blob_id stringlengths 40 40 | repo_name stringlengths 5 127 | path stringlengths 2 523 | length_bytes int64 22 545k | score float64 3.5 5.34 | int_score int64 4 5 | text stringlengths 22 545k |
|---|---|---|---|---|---|---|
e5a741e738040de2e2b62dd7515e2ae5afa31440 | lucas-cavalcanti-ads/projetos-fiap | /1ANO/PYTHON/ListaExercicios/Lista02/Ex03.py | 808 | 4.15625 | 4 | teclado = input("Digite o primeiro numero: ")
num1 = int(teclado)
teclado = input("Digite o segundo numero: ")
num2 = int(teclado)
soma = num1 + num2
somar = str(soma)
subtracao = num1 - num2
subtracaor = str(subtracao)
multiplicacao = num1 * num2
multiplicacaor = str(multiplicacao)
divisao = num1 / num2
divisaor = str(divisao)
resto = num1 % num2
restor = str(resto)
numero1 = str(num1)
numero2 = str(num2)
print("A soma de " + numero1 + " + " + numero2 + " e igual a: " + somar)
print("A soma de " + numero1 + " + " + numero2 + " e igual a: " + subtracaor)
print("A multiplicacao de " + numero1 + " + " + numero2 + " e igual a: " + multiplicacaor)
print("A divisao de " + numero1 + " + " + numero2 + " e igual a: " + divisaor)
print("O resto de " + numero1 + " + " + numero2 + " e igual a: " + restor) |
818d2ff7650a21dd1d3eca826e0c9862e448e007 | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-1/desafio-009.py | 1,304 | 3.640625 | 4 | cores = {'limpo': '\033[m',
'ciano': '\033[1;36m',
'roxo': '\033[1;35m',
'azul': '\033[1;34m'}
n = int(input('Coloque um número para ver sua tabuada: '))
n1 = n * 1
n2 = n * 2
n3 = n * 3
n4 = n * 4
n5 = n * 5
n6 = n * 6
n7 = n * 7
n8 = n * 8
n9 = n * 9
n10 = n * 10
print(f'{cores["azul"]}============{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 1{cores["limpo"]} = {cores["roxo"]}{n1}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 2{cores["limpo"]} = {cores["roxo"]}{n2}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 3{cores["limpo"]} = {cores["roxo"]}{n3}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 4{cores["limpo"]} = {cores["roxo"]}{n4}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 5{cores["limpo"]} = {cores["roxo"]}{n5}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 6{cores["limpo"]} = {cores["roxo"]}{n6}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 7{cores["limpo"]} = {cores["roxo"]}{n7}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 8{cores["limpo"]} = {cores["roxo"]}{n8}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 9{cores["limpo"]} = {cores["roxo"]}{n9}{cores["limpo"]}\n'
f'{cores["ciano"]}{n} x 10{cores["limpo"]} = {cores["roxo"]}{n10}{cores["limpo"]}\n'
f'{cores["azul"]}============{cores["limpo"]}')
|
4ccbdf4786b3193c3184f8738b5da13112ee2856 | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-2/desafio-041.py | 393 | 3.953125 | 4 | import datetime
ano = int(input('Que ano o atleta nasceu?: '))
idade = datetime.date.today().year - ano
print(f'Quem nasceu em {ano} tem {idade} anos')
if 0 < idade <= 9:
print('Atleta MIRIM')
elif 9 < idade <= 14:
print('Atleta INFANTIL')
elif 14 < idade <= 19:
print('Atleta JUNIOR')
elif 19 < idade <= 25:
print('Atleta SÊNIOR')
elif 25 < idade:
print('Atleta MASTER')
|
146df0a1eabd265184c94297aedd218347f754ce | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-2/desafio-056.py | 783 | 3.5625 | 4 | médiaidade = 0
maioridadehomem = 0
nomevelho = ''
mulheresmaisnovas = 0
for p in range(1, 5):
print(f'{"=" * 9}{p}ª Pessoa{"=" * 9}')
nome = str(input('Nome: ')).strip()
idade = int(input('Idade: '))
sexo = str(input('Sexo [H/M]: ')).strip().upper()
médiaidade += idade
if p == 1 and sexo == 'H':
maioridadehomem = idade
nomevelho = nome
if sexo == 'H' and idade > maioridadehomem:
maioridadehomem = idade
nomevelho = nome
if sexo == 'M' and 0 < idade < 20:
mulheresmaisnovas += 1
print(f'A média de idade deste grupo é de {médiaidade / 4 :.1f}')
print(f'O homem mais velho é o {nomevelho}, e ele tem {maioridadehomem} anos')
print(f'Nesse grupo temos {mulheresmaisnovas} mulheres com menos de 20 anos')
|
75578330aed370156506f96dbd89fce55a72287b | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-3/desafio-093.py | 1,000 | 3.84375 | 4 | # Declarando as variáveis.
jogador = dict()
gols = list()
# Adicionando os valores ao dicionário "jogador".
jogador['nome'] = str(input('Nome do jogador: ')).strip().title()
partidas = int(input(f'Quantas partidas {jogador["nome"]} jogou?: '))
# Pegando os gols de cada partida utilizando o FOR.
for g in range(0, partidas):
gols.append(int(input(f'Quantos gols na {g+1}ª partida?: ')))
jogador['gols'] = gols[:]
jogador['total'] = sum(gols)
# Mostrando o dicionário
print('-=-' * 30)
print(jogador)
# Mostrando na tela os valores de cada key do dicionário "jogador".
print('-=-' * 30)
for k, v in jogador.items():
print(f'O campo {k} tem o valor {v}.')
# Mostrando na tela a quantidade de partidas jogadas e os gols de cada uma, e o total de gols.
print('-=-' * 30)
print(f'O jogador {jogador["nome"]} jogou {partidas} partidas.')
for p in range(0, partidas):
print(f' -> Na {p+1}ª partida, fez {jogador["gols"][p]} gols.')
print(f'Foi um total de {jogador["total"]} gols.')
|
578d0f26d1f90ca422737d6201e56fe3de3d8adc | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-3/desafio-084.py | 1,027 | 3.765625 | 4 | dados = list()
pessoas = list()
maiornome = list()
menornome = list()
cont = maior = menor = -1
while True:
dados.append(str(input('Nome: ')).strip())
dados.append(float(input('Peso: ')))
if len(pessoas) == 0:
maior = menor = dados[1]
else:
if dados[1] > maior:
maior = dados[1]
if dados[1] < menor:
menor = dados[1]
pessoas.append(dados[:])
dados.clear()
escolha = str(input('Deseja continuar?: [S/N] ')).strip().upper()[0]
if escolha not in 'SN':
while escolha not in 'SN':
escolha = str(input('Opção inválida. Deseja continuar?: [S/N] ')).strip().upper()[0]
if escolha == 'N':
break
print('=' * 35)
print(f'Você registrou {len(pessoas)} pessoas.')
print(f'O maior peso é de {maior}Kg. Peso de ', end='')
for p in pessoas:
if p[1] == maior:
print(p[0], end=' ')
print()
print(f'O menor peso é de {menor}Kg. Peso de ', end='')
for p in pessoas:
if p[1] == menor:
print(p[0], end=' ')
|
34158e8e5e3089846814464a58d30a99a9963e5c | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-2/desafio-036.py | 559 | 4 | 4 | valordacasa = float(input('Qual é o valor da casa?: R$'))
salário = float(input('Qual o seu salário?: R$'))
anos = int(input('Por quantos anos você vai pagar a casa?: '))
print(f'Para pagar uma casa de R${valordacasa :.2f} em {anos} anos, a prestação mensal será de R${valordacasa / anos / 12 :.2f}')
if valordacasa / anos / 12 > salário * 30 / 100:
print(f'Desculpe, mas você não pode financiar essa casa, emprestimo NEGADO.')
elif valordacasa / anos / 12 <= salário * 30 / 100:
print(f'Você pode financiar a casa, emprestimo APROVADO.')
|
910adfeb6b500f702e90a782fbedb43fceaf939b | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-2/desafio-044.py | 1,037 | 3.875 | 4 | preço = float(input('Qual o preço do produto ou das compras?: '))
print('Escolha a forma de pagamento:')
print('''1- À vista com dinheiro/cheque (10% de desconto)
2- À vista no cartão (5% de desconto)
3- 2x no cartão (preço normal)
4- 3x ou mais no cartão (20% de juros)''')
escolha = int(input('Qual forma de pagamento você escolhe?: '))
if escolha == 1:
print(f'O preço do produto à vista com dinheiro/cheque é de R${preço - (preço * 10 / 100)}')
elif escolha == 2:
print(f'O preço do produto à vista no cartão é de R${preço - (preço * 5 / 100)}')
elif escolha == 3:
print(f'O preço do produto dividido 2x no cartão não muda, ainda é R${preço} com parcelas de R${preço / 2}')
elif escolha == 4:
parcelas = int(input('Quantas parcelas?: '))
print(f'''O preço do produto dividido em {parcelas}x no cartão é de R${preço + (preço * 20 / 100) :.2f},
e as parcelas irão custar R${(preço + (preço * 20 / 100)) / parcelas :.2f}''')
else:
print('Esta opção de pagamento não existe')
|
382926b8adb929eb319e68152c815c25b60c1c88 | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-3/desafio-097.py | 380 | 3.703125 | 4 | # Criando uma função que digita uma mensagem no meio de duas linhas.
def escreva(msg):
# Fazendo com que a linha tenha um tamanho que se adapta a mensagem.
print('~' * (len(msg)+4))
print(f' {msg}')
print('~' * (len(msg)+4))
# Programa pricipal - Usando a função "escreva" na prática.
escreva('Gustavo Guanabara')
escreva('Curso de Python no YouTube')
escreva('CeV')
|
0bb3bd040ef8d9316111b4f82a9416b13e81ac75 | LeonardoARGR/Desafios-Python-Curso-em-Video | /Mundo-1/desafio-007.py | 357 | 3.609375 | 4 | cores = {'limpo': '\033[m',
'verde': '\033[1;32m',
'vermelho': '\033[1;31m'}
n1 = float(input('Primeira Nota: '))
n2 = float(input('Segunda Nota: '))
m = (n1+n2) / 2
if m < 5:
print('A sua nota foi {}{}{}'.format(cores['vermelho'], m, cores['limpo']))
else:
print('A sua nota foi {}{}{}'.format(cores['verde'], m, cores['limpo']))
|
cb47ef51e8c71a29c9f0d1345210b2242382be50 | naodell/Project-Euler | /Page 1/problem_34.py | 484 | 3.71875 | 4 | '''
145 is a curious number, as 1! + 4! + 5! = 1 + 24 + 120 = 145.
Find the sum of all numbers which are equal to the sum of the factorial of
their digits.
Note: as 1! = 1 and 2! = 2 are not sums they are not included.
'''
import math
number = 11
answer = 0
while(number < 2.6e6):
digits = str(number)
digitSum = 0
for digit in digits:
digitSum += math.factorial(int(digit))
if number == digitSum:
answer += number
number += 1
print answer
|
baec9cad1d5d24f74935ccd2d537b33c11ca7093 | naodell/Project-Euler | /Page 1/problem_38.py | 1,128 | 4.03125 | 4 | '''
Take the number 192 and multiply it by each of 1, 2, and 3:
192 x 1 = 192, 192 x 2 = 384, 192 x 3 = 576
By concatenating each product we get the 1 to 9 pandigital, 192384576. We will
call 192384576 the concatenated product of 192 and (1,2,3).
The same can be achieved by starting with 9 and multiplying by 1, 2, 3, 4, and
5, giving the pandigital, 918273645, which is the concatenated product of 9 and
(1,2,3,4,5).
What is the largest 1 to 9 pandigital 9-digit number that can be formed as the
concatenated product of an integer with (1,2, ... , n) where n > 1?
'''
number = 1
panDigits = ''.join([str(i) for i in range(1,10)])
while(number < 100000):
ccNumber = 0
multiplier = 1
ccString = ''
isPandigital = False
while ccNumber < 1e10 and multiplier < number:
ccString += str(number*multiplier)
ccNumber = int(ccString)
#print ccString, ''.join(sorted(ccString))
if ''.join(sorted(ccString)) == panDigits:
isPandigital = True
break
multiplier += 1
if isPandigital:
print number, ccNumber
number += 1
|
ec7dc5024c1fd2c5fd017120e3b8ceb45b0fe2c8 | naodell/Project-Euler | /Page 1/problem_44.py | 957 | 3.703125 | 4 | '''
Pentagonal numbers are generated by the formula, P_n=n(3n-1)/2. The first ten
pentagonal numbers are:
1, 5, 12, 22, 35, 51, 70, 92, 117, 145, ...
It can be seen that P_4 + P_7 = 22 + 70 = 92 = P_8. However, their difference,
70 - 22 = 48, is not pentagonal.
Find the pair of pentagonal numbers, P_j and P_k, for which their sum and
difference are pentagonal and D = |P_k - P_j| is minimised; what is the value
of D?
'''
import numpy as np
pentNums = [n*(3*n - 1)/2 for n in range(1,10000)]
isOptimized = False
count = 1
minDiff = 1e9
for i,n in enumerate(pentNums):
for m in pentNums[:i]:
pentSum = n + m
pentDiff = abs(n - m)
if pentSum > pentNums[-1]: break
if pentSum in pentNums and pentDiff in pentNums:
candidate = (n,m)
if pentDiff < minDiff:
minDiff = pentDiff
print candidate
print 'The value of D is {0}'.format(cadidate[0]-candidate[1])
|
a050956731ea15251b18a627eb6be527430f8032 | naodell/Project-Euler | /Page 1/problem_16.py | 268 | 3.75 | 4 | '''
2^15 = 32768 and the sum of its digits is 3 + 2 + 7 + 6 + 8 = 26.
What is the sum of the digits of the number 21000?
'''
bigNumber = pow(2, 1000)
bigString = str(bigNumber)
powSum = 0
for number in bigString:
powSum += int(number)
print bigNumber, powSum
|
5f9b05e919c0dda6fb13f10c86b418a135adf623 | naodell/Project-Euler | /Page 1/problem_22.py | 984 | 3.875 | 4 | '''
Using names.txt (right click and 'Save Link/Target As...'), a 46K text file
containing over five-thousand first names, begin by sorting it into
alphabetical order. Then working out the alphabetical value for each name,
multiply this value by its alphabetical position in the list to obtain a name
score.
For example, when the list is sorted into alphabetical order, COLIN, which is
worth 3 + 15 + 12 + 9 + 14 = 53, is the 938th name in the list. So, COLIN would
obtain a score of 938 x 53 = 49714.
What is the total of all the name scores in the file?
'''
alphabet = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'
namesFile = open('names.txt', 'r')
names = namesFile.read()
nameList = sorted(names.split(','))
nameScores = []
for i,name in enumerate(nameList):
score = 0
for letter in name:
if letter in alphabet:
score += alphabet.index(letter) + 1
score *= i+1
nameScores.append(score)
print 'And the answer is ... {0}'.format(sum(nameScores))
|
40a915b242ccf97509ff90279b0ec32af81946b6 | PierpaoloLucarelli/IR_door_alarm | /activity_monitor/MonitorFSM.py | 3,340 | 3.515625 | 4 | '''
Author : Pierpaolo Lucarelli
MonitorFSM class taht extends the FSM class.
this class ir sesponsible for handling the I/O of the machine
Give a certain type of input and the correct type of output will be send
'''
from FSM import *
class MonitorFSM(FSM):
startState = 'deactivated'
codeState = 0 #state of the code [0,1,2,3,accepted]
def getNextValues(self, state, inp):
if state == 'deactivated' or state == "deactivated-trans":
if inp == "Up" or inp == "Down" or inp == "Left" or inp == "Right":
self.check_code(inp)
# print("Code state: %s" % self.codeState)
if self.codeState == 0:
return ("deactivated", "cross")
elif self.codeState in (1,2,3):
return ("deactivated-trans", "right_arrow")
elif self.codeState == "accepted":
self.codeState = 0 #when code is correct reset the code state to zero and ouput red circle
return ("deactivated-in-trans", "empty_circle_red")
elif inp != "IRSens": #for any input other than Sensor input and dirKeys
print("unacepted input")
self.codeState = 0
return("deactivated", "cross") #machine state back to start (deactivated)
#from here machine is in activated sate
elif state == "activated" or state == "activated-trans":
if inp == "IRSens":
return ("activated", "alarmed") #alarm is alarmed when IR signal is recieved
if inp == "Up" or inp == "Down" or inp == "Left" or inp == "Right":
self.check_code(inp)
# print("Code state: %s" % self.codeState)
if self.codeState == 0:
return ("activated", "full_circle_green") #if code is incorrect return to activated state
elif self.codeState in (1,2,3):
return ("activated-trans", "left_arrow")
elif self.codeState == "accepted":
self.codeState = 0 #reset code check to zero for next code check
return ("deactivated", "cross")
elif inp != "IRSens" : #for any input other that IRsens and dirKeys
self.codeState = 0
return ("activated", "full_circle_green") #return to activated state
#this function gets called when a key is entered, check if the sequience of theese key is Up, Down, Left, Right
def check_code(self,inp):
if self.codeState == 0:
if inp == "Up":
self.codeState = 1
else:
self.codeState = 0
elif self.codeState == 1:
if inp == "Down":
self.codeState = 2
else:
self.codeState = 0
elif self.codeState == 2:
if inp == "Left":
self.codeState = 3
else:
self.codeState = 0
elif self.codeState == 3:
if inp == "Right":
self.codeState = "accepted" #change state of codeState to accepted when sequence is correct
else:
self.codeState = 0
else:
print ("Something went wrong in the code (test only)")
|
86aeb48adfad7762a2ac64e0fe85f50ee7af91b7 | noahklein/daily-coding-problem | /088.py | 428 | 4.09375 | 4 | """
Implement division of two positive integers without using the division,
multiplication, or modulus operators. Return the quotient as an integer,
ignoring the remainder.
