs = [x] + output_attn[1:] return outputs # x, present, (attentions) class GPT2PreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = GPT2Config pretrained_model_archive_map = GPT2_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = load_tf_weights_in_gpt2 base_model_prefix = "transformer" def __init__(self, *inputs, **kwargs): super(GPT2PreTrainedModel, self).__init__(*inputs, **kwargs) def _init_weights(self, module): """ Initialize the weights. """ if isinstance(module, (nn.Linear, nn.Embedding, Conv1D)): # Slightly different from the TF version which uses truncated_normal for initialization # cf https://github.com/pytorch/pytorch/pull/5617 module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) if isinstance(module, (nn.Linear, Conv1D)) and module.bias is not None: module.bias.data.zero_() elif isinstance(module, nn.LayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) GPT2_START_DOCSTRING = r""" OpenAI GPT-2 model was proposed in `Language Models are Unsupervised Multitask Learners`_ by Alec Radford*, Jeffrey Wu*, Rewon Child, David Luan, Dario Amodei** and Ilya Sutskever**. It's a causal (unidirectional) transformer pre-trained using language modeling on a very large corpus of ~40 GB of text data. This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`Language Models are Unsupervised Multitask Learners`: https://openai.com/blog/better-language-models/ .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.GPT2Config`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ GPT2_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. GPT-2 is a model with absolute position embeddings so it's usually advised to pad the inputs on the right rather than the left. Indices can be obtained using :class:`pytorch_transformers.GPT2Tokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **past**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model (see `past` output below). Can be used to speed up sequential decoding. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens (can be used to indicate various portions of the inputs). The embeddings from these tokens will be summed with the respective token embeddings. Indices are selected in the vocabulary (unlike BERT which has a specific vocabulary for segment indices). **position_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of positions of each input sequence tokens in the position embeddings. Selected in the range ``[0, config.max_position_embeddings - 1]``. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare GPT2 Model transformer outputing raw hidden-states without any specific head on top.", GPT2_START_DOCSTRING, GPT2_INPUTS_DOCSTRING) class GPT2Model(GPT2PreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the last layer of the model. **past**: list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: that contains pre-computed hidden-states (key and values in the attention blocks). Can be used (see `past` input) to speed up sequential decoding. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = GPT2Tokenizer.from_pretrained('gpt2') model = GPT2Model.from_pretrained('gpt2') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(GPT2Model, self).__init__(config) self.output_hidden_states = config.output_hidden_states self.output_attentions = config.output_attentions self.wte = nn.Embedding(config.vocab_size, config.n_embd) self.wpe = nn.Embedding(config.n_positions, config.n_embd) self.drop = nn.Dropout(config.embd_pdrop) self.h = nn.ModuleList([Block(config.n_ctx, config, scale=True) for _ in range(config.n_layer)]) self.ln_f = nn.LayerNorm(config.n_embd, eps=config.layer_norm_epsilon) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): self.wte = self._get_resized_embeddings(self.wte, new_num_tokens) return self.wte def _prune_heads(self, heads_to_prune): """ Prunes heads of the model. heads_to_prune: dict of {layer_num: list of heads to prune in this layer} """ for layer, heads in heads_to_prune.items(): self.h[layer].attn.prune_heads(heads) def forward(self, input_ids, past=None, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None): if past is None: past_length = 0 past = [None] * len(self.h) else: past_length = past[0][0].size(-2) if position_ids is None: position_ids = torch.arange(past_length, input_ids.size(-1) + past_length, dtype=torch.long, device=input_ids.device) position_ids = position_ids.unsqueeze(0).expand_as(input_ids) # Attention mask. if attention_mask is not None: # We create a 3D attention mask from a 2D tensor mask. # Sizes are [batch_size, 1, 1, to_seq_length] # So we can broadcast to [batch_size, num_heads, from_seq_length, to_seq_length] # this attention mask is more simple than the triangular masking of causal attention # used in OpenAI GPT, we just need to prepare the broadcast dimension here. attention_mask = attention_mask.unsqueeze(1).unsqueeze(2) # Since attention_mask is 1.0 for positions we want to attend and 0.0 for # masked positions, this operation will create a tensor which is 0.0 for # positions we want to attend and -10000.0 for masked positions. # Since we are adding it to the raw scores before the softmax, this is # effectively the same as removing these entirely. attention_mask = attention_mask.to(dtype=next(self.parameters()).dtype) # fp16 compatibility attention_mask = (1.0 - attention_mask) * -10000.0 # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # head_mask has shape n_layer x batch x n_heads x N x N if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(-1).unsqueeze(-1) head_mask = head_mask.expand(self.config.n_layer, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(-1).unsqueeze(-1) # We can specify head_mask for each layer head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.config.n_layer input_shape = input_ids.size() input_ids = input_ids.view(-1, input_ids.size(-1)) position_ids = position_ids.view(-1, position_ids.size(-1)) inputs_embeds = self.wte(input_ids) position_embeds = self.wpe(position_ids) if token_type_ids is not None: token_type_ids = token_type_ids.view(-1, token_type_ids.size(-1)) token_type_embeds = self.wte(token_type_ids) else: token_type_embeds = 0 hidden_states = inputs_embeds + position_embeds + token_type_embeds hidden_states = self.drop(hidden_states) output_shape = input_shape + (hidden_states.size(-1),) presents = () all_attentions = [] all_hidden_states = () for i, (block, layer_past) in enumerate(zip(self.h, past)): if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states.view(*output_shape),) outputs = block(hidden_states, layer_past=layer_past, attention_mask=attention_mask, head_mask=head_mask[i]) hidden_states, present = outputs[:2] presents = presents + (present,) if self.output_attentions: all_attentions.append(outputs[2]) hidden_states = self.ln_f(hidden_states) hidden_states = hidden_states.view(*output_shape) # Add last hidden state if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states,) outputs = (hidden_states, presents) if self.output_hidden_states: outputs = outputs + (all_hidden_states,) if self.output_attentions: # let the number of heads free (-1) so we can extract attention even after head pruning attention_output_shape = input_shape[:-1] + (-1,) + all_attentions[0].shape[-2:] all_attentions = tuple(t.view(*attention_output_shape) for t in all_attentions) outputs = outputs + (all_attentions,) return outputs # last hidden state, presents, (all hidden_states), (attentions) @add_start_docstrings("""The GPT2 Model transformer with a language modeling head on top (linear layer with weights tied to the input embeddings). """, GPT2_START_DOCSTRING, GPT2_INPUTS_DOCSTRING) class GPT2LMHeadModel(GPT2PreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **past**: list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: that contains pre-computed hidden-states (key and values in the attention blocks). Can be used (see `past` input) to speed up sequential decoding. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: import torch from pytorch_transformers import GPT2Tokenizer, GPT2LMHeadModel tokenizer = GPT2Tokenizer.from_pretrained('gpt2') model = GPT2LMHeadModel.from_pretrained('gpt2') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=input_ids) loss, logits = outputs[:2] """ def __init__(self, config): super(GPT2LMHeadModel, self).__init__(config) self.transformer = GPT2Model(config) self.lm_head = nn.Linear(config.n_embd, config.vocab_size, bias=False) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.lm_head, self.transformer.wte) def forward(self, input_ids, past=None, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, past=past, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) hidden_states = transformer_outputs[0] lm_logits = self.lm_head(hidden_states) outputs = (lm_logits,) + transformer_outputs[1:] if labels is not None: # Shift so that tokens < n predict n shift_logits = lm_logits[..., :-1, :].contiguous() shift_labels = labels[..., 1:].contiguous() # Flatten the tokens loss_fct = CrossEntropyLoss(ignore_index=-1) loss = loss_fct(shift_logits.view(-1, shift_logits.size(-1)), shift_labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), lm_logits, presents, (all hidden_states), (attentions) @add_start_docstrings("""The GPT2 Model transformer with a language modeling and a multiple-choice classification head on top e.g. for RocStories/SWAG tasks. The two heads are two linear layers. The language modeling head has its weights tied to the input embeddings, the classification head takes as input the input of a specified classification token index in the input sequence). """, GPT2_START_DOCSTRING, GPT2_INPUTS_DOCSTRING) class GPT2DoubleHeadsModel(GPT2PreTrainedModel): r""" **mc_token_ids**: (`optional`, default to index of the last token of the input) ``torch.LongTensor`` of shape ``(batch_size, num_choices)``: Index of the classification token in each input sequence. Selected in the range ``[0, input_ids.size(-1) - 1[``. **lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` **mc_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size)``: Labels for computing the multiple choice classification loss. Indices should be in ``[0, ..., num_choices]`` where `num_choices` is the size of the second dimension of the input tensors. (see `input_ids` above) Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **lm_loss**: (`optional`, returned when ``lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **mc_loss**: (`optional`, returned when ``multiple_choice_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Multiple choice classification loss. **lm_prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, num_choices, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **mc_prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, num_choices)`` Prediction scores of the multiplechoice classification head (scores for each choice before SoftMax). **past**: list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: that contains pre-computed hidden-states (key and values in the attention blocks). Can be used (see `past` input) to speed up sequential decoding. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: import torch from pytorch_transformers import GPT2Tokenizer, GPT2DoubleHeadsModel tokenizer = GPT2Tokenizer.from_pretrained('gpt2') model = GPT2DoubleHeadsModel.from_pretrained('gpt2') # Add a [CLS] to the vocabulary (we should train it also!) tokenizer.add_special_tokens({'cls_token': '[CLS]'}) model.resize_token_embeddings(len(tokenizer)) # Update the model embeddings with the new vocabulary size print(tokenizer.cls_token_id, len(tokenizer)) # The newly token the last token of the vocabulary choices = ["Hello, my dog is cute [CLS]", "Hello, my cat is cute [CLS]"] encoded_choices = [tokenizer.encode(s) for s in choices] cls_token_location = [tokens.index(tokenizer.cls_token_id) for tokens in encoded_choices] input_ids = torch.tensor(encoded_choices).unsqueeze(0) # Batch size: 1, number of choices: 2 mc_token_ids = torch.tensor([cls_token_location]) # Batch size: 1 outputs = model(input_ids, mc_token_ids=mc_token_ids) lm_prediction_scores, mc_prediction_scores = outputs[:2] """ def __init__(self, config): super(GPT2DoubleHeadsModel, self).__init__(config) self.transformer = GPT2Model(config) self.lm_head = nn.Linear(config.n_embd, config.vocab_size, bias=False) self.multiple_choice_head = SequenceSummary(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.lm_head, self.transformer.wte) def forward(self, input_ids, past=None, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, mc_token_ids=None, lm_labels=None, mc_labels=None): transformer_outputs = self.transformer(input_ids, past=past, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) hidden_states = transformer_outputs[0] lm_logits = self.lm_head(hidden_states) mc_logits = self.multiple_choice_head(hidden_states, mc_token_ids).squeeze(-1) outputs = (lm_logits, mc_logits) + transformer_outputs[1:] if mc_labels is not None: loss_fct = CrossEntropyLoss() loss = loss_fct(mc_logits.view(-1, mc_logits.size(-1)), mc_labels.view(-1)) outputs = (loss,) + outputs if lm_labels is not None: shift_logits = lm_logits[..., :-1, :].contiguous() shift_labels = lm_labels[..., 1:].contiguous() loss_fct = CrossEntropyLoss(ignore_index=-1) loss = loss_fct(shift_logits.view(-1, shift_logits.size(-1)), shift_labels.view(-1)) outputs = (loss,) + outputs return outputs # (lm loss), (mc loss), lm logits, mc logits, presents, (all hidden_states), (attentions)
32,763
49.021374
148
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_openai.py
# coding=utf-8 # Copyright 2018 The OpenAI Team Authors and HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch OpenAI GPT model.""" from __future__ import absolute_import, division, print_function, unicode_literals import collections import json import logging import math import os import sys from io import open import torch import torch.nn as nn from torch.nn import CrossEntropyLoss from torch.nn.parameter import Parameter from .modeling_utils import PreTrainedModel, Conv1D, prune_conv1d_layer, SequenceSummary from .configuration_openai import OpenAIGPTConfig from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) OPENAI_GPT_PRETRAINED_MODEL_ARCHIVE_MAP = {"openai-gpt": "https://s3.amazonaws.com/models.huggingface.co/bert/openai-gpt-pytorch_model.bin"} def load_tf_weights_in_openai_gpt(model, config, openai_checkpoint_folder_path): """ Load tf pre-trained weights in a pytorch model (from NumPy arrays here) """ import re import numpy as np if '.ckpt' in openai_checkpoint_folder_path: openai_checkpoint_folder_path = os.path.dirname(openai_checkpoint_folder_path) logger.info("Loading weights from {}".format(openai_checkpoint_folder_path)) names = json.load(open(openai_checkpoint_folder_path + '/parameters_names.json', "r", encoding='utf-8')) shapes = json.load(open(openai_checkpoint_folder_path + '/params_shapes.json', "r", encoding='utf-8')) offsets = np.cumsum([np.prod(shape) for shape in shapes]) init_params = [np.load(openai_checkpoint_folder_path + '/params_{}.npy'.format(n)) for n in range(10)] init_params = np.split(np.concatenate(init_params, 0), offsets)[:-1] init_params = [param.reshape(shape) for param, shape in zip(init_params, shapes)] # This was used when we had a single embedding matrix for positions and tokens # init_params[0] = np.concatenate([init_params[1], init_params[0]], 0) # del init_params[1] init_params = [arr.squeeze() for arr in init_params] try: assert model.tokens_embed.weight.shape == init_params[1].shape assert model.positions_embed.weight.shape == init_params[0].shape except AssertionError as e: e.args += (model.tokens_embed.weight.shape, init_params[1].shape) e.args += (model.positions_embed.weight.shape, init_params[0].shape) raise model.tokens_embed.weight.data = torch.from_numpy(init_params[1]) model.positions_embed.weight.data = torch.from_numpy(init_params[0]) names.pop(0) # Pop position and token embedding arrays init_params.pop(0) init_params.pop(0) for name, array in zip(names, init_params): # names[1:n_transfer], init_params[1:n_transfer]): name = name[6:] # skip "model/" assert name[-2:] == ":0" name = name[:-2] name = name.split('/') pointer = model for m_name in name: if re.fullmatch(r'[A-Za-z]+\d+', m_name): l = re.split(r'(\d+)', m_name) else: l = [m_name] if l[0] == 'g': pointer = getattr(pointer, 'weight') elif l[0] == 'b': pointer = getattr(pointer, 'bias') elif l[0] == 'w': pointer = getattr(pointer, 'weight') else: pointer = getattr(pointer, l[0]) if len(l) >= 2: num = int(l[1]) pointer = pointer[num] try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise logger.info("Initialize PyTorch weight {}".format(name)) pointer.data = torch.from_numpy(array) return model def gelu(x): return 0.5 * x * (1 + torch.tanh(math.sqrt(2 / math.pi) * (x + 0.044715 * torch.pow(x, 3)))) def swish(x): return x * torch.sigmoid(x) ACT_FNS = {"relu": nn.ReLU, "swish": swish, "gelu": gelu} class Attention(nn.Module): def __init__(self, nx, n_ctx, config, scale=False): super(Attention, self).__init__() n_state = nx # in Attention: n_state=768 (nx=n_embd) # [switch nx => n_state from Block to Attention to keep identical to TF implem] assert n_state % config.n_head == 0 self.register_buffer("bias", torch.tril(torch.ones(n_ctx, n_ctx)).view(1, 1, n_ctx, n_ctx)) self.n_head = config.n_head self.split_size = n_state self.scale = scale self.output_attentions = config.output_attentions self.c_attn = Conv1D(n_state * 3, nx) self.c_proj = Conv1D(n_state, nx) self.attn_dropout = nn.Dropout(config.attn_pdrop) self.resid_dropout = nn.Dropout(config.resid_pdrop) self.pruned_heads = set() def prune_heads(self, heads): if len(heads) == 0: return mask = torch.ones(self.n_head, self.split_size // self.n_head) heads = set(heads) - self.pruned_heads for head in heads: head -= sum(1 if h < head else 0 for h in self.pruned_heads) mask[head] = 0 mask = mask.view(-1).contiguous().eq(1) index = torch.arange(len(mask))[mask].long() index_attn = torch.cat([index, index + self.split_size, index + (2*self.split_size)]) # Prune conv1d layers self.c_attn = prune_conv1d_layer(self.c_attn, index_attn, dim=1) self.c_proj = prune_conv1d_layer(self.c_proj, index, dim=0) # Update hyper params self.split_size = (self.split_size // self.n_head) * (self.n_head - len(heads)) self.n_head = self.n_head - len(heads) self.pruned_heads = self.pruned_heads.union(heads) def _attn(self, q, k, v, attention_mask=None, head_mask=None): w = torch.matmul(q, k) if self.scale: w = w / math.sqrt(v.size(-1)) # w = w * self.bias + -1e9 * (1 - self.bias) # TF implem method: mask_attn_weights # XD: self.b may be larger than w, so we need to crop it b = self.bias[:, :, : w.size(-2), : w.size(-1)] w = w * b + -1e9 * (1 - b) if attention_mask is not None: # Apply the attention mask w = w + attention_mask w = nn.Softmax(dim=-1)(w) w = self.attn_dropout(w) # Mask heads if we want to if head_mask is not None: w = w * head_mask outputs = [torch.matmul(w, v)] if self.output_attentions: outputs.append(w) return outputs def merge_heads(self, x): x = x.permute(0, 2, 1, 3).contiguous() new_x_shape = x.size()[:-2] + (x.size(-2) * x.size(-1),) return x.view(*new_x_shape) # in Tensorflow implem: fct merge_states def split_heads(self, x, k=False): new_x_shape = x.size()[:-1] + (self.n_head, x.size(-1) // self.n_head) x = x.view(*new_x_shape) # in Tensorflow implem: fct split_states if k: return x.permute(0, 2, 3, 1) else: return x.permute(0, 2, 1, 3) def forward(self, x, attention_mask=None, head_mask=None): x = self.c_attn(x) query, key, value = x.split(self.split_size, dim=2) query = self.split_heads(query) key = self.split_heads(key, k=True) value = self.split_heads(value) attn_outputs = self._attn(query, key, value, attention_mask, head_mask) a = attn_outputs[0] a = self.merge_heads(a) a = self.c_proj(a) a = self.resid_dropout(a) outputs = [a] + attn_outputs[1:] return outputs # a, (attentions) class MLP(nn.Module): def __init__(self, n_state, config): # in MLP: n_state=3072 (4 * n_embd) super(MLP, self).__init__() nx = config.n_embd self.c_fc = Conv1D(n_state, nx) self.c_proj = Conv1D(nx, n_state) self.act = ACT_FNS[config.afn] self.dropout = nn.Dropout(config.resid_pdrop) def forward(self, x): h = self.act(self.c_fc(x)) h2 = self.c_proj(h) return self.dropout(h2) class Block(nn.Module): def __init__(self, n_ctx, config, scale=False): super(Block, self).__init__() nx = config.n_embd self.attn = Attention(nx, n_ctx, config, scale) self.ln_1 = nn.LayerNorm(nx, eps=config.layer_norm_epsilon) self.mlp = MLP(4 * nx, config) self.ln_2 = nn.LayerNorm(nx, eps=config.layer_norm_epsilon) def forward(self, x, attention_mask=None, head_mask=None): attn_outputs = self.attn(x, attention_mask=attention_mask, head_mask=head_mask) a = attn_outputs[0] n = self.ln_1(x + a) m = self.mlp(n) h = self.ln_2(n + m) outputs = [h] + attn_outputs[1:] return outputs class OpenAIGPTPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = OpenAIGPTConfig pretrained_model_archive_map = OPENAI_GPT_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = load_tf_weights_in_openai_gpt base_model_prefix = "transformer" def _init_weights(self, module): """ Initialize the weights. """ if isinstance(module, (nn.Linear, nn.Embedding, Conv1D)): # Slightly different from the TF version which uses truncated_normal for initialization # cf https://github.com/pytorch/pytorch/pull/5617 module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) if isinstance(module, (nn.Linear, Conv1D)) and module.bias is not None: module.bias.data.zero_() elif isinstance(module, nn.LayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) OPENAI_GPT_START_DOCSTRING = r""" OpenAI GPT model was proposed in `Improving Language Understanding by Generative Pre-Training`_ by Alec Radford, Karthik Narasimhan, Tim Salimans and Ilya Sutskever. It's a causal (unidirectional) transformer pre-trained using language modeling on a large corpus will long range dependencies, the Toronto Book Corpus. This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`Improving Language Understanding by Generative Pre-Training`: https://openai.com/blog/language-unsupervised/ .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.OpenAIGPTConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ OPENAI_GPT_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. GPT is a model with absolute position embeddings so it's usually advised to pad the inputs on the right rather than the left. Indices can be obtained using :class:`pytorch_transformers.BPT2Tokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens (can be used to indicate various portions of the inputs). The embeddings from these tokens will be summed with the respective token embeddings. Indices are selected in the vocabulary (unlike BERT which has a specific vocabulary for segment indices) **position_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of positions of each input sequence tokens in the position embeddings. Selected in the range ``[0, config.max_position_embeddings - 1]``. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare OpenAI GPT transformer model outputing raw hidden-states without any specific head on top.", OPENAI_GPT_START_DOCSTRING, OPENAI_GPT_INPUTS_DOCSTRING) class OpenAIGPTModel(OpenAIGPTPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the last layer of the model. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = OpenAIGPTTokenizer.from_pretrained('openai-gpt') model = OpenAIGPTModel.from_pretrained('openai-gpt') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(OpenAIGPTModel, self).__init__(config) self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states self.tokens_embed = nn.Embedding(config.vocab_size, config.n_embd) self.positions_embed = nn.Embedding(config.n_positions, config.n_embd) self.drop = nn.Dropout(config.embd_pdrop) self.h = nn.ModuleList([Block(config.n_ctx, config, scale=True) for _ in range(config.n_layer)]) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): self.tokens_embed = self._get_resized_embeddings(self.tokens_embed, new_num_tokens) return self.tokens_embed def _prune_heads(self, heads_to_prune): """ Prunes heads of the model. heads_to_prune: dict of {layer_num: list of heads to prune in this layer} """ for layer, heads in heads_to_prune.items(): self.h[layer].attn.prune_heads(heads) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None): if position_ids is None: # This was used when we had a single embedding matrice from position and token embeddings # start = self.config.vocab_size + self.config.n_special # end = start + input_ids.size(-1) # position_ids = torch.arange(start, end, dtype=torch.long, device=input_ids.device) position_ids = torch.arange(input_ids.size(-1), dtype=torch.long, device=input_ids.device) position_ids = position_ids.unsqueeze(0).expand_as(input_ids) # Attention mask. if attention_mask is not None: # We create a 3D attention mask from a 2D tensor mask. # Sizes are [batch_size, 1, 1, to_seq_length] # So we can broadcast to [batch_size, num_heads, from_seq_length, to_seq_length] # this attention mask is more simple than the triangular masking of causal attention # used in OpenAI GPT, we just need to prepare the broadcast dimension here. attention_mask = attention_mask.unsqueeze(1).unsqueeze(2) # Since attention_mask is 1.0 for positions we want to attend and 0.0 for # masked positions, this operation will create a tensor which is 0.0 for # positions we want to attend and -10000.0 for masked positions. # Since we are adding it to the raw scores before the softmax, this is # effectively the same as removing these entirely. attention_mask = attention_mask.to(dtype=next(self.parameters()).dtype) # fp16 compatibility attention_mask = (1.0 - attention_mask) * -10000.0 # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # head_mask has shape n_layer x batch x n_heads x N x N if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(-1).unsqueeze(-1) head_mask = head_mask.expand(self.config.n_layer, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(-1).unsqueeze(-1) # We can specify head_mask for each layer head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.config.n_layer input_shape = input_ids.size() input_ids = input_ids.view(-1, input_ids.size(-1)) position_ids = position_ids.view(-1, position_ids.size(-1)) inputs_embeds = self.tokens_embed(input_ids) position_embeds = self.positions_embed(position_ids) if token_type_ids is not None: token_type_ids = token_type_ids.view(-1, token_type_ids.size(-1)) token_type_embeds = self.tokens_embed(token_type_ids) else: token_type_embeds = 0 hidden_states = inputs_embeds + position_embeds + token_type_embeds hidden_states = self.drop(hidden_states) output_shape = input_shape + (hidden_states.size(-1),) all_attentions = () all_hidden_states = () for i, block in enumerate(self.h): if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states.view(*output_shape),) outputs = block(hidden_states, attention_mask, head_mask[i]) hidden_states = outputs[0] if self.output_attentions: all_attentions = all_attentions + (outputs[1],) # Add last layer if self.output_hidden_states: all_hidden_states = all_hidden_states + (hidden_states.view(*output_shape),) outputs = (hidden_states.view(*output_shape),) if self.output_hidden_states: outputs = outputs + (all_hidden_states,) if self.output_attentions: outputs = outputs + (all_attentions,) return outputs # last hidden state, (all hidden states), (all attentions) @add_start_docstrings("""OpenAI GPT Model transformer with a language modeling head on top (linear layer with weights tied to the input embeddings). """, OPENAI_GPT_START_DOCSTRING, OPENAI_GPT_INPUTS_DOCSTRING) class OpenAIGPTLMHeadModel(OpenAIGPTPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = OpenAIGPTTokenizer.from_pretrained('openai-gpt') model = OpenAIGPTLMHeadModel.from_pretrained('openai-gpt') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=input_ids) loss, logits = outputs[:2] """ def __init__(self, config): super(OpenAIGPTLMHeadModel, self).__init__(config) self.transformer = OpenAIGPTModel(config) self.lm_head = nn.Linear(config.n_embd, config.vocab_size, bias=False) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.lm_head, self.transformer.tokens_embed) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) hidden_states = transformer_outputs[0] lm_logits = self.lm_head(hidden_states) outputs = (lm_logits,) + transformer_outputs[1:] if labels is not None: # Shift so that tokens < n predict n shift_logits = lm_logits[..., :-1, :].contiguous() shift_labels = labels[..., 1:].contiguous() # Flatten the tokens loss_fct = CrossEntropyLoss(ignore_index=-1) loss = loss_fct(shift_logits.view(-1, shift_logits.size(-1)), shift_labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), lm_logits, (all hidden states), (all attentions) @add_start_docstrings("""OpenAI GPT Model transformer with a language modeling and a multiple-choice classification head on top e.g. for RocStories/SWAG tasks. The two heads are two linear layers. The language modeling head has its weights tied to the input embeddings, the classification head takes as input the input of a specified classification token index in the input sequence). """, OPENAI_GPT_START_DOCSTRING, OPENAI_GPT_INPUTS_DOCSTRING) class OpenAIGPTDoubleHeadsModel(OpenAIGPTPreTrainedModel): r""" **mc_token_ids**: (`optional`, default to index of the last token of the input) ``torch.LongTensor`` of shape ``(batch_size, num_choices)``: Index of the classification token in each input sequence. Selected in the range ``[0, input_ids.size(-1) - 1[``. **lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` **mc_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size)``: Labels for computing the multiple choice classification loss. Indices should be in ``[0, ..., num_choices]`` where `num_choices` is the size of the second dimension of the input tensors. (see `input_ids` above) `multiple_choice_labels`: optional multiple choice labels: ``torch.LongTensor`` of shape [batch_size] with indices selected in [0, ..., num_choices]. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **lm_loss**: (`optional`, returned when ``lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **mc_loss**: (`optional`, returned when ``multiple_choice_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Multiple choice classification loss. **lm_prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, num_choices, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **mc_prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, num_choices)`` Prediction scores of the multiplechoice classification head (scores for each choice before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = OpenAIGPTTokenizer.from_pretrained('openai-gpt') model = OpenAIGPTDoubleHeadsModel.from_pretrained('openai-gpt') tokenizer.add_special_tokens({'cls_token': '[CLS]'}) # Add a [CLS] to the vocabulary (we should train it also!) choices = ["Hello, my dog is cute [CLS]", "Hello, my cat is cute [CLS]"] input_ids = torch.tensor([tokenizer.encode(s) for s in choices]).unsqueeze(0) # Batch size 1, 2 choices mc_token_ids = torch.tensor([input_ids.size(-1), input_ids.size(-1)]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, mc_token_ids=mc_token_ids) lm_prediction_scores, mc_prediction_scores = outputs[:2] """ def __init__(self, config): super(OpenAIGPTDoubleHeadsModel, self).__init__(config) self.transformer = OpenAIGPTModel(config) self.lm_head = nn.Linear(config.n_embd, config.vocab_size, bias=False) self.multiple_choice_head = SequenceSummary(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.lm_head, self.transformer.tokens_embed) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, mc_token_ids=None, lm_labels=None, mc_labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) hidden_states = transformer_outputs[0] lm_logits = self.lm_head(hidden_states) mc_logits = self.multiple_choice_head(hidden_states, mc_token_ids).squeeze(-1) outputs = (lm_logits, mc_logits) + transformer_outputs[1:] if mc_labels is not None: loss_fct = CrossEntropyLoss() loss = loss_fct(mc_logits.view(-1, mc_logits.size(-1)), mc_labels.view(-1)) outputs = (loss,) + outputs if lm_labels is not None: shift_logits = lm_logits[..., :-1, :].contiguous() shift_labels = lm_labels[..., 1:].contiguous() loss_fct = CrossEntropyLoss(ignore_index=-1) loss = loss_fct(shift_logits.view(-1, shift_logits.size(-1)), shift_labels.view(-1)) outputs = (loss,) + outputs return outputs # (lm loss), (mc loss), lm logits, mc logits, (all hidden_states), (attentions)
30,874
48.638264
148
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/configuration_auto.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Auto Model class. """ from __future__ import absolute_import, division, print_function, unicode_literals import logging from .configuration_bert import BertConfig from .configuration_openai import OpenAIGPTConfig from .configuration_gpt2 import GPT2Config from .configuration_transfo_xl import TransfoXLConfig from .configuration_xlnet import XLNetConfig from .configuration_xlm import XLMConfig from .configuration_roberta import RobertaConfig from .configuration_distilbert import DistilBertConfig logger = logging.getLogger(__name__) class AutoConfig(object): r""":class:`~pytorch_transformers.AutoConfig` is a generic configuration class that will be instantiated as one of the configuration classes of the library when created with the `AutoConfig.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method take care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The base model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertConfig (DistilBERT model) - contains `bert`: BertConfig (Bert model) - contains `openai-gpt`: OpenAIGPTConfig (OpenAI GPT model) - contains `gpt2`: GPT2Config (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLConfig (Transformer-XL model) - contains `xlnet`: XLNetConfig (XLNet model) - contains `xlm`: XLMConfig (XLM model) - contains `roberta`: RobertaConfig (RoBERTa model) This class cannot be instantiated using `__init__()` (throw an error). """ def __init__(self): raise EnvironmentError("AutoConfig is designed to be instantiated " "using the `AutoConfig.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, **kwargs): r""" Instantiate a one of the configuration classes of the library from a pre-trained model configuration. The configuration class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertConfig (DistilBERT model) - contains `bert`: BertConfig (Bert model) - contains `openai-gpt`: OpenAIGPTConfig (OpenAI GPT model) - contains `gpt2`: GPT2Config (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLConfig (Transformer-XL model) - contains `xlnet`: XLNetConfig (XLNet model) - contains `xlm`: XLMConfig (XLM model) - contains `roberta`: RobertaConfig (RoBERTa model) Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model configuration to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing a configuration file saved using the :func:`~pytorch_transformers.PretrainedConfig.save_pretrained` method, e.g.: ``./my_model_directory/``. - a path or url to a saved configuration JSON `file`, e.g.: ``./my_model_directory/configuration.json``. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. kwargs: (`optional`) dict: key/value pairs with which to update the configuration object after loading. - The values in kwargs of any keys which are configuration attributes will be used to override the loaded values. - Behavior concerning key/value pairs whose keys are *not* configuration attributes is controlled by the `return_unused_kwargs` keyword parameter. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. return_unused_kwargs: (`optional`) bool: - If False, then this function returns just the final configuration object. - If True, then this functions returns a tuple `(config, unused_kwargs)` where `unused_kwargs` is a dictionary consisting of the key/value pairs whose keys are not configuration attributes: ie the part of kwargs which has not been used to update `config` and is otherwise ignored. Examples:: config = AutoConfig.from_pretrained('bert-base-uncased') # Download configuration from S3 and cache. config = AutoConfig.from_pretrained('./test/bert_saved_model/') # E.g. config (or model) was saved using `save_pretrained('./test/saved_model/')` config = AutoConfig.from_pretrained('./test/bert_saved_model/my_configuration.json') config = AutoConfig.from_pretrained('bert-base-uncased', output_attention=True, foo=False) assert config.output_attention == True config, unused_kwargs = AutoConfig.from_pretrained('bert-base-uncased', output_attention=True, foo=False, return_unused_kwargs=True) assert config.output_attention == True assert unused_kwargs == {'foo': False} """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'roberta' in pretrained_model_name_or_path: return RobertaConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'openai-gpt' in pretrained_model_name_or_path: return OpenAIGPTConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'gpt2' in pretrained_model_name_or_path: return GPT2Config.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'transfo-xl' in pretrained_model_name_or_path: return TransfoXLConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMConfig.from_pretrained(pretrained_model_name_or_path, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'openai-gpt', 'gpt2', 'transfo-xl', 'xlnet', " "'xlm', 'roberta'".format(pretrained_model_name_or_path))
7,826
56.551471
296
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tokenization_bert.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tokenization classes.""" from __future__ import absolute_import, division, print_function, unicode_literals import collections import logging import os import unicodedata from io import open from .tokenization_utils import PreTrainedTokenizer logger = logging.getLogger(__name__) VOCAB_FILES_NAMES = {'vocab_file': 'vocab.txt'} PRETRAINED_VOCAB_FILES_MAP = { 'vocab_file': { 'bert-base-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-uncased-vocab.txt", 'bert-large-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-vocab.txt", 'bert-base-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-vocab.txt", 'bert-large-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-vocab.txt", 'bert-base-multilingual-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-uncased-vocab.txt", 'bert-base-multilingual-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-multilingual-cased-vocab.txt", 'bert-base-chinese': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-chinese-vocab.txt", 'bert-base-german-cased': "https://int-deepset-models-bert.s3.eu-central-1.amazonaws.com/pytorch/bert-base-german-cased-vocab.txt", 'bert-large-uncased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-vocab.txt", 'bert-large-cased-whole-word-masking': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-vocab.txt", 'bert-large-uncased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-whole-word-masking-finetuned-squad-vocab.txt", 'bert-large-cased-whole-word-masking-finetuned-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-cased-whole-word-masking-finetuned-squad-vocab.txt", 'bert-base-cased-finetuned-mrpc': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-cased-finetuned-mrpc-vocab.txt", } } PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES = { 'bert-base-uncased': 512, 'bert-large-uncased': 512, 'bert-base-cased': 512, 'bert-large-cased': 512, 'bert-base-multilingual-uncased': 512, 'bert-base-multilingual-cased': 512, 'bert-base-chinese': 512, 'bert-base-german-cased': 512, 'bert-large-uncased-whole-word-masking': 512, 'bert-large-cased-whole-word-masking': 512, 'bert-large-uncased-whole-word-masking-finetuned-squad': 512, 'bert-large-cased-whole-word-masking-finetuned-squad': 512, 'bert-base-cased-finetuned-mrpc': 512, } PRETRAINED_INIT_CONFIGURATION = { 'bert-base-uncased': {'do_lower_case': True}, 'bert-large-uncased': {'do_lower_case': True}, 'bert-base-cased': {'do_lower_case': False}, 'bert-large-cased': {'do_lower_case': False}, 'bert-base-multilingual-uncased': {'do_lower_case': True}, 'bert-base-multilingual-cased': {'do_lower_case': False}, 'bert-base-chinese': {'do_lower_case': False}, 'bert-base-german-cased': {'do_lower_case': False}, 'bert-large-uncased-whole-word-masking': {'do_lower_case': True}, 'bert-large-cased-whole-word-masking': {'do_lower_case': False}, 'bert-large-uncased-whole-word-masking-finetuned-squad': {'do_lower_case': True}, 'bert-large-cased-whole-word-masking-finetuned-squad': {'do_lower_case': False}, 'bert-base-cased-finetuned-mrpc': {'do_lower_case': False}, } def load_vocab(vocab_file): """Loads a vocabulary file into a dictionary.""" vocab = collections.OrderedDict() with open(vocab_file, "r", encoding="utf-8") as reader: tokens = reader.readlines() for index, token in enumerate(tokens): token = token.rstrip('\n') vocab[token] = index return vocab def whitespace_tokenize(text): """Runs basic whitespace cleaning and splitting on a piece of text.""" text = text.strip() if not text: return [] tokens = text.split() return tokens class BertTokenizer(PreTrainedTokenizer): r""" Constructs a BertTokenizer. :class:`~pytorch_transformers.BertTokenizer` runs end-to-end tokenization: punctuation splitting + wordpiece Args: vocab_file: Path to a one-wordpiece-per-line vocabulary file do_lower_case: Whether to lower case the input. Only has an effect when do_wordpiece_only=False do_basic_tokenize: Whether to do basic tokenization before wordpiece. max_len: An artificial maximum length to truncate tokenized sequences to; Effective maximum length is always the minimum of this value (if specified) and the underlying BERT model's sequence length. never_split: List of tokens which will never be split during tokenization. Only has an effect when do_wordpiece_only=False """ vocab_files_names = VOCAB_FILES_NAMES pretrained_vocab_files_map = PRETRAINED_VOCAB_FILES_MAP pretrained_init_configuration = PRETRAINED_INIT_CONFIGURATION max_model_input_sizes = PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES def __init__(self, vocab_file, do_lower_case=True, do_basic_tokenize=True, never_split=None, unk_token="[UNK]", sep_token="[SEP]", pad_token="[PAD]", cls_token="[CLS]", mask_token="[MASK]", tokenize_chinese_chars=True, **kwargs): """Constructs a BertTokenizer. Args: **vocab_file**: Path to a one-wordpiece-per-line vocabulary file **do_lower_case**: (`optional`) boolean (default True) Whether to lower case the input Only has an effect when do_basic_tokenize=True **do_basic_tokenize**: (`optional`) boolean (default True) Whether to do basic tokenization before wordpiece. **never_split**: (`optional`) list of string List of tokens which will never be split during tokenization. Only has an effect when do_basic_tokenize=True **tokenize_chinese_chars**: (`optional`) boolean (default True) Whether to tokenize Chinese characters. This should likely be deactivated for Japanese: see: https://github.com/huggingface/pytorch-pretrained-BERT/issues/328 """ super(BertTokenizer, self).__init__(unk_token=unk_token, sep_token=sep_token, pad_token=pad_token, cls_token=cls_token, mask_token=mask_token, **kwargs) self.max_len_single_sentence = self.max_len - 2 # take into account special tokens self.max_len_sentences_pair = self.max_len - 3 # take into account special tokens if not os.path.isfile(vocab_file): raise ValueError( "Can't find a vocabulary file at path '{}'. To load the vocabulary from a Google pretrained " "model use `tokenizer = BertTokenizer.from_pretrained(PRETRAINED_MODEL_NAME)`".format(vocab_file)) self.vocab = load_vocab(vocab_file) self.ids_to_tokens = collections.OrderedDict( [(ids, tok) for tok, ids in self.vocab.items()]) self.do_basic_tokenize = do_basic_tokenize if do_basic_tokenize: self.basic_tokenizer = BasicTokenizer(do_lower_case=do_lower_case, never_split=never_split, tokenize_chinese_chars=tokenize_chinese_chars) self.wordpiece_tokenizer = WordpieceTokenizer(vocab=self.vocab, unk_token=self.unk_token) @property def vocab_size(self): return len(self.vocab) def _tokenize(self, text): split_tokens = [] if self.do_basic_tokenize: for token in self.basic_tokenizer.tokenize(text, never_split=self.all_special_tokens): for sub_token in self.wordpiece_tokenizer.tokenize(token): split_tokens.append(sub_token) else: split_tokens = self.wordpiece_tokenizer.tokenize(text) return split_tokens def _convert_token_to_id(self, token): """ Converts a token (str/unicode) in an id using the vocab. """ return self.vocab.get(token, self.vocab.get(self.unk_token)) def _convert_id_to_token(self, index): """Converts an index (integer) in a token (string/unicode) using the vocab.""" return self.ids_to_tokens.get(index, self.unk_token) def convert_tokens_to_string(self, tokens): """ Converts a sequence of tokens (string) in a single string. """ out_string = ' '.join(tokens).replace(' ##', '').strip() return out_string def add_special_tokens_single_sentence(self, token_ids): """ Adds special tokens to the a sequence for sequence classification tasks. A BERT sequence has the following format: [CLS] X [SEP] """ return [self.cls_token_id] + token_ids + [self.sep_token_id] def add_special_tokens_sentences_pair(self, token_ids_0, token_ids_1): """ Adds special tokens to a sequence pair for sequence classification tasks. A BERT sequence pair has the following format: [CLS] A [SEP] B [SEP] """ sep = [self.sep_token_id] cls = [self.cls_token_id] return cls + token_ids_0 + sep + token_ids_1 + sep def save_vocabulary(self, vocab_path): """Save the tokenizer vocabulary to a directory or file.""" index = 0 if os.path.isdir(vocab_path): vocab_file = os.path.join(vocab_path, VOCAB_FILES_NAMES['vocab_file']) else: vocab_file = vocab_path with open(vocab_file, "w", encoding="utf-8") as writer: for token, token_index in sorted(self.vocab.items(), key=lambda kv: kv[1]): if index != token_index: logger.warning("Saving vocabulary to {}: vocabulary indices are not consecutive." " Please check that the vocabulary is not corrupted!".format(vocab_file)) index = token_index writer.write(token + u'\n') index += 1 return (vocab_file,) class BasicTokenizer(object): """Runs basic tokenization (punctuation splitting, lower casing, etc.).""" def __init__(self, do_lower_case=True, never_split=None, tokenize_chinese_chars=True): """ Constructs a BasicTokenizer. Args: **do_lower_case**: Whether to lower case the input. **never_split**: (`optional`) list of str Kept for backward compatibility purposes. Now implemented directly at the base class level (see :func:`PreTrainedTokenizer.tokenize`) List of token not to split. **tokenize_chinese_chars**: (`optional`) boolean (default True) Whether to tokenize Chinese characters. This should likely be deactivated for Japanese: see: https://github.com/huggingface/pytorch-pretrained-BERT/issues/328 """ if never_split is None: never_split = [] self.do_lower_case = do_lower_case self.never_split = never_split self.tokenize_chinese_chars = tokenize_chinese_chars def tokenize(self, text, never_split=None): """ Basic Tokenization of a piece of text. Split on "white spaces" only, for sub-word tokenization, see WordPieceTokenizer. Args: **never_split**: (`optional`) list of str Kept for backward compatibility purposes. Now implemented directly at the base class level (see :func:`PreTrainedTokenizer.tokenize`) List of token not to split. """ never_split = self.never_split + (never_split if never_split is not None else []) text = self._clean_text(text) # This was added on November 1st, 2018 for the multilingual and Chinese # models. This is also applied to the English models now, but it doesn't # matter since the English models were not trained on any Chinese data # and generally don't have any Chinese data in them (there are Chinese # characters in the vocabulary because Wikipedia does have some Chinese # words in the English Wikipedia.). if self.tokenize_chinese_chars: text = self._tokenize_chinese_chars(text) orig_tokens = whitespace_tokenize(text) split_tokens = [] for token in orig_tokens: if self.do_lower_case and token not in never_split: token = token.lower() token = self._run_strip_accents(token) split_tokens.extend(self._run_split_on_punc(token)) output_tokens = whitespace_tokenize(" ".join(split_tokens)) return output_tokens def _run_strip_accents(self, text): """Strips accents from a piece of text.""" text = unicodedata.normalize("NFD", text) output = [] for char in text: cat = unicodedata.category(char) if cat == "Mn": continue output.append(char) return "".join(output) def _run_split_on_punc(self, text, never_split=None): """Splits punctuation on a piece of text.""" if never_split is not None and text in never_split: return [text] chars = list(text) i = 0 start_new_word = True output = [] while i < len(chars): char = chars[i] if _is_punctuation(char): output.append([char]) start_new_word = True else: if start_new_word: output.append([]) start_new_word = False output[-1].append(char) i += 1 return ["".join(x) for x in output] def _tokenize_chinese_chars(self, text): """Adds whitespace around any CJK character.""" output = [] for char in text: cp = ord(char) if self._is_chinese_char(cp): output.append(" ") output.append(char) output.append(" ") else: output.append(char) return "".join(output) def _is_chinese_char(self, cp): """Checks whether CP is the codepoint of a CJK character.""" # This defines a "chinese character" as anything in the CJK Unicode block: # https://en.wikipedia.org/wiki/CJK_Unified_Ideographs_(Unicode_block) # # Note that the CJK Unicode block is NOT all Japanese and Korean characters, # despite its name. The modern Korean Hangul alphabet is a different block, # as is Japanese Hiragana and Katakana. Those alphabets are used to write # space-separated words, so they are not treated specially and handled # like the all of the other languages. if ((cp >= 0x4E00 and cp <= 0x9FFF) or # (cp >= 0x3400 and cp <= 0x4DBF) or # (cp >= 0x20000 and cp <= 0x2A6DF) or # (cp >= 0x2A700 and cp <= 0x2B73F) or # (cp >= 0x2B740 and cp <= 0x2B81F) or # (cp >= 0x2B820 and cp <= 0x2CEAF) or (cp >= 0xF900 and cp <= 0xFAFF) or # (cp >= 0x2F800 and cp <= 0x2FA1F)): # return True return False def _clean_text(self, text): """Performs invalid character removal and whitespace cleanup on text.""" output = [] for char in text: cp = ord(char) if cp == 0 or cp == 0xfffd or _is_control(char): continue if _is_whitespace(char): output.append(" ") else: output.append(char) return "".join(output) class WordpieceTokenizer(object): """Runs WordPiece tokenization.""" def __init__(self, vocab, unk_token, max_input_chars_per_word=100): self.vocab = vocab self.unk_token = unk_token self.max_input_chars_per_word = max_input_chars_per_word def tokenize(self, text): """Tokenizes a piece of text into its word pieces. This uses a greedy longest-match-first algorithm to perform tokenization using the given vocabulary. For example: input = "unaffable" output = ["un", "##aff", "##able"] Args: text: A single token or whitespace separated tokens. This should have already been passed through `BasicTokenizer`. Returns: A list of wordpiece tokens. """ output_tokens = [] for token in whitespace_tokenize(text): chars = list(token) if len(chars) > self.max_input_chars_per_word: output_tokens.append(self.unk_token) continue is_bad = False start = 0 sub_tokens = [] while start < len(chars): end = len(chars) cur_substr = None while start < end: substr = "".join(chars[start:end]) if start > 0: substr = "##" + substr if substr in self.vocab: cur_substr = substr break end -= 1 if cur_substr is None: is_bad = True break sub_tokens.append(cur_substr) start = end if is_bad: output_tokens.append(self.unk_token) else: output_tokens.extend(sub_tokens) return output_tokens def _is_whitespace(char): """Checks whether `chars` is a whitespace character.""" # \t, \n, and \r are technically contorl characters but we treat them # as whitespace since they are generally considered as such. if char == " " or char == "\t" or char == "\n" or char == "\r": return True cat = unicodedata.category(char) if cat == "Zs": return True return False def _is_control(char): """Checks whether `chars` is a control character.""" # These are technically control characters but we count them as whitespace # characters. if char == "\t" or char == "\n" or char == "\r": return False cat = unicodedata.category(char) if cat.startswith("C"): return True return False def _is_punctuation(char): """Checks whether `chars` is a punctuation character.""" cp = ord(char) # We treat all non-letter/number ASCII as punctuation. # Characters such as "^", "$", and "`" are not in the Unicode # Punctuation class but we treat them as punctuation anyways, for # consistency. if ((cp >= 33 and cp <= 47) or (cp >= 58 and cp <= 64) or (cp >= 91 and cp <= 96) or (cp >= 123 and cp <= 126)): return True cat = unicodedata.category(char) if cat.startswith("P"): return True return False
19,926
42.508734
183
