repo stringlengths 2 99 | file stringlengths 13 225 | code stringlengths 0 18.3M | file_length int64 0 18.3M | avg_line_length float64 0 1.36M | max_line_length int64 0 4.26M | extension_type stringclasses 1
value |
|---|---|---|---|---|---|---|
baselines | baselines-master/baselines/deepq/experiments/train_pong.py | from baselines import deepq
from baselines import bench
from baselines import logger
from baselines.common.atari_wrappers import make_atari
def main():
logger.configure()
env = make_atari('PongNoFrameskip-v4')
env = bench.Monitor(env, logger.get_dir())
env = deepq.wrap_atari_dqn(env)
model = deepq.learn(
env,
"conv_only",
convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)],
hiddens=[256],
dueling=True,
lr=1e-4,
total_timesteps=int(1e7),
buffer_size=10000,
exploration_fraction=0.1,
exploration_final_eps=0.01,
train_freq=4,
learning_starts=10000,
target_network_update_freq=1000,
gamma=0.99,
)
model.save('pong_model.pkl')
env.close()
if __name__ == '__main__':
main()
| 817 | 22.371429 | 54 | py |
baselines | baselines-master/baselines/deepq/experiments/enjoy_cartpole.py | import gym
from baselines import deepq
def main():
env = gym.make("CartPole-v0")
act = deepq.learn(env, network='mlp', total_timesteps=0, load_path="cartpole_model.pkl")
while True:
obs, done = env.reset(), False
episode_rew = 0
while not done:
env.render()
obs, rew, done, _ = env.step(act(obs[None])[0])
episode_rew += rew
print("Episode reward", episode_rew)
if __name__ == '__main__':
main()
| 486 | 21.136364 | 92 | py |
baselines | baselines-master/baselines/deepq/experiments/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/deepq/experiments/custom_cartpole.py | import gym
import itertools
import numpy as np
import tensorflow as tf
import tensorflow.contrib.layers as layers
import baselines.common.tf_util as U
from baselines import logger
from baselines import deepq
from baselines.deepq.replay_buffer import ReplayBuffer
from baselines.deepq.utils import ObservationInput
from baselines.common.schedules import LinearSchedule
def model(inpt, num_actions, scope, reuse=False):
"""This model takes as input an observation and returns values of all actions."""
with tf.variable_scope(scope, reuse=reuse):
out = inpt
out = layers.fully_connected(out, num_outputs=64, activation_fn=tf.nn.tanh)
out = layers.fully_connected(out, num_outputs=num_actions, activation_fn=None)
return out
if __name__ == '__main__':
with U.make_session(num_cpu=8):
# Create the environment
env = gym.make("CartPole-v0")
# Create all the functions necessary to train the model
act, train, update_target, debug = deepq.build_train(
make_obs_ph=lambda name: ObservationInput(env.observation_space, name=name),
q_func=model,
num_actions=env.action_space.n,
optimizer=tf.train.AdamOptimizer(learning_rate=5e-4),
)
# Create the replay buffer
replay_buffer = ReplayBuffer(50000)
# Create the schedule for exploration starting from 1 (every action is random) down to
# 0.02 (98% of actions are selected according to values predicted by the model).
exploration = LinearSchedule(schedule_timesteps=10000, initial_p=1.0, final_p=0.02)
# Initialize the parameters and copy them to the target network.
U.initialize()
update_target()
episode_rewards = [0.0]
obs = env.reset()
for t in itertools.count():
# Take action and update exploration to the newest value
action = act(obs[None], update_eps=exploration.value(t))[0]
new_obs, rew, done, _ = env.step(action)
# Store transition in the replay buffer.
replay_buffer.add(obs, action, rew, new_obs, float(done))
obs = new_obs
episode_rewards[-1] += rew
if done:
obs = env.reset()
episode_rewards.append(0)
is_solved = t > 100 and np.mean(episode_rewards[-101:-1]) >= 200
if is_solved:
# Show off the result
env.render()
else:
# Minimize the error in Bellman's equation on a batch sampled from replay buffer.
if t > 1000:
obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample(32)
train(obses_t, actions, rewards, obses_tp1, dones, np.ones_like(rewards))
# Update target network periodically.
if t % 1000 == 0:
update_target()
if done and len(episode_rewards) % 10 == 0:
logger.record_tabular("steps", t)
logger.record_tabular("episodes", len(episode_rewards))
logger.record_tabular("mean episode reward", round(np.mean(episode_rewards[-101:-1]), 1))
logger.record_tabular("% time spent exploring", int(100 * exploration.value(t)))
logger.dump_tabular()
| 3,358 | 40.9875 | 105 | py |
baselines | baselines-master/baselines/trpo_mpi/defaults.py | from baselines.common.models import mlp, cnn_small
def atari():
return dict(
network = cnn_small(),
timesteps_per_batch=512,
max_kl=0.001,
cg_iters=10,
cg_damping=1e-3,
gamma=0.98,
lam=1.0,
vf_iters=3,
vf_stepsize=1e-4,
entcoeff=0.00,
)
def mujoco():
return dict(
network = mlp(num_hidden=32, num_layers=2),
timesteps_per_batch=1024,
max_kl=0.01,
cg_iters=10,
cg_damping=0.1,
gamma=0.99,
lam=0.98,
vf_iters=5,
vf_stepsize=1e-3,
normalize_observations=True,
)
| 638 | 19.612903 | 51 | py |
baselines | baselines-master/baselines/trpo_mpi/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/trpo_mpi/trpo_mpi.py | from baselines.common import explained_variance, zipsame, dataset
from baselines import logger
import baselines.common.tf_util as U
import tensorflow as tf, numpy as np
import time
from baselines.common import colorize
from collections import deque
from baselines.common import set_global_seeds
from baselines.common.mpi_adam import MpiAdam
from baselines.common.cg import cg
from baselines.common.input import observation_placeholder
from baselines.common.policies import build_policy
from contextlib import contextmanager
try:
from mpi4py import MPI
except ImportError:
MPI = None
def traj_segment_generator(pi, env, horizon, stochastic):
# Initialize state variables
t = 0
ac = env.action_space.sample()
new = True
rew = 0.0
ob = env.reset()
cur_ep_ret = 0
cur_ep_len = 0
ep_rets = []
ep_lens = []
# Initialize history arrays
obs = np.array([ob for _ in range(horizon)])
rews = np.zeros(horizon, 'float32')
vpreds = np.zeros(horizon, 'float32')
news = np.zeros(horizon, 'int32')
acs = np.array([ac for _ in range(horizon)])
prevacs = acs.copy()
while True:
prevac = ac
ac, vpred, _, _ = pi.step(ob, stochastic=stochastic)
# Slight weirdness here because we need value function at time T
# before returning segment [0, T-1] so we get the correct
# terminal value
if t > 0 and t % horizon == 0:
yield {"ob" : obs, "rew" : rews, "vpred" : vpreds, "new" : news,
"ac" : acs, "prevac" : prevacs, "nextvpred": vpred * (1 - new),
"ep_rets" : ep_rets, "ep_lens" : ep_lens}
_, vpred, _, _ = pi.step(ob, stochastic=stochastic)
# Be careful!!! if you change the downstream algorithm to aggregate
# several of these batches, then be sure to do a deepcopy
ep_rets = []
ep_lens = []
i = t % horizon
obs[i] = ob
vpreds[i] = vpred
news[i] = new
acs[i] = ac
prevacs[i] = prevac
ob, rew, new, _ = env.step(ac)
rews[i] = rew
cur_ep_ret += rew
cur_ep_len += 1
if new:
ep_rets.append(cur_ep_ret)
ep_lens.append(cur_ep_len)
cur_ep_ret = 0
cur_ep_len = 0
ob = env.reset()
t += 1
def add_vtarg_and_adv(seg, gamma, lam):
new = np.append(seg["new"], 0) # last element is only used for last vtarg, but we already zeroed it if last new = 1
vpred = np.append(seg["vpred"], seg["nextvpred"])
T = len(seg["rew"])
seg["adv"] = gaelam = np.empty(T, 'float32')
rew = seg["rew"]
lastgaelam = 0
for t in reversed(range(T)):
nonterminal = 1-new[t+1]
delta = rew[t] + gamma * vpred[t+1] * nonterminal - vpred[t]
gaelam[t] = lastgaelam = delta + gamma * lam * nonterminal * lastgaelam
seg["tdlamret"] = seg["adv"] + seg["vpred"]
def learn(*,
network,
env,
total_timesteps,
timesteps_per_batch=1024, # what to train on
max_kl=0.001,
cg_iters=10,
gamma=0.99,
lam=1.0, # advantage estimation
seed=None,
ent_coef=0.0,
cg_damping=1e-2,
vf_stepsize=3e-4,
vf_iters =3,
max_episodes=0, max_iters=0, # time constraint
callback=None,
load_path=None,
**network_kwargs
):
'''
learn a policy function with TRPO algorithm
Parameters:
----------
network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types)
or function that takes input placeholder and returns tuple (output, None) for feedforward nets
or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets
env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class
timesteps_per_batch timesteps per gradient estimation batch
max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) )
ent_coef coefficient of policy entropy term in the optimization objective
cg_iters number of iterations of conjugate gradient algorithm
cg_damping conjugate gradient damping
vf_stepsize learning rate for adam optimizer used to optimie value function loss
vf_iters number of iterations of value function optimization iterations per each policy optimization step
total_timesteps max number of timesteps
max_episodes max number of episodes
max_iters maximum number of policy optimization iterations
callback function to be called with (locals(), globals()) each policy optimization step
load_path str, path to load the model from (default: None, i.e. no model is loaded)
**network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
Returns:
-------
learnt model
'''
if MPI is not None:
nworkers = MPI.COMM_WORLD.Get_size()
rank = MPI.COMM_WORLD.Get_rank()
else:
nworkers = 1
rank = 0
cpus_per_worker = 1
U.get_session(config=tf.ConfigProto(
allow_soft_placement=True,
inter_op_parallelism_threads=cpus_per_worker,
intra_op_parallelism_threads=cpus_per_worker
))
policy = build_policy(env, network, value_network='copy', **network_kwargs)
set_global_seeds(seed)
np.set_printoptions(precision=3)
# Setup losses and stuff
# ----------------------------------------
ob_space = env.observation_space
ac_space = env.action_space
ob = observation_placeholder(ob_space)
with tf.variable_scope("pi"):
pi = policy(observ_placeholder=ob)
with tf.variable_scope("oldpi"):
oldpi = policy(observ_placeholder=ob)
atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable)
ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return
ac = pi.pdtype.sample_placeholder([None])
kloldnew = oldpi.pd.kl(pi.pd)
ent = pi.pd.entropy()
meankl = tf.reduce_mean(kloldnew)
meanent = tf.reduce_mean(ent)
entbonus = ent_coef * meanent
vferr = tf.reduce_mean(tf.square(pi.vf - ret))
ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold
surrgain = tf.reduce_mean(ratio * atarg)
optimgain = surrgain + entbonus
losses = [optimgain, meankl, entbonus, surrgain, meanent]
loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"]
dist = meankl
all_var_list = get_trainable_variables("pi")
# var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")]
# vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")]
var_list = get_pi_trainable_variables("pi")
vf_var_list = get_vf_trainable_variables("pi")
vfadam = MpiAdam(vf_var_list)
get_flat = U.GetFlat(var_list)
set_from_flat = U.SetFromFlat(var_list)
klgrads = tf.gradients(dist, var_list)
flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan")
shapes = [var.get_shape().as_list() for var in var_list]
start = 0
tangents = []
for shape in shapes:
sz = U.intprod(shape)
tangents.append(tf.reshape(flat_tangent[start:start+sz], shape))
start += sz
gvp = tf.add_n([tf.reduce_sum(g*tangent) for (g, tangent) in zipsame(klgrads, tangents)]) #pylint: disable=E1111
fvp = U.flatgrad(gvp, var_list)
assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv)
for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi"))])
compute_losses = U.function([ob, ac, atarg], losses)
compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)])
compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp)
compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list))
@contextmanager
def timed(msg):
if rank == 0:
print(colorize(msg, color='magenta'))
tstart = time.time()
yield
print(colorize("done in %.3f seconds"%(time.time() - tstart), color='magenta'))
else:
yield
def allmean(x):
assert isinstance(x, np.ndarray)
if MPI is not None:
out = np.empty_like(x)
MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM)
out /= nworkers
else:
out = np.copy(x)
return out
U.initialize()
if load_path is not None:
pi.load(load_path)
th_init = get_flat()
if MPI is not None:
MPI.COMM_WORLD.Bcast(th_init, root=0)
set_from_flat(th_init)
vfadam.sync()
print("Init param sum", th_init.sum(), flush=True)
# Prepare for rollouts
# ----------------------------------------
seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True)
episodes_so_far = 0
timesteps_so_far = 0
iters_so_far = 0
tstart = time.time()
lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths
rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards
if sum([max_iters>0, total_timesteps>0, max_episodes>0])==0:
# noththing to be done
return pi
assert sum([max_iters>0, total_timesteps>0, max_episodes>0]) < 2, \
'out of max_iters, total_timesteps, and max_episodes only one should be specified'
while True:
if callback: callback(locals(), globals())
if total_timesteps and timesteps_so_far >= total_timesteps:
break
elif max_episodes and episodes_so_far >= max_episodes:
break
elif max_iters and iters_so_far >= max_iters:
break
logger.log("********** Iteration %i ************"%iters_so_far)
with timed("sampling"):
seg = seg_gen.__next__()
add_vtarg_and_adv(seg, gamma, lam)
# ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets))
ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"]
vpredbefore = seg["vpred"] # predicted value function before udpate
atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate
if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret)
if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy
args = seg["ob"], seg["ac"], atarg
fvpargs = [arr[::5] for arr in args]
def fisher_vector_product(p):
return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p
assign_old_eq_new() # set old parameter values to new parameter values
with timed("computegrad"):
*lossbefore, g = compute_lossandgrad(*args)
lossbefore = allmean(np.array(lossbefore))
g = allmean(g)
if np.allclose(g, 0):
logger.log("Got zero gradient. not updating")
else:
with timed("cg"):
stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank==0)
assert np.isfinite(stepdir).all()
shs = .5*stepdir.dot(fisher_vector_product(stepdir))
lm = np.sqrt(shs / max_kl)
# logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g))
fullstep = stepdir / lm
expectedimprove = g.dot(fullstep)
surrbefore = lossbefore[0]
stepsize = 1.0
thbefore = get_flat()
for _ in range(10):
thnew = thbefore + fullstep * stepsize
set_from_flat(thnew)
meanlosses = surr, kl, *_ = allmean(np.array(compute_losses(*args)))
improve = surr - surrbefore
logger.log("Expected: %.3f Actual: %.3f"%(expectedimprove, improve))
if not np.isfinite(meanlosses).all():
logger.log("Got non-finite value of losses -- bad!")
elif kl > max_kl * 1.5:
logger.log("violated KL constraint. shrinking step.")
elif improve < 0:
logger.log("surrogate didn't improve. shrinking step.")
else:
logger.log("Stepsize OK!")
break
stepsize *= .5
else:
logger.log("couldn't compute a good step")
set_from_flat(thbefore)
if nworkers > 1 and iters_so_far % 20 == 0:
paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), vfadam.getflat().sum())) # list of tuples
assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:])
for (lossname, lossval) in zip(loss_names, meanlosses):
logger.record_tabular(lossname, lossval)
with timed("vf"):
for _ in range(vf_iters):
for (mbob, mbret) in dataset.iterbatches((seg["ob"], seg["tdlamret"]),
include_final_partial_batch=False, batch_size=64):
g = allmean(compute_vflossandgrad(mbob, mbret))
vfadam.update(g, vf_stepsize)
logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret))
lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values
if MPI is not None:
listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples
else:
listoflrpairs = [lrlocal]
lens, rews = map(flatten_lists, zip(*listoflrpairs))
lenbuffer.extend(lens)
rewbuffer.extend(rews)
logger.record_tabular("EpLenMean", np.mean(lenbuffer))
logger.record_tabular("EpRewMean", np.mean(rewbuffer))
logger.record_tabular("EpThisIter", len(lens))
episodes_so_far += len(lens)
timesteps_so_far += sum(lens)
iters_so_far += 1
logger.record_tabular("EpisodesSoFar", episodes_so_far)
logger.record_tabular("TimestepsSoFar", timesteps_so_far)
logger.record_tabular("TimeElapsed", time.time() - tstart)
if rank==0:
logger.dump_tabular()
return pi
def flatten_lists(listoflists):
return [el for list_ in listoflists for el in list_]
def get_variables(scope):
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope)
def get_trainable_variables(scope):
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, scope)
def get_vf_trainable_variables(scope):
return [v for v in get_trainable_variables(scope) if 'vf' in v.name[len(scope):].split('/')]
def get_pi_trainable_variables(scope):
return [v for v in get_trainable_variables(scope) if 'pi' in v.name[len(scope):].split('/')]
| 15,098 | 35.91687 | 170 | py |
baselines | baselines-master/baselines/common/mpi_adam.py | import baselines.common.tf_util as U
import tensorflow as tf
import numpy as np
try:
from mpi4py import MPI
except ImportError:
MPI = None
class MpiAdam(object):
def __init__(self, var_list, *, beta1=0.9, beta2=0.999, epsilon=1e-08, scale_grad_by_procs=True, comm=None):
self.var_list = var_list
self.beta1 = beta1
self.beta2 = beta2
self.epsilon = epsilon
self.scale_grad_by_procs = scale_grad_by_procs
size = sum(U.numel(v) for v in var_list)
self.m = np.zeros(size, 'float32')
self.v = np.zeros(size, 'float32')
self.t = 0
self.setfromflat = U.SetFromFlat(var_list)
self.getflat = U.GetFlat(var_list)
self.comm = MPI.COMM_WORLD if comm is None and MPI is not None else comm
def update(self, localg, stepsize):
if self.t % 100 == 0:
self.check_synced()
localg = localg.astype('float32')
if self.comm is not None:
globalg = np.zeros_like(localg)
self.comm.Allreduce(localg, globalg, op=MPI.SUM)
if self.scale_grad_by_procs:
globalg /= self.comm.Get_size()
else:
globalg = np.copy(localg)
self.t += 1
a = stepsize * np.sqrt(1 - self.beta2**self.t)/(1 - self.beta1**self.t)
self.m = self.beta1 * self.m + (1 - self.beta1) * globalg
self.v = self.beta2 * self.v + (1 - self.beta2) * (globalg * globalg)
step = (- a) * self.m / (np.sqrt(self.v) + self.epsilon)
self.setfromflat(self.getflat() + step)
def sync(self):
if self.comm is None:
return
theta = self.getflat()
self.comm.Bcast(theta, root=0)
self.setfromflat(theta)
def check_synced(self):
if self.comm is None:
return
if self.comm.Get_rank() == 0: # this is root
theta = self.getflat()
self.comm.Bcast(theta, root=0)
else:
thetalocal = self.getflat()
thetaroot = np.empty_like(thetalocal)
self.comm.Bcast(thetaroot, root=0)
assert (thetaroot == thetalocal).all(), (thetaroot, thetalocal)
@U.in_session
def test_MpiAdam():
np.random.seed(0)
tf.set_random_seed(0)
a = tf.Variable(np.random.randn(3).astype('float32'))
b = tf.Variable(np.random.randn(2,5).astype('float32'))
loss = tf.reduce_sum(tf.square(a)) + tf.reduce_sum(tf.sin(b))
stepsize = 1e-2
update_op = tf.train.AdamOptimizer(stepsize).minimize(loss)
do_update = U.function([], loss, updates=[update_op])
tf.get_default_session().run(tf.global_variables_initializer())
losslist_ref = []
for i in range(10):
l = do_update()
print(i, l)
losslist_ref.append(l)
tf.set_random_seed(0)
tf.get_default_session().run(tf.global_variables_initializer())
var_list = [a,b]
lossandgrad = U.function([], [loss, U.flatgrad(loss, var_list)])
adam = MpiAdam(var_list)
losslist_test = []
for i in range(10):
l,g = lossandgrad()
adam.update(g, stepsize)
print(i,l)
losslist_test.append(l)
np.testing.assert_allclose(np.array(losslist_ref), np.array(losslist_test), atol=1e-4)
if __name__ == '__main__':
test_MpiAdam()
| 3,296 | 30.701923 | 112 | py |
baselines | baselines-master/baselines/common/cg.py | import numpy as np
def cg(f_Ax, b, cg_iters=10, callback=None, verbose=False, residual_tol=1e-10):
"""
Demmel p 312
"""
p = b.copy()
r = b.copy()
x = np.zeros_like(b)
rdotr = r.dot(r)
fmtstr = "%10i %10.3g %10.3g"
titlestr = "%10s %10s %10s"
if verbose: print(titlestr % ("iter", "residual norm", "soln norm"))
for i in range(cg_iters):
if callback is not None:
callback(x)
if verbose: print(fmtstr % (i, rdotr, np.linalg.norm(x)))
z = f_Ax(p)
v = rdotr / p.dot(z)
x += v*p
r -= v*z
newrdotr = r.dot(r)
mu = newrdotr/rdotr
p = r + mu*p
rdotr = newrdotr
if rdotr < residual_tol:
break
if callback is not None:
callback(x)
if verbose: print(fmtstr % (i+1, rdotr, np.linalg.norm(x))) # pylint: disable=W0631
return x
| 897 | 24.657143 | 88 | py |
baselines | baselines-master/baselines/common/runners.py | import numpy as np
from abc import ABC, abstractmethod
class AbstractEnvRunner(ABC):
def __init__(self, *, env, model, nsteps):
self.env = env
self.model = model
self.nenv = nenv = env.num_envs if hasattr(env, 'num_envs') else 1
self.batch_ob_shape = (nenv*nsteps,) + env.observation_space.shape
self.obs = np.zeros((nenv,) + env.observation_space.shape, dtype=env.observation_space.dtype.name)
self.obs[:] = env.reset()
self.nsteps = nsteps
self.states = model.initial_state
self.dones = [False for _ in range(nenv)]
@abstractmethod
def run(self):
raise NotImplementedError
| 670 | 32.55 | 106 | py |
baselines | baselines-master/baselines/common/distributions.py | import tensorflow as tf
import numpy as np
import baselines.common.tf_util as U
from baselines.a2c.utils import fc
from tensorflow.python.ops import math_ops
class Pd(object):
"""
A particular probability distribution
"""
def flatparam(self):
raise NotImplementedError
def mode(self):
raise NotImplementedError
def neglogp(self, x):
# Usually it's easier to define the negative logprob
raise NotImplementedError
def kl(self, other):
raise NotImplementedError
def entropy(self):
raise NotImplementedError
def sample(self):
raise NotImplementedError
def logp(self, x):
return - self.neglogp(x)
def get_shape(self):
return self.flatparam().shape
@property
def shape(self):
return self.get_shape()
def __getitem__(self, idx):
return self.__class__(self.flatparam()[idx])
class PdType(object):
"""
Parametrized family of probability distributions
"""
def pdclass(self):
raise NotImplementedError
def pdfromflat(self, flat):
return self.pdclass()(flat)
def pdfromlatent(self, latent_vector, init_scale, init_bias):
raise NotImplementedError
def param_shape(self):
raise NotImplementedError
def sample_shape(self):
raise NotImplementedError
def sample_dtype(self):
raise NotImplementedError
def param_placeholder(self, prepend_shape, name=None):
return tf.placeholder(dtype=tf.float32, shape=prepend_shape+self.param_shape(), name=name)
def sample_placeholder(self, prepend_shape, name=None):
return tf.placeholder(dtype=self.sample_dtype(), shape=prepend_shape+self.sample_shape(), name=name)
def __eq__(self, other):
return (type(self) == type(other)) and (self.__dict__ == other.__dict__)
class CategoricalPdType(PdType):
def __init__(self, ncat):
self.ncat = ncat
def pdclass(self):
return CategoricalPd
def pdfromlatent(self, latent_vector, init_scale=1.0, init_bias=0.0):
pdparam = _matching_fc(latent_vector, 'pi', self.ncat, init_scale=init_scale, init_bias=init_bias)
return self.pdfromflat(pdparam), pdparam
def param_shape(self):
return [self.ncat]
def sample_shape(self):
return []
def sample_dtype(self):
return tf.int32
class MultiCategoricalPdType(PdType):
def __init__(self, nvec):
self.ncats = nvec.astype('int32')
assert (self.ncats > 0).all()
def pdclass(self):
return MultiCategoricalPd
def pdfromflat(self, flat):
return MultiCategoricalPd(self.ncats, flat)
def pdfromlatent(self, latent, init_scale=1.0, init_bias=0.0):
pdparam = _matching_fc(latent, 'pi', self.ncats.sum(), init_scale=init_scale, init_bias=init_bias)
return self.pdfromflat(pdparam), pdparam
def param_shape(self):
return [sum(self.ncats)]
def sample_shape(self):
return [len(self.ncats)]
def sample_dtype(self):
return tf.int32
class DiagGaussianPdType(PdType):
def __init__(self, size):
self.size = size
def pdclass(self):
return DiagGaussianPd
def pdfromlatent(self, latent_vector, init_scale=1.0, init_bias=0.0):
mean = _matching_fc(latent_vector, 'pi', self.size, init_scale=init_scale, init_bias=init_bias)
logstd = tf.get_variable(name='pi/logstd', shape=[1, self.size], initializer=tf.zeros_initializer())
pdparam = tf.concat([mean, mean * 0.0 + logstd], axis=1)
return self.pdfromflat(pdparam), mean
def param_shape(self):
return [2*self.size]
def sample_shape(self):
return [self.size]
def sample_dtype(self):
return tf.float32
class BernoulliPdType(PdType):
def __init__(self, size):
self.size = size
def pdclass(self):
return BernoulliPd
def param_shape(self):
return [self.size]
def sample_shape(self):
return [self.size]
def sample_dtype(self):
return tf.int32
def pdfromlatent(self, latent_vector, init_scale=1.0, init_bias=0.0):
pdparam = _matching_fc(latent_vector, 'pi', self.size, init_scale=init_scale, init_bias=init_bias)
return self.pdfromflat(pdparam), pdparam
# WRONG SECOND DERIVATIVES
# class CategoricalPd(Pd):
# def __init__(self, logits):
# self.logits = logits
# self.ps = tf.nn.softmax(logits)
# @classmethod
# def fromflat(cls, flat):
# return cls(flat)
# def flatparam(self):
# return self.logits
# def mode(self):
# return U.argmax(self.logits, axis=-1)
# def logp(self, x):
# return -tf.nn.sparse_softmax_cross_entropy_with_logits(self.logits, x)
# def kl(self, other):
# return tf.nn.softmax_cross_entropy_with_logits(other.logits, self.ps) \
# - tf.nn.softmax_cross_entropy_with_logits(self.logits, self.ps)
# def entropy(self):
# return tf.nn.softmax_cross_entropy_with_logits(self.logits, self.ps)
# def sample(self):
# u = tf.random_uniform(tf.shape(self.logits))
# return U.argmax(self.logits - tf.log(-tf.log(u)), axis=-1)
class CategoricalPd(Pd):
def __init__(self, logits):
self.logits = logits
def flatparam(self):
return self.logits
def mode(self):
return tf.argmax(self.logits, axis=-1)
@property
def mean(self):
return tf.nn.softmax(self.logits)
def neglogp(self, x):
# return tf.nn.sparse_softmax_cross_entropy_with_logits(logits=self.logits, labels=x)
# Note: we can't use sparse_softmax_cross_entropy_with_logits because
# the implementation does not allow second-order derivatives...
if x.dtype in {tf.uint8, tf.int32, tf.int64}:
# one-hot encoding
x_shape_list = x.shape.as_list()
logits_shape_list = self.logits.get_shape().as_list()[:-1]
for xs, ls in zip(x_shape_list, logits_shape_list):
if xs is not None and ls is not None:
assert xs == ls, 'shape mismatch: {} in x vs {} in logits'.format(xs, ls)
x = tf.one_hot(x, self.logits.get_shape().as_list()[-1])
else:
# already encoded
assert x.shape.as_list() == self.logits.shape.as_list()
return tf.nn.softmax_cross_entropy_with_logits_v2(
logits=self.logits,
labels=x)
def kl(self, other):
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
a1 = other.logits - tf.reduce_max(other.logits, axis=-1, keepdims=True)
ea0 = tf.exp(a0)
ea1 = tf.exp(a1)
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
z1 = tf.reduce_sum(ea1, axis=-1, keepdims=True)
p0 = ea0 / z0
return tf.reduce_sum(p0 * (a0 - tf.log(z0) - a1 + tf.log(z1)), axis=-1)
def entropy(self):
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
ea0 = tf.exp(a0)
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
p0 = ea0 / z0
return tf.reduce_sum(p0 * (tf.log(z0) - a0), axis=-1)
def sample(self):
u = tf.random_uniform(tf.shape(self.logits), dtype=self.logits.dtype)
return tf.argmax(self.logits - tf.log(-tf.log(u)), axis=-1)
@classmethod
def fromflat(cls, flat):
return cls(flat)
class MultiCategoricalPd(Pd):
def __init__(self, nvec, flat):
self.flat = flat
self.categoricals = list(map(CategoricalPd,
tf.split(flat, np.array(nvec, dtype=np.int32), axis=-1)))
def flatparam(self):
return self.flat
def mode(self):
return tf.cast(tf.stack([p.mode() for p in self.categoricals], axis=-1), tf.int32)
def neglogp(self, x):
return tf.add_n([p.neglogp(px) for p, px in zip(self.categoricals, tf.unstack(x, axis=-1))])
def kl(self, other):
return tf.add_n([p.kl(q) for p, q in zip(self.categoricals, other.categoricals)])
def entropy(self):
return tf.add_n([p.entropy() for p in self.categoricals])
def sample(self):
return tf.cast(tf.stack([p.sample() for p in self.categoricals], axis=-1), tf.int32)
@classmethod
def fromflat(cls, flat):
raise NotImplementedError
class DiagGaussianPd(Pd):
def __init__(self, flat):
self.flat = flat
mean, logstd = tf.split(axis=len(flat.shape)-1, num_or_size_splits=2, value=flat)
self.mean = mean
self.logstd = logstd
self.std = tf.exp(logstd)
def flatparam(self):
return self.flat
def mode(self):
return self.mean
def neglogp(self, x):
return 0.5 * tf.reduce_sum(tf.square((x - self.mean) / self.std), axis=-1) \
+ 0.5 * np.log(2.0 * np.pi) * tf.to_float(tf.shape(x)[-1]) \
+ tf.reduce_sum(self.logstd, axis=-1)
def kl(self, other):
assert isinstance(other, DiagGaussianPd)
return tf.reduce_sum(other.logstd - self.logstd + (tf.square(self.std) + tf.square(self.mean - other.mean)) / (2.0 * tf.square(other.std)) - 0.5, axis=-1)
def entropy(self):
return tf.reduce_sum(self.logstd + .5 * np.log(2.0 * np.pi * np.e), axis=-1)
def sample(self):
return self.mean + self.std * tf.random_normal(tf.shape(self.mean))
@classmethod
def fromflat(cls, flat):
return cls(flat)
class BernoulliPd(Pd):
def __init__(self, logits):
self.logits = logits
self.ps = tf.sigmoid(logits)
def flatparam(self):
return self.logits
@property
def mean(self):
return self.ps
def mode(self):
return tf.round(self.ps)
def neglogp(self, x):
return tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(logits=self.logits, labels=tf.to_float(x)), axis=-1)
def kl(self, other):
return tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(logits=other.logits, labels=self.ps), axis=-1) - tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(logits=self.logits, labels=self.ps), axis=-1)
def entropy(self):
return tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(logits=self.logits, labels=self.ps), axis=-1)
def sample(self):
u = tf.random_uniform(tf.shape(self.ps))
return tf.to_float(math_ops.less(u, self.ps))
@classmethod
def fromflat(cls, flat):
return cls(flat)
def make_pdtype(ac_space):
from gym import spaces
if isinstance(ac_space, spaces.Box):
assert len(ac_space.shape) == 1
return DiagGaussianPdType(ac_space.shape[0])
elif isinstance(ac_space, spaces.Discrete):
return CategoricalPdType(ac_space.n)
elif isinstance(ac_space, spaces.MultiDiscrete):
return MultiCategoricalPdType(ac_space.nvec)
elif isinstance(ac_space, spaces.MultiBinary):
return BernoulliPdType(ac_space.n)
else:
raise NotImplementedError
def shape_el(v, i):
maybe = v.get_shape()[i]
if maybe is not None:
return maybe
else:
return tf.shape(v)[i]
@U.in_session
def test_probtypes():
np.random.seed(0)
pdparam_diag_gauss = np.array([-.2, .3, .4, -.5, .1, -.5, .1, 0.8])
diag_gauss = DiagGaussianPdType(pdparam_diag_gauss.size // 2) #pylint: disable=E1101
validate_probtype(diag_gauss, pdparam_diag_gauss)
pdparam_categorical = np.array([-.2, .3, .5])
categorical = CategoricalPdType(pdparam_categorical.size) #pylint: disable=E1101
validate_probtype(categorical, pdparam_categorical)
nvec = [1,2,3]
pdparam_multicategorical = np.array([-.2, .3, .5, .1, 1, -.1])
multicategorical = MultiCategoricalPdType(nvec) #pylint: disable=E1101
validate_probtype(multicategorical, pdparam_multicategorical)
pdparam_bernoulli = np.array([-.2, .3, .5])
bernoulli = BernoulliPdType(pdparam_bernoulli.size) #pylint: disable=E1101
validate_probtype(bernoulli, pdparam_bernoulli)
def validate_probtype(probtype, pdparam):
N = 100000
# Check to see if mean negative log likelihood == differential entropy
Mval = np.repeat(pdparam[None, :], N, axis=0)
M = probtype.param_placeholder([N])
X = probtype.sample_placeholder([N])
pd = probtype.pdfromflat(M)
calcloglik = U.function([X, M], pd.logp(X))
calcent = U.function([M], pd.entropy())
Xval = tf.get_default_session().run(pd.sample(), feed_dict={M:Mval})
logliks = calcloglik(Xval, Mval)
entval_ll = - logliks.mean() #pylint: disable=E1101
entval_ll_stderr = logliks.std() / np.sqrt(N) #pylint: disable=E1101
entval = calcent(Mval).mean() #pylint: disable=E1101
assert np.abs(entval - entval_ll) < 3 * entval_ll_stderr # within 3 sigmas
# Check to see if kldiv[p,q] = - ent[p] - E_p[log q]
M2 = probtype.param_placeholder([N])
pd2 = probtype.pdfromflat(M2)
q = pdparam + np.random.randn(pdparam.size) * 0.1
Mval2 = np.repeat(q[None, :], N, axis=0)
calckl = U.function([M, M2], pd.kl(pd2))
klval = calckl(Mval, Mval2).mean() #pylint: disable=E1101
logliks = calcloglik(Xval, Mval2)
klval_ll = - entval - logliks.mean() #pylint: disable=E1101
klval_ll_stderr = logliks.std() / np.sqrt(N) #pylint: disable=E1101
assert np.abs(klval - klval_ll) < 3 * klval_ll_stderr # within 3 sigmas
print('ok on', probtype, pdparam)
def _matching_fc(tensor, name, size, init_scale, init_bias):
if tensor.shape[-1] == size:
return tensor
else:
return fc(tensor, name, size, init_scale=init_scale, init_bias=init_bias)
| 13,595 | 37.191011 | 217 | py |
baselines | baselines-master/baselines/common/mpi_util.py | from collections import defaultdict
import os, numpy as np
import platform
import shutil
import subprocess
import warnings
import sys
try:
from mpi4py import MPI
except ImportError:
MPI = None
def sync_from_root(sess, variables, comm=None):
"""
Send the root node's parameters to every worker.
Arguments:
sess: the TensorFlow session.
variables: all parameter variables including optimizer's
"""
if comm is None: comm = MPI.COMM_WORLD
import tensorflow as tf
values = comm.bcast(sess.run(variables))
sess.run([tf.assign(var, val)
for (var, val) in zip(variables, values)])
def gpu_count():
"""
Count the GPUs on this machine.
"""
if shutil.which('nvidia-smi') is None:
return 0
output = subprocess.check_output(['nvidia-smi', '--query-gpu=gpu_name', '--format=csv'])
return max(0, len(output.split(b'\n')) - 2)
def setup_mpi_gpus():
"""
Set CUDA_VISIBLE_DEVICES to MPI rank if not already set
"""
if 'CUDA_VISIBLE_DEVICES' not in os.environ:
if sys.platform == 'darwin': # This Assumes if you're on OSX you're just
ids = [] # doing a smoke test and don't want GPUs
else:
lrank, _lsize = get_local_rank_size(MPI.COMM_WORLD)
ids = [lrank]
os.environ["CUDA_VISIBLE_DEVICES"] = ",".join(map(str, ids))
def get_local_rank_size(comm):
"""
Returns the rank of each process on its machine
The processes on a given machine will be assigned ranks
0, 1, 2, ..., N-1,
where N is the number of processes on this machine.
Useful if you want to assign one gpu per machine
"""
this_node = platform.node()
ranks_nodes = comm.allgather((comm.Get_rank(), this_node))
node2rankssofar = defaultdict(int)
local_rank = None
for (rank, node) in ranks_nodes:
if rank == comm.Get_rank():
local_rank = node2rankssofar[node]
node2rankssofar[node] += 1
assert local_rank is not None
return local_rank, node2rankssofar[this_node]
def share_file(comm, path):
"""
Copies the file from rank 0 to all other ranks
Puts it in the same place on all machines
"""
localrank, _ = get_local_rank_size(comm)
if comm.Get_rank() == 0:
with open(path, 'rb') as fh:
data = fh.read()
comm.bcast(data)
else:
data = comm.bcast(None)
if localrank == 0:
os.makedirs(os.path.dirname(path), exist_ok=True)
with open(path, 'wb') as fh:
fh.write(data)
comm.Barrier()
def dict_gather(comm, d, op='mean', assert_all_have_data=True):
"""
Perform a reduction operation over dicts
"""
if comm is None: return d
alldicts = comm.allgather(d)
size = comm.size
k2li = defaultdict(list)
for d in alldicts:
for (k,v) in d.items():
k2li[k].append(v)
result = {}
for (k,li) in k2li.items():
if assert_all_have_data:
assert len(li)==size, "only %i out of %i MPI workers have sent '%s'" % (len(li), size, k)
if op=='mean':
result[k] = np.mean(li, axis=0)
elif op=='sum':
result[k] = np.sum(li, axis=0)
else:
assert 0, op
return result
def mpi_weighted_mean(comm, local_name2valcount):
"""
Perform a weighted average over dicts that are each on a different node
Input: local_name2valcount: dict mapping key -> (value, count)
Returns: key -> mean
"""
all_name2valcount = comm.gather(local_name2valcount)
if comm.rank == 0:
name2sum = defaultdict(float)
name2count = defaultdict(float)
for n2vc in all_name2valcount:
for (name, (val, count)) in n2vc.items():
try:
val = float(val)
except ValueError:
if comm.rank == 0:
warnings.warn('WARNING: tried to compute mean on non-float {}={}'.format(name, val))
else:
name2sum[name] += val * count
name2count[name] += count
return {name : name2sum[name] / name2count[name] for name in name2sum}
else:
return {}
| 4,259 | 30.791045 | 108 | py |
baselines | baselines-master/baselines/common/schedules.py | """This file is used for specifying various schedules that evolve over
time throughout the execution of the algorithm, such as:
- learning rate for the optimizer
- exploration epsilon for the epsilon greedy exploration strategy
- beta parameter for beta parameter in prioritized replay
Each schedule has a function `value(t)` which returns the current value
of the parameter given the timestep t of the optimization procedure.
"""
class Schedule(object):
def value(self, t):
"""Value of the schedule at time t"""
raise NotImplementedError()
class ConstantSchedule(object):
def __init__(self, value):
"""Value remains constant over time.
Parameters
----------
value: float
Constant value of the schedule
"""
self._v = value
def value(self, t):
"""See Schedule.value"""
return self._v
def linear_interpolation(l, r, alpha):
return l + alpha * (r - l)
class PiecewiseSchedule(object):
def __init__(self, endpoints, interpolation=linear_interpolation, outside_value=None):
"""Piecewise schedule.
endpoints: [(int, int)]
list of pairs `(time, value)` meanining that schedule should output
`value` when `t==time`. All the values for time must be sorted in
an increasing order. When t is between two times, e.g. `(time_a, value_a)`
and `(time_b, value_b)`, such that `time_a <= t < time_b` then value outputs
`interpolation(value_a, value_b, alpha)` where alpha is a fraction of
time passed between `time_a` and `time_b` for time `t`.
interpolation: lambda float, float, float: float
a function that takes value to the left and to the right of t according
to the `endpoints`. Alpha is the fraction of distance from left endpoint to
right endpoint that t has covered. See linear_interpolation for example.
outside_value: float
if the value is requested outside of all the intervals sepecified in
`endpoints` this value is returned. If None then AssertionError is
raised when outside value is requested.
"""
idxes = [e[0] for e in endpoints]
assert idxes == sorted(idxes)
self._interpolation = interpolation
self._outside_value = outside_value
self._endpoints = endpoints
def value(self, t):
"""See Schedule.value"""
for (l_t, l), (r_t, r) in zip(self._endpoints[:-1], self._endpoints[1:]):
if l_t <= t and t < r_t:
alpha = float(t - l_t) / (r_t - l_t)
return self._interpolation(l, r, alpha)
# t does not belong to any of the pieces, so doom.
assert self._outside_value is not None
return self._outside_value
class LinearSchedule(object):
def __init__(self, schedule_timesteps, final_p, initial_p=1.0):
"""Linear interpolation between initial_p and final_p over
schedule_timesteps. After this many timesteps pass final_p is
returned.
Parameters
----------
schedule_timesteps: int
Number of timesteps for which to linearly anneal initial_p
to final_p
initial_p: float
initial output value
final_p: float
final output value
"""
self.schedule_timesteps = schedule_timesteps
self.final_p = final_p
self.initial_p = initial_p
def value(self, t):
"""See Schedule.value"""
fraction = min(float(t) / self.schedule_timesteps, 1.0)
return self.initial_p + fraction * (self.final_p - self.initial_p)
| 3,702 | 36.03 | 90 | py |
baselines | baselines-master/baselines/common/atari_wrappers.py | import numpy as np
import os
os.environ.setdefault('PATH', '')
from collections import deque
import gym
from gym import spaces
import cv2
cv2.ocl.setUseOpenCL(False)
from .wrappers import TimeLimit
class NoopResetEnv(gym.Wrapper):
def __init__(self, env, noop_max=30):
"""Sample initial states by taking random number of no-ops on reset.
No-op is assumed to be action 0.
"""
gym.Wrapper.__init__(self, env)
self.noop_max = noop_max
self.override_num_noops = None
self.noop_action = 0
assert env.unwrapped.get_action_meanings()[0] == 'NOOP'
def reset(self, **kwargs):
""" Do no-op action for a number of steps in [1, noop_max]."""
self.env.reset(**kwargs)
if self.override_num_noops is not None:
noops = self.override_num_noops
else:
noops = self.unwrapped.np_random.randint(1, self.noop_max + 1) #pylint: disable=E1101
assert noops > 0
obs = None
for _ in range(noops):
obs, _, done, _ = self.env.step(self.noop_action)
if done:
obs = self.env.reset(**kwargs)
return obs
def step(self, ac):
return self.env.step(ac)
class FireResetEnv(gym.Wrapper):
def __init__(self, env):
"""Take action on reset for environments that are fixed until firing."""
gym.Wrapper.__init__(self, env)
assert env.unwrapped.get_action_meanings()[1] == 'FIRE'
assert len(env.unwrapped.get_action_meanings()) >= 3
def reset(self, **kwargs):
self.env.reset(**kwargs)
obs, _, done, _ = self.env.step(1)
if done:
self.env.reset(**kwargs)
obs, _, done, _ = self.env.step(2)
if done:
self.env.reset(**kwargs)
return obs
def step(self, ac):
return self.env.step(ac)
class EpisodicLifeEnv(gym.Wrapper):
def __init__(self, env):
"""Make end-of-life == end-of-episode, but only reset on true game over.
Done by DeepMind for the DQN and co. since it helps value estimation.
"""
gym.Wrapper.__init__(self, env)
self.lives = 0
self.was_real_done = True
def step(self, action):
obs, reward, done, info = self.env.step(action)
self.was_real_done = done
# check current lives, make loss of life terminal,
# then update lives to handle bonus lives
lives = self.env.unwrapped.ale.lives()
if lives < self.lives and lives > 0:
# for Qbert sometimes we stay in lives == 0 condition for a few frames
# so it's important to keep lives > 0, so that we only reset once
# the environment advertises done.
done = True
self.lives = lives
return obs, reward, done, info
def reset(self, **kwargs):
"""Reset only when lives are exhausted.
This way all states are still reachable even though lives are episodic,
and the learner need not know about any of this behind-the-scenes.
"""
if self.was_real_done:
obs = self.env.reset(**kwargs)
else:
# no-op step to advance from terminal/lost life state
obs, _, _, _ = self.env.step(0)
self.lives = self.env.unwrapped.ale.lives()
return obs
class MaxAndSkipEnv(gym.Wrapper):
def __init__(self, env, skip=4):
"""Return only every `skip`-th frame"""
gym.Wrapper.__init__(self, env)
# most recent raw observations (for max pooling across time steps)
self._obs_buffer = np.zeros((2,)+env.observation_space.shape, dtype=np.uint8)
self._skip = skip
def step(self, action):
"""Repeat action, sum reward, and max over last observations."""
total_reward = 0.0
done = None
for i in range(self._skip):
obs, reward, done, info = self.env.step(action)
if i == self._skip - 2: self._obs_buffer[0] = obs
if i == self._skip - 1: self._obs_buffer[1] = obs
total_reward += reward
if done:
break
# Note that the observation on the done=True frame
# doesn't matter
max_frame = self._obs_buffer.max(axis=0)
return max_frame, total_reward, done, info
def reset(self, **kwargs):
return self.env.reset(**kwargs)
class ClipRewardEnv(gym.RewardWrapper):
def __init__(self, env):
gym.RewardWrapper.__init__(self, env)
def reward(self, reward):
"""Bin reward to {+1, 0, -1} by its sign."""
return np.sign(reward)
class WarpFrame(gym.ObservationWrapper):
def __init__(self, env, width=84, height=84, grayscale=True, dict_space_key=None):
"""
Warp frames to 84x84 as done in the Nature paper and later work.
If the environment uses dictionary observations, `dict_space_key` can be specified which indicates which
observation should be warped.
"""
super().__init__(env)
self._width = width
self._height = height
self._grayscale = grayscale
self._key = dict_space_key
if self._grayscale:
num_colors = 1
else:
num_colors = 3
new_space = gym.spaces.Box(
low=0,
high=255,
shape=(self._height, self._width, num_colors),
dtype=np.uint8,
)
if self._key is None:
original_space = self.observation_space
self.observation_space = new_space
else:
original_space = self.observation_space.spaces[self._key]
self.observation_space.spaces[self._key] = new_space
assert original_space.dtype == np.uint8 and len(original_space.shape) == 3
def observation(self, obs):
if self._key is None:
frame = obs
else:
frame = obs[self._key]
if self._grayscale:
frame = cv2.cvtColor(frame, cv2.COLOR_RGB2GRAY)
frame = cv2.resize(
frame, (self._width, self._height), interpolation=cv2.INTER_AREA
)
if self._grayscale:
frame = np.expand_dims(frame, -1)
if self._key is None:
obs = frame
else:
obs = obs.copy()
obs[self._key] = frame
return obs
class FrameStack(gym.Wrapper):
def __init__(self, env, k):
"""Stack k last frames.