"""
def divides(a, b):
if b == 0:
raise ArithmeticError()
if a < b:
return 0
return 1 + divides(a - b, b)
assert(divides(10, 1) == 10)
assert(divides(0, 100) == 0)
assert(divides(17, 4) == 4)
assert(divides(100, 5) == 20)
|
5427437c4317a369825b00c755eb1a2b81ae4de5 | 3leonora/fourier-lab | /exercise1.py | 1,622 | 3.59375 | 4 | '''
Exercise 1
Fouriertransform of function with a period of 2pi
Dependencies: numpy, matplotlib
Authors:
@Eleonora Svanberg
@Henrik Jörnling
'''
#hej
#Modules
import numpy as np
import matplotlib.pyplot as plt
def xarray(N: int) -> np.ndarray:
'''Array with x values'''
return np.linspace(0., 2.*np.pi, N, endpoint=False)
def gx(x: np.ndarray) -> np.ndarray:
'''Gives np array with g(x) values'''
return 3.*np.sin(2.*x)+2.*np.cos(5.*x)
# a)
N1 = 100 # number of data points
N2 = 50
x1 = xarray(N1)
x2 = xarray(N2)
# b)
gx1 = gx(x1)
gx2 = gx(x2)
# c)
plt.plot(x1, gx1, label=f'N={N1}') # Plot signal g(x) vs x
plt.plot(x2, gx2, label=f'N={N2}' )
plt.legend()
plt.show()
# d)
Fgx1 = np.fft.rfft(gx1) # Fouriertransfor F(g) of real signal g(x) (r = real)
Fgx2 = np.fft.rfft(gx2)
print(f'Size of Fgx1 (N={N1}): {len(Fgx1)}')
print(f'Size of Fgx2 (N={N2}): {len(Fgx2)}')
# e)
print(f'c_2={Fgx1[2]:.1f}') #c_2=0.0-150.0j, c_2*N
print(f'c_5={Fgx1[5]:.1f}') #c_5=100.0+0.0j, c_5*N
plt.plot(np.real(Fgx1),'o', color='g', label=f'N={N1}') # Plot real part of Fgx vs looping index
plt.plot(np.imag(Fgx1),'o', color='r') # Plot imaginary part of Fgx vs looping index
plt.plot(np.real(Fgx2),'x', color='g', label=f'N={N2}')
plt.plot(np.imag(Fgx2),'x', color='r')
plt.title('Complex Fourier (green-real, red-imag)')
plt.legend()
plt.show()
plt.plot([2*z/N1 for z in np.real(Fgx1)],'o', color='g', label='a') # Plot real part of Fgx vs looping index
plt.plot([-2*z/N1 for z in np.imag(Fgx1)],'o', color='r', label='b') # Plot imaginary part of Fgx vs looping index
plt.title(f'Real Fourier (N={N1})')
plt.legend()
plt.show()
|
56580b82fb7ecef03712dfecdb2f1e72d0442cff | KraProgrammer/AdventOfCode2020 | /src/day23.py | 3,892 | 3.515625 | 4 | from aocd.models import Puzzle
class Node:
def __init__(self, data, prev_node, next_node):
self.data = data
self.prev_node = prev_node
self.next_node = next_node
class LinkedList:
def __init__(self):
self.index = {}
def append(self, prev, data) -> Node:
if prev is None:
node = Node(data, None, None)
node.next_node = node
node.prev_node = node
self.index[data] = node
return node
else:
node = Node(data, prev, prev.next_node)
prev.next_node = node
node.next_node.prev_node = node
self.index[data] = node
return node
def get(self, data) -> Node:
return self.index[data]
def len(self):
return len(self.index)
def to_list(self, start):
node = self.get(start)
array = [node.data]
node = node.next_node
while node.data != start:
array.append(node.data)
node = node.next_node
return array
def solve_puzzle_one(input):
print(input)
llist = LinkedList()
prev = None
for num in input:
prev = llist.append(prev, num)
current = llist.get(input[0])
move = 0
while move < 100:
move += 1
pickup_start = current.next_node
pickup_end = pickup_start.next_node.next_node
skips = []
c = pickup_start
for _ in range(3):
skips.append(c.data)
c = c.next_node
pickup_end.next_node.prev_node = current
current.next_node = pickup_end.next_node
num = current.data
destination = llist.len() if num == 1 else num - 1
while destination in skips:
destination = llist.len() if destination == 1 else destination - 1
destination_node = llist.get(destination)
pickup_end.next_node = destination_node.next_node
destination_node.next_node.prev_node = pickup_end
destination_node.next_node = pickup_start
pickup_start.prev_node = destination_node
current = current.next_node
print(''.join([str(x) for x in llist.to_list(1)[1:]]))
def solve_puzzle_two(input):
print(input)
llist = LinkedList()
prev = None
for num in input:
prev = llist.append(prev, num)
v = llist.len() + 1
while llist.len() < 1000000:
prev = llist.append(prev, v)
v += 1
current = llist.get(input[0])
move = 0
while move < 10000000:
move += 1
pickup_start = current.next_node
pickup_end = pickup_start.next_node.next_node
skips = []
c = pickup_start
for _ in range(3):
skips.append(c.data)
c = c.next_node
pickup_end.next_node.prev_node = current
current.next_node = pickup_end.next_node
num = current.data
destination = llist.len() if num == 1 else num - 1
while destination in skips:
destination = llist.len() if destination == 1 else destination - 1
destination_node = llist.get(destination)
pickup_end.next_node = destination_node.next_node
destination_node.next_node.prev_node = pickup_end
destination_node.next_node = pickup_start
pickup_start.prev_node = destination_node
current = current.next_node
print(llist.get(1).next_node.data)
print(llist.get(1).next_node.next_node.data)
print(llist.get(1).next_node.next_node.data * llist.get(1).next_node.data)
def parse_input(data):
return [int(num) for num in data]
test_input = """389125467"""
if __name__ == '__main__':
puzzle = Puzzle(year=2020, day=23)
input = puzzle.input_data
if False:
input = test_input
solve_puzzle_one(parse_input(input.strip()))
solve_puzzle_two(parse_input(input.strip()))
|
529a0ae383f5e1650a35935e51e289f13dd8d1e5 | KraProgrammer/AdventOfCode2020 | /src/day21.py | 2,197 | 3.5 | 4 | from collections import defaultdict
from aocd.models import Puzzle
def solve_puzzle_one(input_array):
counter, ingredients, allergens, possible_allergens = get_data(input_array)
c = 0
for i in ingredients:
if not possible_allergens[i]:
c += counter[i]
print(c)
def get_data(input_array):
ingredients = set()
allergens = set()
for i, a in input_array:
ingredients = ingredients.union(i)
allergens = allergens.union(a)
possible_allergens = {i: allergens.copy() for i in ingredients}
counter = defaultdict(int)
for i_of_food, a_of_food in input_array:
for a in a_of_food:
for i in ingredients:
if i not in i_of_food:
possible_allergens[i].discard(a)
for i in i_of_food:
counter[i] += 1
return counter, ingredients, allergens, possible_allergens
def solve_puzzle_two(input_array):
counter, ingredients, allergens, possible_allergens = get_data(input_array)
mapping = {}
used = set()
while len(mapping) < len(allergens):
for i in ingredients:
possible = [a for a in possible_allergens[i] if a not in used]
if len(possible) == 1:
mapping[i] = possible[0]
used.add(possible[0])
s = ""
# https://stackoverflow.com/questions/613183/how-do-i-sort-a-dictionary-by-value
array = [k for k, v in sorted(mapping.items(), key=lambda item: item[1])]
print(','.join(array))
def parse_input(data):
array = []
for line in data.splitlines():
i, rest = line.split('(contains ')
ingredients = set(i.split())
allergens = set(rest[:-1].split(", "))
array.append((ingredients, allergens))
return array
test_input = """mxmxvkd kfcds sqjhc nhms (contains dairy, fish)
trh fvjkl sbzzf mxmxvkd (contains dairy)
sqjhc fvjkl (contains soy)
sqjhc mxmxvkd sbzzf (contains fish)"""
if __name__ == '__main__':
puzzle = Puzzle(year=2020, day=21)
input = puzzle.input_data
if False:
input = test_input
solve_puzzle_one(parse_input(input.strip()))
solve_puzzle_two(parse_input(input.strip()))
|
7f2f690fa1b67d1c43566771e783c08d2eb57588 | jamathis77/Python-fundamentals | /conditionals.py | 2,444 | 4.28125 | 4 | # A conditional resolves to a boolean statement ( True or False)
left = True
right = False
# Equality Operators
left != right # left and right are not equivalent
left == right # left and right are equivalent
left is right # left and right are same identity
left is not right # Left and right are not same identity
age_1 = 23
age_2 = 45
# Comparison Operators
age_1 > age_2 # left is greater than right
age_1 < age_2
age_1 >= age_2
age_1 <= age_2
# Logical Operators
age_1 == 4 and age_2 < 22 # and operator (True) and (True)
age_1 == 4 or age_2 < 22 # or operator
not age_1 == 23
# a b a and b
#-------------------------------
# True True True
# True False False
# False True False
# False False False
# a b a or b
# -----------------------------
# True True True
# True False True
# False True True
# False False False
# a not a
# ---------------
# True False
# False True
# x = 3
# name = "Ryan"
# if x > 3 and name == "Ryan":
# if True:
# print("I'm inside of an if if statment")
# print("X is pretty big, and that person's name is ryan")
# elif x <= 3:
# print("Maybe x is big, idunno")
# else:
# print("Otherwise, no")
# Challenge
# Take a name and age, and if the person is under 18, say "NAME, you are not an adult",
# if the person is 18 but not 21, say "You are an adult, but not quite yet"
# if the person is 21 and older, say ' You are fully an adult '
# cases ( 12, 18, 20, 21, 89 )
# extra spicy
# If their name starts with an A, say "Cool name"
# name = input("What is your name? > ")
# age = int(input("What is your age? > "))
# if age in range(18):
# print(f"{ name }, you are not an adult")
# elif age in range(18, 21):
# print("You are an adult, ish")
# elif age >= 21:
# print("You are a big person now")
# if name[0].lower() == "a":
# print("Cool name")
# Declare a number
# If the number is divisible by 3, print "Fizz"
# If the number is divisible by 5, print "Buzz"
# If the number is divisible by both 3 AND 5, print ONLY "FizzBuzz"
# Otherwise, just print the number
# Test cases: 1, 3, 5, 10, 15, 98
number = 98
if number % 3 == 0 and number % 5 == 0: # Or number % 15 == 0
print("FizzBuzz")
elif number % 3 == 0:
print("Fizz")
elif number % 5 == 0:
print("Buzz")
else:
print(number)
|
ce124a17f9b0f62b3a8f2f457f28a0fdf6c0babb | evargas1/Algorthims | /Non_repeat_elements.py | 1,653 | 3.609375 | 4 | """
Linear time solution
Non repeat element
Take a string and return characters that never repeats if mutiple unique
then only return only the first
unique character
This algo is really helpful in
cyber sercuity!
"""
def non_repeating(s):
s = s.replace(' ', '').lower()
char_count = {}
# answer = set()
# could make this a set and use
# the add varaible or you could
# make it an empty list and
# append the letter
# but i think set works better
# to catch erros
for c in s:
if c in char_count:
char_count[c] += 1
else:
char_count[c] = 1
# for c in s:
# if char_count[c] == 1:
# answer.add(c)
answer = [ c for c in s if char_count[c]==1]
return answer
print(non_repeating('I apple Love eating'))
def non(s):
char_count = {}
s = s.replace(' ', '').lower()
for c in s:
if c in char_count:
char_count[c] += 1
else:
char_count[c] = 1
unique = []
y = sorted(
char_count.items(),
key=lambda x: x[1]
# will sort by second
# tuple posistion in this
# case the value
)
print(y[0])
print(y)
for item in y:
# checking the index
# posistion of 1 now a tuple
# which use to be the value
# or number
print(item)
if item[1] == y[0][1]:
# [0] first value
# [1] the value in the first key value
# index posistion?
unique.append(item)
return unique
print(non('uuu iiiiiikkkkkklllll'))
|
edf5f02ad075fcac802302e8f71bc62746d6d051 | jacob-brown/programming-notes-book | /programming_notes/_build/jupyter_execute/python_basic.py | 4,747 | 4.46875 | 4 | # Python: Basics
## Lists
Methods:
* `append()`
* `clear()`
* `copy()`
* `count()`
* `extend()`
* `index()`
* `insert()`
* `pop()`
* `remove()`
* `reverse()`
* `sort()`
demoList = ["apple", "banana", "orange", "kiwi"]
print(demoList)
Adding/Removing items
demoList.append('cherry')
print(demoList)
demoList.insert(1, 'grape')
print(demoList)
join 2 lists
thislist = ["apple", "banana", "cherry"]
tropical = ["mango", "pineapple", "papaya"]
thislist.extend(tropical)
print(thislist)
or...
thislist = ["apple", "banana", "cherry"]
tropical = ["mango", "pineapple", "papaya"]
thislist + tropical
Removing items
demoList = ["apple", "banana", "orange", "kiwi"]
demoList.remove('apple')
print(demoList)
demoList.pop(1)
print(demoList)
del demoList[0]
print(demoList)
demoList.clear() # removes all items
print(demoList)
## Copying a list
make sure the lists aren't linked, with a deep copy
thislist = ["apple", "banana", "cherry"]
mylist = thislist.copy()
print(mylist)
del thislist[1]
print(thislist)
print(mylist)
## Tuples
unchangeable
`count()` and `index()`
tupExample = (1, 2, 3)
tupExample
## Sets
unordered and unindexed, adding/removing is possible but not changing
thisset = {"apple", "banana", "cherry"}
thisset.add("orange")
print(thisset)
## Dictionaries
fruitDict = {
"type" : "apple",
"colour" : ["red", "green"],
"weight" : 200
}
print(fruitDict)
print(fruitDict["type"])
fruitDict.get("weight")
fruitDict.keys()
fruitDict.values()
fruitDict.items()
Changing, adding, and removing items in a dictionary
fruitDict = {
"type" : "apple",
"colour" : ["red", "green"],
"weight" : 200
}
fruitDict["weight"] = 500
print(fruitDict)
fruitDict.update({"smell" : "appley"})
print(fruitDict)
fruitDict["season"] = "summer"
print(fruitDict["season"])
del fruitDict["colour"]
print(fruitDict)
## Loops
for i in range(0,5):
print(i)
x = 0
while x < 6:
print(x)
x = x + 1
breaks within loops
x = 0
while x < 6:
print(x)
if x == 4:
break
x = x + 1
continue jumps back to the start of the loop
x = 0
while x < 6:
x += 1
if x == 4:
continue
print(x)
i = 1
while i < 6:
print(i)
i += 1
else:
print("i is no longer less than 6")
## Conditions (If..Else)
a = 2
b = 20
if a > b:
print("a is larger")
elif a == b:
print("they are equal")
else:
print("b is larger")
a = 200
b = 33
c = 500
if a > b or a > c:
print("At least one of the conditions is True")
use `pass` to avoid an error.
if 1 > 10:
pass
## List Comprehension
newList = ["apple", "banana", "cherry"]
[x for x in newList]
[x for x in newList if x != 'apple']
[x for x in newList if x != 'apple']
[x.upper() for x in newList]
## Functions and lambda
lambda can have only one expression
def printHello():
print("Hello")
printHello()
addTen = lambda x : x + 10
addTen(2)
x = lambda a, b : a * b
print(x(5, 6))
## Key Concepts of Functions
**Parameter** - varriable listed *when defining* the function
**Argument** (args)- value that is sent to the function. Passes into a list
**Keyword Argument** (kwargs) - arguments wth a *key = value* syntax. Passes into a dict
```{python}
def add(a, b): # a and b are parameters
return a+ b
add(1, 2) # 1 and 2 are arguments
add(a = 1, b = 2) # both are keyword arguments
```
N.B. positional arguments are those not defined with a keyword
If we do not know how many positional arguments to pass use `*`
def tupleOfNumbers(*numbers):
return numbers
tupleOfNumbers(1, 2, 3, 4, 5, 6)
If we do not know how many keyword arguments to pass use `**`
def makePerson(**infoOnPerson):
for key, value in infoOnPerson.items():
print("{} is {}".format(key,value))
jacob = makePerson(first = "jacob", last = "brown", Age = 26)
## Modules
Code library or a local `.py` file
import numpy as np
np.array([1, 2, 3])
from pandas import DataFrame as df
df([1,2,3])
## RegEx
`import re`
`re.` methods:
* `findall` - Returns a list containing all matches
* `search` - Returns a Match object if there is a match anywhere in the string
* `.span()` - returns a tuple containing the start and end positions of the match.
* `.string` - returns the string passed into the function
* `.group()` - returns the part of the string where there was a match
* `split` - Returns a list where the string has been split at each match
* `sub` - Replaces one or many matches with a string
*from w3*
## File Handling
`open(filename, mode)`
Mode types:
`"r"` - read
`"a"` - append
`"w"` - write
`"x"` - create
open, readlines,and close
```python
f = open("demofile.txt", "r")
print(f.readline())
f.close()
```
|
6726f3ca4feff9c2fcf5d368be13470b2cc8d73f | makowiecka/Hangman | /door.py | 1,332 | 3.65625 | 4 | class DoorError(RuntimeError): #nowy błąd na podstawie istniejącego, doorerror dziedziczy po Runtimeerror i przyjmuje wszystkie jego własciwości
pass
class Door: # w klasach tworzymy w liczbach pojedyńczych
def __init__(self, name: str):
self.__name = name # ja wstawimy __ - nie mamy dostępu z zewnątrz, jest prywatna z punktu widzenia obiektu
self.__locked = False
self.__closed = False
def open(self):
if self.__locked:
raise DoorError('Unlock the door to open them. ')
self.__closed = False
def close(self):
self.__closed = True
def lock(self):
if not self.__closed:
raise DoorError('Close the door to lock them. ')
self.__locked = True
def unlock(self):
self.__locked = False
def is_locked(self):
return self.__locked
def is_closed(self):
return self.__closed
# print(f'door nazywa się: {__name__}')
if __name__ == '__main__': # name zmienna która przechowuje inf o nazwi modułu. Jeśli uruchamiamy ten moduł bezpośrenia to pod name jest main. Dołączam plik to nazwa pliku
door = Door('front left')
try:
door.close()
door.lock()
except DoorError as error_message:
print(error_message)
print('qqq', door.is_locked()) |
b2a57d3dfb42d63aaeda6039e0b957661872528c | makowiecka/Hangman | /words_from_file/words.py | 2,434 | 3.65625 | 4 | import os
from random import randint
from abstract_word import AbstractWord
class WordsFromFile(AbstractWord):
@staticmethod #nie będzie działała na żadnych własnosciach danego obiektu
def get_path(): #ścieżka
return os.path.abspath(os.path.dirname(__file__)) #biblioteka os, moduł - path, funkcja dirname pierwsza część os.path.abspath - nie musiałoby być kiedyś był bład w programie i lepiej wpisywać
def get_random_word(self): #zwróci wylosowane słowo tzn wylosuje linie ze zbioru
words_in_file = self.get_words_count() # odwołujemy się do funkcji poniżej
word_number = randint(1, words_in_file) #numer losujemy od 1 do całego zbioru
return self.get_word_from_file(word_number).strip('\n') #zwróci słowo / linie z wylosowanej lini, usówając białe zanki przed i po słowie
def get_word_from_file (self, word_number): #pobierze konkretne słowo z lini
with open(f'{self.get_path()}/words.txt', 'r') as file: #otwiera plik
for i in range(1, word_number + 1):
word = file.readline()
return word
def get_words_count(self): #pobiera informacje o ilości lini czyli słów
#normlnie pliki zaczytujemy do pamięci i nie martwimy się o nic więcej bo plik nie jest specjalnie wielki
words_in_file = 0
with open(f'{self.get_path()}/words.txt', 'r') as file:
while file.readline():
words_in_file += 1
return words_in_file
# def get_random_word(self) -> str: #dopisujemy self - self mówi szukaj w środku w mojej klasie, w moim obiekcie, dopisuje parametr do funkcji
# word_index = randint(0, len(self.words) - 1)
# return self.words[word_index]
# if __name__ == '__main__':
# file = open('words.txt') #poczytać o open
# while True:
# line = file.readline()
#
# if line == '':
# break
# print(line.strip()) #funkcja strip usuwa białe znaki z lewej i praej stronie
#
# file.close() #musimy zamknąc
#nie musimy pamiętać o zmaykaniu jeśli
# if __name__ == '__main__':
# with open('words.txt') as file: # poczytać o open
# # python 3.8
# #while line := file.readline()
# # print(line.strip())
# while True:
# line = file.readline()
# if line == '':
# break
# print(line.strip()) |
6d031a90814976c539f22823bffd72222b4625c9 | JianfengYao/C-practice | /algorithm/algorithm-python/src/number_theory/gcd.py | 274 | 3.78125 | 4 | #!/usr/bin/env python
# -*- coding:UTF-8
def gcd(a, b):
divisor = a
dividend = b
while dividend is not 0:
divisor, dividend = dividend, divisor % dividend
return divisor
def main():
print(gcd(12, 18))
if __name__ == "__main__":
main()
|
bb6a42640770f39615f60d5b368ace2836d2e545 | JianfengYao/C-practice | /algorithm/algorithm-python/src/lib/stack.py | 828 | 4 | 4 | #!/usr/bin/env python
# -*- coding:UTF-8
import copy
class Stack(object):
"""
使用Python快速实现一个栈
"""
def __init__(self, *arg):
super(Stack, self).__init__()
self.__stack = list(copy.copy(arg))
self.__size = len(self.__stack)
def push(self, value):
self.__stack.append(value)
self.__size += 1
def pop(self):
if self.__size <= 0:
return None
else:
value = self.__stack[-1]
self.__size -= 1
del self.__stack[-1]
return value
def __len__(self):
return self.__size
def empty(self):
return self.__size <= 0
def __str__(self):
return "".join(["Stack(list=", str(map(lambda s: str(s), self.__stack)), ",size=", str(self.__size), ')'])
|
7c2fde5d7a2da2544cf8ee68fe6ed77177fbacfc | sjogleka/Intelligent_Systems | /IS_Project2/code.py | 15,712 | 3.8125 | 4 | from random import randrange
from copy import deepcopy
from random import choice
# A class to create queenstate and identify the best possible children based on number of queens attacking
class QueensState:
instance_counter = 0
def __init__(self, queen_positions=None, parent=None,f_cost=0,):
self.side_length = int(n)
if queen_positions == None:
self.queen_num = self.side_length
self.queen_positions = frozenset(self.random_queen_position())
else:
self.queen_positions = frozenset(queen_positions)
self.queen_num = len(self.queen_positions)
self.path_cost = 0
self.f_cost = f_cost
self.parent = parent
self.id = QueensState.instance_counter
QueensState.instance_counter += 1
# A function to generate queen positions randomly
def random_queen_position(self):
''' Each queen is placed in a random row in a separate column '''
open_columns = list(range(self.side_length))
queen_positions = [(open_columns.pop(randrange(len(open_columns))), randrange(self.side_length)) for _ in
range(self.queen_num)]
return queen_positions
# get the possible children from parent node
def get_children(self):
children = []
parent_queen_positions = list(self.queen_positions)
for queen_index, queen in enumerate(parent_queen_positions):
new_positions = [(queen[0], row) for row in range(self.side_length) if row != queen[1]]
for new_position in new_positions:
queen_positions = deepcopy(parent_queen_positions)
queen_positions[queen_index] = new_position
children.append(QueensState(queen_positions))
return children
# A function to identify attacking queens
def queen_attacks(self):
def range_between(a, b):
if a > b:
return range(a-1, b, -1)
elif a < b:
return range(a+1, b)
else:
return [a]
def zip_repeat(a, b):
if len(a) == 1:
a = a*len(b)
elif len(b) == 1:
b = b*len(a)
return zip(a, b)
def points_between(a, b):
return zip_repeat(list(range_between(a[0], b[0])), list(range_between(a[1], b[1])))
def is_attacking(queens, a, b):
if (a[0] == b[0]) or (a[1] == b[1]) or (abs(a[0]-b[0]) == abs(a[1] - b[1])):
for between in points_between(a, b):
if between in queens:
return False
return True
else:
return False
attacking_pairs = []
queen_positions = list(self.queen_positions)
left_to_check = deepcopy(queen_positions)
while left_to_check:
a = left_to_check.pop()
for b in left_to_check:
if is_attacking(queen_positions, a, b):
attacking_pairs.append([a, b])
return attacking_pairs
def num_queen_attacks(self):
return len(self.queen_attacks())
def __str__(self):
return '\n'.join([' '.join(['0' if (col, row) not in self.queen_positions else 'Q' for col in range(
self.side_length)]) for row in range(self.side_length)])
def __hash__(self):
return hash(self.queen_positions)
def __eq__(self, other):
return self.queen_positions == other.queen_positions
def __lt__(self, other):
return self.f_cost < other.f_cost or (self.f_cost == other.f_cost and self.id > other.id)
print("Please select the algorithm to be executed :\n 1. Steepest Ascent \n 2. Hill Climbing with Sideway Moves\n 3. Random Restart")
x=input()#Taking Input from User
def steepest_ascent_hill_climb_false(queens_state,counter,allow_sideways=False, max_sideways=100):
# This function will get call when steepest Ascent Hill Climb without side moves is selected
node = queens_state
path = []
sideways_moves = 0
while True:
path.append(node)
children = node.get_children()
children_num_queen_attacks = [child.num_queen_attacks() for child in children]
min_queen_attacks = min(children_num_queen_attacks)
# If best child is not chosen randomly from the set of children that have the lowest number of attacks,
# algorithm will go into infinite loop
best_child = choice([child for child_index, child in enumerate(children) if children_num_queen_attacks[
child_index] == min_queen_attacks])# 'for' loop will check the best heuristic by iterating through the num of attacking moves related to particular child node.