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_xlnet_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert BERT checkpoint.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import os import argparse import torch from pytorch_transformers import (CONFIG_NAME, WEIGHTS_NAME, XLNetConfig, XLNetLMHeadModel, XLNetForQuestionAnswering, XLNetForSequenceClassification, load_tf_weights_in_xlnet) GLUE_TASKS_NUM_LABELS = { "cola": 2, "mnli": 3, "mrpc": 2, "sst-2": 2, "sts-b": 1, "qqp": 2, "qnli": 2, "rte": 2, "wnli": 2, } import logging logging.basicConfig(level=logging.INFO) def convert_xlnet_checkpoint_to_pytorch(tf_checkpoint_path, bert_config_file, pytorch_dump_folder_path, finetuning_task=None): # Initialise PyTorch model config = XLNetConfig.from_json_file(bert_config_file) finetuning_task = finetuning_task.lower() if finetuning_task is not None else "" if finetuning_task in GLUE_TASKS_NUM_LABELS: print("Building PyTorch XLNetForSequenceClassification model from configuration: {}".format(str(config))) config.finetuning_task = finetuning_task config.num_labels = GLUE_TASKS_NUM_LABELS[finetuning_task] model = XLNetForSequenceClassification(config) elif 'squad' in finetuning_task: config.finetuning_task = finetuning_task model = XLNetForQuestionAnswering(config) else: model = XLNetLMHeadModel(config) # Load weights from tf checkpoint load_tf_weights_in_xlnet(model, config, tf_checkpoint_path) # Save pytorch-model pytorch_weights_dump_path = os.path.join(pytorch_dump_folder_path, WEIGHTS_NAME) pytorch_config_dump_path = os.path.join(pytorch_dump_folder_path, CONFIG_NAME) print("Save PyTorch model to {}".format(os.path.abspath(pytorch_weights_dump_path))) torch.save(model.state_dict(), pytorch_weights_dump_path) print("Save configuration file to {}".format(os.path.abspath(pytorch_config_dump_path))) with open(pytorch_config_dump_path, "w", encoding="utf-8") as f: f.write(config.to_json_string()) if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--tf_checkpoint_path", default = None, type = str, required = True, help = "Path to the TensorFlow checkpoint path.") parser.add_argument("--xlnet_config_file", default = None, type = str, required = True, help = "The config json file corresponding to the pre-trained XLNet model. \n" "This specifies the model architecture.") parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the folder to store the PyTorch model or dataset/vocab.") parser.add_argument("--finetuning_task", default = None, type = str, help = "Name of a task on which the XLNet TensorFloaw model was fine-tuned") args = parser.parse_args() print(args) convert_xlnet_checkpoint_to_pytorch(args.tf_checkpoint_path, args.xlnet_config_file, args.pytorch_dump_folder_path, args.finetuning_task)
4,342
40.361905
126
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_xlm_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert OpenAI GPT checkpoint.""" from __future__ import absolute_import, division, print_function import argparse import json from io import open import torch import numpy from pytorch_transformers import CONFIG_NAME, WEIGHTS_NAME from pytorch_transformers.tokenization_xlm import VOCAB_FILES_NAMES import logging logging.basicConfig(level=logging.INFO) def convert_xlm_checkpoint_to_pytorch(xlm_checkpoint_path, pytorch_dump_folder_path): # Load checkpoint chkpt = torch.load(xlm_checkpoint_path, map_location='cpu') model = chkpt['model'] config = chkpt['params'] config = dict((n, v) for n, v in config.items() if not isinstance(v, (torch.FloatTensor, numpy.ndarray))) vocab = chkpt['dico_word2id'] vocab = dict((s + '</w>' if s.find('@@') == -1 and i > 13 else s.replace('@@', ''), i) for s, i in vocab.items()) # Save pytorch-model pytorch_weights_dump_path = pytorch_dump_folder_path + '/' + WEIGHTS_NAME pytorch_config_dump_path = pytorch_dump_folder_path + '/' + CONFIG_NAME pytorch_vocab_dump_path = pytorch_dump_folder_path + '/' + VOCAB_FILES_NAMES['vocab_file'] print("Save PyTorch model to {}".format(pytorch_weights_dump_path)) torch.save(model, pytorch_weights_dump_path) print("Save configuration file to {}".format(pytorch_config_dump_path)) with open(pytorch_config_dump_path, "w", encoding="utf-8") as f: f.write(json.dumps(config, indent=2) + "\n") print("Save vocab file to {}".format(pytorch_config_dump_path)) with open(pytorch_vocab_dump_path, "w", encoding="utf-8") as f: f.write(json.dumps(vocab, indent=2) + "\n") if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--xlm_checkpoint_path", default = None, type = str, required = True, help = "Path the official PyTorch dump.") parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the output PyTorch model.") args = parser.parse_args() convert_xlm_checkpoint_to_pytorch(args.xlm_checkpoint_path, args.pytorch_dump_folder_path)
2,940
37.697368
117
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_auto.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Auto Model class. """ from __future__ import absolute_import, division, print_function, unicode_literals import logging from .modeling_bert import BertModel, BertForMaskedLM, BertForSequenceClassification, BertForQuestionAnswering from .modeling_openai import OpenAIGPTModel, OpenAIGPTLMHeadModel from .modeling_gpt2 import GPT2Model, GPT2LMHeadModel from .modeling_transfo_xl import TransfoXLModel, TransfoXLLMHeadModel from .modeling_xlnet import XLNetModel, XLNetLMHeadModel, XLNetForSequenceClassification, XLNetForQuestionAnswering from .modeling_xlm import XLMModel, XLMWithLMHeadModel, XLMForSequenceClassification, XLMForQuestionAnswering from .modeling_roberta import RobertaModel, RobertaForMaskedLM, RobertaForSequenceClassification from .modeling_distilbert import DistilBertModel, DistilBertForQuestionAnswering, DistilBertForMaskedLM, DistilBertForSequenceClassification from .modeling_utils import PreTrainedModel, SequenceSummary from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) class AutoModel(object): r""" :class:`~pytorch_transformers.AutoModel` is a generic model class that will be instantiated as one of the base model classes of the library when created with the `AutoModel.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The base model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertModel (DistilBERT model) - contains `roberta`: RobertaModel (RoBERTa model) - contains `bert`: BertModel (Bert model) - contains `openai-gpt`: OpenAIGPTModel (OpenAI GPT model) - contains `gpt2`: GPT2Model (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLModel (Transformer-XL model) - contains `xlnet`: XLNetModel (XLNet model) - contains `xlm`: XLMModel (XLM model) This class cannot be instantiated using `__init__()` (throws an error). """ def __init__(self): raise EnvironmentError("AutoModel is designed to be instantiated " "using the `AutoModel.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *model_args, **kwargs): r""" Instantiates one of the base model classes of the library from a pre-trained model configuration. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertModel (DistilBERT model) - contains `roberta`: RobertaModel (RoBERTa model) - contains `bert`: BertModel (Bert model) - contains `openai-gpt`: OpenAIGPTModel (OpenAI GPT model) - contains `gpt2`: GPT2Model (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLModel (Transformer-XL model) - contains `xlnet`: XLNetModel (XLNet model) - contains `xlm`: XLMModel (XLM model) The model is set in evaluation mode by default using `model.eval()` (Dropout modules are deactivated) To train the model, you should first set it back in training mode with `model.train()` Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing model weights saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained`, e.g.: ``./my_model_directory/``. - a path or url to a `tensorflow index checkpoint file` (e.g. `./tf_model/model.ckpt.index`). In this case, ``from_tf`` should be set to True and a configuration object should be provided as ``config`` argument. This loading path is slower than converting the TensorFlow checkpoint in a PyTorch model using the provided conversion scripts and loading the PyTorch model afterwards. model_args: (`optional`) Sequence of positional arguments: All remaning positional arguments will be passed to the underlying model's ``__init__`` method config: (`optional`) instance of a class derived from :class:`~pytorch_transformers.PretrainedConfig`: Configuration for the model to use instead of an automatically loaded configuation. Configuration can be automatically loaded when: - the model is a model provided by the library (loaded with the ``shortcut-name`` string of a pretrained model), or - the model was saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and is reloaded by suppling the save directory. - the model is loaded by suppling a local directory as ``pretrained_model_name_or_path`` and a configuration JSON file named `config.json` is found in the directory. state_dict: (`optional`) dict: an optional state dictionnary for the model to use instead of a state dictionary loaded from saved weights file. This option can be used if you want to create a model from a pretrained configuration but load your own weights. In this case though, you should check if using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and :func:`~pytorch_transformers.PreTrainedModel.from_pretrained` is not a simpler option. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. output_loading_info: (`optional`) boolean: Set to ``True`` to also return a dictionnary containing missing keys, unexpected keys and error messages. kwargs: (`optional`) Remaining dictionary of keyword arguments: Can be used to update the configuration object (after it being loaded) and initiate the model. (e.g. ``output_attention=True``). Behave differently depending on whether a `config` is provided or automatically loaded: - If a configuration is provided with ``config``, ``**kwargs`` will be directly passed to the underlying model's ``__init__`` method (we assume all relevant updates to the configuration have already been done) - If a configuration is not provided, ``kwargs`` will be first passed to the configuration class initialization function (:func:`~pytorch_transformers.PretrainedConfig.from_pretrained`). Each key of ``kwargs`` that corresponds to a configuration attribute will be used to override said attribute with the supplied ``kwargs`` value. Remaining keys that do not correspond to any configuration attribute will be passed to the underlying model's ``__init__`` function. Examples:: model = AutoModel.from_pretrained('bert-base-uncased') # Download model and configuration from S3 and cache. model = AutoModel.from_pretrained('./test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = AutoModel.from_pretrained('bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = AutoModel.from_pretrained('./tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'roberta' in pretrained_model_name_or_path: return RobertaModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'openai-gpt' in pretrained_model_name_or_path: return OpenAIGPTModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'gpt2' in pretrained_model_name_or_path: return GPT2Model.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'transfo-xl' in pretrained_model_name_or_path: return TransfoXLModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'openai-gpt', 'gpt2', 'transfo-xl', 'xlnet', " "'xlm', 'roberta'".format(pretrained_model_name_or_path)) class AutoModelWithLMHead(object): r""" :class:`~pytorch_transformers.AutoModelWithLMHead` is a generic model class that will be instantiated as one of the language modeling model classes of the library when created with the `AutoModelWithLMHead.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForMaskedLM (DistilBERT model) - contains `roberta`: RobertaForMaskedLM (RoBERTa model) - contains `bert`: BertForMaskedLM (Bert model) - contains `openai-gpt`: OpenAIGPTLMHeadModel (OpenAI GPT model) - contains `gpt2`: GPT2LMHeadModel (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLLMHeadModel (Transformer-XL model) - contains `xlnet`: XLNetLMHeadModel (XLNet model) - contains `xlm`: XLMWithLMHeadModel (XLM model) This class cannot be instantiated using `__init__()` (throws an error). """ def __init__(self): raise EnvironmentError("AutoModelWithLMHead is designed to be instantiated " "using the `AutoModelWithLMHead.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *model_args, **kwargs): r""" Instantiates one of the language modeling model classes of the library from a pre-trained model configuration. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForMaskedLM (DistilBERT model) - contains `roberta`: RobertaForMaskedLM (RoBERTa model) - contains `bert`: BertForMaskedLM (Bert model) - contains `openai-gpt`: OpenAIGPTLMHeadModel (OpenAI GPT model) - contains `gpt2`: GPT2LMHeadModel (OpenAI GPT-2 model) - contains `transfo-xl`: TransfoXLLMHeadModel (Transformer-XL model) - contains `xlnet`: XLNetLMHeadModel (XLNet model) - contains `xlm`: XLMWithLMHeadModel (XLM model) The model is set in evaluation mode by default using `model.eval()` (Dropout modules are deactivated) To train the model, you should first set it back in training mode with `model.train()` Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing model weights saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained`, e.g.: ``./my_model_directory/``. - a path or url to a `tensorflow index checkpoint file` (e.g. `./tf_model/model.ckpt.index`). In this case, ``from_tf`` should be set to True and a configuration object should be provided as ``config`` argument. This loading path is slower than converting the TensorFlow checkpoint in a PyTorch model using the provided conversion scripts and loading the PyTorch model afterwards. model_args: (`optional`) Sequence of positional arguments: All remaning positional arguments will be passed to the underlying model's ``__init__`` method config: (`optional`) instance of a class derived from :class:`~pytorch_transformers.PretrainedConfig`: Configuration for the model to use instead of an automatically loaded configuation. Configuration can be automatically loaded when: - the model is a model provided by the library (loaded with the ``shortcut-name`` string of a pretrained model), or - the model was saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and is reloaded by suppling the save directory. - the model is loaded by suppling a local directory as ``pretrained_model_name_or_path`` and a configuration JSON file named `config.json` is found in the directory. state_dict: (`optional`) dict: an optional state dictionnary for the model to use instead of a state dictionary loaded from saved weights file. This option can be used if you want to create a model from a pretrained configuration but load your own weights. In this case though, you should check if using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and :func:`~pytorch_transformers.PreTrainedModel.from_pretrained` is not a simpler option. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. output_loading_info: (`optional`) boolean: Set to ``True`` to also return a dictionnary containing missing keys, unexpected keys and error messages. kwargs: (`optional`) Remaining dictionary of keyword arguments: Can be used to update the configuration object (after it being loaded) and initiate the model. (e.g. ``output_attention=True``). Behave differently depending on whether a `config` is provided or automatically loaded: - If a configuration is provided with ``config``, ``**kwargs`` will be directly passed to the underlying model's ``__init__`` method (we assume all relevant updates to the configuration have already been done) - If a configuration is not provided, ``kwargs`` will be first passed to the configuration class initialization function (:func:`~pytorch_transformers.PretrainedConfig.from_pretrained`). Each key of ``kwargs`` that corresponds to a configuration attribute will be used to override said attribute with the supplied ``kwargs`` value. Remaining keys that do not correspond to any configuration attribute will be passed to the underlying model's ``__init__`` function. Examples:: model = AutoModelWithLMHead.from_pretrained('bert-base-uncased') # Download model and configuration from S3 and cache. model = AutoModelWithLMHead.from_pretrained('./test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = AutoModelWithLMHead.from_pretrained('bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = AutoModelWithLMHead.from_pretrained('./tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertForMaskedLM.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'roberta' in pretrained_model_name_or_path: return RobertaForMaskedLM.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertForMaskedLM.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'openai-gpt' in pretrained_model_name_or_path: return OpenAIGPTLMHeadModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'gpt2' in pretrained_model_name_or_path: return GPT2LMHeadModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'transfo-xl' in pretrained_model_name_or_path: return TransfoXLLMHeadModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetLMHeadModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMWithLMHeadModel.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'openai-gpt', 'gpt2', 'transfo-xl', 'xlnet', " "'xlm', 'roberta'".format(pretrained_model_name_or_path)) class AutoModelForSequenceClassification(object): r""" :class:`~pytorch_transformers.AutoModelForSequenceClassification` is a generic model class that will be instantiated as one of the sequence classification model classes of the library when created with the `AutoModelForSequenceClassification.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForSequenceClassification (DistilBERT model) - contains `roberta`: RobertaForSequenceClassification (RoBERTa model) - contains `bert`: BertForSequenceClassification (Bert model) - contains `xlnet`: XLNetForSequenceClassification (XLNet model) - contains `xlm`: XLMForSequenceClassification (XLM model) This class cannot be instantiated using `__init__()` (throws an error). """ def __init__(self): raise EnvironmentError("AutoModelWithLMHead is designed to be instantiated " "using the `AutoModelWithLMHead.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *model_args, **kwargs): r""" Instantiates one of the sequence classification model classes of the library from a pre-trained model configuration. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForSequenceClassification (DistilBERT model) - contains `roberta`: RobertaForSequenceClassification (RoBERTa model) - contains `bert`: BertForSequenceClassification (Bert model) - contains `xlnet`: XLNetForSequenceClassification (XLNet model) - contains `xlm`: XLMForSequenceClassification (XLM model) The model is set in evaluation mode by default using `model.eval()` (Dropout modules are deactivated) To train the model, you should first set it back in training mode with `model.train()` Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing model weights saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained`, e.g.: ``./my_model_directory/``. - a path or url to a `tensorflow index checkpoint file` (e.g. `./tf_model/model.ckpt.index`). In this case, ``from_tf`` should be set to True and a configuration object should be provided as ``config`` argument. This loading path is slower than converting the TensorFlow checkpoint in a PyTorch model using the provided conversion scripts and loading the PyTorch model afterwards. model_args: (`optional`) Sequence of positional arguments: All remaning positional arguments will be passed to the underlying model's ``__init__`` method config: (`optional`) instance of a class derived from :class:`~pytorch_transformers.PretrainedConfig`: Configuration for the model to use instead of an automatically loaded configuation. Configuration can be automatically loaded when: - the model is a model provided by the library (loaded with the ``shortcut-name`` string of a pretrained model), or - the model was saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and is reloaded by suppling the save directory. - the model is loaded by suppling a local directory as ``pretrained_model_name_or_path`` and a configuration JSON file named `config.json` is found in the directory. state_dict: (`optional`) dict: an optional state dictionnary for the model to use instead of a state dictionary loaded from saved weights file. This option can be used if you want to create a model from a pretrained configuration but load your own weights. In this case though, you should check if using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and :func:`~pytorch_transformers.PreTrainedModel.from_pretrained` is not a simpler option. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. output_loading_info: (`optional`) boolean: Set to ``True`` to also return a dictionnary containing missing keys, unexpected keys and error messages. kwargs: (`optional`) Remaining dictionary of keyword arguments: Can be used to update the configuration object (after it being loaded) and initiate the model. (e.g. ``output_attention=True``). Behave differently depending on whether a `config` is provided or automatically loaded: - If a configuration is provided with ``config``, ``**kwargs`` will be directly passed to the underlying model's ``__init__`` method (we assume all relevant updates to the configuration have already been done) - If a configuration is not provided, ``kwargs`` will be first passed to the configuration class initialization function (:func:`~pytorch_transformers.PretrainedConfig.from_pretrained`). Each key of ``kwargs`` that corresponds to a configuration attribute will be used to override said attribute with the supplied ``kwargs`` value. Remaining keys that do not correspond to any configuration attribute will be passed to the underlying model's ``__init__`` function. Examples:: model = AutoModelForSequenceClassification.from_pretrained('bert-base-uncased') # Download model and configuration from S3 and cache. model = AutoModelForSequenceClassification.from_pretrained('./test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = AutoModelForSequenceClassification.from_pretrained('bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = AutoModelForSequenceClassification.from_pretrained('./tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertForSequenceClassification.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'roberta' in pretrained_model_name_or_path: return RobertaForSequenceClassification.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertForSequenceClassification.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetForSequenceClassification.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMForSequenceClassification.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'xlnet', 'xlm', 'roberta'".format(pretrained_model_name_or_path)) class AutoModelForQuestionAnswering(object): r""" :class:`~pytorch_transformers.AutoModelForQuestionAnswering` is a generic model class that will be instantiated as one of the question answering model classes of the library when created with the `AutoModelForQuestionAnswering.from_pretrained(pretrained_model_name_or_path)` class method. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForQuestionAnswering (DistilBERT model) - contains `bert`: BertForQuestionAnswering (Bert model) - contains `xlnet`: XLNetForQuestionAnswering (XLNet model) - contains `xlm`: XLMForQuestionAnswering (XLM model) This class cannot be instantiated using `__init__()` (throws an error). """ def __init__(self): raise EnvironmentError("AutoModelWithLMHead is designed to be instantiated " "using the `AutoModelWithLMHead.from_pretrained(pretrained_model_name_or_path)` method.") @classmethod def from_pretrained(cls, pretrained_model_name_or_path, *model_args, **kwargs): r""" Instantiates one of the question answering model classes of the library from a pre-trained model configuration. The `from_pretrained()` method takes care of returning the correct model class instance using pattern matching on the `pretrained_model_name_or_path` string. The model class to instantiate is selected as the first pattern matching in the `pretrained_model_name_or_path` string (in the following order): - contains `distilbert`: DistilBertForQuestionAnswering (DistilBERT model) - contains `bert`: BertForQuestionAnswering (Bert model) - contains `xlnet`: XLNetForQuestionAnswering (XLNet model) - contains `xlm`: XLMForQuestionAnswering (XLM model) The model is set in evaluation mode by default using `model.eval()` (Dropout modules are deactivated) To train the model, you should first set it back in training mode with `model.train()` Params: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a pre-trained model to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing model weights saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained`, e.g.: ``./my_model_directory/``. - a path or url to a `tensorflow index checkpoint file` (e.g. `./tf_model/model.ckpt.index`). In this case, ``from_tf`` should be set to True and a configuration object should be provided as ``config`` argument. This loading path is slower than converting the TensorFlow checkpoint in a PyTorch model using the provided conversion scripts and loading the PyTorch model afterwards. model_args: (`optional`) Sequence of positional arguments: All remaning positional arguments will be passed to the underlying model's ``__init__`` method config: (`optional`) instance of a class derived from :class:`~pytorch_transformers.PretrainedConfig`: Configuration for the model to use instead of an automatically loaded configuation. Configuration can be automatically loaded when: - the model is a model provided by the library (loaded with the ``shortcut-name`` string of a pretrained model), or - the model was saved using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and is reloaded by suppling the save directory. - the model is loaded by suppling a local directory as ``pretrained_model_name_or_path`` and a configuration JSON file named `config.json` is found in the directory. state_dict: (`optional`) dict: an optional state dictionnary for the model to use instead of a state dictionary loaded from saved weights file. This option can be used if you want to create a model from a pretrained configuration but load your own weights. In this case though, you should check if using :func:`~pytorch_transformers.PreTrainedModel.save_pretrained` and :func:`~pytorch_transformers.PreTrainedModel.from_pretrained` is not a simpler option. cache_dir: (`optional`) string: Path to a directory in which a downloaded pre-trained model configuration should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the model weights and configuration files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. output_loading_info: (`optional`) boolean: Set to ``True`` to also return a dictionnary containing missing keys, unexpected keys and error messages. kwargs: (`optional`) Remaining dictionary of keyword arguments: Can be used to update the configuration object (after it being loaded) and initiate the model. (e.g. ``output_attention=True``). Behave differently depending on whether a `config` is provided or automatically loaded: - If a configuration is provided with ``config``, ``**kwargs`` will be directly passed to the underlying model's ``__init__`` method (we assume all relevant updates to the configuration have already been done) - If a configuration is not provided, ``kwargs`` will be first passed to the configuration class initialization function (:func:`~pytorch_transformers.PretrainedConfig.from_pretrained`). Each key of ``kwargs`` that corresponds to a configuration attribute will be used to override said attribute with the supplied ``kwargs`` value. Remaining keys that do not correspond to any configuration attribute will be passed to the underlying model's ``__init__`` function. Examples:: model = AutoModelForQuestionAnswering.from_pretrained('bert-base-uncased') # Download model and configuration from S3 and cache. model = AutoModelForQuestionAnswering.from_pretrained('./test/bert_model/') # E.g. model was saved using `save_pretrained('./test/saved_model/')` model = AutoModelForQuestionAnswering.from_pretrained('bert-base-uncased', output_attention=True) # Update configuration during loading assert model.config.output_attention == True # Loading from a TF checkpoint file instead of a PyTorch model (slower) config = AutoConfig.from_json_file('./tf_model/bert_tf_model_config.json') model = AutoModelForQuestionAnswering.from_pretrained('./tf_model/bert_tf_checkpoint.ckpt.index', from_tf=True, config=config) """ if 'distilbert' in pretrained_model_name_or_path: return DistilBertForQuestionAnswering.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'bert' in pretrained_model_name_or_path: return BertForQuestionAnswering.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlnet' in pretrained_model_name_or_path: return XLNetForQuestionAnswering.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) elif 'xlm' in pretrained_model_name_or_path: return XLMForQuestionAnswering.from_pretrained(pretrained_model_name_or_path, *model_args, **kwargs) raise ValueError("Unrecognized model identifier in {}. Should contains one of " "'bert', 'xlnet', 'xlm'".format(pretrained_model_name_or_path))
36,632
72.560241
480
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_transfo_xl_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert Transformer XL checkpoint and datasets.""" from __future__ import absolute_import, division, print_function import argparse import os import sys from io import open import torch import pytorch_transformers.tokenization_transfo_xl as data_utils from pytorch_transformers import CONFIG_NAME, WEIGHTS_NAME from pytorch_transformers import (TransfoXLConfig, TransfoXLLMHeadModel, load_tf_weights_in_transfo_xl) from pytorch_transformers.tokenization_transfo_xl import (CORPUS_NAME, VOCAB_FILES_NAMES) if sys.version_info[0] == 2: import cPickle as pickle else: import pickle import logging logging.basicConfig(level=logging.INFO) # We do this to be able to load python 2 datasets pickles # See e.g. https://stackoverflow.com/questions/2121874/python-pickling-after-changing-a-modules-directory/2121918#2121918 data_utils.Vocab = data_utils.TransfoXLTokenizer data_utils.Corpus = data_utils.TransfoXLCorpus sys.modules['data_utils'] = data_utils sys.modules['vocabulary'] = data_utils def convert_transfo_xl_checkpoint_to_pytorch(tf_checkpoint_path, transfo_xl_config_file, pytorch_dump_folder_path, transfo_xl_dataset_file): if transfo_xl_dataset_file: # Convert a pre-processed corpus (see original TensorFlow repo) with open(transfo_xl_dataset_file, "rb") as fp: corpus = pickle.load(fp, encoding="latin1") # Save vocabulary and dataset cache as Dictionaries (should be better than pickles for the long-term) pytorch_vocab_dump_path = pytorch_dump_folder_path + '/' + VOCAB_FILES_NAMES['pretrained_vocab_file'] print("Save vocabulary to {}".format(pytorch_vocab_dump_path)) corpus_vocab_dict = corpus.vocab.__dict__ torch.save(corpus_vocab_dict, pytorch_vocab_dump_path) corpus_dict_no_vocab = corpus.__dict__ corpus_dict_no_vocab.pop('vocab', None) pytorch_dataset_dump_path = pytorch_dump_folder_path + '/' + CORPUS_NAME print("Save dataset to {}".format(pytorch_dataset_dump_path)) torch.save(corpus_dict_no_vocab, pytorch_dataset_dump_path) if tf_checkpoint_path: # Convert a pre-trained TensorFlow model config_path = os.path.abspath(transfo_xl_config_file) tf_path = os.path.abspath(tf_checkpoint_path) print("Converting Transformer XL checkpoint from {} with config at {}".format(tf_path, config_path)) # Initialise PyTorch model if transfo_xl_config_file == "": config = TransfoXLConfig() else: config = TransfoXLConfig.from_json_file(transfo_xl_config_file) print("Building PyTorch model from configuration: {}".format(str(config))) model = TransfoXLLMHeadModel(config) model = load_tf_weights_in_transfo_xl(model, config, tf_path) # Save pytorch-model pytorch_weights_dump_path = os.path.join(pytorch_dump_folder_path, WEIGHTS_NAME) pytorch_config_dump_path = os.path.join(pytorch_dump_folder_path, CONFIG_NAME) print("Save PyTorch model to {}".format(os.path.abspath(pytorch_weights_dump_path))) torch.save(model.state_dict(), pytorch_weights_dump_path) print("Save configuration file to {}".format(os.path.abspath(pytorch_config_dump_path))) with open(pytorch_config_dump_path, "w", encoding="utf-8") as f: f.write(config.to_json_string()) if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the folder to store the PyTorch model or dataset/vocab.") parser.add_argument("--tf_checkpoint_path", default = "", type = str, help = "An optional path to a TensorFlow checkpoint path to be converted.") parser.add_argument("--transfo_xl_config_file", default = "", type = str, help = "An optional config json file corresponding to the pre-trained BERT model. \n" "This specifies the model architecture.") parser.add_argument("--transfo_xl_dataset_file", default = "", type = str, help = "An optional dataset file to be converted in a vocabulary.") args = parser.parse_args() convert_transfo_xl_checkpoint_to_pytorch(args.tf_checkpoint_path, args.transfo_xl_config_file, args.pytorch_dump_folder_path, args.transfo_xl_dataset_file)
5,550
46.042373
121
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tokenization_distilbert.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tokenization classes for DistilBERT.""" from __future__ import absolute_import, division, print_function, unicode_literals import collections import logging import os import unicodedata from io import open from .tokenization_bert import BertTokenizer logger = logging.getLogger(__name__) VOCAB_FILES_NAMES = {'vocab_file': 'vocab.txt'} PRETRAINED_VOCAB_FILES_MAP = { 'vocab_file': { 'distilbert-base-uncased': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-base-uncased-vocab.txt", 'distilbert-base-uncased-distilled-squad': "https://s3.amazonaws.com/models.huggingface.co/bert/bert-large-uncased-vocab.txt", } } PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES = { 'distilbert-base-uncased': 512, 'distilbert-base-uncased-distilled-squad': 512, } class DistilBertTokenizer(BertTokenizer): r""" Constructs a DistilBertTokenizer. :class:`~pytorch_transformers.DistilBertTokenizer` is identical to BertTokenizer and runs end-to-end tokenization: punctuation splitting + wordpiece Args: vocab_file: Path to a one-wordpiece-per-line vocabulary file do_lower_case: Whether to lower case the input. Only has an effect when do_wordpiece_only=False do_basic_tokenize: Whether to do basic tokenization before wordpiece. max_len: An artificial maximum length to truncate tokenized sequences to; Effective maximum length is always the minimum of this value (if specified) and the underlying BERT model's sequence length. never_split: List of tokens which will never be split during tokenization. Only has an effect when do_wordpiece_only=False """ vocab_files_names = VOCAB_FILES_NAMES pretrained_vocab_files_map = PRETRAINED_VOCAB_FILES_MAP max_model_input_sizes = PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES
2,446
37.84127
152
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_roberta_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert RoBERTa checkpoint.""" from __future__ import absolute_import, division, print_function import argparse import logging import numpy as np import torch from fairseq.models.roberta import RobertaModel as FairseqRobertaModel from fairseq.modules import TransformerSentenceEncoderLayer from pytorch_transformers import (BertConfig, BertEncoder, BertIntermediate, BertLayer, BertModel, BertOutput, BertSelfAttention, BertSelfOutput) from pytorch_transformers import (RobertaEmbeddings, RobertaForMaskedLM, RobertaForSequenceClassification, RobertaModel) logging.basicConfig(level=logging.INFO) logger = logging.getLogger(__name__) SAMPLE_TEXT = 'Hello world! cécé herlolip' def convert_roberta_checkpoint_to_pytorch(roberta_checkpoint_path, pytorch_dump_folder_path, classification_head): """ Copy/paste/tweak roberta's weights to our BERT structure. """ roberta = FairseqRobertaModel.from_pretrained(roberta_checkpoint_path) roberta.eval() # disable dropout config = BertConfig( vocab_size_or_config_json_file=50265, hidden_size=roberta.args.encoder_embed_dim, num_hidden_layers=roberta.args.encoder_layers, num_attention_heads=roberta.args.encoder_attention_heads, intermediate_size=roberta.args.encoder_ffn_embed_dim, max_position_embeddings=514, type_vocab_size=1, layer_norm_eps=1e-5, # PyTorch default used in fairseq ) if classification_head: config.num_labels = roberta.args.num_classes print("Our BERT config:", config) model = RobertaForSequenceClassification(config) if classification_head else RobertaForMaskedLM(config) model.eval() # Now let's copy all the weights. # Embeddings roberta_sent_encoder = roberta.model.decoder.sentence_encoder model.roberta.embeddings.word_embeddings.weight = roberta_sent_encoder.embed_tokens.weight model.roberta.embeddings.position_embeddings.weight = roberta_sent_encoder.embed_positions.weight model.roberta.embeddings.token_type_embeddings.weight.data = torch.zeros_like(model.roberta.embeddings.token_type_embeddings.weight) # just zero them out b/c RoBERTa doesn't use them. model.roberta.embeddings.LayerNorm.weight = roberta_sent_encoder.emb_layer_norm.weight model.roberta.embeddings.LayerNorm.bias = roberta_sent_encoder.emb_layer_norm.bias for i in range(config.num_hidden_layers): # Encoder: start of layer layer: BertLayer = model.roberta.encoder.layer[i] roberta_layer: TransformerSentenceEncoderLayer = roberta_sent_encoder.layers[i] ### self attention self_attn: BertSelfAttention = layer.attention.self assert( roberta_layer.self_attn.in_proj_weight.shape == torch.Size((3 * config.hidden_size, config.hidden_size)) ) # we use three distinct linear layers so we split the source layer here. self_attn.query.weight.data = roberta_layer.self_attn.in_proj_weight[:config.hidden_size, :] self_attn.query.bias.data = roberta_layer.self_attn.in_proj_bias[:config.hidden_size] self_attn.key.weight.data = roberta_layer.self_attn.in_proj_weight[config.hidden_size:2*config.hidden_size, :] self_attn.key.bias.data = roberta_layer.self_attn.in_proj_bias[config.hidden_size:2*config.hidden_size] self_attn.value.weight.data = roberta_layer.self_attn.in_proj_weight[2*config.hidden_size:, :] self_attn.value.bias.data = roberta_layer.self_attn.in_proj_bias[2*config.hidden_size:] ### self-attention output self_output: BertSelfOutput = layer.attention.output assert( self_output.dense.weight.shape == roberta_layer.self_attn.out_proj.weight.shape ) self_output.dense.weight = roberta_layer.self_attn.out_proj.weight self_output.dense.bias = roberta_layer.self_attn.out_proj.bias self_output.LayerNorm.weight = roberta_layer.self_attn_layer_norm.weight self_output.LayerNorm.bias = roberta_layer.self_attn_layer_norm.bias ### intermediate intermediate: BertIntermediate = layer.intermediate assert( intermediate.dense.weight.shape == roberta_layer.fc1.weight.shape ) intermediate.dense.weight = roberta_layer.fc1.weight intermediate.dense.bias = roberta_layer.fc1.bias ### output bert_output: BertOutput = layer.output assert( bert_output.dense.weight.shape == roberta_layer.fc2.weight.shape ) bert_output.dense.weight = roberta_layer.fc2.weight bert_output.dense.bias = roberta_layer.fc2.bias bert_output.LayerNorm.weight = roberta_layer.final_layer_norm.weight bert_output.LayerNorm.bias = roberta_layer.final_layer_norm.bias #### end of layer if classification_head: model.classifier.dense.weight = roberta.model.classification_heads['mnli'].dense.weight model.classifier.dense.bias = roberta.model.classification_heads['mnli'].dense.bias model.classifier.out_proj.weight = roberta.model.classification_heads['mnli'].out_proj.weight model.classifier.out_proj.bias = roberta.model.classification_heads['mnli'].out_proj.bias else: # LM Head model.lm_head.dense.weight = roberta.model.decoder.lm_head.dense.weight model.lm_head.dense.bias = roberta.model.decoder.lm_head.dense.bias model.lm_head.layer_norm.weight = roberta.model.decoder.lm_head.layer_norm.weight model.lm_head.layer_norm.bias = roberta.model.decoder.lm_head.layer_norm.bias model.lm_head.decoder.weight = roberta.model.decoder.lm_head.weight model.lm_head.bias = roberta.model.decoder.lm_head.bias # Let's check that we get the same results. input_ids: torch.Tensor = roberta.encode(SAMPLE_TEXT).unsqueeze(0) # batch of size 1 our_output = model(input_ids)[0] if classification_head: their_output = roberta.model.classification_heads['mnli'](roberta.extract_features(input_ids)) else: their_output = roberta.model(input_ids)[0] print(our_output.shape, their_output.shape) max_absolute_diff = torch.max(torch.abs(our_output - their_output)).item() print(f"max_absolute_diff = {max_absolute_diff}") # ~ 1e-7 success = torch.allclose(our_output, their_output, atol=1e-3) print( "Do both models output the same tensors?", "🔥" if success else "💩" ) if not success: raise Exception("Something went wRoNg") print(f"Saving model to {pytorch_dump_folder_path}") model.save_pretrained(pytorch_dump_folder_path) if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--roberta_checkpoint_path", default = None, type = str, required = True, help = "Path the official PyTorch dump.") parser.add_argument("--pytorch_dump_folder_path", default = None, type = str, required = True, help = "Path to the output PyTorch model.") parser.add_argument("--classification_head", action = "store_true", help = "Whether to convert a final classification head.") args = parser.parse_args() convert_roberta_checkpoint_to_pytorch( args.roberta_checkpoint_path, args.pytorch_dump_folder_path, args.classification_head )
8,527
46.116022
188
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/file_utils.py
""" Utilities for working with the local dataset cache. This file is adapted from the AllenNLP library at https://github.com/allenai/allennlp Copyright by the AllenNLP authors. """ from __future__ import (absolute_import, division, print_function, unicode_literals) import sys import json import logging import os import six import shutil import tempfile import fnmatch from functools import wraps from hashlib import sha256 from io import open import boto3 from botocore.config import Config from botocore.exceptions import ClientError import requests from tqdm import tqdm try: from torch.hub import _get_torch_home torch_cache_home = _get_torch_home() except ImportError: torch_cache_home = os.path.expanduser( os.getenv('TORCH_HOME', os.path.join( os.getenv('XDG_CACHE_HOME', '~/.cache'), 'torch'))) default_cache_path = os.path.join(torch_cache_home, 'pytorch_transformers') try: from urllib.parse import urlparse except ImportError: from urlparse import urlparse try: from pathlib import Path PYTORCH_PRETRAINED_BERT_CACHE = Path( os.getenv('PYTORCH_TRANSFORMERS_CACHE', os.getenv('PYTORCH_PRETRAINED_BERT_CACHE', default_cache_path))) except (AttributeError, ImportError): PYTORCH_PRETRAINED_BERT_CACHE = os.getenv('PYTORCH_TRANSFORMERS_CACHE', os.getenv('PYTORCH_PRETRAINED_BERT_CACHE', default_cache_path)) PYTORCH_TRANSFORMERS_CACHE = PYTORCH_PRETRAINED_BERT_CACHE # Kept for backward compatibility WEIGHTS_NAME = "pytorch_model.bin" TF_WEIGHTS_NAME = 'model.ckpt' CONFIG_NAME = "config.json" logger = logging.getLogger(__name__) # pylint: disable=invalid-name if not six.PY2: def add_start_docstrings(*docstr): def docstring_decorator(fn): fn.__doc__ = ''.join(docstr) + fn.__doc__ return fn return docstring_decorator def add_end_docstrings(*docstr): def docstring_decorator(fn): fn.__doc__ = fn.__doc__ + ''.join(docstr) return fn return docstring_decorator else: # Not possible to update class docstrings on python2 def add_start_docstrings(*docstr): def docstring_decorator(fn): return fn return docstring_decorator def add_end_docstrings(*docstr): def docstring_decorator(fn): return fn return docstring_decorator def url_to_filename(url, etag=None): """ Convert `url` into a hashed filename in a repeatable way. If `etag` is specified, append its hash to the url's, delimited by a period. """ url_bytes = url.encode('utf-8') url_hash = sha256(url_bytes) filename = url_hash.hexdigest() if etag: etag_bytes = etag.encode('utf-8') etag_hash = sha256(etag_bytes) filename += '.' + etag_hash.hexdigest() return filename def filename_to_url(filename, cache_dir=None): """ Return the url and etag (which may be ``None``) stored for `filename`. Raise ``EnvironmentError`` if `filename` or its stored metadata do not exist. """ if cache_dir is None: cache_dir = PYTORCH_TRANSFORMERS_CACHE if sys.version_info[0] == 3 and isinstance(cache_dir, Path): cache_dir = str(cache_dir) cache_path = os.path.join(cache_dir, filename) if not os.path.exists(cache_path): raise EnvironmentError("file {} not found".format(cache_path)) meta_path = cache_path + '.json' if not os.path.exists(meta_path): raise EnvironmentError("file {} not found".format(meta_path)) with open(meta_path, encoding="utf-8") as meta_file: metadata = json.load(meta_file) url = metadata['url'] etag = metadata['etag'] return url, etag def cached_path(url_or_filename, cache_dir=None, force_download=False, proxies=None): """ Given something that might be a URL (or might be a local path), determine which. If it's a URL, download the file and cache it, and return the path to the cached file. If it's already a local path, make sure the file exists and then return the path. Args: cache_dir: specify a cache directory to save the file to (overwrite the default cache dir). force_download: if True, re-dowload the file even if it's already cached in the cache dir. """ if cache_dir is None: cache_dir = PYTORCH_TRANSFORMERS_CACHE if sys.version_info[0] == 3 and isinstance(url_or_filename, Path): url_or_filename = str(url_or_filename) if sys.version_info[0] == 3 and isinstance(cache_dir, Path): cache_dir = str(cache_dir) parsed = urlparse(url_or_filename) if parsed.scheme in ('http', 'https', 's3'): # URL, so get it from the cache (downloading if necessary) return get_from_cache(url_or_filename, cache_dir=cache_dir, force_download=force_download, proxies=proxies) elif os.path.exists(url_or_filename): # File, and it exists. return url_or_filename elif parsed.scheme == '': # File, but it doesn't exist. raise EnvironmentError("file {} not found".format(url_or_filename)) else: # Something unknown raise ValueError("unable to parse {} as a URL or as a local path".format(url_or_filename)) def split_s3_path(url): """Split a full s3 path into the bucket name and path.""" parsed = urlparse(url) if not parsed.netloc or not parsed.path: raise ValueError("bad s3 path {}".format(url)) bucket_name = parsed.netloc s3_path = parsed.path # Remove '/' at beginning of path. if s3_path.startswith("/"): s3_path = s3_path[1:] return bucket_name, s3_path def s3_request(func): """ Wrapper function for s3 requests in order to create more helpful error messages. """ @wraps(func) def wrapper(url, *args, **kwargs): try: return func(url, *args, **kwargs) except ClientError as exc: if int(exc.response["Error"]["Code"]) == 404: raise EnvironmentError("file {} not found".format(url)) else: raise return wrapper @s3_request def s3_etag(url, proxies=None): """Check ETag on S3 object.""" s3_resource = boto3.resource("s3", config=Config(proxies=proxies)) bucket_name, s3_path = split_s3_path(url) s3_object = s3_resource.Object(bucket_name, s3_path) return s3_object.e_tag @s3_request def s3_get(url, temp_file, proxies=None): """Pull a file directly from S3.""" s3_resource = boto3.resource("s3", config=Config(proxies=proxies)) bucket_name, s3_path = split_s3_path(url) s3_resource.Bucket(bucket_name).download_fileobj(s3_path, temp_file) def http_get(url, temp_file, proxies=None): req = requests.get(url, stream=True, proxies=proxies) content_length = req.headers.get('Content-Length') total = int(content_length) if content_length is not None else None progress = tqdm(unit="B", total=total) for chunk in req.iter_content(chunk_size=1024): if chunk: # filter out keep-alive new chunks progress.update(len(chunk)) temp_file.write(chunk) progress.close() def get_from_cache(url, cache_dir=None, force_download=False, proxies=None): """ Given a URL, look for the corresponding dataset in the local cache. If it's not there, download it. Then return the path to the cached file. """ if cache_dir is None: cache_dir = PYTORCH_TRANSFORMERS_CACHE if sys.version_info[0] == 3 and isinstance(cache_dir, Path): cache_dir = str(cache_dir) if sys.version_info[0] == 2 and not isinstance(cache_dir, str): cache_dir = str(cache_dir) if not os.path.exists(cache_dir): os.makedirs(cache_dir) # Get eTag to add to filename, if it exists. if url.startswith("s3://"): etag = s3_etag(url, proxies=proxies) else: try: response = requests.head(url, allow_redirects=True, proxies=proxies) if response.status_code != 200: etag = None else: etag = response.headers.get("ETag") except EnvironmentError: etag = None if sys.version_info[0] == 2 and etag is not None: etag = etag.decode('utf-8') filename = url_to_filename(url, etag) # get cache path to put the file cache_path = os.path.join(cache_dir, filename) # If we don't have a connection (etag is None) and can't identify the file # try to get the last downloaded one if not os.path.exists(cache_path) and etag is None: matching_files = fnmatch.filter(os.listdir(cache_dir), filename + '.*') matching_files = list(filter(lambda s: not s.endswith('.json'), matching_files)) if matching_files: cache_path = os.path.join(cache_dir, matching_files[-1]) if not os.path.exists(cache_path) or force_download: # Download to temporary file, then copy to cache dir once finished. # Otherwise you get corrupt cache entries if the download gets interrupted. with tempfile.NamedTemporaryFile() as temp_file: logger.info("%s not found in cache or force_download set to True, downloading to %s", url, temp_file.name) # GET file object if url.startswith("s3://"): s3_get(url, temp_file, proxies=proxies) else: http_get(url, temp_file, proxies=proxies) # we are copying the file before closing it, so flush to avoid truncation temp_file.flush() # shutil.copyfileobj() starts at the current position, so go to the start temp_file.seek(0) logger.info("copying %s to cache at %s", temp_file.name, cache_path) with open(cache_path, 'wb') as cache_file: shutil.copyfileobj(temp_file, cache_file) logger.info("creating metadata file for %s", cache_path) meta = {'url': url, 'etag': etag} meta_path = cache_path + '.json' with open(meta_path, 'w') as meta_file: output_string = json.dumps(meta) if sys.version_info[0] == 2 and isinstance(output_string, str): output_string = unicode(output_string, 'utf-8') # The beauty of python 2 meta_file.write(output_string) logger.info("removing temp file %s", temp_file.name) return cache_path
10,536
34.718644
118
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_tf_checkpoint_to_pytorch.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert BERT checkpoint.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import argparse import torch from pytorch_transformers import BertConfig, BertForPreTraining, load_tf_weights_in_bert import logging logging.basicConfig(level=logging.INFO) def convert_tf_checkpoint_to_pytorch(tf_checkpoint_path, bert_config_file, pytorch_dump_path): # Initialise PyTorch model config = BertConfig.from_json_file(bert_config_file) print("Building PyTorch model from configuration: {}".format(str(config))) model = BertForPreTraining(config) # Load weights from tf checkpoint load_tf_weights_in_bert(model, config, tf_checkpoint_path) # Save pytorch-model print("Save PyTorch model to {}".format(pytorch_dump_path)) torch.save(model.state_dict(), pytorch_dump_path) if __name__ == "__main__": parser = argparse.ArgumentParser() ## Required parameters parser.add_argument("--tf_checkpoint_path", default = None, type = str, required = True, help = "Path to the TensorFlow checkpoint path.") parser.add_argument("--bert_config_file", default = None, type = str, required = True, help = "The config json file corresponding to the pre-trained BERT model. \n" "This specifies the model architecture.") parser.add_argument("--pytorch_dump_path", default = None, type = str, required = True, help = "Path to the output PyTorch model.") args = parser.parse_args() convert_tf_checkpoint_to_pytorch(args.tf_checkpoint_path, args.bert_config_file, args.pytorch_dump_path)
2,585
38.181818
101