Returns lazy array, which is much more memory efficient.
See Also
--------
baselines.common.atari_wrappers.LazyFrames
"""
gym.Wrapper.__init__(self, env)
self.k = k
self.frames = deque([], maxlen=k)
shp = env.observation_space.shape
self.observation_space = spaces.Box(low=0, high=255, shape=(shp[:-1] + (shp[-1] * k,)), dtype=env.observation_space.dtype)
def reset(self):
ob = self.env.reset()
for _ in range(self.k):
self.frames.append(ob)
return self._get_ob()
def step(self, action):
ob, reward, done, info = self.env.step(action)
self.frames.append(ob)
return self._get_ob(), reward, done, info
def _get_ob(self):
assert len(self.frames) == self.k
return LazyFrames(list(self.frames))
class ScaledFloatFrame(gym.ObservationWrapper):
def __init__(self, env):
gym.ObservationWrapper.__init__(self, env)
self.observation_space = gym.spaces.Box(low=0, high=1, shape=env.observation_space.shape, dtype=np.float32)
def observation(self, observation):
# careful! This undoes the memory optimization, use
# with smaller replay buffers only.
return np.array(observation).astype(np.float32) / 255.0
class LazyFrames(object):
def __init__(self, frames):
"""This object ensures that common frames between the observations are only stored once.
It exists purely to optimize memory usage which can be huge for DQN's 1M frames replay
buffers.
This object should only be converted to numpy array before being passed to the model.
You'd not believe how complex the previous solution was."""
self._frames = frames
self._out = None
def _force(self):
if self._out is None:
self._out = np.concatenate(self._frames, axis=-1)
self._frames = None
return self._out
def __array__(self, dtype=None):
out = self._force()
if dtype is not None:
out = out.astype(dtype)
return out
def __len__(self):
return len(self._force())
def __getitem__(self, i):
return self._force()[i]
def count(self):
frames = self._force()
return frames.shape[frames.ndim - 1]
def frame(self, i):
return self._force()[..., i]
def make_atari(env_id, max_episode_steps=None):
env = gym.make(env_id)
assert 'NoFrameskip' in env.spec.id
env = NoopResetEnv(env, noop_max=30)
env = MaxAndSkipEnv(env, skip=4)
if max_episode_steps is not None:
env = TimeLimit(env, max_episode_steps=max_episode_steps)
return env
def wrap_deepmind(env, episode_life=True, clip_rewards=True, frame_stack=False, scale=False):
"""Configure environment for DeepMind-style Atari.
"""
if episode_life:
env = EpisodicLifeEnv(env)
if 'FIRE' in env.unwrapped.get_action_meanings():
env = FireResetEnv(env)
env = WarpFrame(env)
if scale:
env = ScaledFloatFrame(env)
if clip_rewards:
env = ClipRewardEnv(env)
if frame_stack:
env = FrameStack(env, 4)
return env
| 9,686 | 32.28866 | 130 | py |
baselines | baselines-master/baselines/common/mpi_running_mean_std.py | try:
from mpi4py import MPI
except ImportError:
MPI = None
import tensorflow as tf, baselines.common.tf_util as U, numpy as np
class RunningMeanStd(object):
# https://en.wikipedia.org/wiki/Algorithms_for_calculating_variance#Parallel_algorithm
def __init__(self, epsilon=1e-2, shape=()):
self._sum = tf.get_variable(
dtype=tf.float64,
shape=shape,
initializer=tf.constant_initializer(0.0),
name="runningsum", trainable=False)
self._sumsq = tf.get_variable(
dtype=tf.float64,
shape=shape,
initializer=tf.constant_initializer(epsilon),
name="runningsumsq", trainable=False)
self._count = tf.get_variable(
dtype=tf.float64,
shape=(),
initializer=tf.constant_initializer(epsilon),
name="count", trainable=False)
self.shape = shape
self.mean = tf.to_float(self._sum / self._count)
self.std = tf.sqrt( tf.maximum( tf.to_float(self._sumsq / self._count) - tf.square(self.mean) , 1e-2 ))
newsum = tf.placeholder(shape=self.shape, dtype=tf.float64, name='sum')
newsumsq = tf.placeholder(shape=self.shape, dtype=tf.float64, name='var')
newcount = tf.placeholder(shape=[], dtype=tf.float64, name='count')
self.incfiltparams = U.function([newsum, newsumsq, newcount], [],
updates=[tf.assign_add(self._sum, newsum),
tf.assign_add(self._sumsq, newsumsq),
tf.assign_add(self._count, newcount)])
def update(self, x):
x = x.astype('float64')
n = int(np.prod(self.shape))
totalvec = np.zeros(n*2+1, 'float64')
addvec = np.concatenate([x.sum(axis=0).ravel(), np.square(x).sum(axis=0).ravel(), np.array([len(x)],dtype='float64')])
if MPI is not None:
MPI.COMM_WORLD.Allreduce(addvec, totalvec, op=MPI.SUM)
self.incfiltparams(totalvec[0:n].reshape(self.shape), totalvec[n:2*n].reshape(self.shape), totalvec[2*n])
@U.in_session
def test_runningmeanstd():
for (x1, x2, x3) in [
(np.random.randn(3), np.random.randn(4), np.random.randn(5)),
(np.random.randn(3,2), np.random.randn(4,2), np.random.randn(5,2)),
]:
rms = RunningMeanStd(epsilon=0.0, shape=x1.shape[1:])
U.initialize()
x = np.concatenate([x1, x2, x3], axis=0)
ms1 = [x.mean(axis=0), x.std(axis=0)]
rms.update(x1)
rms.update(x2)
rms.update(x3)
ms2 = [rms.mean.eval(), rms.std.eval()]
assert np.allclose(ms1, ms2)
@U.in_session
def test_dist():
np.random.seed(0)
p1,p2,p3=(np.random.randn(3,1), np.random.randn(4,1), np.random.randn(5,1))
q1,q2,q3=(np.random.randn(6,1), np.random.randn(7,1), np.random.randn(8,1))
# p1,p2,p3=(np.random.randn(3), np.random.randn(4), np.random.randn(5))
# q1,q2,q3=(np.random.randn(6), np.random.randn(7), np.random.randn(8))
comm = MPI.COMM_WORLD
assert comm.Get_size()==2
if comm.Get_rank()==0:
x1,x2,x3 = p1,p2,p3
elif comm.Get_rank()==1:
x1,x2,x3 = q1,q2,q3
else:
assert False
rms = RunningMeanStd(epsilon=0.0, shape=(1,))
U.initialize()
rms.update(x1)
rms.update(x2)
rms.update(x3)
bigvec = np.concatenate([p1,p2,p3,q1,q2,q3])
def checkallclose(x,y):
print(x,y)
return np.allclose(x,y)
assert checkallclose(
bigvec.mean(axis=0),
rms.mean.eval(),
)
assert checkallclose(
bigvec.std(axis=0),
rms.std.eval(),
)
if __name__ == "__main__":
# Run with mpirun -np 2 python <filename>
test_dist()
| 3,706 | 31.80531 | 126 | py |
baselines | baselines-master/baselines/common/test_mpi_util.py | from baselines.common import mpi_util
from baselines import logger
from baselines.common.tests.test_with_mpi import with_mpi
try:
from mpi4py import MPI
except ImportError:
MPI = None
@with_mpi()
def test_mpi_weighted_mean():
comm = MPI.COMM_WORLD
with logger.scoped_configure(comm=comm):
if comm.rank == 0:
name2valcount = {'a' : (10, 2), 'b' : (20,3)}
elif comm.rank == 1:
name2valcount = {'a' : (19, 1), 'c' : (42,3)}
else:
raise NotImplementedError
d = mpi_util.mpi_weighted_mean(comm, name2valcount)
correctval = {'a' : (10 * 2 + 19) / 3.0, 'b' : 20, 'c' : 42}
if comm.rank == 0:
assert d == correctval, '{} != {}'.format(d, correctval)
for name, (val, count) in name2valcount.items():
for _ in range(count):
logger.logkv_mean(name, val)
d2 = logger.dumpkvs()
if comm.rank == 0:
assert d2 == correctval
| 986 | 31.9 | 68 | py |
baselines | baselines-master/baselines/common/misc_util.py | import gym
import numpy as np
import os
import pickle
import random
import tempfile
import zipfile
def zipsame(*seqs):
L = len(seqs[0])
assert all(len(seq) == L for seq in seqs[1:])
return zip(*seqs)
class EzPickle(object):
"""Objects that are pickled and unpickled via their constructor
arguments.
Example usage:
class Dog(Animal, EzPickle):
def __init__(self, furcolor, tailkind="bushy"):
Animal.__init__()
EzPickle.__init__(furcolor, tailkind)
...
When this object is unpickled, a new Dog will be constructed by passing the provided
furcolor and tailkind into the constructor. However, philosophers are still not sure
whether it is still the same dog.
This is generally needed only for environments which wrap C/C++ code, such as MuJoCo
and Atari.
"""
def __init__(self, *args, **kwargs):
self._ezpickle_args = args
self._ezpickle_kwargs = kwargs
def __getstate__(self):
return {"_ezpickle_args": self._ezpickle_args, "_ezpickle_kwargs": self._ezpickle_kwargs}
def __setstate__(self, d):
out = type(self)(*d["_ezpickle_args"], **d["_ezpickle_kwargs"])
self.__dict__.update(out.__dict__)
def set_global_seeds(i):
try:
import MPI
rank = MPI.COMM_WORLD.Get_rank()
except ImportError:
rank = 0
myseed = i + 1000 * rank if i is not None else None
try:
import tensorflow as tf
tf.set_random_seed(myseed)
except ImportError:
pass
np.random.seed(myseed)
random.seed(myseed)
def pretty_eta(seconds_left):
"""Print the number of seconds in human readable format.
Examples:
2 days
2 hours and 37 minutes
less than a minute
Paramters
---------
seconds_left: int
Number of seconds to be converted to the ETA
Returns
-------
eta: str
String representing the pretty ETA.
"""
minutes_left = seconds_left // 60
seconds_left %= 60
hours_left = minutes_left // 60
minutes_left %= 60
days_left = hours_left // 24
hours_left %= 24
def helper(cnt, name):
return "{} {}{}".format(str(cnt), name, ('s' if cnt > 1 else ''))
if days_left > 0:
msg = helper(days_left, 'day')
if hours_left > 0:
msg += ' and ' + helper(hours_left, 'hour')
return msg
if hours_left > 0:
msg = helper(hours_left, 'hour')
if minutes_left > 0:
msg += ' and ' + helper(minutes_left, 'minute')
return msg
if minutes_left > 0:
return helper(minutes_left, 'minute')
return 'less than a minute'
class RunningAvg(object):
def __init__(self, gamma, init_value=None):
"""Keep a running estimate of a quantity. This is a bit like mean
but more sensitive to recent changes.
Parameters
----------
gamma: float
Must be between 0 and 1, where 0 is the most sensitive to recent
changes.
init_value: float or None
Initial value of the estimate. If None, it will be set on the first update.
"""
self._value = init_value
self._gamma = gamma
def update(self, new_val):
"""Update the estimate.
Parameters
----------
new_val: float
new observated value of estimated quantity.
"""
if self._value is None:
self._value = new_val
else:
self._value = self._gamma * self._value + (1.0 - self._gamma) * new_val
def __float__(self):
"""Get the current estimate"""
return self._value
def boolean_flag(parser, name, default=False, help=None):
"""Add a boolean flag to argparse parser.
Parameters
----------
parser: argparse.Parser
parser to add the flag to
name: str
--<name> will enable the flag, while --no-<name> will disable it
default: bool or None
default value of the flag
help: str
help string for the flag
"""
dest = name.replace('-', '_')
parser.add_argument("--" + name, action="store_true", default=default, dest=dest, help=help)
parser.add_argument("--no-" + name, action="store_false", dest=dest)
def get_wrapper_by_name(env, classname):
"""Given an a gym environment possibly wrapped multiple times, returns a wrapper
of class named classname or raises ValueError if no such wrapper was applied
Parameters
----------
env: gym.Env of gym.Wrapper
gym environment
classname: str
name of the wrapper
Returns
-------
wrapper: gym.Wrapper
wrapper named classname
"""
currentenv = env
while True:
if classname == currentenv.class_name():
return currentenv
elif isinstance(currentenv, gym.Wrapper):
currentenv = currentenv.env
else:
raise ValueError("Couldn't find wrapper named %s" % classname)
def relatively_safe_pickle_dump(obj, path, compression=False):
"""This is just like regular pickle dump, except from the fact that failure cases are
different:
- It's never possible that we end up with a pickle in corrupted state.
- If a there was a different file at the path, that file will remain unchanged in the
even of failure (provided that filesystem rename is atomic).
- it is sometimes possible that we end up with useless temp file which needs to be
deleted manually (it will be removed automatically on the next function call)
The indended use case is periodic checkpoints of experiment state, such that we never
corrupt previous checkpoints if the current one fails.
Parameters
----------
obj: object
object to pickle
path: str
path to the output file
compression: bool
if true pickle will be compressed
"""
temp_storage = path + ".relatively_safe"
if compression:
# Using gzip here would be simpler, but the size is limited to 2GB
with tempfile.NamedTemporaryFile() as uncompressed_file:
pickle.dump(obj, uncompressed_file)
uncompressed_file.file.flush()
with zipfile.ZipFile(temp_storage, "w", compression=zipfile.ZIP_DEFLATED) as myzip:
myzip.write(uncompressed_file.name, "data")
else:
with open(temp_storage, "wb") as f:
pickle.dump(obj, f)
os.rename(temp_storage, path)
def pickle_load(path, compression=False):
"""Unpickle a possible compressed pickle.
Parameters
----------
path: str
path to the output file
compression: bool
if true assumes that pickle was compressed when created and attempts decompression.
Returns
-------
obj: object
the unpickled object
"""
if compression:
with zipfile.ZipFile(path, "r", compression=zipfile.ZIP_DEFLATED) as myzip:
with myzip.open("data") as f:
return pickle.load(f)
else:
with open(path, "rb") as f:
return pickle.load(f)
| 7,166 | 28.372951 | 97 | py |
baselines | baselines-master/baselines/common/mpi_fork.py | import os, subprocess, sys
def mpi_fork(n, bind_to_core=False):
"""Re-launches the current script with workers
Returns "parent" for original parent, "child" for MPI children
"""
if n<=1:
return "child"
if os.getenv("IN_MPI") is None:
env = os.environ.copy()
env.update(
MKL_NUM_THREADS="1",
OMP_NUM_THREADS="1",
IN_MPI="1"
)
args = ["mpirun", "-np", str(n)]
if bind_to_core:
args += ["-bind-to", "core"]
args += [sys.executable] + sys.argv
subprocess.check_call(args, env=env)
return "parent"
else:
return "child"
| 667 | 26.833333 | 66 | py |
baselines | baselines-master/baselines/common/dataset.py | import numpy as np
class Dataset(object):
def __init__(self, data_map, deterministic=False, shuffle=True):
self.data_map = data_map
self.deterministic = deterministic
self.enable_shuffle = shuffle
self.n = next(iter(data_map.values())).shape[0]
self._next_id = 0
self.shuffle()
def shuffle(self):
if self.deterministic:
return
perm = np.arange(self.n)
np.random.shuffle(perm)
for key in self.data_map:
self.data_map[key] = self.data_map[key][perm]
self._next_id = 0
def next_batch(self, batch_size):
if self._next_id >= self.n and self.enable_shuffle:
self.shuffle()
cur_id = self._next_id
cur_batch_size = min(batch_size, self.n - self._next_id)
self._next_id += cur_batch_size
data_map = dict()
for key in self.data_map:
data_map[key] = self.data_map[key][cur_id:cur_id+cur_batch_size]
return data_map
def iterate_once(self, batch_size):
if self.enable_shuffle: self.shuffle()
while self._next_id <= self.n - batch_size:
yield self.next_batch(batch_size)
self._next_id = 0
def subset(self, num_elements, deterministic=True):
data_map = dict()
for key in self.data_map:
data_map[key] = self.data_map[key][:num_elements]
return Dataset(data_map, deterministic)
def iterbatches(arrays, *, num_batches=None, batch_size=None, shuffle=True, include_final_partial_batch=True):
assert (num_batches is None) != (batch_size is None), 'Provide num_batches or batch_size, but not both'
arrays = tuple(map(np.asarray, arrays))
n = arrays[0].shape[0]
assert all(a.shape[0] == n for a in arrays[1:])
inds = np.arange(n)
if shuffle: np.random.shuffle(inds)
sections = np.arange(0, n, batch_size)[1:] if num_batches is None else num_batches
for batch_inds in np.array_split(inds, sections):
if include_final_partial_batch or len(batch_inds) == batch_size:
yield tuple(a[batch_inds] for a in arrays)
| 2,132 | 33.967213 | 110 | py |
baselines | baselines-master/baselines/common/math_util.py | import numpy as np
import scipy.signal
def discount(x, gamma):
"""
computes discounted sums along 0th dimension of x.
inputs
------
x: ndarray
gamma: float
outputs
-------
y: ndarray with same shape as x, satisfying
y[t] = x[t] + gamma*x[t+1] + gamma^2*x[t+2] + ... + gamma^k x[t+k],
where k = len(x) - t - 1
"""
assert x.ndim >= 1
return scipy.signal.lfilter([1],[1,-gamma],x[::-1], axis=0)[::-1]
def explained_variance(ypred,y):
"""
Computes fraction of variance that ypred explains about y.
Returns 1 - Var[y-ypred] / Var[y]
interpretation:
ev=0 => might as well have predicted zero
ev=1 => perfect prediction
ev<0 => worse than just predicting zero
"""
assert y.ndim == 1 and ypred.ndim == 1
vary = np.var(y)
return np.nan if vary==0 else 1 - np.var(y-ypred)/vary
def explained_variance_2d(ypred, y):
assert y.ndim == 2 and ypred.ndim == 2
vary = np.var(y, axis=0)
out = 1 - np.var(y-ypred)/vary
out[vary < 1e-10] = 0
return out
def ncc(ypred, y):
return np.corrcoef(ypred, y)[1,0]
def flatten_arrays(arrs):
return np.concatenate([arr.flat for arr in arrs])
def unflatten_vector(vec, shapes):
i=0
arrs = []
for shape in shapes:
size = np.prod(shape)
arr = vec[i:i+size].reshape(shape)
arrs.append(arr)
i += size
return arrs
def discount_with_boundaries(X, New, gamma):
"""
X: 2d array of floats, time x features
New: 2d array of bools, indicating when a new episode has started
"""
Y = np.zeros_like(X)
T = X.shape[0]
Y[T-1] = X[T-1]
for t in range(T-2, -1, -1):
Y[t] = X[t] + gamma * Y[t+1] * (1 - New[t+1])
return Y
def test_discount_with_boundaries():
gamma=0.9
x = np.array([1.0, 2.0, 3.0, 4.0], 'float32')
starts = [1.0, 0.0, 0.0, 1.0]
y = discount_with_boundaries(x, starts, gamma)
assert np.allclose(y, [
1 + gamma * 2 + gamma**2 * 3,
2 + gamma * 3,
3,
4
])
| 2,094 | 23.360465 | 75 | py |
baselines | baselines-master/baselines/common/tf_util.py | import numpy as np
import tensorflow as tf # pylint: ignore-module
import copy
import os
import functools
import collections
import multiprocessing
def switch(condition, then_expression, else_expression):
"""Switches between two operations depending on a scalar value (int or bool).
Note that both `then_expression` and `else_expression`
should be symbolic tensors of the *same shape*.
# Arguments
condition: scalar tensor.
then_expression: TensorFlow operation.
else_expression: TensorFlow operation.
"""
x_shape = copy.copy(then_expression.get_shape())
x = tf.cond(tf.cast(condition, 'bool'),
lambda: then_expression,
lambda: else_expression)
x.set_shape(x_shape)
return x
# ================================================================
# Extras
# ================================================================
def lrelu(x, leak=0.2):
f1 = 0.5 * (1 + leak)
f2 = 0.5 * (1 - leak)
return f1 * x + f2 * abs(x)
# ================================================================
# Mathematical utils
# ================================================================
def huber_loss(x, delta=1.0):
"""Reference: https://en.wikipedia.org/wiki/Huber_loss"""
return tf.where(
tf.abs(x) < delta,
tf.square(x) * 0.5,
delta * (tf.abs(x) - 0.5 * delta)
)
# ================================================================
# Global session
# ================================================================
def get_session(config=None):
"""Get default session or create one with a given config"""
sess = tf.get_default_session()
if sess is None:
sess = make_session(config=config, make_default=True)
return sess
def make_session(config=None, num_cpu=None, make_default=False, graph=None):
"""Returns a session that will use <num_cpu> CPU's only"""
if num_cpu is None:
num_cpu = int(os.getenv('RCALL_NUM_CPU', multiprocessing.cpu_count()))
if config is None:
config = tf.ConfigProto(
allow_soft_placement=True,
inter_op_parallelism_threads=num_cpu,
intra_op_parallelism_threads=num_cpu)
config.gpu_options.allow_growth = True
if make_default:
return tf.InteractiveSession(config=config, graph=graph)
else:
return tf.Session(config=config, graph=graph)
def single_threaded_session():
"""Returns a session which will only use a single CPU"""
return make_session(num_cpu=1)
def in_session(f):
@functools.wraps(f)
def newfunc(*args, **kwargs):
with tf.Session():
f(*args, **kwargs)
return newfunc
ALREADY_INITIALIZED = set()
def initialize():
"""Initialize all the uninitialized variables in the global scope."""
new_variables = set(tf.global_variables()) - ALREADY_INITIALIZED
get_session().run(tf.variables_initializer(new_variables))
ALREADY_INITIALIZED.update(new_variables)
# ================================================================
# Model components
# ================================================================
def normc_initializer(std=1.0, axis=0):
def _initializer(shape, dtype=None, partition_info=None): # pylint: disable=W0613
out = np.random.randn(*shape).astype(dtype.as_numpy_dtype)
out *= std / np.sqrt(np.square(out).sum(axis=axis, keepdims=True))
return tf.constant(out)
return _initializer
def conv2d(x, num_filters, name, filter_size=(3, 3), stride=(1, 1), pad="SAME", dtype=tf.float32, collections=None,
summary_tag=None):
with tf.variable_scope(name):
stride_shape = [1, stride[0], stride[1], 1]
filter_shape = [filter_size[0], filter_size[1], int(x.get_shape()[3]), num_filters]
# there are "num input feature maps * filter height * filter width"
# inputs to each hidden unit
fan_in = intprod(filter_shape[:3])
# each unit in the lower layer receives a gradient from:
# "num output feature maps * filter height * filter width" /
# pooling size
fan_out = intprod(filter_shape[:2]) * num_filters
# initialize weights with random weights
w_bound = np.sqrt(6. / (fan_in + fan_out))
w = tf.get_variable("W", filter_shape, dtype, tf.random_uniform_initializer(-w_bound, w_bound),
collections=collections)
b = tf.get_variable("b", [1, 1, 1, num_filters], initializer=tf.zeros_initializer(),
collections=collections)
if summary_tag is not None:
tf.summary.image(summary_tag,
tf.transpose(tf.reshape(w, [filter_size[0], filter_size[1], -1, 1]),
[2, 0, 1, 3]),
max_images=10)
return tf.nn.conv2d(x, w, stride_shape, pad) + b
# ================================================================
# Theano-like Function
# ================================================================
def function(inputs, outputs, updates=None, givens=None):
"""Just like Theano function. Take a bunch of tensorflow placeholders and expressions
computed based on those placeholders and produces f(inputs) -> outputs. Function f takes
values to be fed to the input's placeholders and produces the values of the expressions
in outputs.
Input values can be passed in the same order as inputs or can be provided as kwargs based
on placeholder name (passed to constructor or accessible via placeholder.op.name).
Example:
x = tf.placeholder(tf.int32, (), name="x")
y = tf.placeholder(tf.int32, (), name="y")
z = 3 * x + 2 * y
lin = function([x, y], z, givens={y: 0})
with single_threaded_session():
initialize()
assert lin(2) == 6
assert lin(x=3) == 9
assert lin(2, 2) == 10
assert lin(x=2, y=3) == 12
Parameters
----------
inputs: [tf.placeholder, tf.constant, or object with make_feed_dict method]
list of input arguments
outputs: [tf.Variable] or tf.Variable
list of outputs or a single output to be returned from function. Returned
value will also have the same shape.
updates: [tf.Operation] or tf.Operation
list of update functions or single update function that will be run whenever
the function is called. The return is ignored.
"""
if isinstance(outputs, list):
return _Function(inputs, outputs, updates, givens=givens)
elif isinstance(outputs, (dict, collections.OrderedDict)):
f = _Function(inputs, outputs.values(), updates, givens=givens)
return lambda *args, **kwargs: type(outputs)(zip(outputs.keys(), f(*args, **kwargs)))
else:
f = _Function(inputs, [outputs], updates, givens=givens)
return lambda *args, **kwargs: f(*args, **kwargs)[0]
class _Function(object):
def __init__(self, inputs, outputs, updates, givens):
for inpt in inputs:
if not hasattr(inpt, 'make_feed_dict') and not (type(inpt) is tf.Tensor and len(inpt.op.inputs) == 0):
assert False, "inputs should all be placeholders, constants, or have a make_feed_dict method"
self.inputs = inputs
self.input_names = {inp.name.split("/")[-1].split(":")[0]: inp for inp in inputs}
updates = updates or []
self.update_group = tf.group(*updates)
self.outputs_update = list(outputs) + [self.update_group]
self.givens = {} if givens is None else givens
def _feed_input(self, feed_dict, inpt, value):
if hasattr(inpt, 'make_feed_dict'):
feed_dict.update(inpt.make_feed_dict(value))
else:
feed_dict[inpt] = adjust_shape(inpt, value)
def __call__(self, *args, **kwargs):
assert len(args) + len(kwargs) <= len(self.inputs), "Too many arguments provided"
feed_dict = {}
# Update feed dict with givens.
for inpt in self.givens:
feed_dict[inpt] = adjust_shape(inpt, feed_dict.get(inpt, self.givens[inpt]))
# Update the args
for inpt, value in zip(self.inputs, args):
self._feed_input(feed_dict, inpt, value)
for inpt_name, value in kwargs.items():
self._feed_input(feed_dict, self.input_names[inpt_name], value)
results = get_session().run(self.outputs_update, feed_dict=feed_dict)[:-1]
return results
# ================================================================
# Flat vectors
# ================================================================
def var_shape(x):
out = x.get_shape().as_list()
assert all(isinstance(a, int) for a in out), \
"shape function assumes that shape is fully known"
return out
def numel(x):
return intprod(var_shape(x))
def intprod(x):
return int(np.prod(x))
def flatgrad(loss, var_list, clip_norm=None):
grads = tf.gradients(loss, var_list)
if clip_norm is not None:
grads = [tf.clip_by_norm(grad, clip_norm=clip_norm) for grad in grads]
return tf.concat(axis=0, values=[
tf.reshape(grad if grad is not None else tf.zeros_like(v), [numel(v)])
for (v, grad) in zip(var_list, grads)
])
class SetFromFlat(object):
def __init__(self, var_list, dtype=tf.float32):
assigns = []
shapes = list(map(var_shape, var_list))
total_size = np.sum([intprod(shape) for shape in shapes])
self.theta = theta = tf.placeholder(dtype, [total_size])
start = 0
assigns = []
for (shape, v) in zip(shapes, var_list):
size = intprod(shape)
assigns.append(tf.assign(v, tf.reshape(theta[start:start + size], shape)))
start += size
self.op = tf.group(*assigns)
def __call__(self, theta):
tf.get_default_session().run(self.op, feed_dict={self.theta: theta})
class GetFlat(object):
def __init__(self, var_list):
self.op = tf.concat(axis=0, values=[tf.reshape(v, [numel(v)]) for v in var_list])
def __call__(self):
return tf.get_default_session().run(self.op)
def flattenallbut0(x):
return tf.reshape(x, [-1, intprod(x.get_shape().as_list()[1:])])
# =============================================================
# TF placeholders management
# ============================================================
_PLACEHOLDER_CACHE = {} # name -> (placeholder, dtype, shape)
def get_placeholder(name, dtype, shape):
if name in _PLACEHOLDER_CACHE:
out, dtype1, shape1 = _PLACEHOLDER_CACHE[name]
if out.graph == tf.get_default_graph():
assert dtype1 == dtype and shape1 == shape, \
'Placeholder with name {} has already been registered and has shape {}, different from requested {}'.format(name, shape1, shape)
return out
out = tf.placeholder(dtype=dtype, shape=shape, name=name)
_PLACEHOLDER_CACHE[name] = (out, dtype, shape)
return out
def get_placeholder_cached(name):
return _PLACEHOLDER_CACHE[name][0]
# ================================================================
# Diagnostics
# ================================================================
def display_var_info(vars):
from baselines import logger
count_params = 0
for v in vars:
name = v.name
if "/Adam" in name or "beta1_power" in name or "beta2_power" in name: continue
v_params = np.prod(v.shape.as_list())
count_params += v_params
if "/b:" in name or "/bias" in name: continue # Wx+b, bias is not interesting to look at => count params, but not print
logger.info(" %s%s %i params %s" % (name, " "*(55-len(name)), v_params, str(v.shape)))
logger.info("Total model parameters: %0.2f million" % (count_params*1e-6))
def get_available_gpus(session_config=None):
# based on recipe from https://stackoverflow.com/a/38580201
# Unless we allocate a session here, subsequent attempts to create one
# will ignore our custom config (in particular, allow_growth=True will have
# no effect).
if session_config is None:
session_config = get_session()._config
from tensorflow.python.client import device_lib
local_device_protos = device_lib.list_local_devices(session_config)
return [x.name for x in local_device_protos if x.device_type == 'GPU']
# ================================================================
# Saving variables
# ================================================================
def load_state(fname, sess=None):
from baselines import logger
logger.warn('load_state method is deprecated, please use load_variables instead')
sess = sess or get_session()
saver = tf.train.Saver()
saver.restore(tf.get_default_session(), fname)
def save_state(fname, sess=None):
from baselines import logger
logger.warn('save_state method is deprecated, please use save_variables instead')
sess = sess or get_session()
dirname = os.path.dirname(fname)
if any(dirname):
os.makedirs(dirname, exist_ok=True)
saver = tf.train.Saver()
saver.save(tf.get_default_session(), fname)
# The methods above and below are clearly doing the same thing, and in a rather similar way
# TODO: ensure there is no subtle differences and remove one
def save_variables(save_path, variables=None, sess=None):
import joblib
sess = sess or get_session()
variables = variables or tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES)
ps = sess.run(variables)
save_dict = {v.name: value for v, value in zip(variables, ps)}
dirname = os.path.dirname(save_path)
if any(dirname):
os.makedirs(dirname, exist_ok=True)
joblib.dump(save_dict, save_path)
def load_variables(load_path, variables=None, sess=None):
import joblib
sess = sess or get_session()
variables = variables or tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES)
loaded_params = joblib.load(os.path.expanduser(load_path))
restores = []
if isinstance(loaded_params, list):
assert len(loaded_params) == len(variables), 'number of variables loaded mismatches len(variables)'
for d, v in zip(loaded_params, variables):
restores.append(v.assign(d))
else:
for v in variables:
restores.append(v.assign(loaded_params[v.name]))
sess.run(restores)
# ================================================================
# Shape adjustment for feeding into tf placeholders
# ================================================================
def adjust_shape(placeholder, data):
'''
adjust shape of the data to the shape of the placeholder if possible.
If shape is incompatible, AssertionError is thrown
Parameters:
placeholder tensorflow input placeholder
data input data to be (potentially) reshaped to be fed into placeholder
Returns:
reshaped data
'''
if not isinstance(data, np.ndarray) and not isinstance(data, list):
return data
if isinstance(data, list):
data = np.array(data)
placeholder_shape = [x or -1 for x in placeholder.shape.as_list()]
assert _check_shape(placeholder_shape, data.shape), \
'Shape of data {} is not compatible with shape of the placeholder {}'.format(data.shape, placeholder_shape)
return np.reshape(data, placeholder_shape)
def _check_shape(placeholder_shape, data_shape):
''' check if two shapes are compatible (i.e. differ only by dimensions of size 1, or by the batch dimension)'''
return True
squeezed_placeholder_shape = _squeeze_shape(placeholder_shape)
squeezed_data_shape = _squeeze_shape(data_shape)
for i, s_data in enumerate(squeezed_data_shape):
s_placeholder = squeezed_placeholder_shape[i]
if s_placeholder != -1 and s_data != s_placeholder:
return False
return True
def _squeeze_shape(shape):
return [x for x in shape if x != 1]
# ================================================================
# Tensorboard interfacing
# ================================================================
def launch_tensorboard_in_background(log_dir):
'''
To log the Tensorflow graph when using rl-algs
algorithms, you can run the following code
in your main script:
import threading, time
def start_tensorboard(session):
time.sleep(10) # Wait until graph is setup
tb_path = osp.join(logger.get_dir(), 'tb')
summary_writer = tf.summary.FileWriter(tb_path, graph=session.graph)
summary_op = tf.summary.merge_all()
launch_tensorboard_in_background(tb_path)
session = tf.get_default_session()
t = threading.Thread(target=start_tensorboard, args=([session]))
t.start()
'''
import subprocess
subprocess.Popen(['tensorboard', '--logdir', log_dir])
| 16,969 | 37.220721 | 144 | py |
baselines | baselines-master/baselines/common/tile_images.py | import numpy as np
def tile_images(img_nhwc):
"""
Tile N images into one big PxQ image
(P,Q) are chosen to be as close as possible, and if N
is square, then P=Q.
input: img_nhwc, list or array of images, ndim=4 once turned into array
n = batch index, h = height, w = width, c = channel
returns:
bigim_HWc, ndarray with ndim=3
"""
img_nhwc = np.asarray(img_nhwc)
N, h, w, c = img_nhwc.shape
H = int(np.ceil(np.sqrt(N)))
W = int(np.ceil(float(N)/H))
img_nhwc = np.array(list(img_nhwc) + [img_nhwc[0]*0 for _ in range(N, H*W)])
img_HWhwc = img_nhwc.reshape(H, W, h, w, c)
img_HhWwc = img_HWhwc.transpose(0, 2, 1, 3, 4)
img_Hh_Ww_c = img_HhWwc.reshape(H*h, W*w, c)
return img_Hh_Ww_c
| 763 | 30.833333 | 80 | py |
baselines | baselines-master/baselines/common/running_mean_std.py | import tensorflow as tf
import numpy as np
from baselines.common.tf_util import get_session
class RunningMeanStd(object):
# https://en.wikipedia.org/wiki/Algorithms_for_calculating_variance#Parallel_algorithm
def __init__(self, epsilon=1e-4, shape=()):
self.mean = np.zeros(shape, 'float64')
self.var = np.ones(shape, 'float64')
self.count = epsilon
def update(self, x):
batch_mean = np.mean(x, axis=0)
batch_var = np.var(x, axis=0)
batch_count = x.shape[0]
self.update_from_moments(batch_mean, batch_var, batch_count)
def update_from_moments(self, batch_mean, batch_var, batch_count):
self.mean, self.var, self.count = update_mean_var_count_from_moments(
self.mean, self.var, self.count, batch_mean, batch_var, batch_count)
def update_mean_var_count_from_moments(mean, var, count, batch_mean, batch_var, batch_count):
delta = batch_mean - mean
tot_count = count + batch_count
new_mean = mean + delta * batch_count / tot_count
m_a = var * count
m_b = batch_var * batch_count
M2 = m_a + m_b + np.square(delta) * count * batch_count / tot_count
new_var = M2 / tot_count
new_count = tot_count
return new_mean, new_var, new_count
class TfRunningMeanStd(object):
# https://en.wikipedia.org/wiki/Algorithms_for_calculating_variance#Parallel_algorithm
'''
TensorFlow variables-based implmentation of computing running mean and std
Benefit of this implementation is that it can be saved / loaded together with the tensorflow model
'''
def __init__(self, epsilon=1e-4, shape=(), scope=''):
sess = get_session()
self._new_mean = tf.placeholder(shape=shape, dtype=tf.float64)
self._new_var = tf.placeholder(shape=shape, dtype=tf.float64)
self._new_count = tf.placeholder(shape=(), dtype=tf.float64)
with tf.variable_scope(scope, reuse=tf.AUTO_REUSE):
self._mean = tf.get_variable('mean', initializer=np.zeros(shape, 'float64'), dtype=tf.float64)
self._var = tf.get_variable('std', initializer=np.ones(shape, 'float64'), dtype=tf.float64)
self._count = tf.get_variable('count', initializer=np.full((), epsilon, 'float64'), dtype=tf.float64)
self.update_ops = tf.group([
self._var.assign(self._new_var),
self._mean.assign(self._new_mean),
self._count.assign(self._new_count)
])
sess.run(tf.variables_initializer([self._mean, self._var, self._count]))
self.sess = sess
self._set_mean_var_count()
def _set_mean_var_count(self):
self.mean, self.var, self.count = self.sess.run([self._mean, self._var, self._count])
def update(self, x):
batch_mean = np.mean(x, axis=0)
batch_var = np.var(x, axis=0)
batch_count = x.shape[0]
new_mean, new_var, new_count = update_mean_var_count_from_moments(self.mean, self.var, self.count, batch_mean, batch_var, batch_count)
self.sess.run(self.update_ops, feed_dict={
self._new_mean: new_mean,
self._new_var: new_var,
self._new_count: new_count
})
self._set_mean_var_count()
def test_runningmeanstd():
for (x1, x2, x3) in [
(np.random.randn(3), np.random.randn(4), np.random.randn(5)),
(np.random.randn(3,2), np.random.randn(4,2), np.random.randn(5,2)),
]:
rms = RunningMeanStd(epsilon=0.0, shape=x1.shape[1:])
x = np.concatenate([x1, x2, x3], axis=0)
ms1 = [x.mean(axis=0), x.var(axis=0)]
rms.update(x1)
rms.update(x2)
rms.update(x3)
ms2 = [rms.mean, rms.var]
np.testing.assert_allclose(ms1, ms2)
def test_tf_runningmeanstd():
for (x1, x2, x3) in [
(np.random.randn(3), np.random.randn(4), np.random.randn(5)),
(np.random.randn(3,2), np.random.randn(4,2), np.random.randn(5,2)),
]:
rms = TfRunningMeanStd(epsilon=0.0, shape=x1.shape[1:], scope='running_mean_std' + str(np.random.randint(0, 128)))
x = np.concatenate([x1, x2, x3], axis=0)
ms1 = [x.mean(axis=0), x.var(axis=0)]
rms.update(x1)
rms.update(x2)
rms.update(x3)
ms2 = [rms.mean, rms.var]
np.testing.assert_allclose(ms1, ms2)
def profile_tf_runningmeanstd():
import time
from baselines.common import tf_util
tf_util.get_session( config=tf.ConfigProto(
inter_op_parallelism_threads=1,
intra_op_parallelism_threads=1,
allow_soft_placement=True
))
x = np.random.random((376,))
n_trials = 10000
rms = RunningMeanStd()
tfrms = TfRunningMeanStd()
tic1 = time.time()
for _ in range(n_trials):
rms.update(x)
tic2 = time.time()
for _ in range(n_trials):
tfrms.update(x)
tic3 = time.time()
print('rms update time ({} trials): {} s'.format(n_trials, tic2 - tic1))
print('tfrms update time ({} trials): {} s'.format(n_trials, tic3 - tic2))
tic1 = time.time()
for _ in range(n_trials):
z1 = rms.mean
tic2 = time.time()
for _ in range(n_trials):
z2 = tfrms.mean
assert z1 == z2
tic3 = time.time()
print('rms get mean time ({} trials): {} s'.format(n_trials, tic2 - tic1))
print('tfrms get mean time ({} trials): {} s'.format(n_trials, tic3 - tic2))
'''
options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) #pylint: disable=E1101
run_metadata = tf.RunMetadata()
profile_opts = dict(options=options, run_metadata=run_metadata)
from tensorflow.python.client import timeline
fetched_timeline = timeline.Timeline(run_metadata.step_stats) #pylint: disable=E1101
chrome_trace = fetched_timeline.generate_chrome_trace_format()
outfile = '/tmp/timeline.json'
with open(outfile, 'wt') as f:
f.write(chrome_trace)
print('Successfully saved profile to {}. Exiting.'.format(outfile))
exit(0)
'''
if __name__ == '__main__':
profile_tf_runningmeanstd()
| 6,081 | 31.351064 | 142 | py |
baselines | baselines-master/baselines/common/retro_wrappers.py | from collections import deque
import cv2
cv2.ocl.setUseOpenCL(False)
from .atari_wrappers import WarpFrame, ClipRewardEnv, FrameStack, ScaledFloatFrame
from .wrappers import TimeLimit
import numpy as np
import gym
class StochasticFrameSkip(gym.Wrapper):
def __init__(self, env, n, stickprob):
gym.Wrapper.__init__(self, env)
self.n = n
self.stickprob = stickprob
self.curac = None
self.rng = np.random.RandomState()
self.supports_want_render = hasattr(env, "supports_want_render")
def reset(self, **kwargs):
self.curac = None
return self.env.reset(**kwargs)
def step(self, ac):
done = False
totrew = 0
for i in range(self.n):
# First step after reset, use action
if self.curac is None:
self.curac = ac
# First substep, delay with probability=stickprob
elif i==0:
if self.rng.rand() > self.stickprob:
self.curac = ac
# Second substep, new action definitely kicks in
elif i==1:
self.curac = ac
if self.supports_want_render and i<self.n-1:
ob, rew, done, info = self.env.step(self.curac, want_render=False)
else:
ob, rew, done, info = self.env.step(self.curac)
totrew += rew
if done: break
return ob, totrew, done, info
def seed(self, s):
self.rng.seed(s)
class PartialFrameStack(gym.Wrapper):
def __init__(self, env, k, channel=1):
"""
Stack one channel (channel keyword) from previous frames
"""
gym.Wrapper.__init__(self, env)
shp = env.observation_space.shape
self.channel = channel
self.observation_space = gym.spaces.Box(low=0, high=255,
shape=(shp[0], shp[1], shp[2] + k - 1),
dtype=env.observation_space.dtype)
self.k = k
self.frames = deque([], maxlen=k)
shp = env.observation_space.shape
def reset(self):
ob = self.env.reset()
assert ob.shape[2] > self.channel
for _ in range(self.k):
self.frames.append(ob)
return self._get_ob()
def step(self, ac):
ob, reward, done, info = self.env.step(ac)
self.frames.append(ob)
return self._get_ob(), reward, done, info
def _get_ob(self):
assert len(self.frames) == self.k
return np.concatenate([frame if i==self.k-1 else frame[:,:,self.channel:self.channel+1]
for (i, frame) in enumerate(self.frames)], axis=2)
class Downsample(gym.ObservationWrapper):
def __init__(self, env, ratio):
"""
Downsample images by a factor of ratio
"""
gym.ObservationWrapper.__init__(self, env)
(oldh, oldw, oldc) = env.observation_space.shape
newshape = (oldh//ratio, oldw//ratio, oldc)
self.observation_space = gym.spaces.Box(low=0, high=255,
shape=newshape, dtype=np.uint8)
def observation(self, frame):
height, width, _ = self.observation_space.shape
frame = cv2.resize(frame, (width, height), interpolation=cv2.INTER_AREA)
if frame.ndim == 2:
frame = frame[:,:,None]
return frame
class Rgb2gray(gym.ObservationWrapper):
def __init__(self, env):
"""
Downsample images by a factor of ratio
"""
gym.ObservationWrapper.__init__(self, env)
(oldh, oldw, _oldc) = env.observation_space.shape
self.observation_space = gym.spaces.Box(low=0, high=255,
shape=(oldh, oldw, 1), dtype=np.uint8)
def observation(self, frame):
frame = cv2.cvtColor(frame, cv2.COLOR_RGB2GRAY)
return frame[:,:,None]
class MovieRecord(gym.Wrapper):
def __init__(self, env, savedir, k):
gym.Wrapper.__init__(self, env)
self.savedir = savedir
self.k = k
self.epcount = 0
def reset(self):
if self.epcount % self.k == 0:
self.env.unwrapped.movie_path = self.savedir
else:
self.env.unwrapped.movie_path = None
self.env.unwrapped.movie = None
self.epcount += 1
return self.env.reset()
class AppendTimeout(gym.Wrapper):
def __init__(self, env):
gym.Wrapper.__init__(self, env)
self.action_space = env.action_space
self.timeout_space = gym.spaces.Box(low=np.array([0.0]), high=np.array([1.0]), dtype=np.float32)
self.original_os = env.observation_space
if isinstance(self.original_os, gym.spaces.Dict):
import copy
ordered_dict = copy.deepcopy(self.original_os.spaces)
ordered_dict['value_estimation_timeout'] = self.timeout_space
self.observation_space = gym.spaces.Dict(ordered_dict)
self.dict_mode = True
else:
self.observation_space = gym.spaces.Dict({
'original': self.original_os,
'value_estimation_timeout': self.timeout_space
})
self.dict_mode = False
self.ac_count = None
while 1:
if not hasattr(env, "_max_episode_steps"): # Looking for TimeLimit wrapper that has this field
env = env.env
continue
break
self.timeout = env._max_episode_steps
def step(self, ac):
self.ac_count += 1
ob, rew, done, info = self.env.step(ac)
return self._process(ob), rew, done, info
def reset(self):
self.ac_count = 0
return self._process(self.env.reset())
def _process(self, ob):
fracmissing = 1 - self.ac_count / self.timeout
if self.dict_mode:
ob['value_estimation_timeout'] = fracmissing
else:
return { 'original': ob, 'value_estimation_timeout': fracmissing }
class StartDoingRandomActionsWrapper(gym.Wrapper):
"""
Warning: can eat info dicts, not good if you depend on them
"""
def __init__(self, env, max_random_steps, on_startup=True, every_episode=False):
gym.Wrapper.__init__(self, env)
self.on_startup = on_startup
self.every_episode = every_episode
self.random_steps = max_random_steps
self.last_obs = None
if on_startup:
self.some_random_steps()
def some_random_steps(self):
self.last_obs = self.env.reset()
n = np.random.randint(self.random_steps)
#print("running for random %i frames" % n)
for _ in range(n):
self.last_obs, _, done, _ = self.env.step(self.env.action_space.sample())
if done: self.last_obs = self.env.reset()
def reset(self):
return self.last_obs
def step(self, a):
self.last_obs, rew, done, info = self.env.step(a)
if done:
self.last_obs = self.env.reset()
if self.every_episode:
self.some_random_steps()
return self.last_obs, rew, done, info
def make_retro(*, game, state=None, max_episode_steps=4500, **kwargs):
import retro
if state is None:
state = retro.State.DEFAULT
env = retro.make(game, state, **kwargs)
env = StochasticFrameSkip(env, n=4, stickprob=0.25)
if max_episode_steps is not None:
env = TimeLimit(env, max_episode_steps=max_episode_steps)
return env
def wrap_deepmind_retro(env, scale=True, frame_stack=4):
"""
Configure environment for retro games, using config similar to DeepMind-style Atari in wrap_deepmind
"""
env = WarpFrame(env)
env = ClipRewardEnv(env)
if frame_stack > 1:
env = FrameStack(env, frame_stack)
if scale:
env = ScaledFloatFrame(env)
return env
class SonicDiscretizer(gym.ActionWrapper):
"""
Wrap a gym-retro environment and make it use discrete
actions for the Sonic game.