if (best_child.num_queen_attacks() > node.num_queen_attacks()):# If we found better heuristic then break
break
elif best_child.num_queen_attacks() == node.num_queen_attacks():
if not allow_sideways or sideways_moves == max_sideways:# Check if allowed side moves reched to the limit or not.
break
else:
sideways_moves += 1
else:
sideways_moves = 0
node = best_child
if counter <4:
print('Search Sequence :',counter,'\n', best_child, '\n')# Print first three sequences found while finding the solution
return {'outcome': 'success' if node.num_queen_attacks()==0 else 'failure',
'solution': path}
def steepest_ascent_hill_climb_true(queens_state,counter,allow_sideways=True, max_sideways=100):
# This function will get call when steepest Ascent Hill Climb with side moves is selected
node = queens_state
path = []
sideways_moves = 0
while True:
path.append(node)
children = node.get_children()
children_num_queen_attacks = [child.num_queen_attacks() for child in children]
min_queen_attacks = min(children_num_queen_attacks)
# If best child is not chosen randomly from the set of children that have the lowest number of attacks,
# algorithm will go into infinite loop
best_child = choice([child for child_index, child in enumerate(children) if children_num_queen_attacks[
child_index] == min_queen_attacks])
if (best_child.num_queen_attacks() > node.num_queen_attacks()):
break
elif best_child.num_queen_attacks() == node.num_queen_attacks():
if not allow_sideways or sideways_moves == max_sideways:
break
else:
sideways_moves += 1
else:
sideways_moves = 0
node = best_child
if counter <4:
print('Search Sequence :', counter, '\n', best_child, '\n')
#print(best_child)
return {'outcome': 'success' if node.num_queen_attacks()==0 else 'failure',
'solution': path}
def steepest_ascent_hill_climb(queens_state,allow_sideways, max_sideways=100):
node = queens_state
path = []
sideways_moves = 0
while True:
path.append(node)
children = node.get_children()
children_num_queen_attacks = [child.num_queen_attacks() for child in children]
min_queen_attacks = min(children_num_queen_attacks)
# If best child is not chosen randomly from the set of children that have the lowest number of attacks,
# then algorithm will get stuck flip-flopping between two non-random best children when sideways moves are
# allowed
best_child = choice([child for child_index, child in enumerate(children) if children_num_queen_attacks[
child_index] == min_queen_attacks])
if (best_child.num_queen_attacks() > node.num_queen_attacks()):
break
elif best_child.num_queen_attacks() == node.num_queen_attacks():
if not allow_sideways or sideways_moves == max_sideways:
break
else:
sideways_moves += 1
else:
sideways_moves = 0
node = best_child
return {'outcome': 'success' if node.num_queen_attacks()==0 else 'failure',
'solution': path}
def random_restart_hill_climb(random_state_generator,allow_sideways,num_restarts=100, max_sideways=100):
path = []
global total # Global Variable Declaration
for _ in range(num_restarts):
# Repeatedly do the steepest ascent hill climbing algorithm with or without side way moves for n number of iterations.
result = steepest_ascent_hill_climb(random_state_generator(),allow_sideways=allow_sideways,
max_sideways=max_sideways)
path += result['solution']
num_restarts -= 1
temp =0
if result['outcome'] == 'success':
temp = 100-num_restarts #check the num of restarts required for particular iteration
break
result['solution'] = path
array.append(temp)#Appending num of restarts required in an array.
total = 0
for i in array:
total += i # Find the total, summation of restarts found in an arrray for particular iteration
return result
class QueensProblem:
global n,num_iter # Global Variable Declaration
print("Enter the number of queens")
n = input()#Taking number of queens required in NxN board, as a input from user
print("Enter the number of interations")
num_iter = input()#Number of iterations to be performed
num_iter = int(num_iter)
# print(n)
def __init__(self, start_state=QueensState()):
self.start_state = start_state
def stats(search_function,counter=1, num_iterations=num_iter):
results = []
for iter_num in range(num_iterations):
result = search_function(QueensState(),counter)#Create the object of QueenState and call the function passed e.g steepest_ascent_hill_climb/steepest_ascent_hill_climb_false
counter += 1
result['path_length'] = len(result['solution'])-1#Storing the path length of each iteration in result
results.append(result)
arr = [[result for result in results if result['outcome'] == 'success'], #array arr will have all the result of SUCCESS and FAILURE
[result for result in results if result['outcome'] == 'failure']]
success = []
failure = []
for i in arr[0]:
success.append(i['path_length'])#0th index of array is corresponding to Success. Append all elements in success array
for i in arr[1]:
failure.append(i['path_length'])#1st index of array is corresponding to Failure. Append all elements in failure array
if len(success) != 0:
#Print the average number of steps for success
print('Average number of steps when it succeeds: ', int(round(sum(success) / float(len(success)))))
if len(failure) != 0:
# Print the average number of steps for failure
print('Average number of steps when it fails: ', int(round(sum(failure) / float(len(failure)))))
results = [results,
[result for result in results if result['outcome'] == 'success'],
[result for result in results if result['outcome'] == 'failure']]
title_col_width = 30
data_col_width = 15
def print_data_row(row_title, data_string, data_func, results):
#Print function to print in row column format
nonlocal title_col_width, data_col_width
row = (row_title + '\t').rjust(title_col_width)
for result_group in results:
row += data_string.format(**data_func(result_group)).ljust(data_col_width)
print(row)
print('\t'.rjust(title_col_width) +
'All Problems'.ljust(data_col_width) +
'Successes'.ljust(data_col_width) +
'Failures'.ljust(data_col_width))
#Call to print_data_flow function with total number of and percent
print_data_row('Number of Problems:',
'{count:.0f} ({percent:.1%})',
lambda x: {'count':len(x), 'percent': len(x)/num_iterations},
results)
section_break = '\n' + '_'*100 + '\n'
def stats_random(search_function, num_iterations=num_iter):
results = []
global array # Global Variable Declaration
array = []
for iter_num in range(num_iterations):
result = search_function(QueensState())#Create the object of QueenState and call the function passed e.g steepest_ascent_hill_climb/steepest_ascent_hill_climb_false
result['path_length'] = len(result['solution'])-1#Storing the path length of each iteration in result
results.append(result)
arr = [[result for result in results if result['outcome'] == 'success'],#array arr will have all the result of SUCCESS and FAILURE
[result for result in results if result['outcome'] == 'failure']]
success = []
failure = []
for i in arr[0]:
success.append(i['path_length'])#0th index of array is corresponding to Success. Append all elements in success array
for i in arr[1]:
failure.append(i['path_length'])#1st index of array is corresponding to Failure. Append all elements in failure array
if len(success) != 0:
# Print the average number of steps for success
print('Average number of steps when it succeeds: ', int(round(sum(success) / float(len(success)))))
if len(failure) != 0:
# Print the average number of steps for failure
print('Average number of steps when it fails: ', int(round(sum(failure) / float(len(failure)))))
print(' '*50 + '\r', end='', flush=True)
results = [results,
[result for result in results if result['outcome'] == 'success'],
[result for result in results if result['outcome'] == 'failure']]
#print(results[0])
title_col_width = 30
data_col_width = 15
def print_data_row(row_title, data_string, data_func, results):
nonlocal title_col_width, data_col_width
row = (row_title + '\t').rjust(title_col_width)
for result_group in results:
row += data_string.format(**data_func(result_group)).ljust(data_col_width)
print(row)
print('Avg No. of Restarts Required: ', int((total / num_iterations)))
print('\t'.rjust(title_col_width) +
'All Problems'.ljust(data_col_width) +
'Successes'.ljust(data_col_width) +
'Failures'.ljust(data_col_width))
print_data_row('Number of Problems:',
'{count:.0f} ({percent:.1%})',
lambda x: {'count':len(x), 'percent': len(x)/num_iterations},
results)
if x=='1':
print('Steepest ascent hill climb:\n')
stats(steepest_ascent_hill_climb_false)
print(section_break)
elif x=='2':
print('Hill Climbing with Sideway Moves (up to 100 consecutive sideways moves allowed):\n')
stats(steepest_ascent_hill_climb_true)
print(section_break)
else:
print("******************* Random Restart without Sideway Moves ******************")
print('Random_restart_hill_climb):\n')
stats_random(lambda x: random_restart_hill_climb(QueensState, allow_sideways=False))
print(section_break)
print("******************* Random Restart with Sideway Moves ******************")
print('Random_restart_hill_climb):\n')
stats_random(lambda x: random_restart_hill_climb(QueensState, allow_sideways=True))
print(section_break) |
4e5d2fddbb38e7f243c2302203c692e238740ee5 | xudaniel11/interview_preparation | /robot_unique_paths.py | 1,808 | 4.21875 | 4 | """
A robot is located at the top-left corner of an M X N grid. The robot can only move either down or
right at any point in time. The robot is trying to reach the bottom-right corner of the grid.
How many possible unique paths are there?
Input: M, N representing the number of rows and cols, respectively
Output: an integer
bottom-up DP solution from http://articles.leetcode.com/unique-paths/
tldr; the total unique paths at grid (i,j) is equal to the sum of total unique paths from grid to the right (i,j+1) and the grid below (i+1,j).
"""
import numpy as np
import unittest
def get_num_unique_paths(M, N):
mat = np.zeros((M, N))
mat[M - 1] = np.ones((1, N))
mat[:, N - 1] = np.ones(M)
for i in reversed(xrange(M - 1)):
for j in reversed(xrange(N - 1)):
right = mat[i, j + 1]
down = mat[i + 1, j]
mat[i, j] = right + down
return int(mat[0, 0])
"""
Follow up:
Imagine certain spots are "off limits," such that the robot cannot step
on them. Design an algorithm to find a path for the robot from the top
left to the bottom right.
Solution: make blocks 0.
"""
def robot(grid):
m, n = grid.shape
for i in reversed(range(m - 1)):
for j in reversed(range(n - 1)):
if grid[i, j] == 0:
continue
else:
grid[i, j] = grid[i, j + 1] + grid[i + 1, j]
return grid[0, 0]
class TestUniquePaths(unittest.TestCase):
def test_1(self):
result = get_num_unique_paths(3, 7)
expected = 28
self.assertEqual(result, expected)
def test_blocks(self):
mat = np.ones((3, 4))
mat[1, 0] = 0
result = robot(mat)
expected = 6
self.assertEqual(result, expected)
if __name__ == "__main__":
unittest.main()
|
b72c2595f1863a8a3a681657428dd4d6caceefb2 | xudaniel11/interview_preparation | /calculate_BT_height.py | 1,621 | 4.15625 | 4 | """
Calculate height of a binary tree.
"""
import unittest
def calculate_height(node):
if node == None:
return 0
left, right = 1, 1
if node.left:
left = 1 + calculate_height(node.left)
if node.right:
right = 1 + calculate_height(node.right)
return max(left, right)
class BinaryTreeNode():
def __init__(self, val):
self.val = val
self.left = None
self.right = None
class TestFirstCommonAncestor(unittest.TestCase):
def test_1(self):
root = BinaryTreeNode('A')
root.left = BinaryTreeNode('B')
root.right = BinaryTreeNode('C')
root.right.left = BinaryTreeNode('F')
root.right.right = BinaryTreeNode('G')
root.left.left = BinaryTreeNode('D')
root.left.right = BinaryTreeNode('E')
result = calculate_height(root)
expected = 3
self.assertEqual(result, expected)
def test_2(self):
root = BinaryTreeNode('A')
root.left = BinaryTreeNode('B')
root.right = BinaryTreeNode('C')
root.left.left = BinaryTreeNode('D')
root.left.right = BinaryTreeNode('E')
root.left.left.left = BinaryTreeNode('F')
root.left.left.right = BinaryTreeNode('G')
root.left.left.left.left = BinaryTreeNode('H')
result = calculate_height(root)
expected = 5
self.assertEqual(result, expected)
def test_3(self):
root = BinaryTreeNode('A')
result = calculate_height(root)
expected = 1
self.assertEqual(result, expected)
if __name__ == '__main__':
unittest.main()
|
3c419ab15020a8827a24044dfa180da9a7a5c47f | xudaniel11/interview_preparation | /array_of_array_products.py | 1,044 | 4.15625 | 4 | """
Given an array of integers arr, write a function that returns another array at the same length where the value at each index i is the product of all array values except arr[i].
Solve without using division and analyze the runtime and space complexity
Example: given the array [2, 7, 3, 4]
your function would return: [84, 24, 56, 42] (by calculating: [7*3*4, 2*3*4, 2*7*4, 2*7*3])
Algorithm should run in O(N) time.
Solution: create two arrays representing the direction we iterate in. Each element in each array represents
the product so far from a particular direction up to that index.
"""
def get_array_of_array_products(arr):
going_right = [1]
for i in range(1, len(arr)):
going_right.append(going_right[i - 1] * arr[i - 1])
going_left = [1]
for i in range(1, len(arr)):
going_left.append(going_left[i - 1] * arr[len(arr) - i])
going_left.reverse()
return [x * y for x, y in zip(going_left, going_right)]
print get_array_of_array_products([2, 4, 6, 7]) # should be [168, 84, 56, 48]
|
481fb0533a3f52fb1a2093472bbf07bcf8f1da0e | xudaniel11/interview_preparation | /city_destinations.py | 2,047 | 4.09375 | 4 | """
Given an input city, return the cities that can be reached.
Algorithm: iterate through the initial list in order to create the adjacency matrix.
Then, use DFS to figure out what cities can be connected to from the input one.
"""
import unittest
def city_destinations(cities, original_city):
# build adjacency list
ad_list = adjacencyList()
for i, (source, destination) in enumerate(cities):
if ad_list.has_city(source):
ad_list.add_destination(source, destination)
elif not ad_list.has_city(source):
ad_list.add_source(source)
ad_list.add_destination(source, destination)
# DFS
visited = set()
stack = []
stack.append(original_city)
stack.extend(ad_list.get_destinations(original_city))
while stack:
city = stack.pop()
print city
if city not in visited:
visited.add(city)
destinations = ad_list.get_destinations(city)
if destinations:
stack.extend(destinations)
return visited
class adjacencyList():
def __init__(self):
self.ad_list = {}
def add_source(self, city):
self.ad_list[city] = []
def add_destination(self, source, destination):
self.ad_list[source].append(destination)
def has_city(self, city):
return self.ad_list.has_key(city)
def get_destinations(self, source):
return self.ad_list.get(source)
class TestCityDestinations(unittest.TestCase):
"""
SFO : [NYC, SAC, LAX, DC]
NYC : [SFO, OAK]
SAC : [LAX]
DEL : [AUX]
"""
def test_usual_case(self):
ex = [("SFO","NYC"),("NYC", "SFO"), ("NYC", "OAK"), ("SFO", "SAC"), ("SAC", "LAX"), ("SFO", "LAX"), ("DEL", "AUX"), ("SFO", "DC")]
result = city_destinations(ex, "SFO")
self.assertItemsEqual(result, ["NYC", "SAC", "LAX", "DC", "SFO", "OAK"])
def test_cycle(self):
ex = [("SFO", "NYC"), ("NYC", "SFO")]
result = city_destinations(ex, "SFO")
self.assertItemsEqual(result, ["SFO", "NYC"])
def test_no_destinations(self):
ex = [("SFO", "NYC"), ("DEL", "LAX")]
result = city_destinations(ex, "SFO")
self.assertItemsEqual(result, ["SFO", "NYC"])
if __name__ == '__main__':
unittest.main()
|
be3e45acb992ac1db59427d3b411bdc2c8a3d84a | xudaniel11/interview_preparation | /Queue.py | 337 | 3.71875 | 4 | """
Queue DS
"""
class Queue():
def __init__(self):
self.q = []
def enqueue(self, item):
self.q.append(item)
def dequeue(self):
return self.q.pop(0)
def is_empty(self):
return len(self.q) == 0
def size(self):
return len(self.q)
def front(eslf):
return A[0]
|
f26285e201db5aca5cf026b2e3377539ee23d1ab | xudaniel11/interview_preparation | /remove_duplicates_LL.py | 1,403 | 3.875 | 4 | """
Remove duplicates from an unsorted linked list in O(1) space.
"""
import Singly_LL as LL
import unittest
def remove_duplicates(ll):
if ll.get_size() == 0 or ll.get_size == 1:
return ll
prev = ll.head
curr = ll.head.next
while curr:
runner = ll.head
while runner != curr:
if runner.val == curr.val:
# keep the first duplicate and remove curr, which is the
# later one
temp = curr.next
prev.next = temp
curr = temp
break
runner = runner.next
if runner == curr:
# only move on to the next curr if we've finished removing all
# the dupes
prev = curr
curr = curr.next
return ll
class TestRemoveDupes(unittest.TestCase):
def test_1(self):
example = LL.Singly_LL()
example.add(3)
example.add(1)
example.add(2)
example.add(2)
example.add(4)
result = remove_duplicates(example)
result.print_LL() # should 3 1 2 4
print "\n"
def test_2(self):
example = LL.Singly_LL()
example.add(2)
example.add(1)
example.add(2)
example.add(2)
result = remove_duplicates(example)
result.print_LL() # should be 2
if __name__ == "__main__":
unittest.main()
|
8268e7d5e29f7ccb1616fa17c022ad060256c569 | xudaniel11/interview_preparation | /check_balanced_tree.py | 1,516 | 4.4375 | 4 | """
Implement a function to check if a tree is balanced. For the purposes of this question,
a balanced tree is defined to be a tree such that no two leaf nodes differ in distance
from the root by more than one.
Solution taken from CTCI: recursive algorithms calculate the maximum and minimum length
paths in the tree. Compare the two at the end.
"""
import unittest
def max_depth(node):
if node == None:
return 0
else:
return 1 + max(max_depth(node.left), max_depth(node.right))
def min_depth(node):
if node == None:
return 0
else:
return 1 + min(min_depth(node.left), min_depth(node.right))
def check_balanced_tree(node):
return max_depth(node) - min_depth(node) <= 1
class BinaryTreeNode():
def __init__(self, val):
self.val = val
self.left = None
self.right = None
class Test_Balanced_Tree(unittest.TestCase):
def test_case_1(self):
root = BinaryTreeNode('A')
root.left = BinaryTreeNode('B')
root.right = BinaryTreeNode('C')
root.right.left = BinaryTreeNode('F')
root.right.right = BinaryTreeNode('G')
root.left.left = BinaryTreeNode('D')
root.left.right = BinaryTreeNode('E')
result = check_balanced_tree(root)
self.assertEqual(result, True)
def test_case_2(self):
root = BinaryTreeNode('A')
root.left = BinaryTreeNode('B')
root.right = BinaryTreeNode('C')
root.right.left = BinaryTreeNode('F')
root.right.left.left = BinaryTreeNode('G')
result = check_balanced_tree(root)
self.assertEqual(result, False)
if __name__ == "__main__":
unittest.main() |
5b460faff9b8266878e666793101b3ac11e9cc87 | xudaniel11/interview_preparation | /all_possible_subsets.py | 1,072 | 4.03125 | 4 | """
Given a set of distinct integers, S, return all possible subsets.
Note:
Elements in a subset must be in non-descending order.
The solution set must not contain duplicate subsets.
Also, the subsets should be sorted in ascending ( lexicographic ) order.
The list is not necessarily sorted.