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_transfo_xl.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ PyTorch Transformer XL model. Adapted from https://github.com/kimiyoung/transformer-xl. In particular https://github.com/kimiyoung/transformer-xl/blob/master/pytorch/mem_transformer.py """ from __future__ import absolute_import, division, print_function, unicode_literals import os import json import math import logging import collections import sys from io import open import torch import torch.nn as nn import torch.nn.functional as F from torch.nn import CrossEntropyLoss from torch.nn.parameter import Parameter from .modeling_utils import PreTrainedModel, Conv1D, prune_conv1d_layer, SequenceSummary from .configuration_transfo_xl import TransfoXLConfig from .modeling_transfo_xl_utilities import ProjectedAdaptiveLogSoftmax, sample_logits from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) TRANSFO_XL_PRETRAINED_MODEL_ARCHIVE_MAP = { 'transfo-xl-wt103': "https://s3.amazonaws.com/models.huggingface.co/bert/transfo-xl-wt103-pytorch_model.bin", } def build_tf_to_pytorch_map(model, config): """ A map of modules from TF to PyTorch. This time I use a map to keep the PyTorch model as identical to the original PyTorch model as possible. """ tf_to_pt_map = {} if hasattr(model, 'transformer'): # We are loading in a TransfoXLLMHeadModel => we will load also the Adaptive Softmax tf_to_pt_map.update({ "transformer/adaptive_softmax/cutoff_0/cluster_W": model.crit.cluster_weight, "transformer/adaptive_softmax/cutoff_0/cluster_b": model.crit.cluster_bias}) for i, (out_l, proj_l, tie_proj) in enumerate(zip( model.crit.out_layers, model.crit.out_projs, config.tie_projs)): layer_str = "transformer/adaptive_softmax/cutoff_%d/" % i if config.tie_weight: tf_to_pt_map.update({ layer_str + 'b': out_l.bias}) else: raise NotImplementedError # I don't think this is implemented in the TF code tf_to_pt_map.update({ layer_str + 'lookup_table': out_l.weight, layer_str + 'b': out_l.bias}) if not tie_proj: tf_to_pt_map.update({ layer_str + 'proj': proj_l }) # Now load the rest of the transformer model = model.transformer # Embeddings for i, (embed_l, proj_l) in enumerate(zip(model.word_emb.emb_layers, model.word_emb.emb_projs)): layer_str = "transformer/adaptive_embed/cutoff_%d/" % i tf_to_pt_map.update({ layer_str + 'lookup_table': embed_l.weight, layer_str + 'proj_W': proj_l }) # Transformer blocks for i, b in enumerate(model.layers): layer_str = "transformer/layer_%d/" % i tf_to_pt_map.update({ layer_str + "rel_attn/LayerNorm/gamma": b.dec_attn.layer_norm.weight, layer_str + "rel_attn/LayerNorm/beta": b.dec_attn.layer_norm.bias, layer_str + "rel_attn/o/kernel": b.dec_attn.o_net.weight, layer_str + "rel_attn/qkv/kernel": b.dec_attn.qkv_net.weight, layer_str + "rel_attn/r/kernel": b.dec_attn.r_net.weight, layer_str + "ff/LayerNorm/gamma": b.pos_ff.layer_norm.weight, layer_str + "ff/LayerNorm/beta": b.pos_ff.layer_norm.bias, layer_str + "ff/layer_1/kernel": b.pos_ff.CoreNet[0].weight, layer_str + "ff/layer_1/bias": b.pos_ff.CoreNet[0].bias, layer_str + "ff/layer_2/kernel": b.pos_ff.CoreNet[3].weight, layer_str + "ff/layer_2/bias": b.pos_ff.CoreNet[3].bias, }) # Relative positioning biases if config.untie_r: r_r_list = [] r_w_list = [] for b in model.layers: r_r_list.append(b.dec_attn.r_r_bias) r_w_list.append(b.dec_attn.r_w_bias) else: r_r_list = [model.r_r_bias] r_w_list = [model.r_w_bias] tf_to_pt_map.update({ 'transformer/r_r_bias': r_r_list, 'transformer/r_w_bias': r_w_list}) return tf_to_pt_map def load_tf_weights_in_transfo_xl(model, config, tf_path): """ Load tf checkpoints in a pytorch model """ try: import numpy as np import tensorflow as tf except ImportError: logger.error("Loading a TensorFlow models in PyTorch, requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise # Build TF to PyTorch weights loading map tf_to_pt_map = build_tf_to_pytorch_map(model, config) # Load weights from TF model init_vars = tf.train.list_variables(tf_path) tf_weights = {} for name, shape in init_vars: logger.info("Loading TF weight {} with shape {}".format(name, shape)) array = tf.train.load_variable(tf_path, name) tf_weights[name] = array for name, pointer in tf_to_pt_map.items(): assert name in tf_weights array = tf_weights[name] # adam_v and adam_m are variables used in AdamWeightDecayOptimizer to calculated m and v # which are not required for using pretrained model if 'kernel' in name or 'proj' in name: array = np.transpose(array) if ('r_r_bias' in name or 'r_w_bias' in name) and len(pointer) > 1: # Here we will split the TF weigths assert len(pointer) == array.shape[0] for i, p_i in enumerate(pointer): arr_i = array[i, ...] try: assert p_i.shape == arr_i.shape except AssertionError as e: e.args += (p_i.shape, arr_i.shape) raise logger.info("Initialize PyTorch weight {} for layer {}".format(name, i)) p_i.data = torch.from_numpy(arr_i) else: try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise logger.info("Initialize PyTorch weight {}".format(name)) pointer.data = torch.from_numpy(array) tf_weights.pop(name, None) tf_weights.pop(name + '/Adam', None) tf_weights.pop(name + '/Adam_1', None) logger.info("Weights not copied to PyTorch model: {}".format(', '.join(tf_weights.keys()))) return model class PositionalEmbedding(nn.Module): def __init__(self, demb): super(PositionalEmbedding, self).__init__() self.demb = demb inv_freq = 1 / (10000 ** (torch.arange(0.0, demb, 2.0) / demb)) self.register_buffer('inv_freq', inv_freq) def forward(self, pos_seq, bsz=None): sinusoid_inp = torch.ger(pos_seq, self.inv_freq) pos_emb = torch.cat([sinusoid_inp.sin(), sinusoid_inp.cos()], dim=-1) if bsz is not None: return pos_emb[:,None,:].expand(-1, bsz, -1) else: return pos_emb[:,None,:] class PositionwiseFF(nn.Module): def __init__(self, d_model, d_inner, dropout, pre_lnorm=False): super(PositionwiseFF, self).__init__() self.d_model = d_model self.d_inner = d_inner self.dropout = dropout self.CoreNet = nn.Sequential( nn.Linear(d_model, d_inner), nn.ReLU(inplace=True), nn.Dropout(dropout), nn.Linear(d_inner, d_model), nn.Dropout(dropout), ) self.layer_norm = nn.LayerNorm(d_model) self.pre_lnorm = pre_lnorm def forward(self, inp): if self.pre_lnorm: ##### layer normalization + positionwise feed-forward core_out = self.CoreNet(self.layer_norm(inp)) ##### residual connection output = core_out + inp else: ##### positionwise feed-forward core_out = self.CoreNet(inp) ##### residual connection + layer normalization output = self.layer_norm(inp + core_out) return output class MultiHeadAttn(nn.Module): def __init__(self, n_head, d_model, d_head, dropout, dropatt=0, pre_lnorm=False, r_r_bias=None, r_w_bias=None, output_attentions=False): super(MultiHeadAttn, self).__init__() self.output_attentions = output_attentions self.n_head = n_head self.d_model = d_model self.d_head = d_head self.dropout = dropout self.q_net = nn.Linear(d_model, n_head * d_head, bias=False) self.kv_net = nn.Linear(d_model, 2 * n_head * d_head, bias=False) self.drop = nn.Dropout(dropout) self.dropatt = nn.Dropout(dropatt) self.o_net = nn.Linear(n_head * d_head, d_model, bias=False) self.layer_norm = nn.LayerNorm(d_model) self.scale = 1 / (d_head ** 0.5) self.pre_lnorm = pre_lnorm if r_r_bias is None or r_w_bias is None: # Biases are not shared self.r_r_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.r_w_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) else: self.r_r_bias = r_r_bias self.r_w_bias = r_w_bias def forward(self, h, attn_mask=None, mems=None, head_mask=None): ##### multihead attention # [hlen x bsz x n_head x d_head] if mems is not None: c = torch.cat([mems, h], 0) else: c = h if self.pre_lnorm: ##### layer normalization c = self.layer_norm(c) head_q = self.q_net(h) head_k, head_v = torch.chunk(self.kv_net(c), 2, -1) head_q = head_q.view(h.size(0), h.size(1), self.n_head, self.d_head) head_k = head_k.view(c.size(0), c.size(1), self.n_head, self.d_head) head_v = head_v.view(c.size(0), c.size(1), self.n_head, self.d_head) # [qlen x klen x bsz x n_head] attn_score = torch.einsum('ibnd,jbnd->ijbn', (head_q, head_k)) attn_score.mul_(self.scale) if attn_mask is not None and torch.sum(attn_mask).item(): attn_mask = (attn_mask == 1) # Switch to bool if attn_mask.dim() == 2: attn_score.masked_fill_(attn_mask[None,:,:,None], -float('inf')) elif attn_mask.dim() == 3: attn_score.masked_fill_(attn_mask[:,:,:,None], -float('inf')) # [qlen x klen x bsz x n_head] attn_prob = F.softmax(attn_score, dim=1) attn_prob = self.dropatt(attn_prob) # Mask heads if we want to if head_mask is not None: attn_prob = attn_prob * head_mask # [qlen x klen x bsz x n_head] + [klen x bsz x n_head x d_head] -> [qlen x bsz x n_head x d_head] attn_vec = torch.einsum('ijbn,jbnd->ibnd', (attn_prob, head_v)) attn_vec = attn_vec.contiguous().view( attn_vec.size(0), attn_vec.size(1), self.n_head * self.d_head) ##### linear projection attn_out = self.o_net(attn_vec) attn_out = self.drop(attn_out) if self.pre_lnorm: ##### residual connection outputs = [h + attn_out] else: ##### residual connection + layer normalization outputs = [self.layer_norm(h + attn_out)] if self.output_attentions: outputs.append(attn_prob) return outputs class RelMultiHeadAttn(nn.Module): def __init__(self, n_head, d_model, d_head, dropout, dropatt=0, tgt_len=None, ext_len=None, mem_len=None, pre_lnorm=False, r_r_bias=None, r_w_bias=None, output_attentions=False): super(RelMultiHeadAttn, self).__init__() self.output_attentions = output_attentions self.n_head = n_head self.d_model = d_model self.d_head = d_head self.dropout = dropout self.qkv_net = nn.Linear(d_model, 3 * n_head * d_head, bias=False) self.drop = nn.Dropout(dropout) self.dropatt = nn.Dropout(dropatt) self.o_net = nn.Linear(n_head * d_head, d_model, bias=False) self.layer_norm = nn.LayerNorm(d_model) self.scale = 1 / (d_head ** 0.5) self.pre_lnorm = pre_lnorm if r_r_bias is None or r_w_bias is None: # Biases are not shared self.r_r_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.r_w_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) else: self.r_r_bias = r_r_bias self.r_w_bias = r_w_bias def _parallelogram_mask(self, h, w, left=False): mask = torch.ones((h, w)).byte() m = min(h, w) mask[:m,:m] = torch.triu(mask[:m,:m]) mask[-m:,-m:] = torch.tril(mask[-m:,-m:]) if left: return mask else: return mask.flip(0) def _shift(self, x, qlen, klen, mask, left=False): if qlen > 1: zero_pad = torch.zeros((x.size(0), qlen-1, x.size(2), x.size(3)), device=x.device, dtype=x.dtype) else: zero_pad = torch.zeros(0, device=x.device, dtype=x.dtype) if left: mask = mask.flip(1) x_padded = torch.cat([zero_pad, x], dim=1).expand(qlen, -1, -1, -1) else: x_padded = torch.cat([x, zero_pad], dim=1).expand(qlen, -1, -1, -1) x = x_padded.masked_select(mask[:,:,None,None]) \ .view(qlen, klen, x.size(2), x.size(3)) return x def _rel_shift(self, x, zero_triu=False): zero_pad_shape = (x.size(0), 1) + x.size()[2:] zero_pad = torch.zeros(zero_pad_shape, device=x.device, dtype=x.dtype) x_padded = torch.cat([zero_pad, x], dim=1) x_padded_shape = (x.size(1) + 1, x.size(0)) + x.size()[2:] x_padded = x_padded.view(*x_padded_shape) x = x_padded[1:].view_as(x) if zero_triu: ones = torch.ones((x.size(0), x.size(1))) x = x * torch.tril(ones, x.size(1) - x.size(0))[:,:,None,None] return x def forward(self, w, r, attn_mask=None, mems=None): raise NotImplementedError class RelPartialLearnableMultiHeadAttn(RelMultiHeadAttn): def __init__(self, *args, **kwargs): super(RelPartialLearnableMultiHeadAttn, self).__init__(*args, **kwargs) self.r_net = nn.Linear(self.d_model, self.n_head * self.d_head, bias=False) def forward(self, w, r, attn_mask=None, mems=None, head_mask=None): qlen, rlen, bsz = w.size(0), r.size(0), w.size(1) if mems is not None: cat = torch.cat([mems, w], 0) if self.pre_lnorm: w_heads = self.qkv_net(self.layer_norm(cat)) else: w_heads = self.qkv_net(cat) r_head_k = self.r_net(r) w_head_q, w_head_k, w_head_v = torch.chunk(w_heads, 3, dim=-1) w_head_q = w_head_q[-qlen:] else: if self.pre_lnorm: w_heads = self.qkv_net(self.layer_norm(w)) else: w_heads = self.qkv_net(w) r_head_k = self.r_net(r) w_head_q, w_head_k, w_head_v = torch.chunk(w_heads, 3, dim=-1) klen = w_head_k.size(0) w_head_q = w_head_q.view(qlen, bsz, self.n_head, self.d_head) # qlen x bsz x n_head x d_head w_head_k = w_head_k.view(klen, bsz, self.n_head, self.d_head) # qlen x bsz x n_head x d_head w_head_v = w_head_v.view(klen, bsz, self.n_head, self.d_head) # qlen x bsz x n_head x d_head r_head_k = r_head_k.view(rlen, self.n_head, self.d_head) # qlen x n_head x d_head #### compute attention score rw_head_q = w_head_q + self.r_w_bias # qlen x bsz x n_head x d_head AC = torch.einsum('ibnd,jbnd->ijbn', (rw_head_q, w_head_k)) # qlen x klen x bsz x n_head rr_head_q = w_head_q + self.r_r_bias BD = torch.einsum('ibnd,jnd->ijbn', (rr_head_q, r_head_k)) # qlen x klen x bsz x n_head BD = self._rel_shift(BD) # [qlen x klen x bsz x n_head] attn_score = AC + BD attn_score.mul_(self.scale) #### compute attention probability if attn_mask is not None and torch.sum(attn_mask).item(): attn_mask = (attn_mask == 1) # Switch to bool if attn_mask.dim() == 2: attn_score = attn_score.float().masked_fill( attn_mask[None,:,:,None], -1e30).type_as(attn_score) elif attn_mask.dim() == 3: attn_score = attn_score.float().masked_fill( attn_mask[:,:,:,None], -1e30).type_as(attn_score) # [qlen x klen x bsz x n_head] attn_prob = F.softmax(attn_score, dim=1) attn_prob = self.dropatt(attn_prob) # Mask heads if we want to if head_mask is not None: attn_prob = attn_prob * head_mask #### compute attention vector attn_vec = torch.einsum('ijbn,jbnd->ibnd', (attn_prob, w_head_v)) # [qlen x bsz x n_head x d_head] attn_vec = attn_vec.contiguous().view( attn_vec.size(0), attn_vec.size(1), self.n_head * self.d_head) ##### linear projection attn_out = self.o_net(attn_vec) attn_out = self.drop(attn_out) if self.pre_lnorm: ##### residual connection outputs = [w + attn_out] else: ##### residual connection + layer normalization outputs = [self.layer_norm(w + attn_out)] if self.output_attentions: outputs.append(attn_prob) return outputs class RelLearnableMultiHeadAttn(RelMultiHeadAttn): def __init__(self, *args, **kwargs): super(RelLearnableMultiHeadAttn, self).__init__(*args, **kwargs) def forward(self, w, r_emb, r_w_bias, r_bias, attn_mask=None, mems=None, head_mask=None): # r_emb: [klen, n_head, d_head], used for term B # r_w_bias: [n_head, d_head], used for term C # r_bias: [klen, n_head], used for term D qlen, bsz = w.size(0), w.size(1) if mems is not None: cat = torch.cat([mems, w], 0) if self.pre_lnorm: w_heads = self.qkv_net(self.layer_norm(cat)) else: w_heads = self.qkv_net(cat) w_head_q, w_head_k, w_head_v = torch.chunk(w_heads, 3, dim=-1) w_head_q = w_head_q[-qlen:] else: if self.pre_lnorm: w_heads = self.qkv_net(self.layer_norm(w)) else: w_heads = self.qkv_net(w) w_head_q, w_head_k, w_head_v = torch.chunk(w_heads, 3, dim=-1) klen = w_head_k.size(0) w_head_q = w_head_q.view(qlen, bsz, self.n_head, self.d_head) w_head_k = w_head_k.view(klen, bsz, self.n_head, self.d_head) w_head_v = w_head_v.view(klen, bsz, self.n_head, self.d_head) if klen > r_emb.size(0): r_emb_pad = r_emb[0:1].expand(klen-r_emb.size(0), -1, -1) r_emb = torch.cat([r_emb_pad, r_emb], 0) r_bias_pad = r_bias[0:1].expand(klen-r_bias.size(0), -1) r_bias = torch.cat([r_bias_pad, r_bias], 0) else: r_emb = r_emb[-klen:] r_bias = r_bias[-klen:] #### compute attention score rw_head_q = w_head_q + r_w_bias[None] # qlen x bsz x n_head x d_head AC = torch.einsum('ibnd,jbnd->ijbn', (rw_head_q, w_head_k)) # qlen x klen x bsz x n_head B_ = torch.einsum('ibnd,jnd->ijbn', (w_head_q, r_emb)) # qlen x klen x bsz x n_head D_ = r_bias[None, :, None] # 1 x klen x 1 x n_head BD = self._rel_shift(B_ + D_) # [qlen x klen x bsz x n_head] attn_score = AC + BD attn_score.mul_(self.scale) #### compute attention probability if attn_mask is not None and torch.sum(attn_mask).item(): attn_mask = (attn_mask == 1) # Switch to bool if attn_mask.dim() == 2: attn_score.masked_fill_(attn_mask[None,:,:,None], -float('inf')) elif attn_mask.dim() == 3: attn_score.masked_fill_(attn_mask[:,:,:,None], -float('inf')) # [qlen x klen x bsz x n_head] attn_prob = F.softmax(attn_score, dim=1) attn_prob = self.dropatt(attn_prob) if head_mask is not None: attn_prob = attn_prob * head_mask #### compute attention vector attn_vec = torch.einsum('ijbn,jbnd->ibnd', (attn_prob, w_head_v)) # [qlen x bsz x n_head x d_head] attn_vec = attn_vec.contiguous().view( attn_vec.size(0), attn_vec.size(1), self.n_head * self.d_head) ##### linear projection attn_out = self.o_net(attn_vec) attn_out = self.drop(attn_out) if self.pre_lnorm: ##### residual connection outputs = [w + attn_out] else: ##### residual connection + layer normalization outputs = [self.layer_norm(w + attn_out)] if self.output_attentions: outputs.append(attn_prob) return outputs class DecoderLayer(nn.Module): def __init__(self, n_head, d_model, d_head, d_inner, dropout, **kwargs): super(DecoderLayer, self).__init__() self.dec_attn = MultiHeadAttn(n_head, d_model, d_head, dropout, **kwargs) self.pos_ff = PositionwiseFF(d_model, d_inner, dropout, pre_lnorm=kwargs.get('pre_lnorm')) def forward(self, dec_inp, dec_attn_mask=None, mems=None, head_mask=None): attn_outputs = self.dec_attn(dec_inp, attn_mask=dec_attn_mask, mems=mems, head_mask=head_mask) ff_output = self.pos_ff(attn_outputs[0]) outputs = [ff_output] + attn_outputs[1:] return outputs class RelLearnableDecoderLayer(nn.Module): def __init__(self, n_head, d_model, d_head, d_inner, dropout, **kwargs): super(RelLearnableDecoderLayer, self).__init__() self.dec_attn = RelLearnableMultiHeadAttn(n_head, d_model, d_head, dropout, **kwargs) self.pos_ff = PositionwiseFF(d_model, d_inner, dropout, pre_lnorm=kwargs.get('pre_lnorm')) def forward(self, dec_inp, r_emb, r_w_bias, r_bias, dec_attn_mask=None, mems=None, head_mask=None): attn_outputs = self.dec_attn(dec_inp, r_emb, r_w_bias, r_bias, attn_mask=dec_attn_mask, mems=mems, head_mask=head_mask) ff_output = self.pos_ff(attn_outputs[0]) outputs = [ff_output] + attn_outputs[1:] return outputs class RelPartialLearnableDecoderLayer(nn.Module): def __init__(self, n_head, d_model, d_head, d_inner, dropout, **kwargs): super(RelPartialLearnableDecoderLayer, self).__init__() self.dec_attn = RelPartialLearnableMultiHeadAttn(n_head, d_model, d_head, dropout, **kwargs) self.pos_ff = PositionwiseFF(d_model, d_inner, dropout, pre_lnorm=kwargs.get('pre_lnorm')) def forward(self, dec_inp, r, dec_attn_mask=None, mems=None, head_mask=None): attn_outputs = self.dec_attn(dec_inp, r, attn_mask=dec_attn_mask, mems=mems, head_mask=head_mask) ff_output = self.pos_ff(attn_outputs[0]) outputs = [ff_output] + attn_outputs[1:] return outputs class AdaptiveEmbedding(nn.Module): def __init__(self, n_token, d_embed, d_proj, cutoffs, div_val=1, sample_softmax=False): super(AdaptiveEmbedding, self).__init__() self.n_token = n_token self.d_embed = d_embed self.cutoffs = cutoffs + [n_token] self.div_val = div_val self.d_proj = d_proj self.emb_scale = d_proj ** 0.5 self.cutoff_ends = [0] + self.cutoffs self.emb_layers = nn.ModuleList() self.emb_projs = nn.ParameterList() if div_val == 1: self.emb_layers.append( nn.Embedding(n_token, d_embed, sparse=sample_softmax>0) ) if d_proj != d_embed: self.emb_projs.append(nn.Parameter(torch.FloatTensor(d_proj, d_embed))) else: for i in range(len(self.cutoffs)): l_idx, r_idx = self.cutoff_ends[i], self.cutoff_ends[i+1] d_emb_i = d_embed // (div_val ** i) self.emb_layers.append(nn.Embedding(r_idx-l_idx, d_emb_i)) self.emb_projs.append(nn.Parameter(torch.FloatTensor(d_proj, d_emb_i))) def forward(self, inp): if self.div_val == 1: embed = self.emb_layers[0](inp) if self.d_proj != self.d_embed: embed = F.linear(embed, self.emb_projs[0]) else: param = next(self.parameters()) inp_flat = inp.view(-1) emb_flat = torch.zeros([inp_flat.size(0), self.d_proj], dtype=param.dtype, device=param.device) for i in range(len(self.cutoffs)): l_idx, r_idx = self.cutoff_ends[i], self.cutoff_ends[i + 1] mask_i = (inp_flat >= l_idx) & (inp_flat < r_idx) indices_i = mask_i.nonzero().squeeze() if indices_i.numel() == 0: continue inp_i = inp_flat.index_select(0, indices_i) - l_idx emb_i = self.emb_layers[i](inp_i) emb_i = F.linear(emb_i, self.emb_projs[i]) emb_flat.index_copy_(0, indices_i, emb_i) embed_shape = inp.size() + (self.d_proj,) embed = emb_flat.view(embed_shape) embed.mul_(self.emb_scale) return embed class TransfoXLPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = TransfoXLConfig pretrained_model_archive_map = TRANSFO_XL_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = load_tf_weights_in_transfo_xl base_model_prefix = "transformer" def _init_weight(self, weight): if self.config.init == 'uniform': nn.init.uniform_(weight, -self.config.init_range, self.config.init_range) elif self.config.init == 'normal': nn.init.normal_(weight, 0.0, self.config.init_std) def _init_bias(self, bias): nn.init.constant_(bias, 0.0) def _init_weights(self, m): """ Initialize the weights. """ classname = m.__class__.__name__ if classname.find('Linear') != -1: if hasattr(m, 'weight') and m.weight is not None: self._init_weight(m.weight) if hasattr(m, 'bias') and m.bias is not None: self._init_bias(m.bias) elif classname.find('AdaptiveEmbedding') != -1: if hasattr(m, 'emb_projs'): for i in range(len(m.emb_projs)): if m.emb_projs[i] is not None: nn.init.normal_(m.emb_projs[i], 0.0, self.config.proj_init_std) elif classname.find('Embedding') != -1: if hasattr(m, 'weight'): self._init_weight(m.weight) elif classname.find('ProjectedAdaptiveLogSoftmax') != -1: if hasattr(m, 'cluster_weight') and m.cluster_weight is not None: self._init_weight(m.cluster_weight) if hasattr(m, 'cluster_bias') and m.cluster_bias is not None: self._init_bias(m.cluster_bias) if hasattr(m, 'out_projs'): for i in range(len(m.out_projs)): if m.out_projs[i] is not None: nn.init.normal_(m.out_projs[i], 0.0, self.config.proj_init_std) elif classname.find('LayerNorm') != -1: if hasattr(m, 'weight'): nn.init.normal_(m.weight, 1.0, self.config.init_std) if hasattr(m, 'bias') and m.bias is not None: self._init_bias(m.bias) else: if hasattr(m, 'r_emb'): self._init_weight(m.r_emb) if hasattr(m, 'r_w_bias'): self._init_weight(m.r_w_bias) if hasattr(m, 'r_r_bias'): self._init_weight(m.r_r_bias) if hasattr(m, 'r_bias'): self._init_bias(m.r_bias) def set_num_special_tokens(self, num_special_tokens): pass TRANSFO_XL_START_DOCSTRING = r""" The Transformer-XL model was proposed in `Transformer-XL: Attentive Language Models Beyond a Fixed-Length Context`_ by Zihang Dai*, Zhilin Yang*, Yiming Yang, Jaime Carbonell, Quoc V. Le, Ruslan Salakhutdinov. It's a causal (uni-directional) transformer with relative positioning (sinusoïdal) embeddings which can reuse previously computed hidden-states to attend to longer context (memory). This model also uses adaptive softmax inputs and outputs (tied). This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`Transformer-XL: Attentive Language Models Beyond a Fixed-Length Context`: https://arxiv.org/abs/1901.02860 .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.TransfoXLConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ TRANSFO_XL_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. Transformer-XL is a model with relative position embeddings so you can either pad the inputs on the right or on the left. Indices can be obtained using :class:`pytorch_transformers.TransfoXLTokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **mems**: (`optional`) list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model (see `mems` output below). Can be used to speed up sequential decoding and attend to longer context. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare Bert Model transformer outputing raw hidden-states without any specific head on top.", TRANSFO_XL_START_DOCSTRING, TRANSFO_XL_INPUTS_DOCSTRING) class TransfoXLModel(TransfoXLPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the last layer of the model. **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model (see `mems` input above). Can be used to speed up sequential decoding and attend to longer context. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = TransfoXLTokenizer.from_pretrained('transfo-xl-wt103') model = TransfoXLModel.from_pretrained('transfo-xl-wt103') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states, mems = outputs[:2] """ def __init__(self, config): super(TransfoXLModel, self).__init__(config) self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states self.n_token = config.n_token self.d_embed = config.d_embed self.d_model = config.d_model self.n_head = config.n_head self.d_head = config.d_head self.word_emb = AdaptiveEmbedding(config.n_token, config.d_embed, config.d_model, config.cutoffs, div_val=config.div_val) self.drop = nn.Dropout(config.dropout) self.n_layer = config.n_layer self.tgt_len = config.tgt_len self.mem_len = config.mem_len self.ext_len = config.ext_len self.max_klen = config.tgt_len + config.ext_len + config.mem_len self.attn_type = config.attn_type if not config.untie_r: self.r_w_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.r_r_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.layers = nn.ModuleList() if config.attn_type == 0: # the default attention for i in range(config.n_layer): self.layers.append( RelPartialLearnableDecoderLayer( config.n_head, config.d_model, config.d_head, config.d_inner, config.dropout, tgt_len=config.tgt_len, ext_len=config.ext_len, mem_len=config.mem_len, dropatt=config.dropatt, pre_lnorm=config.pre_lnorm, r_w_bias=None if config.untie_r else self.r_w_bias, r_r_bias=None if config.untie_r else self.r_r_bias, output_attentions=self.output_attentions) ) elif config.attn_type == 1: # learnable embeddings for i in range(config.n_layer): self.layers.append( RelLearnableDecoderLayer( config.n_head, config.d_model, config.d_head, config.d_inner, config.dropout, tgt_len=config.tgt_len, ext_len=config.ext_len, mem_len=config.mem_len, dropatt=config.dropatt, pre_lnorm=config.pre_lnorm, r_w_bias=None if config.untie_r else self.r_w_bias, r_r_bias=None if config.untie_r else self.r_r_bias, output_attentions=self.output_attentions) ) elif config.attn_type in [2, 3]: # absolute embeddings for i in range(config.n_layer): self.layers.append( DecoderLayer( config.n_head, config.d_model, config.d_head, config.d_inner, config.dropout, dropatt=config.dropatt, pre_lnorm=config.pre_lnorm, r_w_bias=None if config.untie_r else self.r_w_bias, r_r_bias=None if config.untie_r else self.r_r_bias, output_attentions=self.output_attentions) ) self.same_length = config.same_length self.clamp_len = config.clamp_len if self.attn_type == 0: # default attention self.pos_emb = PositionalEmbedding(self.d_model) elif self.attn_type == 1: # learnable self.r_emb = nn.Parameter(torch.FloatTensor( self.n_layer, self.max_klen, self.n_head, self.d_head)) self.r_bias = nn.Parameter(torch.FloatTensor( self.n_layer, self.max_klen, self.n_head)) elif self.attn_type == 2: # absolute standard self.pos_emb = PositionalEmbedding(self.d_model) elif self.attn_type == 3: # absolute deeper SA self.r_emb = nn.Parameter(torch.FloatTensor( self.n_layer, self.max_klen, self.n_head, self.d_head)) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): return self.word_emb def backward_compatible(self): self.sample_softmax = -1 def reset_length(self, tgt_len, ext_len, mem_len): self.tgt_len = tgt_len self.mem_len = mem_len self.ext_len = ext_len def _prune_heads(self, heads): logger.info("Head pruning is not implemented for Transformer-XL model") pass def init_mems(self, data): if self.mem_len > 0: mems = [] param = next(self.parameters()) for i in range(self.n_layer): empty = torch.zeros(self.mem_len, data.size(1), self.config.d_model, dtype=param.dtype, device=param.device) mems.append(empty) return mems else: return None def _update_mems(self, hids, mems, qlen, mlen): # does not deal with None if mems is None: return None # mems is not None assert len(hids) == len(mems), 'len(hids) != len(mems)' # There are `mlen + qlen` steps that can be cached into mems # For the next step, the last `ext_len` of the `qlen` tokens # will be used as the extended context. Hence, we only cache # the tokens from `mlen + qlen - self.ext_len - self.mem_len` # to `mlen + qlen - self.ext_len`. with torch.no_grad(): new_mems = [] end_idx = mlen + max(0, qlen - 0 - self.ext_len) beg_idx = max(0, end_idx - self.mem_len) for i in range(len(hids)): cat = torch.cat([mems[i], hids[i]], dim=0) new_mems.append(cat[beg_idx:end_idx].detach()) return new_mems def _forward(self, dec_inp, mems=None, head_mask=None): qlen, bsz = dec_inp.size() # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # input head_mask has shape [num_heads] or [num_hidden_layers x num_heads] (a head_mask for each layer) # and head_mask is converted to shape [num_hidden_layers x qlen x klen x bsz x n_head] if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(0).unsqueeze(0) head_mask = head_mask.expand(self.n_layer, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(1).unsqueeze(1) head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.n_layer word_emb = self.word_emb(dec_inp) mlen = mems[0].size(0) if mems is not None else 0 klen = mlen + qlen if self.same_length: all_ones = word_emb.new_ones((qlen, klen), dtype=torch.uint8) mask_len = klen - self.mem_len if mask_len > 0: mask_shift_len = qlen - mask_len else: mask_shift_len = qlen dec_attn_mask = (torch.triu(all_ones, 1+mlen) + torch.tril(all_ones, -mask_shift_len))[:, :, None] # -1 else: dec_attn_mask = torch.triu( word_emb.new_ones((qlen, klen), dtype=torch.uint8), diagonal=1+mlen)[:,:,None] hids = [] attentions = [] if self.attn_type == 0: # default pos_seq = torch.arange(klen-1, -1, -1.0, device=word_emb.device, dtype=word_emb.dtype) if self.clamp_len > 0: pos_seq.clamp_(max=self.clamp_len) pos_emb = self.pos_emb(pos_seq) core_out = self.drop(word_emb) pos_emb = self.drop(pos_emb) for i, layer in enumerate(self.layers): hids.append(core_out) mems_i = None if mems is None else mems[i] layer_outputs = layer(core_out, pos_emb, dec_attn_mask=dec_attn_mask, mems=mems_i, head_mask=head_mask[i]) core_out = layer_outputs[0] if self.output_attentions: attentions.append(layer_outputs[1]) elif self.attn_type == 1: # learnable core_out = self.drop(word_emb) for i, layer in enumerate(self.layers): hids.append(core_out) if self.clamp_len > 0: r_emb = self.r_emb[i][-self.clamp_len :] r_bias = self.r_bias[i][-self.clamp_len :] else: r_emb, r_bias = self.r_emb[i], self.r_bias[i] mems_i = None if mems is None else mems[i] layer_outputs = layer(core_out, r_emb, self.r_w_bias[i], r_bias, dec_attn_mask=dec_attn_mask, mems=mems_i, head_mask=head_mask[i]) core_out = layer_outputs[0] if self.output_attentions: attentions.append(layer_outputs[1]) elif self.attn_type == 2: # absolute pos_seq = torch.arange(klen - 1, -1, -1.0, device=word_emb.device, dtype=word_emb.dtype) if self.clamp_len > 0: pos_seq.clamp_(max=self.clamp_len) pos_emb = self.pos_emb(pos_seq) core_out = self.drop(word_emb + pos_emb[-qlen:]) for i, layer in enumerate(self.layers): hids.append(core_out) mems_i = None if mems is None else mems[i] if mems_i is not None and i == 0: mems_i += pos_emb[:mlen] layer_outputs = layer(core_out, dec_attn_mask=dec_attn_mask, mems=mems_i, head_mask=head_mask[i]) core_out = layer_outputs[0] if self.output_attentions: attentions.append(layer_outputs[1]) elif self.attn_type == 3: core_out = self.drop(word_emb) for i, layer in enumerate(self.layers): hids.append(core_out) mems_i = None if mems is None else mems[i] if mems_i is not None and mlen > 0: cur_emb = self.r_emb[i][:-qlen] cur_size = cur_emb.size(0) if cur_size < mlen: cur_emb_pad = cur_emb[0:1].expand(mlen-cur_size, -1, -1) cur_emb = torch.cat([cur_emb_pad, cur_emb], 0) else: cur_emb = cur_emb[-mlen:] mems_i += cur_emb.view(mlen, 1, -1) core_out += self.r_emb[i][-qlen:].view(qlen, 1, -1) layer_outputs = layer(core_out, dec_attn_mask=dec_attn_mask, mems=mems_i, head_mask=head_mask[i]) core_out = layer_outputs[0] if self.output_attentions: attentions.append(layer_outputs[1]) core_out = self.drop(core_out) new_mems = self._update_mems(hids, mems, mlen, qlen) # We transpose back here to shape [bsz, len, hidden_dim] outputs = [core_out.transpose(0, 1).contiguous(), new_mems] if self.output_hidden_states: # Add last layer and transpose to library standard shape [bsz, len, hidden_dim] hids.append(core_out) hids = list(t.transpose(0, 1).contiguous() for t in hids) outputs.append(hids) if self.output_attentions: # Transpose to library standard shape [bsz, n_heads, query_seq_len, key_seq_len] attentions = list(t.permute(2, 3, 0, 1).contiguous() for t in attentions) outputs.append(attentions) return outputs # last hidden state, new_mems, (all hidden states), (all attentions) def forward(self, input_ids, mems=None, head_mask=None): # the original code for Transformer-XL used shapes [len, bsz] but we want a unified interface in the library # so we transpose here from shape [bsz, len] to shape [len, bsz] input_ids = input_ids.transpose(0, 1).contiguous() if mems is None: mems = self.init_mems(input_ids) outputs = self._forward(input_ids, mems=mems, head_mask=head_mask) return outputs # last hidden state, new_mems, (all hidden states), (all attentions) @add_start_docstrings("""The Transformer-XL Model with a language modeling head on top (adaptive softmax with weights tied to the adaptive input embeddings)""", TRANSFO_XL_START_DOCSTRING, TRANSFO_XL_INPUTS_DOCSTRING) class TransfoXLLMHeadModel(TransfoXLPreTrainedModel): r""" **lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **prediction_scores**: ``None`` if ``lm_labels`` is provided else ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). We don't output them when the loss is computed to speedup adaptive softmax decoding. **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model (see `mems` input above). Can be used to speed up sequential decoding and attend to longer context. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = TransfoXLTokenizer.from_pretrained('transfo-xl-wt103') model = TransfoXLLMHeadModel.from_pretrained('transfo-xl-wt103') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) prediction_scores, mems = outputs[:2] """ def __init__(self, config): super(TransfoXLLMHeadModel, self).__init__(config) self.transformer = TransfoXLModel(config) self.sample_softmax = config.sample_softmax # use sampled softmax if config.sample_softmax > 0: self.out_layer = nn.Linear(config.d_model, config.n_token) self.sampler = LogUniformSampler(config.n_token, config.sample_softmax) # use adaptive softmax (including standard softmax) else: self.crit = ProjectedAdaptiveLogSoftmax(config.n_token, config.d_embed, config.d_model, config.cutoffs, div_val=config.div_val) self.init_weights() self.tie_weights() def tie_weights(self): """ Run this to be sure output and input (adaptive) softmax weights are tied """ # sampled softmax if self.sample_softmax > 0: if self.config.tie_weight: self.out_layer.weight = self.transformer.word_emb.weight # adaptive softmax (including standard softmax) else: if self.config.tie_weight: for i in range(len(self.crit.out_layers)): self._tie_or_clone_weights(self.crit.out_layers[i], self.transformer.word_emb.emb_layers[i]) if self.config.tie_projs: for i, tie_proj in enumerate(self.config.tie_projs): if tie_proj and self.config.div_val == 1 and self.config.d_model != self.config.d_embed: if self.config.torchscript: self.crit.out_projs[i] = nn.Parameter(self.transformer.word_emb.emb_projs[0].clone()) else: self.crit.out_projs[i] = self.transformer.word_emb.emb_projs[0] elif tie_proj and self.config.div_val != 1: if self.config.torchscript: self.crit.out_projs[i] = nn.Parameter(self.transformer.word_emb.emb_projs[i].clone()) else: self.crit.out_projs[i] = self.transformer.word_emb.emb_projs[i] def reset_length(self, tgt_len, ext_len, mem_len): self.transformer.reset_length(tgt_len, ext_len, mem_len) def init_mems(self, data): return self.transformer.init_mems(data) def forward(self, input_ids, mems=None, head_mask=None, labels=None): bsz = input_ids.size(0) tgt_len = input_ids.size(1) transformer_outputs = self.transformer(input_ids, mems=mems, head_mask=head_mask) last_hidden = transformer_outputs[0] pred_hid = last_hidden[:, -tgt_len:] outputs = transformer_outputs[1:] if self.sample_softmax > 0 and self.training: assert self.config.tie_weight logit = sample_logits(self.transformer.word_emb, self.out_layer.bias, labels, pred_hid, self.sampler) softmax_output = -F.log_softmax(logit, -1)[:, :, 0] outputs = [softmax_output] + outputs if labels is not None: # TODO: This is not implemented raise NotImplementedError else: softmax_output = self.crit(pred_hid.view(-1, pred_hid.size(-1)), labels) if labels is None: softmax_output = softmax_output.view(bsz, tgt_len, -1) outputs = [softmax_output] + outputs else: softmax_output = softmax_output.view(bsz, tgt_len) outputs = [softmax_output, None] + outputs return outputs # (loss), logits or None if labels is not None (speed up adaptive softmax), new_mems, (all hidden states), (all attentions)
53,261
42.19708
157
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_xlnet.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ PyTorch XLNet model. """ from __future__ import absolute_import, division, print_function, unicode_literals import json import logging import math import os import sys from io import open import torch from torch import nn from torch.nn import functional as F from torch.nn import CrossEntropyLoss, MSELoss from .modeling_utils import PreTrainedModel, prune_linear_layer, SequenceSummary, PoolerAnswerClass, PoolerEndLogits, PoolerStartLogits from .configuration_xlnet import XLNetConfig from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) XLNET_PRETRAINED_MODEL_ARCHIVE_MAP = { 'xlnet-base-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/xlnet-base-cased-pytorch_model.bin", 'xlnet-large-cased': "https://s3.amazonaws.com/models.huggingface.co/bert/xlnet-large-cased-pytorch_model.bin", } def build_tf_xlnet_to_pytorch_map(model, config, tf_weights=None): """ A map of modules from TF to PyTorch. I use a map to keep the PyTorch model as identical to the original PyTorch model as possible. """ tf_to_pt_map = {} if hasattr(model, 'transformer'): if hasattr(model, 'lm_loss'): # We will load also the output bias tf_to_pt_map['model/lm_loss/bias'] = model.lm_loss.bias if hasattr(model, 'sequence_summary') and 'model/sequnece_summary/summary/kernel' in tf_weights: # We will load also the sequence summary tf_to_pt_map['model/sequnece_summary/summary/kernel'] = model.sequence_summary.summary.weight tf_to_pt_map['model/sequnece_summary/summary/bias'] = model.sequence_summary.summary.bias if hasattr(model, 'logits_proj') and config.finetuning_task is not None \ and 'model/regression_{}/logit/kernel'.format(config.finetuning_task) in tf_weights: tf_to_pt_map['model/regression_{}/logit/kernel'.format(config.finetuning_task)] = model.logits_proj.weight tf_to_pt_map['model/regression_{}/logit/bias'.format(config.finetuning_task)] = model.logits_proj.bias # Now load the rest of the transformer model = model.transformer # Embeddings and output tf_to_pt_map.update({'model/transformer/word_embedding/lookup_table': model.word_embedding.weight, 'model/transformer/mask_emb/mask_emb': model.mask_emb}) # Transformer blocks for i, b in enumerate(model.layer): layer_str = "model/transformer/layer_%d/" % i tf_to_pt_map.update({ layer_str + "rel_attn/LayerNorm/gamma": b.rel_attn.layer_norm.weight, layer_str + "rel_attn/LayerNorm/beta": b.rel_attn.layer_norm.bias, layer_str + "rel_attn/o/kernel": b.rel_attn.o, layer_str + "rel_attn/q/kernel": b.rel_attn.q, layer_str + "rel_attn/k/kernel": b.rel_attn.k, layer_str + "rel_attn/r/kernel": b.rel_attn.r, layer_str + "rel_attn/v/kernel": b.rel_attn.v, layer_str + "ff/LayerNorm/gamma": b.ff.layer_norm.weight, layer_str + "ff/LayerNorm/beta": b.ff.layer_norm.bias, layer_str + "ff/layer_1/kernel": b.ff.layer_1.weight, layer_str + "ff/layer_1/bias": b.ff.layer_1.bias, layer_str + "ff/layer_2/kernel": b.ff.layer_2.weight, layer_str + "ff/layer_2/bias": b.ff.layer_2.bias, }) # Relative positioning biases if config.untie_r: r_r_list = [] r_w_list = [] r_s_list = [] seg_embed_list = [] for b in model.layer: r_r_list.append(b.rel_attn.r_r_bias) r_w_list.append(b.rel_attn.r_w_bias) r_s_list.append(b.rel_attn.r_s_bias) seg_embed_list.append(b.rel_attn.seg_embed) else: r_r_list = [model.r_r_bias] r_w_list = [model.r_w_bias] r_s_list = [model.r_s_bias] seg_embed_list = [model.seg_embed] tf_to_pt_map.update({ 'model/transformer/r_r_bias': r_r_list, 'model/transformer/r_w_bias': r_w_list, 'model/transformer/r_s_bias': r_s_list, 'model/transformer/seg_embed': seg_embed_list}) return tf_to_pt_map def load_tf_weights_in_xlnet(model, config, tf_path): """ Load tf checkpoints in a pytorch model """ try: import numpy as np import tensorflow as tf except ImportError: logger.error("Loading a TensorFlow models in PyTorch, requires TensorFlow to be installed. Please see " "https://www.tensorflow.org/install/ for installation instructions.") raise # Load weights from TF model init_vars = tf.train.list_variables(tf_path) tf_weights = {} for name, shape in init_vars: logger.info("Loading TF weight {} with shape {}".format(name, shape)) array = tf.train.load_variable(tf_path, name) tf_weights[name] = array # Build TF to PyTorch weights loading map tf_to_pt_map = build_tf_xlnet_to_pytorch_map(model, config, tf_weights) for name, pointer in tf_to_pt_map.items(): logger.info("Importing {}".format(name)) if name not in tf_weights: logger.info("{} not in tf pre-trained weights, skipping".format(name)) continue array = tf_weights[name] # adam_v and adam_m are variables used in AdamWeightDecayOptimizer to calculated m and v # which are not required for using pretrained model if 'kernel' in name and ('ff' in name or 'summary' in name or 'logit' in name): logger.info("Transposing") array = np.transpose(array) if isinstance(pointer, list): # Here we will split the TF weigths assert len(pointer) == array.shape[0] for i, p_i in enumerate(pointer): arr_i = array[i, ...] try: assert p_i.shape == arr_i.shape except AssertionError as e: e.args += (p_i.shape, arr_i.shape) raise logger.info("Initialize PyTorch weight {} for layer {}".format(name, i)) p_i.data = torch.from_numpy(arr_i) else: try: assert pointer.shape == array.shape except AssertionError as e: e.args += (pointer.shape, array.shape) raise logger.info("Initialize PyTorch weight {}".format(name)) pointer.data = torch.from_numpy(array) tf_weights.pop(name, None) tf_weights.pop(name + '/Adam', None) tf_weights.pop(name + '/Adam_1', None) logger.info("Weights not copied to PyTorch model: {}".format(', '.join(tf_weights.keys()))) return model def gelu(x): """ Implementation of the gelu activation function. XLNet is using OpenAI GPT's gelu (not exactly the same as BERT) Also see https://arxiv.org/abs/1606.08415 """ cdf = 0.5 * (1.0 + torch.tanh(math.sqrt(2 / math.pi) * (x + 0.044715 * torch.pow(x, 3)))) return x * cdf def swish(x): return x * torch.sigmoid(x) ACT2FN = {"gelu": gelu, "relu": torch.nn.functional.relu, "swish": swish} try: from apex.normalization.fused_layer_norm import FusedLayerNorm as XLNetLayerNorm except (ImportError, AttributeError) as e: logger.info("Better speed can be achieved with apex installed from https://www.github.com/nvidia/apex .") from torch.nn import LayerNorm as XLNetLayerNorm class XLNetRelativeAttention(nn.Module): def __init__(self, config): super(XLNetRelativeAttention, self).__init__() self.output_attentions = config.output_attentions if config.d_model % config.n_head != 0: raise ValueError( "The hidden size (%d) is not a multiple of the number of attention " "heads (%d)" % (config.d_model, config.n_head)) self.n_head = config.n_head self.d_head = config.d_head self.d_model = config.d_model self.scale = 1 / (config.d_head ** 0.5) self.q = nn.Parameter(torch.FloatTensor(config.d_model, self.n_head, self.d_head)) self.k = nn.Parameter(torch.FloatTensor(config.d_model, self.n_head, self.d_head)) self.v = nn.Parameter(torch.FloatTensor(config.d_model, self.n_head, self.d_head)) self.o = nn.Parameter(torch.FloatTensor(config.d_model, self.n_head, self.d_head)) self.r = nn.Parameter(torch.FloatTensor(config.d_model, self.n_head, self.d_head)) self.r_r_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.r_s_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.r_w_bias = nn.Parameter(torch.FloatTensor(self.n_head, self.d_head)) self.seg_embed = nn.Parameter(torch.FloatTensor(2, self.n_head, self.d_head)) self.layer_norm = XLNetLayerNorm(config.d_model, eps=config.layer_norm_eps) self.dropout = nn.Dropout(config.dropout) def prune_heads(self, heads): raise NotImplementedError @staticmethod def rel_shift(x, klen=-1): """perform relative shift to form the relative attention score.""" x_size = x.shape x = x.reshape(x_size[1], x_size[0], x_size[2], x_size[3]) x = x[1:, ...] x = x.reshape(x_size[0], x_size[1] - 1, x_size[2], x_size[3]) # x = x[:, 0:klen, :, :] x = torch.index_select(x, 1, torch.arange(klen, device=x.device, dtype=torch.long)) return x def rel_attn_core(self, q_head, k_head_h, v_head_h, k_head_r, seg_mat=None, attn_mask=None, head_mask=None): """Core relative positional attention operations.""" # content based attention score ac = torch.einsum('ibnd,jbnd->ijbn', q_head + self.r_w_bias, k_head_h) # position based attention score bd = torch.einsum('ibnd,jbnd->ijbn', q_head + self.r_r_bias, k_head_r) bd = self.rel_shift(bd, klen=ac.shape[1]) # segment based attention score if seg_mat is None: ef = 0 else: ef = torch.einsum('ibnd,snd->ibns', q_head + self.r_s_bias, self.seg_embed) ef = torch.einsum('ijbs,ibns->ijbn', seg_mat, ef) # merge attention scores and perform masking attn_score = (ac + bd + ef) * self.scale if attn_mask is not None: # attn_score = attn_score * (1 - attn_mask) - 1e30 * attn_mask if attn_mask.dtype == torch.float16: attn_score = attn_score - 65500 * attn_mask else: attn_score = attn_score - 1e30 * attn_mask # attention probability attn_prob = F.softmax(attn_score, dim=1) attn_prob = self.dropout(attn_prob) # Mask heads if we want to if head_mask is not None: attn_prob = attn_prob * head_mask # attention output attn_vec = torch.einsum('ijbn,jbnd->ibnd', attn_prob, v_head_h) if self.output_attentions: return attn_vec, attn_prob return attn_vec def post_attention(self, h, attn_vec, residual=True): """Post-attention processing.""" # post-attention projection (back to `d_model`) attn_out = torch.einsum('ibnd,hnd->ibh', attn_vec, self.o) attn_out = self.dropout(attn_out) if residual: attn_out = attn_out + h output = self.layer_norm(attn_out) return output def forward(self, h, g, attn_mask_h, attn_mask_g, r, seg_mat, mems=None, target_mapping=None, head_mask=None): if g is not None: ###### Two-stream attention with relative positional encoding. # content based attention score if mems is not None and mems.dim() > 1: cat = torch.cat([mems, h], dim=0) else: cat = h # content-based key head k_head_h = torch.einsum('ibh,hnd->ibnd', cat, self.k) # content-based value head v_head_h = torch.einsum('ibh,hnd->ibnd', cat, self.v) # position-based key head k_head_r = torch.einsum('ibh,hnd->ibnd', r, self.r) ##### h-stream # content-stream query head q_head_h = torch.einsum('ibh,hnd->ibnd', h, self.q) # core attention ops attn_vec_h = self.rel_attn_core( q_head_h, k_head_h, v_head_h, k_head_r, seg_mat=seg_mat, attn_mask=attn_mask_h, head_mask=head_mask) if self.output_attentions: attn_vec_h, attn_prob_h = attn_vec_h # post processing output_h = self.post_attention(h, attn_vec_h) ##### g-stream # query-stream query head q_head_g = torch.einsum('ibh,hnd->ibnd', g, self.q) # core attention ops if target_mapping is not None: q_head_g = torch.einsum('mbnd,mlb->lbnd', q_head_g, target_mapping) attn_vec_g = self.rel_attn_core( q_head_g, k_head_h, v_head_h, k_head_r, seg_mat=seg_mat, attn_mask=attn_mask_g, head_mask=head_mask) if self.output_attentions: attn_vec_g, attn_prob_g = attn_vec_g attn_vec_g = torch.einsum('lbnd,mlb->mbnd', attn_vec_g, target_mapping) else: attn_vec_g = self.rel_attn_core( q_head_g, k_head_h, v_head_h, k_head_r, seg_mat=seg_mat, attn_mask=attn_mask_g, head_mask=head_mask) if self.output_attentions: attn_vec_g, attn_prob_g = attn_vec_g # post processing output_g = self.post_attention(g, attn_vec_g) if self.output_attentions: attn_prob = attn_prob_h, attn_prob_g else: ###### Multi-head attention with relative positional encoding if mems is not None and mems.dim() > 1: cat = torch.cat([mems, h], dim=0) else: cat = h # content heads q_head_h = torch.einsum('ibh,hnd->ibnd', h, self.q) k_head_h = torch.einsum('ibh,hnd->ibnd', cat, self.k) v_head_h = torch.einsum('ibh,hnd->ibnd', cat, self.v) # positional heads k_head_r = torch.einsum('ibh,hnd->ibnd', r, self.r) # core attention ops attn_vec = self.rel_attn_core( q_head_h, k_head_h, v_head_h, k_head_r, seg_mat=seg_mat, attn_mask=attn_mask_h, head_mask=head_mask) if self.output_attentions: attn_vec, attn_prob = attn_vec # post processing output_h = self.post_attention(h, attn_vec) output_g = None outputs = (output_h, output_g) if self.output_attentions: outputs = outputs + (attn_prob,) return outputs class XLNetFeedForward(nn.Module): def __init__(self, config): super(XLNetFeedForward, self).__init__() self.layer_norm = XLNetLayerNorm(config.d_model, eps=config.layer_norm_eps) self.layer_1 = nn.Linear(config.d_model, config.d_inner) self.layer_2 = nn.Linear(config.d_inner, config.d_model) self.dropout = nn.Dropout(config.dropout) if isinstance(config.ff_activation, str) or \ (sys.version_info[0] == 2 and isinstance(config.ff_activation, unicode)): self.activation_function = ACT2FN[config.ff_activation] else: self.activation_function = config.ff_activation def forward(self, inp): output = inp output = self.layer_1(output) output = self.activation_function(output) output = self.dropout(output) output = self.layer_2(output) output = self.dropout(output) output = self.layer_norm(output + inp) return output class XLNetLayer(nn.Module): def __init__(self, config): super(XLNetLayer, self).__init__() self.rel_attn = XLNetRelativeAttention(config) self.ff = XLNetFeedForward(config) self.dropout = nn.Dropout(config.dropout) def forward(self, output_h, output_g, attn_mask_h, attn_mask_g, r, seg_mat, mems=None, target_mapping=None, head_mask=None): outputs = self.rel_attn(output_h, output_g, attn_mask_h, attn_mask_g, r, seg_mat, mems=mems, target_mapping=target_mapping, head_mask=head_mask) output_h, output_g = outputs[:2] if output_g is not None: output_g = self.ff(output_g) output_h = self.ff(output_h) outputs = (output_h, output_g) + outputs[2:] # Add again attentions if there are there return outputs class XLNetPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = XLNetConfig pretrained_model_archive_map = XLNET_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = load_tf_weights_in_xlnet base_model_prefix = "transformer" def _init_weights(self, module): """ Initialize the weights. """ if isinstance(module, (nn.Linear, nn.Embedding)): # Slightly different from the TF version which uses truncated_normal for initialization # cf https://github.com/pytorch/pytorch/pull/5617 module.weight.data.normal_(mean=0.0, std=self.config.initializer_range) if isinstance(module, nn.Linear) and module.bias is not None: module.bias.data.zero_() elif isinstance(module, XLNetLayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) elif isinstance(module, XLNetRelativeAttention): for param in [module.q, module.k, module.v, module.o, module.r, module.r_r_bias, module.r_s_bias, module.r_w_bias, module.seg_embed]: param.data.normal_(mean=0.0, std=self.config.initializer_range) elif isinstance(module, XLNetModel): module.mask_emb.data.normal_(mean=0.0, std=self.config.initializer_range) XLNET_START_DOCSTRING = r""" The XLNet model was proposed in `XLNet: Generalized Autoregressive Pretraining for Language Understanding`_ by Zhilin Yang*, Zihang Dai*, Yiming Yang, Jaime Carbonell, Ruslan Salakhutdinov, Quoc V. Le. XLnet is an extension of the Transformer-XL model pre-trained using an autoregressive method to learn bidirectional contexts by maximizing the expected likelihood over all permutations of the input sequence factorization order. The specific attention pattern can be controlled at training and test time using the `perm_mask` input. Do to the difficulty of training a fully auto-regressive model over various factorization order, XLNet is pretrained using only a sub-set of the output tokens as target which are selected with the `target_mapping` input. To use XLNet for sequential decoding (i.e. not in fully bi-directional setting), use the `perm_mask` and `target_mapping` inputs to control the attention span and outputs (see examples in `examples/run_generation.py`) This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`XLNet: Generalized Autoregressive Pretraining for Language Understanding`: http://arxiv.org/abs/1906.08237 .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.XLNetConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ XLNET_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. XLNet is a model with relative position embeddings so you can either pad the inputs on the right or on the left. Indices can be obtained using :class:`pytorch_transformers.XLNetTokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens (can be used to indicate various portions of the inputs). The type indices in XLNet are NOT selected in the vocabulary, they can be arbitrary numbers and the important thing is that they should be different for tokens which belong to different segments. The model will compute relative segment differences from the given type indices: 0 if the segment id of two tokens are the same, 1 if not. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **mems**: (`optional`) list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as output by the model (see `mems` output below). Can be used to speed up sequential decoding and attend to longer context. To activate mems you need to set up config.mem_len to a positive value which will be the max number of tokens in the memory output by the model. E.g. `model = XLNetModel.from_pretrained('xlnet-base-case, mem_len=1024)` will instantiate a model which can use up to 1024 tokens of memory (in addition to the input it self). **perm_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, sequence_length)``: Mask to indicate the attention pattern for each input token with values selected in ``[0, 1]``: If ``perm_mask[k, i, j] = 0``, i attend to j in batch k; if ``perm_mask[k, i, j] = 1``, i does not attend to j in batch k. If None, each token attends to all the others (full bidirectional attention). Only used during pretraining (to define factorization order) or for sequential decoding (generation). **target_mapping**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, num_predict, sequence_length)``: Mask to indicate the output tokens to use. If ``target_mapping[k, i, j] = 1``, the i-th predict in batch k is on the j-th token. Only used during pretraining for partial prediction or for sequential decoding (generation). **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens (can be used to indicate various portions of the inputs). The embeddings from these tokens will be summed with the respective token embeddings. Indices are selected in the vocabulary (unlike BERT which has a specific vocabulary for segment indices). **input_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Negative of `attention_mask`, i.e. with 0 for real tokens and 1 for padding. Kept for compatibility with the original code base. You can only uses one of `input_mask` and `attention_mask` Mask values selected in ``[0, 1]``: ``1`` for tokens that are MASKED, ``0`` for tokens that are NOT MASKED. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare XLNet Model transformer outputing raw hidden-states without any specific head on top.", XLNET_START_DOCSTRING, XLNET_INPUTS_DOCSTRING) class XLNetModel(XLNetPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the last layer of the model. **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model if config.mem_len > 0 else tuple of None. Can be used to speed up sequential decoding and attend to longer context. See details in the docstring of the `mems` input above. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLNetTokenizer.from_pretrained('xlnet-large-cased') model = XLNetModel.from_pretrained('xlnet-large-cased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(XLNetModel, self).__init__(config) self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states self.mem_len = config.mem_len self.reuse_len = config.reuse_len self.d_model = config.d_model self.same_length = config.same_length self.attn_type = config.attn_type self.bi_data = config.bi_data self.clamp_len = config.clamp_len self.n_layer = config.n_layer self.word_embedding = nn.Embedding(config.n_token, config.d_model) self.mask_emb = nn.Parameter(torch.FloatTensor(1, 1, config.d_model)) self.layer = nn.ModuleList([XLNetLayer(config) for _ in range(config.n_layer)]) self.dropout = nn.Dropout(config.dropout) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): self.word_embedding = self._get_resized_embeddings(self.word_embedding, new_num_tokens) return self.word_embedding def _prune_heads(self, heads_to_prune): raise NotImplementedError def create_mask(self, qlen, mlen): """ Creates causal attention mask. Float mask where 1.0 indicates masked, 0.0 indicates not-masked. Args: qlen: TODO Lysandre didn't fill mlen: TODO Lysandre didn't fill :: same_length=False: same_length=True: <mlen > < qlen > <mlen > < qlen > ^ [0 0 0 0 0 1 1 1 1] [0 0 0 0 0 1 1 1 1] [0 0 0 0 0 0 1 1 1] [1 0 0 0 0 0 1 1 1] qlen [0 0 0 0 0 0 0 1 1] [1 1 0 0 0 0 0 1 1] [0 0 0 0 0 0 0 0 1] [1 1 1 0 0 0 0 0 1] v [0 0 0 0 0 0 0 0 0] [1 1 1 1 0 0 0 0 0] """ attn_mask = torch.ones([qlen, qlen]) mask_up = torch.triu(attn_mask, diagonal=1) attn_mask_pad = torch.zeros([qlen, mlen]) ret = torch.cat([attn_mask_pad, mask_up], dim=1) if self.same_length: mask_lo = torch.tril(attn_mask, diagonal=-1) ret = torch.cat([ret[:, :qlen] + mask_lo, ret[:, qlen:]], dim=1) ret = ret.to(next(self.parameters())) return ret def cache_mem(self, curr_out, prev_mem): """cache hidden states into memory.""" if self.mem_len is None or self.mem_len == 0: return None else: if self.reuse_len is not None and self.reuse_len > 0: curr_out = curr_out[:self.reuse_len] if prev_mem is None: new_mem = curr_out[-self.mem_len:] else: new_mem = torch.cat([prev_mem, curr_out], dim=0)[-self.mem_len:] return new_mem.detach() @staticmethod def positional_embedding(pos_seq, inv_freq, bsz=None): sinusoid_inp = torch.einsum('i,d->id', pos_seq, inv_freq) pos_emb = torch.cat([torch.sin(sinusoid_inp), torch.cos(sinusoid_inp)], dim=-1) pos_emb = pos_emb[:, None, :] if bsz is not None: pos_emb = pos_emb.expand(-1, bsz, -1) return pos_emb def relative_positional_encoding(self, qlen, klen, bsz=None): """create relative positional encoding.""" freq_seq = torch.arange(0, self.d_model, 2.0, dtype=torch.float) inv_freq = 1 / torch.pow(10000, (freq_seq / self.d_model)) if self.attn_type == 'bi': # beg, end = klen - 1, -qlen beg, end = klen, -qlen elif self.attn_type == 'uni': # beg, end = klen - 1, -1 beg, end = klen, -1 else: raise ValueError('Unknown `attn_type` {}.'.format(self.attn_type)) if self.bi_data: fwd_pos_seq = torch.arange(beg, end, -1.0, dtype=torch.float) bwd_pos_seq = torch.arange(-beg, -end, 1.0, dtype=torch.float) if self.clamp_len > 0: fwd_pos_seq = fwd_pos_seq.clamp(-self.clamp_len, self.clamp_len) bwd_pos_seq = bwd_pos_seq.clamp(-self.clamp_len, self.clamp_len) if bsz is not None: fwd_pos_emb = self.positional_embedding(fwd_pos_seq, inv_freq, bsz//2) bwd_pos_emb = self.positional_embedding(bwd_pos_seq, inv_freq, bsz//2) else: fwd_pos_emb = self.positional_embedding(fwd_pos_seq, inv_freq) bwd_pos_emb = self.positional_embedding(bwd_pos_seq, inv_freq) pos_emb = torch.cat([fwd_pos_emb, bwd_pos_emb], dim=1) else: fwd_pos_seq = torch.arange(beg, end, -1.0) if self.clamp_len > 0: fwd_pos_seq = fwd_pos_seq.clamp(-self.clamp_len, self.clamp_len) pos_emb = self.positional_embedding(fwd_pos_seq, inv_freq, bsz) pos_emb = pos_emb.to(next(self.parameters())) return pos_emb def forward(self, input_ids, attention_mask=None, mems=None, perm_mask=None, target_mapping=None, token_type_ids=None, input_mask=None, head_mask=None): # the original code for XLNet uses shapes [len, bsz] with the batch dimension at the end # but we want a unified interface in the library with the batch size on the first dimension # so we move here the first dimension (batch) to the end input_ids = input_ids.transpose(0, 1).contiguous() token_type_ids = token_type_ids.transpose(0, 1).contiguous() if token_type_ids is not None else None input_mask = input_mask.transpose(0, 1).contiguous() if input_mask is not None else None attention_mask = attention_mask.transpose(0, 1).contiguous() if attention_mask is not None else None perm_mask = perm_mask.permute(1, 2, 0).contiguous() if perm_mask is not None else None target_mapping = target_mapping.permute(1, 2, 0).contiguous() if target_mapping is not None else None qlen, bsz = input_ids.shape[0], input_ids.shape[1] mlen = mems[0].shape[0] if mems is not None and mems[0] is not None else 0 klen = mlen + qlen dtype_float = next(self.parameters()).dtype device = next(self.parameters()).device ##### Attention mask # causal attention mask if self.attn_type == 'uni': attn_mask = self.create_mask(qlen, mlen) attn_mask = attn_mask[:, :, None, None] elif self.attn_type == 'bi': attn_mask = None else: raise ValueError('Unsupported attention type: {}'.format(self.attn_type)) # data mask: input mask & perm mask assert input_mask is None or attention_mask is None, "You can only use one of input_mask (uses 1 for padding) " "or attention_mask (uses 0 for padding, added for compatbility with BERT). Please choose one." if input_mask is None and attention_mask is not None: input_mask = 1.0 - attention_mask if input_mask is not None and perm_mask is not None: data_mask = input_mask[None] + perm_mask elif input_mask is not None and perm_mask is None: data_mask = input_mask[None] elif input_mask is None and perm_mask is not None: data_mask = perm_mask else: data_mask = None if data_mask is not None: # all mems can be attended to mems_mask = torch.zeros([data_mask.shape[0], mlen, bsz]).to(data_mask) data_mask = torch.cat([mems_mask, data_mask], dim=1) if attn_mask is None: attn_mask = data_mask[:, :, :, None] else: attn_mask += data_mask[:, :, :, None] if attn_mask is not None: attn_mask = (attn_mask > 0).to(dtype_float) if attn_mask is not None: non_tgt_mask = -torch.eye(qlen).to(attn_mask) non_tgt_mask = torch.cat([torch.zeros([qlen, mlen]).to(attn_mask), non_tgt_mask], dim=-1) non_tgt_mask = ((attn_mask + non_tgt_mask[:, :, None, None]) > 0).to(attn_mask) else: non_tgt_mask = None ##### Word embeddings and prepare h & g hidden states word_emb_k = self.word_embedding(input_ids) output_h = self.dropout(word_emb_k) if target_mapping is not None: word_emb_q = self.mask_emb.expand(target_mapping.shape[0], bsz, -1) # else: # We removed the inp_q input which was same as target mapping # inp_q_ext = inp_q[:, :, None] # word_emb_q = inp_q_ext * self.mask_emb + (1 - inp_q_ext) * word_emb_k output_g = self.dropout(word_emb_q) else: output_g = None ##### Segment embedding if token_type_ids is not None: # Convert `token_type_ids` to one-hot `seg_mat` mem_pad = torch.zeros([mlen, bsz], dtype=torch.long, device=device) cat_ids = torch.cat([mem_pad, token_type_ids], dim=0) # `1` indicates not in the same segment [qlen x klen x bsz] seg_mat = (token_type_ids[:, None] != cat_ids[None, :]).long() seg_mat = F.one_hot(seg_mat, num_classes=2).to(dtype_float) else: seg_mat = None ##### Positional encoding pos_emb = self.relative_positional_encoding(qlen, klen, bsz=bsz) pos_emb = self.dropout(pos_emb) # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # input head_mask has shape [num_heads] or [num_hidden_layers x num_heads] (a head_mask for each layer) # and head_mask is converted to shape [num_hidden_layers x qlen x klen x bsz x n_head] if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(0).unsqueeze(0) head_mask = head_mask.expand(self.n_layer, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(1).unsqueeze(1) head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.n_layer new_mems = () if mems is None: mems = [None] * len(self.layer) attentions = [] hidden_states = [] for i, layer_module in enumerate(self.layer): # cache new mems new_mems = new_mems + (self.cache_mem(output_h, mems[i]),) if self.output_hidden_states: hidden_states.append((output_h, output_g) if output_g is not None else output_h) outputs = layer_module(output_h, output_g, attn_mask_h=non_tgt_mask, attn_mask_g=attn_mask, r=pos_emb, seg_mat=seg_mat, mems=mems[i], target_mapping=target_mapping, head_mask=head_mask[i]) output_h, output_g = outputs[:2] if self.output_attentions: attentions.append(outputs[2]) # Add last hidden state if self.output_hidden_states: hidden_states.append((output_h, output_g) if output_g is not None else output_h) output = self.dropout(output_g if output_g is not None else output_h) # Prepare outputs, we transpose back here to shape [bsz, len, hidden_dim] (cf. beginning of forward() method) outputs = (output.permute(1, 0, 2).contiguous(), new_mems) if self.output_hidden_states: if output_g is not None: hidden_states = tuple(h.permute(1, 0, 2).contiguous() for hs in hidden_states for h in hs) else: hidden_states = tuple(hs.permute(1, 0, 2).contiguous() for hs in hidden_states) outputs = outputs + (hidden_states,) if self.output_attentions: attentions = tuple(t.permute(2, 3, 0, 1).contiguous() for t in attentions) outputs = outputs + (attentions,) return outputs # outputs, new_mems, (hidden_states), (attentions) @add_start_docstrings("""XLNet Model with a language modeling head on top (linear layer with weights tied to the input embeddings). """, XLNET_START_DOCSTRING, XLNET_INPUTS_DOCSTRING) class XLNetLMHeadModel(XLNetPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model if config.mem_len > 0 else tuple of None. Can be used to speed up sequential decoding and attend to longer context. See details in the docstring of the `mems` input above. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLNetTokenizer.from_pretrained('xlnet-large-cased') model = XLNetLMHeadModel.from_pretrained('xlnet-large-cased') # We show how to setup inputs to predict a next token using a bi-directional context. input_ids = torch.tensor(tokenizer.encode("Hello, my dog is very <mask>")).unsqueeze(0) # We will predict the masked token perm_mask = torch.zeros((1, input_ids.shape[1], input_ids.shape[1]), dtype=torch.float) perm_mask[:, :, -1] = 1.0 # Previous tokens don't see last token target_mapping = torch.zeros((1, 1, input_ids.shape[1]), dtype=torch.float) # Shape [1, 1, seq_length] => let's predict one token target_mapping[0, 0, -1] = 1.0 # Our first (and only) prediction will be the last token of the sequence (the masked token) outputs = model(input_ids, perm_mask=perm_mask, target_mapping=target_mapping) next_token_logits = outputs[0] # Output has shape [target_mapping.size(0), target_mapping.size(1), config.vocab_size] """ def __init__(self, config): super(XLNetLMHeadModel, self).__init__(config) self.attn_type = config.attn_type self.same_length = config.same_length self.transformer = XLNetModel(config) self.lm_loss = nn.Linear(config.d_model, config.n_token, bias=True) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the embeddings """ self._tie_or_clone_weights(self.lm_loss, self.transformer.word_embedding) def forward(self, input_ids, attention_mask=None, mems=None, perm_mask=None, target_mapping=None, token_type_ids=None, input_mask=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, mems=mems, perm_mask=perm_mask, target_mapping=target_mapping, token_type_ids=token_type_ids, input_mask=input_mask, head_mask=head_mask) logits = self.lm_loss(transformer_outputs[0]) outputs = (logits,) + transformer_outputs[1:] # Keep mems, hidden states, attentions if there are in it if labels is not None: # Flatten the tokens loss_fct = CrossEntropyLoss(ignore_index=-1) loss = loss_fct(logits.view(-1, logits.size(-1)), labels.view(-1)) outputs = (loss,) + outputs return outputs # return (loss), logits, mems, (hidden states), (attentions) @add_start_docstrings("""XLNet Model with a sequence classification/regression head on top (a linear layer on top of the pooled output) e.g. for GLUE tasks. """, XLNET_START_DOCSTRING, XLNET_INPUTS_DOCSTRING) class XLNetForSequenceClassification(XLNetPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the sequence classification/regression loss. Indices should be in ``[0, ..., config.num_labels - 1]``. If ``config.num_labels == 1`` a regression loss is computed (Mean-Square loss), If ``config.num_labels > 1`` a classification loss is computed (Cross-Entropy). Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification (or regression if config.num_labels==1) loss. **logits**: ``torch.FloatTensor`` of shape ``(batch_size, config.num_labels)`` Classification (or regression if config.num_labels==1) scores (before SoftMax). **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model if config.mem_len > 0 else tuple of None. Can be used to speed up sequential decoding and attend to longer context. See details in the docstring of the `mems` input above. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLNetTokenizer.from_pretrained('xlnet-large-cased') model = XLNetForSequenceClassification.from_pretrained('xlnet-large-cased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, logits = outputs[:2] """ def __init__(self, config): super(XLNetForSequenceClassification, self).__init__(config) self.num_labels = config.num_labels self.transformer = XLNetModel(config) self.sequence_summary = SequenceSummary(config) self.logits_proj = nn.Linear(config.d_model, config.num_labels) self.init_weights() def forward(self, input_ids, attention_mask=None, mems=None, perm_mask=None, target_mapping=None, token_type_ids=None, input_mask=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, mems=mems, perm_mask=perm_mask, target_mapping=target_mapping, token_type_ids=token_type_ids, input_mask=input_mask, head_mask=head_mask) output = transformer_outputs[0] output = self.sequence_summary(output) logits = self.logits_proj(output) outputs = (logits,) + transformer_outputs[1:] # Keep mems, hidden states, attentions if there are in it if labels is not None: if self.num_labels == 1: # We are doing regression loss_fct = MSELoss() loss = loss_fct(logits.view(-1), labels.view(-1)) else: loss_fct = CrossEntropyLoss() loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs # return (loss), logits, mems, (hidden states), (attentions) @add_start_docstrings("""XLNet Model with a span classification head on top for extractive question-answering tasks like SQuAD (a linear layers on top of the hidden-states output to compute `span start logits` and `span end logits`). """, XLNET_START_DOCSTRING, XLNET_INPUTS_DOCSTRING) class XLNetForQuestionAnswering(XLNetPreTrainedModel): r""" **start_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the start of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **end_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the end of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **is_impossible**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels whether a question has an answer or no answer (SQuAD 2.0) **cls_index**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the classification token to use as input for computing plausibility of the answer. **p_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Optional mask of tokens which can't be in answers (e.g. [CLS], [PAD], ...). 1.0 means token should be masked. 0.0 mean token is not masked. Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned if both ``start_positions`` and ``end_positions`` are provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification loss as the sum of start token, end token (and is_impossible if provided) classification losses. **start_top_log_probs**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size, config.start_n_top)`` Log probabilities for the top config.start_n_top start token possibilities (beam-search). **start_top_index**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.LongTensor`` of shape ``(batch_size, config.start_n_top)`` Indices for the top config.start_n_top start token possibilities (beam-search). **end_top_log_probs**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size, config.start_n_top * config.end_n_top)`` Log probabilities for the top ``config.start_n_top * config.end_n_top`` end token possibilities (beam-search). **end_top_index**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.LongTensor`` of shape ``(batch_size, config.start_n_top * config.end_n_top)`` Indices for the top ``config.start_n_top * config.end_n_top`` end token possibilities (beam-search). **cls_logits**: (`optional`, returned if ``start_positions`` or ``end_positions`` is not provided) ``torch.FloatTensor`` of shape ``(batch_size,)`` Log probabilities for the ``is_impossible`` label of the answers. **mems**: list of ``torch.FloatTensor`` (one for each layer): that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model if config.mem_len > 0 else tuple of None. Can be used to speed up sequential decoding and attend to longer context. See details in the docstring of the `mems` input above. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLMTokenizer.from_pretrained('xlm-mlm-en-2048') model = XLMForQuestionAnswering.from_pretrained('xlnet-large-cased') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 start_positions = torch.tensor([1]) end_positions = torch.tensor([3]) outputs = model(input_ids, start_positions=start_positions, end_positions=end_positions) loss, start_scores, end_scores = outputs[:2] """ def __init__(self, config): super(XLNetForQuestionAnswering, self).__init__(config) self.start_n_top = config.start_n_top self.end_n_top = config.end_n_top self.transformer = XLNetModel(config) self.start_logits = PoolerStartLogits(config) self.end_logits = PoolerEndLogits(config) self.answer_class = PoolerAnswerClass(config) self.init_weights() def forward(self, input_ids, attention_mask=None, mems=None, perm_mask=None, target_mapping=None, token_type_ids=None, input_mask=None, head_mask=None, start_positions=None, end_positions=None, is_impossible=None, cls_index=None, p_mask=None,): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, mems=mems, perm_mask=perm_mask, target_mapping=target_mapping, token_type_ids=token_type_ids, input_mask=input_mask, head_mask=head_mask) hidden_states = transformer_outputs[0] start_logits = self.start_logits(hidden_states, p_mask=p_mask) outputs = transformer_outputs[1:] # Keep mems, hidden states, attentions if there are in it if start_positions is not None and end_positions is not None: # If we are on multi-GPU, let's remove the dimension added by batch splitting for x in (start_positions, end_positions, cls_index, is_impossible): if x is not None and x.dim() > 1: x.squeeze_(-1) # during training, compute the end logits based on the ground truth of the start position end_logits = self.end_logits(hidden_states, start_positions=start_positions, p_mask=p_mask) loss_fct = CrossEntropyLoss() start_loss = loss_fct(start_logits, start_positions) end_loss = loss_fct(end_logits, end_positions) total_loss = (start_loss + end_loss) / 2 if cls_index is not None and is_impossible is not None: # Predict answerability from the representation of CLS and START cls_logits = self.answer_class(hidden_states, start_positions=start_positions, cls_index=cls_index) loss_fct_cls = nn.BCEWithLogitsLoss() cls_loss = loss_fct_cls(cls_logits, is_impossible) # note(zhiliny): by default multiply the loss by 0.5 so that the scale is comparable to start_loss and end_loss total_loss += cls_loss * 0.5 outputs = (total_loss,) + outputs else: # during inference, compute the end logits based on beam search bsz, slen, hsz = hidden_states.size() start_log_probs = F.softmax(start_logits, dim=-1) # shape (bsz, slen) start_top_log_probs, start_top_index = torch.topk(start_log_probs, self.start_n_top, dim=-1) # shape (bsz, start_n_top) start_top_index_exp = start_top_index.unsqueeze(-1).expand(-1, -1, hsz) # shape (bsz, start_n_top, hsz) start_states = torch.gather(hidden_states, -2, start_top_index_exp) # shape (bsz, start_n_top, hsz) start_states = start_states.unsqueeze(1).expand(-1, slen, -1, -1) # shape (bsz, slen, start_n_top, hsz) hidden_states_expanded = hidden_states.unsqueeze(2).expand_as(start_states) # shape (bsz, slen, start_n_top, hsz) p_mask = p_mask.unsqueeze(-1) if p_mask is not None else None end_logits = self.end_logits(hidden_states_expanded, start_states=start_states, p_mask=p_mask) end_log_probs = F.softmax(end_logits, dim=1) # shape (bsz, slen, start_n_top) end_top_log_probs, end_top_index = torch.topk(end_log_probs, self.end_n_top, dim=1) # shape (bsz, end_n_top, start_n_top) end_top_log_probs = end_top_log_probs.view(-1, self.start_n_top * self.end_n_top) end_top_index = end_top_index.view(-1, self.start_n_top * self.end_n_top) start_states = torch.einsum("blh,bl->bh", hidden_states, start_log_probs) # get the representation of START as weighted sum of hidden states cls_logits = self.answer_class(hidden_states, start_states=start_states, cls_index=cls_index) # Shape (batch size,): one single `cls_logits` for each sample outputs = (start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits) + outputs # return start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits # or (if labels are provided) (total_loss,) return outputs
59,258
50.39549
169
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_xlm.py
# coding=utf-8 # Copyright 2019-present, Facebook, Inc and the HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ PyTorch XLM model. """ from __future__ import absolute_import, division, print_function, unicode_literals import logging import math import itertools import numpy as np import torch from torch import nn from torch.nn import functional as F from torch.nn import CrossEntropyLoss, MSELoss from .modeling_utils import PreTrainedModel, prune_linear_layer, SequenceSummary, SQuADHead from .configuration_xlm import XLMConfig from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) XLM_PRETRAINED_MODEL_ARCHIVE_MAP = { 'xlm-mlm-en-2048': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-en-2048-pytorch_model.bin", 'xlm-mlm-ende-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-ende-1024-pytorch_model.bin", 'xlm-mlm-enfr-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-enfr-1024-pytorch_model.bin", 'xlm-mlm-enro-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-enro-1024-pytorch_model.bin", 'xlm-mlm-tlm-xnli15-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-tlm-xnli15-1024-pytorch_model.bin", 'xlm-mlm-xnli15-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-xnli15-1024-pytorch_model.bin", 'xlm-clm-enfr-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-clm-enfr-1024-pytorch_model.bin", 'xlm-clm-ende-1024': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-clm-ende-1024-pytorch_model.bin", 'xlm-mlm-17-1280': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-17-1280-pytorch_model.bin", 'xlm-mlm-100-1280': "https://s3.amazonaws.com/models.huggingface.co/bert/xlm-mlm-100-1280-pytorch_model.bin", } def create_sinusoidal_embeddings(n_pos, dim, out): position_enc = np.array([ [pos / np.power(10000, 2 * (j // 2) / dim) for j in range(dim)] for pos in range(n_pos) ]) out[:, 0::2] = torch.FloatTensor(np.sin(position_enc[:, 0::2])) out[:, 1::2] = torch.FloatTensor(np.cos(position_enc[:, 1::2])) out.detach_() out.requires_grad = False def gelu(x): """ GELU activation https://arxiv.org/abs/1606.08415 https://github.com/huggingface/pytorch-openai-transformer-lm/blob/master/model_pytorch.py#L14 https://github.com/huggingface/pytorch-transformers/blob/master/modeling.py """ # return 0.5 * x * (1 + torch.tanh(math.sqrt(2 / math.pi) * (x + 0.044715 * torch.pow(x, 3)))) return 0.5 * x * (1.0 + torch.erf(x / math.sqrt(2.0))) def get_masks(slen, lengths, causal, padding_mask=None): """ Generate hidden states mask, and optionally an attention mask. """ bs = lengths.size(0) if padding_mask is not None: mask = padding_mask else: assert lengths.max().item() <= slen alen = torch.arange(slen, dtype=torch.long, device=lengths.device) mask = alen < lengths[:, None] # attention mask is the same as mask, or triangular inferior attention (causal) if causal: attn_mask = alen[None, None, :].repeat(bs, slen, 1) <= alen[None, :, None] else: attn_mask = mask # sanity check assert mask.size() == (bs, slen) assert causal is False or attn_mask.size() == (bs, slen, slen) return mask, attn_mask class MultiHeadAttention(nn.Module): NEW_ID = itertools.count() def __init__(self, n_heads, dim, config): super(MultiHeadAttention, self).__init__() self.layer_id = next(MultiHeadAttention.NEW_ID) self.output_attentions = config.output_attentions self.dim = dim self.n_heads = n_heads self.dropout = config.attention_dropout assert self.dim % self.n_heads == 0 self.q_lin = nn.Linear(dim, dim) self.k_lin = nn.Linear(dim, dim) self.v_lin = nn.Linear(dim, dim) self.out_lin = nn.Linear(dim, dim) self.pruned_heads = set() def prune_heads(self, heads): attention_head_size = self.dim // self.n_heads if len(heads) == 0: return mask = torch.ones(self.n_heads, attention_head_size) heads = set(heads) - self.pruned_heads for head in heads: head -= sum(1 if h < head else 0 for h in self.pruned_heads) mask[head] = 0 mask = mask.view(-1).contiguous().eq(1) index = torch.arange(len(mask))[mask].long() # Prune linear layers self.q_lin = prune_linear_layer(self.q_lin, index) self.k_lin = prune_linear_layer(self.k_lin, index) self.v_lin = prune_linear_layer(self.v_lin, index) self.out_lin = prune_linear_layer(self.out_lin, index, dim=1) # Update hyper params self.n_heads = self.n_heads - len(heads) self.dim = attention_head_size * self.n_heads self.pruned_heads = self.pruned_heads.union(heads) def forward(self, input, mask, kv=None, cache=None, head_mask=None): """ Self-attention (if kv is None) or attention over source sentence (provided by kv). """ # Input is (bs, qlen, dim) # Mask is (bs, klen) (non-causal) or (bs, klen, klen) bs, qlen, dim = input.size() if kv is None: klen = qlen if cache is None else cache['slen'] + qlen else: klen = kv.size(1) # assert dim == self.dim, 'Dimensions do not match: %s input vs %s configured' % (dim, self.dim) n_heads = self.n_heads dim_per_head = self.dim // n_heads mask_reshape = (bs, 1, qlen, klen) if mask.dim() == 3 else (bs, 1, 1, klen) def shape(x): """ projection """ return x.view(bs, -1, self.n_heads, dim_per_head).transpose(1, 2) def unshape(x): """ compute context """ return x.transpose(1, 2).contiguous().view(bs, -1, self.n_heads * dim_per_head) q = shape(self.q_lin(input)) # (bs, n_heads, qlen, dim_per_head) if kv is None: k = shape(self.k_lin(input)) # (bs, n_heads, qlen, dim_per_head) v = shape(self.v_lin(input)) # (bs, n_heads, qlen, dim_per_head) elif cache is None or self.layer_id not in cache: k = v = kv k = shape(self.k_lin(k)) # (bs, n_heads, qlen, dim_per_head) v = shape(self.v_lin(v)) # (bs, n_heads, qlen, dim_per_head) if cache is not None: if self.layer_id in cache: if kv is None: k_, v_ = cache[self.layer_id] k = torch.cat([k_, k], dim=2) # (bs, n_heads, klen, dim_per_head) v = torch.cat([v_, v], dim=2) # (bs, n_heads, klen, dim_per_head) else: k, v = cache[self.layer_id] cache[self.layer_id] = (k, v) q = q / math.sqrt(dim_per_head) # (bs, n_heads, qlen, dim_per_head) scores = torch.matmul(q, k.transpose(2, 3)) # (bs, n_heads, qlen, klen) mask = (mask == 0).view(mask_reshape).expand_as(scores) # (bs, n_heads, qlen, klen) scores.masked_fill_(mask, -float('inf')) # (bs, n_heads, qlen, klen) weights = F.softmax(scores.float(), dim=-1).type_as(scores) # (bs, n_heads, qlen, klen) weights = F.dropout(weights, p=self.dropout, training=self.training) # (bs, n_heads, qlen, klen) # Mask heads if we want to if head_mask is not None: weights = weights * head_mask context = torch.matmul(weights, v) # (bs, n_heads, qlen, dim_per_head) context = unshape(context) # (bs, qlen, dim) outputs = (self.out_lin(context),) if self.output_attentions: outputs = outputs + (weights,) return outputs class TransformerFFN(nn.Module): def __init__(self, in_dim, dim_hidden, out_dim, config): super(TransformerFFN, self).__init__() self.dropout = config.dropout self.lin1 = nn.Linear(in_dim, dim_hidden) self.lin2 = nn.Linear(dim_hidden, out_dim) self.act = gelu if config.gelu_activation else F.relu def forward(self, input): x = self.lin1(input) x = self.act(x) x = self.lin2(x) x = F.dropout(x, p=self.dropout, training=self.training) return x class XLMPreTrainedModel(PreTrainedModel): """ An abstract class to handle weights initialization and a simple interface for dowloading and loading pretrained models. """ config_class = XLMConfig pretrained_model_archive_map = XLM_PRETRAINED_MODEL_ARCHIVE_MAP load_tf_weights = None base_model_prefix = "transformer" def __init__(self, *inputs, **kwargs): super(XLMPreTrainedModel, self).__init__(*inputs, **kwargs) def _init_weights(self, module): """ Initialize the weights. """ if isinstance(module, nn.Embedding): if self.config is not None and self.config.embed_init_std is not None: nn.init.normal_(module.weight, mean=0, std=self.config.embed_init_std) if isinstance(module, nn.Linear): if self.config is not None and self.config.init_std is not None: nn.init.normal_(module.weight, mean=0, std=self.config.init_std) if hasattr(module, 'bias') and module.bias is not None: nn.init.constant_(module.bias, 0.) if isinstance(module, nn.LayerNorm): module.bias.data.zero_() module.weight.data.fill_(1.0) XLM_START_DOCSTRING = r""" The XLM model was proposed in `Cross-lingual Language Model Pretraining`_ by Guillaume Lample*, Alexis Conneau*. It's a transformer pre-trained using one of the following objectives: - a causal language modeling (CLM) objective (next token prediction), - a masked language modeling (MLM) objective (Bert-like), or - a Translation Language Modeling (TLM) object (extension of Bert's MLM to multiple language inputs) Original code can be found `here`_. This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`Cross-lingual Language Model Pretraining`: https://arxiv.org/abs/1901.07291 .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module .. _`here`: https://github.com/facebookresearch/XLM Parameters: config (:class:`~pytorch_transformers.XLMConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ XLM_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. XLM is a model with absolute position embeddings so it's usually advised to pad the inputs on the right rather than the left. Indices can be obtained using :class:`pytorch_transformers.XLMTokenizer`. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **langs**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens to be used to indicate the language of each token in the input. Indices are languages ids which can be obtained from the language names by using two conversion mappings provided in the configuration of the model (only provided for multilingual models). More precisely, the `language name -> language id` mapping is in `model.config.lang2id` (dict str -> int) and the `language id -> language name` mapping is `model.config.id2lang` (dict int -> str). **token_type_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: A parallel sequence of tokens (can be used to indicate various portions of the inputs). The embeddings from these tokens will be summed with the respective token embeddings. Indices are selected in the vocabulary (unlike BERT which has a specific vocabulary for segment indices). **position_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of positions of each input sequence tokens in the position embeddings. Selected in the range ``[0, config.max_position_embeddings - 1]``. **lengths**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Length of each sentence that can be used to avoid performing attention on padding token indices. You can also use `attention_mask` for the same result (see above), kept here for compatbility. Indices selected in ``[0, ..., input_ids.size(-1)]``: **cache**: dictionary with ``torch.FloatTensor`` that contains pre-computed hidden-states (key and values in the attention blocks) as computed by the model (see `cache` output below). Can be used to speed up sequential decoding. The dictionary object will be modified in-place during the forward pass to add newly computed hidden-states. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare XLM Model transformer outputing raw hidden-states without any specific head on top.", XLM_START_DOCSTRING, XLM_INPUTS_DOCSTRING) class XLMModel(XLMPreTrainedModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the last layer of the model. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLMTokenizer.from_pretrained('xlm-mlm-en-2048') model = XLMModel.from_pretrained('xlm-mlm-en-2048') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ ATTRIBUTES = ['encoder', 'eos_index', 'pad_index', # 'with_output', 'n_langs', 'use_lang_emb', 'n_words', 'dim', 'n_layers', 'n_heads', 'hidden_dim', 'dropout', 'attention_dropout', 'asm', 'asm_cutoffs', 'asm_div_value'] def __init__(self, config): #, dico, is_encoder, with_output): super(XLMModel, self).__init__(config) self.output_attentions = config.output_attentions self.output_hidden_states = config.output_hidden_states # encoder / decoder, output layer self.is_encoder = config.is_encoder self.is_decoder = not config.is_encoder if self.is_decoder: raise NotImplementedError("Currently XLM can only be used as an encoder") # self.with_output = with_output self.causal = config.causal # dictionary / languages self.n_langs = config.n_langs self.use_lang_emb = config.use_lang_emb self.n_words = config.n_words self.eos_index = config.eos_index self.pad_index = config.pad_index # self.dico = dico # self.id2lang = config.id2lang # self.lang2id = config.lang2id # assert len(self.dico) == self.n_words # assert len(self.id2lang) == len(self.lang2id) == self.n_langs # model parameters self.dim = config.emb_dim # 512 by default self.hidden_dim = self.dim * 4 # 2048 by default self.n_heads = config.n_heads # 8 by default self.n_layers = config.n_layers self.dropout = config.dropout self.attention_dropout = config.attention_dropout assert self.dim % self.n_heads == 0, 'transformer dim must be a multiple of n_heads' # embeddings self.position_embeddings = nn.Embedding(config.max_position_embeddings, self.dim) if config.sinusoidal_embeddings: create_sinusoidal_embeddings(config.max_position_embeddings, self.dim, out=self.position_embeddings.weight) if config.n_langs > 1 and config.use_lang_emb: self.lang_embeddings = nn.Embedding(self.n_langs, self.dim) self.embeddings = nn.Embedding(self.n_words, self.dim, padding_idx=self.pad_index) self.layer_norm_emb = nn.LayerNorm(self.dim, eps=config.layer_norm_eps) # transformer layers self.attentions = nn.ModuleList() self.layer_norm1 = nn.ModuleList() self.ffns = nn.ModuleList() self.layer_norm2 = nn.ModuleList() # if self.is_decoder: # self.layer_norm15 = nn.ModuleList() # self.encoder_attn = nn.ModuleList() for _ in range(self.n_layers): self.attentions.append(MultiHeadAttention(self.n_heads, self.dim, config=config)) self.layer_norm1.append(nn.LayerNorm(self.dim, eps=config.layer_norm_eps)) # if self.is_decoder: # self.layer_norm15.append(nn.LayerNorm(self.dim, eps=config.layer_norm_eps)) # self.encoder_attn.append(MultiHeadAttention(self.n_heads, self.dim, dropout=self.attention_dropout)) self.ffns.append(TransformerFFN(self.dim, self.hidden_dim, self.dim, config=config)) self.layer_norm2.append(nn.LayerNorm(self.dim, eps=config.layer_norm_eps)) if hasattr(config, "pruned_heads"): pruned_heads = config.pruned_heads.copy().items() config.pruned_heads = {} for layer, heads in pruned_heads: if self.attentions[int(layer)].n_heads == config.n_heads: self.prune_heads({int(layer): list(map(int, heads))}) self.init_weights() def _resize_token_embeddings(self, new_num_tokens): self.embeddings = self._get_resized_embeddings(self.embeddings, new_num_tokens) return self.embeddings def _prune_heads(self, heads_to_prune): """ Prunes heads of the model. heads_to_prune: dict of {layer_num: list of heads to prune in this layer} See base class PreTrainedModel """ for layer, heads in heads_to_prune.items(): self.attentions[layer].prune_heads(heads) def forward(self, input_ids, attention_mask=None, langs=None, token_type_ids=None, position_ids=None, lengths=None, cache=None, head_mask=None): # removed: src_enc=None, src_len=None if lengths is None: lengths = (input_ids != self.pad_index).sum(dim=1).long() # mask = input_ids != self.pad_index # check inputs bs, slen = input_ids.size() assert lengths.size(0) == bs assert lengths.max().item() <= slen # input_ids = input_ids.transpose(0, 1) # batch size as dimension 0 # assert (src_enc is None) == (src_len is None) # if src_enc is not None: # assert self.is_decoder # assert src_enc.size(0) == bs # generate masks mask, attn_mask = get_masks(slen, lengths, self.causal, padding_mask=attention_mask) # if self.is_decoder and src_enc is not None: # src_mask = torch.arange(src_len.max(), dtype=torch.long, device=lengths.device) < src_len[:, None] # position_ids if position_ids is None: position_ids = input_ids.new((slen,)).long() position_ids = torch.arange(slen, out=position_ids).unsqueeze(0) else: assert position_ids.size() == (bs, slen) # (slen, bs) # position_ids = position_ids.transpose(0, 1) # langs if langs is not None: assert langs.size() == (bs, slen) # (slen, bs) # langs = langs.transpose(0, 1) # Prepare head mask if needed # 1.0 in head_mask indicate we keep the head # attention_probs has shape bsz x n_heads x N x N # input head_mask has shape [num_heads] or [num_hidden_layers x num_heads] # and head_mask is converted to shape [num_hidden_layers x batch x num_heads x qlen x klen] if head_mask is not None: if head_mask.dim() == 1: head_mask = head_mask.unsqueeze(0).unsqueeze(0).unsqueeze(-1).unsqueeze(-1) head_mask = head_mask.expand(self.n_layers, -1, -1, -1, -1) elif head_mask.dim() == 2: head_mask = head_mask.unsqueeze(1).unsqueeze(-1).unsqueeze(-1) # We can specify head_mask for each layer head_mask = head_mask.to(dtype=next(self.parameters()).dtype) # switch to fload if need + fp16 compatibility else: head_mask = [None] * self.n_layers # do not recompute cached elements if cache is not None: _slen = slen - cache['slen'] input_ids = input_ids[:, -_slen:] position_ids = position_ids[:, -_slen:] if langs is not None: langs = langs[:, -_slen:] mask = mask[:, -_slen:] attn_mask = attn_mask[:, -_slen:] # embeddings tensor = self.embeddings(input_ids) tensor = tensor + self.position_embeddings(position_ids).expand_as(tensor) if langs is not None and self.use_lang_emb: tensor = tensor + self.lang_embeddings(langs) if token_type_ids is not None: tensor = tensor + self.embeddings(token_type_ids) tensor = self.layer_norm_emb(tensor) tensor = F.dropout(tensor, p=self.dropout, training=self.training) tensor *= mask.unsqueeze(-1).to(tensor.dtype) # transformer layers hidden_states = () attentions = () for i in range(self.n_layers): if self.output_hidden_states: hidden_states = hidden_states + (tensor,) # self attention attn_outputs = self.attentions[i](tensor, attn_mask, cache=cache, head_mask=head_mask[i]) attn = attn_outputs[0] if self.output_attentions: attentions = attentions + (attn_outputs[1],) attn = F.dropout(attn, p=self.dropout, training=self.training) tensor = tensor + attn tensor = self.layer_norm1[i](tensor) # encoder attention (for decoder only) # if self.is_decoder and src_enc is not None: # attn = self.encoder_attn[i](tensor, src_mask, kv=src_enc, cache=cache) # attn = F.dropout(attn, p=self.dropout, training=self.training) # tensor = tensor + attn # tensor = self.layer_norm15[i](tensor) # FFN tensor = tensor + self.ffns[i](tensor) tensor = self.layer_norm2[i](tensor) tensor *= mask.unsqueeze(-1).to(tensor.dtype) # Add last hidden state if self.output_hidden_states: hidden_states = hidden_states + (tensor,) # update cache length if cache is not None: cache['slen'] += tensor.size(1) # move back sequence length to dimension 0 # tensor = tensor.transpose(0, 1) outputs = (tensor,) if self.output_hidden_states: outputs = outputs + (hidden_states,) if self.output_attentions: outputs = outputs + (attentions,) return outputs # outputs, (hidden_states), (attentions) class XLMPredLayer(nn.Module): """ Prediction layer (cross_entropy or adaptive_softmax). """ def __init__(self, config): super(XLMPredLayer, self).__init__() self.asm = config.asm self.n_words = config.n_words self.pad_index = config.pad_index dim = config.emb_dim if config.asm is False: self.proj = nn.Linear(dim, config.n_words, bias=True) else: self.proj = nn.AdaptiveLogSoftmaxWithLoss( in_features=dim, n_classes=config.n_words, cutoffs=config.asm_cutoffs, div_value=config.asm_div_value, head_bias=True, # default is False ) def forward(self, x, y=None): """ Compute the loss, and optionally the scores. """ outputs = () if self.asm is False: scores = self.proj(x).view(-1, self.n_words) outputs = (scores,) + outputs if y is not None: loss = F.cross_entropy(scores, y, reduction='elementwise_mean') outputs = (loss,) + outputs else: scores = self.proj.log_prob(x) outputs = (scores,) + outputs if y is not None: _, loss = self.proj(x, y) outputs = (loss,) + outputs return outputs @add_start_docstrings("""The XLM Model transformer with a language modeling head on top (linear layer with weights tied to the input embeddings). """, XLM_START_DOCSTRING, XLM_INPUTS_DOCSTRING) class XLMWithLMHeadModel(XLMPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for language modeling. Note that the labels **are shifted** inside the model, i.e. you can set ``lm_labels = input_ids`` Indices are selected in ``[-1, 0, ..., config.vocab_size]`` All labels set to ``-1`` are ignored (masked), the loss is only computed for labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLMTokenizer.from_pretrained('xlm-mlm-en-2048') model = XLMWithLMHeadModel.from_pretrained('xlm-mlm-en-2048') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ def __init__(self, config): super(XLMWithLMHeadModel, self).__init__(config) self.transformer = XLMModel(config) self.pred_layer = XLMPredLayer(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the embeddings """ self._tie_or_clone_weights(self.pred_layer.proj, self.transformer.embeddings) def forward(self, input_ids, attention_mask=None, langs=None, token_type_ids=None, position_ids=None, lengths=None, cache=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, langs=langs, token_type_ids=token_type_ids, position_ids=position_ids, lengths=lengths, cache=cache, head_mask=head_mask) output = transformer_outputs[0] outputs = self.pred_layer(output, labels) outputs = outputs + transformer_outputs[1:] # Keep new_mems and attention/hidden states if they are here return outputs @add_start_docstrings("""XLM Model with a sequence classification/regression head on top (a linear layer on top of the pooled output) e.g. for GLUE tasks. """, XLM_START_DOCSTRING, XLM_INPUTS_DOCSTRING) class XLMForSequenceClassification(XLMPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the sequence classification/regression loss. Indices should be in ``[0, ..., config.num_labels - 1]``. If ``config.num_labels == 1`` a regression loss is computed (Mean-Square loss), If ``config.num_labels > 1`` a classification loss is computed (Cross-Entropy). Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification (or regression if config.num_labels==1) loss. **logits**: ``torch.FloatTensor`` of shape ``(batch_size, config.num_labels)`` Classification (or regression if config.num_labels==1) scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLMTokenizer.from_pretrained('xlm-mlm-en-2048') model = XLMForSequenceClassification.from_pretrained('xlm-mlm-en-2048') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, logits = outputs[:2] """ def __init__(self, config): super(XLMForSequenceClassification, self).__init__(config) self.num_labels = config.num_labels self.transformer = XLMModel(config) self.sequence_summary = SequenceSummary(config) self.init_weights() def forward(self, input_ids, attention_mask=None, langs=None, token_type_ids=None, position_ids=None, lengths=None, cache=None, head_mask=None, labels=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, langs=langs, token_type_ids=token_type_ids, position_ids=position_ids, lengths=lengths, cache=cache, head_mask=head_mask) output = transformer_outputs[0] logits = self.sequence_summary(output) outputs = (logits,) + transformer_outputs[1:] # Keep new_mems and attention/hidden states if they are here if labels is not None: if self.num_labels == 1: # We are doing regression loss_fct = MSELoss() loss = loss_fct(logits.view(-1), labels.view(-1)) else: loss_fct = CrossEntropyLoss() loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs @add_start_docstrings("""XLM Model with a span classification head on top for extractive question-answering tasks like SQuAD (a linear layers on top of the hidden-states output to compute `span start logits` and `span end logits`). """, XLM_START_DOCSTRING, XLM_INPUTS_DOCSTRING) class XLMForQuestionAnswering(XLMPreTrainedModel): r""" **start_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the start of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **end_positions**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the end of the labelled span for computing the token classification loss. Positions are clamped to the length of the sequence (`sequence_length`). Position outside of the sequence are not taken into account for computing the loss. **is_impossible**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels whether a question has an answer or no answer (SQuAD 2.0) **cls_index**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for position (index) of the classification token to use as input for computing plausibility of the answer. **p_mask**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Optional mask of tokens which can't be in answers (e.g. [CLS], [PAD], ...) Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Total span extraction loss is the sum of a Cross-Entropy for the start and end positions. **start_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-start scores (before SoftMax). **end_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length,)`` Span-end scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = XLMTokenizer.from_pretrained('xlm-mlm-en-2048') model = XLMForQuestionAnswering.from_pretrained('xlm-mlm-en-2048') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 start_positions = torch.tensor([1]) end_positions = torch.tensor([3]) outputs = model(input_ids, start_positions=start_positions, end_positions=end_positions) loss, start_scores, end_scores = outputs[:2] """ def __init__(self, config): super(XLMForQuestionAnswering, self).__init__(config) self.transformer = XLMModel(config) self.qa_outputs = SQuADHead(config) self.init_weights() def forward(self, input_ids, attention_mask=None, langs=None, token_type_ids=None, position_ids=None, lengths=None, cache=None, head_mask=None, start_positions=None, end_positions=None, is_impossible=None, cls_index=None, p_mask=None): transformer_outputs = self.transformer(input_ids, attention_mask=attention_mask, langs=langs, token_type_ids=token_type_ids, position_ids=position_ids, lengths=lengths, cache=cache, head_mask=head_mask) output = transformer_outputs[0] outputs = self.qa_outputs(output, start_positions=start_positions, end_positions=end_positions, cls_index=cls_index, is_impossible=is_impossible, p_mask=p_mask) outputs = outputs + transformer_outputs[1:] # Keep new_mems and attention/hidden states if they are here return outputs
40,005
49.195734
151