"""
def __init__(self, env):
super(SonicDiscretizer, self).__init__(env)
buttons = ["B", "A", "MODE", "START", "UP", "DOWN", "LEFT", "RIGHT", "C", "Y", "X", "Z"]
actions = [['LEFT'], ['RIGHT'], ['LEFT', 'DOWN'], ['RIGHT', 'DOWN'], ['DOWN'],
['DOWN', 'B'], ['B']]
self._actions = []
for action in actions:
arr = np.array([False] * 12)
for button in action:
arr[buttons.index(button)] = True
self._actions.append(arr)
self.action_space = gym.spaces.Discrete(len(self._actions))
def action(self, a): # pylint: disable=W0221
return self._actions[a].copy()
class RewardScaler(gym.RewardWrapper):
"""
Bring rewards to a reasonable scale for PPO.
This is incredibly important and effects performance
drastically.
"""
def __init__(self, env, scale=0.01):
super(RewardScaler, self).__init__(env)
self.scale = scale
def reward(self, reward):
return reward * self.scale
class AllowBacktracking(gym.Wrapper):
"""
Use deltas in max(X) as the reward, rather than deltas
in X. This way, agents are not discouraged too heavily
from exploring backwards if there is no way to advance
head-on in the level.
"""
def __init__(self, env):
super(AllowBacktracking, self).__init__(env)
self._cur_x = 0
self._max_x = 0
def reset(self, **kwargs): # pylint: disable=E0202
self._cur_x = 0
self._max_x = 0
return self.env.reset(**kwargs)
def step(self, action): # pylint: disable=E0202
obs, rew, done, info = self.env.step(action)
self._cur_x += rew
rew = max(0, self._cur_x - self._max_x)
self._max_x = max(self._max_x, self._cur_x)
return obs, rew, done, info
| 9,752 | 33.708185 | 107 | py |
baselines | baselines-master/baselines/common/wrappers.py | import gym
class TimeLimit(gym.Wrapper):
def __init__(self, env, max_episode_steps=None):
super(TimeLimit, self).__init__(env)
self._max_episode_steps = max_episode_steps
self._elapsed_steps = 0
def step(self, ac):
observation, reward, done, info = self.env.step(ac)
self._elapsed_steps += 1
if self._elapsed_steps >= self._max_episode_steps:
done = True
info['TimeLimit.truncated'] = True
return observation, reward, done, info
def reset(self, **kwargs):
self._elapsed_steps = 0
return self.env.reset(**kwargs)
class ClipActionsWrapper(gym.Wrapper):
def step(self, action):
import numpy as np
action = np.nan_to_num(action)
action = np.clip(action, self.action_space.low, self.action_space.high)
return self.env.step(action)
def reset(self, **kwargs):
return self.env.reset(**kwargs)
| 946 | 30.566667 | 79 | py |
baselines | baselines-master/baselines/common/segment_tree.py | import operator
class SegmentTree(object):
def __init__(self, capacity, operation, neutral_element):
"""Build a Segment Tree data structure.
https://en.wikipedia.org/wiki/Segment_tree
Can be used as regular array, but with two
important differences:
a) setting item's value is slightly slower.
It is O(lg capacity) instead of O(1).
b) user has access to an efficient ( O(log segment size) )
`reduce` operation which reduces `operation` over
a contiguous subsequence of items in the array.
Paramters
---------
capacity: int
Total size of the array - must be a power of two.
operation: lambda obj, obj -> obj
and operation for combining elements (eg. sum, max)
must form a mathematical group together with the set of
possible values for array elements (i.e. be associative)
neutral_element: obj
neutral element for the operation above. eg. float('-inf')
for max and 0 for sum.
"""
assert capacity > 0 and capacity & (capacity - 1) == 0, "capacity must be positive and a power of 2."
self._capacity = capacity
self._value = [neutral_element for _ in range(2 * capacity)]
self._operation = operation
def _reduce_helper(self, start, end, node, node_start, node_end):
if start == node_start and end == node_end:
return self._value[node]
mid = (node_start + node_end) // 2
if end <= mid:
return self._reduce_helper(start, end, 2 * node, node_start, mid)
else:
if mid + 1 <= start:
return self._reduce_helper(start, end, 2 * node + 1, mid + 1, node_end)
else:
return self._operation(
self._reduce_helper(start, mid, 2 * node, node_start, mid),
self._reduce_helper(mid + 1, end, 2 * node + 1, mid + 1, node_end)
)
def reduce(self, start=0, end=None):
"""Returns result of applying `self.operation`
to a contiguous subsequence of the array.
self.operation(arr[start], operation(arr[start+1], operation(... arr[end])))
Parameters
----------
start: int
beginning of the subsequence
end: int
end of the subsequences
Returns
-------
reduced: obj
result of reducing self.operation over the specified range of array elements.
"""
if end is None:
end = self._capacity
if end < 0:
end += self._capacity
end -= 1
return self._reduce_helper(start, end, 1, 0, self._capacity - 1)
def __setitem__(self, idx, val):
# index of the leaf
idx += self._capacity
self._value[idx] = val
idx //= 2
while idx >= 1:
self._value[idx] = self._operation(
self._value[2 * idx],
self._value[2 * idx + 1]
)
idx //= 2
def __getitem__(self, idx):
assert 0 <= idx < self._capacity
return self._value[self._capacity + idx]
class SumSegmentTree(SegmentTree):
def __init__(self, capacity):
super(SumSegmentTree, self).__init__(
capacity=capacity,
operation=operator.add,
neutral_element=0.0
)
def sum(self, start=0, end=None):
"""Returns arr[start] + ... + arr[end]"""
return super(SumSegmentTree, self).reduce(start, end)
def find_prefixsum_idx(self, prefixsum):
"""Find the highest index `i` in the array such that
sum(arr[0] + arr[1] + ... + arr[i - i]) <= prefixsum
if array values are probabilities, this function
allows to sample indexes according to the discrete
probability efficiently.
Parameters
----------
perfixsum: float
upperbound on the sum of array prefix
Returns
-------
idx: int
highest index satisfying the prefixsum constraint
"""
assert 0 <= prefixsum <= self.sum() + 1e-5
idx = 1
while idx < self._capacity: # while non-leaf
if self._value[2 * idx] > prefixsum:
idx = 2 * idx
else:
prefixsum -= self._value[2 * idx]
idx = 2 * idx + 1
return idx - self._capacity
class MinSegmentTree(SegmentTree):
def __init__(self, capacity):
super(MinSegmentTree, self).__init__(
capacity=capacity,
operation=min,
neutral_element=float('inf')
)
def min(self, start=0, end=None):
"""Returns min(arr[start], ..., arr[end])"""
return super(MinSegmentTree, self).reduce(start, end)
| 4,899 | 32.561644 | 109 | py |
baselines | baselines-master/baselines/common/policies.py | import tensorflow as tf
from baselines.common import tf_util
from baselines.a2c.utils import fc
from baselines.common.distributions import make_pdtype
from baselines.common.input import observation_placeholder, encode_observation
from baselines.common.tf_util import adjust_shape
from baselines.common.mpi_running_mean_std import RunningMeanStd
from baselines.common.models import get_network_builder
import gym
class PolicyWithValue(object):
"""
Encapsulates fields and methods for RL policy and value function estimation with shared parameters
"""
def __init__(self, env, observations, latent, estimate_q=False, vf_latent=None, sess=None, **tensors):
"""
Parameters:
----------
env RL environment
observations tensorflow placeholder in which the observations will be fed
latent latent state from which policy distribution parameters should be inferred
vf_latent latent state from which value function should be inferred (if None, then latent is used)
sess tensorflow session to run calculations in (if None, default session is used)
**tensors tensorflow tensors for additional attributes such as state or mask
"""
self.X = observations
self.state = tf.constant([])
self.initial_state = None
self.__dict__.update(tensors)
vf_latent = vf_latent if vf_latent is not None else latent
vf_latent = tf.layers.flatten(vf_latent)
latent = tf.layers.flatten(latent)
# Based on the action space, will select what probability distribution type
self.pdtype = make_pdtype(env.action_space)
self.pd, self.pi = self.pdtype.pdfromlatent(latent, init_scale=0.01)
# Take an action
self.action = self.pd.sample()
# Calculate the neg log of our probability
self.neglogp = self.pd.neglogp(self.action)
self.sess = sess or tf.get_default_session()
if estimate_q:
assert isinstance(env.action_space, gym.spaces.Discrete)
self.q = fc(vf_latent, 'q', env.action_space.n)
self.vf = self.q
else:
self.vf = fc(vf_latent, 'vf', 1)
self.vf = self.vf[:,0]
def _evaluate(self, variables, observation, **extra_feed):
sess = self.sess
feed_dict = {self.X: adjust_shape(self.X, observation)}
for inpt_name, data in extra_feed.items():
if inpt_name in self.__dict__.keys():
inpt = self.__dict__[inpt_name]
if isinstance(inpt, tf.Tensor) and inpt._op.type == 'Placeholder':
feed_dict[inpt] = adjust_shape(inpt, data)
return sess.run(variables, feed_dict)
def step(self, observation, **extra_feed):
"""
Compute next action(s) given the observation(s)
Parameters:
----------
observation observation data (either single or a batch)
**extra_feed additional data such as state or mask (names of the arguments should match the ones in constructor, see __init__)
Returns:
-------
(action, value estimate, next state, negative log likelihood of the action under current policy parameters) tuple
"""
a, v, state, neglogp = self._evaluate([self.action, self.vf, self.state, self.neglogp], observation, **extra_feed)
if state.size == 0:
state = None
return a, v, state, neglogp
def value(self, ob, *args, **kwargs):
"""
Compute value estimate(s) given the observation(s)
Parameters:
----------
observation observation data (either single or a batch)
**extra_feed additional data such as state or mask (names of the arguments should match the ones in constructor, see __init__)
Returns:
-------
value estimate
"""
return self._evaluate(self.vf, ob, *args, **kwargs)
def save(self, save_path):
tf_util.save_state(save_path, sess=self.sess)
def load(self, load_path):
tf_util.load_state(load_path, sess=self.sess)
def build_policy(env, policy_network, value_network=None, normalize_observations=False, estimate_q=False, **policy_kwargs):
if isinstance(policy_network, str):
network_type = policy_network
policy_network = get_network_builder(network_type)(**policy_kwargs)
def policy_fn(nbatch=None, nsteps=None, sess=None, observ_placeholder=None):
ob_space = env.observation_space
X = observ_placeholder if observ_placeholder is not None else observation_placeholder(ob_space, batch_size=nbatch)
extra_tensors = {}
if normalize_observations and X.dtype == tf.float32:
encoded_x, rms = _normalize_clip_observation(X)
extra_tensors['rms'] = rms
else:
encoded_x = X
encoded_x = encode_observation(ob_space, encoded_x)
with tf.variable_scope('pi', reuse=tf.AUTO_REUSE):
policy_latent = policy_network(encoded_x)
if isinstance(policy_latent, tuple):
policy_latent, recurrent_tensors = policy_latent
if recurrent_tensors is not None:
# recurrent architecture, need a few more steps
nenv = nbatch // nsteps
assert nenv > 0, 'Bad input for recurrent policy: batch size {} smaller than nsteps {}'.format(nbatch, nsteps)
policy_latent, recurrent_tensors = policy_network(encoded_x, nenv)
extra_tensors.update(recurrent_tensors)
_v_net = value_network
if _v_net is None or _v_net == 'shared':
vf_latent = policy_latent
else:
if _v_net == 'copy':
_v_net = policy_network
else:
assert callable(_v_net)
with tf.variable_scope('vf', reuse=tf.AUTO_REUSE):
# TODO recurrent architectures are not supported with value_network=copy yet
vf_latent = _v_net(encoded_x)
policy = PolicyWithValue(
env=env,
observations=X,
latent=policy_latent,
vf_latent=vf_latent,
sess=sess,
estimate_q=estimate_q,
**extra_tensors
)
return policy
return policy_fn
def _normalize_clip_observation(x, clip_range=[-5.0, 5.0]):
rms = RunningMeanStd(shape=x.shape[1:])
norm_x = tf.clip_by_value((x - rms.mean) / rms.std, min(clip_range), max(clip_range))
return norm_x, rms
| 6,652 | 34.57754 | 137 | py |
baselines | baselines-master/baselines/common/models.py | import numpy as np
import tensorflow as tf
from baselines.a2c import utils
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch
from baselines.common.mpi_running_mean_std import RunningMeanStd
mapping = {}
def register(name):
def _thunk(func):
mapping[name] = func
return func
return _thunk
def nature_cnn(unscaled_images, **conv_kwargs):
"""
CNN from Nature paper.
"""
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
activ = tf.nn.relu
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
**conv_kwargs))
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
h3 = conv_to_fc(h3)
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
def build_impala_cnn(unscaled_images, depths=[16,32,32], **conv_kwargs):
"""
Model used in the paper "IMPALA: Scalable Distributed Deep-RL with
Importance Weighted Actor-Learner Architectures" https://arxiv.org/abs/1802.01561
"""
layer_num = 0
def get_layer_num_str():
nonlocal layer_num
num_str = str(layer_num)
layer_num += 1
return num_str
def conv_layer(out, depth):
return tf.layers.conv2d(out, depth, 3, padding='same', name='layer_' + get_layer_num_str())
def residual_block(inputs):
depth = inputs.get_shape()[-1].value
out = tf.nn.relu(inputs)
out = conv_layer(out, depth)
out = tf.nn.relu(out)
out = conv_layer(out, depth)
return out + inputs
def conv_sequence(inputs, depth):
out = conv_layer(inputs, depth)
out = tf.layers.max_pooling2d(out, pool_size=3, strides=2, padding='same')
out = residual_block(out)
out = residual_block(out)
return out
out = tf.cast(unscaled_images, tf.float32) / 255.
for depth in depths:
out = conv_sequence(out, depth)
out = tf.layers.flatten(out)
out = tf.nn.relu(out)
out = tf.layers.dense(out, 256, activation=tf.nn.relu, name='layer_' + get_layer_num_str())
return out
@register("mlp")
def mlp(num_layers=2, num_hidden=64, activation=tf.tanh, layer_norm=False):
"""
Stack of fully-connected layers to be used in a policy / q-function approximator
Parameters:
----------
num_layers: int number of fully-connected layers (default: 2)
num_hidden: int size of fully-connected layers (default: 64)
activation: activation function (default: tf.tanh)
Returns:
-------
function that builds fully connected network with a given input tensor / placeholder
"""
def network_fn(X):
h = tf.layers.flatten(X)
for i in range(num_layers):
h = fc(h, 'mlp_fc{}'.format(i), nh=num_hidden, init_scale=np.sqrt(2))
if layer_norm:
h = tf.contrib.layers.layer_norm(h, center=True, scale=True)
h = activation(h)
return h
return network_fn
@register("cnn")
def cnn(**conv_kwargs):
def network_fn(X):
return nature_cnn(X, **conv_kwargs)
return network_fn
@register("impala_cnn")
def impala_cnn(**conv_kwargs):
def network_fn(X):
return build_impala_cnn(X)
return network_fn
@register("cnn_small")
def cnn_small(**conv_kwargs):
def network_fn(X):
h = tf.cast(X, tf.float32) / 255.
activ = tf.nn.relu
h = activ(conv(h, 'c1', nf=8, rf=8, stride=4, init_scale=np.sqrt(2), **conv_kwargs))
h = activ(conv(h, 'c2', nf=16, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
h = conv_to_fc(h)
h = activ(fc(h, 'fc1', nh=128, init_scale=np.sqrt(2)))
return h
return network_fn
@register("lstm")
def lstm(nlstm=128, layer_norm=False):
"""
Builds LSTM (Long-Short Term Memory) network to be used in a policy.
Note that the resulting function returns not only the output of the LSTM
(i.e. hidden state of lstm for each step in the sequence), but also a dictionary
with auxiliary tensors to be set as policy attributes.
Specifically,
S is a placeholder to feed current state (LSTM state has to be managed outside policy)
M is a placeholder for the mask (used to mask out observations after the end of the episode, but can be used for other purposes too)
initial_state is a numpy array containing initial lstm state (usually zeros)
state is the output LSTM state (to be fed into S at the next call)
An example of usage of lstm-based policy can be found here: common/tests/test_doc_examples.py/test_lstm_example
Parameters:
----------
nlstm: int LSTM hidden state size
layer_norm: bool if True, layer-normalized version of LSTM is used
Returns:
-------
function that builds LSTM with a given input tensor / placeholder
"""
def network_fn(X, nenv=1):
nbatch = X.shape[0]
nsteps = nbatch // nenv
h = tf.layers.flatten(X)
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
S = tf.placeholder(tf.float32, [nenv, 2*nlstm]) #states
xs = batch_to_seq(h, nenv, nsteps)
ms = batch_to_seq(M, nenv, nsteps)
if layer_norm:
h5, snew = utils.lnlstm(xs, ms, S, scope='lnlstm', nh=nlstm)
else:
h5, snew = utils.lstm(xs, ms, S, scope='lstm', nh=nlstm)
h = seq_to_batch(h5)
initial_state = np.zeros(S.shape.as_list(), dtype=float)
return h, {'S':S, 'M':M, 'state':snew, 'initial_state':initial_state}
return network_fn
@register("cnn_lstm")
def cnn_lstm(nlstm=128, layer_norm=False, conv_fn=nature_cnn, **conv_kwargs):
def network_fn(X, nenv=1):
nbatch = X.shape[0]
nsteps = nbatch // nenv
h = conv_fn(X, **conv_kwargs)
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
S = tf.placeholder(tf.float32, [nenv, 2*nlstm]) #states
xs = batch_to_seq(h, nenv, nsteps)
ms = batch_to_seq(M, nenv, nsteps)
if layer_norm:
h5, snew = utils.lnlstm(xs, ms, S, scope='lnlstm', nh=nlstm)
else:
h5, snew = utils.lstm(xs, ms, S, scope='lstm', nh=nlstm)
h = seq_to_batch(h5)
initial_state = np.zeros(S.shape.as_list(), dtype=float)
return h, {'S':S, 'M':M, 'state':snew, 'initial_state':initial_state}
return network_fn
@register("impala_cnn_lstm")
def impala_cnn_lstm():
return cnn_lstm(nlstm=256, conv_fn=build_impala_cnn)
@register("cnn_lnlstm")
def cnn_lnlstm(nlstm=128, **conv_kwargs):
return cnn_lstm(nlstm, layer_norm=True, **conv_kwargs)
@register("conv_only")
def conv_only(convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)], **conv_kwargs):
'''
convolutions-only net
Parameters:
----------
conv: list of triples (filter_number, filter_size, stride) specifying parameters for each layer.
Returns:
function that takes tensorflow tensor as input and returns the output of the last convolutional layer
'''
def network_fn(X):
out = tf.cast(X, tf.float32) / 255.
with tf.variable_scope("convnet"):
for num_outputs, kernel_size, stride in convs:
out = tf.contrib.layers.convolution2d(out,
num_outputs=num_outputs,
kernel_size=kernel_size,
stride=stride,
activation_fn=tf.nn.relu,
**conv_kwargs)
return out
return network_fn
def _normalize_clip_observation(x, clip_range=[-5.0, 5.0]):
rms = RunningMeanStd(shape=x.shape[1:])
norm_x = tf.clip_by_value((x - rms.mean) / rms.std, min(clip_range), max(clip_range))
return norm_x, rms
def get_network_builder(name):
"""
If you want to register your own network outside models.py, you just need:
Usage Example:
-------------
from baselines.common.models import register
@register("your_network_name")
def your_network_define(**net_kwargs):
...
return network_fn
"""
if callable(name):
return name
elif name in mapping:
return mapping[name]
else:
raise ValueError('Unknown network type: {}'.format(name))
| 8,557 | 30.007246 | 140 | py |
baselines | baselines-master/baselines/common/mpi_adam_optimizer.py | import numpy as np
import tensorflow as tf
from baselines.common import tf_util as U
from baselines.common.tests.test_with_mpi import with_mpi
from baselines import logger
try:
from mpi4py import MPI
except ImportError:
MPI = None
class MpiAdamOptimizer(tf.train.AdamOptimizer):
"""Adam optimizer that averages gradients across mpi processes."""
def __init__(self, comm, grad_clip=None, mpi_rank_weight=1, **kwargs):
self.comm = comm
self.grad_clip = grad_clip
self.mpi_rank_weight = mpi_rank_weight
tf.train.AdamOptimizer.__init__(self, **kwargs)
def compute_gradients(self, loss, var_list, **kwargs):
grads_and_vars = tf.train.AdamOptimizer.compute_gradients(self, loss, var_list, **kwargs)
grads_and_vars = [(g, v) for g, v in grads_and_vars if g is not None]
flat_grad = tf.concat([tf.reshape(g, (-1,)) for g, v in grads_and_vars], axis=0) * self.mpi_rank_weight
shapes = [v.shape.as_list() for g, v in grads_and_vars]
sizes = [int(np.prod(s)) for s in shapes]
total_weight = np.zeros(1, np.float32)
self.comm.Allreduce(np.array([self.mpi_rank_weight], dtype=np.float32), total_weight, op=MPI.SUM)
total_weight = total_weight[0]
buf = np.zeros(sum(sizes), np.float32)
countholder = [0] # Counts how many times _collect_grads has been called
stat = tf.reduce_sum(grads_and_vars[0][1]) # sum of first variable
def _collect_grads(flat_grad, np_stat):
if self.grad_clip is not None:
gradnorm = np.linalg.norm(flat_grad)
if gradnorm > 1:
flat_grad /= gradnorm
logger.logkv_mean('gradnorm', gradnorm)
logger.logkv_mean('gradclipfrac', float(gradnorm > 1))
self.comm.Allreduce(flat_grad, buf, op=MPI.SUM)
np.divide(buf, float(total_weight), out=buf)
if countholder[0] % 100 == 0:
check_synced(np_stat, self.comm)
countholder[0] += 1
return buf
avg_flat_grad = tf.py_func(_collect_grads, [flat_grad, stat], tf.float32)
avg_flat_grad.set_shape(flat_grad.shape)
avg_grads = tf.split(avg_flat_grad, sizes, axis=0)
avg_grads_and_vars = [(tf.reshape(g, v.shape), v)
for g, (_, v) in zip(avg_grads, grads_and_vars)]
return avg_grads_and_vars
def check_synced(localval, comm=None):
"""
It's common to forget to initialize your variables to the same values, or
(less commonly) if you update them in some other way than adam, to get them out of sync.
This function checks that variables on all MPI workers are the same, and raises
an AssertionError otherwise
Arguments:
comm: MPI communicator
localval: list of local variables (list of variables on current worker to be compared with the other workers)
"""
comm = comm or MPI.COMM_WORLD
vals = comm.gather(localval)
if comm.rank == 0:
assert all(val==vals[0] for val in vals[1:]),\
'MpiAdamOptimizer detected that different workers have different weights: {}'.format(vals)
@with_mpi(timeout=5)
def test_nonfreeze():
np.random.seed(0)
tf.set_random_seed(0)
a = tf.Variable(np.random.randn(3).astype('float32'))
b = tf.Variable(np.random.randn(2,5).astype('float32'))
loss = tf.reduce_sum(tf.square(a)) + tf.reduce_sum(tf.sin(b))
stepsize = 1e-2
# for some reason the session config with inter_op_parallelism_threads was causing
# nested sess.run calls to freeze
config = tf.ConfigProto(inter_op_parallelism_threads=1)
sess = U.get_session(config=config)
update_op = MpiAdamOptimizer(comm=MPI.COMM_WORLD, learning_rate=stepsize).minimize(loss)
sess.run(tf.global_variables_initializer())
losslist_ref = []
for i in range(100):
l,_ = sess.run([loss, update_op])
print(i, l)
losslist_ref.append(l)
| 3,976 | 42.703297 | 117 | py |
baselines | baselines-master/baselines/common/__init__.py | # flake8: noqa F403
from baselines.common.console_util import *
from baselines.common.dataset import Dataset
from baselines.common.math_util import *
from baselines.common.misc_util import *
| 191 | 31 | 44 | py |
baselines | baselines-master/baselines/common/mpi_moments.py | from mpi4py import MPI
import numpy as np
from baselines.common import zipsame
def mpi_mean(x, axis=0, comm=None, keepdims=False):
x = np.asarray(x)
assert x.ndim > 0
if comm is None: comm = MPI.COMM_WORLD
xsum = x.sum(axis=axis, keepdims=keepdims)
n = xsum.size
localsum = np.zeros(n+1, x.dtype)
localsum[:n] = xsum.ravel()
localsum[n] = x.shape[axis]
# globalsum = np.zeros_like(localsum)
# comm.Allreduce(localsum, globalsum, op=MPI.SUM)
globalsum = comm.allreduce(localsum, op=MPI.SUM)
return globalsum[:n].reshape(xsum.shape) / globalsum[n], globalsum[n]
def mpi_moments(x, axis=0, comm=None, keepdims=False):
x = np.asarray(x)
assert x.ndim > 0
mean, count = mpi_mean(x, axis=axis, comm=comm, keepdims=True)
sqdiffs = np.square(x - mean)
meansqdiff, count1 = mpi_mean(sqdiffs, axis=axis, comm=comm, keepdims=True)
assert count1 == count
std = np.sqrt(meansqdiff)
if not keepdims:
newshape = mean.shape[:axis] + mean.shape[axis+1:]
mean = mean.reshape(newshape)
std = std.reshape(newshape)
return mean, std, count
def test_runningmeanstd():
import subprocess
subprocess.check_call(['mpirun', '-np', '3',
'python','-c',
'from baselines.common.mpi_moments import _helper_runningmeanstd; _helper_runningmeanstd()'])
def _helper_runningmeanstd():
comm = MPI.COMM_WORLD
np.random.seed(0)
for (triple,axis) in [
((np.random.randn(3), np.random.randn(4), np.random.randn(5)),0),
((np.random.randn(3,2), np.random.randn(4,2), np.random.randn(5,2)),0),
((np.random.randn(2,3), np.random.randn(2,4), np.random.randn(2,4)),1),
]:
x = np.concatenate(triple, axis=axis)
ms1 = [x.mean(axis=axis), x.std(axis=axis), x.shape[axis]]
ms2 = mpi_moments(triple[comm.Get_rank()],axis=axis)
for (a1,a2) in zipsame(ms1, ms2):
print(a1, a2)
assert np.allclose(a1, a2)
print("ok!")
| 2,018 | 31.564516 | 101 | py |
baselines | baselines-master/baselines/common/console_util.py | from __future__ import print_function
from contextlib import contextmanager
import numpy as np
import time
import shlex
import subprocess
# ================================================================
# Misc
# ================================================================
def fmt_row(width, row, header=False):
out = " | ".join(fmt_item(x, width) for x in row)
if header: out = out + "\n" + "-"*len(out)
return out
def fmt_item(x, l):
if isinstance(x, np.ndarray):
assert x.ndim==0
x = x.item()
if isinstance(x, (float, np.float32, np.float64)):
v = abs(x)
if (v < 1e-4 or v > 1e+4) and v > 0:
rep = "%7.2e" % x
else:
rep = "%7.5f" % x
else: rep = str(x)
return " "*(l - len(rep)) + rep
color2num = dict(
gray=30,
red=31,
green=32,
yellow=33,
blue=34,
magenta=35,
cyan=36,
white=37,
crimson=38
)
def colorize(string, color='green', bold=False, highlight=False):
attr = []
num = color2num[color]
if highlight: num += 10
attr.append(str(num))
if bold: attr.append('1')
return '\x1b[%sm%s\x1b[0m' % (';'.join(attr), string)
def print_cmd(cmd, dry=False):
if isinstance(cmd, str): # for shell=True
pass
else:
cmd = ' '.join(shlex.quote(arg) for arg in cmd)
print(colorize(('CMD: ' if not dry else 'DRY: ') + cmd))
def get_git_commit(cwd=None):
return subprocess.check_output(['git', 'rev-parse', '--short', 'HEAD'], cwd=cwd).decode('utf8')
def get_git_commit_message(cwd=None):
return subprocess.check_output(['git', 'show', '-s', '--format=%B', 'HEAD'], cwd=cwd).decode('utf8')
def ccap(cmd, dry=False, env=None, **kwargs):
print_cmd(cmd, dry)
if not dry:
subprocess.check_call(cmd, env=env, **kwargs)
MESSAGE_DEPTH = 0
@contextmanager
def timed(msg):
global MESSAGE_DEPTH #pylint: disable=W0603
print(colorize('\t'*MESSAGE_DEPTH + '=: ' + msg, color='magenta'))
tstart = time.time()
MESSAGE_DEPTH += 1
yield
MESSAGE_DEPTH -= 1
print(colorize('\t'*MESSAGE_DEPTH + "done in %.3f seconds"%(time.time() - tstart), color='magenta'))
| 2,179 | 25.91358 | 104 | py |
baselines | baselines-master/baselines/common/cmd_util.py | """
Helpers for scripts like run_atari.py.
"""
import os
try:
from mpi4py import MPI
except ImportError:
MPI = None
import gym
from gym.wrappers import FlattenObservation, FilterObservation
from baselines import logger
from baselines.bench import Monitor
from baselines.common import set_global_seeds
from baselines.common.atari_wrappers import make_atari, wrap_deepmind
from baselines.common.vec_env.subproc_vec_env import SubprocVecEnv
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
from baselines.common import retro_wrappers
from baselines.common.wrappers import ClipActionsWrapper
def make_vec_env(env_id, env_type, num_env, seed,
wrapper_kwargs=None,
env_kwargs=None,
start_index=0,
reward_scale=1.0,
flatten_dict_observations=True,
gamestate=None,
initializer=None,
force_dummy=False):
"""
Create a wrapped, monitored SubprocVecEnv for Atari and MuJoCo.
"""
wrapper_kwargs = wrapper_kwargs or {}
env_kwargs = env_kwargs or {}
mpi_rank = MPI.COMM_WORLD.Get_rank() if MPI else 0
seed = seed + 10000 * mpi_rank if seed is not None else None
logger_dir = logger.get_dir()
def make_thunk(rank, initializer=None):
return lambda: make_env(
env_id=env_id,
env_type=env_type,
mpi_rank=mpi_rank,
subrank=rank,
seed=seed,
reward_scale=reward_scale,
gamestate=gamestate,
flatten_dict_observations=flatten_dict_observations,
wrapper_kwargs=wrapper_kwargs,
env_kwargs=env_kwargs,
logger_dir=logger_dir,
initializer=initializer
)
set_global_seeds(seed)
if not force_dummy and num_env > 1:
return SubprocVecEnv([make_thunk(i + start_index, initializer=initializer) for i in range(num_env)])
else:
return DummyVecEnv([make_thunk(i + start_index, initializer=None) for i in range(num_env)])
def make_env(env_id, env_type, mpi_rank=0, subrank=0, seed=None, reward_scale=1.0, gamestate=None, flatten_dict_observations=True, wrapper_kwargs=None, env_kwargs=None, logger_dir=None, initializer=None):
if initializer is not None:
initializer(mpi_rank=mpi_rank, subrank=subrank)
wrapper_kwargs = wrapper_kwargs or {}
env_kwargs = env_kwargs or {}
if ':' in env_id:
import re
import importlib
module_name = re.sub(':.*','',env_id)
env_id = re.sub('.*:', '', env_id)
importlib.import_module(module_name)
if env_type == 'atari':
env = make_atari(env_id)
elif env_type == 'retro':
import retro
gamestate = gamestate or retro.State.DEFAULT
env = retro_wrappers.make_retro(game=env_id, max_episode_steps=10000, use_restricted_actions=retro.Actions.DISCRETE, state=gamestate)
else:
env = gym.make(env_id, **env_kwargs)
if flatten_dict_observations and isinstance(env.observation_space, gym.spaces.Dict):
env = FlattenObservation(env)
env.seed(seed + subrank if seed is not None else None)
env = Monitor(env,
logger_dir and os.path.join(logger_dir, str(mpi_rank) + '.' + str(subrank)),
allow_early_resets=True)
if env_type == 'atari':
env = wrap_deepmind(env, **wrapper_kwargs)
elif env_type == 'retro':
if 'frame_stack' not in wrapper_kwargs:
wrapper_kwargs['frame_stack'] = 1
env = retro_wrappers.wrap_deepmind_retro(env, **wrapper_kwargs)
if isinstance(env.action_space, gym.spaces.Box):
env = ClipActionsWrapper(env)
if reward_scale != 1:
env = retro_wrappers.RewardScaler(env, reward_scale)
return env
def make_mujoco_env(env_id, seed, reward_scale=1.0):
"""
Create a wrapped, monitored gym.Env for MuJoCo.
"""
rank = MPI.COMM_WORLD.Get_rank()
myseed = seed + 1000 * rank if seed is not None else None
set_global_seeds(myseed)
env = gym.make(env_id)
logger_path = None if logger.get_dir() is None else os.path.join(logger.get_dir(), str(rank))
env = Monitor(env, logger_path, allow_early_resets=True)
env.seed(seed)
if reward_scale != 1.0:
from baselines.common.retro_wrappers import RewardScaler
env = RewardScaler(env, reward_scale)
return env
def make_robotics_env(env_id, seed, rank=0):
"""
Create a wrapped, monitored gym.Env for MuJoCo.
"""
set_global_seeds(seed)
env = gym.make(env_id)
env = FlattenObservation(FilterObservation(env, ['observation', 'desired_goal']))
env = Monitor(
env, logger.get_dir() and os.path.join(logger.get_dir(), str(rank)),
info_keywords=('is_success',))
env.seed(seed)
return env
def arg_parser():
"""
Create an empty argparse.ArgumentParser.
"""
import argparse
return argparse.ArgumentParser(formatter_class=argparse.ArgumentDefaultsHelpFormatter)
def atari_arg_parser():
"""
Create an argparse.ArgumentParser for run_atari.py.
"""
print('Obsolete - use common_arg_parser instead')
return common_arg_parser()
def mujoco_arg_parser():
print('Obsolete - use common_arg_parser instead')
return common_arg_parser()
def common_arg_parser():
"""
Create an argparse.ArgumentParser for run_mujoco.py.
"""
parser = arg_parser()
parser.add_argument('--env', help='environment ID', type=str, default='Reacher-v2')
parser.add_argument('--env_type', help='type of environment, used when the environment type cannot be automatically determined', type=str)
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
parser.add_argument('--alg', help='Algorithm', type=str, default='ppo2')
parser.add_argument('--num_timesteps', type=float, default=1e6),
parser.add_argument('--network', help='network type (mlp, cnn, lstm, cnn_lstm, conv_only)', default=None)
parser.add_argument('--gamestate', help='game state to load (so far only used in retro games)', default=None)
parser.add_argument('--num_env', help='Number of environment copies being run in parallel. When not specified, set to number of cpus for Atari, and to 1 for Mujoco', default=None, type=int)
parser.add_argument('--reward_scale', help='Reward scale factor. Default: 1.0', default=1.0, type=float)
parser.add_argument('--save_path', help='Path to save trained model to', default=None, type=str)
parser.add_argument('--save_video_interval', help='Save video every x steps (0 = disabled)', default=0, type=int)
parser.add_argument('--save_video_length', help='Length of recorded video. Default: 200', default=200, type=int)
parser.add_argument('--log_path', help='Directory to save learning curve data.', default=None, type=str)
parser.add_argument('--play', default=False, action='store_true')
return parser
def robotics_arg_parser():
"""
Create an argparse.ArgumentParser for run_mujoco.py.
"""
parser = arg_parser()
parser.add_argument('--env', help='environment ID', type=str, default='FetchReach-v0')
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
parser.add_argument('--num-timesteps', type=int, default=int(1e6))
return parser
def parse_unknown_args(args):
"""
Parse arguments not consumed by arg parser into a dictionary
"""
retval = {}
preceded_by_key = False
for arg in args:
if arg.startswith('--'):
if '=' in arg:
key = arg.split('=')[0][2:]
value = arg.split('=')[1]
retval[key] = value
else:
key = arg[2:]
preceded_by_key = True
elif preceded_by_key:
retval[key] = arg
preceded_by_key = False
return retval
| 7,922 | 37.275362 | 204 | py |
baselines | baselines-master/baselines/common/input.py | import numpy as np
import tensorflow as tf
from gym.spaces import Discrete, Box, MultiDiscrete
def observation_placeholder(ob_space, batch_size=None, name='Ob'):
'''
Create placeholder to feed observations into of the size appropriate to the observation space
Parameters:
----------
ob_space: gym.Space observation space
batch_size: int size of the batch to be fed into input. Can be left None in most cases.
name: str name of the placeholder
Returns:
-------
tensorflow placeholder tensor
'''
assert isinstance(ob_space, Discrete) or isinstance(ob_space, Box) or isinstance(ob_space, MultiDiscrete), \
'Can only deal with Discrete and Box observation spaces for now'
dtype = ob_space.dtype
if dtype == np.int8:
dtype = np.uint8
return tf.placeholder(shape=(batch_size,) + ob_space.shape, dtype=dtype, name=name)
def observation_input(ob_space, batch_size=None, name='Ob'):
'''
Create placeholder to feed observations into of the size appropriate to the observation space, and add input
encoder of the appropriate type.
'''
placeholder = observation_placeholder(ob_space, batch_size, name)
return placeholder, encode_observation(ob_space, placeholder)
def encode_observation(ob_space, placeholder):
'''
Encode input in the way that is appropriate to the observation space
Parameters:
----------
ob_space: gym.Space observation space
placeholder: tf.placeholder observation input placeholder
'''
if isinstance(ob_space, Discrete):
return tf.to_float(tf.one_hot(placeholder, ob_space.n))
elif isinstance(ob_space, Box):
return tf.to_float(placeholder)
elif isinstance(ob_space, MultiDiscrete):
placeholder = tf.cast(placeholder, tf.int32)
one_hots = [tf.to_float(tf.one_hot(placeholder[..., i], ob_space.nvec[i])) for i in range(placeholder.shape[-1])]
return tf.concat(one_hots, axis=-1)
else:
raise NotImplementedError
| 2,071 | 30.876923 | 121 | py |
baselines | baselines-master/baselines/common/plot_util.py | import matplotlib.pyplot as plt
import os.path as osp
import json
import os
import numpy as np
import pandas
from collections import defaultdict, namedtuple
from baselines.bench import monitor
from baselines.logger import read_json, read_csv
def smooth(y, radius, mode='two_sided', valid_only=False):
'''
Smooth signal y, where radius is determines the size of the window
mode='twosided':
average over the window [max(index - radius, 0), min(index + radius, len(y)-1)]
mode='causal':
average over the window [max(index - radius, 0), index]
valid_only: put nan in entries where the full-sized window is not available
'''
assert mode in ('two_sided', 'causal')
if len(y) < 2*radius+1:
return np.ones_like(y) * y.mean()
elif mode == 'two_sided':
convkernel = np.ones(2 * radius+1)
out = np.convolve(y, convkernel,mode='same') / np.convolve(np.ones_like(y), convkernel, mode='same')
if valid_only:
out[:radius] = out[-radius:] = np.nan
elif mode == 'causal':
convkernel = np.ones(radius)
out = np.convolve(y, convkernel,mode='full') / np.convolve(np.ones_like(y), convkernel, mode='full')
out = out[:-radius+1]
if valid_only:
out[:radius] = np.nan
return out
def one_sided_ema(xolds, yolds, low=None, high=None, n=512, decay_steps=1., low_counts_threshold=1e-8):
'''
perform one-sided (causal) EMA (exponential moving average)
smoothing and resampling to an even grid with n points.
Does not do extrapolation, so we assume
xolds[0] <= low && high <= xolds[-1]
Arguments:
xolds: array or list - x values of data. Needs to be sorted in ascending order
yolds: array of list - y values of data. Has to have the same length as xolds
low: float - min value of the new x grid. By default equals to xolds[0]
high: float - max value of the new x grid. By default equals to xolds[-1]
n: int - number of points in new x grid
decay_steps: float - EMA decay factor, expressed in new x grid steps.
low_counts_threshold: float or int
- y values with counts less than this value will be set to NaN
Returns:
tuple sum_ys, count_ys where
xs - array with new x grid
ys - array of EMA of y at each point of the new x grid
count_ys - array of EMA of y counts at each point of the new x grid
'''
low = xolds[0] if low is None else low
high = xolds[-1] if high is None else high
assert xolds[0] <= low, 'low = {} < xolds[0] = {} - extrapolation not permitted!'.format(low, xolds[0])
assert xolds[-1] >= high, 'high = {} > xolds[-1] = {} - extrapolation not permitted!'.format(high, xolds[-1])
assert len(xolds) == len(yolds), 'length of xolds ({}) and yolds ({}) do not match!'.format(len(xolds), len(yolds))
xolds = xolds.astype('float64')
yolds = yolds.astype('float64')
luoi = 0 # last unused old index
sum_y = 0.
count_y = 0.
xnews = np.linspace(low, high, n)
decay_period = (high - low) / (n - 1) * decay_steps
interstep_decay = np.exp(- 1. / decay_steps)
sum_ys = np.zeros_like(xnews)
count_ys = np.zeros_like(xnews)
for i in range(n):
xnew = xnews[i]
sum_y *= interstep_decay
count_y *= interstep_decay
while True:
if luoi >= len(xolds):
break
xold = xolds[luoi]
if xold <= xnew:
decay = np.exp(- (xnew - xold) / decay_period)
sum_y += decay * yolds[luoi]
count_y += decay
luoi += 1
else:
break
sum_ys[i] = sum_y
count_ys[i] = count_y
ys = sum_ys / count_ys
ys[count_ys < low_counts_threshold] = np.nan
return xnews, ys, count_ys
def symmetric_ema(xolds, yolds, low=None, high=None, n=512, decay_steps=1., low_counts_threshold=1e-8):
'''
perform symmetric EMA (exponential moving average)
smoothing and resampling to an even grid with n points.
Does not do extrapolation, so we assume
xolds[0] <= low && high <= xolds[-1]
Arguments:
xolds: array or list - x values of data. Needs to be sorted in ascending order
yolds: array of list - y values of data. Has to have the same length as xolds
low: float - min value of the new x grid. By default equals to xolds[0]
high: float - max value of the new x grid. By default equals to xolds[-1]
n: int - number of points in new x grid
decay_steps: float - EMA decay factor, expressed in new x grid steps.
low_counts_threshold: float or int
- y values with counts less than this value will be set to NaN
Returns:
tuple sum_ys, count_ys where
xs - array with new x grid
ys - array of EMA of y at each point of the new x grid
count_ys - array of EMA of y counts at each point of the new x grid
'''
xs, ys1, count_ys1 = one_sided_ema(xolds, yolds, low, high, n, decay_steps, low_counts_threshold=0)
_, ys2, count_ys2 = one_sided_ema(-xolds[::-1], yolds[::-1], -high, -low, n, decay_steps, low_counts_threshold=0)
ys2 = ys2[::-1]
count_ys2 = count_ys2[::-1]
count_ys = count_ys1 + count_ys2
ys = (ys1 * count_ys1 + ys2 * count_ys2) / count_ys
ys[count_ys < low_counts_threshold] = np.nan
return xs, ys, count_ys
Result = namedtuple('Result', 'monitor progress dirname metadata')
Result.__new__.__defaults__ = (None,) * len(Result._fields)
def load_results(root_dir_or_dirs, enable_progress=True, enable_monitor=True, verbose=False):
'''
load summaries of runs from a list of directories (including subdirectories)
Arguments:
enable_progress: bool - if True, will attempt to load data from progress.csv files (data saved by logger). Default: True
enable_monitor: bool - if True, will attempt to load data from monitor.csv files (data saved by Monitor environment wrapper). Default: True
verbose: bool - if True, will print out list of directories from which the data is loaded. Default: False
Returns:
List of Result objects with the following fields:
- dirname - path to the directory data was loaded from
- metadata - run metadata (such as command-line arguments and anything else in metadata.json file
- monitor - if enable_monitor is True, this field contains pandas dataframe with loaded monitor.csv file (or aggregate of all *.monitor.csv files in the directory)
- progress - if enable_progress is True, this field contains pandas dataframe with loaded progress.csv file
'''
import re
if isinstance(root_dir_or_dirs, str):
rootdirs = [osp.expanduser(root_dir_or_dirs)]
else:
rootdirs = [osp.expanduser(d) for d in root_dir_or_dirs]
allresults = []
for rootdir in rootdirs:
assert osp.exists(rootdir), "%s doesn't exist"%rootdir
for dirname, dirs, files in os.walk(rootdir):
if '-proc' in dirname:
files[:] = []
continue
monitor_re = re.compile(r'(\d+\.)?(\d+\.)?monitor\.csv')
if set(['metadata.json', 'monitor.json', 'progress.json', 'progress.csv']).intersection(files) or \
any([f for f in files if monitor_re.match(f)]): # also match monitor files like 0.1.monitor.csv
# used to be uncommented, which means do not go deeper than current directory if any of the data files
# are found
# dirs[:] = []
result = {'dirname' : dirname}
if "metadata.json" in files:
with open(osp.join(dirname, "metadata.json"), "r") as fh:
result['metadata'] = json.load(fh)
progjson = osp.join(dirname, "progress.json")
progcsv = osp.join(dirname, "progress.csv")
if enable_progress:
if osp.exists(progjson):
result['progress'] = pandas.DataFrame(read_json(progjson))
elif osp.exists(progcsv):
try:
result['progress'] = read_csv(progcsv)
except pandas.errors.EmptyDataError:
print('skipping progress file in ', dirname, 'empty data')
else:
if verbose: print('skipping %s: no progress file'%dirname)
if enable_monitor:
try:
result['monitor'] = pandas.DataFrame(monitor.load_results(dirname))
except monitor.LoadMonitorResultsError:
print('skipping %s: no monitor files'%dirname)
except Exception as e:
print('exception loading monitor file in %s: %s'%(dirname, e))
if result.get('monitor') is not None or result.get('progress') is not None:
allresults.append(Result(**result))
if verbose:
print('successfully loaded %s'%dirname)
if verbose: print('loaded %i results'%len(allresults))
return allresults
COLORS = ['blue', 'green', 'red', 'cyan', 'magenta', 'yellow', 'black', 'purple', 'pink',
'brown', 'orange', 'teal', 'lightblue', 'lime', 'lavender', 'turquoise',
'darkgreen', 'tan', 'salmon', 'gold', 'darkred', 'darkblue']
def default_xy_fn(r):
x = np.cumsum(r.monitor.l)
y = smooth(r.monitor.r, radius=10)
return x,y
def default_split_fn(r):
import re
# match name between slash and -<digits> at the end of the string
# (slash in the beginning or -<digits> in the end or either may be missing)
match = re.search(r'[^/-]+(?=(-\d+)?\Z)', r.dirname)
if match:
return match.group(0)
def plot_results(
allresults, *,
xy_fn=default_xy_fn,
split_fn=default_split_fn,
group_fn=default_split_fn,
average_group=False,
shaded_std=True,
shaded_err=True,
figsize=None,
legend_outside=False,
resample=0,
smooth_step=1.0,
tiling='vertical',
xlabel=None,
ylabel=None
):
'''
Plot multiple Results objects
xy_fn: function Result -> x,y - function that converts results objects into tuple of x and y values.