Example :
If S = [1,2,3], a solution is:
[
[],
[1],
[1, 2],
[1, 2, 3],
[1, 3],
[2],
[2, 3],
[3],
]
"""
def subsets_wrong(arr):
result = [[]]
for i, num in enumerate(arr):
new_results = []
for j, subset in enumerate(result):
# wrong bc im assigning a reference to the original object,
# not copying it
tmp = subset
tmp.append(num)
new_results.append(tmp)
result.extend(new_results)
return result
def subsets(arr):
result = [[]]
for i, num in enumerate(arr):
new_results = []
for j, subset in enumerate(result):
new_results.append(subset + [num])
result.extend(new_results)
return result
print subsets([1, 2, 3])
|
6bfa59c214fd9b3794027905132da251f3775af6 | xudaniel11/interview_preparation | /stairs.py | 448 | 3.9375 | 4 | """
There are n stairs, a person standing at the bottom wants to reach the top.
The person can climb either 1, 2, or 3 stairs at a time. Count the number
of ways, the person can reach the top.
Base cases handle illegal cases.
"""
def stairs(n):
if n == 0:
return 1
elif n < 0:
return 0
else:
return stairs(n - 1) + stairs(n - 2) + stairs(n - 3)
print stairs(4) # should be 7
print stairs(5) # should be 13
|
0b95a6a31595b540c25dbb81cad8b99acd3af537 | xudaniel11/interview_preparation | /binaryMatrixCloseness_INCORRECT.py | 2,902 | 3.578125 | 4 | """
@author - Daniel Xu
Given a matrix M of number 1 and 0, for each cell in the matrix determine how far
the closest 1 is to the current cell. If the 1 is the current cell, then the distance is 0
because there is no "distance". If the 1 is next to the cell, the distance is 1.
Only consider cardinal directions (up, down, left, right) to consider the distances
WARNING - THIS APPROACH IS WRONG
a) DO NOT WANT TO USE DFS, WANT BFS
b) DANGER OF CYCLES == INCORRECT METHODOLOGY
c) USE binaryMatrixCloseness_v2.py !!!!!
Want to do iterative / successive expansion from the starting 1 points
"""
import numpy as np
import sys
class BinaryMatrix:
def __init__(self, inputMatrix):
self.inputMatrix = inputMatrix
self.height = inputMatrix.shape[0]
self.width = inputMatrix.shape[1]
self.memoMatrix = np.empty(inputMatrix.shape)
self.memoMatrix[:] = sys.maxint
self.visitMatrix = np.empty(inputMatrix.shape)
self.visitMatrix[:] = np.NAN
def resetVisitMatrix(self):
self.visitMatrix = np.empty(self.inputMatrix.shape)
self.visitMatrix[:] = np.NAN
def setClosestOne(self, i, j):
if i < 0 or i >= self.height or j < 0 or j >= self.width:
return sys.maxint
if self.memoMatrix[i,j] != sys.maxint:
return self.memoMatrix[i,j]
if self.inputMatrix[i,j] == 1:
self.memoMatrix[i,j] = 0
return 0
if self.visitMatrix[i,j] == True:
return sys.maxint
self.visitMatrix[i,j] = True
#print i,j
uDist = self.setClosestOne(i+1,j)
lDist = self.setClosestOne(i,j+1)
dDist = self.setClosestOne(i-1,j)
rDist = self.setClosestOne(i,j-1)
# if i == 2 and j == 3:
# print [uDist, lDist, dDist, rDist]
self.memoMatrix[i,j] = 1 + min(uDist, lDist, dDist, rDist)
return self.memoMatrix[i,j]
def calculateMatrixCloseness(self):
for i in range(self.height):
for j in range(self.width):
self.resetVisitMatrix()
self.setClosestOne(i,j)
self.printMemoMatrix()
def printMemoMatrix(self):
np.set_printoptions(precision=0)
np.set_printoptions(suppress=True)
print np.around(self.memoMatrix)
testMatrix_1 = np.matrix([[0,0,1,0,0],[1,1,1,0,1],[1,0,1,0,0],[0,0,0,0,1],[1,0,0,0,0]])
testMatrix_2 = np.matrix([[0,0,0,0,0],[0,0,0,0,0],[0,0,0,0,0],[0,0,0,0,0],[0,0,0,0,0]])
testMatrix_3 = np.matrix([[1,1,1,1,1],[1,1,1,1,1],[1,1,1,1,1],[1,1,1,1,1],[1,1,1,1,1]])
testMatrix_4 = np.matrix([[1,1,1,1,1],[0,0,0,0,0],[0,0,0,0,0],[0,0,0,0,0],[1,1,1,1,1]])
t1 = BinaryMatrix(testMatrix_1)
t2 = BinaryMatrix(testMatrix_2)
t3 = BinaryMatrix(testMatrix_3)
t4 = BinaryMatrix(testMatrix_4)
print "Testing\n %s" % testMatrix_1
t1.calculateMatrixCloseness()
print "\n\nTesting\n %s" % testMatrix_2
t2.calculateMatrixCloseness()
print "\n\nTesting\n %s" % testMatrix_3
t3.calculateMatrixCloseness()
print "\n\nTesting\n %s" % testMatrix_4
t4.calculateMatrixCloseness()
|
f35842ab5a7e78d864e28944a262c49f06bfde31 | BeatrizVasconcelos/Trabalho-Banco-de-Dados | /aux.py | 14,799 | 3.609375 | 4 | from getpass import getpass
from cripto import crip
# função que realiza login
def login(db):
while(True):
# lê email do usuário
print('Digite seu e-mail:')
email = input()
# executa query para buscar email digitado
q = "SELECT * FROM usuario WHERE email='{}';".format(email)
tuplas = db.select(q) # lista de tuplas
# caso o email não esteja cadastrado, retorna ao inicio
if(len(tuplas) < 1):
print('Email não cadastrado.')
continue
# caso o usuario seja um autor, busca pela tupla correspondente
if(tuplas[0][5] == 'Autor'):
# executa query para buscar email digitado
q = "SELECT * FROM autor WHERE email='{}';".format(email)
tuplas = db.select(q) # lista de tuplas
# usuario
usuario = tuplas[0]
# lê a senha do usuário
senha = getpass('Digite sua senha:\n')
senha = crip(senha)
# checa se a senha foi digitada corretamente
# caso sim, retorna uma lista com as funções do usuario
if(senha == usuario[4]):
print('Logado com sucesso.')
return usuario
# caso não, retorna ao começo
else:
print('Senha incorreta.')
continue
# função que realiza cadastro de usuários
def cadastro(db):
# lê nome e sobrenome do usuário
print('Digite seu nome:')
nome = input()
print('Digite seu sobrenome:')
sobrenome = input()
# lê o email do usuário até que ele digite um email não cadastrado
while(True):
print('Digite seu e-mail:')
email = input()
q = "SELECT email FROM usuario WHERE email='{}';".format(email)
tuplas = db.select(q)
if(len(tuplas) == 0):
break
else:
print('Email já cadastrado.')
# lê a senha até que o usuario digite a mesma senha duas vezes
while(True):
senha = getpass('Digite uma senha:\n')
senha2 = getpass('Digite novamente:\n')
if(senha == senha2):
senha = crip(senha)
break
else:
print('Senhas não correspondem.')
# lê o tipo de autor até que o usuário selecione uma opção válida
while(True):
print('Digite qual sua qualificação na cozinha! :)')
print('1 - Amador')
print('2 - Estudante')
print('3 - Profissional')
tipo = int(input())
if(tipo in (1, 2, 3)):
if(tipo == 1):
tipo = 'Amador'
elif(tipo == 2):
tipo = 'Estudante'
else:
tipo = 'Profissional'
break
else:
print('Digite uma opção válida.')
# query que insere um novo usuario
q = "INSERT INTO autor" \
" (nome, sobrenome, email, senha, permissao, tipo_autor)" \
" VALUES ('{}', '{}', '{}', '{}', 'Autor', '{}');"
q = q.format(nome, sobrenome, email, senha, tipo)
# executa a query
db.execute_query(q)
# query para buscar o usuario inserido
q = "SELECT * FROM autor WHERE email='{}';".format(email)
tuplas = db.select(q)
# retorna o usuario cadastrado
return tuplas[0]
# busca as receitas
def get_receitas(db, *argv):
# query basica para buscar receitas
q = "SELECT * FROM Receita"
# caso seja passado um argumento adicional,
# adiciona na query
if(len(argv) > 0):
q += argv[0]
# adicionada condição para ordenar por avaliacao_media
# do maior para o menor
q += " ORDER BY avaliacao_media DESC;"
return db.select(q)
# função para inserir uma receita
def insere_receita(db, id_autor):
meds = ('kg', 'g', 'colher de chá', 'colher de sopa', 'l', 'ml', 'unidade')
cats = ('Lanche', 'Acompanhamento',
'Prato Principal', 'Sobremesa', 'Entrada')
# lê o nome da receita
print('Digite o nome da receita:')
nome = input()
# lê a categoria da receita
print('Digite a categoria:')
print(cats)
while(True):
categoria = input()
if(categoria in cats):
break
print('Digite uma categoria válida')
# lê os ingredientes
print('Digite os ingredientes:')
ingredientes = []
qtdes = []
while(True):
# lê o nome do ingrediente
print('Qual ingrediente você deseja adicionar?')
ingrediente = input()
# busca pelo ingrediente
q = "SELECT * FROM ingrediente WHERE nome='{}';".format(ingrediente)
tuplas = db.select(q)
# caso encontre o ingrediente
if(len(tuplas) > 0):
# adiciona o id do ingrediente na lista
ingredientes.append(tuplas[0][0])
# caso não encontre o ingrediente
else:
# insere o ingrediente na tabela
q = "INSERT INTO ingrediente (nome)" \
" VALUES ('{}');".format(ingrediente)
db.execute_query(q)
# busca pelo ingrediente inserido
q = "SELECT * FROM ingrediente" \
" WHERE nome='{}';".format(ingrediente)
tuplas = db.select(q)
# adiciona o id do ingrediente na lista
ingredientes.append(tuplas[0][0])
# lê a quantidade de cada ingrediente
print('Digite a quantidade:')
while(True):
try:
resp1 = float(input())
except ValueError:
resp1 = None
finally:
if(resp1):
break
print('Valor inválido')
# lê a medida de cada ingrediente
print('Digite a unidade de medida:')
print(meds)
while(True):
try:
resp2 = input()
except ValueError:
resp2 = None
finally:
if(resp2 in meds):
break
print('Valor inválido')
# adiciona na lista de quantidades
qtdes.append((resp1, resp2))
# lê do usuario se ele deseja inserir ou não outro ingrediente
print('Deseja adicionar outro ingrediente?')
resposta = sim_ou_nao()
# sai do while caso a resposta seja 2
if(resposta == 2):
break
# query para inserir na tabela receita
q1 = "INSERT INTO receita (nome, id_autor, categoria)" \
" VALUES ('{}', {}, '{}');".format(nome, id_autor, categoria)
# insere na tabela receita
db.execute_query(q1)
# recupera o id da receita inserida
q = "SELECT id FROM receita WHERE id_autor='{}' ORDER BY id DESC;"
q = q.format(id_autor)
id_rec = (db.select(q))[0][0]
# insere na tabela Utilizado_em
for i in range(len(ingredientes)):
q2 = "INSERT INTO utilizado_em (id_receita, id_ingrediente, " \
"quantidade, medida) VALUES ({}, {}, {}, '{}');"
q2 = q2.format(id_rec, ingredientes[i], qtdes[i][0], qtdes[i][1])
db.execute_query(q2)
# modo de preparo
print('Digite o modo de preparo:')
num_passo = 0
while(True):
num_passo += 1
print('Digite o {}º passo:'.format(num_passo))
passo = input()
q3 = "INSERT INTO preparo VALUES ({}, {}, '{}');"
q3 = q3.format(id_rec, num_passo, passo)
db.execute_query(q3)
# continua ou não
print('Deseja adicionar mais um passo?')
resposta = sim_ou_nao()
# sai do while
if(resposta == 2):
break
# print fim
print('Receita cadastrada!')
# lê do usuario uma resposta entre sim e não
def sim_ou_nao():
print('(1) - Sim')
print('(2) - Não')
while(True):
try:
resposta = int(input())
except ValueError:
resposta = -1
finally:
if(resposta in (1, 2)):
return resposta
print('Resposta inválida')
# altera os dados do usuario
def alterar_cadastro(db, user, cond):
# altera o usuario
q = "UPDATE {} WHERE id={};".format(cond, user)
db.execute_query(q)
# altera receitas
def editar_receita(db, tbs, opc, rec):
q1 = "UPDATE "
q2 = "INSERT INTO "
q3 = "DELETE FROM "
# alterar dados da receita
if(len(tbs) == 1):
q = q1 + "{} SET {} = '{}' WHERE id={};"
# alterar nome
if(opc == 1):
print('Digite o novo nome da receita:')
campo = 'nome'
novo = input()
# alterar categoria
else:
campo = 'categoria'
cats = ('Lanche', 'Acompanhamento',
'Prato Principal', 'Sobremesa', 'Entrada')
print('Digite a nova categoria da receita:')
print(cats)
while(True):
try:
novo = input()
except ValueError:
novo = ''
finally:
if(novo in cats):
break
print('Digite uma opção válida')
# possui todas as informações para completar a query
q = q.format(tbs[0], campo, novo, rec)
# alterar modo de preparo
elif(len(tbs) == 2):
# adicionar passo
if(opc == 1):
q = q2 + "{} (id_receita, num_passo, passo) " \
"VALUES ({}, {}, '{}');"
print('Informe o novo passo:')
novo = input()
# query para buscar o numero de passos
temp = "SELECT COUNT(num_passo) FROM preparo WHERE id_receita={};"
temp = temp.format(rec)
# numero do novo passo
num = (db.select(temp))[0][0] + 1
q = q.format(tbs[0], rec, num, novo)
# remover o ultimo passo
elif(opc == 2):
q = q3 + "{} WHERE id_receita={} AND num_passo IN " \
"(SELECT MAX(num_passo) FROM {} WHERE id_receita={});"
q = q.format(rec, tbs[0], rec)
# editar passo
else:
# recupera a lista de passos da receita
temp = "SELECT * FROM preparo WHERE id_receita={}".format(rec)
passos = db.select(temp)
# percorre a lista de passos
for passo in passos:
print(passo[2])
print('Deseja alterar este passo?')
resp = sim_ou_nao()
# caso o usuario deseje alterar
if(resp == 1):
print('Digite o novo passo:')
novo = input()
q = q1 + "{} SET passo='{}' WHERE id_receita={}" \
"AND num_passo={};".format(tbs[0], novo, rec, passo[1])
db.execute_query(q)
return True
# alterar ingredientes
elif(len(tbs) == 3):
# add ingrediente
if(opc == 1):
meds = ('kg', 'g', 'colher de chá', 'colher de sopa', 'l',
'ml', 'unidade')
# lê o nome do ingrediente
print('Qual ingrediente você deseja adicionar?')
novo = input()
# busca pelo ingrediente
q = "SELECT * FROM utilizado_em WHERE nome='{}';".format(novo)
ingredientes = db.select(q)
# caso encontre o ingrediente
if(len(ingredientes) > 0):
i = ingredientes[0][0]
# caso não encontre
else:
# insere o ingrediente
temp = q2 + "{} (nome) VALUES ('{}')".format(tbs[2], novo)
db.execute_query(temp)
# busca pelo ingrediente inserido
i = (db.select(q))[0][0]
# lê a quantidade de cada ingrediente
print('Digite a quantidade:')
while(True):
try:
qtd = float(input())
except ValueError:
qtd = None
finally:
if(qtd):
break
print('Valor inválido')
# lê a medida de cada ingrediente
print('Digite a unidade de medida:')
print(meds)
while(True):
try:
med = input()
except ValueError:
med = None
finally:
if(med in meds):
break
print('Valor inválido')
# query para inserir em utilizado_em
q = q2 + " (id_receita, id_ingrediente, quantidade, medida) " \
"VALUES ({}, {}, {}, '{}');"
q = q.format(rec, i, qtd, med)
# remover ingrediente
elif(opc == 2):
print('Qual ingrediente você deseja remover?')
while(True):
ing = input()
# busca pelo ingrediente
q = "SELECT id_ingrediente FROM ingrediente INNER JOIN " \
"utilizado_em ON id_ingrediente=id WHERE nome='{} " \
"AND id_receita={}';".format(ing, rec)
ingredientes = db.select(q)
# caso encontre o ingrediente
if(len(ingredientes) > 0):
i = ingredientes[0][0]
break
else:
print('Ingrediente não utilizado')
q = q3 + "{} WHERE id_receita={} AND id_ingrediente={};"
q = q.format(tbs[1], rec, i)
# alterar medida
else:
q = "SELECT nome, quantidade, medida, id FROM ingrediente " \
"INNER JOIN utilizado_em ON id=id_ingrediente WHERE " \
"id_receita={} ORDER BY nome;".format(rec)
utilizados = db.select(q)
for ing in utilizados:
print('{} - {} {}'.format(ing[0], ing[1], ing[2]))
print('Deseja alterar a medida desse ingrediente?')
resp = sim_ou_nao()
# caso sim, lê a nova quantidade
if(resp == 1):
print('Digite um novo valor:')
while(True):
try:
qtd = float(input())
except ValueError:
qtd = None
finally:
if(qtd):
break
print('Valor inválido')
# query para alterar quantidade
q = q1 + "{} SET quantidade={} WHERE id_receita={} AND " \
"id_ingrediente={};".format(tbs[1], qtd, rec, ing[3])
db.execute_query(q)
return True
else:
return None
db.execute_query(q)
return True
|
6c26473dd26a547e51266f8b0d54f6c9df060b36 | MatthewDobsonOnGitHub/Miscellaneous | /python_scripts/test_python_script.py | 1,962 | 3.5 | 4 | #!/usr/bin/env python
#
#
# Load in the necessary libraries; importing them as smaller strings for brevity.
import numpy as np
import matplotlib.pyplot as plt
import math
import pylab
# Now, we load in the transient data.
# Enter data file name inside brackets.
# This will store the data from the file as an array called 'data'.
data = np.loadtxt('textfile.txt')
# If needs be, we can set the size fo the output graph, but this is optional.
# dpi = 'Dots Per Inches'.
fig = plt.figure(figsize=(12,6), dpi = 100)
# DATA PLOTTING
# Firstly, we store the desired data to be plotted in arrays, one for each axis.
# To do this, we select a given column, denoted by a number, and select all rows in the column (:).
# Note: the 1st row/column is denoted '0', the 2nd row/column denoted '1', etc.
x = data[:,0]
y = data[:,1]
y_error = data[:,2]
# Now, we plot the data on the graph.
# Note, we have errors associated with the y-values of the data, and so must be plotted also. To do this, we use the errorbar() function.
# 'fmt' determines the style (1st letter) and colour (2nd letter) of the datapoints; 'o' makes circular points, 'b' makes blue points.
#capsize determines the size fo the error bar caps.