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tokenization_transfo_xl.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Tokenization classes for Transformer XL model. Adapted from https://github.com/kimiyoung/transformer-xl. """ from __future__ import (absolute_import, division, print_function, unicode_literals) import glob import logging import os import sys from collections import Counter, OrderedDict from io import open import torch import numpy as np from .file_utils import cached_path from .tokenization_utils import PreTrainedTokenizer if sys.version_info[0] == 2: import cPickle as pickle else: import pickle logger = logging.getLogger(__name__) VOCAB_FILES_NAMES = {'pretrained_vocab_file': 'vocab.bin', 'vocab_file': 'vocab.txt'} PRETRAINED_VOCAB_FILES_MAP = { 'pretrained_vocab_file': { 'transfo-xl-wt103': "https://s3.amazonaws.com/models.huggingface.co/bert/transfo-xl-wt103-vocab.bin", } } PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES = { 'transfo-xl-wt103': None, } PRETRAINED_CORPUS_ARCHIVE_MAP = { 'transfo-xl-wt103': "https://s3.amazonaws.com/models.huggingface.co/bert/transfo-xl-wt103-corpus.bin", } CORPUS_NAME = 'corpus.bin' class TransfoXLTokenizer(PreTrainedTokenizer): """ Transformer-XL tokenizer adapted from Vocab class in https://github.com/kimiyoung/transformer-xl """ vocab_files_names = VOCAB_FILES_NAMES pretrained_vocab_files_map = PRETRAINED_VOCAB_FILES_MAP max_model_input_sizes = PRETRAINED_POSITIONAL_EMBEDDINGS_SIZES def __init__(self, special=None, min_freq=0, max_size=None, lower_case=False, delimiter=None, vocab_file=None, pretrained_vocab_file=None, never_split=None, unk_token="<unk>", eos_token="<eos>", additional_special_tokens=["<formula>"], **kwargs): super(TransfoXLTokenizer, self).__init__(unk_token=unk_token, eos_token=eos_token, additional_special_tokens=additional_special_tokens, **kwargs) self.max_len_single_sentence = self.max_len # no default special tokens - you can update this value if you add special tokens self.max_len_sentences_pair = self.max_len # no default special tokens - you can update this value if you add special tokens if never_split is None: never_split = self.all_special_tokens if special is None: special = [] self.counter = Counter() self.special = special self.min_freq = min_freq self.max_size = max_size self.lower_case = lower_case self.delimiter = delimiter self.vocab_file = vocab_file self.never_split = never_split if pretrained_vocab_file is not None: # Hack because, honestly this tokenizer was not made to be used # in a library like ours, at all. vocab_dict = torch.load(pretrained_vocab_file) for key, value in vocab_dict.items(): if key not in self.__dict__: self.__dict__[key] = value if vocab_file is not None: self.build_vocab() def count_file(self, path, verbose=False, add_eos=False): if verbose: logger.info('counting file {} ...'.format(path)) assert os.path.exists(path) sents = [] with open(path, 'r', encoding='utf-8') as f: for idx, line in enumerate(f): if verbose and idx > 0 and idx % 500000 == 0: logger.info(' line {}'.format(idx)) symbols = self.tokenize(line, add_eos=add_eos) self.counter.update(symbols) sents.append(symbols) return sents def count_sents(self, sents, verbose=False): """ sents : a list of sentences, each a list of tokenized symbols """ if verbose: logger.info('counting {} sents ...'.format(len(sents))) for idx, symbols in enumerate(sents): if verbose and idx > 0 and idx % 500000 == 0: logger.info(' line {}'.format(idx)) self.counter.update(symbols) def _build_from_file(self, vocab_file): self.idx2sym = [] self.sym2idx = OrderedDict() with open(vocab_file, 'r', encoding='utf-8') as f: for line in f: symb = line.strip().split()[0] self.add_symbol(symb) if '<UNK>' in self.sym2idx: self.unk_idx = self.sym2idx['<UNK>'] elif '<unk>' in self.sym2idx: self.unk_idx = self.sym2idx['<unk>'] else: raise ValueError('No <unkown> token in vocabulary') def save_vocabulary(self, vocab_path): """Save the tokenizer vocabulary to a directory or file.""" if os.path.isdir(vocab_path): vocab_file = os.path.join(vocab_path, VOCAB_FILES_NAMES['pretrained_vocab_file']) torch.save(self.__dict__, vocab_file) return (vocab_file,) def build_vocab(self): if self.vocab_file: logger.info('building vocab from {}'.format(self.vocab_file)) self._build_from_file(self.vocab_file) logger.info('final vocab size {}'.format(len(self))) else: logger.info('building vocab with min_freq={}, max_size={}'.format( self.min_freq, self.max_size)) self.idx2sym = [] self.sym2idx = OrderedDict() for sym in self.special: self.add_special(sym) for sym, cnt in self.counter.most_common(self.max_size): if cnt < self.min_freq: break self.add_symbol(sym) logger.info('final vocab size {} from {} unique tokens'.format( len(self), len(self.counter))) def encode_file(self, path, ordered=False, verbose=False, add_eos=True, add_double_eos=False): if verbose: logger.info('encoding file {} ...'.format(path)) assert os.path.exists(path) encoded = [] with open(path, 'r', encoding='utf-8') as f: for idx, line in enumerate(f): if verbose and idx > 0 and idx % 500000 == 0: logger.info(' line {}'.format(idx)) symbols = self.tokenize(line, add_eos=add_eos, add_double_eos=add_double_eos) encoded.append(self.convert_to_tensor(symbols)) if ordered: encoded = torch.cat(encoded) return encoded def encode_sents(self, sents, ordered=False, verbose=False): if verbose: logger.info('encoding {} sents ...'.format(len(sents))) encoded = [] for idx, symbols in enumerate(sents): if verbose and idx > 0 and idx % 500000 == 0: logger.info(' line {}'.format(idx)) encoded.append(self.convert_to_tensor(symbols)) if ordered: encoded = torch.cat(encoded) return encoded def add_special(self, sym): if sym not in self.sym2idx: self.idx2sym.append(sym) self.sym2idx[sym] = len(self.idx2sym) - 1 setattr(self, '{}_idx'.format(sym.strip('<>')), self.sym2idx[sym]) def add_symbol(self, sym): if sym not in self.sym2idx: self.idx2sym.append(sym) self.sym2idx[sym] = len(self.idx2sym) - 1 def _convert_id_to_token(self, idx): """Converts an id in a token (BPE) using the vocab.""" assert 0 <= idx < len(self), 'Index {} out of vocabulary range'.format(idx) return self.idx2sym[idx] def _convert_token_to_id(self, sym): """ Converts a token (str/unicode) in an id using the vocab. """ if sym in self.sym2idx: return self.sym2idx[sym] else: # logger.info('encounter unk {}'.format(sym)) # assert '<eos>' not in sym if hasattr(self, 'unk_idx'): return self.sym2idx.get(sym, self.unk_idx) # Backward compatibility with pre-trained models elif '<unk>' in self.sym2idx: return self.sym2idx['<unk>'] elif '<UNK>' in self.sym2idx: return self.sym2idx['<UNK>'] else: raise ValueError('Token not in vocabulary and no <unk> token in vocabulary for replacement') def convert_tokens_to_string(self, tokens): """ Converts a sequence of tokens (string) in a single string. """ out_string = ' '.join(tokens).strip() return out_string def convert_to_tensor(self, symbols): return torch.LongTensor(self.convert_tokens_to_ids(symbols)) @property def vocab_size(self): return len(self.idx2sym) def _tokenize(self, line, add_eos=False, add_double_eos=False): line = line.strip() # convert to lower case if self.lower_case: line = line.lower() # empty delimiter '' will evaluate False if self.delimiter == '': symbols = line else: symbols = line.split(self.delimiter) if add_double_eos: # lm1b return ['<S>'] + symbols + ['<S>'] elif add_eos: return symbols + ['<eos>'] else: return symbols class LMOrderedIterator(object): def __init__(self, data, bsz, bptt, device='cpu', ext_len=None): """ data -- LongTensor -- the LongTensor is strictly ordered """ self.bsz = bsz self.bptt = bptt self.ext_len = ext_len if ext_len is not None else 0 self.device = device # Work out how cleanly we can divide the dataset into bsz parts. self.n_step = data.size(0) // bsz # Trim off any extra elements that wouldn't cleanly fit (remainders). data = data.narrow(0, 0, self.n_step * bsz) # Evenly divide the data across the bsz batches. self.data = data.view(bsz, -1).t().contiguous().to(device) # Number of mini-batches self.n_batch = (self.n_step + self.bptt - 1) // self.bptt def get_batch(self, i, bptt=None): if bptt is None: bptt = self.bptt seq_len = min(bptt, self.data.size(0) - 1 - i) end_idx = i + seq_len beg_idx = max(0, i - self.ext_len) data = self.data[beg_idx:end_idx] target = self.data[i+1:i+1+seq_len] data_out = data.transpose(0, 1).contiguous().to(self.device) target_out = target.transpose(0, 1).contiguous().to(self.device) return data_out, target_out, seq_len def get_fixlen_iter(self, start=0): for i in range(start, self.data.size(0) - 1, self.bptt): yield self.get_batch(i) def get_varlen_iter(self, start=0, std=5, min_len=5, max_deviation=3): max_len = self.bptt + max_deviation * std i = start while True: bptt = self.bptt if np.random.random() < 0.95 else self.bptt / 2. bptt = min(max_len, max(min_len, int(np.random.normal(bptt, std)))) data, target, seq_len = self.get_batch(i, bptt) i += seq_len yield data, target, seq_len if i >= self.data.size(0) - 2: break def __iter__(self): return self.get_fixlen_iter() class LMShuffledIterator(object): def __init__(self, data, bsz, bptt, device='cpu', ext_len=None, shuffle=False): """ data -- list[LongTensor] -- there is no order among the LongTensors """ self.data = data self.bsz = bsz self.bptt = bptt self.ext_len = ext_len if ext_len is not None else 0 self.device = device self.shuffle = shuffle def get_sent_stream(self): # index iterator epoch_indices = np.random.permutation(len(self.data)) if self.shuffle \ else np.array(range(len(self.data))) # sentence iterator for idx in epoch_indices: yield self.data[idx] def stream_iterator(self, sent_stream): # streams for each data in the batch streams = [None] * self.bsz data = torch.LongTensor(self.bptt, self.bsz) target = torch.LongTensor(self.bptt, self.bsz) n_retain = 0 while True: # data : [n_retain+bptt x bsz] # target : [bptt x bsz] data[n_retain:].fill_(-1) target.fill_(-1) valid_batch = True for i in range(self.bsz): n_filled = 0 try: while n_filled < self.bptt: if streams[i] is None or len(streams[i]) <= 1: streams[i] = next(sent_stream) # number of new tokens to fill in n_new = min(len(streams[i]) - 1, self.bptt - n_filled) # first n_retain tokens are retained from last batch data[n_retain+n_filled:n_retain+n_filled+n_new, i] = \ streams[i][:n_new] target[n_filled:n_filled+n_new, i] = \ streams[i][1:n_new+1] streams[i] = streams[i][n_new:] n_filled += n_new except StopIteration: valid_batch = False break if not valid_batch: return data_out = data.transpose(0, 1).contiguous().to(self.device) target_out = target.transpose(0, 1).contiguous().to(self.device) yield data_out, target_out, self.bptt n_retain = min(data.size(0), self.ext_len) if n_retain > 0: data[:n_retain] = data[-n_retain:] data.resize_(n_retain + self.bptt, data.size(1)) def __iter__(self): # sent_stream is an iterator sent_stream = self.get_sent_stream() for batch in self.stream_iterator(sent_stream): yield batch class LMMultiFileIterator(LMShuffledIterator): def __init__(self, paths, vocab, bsz, bptt, device='cpu', ext_len=None, shuffle=False): self.paths = paths self.vocab = vocab self.bsz = bsz self.bptt = bptt self.ext_len = ext_len if ext_len is not None else 0 self.device = device self.shuffle = shuffle def get_sent_stream(self, path): sents = self.vocab.encode_file(path, add_double_eos=True) if self.shuffle: np.random.shuffle(sents) sent_stream = iter(sents) return sent_stream def __iter__(self): if self.shuffle: np.random.shuffle(self.paths) for path in self.paths: # sent_stream is an iterator sent_stream = self.get_sent_stream(path) for batch in self.stream_iterator(sent_stream): yield batch class TransfoXLCorpus(object): @classmethod def from_pretrained(cls, pretrained_model_name_or_path, cache_dir=None, *inputs, **kwargs): """ Instantiate a pre-processed corpus. """ vocab = TransfoXLTokenizer.from_pretrained(pretrained_model_name_or_path, *inputs, **kwargs) if pretrained_model_name_or_path in PRETRAINED_CORPUS_ARCHIVE_MAP: corpus_file = PRETRAINED_CORPUS_ARCHIVE_MAP[pretrained_model_name_or_path] else: corpus_file = os.path.join(pretrained_model_name_or_path, CORPUS_NAME) # redirect to the cache, if necessary try: resolved_corpus_file = cached_path(corpus_file, cache_dir=cache_dir) except EnvironmentError: logger.error( "Corpus '{}' was not found in corpus list ({}). " "We assumed '{}' was a path or url but couldn't find files {} " "at this path or url.".format( pretrained_model_name_or_path, ', '.join(PRETRAINED_CORPUS_ARCHIVE_MAP.keys()), pretrained_model_name_or_path, corpus_file)) return None if resolved_corpus_file == corpus_file: logger.info("loading corpus file {}".format(corpus_file)) else: logger.info("loading corpus file {} from cache at {}".format( corpus_file, resolved_corpus_file)) # Instantiate tokenizer. corpus = cls(*inputs, **kwargs) corpus_dict = torch.load(resolved_corpus_file) for key, value in corpus_dict.items(): corpus.__dict__[key] = value corpus.vocab = vocab if corpus.train is not None: corpus.train = torch.tensor(corpus.train, dtype=torch.long) if corpus.valid is not None: corpus.valid = torch.tensor(corpus.valid, dtype=torch.long) if corpus.test is not None: corpus.test = torch.tensor(corpus.test, dtype=torch.long) return corpus def __init__(self, *args, **kwargs): self.vocab = TransfoXLTokenizer(*args, **kwargs) self.dataset = None self.train = None self.valid = None self.test = None def build_corpus(self, path, dataset): self.dataset = dataset if self.dataset in ['ptb', 'wt2', 'enwik8', 'text8']: self.vocab.count_file(os.path.join(path, 'train.txt')) self.vocab.count_file(os.path.join(path, 'valid.txt')) self.vocab.count_file(os.path.join(path, 'test.txt')) elif self.dataset == 'wt103': self.vocab.count_file(os.path.join(path, 'train.txt')) elif self.dataset == 'lm1b': train_path_pattern = os.path.join( path, '1-billion-word-language-modeling-benchmark-r13output', 'training-monolingual.tokenized.shuffled', 'news.en-*') train_paths = glob.glob(train_path_pattern) # the vocab will load from file when build_vocab() is called self.vocab.build_vocab() if self.dataset in ['ptb', 'wt2', 'wt103']: self.train = self.vocab.encode_file( os.path.join(path, 'train.txt'), ordered=True) self.valid = self.vocab.encode_file( os.path.join(path, 'valid.txt'), ordered=True) self.test = self.vocab.encode_file( os.path.join(path, 'test.txt'), ordered=True) elif self.dataset in ['enwik8', 'text8']: self.train = self.vocab.encode_file( os.path.join(path, 'train.txt'), ordered=True, add_eos=False) self.valid = self.vocab.encode_file( os.path.join(path, 'valid.txt'), ordered=True, add_eos=False) self.test = self.vocab.encode_file( os.path.join(path, 'test.txt'), ordered=True, add_eos=False) elif self.dataset == 'lm1b': self.train = train_paths self.valid = self.vocab.encode_file( os.path.join(path, 'valid.txt'), ordered=False, add_double_eos=True) self.test = self.vocab.encode_file( os.path.join(path, 'test.txt'), ordered=False, add_double_eos=True) def get_iterator(self, split, *args, **kwargs): if split == 'train': if self.dataset in ['ptb', 'wt2', 'wt103', 'enwik8', 'text8']: data_iter = LMOrderedIterator(self.train, *args, **kwargs) elif self.dataset == 'lm1b': kwargs['shuffle'] = True data_iter = LMMultiFileIterator(self.train, self.vocab, *args, **kwargs) elif split in ['valid', 'test']: data = self.valid if split == 'valid' else self.test if self.dataset in ['ptb', 'wt2', 'wt103', 'enwik8', 'text8']: data_iter = LMOrderedIterator(data, *args, **kwargs) elif self.dataset == 'lm1b': data_iter = LMShuffledIterator(data, *args, **kwargs) return data_iter def get_lm_corpus(datadir, dataset): fn = os.path.join(datadir, 'cache.pt') fn_pickle = os.path.join(datadir, 'cache.pkl') if os.path.exists(fn): logger.info('Loading cached dataset...') corpus = torch.load(fn_pickle) elif os.path.exists(fn): logger.info('Loading cached dataset from pickle...') with open(fn, "rb") as fp: corpus = pickle.load(fp) else: logger.info('Producing dataset {}...'.format(dataset)) kwargs = {} if dataset in ['wt103', 'wt2']: kwargs['special'] = ['<eos>'] kwargs['lower_case'] = False elif dataset == 'ptb': kwargs['special'] = ['<eos>'] kwargs['lower_case'] = True elif dataset == 'lm1b': kwargs['special'] = [] kwargs['lower_case'] = False kwargs['vocab_file'] = os.path.join(datadir, '1b_word_vocab.txt') elif dataset in ['enwik8', 'text8']: pass corpus = TransfoXLCorpus(datadir, dataset, **kwargs) torch.save(corpus, fn) return corpus
21,777
36.809028
133
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/convert_pytorch_checkpoint_to_tf.py
# coding=utf-8 # Copyright 2018 The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Convert Huggingface Pytorch checkpoint to Tensorflow checkpoint.""" import os import argparse import torch import numpy as np import tensorflow as tf from pytorch_transformers import BertModel def convert_pytorch_checkpoint_to_tf(model:BertModel, ckpt_dir:str, model_name:str): """ :param model:BertModel Pytorch model instance to be converted :param ckpt_dir: Tensorflow model directory :param model_name: model name :return: Currently supported HF models: Y BertModel N BertForMaskedLM N BertForPreTraining N BertForMultipleChoice N BertForNextSentencePrediction N BertForSequenceClassification N BertForQuestionAnswering """ tensors_to_transpose = ( "dense.weight", "attention.self.query", "attention.self.key", "attention.self.value" ) var_map = ( ('layer.', 'layer_'), ('word_embeddings.weight', 'word_embeddings'), ('position_embeddings.weight', 'position_embeddings'), ('token_type_embeddings.weight', 'token_type_embeddings'), ('.', '/'), ('LayerNorm/weight', 'LayerNorm/gamma'), ('LayerNorm/bias', 'LayerNorm/beta'), ('weight', 'kernel') ) if not os.path.isdir(ckpt_dir): os.makedirs(ckpt_dir) state_dict = model.state_dict() def to_tf_var_name(name:str): for patt, repl in iter(var_map): name = name.replace(patt, repl) return 'bert/{}'.format(name) def create_tf_var(tensor:np.ndarray, name:str, session:tf.Session): tf_dtype = tf.dtypes.as_dtype(tensor.dtype) tf_var = tf.get_variable(dtype=tf_dtype, shape=tensor.shape, name=name, initializer=tf.zeros_initializer()) session.run(tf.variables_initializer([tf_var])) session.run(tf_var) return tf_var tf.reset_default_graph() with tf.Session() as session: for var_name in state_dict: tf_name = to_tf_var_name(var_name) torch_tensor = state_dict[var_name].numpy() if any([x in var_name for x in tensors_to_transpose]): torch_tensor = torch_tensor.T tf_var = create_tf_var(tensor=torch_tensor, name=tf_name, session=session) tf.keras.backend.set_value(tf_var, torch_tensor) tf_weight = session.run(tf_var) print("Successfully created {}: {}".format(tf_name, np.allclose(tf_weight, torch_tensor))) saver = tf.train.Saver(tf.trainable_variables()) saver.save(session, os.path.join(ckpt_dir, model_name.replace("-", "_") + ".ckpt")) def main(raw_args=None): parser = argparse.ArgumentParser() parser.add_argument("--model_name", type=str, required=True, help="model name e.g. bert-base-uncased") parser.add_argument("--cache_dir", type=str, default=None, required=False, help="Directory containing pytorch model") parser.add_argument("--pytorch_model_path", type=str, required=True, help="/path/to/<pytorch-model-name>.bin") parser.add_argument("--tf_cache_dir", type=str, required=True, help="Directory in which to save tensorflow model") args = parser.parse_args(raw_args) model = BertModel.from_pretrained( pretrained_model_name_or_path=args.model_name, state_dict=torch.load(args.pytorch_model_path), cache_dir=args.cache_dir ) convert_pytorch_checkpoint_to_tf( model=model, ckpt_dir=args.tf_cache_dir, model_name=args.model_name ) if __name__ == "__main__": main()
4,486
33.251908
115
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_transfo_xl_utilities.py
# coding=utf-8 # Copyright 2018 Google AI, Google Brain and Carnegie Mellon University Authors and the HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Utilities for PyTorch Transformer XL model. Directly adapted from https://github.com/kimiyoung/transformer-xl. """ from collections import defaultdict import numpy as np import torch import torch.nn as nn import torch.nn.functional as F # CUDA_MAJOR = int(torch.version.cuda.split('.')[0]) # CUDA_MINOR = int(torch.version.cuda.split('.')[1]) class ProjectedAdaptiveLogSoftmax(nn.Module): def __init__(self, n_token, d_embed, d_proj, cutoffs, div_val=1, keep_order=False): super(ProjectedAdaptiveLogSoftmax, self).__init__() self.n_token = n_token self.d_embed = d_embed self.d_proj = d_proj self.cutoffs = cutoffs + [n_token] self.cutoff_ends = [0] + self.cutoffs self.div_val = div_val self.shortlist_size = self.cutoffs[0] self.n_clusters = len(self.cutoffs) - 1 self.head_size = self.shortlist_size + self.n_clusters if self.n_clusters > 0: self.cluster_weight = nn.Parameter(torch.zeros(self.n_clusters, self.d_embed)) self.cluster_bias = nn.Parameter(torch.zeros(self.n_clusters)) self.out_layers = nn.ModuleList() self.out_projs = nn.ParameterList() if div_val == 1: for i in range(len(self.cutoffs)): if d_proj != d_embed: self.out_projs.append( nn.Parameter(torch.FloatTensor(d_proj, d_embed)) ) else: self.out_projs.append(None) self.out_layers.append(nn.Linear(d_embed, n_token)) else: for i in range(len(self.cutoffs)): l_idx, r_idx = self.cutoff_ends[i], self.cutoff_ends[i+1] d_emb_i = d_embed // (div_val ** i) self.out_projs.append( nn.Parameter(torch.FloatTensor(d_proj, d_emb_i)) ) self.out_layers.append(nn.Linear(d_emb_i, r_idx-l_idx)) self.keep_order = keep_order def _compute_logit(self, hidden, weight, bias, proj): if proj is None: logit = F.linear(hidden, weight, bias=bias) else: # if CUDA_MAJOR <= 9 and CUDA_MINOR <= 1: proj_hid = F.linear(hidden, proj.t().contiguous()) logit = F.linear(proj_hid, weight, bias=bias) # else: # logit = torch.einsum('bd,de,ev->bv', (hidden, proj, weight.t())) # if bias is not None: # logit = logit + bias return logit def forward(self, hidden, labels=None, keep_order=False): ''' Params: hidden :: [len*bsz x d_proj] labels :: [len*bsz] Return: if labels is None: out :: [len*bsz] Negative log likelihood else: out :: [len*bsz x n_tokens] log probabilities of tokens over the vocabulary We could replace this implementation by the native PyTorch one if their's had an option to set bias on all clusters in the native one. here: https://github.com/pytorch/pytorch/blob/dbe6a7a9ff1a364a8706bf5df58a1ca96d2fd9da/torch/nn/modules/adaptive.py#L138 ''' if labels is not None: labels = labels.view(-1) if hidden.size(0) != labels.size(0): raise RuntimeError('Input and labels should have the same size ' 'in the batch dimension.') if self.n_clusters == 0: logit = self._compute_logit(hidden, self.out_layers[0].weight, self.out_layers[0].bias, self.out_projs[0]) if labels is not None: out = -F.log_softmax(logit, dim=-1) \ .gather(1, labels.unsqueeze(1)).squeeze(1) else: out = F.log_softmax(logit, dim=-1) else: # construct weights and biases weights, biases = [], [] for i in range(len(self.cutoffs)): if self.div_val == 1: l_idx, r_idx = self.cutoff_ends[i], self.cutoff_ends[i + 1] weight_i = self.out_layers[0].weight[l_idx:r_idx] bias_i = self.out_layers[0].bias[l_idx:r_idx] else: weight_i = self.out_layers[i].weight bias_i = self.out_layers[i].bias if i == 0: weight_i = torch.cat( [weight_i, self.cluster_weight], dim=0) bias_i = torch.cat( [bias_i, self.cluster_bias], dim=0) weights.append(weight_i) biases.append(bias_i) head_weight, head_bias, head_proj = weights[0], biases[0], self.out_projs[0] head_logit = self._compute_logit(hidden, head_weight, head_bias, head_proj) head_logprob = F.log_softmax(head_logit, dim=1) if labels is None: out = hidden.new_empty((head_logit.size(0), self.n_token)) else: out = torch.zeros_like(labels, dtype=hidden.dtype, device=hidden.device) offset = 0 cutoff_values = [0] + self.cutoffs for i in range(len(cutoff_values) - 1): l_idx, r_idx = cutoff_values[i], cutoff_values[i + 1] if labels is not None: mask_i = (labels >= l_idx) & (labels < r_idx) indices_i = mask_i.nonzero().squeeze() if indices_i.numel() == 0: continue target_i = labels.index_select(0, indices_i) - l_idx head_logprob_i = head_logprob.index_select(0, indices_i) hidden_i = hidden.index_select(0, indices_i) else: hidden_i = hidden if i == 0: if labels is not None: logprob_i = head_logprob_i.gather(1, target_i[:, None]).squeeze(1) else: out[:, :self.cutoffs[0]] = head_logprob[:, :self.cutoffs[0]] else: weight_i, bias_i, proj_i = weights[i], biases[i], self.out_projs[i] tail_logit_i = self._compute_logit(hidden_i, weight_i, bias_i, proj_i) tail_logprob_i = F.log_softmax(tail_logit_i, dim=1) cluster_prob_idx = self.cutoffs[0] + i - 1 # No probability for the head cluster if labels is not None: logprob_i = head_logprob_i[:, cluster_prob_idx] \ + tail_logprob_i.gather(1, target_i[:, None]).squeeze(1) else: logprob_i = head_logprob[:, cluster_prob_idx, None] + tail_logprob_i out[:, l_idx:r_idx] = logprob_i if labels is not None: if (hasattr(self, 'keep_order') and self.keep_order) or keep_order: out.index_copy_(0, indices_i, -logprob_i) else: out[offset:offset+logprob_i.size(0)].copy_(-logprob_i) offset += logprob_i.size(0) return out def log_prob(self, hidden): r""" Computes log probabilities for all :math:`n\_classes` From: https://github.com/pytorch/pytorch/blob/master/torch/nn/modules/adaptive.py Args: hidden (Tensor): a minibatch of examples Returns: log-probabilities of for each class :math:`c` in range :math:`0 <= c <= n\_classes`, where :math:`n\_classes` is a parameter passed to ``AdaptiveLogSoftmaxWithLoss`` constructor. Shape: - Input: :math:`(N, in\_features)` - Output: :math:`(N, n\_classes)` """ if self.n_clusters == 0: logit = self._compute_logit(hidden, self.out_layers[0].weight, self.out_layers[0].bias, self.out_projs[0]) return F.log_softmax(logit, dim=-1) else: # construct weights and biases weights, biases = [], [] for i in range(len(self.cutoffs)): if self.div_val == 1: l_idx, r_idx = self.cutoff_ends[i], self.cutoff_ends[i + 1] weight_i = self.out_layers[0].weight[l_idx:r_idx] bias_i = self.out_layers[0].bias[l_idx:r_idx] else: weight_i = self.out_layers[i].weight bias_i = self.out_layers[i].bias if i == 0: weight_i = torch.cat( [weight_i, self.cluster_weight], dim=0) bias_i = torch.cat( [bias_i, self.cluster_bias], dim=0) weights.append(weight_i) biases.append(bias_i) head_weight, head_bias, head_proj = weights[0], biases[0], self.out_projs[0] head_logit = self._compute_logit(hidden, head_weight, head_bias, head_proj) out = hidden.new_empty((head_logit.size(0), self.n_token)) head_logprob = F.log_softmax(head_logit, dim=1) cutoff_values = [0] + self.cutoffs for i in range(len(cutoff_values) - 1): start_idx, stop_idx = cutoff_values[i], cutoff_values[i + 1] if i == 0: out[:, :self.cutoffs[0]] = head_logprob[:, :self.cutoffs[0]] else: weight_i, bias_i, proj_i = weights[i], biases[i], self.out_projs[i] tail_logit_i = self._compute_logit(hidden, weight_i, bias_i, proj_i) tail_logprob_i = F.log_softmax(tail_logit_i, dim=1) logprob_i = head_logprob[:, -i] + tail_logprob_i out[:, start_idx, stop_idx] = logprob_i return out class LogUniformSampler(object): def __init__(self, range_max, n_sample): """ Reference : https://github.com/tensorflow/tensorflow/blob/r1.10/tensorflow/python/ops/candidate_sampling_ops.py `P(class) = (log(class + 2) - log(class + 1)) / log(range_max + 1)` expected count can be approximated by 1 - (1 - p)^n and we use a numerically stable version -expm1(num_tries * log1p(-p)) Our implementation fixes num_tries at 2 * n_sample, and the actual #samples will vary from run to run """ with torch.no_grad(): self.range_max = range_max log_indices = torch.arange(1., range_max+2., 1.).log_() self.dist = (log_indices[1:] - log_indices[:-1]) / log_indices[-1] self.log_q = (- (-self.dist.double().log1p_() * 2 * n_sample).expm1_()).log_().float() self.n_sample = n_sample def sample(self, labels): """ labels: [b1, b2] Return true_log_probs: [b1, b2] samp_log_probs: [n_sample] neg_samples: [n_sample] """ # neg_samples = torch.empty(0).long() n_sample = self.n_sample n_tries = 2 * n_sample with torch.no_grad(): neg_samples = torch.multinomial(self.dist, n_tries, replacement=True).unique() device = labels.device neg_samples = neg_samples.to(device) true_log_probs = self.log_q[labels].to(device) samp_log_probs = self.log_q[neg_samples].to(device) return true_log_probs, samp_log_probs, neg_samples def sample_logits(embedding, bias, labels, inputs, sampler): """ embedding: an nn.Embedding layer bias: [n_vocab] labels: [b1, b2] inputs: [b1, b2, n_emb] sampler: you may use a LogUniformSampler Return logits: [b1, b2, 1 + n_sample] """ true_log_probs, samp_log_probs, neg_samples = sampler.sample(labels) n_sample = neg_samples.size(0) b1, b2 = labels.size(0), labels.size(1) all_ids = torch.cat([labels.view(-1), neg_samples]) all_w = embedding(all_ids) true_w = all_w[: -n_sample].view(b1, b2, -1) sample_w = all_w[- n_sample:].view(n_sample, -1) all_b = bias[all_ids] true_b = all_b[: -n_sample].view(b1, b2) sample_b = all_b[- n_sample:] hit = (labels[:, :, None] == neg_samples).detach() true_logits = torch.einsum('ijk,ijk->ij', [true_w, inputs]) + true_b - true_log_probs sample_logits = torch.einsum('lk,ijk->ijl', [sample_w, inputs]) + sample_b - samp_log_probs sample_logits.masked_fill_(hit, -1e30) logits = torch.cat([true_logits[:, :, None], sample_logits], -1) return logits
13,568
39.747748
132
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/modeling_roberta.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors and The HuggingFace Inc. team. # Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PyTorch RoBERTa model. """ from __future__ import (absolute_import, division, print_function, unicode_literals) import logging import torch import torch.nn as nn from torch.nn import CrossEntropyLoss, MSELoss from .modeling_bert import BertEmbeddings, BertLayerNorm, BertModel, BertPreTrainedModel, gelu from .configuration_roberta import RobertaConfig from .file_utils import add_start_docstrings logger = logging.getLogger(__name__) ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP = { 'roberta-base': "https://s3.amazonaws.com/models.huggingface.co/bert/roberta-base-pytorch_model.bin", 'roberta-large': "https://s3.amazonaws.com/models.huggingface.co/bert/roberta-large-pytorch_model.bin", 'roberta-large-mnli': "https://s3.amazonaws.com/models.huggingface.co/bert/roberta-large-mnli-pytorch_model.bin", } class RobertaEmbeddings(BertEmbeddings): """ Same as BertEmbeddings with a tiny tweak for positional embeddings indexing. """ def __init__(self, config): super(RobertaEmbeddings, self).__init__(config) self.padding_idx = 1 def forward(self, input_ids, token_type_ids=None, position_ids=None): seq_length = input_ids.size(1) if position_ids is None: # Position numbers begin at padding_idx+1. Padding symbols are ignored. # cf. fairseq's `utils.make_positions` position_ids = torch.arange(self.padding_idx+1, seq_length+self.padding_idx+1, dtype=torch.long, device=input_ids.device) position_ids = position_ids.unsqueeze(0).expand_as(input_ids) return super(RobertaEmbeddings, self).forward(input_ids, token_type_ids=token_type_ids, position_ids=position_ids) ROBERTA_START_DOCSTRING = r""" The RoBERTa model was proposed in `RoBERTa: A Robustly Optimized BERT Pretraining Approach`_ by Yinhan Liu, Myle Ott, Naman Goyal, Jingfei Du, Mandar Joshi, Danqi Chen, Omer Levy, Mike Lewis, Luke Zettlemoyer, Veselin Stoyanov. It is based on Google's BERT model released in 2018. It builds on BERT and modifies key hyperparameters, removing the next-sentence pretraining objective and training with much larger mini-batches and learning rates. This implementation is the same as BertModel with a tiny embeddings tweak as well as a setup for Roberta pretrained models. This model is a PyTorch `torch.nn.Module`_ sub-class. Use it as a regular PyTorch Module and refer to the PyTorch documentation for all matter related to general usage and behavior. .. _`RoBERTa: A Robustly Optimized BERT Pretraining Approach`: https://arxiv.org/abs/1907.11692 .. _`torch.nn.Module`: https://pytorch.org/docs/stable/nn.html#module Parameters: config (:class:`~pytorch_transformers.RobertaConfig`): Model configuration class with all the parameters of the model. Initializing with a config file does not load the weights associated with the model, only the configuration. Check out the :meth:`~pytorch_transformers.PreTrainedModel.from_pretrained` method to load the model weights. """ ROBERTA_INPUTS_DOCSTRING = r""" Inputs: **input_ids**: ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of input sequence tokens in the vocabulary. To match pre-training, RoBERTa input sequence should be formatted with <s> and </s> tokens as follows: (a) For sequence pairs: ``tokens: <s> Is this Jacksonville ? </s> </s> No it is not . </s>`` (b) For single sequences: ``tokens: <s> the dog is hairy . </s>`` Fully encoded sequences or sequence pairs can be obtained using the RobertaTokenizer.encode function with the ``add_special_tokens`` parameter set to ``True``. RoBERTa is a model with absolute position embeddings so it's usually advised to pad the inputs on the right rather than the left. See :func:`pytorch_transformers.PreTrainedTokenizer.encode` and :func:`pytorch_transformers.PreTrainedTokenizer.convert_tokens_to_ids` for details. **attention_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(batch_size, sequence_length)``: Mask to avoid performing attention on padding token indices. Mask values selected in ``[0, 1]``: ``1`` for tokens that are NOT MASKED, ``0`` for MASKED tokens. **token_type_ids**: (`optional` need to be trained) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Optional segment token indices to indicate first and second portions of the inputs. This embedding matrice is not trained (not pretrained during RoBERTa pretraining), you will have to train it during finetuning. Indices are selected in ``[0, 1]``: ``0`` corresponds to a `sentence A` token, ``1`` corresponds to a `sentence B` token (see `BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding`_ for more details). **position_ids**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Indices of positions of each input sequence tokens in the position embeddings. Selected in the range ``[0, config.max_position_embeddings - 1[``. **head_mask**: (`optional`) ``torch.FloatTensor`` of shape ``(num_heads,)`` or ``(num_layers, num_heads)``: Mask to nullify selected heads of the self-attention modules. Mask values selected in ``[0, 1]``: ``1`` indicates the head is **not masked**, ``0`` indicates the head is **masked**. """ @add_start_docstrings("The bare RoBERTa Model transformer outputing raw hidden-states without any specific head on top.", ROBERTA_START_DOCSTRING, ROBERTA_INPUTS_DOCSTRING) class RobertaModel(BertModel): r""" Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **last_hidden_state**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, hidden_size)`` Sequence of hidden-states at the output of the last layer of the model. **pooler_output**: ``torch.FloatTensor`` of shape ``(batch_size, hidden_size)`` Last layer hidden-state of the first token of the sequence (classification token) further processed by a Linear layer and a Tanh activation function. The Linear layer weights are trained from the next sentence prediction (classification) objective during Bert pretraining. This output is usually *not* a good summary of the semantic content of the input, you're often better with averaging or pooling the sequence of hidden-states for the whole input sequence. **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = RobertaTokenizer.from_pretrained('roberta-base') model = RobertaModel.from_pretrained('roberta-base') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids) last_hidden_states = outputs[0] # The last hidden-state is the first element of the output tuple """ config_class = RobertaConfig pretrained_model_archive_map = ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP base_model_prefix = "roberta" def __init__(self, config): super(RobertaModel, self).__init__(config) self.embeddings = RobertaEmbeddings(config) self.init_weights() def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None): if input_ids[:, 0].sum().item() != 0: logger.warning("A sequence with no special tokens has been passed to the RoBERTa model. " "This model requires special tokens in order to work. " "Please specify add_special_tokens=True in your encoding.") return super(RobertaModel, self).forward(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) @add_start_docstrings("""RoBERTa Model with a `language modeling` head on top. """, ROBERTA_START_DOCSTRING, ROBERTA_INPUTS_DOCSTRING) class RobertaForMaskedLM(BertPreTrainedModel): r""" **masked_lm_labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size, sequence_length)``: Labels for computing the masked language modeling loss. Indices should be in ``[-1, 0, ..., config.vocab_size]`` (see ``input_ids`` docstring) Tokens with indices set to ``-1`` are ignored (masked), the loss is only computed for the tokens with labels in ``[0, ..., config.vocab_size]`` Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``masked_lm_labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Masked language modeling loss. **prediction_scores**: ``torch.FloatTensor`` of shape ``(batch_size, sequence_length, config.vocab_size)`` Prediction scores of the language modeling head (scores for each vocabulary token before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = RobertaTokenizer.from_pretrained('roberta-base') model = RobertaForMaskedLM.from_pretrained('roberta-base') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 outputs = model(input_ids, masked_lm_labels=input_ids) loss, prediction_scores = outputs[:2] """ config_class = RobertaConfig pretrained_model_archive_map = ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP base_model_prefix = "roberta" def __init__(self, config): super(RobertaForMaskedLM, self).__init__(config) self.roberta = RobertaModel(config) self.lm_head = RobertaLMHead(config) self.init_weights() self.tie_weights() def tie_weights(self): """ Make sure we are sharing the input and output embeddings. Export to TorchScript can't handle parameter sharing so we are cloning them instead. """ self._tie_or_clone_weights(self.lm_head.decoder, self.roberta.embeddings.word_embeddings) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, masked_lm_labels=None): outputs = self.roberta(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output = outputs[0] prediction_scores = self.lm_head(sequence_output) outputs = (prediction_scores,) + outputs[2:] # Add hidden states and attention if they are here if masked_lm_labels is not None: loss_fct = CrossEntropyLoss(ignore_index=-1) masked_lm_loss = loss_fct(prediction_scores.view(-1, self.config.vocab_size), masked_lm_labels.view(-1)) outputs = (masked_lm_loss,) + outputs return outputs # (masked_lm_loss), prediction_scores, (hidden_states), (attentions) class RobertaLMHead(nn.Module): """Roberta Head for masked language modeling.""" def __init__(self, config): super(RobertaLMHead, self).__init__() self.dense = nn.Linear(config.hidden_size, config.hidden_size) self.layer_norm = BertLayerNorm(config.hidden_size, eps=config.layer_norm_eps) self.decoder = nn.Linear(config.hidden_size, config.vocab_size, bias=False) self.bias = nn.Parameter(torch.zeros(config.vocab_size)) def forward(self, features, **kwargs): x = self.dense(features) x = gelu(x) x = self.layer_norm(x) # project back to size of vocabulary with bias x = self.decoder(x) + self.bias return x @add_start_docstrings("""RoBERTa Model transformer with a sequence classification/regression head on top (a linear layer on top of the pooled output) e.g. for GLUE tasks. """, ROBERTA_START_DOCSTRING, ROBERTA_INPUTS_DOCSTRING) class RobertaForSequenceClassification(BertPreTrainedModel): r""" **labels**: (`optional`) ``torch.LongTensor`` of shape ``(batch_size,)``: Labels for computing the sequence classification/regression loss. Indices should be in ``[0, ..., config.num_labels]``. If ``config.num_labels == 1`` a regression loss is computed (Mean-Square loss), If ``config.num_labels > 1`` a classification loss is computed (Cross-Entropy). Outputs: `Tuple` comprising various elements depending on the configuration (config) and inputs: **loss**: (`optional`, returned when ``labels`` is provided) ``torch.FloatTensor`` of shape ``(1,)``: Classification (or regression if config.num_labels==1) loss. **logits**: ``torch.FloatTensor`` of shape ``(batch_size, config.num_labels)`` Classification (or regression if config.num_labels==1) scores (before SoftMax). **hidden_states**: (`optional`, returned when ``config.output_hidden_states=True``) list of ``torch.FloatTensor`` (one for the output of each layer + the output of the embeddings) of shape ``(batch_size, sequence_length, hidden_size)``: Hidden-states of the model at the output of each layer plus the initial embedding outputs. **attentions**: (`optional`, returned when ``config.output_attentions=True``) list of ``torch.FloatTensor`` (one for each layer) of shape ``(batch_size, num_heads, sequence_length, sequence_length)``: Attentions weights after the attention softmax, used to compute the weighted average in the self-attention heads. Examples:: tokenizer = RoertaTokenizer.from_pretrained('roberta-base') model = RobertaForSequenceClassification.from_pretrained('roberta-base') input_ids = torch.tensor(tokenizer.encode("Hello, my dog is cute")).unsqueeze(0) # Batch size 1 labels = torch.tensor([1]).unsqueeze(0) # Batch size 1 outputs = model(input_ids, labels=labels) loss, logits = outputs[:2] """ config_class = RobertaConfig pretrained_model_archive_map = ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP base_model_prefix = "roberta" def __init__(self, config): super(RobertaForSequenceClassification, self).__init__(config) self.num_labels = config.num_labels self.roberta = RobertaModel(config) self.classifier = RobertaClassificationHead(config) def forward(self, input_ids, attention_mask=None, token_type_ids=None, position_ids=None, head_mask=None, labels=None): outputs = self.roberta(input_ids, attention_mask=attention_mask, token_type_ids=token_type_ids, position_ids=position_ids, head_mask=head_mask) sequence_output = outputs[0] logits = self.classifier(sequence_output) outputs = (logits,) + outputs[2:] if labels is not None: if self.num_labels == 1: # We are doing regression loss_fct = MSELoss() loss = loss_fct(logits.view(-1), labels.view(-1)) else: loss_fct = CrossEntropyLoss() loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1)) outputs = (loss,) + outputs return outputs # (loss), logits, (hidden_states), (attentions) class RobertaClassificationHead(nn.Module): """Head for sentence-level classification tasks.""" def __init__(self, config): super(RobertaClassificationHead, self).__init__() self.dense = nn.Linear(config.hidden_size, config.hidden_size) self.dropout = nn.Dropout(config.hidden_dropout_prob) self.out_proj = nn.Linear(config.hidden_size, config.num_labels) def forward(self, features, **kwargs): x = features[:, 0, :] # take <s> token (equiv. to [CLS]) x = self.dropout(x) x = self.dense(x) x = torch.tanh(x) x = self.dropout(x) x = self.out_proj(x) return x
18,955
51.655556
134
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tokenization_utils.py
# coding=utf-8 # Copyright 2018 The Open AI Team Authors and The HuggingFace Inc. team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tokenization classes for OpenAI GPT.""" from __future__ import (absolute_import, division, print_function, unicode_literals) import logging import os import json import six import copy from io import open from .file_utils import cached_path logger = logging.getLogger(__name__) SPECIAL_TOKENS_MAP_FILE = 'special_tokens_map.json' ADDED_TOKENS_FILE = 'added_tokens.json' TOKENIZER_CONFIG_FILE = 'tokenizer_config.json' class PreTrainedTokenizer(object): """ Base class for all tokenizers. Handle all the shared methods for tokenization and special tokens as well as methods dowloading/caching/loading pretrained tokenizers as well as adding tokens to the vocabulary. This class also contain the added tokens in a unified way on top of all tokenizers so we don't have to handle the specific vocabulary augmentation methods of the various underlying dictionary structures (BPE, sentencepiece...). Class attributes (overridden by derived classes): - ``vocab_files_names``: a python ``dict`` with, as keys, the ``__init__`` keyword name of each vocabulary file required by the model, and as associated values, the filename for saving the associated file (string). - ``pretrained_vocab_files_map``: a python ``dict of dict`` the high-level keys being the ``__init__`` keyword name of each vocabulary file required by the model, the low-level being the `short-cut-names` (string) of the pretrained models with, as associated values, the `url` (string) to the associated pretrained vocabulary file. - ``max_model_input_sizes``: a python ``dict`` with, as keys, the `short-cut-names` (string) of the pretrained models, and as associated values, the maximum length of the sequence inputs of this model, or None if the model has no maximum input size. - ``pretrained_init_configuration``: a python ``dict`` with, as keys, the `short-cut-names` (string) of the pretrained models, and as associated values, a dictionnary of specific arguments to pass to the ``__init__``method of the tokenizer class for this pretrained model when loading the tokenizer with the ``from_pretrained()`` method. Parameters: - ``bos_token``: (`Optional`) string: a beginning of sentence token. Will be associated to ``self.bos_token`` and ``self.bos_token_id`` - ``eos_token``: (`Optional`) string: an end of sentence token. Will be associated to ``self.eos_token`` and ``self.eos_token_id`` - ``unk_token``: (`Optional`) string: an unknown token. Will be associated to ``self.unk_token`` and ``self.unk_token_id`` - ``sep_token``: (`Optional`) string: a separation token (e.g. to separate context and query in an input sequence). Will be associated to ``self.sep_token`` and ``self.sep_token_id`` - ``pad_token``: (`Optional`) string: a padding token. Will be associated to ``self.pad_token`` and ``self.pad_token_id`` - ``cls_token``: (`Optional`) string: a classification token (e.g. to extract a summary of an input sequence leveraging self-attention along the full depth of the model). Will be associated to ``self.cls_token`` and ``self.cls_token_id`` - ``mask_token``: (`Optional`) string: a masking token (e.g. when training a model with masked-language modeling). Will be associated to ``self.mask_token`` and ``self.mask_token_id`` - ``additional_special_tokens``: (`Optional`) list: a list of additional special tokens. Adding all special tokens here ensure they won't be split by the tokenization process. Will be associated to ``self.additional_special_tokens`` and ``self.additional_special_tokens_ids`` """ vocab_files_names = {} pretrained_vocab_files_map = {} pretrained_init_configuration = {} max_model_input_sizes = {} SPECIAL_TOKENS_ATTRIBUTES = ["bos_token", "eos_token", "unk_token", "sep_token", "pad_token", "cls_token", "mask_token", "additional_special_tokens"] @property def bos_token(self): """ Beginning of sentence token (string). Log an error if used while not having been set. """ if self._bos_token is None: logger.error("Using bos_token, but it is not set yet.") return self._bos_token @property def eos_token(self): """ End of sentence token (string). Log an error if used while not having been set. """ if self._eos_token is None: logger.error("Using eos_token, but it is not set yet.") return self._eos_token @property def unk_token(self): """ Unknown token (string). Log an error if used while not having been set. """ if self._unk_token is None: logger.error("Using unk_token, but it is not set yet.") return self._unk_token @property def sep_token(self): """ Separation token (string). E.g. separate context and query in an input sequence. Log an error if used while not having been set. """ if self._sep_token is None: logger.error("Using sep_token, but it is not set yet.") return self._sep_token @property def pad_token(self): """ Padding token (string). Log an error if used while not having been set. """ if self._pad_token is None: logger.error("Using pad_token, but it is not set yet.") return self._pad_token @property def cls_token(self): """ Classification token (string). E.g. to extract a summary of an input sequence leveraging self-attention along the full depth of the model. Log an error if used while not having been set. """ if self._cls_token is None: logger.error("Using cls_token, but it is not set yet.") return self._cls_token @property def mask_token(self): """ Mask token (string). E.g. when training a model with masked-language modeling. Log an error if used while not having been set. """ if self._mask_token is None: logger.error("Using mask_token, but it is not set yet.") return self._mask_token @property def additional_special_tokens(self): """ All the additional special tokens you may want to use (list of strings). Log an error if used while not having been set. """ if self._additional_special_tokens is None: logger.error("Using additional_special_tokens, but it is not set yet.") return self._additional_special_tokens @bos_token.setter def bos_token(self, value): self._bos_token = value @eos_token.setter def eos_token(self, value): self._eos_token = value @unk_token.setter def unk_token(self, value): self._unk_token = value @sep_token.setter def sep_token(self, value): self._sep_token = value @pad_token.setter def pad_token(self, value): self._pad_token = value @cls_token.setter def cls_token(self, value): self._cls_token = value @mask_token.setter def mask_token(self, value): self._mask_token = value @additional_special_tokens.setter def additional_special_tokens(self, value): self._additional_special_tokens = value @property def bos_token_id(self): """ Id of the beginning of sentence token in the vocabulary. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.bos_token) @property def eos_token_id(self): """ Id of the end of sentence token in the vocabulary. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.eos_token) @property def unk_token_id(self): """ Id of the unknown token in the vocabulary. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.unk_token) @property def sep_token_id(self): """ Id of the separation token in the vocabulary. E.g. separate context and query in an input sequence. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.sep_token) @property def pad_token_id(self): """ Id of the padding token in the vocabulary. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.pad_token) @property def cls_token_id(self): """ Id of the classification token in the vocabulary. E.g. to extract a summary of an input sequence leveraging self-attention along the full depth of the model. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.cls_token) @property def mask_token_id(self): """ Id of the mask token in the vocabulary. E.g. when training a model with masked-language modeling. Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.mask_token) @property def additional_special_tokens_ids(self): """ Ids of all the additional special tokens in the vocabulary (list of integers). Log an error if used while not having been set. """ return self.convert_tokens_to_ids(self.additional_special_tokens) def __init__(self, max_len=None, **kwargs): self._bos_token = None self._eos_token = None self._unk_token = None self._sep_token = None self._pad_token = None self._cls_token = None self._mask_token = None self._additional_special_tokens = [] self.max_len = max_len if max_len is not None else int(1e12) # Added tokens self.added_tokens_encoder = {} self.added_tokens_decoder = {} # inputs and kwargs for saving and re-loading (see ``from_pretrained`` and ``save_pretrained``) self.init_inputs = () self.init_kwargs = {} for key, value in kwargs.items(): if key in self.SPECIAL_TOKENS_ATTRIBUTES: if key == 'additional_special_tokens': assert isinstance(value, (list, tuple)) and all(isinstance(t, str) or (six.PY2 and isinstance(t, unicode)) for t in value) else: assert isinstance(value, str) or (six.PY2 and isinstance(value, unicode)) setattr(self, key, value) @classmethod def from_pretrained(cls, *inputs, **kwargs): r""" Instantiate a :class:`~pytorch_transformers.PreTrainedTokenizer` (or a derived class) from a predefined tokenizer. Args: pretrained_model_name_or_path: either: - a string with the `shortcut name` of a predefined tokenizer to load from cache or download, e.g.: ``bert-base-uncased``. - a path to a `directory` containing vocabulary files required by the tokenizer, for instance saved using the :func:`~pytorch_transformers.PreTrainedTokenizer.save_pretrained` method, e.g.: ``./my_model_directory/``. - (not applicable to all derived classes) a path or url to a single saved vocabulary file if and only if the tokenizer only requires a single vocabulary file (e.g. Bert, XLNet), e.g.: ``./my_model_directory/vocab.txt``. cache_dir: (`optional`) string: Path to a directory in which a downloaded predefined tokenizer vocabulary files should be cached if the standard cache should not be used. force_download: (`optional`) boolean, default False: Force to (re-)download the vocabulary files and override the cached versions if they exists. proxies: (`optional`) dict, default None: A dictionary of proxy servers to use by protocol or endpoint, e.g.: {'http': 'foo.bar:3128', 'http://hostname': 'foo.bar:4012'}. The proxies are used on each request. inputs: (`optional`) positional arguments: will be passed to the Tokenizer ``__init__`` method. kwargs: (`optional`) keyword arguments: will be passed to the Tokenizer ``__init__`` method. Can be used to set special tokens like ``bos_token``, ``eos_token``, ``unk_token``, ``sep_token``, ``pad_token``, ``cls_token``, ``mask_token``, ``additional_special_tokens``. See parameters in the doc string of :class:`~pytorch_transformers.PreTrainedTokenizer` for details. Examples:: # We can't instantiate directly the base class `PreTrainedTokenizer` so let's show our examples on a derived class: BertTokenizer # Download vocabulary from S3 and cache. tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') # If vocabulary files are in a directory (e.g. tokenizer was saved using `save_pretrained('./test/saved_model/')`) tokenizer = BertTokenizer.from_pretrained('./test/saved_model/') # If the tokenizer uses a single vocabulary file, you can point directly to this file tokenizer = BertTokenizer.from_pretrained('./test/saved_model/my_vocab.txt') # You can link tokens to special vocabulary when instantiating tokenizer = BertTokenizer.from_pretrained('bert-base-uncased', unk_token='<unk>') # You should be sure '<unk>' is in the vocabulary when doing that. # Otherwise use tokenizer.add_special_tokens({'unk_token': '<unk>'}) instead) assert tokenizer.unk_token == '<unk>' """ return cls._from_pretrained(*inputs, **kwargs) @classmethod def _from_pretrained(cls, pretrained_model_name_or_path, *init_inputs, **kwargs): cache_dir = kwargs.pop('cache_dir', None) force_download = kwargs.pop('force_download', False) proxies = kwargs.pop('proxies', None) s3_models = list(cls.max_model_input_sizes.keys()) vocab_files = {} init_configuration = {} if pretrained_model_name_or_path in s3_models: # Get the vocabulary from AWS S3 bucket for file_id, map_list in cls.pretrained_vocab_files_map.items(): vocab_files[file_id] = map_list[pretrained_model_name_or_path] if cls.pretrained_init_configuration and pretrained_model_name_or_path in cls.pretrained_init_configuration: init_configuration = cls.pretrained_init_configuration[pretrained_model_name_or_path] else: # Get the vocabulary from local files logger.info( "Model name '{}' not found in model shortcut name list ({}). " "Assuming '{}' is a path or url to a directory containing tokenizer files.".format( pretrained_model_name_or_path, ', '.join(s3_models), pretrained_model_name_or_path)) # Look for the tokenizer main vocabulary files for file_id, file_name in cls.vocab_files_names.items(): if os.path.isdir(pretrained_model_name_or_path): # If a directory is provided we look for the standard filenames full_file_name = os.path.join(pretrained_model_name_or_path, file_name) else: # If a path to a file is provided we use it (will only work for non-BPE tokenizer using a single vocabulary file) full_file_name = pretrained_model_name_or_path if not os.path.exists(full_file_name): logger.info("Didn't find file {}. We won't load it.".format(full_file_name)) full_file_name = None vocab_files[file_id] = full_file_name # Look for the additional tokens files additional_files_names = {'added_tokens_file': ADDED_TOKENS_FILE, 'special_tokens_map_file': SPECIAL_TOKENS_MAP_FILE, 'tokenizer_config_file': TOKENIZER_CONFIG_FILE, } # If a path to a file was provided, get the parent directory saved_directory = pretrained_model_name_or_path if os.path.exists(saved_directory) and not os.path.isdir(saved_directory): saved_directory = os.path.dirname(saved_directory) for file_id, file_name in additional_files_names.items(): full_file_name = os.path.join(saved_directory, file_name) if not os.path.exists(full_file_name): logger.info("Didn't find file {}. We won't load it.".format(full_file_name)) full_file_name = None vocab_files[file_id] = full_file_name if all(full_file_name is None for full_file_name in vocab_files.values()): logger.error( "Model name '{}' was not found in model name list ({}). " "We assumed '{}' was a path or url but couldn't find tokenizer files" "at this path or url.".format( pretrained_model_name_or_path, ', '.join(s3_models), pretrained_model_name_or_path, )) return None # Get files from url, cache, or disk depending on the case try: resolved_vocab_files = {} for file_id, file_path in vocab_files.items(): if file_path is None: resolved_vocab_files[file_id] = None else: resolved_vocab_files[file_id] = cached_path(file_path, cache_dir=cache_dir, force_download=force_download, proxies=proxies) except EnvironmentError as e: if pretrained_model_name_or_path in s3_models: logger.error("Couldn't reach server to download vocabulary.") else: logger.error( "Model name '{}' was not found in model name list ({}). " "We assumed '{}' was a path or url but couldn't find files {} " "at this path or url.".format( pretrained_model_name_or_path, ', '.join(s3_models), pretrained_model_name_or_path, str(vocab_files.keys()))) raise e for file_id, file_path in vocab_files.items(): if file_path == resolved_vocab_files[file_id]: logger.info("loading file {}".format(file_path)) else: logger.info("loading file {} from cache at {}".format( file_path, resolved_vocab_files[file_id])) # Prepare tokenizer initialization kwargs # Did we saved some inputs and kwargs to reload ? tokenizer_config_file = resolved_vocab_files.pop('tokenizer_config_file', None) if tokenizer_config_file is not None: init_kwargs = json.load(open(tokenizer_config_file, encoding="utf-8")) saved_init_inputs = init_kwargs.pop('init_inputs', ()) if not init_inputs: init_inputs = saved_init_inputs else: init_kwargs = init_configuration # Update with newly provided kwargs init_kwargs.update(kwargs) # Set max length if needed if pretrained_model_name_or_path in cls.max_model_input_sizes: # if we're using a pretrained model, ensure the tokenizer # wont index sequences longer than the number of positional embeddings max_len = cls.max_model_input_sizes[pretrained_model_name_or_path] if max_len is not None and isinstance(max_len, (int, float)): init_kwargs['max_len'] = min(init_kwargs.get('max_len', int(1e12)), max_len) # Merge resolved_vocab_files arguments in init_kwargs. added_tokens_file = resolved_vocab_files.pop('added_tokens_file', None) special_tokens_map_file = resolved_vocab_files.pop('special_tokens_map_file', None) for args_name, file_path in resolved_vocab_files.items(): if args_name not in init_kwargs: init_kwargs[args_name] = file_path if special_tokens_map_file is not None: special_tokens_map = json.load(open(special_tokens_map_file, encoding="utf-8")) for key, value in special_tokens_map.items(): if key not in init_kwargs: init_kwargs[key] = value # Instantiate tokenizer. tokenizer = cls(*init_inputs, **init_kwargs) # Save inputs and kwargs for saving and re-loading with ``save_pretrained`` tokenizer.init_inputs = init_inputs tokenizer.init_kwargs = init_kwargs # Add supplementary tokens. if added_tokens_file is not None: added_tok_encoder = json.load(open(added_tokens_file, encoding="utf-8")) added_tok_decoder = {v:k for k, v in added_tok_encoder.items()} tokenizer.added_tokens_encoder.update(added_tok_encoder) tokenizer.added_tokens_decoder.update(added_tok_decoder) return tokenizer def save_pretrained(self, save_directory): """ Save the tokenizer vocabulary files together with: - added tokens, - special-tokens-to-class-attributes-mapping, - tokenizer instantiation positional and keywords inputs (e.g. do_lower_case for Bert). This won't save modifications other than (added tokens and special token mapping) you may have applied to the tokenizer after the instantion (e.g. modifying tokenizer.do_lower_case after creation). This method make sure the full tokenizer can then be re-loaded using the :func:`~pytorch_transformers.PreTrainedTokenizer.from_pretrained` class method. """ if not os.path.isdir(save_directory): logger.error("Saving directory ({}) should be a directory".format(save_directory)) return special_tokens_map_file = os.path.join(save_directory, SPECIAL_TOKENS_MAP_FILE) added_tokens_file = os.path.join(save_directory, ADDED_TOKENS_FILE) tokenizer_config_file = os.path.join(save_directory, TOKENIZER_CONFIG_FILE) tokenizer_config = copy.deepcopy(self.init_kwargs) tokenizer_config['init_inputs'] = copy.deepcopy(self.init_inputs) for file_id in self.vocab_files_names.keys(): tokenizer_config.pop(file_id, None) with open(tokenizer_config_file, 'w', encoding='utf-8') as f: f.write(json.dumps(tokenizer_config, ensure_ascii=False)) with open(special_tokens_map_file, 'w', encoding='utf-8') as f: f.write(json.dumps(self.special_tokens_map, ensure_ascii=False)) with open(added_tokens_file, 'w', encoding='utf-8') as f: if self.added_tokens_encoder: out_str = json.dumps(self.added_tokens_encoder, ensure_ascii=False) else: out_str = u"{}" f.write(out_str) vocab_files = self.save_vocabulary(save_directory) return vocab_files + (special_tokens_map_file, added_tokens_file) def save_vocabulary(self, save_directory): """ Save the tokenizer vocabulary to a directory. This method does *NOT* save added tokens and special token mappings. Please use :func:`~pytorch_transformers.PreTrainedTokenizer.save_pretrained` `()` to save the full Tokenizer state if you want to reload it using the :func:`~pytorch_transformers.PreTrainedTokenizer.from_pretrained` class method. """ raise NotImplementedError def vocab_size(self): """ Size of the base vocabulary (without the added tokens) """ raise NotImplementedError def __len__(self): """ Size of the full vocabulary with the added tokens """ return self.vocab_size + len(self.added_tokens_encoder) def add_tokens(self, new_tokens): """ Add a list of new tokens to the tokenizer class. If the new tokens are not in the vocabulary, they are added to it with indices starting from length of the current vocabulary. Args: new_tokens: list of string. Each string is a token to add. Tokens are only added if they are not already in the vocabulary (tested by checking if the tokenizer assign the index of the ``unk_token`` to them). Returns: Number of tokens added to the vocabulary. Examples:: # Let's see how to increase the vocabulary of Bert model and tokenizer tokenizer = BertTokenizer.from_pretrained('bert-base-uncased') model = BertModel.from_pretrained('bert-base-uncased') num_added_toks = tokenizer.add_tokens(['new_tok1', 'my_new-tok2']) print('We have added', num_added_toks, 'tokens') model.resize_token_embeddings(len(tokenizer)) # Notice: resize_token_embeddings expect to receive the full size of the new vocabulary, i.e. the length of the tokenizer. """ if not new_tokens: return 0 to_add_tokens = [] for token in new_tokens: assert isinstance(token, str) or (six.PY2 and isinstance(token, unicode)) if token != self.unk_token and \ self.convert_tokens_to_ids(token) == self.convert_tokens_to_ids(self.unk_token): to_add_tokens.append(token) logger.info("Adding %s to the vocabulary", token) added_tok_encoder = dict((tok, len(self) + i) for i, tok in enumerate(to_add_tokens)) added_tok_decoder = {v:k for k, v in added_tok_encoder.items()} self.added_tokens_encoder.update(added_tok_encoder) self.added_tokens_decoder.update(added_tok_decoder) return len(to_add_tokens) def add_special_tokens(self, special_tokens_dict): """ Add a dictionary of special tokens (eos, pad, cls...) to the encoder and link them to class attributes. If special tokens are NOT in the vocabulary, they are added to it (indexed starting from the last index of the current vocabulary). Using `add_special_tokens` will ensure your special tokens can be used in several ways: - special tokens are carefully handled by the tokenizer (they are never split) - you can easily refer to special tokens using tokenizer class attributes like `tokenizer.cls_token`. This makes it easy to develop model-agnostic training and fine-tuning scripts. When possible, special tokens are already registered for provided pretrained models (ex: BertTokenizer cls_token is already registered to be '[CLS]' and XLM's one is also registered to be '</s>') Args: special_tokens_dict: dict of string. Keys should be in the list of predefined special attributes: [``bos_token``, ``eos_token``, ``unk_token``, ``sep_token``, ``pad_token``, ``cls_token``, ``mask_token``, ``additional_special_tokens``]. Tokens are only added if they are not already in the vocabulary (tested by checking if the tokenizer assign the index of the ``unk_token`` to them). Returns: Number of tokens added to the vocabulary. Examples:: # Let's see how to add a new classification token to GPT-2 tokenizer = GPT2Tokenizer.from_pretrained('gpt2') model = GPT2Model.from_pretrained('gpt2') special_tokens_dict = {'cls_token': '<CLS>'} num_added_toks = tokenizer.add_special_tokens(special_tokens_dict) print('We have added', num_added_toks, 'tokens') model.resize_token_embeddings(len(tokenizer)) # Notice: resize_token_embeddings expect to receive the full size of the new vocabulary, i.e. the length of the tokenizer. assert tokenizer.cls_token == '<CLS>' """ if not special_tokens_dict: return 0 added_tokens = 0 for key, value in special_tokens_dict.items(): assert key in self.SPECIAL_TOKENS_ATTRIBUTES if key == 'additional_special_tokens': assert isinstance(value, (list, tuple)) and all(isinstance(t, str) or (six.PY2 and isinstance(t, unicode)) for t in value) added_tokens += self.add_tokens(value) else: assert isinstance(value, str) or (six.PY2 and isinstance(value, unicode)) added_tokens += self.add_tokens([value]) logger.info("Assigning %s to the %s key of the tokenizer", value, key) setattr(self, key, value) return added_tokens def tokenize(self, text, **kwargs): """ Converts a string in a sequence of tokens (string), using the tokenizer. Split in words for word-based vocabulary or sub-words for sub-word-based vocabularies (BPE/SentencePieces/WordPieces). Take care of added tokens. """ def split_on_token(tok, text): result = [] split_text = text.split(tok) for i, sub_text in enumerate(split_text): sub_text = sub_text.strip() if i == 0 and not sub_text: result += [tok] elif i == len(split_text) - 1: if sub_text: result += [sub_text] else: pass else: if sub_text: result += [sub_text] result += [tok] return result def split_on_tokens(tok_list, text): if not text: return [] if not tok_list: return self._tokenize(text, **kwargs) tokenized_text = [] text_list = [text] for tok in tok_list: tokenized_text = [] for sub_text in text_list: if sub_text not in self.added_tokens_encoder \ and sub_text not in self.all_special_tokens: tokenized_text += split_on_token(tok, sub_text) else: tokenized_text += [sub_text] text_list = tokenized_text return sum((self._tokenize(token, **kwargs) if token not \ in self.added_tokens_encoder and token not in self.all_special_tokens \ else [token] for token in tokenized_text), []) added_tokens = list(self.added_tokens_encoder.keys()) + self.all_special_tokens tokenized_text = split_on_tokens(added_tokens, text) return tokenized_text def _tokenize(self, text, **kwargs): """ Converts a string in a sequence of tokens (string), using the tokenizer. Split in words for word-based vocabulary or sub-words for sub-word-based vocabularies (BPE/SentencePieces/WordPieces). Do NOT take care of added tokens. """ raise NotImplementedError def convert_tokens_to_ids(self, tokens): """ Converts a single token, or a sequence of tokens, (str/unicode) in a single integer id (resp. a sequence of ids), using the vocabulary. """ if tokens is None: return None if isinstance(tokens, str) or (six.PY2 and isinstance(tokens, unicode)): return self._convert_token_to_id_with_added_voc(tokens) ids = [] for token in tokens: ids.append(self._convert_token_to_id_with_added_voc(token)) if len(ids) > self.max_len: logger.warning("Token indices sequence length is longer than the specified maximum sequence length " "for this model ({} > {}). Running this sequence through the model will result in " "indexing errors".format(len(ids), self.max_len)) return ids def _convert_token_to_id_with_added_voc(self, token): if token is None: return None if token in self.added_tokens_encoder: return self.added_tokens_encoder[token] return self._convert_token_to_id(token) def _convert_token_to_id(self, token): raise NotImplementedError def encode(self, text, text_pair=None, add_special_tokens=False, **kwargs): """ Converts a string in a sequence of ids (integer), using the tokenizer and vocabulary. Same as doing ``self.convert_tokens_to_ids(self.tokenize(text))``. Args: text: The first sequence to be encoded. text_pair: Optional second sequence to be encoded. add_special_tokens: if set to ``True``, the sequences will be encoded with the special tokens relative to their model. **kwargs: passed to the `self.tokenize()` method """ if text_pair is None: if add_special_tokens: return self.add_special_tokens_single_sentence(self.convert_tokens_to_ids(self.tokenize(text, **kwargs))) else: return self.convert_tokens_to_ids(self.tokenize(text, **kwargs)) first_sentence_tokens = [self._convert_token_to_id(token) for token in self.tokenize(text, **kwargs)] second_sentence_tokens = [self._convert_token_to_id(token) for token in self.tokenize(text_pair, **kwargs)] if add_special_tokens: return self.add_special_tokens_sentences_pair(first_sentence_tokens, second_sentence_tokens) else: return first_sentence_tokens, second_sentence_tokens def add_special_tokens_single_sentence(self, token_ids): logger.warning("This tokenizer does not make use of special tokens. The sequence has been returned with no modification.") return token_ids def add_special_tokens_sentences_pair(self, token_ids_0, token_ids_1): logger.warning("This tokenizer does not make use of special tokens. The two sequences have been concatenated.") return token_ids_0 + token_ids_1 def convert_ids_to_tokens(self, ids, skip_special_tokens=False): """ Converts a single index or a sequence of indices (integers) in a token " (resp.) a sequence of tokens (str/unicode), using the vocabulary and added tokens. Args: skip_special_tokens: Don't decode special tokens (self.all_special_tokens). Default: False """ if isinstance(ids, int): if ids in self.added_tokens_decoder: return self.added_tokens_decoder[ids] else: return self._convert_id_to_token(ids) tokens = [] for index in ids: if skip_special_tokens and index in self.all_special_ids: continue if index in self.added_tokens_decoder: tokens.append(self.added_tokens_decoder[index]) else: tokens.append(self._convert_id_to_token(index)) return tokens def _convert_id_to_token(self, index): raise NotImplementedError def convert_tokens_to_string(self, tokens): """ Converts a sequence of tokens (string) in a single string. The most simple way to do it is ' '.join(self.convert_ids_to_tokens(token_ids)) but we often want to remove sub-word tokenization artifacts at the same time. """ return ' '.join(self.convert_ids_to_tokens(tokens)) def decode(self, token_ids, skip_special_tokens=False, clean_up_tokenization_spaces=True): """ Converts a sequence of ids (integer) in a string, using the tokenizer and vocabulary with options to remove special tokens and clean up tokenization spaces. Similar to doing ``self.convert_tokens_to_string(self.convert_ids_to_tokens(token_ids))``. """ filtered_tokens = self.convert_ids_to_tokens(token_ids, skip_special_tokens=skip_special_tokens) # To avoid mixing byte-level and unicode for byte-level BPT # we need to build string separatly for added tokens and byte-level tokens # cf. https://github.com/huggingface/pytorch-transformers/issues/1133 sub_texts = [] current_sub_text = [] for token in filtered_tokens: if skip_special_tokens and token in self.all_special_ids: continue if token in self.added_tokens_encoder: if current_sub_text: sub_texts.append(self.convert_tokens_to_string(current_sub_text)) current_sub_text = [] sub_texts.append(" " + token) else: current_sub_text.append(token) if current_sub_text: sub_texts.append(self.convert_tokens_to_string(current_sub_text)) text = ''.join(sub_texts) if self._sep_token is not None and self._sep_token in text: text = text.replace(self._cls_token, self._sep_token) split_text = list(filter(lambda sentence: len(sentence) > 0, text.split(self._sep_token))) if clean_up_tokenization_spaces: clean_text = [self.clean_up_tokenization(text) for text in split_text] return clean_text else: return split_text else: if clean_up_tokenization_spaces: clean_text = self.clean_up_tokenization(text) return clean_text else: return text @property def special_tokens_map(self): """ A dictionary mapping special token class attribute (cls_token, unk_token...) to their values ('<unk>', '<cls>'...) """ set_attr = {} for attr in self.SPECIAL_TOKENS_ATTRIBUTES: attr_value = getattr(self, "_" + attr) if attr_value: set_attr[attr] = attr_value return set_attr @property def all_special_tokens(self): """ List all the special tokens ('<unk>', '<cls>'...) mapped to class attributes (cls_token, unk_token...). """ all_toks = [] set_attr = self.special_tokens_map for attr_value in set_attr.values(): all_toks = all_toks + (list(attr_value) if isinstance(attr_value, (list, tuple)) else [attr_value]) all_toks = list(set(all_toks)) return all_toks @property def all_special_ids(self): """ List the vocabulary indices of the special tokens ('<unk>', '<cls>'...) mapped to class attributes (cls_token, unk_token...). """ all_toks = self.all_special_tokens all_ids = list(self._convert_token_to_id(t) for t in all_toks) return all_ids @staticmethod def clean_up_tokenization(out_string): """ Clean up a list of simple English tokenization artifacts like spaces before punctuations and abreviated forms. """ out_string = out_string.replace(' .', '.').replace(' ?', '?').replace(' !', '!').replace(' ,', ',' ).replace(" ' ", "'").replace(" n't", "n't").replace(" 'm", "'m").replace(" do not", " don't" ).replace(" 's", "'s").replace(" 've", "'ve").replace(" 're", "'re") return out_string
39,803
47.779412
380
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_transfo_xl_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import random import shutil import pytest import torch from pytorch_transformers import (TransfoXLConfig, TransfoXLModel, TransfoXLLMHeadModel) from pytorch_transformers.modeling_transfo_xl import TRANSFO_XL_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class TransfoXLModelTest(CommonTestCases.CommonModelTester): all_model_classes = (TransfoXLModel, TransfoXLLMHeadModel) test_pruning = False test_torchscript = False test_resize_embeddings = False class TransfoXLModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, mem_len=30, clamp_len=15, is_training=True, use_labels=True, vocab_size=99, cutoffs=[10, 50, 80], hidden_size=32, d_embed=32, num_attention_heads=4, d_head=8, d_inner=128, div_val=2, num_hidden_layers=5, scope=None, seed=1, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.mem_len = mem_len self.key_len = seq_length + mem_len self.clamp_len = clamp_len self.is_training = is_training self.use_labels = use_labels self.vocab_size = vocab_size self.cutoffs = cutoffs self.hidden_size = hidden_size self.d_embed = d_embed self.num_attention_heads = num_attention_heads self.d_head = d_head self.d_inner = d_inner self.div_val = div_val self.num_hidden_layers = num_hidden_layers self.scope = scope self.seed = seed def prepare_config_and_inputs(self): input_ids_1 = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_ids_2 = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) lm_labels = None if self.use_labels: lm_labels = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) config = TransfoXLConfig( vocab_size_or_config_json_file=self.vocab_size, mem_len=self.mem_len, clamp_len=self.clamp_len, cutoffs=self.cutoffs, d_model=self.hidden_size, d_embed=self.d_embed, n_head=self.num_attention_heads, d_head=self.d_head, d_inner=self.d_inner, div_val=self.div_val, n_layer=self.num_hidden_layers) return (config, input_ids_1, input_ids_2, lm_labels) def set_seed(self): random.seed(self.seed) torch.manual_seed(self.seed) def create_transfo_xl_model(self, config, input_ids_1, input_ids_2, lm_labels): model = TransfoXLModel(config) model.eval() hidden_states_1, mems_1 = model(input_ids_1) hidden_states_2, mems_2 = model(input_ids_2, mems_1) outputs = { "hidden_states_1": hidden_states_1, "mems_1": mems_1, "hidden_states_2": hidden_states_2, "mems_2": mems_2, } return outputs def check_transfo_xl_model_output(self, result): self.parent.assertListEqual( list(result["hidden_states_1"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertListEqual( list(result["hidden_states_2"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_1"]), [[self.mem_len, self.batch_size, self.hidden_size]] * self.num_hidden_layers) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_2"]), [[self.mem_len, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def create_transfo_xl_lm_head(self, config, input_ids_1, input_ids_2, lm_labels): model = TransfoXLLMHeadModel(config) model.eval() lm_logits_1, mems_1 = model(input_ids_1) loss_1, _, mems_1 = model(input_ids_1, labels=lm_labels) lm_logits_2, mems_2 = model(input_ids_2, mems=mems_1) loss_2, _, mems_2 = model(input_ids_2, labels=lm_labels, mems=mems_1) outputs = { "loss_1": loss_1, "mems_1": mems_1, "lm_logits_1": lm_logits_1, "loss_2": loss_2, "mems_2": mems_2, "lm_logits_2": lm_logits_2, } return outputs def check_transfo_xl_lm_head_output(self, result): self.parent.assertListEqual( list(result["loss_1"].size()), [self.batch_size, self.seq_length]) self.parent.assertListEqual( list(result["lm_logits_1"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_1"]), [[self.mem_len, self.batch_size, self.hidden_size]] * self.num_hidden_layers) self.parent.assertListEqual( list(result["loss_2"].size()), [self.batch_size, self.seq_length]) self.parent.assertListEqual( list(result["lm_logits_2"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_2"]), [[self.mem_len, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids_1, input_ids_2, lm_labels) = config_and_inputs inputs_dict = {'input_ids': input_ids_1} return config, inputs_dict def setUp(self): self.model_tester = TransfoXLModelTest.TransfoXLModelTester(self) self.config_tester = ConfigTester(self, config_class=TransfoXLConfig, d_embed=37) def test_config(self): self.config_tester.run_common_tests() def test_transfo_xl_model(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() output_result = self.model_tester.create_transfo_xl_model(*config_and_inputs) self.model_tester.check_transfo_xl_model_output(output_result) def test_transfo_xl_lm_head(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() output_result = self.model_tester.create_transfo_xl_lm_head(*config_and_inputs) self.model_tester.check_transfo_xl_lm_head_output(output_result) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(TRANSFO_XL_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = TransfoXLModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
8,554
38.976636
93
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_transfo_xl_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest from io import open from pytorch_transformers.tokenization_transfo_xl import TransfoXLTokenizer, VOCAB_FILES_NAMES from.tokenization_tests_commons import CommonTestCases class TransfoXLTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = TransfoXLTokenizer def setUp(self): super(TransfoXLTokenizationTest, self).setUp() vocab_tokens = [ "<unk>", "[CLS]", "[SEP]", "want", "unwanted", "wa", "un", "running", ",", "low", "l", ] self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) with open(self.vocab_file, "w", encoding='utf-8') as vocab_writer: vocab_writer.write("".join([x + "\n" for x in vocab_tokens])) def get_tokenizer(self, **kwargs): kwargs['lower_case'] = True return TransfoXLTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"<unk> UNwanted , running" output_text = u"<unk> unwanted, running" return input_text, output_text def test_full_tokenizer(self): tokenizer = TransfoXLTokenizer(vocab_file=self.vocab_file, lower_case=True) tokens = tokenizer.tokenize(u"<unk> UNwanted , running") self.assertListEqual(tokens, ["<unk>", "unwanted", ",", "running"]) self.assertListEqual( tokenizer.convert_tokens_to_ids(tokens), [0, 4, 8, 7]) def test_full_tokenizer_lower(self): tokenizer = TransfoXLTokenizer(lower_case=True) self.assertListEqual( tokenizer.tokenize(u" \tHeLLo ! how \n Are yoU ? "), ["hello", "!", "how", "are", "you", "?"]) def test_full_tokenizer_no_lower(self): tokenizer = TransfoXLTokenizer(lower_case=False) self.assertListEqual( tokenizer.tokenize(u" \tHeLLo ! how \n Are yoU ? "), ["HeLLo", "!", "how", "Are", "yoU", "?"]) if __name__ == '__main__': unittest.main()
2,716
35.226667
94
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_openai_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import pytest import shutil from pytorch_transformers import (OpenAIGPTConfig, OpenAIGPTModel, OPENAI_GPT_PRETRAINED_MODEL_ARCHIVE_MAP, OpenAIGPTLMHeadModel, OpenAIGPTDoubleHeadsModel) from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class OpenAIGPTModelTest(CommonTestCases.CommonModelTester): all_model_classes = (OpenAIGPTModel, OpenAIGPTLMHeadModel, OpenAIGPTDoubleHeadsModel) class OpenAIGPTModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_token_type_ids=True, use_labels=True, vocab_size=99, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, intermediate_size=37, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.intermediate_size = intermediate_size self.hidden_act = hidden_act self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) token_type_ids = None if self.use_token_type_ids: token_type_ids = ids_tensor([self.batch_size, self.seq_length], self.type_vocab_size) sequence_labels = None token_labels = None choice_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) choice_labels = ids_tensor([self.batch_size], self.num_choices) config = OpenAIGPTConfig( vocab_size_or_config_json_file=self.vocab_size, n_embd=self.hidden_size, n_layer=self.num_hidden_layers, n_head=self.num_attention_heads, # intermediate_size=self.intermediate_size, # hidden_act=self.hidden_act, # hidden_dropout_prob=self.hidden_dropout_prob, # attention_probs_dropout_prob=self.attention_probs_dropout_prob, n_positions=self.max_position_embeddings, n_ctx=self.max_position_embeddings # type_vocab_size=self.type_vocab_size, # initializer_range=self.initializer_range ) head_mask = ids_tensor([self.num_hidden_layers, self.num_attention_heads], 2) return config, input_ids, head_mask, token_type_ids, sequence_labels, token_labels, choice_labels def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_openai_gpt_model(self, config, input_ids, head_mask, token_type_ids, *args): model = OpenAIGPTModel(config=config) model.eval() model(input_ids, token_type_ids=token_type_ids, head_mask=head_mask) model(input_ids, token_type_ids=token_type_ids) (sequence_output,) = model(input_ids) result = { "sequence_output": sequence_output } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) def create_and_check_lm_head_model(self, config, input_ids, head_mask, token_type_ids, *args): model = OpenAIGPTLMHeadModel(config) model.eval() loss, lm_logits = model(input_ids, token_type_ids=token_type_ids, labels=input_ids) result = { "loss": loss, "lm_logits": lm_logits } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["lm_logits"].size()), [self.batch_size, self.seq_length, self.vocab_size]) def create_and_check_double_lm_head_model(self, config, input_ids, head_mask, token_type_ids, *args): model = OpenAIGPTDoubleHeadsModel(config) model.eval() loss, lm_logits, mc_logits = model(input_ids, token_type_ids=token_type_ids, lm_labels=input_ids) result = { "loss": loss, "lm_logits": lm_logits } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["lm_logits"].size()), [self.batch_size, self.seq_length, self.vocab_size]) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, head_mask, token_type_ids, sequence_labels, token_labels, choice_labels) = config_and_inputs inputs_dict = { 'input_ids': input_ids, 'token_type_ids': token_type_ids, 'head_mask': head_mask } return config, inputs_dict def setUp(self): self.model_tester = OpenAIGPTModelTest.OpenAIGPTModelTester(self) self.config_tester = ConfigTester(self, config_class=OpenAIGPTConfig, n_embd=37) def test_config(self): self.config_tester.run_common_tests() def test_openai_gpt_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_openai_gpt_model(*config_and_inputs) def test_openai_gpt_lm_head_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_lm_head_model(*config_and_inputs) def test_openai_gpt_double_lm_head_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_double_lm_head_model(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(OPENAI_GPT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = OpenAIGPTModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
8,707
39.882629
124
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_roberta_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import shutil import pytest import torch from pytorch_transformers import (RobertaConfig, RobertaModel, RobertaForMaskedLM, RobertaForSequenceClassification) from pytorch_transformers.modeling_roberta import ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class RobertaModelTest(CommonTestCases.CommonModelTester): all_model_classes = (RobertaForMaskedLM, RobertaModel) class RobertaModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_input_mask=True, use_token_type_ids=True, use_labels=True, vocab_size=99, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, intermediate_size=37, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_input_mask = use_input_mask self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.intermediate_size = intermediate_size self.hidden_act = hidden_act self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_mask = None if self.use_input_mask: input_mask = ids_tensor([self.batch_size, self.seq_length], vocab_size=2) token_type_ids = None if self.use_token_type_ids: token_type_ids = ids_tensor([self.batch_size, self.seq_length], self.type_vocab_size) sequence_labels = None token_labels = None choice_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) choice_labels = ids_tensor([self.batch_size], self.num_choices) config = RobertaConfig( vocab_size_or_config_json_file=self.vocab_size, hidden_size=self.hidden_size, num_hidden_layers=self.num_hidden_layers, num_attention_heads=self.num_attention_heads, intermediate_size=self.intermediate_size, hidden_act=self.hidden_act, hidden_dropout_prob=self.hidden_dropout_prob, attention_probs_dropout_prob=self.attention_probs_dropout_prob, max_position_embeddings=self.max_position_embeddings, type_vocab_size=self.type_vocab_size, initializer_range=self.initializer_range) return config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_roberta_model(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = RobertaModel(config=config) model.eval() sequence_output, pooled_output = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids) sequence_output, pooled_output = model(input_ids, token_type_ids=token_type_ids) sequence_output, pooled_output = model(input_ids) result = { "sequence_output": sequence_output, "pooled_output": pooled_output, } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertListEqual(list(result["pooled_output"].size()), [self.batch_size, self.hidden_size]) def create_and_check_roberta_for_masked_lm(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = RobertaForMaskedLM(config=config) model.eval() loss, prediction_scores = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, masked_lm_labels=token_labels) result = { "loss": loss, "prediction_scores": prediction_scores, } self.parent.assertListEqual( list(result["prediction_scores"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.check_loss_output(result) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels) = config_and_inputs inputs_dict = {'input_ids': input_ids, 'token_type_ids': token_type_ids, 'attention_mask': input_mask} return config, inputs_dict def setUp(self): self.model_tester = RobertaModelTest.RobertaModelTester(self) self.config_tester = ConfigTester(self, config_class=RobertaConfig, hidden_size=37) def test_config(self): self.config_tester.run_common_tests() def test_roberta_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_roberta_model(*config_and_inputs) def test_for_masked_lm(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_roberta_for_masked_lm(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(ROBERTA_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = RobertaModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) class RobertaModelIntegrationTest(unittest.TestCase): @pytest.mark.slow def test_inference_masked_lm(self): model = RobertaForMaskedLM.from_pretrained('roberta-base') input_ids = torch.tensor([[ 0, 31414, 232, 328, 740, 1140, 12695, 69, 46078, 1588, 2]]) output = model(input_ids)[0] expected_shape = torch.Size((1, 11, 50265)) self.assertEqual( output.shape, expected_shape ) # compare the actual values for a slice. expected_slice = torch.Tensor( [[[33.8843, -4.3107, 22.7779], [ 4.6533, -2.8099, 13.6252], [ 1.8222, -3.6898, 8.8600]]] ) self.assertTrue( torch.allclose(output[:, :3, :3], expected_slice, atol=1e-3) ) @pytest.mark.slow def test_inference_no_head(self): model = RobertaModel.from_pretrained('roberta-base') input_ids = torch.tensor([[ 0, 31414, 232, 328, 740, 1140, 12695, 69, 46078, 1588, 2]]) output = model(input_ids)[0] # compare the actual values for a slice. expected_slice = torch.Tensor( [[[-0.0231, 0.0782, 0.0074], [-0.1854, 0.0539, -0.0174], [ 0.0548, 0.0799, 0.1687]]] ) self.assertTrue( torch.allclose(output[:, :3, :3], expected_slice, atol=1e-3) ) @pytest.mark.slow def test_inference_classification_head(self): model = RobertaForSequenceClassification.from_pretrained('roberta-large-mnli') input_ids = torch.tensor([[ 0, 31414, 232, 328, 740, 1140, 12695, 69, 46078, 1588, 2]]) output = model(input_ids)[0] expected_shape = torch.Size((1, 3)) self.assertEqual( output.shape, expected_shape ) expected_tensor = torch.Tensor([[-0.9469, 0.3913, 0.5118]]) self.assertTrue( torch.allclose(output, expected_tensor, atol=1e-3) ) if __name__ == "__main__": unittest.main()
10,365
41.483607
143
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_utils_test.py
# coding=utf-8 # Copyright 2018 HuggingFace Inc.. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import six from pytorch_transformers import PreTrainedTokenizer from pytorch_transformers.tokenization_gpt2 import GPT2Tokenizer class TokenizerUtilsTest(unittest.TestCase): def check_tokenizer_from_pretrained(self, tokenizer_class): s3_models = list(tokenizer_class.max_model_input_sizes.keys()) for model_name in s3_models[:1]: tokenizer = tokenizer_class.from_pretrained(model_name) self.assertIsNotNone(tokenizer) self.assertIsInstance(tokenizer, tokenizer_class) self.assertIsInstance(tokenizer, PreTrainedTokenizer) for special_tok in tokenizer.all_special_tokens: if six.PY2: self.assertIsInstance(special_tok, unicode) else: self.assertIsInstance(special_tok, str) special_tok_id = tokenizer.convert_tokens_to_ids(special_tok) self.assertIsInstance(special_tok_id, int) def test_pretrained_tokenizers(self): self.check_tokenizer_from_pretrained(GPT2Tokenizer) if __name__ == "__main__": unittest.main()
1,838
38.12766
77
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_common_test.py
# coding=utf-8 # Copyright 2019 HuggingFace Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import copy import os import shutil import json import random import uuid import unittest import logging import torch from pytorch_transformers import (PretrainedConfig, PreTrainedModel, BertModel, BertConfig, BERT_PRETRAINED_MODEL_ARCHIVE_MAP, GPT2LMHeadModel, GPT2Config, GPT2_PRETRAINED_MODEL_ARCHIVE_MAP) def _config_zero_init(config): configs_no_init = copy.deepcopy(config) for key in configs_no_init.__dict__.keys(): if '_range' in key or '_std' in key: setattr(configs_no_init, key, 0.0) return configs_no_init class CommonTestCases: class CommonModelTester(unittest.TestCase): model_tester = None all_model_classes = () test_torchscript = True test_pruning = True test_resize_embeddings = True test_head_masking = True def test_initialization(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() configs_no_init = _config_zero_init(config) for model_class in self.all_model_classes: model = model_class(config=configs_no_init) for name, param in model.named_parameters(): if param.requires_grad: self.assertIn(param.data.mean().item(), [0.0, 1.0], msg="Parameter {} of model {} seems not properly initialized".format(name, model_class)) def test_attention_outputs(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() for model_class in self.all_model_classes: config.output_attentions = True config.output_hidden_states = False model = model_class(config) model.eval() outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(model.config.output_attentions, True) self.assertEqual(model.config.output_hidden_states, False) self.assertEqual(len(attentions), self.model_tester.num_hidden_layers) self.assertListEqual( list(attentions[0].shape[-3:]), [self.model_tester.num_attention_heads, self.model_tester.seq_length, self.model_tester.key_len if hasattr(self.model_tester, 'key_len') else self.model_tester.seq_length]) out_len = len(outputs) # Check attention is always last and order is fine config.output_attentions = True config.output_hidden_states = True model = model_class(config) model.eval() outputs = model(**inputs_dict) self.assertEqual(out_len+1, len(outputs)) self.assertEqual(model.config.output_attentions, True) self.assertEqual(model.config.output_hidden_states, True) attentions = outputs[-1] self.assertEqual(len(attentions), self.model_tester.num_hidden_layers) self.assertListEqual( list(attentions[0].shape[-3:]), [self.model_tester.num_attention_heads, self.model_tester.seq_length, self.model_tester.key_len if hasattr(self.model_tester, 'key_len') else self.model_tester.seq_length]) def test_torchscript(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() self._create_and_check_torchscript(config, inputs_dict) def test_torchscript_output_attentions(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() config.output_attentions = True self._create_and_check_torchscript(config, inputs_dict) def test_torchscript_output_hidden_state(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() config.output_hidden_states = True self._create_and_check_torchscript(config, inputs_dict) def _create_and_check_torchscript(self, config, inputs_dict): if not self.test_torchscript: return configs_no_init = _config_zero_init(config) # To be sure we have no Nan configs_no_init.torchscript = True for model_class in self.all_model_classes: model = model_class(config=configs_no_init) model.eval() inputs = inputs_dict['input_ids'] # Let's keep only input_ids try: torch.jit.trace(model, inputs) except RuntimeError: self.fail("Couldn't trace module.") try: traced_gpt2 = torch.jit.trace(model, inputs) torch.jit.save(traced_gpt2, "traced_model.pt") except RuntimeError: self.fail("Couldn't save module.") try: loaded_model = torch.jit.load("traced_model.pt") os.remove("traced_model.pt") except ValueError: self.fail("Couldn't load module.") model.eval() loaded_model.eval() model_params = model.parameters() loaded_model_params = loaded_model.parameters() models_equal = True for p1, p2 in zip(model_params, loaded_model_params): if p1.data.ne(p2.data).sum() > 0: models_equal = False self.assertTrue(models_equal) def test_headmasking(self): if not self.test_head_masking: return global_rng.seed(42) config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() global_rng.seed() config.output_attentions = True config.output_hidden_states = True configs_no_init = _config_zero_init(config) # To be sure we have no Nan for model_class in self.all_model_classes: model = model_class(config=configs_no_init) model.eval() # Prepare head_mask # Set require_grad after having prepared the tensor to avoid error (leaf variable has been moved into the graph interior) head_mask = torch.ones(self.model_tester.num_hidden_layers, self.model_tester.num_attention_heads) head_mask[0, 0] = 0 head_mask[-1, :-1] = 0 head_mask.requires_grad_(requires_grad=True) inputs = inputs_dict.copy() inputs['head_mask'] = head_mask outputs = model(**inputs) # Test that we can get a gradient back for importance score computation output = sum(t.sum() for t in outputs[0]) output = output.sum() output.backward() multihead_outputs = head_mask.grad attentions = outputs[-1] hidden_states = outputs[-2] # Remove Nan self.assertIsNotNone(multihead_outputs) self.assertEqual(len(multihead_outputs), self.model_tester.num_hidden_layers) self.assertAlmostEqual( attentions[0][..., 0, :, :].flatten().sum().item(), 0.0) self.assertNotEqual( attentions[0][..., -1, :, :].flatten().sum().item(), 0.0) self.assertNotEqual( attentions[1][..., 0, :, :].flatten().sum().item(), 0.0) self.assertAlmostEqual( attentions[-1][..., -2, :, :].flatten().sum().item(), 0.0) self.assertNotEqual( attentions[-1][..., -1, :, :].flatten().sum().item(), 0.0) def test_head_pruning(self): if not self.test_pruning: return for model_class in self.all_model_classes: config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() if "head_mask" in inputs_dict: del inputs_dict["head_mask"] config.output_attentions = True config.output_hidden_states = False model = model_class(config=config) model.eval() heads_to_prune = {0: list(range(1, self.model_tester.num_attention_heads)), -1: [0]} model.prune_heads(heads_to_prune) outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual( attentions[0].shape[-3], 1) self.assertEqual( attentions[1].shape[-3], self.model_tester.num_attention_heads) self.assertEqual( attentions[-1].shape[-3], self.model_tester.num_attention_heads - 1) def test_head_pruning_save_load_from_pretrained(self): if not self.test_pruning: return for model_class in self.all_model_classes: config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() if "head_mask" in inputs_dict: del inputs_dict["head_mask"] config.output_attentions = True config.output_hidden_states = False model = model_class(config=config) model.eval() heads_to_prune = {0: list(range(1, self.model_tester.num_attention_heads)), -1: [0]} model.prune_heads(heads_to_prune) directory = "pruned_model" if not os.path.exists(directory): os.makedirs(directory) model.save_pretrained(directory) model = model_class.from_pretrained(directory) outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(attentions[0].shape[-3], 1) self.assertEqual(attentions[1].shape[-3], self.model_tester.num_attention_heads) self.assertEqual(attentions[-1].shape[-3], self.model_tester.num_attention_heads - 1) shutil.rmtree(directory) def test_head_pruning_save_load_from_config_init(self): if not self.test_pruning: return for model_class in self.all_model_classes: config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() if "head_mask" in inputs_dict: del inputs_dict["head_mask"] config.output_attentions = True config.output_hidden_states = False heads_to_prune = {0: list(range(1, self.model_tester.num_attention_heads)), -1: [0]} config.pruned_heads = heads_to_prune model = model_class(config=config) model.eval() outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(attentions[0].shape[-3], 1) self.assertEqual(attentions[1].shape[-3], self.model_tester.num_attention_heads) self.assertEqual(attentions[-1].shape[-3], self.model_tester.num_attention_heads - 1) def test_head_pruning_integration(self): if not self.test_pruning: return for model_class in self.all_model_classes: config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() if "head_mask" in inputs_dict: del inputs_dict["head_mask"] config.output_attentions = True config.output_hidden_states = False heads_to_prune = {0: [0], 1: [1, 2]} config.pruned_heads = heads_to_prune model = model_class(config=config) model.eval() outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(attentions[0].shape[-3], self.model_tester.num_attention_heads - 1) self.assertEqual(attentions[1].shape[-3], self.model_tester.num_attention_heads - 2) self.assertEqual(attentions[2].shape[-3], self.model_tester.num_attention_heads) self.assertEqual(attentions[3].shape[-3], self.model_tester.num_attention_heads) directory = "pruned_model" if not os.path.exists(directory): os.makedirs(directory) model.save_pretrained(directory) model = model_class.from_pretrained(directory) shutil.rmtree(directory) outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(attentions[0].shape[-3], self.model_tester.num_attention_heads - 1) self.assertEqual(attentions[1].shape[-3], self.model_tester.num_attention_heads - 2) self.assertEqual(attentions[2].shape[-3], self.model_tester.num_attention_heads) self.assertEqual(attentions[3].shape[-3], self.model_tester.num_attention_heads) heads_to_prune = {0: [0], 2: [1, 2]} model.prune_heads(heads_to_prune) outputs = model(**inputs_dict) attentions = outputs[-1] self.assertEqual(attentions[0].shape[-3], self.model_tester.num_attention_heads -1) self.assertEqual(attentions[1].shape[-3], self.model_tester.num_attention_heads - 2) self.assertEqual(attentions[2].shape[-3], self.model_tester.num_attention_heads - 2) self.assertEqual(attentions[3].shape[-3], self.model_tester.num_attention_heads) self.assertDictEqual(model.config.pruned_heads, {0: [0], 1: [1, 2], 2: [1, 2]}) def test_hidden_states_output(self): config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() for model_class in self.all_model_classes: config.output_hidden_states = True config.output_attentions = False model = model_class(config) model.eval() outputs = model(**inputs_dict) hidden_states = outputs[-1] self.assertEqual(model.config.output_attentions, False) self.assertEqual(model.config.output_hidden_states, True) self.assertEqual(len(hidden_states), self.model_tester.num_hidden_layers + 1) self.assertListEqual( list(hidden_states[0].shape[-2:]), [self.model_tester.seq_length, self.model_tester.hidden_size]) def test_resize_tokens_embeddings(self): original_config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() if not self.test_resize_embeddings: return for model_class in self.all_model_classes: config = copy.deepcopy(original_config) model = model_class(config) model_vocab_size = config.vocab_size # Retrieve the embeddings and clone theme model_embed = model.resize_token_embeddings(model_vocab_size) cloned_embeddings = model_embed.weight.clone() # Check that resizing the token embeddings with a larger vocab size increases the model's vocab size model_embed = model.resize_token_embeddings(model_vocab_size + 10) self.assertEqual(model.config.vocab_size, model_vocab_size + 10) # Check that it actually resizes the embeddings matrix self.assertEqual(model_embed.weight.shape[0], cloned_embeddings.shape[0] + 10) # Check that resizing the token embeddings with a smaller vocab size decreases the model's vocab size model_embed = model.resize_token_embeddings(model_vocab_size - 15) self.assertEqual(model.config.vocab_size, model_vocab_size - 15) # Check that it actually resizes the embeddings matrix self.assertEqual(model_embed.weight.shape[0], cloned_embeddings.shape[0] - 15) # Check that adding and removing tokens has not modified the first part of the embedding matrix. models_equal = True for p1, p2 in zip(cloned_embeddings, model_embed.weight): if p1.data.ne(p2.data).sum() > 0: models_equal = False self.assertTrue(models_equal) def test_tie_model_weights(self): if not self.test_torchscript: return config, inputs_dict = self.model_tester.prepare_config_and_inputs_for_common() def check_same_values(layer_1, layer_2): equal = True for p1, p2 in zip(layer_1.weight, layer_2.weight): if p1.data.ne(p2.data).sum() > 0: equal = False return equal for model_class in self.all_model_classes: if not hasattr(model_class, 'tie_weights'): continue config.torchscript = True model_not_tied = model_class(config) params_not_tied = list(model_not_tied.parameters()) config_tied = copy.deepcopy(config) config_tied.torchscript = False model_tied = model_class(config_tied) params_tied = list(model_tied.parameters()) # Check that the embedding layer and decoding layer are the same in size and in value self.assertGreater(len(params_not_tied), len(params_tied)) # self.assertTrue(check_same_values(embeddings, decoding)) # # Check that after modification, they remain the same. # embeddings.weight.data.div_(2) # # Check that the embedding layer and decoding layer are the same in size and in value # self.assertTrue(embeddings.weight.shape, decoding.weight.shape) # self.assertTrue(check_same_values(embeddings, decoding)) # # Check that after modification, they remain the same. # decoding.weight.data.div_(4) # # Check that the embedding layer and decoding layer are the same in size and in value # self.assertTrue(embeddings.weight.shape, decoding.weight.shape) # self.assertTrue(check_same_values(embeddings, decoding)) # Check that after resize they remain tied. model_tied.resize_token_embeddings(config.vocab_size + 10) params_tied_2 = list(model_tied.parameters()) self.assertGreater(len(params_not_tied), len(params_tied)) self.assertEqual(len(params_tied_2), len(params_tied)) # decoding.weight.data.mul_(20) # # Check that the embedding layer and decoding layer are the same in size and in value # self.assertTrue(model.transformer.wte.weight.shape, model.lm_head.weight.shape) # self.assertTrue(check_same_values(model.transformer.wte, model.lm_head)) class GPTModelTester(CommonModelTester): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_position_ids=True, use_token_type_ids=True, use_labels=True, vocab_size=99, n_positions=33, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, n_choices=3, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, scope=None, config_class=None, base_model_class=None, lm_head_model_class=None, double_head_model_class=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_position_ids = use_position_ids self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.n_positions = n_positions self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.n_choices = n_choices self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.scope = scope self.config_class = config_class self.base_model_class = base_model_class self.lm_head_model_class = lm_head_model_class self.double_head_model_class = double_head_model_class self.all_model_classes = (base_model_class, lm_head_model_class, double_head_model_class) def prepare_config_and_inputs(self): total_num_tokens = self.vocab_size input_ids = ids_tensor([self.batch_size, self.n_choices, self.seq_length], total_num_tokens) position_ids = None if self.use_position_ids: position_ids = ids_tensor([self.batch_size, self.n_choices, self.seq_length], self.n_positions) token_type_ids = None if self.use_token_type_ids: total_voc = self.vocab_size token_type_ids = ids_tensor([self.batch_size, self.n_choices, self.seq_length], total_voc) mc_labels = None lm_labels = None mc_token_ids = None if self.use_labels: mc_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) lm_labels = ids_tensor([self.batch_size, self.n_choices, self.seq_length], self.num_labels) mc_token_ids = ids_tensor([self.batch_size, self.n_choices], self.seq_length) config = self.config_class( vocab_size_or_config_json_file=self.vocab_size, n_positions=self.n_positions, n_embd=self.hidden_size, n_layer=self.num_hidden_layers, n_head=self.num_attention_heads, initializer_range=self.initializer_range) return (config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids) def create_and_check_base_model(self, config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids): model = self.base_model_class(config) model.eval() outputs = model(input_ids, position_ids, token_type_ids) outputs = model(input_ids, position_ids) outputs = model(input_ids) hidden_state = outputs[0] self.parent.assertListEqual( list(hidden_state.size()), [self.batch_size, self.n_choices, self.seq_length, self.hidden_size]) def create_and_check_lm_head(self, config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids): model = self.lm_head_model_class(config) model.eval() outputs = model(input_ids, position_ids, token_type_ids, lm_labels) loss, lm_logits = outputs[:2] total_voc = self.vocab_size self.parent.assertListEqual( list(lm_logits.size()), [self.batch_size, self.n_choices, self.seq_length, total_voc]) self.parent.assertListEqual( list(loss.size()), []) def create_and_check_presents(self, config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids): for model_class in self.all_model_classes: model = model_class(config) model.eval() outputs = model(input_ids) presents = outputs[-1] self.parent.assertEqual(self.num_hidden_layers, len(presents)) self.parent.assertListEqual( list(presents[0].size()), [2, self.batch_size * self.n_choices, self.num_attention_heads, self.seq_length, self.hidden_size // self.num_attention_heads]) def create_and_check_double_heads(self, config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids): model = self.double_head_model_class(config) model.eval() outputs = model(input_ids, mc_token_ids, lm_labels=lm_labels, mc_labels=mc_labels, token_type_ids=token_type_ids, position_ids=position_ids) lm_loss, mc_loss, lm_logits, mc_logits = outputs[:4] loss = [lm_loss, mc_loss] total_voc = self.vocab_size self.parent.assertListEqual( list(lm_logits.size()), [self.batch_size, self.n_choices, self.seq_length, total_voc]) self.parent.assertListEqual( list(mc_logits.size()), [self.batch_size, self.n_choices]) self.parent.assertListEqual( [list(l.size()) for l in loss], [[], []]) def create_and_check_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(self.base_model_class.pretrained_model_archive_map.keys())[:1]: model = self.base_model_class.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.parent.assertIsNotNone(model) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, token_type_ids, position_ids, mc_labels, lm_labels, mc_token_ids) = config_and_inputs inputs_dict = {'input_ids': input_ids} return config, inputs_dict def run_common_tests(self, test_presents=False): config_and_inputs = self.prepare_config_and_inputs() self.create_and_check_base_model(*config_and_inputs) config_and_inputs = self.prepare_config_and_inputs() self.create_and_check_lm_head(*config_and_inputs) config_and_inputs = self.prepare_config_and_inputs() self.create_and_check_double_heads(*config_and_inputs) if test_presents: config_and_inputs = self.prepare_config_and_inputs() self.create_and_check_presents(*config_and_inputs) def run_slow_tests(self): self.create_and_check_model_from_pretrained() class ConfigTester(object): def __init__(self, parent, config_class=None, **kwargs): self.parent = parent self.config_class = config_class self.inputs_dict = kwargs def create_and_test_config_common_properties(self): config = self.config_class(**self.inputs_dict) self.parent.assertTrue(hasattr(config, 'vocab_size')) self.parent.assertTrue(hasattr(config, 'hidden_size')) self.parent.assertTrue(hasattr(config, 'num_attention_heads')) self.parent.assertTrue(hasattr(config, 'num_hidden_layers')) def create_and_test_config_to_json_string(self): config = self.config_class(**self.inputs_dict) obj = json.loads(config.to_json_string()) for key, value in self.inputs_dict.items(): self.parent.assertEqual(obj[key], value) def create_and_test_config_to_json_file(self): config_first = self.config_class(**self.inputs_dict) json_file_path = os.path.join(os.getcwd(), "config_" + str(uuid.uuid4()) + ".json") config_first.to_json_file(json_file_path) config_second = self.config_class.from_json_file(json_file_path) os.remove(json_file_path) self.parent.assertEqual(config_second.to_dict(), config_first.to_dict()) def run_common_tests(self): self.create_and_test_config_common_properties() self.create_and_test_config_to_json_string() self.create_and_test_config_to_json_file() global_rng = random.Random() def ids_tensor(shape, vocab_size, rng=None, name=None): """Creates a random int32 tensor of the shape within the vocab size.""" if rng is None: rng = global_rng total_dims = 1 for dim in shape: total_dims *= dim values = [] for _ in range(total_dims): values.append(rng.randint(0, vocab_size - 1)) return torch.tensor(data=values, dtype=torch.long).view(shape).contiguous() class ModelUtilsTest(unittest.TestCase): def test_model_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: config = BertConfig.from_pretrained(model_name) self.assertIsNotNone(config) self.assertIsInstance(config, PretrainedConfig) model = BertModel.from_pretrained(model_name) model, loading_info = BertModel.from_pretrained(model_name, output_loading_info=True) self.assertIsNotNone(model) self.assertIsInstance(model, PreTrainedModel) for value in loading_info.values(): self.assertEqual(len(value), 0) config = BertConfig.from_pretrained(model_name, output_attentions=True, output_hidden_states=True) model = BertModel.from_pretrained(model_name, output_attentions=True, output_hidden_states=True) self.assertEqual(model.config.output_attentions, True) self.assertEqual(model.config.output_hidden_states, True) self.assertEqual(model.config, config) if __name__ == "__main__": unittest.main()
31,566