By default, x is cumsum of episode lengths, and y is episode rewards
split_fn: function Result -> hashable - function that converts results objects into keys to split curves into sub-panels by.
That is, the results r for which split_fn(r) is different will be put on different sub-panels.
By default, the portion of r.dirname between last / and -<digits> is returned. The sub-panels are
stacked vertically in the figure.
group_fn: function Result -> hashable - function that converts results objects into keys to group curves by.
That is, the results r for which group_fn(r) is the same will be put into the same group.
Curves in the same group have the same color (if average_group is False), or averaged over
(if average_group is True). The default value is the same as default value for split_fn
average_group: bool - if True, will average the curves in the same group and plot the mean. Enables resampling
(if resample = 0, will use 512 steps)
shaded_std: bool - if True (default), the shaded region corresponding to standard deviation of the group of curves will be
shown (only applicable if average_group = True)
shaded_err: bool - if True (default), the shaded region corresponding to error in mean estimate of the group of curves
(that is, standard deviation divided by square root of number of curves) will be
shown (only applicable if average_group = True)
figsize: tuple or None - size of the resulting figure (including sub-panels). By default, width is 6 and height is 6 times number of
sub-panels.
legend_outside: bool - if True, will place the legend outside of the sub-panels.
resample: int - if not zero, size of the uniform grid in x direction to resample onto. Resampling is performed via symmetric
EMA smoothing (see the docstring for symmetric_ema).
Default is zero (no resampling). Note that if average_group is True, resampling is necessary; in that case, default
value is 512.
smooth_step: float - when resampling (i.e. when resample > 0 or average_group is True), use this EMA decay parameter (in units of the new grid step).
See docstrings for decay_steps in symmetric_ema or one_sided_ema functions.
'''
if split_fn is None: split_fn = lambda _ : ''
if group_fn is None: group_fn = lambda _ : ''
sk2r = defaultdict(list) # splitkey2results
for result in allresults:
splitkey = split_fn(result)
sk2r[splitkey].append(result)
assert len(sk2r) > 0
assert isinstance(resample, int), "0: don't resample. <integer>: that many samples"
if tiling == 'vertical' or tiling is None:
nrows = len(sk2r)
ncols = 1
elif tiling == 'horizontal':
ncols = len(sk2r)
nrows = 1
elif tiling == 'symmetric':
import math
N = len(sk2r)
largest_divisor = 1
for i in range(1, int(math.sqrt(N))+1):
if N % i == 0:
largest_divisor = i
ncols = largest_divisor
nrows = N // ncols
figsize = figsize or (6 * ncols, 6 * nrows)
f, axarr = plt.subplots(nrows, ncols, sharex=False, squeeze=False, figsize=figsize)
groups = list(set(group_fn(result) for result in allresults))
default_samples = 512
if average_group:
resample = resample or default_samples
for (isplit, sk) in enumerate(sorted(sk2r.keys())):
g2l = {}
g2c = defaultdict(int)
sresults = sk2r[sk]
gresults = defaultdict(list)
idx_row = isplit // ncols
idx_col = isplit % ncols
ax = axarr[idx_row][idx_col]
for result in sresults:
group = group_fn(result)
g2c[group] += 1
x, y = xy_fn(result)
if x is None: x = np.arange(len(y))
x, y = map(np.asarray, (x, y))
if average_group:
gresults[group].append((x,y))
else:
if resample:
x, y, counts = symmetric_ema(x, y, x[0], x[-1], resample, decay_steps=smooth_step)
l, = ax.plot(x, y, color=COLORS[groups.index(group) % len(COLORS)])
g2l[group] = l
if average_group:
for group in sorted(groups):
xys = gresults[group]
if not any(xys):
continue
color = COLORS[groups.index(group) % len(COLORS)]
origxs = [xy[0] for xy in xys]
minxlen = min(map(len, origxs))
def allequal(qs):
return all((q==qs[0]).all() for q in qs[1:])
if resample:
low = max(x[0] for x in origxs)
high = min(x[-1] for x in origxs)
usex = np.linspace(low, high, resample)
ys = []
for (x, y) in xys:
ys.append(symmetric_ema(x, y, low, high, resample, decay_steps=smooth_step)[1])
else:
assert allequal([x[:minxlen] for x in origxs]),\
'If you want to average unevenly sampled data, set resample=<number of samples you want>'
usex = origxs[0]
ys = [xy[1][:minxlen] for xy in xys]
ymean = np.mean(ys, axis=0)
ystd = np.std(ys, axis=0)
ystderr = ystd / np.sqrt(len(ys))
l, = axarr[idx_row][idx_col].plot(usex, ymean, color=color)
g2l[group] = l
if shaded_err:
ax.fill_between(usex, ymean - ystderr, ymean + ystderr, color=color, alpha=.4)
if shaded_std:
ax.fill_between(usex, ymean - ystd, ymean + ystd, color=color, alpha=.2)
# https://matplotlib.org/users/legend_guide.html
plt.tight_layout()
if any(g2l.keys()):
ax.legend(
g2l.values(),
['%s (%i)'%(g, g2c[g]) for g in g2l] if average_group else g2l.keys(),
loc=2 if legend_outside else None,
bbox_to_anchor=(1,1) if legend_outside else None)
ax.set_title(sk)
# add xlabels, but only to the bottom row
if xlabel is not None:
for ax in axarr[-1]:
plt.sca(ax)
plt.xlabel(xlabel)
# add ylabels, but only to left column
if ylabel is not None:
for ax in axarr[:,0]:
plt.sca(ax)
plt.ylabel(ylabel)
return f, axarr
def regression_analysis(df):
xcols = list(df.columns.copy())
xcols.remove('score')
ycols = ['score']
import statsmodels.api as sm
mod = sm.OLS(df[ycols], sm.add_constant(df[xcols]), hasconst=False)
res = mod.fit()
print(res.summary())
def test_smooth():
norig = 100
nup = 300
ndown = 30
xs = np.cumsum(np.random.rand(norig) * 10 / norig)
yclean = np.sin(xs)
ys = yclean + .1 * np.random.randn(yclean.size)
xup, yup, _ = symmetric_ema(xs, ys, xs.min(), xs.max(), nup, decay_steps=nup/ndown)
xdown, ydown, _ = symmetric_ema(xs, ys, xs.min(), xs.max(), ndown, decay_steps=ndown/ndown)
xsame, ysame, _ = symmetric_ema(xs, ys, xs.min(), xs.max(), norig, decay_steps=norig/ndown)
plt.plot(xs, ys, label='orig', marker='x')
plt.plot(xup, yup, label='up', marker='x')
plt.plot(xdown, ydown, label='down', marker='x')
plt.plot(xsame, ysame, label='same', marker='x')
plt.plot(xs, yclean, label='clean', marker='x')
plt.legend()
plt.show()
| 18,930 | 42.51954 | 174 | py |
baselines | baselines-master/baselines/common/tests/test_env_after_learn.py | import pytest
import gym
import tensorflow as tf
from baselines.common.vec_env.subproc_vec_env import SubprocVecEnv
from baselines.run import get_learn_function
from baselines.common.tf_util import make_session
algos = ['a2c', 'acer', 'acktr', 'deepq', 'ppo2', 'trpo_mpi']
@pytest.mark.parametrize('algo', algos)
def test_env_after_learn(algo):
def make_env():
# acktr requires too much RAM, fails on travis
env = gym.make('CartPole-v1' if algo == 'acktr' else 'PongNoFrameskip-v4')
return env
make_session(make_default=True, graph=tf.Graph())
env = SubprocVecEnv([make_env])
learn = get_learn_function(algo)
# Commenting out the following line resolves the issue, though crash happens at env.reset().
learn(network='mlp', env=env, total_timesteps=0, load_path=None, seed=None)
env.reset()
env.close()
| 865 | 29.928571 | 96 | py |
baselines | baselines-master/baselines/common/tests/test_fetchreach.py | import pytest
import gym
from baselines.run import get_learn_function
from baselines.common.tests.util import reward_per_episode_test
from baselines.common.tests import mark_slow
pytest.importorskip('mujoco_py')
common_kwargs = dict(
network='mlp',
seed=0,
)
learn_kwargs = {
'her': dict(total_timesteps=2000)
}
@mark_slow
@pytest.mark.parametrize("alg", learn_kwargs.keys())
def test_fetchreach(alg):
'''
Test if the algorithm (with an mlp policy)
can learn the FetchReach task
'''
kwargs = common_kwargs.copy()
kwargs.update(learn_kwargs[alg])
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
def env_fn():
env = gym.make('FetchReach-v1')
env.seed(0)
return env
reward_per_episode_test(env_fn, learn_fn, -15)
if __name__ == '__main__':
test_fetchreach('her')
| 860 | 20 | 65 | py |
baselines | baselines-master/baselines/common/tests/test_with_mpi.py | import os
import sys
import subprocess
import cloudpickle
import base64
import pytest
from functools import wraps
try:
from mpi4py import MPI
except ImportError:
MPI = None
def with_mpi(nproc=2, timeout=30, skip_if_no_mpi=True):
def outer_thunk(fn):
@wraps(fn)
def thunk(*args, **kwargs):
serialized_fn = base64.b64encode(cloudpickle.dumps(lambda: fn(*args, **kwargs)))
subprocess.check_call([
'mpiexec','-n', str(nproc),
sys.executable,
'-m', 'baselines.common.tests.test_with_mpi',
serialized_fn
], env=os.environ, timeout=timeout)
if skip_if_no_mpi:
return pytest.mark.skipif(MPI is None, reason="MPI not present")(thunk)
else:
return thunk
return outer_thunk
if __name__ == '__main__':
if len(sys.argv) > 1:
fn = cloudpickle.loads(base64.b64decode(sys.argv[1]))
assert callable(fn)
fn()
| 997 | 24.589744 | 92 | py |
baselines | baselines-master/baselines/common/tests/test_tf_util.py | # tests for tf_util
import tensorflow as tf
from baselines.common.tf_util import (
function,
initialize,
single_threaded_session
)
def test_function():
with tf.Graph().as_default():
x = tf.placeholder(tf.int32, (), name="x")
y = tf.placeholder(tf.int32, (), name="y")
z = 3 * x + 2 * y
lin = function([x, y], z, givens={y: 0})
with single_threaded_session():
initialize()
assert lin(2) == 6
assert lin(x=3) == 9
assert lin(2, 2) == 10
assert lin(x=2, y=3) == 12
def test_multikwargs():
with tf.Graph().as_default():
x = tf.placeholder(tf.int32, (), name="x")
with tf.variable_scope("other"):
x2 = tf.placeholder(tf.int32, (), name="x")
z = 3 * x + 2 * x2
lin = function([x, x2], z, givens={x2: 0})
with single_threaded_session():
initialize()
assert lin(2) == 6
assert lin(2, 2) == 10
if __name__ == '__main__':
test_function()
test_multikwargs()
| 1,072 | 23.953488 | 55 | py |
baselines | baselines-master/baselines/common/tests/test_schedules.py | import numpy as np
from baselines.common.schedules import ConstantSchedule, PiecewiseSchedule
def test_piecewise_schedule():
ps = PiecewiseSchedule([(-5, 100), (5, 200), (10, 50), (100, 50), (200, -50)], outside_value=500)
assert np.isclose(ps.value(-10), 500)
assert np.isclose(ps.value(0), 150)
assert np.isclose(ps.value(5), 200)
assert np.isclose(ps.value(9), 80)
assert np.isclose(ps.value(50), 50)
assert np.isclose(ps.value(80), 50)
assert np.isclose(ps.value(150), 0)
assert np.isclose(ps.value(175), -25)
assert np.isclose(ps.value(201), 500)
assert np.isclose(ps.value(500), 500)
assert np.isclose(ps.value(200 - 1e-10), -50)
def test_constant_schedule():
cs = ConstantSchedule(5)
for i in range(-100, 100):
assert np.isclose(cs.value(i), 5)
| 823 | 29.518519 | 101 | py |
baselines | baselines-master/baselines/common/tests/test_identity.py | import pytest
from baselines.common.tests.envs.identity_env import DiscreteIdentityEnv, BoxIdentityEnv, MultiDiscreteIdentityEnv
from baselines.run import get_learn_function
from baselines.common.tests.util import simple_test
from baselines.common.tests import mark_slow
common_kwargs = dict(
total_timesteps=30000,
network='mlp',
gamma=0.9,
seed=0,
)
learn_kwargs = {
'a2c' : {},
'acktr': {},
'deepq': {},
'ddpg': dict(layer_norm=True),
'ppo2': dict(lr=1e-3, nsteps=64, ent_coef=0.0),
'trpo_mpi': dict(timesteps_per_batch=100, cg_iters=10, gamma=0.9, lam=1.0, max_kl=0.01)
}
algos_disc = ['a2c', 'acktr', 'deepq', 'ppo2', 'trpo_mpi']
algos_multidisc = ['a2c', 'acktr', 'ppo2', 'trpo_mpi']
algos_cont = ['a2c', 'acktr', 'ddpg', 'ppo2', 'trpo_mpi']
@mark_slow
@pytest.mark.parametrize("alg", algos_disc)
def test_discrete_identity(alg):
'''
Test if the algorithm (with an mlp policy)
can learn an identity transformation (i.e. return observation as an action)
'''
kwargs = learn_kwargs[alg]
kwargs.update(common_kwargs)
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
env_fn = lambda: DiscreteIdentityEnv(10, episode_len=100)
simple_test(env_fn, learn_fn, 0.9)
@mark_slow
@pytest.mark.parametrize("alg", algos_multidisc)
def test_multidiscrete_identity(alg):
'''
Test if the algorithm (with an mlp policy)
can learn an identity transformation (i.e. return observation as an action)
'''
kwargs = learn_kwargs[alg]
kwargs.update(common_kwargs)
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
env_fn = lambda: MultiDiscreteIdentityEnv((3,3), episode_len=100)
simple_test(env_fn, learn_fn, 0.9)
@mark_slow
@pytest.mark.parametrize("alg", algos_cont)
def test_continuous_identity(alg):
'''
Test if the algorithm (with an mlp policy)
can learn an identity transformation (i.e. return observation as an action)
to a required precision
'''
kwargs = learn_kwargs[alg]
kwargs.update(common_kwargs)
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
env_fn = lambda: BoxIdentityEnv((1,), episode_len=100)
simple_test(env_fn, learn_fn, -0.1)
if __name__ == '__main__':
test_multidiscrete_identity('acktr')
| 2,304 | 28.935065 | 114 | py |
baselines | baselines-master/baselines/common/tests/test_segment_tree.py | import numpy as np
from baselines.common.segment_tree import SumSegmentTree, MinSegmentTree
def test_tree_set():
tree = SumSegmentTree(4)
tree[2] = 1.0
tree[3] = 3.0
assert np.isclose(tree.sum(), 4.0)
assert np.isclose(tree.sum(0, 2), 0.0)
assert np.isclose(tree.sum(0, 3), 1.0)
assert np.isclose(tree.sum(2, 3), 1.0)
assert np.isclose(tree.sum(2, -1), 1.0)
assert np.isclose(tree.sum(2, 4), 4.0)
def test_tree_set_overlap():
tree = SumSegmentTree(4)
tree[2] = 1.0
tree[2] = 3.0
assert np.isclose(tree.sum(), 3.0)
assert np.isclose(tree.sum(2, 3), 3.0)
assert np.isclose(tree.sum(2, -1), 3.0)
assert np.isclose(tree.sum(2, 4), 3.0)
assert np.isclose(tree.sum(1, 2), 0.0)
def test_prefixsum_idx():
tree = SumSegmentTree(4)
tree[2] = 1.0
tree[3] = 3.0
assert tree.find_prefixsum_idx(0.0) == 2
assert tree.find_prefixsum_idx(0.5) == 2
assert tree.find_prefixsum_idx(0.99) == 2
assert tree.find_prefixsum_idx(1.01) == 3
assert tree.find_prefixsum_idx(3.00) == 3
assert tree.find_prefixsum_idx(4.00) == 3
def test_prefixsum_idx2():
tree = SumSegmentTree(4)
tree[0] = 0.5
tree[1] = 1.0
tree[2] = 1.0
tree[3] = 3.0
assert tree.find_prefixsum_idx(0.00) == 0
assert tree.find_prefixsum_idx(0.55) == 1
assert tree.find_prefixsum_idx(0.99) == 1
assert tree.find_prefixsum_idx(1.51) == 2
assert tree.find_prefixsum_idx(3.00) == 3
assert tree.find_prefixsum_idx(5.50) == 3
def test_max_interval_tree():
tree = MinSegmentTree(4)
tree[0] = 1.0
tree[2] = 0.5
tree[3] = 3.0
assert np.isclose(tree.min(), 0.5)
assert np.isclose(tree.min(0, 2), 1.0)
assert np.isclose(tree.min(0, 3), 0.5)
assert np.isclose(tree.min(0, -1), 0.5)
assert np.isclose(tree.min(2, 4), 0.5)
assert np.isclose(tree.min(3, 4), 3.0)
tree[2] = 0.7
assert np.isclose(tree.min(), 0.7)
assert np.isclose(tree.min(0, 2), 1.0)
assert np.isclose(tree.min(0, 3), 0.7)
assert np.isclose(tree.min(0, -1), 0.7)
assert np.isclose(tree.min(2, 4), 0.7)
assert np.isclose(tree.min(3, 4), 3.0)
tree[2] = 4.0
assert np.isclose(tree.min(), 1.0)
assert np.isclose(tree.min(0, 2), 1.0)
assert np.isclose(tree.min(0, 3), 1.0)
assert np.isclose(tree.min(0, -1), 1.0)
assert np.isclose(tree.min(2, 4), 3.0)
assert np.isclose(tree.min(2, 3), 4.0)
assert np.isclose(tree.min(2, -1), 4.0)
assert np.isclose(tree.min(3, 4), 3.0)
if __name__ == '__main__':
test_tree_set()
test_tree_set_overlap()
test_prefixsum_idx()
test_prefixsum_idx2()
test_max_interval_tree()
| 2,691 | 24.884615 | 72 | py |
baselines | baselines-master/baselines/common/tests/test_mnist.py | import pytest
# from baselines.acer import acer_simple as acer
from baselines.common.tests.envs.mnist_env import MnistEnv
from baselines.common.tests.util import simple_test
from baselines.run import get_learn_function
from baselines.common.tests import mark_slow
# TODO investigate a2c and ppo2 failures - is it due to bad hyperparameters for this problem?
# GitHub issue https://github.com/openai/baselines/issues/189
common_kwargs = {
'seed': 0,
'network':'cnn',
'gamma':0.9,
'pad':'SAME'
}
learn_args = {
'a2c': dict(total_timesteps=50000),
'acer': dict(total_timesteps=20000),
'deepq': dict(total_timesteps=5000),
'acktr': dict(total_timesteps=30000),
'ppo2': dict(total_timesteps=50000, lr=1e-3, nsteps=128, ent_coef=0.0),
'trpo_mpi': dict(total_timesteps=80000, timesteps_per_batch=100, cg_iters=10, lam=1.0, max_kl=0.001)
}
#tests pass, but are too slow on travis. Same algorithms are covered
# by other tests with less compute-hungry nn's and by benchmarks
@pytest.mark.skip
@mark_slow
@pytest.mark.parametrize("alg", learn_args.keys())
def test_mnist(alg):
'''
Test if the algorithm can learn to classify MNIST digits.
Uses CNN policy.
'''
learn_kwargs = learn_args[alg]
learn_kwargs.update(common_kwargs)
learn = get_learn_function(alg)
learn_fn = lambda e: learn(env=e, **learn_kwargs)
env_fn = lambda: MnistEnv(episode_len=100)
simple_test(env_fn, learn_fn, 0.6)
if __name__ == '__main__':
test_mnist('acer')
| 1,515 | 29.32 | 104 | py |
baselines | baselines-master/baselines/common/tests/util.py | import tensorflow as tf
import numpy as np
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
N_TRIALS = 10000
N_EPISODES = 100
_sess_config = tf.ConfigProto(
allow_soft_placement=True,
intra_op_parallelism_threads=1,
inter_op_parallelism_threads=1
)
def simple_test(env_fn, learn_fn, min_reward_fraction, n_trials=N_TRIALS):
def seeded_env_fn():
env = env_fn()
env.seed(0)
return env
np.random.seed(0)
env = DummyVecEnv([seeded_env_fn])
with tf.Graph().as_default(), tf.Session(config=_sess_config).as_default():
tf.set_random_seed(0)
model = learn_fn(env)
sum_rew = 0
done = True
for i in range(n_trials):
if done:
obs = env.reset()
state = model.initial_state
if state is not None:
a, v, state, _ = model.step(obs, S=state, M=[False])
else:
a, v, _, _ = model.step(obs)
obs, rew, done, _ = env.step(a)
sum_rew += float(rew)
print("Reward in {} trials is {}".format(n_trials, sum_rew))
assert sum_rew > min_reward_fraction * n_trials, \
'sum of rewards {} is less than {} of the total number of trials {}'.format(sum_rew, min_reward_fraction, n_trials)
def reward_per_episode_test(env_fn, learn_fn, min_avg_reward, n_trials=N_EPISODES):
env = DummyVecEnv([env_fn])
with tf.Graph().as_default(), tf.Session(config=_sess_config).as_default():
model = learn_fn(env)
N_TRIALS = 100
observations, actions, rewards = rollout(env, model, N_TRIALS)
rewards = [sum(r) for r in rewards]
avg_rew = sum(rewards) / N_TRIALS
print("Average reward in {} episodes is {}".format(n_trials, avg_rew))
assert avg_rew > min_avg_reward, \
'average reward in {} episodes ({}) is less than {}'.format(n_trials, avg_rew, min_avg_reward)
def rollout(env, model, n_trials):
rewards = []
actions = []
observations = []
for i in range(n_trials):
obs = env.reset()
state = model.initial_state if hasattr(model, 'initial_state') else None
episode_rew = []
episode_actions = []
episode_obs = []
while True:
if state is not None:
a, v, state, _ = model.step(obs, S=state, M=[False])
else:
a,v, _, _ = model.step(obs)
obs, rew, done, _ = env.step(a)
episode_rew.append(rew)
episode_actions.append(a)
episode_obs.append(obs)
if done:
break
rewards.append(episode_rew)
actions.append(episode_actions)
observations.append(episode_obs)
return observations, actions, rewards
def smoketest(argstr, **kwargs):
import tempfile
import subprocess
import os
argstr = 'python -m baselines.run ' + argstr
for key, value in kwargs:
argstr += ' --{}={}'.format(key, value)
tempdir = tempfile.mkdtemp()
env = os.environ.copy()
env['OPENAI_LOGDIR'] = tempdir
subprocess.run(argstr.split(' '), env=env)
return tempdir
| 3,181 | 33.215054 | 127 | py |
baselines | baselines-master/baselines/common/tests/test_plot_util.py | # smoke tests of plot_util
from baselines.common import plot_util as pu
from baselines.common.tests.util import smoketest
def test_plot_util():
nruns = 4
logdirs = [smoketest('--alg=ppo2 --env=CartPole-v0 --num_timesteps=10000') for _ in range(nruns)]
data = pu.load_results(logdirs)
assert len(data) == 4
_, axes = pu.plot_results(data[:1]); assert len(axes) == 1
_, axes = pu.plot_results(data, tiling='vertical'); assert axes.shape==(4,1)
_, axes = pu.plot_results(data, tiling='horizontal'); assert axes.shape==(1,4)
_, axes = pu.plot_results(data, tiling='symmetric'); assert axes.shape==(2,2)
_, axes = pu.plot_results(data, split_fn=lambda _: ''); assert len(axes) == 1
| 717 | 38.888889 | 101 | py |
baselines | baselines-master/baselines/common/tests/__init__.py | import os, pytest
mark_slow = pytest.mark.skipif(not os.getenv('RUNSLOW'), reason='slow') | 89 | 44 | 71 | py |
baselines | baselines-master/baselines/common/tests/test_doc_examples.py | import pytest
try:
import mujoco_py
_mujoco_present = True
except BaseException:
mujoco_py = None
_mujoco_present = False
@pytest.mark.skipif(
not _mujoco_present,
reason='error loading mujoco - either mujoco / mujoco key not present, or LD_LIBRARY_PATH is not pointing to mujoco library'
)
def test_lstm_example():
import tensorflow as tf
from baselines.common import policies, models, cmd_util
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
# create vectorized environment
venv = DummyVecEnv([lambda: cmd_util.make_mujoco_env('Reacher-v2', seed=0)])
with tf.Session() as sess:
# build policy based on lstm network with 128 units
policy = policies.build_policy(venv, models.lstm(128))(nbatch=1, nsteps=1)
# initialize tensorflow variables
sess.run(tf.global_variables_initializer())
# prepare environment variables
ob = venv.reset()
state = policy.initial_state
done = [False]
step_counter = 0
# run a single episode until the end (i.e. until done)
while True:
action, _, state, _ = policy.step(ob, S=state, M=done)
ob, reward, done, _ = venv.step(action)
step_counter += 1
if done:
break
assert step_counter > 5
| 1,351 | 26.591837 | 128 | py |
baselines | baselines-master/baselines/common/tests/test_serialization.py | import os
import gym
import tempfile
import pytest
import tensorflow as tf
import numpy as np
from baselines.common.tests.envs.mnist_env import MnistEnv
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
from baselines.run import get_learn_function
from baselines.common.tf_util import make_session, get_session
from functools import partial
learn_kwargs = {
'deepq': {},
'a2c': {},
'acktr': {},
'acer': {},
'ppo2': {'nminibatches': 1, 'nsteps': 10},
'trpo_mpi': {},
}
network_kwargs = {
'mlp': {},
'cnn': {'pad': 'SAME'},
'lstm': {},
'cnn_lnlstm': {'pad': 'SAME'}
}
@pytest.mark.parametrize("learn_fn", learn_kwargs.keys())
@pytest.mark.parametrize("network_fn", network_kwargs.keys())
def test_serialization(learn_fn, network_fn):
'''
Test if the trained model can be serialized
'''
if network_fn.endswith('lstm') and learn_fn in ['acer', 'acktr', 'trpo_mpi', 'deepq']:
# TODO make acktr work with recurrent policies
# and test
# github issue: https://github.com/openai/baselines/issues/660
return
def make_env():
env = MnistEnv(episode_len=100)
env.seed(10)
return env
env = DummyVecEnv([make_env])
ob = env.reset().copy()
learn = get_learn_function(learn_fn)
kwargs = {}
kwargs.update(network_kwargs[network_fn])
kwargs.update(learn_kwargs[learn_fn])
learn = partial(learn, env=env, network=network_fn, seed=0, **kwargs)
with tempfile.TemporaryDirectory() as td:
model_path = os.path.join(td, 'serialization_test_model')
with tf.Graph().as_default(), make_session().as_default():
model = learn(total_timesteps=100)
model.save(model_path)
mean1, std1 = _get_action_stats(model, ob)
variables_dict1 = _serialize_variables()
with tf.Graph().as_default(), make_session().as_default():
model = learn(total_timesteps=0, load_path=model_path)
mean2, std2 = _get_action_stats(model, ob)
variables_dict2 = _serialize_variables()
for k, v in variables_dict1.items():
np.testing.assert_allclose(v, variables_dict2[k], atol=0.01,
err_msg='saved and loaded variable {} value mismatch'.format(k))
np.testing.assert_allclose(mean1, mean2, atol=0.5)
np.testing.assert_allclose(std1, std2, atol=0.5)
@pytest.mark.parametrize("learn_fn", learn_kwargs.keys())
@pytest.mark.parametrize("network_fn", ['mlp'])
def test_coexistence(learn_fn, network_fn):
'''
Test if more than one model can exist at a time
'''
if learn_fn == 'deepq':
# TODO enable multiple DQN models to be useable at the same time
# github issue https://github.com/openai/baselines/issues/656
return
if network_fn.endswith('lstm') and learn_fn in ['acktr', 'trpo_mpi', 'deepq']:
# TODO make acktr work with recurrent policies
# and test
# github issue: https://github.com/openai/baselines/issues/660
return
env = DummyVecEnv([lambda: gym.make('CartPole-v0')])
learn = get_learn_function(learn_fn)
kwargs = {}
kwargs.update(network_kwargs[network_fn])
kwargs.update(learn_kwargs[learn_fn])
learn = partial(learn, env=env, network=network_fn, total_timesteps=0, **kwargs)
make_session(make_default=True, graph=tf.Graph())
model1 = learn(seed=1)
make_session(make_default=True, graph=tf.Graph())
model2 = learn(seed=2)
model1.step(env.observation_space.sample())
model2.step(env.observation_space.sample())
def _serialize_variables():
sess = get_session()
variables = tf.trainable_variables()
values = sess.run(variables)
return {var.name: value for var, value in zip(variables, values)}
def _get_action_stats(model, ob):
ntrials = 1000
if model.initial_state is None or model.initial_state == []:
actions = np.array([model.step(ob)[0] for _ in range(ntrials)])
else:
actions = np.array([model.step(ob, S=model.initial_state, M=[False])[0] for _ in range(ntrials)])
mean = np.mean(actions, axis=0)
std = np.std(actions, axis=0)
return mean, std
| 4,273 | 29.528571 | 105 | py |
baselines | baselines-master/baselines/common/tests/test_cartpole.py | import pytest
import gym
from baselines.run import get_learn_function
from baselines.common.tests.util import reward_per_episode_test
from baselines.common.tests import mark_slow
common_kwargs = dict(
total_timesteps=30000,
network='mlp',
gamma=1.0,
seed=0,
)
learn_kwargs = {
'a2c' : dict(nsteps=32, value_network='copy', lr=0.05),
'acer': dict(value_network='copy'),
'acktr': dict(nsteps=32, value_network='copy', is_async=False),
'deepq': dict(total_timesteps=20000),
'ppo2': dict(value_network='copy'),
'trpo_mpi': {}
}
@mark_slow
@pytest.mark.parametrize("alg", learn_kwargs.keys())
def test_cartpole(alg):
'''
Test if the algorithm (with an mlp policy)
can learn to balance the cartpole
'''
kwargs = common_kwargs.copy()
kwargs.update(learn_kwargs[alg])
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
def env_fn():
env = gym.make('CartPole-v0')
env.seed(0)
return env
reward_per_episode_test(env_fn, learn_fn, 100)
if __name__ == '__main__':
test_cartpole('acer')
| 1,098 | 22.891304 | 67 | py |
baselines | baselines-master/baselines/common/tests/test_fixed_sequence.py | import pytest
from baselines.common.tests.envs.fixed_sequence_env import FixedSequenceEnv
from baselines.common.tests.util import simple_test
from baselines.run import get_learn_function
from baselines.common.tests import mark_slow
common_kwargs = dict(
seed=0,
total_timesteps=50000,
)
learn_kwargs = {
'a2c': {},
'ppo2': dict(nsteps=10, ent_coef=0.0, nminibatches=1),
# TODO enable sequential models for trpo_mpi (proper handling of nbatch and nsteps)
# github issue: https://github.com/openai/baselines/issues/188
# 'trpo_mpi': lambda e, p: trpo_mpi.learn(policy_fn=p(env=e), env=e, max_timesteps=30000, timesteps_per_batch=100, cg_iters=10, gamma=0.9, lam=1.0, max_kl=0.001)
}
alg_list = learn_kwargs.keys()
rnn_list = ['lstm']
@mark_slow
@pytest.mark.parametrize("alg", alg_list)
@pytest.mark.parametrize("rnn", rnn_list)
def test_fixed_sequence(alg, rnn):
'''
Test if the algorithm (with a given policy)
can learn an identity transformation (i.e. return observation as an action)
'''
kwargs = learn_kwargs[alg]
kwargs.update(common_kwargs)
env_fn = lambda: FixedSequenceEnv(n_actions=10, episode_len=5)
learn = lambda e: get_learn_function(alg)(
env=e,
network=rnn,
**kwargs
)
simple_test(env_fn, learn, 0.7)
if __name__ == '__main__':
test_fixed_sequence('ppo2', 'lstm')
| 1,389 | 25.226415 | 165 | py |
baselines | baselines-master/baselines/common/tests/envs/mnist_env.py | import os.path as osp
import numpy as np
import tempfile
from gym import Env
from gym.spaces import Discrete, Box
class MnistEnv(Env):
def __init__(
self,
episode_len=None,
no_images=None
):
import filelock
from tensorflow.examples.tutorials.mnist import input_data
# we could use temporary directory for this with a context manager and
# TemporaryDirecotry, but then each test that uses mnist would re-download the data
# this way the data is not cleaned up, but we only download it once per machine
mnist_path = osp.join(tempfile.gettempdir(), 'MNIST_data')
with filelock.FileLock(mnist_path + '.lock'):
self.mnist = input_data.read_data_sets(mnist_path)
self.np_random = np.random.RandomState()
self.observation_space = Box(low=0.0, high=1.0, shape=(28,28,1))
self.action_space = Discrete(10)
self.episode_len = episode_len
self.time = 0
self.no_images = no_images
self.train_mode()
self.reset()
def reset(self):
self._choose_next_state()
self.time = 0
return self.state[0]
def step(self, actions):
rew = self._get_reward(actions)
self._choose_next_state()
done = False
if self.episode_len and self.time >= self.episode_len:
rew = 0
done = True
return self.state[0], rew, done, {}
def seed(self, seed=None):
self.np_random.seed(seed)
def train_mode(self):
self.dataset = self.mnist.train
def test_mode(self):
self.dataset = self.mnist.test
def _choose_next_state(self):
max_index = (self.no_images if self.no_images is not None else self.dataset.num_examples) - 1
index = self.np_random.randint(0, max_index)
image = self.dataset.images[index].reshape(28,28,1)*255
label = self.dataset.labels[index]
self.state = (image, label)
self.time += 1
def _get_reward(self, actions):
return 1 if self.state[1] == actions else 0
| 2,110 | 28.319444 | 101 | py |
baselines | baselines-master/baselines/common/tests/envs/fixed_sequence_env.py | import numpy as np
from gym import Env
from gym.spaces import Discrete
class FixedSequenceEnv(Env):
def __init__(
self,
n_actions=10,
episode_len=100
):
self.action_space = Discrete(n_actions)
self.observation_space = Discrete(1)
self.np_random = np.random.RandomState(0)
self.episode_len = episode_len
self.sequence = [self.np_random.randint(0, self.action_space.n)
for _ in range(self.episode_len)]
self.time = 0
def reset(self):
self.time = 0
return 0
def step(self, actions):
rew = self._get_reward(actions)
self._choose_next_state()
done = False
if self.episode_len and self.time >= self.episode_len:
done = True
return 0, rew, done, {}
def seed(self, seed=None):
self.np_random.seed(seed)
def _choose_next_state(self):
self.time += 1
def _get_reward(self, actions):
return 1 if actions == self.sequence[self.time] else 0
| 1,054 | 22.977273 | 71 | py |
baselines | baselines-master/baselines/common/tests/envs/identity_env.py | import numpy as np
from abc import abstractmethod
from gym import Env
from gym.spaces import MultiDiscrete, Discrete, Box
from collections import deque
class IdentityEnv(Env):
def __init__(
self,
episode_len=None,
delay=0,
zero_first_rewards=True
):
self.observation_space = self.action_space
self.episode_len = episode_len
self.time = 0
self.delay = delay
self.zero_first_rewards = zero_first_rewards
self.q = deque(maxlen=delay+1)
def reset(self):
self.q.clear()
for _ in range(self.delay + 1):
self.q.append(self.action_space.sample())
self.time = 0
return self.q[-1]
def step(self, actions):
rew = self._get_reward(self.q.popleft(), actions)
if self.zero_first_rewards and self.time < self.delay:
rew = 0
self.q.append(self.action_space.sample())
self.time += 1
done = self.episode_len is not None and self.time >= self.episode_len
return self.q[-1], rew, done, {}
def seed(self, seed=None):
self.action_space.seed(seed)
@abstractmethod
def _get_reward(self, state, actions):
raise NotImplementedError
class DiscreteIdentityEnv(IdentityEnv):
def __init__(
self,
dim,
episode_len=None,
delay=0,
zero_first_rewards=True
):
self.action_space = Discrete(dim)
super().__init__(episode_len=episode_len, delay=delay, zero_first_rewards=zero_first_rewards)
def _get_reward(self, state, actions):
return 1 if state == actions else 0
class MultiDiscreteIdentityEnv(IdentityEnv):
def __init__(
self,
dims,
episode_len=None,
delay=0,
):
self.action_space = MultiDiscrete(dims)
super().__init__(episode_len=episode_len, delay=delay)
def _get_reward(self, state, actions):
return 1 if all(state == actions) else 0
class BoxIdentityEnv(IdentityEnv):
def __init__(
self,
shape,
episode_len=None,
):
self.action_space = Box(low=-1.0, high=1.0, shape=shape, dtype=np.float32)
super().__init__(episode_len=episode_len)
def _get_reward(self, state, actions):
diff = actions - state
diff = diff[:]
return -0.5 * np.dot(diff, diff)
| 2,444 | 25.868132 | 101 | py |
baselines | baselines-master/baselines/common/tests/envs/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/common/tests/envs/identity_env_test.py | from baselines.common.tests.envs.identity_env import DiscreteIdentityEnv
def test_discrete_nodelay():
nsteps = 100
eplen = 50
env = DiscreteIdentityEnv(10, episode_len=eplen)
ob = env.reset()
for t in range(nsteps):
action = env.action_space.sample()
next_ob, rew, done, info = env.step(action)
assert rew == (1 if action == ob else 0)
if (t + 1) % eplen == 0:
assert done
next_ob = env.reset()
else:
assert not done
ob = next_ob
def test_discrete_delay1():
eplen = 50
env = DiscreteIdentityEnv(10, episode_len=eplen, delay=1)
ob = env.reset()
prev_ob = None
for t in range(eplen):
action = env.action_space.sample()
next_ob, rew, done, info = env.step(action)
if t > 0:
assert rew == (1 if action == prev_ob else 0)
else:
assert rew == 0
prev_ob = ob
ob = next_ob
if t < eplen - 1:
assert not done
assert done
| 1,034 | 26.972973 | 72 | py |
baselines | baselines-master/baselines/common/vec_env/vec_video_recorder.py | import os
from baselines import logger
from baselines.common.vec_env import VecEnvWrapper
from gym.wrappers.monitoring import video_recorder
class VecVideoRecorder(VecEnvWrapper):
"""
Wrap VecEnv to record rendered image as mp4 video.
"""
def __init__(self, venv, directory, record_video_trigger, video_length=200):
"""
# Arguments
venv: VecEnv to wrap
directory: Where to save videos
record_video_trigger:
Function that defines when to start recording.
The function takes the current number of step,
and returns whether we should start recording or not.
video_length: Length of recorded video
"""
VecEnvWrapper.__init__(self, venv)
self.record_video_trigger = record_video_trigger
self.video_recorder = None
self.directory = os.path.abspath(directory)
if not os.path.exists(self.directory): os.mkdir(self.directory)
self.file_prefix = "vecenv"
self.file_infix = '{}'.format(os.getpid())
self.step_id = 0
self.video_length = video_length
self.recording = False
self.recorded_frames = 0
def reset(self):
obs = self.venv.reset()
self.start_video_recorder()
return obs
def start_video_recorder(self):
self.close_video_recorder()
base_path = os.path.join(self.directory, '{}.video.{}.video{:06}'.format(self.file_prefix, self.file_infix, self.step_id))
self.video_recorder = video_recorder.VideoRecorder(
env=self.venv,
base_path=base_path,
metadata={'step_id': self.step_id}
)
self.video_recorder.capture_frame()
self.recorded_frames = 1
self.recording = True
def _video_enabled(self):
return self.record_video_trigger(self.step_id)
def step_wait(self):
obs, rews, dones, infos = self.venv.step_wait()
self.step_id += 1
if self.recording:
self.video_recorder.capture_frame()
self.recorded_frames += 1
if self.recorded_frames > self.video_length:
logger.info("Saving video to ", self.video_recorder.path)
self.close_video_recorder()
elif self._video_enabled():
self.start_video_recorder()
return obs, rews, dones, infos
def close_video_recorder(self):
if self.recording:
self.video_recorder.close()
self.recording = False
self.recorded_frames = 0
def close(self):
VecEnvWrapper.close(self)
self.close_video_recorder()
def __del__(self):
self.close()
| 2,746 | 29.522222 | 130 | py |
baselines | baselines-master/baselines/common/vec_env/vec_normalize.py | from . import VecEnvWrapper
import numpy as np
class VecNormalize(VecEnvWrapper):
"""
A vectorized wrapper that normalizes the observations
and returns from an environment.
"""
def __init__(self, venv, ob=True, ret=True, clipob=10., cliprew=10., gamma=0.99, epsilon=1e-8, use_tf=False):
VecEnvWrapper.__init__(self, venv)
if use_tf:
from baselines.common.running_mean_std import TfRunningMeanStd
self.ob_rms = TfRunningMeanStd(shape=self.observation_space.shape, scope='ob_rms') if ob else None
self.ret_rms = TfRunningMeanStd(shape=(), scope='ret_rms') if ret else None
else:
from baselines.common.running_mean_std import RunningMeanStd
self.ob_rms = RunningMeanStd(shape=self.observation_space.shape) if ob else None
self.ret_rms = RunningMeanStd(shape=()) if ret else None
self.clipob = clipob
self.cliprew = cliprew
self.ret = np.zeros(self.num_envs)
self.gamma = gamma
self.epsilon = epsilon
def step_wait(self):
obs, rews, news, infos = self.venv.step_wait()
self.ret = self.ret * self.gamma + rews
obs = self._obfilt(obs)
if self.ret_rms:
self.ret_rms.update(self.ret)
rews = np.clip(rews / np.sqrt(self.ret_rms.var + self.epsilon), -self.cliprew, self.cliprew)
self.ret[news] = 0.
return obs, rews, news, infos
def _obfilt(self, obs):
if self.ob_rms:
self.ob_rms.update(obs)
obs = np.clip((obs - self.ob_rms.mean) / np.sqrt(self.ob_rms.var + self.epsilon), -self.clipob, self.clipob)
return obs
else:
return obs
def reset(self):
self.ret = np.zeros(self.num_envs)
obs = self.venv.reset()
return self._obfilt(obs)
| 1,854 | 37.645833 | 120 | py |
baselines | baselines-master/baselines/common/vec_env/test_vec_env.py | """
Tests for asynchronous vectorized environments.
"""
import gym
import numpy as np
import pytest
from .dummy_vec_env import DummyVecEnv
from .shmem_vec_env import ShmemVecEnv
from .subproc_vec_env import SubprocVecEnv
from baselines.common.tests.test_with_mpi import with_mpi
def assert_venvs_equal(venv1, venv2, num_steps):
"""
Compare two environments over num_steps steps and make sure
that the observations produced by each are the same when given
the same actions.
"""
assert venv1.num_envs == venv2.num_envs
assert venv1.observation_space.shape == venv2.observation_space.shape
assert venv1.observation_space.dtype == venv2.observation_space.dtype
assert venv1.action_space.shape == venv2.action_space.shape
assert venv1.action_space.dtype == venv2.action_space.dtype
try:
obs1, obs2 = venv1.reset(), venv2.reset()
assert np.array(obs1).shape == np.array(obs2).shape
assert np.array(obs1).shape == (venv1.num_envs,) + venv1.observation_space.shape
assert np.allclose(obs1, obs2)
venv1.action_space.seed(1337)
for _ in range(num_steps):
actions = np.array([venv1.action_space.sample() for _ in range(venv1.num_envs)])
for venv in [venv1, venv2]:
venv.step_async(actions)
outs1 = venv1.step_wait()
outs2 = venv2.step_wait()
for out1, out2 in zip(outs1[:3], outs2[:3]):
assert np.array(out1).shape == np.array(out2).shape
assert np.allclose(out1, out2)
assert list(outs1[3]) == list(outs2[3])
finally:
venv1.close()
venv2.close()
@pytest.mark.parametrize('klass', (ShmemVecEnv, SubprocVecEnv))
@pytest.mark.parametrize('dtype', ('uint8', 'float32'))
def test_vec_env(klass, dtype): # pylint: disable=R0914
"""
Test that a vectorized environment is equivalent to
DummyVecEnv, since DummyVecEnv is less likely to be
error prone.
"""
num_envs = 3
num_steps = 100
shape = (3, 8)
def make_fn(seed):
"""
Get an environment constructor with a seed.
"""
return lambda: SimpleEnv(seed, shape, dtype)
fns = [make_fn(i) for i in range(num_envs)]
env1 = DummyVecEnv(fns)
env2 = klass(fns)
assert_venvs_equal(env1, env2, num_steps=num_steps)
@pytest.mark.parametrize('dtype', ('uint8', 'float32'))
@pytest.mark.parametrize('num_envs_in_series', (3, 4, 6))
def test_sync_sampling(dtype, num_envs_in_series):
"""
Test that a SubprocVecEnv running with envs in series
outputs the same as DummyVecEnv.
"""
num_envs = 12
num_steps = 100
shape = (3, 8)
def make_fn(seed):
"""
Get an environment constructor with a seed.
"""
return lambda: SimpleEnv(seed, shape, dtype)
fns = [make_fn(i) for i in range(num_envs)]
env1 = DummyVecEnv(fns)
env2 = SubprocVecEnv(fns, in_series=num_envs_in_series)
assert_venvs_equal(env1, env2, num_steps=num_steps)
@pytest.mark.parametrize('dtype', ('uint8', 'float32'))
@pytest.mark.parametrize('num_envs_in_series', (3, 4, 6))
def test_sync_sampling_sanity(dtype, num_envs_in_series):
"""
Test that a SubprocVecEnv running with envs in series
outputs the same as SubprocVecEnv without running in series.
"""
num_envs = 12
num_steps = 100
shape = (3, 8)
def make_fn(seed):
"""
Get an environment constructor with a seed.
"""
return lambda: SimpleEnv(seed, shape, dtype)
fns = [make_fn(i) for i in range(num_envs)]
env1 = SubprocVecEnv(fns)
env2 = SubprocVecEnv(fns, in_series=num_envs_in_series)
assert_venvs_equal(env1, env2, num_steps=num_steps)
class SimpleEnv(gym.Env):
"""
An environment with a pre-determined observation space
and RNG seed.