# linestyle determies the style of the line that joins the data points; here, we leave it blank, so no line is formed.
plt.errorbar(x, y, yerr = y_error, fmt = 'ob', capsize = 5, linestyle = '')
# Setting the titles for the x- and y-axes.
# x-axis is time in units if Modified Julian Days.
# y-axis is flux of light.
plt.xlabel('MJD')
plt.ylabel('Transient Flux')
# Setting the numerical limits of the x- and y-axes
plt.xlim([0,11])
plt.ylim([-20,120])
# We can also set gridlines and tick marks on the graph.
plt.minorticks_on()
plt.grid(which='major', linestyle=':')
plt.grid(which='minor', linestyle=':')
# Before plotting the figure, we save it
plt.savefig('test_plot.pdf')
# Now we display the figure itself!
plt.show()
|
c6852a0f14a112645380329be291055f21736919 | MatthewDobsonOnGitHub/Miscellaneous | /python_scripts/clipping_function.py | 2,388 | 3.65625 | 4 |
def clipping_function(input_dictionary, output_dictionary):
output_dictionary = {}
# We loop through all the days of measurements, and loop through all the measurements taken on each day (nested loops).
for key, value in input_dictionary.items():
# Define the number of points per day in the initial, unclipped data.
list_length = len(value)
# Define the number of points per day in the clipped data - this will be subject to change of value with each iteration
list_length_new = len(value)
# Create an array of list lengths, starting with original list length
length_array = [list_length]
# Finding the standard deviation and median values for each day; the function returns two variables, and assigns the values in a specific order, so be careful!
sigma, med = median_and_stdev(value)
# Performs the clipping an initial first time, calling the function 'remove_row' to remove an outlying data point (if one exists).
new_list = remove_row(value, sigma, med)
# Appends the length of the new, clipped list to the array.
length_array.append(len(new_list))
print(length_array)
while(True): # Infinite loop, until the last two elements in the array are of equal length
# calculate new s.d. and median for every clipping iteration
sigma, med = median_and_stdev(new_list)
# If no more points have been clipped (i.e. the number of unclipped points in a day after passing the data through the clipping function is the same), we want the algorithm to stop for a given day.
if length_array[-1] == length_array[-2]:
# The newest list is appended to the empty dictionary for clipped data, with the same key as the original, unclipped data.
output_dictionary[key] = new_list
print("Break Out")
print(length_array)
return new_list
break
# If clipping has been performed (i.e. if the new clipped list is shorter than before), we want this to continue.
else:
# perform clipping again
new_list = remove_row(value, sigma, med)
# newest list added to the clipped data dictionary (it seemingly overwrites the original array)
# number of remaining data points calculated, and appended to the appropriate array
length_array.append(len(new_list))
print(length_array)
sigma, med = median_and_stdev(new_list)
output_dictionary[key] new_list
return output_dictionary
|
30ca063384563a9b904f680295e18ed3061593b5 | rodrigoctoledo/UnipPandemia | /Pademia1.py | 10,035 | 3.9375 | 4 | '''
Rodrigo de Camargo Toledo D26EB3-6 CCP13
Algoritmo Pandemia
Desenvolvedor: Rodrigo Toledo
Baseado no Enunciado do Professor Dirceu,
As Vezes é necessario interagir com o programa, apertando Enter para obter resultados ou inserindo informações
Após apertar, o enter, pode demorar um pouco, pois coloquei o elemento temporal
Durante o codigo Tem os meus Codigos e referencias as questoes do Professor e com as questões as respostas
'''
import random
from random import randint
import os
import time
print("Bem Vindo ao Fim do Mundo de Pandemia")
doenca = input('Entre com o nome da Doença: ')
#Referencia da Probalidade: https://www.the-hospitalist.org/hospitalist/article/218769/coronavirus-updates/covid-19-update-transmission-5-or-less-among-close
probalidade = int(randint(1,5))
# Parte do Codigo para Limpeza de Tela, mas como funciona apenas no CMD do Windows, Resolvi deixar comentado
''' matriz[l][c] = int(randint(0,200))
textoNaTela = "\ncomo limpar a tela do terminal cmd"
print(10 * textoNaTela)
print("\nLimparei a tela em 5 segundos!")
os.system("cls")
'''
'''
a) Implemente um software que contenha uma área (uma matriz quadrada, escolha o tamanho),
que pode ser ocupada por pontos (escolha a quantidade),
chamado de elementos (pessoas)
'''
elementos = [[0,0,0,0,0,0],[0,0,0,0,0,0],[0,0,0,0,0,0]]
elementos1 = [[0,0,0,0,0,0],[0,0,0,0,0,0],[0,0,0,0,0,0]]
elementos2 = [[0,0,0,0,0,0],[0,0,0,0,0,0],[0,0,0,0,0,0]]
for l in range(0,3):
for c in range(0,6):
elementos[l][c] = 'Saudavel'
elementos1[l][c] = 'Saudavel'
elementos2[l][c] = 'Saudavel'
print('-='*30)
for l in range(0,3):
for c in range(0,6):
if l == 0 and c == 0:
elementos[l][c] ='Contaminado'
'''A.1) Cada pessoa se movimentará dentro desta área'''
print('Essa é o Esquema simples que representa o primeiro contaminado')
for l in range(0, 3):
# l1 += 1
# print("L1:"+str(l1))
for c in range(0, 6):
# l2 += 1
# print("L2:" + str(l2))
print(f'[{elementos[l][c]:^5}]', end='')
print()
input("Pressione ENTER para continuar:")
'''A.2) A cada ciclo (unidade temporal), cada pessoa se movimentará dentro desta área.'''
print('-='*60)
contflag = 0
contpassa =0
conttempo1 =0
flag = False
# A.3) Em uma velocidade aleatória
while(contflag < 17):
time.sleep(randint(1, 1))
conttempo1 += 1
for l in range(0,3):
for c in range(0,6):
if elementos[l][c] =='Saudavel':
# ao entrar em contato com outros elementos.
# Ao final de cada ciclo, se uma pessoa estiver próxima de outra pessoa,
# ela pode transmitir a doença para os elementos que estão em volta de si
# (considere o posicionamento dentro da matriz, mais a probabilidade de transmissão da doença para este cálculo).
#No caso, utilizei um Random, para possibilidade, e a Matriz se a pessoa está saudavel, no if acima
prabalidade = randint(0, probalidade)
# print(prabalidade)
contpassa += 1
if prabalidade <=30:
contflag += 1
#print("ContFlag:"+str(contflag))
elementos[l][c] ='Contaminado'
for l in range(0, 3):
# l1 += 1
# print("L1:"+str(l1))
for c in range(0, 6):
# l2 += 1
# print("L2:" + str(l2))
print(f'[{elementos[l][c]:^5}]', end='')
print()
#b) Calcule quantos ciclos são necessários para se contaminar todos os elementos do grupo.
print("Quantidade de ciclos para infectar todos:" + str(contpassa))
print("Tempo de passagem: "+str(conttempo1)+" Segundos")
input("Pressione ENTER para continuar:")
#c) Qual é a influencia da quantidade de pessoas que estão circulando pelas ruas,
# na velocidade de contaminação das pessoas?
# R: Quanto Mais pessoas nas Ruas, menos tempo ou ciclos acontece a infeccção de todos
#Não consegui achar um numero para probalidade
# https://saude.abril.com.br/medicina/coronavirus-novos-dados-sobre-grupos-de-risco/
# Peguei desse Site a Idade, para estipular o grupo de Risco
#https://g1.globo.com/ciencia-e-saude/noticia/2019/09/16/estudo-confirma-recorde-de-longevidade-da-francesa-jeanne-calment-que-morreu-aos-122-anos.ghtml
print('-='*60)
contflag = 0
contpassa =0
i =int(0)
flag = False
conttempo2 =0
# C.1) e calcule, quanto isso influencia na velocidade de contaminação dos elementos.
while(contflag <= 17):
time.sleep(randint(1, 1))
conttempo2 += 1
idade = int(randint(0, 122))
i+=1
# C.1) Faça exercícios de limitando a movimentação dos elementos na matriz,
# Pessoas Com mais de 60 ou com alguma outra doença que entre no grupo, representado, por resto da divisão 1, não se movimentam
if idade >=60 and idade % 2 == 0:
print("Pessoa no Grupo de Risco, não pode sair")
else:
for l in range(0,3):
for c in range(0,6):
if elementos1[l][c] =='Saudavel':
# ao entrar em contato com outros elementos.
# Ao final de cada ciclo, se uma pessoa estiver próxima de outra pessoa,
# ela pode transmitir a doença para os elementos que estão em volta de si
# (considere o posicionamento dentro da matriz, mais a probabilidade de transmissão da doença para este cálculo).
#No caso, utilizei um Random, para possibilidade, e a Matriz se a pessoa está saudavel, no if acima
prabalidade = randint(0, probalidade)
# print(prabalidade)
contpassa += 1
if prabalidade <=30:
contflag += 1
# print("ContFlag:"+str(contflag))
elementos1[l][c] ='Contaminado'
for l in range(0, 3):
# l1 += 1
# print("L1:"+str(l1))
for c in range(0, 6):
# l2 += 1
# print("L2:" + str(l2))
print(f'[{elementos1[l][c]:^5}]', end='')
print()
print("Quantidade de ciclos para infectar todos:" + str(contpassa))
print("Tempo de passagem: "+str(conttempo2)+" Segundos")
#C.3) Qual é a diferença entre o tempo que demora para contaminar todos os elementos no b, e com a limitação da movimentação.
print("Dirença de Tempo para o ciclo com e sem limitação: "+str(conttempo1-conttempo2)+" Segundos")
input("Pressione ENTER para continuar:")
#d) No protocolo de epidemia, estudado em classe, nem todos os elementos do sistema podem receber as informações mais atualizadas, isto acontece neste caso? Demonstre.
#Vou mandar Via Email
#e) Adicione o componente temporal,
print('-='*60)
contflag = 0
contpassa =0
mortes=0
curados=0
while(contflag <= 17):
time.sleep(randint(1, 1))
conttempo2 += 1
for l in range(0,3):
for c in range(0,6):
if elementos2[l][c] =='Saudavel':
# ao entrar em contato com outros elementos.
# Ao final de cada ciclo, se uma pessoa estiver próxima de outra pessoa,
# ela pode transmitir a doença para os elementos que estão em volta de si
# (considere o posicionamento dentro da matriz, mais a probabilidade de transmissão da doença para este cálculo).
#No caso, utilizei um Random, para possibilidade, e a Matriz se a pessoa está saudavel, no if acima
prabalidade = randint(0, probalidade)
# print(prabalidade)
contpassa += 1
if prabalidade <=30:
contflag += 1
# print("ContFlag:"+str(contflag))
elementos2[l][c] ='Contaminado'
# As Mortes São bem Variaveis, segundo esse site:
#Coloque de 1 a 30% possibilidade
#https://www.abrasco.org.br/site/outras-noticias/saude-da-populacao/estimativas-do-impacto-da-covid-19-na-mortalidade-no-brasil/46151/
Morte = int(randint(1, 100))
Vivos = int(randint(1, 100))
#E.1) e comece a considerar que as pessoas se curam, depois de algum tempo,
if Vivos >=90:
elementos2[l][c] = 'Saudavel'
# E.2)e que algumas morrem. O que muda neste cenário?
# Quantos ciclos demora pras pessoas serem contaminadas,
if Morte <= 5:
elementos2[l][c] = 'Morto'
mortes +=1
for l in range(0, 3):
# l1 += 1
# print("L1:"+str(l1))
for c in range(0, 6):
# l2 += 1
# print("L2:" + str(l2))
print(f'[{elementos2[l][c]:^5}]', end='')
print()
print("Quantidade de ciclos para infectar todos:" + str(contpassa))
#E.3) quantas pessoas morrem?
print("Quantidade de Mortos:" + str(mortes))
print(doenca+" Ferrou o Mundo :( ")
#f) Como comparar o espalhamento de um vírus, com a consistência de um banco de dados?
#R: Em questão de Replicação de Dados ou Pessoas contamidas que replicam os virus para outros pelo contato, a Consistência eventual,
#como apresenta alguns problemas de Replicação, assosio com as pessoas evitando contando e assim quebrando a replica do Virus
#e) Como você compara cada indivíduo deste exercício, com processos e threads em um sistema distribuído?
#R: Um Local fechado, seria o processador, e as pessoas são Theads e processos, o virus é o Recurso, se as Theads(Pessoas)
#no Processador(Local), pararem de compartilhar recursos(Virus), vai ocorrer o Deadlock e as pessoas vão parar de compartilhar o virus
#
|
6d1b7c713ca3d76f905109aa6770b67d3b2da4a3 | Roooommmmelllll/Python-Codes | /randomNumList.py | 1,029 | 3.984375 | 4 | import random
def makeList():
numList = []
for i in range(50):
numList.append(random.randint(0,100))
return numList
def stats(numList):
total = 0
minimum = 100
maximum = 0
for i in range(50):
total+=numList[i]
if (numList[i] < minimum):
minimum = numList[i]
if (numList[i] > maximum):
maximum = numList[i]
average = total/50
print("Average is:", average)
print("Minimum is:", minimum)
print("Maximum is:", maximum)
def bubbleSort(numList):
swapped = True
while(swapped == True):
swapped = False
for i in range(0,50):
for j in range(i+1,50):
if(numList[i] > numList[j]):
temp = numList[i]
numList[i] = numList[j]
numList[j] = temp
swapped = True
return numList
def printList(numList):
print(numList)
def main():
numList = makeList()
printList(numList)
stats(numList)
sortedList = bubbleSort(numList)
printList(sortedList)
main()
|
d9aeb4ebe92db4d93fabc3c2362a1889605f1c35 | Roooommmmelllll/Python-Codes | /string_slicing.py | 176 | 3.78125 | 4 | #string slicing
def strSlice():
name = "Abraham Lincoln"
print (name)
#print (name[0])
#print (name[6:11])
#print (name[2::2])
print (name[-1::-1])
strSlice()
|
67f02f80af5d677d4752503c9947c994be1ad901 | Roooommmmelllll/Python-Codes | /conversion_table.py | 453 | 4.1875 | 4 | #print a conversion table from kilograms to pounds
#print every odd number from 1 - 199 in kilograms
#and convert. Kilograms to the left and pounds to the right
def conversionTable():
print("Kilograms Pounds")
#2.2 pound = 1kilograms
kilograms = 1
kilograms = float(kilograms)
while kilograms <= 199:
pounds = kilograms*2.2
print(str("%4.2f"%kilograms) + str("%20.2f"%pounds))
kilograms += 2
conversionTable()
|
648905f5d1d15cccd1a9356204ad69db0f30ce31 | Roooommmmelllll/Python-Codes | /rightTriangleTest.py | 970 | 4.21875 | 4 | def getSides():
print("Please enter the three sides for a triagnle.\n" +
"Program will determine if it is a right triangle.")
sideA = int(input("Side A: "))
sideB = int(input("Side B: "))
sideC = int(input("Side C: "))
return sideA, sideB, sideC
def checkRight(sideA, sideB, sideC):
if sideA >= sideB and sideA >= sideC:
if sideA**2 == (sideB**2+sideC**2):
return True
elif sideB >= sideA and sideB >= sideC:
if sideB**2 == (sideA**2+sideC**2):
return True
elif sideC >= sideA and sideC >= sideB:
if sideC**2 == (sideA**2+sideB**2):
return True
return False
def printMe(right):
if right == True:
print("Those values create a right triangle!")
else:
print("Those values DO NOT create a right triangle!")
def main():
sideA, sideB, sideC = getSides()
#checkTriangle
right = checkRight(sideA, sideB, sideC)
printMe(right)
main()
|
996e8730e24a1d8f763ea3f2f2fd1b7eebcfcd03 | Roooommmmelllll/Python-Codes | /Brute_Force.py | 1,814 | 3.625 | 4 | import itertools
import hashlib
def main():
#Original Data
name = "Jane Doe Smith"
bd = "02/13/1981"
ssn = "567-33-2013"
pn = "831.228.5671"
petName = "Kujo Friendly"
win7Pass = "ae2e1fa899105c28184c0d0d11be8241"
print("The Original Data")
print(name,"\n",bd,"\n",ssn,"\n",pn,"\n",petName,"\n")
#Splits Data into Lists
nameStr = name.split(" ")
bdStr = bd.split("/")
ssnStr = ssn.split("-")
pnStr = pn.split(".")
petNameStr = petName.split(" ")
print("The String Form Data")
print(nameStr,"\n",bdStr,"\n",ssnStr,"\n",pnStr,"\n",petNameStr,"\n")
#Combines all the lists into one big list
bigList = nameStr + bdStr + ssnStr + pnStr + petNameStr
print("The Combined Data List")
print(bigList)
#Permutates the pieces of the list into single strings and puts them in a list
perms = itertools.permutations(bigList, r=3)
permsList = list(perms)
print("The list pieces have been separated into sets of 3.")
#Finds the password!
print("\n\nNow looking for password.")
correctPass = "" #Holds password if found.
correctHash = "" #Holds the password hash if found.
tries = 0
for i in range(len(permsList)):
#turns the generated password into MD5 hex
joinedItem = ''.join((permsList[i]))
joinItemByte = joinedItem.encode('utf-8')
joinItemMD5 = hashlib.md5(joinItemByte)
joinItemDigest = joinItemMD5.hexdigest()
#keeps check of the tries
tries += 1
#checks against the taken password
if win7Pass == joinItemDigest:
correctPass = joinedItem
correctHash = joinItemDigest
print("Password found!")
break
print("\nThe Hashed MD5:", correctHash)
print("\nThe password is:", correctPass)
print("\nIt only took", tries, "tries!")
main()
|
cc19bcc1c8da5e3ab76d70a2c460820ddbc7e1ea | Roooommmmelllll/Python-Codes | /4 Points Distance CHecker.py | 1,225 | 4 | 4 | def woot():
print("Program will determine the " +
"fastest route between four " +
"points of travel.")
print("Assume that point A is already plotted")
pointsNum = 0
while pointsNum < 6:
pointsNum+=1
if pointsNum == 1:
pointAB = int(input("Please input the distance" +
"from point A to B")
elif pointsNum == 2:
pointAC = int(input("Please input the distance" +
"from point A to C")
elif pointsNum == 3:
pointAD = int(input("Please input the distance" +
"from point A to D")
elif pointsNum == 4:
pointBC = int(input("Please input the distance" +
"from point B to C")
elif pointsNum == 5:
pointBD = int(input("Please input the distance" +
"from point B to D")
elif pointsNum == 6:
pointCD = int(input("Please input the distance" +
"from point C to D")
check1 = pointAB + pointBC + pointCD
shortest = check1
check2 = pointAB + pointBD + pointCD
if check1 > check2:
shortest = check2
else:
|
3d12d105de0090fc2711f13e08ad7172732402b9 | Roooommmmelllll/Python-Codes | /class_ifs.py | 2,183 | 3.953125 | 4 | def divide():
topnum = int(input("Please input a number for the numerator: "))
botnum = int(input("Please input a number for the denominator: "))
if(botnum == 0):
print("You cannot divide with zero!!")
answer = "undefined"
return
answer = topnum/botnum
print("The answer is " + str(answer) + ".")
def wages():
hours = int(input("Please input the amount of hours that you worked: "))
wage = float(input("Please input your hourly wage: "))
if(hours < 0 or wage < 0):
print("You cannot enter a negative number!!")
return
earnings = hours*wage
print("You earned " + str(("%.2f")%earnings) + " dollars in " + str(hours) + " hours.")
def showMessage():
message = "Hello, world!"
answer = input("Do you want to see the message? (Y / N): ")
answer = answer.lower()
if (answer == "yes" or answer == "y"):
print(message)
def channel():
print("This program will tell you what kind\nof programming is on the channel you enter.")
channelNum = int(input("Please enter a favorite t.v. channel: "))
if (channelNum == 25):
print("You must like sports.")
if (channelNum == 72):
print("You must like cartoons.")
if (channelNum == 9):
print("You must like public tv.")
if (channelNum != 25 and channelNum != 72 and channelNum != 9):
print("I do not know that channel.. :(")
def drive():
print("This program will find out if you can drive a car in CA")
age = int(input("How old are you?: "))
if (age >= 16):
hasCar = input("Do you have a car? (Y/N): ")
hasCar = hasCar.lower()
if (hasCar == 'y' or hasCar == 'yes'):
hasLicense = input("Do you have a driver's license? (Y/N): ")
hasLicense = hasLicense.lower()
if (hasLicense == 'y' or hasLicense == 'yes'):
print("You can drive a car!")
else:
print("You need to have a car in order to drive..")
else:
print("You must have a license in order to drive a car.")
else:
print("You are not old enough to drive.")
drive()
|
273d7533f1f2de41e71eb77e9d291101f461bb5f | Roooommmmelllll/Python-Codes | /bus_seats.py | 247 | 3.96875 | 4 | def rentbus():
people = int(input("How many people are going?: "))
extra = people - 34
if extra >= 0:
print(extra, "people need to drive.")
else:
extra *= -1
print("There are", extra, "spaces empty on the bus.")
|
d28babacc9ada1b6bd9b74f941fe6b6b6d0131cc | Roooommmmelllll/Python-Codes | /highscores.py | 774 | 4 | 4 | def highscore():
loop = True
while loop == True:
students = input("How many students are in the class?: ")
if students.isdigit() == True:
break
chr(2)
ord(a)
highscore1 = 0
highscore2 = 0
for i in range(0, students):
while loop == True:
newScore = input("Input a student's score: ")
if newScore.isdigit() == True:
break
newScore = float(newScore)
if newScore > highscore1 or newScore == highscore1:
highscore2 = highscore1
highscore1 = newScore
elif newScore > highscore2 and newScore < highscore1:
highscore2 = newScore
print("The highest score is:", highscore1)
print("The second heighest score is:", highscore2)
highscore()
|
fb44a10c97370bd7f1c1214260c1469b1c2f91b9 | Roooommmmelllll/Python-Codes | /MathCAI.py | 7,608 | 4.28125 | 4 | # Computer Assisted Instruction. Practice Arithmetic.
# At least 6 functions.
# Use echo printing where apporpriate (printing with variables)
# Extensions
# F) Extend your program so that it has differnt grade levels.
# For example, the program will only give problems with numbers at the level.
# Grade 1 - Numbers 1 > 5
# Grade 2 - Numbers 1 > 10
# Grade 3 - Numbers 1 > 20
# Using the score of how the student is doing overall, you can promote
# the student to the next grade level automatically if they are getting
# 90% or more right at their grade level.
import random
# A) Extend your program so that when the user gets the right answer,
# your program uses the random number generator to print out 1 out of
# 4 different possible responses.
# Do the same thing for their incorrect answers.
def randOutput(isCorrect):
randNum = random.randint(1,4)
if (isCorrect == True):
if(randNum == 1):
print("That is Correct!")
elif(randNum == 2):
print("Awesome, right answer!")
elif(randNum == 3):
print("Good Job! That was correct!")
elif(randNum == 4):
print("Amazing! That's right!")
else:
if(randNum == 1):
print("I'm sorry, but that is incorrect.")
elif(randNum == 2):
print("Good try! But that is wrong :(")
elif(randNum == 3):
print("Sorry, that's the wrong answer.")
elif(randNum == 4):
print("That answer's a little off. Sorry.")