43.335674
137
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_xlm_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest import json from pytorch_transformers.tokenization_xlm import XLMTokenizer, VOCAB_FILES_NAMES from .tokenization_tests_commons import CommonTestCases class XLMTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = XLMTokenizer def setUp(self): super(XLMTokenizationTest, self).setUp() # Adapted from Sennrich et al. 2015 and https://github.com/rsennrich/subword-nmt vocab = ["l", "o", "w", "e", "r", "s", "t", "i", "d", "n", "w</w>", "r</w>", "t</w>", "lo", "low", "er</w>", "low</w>", "lowest</w>", "newer</w>", "wider</w>", "<unk>"] vocab_tokens = dict(zip(vocab, range(len(vocab)))) merges = ["l o 123", "lo w 1456", "e r</w> 1789", ""] self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) self.merges_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['merges_file']) with open(self.vocab_file, "w") as fp: fp.write(json.dumps(vocab_tokens)) with open(self.merges_file, "w") as fp: fp.write("\n".join(merges)) def get_tokenizer(self, **kwargs): return XLMTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"lower newer" output_text = u"lower newer" return input_text, output_text def test_full_tokenizer(self): """ Adapted from Sennrich et al. 2015 and https://github.com/rsennrich/subword-nmt """ tokenizer = XLMTokenizer(self.vocab_file, self.merges_file) text = "lower" bpe_tokens = ["low", "er</w>"] tokens = tokenizer.tokenize(text) self.assertListEqual(tokens, bpe_tokens) input_tokens = tokens + ["<unk>"] input_bpe_tokens = [14, 15, 20] self.assertListEqual( tokenizer.convert_tokens_to_ids(input_tokens), input_bpe_tokens) def test_sequence_builders(self): tokenizer = XLMTokenizer.from_pretrained("xlm-mlm-en-2048") text = tokenizer.encode("sequence builders") text_2 = tokenizer.encode("multi-sequence build") encoded_sentence = tokenizer.add_special_tokens_single_sentence(text) encoded_pair = tokenizer.add_special_tokens_sentences_pair(text, text_2) assert encoded_sentence == [1] + text + [1] assert encoded_pair == [1] + text + [1] + text_2 + [1] if __name__ == '__main__': unittest.main()
3,201
37.578313
94
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_auto_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import shutil import pytest import logging from pytorch_transformers import (AutoConfig, BertConfig, AutoModel, BertModel, AutoModelWithLMHead, BertForMaskedLM, AutoModelForSequenceClassification, BertForSequenceClassification, AutoModelForQuestionAnswering, BertForQuestionAnswering) from pytorch_transformers.modeling_bert import BERT_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class AutoModelTest(unittest.TestCase): def test_model_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: config = AutoConfig.from_pretrained(model_name) self.assertIsNotNone(config) self.assertIsInstance(config, BertConfig) model = AutoModel.from_pretrained(model_name) model, loading_info = AutoModel.from_pretrained(model_name, output_loading_info=True) self.assertIsNotNone(model) self.assertIsInstance(model, BertModel) for value in loading_info.values(): self.assertEqual(len(value), 0) def test_lmhead_model_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: config = AutoConfig.from_pretrained(model_name) self.assertIsNotNone(config) self.assertIsInstance(config, BertConfig) model = AutoModelWithLMHead.from_pretrained(model_name) model, loading_info = AutoModelWithLMHead.from_pretrained(model_name, output_loading_info=True) self.assertIsNotNone(model) self.assertIsInstance(model, BertForMaskedLM) def test_sequence_classification_model_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: config = AutoConfig.from_pretrained(model_name) self.assertIsNotNone(config) self.assertIsInstance(config, BertConfig) model = AutoModelForSequenceClassification.from_pretrained(model_name) model, loading_info = AutoModelForSequenceClassification.from_pretrained(model_name, output_loading_info=True) self.assertIsNotNone(model) self.assertIsInstance(model, BertForSequenceClassification) def test_question_answering_model_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: config = AutoConfig.from_pretrained(model_name) self.assertIsNotNone(config) self.assertIsInstance(config, BertConfig) model = AutoModelForQuestionAnswering.from_pretrained(model_name) model, loading_info = AutoModelForQuestionAnswering.from_pretrained(model_name, output_loading_info=True) self.assertIsNotNone(model) self.assertIsInstance(model, BertForQuestionAnswering) if __name__ == "__main__": unittest.main()
4,040
44.404494
122
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_dilbert_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest from io import open from pytorch_transformers.tokenization_distilbert import (DistilBertTokenizer) from .tokenization_tests_commons import CommonTestCases from .tokenization_bert_test import BertTokenizationTest class DistilBertTokenizationTest(BertTokenizationTest): tokenizer_class = DistilBertTokenizer def get_tokenizer(self, **kwargs): return DistilBertTokenizer.from_pretrained(self.tmpdirname, **kwargs) def test_sequence_builders(self): tokenizer = DistilBertTokenizer.from_pretrained("distilbert-base-uncased") text = tokenizer.encode("sequence builders") text_2 = tokenizer.encode("multi-sequence build") encoded_sentence = tokenizer.add_special_tokens_single_sentence(text) encoded_pair = tokenizer.add_special_tokens_sentences_pair(text, text_2) assert encoded_sentence == [101] + text + [102] assert encoded_pair == [101] + text + [102] + text_2 + [102] if __name__ == '__main__': unittest.main()
1,725
35.723404
82
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_bert_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import shutil import pytest from pytorch_transformers import (BertConfig, BertModel, BertForMaskedLM, BertForNextSentencePrediction, BertForPreTraining, BertForQuestionAnswering, BertForSequenceClassification, BertForTokenClassification, BertForMultipleChoice) from pytorch_transformers.modeling_bert import BERT_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class BertModelTest(CommonTestCases.CommonModelTester): all_model_classes = (BertModel, BertForMaskedLM, BertForNextSentencePrediction, BertForPreTraining, BertForQuestionAnswering, BertForSequenceClassification, BertForTokenClassification) class BertModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_input_mask=True, use_token_type_ids=True, use_labels=True, vocab_size=99, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, intermediate_size=37, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_input_mask = use_input_mask self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.intermediate_size = intermediate_size self.hidden_act = hidden_act self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_mask = None if self.use_input_mask: input_mask = ids_tensor([self.batch_size, self.seq_length], vocab_size=2) token_type_ids = None if self.use_token_type_ids: token_type_ids = ids_tensor([self.batch_size, self.seq_length], self.type_vocab_size) sequence_labels = None token_labels = None choice_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) choice_labels = ids_tensor([self.batch_size], self.num_choices) config = BertConfig( vocab_size_or_config_json_file=self.vocab_size, hidden_size=self.hidden_size, num_hidden_layers=self.num_hidden_layers, num_attention_heads=self.num_attention_heads, intermediate_size=self.intermediate_size, hidden_act=self.hidden_act, hidden_dropout_prob=self.hidden_dropout_prob, attention_probs_dropout_prob=self.attention_probs_dropout_prob, max_position_embeddings=self.max_position_embeddings, type_vocab_size=self.type_vocab_size, initializer_range=self.initializer_range) return config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_bert_model(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = BertModel(config=config) model.eval() sequence_output, pooled_output = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids) sequence_output, pooled_output = model(input_ids, token_type_ids=token_type_ids) sequence_output, pooled_output = model(input_ids) result = { "sequence_output": sequence_output, "pooled_output": pooled_output, } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertListEqual(list(result["pooled_output"].size()), [self.batch_size, self.hidden_size]) def create_and_check_bert_for_masked_lm(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = BertForMaskedLM(config=config) model.eval() loss, prediction_scores = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, masked_lm_labels=token_labels) result = { "loss": loss, "prediction_scores": prediction_scores, } self.parent.assertListEqual( list(result["prediction_scores"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.check_loss_output(result) def create_and_check_bert_for_next_sequence_prediction(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = BertForNextSentencePrediction(config=config) model.eval() loss, seq_relationship_score = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, next_sentence_label=sequence_labels) result = { "loss": loss, "seq_relationship_score": seq_relationship_score, } self.parent.assertListEqual( list(result["seq_relationship_score"].size()), [self.batch_size, 2]) self.check_loss_output(result) def create_and_check_bert_for_pretraining(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = BertForPreTraining(config=config) model.eval() loss, prediction_scores, seq_relationship_score = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, masked_lm_labels=token_labels, next_sentence_label=sequence_labels) result = { "loss": loss, "prediction_scores": prediction_scores, "seq_relationship_score": seq_relationship_score, } self.parent.assertListEqual( list(result["prediction_scores"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.parent.assertListEqual( list(result["seq_relationship_score"].size()), [self.batch_size, 2]) self.check_loss_output(result) def create_and_check_bert_for_question_answering(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): model = BertForQuestionAnswering(config=config) model.eval() loss, start_logits, end_logits = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, start_positions=sequence_labels, end_positions=sequence_labels) result = { "loss": loss, "start_logits": start_logits, "end_logits": end_logits, } self.parent.assertListEqual( list(result["start_logits"].size()), [self.batch_size, self.seq_length]) self.parent.assertListEqual( list(result["end_logits"].size()), [self.batch_size, self.seq_length]) self.check_loss_output(result) def create_and_check_bert_for_sequence_classification(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): config.num_labels = self.num_labels model = BertForSequenceClassification(config) model.eval() loss, logits = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, labels=sequence_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.num_labels]) self.check_loss_output(result) def create_and_check_bert_for_token_classification(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): config.num_labels = self.num_labels model = BertForTokenClassification(config=config) model.eval() loss, logits = model(input_ids, attention_mask=input_mask, token_type_ids=token_type_ids, labels=token_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.seq_length, self.num_labels]) self.check_loss_output(result) def create_and_check_bert_for_multiple_choice(self, config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels): config.num_choices = self.num_choices model = BertForMultipleChoice(config=config) model.eval() multiple_choice_inputs_ids = input_ids.unsqueeze(1).expand(-1, self.num_choices, -1).contiguous() multiple_choice_token_type_ids = token_type_ids.unsqueeze(1).expand(-1, self.num_choices, -1).contiguous() multiple_choice_input_mask = input_mask.unsqueeze(1).expand(-1, self.num_choices, -1).contiguous() loss, logits = model(multiple_choice_inputs_ids, attention_mask=multiple_choice_input_mask, token_type_ids=multiple_choice_token_type_ids, labels=choice_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.num_choices]) self.check_loss_output(result) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, token_type_ids, input_mask, sequence_labels, token_labels, choice_labels) = config_and_inputs inputs_dict = {'input_ids': input_ids, 'token_type_ids': token_type_ids, 'attention_mask': input_mask} return config, inputs_dict def setUp(self): self.model_tester = BertModelTest.BertModelTester(self) self.config_tester = ConfigTester(self, config_class=BertConfig, hidden_size=37) def test_config(self): self.config_tester.run_common_tests() def test_bert_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_model(*config_and_inputs) def test_for_masked_lm(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_masked_lm(*config_and_inputs) def test_for_multiple_choice(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_multiple_choice(*config_and_inputs) def test_for_next_sequence_prediction(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_next_sequence_prediction(*config_and_inputs) def test_for_pretraining(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_pretraining(*config_and_inputs) def test_for_question_answering(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_question_answering(*config_and_inputs) def test_for_sequence_classification(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_sequence_classification(*config_and_inputs) def test_for_token_classification(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_bert_for_token_classification(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = BertModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
15,142
46.920886
162
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/optimization_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import os import torch from pytorch_transformers import (AdamW, ConstantLRSchedule, WarmupConstantSchedule, WarmupCosineSchedule, WarmupCosineWithHardRestartsSchedule, WarmupLinearSchedule) from .tokenization_tests_commons import TemporaryDirectory def unwrap_schedule(scheduler, num_steps=10): lrs = [] for _ in range(num_steps): scheduler.step() lrs.append(scheduler.get_lr()) return lrs def unwrap_and_save_reload_schedule(scheduler, num_steps=10): lrs = [] for step in range(num_steps): scheduler.step() lrs.append(scheduler.get_lr()) if step == num_steps // 2: with TemporaryDirectory() as tmpdirname: file_name = os.path.join(tmpdirname, 'schedule.bin') torch.save(scheduler.state_dict(), file_name) state_dict = torch.load(file_name) scheduler.load_state_dict(state_dict) return lrs class OptimizationTest(unittest.TestCase): def assertListAlmostEqual(self, list1, list2, tol): self.assertEqual(len(list1), len(list2)) for a, b in zip(list1, list2): self.assertAlmostEqual(a, b, delta=tol) def test_adam_w(self): w = torch.tensor([0.1, -0.2, -0.1], requires_grad=True) target = torch.tensor([0.4, 0.2, -0.5]) criterion = torch.nn.MSELoss() # No warmup, constant schedule, no gradient clipping optimizer = AdamW(params=[w], lr=2e-1, weight_decay=0.0) for _ in range(100): loss = criterion(w, target) loss.backward() optimizer.step() w.grad.detach_() # No zero_grad() function on simple tensors. we do it ourselves. w.grad.zero_() self.assertListAlmostEqual(w.tolist(), [0.4, 0.2, -0.5], tol=1e-2) class ScheduleInitTest(unittest.TestCase): m = torch.nn.Linear(50, 50) optimizer = AdamW(m.parameters(), lr=10.) num_steps = 10 def assertListAlmostEqual(self, list1, list2, tol): self.assertEqual(len(list1), len(list2)) for a, b in zip(list1, list2): self.assertAlmostEqual(a, b, delta=tol) def test_constant_scheduler(self): scheduler = ConstantLRSchedule(self.optimizer) lrs = unwrap_schedule(scheduler, self.num_steps) expected_learning_rates = [10.] * self.num_steps self.assertEqual(len(lrs[0]), 1) self.assertListEqual([l[0] for l in lrs], expected_learning_rates) scheduler = ConstantLRSchedule(self.optimizer) lrs_2 = unwrap_and_save_reload_schedule(scheduler, self.num_steps) self.assertListEqual([l[0] for l in lrs], [l[0] for l in lrs_2]) def test_warmup_constant_scheduler(self): scheduler = WarmupConstantSchedule(self.optimizer, warmup_steps=4) lrs = unwrap_schedule(scheduler, self.num_steps) expected_learning_rates = [2.5, 5.0, 7.5, 10.0, 10.0, 10.0, 10.0, 10.0, 10.0, 10.0] self.assertEqual(len(lrs[0]), 1) self.assertListEqual([l[0] for l in lrs], expected_learning_rates) scheduler = WarmupConstantSchedule(self.optimizer, warmup_steps=4) lrs_2 = unwrap_and_save_reload_schedule(scheduler, self.num_steps) self.assertListEqual([l[0] for l in lrs], [l[0] for l in lrs_2]) def test_warmup_linear_scheduler(self): scheduler = WarmupLinearSchedule(self.optimizer, warmup_steps=2, t_total=10) lrs = unwrap_schedule(scheduler, self.num_steps) expected_learning_rates = [5.0, 10.0, 8.75, 7.5, 6.25, 5.0, 3.75, 2.5, 1.25, 0.0] self.assertEqual(len(lrs[0]), 1) self.assertListEqual([l[0] for l in lrs], expected_learning_rates) scheduler = WarmupLinearSchedule(self.optimizer, warmup_steps=2, t_total=10) lrs_2 = unwrap_and_save_reload_schedule(scheduler, self.num_steps) self.assertListEqual([l[0] for l in lrs], [l[0] for l in lrs_2]) def test_warmup_cosine_scheduler(self): scheduler = WarmupCosineSchedule(self.optimizer, warmup_steps=2, t_total=10) lrs = unwrap_schedule(scheduler, self.num_steps) expected_learning_rates = [5.0, 10.0, 9.61, 8.53, 6.91, 5.0, 3.08, 1.46, 0.38, 0.0] self.assertEqual(len(lrs[0]), 1) self.assertListAlmostEqual([l[0] for l in lrs], expected_learning_rates, tol=1e-2) scheduler = WarmupCosineSchedule(self.optimizer, warmup_steps=2, t_total=10) lrs_2 = unwrap_and_save_reload_schedule(scheduler, self.num_steps) self.assertListEqual([l[0] for l in lrs], [l[0] for l in lrs_2]) def test_warmup_cosine_hard_restart_scheduler(self): scheduler = WarmupCosineWithHardRestartsSchedule(self.optimizer, warmup_steps=2, cycles=2, t_total=10) lrs = unwrap_schedule(scheduler, self.num_steps) expected_learning_rates = [5.0, 10.0, 8.53, 5.0, 1.46, 10.0, 8.53, 5.0, 1.46, 0.0] self.assertEqual(len(lrs[0]), 1) self.assertListAlmostEqual([l[0] for l in lrs], expected_learning_rates, tol=1e-2) scheduler = WarmupCosineWithHardRestartsSchedule(self.optimizer, warmup_steps=2, cycles=2, t_total=10) lrs_2 = unwrap_and_save_reload_schedule(scheduler, self.num_steps) self.assertListEqual([l[0] for l in lrs], [l[0] for l in lrs_2]) if __name__ == "__main__": unittest.main()
6,088
42.492857
115
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_xlnet_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import os import unittest import json import random import shutil import pytest import torch from pytorch_transformers import (XLNetConfig, XLNetModel, XLNetLMHeadModel, XLNetForSequenceClassification, XLNetForQuestionAnswering) from pytorch_transformers.modeling_xlnet import XLNET_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class XLNetModelTest(CommonTestCases.CommonModelTester): all_model_classes=(XLNetModel, XLNetLMHeadModel, XLNetForSequenceClassification, XLNetForQuestionAnswering) test_pruning = False class XLNetModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, mem_len=10, clamp_len=-1, reuse_len=15, is_training=True, use_labels=True, vocab_size=99, cutoffs=[10, 50, 80], hidden_size=32, num_attention_heads=4, d_inner=128, num_hidden_layers=5, max_position_embeddings=10, type_sequence_label_size=2, untie_r=True, bi_data=False, same_length=False, initializer_range=0.05, seed=1, type_vocab_size=2, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.mem_len = mem_len # self.key_len = seq_length + mem_len self.clamp_len = clamp_len self.reuse_len = reuse_len self.is_training = is_training self.use_labels = use_labels self.vocab_size = vocab_size self.cutoffs = cutoffs self.hidden_size = hidden_size self.num_attention_heads = num_attention_heads self.d_inner = d_inner self.num_hidden_layers = num_hidden_layers self.max_position_embeddings = max_position_embeddings self.bi_data = bi_data self.untie_r = untie_r self.same_length = same_length self.initializer_range = initializer_range self.seed = seed self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size def prepare_config_and_inputs(self): input_ids_1 = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_ids_2 = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) segment_ids = ids_tensor([self.batch_size, self.seq_length], self.type_vocab_size) input_mask = ids_tensor([self.batch_size, self.seq_length], 2).float() input_ids_q = ids_tensor([self.batch_size, self.seq_length + 1], self.vocab_size) perm_mask = torch.zeros(self.batch_size, self.seq_length + 1, self.seq_length + 1, dtype=torch.float) perm_mask[:, :, -1] = 1.0 # Previous tokens don't see last token target_mapping = torch.zeros(self.batch_size, 1, self.seq_length + 1, dtype=torch.float) target_mapping[:, 0, -1] = 1.0 # predict last token sequence_labels = None lm_labels = None is_impossible_labels = None if self.use_labels: lm_labels = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) is_impossible_labels = ids_tensor([self.batch_size], 2).float() config = XLNetConfig( vocab_size_or_config_json_file=self.vocab_size, d_model=self.hidden_size, n_head=self.num_attention_heads, d_inner=self.d_inner, n_layer=self.num_hidden_layers, untie_r=self.untie_r, max_position_embeddings=self.max_position_embeddings, mem_len=self.mem_len, clamp_len=self.clamp_len, same_length=self.same_length, reuse_len=self.reuse_len, bi_data=self.bi_data, initializer_range=self.initializer_range, num_labels=self.type_sequence_label_size) return (config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels) def set_seed(self): random.seed(self.seed) torch.manual_seed(self.seed) def create_and_check_xlnet_base_model(self, config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels): model = XLNetModel(config) model.eval() _, _ = model(input_ids_1, input_mask=input_mask) _, _ = model(input_ids_1, attention_mask=input_mask) _, _ = model(input_ids_1, token_type_ids=segment_ids) outputs, mems_1 = model(input_ids_1) result = { "mems_1": mems_1, "outputs": outputs, } self.parent.assertListEqual( list(result["outputs"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_1"]), [[self.seq_length, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def create_and_check_xlnet_lm_head(self, config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels): model = XLNetLMHeadModel(config) model.eval() loss_1, all_logits_1, mems_1 = model(input_ids_1, token_type_ids=segment_ids, labels=lm_labels) loss_2, all_logits_2, mems_2 = model(input_ids_2, token_type_ids=segment_ids, labels=lm_labels, mems=mems_1) logits, _ = model(input_ids_q, perm_mask=perm_mask, target_mapping=target_mapping) result = { "loss_1": loss_1, "mems_1": mems_1, "all_logits_1": all_logits_1, "loss_2": loss_2, "mems_2": mems_2, "all_logits_2": all_logits_2, } self.parent.assertListEqual( list(result["loss_1"].size()), []) self.parent.assertListEqual( list(result["all_logits_1"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_1"]), [[self.seq_length, self.batch_size, self.hidden_size]] * self.num_hidden_layers) self.parent.assertListEqual( list(result["loss_2"].size()), []) self.parent.assertListEqual( list(result["all_logits_2"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_2"]), [[self.mem_len, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def create_and_check_xlnet_qa(self, config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels): model = XLNetForQuestionAnswering(config) model.eval() outputs = model(input_ids_1) start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits, mems = outputs outputs = model(input_ids_1, start_positions=sequence_labels, end_positions=sequence_labels, cls_index=sequence_labels, is_impossible=is_impossible_labels, p_mask=input_mask) outputs = model(input_ids_1, start_positions=sequence_labels, end_positions=sequence_labels, cls_index=sequence_labels, is_impossible=is_impossible_labels) total_loss, mems = outputs outputs = model(input_ids_1, start_positions=sequence_labels, end_positions=sequence_labels) total_loss, mems = outputs result = { "loss": total_loss, "start_top_log_probs": start_top_log_probs, "start_top_index": start_top_index, "end_top_log_probs": end_top_log_probs, "end_top_index": end_top_index, "cls_logits": cls_logits, "mems": mems, } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["start_top_log_probs"].size()), [self.batch_size, model.config.start_n_top]) self.parent.assertListEqual( list(result["start_top_index"].size()), [self.batch_size, model.config.start_n_top]) self.parent.assertListEqual( list(result["end_top_log_probs"].size()), [self.batch_size, model.config.start_n_top * model.config.end_n_top]) self.parent.assertListEqual( list(result["end_top_index"].size()), [self.batch_size, model.config.start_n_top * model.config.end_n_top]) self.parent.assertListEqual( list(result["cls_logits"].size()), [self.batch_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems"]), [[self.seq_length, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def create_and_check_xlnet_sequence_classif(self, config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels): model = XLNetForSequenceClassification(config) model.eval() logits, mems_1 = model(input_ids_1) loss, logits, mems_1 = model(input_ids_1, labels=sequence_labels) result = { "loss": loss, "mems_1": mems_1, "logits": logits, } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.type_sequence_label_size]) self.parent.assertListEqual( list(list(mem.size()) for mem in result["mems_1"]), [[self.seq_length, self.batch_size, self.hidden_size]] * self.num_hidden_layers) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids_1, input_ids_2, input_ids_q, perm_mask, input_mask, target_mapping, segment_ids, lm_labels, sequence_labels, is_impossible_labels) = config_and_inputs inputs_dict = {'input_ids': input_ids_1} return config, inputs_dict def setUp(self): self.model_tester = XLNetModelTest.XLNetModelTester(self) self.config_tester = ConfigTester(self, config_class=XLNetConfig, d_inner=37) def test_config(self): self.config_tester.run_common_tests() def test_xlnet_base_model(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_xlnet_base_model(*config_and_inputs) def test_xlnet_lm_head(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_xlnet_lm_head(*config_and_inputs) def test_xlnet_sequence_classif(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_xlnet_sequence_classif(*config_and_inputs) def test_xlnet_qa(self): self.model_tester.set_seed() config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_xlnet_qa(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(XLNET_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = XLNetModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
14,225
42.907407
135
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_distilbert_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest from pytorch_transformers import (DistilBertConfig, DistilBertModel, DistilBertForMaskedLM, DistilBertForQuestionAnswering, DistilBertForSequenceClassification) from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class DistilBertModelTest(CommonTestCases.CommonModelTester): all_model_classes = (DistilBertModel, DistilBertForMaskedLM, DistilBertForQuestionAnswering, DistilBertForSequenceClassification) test_pruning = True test_torchscript = True test_resize_embeddings = True test_head_masking = True class DistilBertModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_input_mask=True, use_token_type_ids=False, use_labels=True, vocab_size=99, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, intermediate_size=37, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_input_mask = use_input_mask self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.intermediate_size = intermediate_size self.hidden_act = hidden_act self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_mask = None if self.use_input_mask: input_mask = ids_tensor([self.batch_size, self.seq_length], vocab_size=2) sequence_labels = None token_labels = None choice_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) choice_labels = ids_tensor([self.batch_size], self.num_choices) config = DistilBertConfig( vocab_size_or_config_json_file=self.vocab_size, dim=self.hidden_size, n_layers=self.num_hidden_layers, n_heads=self.num_attention_heads, hidden_dim=self.intermediate_size, hidden_act=self.hidden_act, dropout=self.hidden_dropout_prob, attention_dropout=self.attention_probs_dropout_prob, max_position_embeddings=self.max_position_embeddings, initializer_range=self.initializer_range) return config, input_ids, input_mask, sequence_labels, token_labels, choice_labels def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_distilbert_model(self, config, input_ids, input_mask, sequence_labels, token_labels, choice_labels): model = DistilBertModel(config=config) model.eval() (sequence_output,) = model(input_ids, input_mask) (sequence_output,) = model(input_ids) result = { "sequence_output": sequence_output, } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) def create_and_check_distilbert_for_masked_lm(self, config, input_ids, input_mask, sequence_labels, token_labels, choice_labels): model = DistilBertForMaskedLM(config=config) model.eval() loss, prediction_scores = model(input_ids, attention_mask=input_mask, masked_lm_labels=token_labels) result = { "loss": loss, "prediction_scores": prediction_scores, } self.parent.assertListEqual( list(result["prediction_scores"].size()), [self.batch_size, self.seq_length, self.vocab_size]) self.check_loss_output(result) def create_and_check_distilbert_for_question_answering(self, config, input_ids, input_mask, sequence_labels, token_labels, choice_labels): model = DistilBertForQuestionAnswering(config=config) model.eval() loss, start_logits, end_logits = model(input_ids, attention_mask=input_mask, start_positions=sequence_labels, end_positions=sequence_labels) result = { "loss": loss, "start_logits": start_logits, "end_logits": end_logits, } self.parent.assertListEqual( list(result["start_logits"].size()), [self.batch_size, self.seq_length]) self.parent.assertListEqual( list(result["end_logits"].size()), [self.batch_size, self.seq_length]) self.check_loss_output(result) def create_and_check_distilbert_for_sequence_classification(self, config, input_ids, input_mask, sequence_labels, token_labels, choice_labels): config.num_labels = self.num_labels model = DistilBertForSequenceClassification(config) model.eval() loss, logits = model(input_ids, attention_mask=input_mask, labels=sequence_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.num_labels]) self.check_loss_output(result) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, input_mask, sequence_labels, token_labels, choice_labels) = config_and_inputs inputs_dict = {'input_ids': input_ids, 'attention_mask': input_mask} return config, inputs_dict def setUp(self): self.model_tester = DistilBertModelTest.DistilBertModelTester(self) self.config_tester = ConfigTester(self, config_class=DistilBertConfig, dim=37) def test_config(self): self.config_tester.run_common_tests() def test_distilbert_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_distilbert_model(*config_and_inputs) def test_for_masked_lm(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_distilbert_for_masked_lm(*config_and_inputs) def test_for_question_answering(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_distilbert_for_question_answering(*config_and_inputs) def test_for_sequence_classification(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_distilbert_for_sequence_classification(*config_and_inputs) # @pytest.mark.slow # def test_model_from_pretrained(self): # cache_dir = "/tmp/pytorch_transformers_test/" # for model_name in list(DISTILBERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: # model = DistilBertModel.from_pretrained(model_name, cache_dir=cache_dir) # shutil.rmtree(cache_dir) # self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
9,661
43.731481
152
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_bert_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest from io import open from pytorch_transformers.tokenization_bert import (BasicTokenizer, BertTokenizer, WordpieceTokenizer, _is_control, _is_punctuation, _is_whitespace, VOCAB_FILES_NAMES) from .tokenization_tests_commons import CommonTestCases class BertTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = BertTokenizer def setUp(self): super(BertTokenizationTest, self).setUp() vocab_tokens = [ "[UNK]", "[CLS]", "[SEP]", "want", "##want", "##ed", "wa", "un", "runn", "##ing", ",", "low", "lowest", ] self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) with open(self.vocab_file, "w", encoding='utf-8') as vocab_writer: vocab_writer.write("".join([x + "\n" for x in vocab_tokens])) def get_tokenizer(self, **kwargs): return BertTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"UNwant\u00E9d,running" output_text = u"unwanted, running" return input_text, output_text def test_full_tokenizer(self): tokenizer = self.tokenizer_class(self.vocab_file) tokens = tokenizer.tokenize(u"UNwant\u00E9d,running") self.assertListEqual(tokens, ["un", "##want", "##ed", ",", "runn", "##ing"]) self.assertListEqual(tokenizer.convert_tokens_to_ids(tokens), [7, 4, 5, 10, 8, 9]) def test_chinese(self): tokenizer = BasicTokenizer() self.assertListEqual( tokenizer.tokenize(u"ah\u535A\u63A8zz"), [u"ah", u"\u535A", u"\u63A8", u"zz"]) def test_basic_tokenizer_lower(self): tokenizer = BasicTokenizer(do_lower_case=True) self.assertListEqual( tokenizer.tokenize(u" \tHeLLo!how \n Are yoU? "), ["hello", "!", "how", "are", "you", "?"]) self.assertListEqual(tokenizer.tokenize(u"H\u00E9llo"), ["hello"]) def test_basic_tokenizer_no_lower(self): tokenizer = BasicTokenizer(do_lower_case=False) self.assertListEqual( tokenizer.tokenize(u" \tHeLLo!how \n Are yoU? "), ["HeLLo", "!", "how", "Are", "yoU", "?"]) def test_wordpiece_tokenizer(self): vocab_tokens = [ "[UNK]", "[CLS]", "[SEP]", "want", "##want", "##ed", "wa", "un", "runn", "##ing" ] vocab = {} for (i, token) in enumerate(vocab_tokens): vocab[token] = i tokenizer = WordpieceTokenizer(vocab=vocab, unk_token="[UNK]") self.assertListEqual(tokenizer.tokenize(""), []) self.assertListEqual( tokenizer.tokenize("unwanted running"), ["un", "##want", "##ed", "runn", "##ing"]) self.assertListEqual( tokenizer.tokenize("unwantedX running"), ["[UNK]", "runn", "##ing"]) def test_is_whitespace(self): self.assertTrue(_is_whitespace(u" ")) self.assertTrue(_is_whitespace(u"\t")) self.assertTrue(_is_whitespace(u"\r")) self.assertTrue(_is_whitespace(u"\n")) self.assertTrue(_is_whitespace(u"\u00A0")) self.assertFalse(_is_whitespace(u"A")) self.assertFalse(_is_whitespace(u"-")) def test_is_control(self): self.assertTrue(_is_control(u"\u0005")) self.assertFalse(_is_control(u"A")) self.assertFalse(_is_control(u" ")) self.assertFalse(_is_control(u"\t")) self.assertFalse(_is_control(u"\r")) def test_is_punctuation(self): self.assertTrue(_is_punctuation(u"-")) self.assertTrue(_is_punctuation(u"$")) self.assertTrue(_is_punctuation(u"`")) self.assertTrue(_is_punctuation(u".")) self.assertFalse(_is_punctuation(u"A")) self.assertFalse(_is_punctuation(u" ")) def test_sequence_builders(self): tokenizer = self.tokenizer_class.from_pretrained("bert-base-uncased") text = tokenizer.encode("sequence builders") text_2 = tokenizer.encode("multi-sequence build") encoded_sentence = tokenizer.add_special_tokens_single_sentence(text) encoded_pair = tokenizer.add_special_tokens_sentences_pair(text, text_2) assert encoded_sentence == [101] + text + [102] assert encoded_pair == [101] + text + [102] + text_2 + [102] if __name__ == '__main__': unittest.main()
5,314
36.429577
90
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_auto_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import shutil import pytest import logging from pytorch_transformers import AutoTokenizer, BertTokenizer, AutoTokenizer, GPT2Tokenizer from pytorch_transformers.modeling_bert import BERT_PRETRAINED_MODEL_ARCHIVE_MAP from pytorch_transformers.modeling_gpt2 import GPT2_PRETRAINED_MODEL_ARCHIVE_MAP class AutoTokenizerTest(unittest.TestCase): def test_tokenizer_from_pretrained(self): logging.basicConfig(level=logging.INFO) for model_name in list(BERT_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: tokenizer = AutoTokenizer.from_pretrained(model_name) self.assertIsNotNone(tokenizer) self.assertIsInstance(tokenizer, BertTokenizer) self.assertGreater(len(tokenizer), 0) for model_name in list(GPT2_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: tokenizer = AutoTokenizer.from_pretrained(model_name) self.assertIsNotNone(tokenizer) self.assertIsInstance(tokenizer, GPT2Tokenizer) self.assertGreater(len(tokenizer), 0) if __name__ == "__main__": unittest.main()
1,825
37.851064
91
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_roberta_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import json import unittest from io import open from pytorch_transformers.tokenization_roberta import RobertaTokenizer, VOCAB_FILES_NAMES from .tokenization_tests_commons import CommonTestCases class RobertaTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = RobertaTokenizer def setUp(self): super(RobertaTokenizationTest, self).setUp() # Adapted from Sennrich et al. 2015 and https://github.com/rsennrich/subword-nmt vocab = ["l", "o", "w", "e", "r", "s", "t", "i", "d", "n", "\u0120", "\u0120l", "\u0120n", "\u0120lo", "\u0120low", "er", "\u0120lowest", "\u0120newer", "\u0120wider", "<unk>"] vocab_tokens = dict(zip(vocab, range(len(vocab)))) merges = ["#version: 0.2", "\u0120 l", "\u0120l o", "\u0120lo w", "e r", ""] self.special_tokens_map = {"unk_token": "<unk>"} self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) self.merges_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['merges_file']) with open(self.vocab_file, "w", encoding="utf-8") as fp: fp.write(json.dumps(vocab_tokens) + "\n") with open(self.merges_file, "w", encoding="utf-8") as fp: fp.write("\n".join(merges)) def get_tokenizer(self, **kwargs): kwargs.update(self.special_tokens_map) return RobertaTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"lower newer" output_text = u" lower newer" return input_text, output_text def test_full_tokenizer(self): tokenizer = RobertaTokenizer(self.vocab_file, self.merges_file, **self.special_tokens_map) text = "lower newer" bpe_tokens = ["\u0120low", "er", "\u0120", "n", "e", "w", "er"] tokens = tokenizer.tokenize(text) self.assertListEqual(tokens, bpe_tokens) input_tokens = tokens + [tokenizer.unk_token] input_bpe_tokens = [14, 15, 10, 9, 3, 2, 15, 19] self.assertListEqual( tokenizer.convert_tokens_to_ids(input_tokens), input_bpe_tokens) def roberta_dict_integration_testing(self): tokenizer = self.get_tokenizer() self.assertListEqual( tokenizer.encode('Hello world!'), [0, 31414, 232, 328, 2] ) self.assertListEqual( tokenizer.encode('Hello world! cécé herlolip 418'), [0, 31414, 232, 328, 740, 1140, 12695, 69, 46078, 1588, 2] ) def test_sequence_builders(self): tokenizer = RobertaTokenizer.from_pretrained("roberta-base") text = tokenizer.encode("sequence builders") text_2 = tokenizer.encode("multi-sequence build") encoded_text_from_decode = tokenizer.encode("sequence builders", add_special_tokens=True) encoded_pair_from_decode = tokenizer.encode("sequence builders", "multi-sequence build", add_special_tokens=True) encoded_sentence = tokenizer.add_special_tokens_single_sentence(text) encoded_pair = tokenizer.add_special_tokens_sentences_pair(text, text_2) assert encoded_sentence == encoded_text_from_decode assert encoded_pair == encoded_pair_from_decode if __name__ == '__main__': unittest.main()
4,038
39.79798
121
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_xlnet_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest from pytorch_transformers.tokenization_xlnet import (XLNetTokenizer, SPIECE_UNDERLINE) from .tokenization_tests_commons import CommonTestCases SAMPLE_VOCAB = os.path.join(os.path.dirname(os.path.abspath(__file__)), 'fixtures/test_sentencepiece.model') class XLNetTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = XLNetTokenizer def setUp(self): super(XLNetTokenizationTest, self).setUp() # We have a SentencePiece fixture for testing tokenizer = XLNetTokenizer(SAMPLE_VOCAB, keep_accents=True) tokenizer.save_pretrained(self.tmpdirname) def get_tokenizer(self, **kwargs): return XLNetTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"This is a test" output_text = u"This is a test" return input_text, output_text def test_full_tokenizer(self): tokenizer = XLNetTokenizer(SAMPLE_VOCAB, keep_accents=True) tokens = tokenizer.tokenize(u'This is a test') self.assertListEqual(tokens, [u'▁This', u'▁is', u'▁a', u'▁t', u'est']) self.assertListEqual( tokenizer.convert_tokens_to_ids(tokens), [285, 46, 10, 170, 382]) tokens = tokenizer.tokenize(u"I was born in 92000, and this is falsé.") self.assertListEqual(tokens, [SPIECE_UNDERLINE + u'I', SPIECE_UNDERLINE + u'was', SPIECE_UNDERLINE + u'b', u'or', u'n', SPIECE_UNDERLINE + u'in', SPIECE_UNDERLINE + u'', u'9', u'2', u'0', u'0', u'0', u',', SPIECE_UNDERLINE + u'and', SPIECE_UNDERLINE + u'this', SPIECE_UNDERLINE + u'is', SPIECE_UNDERLINE + u'f', u'al', u's', u'é', u'.']) ids = tokenizer.convert_tokens_to_ids(tokens) self.assertListEqual( ids, [8, 21, 84, 55, 24, 19, 7, 0, 602, 347, 347, 347, 3, 12, 66, 46, 72, 80, 6, 0, 4]) back_tokens = tokenizer.convert_ids_to_tokens(ids) self.assertListEqual(back_tokens, [SPIECE_UNDERLINE + u'I', SPIECE_UNDERLINE + u'was', SPIECE_UNDERLINE + u'b', u'or', u'n', SPIECE_UNDERLINE + u'in', SPIECE_UNDERLINE + u'', u'<unk>', u'2', u'0', u'0', u'0', u',', SPIECE_UNDERLINE + u'and', SPIECE_UNDERLINE + u'this', SPIECE_UNDERLINE + u'is', SPIECE_UNDERLINE + u'f', u'al', u's', u'<unk>', u'.']) def test_tokenizer_lower(self): tokenizer = XLNetTokenizer(SAMPLE_VOCAB, do_lower_case=True) tokens = tokenizer.tokenize(u"I was born in 92000, and this is falsé.") self.assertListEqual(tokens, [SPIECE_UNDERLINE + u'', u'i', SPIECE_UNDERLINE + u'was', SPIECE_UNDERLINE + u'b', u'or', u'n', SPIECE_UNDERLINE + u'in', SPIECE_UNDERLINE + u'', u'9', u'2', u'0', u'0', u'0', u',', SPIECE_UNDERLINE + u'and', SPIECE_UNDERLINE + u'this', SPIECE_UNDERLINE + u'is', SPIECE_UNDERLINE + u'f', u'al', u'se', u'.']) self.assertListEqual(tokenizer.tokenize(u"H\u00E9llo"), [u"▁he", u"ll", u"o"]) def test_tokenizer_no_lower(self): tokenizer = XLNetTokenizer(SAMPLE_VOCAB, do_lower_case=False) tokens = tokenizer.tokenize(u"I was born in 92000, and this is falsé.") self.assertListEqual(tokens, [SPIECE_UNDERLINE + u'I', SPIECE_UNDERLINE + u'was', SPIECE_UNDERLINE + u'b', u'or', u'n', SPIECE_UNDERLINE + u'in', SPIECE_UNDERLINE + u'', u'9', u'2', u'0', u'0', u'0', u',', SPIECE_UNDERLINE + u'and', SPIECE_UNDERLINE + u'this', SPIECE_UNDERLINE + u'is', SPIECE_UNDERLINE + u'f', u'al', u'se', u'.']) def test_sequence_builders(self): tokenizer = XLNetTokenizer.from_pretrained("xlnet-base-cased") text = tokenizer.encode("sequence builders") text_2 = tokenizer.encode("multi-sequence build") encoded_sentence = tokenizer.add_special_tokens_single_sentence(text) encoded_pair = tokenizer.add_special_tokens_sentences_pair(text, text_2) assert encoded_sentence == text + [4, 3] assert encoded_pair == text + [4] + text_2 + [4, 3] if __name__ == '__main__': unittest.main()
5,262
48.186916
128
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_xlm_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import shutil import pytest from pytorch_transformers import (XLMConfig, XLMModel, XLMWithLMHeadModel, XLMForQuestionAnswering, XLMForSequenceClassification) from pytorch_transformers.modeling_xlm import XLM_PRETRAINED_MODEL_ARCHIVE_MAP from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class XLMModelTest(CommonTestCases.CommonModelTester): all_model_classes = (XLMModel, XLMWithLMHeadModel, XLMForQuestionAnswering, XLMForSequenceClassification) # , XLMForSequenceClassification, XLMForTokenClassification), class XLMModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_input_lengths=True, use_token_type_ids=True, use_labels=True, gelu_activation=True, sinusoidal_embeddings=False, causal=False, asm=False, n_langs=2, vocab_size=99, n_special=0, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, summary_type="last", use_proj=True, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_input_lengths = use_input_lengths self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.gelu_activation = gelu_activation self.sinusoidal_embeddings = sinusoidal_embeddings self.asm = asm self.n_langs = n_langs self.vocab_size = vocab_size self.n_special = n_special self.summary_type = summary_type self.causal = causal self.use_proj = use_proj self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.n_langs = n_langs self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.summary_type = summary_type self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) input_mask = ids_tensor([self.batch_size, self.seq_length], 2).float() input_lengths = None if self.use_input_lengths: input_lengths = ids_tensor([self.batch_size], vocab_size=2) + self.seq_length - 2 # small variation of seq_length token_type_ids = None if self.use_token_type_ids: token_type_ids = ids_tensor([self.batch_size, self.seq_length], self.n_langs) sequence_labels = None token_labels = None is_impossible_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) is_impossible_labels = ids_tensor([self.batch_size], 2).float() config = XLMConfig( vocab_size_or_config_json_file=self.vocab_size, n_special=self.n_special, emb_dim=self.hidden_size, n_layers=self.num_hidden_layers, n_heads=self.num_attention_heads, dropout=self.hidden_dropout_prob, attention_dropout=self.attention_probs_dropout_prob, gelu_activation=self.gelu_activation, sinusoidal_embeddings=self.sinusoidal_embeddings, asm=self.asm, causal=self.causal, n_langs=self.n_langs, max_position_embeddings=self.max_position_embeddings, initializer_range=self.initializer_range, summary_type=self.summary_type, use_proj=self.use_proj) return config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_xlm_model(self, config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask): model = XLMModel(config=config) model.eval() outputs = model(input_ids, lengths=input_lengths, langs=token_type_ids) outputs = model(input_ids, langs=token_type_ids) outputs = model(input_ids) sequence_output = outputs[0] result = { "sequence_output": sequence_output, } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) def create_and_check_xlm_lm_head(self, config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask): model = XLMWithLMHeadModel(config) model.eval() loss, logits = model(input_ids, token_type_ids=token_type_ids, labels=token_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.seq_length, self.vocab_size]) def create_and_check_xlm_qa(self, config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask): model = XLMForQuestionAnswering(config) model.eval() outputs = model(input_ids) start_top_log_probs, start_top_index, end_top_log_probs, end_top_index, cls_logits, mems = outputs outputs = model(input_ids, start_positions=sequence_labels, end_positions=sequence_labels, cls_index=sequence_labels, is_impossible=is_impossible_labels, p_mask=input_mask) outputs = model(input_ids, start_positions=sequence_labels, end_positions=sequence_labels, cls_index=sequence_labels, is_impossible=is_impossible_labels) (total_loss,) = outputs outputs = model(input_ids, start_positions=sequence_labels, end_positions=sequence_labels) (total_loss,) = outputs result = { "loss": total_loss, "start_top_log_probs": start_top_log_probs, "start_top_index": start_top_index, "end_top_log_probs": end_top_log_probs, "end_top_index": end_top_index, "cls_logits": cls_logits, } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["start_top_log_probs"].size()), [self.batch_size, model.config.start_n_top]) self.parent.assertListEqual( list(result["start_top_index"].size()), [self.batch_size, model.config.start_n_top]) self.parent.assertListEqual( list(result["end_top_log_probs"].size()), [self.batch_size, model.config.start_n_top * model.config.end_n_top]) self.parent.assertListEqual( list(result["end_top_index"].size()), [self.batch_size, model.config.start_n_top * model.config.end_n_top]) self.parent.assertListEqual( list(result["cls_logits"].size()), [self.batch_size]) def create_and_check_xlm_sequence_classif(self, config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask): model = XLMForSequenceClassification(config) model.eval() (logits,) = model(input_ids) loss, logits = model(input_ids, labels=sequence_labels) result = { "loss": loss, "logits": logits, } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["logits"].size()), [self.batch_size, self.type_sequence_label_size]) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, token_type_ids, input_lengths, sequence_labels, token_labels, is_impossible_labels, input_mask) = config_and_inputs inputs_dict = {'input_ids': input_ids, 'token_type_ids': token_type_ids, 'lengths': input_lengths} return config, inputs_dict def setUp(self): self.model_tester = XLMModelTest.XLMModelTester(self) self.config_tester = ConfigTester(self, config_class=XLMConfig, emb_dim=37) def test_config(self): self.config_tester.run_common_tests() def test_xlm_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_xlm_model(*config_and_inputs) # config_and_inputs = tester.prepare_config_and_inputs() # tester.create_and_check_xlm_for_masked_lm(*config_and_inputs) # config_and_inputs = tester.prepare_config_and_inputs() # tester.create_and_check_xlm_for_multiple_choice(*config_and_inputs) # config_and_inputs = tester.prepare_config_and_inputs() # tester.create_and_check_xlm_for_question_answering(*config_and_inputs) # config_and_inputs = tester.prepare_config_and_inputs() # tester.create_and_check_xlm_for_sequence_classification(*config_and_inputs) # config_and_inputs = tester.prepare_config_and_inputs() # tester.create_and_check_xlm_for_token_classification(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(XLM_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = XLMModel.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
12,712
42.094915
171