"""
def __init__(self, seed, shape, dtype):
np.random.seed(seed)
self._dtype = dtype
self._start_obs = np.array(np.random.randint(0, 0x100, size=shape),
dtype=dtype)
self._max_steps = seed + 1
self._cur_obs = None
self._cur_step = 0
# this is 0xFF instead of 0x100 because the Box space includes
# the high end, while randint does not
self.action_space = gym.spaces.Box(low=0, high=0xFF, shape=shape, dtype=dtype)
self.observation_space = self.action_space
def step(self, action):
self._cur_obs += np.array(action, dtype=self._dtype)
self._cur_step += 1
done = self._cur_step >= self._max_steps
reward = self._cur_step / self._max_steps
return self._cur_obs, reward, done, {'foo': 'bar' + str(reward)}
def reset(self):
self._cur_obs = self._start_obs
self._cur_step = 0
return self._cur_obs
def render(self, mode=None):
raise NotImplementedError
@with_mpi()
def test_mpi_with_subprocvecenv():
shape = (2,3,4)
nenv = 1
venv = SubprocVecEnv([lambda: SimpleEnv(0, shape, 'float32')] * nenv)
ob = venv.reset()
venv.close()
assert ob.shape == (nenv,) + shape
| 5,162 | 31.471698 | 92 | py |
baselines | baselines-master/baselines/common/vec_env/vec_env.py | import contextlib
import os
from abc import ABC, abstractmethod
from baselines.common.tile_images import tile_images
class AlreadySteppingError(Exception):
"""
Raised when an asynchronous step is running while
step_async() is called again.
"""
def __init__(self):
msg = 'already running an async step'
Exception.__init__(self, msg)
class NotSteppingError(Exception):
"""
Raised when an asynchronous step is not running but
step_wait() is called.
"""
def __init__(self):
msg = 'not running an async step'
Exception.__init__(self, msg)
class VecEnv(ABC):
"""
An abstract asynchronous, vectorized environment.
Used to batch data from multiple copies of an environment, so that
each observation becomes an batch of observations, and expected action is a batch of actions to
be applied per-environment.
"""
closed = False
viewer = None
metadata = {
'render.modes': ['human', 'rgb_array']
}
def __init__(self, num_envs, observation_space, action_space):
self.num_envs = num_envs
self.observation_space = observation_space
self.action_space = action_space
@abstractmethod
def reset(self):
"""
Reset all the environments and return an array of
observations, or a dict of observation arrays.
If step_async is still doing work, that work will
be cancelled and step_wait() should not be called
until step_async() is invoked again.
"""
pass
@abstractmethod
def step_async(self, actions):
"""
Tell all the environments to start taking a step
with the given actions.
Call step_wait() to get the results of the step.
You should not call this if a step_async run is
already pending.
"""
pass
@abstractmethod
def step_wait(self):
"""
Wait for the step taken with step_async().
Returns (obs, rews, dones, infos):
- obs: an array of observations, or a dict of
arrays of observations.
- rews: an array of rewards
- dones: an array of "episode done" booleans
- infos: a sequence of info objects
"""
pass
def close_extras(self):
"""
Clean up the extra resources, beyond what's in this base class.
Only runs when not self.closed.
"""
pass
def close(self):
if self.closed:
return
if self.viewer is not None:
self.viewer.close()
self.close_extras()
self.closed = True
def step(self, actions):
"""
Step the environments synchronously.
This is available for backwards compatibility.
"""
self.step_async(actions)
return self.step_wait()
def render(self, mode='human'):
imgs = self.get_images()
bigimg = tile_images(imgs)
if mode == 'human':
self.get_viewer().imshow(bigimg)
return self.get_viewer().isopen
elif mode == 'rgb_array':
return bigimg
else:
raise NotImplementedError
def get_images(self):
"""
Return RGB images from each environment
"""
raise NotImplementedError
@property
def unwrapped(self):
if isinstance(self, VecEnvWrapper):
return self.venv.unwrapped
else:
return self
def get_viewer(self):
if self.viewer is None:
from gym.envs.classic_control import rendering
self.viewer = rendering.SimpleImageViewer()
return self.viewer
class VecEnvWrapper(VecEnv):
"""
An environment wrapper that applies to an entire batch
of environments at once.
"""
def __init__(self, venv, observation_space=None, action_space=None):
self.venv = venv
super().__init__(num_envs=venv.num_envs,
observation_space=observation_space or venv.observation_space,
action_space=action_space or venv.action_space)
def step_async(self, actions):
self.venv.step_async(actions)
@abstractmethod
def reset(self):
pass
@abstractmethod
def step_wait(self):
pass
def close(self):
return self.venv.close()
def render(self, mode='human'):
return self.venv.render(mode=mode)
def get_images(self):
return self.venv.get_images()
def __getattr__(self, name):
if name.startswith('_'):
raise AttributeError("attempted to get missing private attribute '{}'".format(name))
return getattr(self.venv, name)
class VecEnvObservationWrapper(VecEnvWrapper):
@abstractmethod
def process(self, obs):
pass
def reset(self):
obs = self.venv.reset()
return self.process(obs)
def step_wait(self):
obs, rews, dones, infos = self.venv.step_wait()
return self.process(obs), rews, dones, infos
class CloudpickleWrapper(object):
"""
Uses cloudpickle to serialize contents (otherwise multiprocessing tries to use pickle)
"""
def __init__(self, x):
self.x = x
def __getstate__(self):
import cloudpickle
return cloudpickle.dumps(self.x)
def __setstate__(self, ob):
import pickle
self.x = pickle.loads(ob)
@contextlib.contextmanager
def clear_mpi_env_vars():
"""
from mpi4py import MPI will call MPI_Init by default. If the child process has MPI environment variables, MPI will think that the child process is an MPI process just like the parent and do bad things such as hang.
This context manager is a hacky way to clear those environment variables temporarily such as when we are starting multiprocessing
Processes.
"""
removed_environment = {}
for k, v in list(os.environ.items()):
for prefix in ['OMPI_', 'PMI_']:
if k.startswith(prefix):
removed_environment[k] = v
del os.environ[k]
try:
yield
finally:
os.environ.update(removed_environment)
| 6,195 | 26.660714 | 219 | py |
baselines | baselines-master/baselines/common/vec_env/vec_monitor.py | from . import VecEnvWrapper
from baselines.bench.monitor import ResultsWriter
import numpy as np
import time
from collections import deque
class VecMonitor(VecEnvWrapper):
def __init__(self, venv, filename=None, keep_buf=0, info_keywords=()):
VecEnvWrapper.__init__(self, venv)
self.eprets = None
self.eplens = None
self.epcount = 0
self.tstart = time.time()
if filename:
self.results_writer = ResultsWriter(filename, header={'t_start': self.tstart},
extra_keys=info_keywords)
else:
self.results_writer = None
self.info_keywords = info_keywords
self.keep_buf = keep_buf
if self.keep_buf:
self.epret_buf = deque([], maxlen=keep_buf)
self.eplen_buf = deque([], maxlen=keep_buf)
def reset(self):
obs = self.venv.reset()
self.eprets = np.zeros(self.num_envs, 'f')
self.eplens = np.zeros(self.num_envs, 'i')
return obs
def step_wait(self):
obs, rews, dones, infos = self.venv.step_wait()
self.eprets += rews
self.eplens += 1
newinfos = list(infos[:])
for i in range(len(dones)):
if dones[i]:
info = infos[i].copy()
ret = self.eprets[i]
eplen = self.eplens[i]
epinfo = {'r': ret, 'l': eplen, 't': round(time.time() - self.tstart, 6)}
for k in self.info_keywords:
epinfo[k] = info[k]
info['episode'] = epinfo
if self.keep_buf:
self.epret_buf.append(ret)
self.eplen_buf.append(eplen)
self.epcount += 1
self.eprets[i] = 0
self.eplens[i] = 0
if self.results_writer:
self.results_writer.write_row(epinfo)
newinfos[i] = info
return obs, rews, dones, newinfos
| 1,971 | 34.214286 | 90 | py |
baselines | baselines-master/baselines/common/vec_env/dummy_vec_env.py | import numpy as np
from .vec_env import VecEnv
from .util import copy_obs_dict, dict_to_obs, obs_space_info
class DummyVecEnv(VecEnv):
"""
VecEnv that does runs multiple environments sequentially, that is,
the step and reset commands are send to one environment at a time.
Useful when debugging and when num_env == 1 (in the latter case,
avoids communication overhead)
"""
def __init__(self, env_fns):
"""
Arguments:
env_fns: iterable of callables functions that build environments
"""
self.envs = [fn() for fn in env_fns]
env = self.envs[0]
VecEnv.__init__(self, len(env_fns), env.observation_space, env.action_space)
obs_space = env.observation_space
self.keys, shapes, dtypes = obs_space_info(obs_space)
self.buf_obs = { k: np.zeros((self.num_envs,) + tuple(shapes[k]), dtype=dtypes[k]) for k in self.keys }
self.buf_dones = np.zeros((self.num_envs,), dtype=np.bool)
self.buf_rews = np.zeros((self.num_envs,), dtype=np.float32)
self.buf_infos = [{} for _ in range(self.num_envs)]
self.actions = None
self.spec = self.envs[0].spec
def step_async(self, actions):
listify = True
try:
if len(actions) == self.num_envs:
listify = False
except TypeError:
pass
if not listify:
self.actions = actions
else:
assert self.num_envs == 1, "actions {} is either not a list or has a wrong size - cannot match to {} environments".format(actions, self.num_envs)
self.actions = [actions]
def step_wait(self):
for e in range(self.num_envs):
action = self.actions[e]
# if isinstance(self.envs[e].action_space, spaces.Discrete):
# action = int(action)
obs, self.buf_rews[e], self.buf_dones[e], self.buf_infos[e] = self.envs[e].step(action)
if self.buf_dones[e]:
obs = self.envs[e].reset()
self._save_obs(e, obs)
return (self._obs_from_buf(), np.copy(self.buf_rews), np.copy(self.buf_dones),
self.buf_infos.copy())
def reset(self):
for e in range(self.num_envs):
obs = self.envs[e].reset()
self._save_obs(e, obs)
return self._obs_from_buf()
def _save_obs(self, e, obs):
for k in self.keys:
if k is None:
self.buf_obs[k][e] = obs
else:
self.buf_obs[k][e] = obs[k]
def _obs_from_buf(self):
return dict_to_obs(copy_obs_dict(self.buf_obs))
def get_images(self):
return [env.render(mode='rgb_array') for env in self.envs]
def render(self, mode='human'):
if self.num_envs == 1:
return self.envs[0].render(mode=mode)
else:
return super().render(mode=mode)
| 2,923 | 34.658537 | 157 | py |
baselines | baselines-master/baselines/common/vec_env/util.py | """
Helpers for dealing with vectorized environments.
"""
from collections import OrderedDict
import gym
import numpy as np
def copy_obs_dict(obs):
"""
Deep-copy an observation dict.
"""
return {k: np.copy(v) for k, v in obs.items()}
def dict_to_obs(obs_dict):
"""
Convert an observation dict into a raw array if the
original observation space was not a Dict space.
"""
if set(obs_dict.keys()) == {None}:
return obs_dict[None]
return obs_dict
def obs_space_info(obs_space):
"""
Get dict-structured information about a gym.Space.
Returns:
A tuple (keys, shapes, dtypes):
keys: a list of dict keys.
shapes: a dict mapping keys to shapes.
dtypes: a dict mapping keys to dtypes.
"""
if isinstance(obs_space, gym.spaces.Dict):
assert isinstance(obs_space.spaces, OrderedDict)
subspaces = obs_space.spaces
elif isinstance(obs_space, gym.spaces.Tuple):
assert isinstance(obs_space.spaces, tuple)
subspaces = {i: obs_space.spaces[i] for i in range(len(obs_space.spaces))}
else:
subspaces = {None: obs_space}
keys = []
shapes = {}
dtypes = {}
for key, box in subspaces.items():
keys.append(key)
shapes[key] = box.shape
dtypes[key] = box.dtype
return keys, shapes, dtypes
def obs_to_dict(obs):
"""
Convert an observation into a dict.
"""
if isinstance(obs, dict):
return obs
return {None: obs}
| 1,513 | 23.031746 | 82 | py |
baselines | baselines-master/baselines/common/vec_env/__init__.py | from .vec_env import AlreadySteppingError, NotSteppingError, VecEnv, VecEnvWrapper, VecEnvObservationWrapper, CloudpickleWrapper
from .dummy_vec_env import DummyVecEnv
from .shmem_vec_env import ShmemVecEnv
from .subproc_vec_env import SubprocVecEnv
from .vec_frame_stack import VecFrameStack
from .vec_monitor import VecMonitor
from .vec_normalize import VecNormalize
from .vec_remove_dict_obs import VecExtractDictObs
__all__ = ['AlreadySteppingError', 'NotSteppingError', 'VecEnv', 'VecEnvWrapper', 'VecEnvObservationWrapper', 'CloudpickleWrapper', 'DummyVecEnv', 'ShmemVecEnv', 'SubprocVecEnv', 'VecFrameStack', 'VecMonitor', 'VecNormalize', 'VecExtractDictObs']
| 668 | 59.818182 | 246 | py |
baselines | baselines-master/baselines/common/vec_env/subproc_vec_env.py | import multiprocessing as mp
import numpy as np
from .vec_env import VecEnv, CloudpickleWrapper, clear_mpi_env_vars
def worker(remote, parent_remote, env_fn_wrappers):
def step_env(env, action):
ob, reward, done, info = env.step(action)
if done:
ob = env.reset()
return ob, reward, done, info
parent_remote.close()
envs = [env_fn_wrapper() for env_fn_wrapper in env_fn_wrappers.x]
try:
while True:
cmd, data = remote.recv()
if cmd == 'step':
remote.send([step_env(env, action) for env, action in zip(envs, data)])
elif cmd == 'reset':
remote.send([env.reset() for env in envs])
elif cmd == 'render':
remote.send([env.render(mode='rgb_array') for env in envs])
elif cmd == 'close':
remote.close()
break
elif cmd == 'get_spaces_spec':
remote.send(CloudpickleWrapper((envs[0].observation_space, envs[0].action_space, envs[0].spec)))
else:
raise NotImplementedError
except KeyboardInterrupt:
print('SubprocVecEnv worker: got KeyboardInterrupt')
finally:
for env in envs:
env.close()
class SubprocVecEnv(VecEnv):
"""
VecEnv that runs multiple environments in parallel in subproceses and communicates with them via pipes.
Recommended to use when num_envs > 1 and step() can be a bottleneck.
"""
def __init__(self, env_fns, spaces=None, context='spawn', in_series=1):
"""
Arguments:
env_fns: iterable of callables - functions that create environments to run in subprocesses. Need to be cloud-pickleable
in_series: number of environments to run in series in a single process
(e.g. when len(env_fns) == 12 and in_series == 3, it will run 4 processes, each running 3 envs in series)
"""
self.waiting = False
self.closed = False
self.in_series = in_series
nenvs = len(env_fns)
assert nenvs % in_series == 0, "Number of envs must be divisible by number of envs to run in series"
self.nremotes = nenvs // in_series
env_fns = np.array_split(env_fns, self.nremotes)
ctx = mp.get_context(context)
self.remotes, self.work_remotes = zip(*[ctx.Pipe() for _ in range(self.nremotes)])
self.ps = [ctx.Process(target=worker, args=(work_remote, remote, CloudpickleWrapper(env_fn)))
for (work_remote, remote, env_fn) in zip(self.work_remotes, self.remotes, env_fns)]
for p in self.ps:
p.daemon = True # if the main process crashes, we should not cause things to hang
with clear_mpi_env_vars():
p.start()
for remote in self.work_remotes:
remote.close()
self.remotes[0].send(('get_spaces_spec', None))
observation_space, action_space, self.spec = self.remotes[0].recv().x
self.viewer = None
VecEnv.__init__(self, nenvs, observation_space, action_space)
def step_async(self, actions):
self._assert_not_closed()
actions = np.array_split(actions, self.nremotes)
for remote, action in zip(self.remotes, actions):
remote.send(('step', action))
self.waiting = True
def step_wait(self):
self._assert_not_closed()
results = [remote.recv() for remote in self.remotes]
results = _flatten_list(results)
self.waiting = False
obs, rews, dones, infos = zip(*results)
return _flatten_obs(obs), np.stack(rews), np.stack(dones), infos
def reset(self):
self._assert_not_closed()
for remote in self.remotes:
remote.send(('reset', None))
obs = [remote.recv() for remote in self.remotes]
obs = _flatten_list(obs)
return _flatten_obs(obs)
def close_extras(self):
self.closed = True
if self.waiting:
for remote in self.remotes:
remote.recv()
for remote in self.remotes:
remote.send(('close', None))
for p in self.ps:
p.join()
def get_images(self):
self._assert_not_closed()
for pipe in self.remotes:
pipe.send(('render', None))
imgs = [pipe.recv() for pipe in self.remotes]
imgs = _flatten_list(imgs)
return imgs
def _assert_not_closed(self):
assert not self.closed, "Trying to operate on a SubprocVecEnv after calling close()"
def __del__(self):
if not self.closed:
self.close()
def _flatten_obs(obs):
assert isinstance(obs, (list, tuple))
assert len(obs) > 0
if isinstance(obs[0], dict):
keys = obs[0].keys()
return {k: np.stack([o[k] for o in obs]) for k in keys}
else:
return np.stack(obs)
def _flatten_list(l):
assert isinstance(l, (list, tuple))
assert len(l) > 0
assert all([len(l_) > 0 for l_ in l])
return [l__ for l_ in l for l__ in l_]
| 5,069 | 35.47482 | 128 | py |
baselines | baselines-master/baselines/common/vec_env/test_video_recorder.py | """
Tests for asynchronous vectorized environments.
"""
import gym
import pytest
import os
import glob
import tempfile
from .dummy_vec_env import DummyVecEnv
from .shmem_vec_env import ShmemVecEnv
from .subproc_vec_env import SubprocVecEnv
from .vec_video_recorder import VecVideoRecorder
@pytest.mark.parametrize('klass', (DummyVecEnv, ShmemVecEnv, SubprocVecEnv))
@pytest.mark.parametrize('num_envs', (1, 4))
@pytest.mark.parametrize('video_length', (10, 100))
@pytest.mark.parametrize('video_interval', (1, 50))
def test_video_recorder(klass, num_envs, video_length, video_interval):
"""
Wrap an existing VecEnv with VevVideoRecorder,
Make (video_interval + video_length + 1) steps,
then check that the file is present
"""
def make_fn():
env = gym.make('PongNoFrameskip-v4')
return env
fns = [make_fn for _ in range(num_envs)]
env = klass(fns)
with tempfile.TemporaryDirectory() as video_path:
env = VecVideoRecorder(env, video_path, record_video_trigger=lambda x: x % video_interval == 0, video_length=video_length)
env.reset()
for _ in range(video_interval + video_length + 1):
env.step([0] * num_envs)
env.close()
recorded_video = glob.glob(os.path.join(video_path, "*.mp4"))
# first and second step
assert len(recorded_video) == 2
# Files are not empty
assert all(os.stat(p).st_size != 0 for p in recorded_video)
| 1,467 | 28.36 | 130 | py |
baselines | baselines-master/baselines/common/vec_env/shmem_vec_env.py | """
An interface for asynchronous vectorized environments.
"""
import multiprocessing as mp
import numpy as np
from .vec_env import VecEnv, CloudpickleWrapper, clear_mpi_env_vars
import ctypes
from baselines import logger
from .util import dict_to_obs, obs_space_info, obs_to_dict
_NP_TO_CT = {np.float32: ctypes.c_float,
np.int32: ctypes.c_int32,
np.int8: ctypes.c_int8,
np.uint8: ctypes.c_char,
np.bool: ctypes.c_bool}
class ShmemVecEnv(VecEnv):
"""
Optimized version of SubprocVecEnv that uses shared variables to communicate observations.
"""
def __init__(self, env_fns, spaces=None, context='spawn'):
"""
If you don't specify observation_space, we'll have to create a dummy
environment to get it.
"""
ctx = mp.get_context(context)
if spaces:
observation_space, action_space = spaces
else:
logger.log('Creating dummy env object to get spaces')
with logger.scoped_configure(format_strs=[]):
dummy = env_fns[0]()
observation_space, action_space = dummy.observation_space, dummy.action_space
dummy.close()
del dummy
VecEnv.__init__(self, len(env_fns), observation_space, action_space)
self.obs_keys, self.obs_shapes, self.obs_dtypes = obs_space_info(observation_space)
self.obs_bufs = [
{k: ctx.Array(_NP_TO_CT[self.obs_dtypes[k].type], int(np.prod(self.obs_shapes[k]))) for k in self.obs_keys}
for _ in env_fns]
self.parent_pipes = []
self.procs = []
with clear_mpi_env_vars():
for env_fn, obs_buf in zip(env_fns, self.obs_bufs):
wrapped_fn = CloudpickleWrapper(env_fn)
parent_pipe, child_pipe = ctx.Pipe()
proc = ctx.Process(target=_subproc_worker,
args=(child_pipe, parent_pipe, wrapped_fn, obs_buf, self.obs_shapes, self.obs_dtypes, self.obs_keys))
proc.daemon = True
self.procs.append(proc)
self.parent_pipes.append(parent_pipe)
proc.start()
child_pipe.close()
self.waiting_step = False
self.viewer = None
def reset(self):
if self.waiting_step:
logger.warn('Called reset() while waiting for the step to complete')
self.step_wait()
for pipe in self.parent_pipes:
pipe.send(('reset', None))
return self._decode_obses([pipe.recv() for pipe in self.parent_pipes])
def step_async(self, actions):
assert len(actions) == len(self.parent_pipes)
for pipe, act in zip(self.parent_pipes, actions):
pipe.send(('step', act))
self.waiting_step = True
def step_wait(self):
outs = [pipe.recv() for pipe in self.parent_pipes]
self.waiting_step = False
obs, rews, dones, infos = zip(*outs)
return self._decode_obses(obs), np.array(rews), np.array(dones), infos
def close_extras(self):
if self.waiting_step:
self.step_wait()
for pipe in self.parent_pipes:
pipe.send(('close', None))
for pipe in self.parent_pipes:
pipe.recv()
pipe.close()
for proc in self.procs:
proc.join()
def get_images(self, mode='human'):
for pipe in self.parent_pipes:
pipe.send(('render', None))
return [pipe.recv() for pipe in self.parent_pipes]
def _decode_obses(self, obs):
result = {}
for k in self.obs_keys:
bufs = [b[k] for b in self.obs_bufs]
o = [np.frombuffer(b.get_obj(), dtype=self.obs_dtypes[k]).reshape(self.obs_shapes[k]) for b in bufs]
result[k] = np.array(o)
return dict_to_obs(result)
def _subproc_worker(pipe, parent_pipe, env_fn_wrapper, obs_bufs, obs_shapes, obs_dtypes, keys):
"""
Control a single environment instance using IPC and
shared memory.
"""
def _write_obs(maybe_dict_obs):
flatdict = obs_to_dict(maybe_dict_obs)
for k in keys:
dst = obs_bufs[k].get_obj()
dst_np = np.frombuffer(dst, dtype=obs_dtypes[k]).reshape(obs_shapes[k]) # pylint: disable=W0212
np.copyto(dst_np, flatdict[k])
env = env_fn_wrapper.x()
parent_pipe.close()
try:
while True:
cmd, data = pipe.recv()
if cmd == 'reset':
pipe.send(_write_obs(env.reset()))
elif cmd == 'step':
obs, reward, done, info = env.step(data)
if done:
obs = env.reset()
pipe.send((_write_obs(obs), reward, done, info))
elif cmd == 'render':
pipe.send(env.render(mode='rgb_array'))
elif cmd == 'close':
pipe.send(None)
break
else:
raise RuntimeError('Got unrecognized cmd %s' % cmd)
except KeyboardInterrupt:
print('ShmemVecEnv worker: got KeyboardInterrupt')
finally:
env.close()
| 5,178 | 35.471831 | 129 | py |
baselines | baselines-master/baselines/common/vec_env/vec_frame_stack.py | from .vec_env import VecEnvWrapper
import numpy as np
from gym import spaces
class VecFrameStack(VecEnvWrapper):
def __init__(self, venv, nstack):
self.venv = venv
self.nstack = nstack
wos = venv.observation_space # wrapped ob space
low = np.repeat(wos.low, self.nstack, axis=-1)
high = np.repeat(wos.high, self.nstack, axis=-1)
self.stackedobs = np.zeros((venv.num_envs,) + low.shape, low.dtype)
observation_space = spaces.Box(low=low, high=high, dtype=venv.observation_space.dtype)
VecEnvWrapper.__init__(self, venv, observation_space=observation_space)
def step_wait(self):
obs, rews, news, infos = self.venv.step_wait()
self.stackedobs = np.roll(self.stackedobs, shift=-1, axis=-1)
for (i, new) in enumerate(news):
if new:
self.stackedobs[i] = 0
self.stackedobs[..., -obs.shape[-1]:] = obs
return self.stackedobs, rews, news, infos
def reset(self):
obs = self.venv.reset()
self.stackedobs[...] = 0
self.stackedobs[..., -obs.shape[-1]:] = obs
return self.stackedobs
| 1,150 | 36.129032 | 94 | py |
baselines | baselines-master/baselines/common/vec_env/vec_remove_dict_obs.py | from .vec_env import VecEnvObservationWrapper
class VecExtractDictObs(VecEnvObservationWrapper):
def __init__(self, venv, key):
self.key = key
super().__init__(venv=venv,
observation_space=venv.observation_space.spaces[self.key])
def process(self, obs):
return obs[self.key]
| 321 | 28.272727 | 70 | py |
baselines | baselines-master/baselines/ppo2/ppo2.py | import os
import time
import numpy as np
import os.path as osp
from baselines import logger
from collections import deque
from baselines.common import explained_variance, set_global_seeds
from baselines.common.policies import build_policy
try:
from mpi4py import MPI
except ImportError:
MPI = None
from baselines.ppo2.runner import Runner
def constfn(val):
def f(_):
return val
return f
def learn(*, network, env, total_timesteps, eval_env = None, seed=None, nsteps=2048, ent_coef=0.0, lr=3e-4,
vf_coef=0.5, max_grad_norm=0.5, gamma=0.99, lam=0.95,
log_interval=10, nminibatches=4, noptepochs=4, cliprange=0.2,
save_interval=0, load_path=None, model_fn=None, update_fn=None, init_fn=None, mpi_rank_weight=1, comm=None, **network_kwargs):
'''
Learn policy using PPO algorithm (https://arxiv.org/abs/1707.06347)
Parameters:
----------
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
See common/models.py/lstm for more details on using recurrent nets in policies
env: baselines.common.vec_env.VecEnv environment. Needs to be vectorized for parallel environment simulation.
The environments produced by gym.make can be wrapped using baselines.common.vec_env.DummyVecEnv class.
nsteps: int number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
nenv is number of environment copies simulated in parallel)
total_timesteps: int number of timesteps (i.e. number of actions taken in the environment)
ent_coef: float policy entropy coefficient in the optimization objective
lr: float or function learning rate, constant or a schedule function [0,1] -> R+ where 1 is beginning of the
training and 0 is the end of the training.
vf_coef: float value function loss coefficient in the optimization objective
max_grad_norm: float or None gradient norm clipping coefficient
gamma: float discounting factor
lam: float advantage estimation discounting factor (lambda in the paper)
log_interval: int number of timesteps between logging events
nminibatches: int number of training minibatches per update. For recurrent policies,
should be smaller or equal than number of environments run in parallel.
noptepochs: int number of training epochs per update
cliprange: float or function clipping range, constant or schedule function [0,1] -> R+ where 1 is beginning of the training
and 0 is the end of the training
save_interval: int number of timesteps between saving events
load_path: str path to load the model from
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
'''
set_global_seeds(seed)
if isinstance(lr, float): lr = constfn(lr)
else: assert callable(lr)
if isinstance(cliprange, float): cliprange = constfn(cliprange)
else: assert callable(cliprange)
total_timesteps = int(total_timesteps)
policy = build_policy(env, network, **network_kwargs)
# Get the nb of env
nenvs = env.num_envs
# Get state_space and action_space
ob_space = env.observation_space
ac_space = env.action_space
# Calculate the batch_size
nbatch = nenvs * nsteps
nbatch_train = nbatch // nminibatches
is_mpi_root = (MPI is None or MPI.COMM_WORLD.Get_rank() == 0)
# Instantiate the model object (that creates act_model and train_model)
if model_fn is None:
from baselines.ppo2.model import Model
model_fn = Model
model = model_fn(policy=policy, ob_space=ob_space, ac_space=ac_space, nbatch_act=nenvs, nbatch_train=nbatch_train,
nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
max_grad_norm=max_grad_norm, comm=comm, mpi_rank_weight=mpi_rank_weight)
if load_path is not None:
model.load(load_path)
# Instantiate the runner object
runner = Runner(env=env, model=model, nsteps=nsteps, gamma=gamma, lam=lam)
if eval_env is not None:
eval_runner = Runner(env = eval_env, model = model, nsteps = nsteps, gamma = gamma, lam= lam)
epinfobuf = deque(maxlen=100)
if eval_env is not None:
eval_epinfobuf = deque(maxlen=100)
if init_fn is not None:
init_fn()
# Start total timer
tfirststart = time.perf_counter()
nupdates = total_timesteps//nbatch
for update in range(1, nupdates+1):
assert nbatch % nminibatches == 0
# Start timer
tstart = time.perf_counter()
frac = 1.0 - (update - 1.0) / nupdates
# Calculate the learning rate
lrnow = lr(frac)
# Calculate the cliprange
cliprangenow = cliprange(frac)
if update % log_interval == 0 and is_mpi_root: logger.info('Stepping environment...')
# Get minibatch
obs, returns, masks, actions, values, neglogpacs, states, epinfos = runner.run() #pylint: disable=E0632
if eval_env is not None:
eval_obs, eval_returns, eval_masks, eval_actions, eval_values, eval_neglogpacs, eval_states, eval_epinfos = eval_runner.run() #pylint: disable=E0632
if update % log_interval == 0 and is_mpi_root: logger.info('Done.')
epinfobuf.extend(epinfos)
if eval_env is not None:
eval_epinfobuf.extend(eval_epinfos)
# Here what we're going to do is for each minibatch calculate the loss and append it.
mblossvals = []
if states is None: # nonrecurrent version
# Index of each element of batch_size
# Create the indices array
inds = np.arange(nbatch)
for _ in range(noptepochs):
# Randomize the indexes
np.random.shuffle(inds)
# 0 to batch_size with batch_train_size step
for start in range(0, nbatch, nbatch_train):
end = start + nbatch_train
mbinds = inds[start:end]
slices = (arr[mbinds] for arr in (obs, returns, masks, actions, values, neglogpacs))
mblossvals.append(model.train(lrnow, cliprangenow, *slices))
else: # recurrent version
assert nenvs % nminibatches == 0
envsperbatch = nenvs // nminibatches
envinds = np.arange(nenvs)
flatinds = np.arange(nenvs * nsteps).reshape(nenvs, nsteps)
for _ in range(noptepochs):
np.random.shuffle(envinds)
for start in range(0, nenvs, envsperbatch):
end = start + envsperbatch
mbenvinds = envinds[start:end]
mbflatinds = flatinds[mbenvinds].ravel()
slices = (arr[mbflatinds] for arr in (obs, returns, masks, actions, values, neglogpacs))
mbstates = states[mbenvinds]
mblossvals.append(model.train(lrnow, cliprangenow, *slices, mbstates))
# Feedforward --> get losses --> update
lossvals = np.mean(mblossvals, axis=0)
# End timer
tnow = time.perf_counter()
# Calculate the fps (frame per second)
fps = int(nbatch / (tnow - tstart))
if update_fn is not None:
update_fn(update)
if update % log_interval == 0 or update == 1:
# Calculates if value function is a good predicator of the returns (ev > 1)
# or if it's just worse than predicting nothing (ev =< 0)
ev = explained_variance(values, returns)
logger.logkv("misc/serial_timesteps", update*nsteps)
logger.logkv("misc/nupdates", update)
logger.logkv("misc/total_timesteps", update*nbatch)
logger.logkv("fps", fps)
logger.logkv("misc/explained_variance", float(ev))
logger.logkv('eprewmean', safemean([epinfo['r'] for epinfo in epinfobuf]))
logger.logkv('eplenmean', safemean([epinfo['l'] for epinfo in epinfobuf]))
if eval_env is not None:
logger.logkv('eval_eprewmean', safemean([epinfo['r'] for epinfo in eval_epinfobuf]) )
logger.logkv('eval_eplenmean', safemean([epinfo['l'] for epinfo in eval_epinfobuf]) )
logger.logkv('misc/time_elapsed', tnow - tfirststart)
for (lossval, lossname) in zip(lossvals, model.loss_names):
logger.logkv('loss/' + lossname, lossval)
logger.dumpkvs()
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir() and is_mpi_root:
checkdir = osp.join(logger.get_dir(), 'checkpoints')
os.makedirs(checkdir, exist_ok=True)
savepath = osp.join(checkdir, '%.5i'%update)
print('Saving to', savepath)
model.save(savepath)
return model
# Avoid division error when calculate the mean (in our case if epinfo is empty returns np.nan, not return an error)
def safemean(xs):
return np.nan if len(xs) == 0 else np.mean(xs)
| 10,229 | 44.466667 | 184 | py |
baselines | baselines-master/baselines/ppo2/microbatched_model.py | import tensorflow as tf
import numpy as np
from baselines.ppo2.model import Model
class MicrobatchedModel(Model):
"""
Model that does training one microbatch at a time - when gradient computation
on the entire minibatch causes some overflow
"""
def __init__(self, *, policy, ob_space, ac_space, nbatch_act, nbatch_train,
nsteps, ent_coef, vf_coef, max_grad_norm, mpi_rank_weight, comm, microbatch_size):
self.nmicrobatches = nbatch_train // microbatch_size
self.microbatch_size = microbatch_size
assert nbatch_train % microbatch_size == 0, 'microbatch_size ({}) should divide nbatch_train ({}) evenly'.format(microbatch_size, nbatch_train)
super().__init__(
policy=policy,
ob_space=ob_space,
ac_space=ac_space,
nbatch_act=nbatch_act,
nbatch_train=microbatch_size,
nsteps=nsteps,
ent_coef=ent_coef,
vf_coef=vf_coef,
max_grad_norm=max_grad_norm,
mpi_rank_weight=mpi_rank_weight,
comm=comm)
self.grads_ph = [tf.placeholder(dtype=g.dtype, shape=g.shape) for g in self.grads]
grads_ph_and_vars = list(zip(self.grads_ph, self.var))
self._apply_gradients_op = self.trainer.apply_gradients(grads_ph_and_vars)
def train(self, lr, cliprange, obs, returns, masks, actions, values, neglogpacs, states=None):
assert states is None, "microbatches with recurrent models are not supported yet"
# Here we calculate advantage A(s,a) = R + yV(s') - V(s)
# Returns = R + yV(s')
advs = returns - values
# Normalize the advantages
advs = (advs - advs.mean()) / (advs.std() + 1e-8)
# Initialize empty list for per-microbatch stats like pg_loss, vf_loss, entropy, approxkl (whatever is in self.stats_list)
stats_vs = []
for microbatch_idx in range(self.nmicrobatches):
_sli = range(microbatch_idx * self.microbatch_size, (microbatch_idx+1) * self.microbatch_size)
td_map = {
self.train_model.X: obs[_sli],
self.A:actions[_sli],
self.ADV:advs[_sli],
self.R:returns[_sli],
self.CLIPRANGE:cliprange,
self.OLDNEGLOGPAC:neglogpacs[_sli],
self.OLDVPRED:values[_sli]
}
# Compute gradient on a microbatch (note that variables do not change here) ...
grad_v, stats_v = self.sess.run([self.grads, self.stats_list], td_map)
if microbatch_idx == 0:
sum_grad_v = grad_v
else:
# .. and add to the total of the gradients
for i, g in enumerate(grad_v):
sum_grad_v[i] += g
stats_vs.append(stats_v)
feed_dict = {ph: sum_g / self.nmicrobatches for ph, sum_g in zip(self.grads_ph, sum_grad_v)}
feed_dict[self.LR] = lr
# Update variables using average of the gradients
self.sess.run(self._apply_gradients_op, feed_dict)
# Return average of the stats
return np.mean(np.array(stats_vs), axis=0).tolist()
| 3,241 | 40.037975 | 151 | py |
baselines | baselines-master/baselines/ppo2/test_microbatches.py | import gym
import tensorflow as tf
import numpy as np
from functools import partial
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
from baselines.common.tf_util import make_session
from baselines.ppo2.ppo2 import learn
from baselines.ppo2.microbatched_model import MicrobatchedModel
def test_microbatches():
def env_fn():
env = gym.make('CartPole-v0')
env.seed(0)
return env
learn_fn = partial(learn, network='mlp', nsteps=32, total_timesteps=32, seed=0)
env_ref = DummyVecEnv([env_fn])
sess_ref = make_session(make_default=True, graph=tf.Graph())
learn_fn(env=env_ref)
vars_ref = {v.name: sess_ref.run(v) for v in tf.trainable_variables()}
env_test = DummyVecEnv([env_fn])
sess_test = make_session(make_default=True, graph=tf.Graph())
learn_fn(env=env_test, model_fn=partial(MicrobatchedModel, microbatch_size=2))
# learn_fn(env=env_test)
vars_test = {v.name: sess_test.run(v) for v in tf.trainable_variables()}
for v in vars_ref:
np.testing.assert_allclose(vars_ref[v], vars_test[v], atol=3e-3)
if __name__ == '__main__':
test_microbatches()
| 1,152 | 31.027778 | 83 | py |
baselines | baselines-master/baselines/ppo2/model.py | import tensorflow as tf
import functools
from baselines.common.tf_util import get_session, save_variables, load_variables
from baselines.common.tf_util import initialize
try:
from baselines.common.mpi_adam_optimizer import MpiAdamOptimizer
from mpi4py import MPI
from baselines.common.mpi_util import sync_from_root
except ImportError:
MPI = None
class Model(object):
"""
We use this object to :
__init__:
- Creates the step_model
- Creates the train_model
train():
- Make the training part (feedforward and retropropagation of gradients)
save/load():
- Save load the model
"""
def __init__(self, *, policy, ob_space, ac_space, nbatch_act, nbatch_train,
nsteps, ent_coef, vf_coef, max_grad_norm, mpi_rank_weight=1, comm=None, microbatch_size=None):
self.sess = sess = get_session()
if MPI is not None and comm is None:
comm = MPI.COMM_WORLD
with tf.variable_scope('ppo2_model', reuse=tf.AUTO_REUSE):
# CREATE OUR TWO MODELS
# act_model that is used for sampling
act_model = policy(nbatch_act, 1, sess)
# Train model for training
if microbatch_size is None:
train_model = policy(nbatch_train, nsteps, sess)
else:
train_model = policy(microbatch_size, nsteps, sess)
# CREATE THE PLACEHOLDERS
self.A = A = train_model.pdtype.sample_placeholder([None])
self.ADV = ADV = tf.placeholder(tf.float32, [None])
self.R = R = tf.placeholder(tf.float32, [None])
# Keep track of old actor
self.OLDNEGLOGPAC = OLDNEGLOGPAC = tf.placeholder(tf.float32, [None])
# Keep track of old critic
self.OLDVPRED = OLDVPRED = tf.placeholder(tf.float32, [None])
self.LR = LR = tf.placeholder(tf.float32, [])
# Cliprange
self.CLIPRANGE = CLIPRANGE = tf.placeholder(tf.float32, [])
neglogpac = train_model.pd.neglogp(A)
# Calculate the entropy
# Entropy is used to improve exploration by limiting the premature convergence to suboptimal policy.
entropy = tf.reduce_mean(train_model.pd.entropy())
# CALCULATE THE LOSS
# Total loss = Policy gradient loss - entropy * entropy coefficient + Value coefficient * value loss
# Clip the value to reduce variability during Critic training
# Get the predicted value
vpred = train_model.vf
vpredclipped = OLDVPRED + tf.clip_by_value(train_model.vf - OLDVPRED, - CLIPRANGE, CLIPRANGE)
# Unclipped value
vf_losses1 = tf.square(vpred - R)
# Clipped value
vf_losses2 = tf.square(vpredclipped - R)
vf_loss = .5 * tf.reduce_mean(tf.maximum(vf_losses1, vf_losses2))
# Calculate ratio (pi current policy / pi old policy)
ratio = tf.exp(OLDNEGLOGPAC - neglogpac)
# Defining Loss = - J is equivalent to max J
pg_losses = -ADV * ratio
pg_losses2 = -ADV * tf.clip_by_value(ratio, 1.0 - CLIPRANGE, 1.0 + CLIPRANGE)
# Final PG loss
pg_loss = tf.reduce_mean(tf.maximum(pg_losses, pg_losses2))
approxkl = .5 * tf.reduce_mean(tf.square(neglogpac - OLDNEGLOGPAC))
clipfrac = tf.reduce_mean(tf.to_float(tf.greater(tf.abs(ratio - 1.0), CLIPRANGE)))
# Total loss
loss = pg_loss - entropy * ent_coef + vf_loss * vf_coef
# UPDATE THE PARAMETERS USING LOSS
# 1. Get the model parameters
params = tf.trainable_variables('ppo2_model')
# 2. Build our trainer
if comm is not None and comm.Get_size() > 1:
self.trainer = MpiAdamOptimizer(comm, learning_rate=LR, mpi_rank_weight=mpi_rank_weight, epsilon=1e-5)
else:
self.trainer = tf.train.AdamOptimizer(learning_rate=LR, epsilon=1e-5)
# 3. Calculate the gradients
grads_and_var = self.trainer.compute_gradients(loss, params)
grads, var = zip(*grads_and_var)
if max_grad_norm is not None:
# Clip the gradients (normalize)
grads, _grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
grads_and_var = list(zip(grads, var))
# zip aggregate each gradient with parameters associated
# For instance zip(ABCD, xyza) => Ax, By, Cz, Da
self.grads = grads
self.var = var
self._train_op = self.trainer.apply_gradients(grads_and_var)
self.loss_names = ['policy_loss', 'value_loss', 'policy_entropy', 'approxkl', 'clipfrac']
self.stats_list = [pg_loss, vf_loss, entropy, approxkl, clipfrac]
self.train_model = train_model
self.act_model = act_model
self.step = act_model.step
self.value = act_model.value
self.initial_state = act_model.initial_state
self.save = functools.partial(save_variables, sess=sess)
self.load = functools.partial(load_variables, sess=sess)
initialize()
global_variables = tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope="")
if MPI is not None:
sync_from_root(sess, global_variables, comm=comm) #pylint: disable=E1101
def train(self, lr, cliprange, obs, returns, masks, actions, values, neglogpacs, states=None):
# Here we calculate advantage A(s,a) = R + yV(s') - V(s)
# Returns = R + yV(s')
advs = returns - values
# Normalize the advantages
advs = (advs - advs.mean()) / (advs.std() + 1e-8)
td_map = {
self.train_model.X : obs,
self.A : actions,
self.ADV : advs,
self.R : returns,
self.LR : lr,
self.CLIPRANGE : cliprange,
self.OLDNEGLOGPAC : neglogpacs,
self.OLDVPRED : values
}
if states is not None:
td_map[self.train_model.S] = states
td_map[self.train_model.M] = masks
return self.sess.run(
self.stats_list + [self._train_op],
td_map
)[:-1]
| 6,054 | 36.84375 | 114 | py |
baselines | baselines-master/baselines/ppo2/defaults.py | def mujoco():
return dict(
nsteps=2048,
nminibatches=32,
lam=0.95,
gamma=0.99,
noptepochs=10,
log_interval=1,
ent_coef=0.0,
lr=lambda f: 3e-4 * f,
cliprange=0.2,
value_network='copy'
)
def atari():
return dict(
nsteps=128, nminibatches=4,
lam=0.95, gamma=0.99, noptepochs=4, log_interval=1,
ent_coef=.01,
lr=lambda f : f * 2.5e-4,
cliprange=0.1,
)
def retro():
return atari()
| 518 | 18.961538 | 59 | py |
baselines | baselines-master/baselines/ppo2/runner.py | import numpy as np
from baselines.common.runners import AbstractEnvRunner
class Runner(AbstractEnvRunner):
"""
We use this object to make a mini batch of experiences
__init__:
- Initialize the runner
run():
- Make a mini batch
"""
def __init__(self, *, env, model, nsteps, gamma, lam):
super().__init__(env=env, model=model, nsteps=nsteps)
# Lambda used in GAE (General Advantage Estimation)
self.lam = lam
# Discount rate
self.gamma = gamma
def run(self):
# Here, we init the lists that will contain the mb of experiences
mb_obs, mb_rewards, mb_actions, mb_values, mb_dones, mb_neglogpacs = [],[],[],[],[],[]
mb_states = self.states
epinfos = []
# For n in range number of steps
for _ in range(self.nsteps):
# Given observations, get action value and neglopacs
# We already have self.obs because Runner superclass run self.obs[:] = env.reset() on init
actions, values, self.states, neglogpacs = self.model.step(self.obs, S=self.states, M=self.dones)
mb_obs.append(self.obs.copy())
mb_actions.append(actions)
mb_values.append(values)
mb_neglogpacs.append(neglogpacs)
mb_dones.append(self.dones)
# Take actions in env and look the results
# Infos contains a ton of useful informations
self.obs[:], rewards, self.dones, infos = self.env.step(actions)
for info in infos:
maybeepinfo = info.get('episode')
if maybeepinfo: epinfos.append(maybeepinfo)
mb_rewards.append(rewards)
#batch of steps to batch of rollouts
mb_obs = np.asarray(mb_obs, dtype=self.obs.dtype)
mb_rewards = np.asarray(mb_rewards, dtype=np.float32)
mb_actions = np.asarray(mb_actions)
mb_values = np.asarray(mb_values, dtype=np.float32)
mb_neglogpacs = np.asarray(mb_neglogpacs, dtype=np.float32)
mb_dones = np.asarray(mb_dones, dtype=np.bool)
last_values = self.model.value(self.obs, S=self.states, M=self.dones)
# discount/bootstrap off value fn
mb_returns = np.zeros_like(mb_rewards)
mb_advs = np.zeros_like(mb_rewards)
lastgaelam = 0
for t in reversed(range(self.nsteps)):
if t == self.nsteps - 1:
nextnonterminal = 1.0 - self.dones
nextvalues = last_values
else:
nextnonterminal = 1.0 - mb_dones[t+1]
nextvalues = mb_values[t+1]
delta = mb_rewards[t] + self.gamma * nextvalues * nextnonterminal - mb_values[t]
mb_advs[t] = lastgaelam = delta + self.gamma * self.lam * nextnonterminal * lastgaelam
mb_returns = mb_advs + mb_values
return (*map(sf01, (mb_obs, mb_returns, mb_dones, mb_actions, mb_values, mb_neglogpacs)),
mb_states, epinfos)
# obs, returns, masks, actions, values, neglogpacs, states = runner.run()
def sf01(arr):
"""
swap and then flatten axes 0 and 1
"""
s = arr.shape
return arr.swapaxes(0, 1).reshape(s[0] * s[1], *s[2:])
| 3,194 | 40.493506 | 109 | py |
baselines | baselines-master/baselines/ppo2/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/a2c/a2c.py | import time
import functools
import tensorflow as tf
from baselines import logger
from baselines.common import set_global_seeds, explained_variance
from baselines.common import tf_util
from baselines.common.policies import build_policy
from baselines.a2c.utils import Scheduler, find_trainable_variables
from baselines.a2c.runner import Runner
from baselines.ppo2.ppo2 import safemean
from collections import deque
from tensorflow import losses
class Model(object):
"""
We use this class to :
__init__:
- Creates the step_model
- Creates the train_model
train():
- Make the training part (feedforward and retropropagation of gradients)
save/load():
- Save load the model
"""
def __init__(self, policy, env, nsteps,
ent_coef=0.01, vf_coef=0.5, max_grad_norm=0.5, lr=7e-4,
alpha=0.99, epsilon=1e-5, total_timesteps=int(80e6), lrschedule='linear'):
sess = tf_util.get_session()
nenvs = env.num_envs
nbatch = nenvs*nsteps
with tf.variable_scope('a2c_model', reuse=tf.AUTO_REUSE):
# step_model is used for sampling
step_model = policy(nenvs, 1, sess)
# train_model is used to train our network
train_model = policy(nbatch, nsteps, sess)
A = tf.placeholder(train_model.action.dtype, train_model.action.shape)
ADV = tf.placeholder(tf.float32, [nbatch])
R = tf.placeholder(tf.float32, [nbatch])
LR = tf.placeholder(tf.float32, [])
# Calculate the loss
# Total loss = Policy gradient loss - entropy * entropy coefficient + Value coefficient * value loss
# Policy loss
neglogpac = train_model.pd.neglogp(A)
# L = A(s,a) * -logpi(a|s)
pg_loss = tf.reduce_mean(ADV * neglogpac)
# Entropy is used to improve exploration by limiting the premature convergence to suboptimal policy.
entropy = tf.reduce_mean(train_model.pd.entropy())
# Value loss
vf_loss = losses.mean_squared_error(tf.squeeze(train_model.vf), R)
loss = pg_loss - entropy*ent_coef + vf_loss * vf_coef
# Update parameters using loss
# 1. Get the model parameters
params = find_trainable_variables("a2c_model")
# 2. Calculate the gradients
grads = tf.gradients(loss, params)
if max_grad_norm is not None:
# Clip the gradients (normalize)
grads, grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
grads = list(zip(grads, params))
# zip aggregate each gradient with parameters associated
# For instance zip(ABCD, xyza) => Ax, By, Cz, Da
# 3. Make op for one policy and value update step of A2C
trainer = tf.train.RMSPropOptimizer(learning_rate=LR, decay=alpha, epsilon=epsilon)
_train = trainer.apply_gradients(grads)
lr = Scheduler(v=lr, nvalues=total_timesteps, schedule=lrschedule)
def train(obs, states, rewards, masks, actions, values):
# Here we calculate advantage A(s,a) = R + yV(s') - V(s)
# rewards = R + yV(s')
advs = rewards - values
for step in range(len(obs)):
cur_lr = lr.value()
td_map = {train_model.X:obs, A:actions, ADV:advs, R:rewards, LR:cur_lr}
if states is not None:
td_map[train_model.S] = states
td_map[train_model.M] = masks
policy_loss, value_loss, policy_entropy, _ = sess.run(
[pg_loss, vf_loss, entropy, _train],
td_map
)
return policy_loss, value_loss, policy_entropy
self.train = train
self.train_model = train_model
self.step_model = step_model
self.step = step_model.step
self.value = step_model.value
self.initial_state = step_model.initial_state
self.save = functools.partial(tf_util.save_variables, sess=sess)
self.load = functools.partial(tf_util.load_variables, sess=sess)
tf.global_variables_initializer().run(session=sess)
def learn(
network,
env,
seed=None,
nsteps=5,
total_timesteps=int(80e6),
vf_coef=0.5,
ent_coef=0.01,
max_grad_norm=0.5,
lr=7e-4,
lrschedule='linear',
epsilon=1e-5,
alpha=0.99,
gamma=0.99,
log_interval=100,
load_path=None,
**network_kwargs):
'''
Main entrypoint for A2C algorithm. Train a policy with given network architecture on a given environment using a2c algorithm.