# C) Extend the program so that it evaluates the user by their scores.
# This will take place at the end of each math type.
# 100% right out of 10 problems, Amazing!
# 90% right out of 10 problems, Excellent!
# 80% is pretty good.
# 70 - 80% is average, but needs more practice.
# Below 70%, need a lot of review and practice.
# If they get below 70% the program will display a review of that operation.
# For example, multiplication should show a multiplication table
def evaluateScore(percentCorrect):
print("You got", percentCorrect, "% questions correct out of 10.")
if(percentCorrect >= 90):
print("Amazing job, you really have a knack for this!")
elif(percentCorrect >= 80 and percentCorrect < 90):
print("You should be proud of yourself!")
elif(percentCorrect >= 70 and percentCorrect < 80):
print("Almost there, a little more effort!")
elif(percentCorrect < 70):
print("You need some review and practice, here's some help.")
def extraHelp(operand):
if(operand == "+"):
print("\n\nRemember that addition is like adding two bags of things together.")
print("If you have one bag of marbles, with 3 marbles in it.")
print("And you have another bag of marbles, with 2 marbles in it.")
print("Then you put all the marbles from one bag and put it into the other,")
print("you can count the marbles one by one, from the other bag.")
print("Right now, the second bag has 2 marbles, so take one out.")
print("The first bag has 4 marbles in it now, and the second bag has only 1.")
print("Then you can take the last marble out of the second bag.")
print("The first bag now has 5 marbles in it, and the second bag is empty!")
print("This idea works for anything, and in normal math looks like 3 + 2 = ?")
print("Which is 5!\n\n")
elif(operand == "-"):
print("\n\nRemember that you can think of subtraction as taking marbles out of a bag.")
print("If you have a bag of 3 marbles, and you wish to take 2 out.")
print("You remove one marble, so the bag now has 2 marbles in it.")
print("Then you remove another marble, so that the bag now has 1 marble in it.")
print("You can think of this problem in normal math as, 3 - 2 = ?")
print("Which equals 1!\n\n")
elif(operand == "*"):
print("/n/n")
colLine = ""+str("%5.0f"%())
for cols in range(1,13):
colLine+= str("%5.0f"%(cols))
print(colLine)
for vert in range(1,13):
line = ""+str(vert)
for horiz in range(1,13):
line += str("%5.0f"%(vert*horiz))
print(line)
print("/n/n")
elif(operand == "/"):
print("/n/nDivision is hard, but you cank think of it like this:")
print("10 / 2 = ?")
print("You subtract 2 from 10, until it reaches 0.")
print("Then you add up how many times you had to subtract.")
print("In this case, 10-2 = 8. 8-2 = 6. 6-2 = 4. 4-2 = 2. 2-2 = 0.")
print("So, I had to subtract the 2 a total of five ( 5 ) times.")
print("That means that 10 / 2 = 5!/n/n")
# Give the student 10 problems, using random numbers from 1 to 12.
# Questions should be in format, "What is 6 x 5?" or "What is 2 + 12?"
def mathAdd():
counter = 0
correct = 0
while(counter < 10):
tries = 0
num1 = random.randint(1,12)
num2 = random.randint(1,12)
answer = num1+num2
# D) Extend the program so that if the student gets it wrong, they can
# try again and again until they get it right, and but is not counted
# in their total for correct answers, it will only count by getting
# it right on the first try.
while(tries >= 0):
print()
print("What is", num1, "+", str(num2)+"?")
user = input()
# After giving an answer, check if the answer is correct, print out something like "Excellent!"
if(int(user) == int(answer)):
randOutput(True)
if(tries == 0):
correct += 1
break
else:
break
else:
randOutput(False)
tries+=1
# If the answer is wrong, print out "Sorry, that is wrong. The correct answer is ##"
counter += 1
# Your program should keep a count of how many questions the
# student gets right. And should let them know at the end what
# percentage of the ten programs they got right. This should
# display at the end of each practice session operation.
percentCorrect = correct*10
evaluateScore(percentCorrect)
if(correct < 7):
extraHelp("+")
return correct
#def mathSub():
#def mathMult():
#def mathDiv():
# B) Extend the program by adding a Mixture option.
# Where they are given 10 questions using different Mathematics options.
#def mathMix():
# Present students with a menu, where they can repeatedly choose to practice.
# - Addition, Subtraction, Multiplication, and Division problems or to exit the program.
# User chooses math operation to practice ( +, -, *, / )
def main():
totalCorrect = 0
totalQuestions = 0
while (totalQuestions >= 0):
print("Please choose an operation to practice ( +, -, *, / )")
print("You can enter M for a mix, or enter 0 (zero) to exit the program.")
choice = input()
if(choice == "0"):
print("Thank you for using the Math Computer Assisted Instruction Program.")
return
elif(choice == "+"):
numCorrect = mathAdd()
# Keep track of a running score of the questions they got right in the whole program.
# At the end of each 10 questions, the program should tell them their overall progress.
# And then return to the menu.
totalCorrect += numCorrect
totalQuestions += 10
print("You currently have gotten", totalCorrect, "questions correct out of", totalQuestions)
elif(choice == "-"):
mathSub()
elif(choice == "*"):
mathMult()
elif(choice == "/"):
mathDiv()
elif(choice == "M"):
mathMix()
#else:
main()
|
722687225a39c563b955c4a56c8270b3aaea647c | Roooommmmelllll/Python-Codes | /printSlow.py | 322 | 3.828125 | 4 | import time
def printSlow():
print("Please input a speed to print at")
print("0.5 is pretty fast, while 5 is very very slow.")
printSpeed = float(input())
newString = input("Input a long string: ")
for i in range(len(newString)):
print(newString[i], end="")
time.sleep(printSpeed)
printSlow()
|
5ba3a2d27ec8f58f97c54cc837c81f210362508a | Roooommmmelllll/Python-Codes | /largerNumber.py | 241 | 4.125 | 4 |
def largeNumbers():
value = 0
for i in range(7):
user = int(input("Please input seven numbers: "))
if user > value:
value = user
print("The largest number you entered was: " + str(value) + ".")
largeNumbers()
|
109899d74d6d0c48afe0052224a64a258ea793e3 | nishhub/EasyLevelPythonPrograms | /Sorting/Bubble Sort.py | 346 | 3.890625 | 4 | def bubble_sort(a_list):
swap = True
for i in range(len(a_list)-1, 0, -1):
for j in range(0, i):
if a_list[j] > a_list[j+1]:
a_list[j], a_list[j+1] = a_list[j+1], a_list[j]
swap = False
if swap:
return
a_list = [4, 2, 38, 10, 5]
bubble_sort(a_list)
print(a_list) |
8af20acbd18a8e179396fff27dedfa4cddda7d3c | mayer-qian/Python_Crash_Course | /chapter4/numbers.py | 1,092 | 4.34375 | 4 | #使用函数range生成数字,从1开始到5结束,不包含5
for value in range(1, 5):
print(value)
print("=======================================")
#用range创建数字列表
numbers = list(range(1, 6))
print(numbers)
print("=======================================")
#定义步长
even_numbers = list(range(2, 11, 2))
print(even_numbers)
print("=======================================")
#将1-10的平方添加到列表
squares = []
for value in range(1, 11):
squares.append(value**2)
print(squares)
print("=======================================")
#列表解析
squares = [value**2 for value in range(1, 11)]
print(squares)
print("=======================================")
#求大,求小,求和
digits = list(range(1, 11))
print("max digit is " + str(max(digits)))
print("min digit is " + str(min(digits)))
print("sum of digit is " + str(sum(digits)))
print(sum(list(range(1, 1000000))))
#打印3到30内3的倍数
digis = list(range(3, 31, 3))
for digi in digis:
print(digi)
#1-10的立方
lifang = [value**3 for value in range(1, 11)]
print(lifang)
|
c8d52dbd74315b07d658790c57a73802414fdba2 | badre-Idrissi/tpPython | /application2.py | 244 | 3.6875 | 4 | nom = input("sasissez le nom : \n")
genre_val=input("saisir le genre :\n")
#genre= ("Monsieur" if genre_val=="1" else "Madame")
genre=("Monsieur", "Madame")[genre_val=="0"]
msg= "Bonjour {} {}"
print("Bonjour {} {}".format(genre,nom))
|
0c3b01eeef287780b3c0cc135e5a4fe06f640778 | christinalow/compsci-class | /projects/semester 1/#2-11-16-2017.py | 376 | 3.5 | 4 | import math
#a = p(1+(r/n))**nt
p = float(input("What is the amount you saved up?"))
r = (int(input("What is your current savings rate in percent?"))/100)
n = int(input("How often does your investment compound per year?"))
a = 2*p
x = (1 + (r/n))
y = a/p
#y will always be 2
t = ((math.log10(y))/ (n*(math.log10(x))))
print("Your amount will double in " + str(t) + " years")
|
da90287810410dc0e41db8a5b93f63f99214496e | christinalow/compsci-class | /practice/2017-12-18.py | 499 | 3.921875 | 4 | sum=0
for i in range(1000):
if i%4==0 or i%7==0:
sum= sum + i
print("The sum of all the multiples of 4 and 7 below 1000 is " + str(sum) +".")
#checks to if user input is a prime number:
import math
num = int(input("Enter an integer: "))
mid = int(math.sqrt(num))+1
count=0
for x in range(2,mid):
if num%x==0:
count+=1
if count>0:
print(str(num)+" is not a prime number.")
elif count==0:
print(str(num)+" is a prime number.")
#future steps/challenge: see which is the highest factor
|
7d4ef9a2f61bbab56b14b9c3b26cc300e2fa6f1f | lxndrvn/python-lightweight-erp-3rd-tw-overload | /common.py | 917 | 3.8125 | 4 | # implement commonly used functions here
import random
# generate and return a unique and random string
# other expectation:
# - at least 2 special char()expect: ';'), 2 number, 2 l and 2 u case letter
# - it must be unique in the list
#
# @table: list of list
# @generated: string - generated random string (unique in the @table)
def generate_random(table):
l = "abcdefghijklmnopqrstuvwxyz"
c = "[!@#$%^&*()?]"
id = [i[0] for i in table]
while True:
num = [random.randint(0, 9) for i in range(2)]
lo = [l[random.randint(0, len(l) - 1)] for i in range(2)]
up = [l[random.randint(0, len(l) - 1)].upper() for i in range(2)]
spec = [c[random.randint(0, len(c) - 1)] for i in range(2)]
app = num + lo + up + spec
generated = "".join(str(i) for i in app)
if generated not in id:
return False
else:
return generated
|
27a145eb25b3a446ef753448253916a71a4c44a9 | WarriorsWCH/python-lesson | /字典/dict.py | 699 | 4 | 4 | info = {'name':'li', 'id':100, 'sex':'f', 'address':'english'}
# 修改元素
info['id'] = 50
print(info)
# 添加新的元素
info['age'] = 23
print(info)
# del删除指定的元素
del info['sex']
print(info)
# clear清空整个字典
info.clear()
print(info)
info = {'name':'li', 'id':100, 'sex':'f', 'address':'english'}
# 键值对的个数
print(len(info))
# 返回一个包含字典所有KEY的列表
print(info.keys())
# 返回一个包含字典所有value的列表
print(info.values())
# 返回一个包含所有(键,值)元组的列表
print(info.items())
for key,value in info.items():
print(key,value)
print('name' in info)
print('li' in info)
print('li' not in info) |
5ffbd62fd3238c5c2bdddf9b3f24ffdc7262bf01 | dmyerscough/demo | /test_main.py | 407 | 3.53125 | 4 | #!/usr/bin/env python
import unittest
from main import fib
class TestFib(unittest.TestCase):
def test_fib(self):
"""
Test fibonacci
"""
fibonacci = []
s = fib()
for _ in range(0, 11):
fibonacci.append(next(s))
self.assertEqual(fibonacci, [0, 1, 1, 2, 3, 5, 8, 13, 21, 34, 55])
if __name__ == '__main__':
unittest.main()
|
9acef6fa13ba60dd674dfea65c1674d4dd939c94 | thammaneni/Python | /Practice/TimedeltaExcercise.py | 324 | 3.84375 | 4 | from datetime import date
from datetime import time
from datetime import datetime
from datetime import timedelta
now = datetime.now()
print ("Today is "+ str(now))
print ("Time after 365 days :"+str(now + timedelta(days=365)))
print ("Date after 6 weeks, 4 days,20hours : ", str(now + timedelta(weeks=6,days=4,hours=20))) |
79a6d94edab18821979a117ba4c226544aef0882 | thammaneni/Python | /Practice/DateTimeFormat.py | 443 | 4.0625 | 4 | from datetime import datetime
t = datetime.now()
print (t.strftime("The current year is : %Y"))
print (t.strftime("The current date is : %d"))
print (t.strftime("The current month is : %B"))
print (t.strftime("The current weekday is : %A"))
print (t.strftime("The Local Date and Time is : %c"))
print (t.strftime("The Local date is : %x"))
print (t.strftime("The Local time is : %X"))
print (t.strftime("The current time is : %I:%M:%S %p")) |
b81b5ccc53216e4485737df5a37121c85939eb33 | thammaneni/Python | /PythonPracticeEx/EvenListCreationSingleSTMT.py | 450 | 3.859375 | 4 | # import random
# randomNumber = random.randint(0,5)
# print (randomNumber)
#=========================================================
list1 = [30,32,46,12,13,14,15,16,17,18,19,20]
subList = [ i for i in list1 if i % 2 == 0]
subList.sort()
print (subList)
#========================================================
# a = [1, 4, 9, 16, 25, 36, 49, 64, 81, 100]
# def only_even():
# onlyeven = a[0:len(a)-1:2]
# print(onlyeven)
# only_even()
|
c424feca5aea8d199dfc86454391ab6266123ea0 | KinPeter/Udemy-and-other-courses | /Python-mega-course-by-Ardit-Sulce/bokeh_visualization/basic_graph.py | 796 | 3.78125 | 4 | # making a basic bokeh line graph
from bokeh.plotting import figure
from bokeh.io import output_file, show
import pandas
# ---- from python lists
# prepare some data
x = [1,2,3,4,5]
y = [6,7,8,9,10] # need to be the same length
# prepare the output file
output_file('line.html')
# create a figure object
f1 = figure()
# create line plot
f1.line(x, y)
# show the figure object
show(f1)
# ---- from local csv file
df = pandas.read_csv('data.csv')
x = df['x'] # index is the column name
y = df['y']
output_file('line_from_csv.html')
f2 = figure()
f2.line(x, y)
show(f2)
# ---- from local online csv file
df2 = pandas.read_csv('http://pythonhow.com/data/bachelors.csv')
x = df2['Year']
y = df2['Engineering']
output_file('line_from_web_csv.html')
f3 = figure()
f3.line(x, y)
show(f3)
|
a6a16620fe79273b2d803874fdfca403a58cac4a | KinPeter/Udemy-and-other-courses | /Python-mega-course-by-Ardit-Sulce/pandas_jupyter/supermarkets/import_read_and_slice_dataframes.py | 1,874 | 3.84375 | 4 | import os
os.listdir()
import pandas
# import csv file
df1 = pandas.read_csv("supermarkets.csv") # header = None : will not treat first row as header
print(df1.set_index("ID")) # will treat ID column as index but only for output, not saving it
print(df1.shape) # how many rows and colums we have?
# import json file
df2 = pandas.read_json("supermarkets.json")
print(df2)
# import excel file
df3 = pandas.read_excel("supermarkets.xlsx", sheet_name=0) # sheet's index, so 0, 1, 2, etc
print(df3)
# import txt file, data separated by commas
df4 = pandas.read_csv("supermarkets-commas.txt") # for txt with separated by commas just simply use read_csv
print(df4)
# import txt file, data separated by other character
df5 = pandas.read_csv("supermarkets-semi-colons.txt", sep=";") # for txt with other separator use read_csv and add sep=""
print(df5)
# import online files
df6 = pandas.read_csv("http://pythonhow.com/supermarkets.csv") # to open online file
print(df6)
# changing the layout with index, and save:
df7 = df6.set_index("Address") # save table with index "address" to a new variable
print(df7)
# label based indexing:
print(
df7.loc["735 Dolores St" : "3995 23rd St", "City" : "Country"] # slice of table with range of rows and range of columns
)
# getting a single cell:
print(
df7.loc["332 Hill St", "Name"]
)
# getting 1 row to a list:
print(
list(df7.loc["551 Alvarado St", : ]) # excludes the index cell!
)
# position based indexing:
print(
df7.iloc[1:4, 1:4] # range here is upperbound exclusive!
)
# getting a single cell:
print(
df7.iloc[2, 4] # range excludes the index cell!
)
# getting 1 row to a list:
print(
list(df7.iloc[5, : ]) # excludes the index cell!
)
# combined indexing (Deprecated):
print(
df7.ix[2, "Name"] # can combine position and label, also can use range similarily as .loc and .iloc
) |
9700cb032358926683c69bfd64b0f904d2f0f757 | KinPeter/Udemy-and-other-courses | /Python-by-in28minutes/02-OOP-project/book-reviews.py | 709 | 3.59375 | 4 | class Book:
def __init__(self, id, name, author):
self.id = id
self.name = name
self.author = author
self.review = []
def __repr__(self):
return repr((self.id, self.name, self.author, self.review))
def add_review(self, review):
self.review.append(review)
class Review:
def __init__(self, id, review, rating):
self.id = id
self.review = review
self.rating = rating
def __repr__(self):
return repr((self.id, self.review, self.rating))
book = Book(101, 'Object Oriented Programming with Python', 'Ranga')
book.add_review(Review(10, "Great Book", 5))
book.add_review(Review(11, "Awesome", 5))
print(book)
|
6ddcb742d401c9179a8d0c36be4c9729950f51bd | KinPeter/Udemy-and-other-courses | /Python-mega-course-by-Ardit-Sulce/bokeh_visualization/weather_data.py | 610 | 3.625 | 4 | import pandas
from bokeh.plotting import figure
from bokeh.io import output_file, show
p = figure(plot_width=800, plot_height=600, tools='pan')
df = pandas.read_excel('http://pythonhow.com/data/verlegenhuken.xlsx')
x = df['Temperature'] / 10
y = df['Pressure'] / 10
p.title.text='Temperature and Air Pressure'
p.title.text_color='Gray'
p.title.text_font='Arial'
p.title.text_font_style='bold'
p.xaxis.minor_tick_line_color=None
p.yaxis.minor_tick_line_color=None
p.xaxis.axis_label='Temperature (C)'
p.yaxis.axis_label='Pressure (hPa)'
p.circle(x, y, size=0.5)
output_file('temp_and_press.html')
show(p)
|
d8d913f624f5afef56252ae6a768bc688241708d | anti401/python1 | /python1-lesson1/easy-3.py | 535 | 3.96875 | 4 | # coding : utf-8
# Задача-3: Запросите у пользователя его возраст.
# Если ему есть 18 лет, выведите: "Доступ разрешен",
# иначе "Извините, пользование данным ресурсом только с 18 лет"
age = int(input('Сколько вам лет? - '))
if age >= 18:
print('Доступ разрешен')
else:
print('Извините, пользование данным ресурсом только с 18 лет')
|
d9657338aa5ce5c4be2b5f189f5d6ea7b3bae1a6 | anti401/python1 | /python1-lesson1/easy-2.py | 555 | 4.21875 | 4 | # coding : utf-8
# Задача-2: Исходные значения двух переменных запросить у пользователя.
# Поменять значения переменных местами. Вывести новые значения на экран.
a = input('A = ')
b = input('B = ')
print('Вы ввели A = ' + str(a) + ' и B = ' + str(b))
# перестановка значений через временную переменную
t = a
a = b
b = t
print('А теперь A = ' + str(a) + ' и B = ' + str(b))
|
eb18ec7075c744764ea2d06be8bb29785f76f8da | anti401/python1 | /python1-lesson3/normal-4.py | 1,003 | 4.09375 | 4 | # coding : utf-8
# Задача-4:
# Даны четыре точки А1(х1, у1), А2(x2 ,у2), А3(x3 , у3), А4(х4, у4).
# Определить, будут ли они вершинами параллелограмма.
def middle(A, B):
# середина отрезка
return (A[0] + B[0]) / 2, (A[1] + B[1]) / 2
def equals(A, B):
# совпадение точек
return A[0] == B[0] and A[1] == B[1]
points = [1, 1], [2, 4], [4, 1], [5, 4]
# если совпадают середины диагоналей - параллелограмм
if equals(middle(points[0], points[1]), middle(points[2], points[3])):
print('Это параллелограмм!')
elif equals(middle(points[0], points[2]), middle(points[1], points[3])):
print('Это параллелограмм!')
elif equals(middle(points[0], points[3]), middle(points[2], points[1])):
print('Это параллелограмм!')
else:
print('Это не параллелограмм.')