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/modeling_gpt2_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import unittest import pytest import shutil from pytorch_transformers import (GPT2Config, GPT2Model, GPT2_PRETRAINED_MODEL_ARCHIVE_MAP, GPT2LMHeadModel, GPT2DoubleHeadsModel) from .modeling_common_test import (CommonTestCases, ids_tensor) from .configuration_common_test import ConfigTester class GPT2ModelTest(CommonTestCases.CommonModelTester): all_model_classes = (GPT2Model, GPT2LMHeadModel, GPT2DoubleHeadsModel) class GPT2ModelTester(object): def __init__(self, parent, batch_size=13, seq_length=7, is_training=True, use_token_type_ids=True, use_labels=True, vocab_size=99, hidden_size=32, num_hidden_layers=5, num_attention_heads=4, intermediate_size=37, hidden_act="gelu", hidden_dropout_prob=0.1, attention_probs_dropout_prob=0.1, max_position_embeddings=512, type_vocab_size=16, type_sequence_label_size=2, initializer_range=0.02, num_labels=3, num_choices=4, scope=None, ): self.parent = parent self.batch_size = batch_size self.seq_length = seq_length self.is_training = is_training self.use_token_type_ids = use_token_type_ids self.use_labels = use_labels self.vocab_size = vocab_size self.hidden_size = hidden_size self.num_hidden_layers = num_hidden_layers self.num_attention_heads = num_attention_heads self.intermediate_size = intermediate_size self.hidden_act = hidden_act self.hidden_dropout_prob = hidden_dropout_prob self.attention_probs_dropout_prob = attention_probs_dropout_prob self.max_position_embeddings = max_position_embeddings self.type_vocab_size = type_vocab_size self.type_sequence_label_size = type_sequence_label_size self.initializer_range = initializer_range self.num_labels = num_labels self.num_choices = num_choices self.scope = scope def prepare_config_and_inputs(self): input_ids = ids_tensor([self.batch_size, self.seq_length], self.vocab_size) token_type_ids = None if self.use_token_type_ids: token_type_ids = ids_tensor([self.batch_size, self.seq_length], self.type_vocab_size) sequence_labels = None token_labels = None choice_labels = None if self.use_labels: sequence_labels = ids_tensor([self.batch_size], self.type_sequence_label_size) token_labels = ids_tensor([self.batch_size, self.seq_length], self.num_labels) choice_labels = ids_tensor([self.batch_size], self.num_choices) config = GPT2Config( vocab_size_or_config_json_file=self.vocab_size, n_embd=self.hidden_size, n_layer=self.num_hidden_layers, n_head=self.num_attention_heads, # intermediate_size=self.intermediate_size, # hidden_act=self.hidden_act, # hidden_dropout_prob=self.hidden_dropout_prob, # attention_probs_dropout_prob=self.attention_probs_dropout_prob, n_positions=self.max_position_embeddings, n_ctx=self.max_position_embeddings # type_vocab_size=self.type_vocab_size, # initializer_range=self.initializer_range ) head_mask = ids_tensor([self.num_hidden_layers, self.num_attention_heads], 2) return config, input_ids, head_mask, token_type_ids, sequence_labels, token_labels, choice_labels def check_loss_output(self, result): self.parent.assertListEqual( list(result["loss"].size()), []) def create_and_check_gpt2_model(self, config, input_ids, head_mask, token_type_ids, *args): model = GPT2Model(config=config) model.eval() model(input_ids, token_type_ids=token_type_ids, head_mask=head_mask) model(input_ids, token_type_ids=token_type_ids) sequence_output, presents = model(input_ids) result = { "sequence_output": sequence_output, "presents": presents, } self.parent.assertListEqual( list(result["sequence_output"].size()), [self.batch_size, self.seq_length, self.hidden_size]) self.parent.assertEqual(len(result["presents"]), config.n_layer) def create_and_check_lm_head_model(self, config, input_ids, head_mask, token_type_ids, *args): model = GPT2LMHeadModel(config) model.eval() loss, lm_logits, _ = model(input_ids, token_type_ids=token_type_ids, labels=input_ids) result = { "loss": loss, "lm_logits": lm_logits } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["lm_logits"].size()), [self.batch_size, self.seq_length, self.vocab_size]) def create_and_check_double_lm_head_model(self, config, input_ids, head_mask, token_type_ids, *args): model = GPT2DoubleHeadsModel(config) model.eval() loss, lm_logits, mc_logits, _ = model(input_ids, token_type_ids=token_type_ids, lm_labels=input_ids) result = { "loss": loss, "lm_logits": lm_logits } self.parent.assertListEqual( list(result["loss"].size()), []) self.parent.assertListEqual( list(result["lm_logits"].size()), [self.batch_size, self.seq_length, self.vocab_size]) def prepare_config_and_inputs_for_common(self): config_and_inputs = self.prepare_config_and_inputs() (config, input_ids, head_mask, token_type_ids, sequence_labels, token_labels, choice_labels) = config_and_inputs inputs_dict = { 'input_ids': input_ids, 'token_type_ids': token_type_ids, 'head_mask': head_mask } return config, inputs_dict def setUp(self): self.model_tester = GPT2ModelTest.GPT2ModelTester(self) self.config_tester = ConfigTester(self, config_class=GPT2Config, n_embd=37) def test_config(self): self.config_tester.run_common_tests() def test_gpt2_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_gpt2_model(*config_and_inputs) def test_gpt2_lm_head_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_lm_head_model(*config_and_inputs) def test_gpt2_double_lm_head_model(self): config_and_inputs = self.model_tester.prepare_config_and_inputs() self.model_tester.create_and_check_double_lm_head_model(*config_and_inputs) @pytest.mark.slow def test_model_from_pretrained(self): cache_dir = "/tmp/pytorch_transformers_test/" for model_name in list(GPT2_PRETRAINED_MODEL_ARCHIVE_MAP.keys())[:1]: model = GPT2Model.from_pretrained(model_name, cache_dir=cache_dir) shutil.rmtree(cache_dir) self.assertIsNotNone(model) if __name__ == "__main__": unittest.main()
8,709
39.511628
124
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_gpt2_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest import json from io import open from pytorch_transformers.tokenization_gpt2 import GPT2Tokenizer, VOCAB_FILES_NAMES from .tokenization_tests_commons import CommonTestCases class GPT2TokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = GPT2Tokenizer def setUp(self): super(GPT2TokenizationTest, self).setUp() # Adapted from Sennrich et al. 2015 and https://github.com/rsennrich/subword-nmt vocab = ["l", "o", "w", "e", "r", "s", "t", "i", "d", "n", "\u0120", "\u0120l", "\u0120n", "\u0120lo", "\u0120low", "er", "\u0120lowest", "\u0120newer", "\u0120wider", "<unk>"] vocab_tokens = dict(zip(vocab, range(len(vocab)))) merges = ["#version: 0.2", "\u0120 l", "\u0120l o", "\u0120lo w", "e r", ""] self.special_tokens_map = {"unk_token": "<unk>"} self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) self.merges_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['merges_file']) with open(self.vocab_file, "w", encoding="utf-8") as fp: fp.write(json.dumps(vocab_tokens) + "\n") with open(self.merges_file, "w", encoding="utf-8") as fp: fp.write("\n".join(merges)) def get_tokenizer(self, **kwargs): kwargs.update(self.special_tokens_map) return GPT2Tokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"lower newer" output_text = u" lower newer" return input_text, output_text def test_full_tokenizer(self): tokenizer = GPT2Tokenizer(self.vocab_file, self.merges_file, **self.special_tokens_map) text = "lower newer" bpe_tokens = ["\u0120low", "er", "\u0120", "n", "e", "w", "er"] tokens = tokenizer.tokenize(text) self.assertListEqual(tokens, bpe_tokens) input_tokens = tokens + [tokenizer.unk_token] input_bpe_tokens = [14, 15, 10, 9, 3, 2, 15, 19] self.assertListEqual( tokenizer.convert_tokens_to_ids(input_tokens), input_bpe_tokens) if __name__ == '__main__': unittest.main()
2,912
38.90411
95
py
CETE-LREC
CETE-LREC-master/CETE Fine-Tuning/HuggingFacePytorchTransformer/pytorch_transformers/tests/tokenization_openai_test.py
# coding=utf-8 # Copyright 2018 The Google AI Language Team Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals import os import unittest import json from pytorch_transformers.tokenization_openai import OpenAIGPTTokenizer, VOCAB_FILES_NAMES from .tokenization_tests_commons import CommonTestCases class OpenAIGPTTokenizationTest(CommonTestCases.CommonTokenizerTester): tokenizer_class = OpenAIGPTTokenizer def setUp(self): super(OpenAIGPTTokenizationTest, self).setUp() # Adapted from Sennrich et al. 2015 and https://github.com/rsennrich/subword-nmt vocab = ["l", "o", "w", "e", "r", "s", "t", "i", "d", "n", "w</w>", "r</w>", "t</w>", "lo", "low", "er</w>", "low</w>", "lowest</w>", "newer</w>", "wider</w>", "<unk>"] vocab_tokens = dict(zip(vocab, range(len(vocab)))) merges = ["#version: 0.2", "l o", "lo w", "e r</w>", ""] self.vocab_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['vocab_file']) self.merges_file = os.path.join(self.tmpdirname, VOCAB_FILES_NAMES['merges_file']) with open(self.vocab_file, "w") as fp: fp.write(json.dumps(vocab_tokens)) with open(self.merges_file, "w") as fp: fp.write("\n".join(merges)) def get_tokenizer(self, **kwargs): return OpenAIGPTTokenizer.from_pretrained(self.tmpdirname, **kwargs) def get_input_output_texts(self): input_text = u"lower newer" output_text = u"lower newer" return input_text, output_text def test_full_tokenizer(self): tokenizer = OpenAIGPTTokenizer(self.vocab_file, self.merges_file) text = "lower" bpe_tokens = ["low", "er</w>"] tokens = tokenizer.tokenize(text) self.assertListEqual(tokens, bpe_tokens) input_tokens = tokens + ["<unk>"] input_bpe_tokens = [14, 15, 20] self.assertListEqual( tokenizer.convert_tokens_to_ids(input_tokens), input_bpe_tokens) if __name__ == '__main__': unittest.main()
2,656
35.39726
90
py
qutip-qip
qutip-qip-master/doc/source/conf.py
# Configuration file for the Sphinx documentation builder. # # This file only contains a selection of the most common options. For a full # list see the documentation: # https://www.sphinx-doc.org/en/master/usage/configuration.html # -- Path setup -------------------------------------------------------------- # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # import os import pathlib import sys sys.path.insert(0, os.path.abspath('.')) # -- Project information ----------------------------------------------------- project = 'qutip_qip' copyright = '2021, QuTiP Community' author = 'QuTiP Community' def qutip_qip_version(): """ Retrieve the qutip-qip version from ``../../VERSION``. """ src_folder_root = pathlib.Path(__file__).absolute().parent.parent.parent version = src_folder_root.joinpath( "VERSION" ).read_text().strip() return version # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # The full version, including alpha/beta/rc tags. release = qutip_qip_version() # The short X.Y version. version = ".".join(release.split(".")[:2]) # -- General configuration --------------------------------------------------- # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = ['sphinx.ext.mathjax', 'matplotlib.sphinxext.plot_directive', 'sphinx.ext.autodoc', 'sphinx.ext.doctest', 'sphinx.ext.autosummary', 'numpydoc', 'sphinx.ext.extlinks', 'sphinx.ext.viewcode', 'sphinx.ext.ifconfig', 'sphinx.ext.napoleon', 'sphinxcontrib.bibtex', 'sphinx.ext.intersphinx', ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This pattern also affects html_static_path and html_extra_path. exclude_patterns = [] # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'sphinx_rtd_theme' # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = [] # -- Options for LaTeX output --------------------------------------------- # AJGP 2017-01-8: Switching to manual, ditching the preamble # latex_header = open('latex_output_files/latex_preamble.tex', 'r+') # PREAMBLE = latex_header.read(); latex_elements = { 'papersize':'a4paper', 'pointsize':'10pt', 'classoptions': '', 'babel': '\\usepackage[english]{babel}', 'fncychap' : '', 'figure_align': 'H', # 'preamble': PREAMBLE } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ ('index', 'qutip.tex', project, author, 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. latex_logo = 'figures/logo.png' # Sometimes make might suggest setting this to False. # It screws a few things up if you do - don't be tempted. latex_keep_old_macro_names=True # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = True # If true, show page references after internal links. #latex_show_pagerefs = False # If true, show URL addresses after external links. #latex_show_urls = False # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_domain_indices = True # -- Doctest Setup --------------------------------------- os_nt = False if os.name == "nt": os_nt = True doctest_global_setup = ''' from pylab import * from qutip import * import numpy as np import os import warnings warnings.filterwarnings("ignore") import numpy as np np.set_printoptions(precision=5) os_nt = {} '''.format(os_nt) # -- Options for plot directive --------------------------------------- plot_working_directory = "./" plot_pre_code = """ from pylab import * from scipy import * from qutip import * import numpy as np import matplotlib.pyplot as plt plt.close("all") """ plot_include_source = True plot_html_show_source_link = False # -- Options for numpydoc --------------------------------------- numpydoc_show_class_members = False napoleon_numpy_docstring = True napoleon_use_admonition_for_notes = True # -- Options for api doc --------------------------------------- # autosummary_generate can be turned on to automatically generate files # in the apidoc folder. This is particularly useful for modules with # lots of functions/classes like qutip_qip.operations. However, pay # attention that some api docs files are adjusted manually for better illustration # and should not be overwritten. autosummary_generate = False autosummary_imported_members = True # -- Options for biblatex --------------------------------------- bibtex_bibfiles = ['references.bib'] bibtex_default_style = 'unsrt' # -- Options for intersphinx --------------------------------------- intersphinx_mapping = { 'qutip': ('https://qutip.org/docs/latest/', None), }
5,954
30.507937
82
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/evaluate.py
import os from asyncio.log import logger from distutils.command.build import build from statistics import mode from matplotlib.pyplot import axis import torch import numpy as np from core.datasets.seg_dataset import SegDataset from core.utils.utils import _data_part,setup_logger,iou,f1 from core.utils.data_display import lbl_img_from_tensor from core.models.build import build_seg_model import torch.functional as F import pandas as pd import argparse import albumentations as A from core.configs.default_seg import _C as cfg def get_test_loader(dataset, batch_size, num_workers=1, shuffle=False): return torch.utils.data.DataLoader(dataset, batch_size=batch_size, num_workers=num_workers, shuffle=shuffle) def get_palette(dataset): palette = [] for item in dataset.palette: palette += item palette += [0, 0, 0] * 249 return palette def seg_eval_once(model, dataset, logger, save_path, batch_size = 1, generate_res=True): dataset.get_file_name = True dataloader = get_test_loader(dataset, batch_size) model.eval() iou_sum = np.zeros((7,)) f1_sum = np.zeros((7,)) palette = get_palette(dataset) os.makedirs(f"{save_path}/res", exist_ok=True) for i, (file_name, input, target) in enumerate(dataloader): logger.info(f"evaluating {i}\n") input = input.cuda() target = target.cuda() y_pred = model.predict(input) iou_sum += iou(y_pred, target) f1_sum += f1(y_pred, target) if generate_res: for j in range(y_pred.shape[0]): lbl_img = lbl_img_from_tensor(torch.argmax(y_pred[j], dim=0), palette) lbl_img.save(f"{save_path}/res/{file_name[j]}") c_iou = iou_sum / len(dataloader) c_f1 = f1_sum / len(dataloader) return c_iou, c_f1 def evl(model, dataset, logger, save_path, batch_size, generate_res): iou, f1 = seg_eval_once(model, dataset, logger, save_path, batch_size, generate_res) columns = dataset.label + ["overall"] data = [[],[]] for i in range(len(iou)): data[0].append(iou[i]) data[1].append(f1[i]) logger.info(f"finish, iou={iou[-1]}, f1={f1[-1]}") pf = pd.DataFrame(data=data, columns=columns, index=["iou", "f1"], dtype=float) pf.to_excel(f"{save_path}/evl_res.xlsx", index=True) def main(): parser = argparse.ArgumentParser() parser.add_argument("-cfg", "--config_file", default="", metavar="FILE", help="path to config file", type=str, ) parser.add_argument( "-opts", help="Modify config options using the command-line", default="", nargs=argparse.REMAINDER, ) parser.add_argument( "--model_path", default="", type=str ) args = parser.parse_args() cfg.merge_from_file(args.config_file) cfg.merge_from_list(args.opts) cfg.freeze() os.makedirs(cfg.OUTPUT_DIR, exist_ok=True) logger = setup_logger("segmentation", cfg.OUTPUT_DIR) model = build_seg_model(cfg) model.load_state_dict(torch.load(args.model_path)) model = model.cuda() _all, _train = _data_part(cfg.DATASETS.EVL_PART) trans = A.Compose([A.RandomCrop(cfg.DATASETS.SIZE, cfg.DATASETS.SIZE)]) val_ds = SegDataset(cfg.DATASETS.EVL_DATASET_PATH, all=_all, train=_train, transform=trans) evl(model, val_ds, logger, cfg.OUTPUT_DIR+"/res", cfg.DATASETS.EVL_BATCH, True) if __name__ == "__main__": main()
3,505
32.075472
112
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/train_seg.py
import argparse import os import torch from torch.utils.data import DataLoader import albumentations as A import time import copy import logging import numpy as np import torch.nn.functional as F from torch.nn.modules import CrossEntropyLoss, BCEWithLogitsLoss from torch.autograd import Variable from core.configs.default_seg import _C as cfg from core.utils.utils import weights_init_normal, UnNormalize, adjust_param, setup_logger, _data_part from core.models.focal_loss import FocalLoss2d from core.models.build import build_seg_model from core.models.output_discriminator import OutputDiscriminator from core.datasets.seg_dataset import SegDataset from core.utils.utils import * from evaluate import evl os.environ['CUDA_LAUNCH_BLOCKING'] = "1" def train(cfg): logger = logging.getLogger("segmentation.trainer") logger.info("Start training") device = cfg.MODELS.DEVICE model = build_seg_model(cfg).to(device) save_path = cfg.OUTPUT_DIR + "/model" if cfg.TRAIN.EPOCH >0: model.load_state_dict(torch.load(f"{save_path}/model.pt")) discriminator = OutputDiscriminator(cfg.MODELS.CLASSES).to(device) if cfg.TRAIN.LOSS == "ce": criterion = CrossEntropyLoss(ignore_index=255).to(device) elif cfg.TRAIN.LOSS == "focal": criterion = FocalLoss2d(ignore_index=255).to(device) else: raise Exception("not impletment yet") bce_loss = BCEWithLogitsLoss().to(device) optimizer = torch.optim.Adam(model.parameters(), cfg.TRAIN.LR) optimizer_D = torch.optim.Adam(discriminator.parameters(), cfg.TRAIN.LR_D) scheduler = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer, mode='min', factor=0.5, min_lr=0.00002, patience=20) trans = A.Compose([ A.RandomCrop(cfg.DATASETS.SIZE, cfg.DATASETS.SIZE), A.HorizontalFlip(p=0.5), A.VerticalFlip(p=0.5), A.RandomRotate90(p=0.5) ]) _all, _train = _data_part(cfg.DATASETS.SOURCE_PART) ds = SegDataset(cfg.DATASETS.SOURCE_DATASET_PATH, all=_all, train=_train, transform=trans) # ds = SegDatatset(dataset_path, all=True, transform=trans) dataloader = DataLoader(ds, batch_size=cfg.TRAIN.BATCH_SIZE, num_workers=cfg.TRAIN.N_CPU, shuffle=True) _all, _train = _data_part(cfg.DATASETS.VAL_PART) val_ds = SegDataset(cfg.DATASETS.VAL_DATASET_PATH, all=_all, train=_train, transform=trans) val_dataloader = DataLoader(val_ds, batch_size=cfg.TRAIN.BATCH_SIZE, num_workers=cfg.TRAIN.N_CPU, shuffle=True) _all, _train = _data_part(cfg.DATASETS.TARGET_PART) target_ds = SegDataset(cfg.DATASETS.TARGET_DATASET_PATH, all=_all, train=_train, transform=trans, iter_len=len(ds), get_label=False) target_dataloader = DataLoader(target_ds, batch_size=cfg.TRAIN.BATCH_SIZE, num_workers=cfg.TRAIN.N_CPU, shuffle=True) source_label = 0 target_label = 1 save_iou = 0 save_model = None os.makedirs(save_path , exist_ok=True) start_t = time.time() for epoch in range(cfg.TRAIN.EPOCH, cfg.TRAIN.TOTAL_EPOCH): model.train() discriminator.train() adv_loss_sum = 0 epoch_loss = 0 d_loss_sum = 0 source_iter = enumerate(dataloader) target_iter = enumerate(target_dataloader) t1 = time.time() # train for i in range(len(dataloader)): optimizer.zero_grad() optimizer_D.zero_grad() # train segmentation module # don't accumulate gradients of Driscriminator for param in discriminator.parameters(): param.requires_grad = False _, (input, target) = source_iter.__next__() input = input.to(device) target = target.to(device).long() y_pred = model.forward(input) if cfg.MODELS.BACKBONE == "MiT": y_pred = F.interpolate(y_pred, scale_factor=4) loss = criterion(y_pred, target) loss.backward() if cfg.MODELS.OUT_ADV: # train with target _, (input_target, _) = target_iter.__next__() input_target = input_target.to(device) y_pred_target = model.forward(input_target) if cfg.MODELS.BACKBONE == "MiT": y_pred_target = F.interpolate(y_pred_target, scale_factor=4) d_out = discriminator.forward(F.softmax(y_pred_target, dim=1)) adv_loss = bce_loss(d_out, Variable(torch.FloatTensor(d_out.data.size()).fill_(source_label)).to(device)) adv_loss = adv_loss*cfg.LOSS.ADV # print("adv_loss:{}".format(adv_loss)) adv_loss.backward() # train discriminator for param in discriminator.parameters(): param.requires_grad = True y_pred = y_pred.detach() y_pred_target = y_pred_target.detach() d_out = discriminator(F.softmax(y_pred, dim=1)) d_loss_1 = bce_loss(d_out, Variable(torch.FloatTensor(d_out.data.size()).fill_(source_label)).to(device)) d_out = discriminator(F.softmax(y_pred_target, dim=1)) d_loss_2 = bce_loss(d_out, Variable(torch.FloatTensor(d_out.data.size()).fill_(target_label)).to(device)) d_loss = d_loss_1 + d_loss_2 # print("d_loss:{}".format(d_loss)) d_loss.backward() optimizer_D.step() adv_loss_sum += adv_loss.data d_loss_sum += d_loss.data optimizer.step() # log info while training epoch_loss += loss.data t2 = time.time() logger.info('epoch={}\ti={}\tloss:{:.3f}\tadv_loss:{:.5f}\td_loss:{:.3f}\ttime:{:.3f} s\tlr:{:.6f}'.format (epoch, i, epoch_loss / len(dataloader), adv_loss_sum/ len(dataloader), d_loss_sum/ len(dataloader), t2 - t1, optimizer.param_groups[0]['lr'])) scheduler.step(epoch_loss) # validation using images of target domain val_loss = 0 iou_sum = np.zeros((7,)) f1_sum = np.zeros((7,)) model.eval() discriminator.eval() with torch.no_grad(): for i, (input, target) in enumerate(val_dataloader): input = input.to(device) target = target.to(device).long() y_pred = model.predict(input) if cfg.MODELS.BACKBONE == "MiT": y_pred = F.interpolate(y_pred, scale_factor=4) val_loss += criterion(y_pred, target).data iou_sum += iou(y_pred, target) f1_sum += f1(y_pred, target) avg_loss = val_loss / len(val_dataloader) c_iou = iou_sum/len(val_dataloader) c_f1 = f1_sum/len(val_dataloader) logger.info(f"epoch={epoch}\tavg_loss={avg_loss}\tiou={c_iou}\tf1={c_f1}\n") if c_iou[-1] >= save_iou: save_iou = c_iou[-1] logger.info(f"save model with iou=\n{c_iou}") model.eval() save_model = copy.deepcopy(model) torch.save(model.state_dict(), f'{save_path}/model.pt') return save_model def main(): parser = argparse.ArgumentParser() parser.add_argument("-cfg", "--config_file", default="", metavar="FILE", help="path to config file", type=str, ) parser.add_argument( "-opts", help="Modify config options using the command-line", default="", nargs=argparse.REMAINDER, ) args = parser.parse_args() cfg.merge_from_file(args.config_file) cfg.merge_from_list(args.opts) cfg.freeze() os.makedirs(cfg.OUTPUT_DIR, exist_ok=True) logger = setup_logger("segmentation", cfg.OUTPUT_DIR) logger.info(args) logger.info("Loaded configuration file {}".format(args.config_file)) with open(args.config_file, "r") as cf: config_str = "\n" + cf.read() logger.info(config_str) logger.info("Running with config:\n{}".format(cfg)) model = train(cfg) _all, _train = _data_part(cfg.DATASETS.EVL_PART) trans = A.Compose([A.RandomCrop(cfg.DATASETS.SIZE, cfg.DATASETS.SIZE)]) val_ds = SegDataset(cfg.DATASETS.EVL_DATASET_PATH, all=_all, train=_train, transform=trans) evl(model, val_ds, logger, cfg.OUTPUT_DIR+"/res", cfg.DATASETS.EVL_BATCH, cfg.DATASETS.EVL_GENERATE) if __name__ == "__main__": main()
8,635
37.553571
136
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/train_residualgan.py
import sys import PIL import torchvision from yacs.config import CfgNode as CN import argparse import os import numpy as np import math import itertools import time import datetime import logging import torch.nn as nn import torch.nn.functional as F import torch from torch import FloatTensor import torchvision.transforms as transforms from torchvision.utils import save_image from torch.utils.data import DataLoader from torch.autograd import Variable import torch.autograd as autograd from core.models.residualgan import * from core.models.resize_block import ResizeBlock from core.models.build import * from core.utils.utils import weights_init_normal, UnNormalize, adjust_param, setup_logger, BerHu from core.utils.data_display import * from core.datasets.dual_dataset import DualDataset from core.configs.default import _C as cfg from transfer import transfer os.environ['CUDA_LAUNCH_BLOCKING'] = "1" def compute_gradient_penalty(D, real_samples, fake_samples, device): """Calculates the gradient penalty loss for WGAN GP""" # Random weight term for interpolation between real and fake samples alpha = torch.cuda.FloatTensor(np.random.random((real_samples.size(0), 1, 1, 1)), device=device) if device[:4] == "cuda" else \ FloatTensor(np.random.random((real_samples.size(0), 1, 1, 1)), device=device) # Get random interpolation between real and fake samples interpolates = (alpha * real_samples + ((1 - alpha) * fake_samples)).requires_grad_(True) validity = D(interpolates) fake = Variable(torch.cuda.FloatTensor(np.ones(validity.shape), device=device), requires_grad=False) if device[:4] == "cuda" else \ Variable(torch.cuda.FloatTensor(np.ones(validity.shape), device=device)) # Get gradient w.r.t. interpolates gradients = autograd.grad( outputs=validity, inputs=interpolates, grad_outputs=fake, create_graph=True, retain_graph=True, only_inputs=True, )[0] gradients = gradients.view(gradients.size(0), -1) gradient_penalty = ((gradients.norm(2, dim=1) - 1) ** 2).mean() return gradient_penalty def train(cfg): logger = logging.getLogger("RDG.trainer") logger.info("Start training") save_path = cfg.OUTPUT_DIR + "/models" model_path = f"{save_path}" os.makedirs(model_path, exist_ok=True) os.makedirs(f"{save_path}/temp", exist_ok=True) device = cfg.MODELS.DEVICE G_AB, G_BA = build_generators(cfg) G_AB.to(device) G_BA.to(device) D_A = Discriminator().to(device) D_B = Discriminator().to(device) if cfg.TRAIN.EPOCH != 0: # Load pretrained models G_AB.load_state_dict(torch.load(f"{model_path}/G_AB_{cfg.TRAIN.EPOCH}.pth")) G_BA.load_state_dict(torch.load(f"{model_path}/G_BA_{cfg.TRAIN.EPOCH}.pth")) D_A.load_state_dict(torch.load(f"{model_path}/D_A_{cfg.TRAIN.EPOCH}.pth")) D_B.load_state_dict(torch.load(f"{model_path}/D_B_{cfg.TRAIN.EPOCH}.pth")) else: # Initialize weights G_AB.apply(weights_init_normal) G_BA.apply(weights_init_normal) D_A.apply(weights_init_normal) D_B.apply(weights_init_normal) transform_imgs = transforms.Compose([ transforms.ToTensor(), transforms.Normalize((0.5,0.5,0.5), (0.5,0.5,0.5)), ]) transform_dsms = transforms.Compose([ transforms.ToTensor(), transforms.Normalize((0.5), (0.5)), ]) dual_dataset = DualDataset(f"{cfg.DATASETS.SOURCE_PATH}", f"{cfg.DATASETS.TARGET_PATH}", transform_imgs, transform_dsms) dataloader = DataLoader(dual_dataset, batch_size=cfg.TRAIN.BATCH_SIZE, num_workers=cfg.TRAIN.N_CPU) cycle_loss = torch.nn.L1Loss().to(device) depth_loss_f = BerHu() if cfg.TRAIN.DEPTH_LOSS == "berhu" else torch.nn.L1Loss() depth_loss_f.to(device) optimizer_G = torch.optim.Adam( itertools.chain(G_AB.parameters(), G_BA.parameters()), lr=cfg.TRAIN.LR, betas=(cfg.TRAIN.B1, cfg.TRAIN.B2) ) optimizer_D_A = torch.optim.RMSprop(D_A.parameters(), lr=cfg.TRAIN.LR) optimizer_D_B = torch.optim.RMSprop(D_B.parameters(), lr=cfg.TRAIN.LR) un_normalize = UnNormalize((0.5,0.5,0.5), (0.5,0.5,0.5)) scheduler_G = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer_G, mode='min', factor=0.5, min_lr=0.000001, patience=25) scheduler_D_A = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer_D_A, mode='min', factor=0.5, min_lr=0.000001, patience=25) scheduler_D_B = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer_D_B, mode='min', factor=0.5, min_lr=0.000001, patience=25) lambda_adv = cfg.LOSS.ADV lambda_cycle = cfg.LOSS.CYCLE lambda_gp = cfg.LOSS.GP lambda_depth = cfg.LOSS.DEPTH lambda_depth_cycle = cfg.LOSS.DEPTH_CYCLE require_depth = True if not (lambda_depth or lambda_depth_cycle): require_depth = False batches_done = 0 prev_time = time.time() for epoch in range(cfg.TRAIN.EPOCH, cfg.TRAIN.TOTAL_EPOCH): cnt = 0 g_loss_avg = d_loss_avg = cycle_loss_avg = depth_avg = depth_cyc_avg = 0 state_str = "" for i, (imgs_a, imgs_b, dsm_a, dsm_b) in enumerate(dataloader): imgs_a = imgs_a.to(device) imgs_b = imgs_b.to(device) if require_depth: dsm_a = dsm_a.to(device) dsm_b = dsm_b.to(device) # ---------------------- # Train Discriminators # ---------------------- optimizer_D_A.zero_grad() optimizer_D_B.zero_grad() # Generate a batch of images fake_A = G_BA(imgs_b).detach() fake_B = G_AB(imgs_a).detach() # ---------- # Domain A # ---------- # Compute gradient penalty for improved wasserstein training gp_A = compute_gradient_penalty(D_A, imgs_a.data, fake_A.data, device) # Adversarial loss D_A_loss = -torch.mean(D_A(imgs_a)) + torch.mean(D_A(fake_A)) + lambda_gp * gp_A # ---------- # Domain B # ---------- # Compute gradient penalty for improved wasserstein training gp_B = compute_gradient_penalty(D_B, imgs_b.data, fake_B.data, device) # Adversarial loss D_B_loss = -torch.mean(D_B(imgs_b)) + torch.mean(D_B(fake_B)) + lambda_gp * gp_B # Total loss D_loss = D_A_loss + D_B_loss D_loss.backward() optimizer_D_A.step() optimizer_D_B.step() if i % cfg.TRAIN.N_CRITIC == 0: # ------------------ # Train Generators # ------------------ optimizer_G.zero_grad() if require_depth: # Translate images to opposite domain fake_A, depth_b = G_BA(imgs_b, require_depth=True) fake_B, depth_a = G_AB(imgs_a, require_depth=True) # Reconstruct images recov_A, depth_fake_b = G_BA(fake_B, require_depth=True) recov_B, depth_fake_a = G_AB(fake_A, require_depth=True) else: fake_A = G_BA(imgs_b, require_depth=False) fake_B = G_AB(imgs_a, require_depth=False) # Reconstruct images recov_A = G_BA(fake_B, require_depth=False) recov_B = G_AB(fake_A, require_depth=False) # Adversarial loss G_adv = -torch.mean(D_A(fake_A)) - torch.mean(D_B(fake_B)) # Cycle loss G_cycle = cycle_loss(recov_A, imgs_a) + cycle_loss(recov_B, imgs_b) #BerHu Loss # depth_loss = berhu_loss(depth_b, dsm_b) + berhu_loss(depth_a, dsm_a) + \ # berhu_loss(depth_fake_b, F.interpolate(dsm_a, depth_fake_b.shape[2:])) +\ # berhu_loss(depth_fake_a, F.interpolate(dsm_b, depth_fake_a.shape[2:])) depth_loss = (depth_loss_f(depth_b, dsm_b) + depth_loss_f(depth_a, dsm_a))\ if lambda_depth !=0 else 0 depth_cycle_loss = (depth_loss_f(depth_fake_b, F.interpolate(dsm_a, depth_fake_b.shape[2:])) +\ depth_loss_f(depth_fake_a, F.interpolate(dsm_b, depth_fake_a.shape[2:])))\ if lambda_depth_cycle !=0 else 0 # Total loss G_loss = lambda_adv * G_adv + lambda_cycle * G_cycle + \ lambda_depth * depth_loss + lambda_depth_cycle * depth_cycle_loss G_loss.backward() optimizer_G.step() # -------------- # Log Progress # -------------- if i % 200 == 0: save_image(un_normalize(imgs_a[0]), f"{save_path}/temp/ori.png") save_image(un_normalize(fake_B[0].detach()), f"{save_path}/temp/res.png") save_image(un_normalize(recov_A[0].detach()), f"{save_path}/temp/recov.png") # Determine approximate time left batches_left = (cfg.TRAIN.TOTAL_EPOCH - cfg.TRAIN.EPOCH) * len(dataloader) - batches_done time_left = datetime.timedelta(seconds=batches_left * (time.time() - prev_time) / cfg.TRAIN.N_CRITIC) prev_time = time.time() cnt += 1 g_loss_avg = update_avg(G_adv.item(), g_loss_avg, cnt) d_loss_avg = update_avg(D_loss.item(), d_loss_avg, cnt) cycle_loss_avg = update_avg(G_cycle.item(), cycle_loss_avg, cnt) depth_avg = update_avg(depth_loss.item(), depth_avg, cnt)\ if lambda_depth !=0 else 0 depth_cyc_avg = update_avg(depth_cycle_loss.item(), depth_cyc_avg, cnt)\ if lambda_depth_cycle !=0 else 0 state_str = "epoch={}/{}\tbatch={}/{}\tD loss={:.6f}\tG loss={:.6f}\tcycle={:.6f}\tdepth_avg={:.6f}\tdepth_cyc_avg={:.6f}\tk_AB={:.4f}\tk_BA={:.4f}\tETA:{}\n".format( epoch, cfg.TRAIN.TOTAL_EPOCH, i, len(dataloader), d_loss_avg, g_loss_avg, cycle_loss_avg, depth_avg, depth_cyc_avg, G_AB.generator.k.item(), G_BA.generator.k.item(), time_left ) logger.debug(state_str) batches_done += 1 scheduler_G.step(G_loss) scheduler_D_A.step(D_A_loss) scheduler_D_B.step(D_B_loss) logger.info(state_str) if cfg.TRAIN.CHECKPOINT != -1 and epoch % cfg.TRAIN.CHECKPOINT == 0 and epoch!=0: # Save model checkpoints torch.save(G_AB.state_dict(), f"{model_path}/G_AB_{cfg.TRAIN.EPOCH}.pth") torch.save(G_BA.state_dict(), f"{model_path}/G_BA_{cfg.TRAIN.EPOCH}.pth") torch.save(D_A.state_dict(), f"{model_path}/D_A_{cfg.TRAIN.EPOCH}.pth") torch.save(D_B.state_dict(), f"{model_path}/D_B_{cfg.TRAIN.EPOCH}.pth") return G_AB, G_BA def main(): parser = argparse.ArgumentParser() parser.add_argument("-cfg", "--config_file", default="", metavar="FILE", help="path to config file", type=str, ) parser.add_argument( "-opts", help="Modify config options using the command-line", default="", nargs=argparse.REMAINDER, ) args = parser.parse_args() cfg.merge_from_file(args.config_file) cfg.merge_from_list(args.opts) cfg.freeze() os.makedirs(cfg.OUTPUT_DIR, exist_ok=True) logger = setup_logger("RDG", cfg.OUTPUT_DIR) logger.info(args) logger.info("Loaded configuration file {}".format(args.config_file)) with open(args.config_file, "r") as cf: config_str = "\n" + cf.read() logger.info(config_str) logger.info("Running with config:\n{}".format(cfg)) G_AB, _ = train(cfg) transfer(G_AB, f"{cfg.DATASETS.SOURCE_PATH}", cfg.DATASETS.TARGET_SIZE, cfg.OUTPUT_DIR+"/data", torch.device(cfg.MODELS.DEVICE)) if __name__ == "__main__": main()
12,278
39.93
182
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/transfer.py
from core.datasets.dual_dataset import TransferDataset from core.models.residualgan import ResizeGenerator from core.utils.utils import UnNormalize, setup_logger from core.models.build import build_generators import torchvision.transforms as transforms import torch.utils.data as D import albumentations as A import os import torch from torchvision.utils import save_image import torch.nn.functional as F from PIL import Image import argparse from shutil import copyfile import logging from core.configs.default import _C as cfg def transfer(model, data_path, target_size, tar_path, device="cuda:0", batch_size=8, require_depth=False): logger = logging.getLogger("RDG.transfer") logger.info("Start transferring") transform = transforms.Compose([ transforms.ToTensor(), transforms.Normalize((0.5,0.5,0.5), (0.5,0.5,0.5)), ]) ds = TransferDataset(data_path, transform) dataloader = D.DataLoader(ds, batch_size=batch_size, num_workers=8) model.eval() un_normalize = UnNormalize((0.5,0.5,0.5), (0.5,0.5,0.5)) un_normalize_depth = UnNormalize((0.5,),(0.5,)) os.makedirs(f"{tar_path}/images/", exist_ok=True) os.makedirs(f"{tar_path}/labels/", exist_ok=True) os.makedirs(f"{tar_path}/dsms/", exist_ok=True) with torch.no_grad(): for i,(file_name, img, lbl) in enumerate(dataloader): logger.info(f"images shape: {img.shape}, labels shape: {lbl.shape}") logger.info(f"file name: {file_name}") img = img.to(device) if require_depth: res, depth = model(img, require_depth=True) else: res = model(img, require_depth=False) for j in range(len(img)): img_path = "{}/images/{}".format(tar_path, file_name[j]) lbl_path = "{}/labels/{}".format(tar_path, file_name[j]) dsm_path = "{}/dsms/{}".format(tar_path, file_name[j]) save_image(un_normalize(res[j]), img_path) if require_depth: save_image(un_normalize_depth(depth[j]), dsm_path) cur_lbl = transforms.ToPILImage()(lbl[j]) cur_lbl = cur_lbl.resize((target_size, target_size), Image.NEAREST) cur_lbl.save(lbl_path) copyfile(f"{data_path}/all.txt", f"{tar_path}/all.txt") copyfile(f"{data_path}/train.txt", f"{tar_path}/train.txt") copyfile(f"{data_path}/test.txt", f"{tar_path}/test.txt") def transfer_main(): parser = argparse.ArgumentParser() parser.add_argument("-cfg", "--config_file", default="", metavar="FILE", help="path to config file", type=str, ) parser.add_argument( "--opts", help="Modify config options using the command-line", default=None, nargs=argparse.REMAINDER, ) args = parser.parse_args() cfg.merge_from_file(args.config_file) cfg.merge_from_list(args.opts) cfg.freeze() os.makedirs(cfg.OUTPUT_DIR, exist_ok=True) logger = setup_logger("RDG", cfg.OUTPUT_DIR) logger.info(args) logger.info("Loaded configuration file {}".format(args.config_file)) with open(args.config_file, "r") as cf: config_str = "\n" + cf.read() logger.info(config_str) logger.info("Running with config:\n{}".format(cfg)) model_path = f"{cfg.OUTPUT_DIR}/models/G_AB_{cfg.TRAIN.TOTAL_EPOCH-1}.pth" data_path = f"{cfg.DATASETS.SOURCE_PATH}" target_size = cfg.DATASETS.TARGET_SIZE target_path = cfg.GENERATE_PATH model, _ = build_generators(cfg) model.load_state_dict(torch.load(model_path)) model = model.to("cuda:0") transfer(model, data_path, target_size, target_path) if __name__ == "__main__": transfer_main()
3,849
36.378641
106
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/models/output_discriminator.py
import torch.nn as nn class OutputDiscriminator(nn.Module): def __init__(self, num_classes, ndf = 64): super(OutputDiscriminator, self).__init__() self.conv1 = nn.Conv2d(num_classes, ndf, kernel_size=4, stride=2, padding=1) self.conv2 = nn.Conv2d(ndf, ndf*2, kernel_size=4, stride=2, padding=1) self.conv3 = nn.Conv2d(ndf*2, ndf*4, kernel_size=4, stride=2, padding=1) self.conv4 = nn.Conv2d(ndf*4, ndf*8, kernel_size=4, stride=2, padding=1) self.classifier = nn.Conv2d(ndf*8, 1, kernel_size=4, stride=2, padding=1) self.leaky_relu = nn.LeakyReLU(negative_slope=0.2, inplace=True) self.up_sample = nn.Upsample(scale_factor=32, mode='bilinear') self.sigmoid = nn.Sigmoid() def forward(self, x): x = self.conv1(x) x = self.leaky_relu(x) x = self.conv2(x) x = self.leaky_relu(x) x = self.conv3(x) x = self.leaky_relu(x) x = self.conv4(x) x = self.leaky_relu(x) x = self.classifier(x) x = self.up_sample(x) # x = self.sigmoid(x) return x
1,126
36.566667
84
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/models/resize_block.py
import torch.nn as nn import torch.nn.functional as F class ResBlock(nn.Module): def __init__(self, in_channels, out_channels): super(ResBlock, self).__init__() self.block = nn.Sequential( nn.Conv2d(in_channels, out_channels, kernel_size=3, stride=1, padding=1, bias=False), nn.BatchNorm2d(out_channels), nn.LeakyReLU(inplace=True), nn.Conv2d(in_channels, out_channels, kernel_size=3, stride=1, padding=1, bias=False), nn.BatchNorm2d(out_channels), ) def forward(self, x): residual = x return self.block(x) + residual class ResizeBlock(nn.Module): def __init__(self, size, in_channels=3, residual_num=1): super(ResizeBlock, self).__init__() self.size = size self.block1 = nn.Sequential( nn.Conv2d(in_channels=in_channels, out_channels=16, kernel_size=7, stride=1, padding=3), nn.LeakyReLU(inplace=True) ) self.block2 = nn.Sequential( nn.Conv2d(in_channels=16, out_channels=16, kernel_size=1, stride=1, padding=0), nn.LeakyReLU(inplace=True), nn.BatchNorm2d(16) ) residual_layers = [] for i in range(residual_num): residual_layers.append(ResBlock(16, 16)) self.residual_blocks = nn.Sequential(*residual_layers) self.block3 = nn.Sequential( nn.Conv2d(in_channels=16, out_channels=16, kernel_size=3, stride=1, padding=1), nn.BatchNorm2d(16) ) self.block4 = nn.Conv2d(in_channels=16, out_channels=3, kernel_size=7, stride=1, padding=3) def forward(self, x): x1 = F.interpolate(x, size=self.size, mode="bilinear", align_corners=False, recompute_scale_factor=False) x2 = self.block1(x) x3 = self.block2(x2) x4 = F.interpolate(x3, size=self.size, mode="bilinear", align_corners=False, recompute_scale_factor=False) x5 = self.residual_blocks(x4) x6 = self.block3(x5) x7 = self.block4(x6+x4) return x7 + x1
2,116
33.704918
100
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/models/focal_loss.py
# from: https://github.com/doiken23/focal_segmentation/blob/master/focalloss2d.py import torch import torch.nn as nn import torch.nn.functional as F from torch.autograd import Variable class FocalLoss2d(nn.Module): def __init__(self, gamma=0, weight=None, size_average=True, ignore_index=255): super(FocalLoss2d, self).__init__() self.gamma = gamma self.weight = weight self.size_average = size_average self.ignore_index = ignore_index def forward(self, input, target): if input.dim()>2: input = input.contiguous().view(input.size(0), input.size(1), -1) input = input.transpose(1,2) input = input.contiguous().view(-1, input.size(2)).squeeze() if target.dim()==4: target = target.contiguous().view(target.size(0), target.size(1), -1) target = target.transpose(1,2) target = target.contiguous().view(-1, target.size(2)).squeeze() elif target.dim()==3: target = target.view(-1) else: target = target.view(-1, 1) # compute the negative likelyhood weight = Variable(self.weight) logpt = -F.cross_entropy(input, target, ignore_index=self.ignore_index) pt = torch.exp(logpt) # compute the loss loss = -((1-pt)**self.gamma) * logpt # averaging (or not) loss if self.size_average: return loss.mean() else: return loss.sum()
1,495
33
82
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/models/residualgan.py
import torch.nn as nn import torch from .resize_block import ResizeBlock import torch.nn.functional as F import segmentation_models_pytorch as smp class UNetDown(nn.Module): def __init__(self, in_size, out_size, normalize=True, dropout=0.0): super(UNetDown, self).__init__() layers = [nn.Conv2d(in_size, out_size, 4, stride=2, padding=1, bias=False)] if normalize: layers.append(nn.InstanceNorm2d(out_size, affine=True)) layers.append(nn.LeakyReLU(0.2)) if dropout: layers.append(nn.Dropout(dropout)) self.model = nn.Sequential(*layers) def forward(self, x): return self.model(x) class UNetUp(nn.Module): def __init__(self, in_size, out_size, dropout=0.0): super(UNetUp, self).__init__() layers = [ nn.ConvTranspose2d(in_size, out_size, 4, stride=2, padding=1, bias=False), nn.InstanceNorm2d(out_size, affine=True), nn.ReLU(inplace=True), ] if dropout: layers.append(nn.Dropout(dropout)) self.model = nn.Sequential(*layers) def forward(self, x, skip_input): x = self.model(x) x = torch.cat((x, skip_input), 1) return x class Generator(nn.Module): def __init__(self, channels=3, k=1.0, k_grad=False): super(Generator, self).__init__() self.down1 = UNetDown(channels, 64, normalize=False) self.down2 = UNetDown(64, 128) self.down3 = UNetDown(128, 256) self.down4 = UNetDown(256, 512, dropout=0.5) self.down5 = UNetDown(512, 512, dropout=0.5) self.down6 = UNetDown(512, 512, dropout=0.5) self.down7 = UNetDown(512, 512, dropout=0.5, normalize=False) self.up1 = UNetUp(512, 512, dropout=0.5) self.up2 = UNetUp(1024, 512, dropout=0.5) self.up3 = UNetUp(1024, 512, dropout=0.5) self.up4 = UNetUp(1024, 256) self.up5 = UNetUp(512, 128) self.up6 = UNetUp(256, 64) self.final = nn.Sequential(nn.ConvTranspose2d(128, channels, 4, stride=2, padding=1),nn.Tanh()) self.k = torch.nn.Parameter(torch.tensor([k]), requires_grad=k_grad) self.dup1 = UNetUp(512, 512, dropout=0.5) self.dup2 = UNetUp(1024, 512, dropout=0.5) self.dup3 = UNetUp(1024, 512, dropout=0.5) self.dup4 = UNetUp(1024, 256) self.dup5 = UNetUp(512, 128) self.dup6 = UNetUp(256, 64) self.dfinal = nn.Sequential(nn.ConvTranspose2d(128, 1, 4, stride=2, padding=1), nn.Sigmoid()) def forward(self, x, require_depth=False): # Propogate noise through fc layer and reshape to img shape d1 = self.down1(x) d2 = self.down2(d1) d3 = self.down3(d2) d4 = self.down4(d3) d5 = self.down5(d4) d6 = self.down6(d5) d7 = self.down7(d6) u1 = self.up1(d7, d6) u2 = self.up2(u1, d5) u3 = self.up3(u2, d4) u4 = self.up4(u3, d3) u5 = self.up5(u4, d2) u6 = self.up6(u5, d1) if require_depth: du1 = self.up1(d7, d6) du2 = self.up2(du1, d5) du3 = self.up3(du2, d4) du4 = self.up4(du3, d3) du5 = self.up5(du4, d2) du6 = self.up6(du5, d1) return self.final(u6) + self.k * x, self.dfinal(du6) else: return self.final(u6) + self.k * x class LinkNetUp(nn.Module): def __init__(self, in_size, out_size, dropout=0.0): super(LinkNetUp, self).__init__() layers = [ nn.ConvTranspose2d(in_size, out_size, 4, stride=2, padding=1, bias=False), nn.InstanceNorm2d(out_size, affine=True), nn.ReLU(inplace=True), ] if dropout: layers.append(nn.Dropout(dropout)) self.model = nn.Sequential(*layers) def forward(self, x): x = self.model(x) return x class ResizeGenerator(nn.Module): def __init__(self, in_channels, size, generator="UNet", resize_block=False, interpolation="bilinear", k=1.0, residual_blocks=5, k_grad=False, post_resize=True): super(ResizeGenerator, self).__init__() self.channels = in_channels self.size = size self.interpolation = interpolation self.post_resize = post_resize if generator=="UNet": self.generator = Generator(in_channels, k, k_grad=k_grad) # TODO: k elif generator=="LinkNet": self.generator = GeneratorLink(in_channels, k, k_grad=k_grad) elif generator=="ResNet": self.generator = GeneratorResNet(in_channels, residual_blocks, k, k_grad=k_grad) else: raise NotImplementedError if resize_block: self.resize_block = ResizeBlock(size, in_channels) else: self.resize_block = None def _resize(self,x): if self.resize_block: x = self.resize_block(x) else: x = F.interpolate(x, size=self.size, mode=self.interpolation, recompute_scale_factor=False) return x def forward(self, x, require_depth=False): if not self.post_resize: x = self._resize(x) if not require_depth: x = self.generator.forward(x, require_depth) else: x, depth = self.generator.forward(x, require_depth) if self.post_resize: x = self._resize(x) if require_depth: return x, depth return x class Discriminator(nn.Module): def __init__(self, in_channels=3): super(Discriminator, self).__init__() def discrimintor_block(in_features, out_features, normalize=True): """Discriminator block""" layers = [nn.Conv2d(in_features, out_features, 4, stride=2, padding=1)] if normalize: layers.append(nn.BatchNorm2d(out_features, 0.8)) layers.append(nn.LeakyReLU(0.2, inplace=True)) return layers self.model = nn.Sequential( *discrimintor_block(in_channels, 64, normalize=False), *discrimintor_block(64, 128), *discrimintor_block(128, 256), *discrimintor_block(256, 512), *discrimintor_block(512, 512), nn.ZeroPad2d((1, 0, 1, 0)), nn.Conv2d(512, 1, kernel_size=4) ) def forward(self, img): return self.model(img) class ResidualBlock(nn.Module): def __init__(self, in_features): super(ResidualBlock, self).__init__() self.block = nn.Sequential( nn.ReflectionPad2d(1), nn.Conv2d(in_features, in_features, 3), nn.InstanceNorm2d(in_features), nn.ReLU(inplace=True), nn.ReflectionPad2d(1), nn.Conv2d(in_features, in_features, 3), nn.InstanceNorm2d(in_features), ) def forward(self, x): return x + self.block(x) class GeneratorResNet(nn.Module): def __init__(self, channels, num_residual_blocks, k=1.0, k_grad=False): super(GeneratorResNet, self).__init__() self.k = torch.nn.Parameter(torch.tensor([k]), requires_grad=k_grad) # Initial convolution block out_features = 64 model = [ nn.ReflectionPad2d(channels), nn.Conv2d(channels, out_features, 7), nn.InstanceNorm2d(out_features), nn.ReLU(inplace=True), ] in_features = out_features # Downsampling for _ in range(2): out_features *= 2 model += [ nn.Conv2d(in_features, out_features, 3, stride=2, padding=1), nn.InstanceNorm2d(out_features), nn.ReLU(inplace=True), ] in_features = out_features # Residual blocks for _ in range(num_residual_blocks): model += [ResidualBlock(out_features)] # Upsampling for _ in range(2): out_features //= 2 model += [ nn.Upsample(scale_factor=2), nn.Conv2d(in_features, out_features, 3, stride=1, padding=1), nn.InstanceNorm2d(out_features), nn.ReLU(inplace=True), ] in_features = out_features # Output layer model += [nn.ReflectionPad2d(channels), nn.Conv2d(out_features, channels, 7), nn.Tanh()] self.model = nn.Sequential(*model) def forward(self, x, require_depth=False): if require_depth: raise NotImplementedError("resnet for requiring depth") return self.model(x) + self.k * x class GeneratorLink(nn.Module): def __init__(self, channels = 3, k=1.0, k_grad=False): super(GeneratorLink, self).__init__() self.k = torch.nn.Parameter(torch.tensor([k]), requires_grad=k_grad) self.down1 = UNetDown(channels, 64, normalize=False) self.down2 = UNetDown(64, 128) self.down3 = UNetDown(128, 256) self.down4 = UNetDown(256, 512, dropout=0.5) self.down5 = UNetDown(512, 512, dropout=0.5) self.down6 = UNetDown(512, 512, dropout=0.5) self.down7 = UNetDown(512, 512, dropout=0.5, normalize=False) self.up1 = LinkNetUp(512, 512, dropout=0.5) self.up2 = LinkNetUp(512, 512, dropout=0.5) self.up3 = LinkNetUp(512, 512, dropout=0.5) self.up4 = LinkNetUp(512, 256) self.up5 = LinkNetUp(256, 128) self.up6 = LinkNetUp(128, 64) self.final = nn.Sequential(nn.ConvTranspose2d(64, channels, 4, stride=2, padding=1), nn.Tanh()) def forward(self, x, require_depth=False): if require_depth: raise NotImplementedError("linknet for requiring depth") d1 = self.down1(x) # 64 d2 = self.down2(d1) # 128 d3 = self.down3(d2) # 256 d4 = self.down4(d3) # 512 d5 = self.down5(d4) # 512 d6 = self.down6(d5) # 512 d7 = self.down7(d6) # 512 u1 = self.up1(d7) + d6 # 512->512 u2 = self.up2(u1) + d5 # 512->512 u3 = self.up3(u2) + d4 # 512->512 u4 = self.up4(u3) + d3 # 512->256 u5 = self.up5(u4) + d2 # 256->128 u6 = self.up6(u5) + d1 # 128->64 return self.final(u6) + self.k * x
10,422
33.062092
103
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/models/build.py
from .residualgan import * from .resize_block import * import segmentation_models_pytorch as smp def build_generators(cfg): G_AB = ResizeGenerator( cfg.MODELS.IN_CHANNELS, (cfg.DATASETS.TARGET_SIZE, cfg.DATASETS.TARGET_SIZE), generator=cfg.MODELS.GENERATOR, resize_block=cfg.MODELS.RESIZE_BLOCK, interpolation=cfg.MODELS.INTERPOLATION, k = cfg.MODELS.K, k_grad=cfg.MODELS.K_GRAD, post_resize=cfg.MODELS.POST_RESIZE ) # G_AB.generator.k = torch.nn.Parameter(torch.Tensor([float(cfg.MODELS.K)])) G_BA = ResizeGenerator( cfg.MODELS.IN_CHANNELS, ( cfg.DATASETS.SOURCE_SIZE, cfg.DATASETS.SOURCE_SIZE), generator=cfg.MODELS.GENERATOR, resize_block=cfg.MODELS.RESIZE_BLOCK, interpolation=cfg.MODELS.INTERPOLATION, k = cfg.MODELS.K, k_grad=cfg.MODELS.K_GRAD, post_resize=cfg.MODELS.POST_RESIZE ) # G_BA.generator.k = torch.nn.Parameter(torch.Tensor([float(cfg.MODELS.K)])) return G_AB, G_BA def build_seg_model(cfg): model = None if cfg.MODELS.BACKBONE == "UNet": model = smp.Unet( encoder_name=cfg.MODELS.ENCODER, # choose encoder, e.g. mobilenet_v2 or efficientnet-b7 encoder_weights=cfg.MODELS.PRETRAIN, # use `imagenet` pre-trained weights for encoder initialization in_channels=cfg.MODELS.IN_CHANNELS, # model input channels (1 for gray-scale images, 3 for RGB, etc.) classes=cfg.MODELS.CLASSES, # model output channels (number of classes in your dataset) ) elif cfg.MODELS.BACKBONE == "DeepLabV3": model = smp.DeepLabV3( encoder_name=cfg.MODELS.ENCODER, # choose encoder, e.g. mobilenet_v2 or efficientnet-b7 encoder_weights=cfg.MODELS.PRETRAIN, in_channels=cfg.MODELS.IN_CHANNELS, # model input channels (1 for gray-scale images, 3 for RGB, etc.) classes=cfg.MODELS.CLASSES, # model output channels (number of classes in your dataset) ) elif cfg.MODELS.BACKBONE == "DeepLabV3+": model = smp.DeepLabV3Plus( encoder_name=cfg.MODELS.ENCODER, encoder_weights=cfg.MODELS.PRETRAIN, in_channels=cfg.MODELS.IN_CHANNELS, # model input channels (1 for gray-scale images, 3 for RGB, etc.) classes=cfg.MODELS.CLASSES, # model output channels (number of classes in your dataset) ) elif cfg.MODELS.BACKBONE == "MiT": raise NotImplementedError # model = Segformer(num_classes=6, decoder_dim=256, dims=(64,128,320,448)).cuda() else: raise NotImplementedError return model
2,736
43.868852
118
py
ResiDualGAN-DRDG
ResiDualGAN-DRDG-main/core/datasets/seg_dataset.py
import torch import torch.nn as nn import torch.utils.data as D import random from PIL import Image import numpy as np import torchvision.transforms as transforms class SegDataset(D.Dataset): def __init__(self, path, all=False, train=True, transform=None, iter_len=None, in_memory=True, get_label=True) -> None: super().__init__() self.path = path self.files = [] self.transform = transform self.iter_len = iter_len self.in_memory = in_memory self.get_label = get_label if not all: file_path = f"{self.path}/train.txt" if train else f"{self.path}/test.txt" else: file_path = f"{self.path}/all.txt" with open(file_path, mode="r") as f: lines = f.readlines() for line in lines: self.files.append(line.strip()) self.items = [] if self.in_memory: for file_name in self.files: img_path = "{}/images/{}".format(self.path, file_name) lbl_path = "{}/labels/{}".format(self.path, file_name) img = np.array(Image.open(img_path)) lbl = np.array(Image.open(lbl_path)) if self.get_label else 0 self.items.append((file_name, img, lbl)) if self.iter_len is None: self.len = len(self.files) else: self.len = self.iter_len self.label2train = [ [0, 255], [1, 0], [2, 1], [3, 2], [4, 3], [5, 4], [6, 5]] self.palette = [ [255,0,0], [255,255,255], [255,255,0], [0,255,0], [0,255,255], [0,0,255]] self.label = [ "Clutter background", "Imprevious surfaces", "Car", "Tree", "Low vegetation", "Building"] self.get_file_name = False def __getitem__(self, index): if self.iter_len is not None: img_index= random.randint(0, len(self.files)-1) else: assert index < len(self.files) img_index = index if self.in_memory: file_name, img, lbl = self.items[img_index] else: file_name = self.files[img_index] img_path = "{}/images/{}".format(self.path, file_name) lbl_path = "{}/labels/{}".format(self.path, file_name) img = np.array(Image.open(img_path)) lbl = np.array(Image.open(lbl_path)) if self.get_label else 0 if self.get_label: for item in self.label2train: lbl[lbl == item[0]] = item[1] if self.transform is not None: if self.get_label: trans = self.transform(image=img, mask=lbl) img = trans["image"] lbl = trans["mask"].squeeze() else: trans = self.transform(image=img) img = trans["image"] if not self.get_file_name: return transforms.ToTensor()(img).float(), lbl return file_name, transforms.ToTensor()(img).float(), lbl def __len__(self): return self.len
3,485
31.277778
123
py