Parameters:
-----------
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
env: RL environment. Should implement interface similar to VecEnv (baselines.common/vec_env) or be wrapped with DummyVecEnv (baselines.common/vec_env/dummy_vec_env.py)
seed: seed to make random number sequence in the alorightm reproducible. By default is None which means seed from system noise generator (not reproducible)
nsteps: int, number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
nenv is number of environment copies simulated in parallel)
total_timesteps: int, total number of timesteps to train on (default: 80M)
vf_coef: float, coefficient in front of value function loss in the total loss function (default: 0.5)
ent_coef: float, coeffictiant in front of the policy entropy in the total loss function (default: 0.01)
max_gradient_norm: float, gradient is clipped to have global L2 norm no more than this value (default: 0.5)
lr: float, learning rate for RMSProp (current implementation has RMSProp hardcoded in) (default: 7e-4)
lrschedule: schedule of learning rate. Can be 'linear', 'constant', or a function [0..1] -> [0..1] that takes fraction of the training progress as input and
returns fraction of the learning rate (specified as lr) as output
epsilon: float, RMSProp epsilon (stabilizes square root computation in denominator of RMSProp update) (default: 1e-5)
alpha: float, RMSProp decay parameter (default: 0.99)
gamma: float, reward discounting parameter (default: 0.99)
log_interval: int, specifies how frequently the logs are printed out (default: 100)
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
'''
set_global_seeds(seed)
# Get the nb of env
nenvs = env.num_envs
policy = build_policy(env, network, **network_kwargs)
# Instantiate the model object (that creates step_model and train_model)
model = Model(policy=policy, env=env, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
max_grad_norm=max_grad_norm, lr=lr, alpha=alpha, epsilon=epsilon, total_timesteps=total_timesteps, lrschedule=lrschedule)
if load_path is not None:
model.load(load_path)
# Instantiate the runner object
runner = Runner(env, model, nsteps=nsteps, gamma=gamma)
epinfobuf = deque(maxlen=100)
# Calculate the batch_size
nbatch = nenvs*nsteps
# Start total timer
tstart = time.time()
for update in range(1, total_timesteps//nbatch+1):
# Get mini batch of experiences
obs, states, rewards, masks, actions, values, epinfos = runner.run()
epinfobuf.extend(epinfos)
policy_loss, value_loss, policy_entropy = model.train(obs, states, rewards, masks, actions, values)
nseconds = time.time()-tstart
# Calculate the fps (frame per second)
fps = int((update*nbatch)/nseconds)
if update % log_interval == 0 or update == 1:
# Calculates if value function is a good predicator of the returns (ev > 1)
# or if it's just worse than predicting nothing (ev =< 0)
ev = explained_variance(values, rewards)
logger.record_tabular("nupdates", update)
logger.record_tabular("total_timesteps", update*nbatch)
logger.record_tabular("fps", fps)
logger.record_tabular("policy_entropy", float(policy_entropy))
logger.record_tabular("value_loss", float(value_loss))
logger.record_tabular("explained_variance", float(ev))
logger.record_tabular("eprewmean", safemean([epinfo['r'] for epinfo in epinfobuf]))
logger.record_tabular("eplenmean", safemean([epinfo['l'] for epinfo in epinfobuf]))
logger.dump_tabular()
return model
| 9,451 | 39.566524 | 186 | py |
baselines | baselines-master/baselines/a2c/utils.py | import os
import numpy as np
import tensorflow as tf
from collections import deque
def sample(logits):
noise = tf.random_uniform(tf.shape(logits))
return tf.argmax(logits - tf.log(-tf.log(noise)), 1)
def cat_entropy(logits):
a0 = logits - tf.reduce_max(logits, 1, keepdims=True)
ea0 = tf.exp(a0)
z0 = tf.reduce_sum(ea0, 1, keepdims=True)
p0 = ea0 / z0
return tf.reduce_sum(p0 * (tf.log(z0) - a0), 1)
def cat_entropy_softmax(p0):
return - tf.reduce_sum(p0 * tf.log(p0 + 1e-6), axis = 1)
def ortho_init(scale=1.0):
def _ortho_init(shape, dtype, partition_info=None):
#lasagne ortho init for tf
shape = tuple(shape)
if len(shape) == 2:
flat_shape = shape
elif len(shape) == 4: # assumes NHWC
flat_shape = (np.prod(shape[:-1]), shape[-1])
else:
raise NotImplementedError
a = np.random.normal(0.0, 1.0, flat_shape)
u, _, v = np.linalg.svd(a, full_matrices=False)
q = u if u.shape == flat_shape else v # pick the one with the correct shape
q = q.reshape(shape)
return (scale * q[:shape[0], :shape[1]]).astype(np.float32)
return _ortho_init
def conv(x, scope, *, nf, rf, stride, pad='VALID', init_scale=1.0, data_format='NHWC', one_dim_bias=False):
if data_format == 'NHWC':
channel_ax = 3
strides = [1, stride, stride, 1]
bshape = [1, 1, 1, nf]
elif data_format == 'NCHW':
channel_ax = 1
strides = [1, 1, stride, stride]
bshape = [1, nf, 1, 1]
else:
raise NotImplementedError
bias_var_shape = [nf] if one_dim_bias else [1, nf, 1, 1]
nin = x.get_shape()[channel_ax].value
wshape = [rf, rf, nin, nf]
with tf.variable_scope(scope):
w = tf.get_variable("w", wshape, initializer=ortho_init(init_scale))
b = tf.get_variable("b", bias_var_shape, initializer=tf.constant_initializer(0.0))
if not one_dim_bias and data_format == 'NHWC':
b = tf.reshape(b, bshape)
return tf.nn.conv2d(x, w, strides=strides, padding=pad, data_format=data_format) + b
def fc(x, scope, nh, *, init_scale=1.0, init_bias=0.0):
with tf.variable_scope(scope):
nin = x.get_shape()[1].value
w = tf.get_variable("w", [nin, nh], initializer=ortho_init(init_scale))
b = tf.get_variable("b", [nh], initializer=tf.constant_initializer(init_bias))
return tf.matmul(x, w)+b
def batch_to_seq(h, nbatch, nsteps, flat=False):
if flat:
h = tf.reshape(h, [nbatch, nsteps])
else:
h = tf.reshape(h, [nbatch, nsteps, -1])
return [tf.squeeze(v, [1]) for v in tf.split(axis=1, num_or_size_splits=nsteps, value=h)]
def seq_to_batch(h, flat = False):
shape = h[0].get_shape().as_list()
if not flat:
assert(len(shape) > 1)
nh = h[0].get_shape()[-1].value
return tf.reshape(tf.concat(axis=1, values=h), [-1, nh])
else:
return tf.reshape(tf.stack(values=h, axis=1), [-1])
def lstm(xs, ms, s, scope, nh, init_scale=1.0):
nbatch, nin = [v.value for v in xs[0].get_shape()]
with tf.variable_scope(scope):
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
wh = tf.get_variable("wh", [nh, nh*4], initializer=ortho_init(init_scale))
b = tf.get_variable("b", [nh*4], initializer=tf.constant_initializer(0.0))
c, h = tf.split(axis=1, num_or_size_splits=2, value=s)
for idx, (x, m) in enumerate(zip(xs, ms)):
c = c*(1-m)
h = h*(1-m)
z = tf.matmul(x, wx) + tf.matmul(h, wh) + b
i, f, o, u = tf.split(axis=1, num_or_size_splits=4, value=z)
i = tf.nn.sigmoid(i)
f = tf.nn.sigmoid(f)
o = tf.nn.sigmoid(o)
u = tf.tanh(u)
c = f*c + i*u
h = o*tf.tanh(c)
xs[idx] = h
s = tf.concat(axis=1, values=[c, h])
return xs, s
def _ln(x, g, b, e=1e-5, axes=[1]):
u, s = tf.nn.moments(x, axes=axes, keep_dims=True)
x = (x-u)/tf.sqrt(s+e)
x = x*g+b
return x
def lnlstm(xs, ms, s, scope, nh, init_scale=1.0):
nbatch, nin = [v.value for v in xs[0].get_shape()]
with tf.variable_scope(scope):
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
gx = tf.get_variable("gx", [nh*4], initializer=tf.constant_initializer(1.0))
bx = tf.get_variable("bx", [nh*4], initializer=tf.constant_initializer(0.0))
wh = tf.get_variable("wh", [nh, nh*4], initializer=ortho_init(init_scale))
gh = tf.get_variable("gh", [nh*4], initializer=tf.constant_initializer(1.0))
bh = tf.get_variable("bh", [nh*4], initializer=tf.constant_initializer(0.0))
b = tf.get_variable("b", [nh*4], initializer=tf.constant_initializer(0.0))
gc = tf.get_variable("gc", [nh], initializer=tf.constant_initializer(1.0))
bc = tf.get_variable("bc", [nh], initializer=tf.constant_initializer(0.0))
c, h = tf.split(axis=1, num_or_size_splits=2, value=s)
for idx, (x, m) in enumerate(zip(xs, ms)):
c = c*(1-m)
h = h*(1-m)
z = _ln(tf.matmul(x, wx), gx, bx) + _ln(tf.matmul(h, wh), gh, bh) + b
i, f, o, u = tf.split(axis=1, num_or_size_splits=4, value=z)
i = tf.nn.sigmoid(i)
f = tf.nn.sigmoid(f)
o = tf.nn.sigmoid(o)
u = tf.tanh(u)
c = f*c + i*u
h = o*tf.tanh(_ln(c, gc, bc))
xs[idx] = h
s = tf.concat(axis=1, values=[c, h])
return xs, s
def conv_to_fc(x):
nh = np.prod([v.value for v in x.get_shape()[1:]])
x = tf.reshape(x, [-1, nh])
return x
def discount_with_dones(rewards, dones, gamma):
discounted = []
r = 0
for reward, done in zip(rewards[::-1], dones[::-1]):
r = reward + gamma*r*(1.-done) # fixed off by one bug
discounted.append(r)
return discounted[::-1]
def find_trainable_variables(key):
return tf.trainable_variables(key)
def make_path(f):
return os.makedirs(f, exist_ok=True)
def constant(p):
return 1
def linear(p):
return 1-p
def middle_drop(p):
eps = 0.75
if 1-p<eps:
return eps*0.1
return 1-p
def double_linear_con(p):
p *= 2
eps = 0.125
if 1-p<eps:
return eps
return 1-p
def double_middle_drop(p):
eps1 = 0.75
eps2 = 0.25
if 1-p<eps1:
if 1-p<eps2:
return eps2*0.5
return eps1*0.1
return 1-p
schedules = {
'linear':linear,
'constant':constant,
'double_linear_con': double_linear_con,
'middle_drop': middle_drop,
'double_middle_drop': double_middle_drop
}
class Scheduler(object):
def __init__(self, v, nvalues, schedule):
self.n = 0.
self.v = v
self.nvalues = nvalues
self.schedule = schedules[schedule]
def value(self):
current_value = self.v*self.schedule(self.n/self.nvalues)
self.n += 1.
return current_value
def value_steps(self, steps):
return self.v*self.schedule(steps/self.nvalues)
class EpisodeStats:
def __init__(self, nsteps, nenvs):
self.episode_rewards = []
for i in range(nenvs):
self.episode_rewards.append([])
self.lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths
self.rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards
self.nsteps = nsteps
self.nenvs = nenvs
def feed(self, rewards, masks):
rewards = np.reshape(rewards, [self.nenvs, self.nsteps])
masks = np.reshape(masks, [self.nenvs, self.nsteps])
for i in range(0, self.nenvs):
for j in range(0, self.nsteps):
self.episode_rewards[i].append(rewards[i][j])
if masks[i][j]:
l = len(self.episode_rewards[i])
s = sum(self.episode_rewards[i])
self.lenbuffer.append(l)
self.rewbuffer.append(s)
self.episode_rewards[i] = []
def mean_length(self):
if self.lenbuffer:
return np.mean(self.lenbuffer)
else:
return 0 # on the first params dump, no episodes are finished
def mean_reward(self):
if self.rewbuffer:
return np.mean(self.rewbuffer)
else:
return 0
# For ACER
def get_by_index(x, idx):
assert(len(x.get_shape()) == 2)
assert(len(idx.get_shape()) == 1)
idx_flattened = tf.range(0, x.shape[0]) * x.shape[1] + idx
y = tf.gather(tf.reshape(x, [-1]), # flatten input
idx_flattened) # use flattened indices
return y
def check_shape(ts,shapes):
i = 0
for (t,shape) in zip(ts,shapes):
assert t.get_shape().as_list()==shape, "id " + str(i) + " shape " + str(t.get_shape()) + str(shape)
i += 1
def avg_norm(t):
return tf.reduce_mean(tf.sqrt(tf.reduce_sum(tf.square(t), axis=-1)))
def gradient_add(g1, g2, param):
print([g1, g2, param.name])
assert (not (g1 is None and g2 is None)), param.name
if g1 is None:
return g2
elif g2 is None:
return g1
else:
return g1 + g2
def q_explained_variance(qpred, q):
_, vary = tf.nn.moments(q, axes=[0, 1])
_, varpred = tf.nn.moments(q - qpred, axes=[0, 1])
check_shape([vary, varpred], [[]] * 2)
return 1.0 - (varpred / vary)
| 9,348 | 32.035336 | 107 | py |
baselines | baselines-master/baselines/a2c/runner.py | import numpy as np
from baselines.a2c.utils import discount_with_dones
from baselines.common.runners import AbstractEnvRunner
class Runner(AbstractEnvRunner):
"""
We use this class to generate batches of experiences
__init__:
- Initialize the runner
run():
- Make a mini batch of experiences
"""
def __init__(self, env, model, nsteps=5, gamma=0.99):
super().__init__(env=env, model=model, nsteps=nsteps)
self.gamma = gamma
self.batch_action_shape = [x if x is not None else -1 for x in model.train_model.action.shape.as_list()]
self.ob_dtype = model.train_model.X.dtype.as_numpy_dtype
def run(self):
# We initialize the lists that will contain the mb of experiences
mb_obs, mb_rewards, mb_actions, mb_values, mb_dones = [],[],[],[],[]
mb_states = self.states
epinfos = []
for n in range(self.nsteps):
# Given observations, take action and value (V(s))
# We already have self.obs because Runner superclass run self.obs[:] = env.reset() on init
actions, values, states, _ = self.model.step(self.obs, S=self.states, M=self.dones)
# Append the experiences
mb_obs.append(np.copy(self.obs))
mb_actions.append(actions)
mb_values.append(values)
mb_dones.append(self.dones)
# Take actions in env and look the results
obs, rewards, dones, infos = self.env.step(actions)
for info in infos:
maybeepinfo = info.get('episode')
if maybeepinfo: epinfos.append(maybeepinfo)
self.states = states
self.dones = dones
self.obs = obs
mb_rewards.append(rewards)
mb_dones.append(self.dones)
# Batch of steps to batch of rollouts
mb_obs = np.asarray(mb_obs, dtype=self.ob_dtype).swapaxes(1, 0).reshape(self.batch_ob_shape)
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
mb_actions = np.asarray(mb_actions, dtype=self.model.train_model.action.dtype.name).swapaxes(1, 0)
mb_values = np.asarray(mb_values, dtype=np.float32).swapaxes(1, 0)
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
mb_masks = mb_dones[:, :-1]
mb_dones = mb_dones[:, 1:]
if self.gamma > 0.0:
# Discount/bootstrap off value fn
last_values = self.model.value(self.obs, S=self.states, M=self.dones).tolist()
for n, (rewards, dones, value) in enumerate(zip(mb_rewards, mb_dones, last_values)):
rewards = rewards.tolist()
dones = dones.tolist()
if dones[-1] == 0:
rewards = discount_with_dones(rewards+[value], dones+[0], self.gamma)[:-1]
else:
rewards = discount_with_dones(rewards, dones, self.gamma)
mb_rewards[n] = rewards
mb_actions = mb_actions.reshape(self.batch_action_shape)
mb_rewards = mb_rewards.flatten()
mb_values = mb_values.flatten()
mb_masks = mb_masks.flatten()
return mb_obs, mb_states, mb_rewards, mb_masks, mb_actions, mb_values, epinfos
| 3,241 | 41.103896 | 112 | py |
baselines | baselines-master/baselines/a2c/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/gail/behavior_clone.py | '''
The code is used to train BC imitator, or pretrained GAIL imitator
'''
import argparse
import tempfile
import os.path as osp
import gym
import logging
from tqdm import tqdm
import tensorflow as tf
from baselines.gail import mlp_policy
from baselines import bench
from baselines import logger
from baselines.common import set_global_seeds, tf_util as U
from baselines.common.misc_util import boolean_flag
from baselines.common.mpi_adam import MpiAdam
from baselines.gail.run_mujoco import runner
from baselines.gail.dataset.mujoco_dset import Mujoco_Dset
def argsparser():
parser = argparse.ArgumentParser("Tensorflow Implementation of Behavior Cloning")
parser.add_argument('--env_id', help='environment ID', default='Hopper-v2')
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
parser.add_argument('--expert_path', type=str, default='data/deterministic.trpo.Hopper.0.00.npz')
parser.add_argument('--checkpoint_dir', help='the directory to save model', default='checkpoint')
parser.add_argument('--log_dir', help='the directory to save log file', default='log')
# Mujoco Dataset Configuration
parser.add_argument('--traj_limitation', type=int, default=-1)
# Network Configuration (Using MLP Policy)
parser.add_argument('--policy_hidden_size', type=int, default=100)
# for evaluatation
boolean_flag(parser, 'stochastic_policy', default=False, help='use stochastic/deterministic policy to evaluate')
boolean_flag(parser, 'save_sample', default=False, help='save the trajectories or not')
parser.add_argument('--BC_max_iter', help='Max iteration for training BC', type=int, default=1e5)
return parser.parse_args()
def learn(env, policy_func, dataset, optim_batch_size=128, max_iters=1e4,
adam_epsilon=1e-5, optim_stepsize=3e-4,
ckpt_dir=None, log_dir=None, task_name=None,
verbose=False):
val_per_iter = int(max_iters/10)
ob_space = env.observation_space
ac_space = env.action_space
pi = policy_func("pi", ob_space, ac_space) # Construct network for new policy
# placeholder
ob = U.get_placeholder_cached(name="ob")
ac = pi.pdtype.sample_placeholder([None])
stochastic = U.get_placeholder_cached(name="stochastic")
loss = tf.reduce_mean(tf.square(ac-pi.ac))
var_list = pi.get_trainable_variables()
adam = MpiAdam(var_list, epsilon=adam_epsilon)
lossandgrad = U.function([ob, ac, stochastic], [loss]+[U.flatgrad(loss, var_list)])
U.initialize()
adam.sync()
logger.log("Pretraining with Behavior Cloning...")
for iter_so_far in tqdm(range(int(max_iters))):
ob_expert, ac_expert = dataset.get_next_batch(optim_batch_size, 'train')
train_loss, g = lossandgrad(ob_expert, ac_expert, True)
adam.update(g, optim_stepsize)
if verbose and iter_so_far % val_per_iter == 0:
ob_expert, ac_expert = dataset.get_next_batch(-1, 'val')
val_loss, _ = lossandgrad(ob_expert, ac_expert, True)
logger.log("Training loss: {}, Validation loss: {}".format(train_loss, val_loss))
if ckpt_dir is None:
savedir_fname = tempfile.TemporaryDirectory().name
else:
savedir_fname = osp.join(ckpt_dir, task_name)
U.save_variables(savedir_fname, variables=pi.get_variables())
return savedir_fname
def get_task_name(args):
task_name = 'BC'
task_name += '.{}'.format(args.env_id.split("-")[0])
task_name += '.traj_limitation_{}'.format(args.traj_limitation)
task_name += ".seed_{}".format(args.seed)
return task_name
def main(args):
U.make_session(num_cpu=1).__enter__()
set_global_seeds(args.seed)
env = gym.make(args.env_id)
def policy_fn(name, ob_space, ac_space, reuse=False):
return mlp_policy.MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space,
reuse=reuse, hid_size=args.policy_hidden_size, num_hid_layers=2)
env = bench.Monitor(env, logger.get_dir() and
osp.join(logger.get_dir(), "monitor.json"))
env.seed(args.seed)
gym.logger.setLevel(logging.WARN)
task_name = get_task_name(args)
args.checkpoint_dir = osp.join(args.checkpoint_dir, task_name)
args.log_dir = osp.join(args.log_dir, task_name)
dataset = Mujoco_Dset(expert_path=args.expert_path, traj_limitation=args.traj_limitation)
savedir_fname = learn(env,
policy_fn,
dataset,
max_iters=args.BC_max_iter,
ckpt_dir=args.checkpoint_dir,
log_dir=args.log_dir,
task_name=task_name,
verbose=True)
avg_len, avg_ret = runner(env,
policy_fn,
savedir_fname,
timesteps_per_batch=1024,
number_trajs=10,
stochastic_policy=args.stochastic_policy,
save=args.save_sample,
reuse=True)
if __name__ == '__main__':
args = argsparser()
main(args)
| 5,195 | 40.568 | 116 | py |
baselines | baselines-master/baselines/gail/adversary.py | '''
Reference: https://github.com/openai/imitation
I follow the architecture from the official repository
'''
import tensorflow as tf
import numpy as np
from baselines.common.mpi_running_mean_std import RunningMeanStd
from baselines.common import tf_util as U
def logsigmoid(a):
'''Equivalent to tf.log(tf.sigmoid(a))'''
return -tf.nn.softplus(-a)
""" Reference: https://github.com/openai/imitation/blob/99fbccf3e060b6e6c739bdf209758620fcdefd3c/policyopt/thutil.py#L48-L51"""
def logit_bernoulli_entropy(logits):
ent = (1.-tf.nn.sigmoid(logits))*logits - logsigmoid(logits)
return ent
class TransitionClassifier(object):
def __init__(self, env, hidden_size, entcoeff=0.001, lr_rate=1e-3, scope="adversary"):
self.scope = scope
self.observation_shape = env.observation_space.shape
self.actions_shape = env.action_space.shape
self.input_shape = tuple([o+a for o, a in zip(self.observation_shape, self.actions_shape)])
self.num_actions = env.action_space.shape[0]
self.hidden_size = hidden_size
self.build_ph()
# Build grpah
generator_logits = self.build_graph(self.generator_obs_ph, self.generator_acs_ph, reuse=False)
expert_logits = self.build_graph(self.expert_obs_ph, self.expert_acs_ph, reuse=True)
# Build accuracy
generator_acc = tf.reduce_mean(tf.to_float(tf.nn.sigmoid(generator_logits) < 0.5))
expert_acc = tf.reduce_mean(tf.to_float(tf.nn.sigmoid(expert_logits) > 0.5))
# Build regression loss
# let x = logits, z = targets.
# z * -log(sigmoid(x)) + (1 - z) * -log(1 - sigmoid(x))
generator_loss = tf.nn.sigmoid_cross_entropy_with_logits(logits=generator_logits, labels=tf.zeros_like(generator_logits))
generator_loss = tf.reduce_mean(generator_loss)
expert_loss = tf.nn.sigmoid_cross_entropy_with_logits(logits=expert_logits, labels=tf.ones_like(expert_logits))
expert_loss = tf.reduce_mean(expert_loss)
# Build entropy loss
logits = tf.concat([generator_logits, expert_logits], 0)
entropy = tf.reduce_mean(logit_bernoulli_entropy(logits))
entropy_loss = -entcoeff*entropy
# Loss + Accuracy terms
self.losses = [generator_loss, expert_loss, entropy, entropy_loss, generator_acc, expert_acc]
self.loss_name = ["generator_loss", "expert_loss", "entropy", "entropy_loss", "generator_acc", "expert_acc"]
self.total_loss = generator_loss + expert_loss + entropy_loss
# Build Reward for policy
self.reward_op = -tf.log(1-tf.nn.sigmoid(generator_logits)+1e-8)
var_list = self.get_trainable_variables()
self.lossandgrad = U.function([self.generator_obs_ph, self.generator_acs_ph, self.expert_obs_ph, self.expert_acs_ph],
self.losses + [U.flatgrad(self.total_loss, var_list)])
def build_ph(self):
self.generator_obs_ph = tf.placeholder(tf.float32, (None, ) + self.observation_shape, name="observations_ph")
self.generator_acs_ph = tf.placeholder(tf.float32, (None, ) + self.actions_shape, name="actions_ph")
self.expert_obs_ph = tf.placeholder(tf.float32, (None, ) + self.observation_shape, name="expert_observations_ph")
self.expert_acs_ph = tf.placeholder(tf.float32, (None, ) + self.actions_shape, name="expert_actions_ph")
def build_graph(self, obs_ph, acs_ph, reuse=False):
with tf.variable_scope(self.scope):
if reuse:
tf.get_variable_scope().reuse_variables()
with tf.variable_scope("obfilter"):
self.obs_rms = RunningMeanStd(shape=self.observation_shape)
obs = (obs_ph - self.obs_rms.mean) / self.obs_rms.std
_input = tf.concat([obs, acs_ph], axis=1) # concatenate the two input -> form a transition
p_h1 = tf.contrib.layers.fully_connected(_input, self.hidden_size, activation_fn=tf.nn.tanh)
p_h2 = tf.contrib.layers.fully_connected(p_h1, self.hidden_size, activation_fn=tf.nn.tanh)
logits = tf.contrib.layers.fully_connected(p_h2, 1, activation_fn=tf.identity)
return logits
def get_trainable_variables(self):
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, self.scope)
def get_reward(self, obs, acs):
sess = tf.get_default_session()
if len(obs.shape) == 1:
obs = np.expand_dims(obs, 0)
if len(acs.shape) == 1:
acs = np.expand_dims(acs, 0)
feed_dict = {self.generator_obs_ph: obs, self.generator_acs_ph: acs}
reward = sess.run(self.reward_op, feed_dict)
return reward
| 4,674 | 52.125 | 129 | py |
baselines | baselines-master/baselines/gail/run_mujoco.py | '''
Disclaimer: this code is highly based on trpo_mpi at @openai/baselines and @openai/imitation
'''
import argparse
import os.path as osp
import logging
from mpi4py import MPI
from tqdm import tqdm
import numpy as np
import gym
from baselines.gail import mlp_policy
from baselines.common import set_global_seeds, tf_util as U
from baselines.common.misc_util import boolean_flag
from baselines import bench
from baselines import logger
from baselines.gail.dataset.mujoco_dset import Mujoco_Dset
from baselines.gail.adversary import TransitionClassifier
def argsparser():
parser = argparse.ArgumentParser("Tensorflow Implementation of GAIL")
parser.add_argument('--env_id', help='environment ID', default='Hopper-v2')
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
parser.add_argument('--expert_path', type=str, default='data/deterministic.trpo.Hopper.0.00.npz')
parser.add_argument('--checkpoint_dir', help='the directory to save model', default='checkpoint')
parser.add_argument('--log_dir', help='the directory to save log file', default='log')
parser.add_argument('--load_model_path', help='if provided, load the model', type=str, default=None)
# Task
parser.add_argument('--task', type=str, choices=['train', 'evaluate', 'sample'], default='train')
# for evaluatation
boolean_flag(parser, 'stochastic_policy', default=False, help='use stochastic/deterministic policy to evaluate')
boolean_flag(parser, 'save_sample', default=False, help='save the trajectories or not')
# Mujoco Dataset Configuration
parser.add_argument('--traj_limitation', type=int, default=-1)
# Optimization Configuration
parser.add_argument('--g_step', help='number of steps to train policy in each epoch', type=int, default=3)
parser.add_argument('--d_step', help='number of steps to train discriminator in each epoch', type=int, default=1)
# Network Configuration (Using MLP Policy)
parser.add_argument('--policy_hidden_size', type=int, default=100)
parser.add_argument('--adversary_hidden_size', type=int, default=100)
# Algorithms Configuration
parser.add_argument('--algo', type=str, choices=['trpo', 'ppo'], default='trpo')
parser.add_argument('--max_kl', type=float, default=0.01)
parser.add_argument('--policy_entcoeff', help='entropy coefficiency of policy', type=float, default=0)
parser.add_argument('--adversary_entcoeff', help='entropy coefficiency of discriminator', type=float, default=1e-3)
# Traing Configuration
parser.add_argument('--save_per_iter', help='save model every xx iterations', type=int, default=100)
parser.add_argument('--num_timesteps', help='number of timesteps per episode', type=int, default=5e6)
# Behavior Cloning
boolean_flag(parser, 'pretrained', default=False, help='Use BC to pretrain')
parser.add_argument('--BC_max_iter', help='Max iteration for training BC', type=int, default=1e4)
return parser.parse_args()
def get_task_name(args):
task_name = args.algo + "_gail."
if args.pretrained:
task_name += "with_pretrained."
if args.traj_limitation != np.inf:
task_name += "transition_limitation_%d." % args.traj_limitation
task_name += args.env_id.split("-")[0]
task_name = task_name + ".g_step_" + str(args.g_step) + ".d_step_" + str(args.d_step) + \
".policy_entcoeff_" + str(args.policy_entcoeff) + ".adversary_entcoeff_" + str(args.adversary_entcoeff)
task_name += ".seed_" + str(args.seed)
return task_name
def main(args):
U.make_session(num_cpu=1).__enter__()
set_global_seeds(args.seed)
env = gym.make(args.env_id)
def policy_fn(name, ob_space, ac_space, reuse=False):
return mlp_policy.MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space,
reuse=reuse, hid_size=args.policy_hidden_size, num_hid_layers=2)
env = bench.Monitor(env, logger.get_dir() and
osp.join(logger.get_dir(), "monitor.json"))
env.seed(args.seed)
gym.logger.setLevel(logging.WARN)
task_name = get_task_name(args)
args.checkpoint_dir = osp.join(args.checkpoint_dir, task_name)
args.log_dir = osp.join(args.log_dir, task_name)
if args.task == 'train':
dataset = Mujoco_Dset(expert_path=args.expert_path, traj_limitation=args.traj_limitation)
reward_giver = TransitionClassifier(env, args.adversary_hidden_size, entcoeff=args.adversary_entcoeff)
train(env,
args.seed,
policy_fn,
reward_giver,
dataset,
args.algo,
args.g_step,
args.d_step,
args.policy_entcoeff,
args.num_timesteps,
args.save_per_iter,
args.checkpoint_dir,
args.log_dir,
args.pretrained,
args.BC_max_iter,
task_name
)
elif args.task == 'evaluate':
runner(env,
policy_fn,
args.load_model_path,
timesteps_per_batch=1024,
number_trajs=10,
stochastic_policy=args.stochastic_policy,
save=args.save_sample
)
else:
raise NotImplementedError
env.close()
def train(env, seed, policy_fn, reward_giver, dataset, algo,
g_step, d_step, policy_entcoeff, num_timesteps, save_per_iter,
checkpoint_dir, log_dir, pretrained, BC_max_iter, task_name=None):
pretrained_weight = None
if pretrained and (BC_max_iter > 0):
# Pretrain with behavior cloning
from baselines.gail import behavior_clone
pretrained_weight = behavior_clone.learn(env, policy_fn, dataset,
max_iters=BC_max_iter)
if algo == 'trpo':
from baselines.gail import trpo_mpi
# Set up for MPI seed
rank = MPI.COMM_WORLD.Get_rank()
if rank != 0:
logger.set_level(logger.DISABLED)
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
set_global_seeds(workerseed)
env.seed(workerseed)
trpo_mpi.learn(env, policy_fn, reward_giver, dataset, rank,
pretrained=pretrained, pretrained_weight=pretrained_weight,
g_step=g_step, d_step=d_step,
entcoeff=policy_entcoeff,
max_timesteps=num_timesteps,
ckpt_dir=checkpoint_dir, log_dir=log_dir,
save_per_iter=save_per_iter,
timesteps_per_batch=1024,
max_kl=0.01, cg_iters=10, cg_damping=0.1,
gamma=0.995, lam=0.97,
vf_iters=5, vf_stepsize=1e-3,
task_name=task_name)
else:
raise NotImplementedError
def runner(env, policy_func, load_model_path, timesteps_per_batch, number_trajs,
stochastic_policy, save=False, reuse=False):
# Setup network
# ----------------------------------------
ob_space = env.observation_space
ac_space = env.action_space
pi = policy_func("pi", ob_space, ac_space, reuse=reuse)
U.initialize()
# Prepare for rollouts
# ----------------------------------------
U.load_variables(load_model_path)
obs_list = []
acs_list = []
len_list = []
ret_list = []
for _ in tqdm(range(number_trajs)):
traj = traj_1_generator(pi, env, timesteps_per_batch, stochastic=stochastic_policy)
obs, acs, ep_len, ep_ret = traj['ob'], traj['ac'], traj['ep_len'], traj['ep_ret']
obs_list.append(obs)
acs_list.append(acs)
len_list.append(ep_len)
ret_list.append(ep_ret)
if stochastic_policy:
print('stochastic policy:')
else:
print('deterministic policy:')
if save:
filename = load_model_path.split('/')[-1] + '.' + env.spec.id
np.savez(filename, obs=np.array(obs_list), acs=np.array(acs_list),
lens=np.array(len_list), rets=np.array(ret_list))
avg_len = sum(len_list)/len(len_list)
avg_ret = sum(ret_list)/len(ret_list)
print("Average length:", avg_len)
print("Average return:", avg_ret)
return avg_len, avg_ret
# Sample one trajectory (until trajectory end)
def traj_1_generator(pi, env, horizon, stochastic):
t = 0
ac = env.action_space.sample() # not used, just so we have the datatype
new = True # marks if we're on first timestep of an episode
ob = env.reset()
cur_ep_ret = 0 # return in current episode
cur_ep_len = 0 # len of current episode
# Initialize history arrays
obs = []
rews = []
news = []
acs = []
while True:
ac, vpred = pi.act(stochastic, ob)
obs.append(ob)
news.append(new)
acs.append(ac)
ob, rew, new, _ = env.step(ac)
rews.append(rew)
cur_ep_ret += rew
cur_ep_len += 1
if new or t >= horizon:
break
t += 1
obs = np.array(obs)
rews = np.array(rews)
news = np.array(news)
acs = np.array(acs)
traj = {"ob": obs, "rew": rews, "new": news, "ac": acs,
"ep_ret": cur_ep_ret, "ep_len": cur_ep_len}
return traj
if __name__ == '__main__':
args = argsparser()
main(args)
| 9,366 | 38.029167 | 119 | py |
baselines | baselines-master/baselines/gail/gail-eval.py | '''
This code is used to evalaute the imitators trained with different number of trajectories
and plot the results in the same figure for easy comparison.
'''
import argparse
import os
import glob
import gym
import matplotlib.pyplot as plt
import numpy as np
import tensorflow as tf
from baselines.gail import run_mujoco
from baselines.gail import mlp_policy
from baselines.common import set_global_seeds, tf_util as U
from baselines.common.misc_util import boolean_flag
from baselines.gail.dataset.mujoco_dset import Mujoco_Dset
plt.style.use('ggplot')
CONFIG = {
'traj_limitation': [1, 5, 10, 50],
}
def load_dataset(expert_path):
dataset = Mujoco_Dset(expert_path=expert_path)
return dataset
def argsparser():
parser = argparse.ArgumentParser('Do evaluation')
parser.add_argument('--seed', type=int, default=0)
parser.add_argument('--policy_hidden_size', type=int, default=100)
parser.add_argument('--env', type=str, choices=['Hopper', 'Walker2d', 'HalfCheetah',
'Humanoid', 'HumanoidStandup'])
boolean_flag(parser, 'stochastic_policy', default=False, help='use stochastic/deterministic policy to evaluate')
return parser.parse_args()
def evaluate_env(env_name, seed, policy_hidden_size, stochastic, reuse, prefix):
def get_checkpoint_dir(checkpoint_list, limit, prefix):
for checkpoint in checkpoint_list:
if ('limitation_'+str(limit) in checkpoint) and (prefix in checkpoint):
return checkpoint
return None
def policy_fn(name, ob_space, ac_space, reuse=False):
return mlp_policy.MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space,
reuse=reuse, hid_size=policy_hidden_size, num_hid_layers=2)
data_path = os.path.join('data', 'deterministic.trpo.' + env_name + '.0.00.npz')
dataset = load_dataset(data_path)
checkpoint_list = glob.glob(os.path.join('checkpoint', '*' + env_name + ".*"))
log = {
'traj_limitation': [],
'upper_bound': [],
'avg_ret': [],
'avg_len': [],
'normalized_ret': []
}
for i, limit in enumerate(CONFIG['traj_limitation']):
# Do one evaluation
upper_bound = sum(dataset.rets[:limit])/limit
checkpoint_dir = get_checkpoint_dir(checkpoint_list, limit, prefix=prefix)
checkpoint_path = tf.train.latest_checkpoint(checkpoint_dir)
env = gym.make(env_name + '-v1')
env.seed(seed)
print('Trajectory limitation: {}, Load checkpoint: {}, '.format(limit, checkpoint_path))
avg_len, avg_ret = run_mujoco.runner(env,
policy_fn,
checkpoint_path,
timesteps_per_batch=1024,
number_trajs=10,
stochastic_policy=stochastic,
reuse=((i != 0) or reuse))
normalized_ret = avg_ret/upper_bound
print('Upper bound: {}, evaluation returns: {}, normalized scores: {}'.format(
upper_bound, avg_ret, normalized_ret))
log['traj_limitation'].append(limit)
log['upper_bound'].append(upper_bound)
log['avg_ret'].append(avg_ret)
log['avg_len'].append(avg_len)
log['normalized_ret'].append(normalized_ret)
env.close()
return log
def plot(env_name, bc_log, gail_log, stochastic):
upper_bound = bc_log['upper_bound']
bc_avg_ret = bc_log['avg_ret']
gail_avg_ret = gail_log['avg_ret']
plt.plot(CONFIG['traj_limitation'], upper_bound)
plt.plot(CONFIG['traj_limitation'], bc_avg_ret)
plt.plot(CONFIG['traj_limitation'], gail_avg_ret)
plt.xlabel('Number of expert trajectories')
plt.ylabel('Accumulated reward')
plt.title('{} unnormalized scores'.format(env_name))
plt.legend(['expert', 'bc-imitator', 'gail-imitator'], loc='lower right')
plt.grid(b=True, which='major', color='gray', linestyle='--')
if stochastic:
title_name = 'result/{}-unnormalized-stochastic-scores.png'.format(env_name)
else:
title_name = 'result/{}-unnormalized-deterministic-scores.png'.format(env_name)
plt.savefig(title_name)
plt.close()
bc_normalized_ret = bc_log['normalized_ret']
gail_normalized_ret = gail_log['normalized_ret']
plt.plot(CONFIG['traj_limitation'], np.ones(len(CONFIG['traj_limitation'])))
plt.plot(CONFIG['traj_limitation'], bc_normalized_ret)
plt.plot(CONFIG['traj_limitation'], gail_normalized_ret)
plt.xlabel('Number of expert trajectories')
plt.ylabel('Normalized performance')
plt.title('{} normalized scores'.format(env_name))
plt.legend(['expert', 'bc-imitator', 'gail-imitator'], loc='lower right')
plt.grid(b=True, which='major', color='gray', linestyle='--')
if stochastic:
title_name = 'result/{}-normalized-stochastic-scores.png'.format(env_name)
else:
title_name = 'result/{}-normalized-deterministic-scores.png'.format(env_name)
plt.ylim(0, 1.6)
plt.savefig(title_name)
plt.close()
def main(args):
U.make_session(num_cpu=1).__enter__()
set_global_seeds(args.seed)
print('Evaluating {}'.format(args.env))
bc_log = evaluate_env(args.env, args.seed, args.policy_hidden_size,
args.stochastic_policy, False, 'BC')
print('Evaluation for {}'.format(args.env))
print(bc_log)
gail_log = evaluate_env(args.env, args.seed, args.policy_hidden_size,
args.stochastic_policy, True, 'gail')
print('Evaluation for {}'.format(args.env))
print(gail_log)
plot(args.env, bc_log, gail_log, args.stochastic_policy)
if __name__ == '__main__':
args = argsparser()
main(args)
| 5,886 | 38.777027 | 116 | py |
baselines | baselines-master/baselines/gail/mlp_policy.py | '''
from baselines/ppo1/mlp_policy.py and add simple modification
(1) add reuse argument
(2) cache the `stochastic` placeholder
'''
import tensorflow as tf
import gym
import baselines.common.tf_util as U
from baselines.common.mpi_running_mean_std import RunningMeanStd
from baselines.common.distributions import make_pdtype
from baselines.acktr.utils import dense
class MlpPolicy(object):
recurrent = False
def __init__(self, name, reuse=False, *args, **kwargs):
with tf.variable_scope(name):
if reuse:
tf.get_variable_scope().reuse_variables()
self._init(*args, **kwargs)
self.scope = tf.get_variable_scope().name
def _init(self, ob_space, ac_space, hid_size, num_hid_layers, gaussian_fixed_var=True):
assert isinstance(ob_space, gym.spaces.Box)
self.pdtype = pdtype = make_pdtype(ac_space)
sequence_length = None
ob = U.get_placeholder(name="ob", dtype=tf.float32, shape=[sequence_length] + list(ob_space.shape))
with tf.variable_scope("obfilter"):
self.ob_rms = RunningMeanStd(shape=ob_space.shape)
obz = tf.clip_by_value((ob - self.ob_rms.mean) / self.ob_rms.std, -5.0, 5.0)
last_out = obz
for i in range(num_hid_layers):
last_out = tf.nn.tanh(dense(last_out, hid_size, "vffc%i" % (i+1), weight_init=U.normc_initializer(1.0)))
self.vpred = dense(last_out, 1, "vffinal", weight_init=U.normc_initializer(1.0))[:, 0]
last_out = obz
for i in range(num_hid_layers):
last_out = tf.nn.tanh(dense(last_out, hid_size, "polfc%i" % (i+1), weight_init=U.normc_initializer(1.0)))
if gaussian_fixed_var and isinstance(ac_space, gym.spaces.Box):
mean = dense(last_out, pdtype.param_shape()[0]//2, "polfinal", U.normc_initializer(0.01))
logstd = tf.get_variable(name="logstd", shape=[1, pdtype.param_shape()[0]//2], initializer=tf.zeros_initializer())
pdparam = tf.concat([mean, mean * 0.0 + logstd], axis=1)
else:
pdparam = dense(last_out, pdtype.param_shape()[0], "polfinal", U.normc_initializer(0.01))
self.pd = pdtype.pdfromflat(pdparam)
self.state_in = []
self.state_out = []
# change for BC
stochastic = U.get_placeholder(name="stochastic", dtype=tf.bool, shape=())
ac = U.switch(stochastic, self.pd.sample(), self.pd.mode())
self.ac = ac
self._act = U.function([stochastic, ob], [ac, self.vpred])
def act(self, stochastic, ob):
ac1, vpred1 = self._act(stochastic, ob[None])
return ac1[0], vpred1[0]
def get_variables(self):
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, self.scope)
def get_trainable_variables(self):
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, self.scope)
def get_initial_state(self):
return []
| 2,930 | 37.565789 | 126 | py |
baselines | baselines-master/baselines/gail/statistics.py | '''
This code is highly based on https://github.com/carpedm20/deep-rl-tensorflow/blob/master/agents/statistic.py
'''
import tensorflow as tf
import numpy as np
import baselines.common.tf_util as U
class stats():
def __init__(self, scalar_keys=[], histogram_keys=[]):
self.scalar_keys = scalar_keys
self.histogram_keys = histogram_keys
self.scalar_summaries = []
self.scalar_summaries_ph = []
self.histogram_summaries_ph = []
self.histogram_summaries = []
with tf.variable_scope('summary'):
for k in scalar_keys:
ph = tf.placeholder('float32', None, name=k+'.scalar.summary')
sm = tf.summary.scalar(k+'.scalar.summary', ph)
self.scalar_summaries_ph.append(ph)
self.scalar_summaries.append(sm)
for k in histogram_keys:
ph = tf.placeholder('float32', None, name=k+'.histogram.summary')
sm = tf.summary.scalar(k+'.histogram.summary', ph)
self.histogram_summaries_ph.append(ph)
self.histogram_summaries.append(sm)
self.summaries = tf.summary.merge(self.scalar_summaries+self.histogram_summaries)
def add_all_summary(self, writer, values, iter):
# Note that the order of the incoming ```values``` should be the same as the that of the
# ```scalar_keys``` given in ```__init__```
if np.sum(np.isnan(values)+0) != 0:
return
sess = U.get_session()
keys = self.scalar_summaries_ph + self.histogram_summaries_ph
feed_dict = {}
for k, v in zip(keys, values):
feed_dict.update({k: v})
summaries_str = sess.run(self.summaries, feed_dict)
writer.add_summary(summaries_str, iter)
| 1,802 | 38.195652 | 108 | py |
baselines | baselines-master/baselines/gail/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/gail/trpo_mpi.py | '''
Disclaimer: The trpo part highly rely on trpo_mpi at @openai/baselines
'''
import time
import os
from contextlib import contextmanager
from mpi4py import MPI
from collections import deque
import tensorflow as tf
import numpy as np
import baselines.common.tf_util as U
from baselines.common import explained_variance, zipsame, dataset, fmt_row
from baselines import logger
from baselines.common import colorize
from baselines.common.mpi_adam import MpiAdam
from baselines.common.cg import cg
from baselines.gail.statistics import stats
def traj_segment_generator(pi, env, reward_giver, horizon, stochastic):
# Initialize state variables
t = 0
ac = env.action_space.sample()
new = True
rew = 0.0
true_rew = 0.0
ob = env.reset()
cur_ep_ret = 0
cur_ep_len = 0
cur_ep_true_ret = 0
ep_true_rets = []
ep_rets = []
ep_lens = []
# Initialize history arrays
obs = np.array([ob for _ in range(horizon)])
true_rews = np.zeros(horizon, 'float32')
rews = np.zeros(horizon, 'float32')
vpreds = np.zeros(horizon, 'float32')
news = np.zeros(horizon, 'int32')
acs = np.array([ac for _ in range(horizon)])
prevacs = acs.copy()
while True:
prevac = ac
ac, vpred = pi.act(stochastic, ob)
# Slight weirdness here because we need value function at time T
# before returning segment [0, T-1] so we get the correct
# terminal value
if t > 0 and t % horizon == 0:
yield {"ob": obs, "rew": rews, "vpred": vpreds, "new": news,
"ac": acs, "prevac": prevacs, "nextvpred": vpred * (1 - new),
"ep_rets": ep_rets, "ep_lens": ep_lens, "ep_true_rets": ep_true_rets}
_, vpred = pi.act(stochastic, ob)
# Be careful!!! if you change the downstream algorithm to aggregate
# several of these batches, then be sure to do a deepcopy
ep_rets = []
ep_true_rets = []
ep_lens = []
i = t % horizon
obs[i] = ob
vpreds[i] = vpred
news[i] = new
acs[i] = ac
prevacs[i] = prevac
rew = reward_giver.get_reward(ob, ac)
ob, true_rew, new, _ = env.step(ac)
rews[i] = rew
true_rews[i] = true_rew
cur_ep_ret += rew
cur_ep_true_ret += true_rew
cur_ep_len += 1
if new:
ep_rets.append(cur_ep_ret)
ep_true_rets.append(cur_ep_true_ret)
ep_lens.append(cur_ep_len)
cur_ep_ret = 0
cur_ep_true_ret = 0
cur_ep_len = 0
ob = env.reset()
t += 1
def add_vtarg_and_adv(seg, gamma, lam):
new = np.append(seg["new"], 0) # last element is only used for last vtarg, but we already zeroed it if last new = 1
vpred = np.append(seg["vpred"], seg["nextvpred"])
T = len(seg["rew"])
seg["adv"] = gaelam = np.empty(T, 'float32')
rew = seg["rew"]
lastgaelam = 0
for t in reversed(range(T)):
nonterminal = 1-new[t+1]
delta = rew[t] + gamma * vpred[t+1] * nonterminal - vpred[t]
gaelam[t] = lastgaelam = delta + gamma * lam * nonterminal * lastgaelam
seg["tdlamret"] = seg["adv"] + seg["vpred"]
def learn(env, policy_func, reward_giver, expert_dataset, rank,
pretrained, pretrained_weight, *,
g_step, d_step, entcoeff, save_per_iter,
ckpt_dir, log_dir, timesteps_per_batch, task_name,
gamma, lam,
max_kl, cg_iters, cg_damping=1e-2,
vf_stepsize=3e-4, d_stepsize=3e-4, vf_iters=3,
max_timesteps=0, max_episodes=0, max_iters=0,
callback=None
):
nworkers = MPI.COMM_WORLD.Get_size()
rank = MPI.COMM_WORLD.Get_rank()
np.set_printoptions(precision=3)
# Setup losses and stuff
# ----------------------------------------
ob_space = env.observation_space
ac_space = env.action_space
pi = policy_func("pi", ob_space, ac_space, reuse=(pretrained_weight != None))
oldpi = policy_func("oldpi", ob_space, ac_space)
atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable)
ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return
ob = U.get_placeholder_cached(name="ob")
ac = pi.pdtype.sample_placeholder([None])
kloldnew = oldpi.pd.kl(pi.pd)
ent = pi.pd.entropy()
meankl = tf.reduce_mean(kloldnew)
meanent = tf.reduce_mean(ent)
entbonus = entcoeff * meanent
vferr = tf.reduce_mean(tf.square(pi.vpred - ret))
ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold
surrgain = tf.reduce_mean(ratio * atarg)
optimgain = surrgain + entbonus
losses = [optimgain, meankl, entbonus, surrgain, meanent]
loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"]
dist = meankl
all_var_list = pi.get_trainable_variables()
var_list = [v for v in all_var_list if v.name.startswith("pi/pol") or v.name.startswith("pi/logstd")]
vf_var_list = [v for v in all_var_list if v.name.startswith("pi/vff")]
assert len(var_list) == len(vf_var_list) + 1
d_adam = MpiAdam(reward_giver.get_trainable_variables())
vfadam = MpiAdam(vf_var_list)
get_flat = U.GetFlat(var_list)
set_from_flat = U.SetFromFlat(var_list)
klgrads = tf.gradients(dist, var_list)
flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan")
shapes = [var.get_shape().as_list() for var in var_list]
start = 0
tangents = []
for shape in shapes:
sz = U.intprod(shape)
tangents.append(tf.reshape(flat_tangent[start:start+sz], shape))
start += sz
gvp = tf.add_n([tf.reduce_sum(g*tangent) for (g, tangent) in zipsame(klgrads, tangents)]) # pylint: disable=E1111
fvp = U.flatgrad(gvp, var_list)
assign_old_eq_new = U.function([], [], updates=[tf.assign(oldv, newv)
for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())])
compute_losses = U.function([ob, ac, atarg], losses)
compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)])
compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp)
compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list))
@contextmanager
def timed(msg):
if rank == 0:
print(colorize(msg, color='magenta'))
tstart = time.time()
yield
print(colorize("done in %.3f seconds" % (time.time() - tstart), color='magenta'))
else:
yield
def allmean(x):
assert isinstance(x, np.ndarray)
out = np.empty_like(x)
MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM)
out /= nworkers
return out
U.initialize()
th_init = get_flat()
MPI.COMM_WORLD.Bcast(th_init, root=0)
set_from_flat(th_init)
d_adam.sync()
vfadam.sync()
if rank == 0:
print("Init param sum", th_init.sum(), flush=True)
# Prepare for rollouts
# ----------------------------------------
seg_gen = traj_segment_generator(pi, env, reward_giver, timesteps_per_batch, stochastic=True)
episodes_so_far = 0
timesteps_so_far = 0
iters_so_far = 0
tstart = time.time()
lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths
rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards
true_rewbuffer = deque(maxlen=40)
assert sum([max_iters > 0, max_timesteps > 0, max_episodes > 0]) == 1
g_loss_stats = stats(loss_names)
d_loss_stats = stats(reward_giver.loss_name)
ep_stats = stats(["True_rewards", "Rewards", "Episode_length"])
# if provide pretrained weight
if pretrained_weight is not None:
U.load_state(pretrained_weight, var_list=pi.get_variables())
while True:
if callback: callback(locals(), globals())
if max_timesteps and timesteps_so_far >= max_timesteps:
break
elif max_episodes and episodes_so_far >= max_episodes:
break
elif max_iters and iters_so_far >= max_iters:
break
# Save model
if rank == 0 and iters_so_far % save_per_iter == 0 and ckpt_dir is not None:
fname = os.path.join(ckpt_dir, task_name)
os.makedirs(os.path.dirname(fname), exist_ok=True)
saver = tf.train.Saver()
saver.save(tf.get_default_session(), fname)
logger.log("********** Iteration %i ************" % iters_so_far)
def fisher_vector_product(p):
return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p
# ------------------ Update G ------------------
logger.log("Optimizing Policy...")