|
84766bbb2176c3375eb0717a0566c46bdcbfff42 | anti401/python1 | /python1-lesson2/normal-1.py | 865 | 3.640625 | 4 | # coding : utf-8
# Дан список, заполненный произвольными целыми числами, получите новый список,
# элементами которого будут квадратные корни элементов исходного списка,
# но только если результаты извлечения корня не имеют десятичной части и
# если такой корень вообще можно извлечь
# Пример: Дано: [2, -5, 8, 9, -25, 25, 4] Результат: [3, 5, 2]
import math
list_orig = [2, -5, 8, 9, -25, 25, 4]
list_new = []
for el in list_orig:
if el >= 0 and math.sqrt(el).is_integer():
list_new.append(int(math.sqrt(el)))
print('Исходный список: ', list_orig)
print('Новый список: ', list_new)
|
9ec5a1b69aeddeef690353a6b10b1f7e8604fe23 | miseop25/CS_Basic | /Algorithm/Sorting/QuickSort.py | 1,014 | 3.96875 | 4 | class Sort :
def __init__(self, array):
self.array = array
def quickSort(self, st, ed) :
if st >= ed :
return
pivot = st
small = st + 1
big = ed
temp = 0
while small <= big :
while small <= ed and self.array[small] <= self.array[pivot] :
small += 1
while big > st and self.array[big] >= self.array[pivot] :
big -= 1
if small > big :
temp = self.array[big]
self.array[big] = self.array[pivot]
self.array[pivot] = temp
else :
temp = self.array[small]
self.array[small] = self.array[big]
self.array[big] = temp
self.quickSort(st, big-1)
self.quickSort(big+1 , ed)
if __name__ == "__main__":
test = [3,7,8,1,5,9,6,10,2,4]
s = Sort(test)
s.quickSort(0, len(test)-1)
print(s.array) |
4ef007bae17e06e2f2f81f160d2d07e8e029375f | kahnadam/learningOOP | /Lesson_2_rename.py | 688 | 4.3125 | 4 | # rename files with Python
import os
def rename_files():
#(1) get file names from a folder
file_list = os.listdir(r"C:\Users\adamkahn\learningOOP\lesson_2_prank")
#find the current working directory
saved_path = os.getcwd()
print("Current Working Directory is "+saved_path)
#change directory to the one with the files
os.chdir(r"C:\Users\adamkahn\learningOOP\lesson_2_prank")
#(2) for each file, rename file
for file_name in file_list:
print("Old Name - "+file_name)
print("New Name - "+file_name.translate(None, "0123456789"))
os.rename(file_name,file_name.translate(None, "0123456789"))
#return to original working directory
os.chdir(saved_path)
rename_files() |
43a152688669d42bbfe9472235b37505bd315265 | jlopez0591/python-automate | /strings/table_printer.py | 814 | 4 | 4 | #table_printer.py
#prints a table of lists with the same amount of elements
#Function to print the table
def printTable(tableData):
rowLength = 0
colWidths = [0] * len(tableData)
for i, column in enumerate(tableData):
if(rowLength<len(column)):
rowLength = len(column)
for word in column:
if(colWidths[i] < len(word)):
colWidths[i] = len(word)
for i in range(rowLength):
tableRow=''
for j, row in enumerate(tableData):
tableRow+=row[i].rjust(colWidths[j])+' '
print(tableRow)
#Main part of the program
tableData = [['apples', 'oranges', 'cherries', 'banana'],
['Alice', 'Bob', 'Carol', 'David'],
['dogs', 'cats', 'moose', 'goose']]
printTable(tableData)
|
ce4909318398deed3194ca364684bbb07305892f | MarcusVinix/Cursos | /curso-de-python/exemplos/enumerate.py | 411 | 4 | 4 | numeros = [30, 28, 43, 54, -1, -4, -6, -7, 8, 7, 9,]
print(numeros)
i = 0
for num in numeros:
print("FOR sem enumerate: [%d] --> %d" % (i, num))
#print("FOR sem enumerate: [", i, "] --> ", num)
i += 1
i = 0
while i < len(numeros):
print("While sem enumerate: [%d] --> [%d]" % (i, numeros[i]))
i += 1
for i, num in enumerate(numeros):
print("FOR com enumerate: [%d] --> %d" % (i, num))
|
291a113d8bcc954b18d084b0d6a64340d5c88958 | MarcusVinix/Cursos | /curso-de-python/modulos/modulo_type.py | 738 | 3.65625 | 4 | import types
def mostraTipo(dado):
tipo = type(dado)
if tipo == str:
return ("String")
elif tipo == int:
return ("inteiro")
elif tipo == list:
return ("Lista")
elif tipo == dict:
return ("Dicionario")
elif tipo == float:
return ("Numero decimal")
elif tipo == bool:
return ("Booleano")
elif tipo == types.BuiltinFunctionType:
return ("Função interna")
elif tipo == types.FunctionType:
return ("Função")
else:
return (str(tipo))
print(mostraTipo("Marcus"))
print(mostraTipo(28))
print(mostraTipo(78.8))
print(mostraTipo([5,7,8]))
print(mostraTipo({"Python":120, "Go":130}))
print(mostraTipo(print))
print(mostraTipo(None)) |
35b4f63c77d843ae5f23d2e1455fcc8cf2a184f6 | MarcusVinix/Cursos | /curso-de-python/exercicios/contagem_cedulas.py | 761 | 3.75 | 4 | valor = float(input("Digite o valor: "))
cedulas = 0
valorCedulaAtual = 100
valorASerEntregue = valor
while True:
if valorCedulaAtual <= valorASerEntregue:
cedulas += 1
valorASerEntregue -=valorCedulaAtual
else:
if cedulas > 0:
print("%d cedula(s) de R$ %5.2f" % (cedulas, valorCedulaAtual))
if valorASerEntregue == 0:
break
if valorCedulaAtual == 100:
valorCedulaAtual = 50
elif valorCedulaAtual == 50:
valorCedulaAtual = 20
elif valorCedulaAtual == 20:
valorCedulaAtual = 10
elif valorCedulaAtual == 10:
valorCedulaAtual = 5
elif valorCedulaAtual == 5:
valorCedulaAtual = 2
cedulas = 0
|
727df69164898002020bade490e3ac13d9b4c4b0 | MarcusVinix/Cursos | /curso-de-python/funcoes_def/criando_funcoes_fatorial.py | 485 | 4.0625 | 4 | #fatorial de 3: 3 * 2 * 1 = 6
#fatorial de 4: 4 * 3 * 2 * 1 = 24
#fatorial de 5: 5 * 4 * 3 * 2 * 1 = 120
def fatorial(numero):
f = 1
while numero > 1:
f *= numero
numero -= 1
return f
print(fatorial(3))
print(fatorial(4))
print(fatorial(5))
print(fatorial(6))
def fatorial1(numero):
f = 1
i = 1
while i <= numero:
f *= i
i += 1
return f
print(fatorial1(3))
print(fatorial1(4))
print(fatorial1(5))
print(fatorial1(6))
|
073248546d1afb1cd215ae07e8c69a3f5c5c9373 | MarcusVinix/Cursos | /curso-de-python/exemplos/string_len.py | 130 | 3.59375 | 4 | nome = "Marcus Vinicius"
print("Nome: ", nome)
print("Tamanho: ", len(nome))
tamanho = len(nome)
print("Tamanho: ", tamanho)
print(nome[5]) |
596f04b0adf35ebf8679d29bcab401868eb5eecb | MarcusVinix/Cursos | /curso-de-python/funcoes_def/criando_funcoes_pesquisa.py | 829 | 3.6875 | 4 | def pesquisar(lista, codigo):
for i, codigos in enumerate(lista):
if codigos == codigo:
return ("Codigo %d encontrado no indice %d" % (codigo, i))
return ("O codigo %d não foi localizado" % codigo)
listaProdutos = [4, 8, 2, 67, 5, 12]
print(pesquisar(listaProdutos, 8))
print(pesquisar(listaProdutos, 5))
print(pesquisar(listaProdutos, 11))
print(pesquisar(listaProdutos, 2))
dicionarioCursos = {"pyhton": 130,
"java": 110,
"arduino": 90}
def pesquisarDicionario(dicionarioPesquisar, cursoPesquisar):
if cursoPesquisar in dicionarioPesquisar:
print("Esse curso foi localizado, o seu preço é R$ %5.2f" % dicionarioPesquisar[cursoPesquisar])
else:
print("Esse curso não foi localizado")
pesquisarDicionario(dicionarioCursos, "java") |
966c55fb0d234a61e5b66999b41be525a979d8c9 | MarcusVinix/Cursos | /curso-de-python/funcoes_def/criando_as_proprias_funcoes.py | 1,062 | 4.34375 | 4 | print("Sem usar funções, a soma é: ", (5+6))
def soma(num1, num2):
print("Usando funções (DEF), a soma é: ", (num1+num2))
def subtracao(num1, num2):
print("Usando funções (DEF), a subtração é: ", (num1 - num2))
def divisao(num1, num2):
print("Usando funções (DEF), a divisão é: ", (num1 / num2))
def multiplicacao(num1, num2):
print("Usando funções (DEF), a multiplicação é: ", (num1 * num2))
soma(23, 45)
subtracao(89, 56)
divisao(87, 54)
multiplicacao(34, 3)
#usando comando return
def soma1(num1, num2):
return(num1+num2)
valor1 = 70
valor2 = 80
print("Usando funções (DEF) com return, a soma é ", soma(8,7))
print("Usando funções (DEF) com return, a soma é ", soma(valor1,valor2))
def numeroPar(numero):
return(numero % 2 == 0)
print("O numero 4 é par? ", numeroPar(4))
print("O numero 5 é par? ", numeroPar(5))
def parOuImpar(numero1):
if numeroPar(numero1):
return "par"
else:
return "impar"
print("O numero 7 é ", parOuImpar(7))
print("O numero 8 é ", parOuImpar(8))
|
22472b8911a31661edf487d34bcee15711c747de | MarcusVinix/Cursos | /curso-de-python/classes/classes_conta_banco.py | 700 | 3.703125 | 4 | class ContaBanco:
def __init__(self, cliente, numeroConta, saldo=0):
self.saldo = saldo
self.cliente = cliente
self.numeroConta = numeroConta
def deposito(self, valor):
self.saldo += valor
print("Foi depositado R$%d em sua conta" % valor)
def saque(self, valor):
self.saldo -= valor
print("Foi sacado R$%d de sua conta" % valor)
def relatorio(self):
print("Cliente: %s, conta numero: %s, saldo: %8.2f" % (self.cliente, self.numeroConta, self.saldo))
contaBanco = ContaBanco("Marcus Vinicius", "9999-99", 500)
contaBanco.relatorio()
contaBanco.deposito(500)
contaBanco.relatorio()
contaBanco.saque(300)
contaBanco.relatorio() |
ff7f7dcb405a313dedf08409f2714e36079b889c | MarcusVinix/Cursos | /curso-de-python/exemplos/tipo_de_dados.py | 397 | 3.5625 | 4 | #int
inteiro = 8
print(type(inteiro))
#float
numero = 9.7
print(type(numero))
#bolean
ativo = True
print(type(ativo))
#string
nome = "Marcus Vinicius"
print(type(nome))
#list
lista = ["Marcus", "Goku", "Naruto", "Natsu"]
print(type(lista))
#dict
familia = {}
familia[0, 0] = "Marcus"
familia[0, 1] = "Goku"
familia[1, 0] = "Naruto"
familia[1, 1] = "Gustavo"
print(type(familia))
print(familia[1, 0]) |
abe978d9498b3edcb311552d4c797e615dbdbc79 | yqstar/MachineLearning | /TangYudi_MachineLearningCourse/MachineLearning/SVM/SVM_Facial_Recognition.py | 2,685 | 3.671875 | 4 | #!/usr/bin/env python
# -*- coding: utf-8 -*-
# @File : svm_face_recognition.py
# @Author: Shulin Liu
# @Date : 2019/3/8
# @Desc :
"""
As an example of support vector machines in action,
let's take a look at the facial recognition problem.
We will use the Labeled Faces in the Wild dataset,
which consists of several thousand collated photos of various public figures.
A fetcher for the dataset is built into Scikit-Learn:
"""
from sklearn.datasets import fetch_lfw_people
from sklearn.svm import SVC
from sklearn.decomposition import PCA
from sklearn.pipeline import make_pipeline
from matplotlib import pyplot as plt
from sklearn.model_selection import train_test_split, GridSearchCV
from sklearn.metrics import classification_report, confusion_matrix
import seaborn as sns
faces = fetch_lfw_people(min_faces_per_person=60)
print(faces.target_names)
print(faces.images.shape)
# Let's plot a few of these faces to see what we're working with:
fig, ax = plt.subplots(3, 5)
for i, axi in enumerate(ax.flat):
axi.imshow(faces.images[i], cmap='bone')
axi.set(xticks=[], yticks=[], xlabel=faces.target_names[faces.target[i]])
plt.show()
# 每个图的大小是 [62×47]
# 在这里把每一个像素点当成了一个特征,但是这样特征太多了,用PCA降维一下吧!
pca = PCA(n_components=150, whiten=True, random_state=0)
svc = SVC(kernel='rbf', class_weight='balanced')
model = make_pipeline(pca, svc)
x_train, x_test, y_train, y_test = train_test_split(faces.data, faces.target, random_state=0)
# 使用grid search cross_validation 来选择参数
param = {'svc__C': [1, 5, 10], 'svc__gamma': [0.0001, 0.0005, 0.001]}
grid = GridSearchCV(model, param)
grid.fit(x_train, y_train)
print(grid.best_params_)
print(grid.best_score_)
model = grid.best_estimator_
y_fit = model.predict(x_test)
# 画出结果
fig, ax = plt.subplots(4, 6)
for i, axi in enumerate(ax.flat):
axi.imshow(x_test[i].reshape(62, 47), cmap='bone')
axi.set(xticks=[], yticks=[])
axi.set_ylabel(faces.target_names[y_fit[i]].split()[-1],
color='black' if y_fit[i] == y_test[i] else 'red')
fig.suptitle('Predicted Names; Incorrect Labels in Red', size=14)
plt.show()
print(classification_report(y_test, y_fit, target_names=faces.target_names))
"""
精度(precision) = 正确预测的个数(TP)/被预测正确的个数(TP+FP)
召回率(recall)=正确预测的个数(TP)/预测个数(TP+FN)
F1 = 2精度召回率/(精度+召回率)
"""
mat = confusion_matrix(y_test, y_fit)
sns.heatmap(mat.T, square=True, annot=True, fmt='d', cbar=False, xticklabels=faces.target_names, yticklabels=faces.target_names)
plt.xlabel('true label')
plt.ylabel('predicted label')
plt.show()
|
1103177ad273c3f1ac526fd1ad555b6cffe52279 | pseandersson/lsystem | /tests/test_lmath.py | 6,402 | 3.5625 | 4 | """
Tests for expressions and calculate
"""
import unittest
from random import choice, uniform
from lsystem.lmath import calculate, Expression, Operator
class TestExpression(unittest.TestCase):
def test_add(self):
"""Test a simple expression"""
expr = Expression('a+1')
self.assertEqual(expr(a=1.), 2)
def test_subtract(self):
"""Test a simple expression"""
expr = Expression('t-1')
self.assertEqual(expr(t=3.), 2)
def test_mul(self):
"""Test a simple linear expression"""
expr = Expression('5*a+2')
self.assertEqual(expr(a=2.), 12)
def test_pow(self):
"""Test a simple linear expression"""
expr = Expression('a^2')
self.assertEqual(expr(a=3.), 9)
def test_passing_vars(self):
expr = Expression('a^2')
def fn(in_expr, **kwargs):
return in_expr(**kwargs)
self.assertEqual(fn(expr, a=3), 9)
def test_constant_expression(self):
"""Test a constant expression e.g 5*3 + 1"""
expr = Expression('5*3+1')
self.assertTrue(expr.is_constant())
self.assertEqual(expr(), 16)
class TestOperations(unittest.TestCase):
"""Class to test a faster calculator"""
def test_operators_only_numbers(self):
"""Iterate over each operatore and do the math"""
N = 10
for i in range(N):
# ops = [OpAdd, OpDivide, OpMin, OpMultiply, OpPower, OpSubtract]
ref_ops = [float.__add__, float.__truediv__,
min, float.__mul__, pow, float.__sub__]
a = [uniform(-10, 10) for x in ref_ops]
b = [choice((-1, 1)) * uniform(0.00001, 10) for x in ref_ops]
ops = [Operator(x, y, op) for x, y, op in zip(a, b, ref_ops)]
ops[:] = [ops[i]() for i, x in enumerate(b)]
ref_ops[:] = [ref_ops[i](x, y)
for i, (x, y) in enumerate(zip(a, b))]
self.assertListEqual(ops, ref_ops)
def test_operators_with_numbers_and_args(self):
"""Iterate over each operatore and do the math with custom arguments"""
N = 10
for i in range(N):
# ops = [OpAdd, OpDivide, OpMin, OpMultiply, OpPower, OpSubtract]
ref_ops = [float.__add__, float.__truediv__,
min, float.__mul__, pow, float.__sub__]
a = [uniform(-10, 10) for x in ref_ops]
b = [choice((-1, 1)) * uniform(0.00001, 10) for x in ref_ops]
ops = [Operator(x, 'x', op) for x, op in zip(a, ref_ops)]
ops[:] = [ops[i](**{'x': x}) for i, x in enumerate(b)]
ref_ops[:] = [ref_ops[i](x, y)
for i, (x, y) in enumerate(zip(a, b))]
self.assertListEqual(ops, ref_ops)
def test_operators_with_only_args(self):
"""Iterate over each operatore and do the math with custom arguments"""
N = 10
for i in range(N):
# ops = [OpAdd, OpDivide, OpMin, OpMultiply, OpPower, OpSubtract]
ref_ops = [float.__add__, float.__truediv__,
min, float.__mul__, pow, float.__sub__]
a = [uniform(-10, 10) for x in ref_ops]
b = [choice((-1, 1)) * uniform(0.00001, 10) for x in ref_ops]
ops = [Operator('a','b', op) for x, op in zip(a, ref_ops)]
ops[:] = [ops[i](**{'a': x, 'b': y})
for i, (x, y) in enumerate(zip(a, b))]
ref_ops[:] = [ref_ops[i](x, y)
for i, (x, y) in enumerate(zip(a, b))]
self.assertListEqual(ops, ref_ops)
def test_operator_multiply(self):
"""test expressions like 1+2*3"""
opr2 = Operator(2., 3., float.__mul__)
opr1 = Operator(1., opr2, float.__add__)
self.assertEqual(opr1(), 7)
def test_operator_multiply_dual(self):
"""test expressions like 1+2*3+4"""
opr2 = Operator(2., 3., float.__mul__)
opr1 = Operator(1., opr2, float.__add__)
opr3 = Operator(opr1, 4., float.__add__)
self.assertEqual(opr3(), 11)
def test_operator_multiply_args(self):
"""test expressions like x+2*3"""
opr2 = Operator(2., 3., float.__mul__)
opr1 = Operator('x', opr2, float.__add__)
args = {'x': 1.}
self.assertEqual(opr1(**args), 7)
class TestCalculateMethod(unittest.TestCase):
"""Class which tests the calculate part of lsystem"""
def test_e_behaivour(self):
"""Test expressions like 4e-1"""
self.assertAlmostEqual(calculate('4e-1'), 0.4)
def test_mul_par_e_div_min_min(self):
"""Test a complex expression"""
self.assertAlmostEqual(calculate('2((3*5e-1)/4-2)-3'), -6.25)
def test_par_add(self):
"""Test add with parentheries"""
self.assertEqual(calculate('(5)+3'), 8)
def test_par_mul(self):
"""Test multiplication with parentheries"""
self.assertEqual(calculate('(5)*3'), 15)
def test_div(self):
"""Test divsion with parentheries"""
self.assertEqual(calculate('(5)/3'), 5 / 3)
def test_scope_exp(self):
"""Test power of"""
self.assertEqual(calculate('(4-2)^2'), 4)
def test_min_to_pow_of_two(self):
self.assertEqual(calculate('-2^2'), -4)
def test_subtract(self):
"""Test of subtraction"""
self.assertEqual(calculate('4-3'), 1)
def test_subtract_neg_val(self):
"""Test subtraction if negation twice"""
self.assertEqual(calculate('4--3'), 7)
def test_neg_val_to_pow_of_two(self):
self.assertEqual(calculate('(-2)^2'), 4)
def test_neg_val_to_pow_mul_min(self):
self.assertEqual(calculate('(-3)^2*2-3'), 15)
def test_mul_neg_val_to_pow(self):
self.assertEqual(calculate('5*(-2)^2'), 20)
def test_val_min_neg_val_to_pow(self):
self.assertEqual(calculate('5-(-2)^2'), 1)
def test_val_min_val_to_decimal_pos(self):
self.assertEqual(calculate('2-4^.5'), 0)
def test_dec_add_val_mul_scope_div_scope_add(self):
self.assertAlmostEqual(calculate('-4.3+3*(2-5)/(2.3-0.3)+4'), -4.8)
def test_val_mininum_scope(self):
"""v denotes the min operator"""
self.assertEqual(calculate('2*(2v(3/2))'), 3)
self.assertEqual(calculate('2*((3/2)v2)'), 3)
if __name__ == "__main__":
unittest.main()
|
822ea9a3fb40c7e580cb25cb7b04f7418897ef28 | fessupboy/python_bootcamp_3 | /Tuples/Tuples.py | 219 | 3.765625 | 4 | t = (1,2,3)
mylist = [1,2,3]
print(type(t))
t = ('one',2)
print(t[0])
print(t[-1])
t = ('a','a','b')
print(t.count('a'))
print(t.index('a'))
print(t.index('b'))
mylist[0] ='NEW'
print(mylist)
t[0] = 'NEW'
print(t)
|
7118bf76fbb295f78247342b3b341f25d2d0a5c0 | adikadu/DSA | /implementStack(LL).py | 1,181 | 4.21875 | 4 | class Stack:
def __init__(self):
self.top = None
self.bottom = None
self.length = 0
def node(self, value):
return {
"value": value,
"next": None
}
def peek(self):
if not self.length: return "Stack is empty!!!"