for _ in range(g_step):
with timed("sampling"):
seg = seg_gen.__next__()
add_vtarg_and_adv(seg, gamma, lam)
# ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets))
ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"]
vpredbefore = seg["vpred"] # predicted value function before udpate
atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate
if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy
args = seg["ob"], seg["ac"], atarg
fvpargs = [arr[::5] for arr in args]
assign_old_eq_new() # set old parameter values to new parameter values
with timed("computegrad"):
*lossbefore, g = compute_lossandgrad(*args)
lossbefore = allmean(np.array(lossbefore))
g = allmean(g)
if np.allclose(g, 0):
logger.log("Got zero gradient. not updating")
else:
with timed("cg"):
stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank == 0)
assert np.isfinite(stepdir).all()
shs = .5*stepdir.dot(fisher_vector_product(stepdir))
lm = np.sqrt(shs / max_kl)
# logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g))
fullstep = stepdir / lm
expectedimprove = g.dot(fullstep)
surrbefore = lossbefore[0]
stepsize = 1.0
thbefore = get_flat()
for _ in range(10):
thnew = thbefore + fullstep * stepsize
set_from_flat(thnew)
meanlosses = surr, kl, *_ = allmean(np.array(compute_losses(*args)))
improve = surr - surrbefore
logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve))
if not np.isfinite(meanlosses).all():
logger.log("Got non-finite value of losses -- bad!")
elif kl > max_kl * 1.5:
logger.log("violated KL constraint. shrinking step.")
elif improve < 0:
logger.log("surrogate didn't improve. shrinking step.")
else:
logger.log("Stepsize OK!")
break
stepsize *= .5
else:
logger.log("couldn't compute a good step")
set_from_flat(thbefore)
if nworkers > 1 and iters_so_far % 20 == 0:
paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), vfadam.getflat().sum())) # list of tuples
assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:])
with timed("vf"):
for _ in range(vf_iters):
for (mbob, mbret) in dataset.iterbatches((seg["ob"], seg["tdlamret"]),
include_final_partial_batch=False, batch_size=128):
if hasattr(pi, "ob_rms"):
pi.ob_rms.update(mbob) # update running mean/std for policy
g = allmean(compute_vflossandgrad(mbob, mbret))
vfadam.update(g, vf_stepsize)
g_losses = meanlosses
for (lossname, lossval) in zip(loss_names, meanlosses):
logger.record_tabular(lossname, lossval)
logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret))
# ------------------ Update D ------------------
logger.log("Optimizing Discriminator...")
logger.log(fmt_row(13, reward_giver.loss_name))
ob_expert, ac_expert = expert_dataset.get_next_batch(len(ob))
batch_size = len(ob) // d_step
d_losses = [] # list of tuples, each of which gives the loss for a minibatch
for ob_batch, ac_batch in dataset.iterbatches((ob, ac),
include_final_partial_batch=False,
batch_size=batch_size):
ob_expert, ac_expert = expert_dataset.get_next_batch(len(ob_batch))
# update running mean/std for reward_giver
if hasattr(reward_giver, "obs_rms"): reward_giver.obs_rms.update(np.concatenate((ob_batch, ob_expert), 0))
*newlosses, g = reward_giver.lossandgrad(ob_batch, ac_batch, ob_expert, ac_expert)
d_adam.update(allmean(g), d_stepsize)
d_losses.append(newlosses)
logger.log(fmt_row(13, np.mean(d_losses, axis=0)))
lrlocal = (seg["ep_lens"], seg["ep_rets"], seg["ep_true_rets"]) # local values
listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples
lens, rews, true_rets = map(flatten_lists, zip(*listoflrpairs))
true_rewbuffer.extend(true_rets)
lenbuffer.extend(lens)
rewbuffer.extend(rews)
logger.record_tabular("EpLenMean", np.mean(lenbuffer))
logger.record_tabular("EpRewMean", np.mean(rewbuffer))
logger.record_tabular("EpTrueRewMean", np.mean(true_rewbuffer))
logger.record_tabular("EpThisIter", len(lens))
episodes_so_far += len(lens)
timesteps_so_far += sum(lens)
iters_so_far += 1
logger.record_tabular("EpisodesSoFar", episodes_so_far)
logger.record_tabular("TimestepsSoFar", timesteps_so_far)
logger.record_tabular("TimeElapsed", time.time() - tstart)
if rank == 0:
logger.dump_tabular()
def flatten_lists(listoflists):
return [el for list_ in listoflists for el in list_]
| 14,662 | 40.304225 | 124 | py |
baselines | baselines-master/baselines/gail/dataset/mujoco_dset.py | '''
Data structure of the input .npz:
the data is save in python dictionary format with keys: 'acs', 'ep_rets', 'rews', 'obs'
the values of each item is a list storing the expert trajectory sequentially
a transition can be: (data['obs'][t], data['acs'][t], data['obs'][t+1]) and get reward data['rews'][t]
'''
from baselines import logger
import numpy as np
class Dset(object):
def __init__(self, inputs, labels, randomize):
self.inputs = inputs
self.labels = labels
assert len(self.inputs) == len(self.labels)
self.randomize = randomize
self.num_pairs = len(inputs)
self.init_pointer()
def init_pointer(self):
self.pointer = 0
if self.randomize:
idx = np.arange(self.num_pairs)
np.random.shuffle(idx)
self.inputs = self.inputs[idx, :]
self.labels = self.labels[idx, :]
def get_next_batch(self, batch_size):
# if batch_size is negative -> return all
if batch_size < 0:
return self.inputs, self.labels
if self.pointer + batch_size >= self.num_pairs:
self.init_pointer()
end = self.pointer + batch_size
inputs = self.inputs[self.pointer:end, :]
labels = self.labels[self.pointer:end, :]
self.pointer = end
return inputs, labels
class Mujoco_Dset(object):
def __init__(self, expert_path, train_fraction=0.7, traj_limitation=-1, randomize=True):
traj_data = np.load(expert_path)
if traj_limitation < 0:
traj_limitation = len(traj_data['obs'])
obs = traj_data['obs'][:traj_limitation]
acs = traj_data['acs'][:traj_limitation]
# obs, acs: shape (N, L, ) + S where N = # episodes, L = episode length
# and S is the environment observation/action space.
# Flatten to (N * L, prod(S))
if len(obs.shape) > 2:
self.obs = np.reshape(obs, [-1, np.prod(obs.shape[2:])])
self.acs = np.reshape(acs, [-1, np.prod(acs.shape[2:])])
else:
self.obs = np.vstack(obs)
self.acs = np.vstack(acs)
self.rets = traj_data['ep_rets'][:traj_limitation]
self.avg_ret = sum(self.rets)/len(self.rets)
self.std_ret = np.std(np.array(self.rets))
if len(self.acs) > 2:
self.acs = np.squeeze(self.acs)
assert len(self.obs) == len(self.acs)
self.num_traj = min(traj_limitation, len(traj_data['obs']))
self.num_transition = len(self.obs)
self.randomize = randomize
self.dset = Dset(self.obs, self.acs, self.randomize)
# for behavior cloning
self.train_set = Dset(self.obs[:int(self.num_transition*train_fraction), :],
self.acs[:int(self.num_transition*train_fraction), :],
self.randomize)
self.val_set = Dset(self.obs[int(self.num_transition*train_fraction):, :],
self.acs[int(self.num_transition*train_fraction):, :],
self.randomize)
self.log_info()
def log_info(self):
logger.log("Total trajectories: %d" % self.num_traj)
logger.log("Total transitions: %d" % self.num_transition)
logger.log("Average returns: %f" % self.avg_ret)
logger.log("Std for returns: %f" % self.std_ret)
def get_next_batch(self, batch_size, split=None):
if split is None:
return self.dset.get_next_batch(batch_size)
elif split == 'train':
return self.train_set.get_next_batch(batch_size)
elif split == 'val':
return self.val_set.get_next_batch(batch_size)
else:
raise NotImplementedError
def plot(self):
import matplotlib.pyplot as plt
plt.hist(self.rets)
plt.savefig("histogram_rets.png")
plt.close()
def test(expert_path, traj_limitation, plot):
dset = Mujoco_Dset(expert_path, traj_limitation=traj_limitation)
if plot:
dset.plot()
if __name__ == '__main__':
import argparse
parser = argparse.ArgumentParser()
parser.add_argument("--expert_path", type=str, default="../data/deterministic.trpo.Hopper.0.00.npz")
parser.add_argument("--traj_limitation", type=int, default=None)
parser.add_argument("--plot", type=bool, default=False)
args = parser.parse_args()
test(args.expert_path, args.traj_limitation, args.plot)
| 4,448 | 37.686957 | 104 | py |
baselines | baselines-master/baselines/gail/dataset/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/ddpg/ddpg.py | import os
import time
from collections import deque
import pickle
from baselines.ddpg.ddpg_learner import DDPG
from baselines.ddpg.models import Actor, Critic
from baselines.ddpg.memory import Memory
from baselines.ddpg.noise import AdaptiveParamNoiseSpec, NormalActionNoise, OrnsteinUhlenbeckActionNoise
from baselines.common import set_global_seeds
import baselines.common.tf_util as U
from baselines import logger
import numpy as np
try:
from mpi4py import MPI
except ImportError:
MPI = None
def learn(network, env,
seed=None,
total_timesteps=None,
nb_epochs=None, # with default settings, perform 1M steps total
nb_epoch_cycles=20,
nb_rollout_steps=100,
reward_scale=1.0,
render=False,
render_eval=False,
noise_type='adaptive-param_0.2',
normalize_returns=False,
normalize_observations=True,
critic_l2_reg=1e-2,
actor_lr=1e-4,
critic_lr=1e-3,
popart=False,
gamma=0.99,
clip_norm=None,
nb_train_steps=50, # per epoch cycle and MPI worker,
nb_eval_steps=100,
batch_size=64, # per MPI worker
tau=0.01,
eval_env=None,
param_noise_adaption_interval=50,
**network_kwargs):
set_global_seeds(seed)
if total_timesteps is not None:
assert nb_epochs is None
nb_epochs = int(total_timesteps) // (nb_epoch_cycles * nb_rollout_steps)
else:
nb_epochs = 500
if MPI is not None:
rank = MPI.COMM_WORLD.Get_rank()
else:
rank = 0
nb_actions = env.action_space.shape[-1]
assert (np.abs(env.action_space.low) == env.action_space.high).all() # we assume symmetric actions.
memory = Memory(limit=int(1e6), action_shape=env.action_space.shape, observation_shape=env.observation_space.shape)
critic = Critic(network=network, **network_kwargs)
actor = Actor(nb_actions, network=network, **network_kwargs)
action_noise = None
param_noise = None
if noise_type is not None:
for current_noise_type in noise_type.split(','):
current_noise_type = current_noise_type.strip()
if current_noise_type == 'none':
pass
elif 'adaptive-param' in current_noise_type:
_, stddev = current_noise_type.split('_')
param_noise = AdaptiveParamNoiseSpec(initial_stddev=float(stddev), desired_action_stddev=float(stddev))
elif 'normal' in current_noise_type:
_, stddev = current_noise_type.split('_')
action_noise = NormalActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions))
elif 'ou' in current_noise_type:
_, stddev = current_noise_type.split('_')
action_noise = OrnsteinUhlenbeckActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions))
else:
raise RuntimeError('unknown noise type "{}"'.format(current_noise_type))
max_action = env.action_space.high
logger.info('scaling actions by {} before executing in env'.format(max_action))
agent = DDPG(actor, critic, memory, env.observation_space.shape, env.action_space.shape,
gamma=gamma, tau=tau, normalize_returns=normalize_returns, normalize_observations=normalize_observations,
batch_size=batch_size, action_noise=action_noise, param_noise=param_noise, critic_l2_reg=critic_l2_reg,
actor_lr=actor_lr, critic_lr=critic_lr, enable_popart=popart, clip_norm=clip_norm,
reward_scale=reward_scale)
logger.info('Using agent with the following configuration:')
logger.info(str(agent.__dict__.items()))
eval_episode_rewards_history = deque(maxlen=100)
episode_rewards_history = deque(maxlen=100)
sess = U.get_session()
# Prepare everything.
agent.initialize(sess)
sess.graph.finalize()
agent.reset()
obs = env.reset()
if eval_env is not None:
eval_obs = eval_env.reset()
nenvs = obs.shape[0]
episode_reward = np.zeros(nenvs, dtype = np.float32) #vector
episode_step = np.zeros(nenvs, dtype = int) # vector
episodes = 0 #scalar
t = 0 # scalar
epoch = 0
start_time = time.time()
epoch_episode_rewards = []
epoch_episode_steps = []
epoch_actions = []
epoch_qs = []
epoch_episodes = 0
for epoch in range(nb_epochs):
for cycle in range(nb_epoch_cycles):
# Perform rollouts.
if nenvs > 1:
# if simulating multiple envs in parallel, impossible to reset agent at the end of the episode in each
# of the environments, so resetting here instead
agent.reset()
for t_rollout in range(nb_rollout_steps):
# Predict next action.
action, q, _, _ = agent.step(obs, apply_noise=True, compute_Q=True)
# Execute next action.
if rank == 0 and render:
env.render()
# max_action is of dimension A, whereas action is dimension (nenvs, A) - the multiplication gets broadcasted to the batch
new_obs, r, done, info = env.step(max_action * action) # scale for execution in env (as far as DDPG is concerned, every action is in [-1, 1])
# note these outputs are batched from vecenv
t += 1
if rank == 0 and render:
env.render()
episode_reward += r
episode_step += 1
# Book-keeping.
epoch_actions.append(action)
epoch_qs.append(q)
agent.store_transition(obs, action, r, new_obs, done) #the batched data will be unrolled in memory.py's append.
obs = new_obs
for d in range(len(done)):
if done[d]:
# Episode done.
epoch_episode_rewards.append(episode_reward[d])
episode_rewards_history.append(episode_reward[d])
epoch_episode_steps.append(episode_step[d])
episode_reward[d] = 0.
episode_step[d] = 0
epoch_episodes += 1
episodes += 1
if nenvs == 1:
agent.reset()
# Train.
epoch_actor_losses = []
epoch_critic_losses = []
epoch_adaptive_distances = []
for t_train in range(nb_train_steps):
# Adapt param noise, if necessary.
if memory.nb_entries >= batch_size and t_train % param_noise_adaption_interval == 0:
distance = agent.adapt_param_noise()
epoch_adaptive_distances.append(distance)
cl, al = agent.train()
epoch_critic_losses.append(cl)
epoch_actor_losses.append(al)
agent.update_target_net()
# Evaluate.
eval_episode_rewards = []
eval_qs = []
if eval_env is not None:
nenvs_eval = eval_obs.shape[0]
eval_episode_reward = np.zeros(nenvs_eval, dtype = np.float32)
for t_rollout in range(nb_eval_steps):
eval_action, eval_q, _, _ = agent.step(eval_obs, apply_noise=False, compute_Q=True)
eval_obs, eval_r, eval_done, eval_info = eval_env.step(max_action * eval_action) # scale for execution in env (as far as DDPG is concerned, every action is in [-1, 1])
if render_eval:
eval_env.render()
eval_episode_reward += eval_r
eval_qs.append(eval_q)
for d in range(len(eval_done)):
if eval_done[d]:
eval_episode_rewards.append(eval_episode_reward[d])
eval_episode_rewards_history.append(eval_episode_reward[d])
eval_episode_reward[d] = 0.0
if MPI is not None:
mpi_size = MPI.COMM_WORLD.Get_size()
else:
mpi_size = 1
# Log stats.
# XXX shouldn't call np.mean on variable length lists
duration = time.time() - start_time
stats = agent.get_stats()
combined_stats = stats.copy()
combined_stats['rollout/return'] = np.mean(epoch_episode_rewards)
combined_stats['rollout/return_std'] = np.std(epoch_episode_rewards)
combined_stats['rollout/return_history'] = np.mean(episode_rewards_history)
combined_stats['rollout/return_history_std'] = np.std(episode_rewards_history)
combined_stats['rollout/episode_steps'] = np.mean(epoch_episode_steps)
combined_stats['rollout/actions_mean'] = np.mean(epoch_actions)
combined_stats['rollout/Q_mean'] = np.mean(epoch_qs)
combined_stats['train/loss_actor'] = np.mean(epoch_actor_losses)
combined_stats['train/loss_critic'] = np.mean(epoch_critic_losses)
combined_stats['train/param_noise_distance'] = np.mean(epoch_adaptive_distances)
combined_stats['total/duration'] = duration
combined_stats['total/steps_per_second'] = float(t) / float(duration)
combined_stats['total/episodes'] = episodes
combined_stats['rollout/episodes'] = epoch_episodes
combined_stats['rollout/actions_std'] = np.std(epoch_actions)
# Evaluation statistics.
if eval_env is not None:
combined_stats['eval/return'] = eval_episode_rewards
combined_stats['eval/return_history'] = np.mean(eval_episode_rewards_history)
combined_stats['eval/Q'] = eval_qs
combined_stats['eval/episodes'] = len(eval_episode_rewards)
def as_scalar(x):
if isinstance(x, np.ndarray):
assert x.size == 1
return x[0]
elif np.isscalar(x):
return x
else:
raise ValueError('expected scalar, got %s'%x)
combined_stats_sums = np.array([ np.array(x).flatten()[0] for x in combined_stats.values()])
if MPI is not None:
combined_stats_sums = MPI.COMM_WORLD.allreduce(combined_stats_sums)
combined_stats = {k : v / mpi_size for (k,v) in zip(combined_stats.keys(), combined_stats_sums)}
# Total statistics.
combined_stats['total/epochs'] = epoch + 1
combined_stats['total/steps'] = t
for key in sorted(combined_stats.keys()):
logger.record_tabular(key, combined_stats[key])
if rank == 0:
logger.dump_tabular()
logger.info('')
logdir = logger.get_dir()
if rank == 0 and logdir:
if hasattr(env, 'get_state'):
with open(os.path.join(logdir, 'env_state.pkl'), 'wb') as f:
pickle.dump(env.get_state(), f)
if eval_env and hasattr(eval_env, 'get_state'):
with open(os.path.join(logdir, 'eval_env_state.pkl'), 'wb') as f:
pickle.dump(eval_env.get_state(), f)
return agent
| 11,283 | 39.884058 | 188 | py |
baselines | baselines-master/baselines/ddpg/memory.py | import numpy as np
class RingBuffer(object):
def __init__(self, maxlen, shape, dtype='float32'):
self.maxlen = maxlen
self.start = 0
self.length = 0
self.data = np.zeros((maxlen,) + shape).astype(dtype)
def __len__(self):
return self.length
def __getitem__(self, idx):
if idx < 0 or idx >= self.length:
raise KeyError()
return self.data[(self.start + idx) % self.maxlen]
def get_batch(self, idxs):
return self.data[(self.start + idxs) % self.maxlen]
def append(self, v):
if self.length < self.maxlen:
# We have space, simply increase the length.
self.length += 1
elif self.length == self.maxlen:
# No space, "remove" the first item.
self.start = (self.start + 1) % self.maxlen
else:
# This should never happen.
raise RuntimeError()
self.data[(self.start + self.length - 1) % self.maxlen] = v
def array_min2d(x):
x = np.array(x)
if x.ndim >= 2:
return x
return x.reshape(-1, 1)
class Memory(object):
def __init__(self, limit, action_shape, observation_shape):
self.limit = limit
self.observations0 = RingBuffer(limit, shape=observation_shape)
self.actions = RingBuffer(limit, shape=action_shape)
self.rewards = RingBuffer(limit, shape=(1,))
self.terminals1 = RingBuffer(limit, shape=(1,))
self.observations1 = RingBuffer(limit, shape=observation_shape)
def sample(self, batch_size):
# Draw such that we always have a proceeding element.
batch_idxs = np.random.randint(self.nb_entries - 2, size=batch_size)
obs0_batch = self.observations0.get_batch(batch_idxs)
obs1_batch = self.observations1.get_batch(batch_idxs)
action_batch = self.actions.get_batch(batch_idxs)
reward_batch = self.rewards.get_batch(batch_idxs)
terminal1_batch = self.terminals1.get_batch(batch_idxs)
result = {
'obs0': array_min2d(obs0_batch),
'obs1': array_min2d(obs1_batch),
'rewards': array_min2d(reward_batch),
'actions': array_min2d(action_batch),
'terminals1': array_min2d(terminal1_batch),
}
return result
def append(self, obs0, action, reward, obs1, terminal1, training=True):
if not training:
return
self.observations0.append(obs0)
self.actions.append(action)
self.rewards.append(reward)
self.observations1.append(obs1)
self.terminals1.append(terminal1)
@property
def nb_entries(self):
return len(self.observations0)
| 2,708 | 31.25 | 76 | py |
baselines | baselines-master/baselines/ddpg/ddpg_learner.py | from copy import copy
from functools import reduce
import numpy as np
import tensorflow as tf
import tensorflow.contrib as tc
from baselines import logger
from baselines.common.mpi_adam import MpiAdam
import baselines.common.tf_util as U
from baselines.common.mpi_running_mean_std import RunningMeanStd
try:
from mpi4py import MPI
except ImportError:
MPI = None
def normalize(x, stats):
if stats is None:
return x
return (x - stats.mean) / (stats.std + 1e-8)
def denormalize(x, stats):
if stats is None:
return x
return x * stats.std + stats.mean
def reduce_std(x, axis=None, keepdims=False):
return tf.sqrt(reduce_var(x, axis=axis, keepdims=keepdims))
def reduce_var(x, axis=None, keepdims=False):
m = tf.reduce_mean(x, axis=axis, keepdims=True)
devs_squared = tf.square(x - m)
return tf.reduce_mean(devs_squared, axis=axis, keepdims=keepdims)
def get_target_updates(vars, target_vars, tau):
logger.info('setting up target updates ...')
soft_updates = []
init_updates = []
assert len(vars) == len(target_vars)
for var, target_var in zip(vars, target_vars):
logger.info(' {} <- {}'.format(target_var.name, var.name))
init_updates.append(tf.assign(target_var, var))
soft_updates.append(tf.assign(target_var, (1. - tau) * target_var + tau * var))
assert len(init_updates) == len(vars)
assert len(soft_updates) == len(vars)
return tf.group(*init_updates), tf.group(*soft_updates)
def get_perturbed_actor_updates(actor, perturbed_actor, param_noise_stddev):
assert len(actor.vars) == len(perturbed_actor.vars)
assert len(actor.perturbable_vars) == len(perturbed_actor.perturbable_vars)
updates = []
for var, perturbed_var in zip(actor.vars, perturbed_actor.vars):
if var in actor.perturbable_vars:
logger.info(' {} <- {} + noise'.format(perturbed_var.name, var.name))
updates.append(tf.assign(perturbed_var, var + tf.random_normal(tf.shape(var), mean=0., stddev=param_noise_stddev)))
else:
logger.info(' {} <- {}'.format(perturbed_var.name, var.name))
updates.append(tf.assign(perturbed_var, var))
assert len(updates) == len(actor.vars)
return tf.group(*updates)
class DDPG(object):
def __init__(self, actor, critic, memory, observation_shape, action_shape, param_noise=None, action_noise=None,
gamma=0.99, tau=0.001, normalize_returns=False, enable_popart=False, normalize_observations=True,
batch_size=128, observation_range=(-5., 5.), action_range=(-1., 1.), return_range=(-np.inf, np.inf),
critic_l2_reg=0., actor_lr=1e-4, critic_lr=1e-3, clip_norm=None, reward_scale=1.):
# Inputs.
self.obs0 = tf.placeholder(tf.float32, shape=(None,) + observation_shape, name='obs0')
self.obs1 = tf.placeholder(tf.float32, shape=(None,) + observation_shape, name='obs1')
self.terminals1 = tf.placeholder(tf.float32, shape=(None, 1), name='terminals1')
self.rewards = tf.placeholder(tf.float32, shape=(None, 1), name='rewards')
self.actions = tf.placeholder(tf.float32, shape=(None,) + action_shape, name='actions')
self.critic_target = tf.placeholder(tf.float32, shape=(None, 1), name='critic_target')
self.param_noise_stddev = tf.placeholder(tf.float32, shape=(), name='param_noise_stddev')
# Parameters.
self.gamma = gamma
self.tau = tau
self.memory = memory
self.normalize_observations = normalize_observations
self.normalize_returns = normalize_returns
self.action_noise = action_noise
self.param_noise = param_noise
self.action_range = action_range
self.return_range = return_range
self.observation_range = observation_range
self.critic = critic
self.actor = actor
self.actor_lr = actor_lr
self.critic_lr = critic_lr
self.clip_norm = clip_norm
self.enable_popart = enable_popart
self.reward_scale = reward_scale
self.batch_size = batch_size
self.stats_sample = None
self.critic_l2_reg = critic_l2_reg
# Observation normalization.
if self.normalize_observations:
with tf.variable_scope('obs_rms'):
self.obs_rms = RunningMeanStd(shape=observation_shape)
else:
self.obs_rms = None
normalized_obs0 = tf.clip_by_value(normalize(self.obs0, self.obs_rms),
self.observation_range[0], self.observation_range[1])
normalized_obs1 = tf.clip_by_value(normalize(self.obs1, self.obs_rms),
self.observation_range[0], self.observation_range[1])
# Return normalization.
if self.normalize_returns:
with tf.variable_scope('ret_rms'):
self.ret_rms = RunningMeanStd()
else:
self.ret_rms = None
# Create target networks.
target_actor = copy(actor)
target_actor.name = 'target_actor'
self.target_actor = target_actor
target_critic = copy(critic)
target_critic.name = 'target_critic'
self.target_critic = target_critic
# Create networks and core TF parts that are shared across setup parts.
self.actor_tf = actor(normalized_obs0)
self.normalized_critic_tf = critic(normalized_obs0, self.actions)
self.critic_tf = denormalize(tf.clip_by_value(self.normalized_critic_tf, self.return_range[0], self.return_range[1]), self.ret_rms)
self.normalized_critic_with_actor_tf = critic(normalized_obs0, self.actor_tf, reuse=True)
self.critic_with_actor_tf = denormalize(tf.clip_by_value(self.normalized_critic_with_actor_tf, self.return_range[0], self.return_range[1]), self.ret_rms)
Q_obs1 = denormalize(target_critic(normalized_obs1, target_actor(normalized_obs1)), self.ret_rms)
self.target_Q = self.rewards + (1. - self.terminals1) * gamma * Q_obs1
# Set up parts.
if self.param_noise is not None:
self.setup_param_noise(normalized_obs0)
self.setup_actor_optimizer()
self.setup_critic_optimizer()
if self.normalize_returns and self.enable_popart:
self.setup_popart()
self.setup_stats()
self.setup_target_network_updates()
self.initial_state = None # recurrent architectures not supported yet
def setup_target_network_updates(self):
actor_init_updates, actor_soft_updates = get_target_updates(self.actor.vars, self.target_actor.vars, self.tau)
critic_init_updates, critic_soft_updates = get_target_updates(self.critic.vars, self.target_critic.vars, self.tau)
self.target_init_updates = [actor_init_updates, critic_init_updates]
self.target_soft_updates = [actor_soft_updates, critic_soft_updates]
def setup_param_noise(self, normalized_obs0):
assert self.param_noise is not None
# Configure perturbed actor.
param_noise_actor = copy(self.actor)
param_noise_actor.name = 'param_noise_actor'
self.perturbed_actor_tf = param_noise_actor(normalized_obs0)
logger.info('setting up param noise')
self.perturb_policy_ops = get_perturbed_actor_updates(self.actor, param_noise_actor, self.param_noise_stddev)
# Configure separate copy for stddev adoption.
adaptive_param_noise_actor = copy(self.actor)
adaptive_param_noise_actor.name = 'adaptive_param_noise_actor'
adaptive_actor_tf = adaptive_param_noise_actor(normalized_obs0)
self.perturb_adaptive_policy_ops = get_perturbed_actor_updates(self.actor, adaptive_param_noise_actor, self.param_noise_stddev)
self.adaptive_policy_distance = tf.sqrt(tf.reduce_mean(tf.square(self.actor_tf - adaptive_actor_tf)))
def setup_actor_optimizer(self):
logger.info('setting up actor optimizer')
self.actor_loss = -tf.reduce_mean(self.critic_with_actor_tf)
actor_shapes = [var.get_shape().as_list() for var in self.actor.trainable_vars]
actor_nb_params = sum([reduce(lambda x, y: x * y, shape) for shape in actor_shapes])
logger.info(' actor shapes: {}'.format(actor_shapes))
logger.info(' actor params: {}'.format(actor_nb_params))
self.actor_grads = U.flatgrad(self.actor_loss, self.actor.trainable_vars, clip_norm=self.clip_norm)
self.actor_optimizer = MpiAdam(var_list=self.actor.trainable_vars,
beta1=0.9, beta2=0.999, epsilon=1e-08)
def setup_critic_optimizer(self):
logger.info('setting up critic optimizer')
normalized_critic_target_tf = tf.clip_by_value(normalize(self.critic_target, self.ret_rms), self.return_range[0], self.return_range[1])
self.critic_loss = tf.reduce_mean(tf.square(self.normalized_critic_tf - normalized_critic_target_tf))
if self.critic_l2_reg > 0.:
critic_reg_vars = [var for var in self.critic.trainable_vars if var.name.endswith('/w:0') and 'output' not in var.name]
for var in critic_reg_vars:
logger.info(' regularizing: {}'.format(var.name))
logger.info(' applying l2 regularization with {}'.format(self.critic_l2_reg))
critic_reg = tc.layers.apply_regularization(
tc.layers.l2_regularizer(self.critic_l2_reg),
weights_list=critic_reg_vars
)
self.critic_loss += critic_reg
critic_shapes = [var.get_shape().as_list() for var in self.critic.trainable_vars]
critic_nb_params = sum([reduce(lambda x, y: x * y, shape) for shape in critic_shapes])
logger.info(' critic shapes: {}'.format(critic_shapes))
logger.info(' critic params: {}'.format(critic_nb_params))
self.critic_grads = U.flatgrad(self.critic_loss, self.critic.trainable_vars, clip_norm=self.clip_norm)
self.critic_optimizer = MpiAdam(var_list=self.critic.trainable_vars,
beta1=0.9, beta2=0.999, epsilon=1e-08)
def setup_popart(self):
# See https://arxiv.org/pdf/1602.07714.pdf for details.
self.old_std = tf.placeholder(tf.float32, shape=[1], name='old_std')
new_std = self.ret_rms.std
self.old_mean = tf.placeholder(tf.float32, shape=[1], name='old_mean')
new_mean = self.ret_rms.mean
self.renormalize_Q_outputs_op = []
for vs in [self.critic.output_vars, self.target_critic.output_vars]:
assert len(vs) == 2
M, b = vs
assert 'kernel' in M.name
assert 'bias' in b.name
assert M.get_shape()[-1] == 1
assert b.get_shape()[-1] == 1
self.renormalize_Q_outputs_op += [M.assign(M * self.old_std / new_std)]
self.renormalize_Q_outputs_op += [b.assign((b * self.old_std + self.old_mean - new_mean) / new_std)]
def setup_stats(self):
ops = []
names = []
if self.normalize_returns:
ops += [self.ret_rms.mean, self.ret_rms.std]
names += ['ret_rms_mean', 'ret_rms_std']
if self.normalize_observations:
ops += [tf.reduce_mean(self.obs_rms.mean), tf.reduce_mean(self.obs_rms.std)]
names += ['obs_rms_mean', 'obs_rms_std']
ops += [tf.reduce_mean(self.critic_tf)]
names += ['reference_Q_mean']
ops += [reduce_std(self.critic_tf)]
names += ['reference_Q_std']
ops += [tf.reduce_mean(self.critic_with_actor_tf)]
names += ['reference_actor_Q_mean']
ops += [reduce_std(self.critic_with_actor_tf)]
names += ['reference_actor_Q_std']
ops += [tf.reduce_mean(self.actor_tf)]
names += ['reference_action_mean']
ops += [reduce_std(self.actor_tf)]
names += ['reference_action_std']
if self.param_noise:
ops += [tf.reduce_mean(self.perturbed_actor_tf)]
names += ['reference_perturbed_action_mean']
ops += [reduce_std(self.perturbed_actor_tf)]
names += ['reference_perturbed_action_std']
self.stats_ops = ops
self.stats_names = names
def step(self, obs, apply_noise=True, compute_Q=True):
if self.param_noise is not None and apply_noise:
actor_tf = self.perturbed_actor_tf
else:
actor_tf = self.actor_tf
feed_dict = {self.obs0: U.adjust_shape(self.obs0, [obs])}
if compute_Q:
action, q = self.sess.run([actor_tf, self.critic_with_actor_tf], feed_dict=feed_dict)
else:
action = self.sess.run(actor_tf, feed_dict=feed_dict)
q = None
if self.action_noise is not None and apply_noise:
noise = self.action_noise()
assert noise.shape == action[0].shape
action += noise
action = np.clip(action, self.action_range[0], self.action_range[1])
return action, q, None, None
def store_transition(self, obs0, action, reward, obs1, terminal1):
reward *= self.reward_scale
B = obs0.shape[0]
for b in range(B):
self.memory.append(obs0[b], action[b], reward[b], obs1[b], terminal1[b])
if self.normalize_observations:
self.obs_rms.update(np.array([obs0[b]]))
def train(self):
# Get a batch.
batch = self.memory.sample(batch_size=self.batch_size)
if self.normalize_returns and self.enable_popart:
old_mean, old_std, target_Q = self.sess.run([self.ret_rms.mean, self.ret_rms.std, self.target_Q], feed_dict={
self.obs1: batch['obs1'],
self.rewards: batch['rewards'],
self.terminals1: batch['terminals1'].astype('float32'),
})
self.ret_rms.update(target_Q.flatten())
self.sess.run(self.renormalize_Q_outputs_op, feed_dict={
self.old_std : np.array([old_std]),
self.old_mean : np.array([old_mean]),
})
# Run sanity check. Disabled by default since it slows down things considerably.
# print('running sanity check')
# target_Q_new, new_mean, new_std = self.sess.run([self.target_Q, self.ret_rms.mean, self.ret_rms.std], feed_dict={
# self.obs1: batch['obs1'],
# self.rewards: batch['rewards'],
# self.terminals1: batch['terminals1'].astype('float32'),
# })
# print(target_Q_new, target_Q, new_mean, new_std)
# assert (np.abs(target_Q - target_Q_new) < 1e-3).all()
else:
target_Q = self.sess.run(self.target_Q, feed_dict={
self.obs1: batch['obs1'],
self.rewards: batch['rewards'],
self.terminals1: batch['terminals1'].astype('float32'),
})
# Get all gradients and perform a synced update.
ops = [self.actor_grads, self.actor_loss, self.critic_grads, self.critic_loss]
actor_grads, actor_loss, critic_grads, critic_loss = self.sess.run(ops, feed_dict={
self.obs0: batch['obs0'],
self.actions: batch['actions'],
self.critic_target: target_Q,
})
self.actor_optimizer.update(actor_grads, stepsize=self.actor_lr)
self.critic_optimizer.update(critic_grads, stepsize=self.critic_lr)
return critic_loss, actor_loss
def initialize(self, sess):
self.sess = sess
self.sess.run(tf.global_variables_initializer())
self.actor_optimizer.sync()
self.critic_optimizer.sync()
self.sess.run(self.target_init_updates)
def update_target_net(self):
self.sess.run(self.target_soft_updates)
def get_stats(self):
if self.stats_sample is None:
# Get a sample and keep that fixed for all further computations.
# This allows us to estimate the change in value for the same set of inputs.
self.stats_sample = self.memory.sample(batch_size=self.batch_size)
values = self.sess.run(self.stats_ops, feed_dict={
self.obs0: self.stats_sample['obs0'],
self.actions: self.stats_sample['actions'],
})
names = self.stats_names[:]
assert len(names) == len(values)
stats = dict(zip(names, values))
if self.param_noise is not None:
stats = {**stats, **self.param_noise.get_stats()}
return stats
def adapt_param_noise(self):
try:
from mpi4py import MPI
except ImportError:
MPI = None
if self.param_noise is None:
return 0.
# Perturb a separate copy of the policy to adjust the scale for the next "real" perturbation.
batch = self.memory.sample(batch_size=self.batch_size)
self.sess.run(self.perturb_adaptive_policy_ops, feed_dict={
self.param_noise_stddev: self.param_noise.current_stddev,
})
distance = self.sess.run(self.adaptive_policy_distance, feed_dict={
self.obs0: batch['obs0'],
self.param_noise_stddev: self.param_noise.current_stddev,
})
if MPI is not None:
mean_distance = MPI.COMM_WORLD.allreduce(distance, op=MPI.SUM) / MPI.COMM_WORLD.Get_size()
else:
mean_distance = distance
self.param_noise.adapt(mean_distance)
return mean_distance
def reset(self):
# Reset internal state after an episode is complete.
if self.action_noise is not None:
self.action_noise.reset()
if self.param_noise is not None:
self.sess.run(self.perturb_policy_ops, feed_dict={
self.param_noise_stddev: self.param_noise.current_stddev,
})
| 17,731 | 43.664987 | 161 | py |
baselines | baselines-master/baselines/ddpg/noise.py | import numpy as np
class AdaptiveParamNoiseSpec(object):
def __init__(self, initial_stddev=0.1, desired_action_stddev=0.1, adoption_coefficient=1.01):
self.initial_stddev = initial_stddev
self.desired_action_stddev = desired_action_stddev
self.adoption_coefficient = adoption_coefficient
self.current_stddev = initial_stddev
def adapt(self, distance):
if distance > self.desired_action_stddev:
# Decrease stddev.
self.current_stddev /= self.adoption_coefficient
else:
# Increase stddev.
self.current_stddev *= self.adoption_coefficient
def get_stats(self):
stats = {
'param_noise_stddev': self.current_stddev,
}
return stats
def __repr__(self):
fmt = 'AdaptiveParamNoiseSpec(initial_stddev={}, desired_action_stddev={}, adoption_coefficient={})'
return fmt.format(self.initial_stddev, self.desired_action_stddev, self.adoption_coefficient)
class ActionNoise(object):
def reset(self):
pass
class NormalActionNoise(ActionNoise):
def __init__(self, mu, sigma):
self.mu = mu
self.sigma = sigma
def __call__(self):
return np.random.normal(self.mu, self.sigma)
def __repr__(self):
return 'NormalActionNoise(mu={}, sigma={})'.format(self.mu, self.sigma)
# Based on http://math.stackexchange.com/questions/1287634/implementing-ornstein-uhlenbeck-in-matlab
class OrnsteinUhlenbeckActionNoise(ActionNoise):
def __init__(self, mu, sigma, theta=.15, dt=1e-2, x0=None):
self.theta = theta
self.mu = mu
self.sigma = sigma
self.dt = dt
self.x0 = x0
self.reset()
def __call__(self):
x = self.x_prev + self.theta * (self.mu - self.x_prev) * self.dt + self.sigma * np.sqrt(self.dt) * np.random.normal(size=self.mu.shape)
self.x_prev = x
return x
def reset(self):
self.x_prev = self.x0 if self.x0 is not None else np.zeros_like(self.mu)
def __repr__(self):
return 'OrnsteinUhlenbeckActionNoise(mu={}, sigma={})'.format(self.mu, self.sigma)
| 2,162 | 30.808824 | 143 | py |
baselines | baselines-master/baselines/ddpg/test_smoke.py | from baselines.common.tests.util import smoketest
def _run(argstr):
smoketest('--alg=ddpg --env=Pendulum-v0 --num_timesteps=0 ' + argstr)
def test_popart():
_run('--normalize_returns=True --popart=True')
def test_noise_normal():
_run('--noise_type=normal_0.1')
def test_noise_ou():
_run('--noise_type=ou_0.1')
def test_noise_adaptive():
_run('--noise_type=adaptive-param_0.2,normal_0.1')
| 413 | 23.352941 | 73 | py |
baselines | baselines-master/baselines/ddpg/models.py | import tensorflow as tf
from baselines.common.models import get_network_builder
class Model(object):
def __init__(self, name, network='mlp', **network_kwargs):
self.name = name
self.network_builder = get_network_builder(network)(**network_kwargs)
@property
def vars(self):
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope=self.name)
@property
def trainable_vars(self):
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, scope=self.name)
@property
def perturbable_vars(self):
return [var for var in self.trainable_vars if 'LayerNorm' not in var.name]
class Actor(Model):
def __init__(self, nb_actions, name='actor', network='mlp', **network_kwargs):
super().__init__(name=name, network=network, **network_kwargs)
self.nb_actions = nb_actions
def __call__(self, obs, reuse=False):
with tf.variable_scope(self.name, reuse=tf.AUTO_REUSE):
x = self.network_builder(obs)
x = tf.layers.dense(x, self.nb_actions, kernel_initializer=tf.random_uniform_initializer(minval=-3e-3, maxval=3e-3))
x = tf.nn.tanh(x)
return x
class Critic(Model):
def __init__(self, name='critic', network='mlp', **network_kwargs):
super().__init__(name=name, network=network, **network_kwargs)
self.layer_norm = True
def __call__(self, obs, action, reuse=False):
with tf.variable_scope(self.name, reuse=tf.AUTO_REUSE):
x = tf.concat([obs, action], axis=-1) # this assumes observation and action can be concatenated
x = self.network_builder(x)
x = tf.layers.dense(x, 1, kernel_initializer=tf.random_uniform_initializer(minval=-3e-3, maxval=3e-3), name='output')
return x
@property
def output_vars(self):
output_vars = [var for var in self.trainable_vars if 'output' in var.name]
return output_vars
| 1,941 | 36.346154 | 129 | py |
baselines | baselines-master/baselines/ddpg/__init__.py | 0 | 0 | 0 | py | |
baselines | baselines-master/baselines/acktr/acktr.py | import os.path as osp
import time
import functools
import tensorflow as tf
from baselines import logger
from baselines.common import set_global_seeds, explained_variance
from baselines.common.policies import build_policy
from baselines.common.tf_util import get_session, save_variables, load_variables
from baselines.a2c.runner import Runner
from baselines.a2c.utils import Scheduler, find_trainable_variables
from baselines.acktr import kfac
from baselines.ppo2.ppo2 import safemean
from collections import deque
class Model(object):
def __init__(self, policy, ob_space, ac_space, nenvs,total_timesteps, nprocs=32, nsteps=20,
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
kfac_clip=0.001, lrschedule='linear', is_async=True):
self.sess = sess = get_session()
nbatch = nenvs * nsteps
with tf.variable_scope('acktr_model', reuse=tf.AUTO_REUSE):
self.model = step_model = policy(nenvs, 1, sess=sess)
self.model2 = train_model = policy(nenvs*nsteps, nsteps, sess=sess)
A = train_model.pdtype.sample_placeholder([None])
ADV = tf.placeholder(tf.float32, [nbatch])
R = tf.placeholder(tf.float32, [nbatch])
PG_LR = tf.placeholder(tf.float32, [])
VF_LR = tf.placeholder(tf.float32, [])
neglogpac = train_model.pd.neglogp(A)
self.logits = train_model.pi
##training loss
pg_loss = tf.reduce_mean(ADV*neglogpac)
entropy = tf.reduce_mean(train_model.pd.entropy())
pg_loss = pg_loss - ent_coef * entropy
vf_loss = tf.losses.mean_squared_error(tf.squeeze(train_model.vf), R)
train_loss = pg_loss + vf_coef * vf_loss
##Fisher loss construction
self.pg_fisher = pg_fisher_loss = -tf.reduce_mean(neglogpac)
sample_net = train_model.vf + tf.random_normal(tf.shape(train_model.vf))
self.vf_fisher = vf_fisher_loss = - vf_fisher_coef*tf.reduce_mean(tf.pow(train_model.vf - tf.stop_gradient(sample_net), 2))
self.joint_fisher = joint_fisher_loss = pg_fisher_loss + vf_fisher_loss
self.params=params = find_trainable_variables("acktr_model")
self.grads_check = grads = tf.gradients(train_loss,params)
with tf.device('/gpu:0'):
self.optim = optim = kfac.KfacOptimizer(learning_rate=PG_LR, clip_kl=kfac_clip,\
momentum=0.9, kfac_update=1, epsilon=0.01,\
stats_decay=0.99, is_async=is_async, cold_iter=10, max_grad_norm=max_grad_norm)
# update_stats_op = optim.compute_and_apply_stats(joint_fisher_loss, var_list=params)
optim.compute_and_apply_stats(joint_fisher_loss, var_list=params)
train_op, q_runner = optim.apply_gradients(list(zip(grads,params)))
self.q_runner = q_runner
self.lr = Scheduler(v=lr, nvalues=total_timesteps, schedule=lrschedule)
def train(obs, states, rewards, masks, actions, values):
advs = rewards - values
for step in range(len(obs)):
cur_lr = self.lr.value()
td_map = {train_model.X:obs, A:actions, ADV:advs, R:rewards, PG_LR:cur_lr, VF_LR:cur_lr}
if states is not None:
td_map[train_model.S] = states
td_map[train_model.M] = masks
policy_loss, value_loss, policy_entropy, _ = sess.run(
[pg_loss, vf_loss, entropy, train_op],
td_map
)
return policy_loss, value_loss, policy_entropy
self.train = train
self.save = functools.partial(save_variables, sess=sess)
self.load = functools.partial(load_variables, sess=sess)
self.train_model = train_model
self.step_model = step_model
self.step = step_model.step
self.value = step_model.value
self.initial_state = step_model.initial_state
tf.global_variables_initializer().run(session=sess)
def learn(network, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval=100, nprocs=32, nsteps=20,
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
kfac_clip=0.001, save_interval=None, lrschedule='linear', load_path=None, is_async=True, **network_kwargs):
set_global_seeds(seed)
if network == 'cnn':
network_kwargs['one_dim_bias'] = True
policy = build_policy(env, network, **network_kwargs)
nenvs = env.num_envs
ob_space = env.observation_space
ac_space = env.action_space
make_model = lambda : Model(policy, ob_space, ac_space, nenvs, total_timesteps, nprocs=nprocs, nsteps
=nsteps, ent_coef=ent_coef, vf_coef=vf_coef, vf_fisher_coef=
vf_fisher_coef, lr=lr, max_grad_norm=max_grad_norm, kfac_clip=kfac_clip,
lrschedule=lrschedule, is_async=is_async)
if save_interval and logger.get_dir():
import cloudpickle
with open(osp.join(logger.get_dir(), 'make_model.pkl'), 'wb') as fh:
fh.write(cloudpickle.dumps(make_model))
model = make_model()
if load_path is not None:
model.load(load_path)
runner = Runner(env, model, nsteps=nsteps, gamma=gamma)
epinfobuf = deque(maxlen=100)
nbatch = nenvs*nsteps
tstart = time.time()
coord = tf.train.Coordinator()
if is_async:
enqueue_threads = model.q_runner.create_threads(model.sess, coord=coord, start=True)
else:
enqueue_threads = []
for update in range(1, total_timesteps//nbatch+1):
obs, states, rewards, masks, actions, values, epinfos = runner.run()
epinfobuf.extend(epinfos)
policy_loss, value_loss, policy_entropy = model.train(obs, states, rewards, masks, actions, values)
model.old_obs = obs
nseconds = time.time()-tstart
fps = int((update*nbatch)/nseconds)
if update % log_interval == 0 or update == 1:
ev = explained_variance(values, rewards)
logger.record_tabular("nupdates", update)
logger.record_tabular("total_timesteps", update*nbatch)
logger.record_tabular("fps", fps)
logger.record_tabular("policy_entropy", float(policy_entropy))
logger.record_tabular("policy_loss", float(policy_loss))
logger.record_tabular("value_loss", float(value_loss))
logger.record_tabular("explained_variance", float(ev))
logger.record_tabular("eprewmean", safemean([epinfo['r'] for epinfo in epinfobuf]))
logger.record_tabular("eplenmean", safemean([epinfo['l'] for epinfo in epinfobuf]))
logger.dump_tabular()
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir():
savepath = osp.join(logger.get_dir(), 'checkpoint%.5i'%update)
print('Saving to', savepath)
model.save(savepath)
coord.request_stop()
coord.join(enqueue_threads)
return model
| 7,037 | 43.264151 | 131 | py |
baselines | baselines-master/baselines/acktr/kfac.py | import tensorflow as tf
import numpy as np
import re
# flake8: noqa F403, F405
from baselines.acktr.kfac_utils import *
from functools import reduce
KFAC_OPS = ['MatMul', 'Conv2D', 'BiasAdd']
KFAC_DEBUG = False
class KfacOptimizer():
# note that KfacOptimizer will be truly synchronous (and thus deterministic) only if a single-threaded session is used
def __init__(self, learning_rate=0.01, momentum=0.9, clip_kl=0.01, kfac_update=2, stats_accum_iter=60, full_stats_init=False, cold_iter=100, cold_lr=None, is_async=False, async_stats=False, epsilon=1e-2, stats_decay=0.95, blockdiag_bias=False, channel_fac=False, factored_damping=False, approxT2=False, use_float64=False, weight_decay_dict={},max_grad_norm=0.5):
self.max_grad_norm = max_grad_norm
self._lr = learning_rate
self._momentum = momentum
self._clip_kl = clip_kl
self._channel_fac = channel_fac
self._kfac_update = kfac_update
self._async = is_async
self._async_stats = async_stats
self._epsilon = epsilon
self._stats_decay = stats_decay
self._blockdiag_bias = blockdiag_bias
self._approxT2 = approxT2
self._use_float64 = use_float64
self._factored_damping = factored_damping
self._cold_iter = cold_iter
if cold_lr == None:
# good heuristics
self._cold_lr = self._lr# * 3.
else:
self._cold_lr = cold_lr
self._stats_accum_iter = stats_accum_iter
self._weight_decay_dict = weight_decay_dict
self._diag_init_coeff = 0.
self._full_stats_init = full_stats_init
if not self._full_stats_init:
self._stats_accum_iter = self._cold_iter
self.sgd_step = tf.Variable(0, name='KFAC/sgd_step', trainable=False)
self.global_step = tf.Variable(
0, name='KFAC/global_step', trainable=False)
self.cold_step = tf.Variable(0, name='KFAC/cold_step', trainable=False)
self.factor_step = tf.Variable(
0, name='KFAC/factor_step', trainable=False)
self.stats_step = tf.Variable(
0, name='KFAC/stats_step', trainable=False)
self.vFv = tf.Variable(0., name='KFAC/vFv', trainable=False)
self.factors = {}
self.param_vars = []
self.stats = {}
self.stats_eigen = {}
def getFactors(self, g, varlist):
graph = tf.get_default_graph()
factorTensors = {}
fpropTensors = []
bpropTensors = []
opTypes = []
fops = []
def searchFactors(gradient, graph):
# hard coded search stratergy
bpropOp = gradient.op
bpropOp_name = bpropOp.name
bTensors = []
fTensors = []
# combining additive gradient, assume they are the same op type and
# indepedent
if 'AddN' in bpropOp_name:
factors = []
for g in gradient.op.inputs:
factors.append(searchFactors(g, graph))
op_names = [item['opName'] for item in factors]
# TO-DO: need to check all the attribute of the ops as well
print (gradient.name)
print (op_names)
print (len(np.unique(op_names)))
assert len(np.unique(op_names)) == 1, gradient.name + \
' is shared among different computation OPs'
bTensors = reduce(lambda x, y: x + y,
[item['bpropFactors'] for item in factors])
if len(factors[0]['fpropFactors']) > 0:
fTensors = reduce(
lambda x, y: x + y, [item['fpropFactors'] for item in factors])
fpropOp_name = op_names[0]
fpropOp = factors[0]['op']
else:
fpropOp_name = re.search(
'gradientsSampled(_[0-9]+|)/(.+?)_grad', bpropOp_name).group(2)
fpropOp = graph.get_operation_by_name(fpropOp_name)
if fpropOp.op_def.name in KFAC_OPS:
# Known OPs
###
bTensor = [
i for i in bpropOp.inputs if 'gradientsSampled' in i.name][-1]
bTensorShape = fpropOp.outputs[0].get_shape()
if bTensor.get_shape()[0].value == None:
bTensor.set_shape(bTensorShape)
bTensors.append(bTensor)
###
if fpropOp.op_def.name == 'BiasAdd':
fTensors = []
else:
fTensors.append(
[i for i in fpropOp.inputs if param.op.name not in i.name][0])
fpropOp_name = fpropOp.op_def.name
else:
# unknown OPs, block approximation used
bInputsList = [i for i in bpropOp.inputs[
0].op.inputs if 'gradientsSampled' in i.name if 'Shape' not in i.name]
if len(bInputsList) > 0:
bTensor = bInputsList[0]
bTensorShape = fpropOp.outputs[0].get_shape()
if len(bTensor.get_shape()) > 0 and bTensor.get_shape()[0].value == None:
bTensor.set_shape(bTensorShape)
bTensors.append(bTensor)
fpropOp_name = opTypes.append('UNK-' + fpropOp.op_def.name)
return {'opName': fpropOp_name, 'op': fpropOp, 'fpropFactors': fTensors, 'bpropFactors': bTensors}
for t, param in zip(g, varlist):
if KFAC_DEBUG:
print(('get factor for '+param.name))
factors = searchFactors(t, graph)
factorTensors[param] = factors
########
# check associated weights and bias for homogeneous coordinate representation
# and check redundent factors
# TO-DO: there may be a bug to detect associate bias and weights for
# forking layer, e.g. in inception models.
for param in varlist:
factorTensors[param]['assnWeights'] = None
factorTensors[param]['assnBias'] = None
for param in varlist:
if factorTensors[param]['opName'] == 'BiasAdd':
factorTensors[param]['assnWeights'] = None
for item in varlist:
if len(factorTensors[item]['bpropFactors']) > 0:
if (set(factorTensors[item]['bpropFactors']) == set(factorTensors[param]['bpropFactors'])) and (len(factorTensors[item]['fpropFactors']) > 0):
factorTensors[param]['assnWeights'] = item
factorTensors[item]['assnBias'] = param
factorTensors[param]['bpropFactors'] = factorTensors[
item]['bpropFactors']
########
########
# concatenate the additive gradients along the batch dimension, i.e.
# assuming independence structure
for key in ['fpropFactors', 'bpropFactors']:
for i, param in enumerate(varlist):
if len(factorTensors[param][key]) > 0:
if (key + '_concat') not in factorTensors[param]:
name_scope = factorTensors[param][key][0].name.split(':')[
0]
with tf.name_scope(name_scope):
factorTensors[param][
key + '_concat'] = tf.concat(factorTensors[param][key], 0)
else:
factorTensors[param][key + '_concat'] = None
for j, param2 in enumerate(varlist[(i + 1):]):
if (len(factorTensors[param][key]) > 0) and (set(factorTensors[param2][key]) == set(factorTensors[param][key])):
factorTensors[param2][key] = factorTensors[param][key]
factorTensors[param2][
key + '_concat'] = factorTensors[param][key + '_concat']
########
if KFAC_DEBUG:
for items in zip(varlist, fpropTensors, bpropTensors, opTypes):
print((items[0].name, factorTensors[item]))
self.factors = factorTensors
return factorTensors
def getStats(self, factors, varlist):
if len(self.stats) == 0:
# initialize stats variables on CPU because eigen decomp is
# computed on CPU
with tf.device('/cpu'):
tmpStatsCache = {}
# search for tensor factors and
# use block diag approx for the bias units
for var in varlist:
fpropFactor = factors[var]['fpropFactors_concat']
bpropFactor = factors[var]['bpropFactors_concat']
opType = factors[var]['opName']
if opType == 'Conv2D':
Kh = var.get_shape()[0]
Kw = var.get_shape()[1]
C = fpropFactor.get_shape()[-1]
Oh = bpropFactor.get_shape()[1]
Ow = bpropFactor.get_shape()[2]
if Oh == 1 and Ow == 1 and self._channel_fac:
# factorization along the channels do not support
# homogeneous coordinate
var_assnBias = factors[var]['assnBias']
if var_assnBias:
factors[var]['assnBias'] = None
factors[var_assnBias]['assnWeights'] = None
##
for var in varlist:
fpropFactor = factors[var]['fpropFactors_concat']
bpropFactor = factors[var]['bpropFactors_concat']
opType = factors[var]['opName']
self.stats[var] = {'opName': opType,
'fprop_concat_stats': [],
'bprop_concat_stats': [],
'assnWeights': factors[var]['assnWeights'],
'assnBias': factors[var]['assnBias'],
}
if fpropFactor is not None:
if fpropFactor not in tmpStatsCache:
if opType == 'Conv2D':
Kh = var.get_shape()[0]
Kw = var.get_shape()[1]
C = fpropFactor.get_shape()[-1]
Oh = bpropFactor.get_shape()[1]
Ow = bpropFactor.get_shape()[2]
if Oh == 1 and Ow == 1 and self._channel_fac:
# factorization along the channels
# assume independence between input channels and spatial
# 2K-1 x 2K-1 covariance matrix and C x C covariance matrix
# factorization along the channels do not
# support homogeneous coordinate, assnBias
# is always None
fpropFactor2_size = Kh * Kw
slot_fpropFactor_stats2 = tf.Variable(tf.diag(tf.ones(
[fpropFactor2_size])) * self._diag_init_coeff, name='KFAC_STATS/' + fpropFactor.op.name, trainable=False)
self.stats[var]['fprop_concat_stats'].append(
slot_fpropFactor_stats2)
fpropFactor_size = C
else:
# 2K-1 x 2K-1 x C x C covariance matrix
# assume BHWC
fpropFactor_size = Kh * Kw * C
else:
# D x D covariance matrix
fpropFactor_size = fpropFactor.get_shape()[-1]
# use homogeneous coordinate
if not self._blockdiag_bias and self.stats[var]['assnBias']:
fpropFactor_size += 1
slot_fpropFactor_stats = tf.Variable(tf.diag(tf.ones(
[fpropFactor_size])) * self._diag_init_coeff, name='KFAC_STATS/' + fpropFactor.op.name, trainable=False)
self.stats[var]['fprop_concat_stats'].append(
slot_fpropFactor_stats)
if opType != 'Conv2D':
tmpStatsCache[fpropFactor] = self.stats[
var]['fprop_concat_stats']
else:
self.stats[var][
'fprop_concat_stats'] = tmpStatsCache[fpropFactor]
if bpropFactor is not None:
# no need to collect backward stats for bias vectors if
# using homogeneous coordinates
if not((not self._blockdiag_bias) and self.stats[var]['assnWeights']):
if bpropFactor not in tmpStatsCache:
slot_bpropFactor_stats = tf.Variable(tf.diag(tf.ones([bpropFactor.get_shape(
)[-1]])) * self._diag_init_coeff, name='KFAC_STATS/' + bpropFactor.op.name, trainable=False)
self.stats[var]['bprop_concat_stats'].append(
slot_bpropFactor_stats)
tmpStatsCache[bpropFactor] = self.stats[
var]['bprop_concat_stats']
else:
self.stats[var][
'bprop_concat_stats'] = tmpStatsCache[bpropFactor]
return self.stats
def compute_and_apply_stats(self, loss_sampled, var_list=None):
varlist = var_list
if varlist is None:
varlist = tf.trainable_variables()
stats = self.compute_stats(loss_sampled, var_list=varlist)
return self.apply_stats(stats)
def compute_stats(self, loss_sampled, var_list=None):
varlist = var_list
if varlist is None:
varlist = tf.trainable_variables()
gs = tf.gradients(loss_sampled, varlist, name='gradientsSampled')
self.gs = gs
factors = self.getFactors(gs, varlist)
stats = self.getStats(factors, varlist)
updateOps = []
statsUpdates = {}
statsUpdates_cache = {}
for var in varlist:
opType = factors[var]['opName']
fops = factors[var]['op']
fpropFactor = factors[var]['fpropFactors_concat']
fpropStats_vars = stats[var]['fprop_concat_stats']
bpropFactor = factors[var]['bpropFactors_concat']
bpropStats_vars = stats[var]['bprop_concat_stats']
SVD_factors = {}
for stats_var in fpropStats_vars:
stats_var_dim = int(stats_var.get_shape()[0])
if stats_var not in statsUpdates_cache:
old_fpropFactor = fpropFactor
B = (tf.shape(fpropFactor)[0]) # batch size
if opType == 'Conv2D':
strides = fops.get_attr("strides")
padding = fops.get_attr("padding")
convkernel_size = var.get_shape()[0:3]
KH = int(convkernel_size[0])
KW = int(convkernel_size[1])
C = int(convkernel_size[2])
flatten_size = int(KH * KW * C)
Oh = int(bpropFactor.get_shape()[1])
Ow = int(bpropFactor.get_shape()[2])
if Oh == 1 and Ow == 1 and self._channel_fac:
# factorization along the channels
# assume independence among input channels
# factor = B x 1 x 1 x (KH xKW x C)
# patches = B x Oh x Ow x (KH xKW x C)
if len(SVD_factors) == 0:
if KFAC_DEBUG:
print(('approx %s act factor with rank-1 SVD factors' % (var.name)))
# find closest rank-1 approx to the feature map
S, U, V = tf.batch_svd(tf.reshape(
fpropFactor, [-1, KH * KW, C]))
# get rank-1 approx slides
sqrtS1 = tf.expand_dims(tf.sqrt(S[:, 0, 0]), 1)
patches_k = U[:, :, 0] * sqrtS1 # B x KH*KW
full_factor_shape = fpropFactor.get_shape()
patches_k.set_shape(
[full_factor_shape[0], KH * KW])
patches_c = V[:, :, 0] * sqrtS1 # B x C
patches_c.set_shape([full_factor_shape[0], C])
SVD_factors[C] = patches_c
SVD_factors[KH * KW] = patches_k
fpropFactor = SVD_factors[stats_var_dim]
else:
# poor mem usage implementation
patches = tf.extract_image_patches(fpropFactor, ksizes=[1, convkernel_size[
0], convkernel_size[1], 1], strides=strides, rates=[1, 1, 1, 1], padding=padding)
if self._approxT2:
if KFAC_DEBUG:
print(('approxT2 act fisher for %s' % (var.name)))
# T^2 terms * 1/T^2, size: B x C
fpropFactor = tf.reduce_mean(patches, [1, 2])
else:
# size: (B x Oh x Ow) x C
fpropFactor = tf.reshape(
patches, [-1, flatten_size]) / Oh / Ow
fpropFactor_size = int(fpropFactor.get_shape()[-1])
if stats_var_dim == (fpropFactor_size + 1) and not self._blockdiag_bias:
if opType == 'Conv2D' and not self._approxT2:
# correct padding for numerical stability (we
# divided out OhxOw from activations for T1 approx)
fpropFactor = tf.concat([fpropFactor, tf.ones(
[tf.shape(fpropFactor)[0], 1]) / Oh / Ow], 1)
else:
# use homogeneous coordinates
fpropFactor = tf.concat(
[fpropFactor, tf.ones([tf.shape(fpropFactor)[0], 1])], 1)
# average over the number of data points in a batch
# divided by B
cov = tf.matmul(fpropFactor, fpropFactor,
transpose_a=True) / tf.cast(B, tf.float32)
updateOps.append(cov)
statsUpdates[stats_var] = cov
if opType != 'Conv2D':
# HACK: for convolution we recompute fprop stats for
# every layer including forking layers
statsUpdates_cache[stats_var] = cov
for stats_var in bpropStats_vars:
stats_var_dim = int(stats_var.get_shape()[0])
if stats_var not in statsUpdates_cache:
old_bpropFactor = bpropFactor
bpropFactor_shape = bpropFactor.get_shape()
B = tf.shape(bpropFactor)[0] # batch size
C = int(bpropFactor_shape[-1]) # num channels
if opType == 'Conv2D' or len(bpropFactor_shape) == 4:
if fpropFactor is not None:
if self._approxT2:
if KFAC_DEBUG:
print(('approxT2 grad fisher for %s' % (var.name)))
bpropFactor = tf.reduce_sum(
bpropFactor, [1, 2]) # T^2 terms * 1/T^2
else:
bpropFactor = tf.reshape(
bpropFactor, [-1, C]) * Oh * Ow # T * 1/T terms
else:
# just doing block diag approx. spatial independent
# structure does not apply here. summing over
# spatial locations
if KFAC_DEBUG:
print(('block diag approx fisher for %s' % (var.name)))
bpropFactor = tf.reduce_sum(bpropFactor, [1, 2])
# assume sampled loss is averaged. TO-DO:figure out better
# way to handle this
bpropFactor *= tf.to_float(B)
##
cov_b = tf.matmul(
bpropFactor, bpropFactor, transpose_a=True) / tf.to_float(tf.shape(bpropFactor)[0])
updateOps.append(cov_b)
statsUpdates[stats_var] = cov_b
statsUpdates_cache[stats_var] = cov_b
if KFAC_DEBUG:
aKey = list(statsUpdates.keys())[0]
statsUpdates[aKey] = tf.Print(statsUpdates[aKey],
[tf.convert_to_tensor('step:'),
self.global_step,
tf.convert_to_tensor(
'computing stats'),
])
self.statsUpdates = statsUpdates
return statsUpdates
def apply_stats(self, statsUpdates):
""" compute stats and update/apply the new stats to the running average
"""
def updateAccumStats():
if self._full_stats_init:
return tf.cond(tf.greater(self.sgd_step, self._cold_iter), lambda: tf.group(*self._apply_stats(statsUpdates, accumulate=True, accumulateCoeff=1. / self._stats_accum_iter)), tf.no_op)
else:
return tf.group(*self._apply_stats(statsUpdates, accumulate=True, accumulateCoeff=1. / self._stats_accum_iter))
def updateRunningAvgStats(statsUpdates, fac_iter=1):
# return tf.cond(tf.greater_equal(self.factor_step,
# tf.convert_to_tensor(fac_iter)), lambda:
# tf.group(*self._apply_stats(stats_list, varlist)), tf.no_op)
return tf.group(*self._apply_stats(statsUpdates))
if self._async_stats:
# asynchronous stats update
update_stats = self._apply_stats(statsUpdates)
queue = tf.FIFOQueue(1, [item.dtype for item in update_stats], shapes=[
item.get_shape() for item in update_stats])
enqueue_op = queue.enqueue(update_stats)
def dequeue_stats_op():
return queue.dequeue()
self.qr_stats = tf.train.QueueRunner(queue, [enqueue_op])
update_stats_op = tf.cond(tf.equal(queue.size(), tf.convert_to_tensor(
0)), tf.no_op, lambda: tf.group(*[dequeue_stats_op(), ]))
else:
# synchronous stats update
update_stats_op = tf.cond(tf.greater_equal(
self.stats_step, self._stats_accum_iter), lambda: updateRunningAvgStats(statsUpdates), updateAccumStats)
self._update_stats_op = update_stats_op
return update_stats_op
def _apply_stats(self, statsUpdates, accumulate=False, accumulateCoeff=0.):
updateOps = []
# obtain the stats var list
for stats_var in statsUpdates:
stats_new = statsUpdates[stats_var]
if accumulate:
# simple superbatch averaging
update_op = tf.assign_add(
stats_var, accumulateCoeff * stats_new, use_locking=True)
else:
# exponential running averaging
update_op = tf.assign(
stats_var, stats_var * self._stats_decay, use_locking=True)
update_op = tf.assign_add(
update_op, (1. - self._stats_decay) * stats_new, use_locking=True)
updateOps.append(update_op)
with tf.control_dependencies(updateOps):
stats_step_op = tf.assign_add(self.stats_step, 1)
if KFAC_DEBUG:
stats_step_op = (tf.Print(stats_step_op,
[tf.convert_to_tensor('step:'),
self.global_step,
tf.convert_to_tensor('fac step:'),
self.factor_step,
tf.convert_to_tensor('sgd step:'),
self.sgd_step,
tf.convert_to_tensor('Accum:'),
tf.convert_to_tensor(accumulate),
tf.convert_to_tensor('Accum coeff:'),
tf.convert_to_tensor(accumulateCoeff),
tf.convert_to_tensor('stat step:'),
self.stats_step, updateOps[0], updateOps[1]]))
return [stats_step_op, ]
def getStatsEigen(self, stats=None):
if len(self.stats_eigen) == 0:
stats_eigen = {}
if stats is None:
stats = self.stats
tmpEigenCache = {}
with tf.device('/cpu:0'):
for var in stats:
for key in ['fprop_concat_stats', 'bprop_concat_stats']:
for stats_var in stats[var][key]:
if stats_var not in tmpEigenCache:
stats_dim = stats_var.get_shape()[1].value
e = tf.Variable(tf.ones(
[stats_dim]), name='KFAC_FAC/' + stats_var.name.split(':')[0] + '/e', trainable=False)
Q = tf.Variable(tf.diag(tf.ones(
[stats_dim])), name='KFAC_FAC/' + stats_var.name.split(':')[0] + '/Q', trainable=False)
stats_eigen[stats_var] = {'e': e, 'Q': Q}
tmpEigenCache[
stats_var] = stats_eigen[stats_var]
else:
stats_eigen[stats_var] = tmpEigenCache[
stats_var]
self.stats_eigen = stats_eigen
return self.stats_eigen
def computeStatsEigen(self):
""" compute the eigen decomp using copied var stats to avoid concurrent read/write from other queue """
# TO-DO: figure out why this op has delays (possibly moving
# eigenvectors around?)
with tf.device('/cpu:0'):
def removeNone(tensor_list):
local_list = []
for item in tensor_list:
if item is not None:
local_list.append(item)
return local_list
def copyStats(var_list):
print("copying stats to buffer tensors before eigen decomp")
redundant_stats = {}
copied_list = []
for item in var_list:
if item is not None:
if item not in redundant_stats:
if self._use_float64:
redundant_stats[item] = tf.cast(
tf.identity(item), tf.float64)
else:
redundant_stats[item] = tf.identity(item)
copied_list.append(redundant_stats[item])
else:
copied_list.append(None)
return copied_list
#stats = [copyStats(self.fStats), copyStats(self.bStats)]
#stats = [self.fStats, self.bStats]
stats_eigen = self.stats_eigen
computedEigen = {}
eigen_reverse_lookup = {}
updateOps = []
# sync copied stats
# with tf.control_dependencies(removeNone(stats[0]) +
# removeNone(stats[1])):
with tf.control_dependencies([]):
for stats_var in stats_eigen:
if stats_var not in computedEigen:
eigens = tf.self_adjoint_eig(stats_var)
e = eigens[0]
Q = eigens[1]
if self._use_float64:
e = tf.cast(e, tf.float32)
Q = tf.cast(Q, tf.float32)
updateOps.append(e)
updateOps.append(Q)
computedEigen[stats_var] = {'e': e, 'Q': Q}
eigen_reverse_lookup[e] = stats_eigen[stats_var]['e']
eigen_reverse_lookup[Q] = stats_eigen[stats_var]['Q']
self.eigen_reverse_lookup = eigen_reverse_lookup
self.eigen_update_list = updateOps
if KFAC_DEBUG:
self.eigen_update_list = [item for item in updateOps]
with tf.control_dependencies(updateOps):
updateOps.append(tf.Print(tf.constant(
0.), [tf.convert_to_tensor('computed factor eigen')]))
return updateOps
def applyStatsEigen(self, eigen_list):
updateOps = []
print(('updating %d eigenvalue/vectors' % len(eigen_list)))
for i, (tensor, mark) in enumerate(zip(eigen_list, self.eigen_update_list)):
stats_eigen_var = self.eigen_reverse_lookup[mark]
updateOps.append(
tf.assign(stats_eigen_var, tensor, use_locking=True))
with tf.control_dependencies(updateOps):
factor_step_op = tf.assign_add(self.factor_step, 1)
updateOps.append(factor_step_op)
if KFAC_DEBUG:
updateOps.append(tf.Print(tf.constant(
0.), [tf.convert_to_tensor('updated kfac factors')]))
return updateOps
def getKfacPrecondUpdates(self, gradlist, varlist):
updatelist = []
vg = 0.
assert len(self.stats) > 0
assert len(self.stats_eigen) > 0
assert len(self.factors) > 0
counter = 0
grad_dict = {var: grad for grad, var in zip(gradlist, varlist)}
for grad, var in zip(gradlist, varlist):
GRAD_RESHAPE = False
GRAD_TRANSPOSE = False
fpropFactoredFishers = self.stats[var]['fprop_concat_stats']
bpropFactoredFishers = self.stats[var]['bprop_concat_stats']
if (len(fpropFactoredFishers) + len(bpropFactoredFishers)) > 0:
counter += 1
GRAD_SHAPE = grad.get_shape()
if len(grad.get_shape()) > 2:
# reshape conv kernel parameters
KW = int(grad.get_shape()[0])
KH = int(grad.get_shape()[1])
C = int(grad.get_shape()[2])
D = int(grad.get_shape()[3])
if len(fpropFactoredFishers) > 1 and self._channel_fac:
# reshape conv kernel parameters into tensor
grad = tf.reshape(grad, [KW * KH, C, D])
else:
# reshape conv kernel parameters into 2D grad
grad = tf.reshape(grad, [-1, D])
GRAD_RESHAPE = True
elif len(grad.get_shape()) == 1:
# reshape bias or 1D parameters
D = int(grad.get_shape()[0])
grad = tf.expand_dims(grad, 0)
GRAD_RESHAPE = True
else:
# 2D parameters
C = int(grad.get_shape()[0])
D = int(grad.get_shape()[1])
if (self.stats[var]['assnBias'] is not None) and not self._blockdiag_bias:
# use homogeneous coordinates only works for 2D grad.
# TO-DO: figure out how to factorize bias grad
# stack bias grad
var_assnBias = self.stats[var]['assnBias']
grad = tf.concat(
[grad, tf.expand_dims(grad_dict[var_assnBias], 0)], 0)
# project gradient to eigen space and reshape the eigenvalues
# for broadcasting
eigVals = []
for idx, stats in enumerate(self.stats[var]['fprop_concat_stats']):
Q = self.stats_eigen[stats]['Q']
e = detectMinVal(self.stats_eigen[stats][
'e'], var, name='act', debug=KFAC_DEBUG)
Q, e = factorReshape(Q, e, grad, facIndx=idx, ftype='act')
eigVals.append(e)
grad = gmatmul(Q, grad, transpose_a=True, reduce_dim=idx)
for idx, stats in enumerate(self.stats[var]['bprop_concat_stats']):
Q = self.stats_eigen[stats]['Q']
e = detectMinVal(self.stats_eigen[stats][
'e'], var, name='grad', debug=KFAC_DEBUG)
Q, e = factorReshape(Q, e, grad, facIndx=idx, ftype='grad')
eigVals.append(e)
grad = gmatmul(grad, Q, transpose_b=False, reduce_dim=idx)
##
#####
# whiten using eigenvalues
weightDecayCoeff = 0.
if var in self._weight_decay_dict:
weightDecayCoeff = self._weight_decay_dict[var]
if KFAC_DEBUG:
print(('weight decay coeff for %s is %f' % (var.name, weightDecayCoeff)))
if self._factored_damping:
if KFAC_DEBUG:
print(('use factored damping for %s' % (var.name)))
coeffs = 1.
num_factors = len(eigVals)
# compute the ratio of two trace norm of the left and right
# KFac matrices, and their generalization
if len(eigVals) == 1:
damping = self._epsilon + weightDecayCoeff
else:
damping = tf.pow(
self._epsilon + weightDecayCoeff, 1. / num_factors)
eigVals_tnorm_avg = [tf.reduce_mean(
tf.abs(e)) for e in eigVals]
for e, e_tnorm in zip(eigVals, eigVals_tnorm_avg):
eig_tnorm_negList = [
item for item in eigVals_tnorm_avg if item != e_tnorm]
if len(eigVals) == 1:
adjustment = 1.
elif len(eigVals) == 2:
adjustment = tf.sqrt(
e_tnorm / eig_tnorm_negList[0])
else:
eig_tnorm_negList_prod = reduce(
lambda x, y: x * y, eig_tnorm_negList)
adjustment = tf.pow(
tf.pow(e_tnorm, num_factors - 1.) / eig_tnorm_negList_prod, 1. / num_factors)
coeffs *= (e + adjustment * damping)
else:
coeffs = 1.
damping = (self._epsilon + weightDecayCoeff)
for e in eigVals:
coeffs *= e
coeffs += damping
#grad = tf.Print(grad, [tf.convert_to_tensor('1'), tf.convert_to_tensor(var.name), grad.get_shape()])
grad /= coeffs
#grad = tf.Print(grad, [tf.convert_to_tensor('2'), tf.convert_to_tensor(var.name), grad.get_shape()])
#####
# project gradient back to euclidean space
for idx, stats in enumerate(self.stats[var]['fprop_concat_stats']):
Q = self.stats_eigen[stats]['Q']
grad = gmatmul(Q, grad, transpose_a=False, reduce_dim=idx)
for idx, stats in enumerate(self.stats[var]['bprop_concat_stats']):
Q = self.stats_eigen[stats]['Q']
grad = gmatmul(grad, Q, transpose_b=True, reduce_dim=idx)
##
#grad = tf.Print(grad, [tf.convert_to_tensor('3'), tf.convert_to_tensor(var.name), grad.get_shape()])
if (self.stats[var]['assnBias'] is not None) and not self._blockdiag_bias:
# use homogeneous coordinates only works for 2D grad.
# TO-DO: figure out how to factorize bias grad
# un-stack bias grad
var_assnBias = self.stats[var]['assnBias']
C_plus_one = int(grad.get_shape()[0])
grad_assnBias = tf.reshape(tf.slice(grad,
begin=[
C_plus_one - 1, 0],
size=[1, -1]), var_assnBias.get_shape())
grad_assnWeights = tf.slice(grad,
begin=[0, 0],
size=[C_plus_one - 1, -1])
grad_dict[var_assnBias] = grad_assnBias
grad = grad_assnWeights
#grad = tf.Print(grad, [tf.convert_to_tensor('4'), tf.convert_to_tensor(var.name), grad.get_shape()])
if GRAD_RESHAPE:
grad = tf.reshape(grad, GRAD_SHAPE)
grad_dict[var] = grad
print(('projecting %d gradient matrices' % counter))
for g, var in zip(gradlist, varlist):
grad = grad_dict[var]
### clipping ###
if KFAC_DEBUG:
print(('apply clipping to %s' % (var.name)))
tf.Print(grad, [tf.sqrt(tf.reduce_sum(tf.pow(grad, 2)))], "Euclidean norm of new grad")
local_vg = tf.reduce_sum(grad * g * (self._lr * self._lr))
vg += local_vg
# recale everything
if KFAC_DEBUG:
print('apply vFv clipping')
scaling = tf.minimum(1., tf.sqrt(self._clip_kl / vg))
if KFAC_DEBUG:
scaling = tf.Print(scaling, [tf.convert_to_tensor(
'clip: '), scaling, tf.convert_to_tensor(' vFv: '), vg])
with tf.control_dependencies([tf.assign(self.vFv, vg)]):
updatelist = [grad_dict[var] for var in varlist]
for i, item in enumerate(updatelist):
updatelist[i] = scaling * item
return updatelist
def compute_gradients(self, loss, var_list=None):
varlist = var_list
if varlist is None:
varlist = tf.trainable_variables()
g = tf.gradients(loss, varlist)
return [(a, b) for a, b in zip(g, varlist)]
def apply_gradients_kfac(self, grads):
g, varlist = list(zip(*grads))
if len(self.stats_eigen) == 0:
self.getStatsEigen()
qr = None
# launch eigen-decomp on a queue thread
if self._async:
print('Use async eigen decomp')
# get a list of factor loading tensors
factorOps_dummy = self.computeStatsEigen()
# define a queue for the list of factor loading tensors
queue = tf.FIFOQueue(1, [item.dtype for item in factorOps_dummy], shapes=[
item.get_shape() for item in factorOps_dummy])
enqueue_op = tf.cond(tf.logical_and(tf.equal(tf.mod(self.stats_step, self._kfac_update), tf.convert_to_tensor(
0)), tf.greater_equal(self.stats_step, self._stats_accum_iter)), lambda: queue.enqueue(self.computeStatsEigen()), tf.no_op)
def dequeue_op():
return queue.dequeue()
qr = tf.train.QueueRunner(queue, [enqueue_op])
updateOps = []
global_step_op = tf.assign_add(self.global_step, 1)
updateOps.append(global_step_op)
with tf.control_dependencies([global_step_op]):
# compute updates
assert self._update_stats_op != None
updateOps.append(self._update_stats_op)
dependency_list = []
if not self._async:
dependency_list.append(self._update_stats_op)
with tf.control_dependencies(dependency_list):
def no_op_wrapper():
return tf.group(*[tf.assign_add(self.cold_step, 1)])
if not self._async:
# synchronous eigen-decomp updates
updateFactorOps = tf.cond(tf.logical_and(tf.equal(tf.mod(self.stats_step, self._kfac_update),
tf.convert_to_tensor(0)),
tf.greater_equal(self.stats_step, self._stats_accum_iter)), lambda: tf.group(*self.applyStatsEigen(self.computeStatsEigen())), no_op_wrapper)
else:
# asynchronous eigen-decomp updates using queue
updateFactorOps = tf.cond(tf.greater_equal(self.stats_step, self._stats_accum_iter),
lambda: tf.cond(tf.equal(queue.size(), tf.convert_to_tensor(0)),
tf.no_op,
lambda: tf.group(
*self.applyStatsEigen(dequeue_op())),
),
no_op_wrapper)
updateOps.append(updateFactorOps)
with tf.control_dependencies([updateFactorOps]):
def gradOp():
return list(g)
def getKfacGradOp():
return self.getKfacPrecondUpdates(g, varlist)
u = tf.cond(tf.greater(self.factor_step,
tf.convert_to_tensor(0)), getKfacGradOp, gradOp)
optim = tf.train.MomentumOptimizer(
self._lr * (1. - self._momentum), self._momentum)
#optim = tf.train.AdamOptimizer(self._lr, epsilon=0.01)
def optimOp():
def updateOptimOp():
if self._full_stats_init:
return tf.cond(tf.greater(self.factor_step, tf.convert_to_tensor(0)), lambda: optim.apply_gradients(list(zip(u, varlist))), tf.no_op)
else:
return optim.apply_gradients(list(zip(u, varlist)))
if self._full_stats_init:
return tf.cond(tf.greater_equal(self.stats_step, self._stats_accum_iter), updateOptimOp, tf.no_op)
else:
return tf.cond(tf.greater_equal(self.sgd_step, self._cold_iter), updateOptimOp, tf.no_op)
updateOps.append(optimOp())
return tf.group(*updateOps), qr
def apply_gradients(self, grads):
coldOptim = tf.train.MomentumOptimizer(
self._cold_lr, self._momentum)
def coldSGDstart():
sgd_grads, sgd_var = zip(*grads)
if self.max_grad_norm != None:
sgd_grads, sgd_grad_norm = tf.clip_by_global_norm(sgd_grads,self.max_grad_norm)
sgd_grads = list(zip(sgd_grads,sgd_var))
sgd_step_op = tf.assign_add(self.sgd_step, 1)
coldOptim_op = coldOptim.apply_gradients(sgd_grads)
if KFAC_DEBUG:
with tf.control_dependencies([sgd_step_op, coldOptim_op]):
sgd_step_op = tf.Print(
sgd_step_op, [self.sgd_step, tf.convert_to_tensor('doing cold sgd step')])
return tf.group(*[sgd_step_op, coldOptim_op])
kfacOptim_op, qr = self.apply_gradients_kfac(grads)
def warmKFACstart():
return kfacOptim_op
return tf.cond(tf.greater(self.sgd_step, self._cold_iter), warmKFACstart, coldSGDstart), qr
def minimize(self, loss, loss_sampled, var_list=None):
grads = self.compute_gradients(loss, var_list=var_list)
update_stats_op = self.compute_and_apply_stats(
loss_sampled, var_list=var_list)
return self.apply_gradients(grads)
| 45,679 | 48.171152 | 366 | py |
baselines | baselines-master/baselines/acktr/utils.py | import tensorflow as tf
def dense(x, size, name, weight_init=None, bias_init=0, weight_loss_dict=None, reuse=None):
with tf.variable_scope(name, reuse=reuse):
assert (len(tf.get_variable_scope().name.split('/')) == 2)
w = tf.get_variable("w", [x.get_shape()[1], size], initializer=weight_init)
b = tf.get_variable("b", [size], initializer=tf.constant_initializer(bias_init))
weight_decay_fc = 3e-4
if weight_loss_dict is not None:
weight_decay = tf.multiply(tf.nn.l2_loss(w), weight_decay_fc, name='weight_decay_loss')
if weight_loss_dict is not None:
weight_loss_dict[w] = weight_decay_fc
weight_loss_dict[b] = 0.0
tf.add_to_collection(tf.get_variable_scope().name.split('/')[0] + '_' + 'losses', weight_decay)
return tf.nn.bias_add(tf.matmul(x, w), b)
def kl_div(action_dist1, action_dist2, action_size):
mean1, std1 = action_dist1[:, :action_size], action_dist1[:, action_size:]
mean2, std2 = action_dist2[:, :action_size], action_dist2[:, action_size:]
numerator = tf.square(mean1 - mean2) + tf.square(std1) - tf.square(std2)
denominator = 2 * tf.square(std2) + 1e-8
return tf.reduce_sum(
numerator/denominator + tf.log(std2) - tf.log(std1),reduction_indices=-1)
| 1,322 | 44.62069 | 107 | py |
baselines | baselines-master/baselines/acktr/defaults.py | def mujoco():
return dict(
nsteps=2500,
value_network='copy'
)
| 87 | 13.666667 | 28 | py |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.