return self.top["value"]
def push(self, value):
node = self.node(value)
node["next"] = self.top
self.top = node
if not self.length: self.bottom = node
self.length+=1
def pop(self):
if not self.length:
print("Stack is empty!!!")
return
node = self.top
if self.length==1:
self.top = None
self.bottom = None
else: self.top = self.top["next"]
self.length -= 1
node["next"] = None
return node
def isEmpty(self):
return not bool(self.length)
def traverse(self):
if not self.length:
print("Stack is empty!!!")
return
x = self.top
for i in range(self.length):
print(x["value"])
x = x["next"]
stack = Stack()
print("Empty:",end=" ")
stack.traverse()
stack.push(1)
stack.push(2)
stack.push(3)
print("Three values:", end=" ")
stack.traverse()
print("peek=", end=" ")
print(stack.peek())
stack.pop()
print("Two values:", end=" ")
stack.traverse()
print("peek=", end=" ")
print(stack.peek())
|
4aaa2473dfc612231522c02ccd11dd26dbfceb0c | adikadu/DSA | /reverseString.py | 437 | 3.859375 | 4 | import re
# def reverseString(a):
# i=0
# j=len(a)-1
# a=list(a)
# while(True):
# if i>=j : return "".join(map(str, a)) # Converts list to string.
# k=a[i]
# a[i]=a[j]
# a[j]=k
# i+=1
# j-=1
# print(reverseString(input()))
def reverseString(a):
if len(re.findall(r"\S+", a)) == 0: #check if string contains only space.
return "Type some input bro!!!"
return a[::-1] # reverse a string
print(reverseString(input())) |
2def6eec36986f0266030ced224a42ef3b127396 | adikadu/DSA | /factorial.py | 197 | 3.75 | 4 | def Rfact(n):
if n == 0 or n==1 : return 1
return n*Rfact(n-1)
def Ifact(n):
if n==0: return 1
x = 1
for i in range(2, n+1):
x *= i
return x
n=int(input())
print(Rfact(n))
print(Ifact(n)) |
1c9b8627cbcd812574bb52edbbfbc1bf9af86455 | Juand0145/AirBnB_clone | /models/engine/file_storage.py | 2,826 | 3.859375 | 4 | #!/usr/Bin/python3
'''Is a class FileStorage that serializes instances
to a JSON file and deserializes JSON file to instances:'''
import json
class FileStorage:
'''Is a class FileStorage that serializes instances
to a JSON file and deserializes JSON file to instances:'''
__file_path = "file.json"
__objects = {}
def all(self):
'''Instance Method that returns the dictionary __objects '''
return FileStorage.__objects
def new(self, obj):
'''Is apublic instance that sets in __objects
the obj with key <obj class name>.id'''
if obj is not None:
key = "{}.{}".format(obj.__class__.__name__, obj.id)
FileStorage.__objects[key] = obj
def save(self):
'''Is a public instance that serializes __objects to the
JSON file (path: __file_path)'''
json_obj_dict = {}
for key, value in FileStorage.__objects.items():
json_obj_dict[key] = value.to_dict()
with open(FileStorage.__file_path, 'w', encoding='utf-8') as my_file:
json.dump(json_obj_dict, my_file)
def reload(self):
'''Is a instance method deserializes the JSON file to __objects
(only if the JSON file (__file_path) exists ; otherwise, do nothing.
If the file doesn’t exist, no exception should be raised)'''
from models.base_model import BaseModel
from models.user import User
from models.state import State
from models.city import City
from models.amenity import Amenity
from models.place import Place
from models.review import Review
''' '''
try:
with open(FileStorage.__file_path, 'r') as my_file:
for key, value in json.load(my_file).items():
if key not in FileStorage.__objects:
class_create = value['__class__']
if class_create == 'BaseModel':
FileStorage.__objects[key] = BaseModel(**value)
elif class_create == 'User':
FileStorage.__objects[key] = User(**value)
elif class_create == 'State':
FileStorage.__objects[key] = State(**value)
elif class_create == 'City':
FileStorage.__objects[key] = City(**value)
elif class_create == 'Amenity':
FileStorage.__objects[key] = Amenity(**value)
elif class_create == 'Place':
FileStorage.__objects[key] = Place(**value)
elif class_create == 'Review':
FileStorage.__objects[key] = Review(**value)
except:
pass
|
95a649309ce0c95b56618400bce8eedb1bc7593d | Alex-Dumitru/python | /APPS/web_scraping/scrape_app.py | 2,852 | 3.59375 | 4 | """
scrape a website, gather data, and export it to csv
target page: century21.com
cached page, for practice: pythonhow.com/real-estate/rock-springs-wy/LCWYROCKSPRINGS/
"""
import requests
from bs4 import BeautifulSoup as BS
web_page = requests.get('http://pythonhow.com/real-estate/rock-springs-wy/LCWYROCKSPRINGS/')
web_page_content = web_page.content
soup = BS(web_page_content, 'html.parser')
allPropertyRow = soup.find_all("div", {"class": "propertyRow"}) # --> bs4.element.ResultSet
# Because this is a list of bs4 elements, we can apply again find or find_all methods to each elem
# extract property price from the 1st element
# we need to use find, to apply the text property. Otherwise, we need to apply it to each element in the list
# returned by find_all
propertyPrice1 = allPropertyRow[0].find("h4", {"class": "propPrice"}).text
# we have some rogue spaces and \n chars, so let's strip them
propertyPrice1 = propertyPrice1.replace("\n","").replace(" ","")
# iterate through all items
# at this stage, we need to 'inspect' each element in the website, and find where it is stored, then extract it
for item in allPropertyRow:
price = item.find("h4", {"class": "propPrice"}).text.replace("\n","").replace(" ", "")
address = item.find_all("span", {"class": "propAddressCollapse"})[0].text
city = item.find_all("span", {"class": "propAddressCollapse"})[1].text
# some items don't have the bed number listed, so we need to take into account that it will return None
# and NoneType doesn't have a text attribute
try:
# this attribute returns the text from the <span> tag, and also the text from the <b> tag
beds = item.find("span", {"class": "infoBed"}).text
# if we want to get only the number of beds, we can apply the find() method again
beds = item.find("span", {"class": "infoBed"}).find("b").text
except:
beds = ""
try:
sqft = item.find("span", {"class": "infoSqFt"}).find("b").text
except:
sqft = ""
try:
baths = item.find("span", {"class": "infoValueFullBath"}).find("b").text
except:
baths = ""
try:
half_bath = item.find("span", {"class": "infoValueHalfBath"}).find("b").text
except:
half_bath = ""
for columnGroup in item.find_all("div", {"class": "columnGroup"}):
# print(columnGroup)
for featureGroup, featureName in zip(columnGroup.find_all("span", {"class": "featureGroup"}), columnGroup.find_all("span", {"class": "featureName"})):
# print(featureGroup.text, featureName.text)
if "Lot Size" in featureGroup.text:
lotSize = featureName.text
print(lotSize)
print(price, beds, baths, half_bath, sqft)
print()
# print(soup.prettify())
# print(allPropertyRow)
# print(">",propertyPrice1,"<")
|
c99ca779476eac58b05e117c1825ba4189922f96 | Alex-Dumitru/python | /APPS/webmap_app/map1.py | 4,458 | 4.0625 | 4 | ''''
ibrary needed folium
pip install folium
the base layer of the map comes from openstreetmaps
'''
import folium
import pandas
def color_prod(elev):
if elev < 1500:
return 'green'
elif 1500 <= elev < 3000:
return 'orange'
else:
return 'red'
map = folium.Map(location=[80,-100]) # create a Map object. Pass lat and long to the location
# if you want specific coordinates, copy them from maps.google.com - Select a location, right click, and choose "What's here"
map = folium.Map(location=[80,-100], zoom_start=6) # you can play with the initial zoom as well
map = folium.Map(location=[80,-100], zoom_start=6, tiles="Mapbox Bright") # you can change the default layer
# add a marker to the map
map.add_child(folium.Marker(location=[80,-100], popup="Hi I am a marker", icon=folium.Icon(color='green')))
# recommended way is to create a feature group to add a marker to your map
fg = folium.FeatureGroup(name="My Map")
# the marker is a feature, so instead of adding it directly to the map, you add it to the group
fg.add_child(folium.Marker(location=[80,-100], popup="Hi I am a marker", icon=folium.Icon(color='green', prefix='fa'))) #1
# and then you pass the FeatureGroup group as a child to the map
map.add_child(fg)
# one way to add multiple markers to the mas is to repeat #1 and change the parameters (loc, text, color etc)
# second way is to use a for loop:
for coordinates in [[81,-100],[81,-101]]:
fg.add_child(folium.Marker(location=coordinates, popup="Hi I am a marker", icon=folium.Icon(color='green'))) #1
# 3rd way is from a file
data = pandas.read_csv("Volcanoes_USA.txt") # generate a data frame with pandas
lat = list(data["LAT"]) # create separate lists for LAT and LON
lon = list(data["LON"])
# for lt, ln in zip(lat, lon):
# fg.add_child(folium.Marker(location=[lt,ln], popup="Hi I am a marker", icon=folium.Icon(color='green')))
# focus on popup to make info dynamic
elev = list(data["ELEV"])
for lt, ln, el in zip(lat, lon, elev):
#fg.add_child(folium.Marker(location=[lt,ln], popup=str(el), icon=folium.Icon(color='green')))
# fg.add_child(folium.Marker(location=[lt,ln], popup="Elevation: "+str(el)+" m", icon=folium.Icon(color='green'))) # or we can add even more text
# in case there are quotes (') in the popup string, we might get a blank webpage. To change this we need to use another parameter for popup
# popup = folium.Popup(str(el), parse_html=True)
# fg.add_child(folium.Marker(location=[lt,ln], popup=popup, icon=folium.Icon(color='green')))
# focus on icons
# change their color to signify the elevation range (green = 0-2000m, orange = 2000-3000 m, red = +3000 m)
# we can create a function to do this for us !!! see the function definition up
#fg.add_child(folium.Marker(location=[lt,ln], popup=str(el), icon=folium.Icon(color=color_prod(el))))
# change the marker to a circle
fg.add_child(folium.CircleMarker(location=[lt,ln], popup=str(el),radius=6, fill=True, fill_color=color_prod(el), color='grey', fill_opacity=0.7))
# add another layer to the map - a polygon layer (1st is the map, 2nd is the markers (point layer), and we can have also line layers to signal roads or rivers for example)
fg.add_child(folium.GeoJson(data=open('world.json', 'r', encoding='utf-8-sig').read()))
# add color-based polygon featuers
# we will show the population of each country by different color (in ranges)
fg.add_child(folium.GeoJson(data=open('world.json', 'r', encoding='utf-8-sig').read(), style_function=lambda x: {'fillColor':'yellow'})) #this will make all polygons filled with yellow
fg.add_child(folium.GeoJson(data=open('world.json', 'r', encoding='utf-8-sig').read(),
style_function=lambda x: {'fillColor':'green' if x['properties']['POP2005'] < 10000000
else 'orange' if 10000000 <= x['properties']['POP2005'] < 20000000 else 'red'}))
# x is mapped to features inside the json file by GeoJson, and actually the method will loop through all of them to find the properties-pop2005 values
# adding a layer control panel (turn on and off the layers (except the base map))
map.add_child(folium.LayerControl()) #basic control (controls all layers at once because we added just one child to the map - the feature group, but the group contains 2 layers)
# solution would be to create feature groups for each layer or group of layers that you want to have separate
map.save("Map1.html") # save the map to html
|
cb0847a0abcf8a256c51c110ce61ea8eb6743f56 | Alex-Dumitru/python | /APPS/gui_and_db/kg_conv.py | 1,052 | 4.0625 | 4 | import tkinter as tk
# create the window object
window = tk.Tk()
# define the function
def kg_conv():
grams = float(e1_value.get()) * 1000 # convert kg to grams
pounds = float(e1_value.get()) * 2.20462 # convert kg to pounds
ounces = float(e1_value.get()) * 35.274 # convert kg to ounces
# insert the values in respective fields
t1.insert(tk.END,grams)
t2.insert(tk.END,pounds)
t3.insert(tk.END,ounces)
# Create the button
b1 = tk.Button(window, text='Convert', command=kg_conv)
b1.grid(row=0, column=3)
# Create the entry text field
e1_value = tk.StringVar()
e1 = tk.Entry(window, textvariable=e1_value)
e1.grid(row=0, column=2)
# Create the text widgets to display the results
t1 = tk.Text(window, height=1, width=20)
t1.grid(row=1,column=1)
t2 = tk.Text(window, height=1, width=20)
t2.grid(row=1,column=2)
t3 = tk.Text(window, height=1, width=20)
t3.grid(row=1,column=3)
# Create a label to display input data type
l1 = tk.Label(window, justify='center', text='KG')
l1.grid(row=0, column=0)
window.mainloop()
|
8d576d97f8aa4c97e8552e974bcedab81f504f3b | indigowhale33/COMS-4995 | /task3/task3.py | 842 | 3.578125 | 4 | from __future__ import print_function, division
import numpy as np
def MSD(nparr, ax=0):
"""
Calculate mean and standard deviation of numpy array by axis
Parameters
----------
- **Parameters**::
nparr : array_like
Array containing numbers
ax : int, optional (default=0)
Axis along which means and standard deviations are computed.
Returns
-------
- **Returns**::
m,std : tuple
tuple of mean and standard deviation of the input array in terms of the axis.
Raises
------
- **Raises**::
ValueError
if the given axis is not None or not 0 or 1.
"""
if(ax != None):
try:
val = int(ax)
except ValueError:
print("axis should be integer")
if( ax < 0 or ax > 1):
raise ValueError("axis should be between 0 to 1")
return np.mean(nparr,axis=ax), np.std(nparr,axis=ax)
MSD(np.array([[1,2],[3,4]]))
|
09fe6ea10b609f2ee63a8f089f44f404b57be93b | mkumar-gt/t1 | /t4i.py | 464 | 3.859375 | 4 | Num_of_Numbers = 5
num_list = []
def main():
for i in range(Num_of_Numbers):
userInput = int(input("please enter number: "))
num_list.append(userInput)
info()
def find_lowest(anything):
lowestNumber = min(anything)
return lowestNumber
def totalN(anything):
total = 0
for i in anything:
total += i
return total
def info():
print("The lowest number is: ", str(find_lowest(num_list)))
print("The total is: ", str(totalN(num_list)))
main() |
70ce7118d3b24c724eb22a295dc82dae9770e511 | Dinesh-Sivanandam/HackerRank-Solutions | /sWAP_cASE.py | 459 | 4.03125 | 4 | def swap_case(S):
import string
lower = string.ascii_lowercase
upper = string.ascii_uppercase
T = []
for i in range(len(S)):
if S[i] in lower:
T.append(S[i].upper())
elif S[i] in upper:
T.append(S[i].lower())
else:
T.append(S[i])
return (''.join(T))
if __name__ == '__main__':
s = input()
result = swap_case(s)
print (result)
|
e32e0bfa71eb66314bf38711126c8d5bf6662360 | phyllis-jia/note-for-python | /generator.py | 341 | 3.546875 | 4 | ##normal
def squares(N):
res=[]
for i in range(N):
res.append(i*i)
return res
for item in squares(9):
print(item)
##generator
def gensquares(N):
for i in range(N):
yield i**2
for item in gensquares(9):
print(item)
##generator has less code than normal way. Lazy evaluation makes computer run better. |
31b8704fbe6fef8de2c1d07e0d963ff053de66d4 | chapman-cs510-2017f/cw-05-seongandkynan | /cplane.py | 5,555 | 3.84375 | 4 | #!/usr/bin/env python3
import abscplane
""" The module includes a new class ListComplexPlane that subclasses the abstract base class AbsComplexPlane which is imported from the abscplane.py module.
"""
class ListComplexPlane(abscplane.AbsComplexPlane):
""" This class implements the complex plane with given attributes.
It uses a list comprehension to represent the 2D grid needed to store
the complex plane. The complex plane is a 2D grid of complex numbers,
having the form (x + y*1j), where 1j is the unit imaginary number in
Python, and one can think of x and y as the coordinates for the horizontal
axis and the vertical axis of the plane respectively. All attributes will
be set during the __init__ constructor, and initialize the plane immediately
upon class instantiation.
Methods:
__create_plane : a private method that creates or refreshs plane
refresh : regenerate plane
apply : apply a given function f
zoom : transform planes going through all functions lists
"""
def __init__(self, xmin=-4,xmax=4,xlen=8,ymin=-4,ymax=4,ylen=8):
"""all attributes will be automatically set when the class becomes
instantiated.
Attributes:
xmax (float) : maximum horizontal axis value
xmin (float) : minimum horizontal axis value
xlen (int) : number of horizontal points
ymax (float) : maximum vertical axis value
ymin (float) : minimum vertical axis value
xunit (int) : grid unit value of x axis
yunit (int) : grid unit value of y axis
ylen (int) : number of vertical points
plane : a list of stored complex plane
fs (list[function]) : function sequence to transform plane
"""
self.xmin = xmin
self.xmax = xmax
self.xlen = xlen
self.ymin = ymin
self.ymax = ymax
self.ylen = ylen
self.xunit = (self.xmax - self.xmin) / self.xlen
self.yunit = (self.ymax - self.ymin) / self.ylen
# See the implementation details of creating a complex plane below
# in _create_plane function.
self.plane = []
self._create_plane()
# store a list of functions that are being applied
# in order to each point of the complex plane, initially empty
self.fs = []
def _create_plane(self):
"""This ia a private method to create a list of complex plane
at the time of class initiation with the default attributes
(xmax, xmin, xlen, ymax, ymin,ylen). The method self.refresh also uses
this private method to refresh each point in comlext planes using
the stored attributes.
Returns:
a list of complex plane
"""
self.plane = [[(self.xmin + x*self.xunit) + (self.ymin + y*self.yunit)*1j for x in range(self.xlen+1)] for y in range(self.ylen+1)]
def refresh(self):
"""Regenerate complex plane.
Populate self.plane with new points (x + y*1j), using
the stored attributes of xmax, xmin, xlen, ymax, ymin,
and ylen to set plane dimensions and resolution. Reset
the attribute fs to an empty list so that no functions
are transforming the fresh plane.
"""
self._create_plane()
self.fs = []
def apply(self, f):
"""Add the function f as the last element of self.fs.
Apply f to every point of the plane, so that the resulting
value of self.plane is the final output of the sequence of
transformations collected in the list self.fs.
"""
self.fs.append(f)
self.plane = [[f(self.plane[x][y]) for x in range(self.xlen+1)] for y in range(self.ylen+1)]
def zoom(self,xmin,xmax,xlen,ymin,ymax,ylen):
"""Reset self.xmin, self.xmax, and self.xlen.
Also reset self.ymin, self.ymax, and self.ylen.
Regenerate the plane with the new range of the x- and y-axes,
then apply all transformations in fs in the correct order to
the new points so that the resulting value of self.plane is the
final output of the sequence of transformations collected in
the list self.fs.
Attributes:
xmax (float) : maximum horizontal axis value
xmin (float) : minimum horizontal axis value
xlen (int) : number of horizontal points
ymax (float) : maximum vertical axis value
ymin (float) : minimum vertical axis value
xunit (int) : grid unit value of x axis
yunit (int) : grid unit value of y axis
ylen (int) : number of vertical points
plane : a list of stored complex plane
fs (list[function]) : function sequence to transform plane
"""
self.xmin = xmin
self.xmax = xmax
self.xlen = xlen
self.ymin = ymin
self.ymax = ymax
self.ylen = ylen
self.xunit = (self.xmax - self.xmin) / self.xlen
self.yunit = (self.ymax - self.ymin) / self.ylen
self._create_plane()
for i, f in enumerate(self.fs):
print("running the function "+str(i+1))
self.plane = [[f(self.plane[x][y]) for x in range(self.xlen+1)] for y in range(self.ylen+1)]
def main():
cplane = ListComplexPlane()
print(cplane.plane)
if __name__ == "__main__":
main()
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.