Dataset Viewer
Auto-converted to Parquet Duplicate
prompt
stringlengths
189
761
answer
stringclasses
2 values
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCc1c(C)oc2c(C)c3oc(=O)cc(C)c3cc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c2ccccc2n[c-](CSCCC(C)C)[n+]1=O
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(NCC(C#N)C#N)ccc1N=Nc1ccc([N+](=O)[O-])cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCN(C=O)CCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccccc1NC(=O)C1C(=O)N(c2ccccc2C)C(=O)C1=NNC(N)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(N=NC2=C3Sc4ccccc4N=C2N(c2ccc(Br)cc2)C(=S)N3c2ccc(Cl)cc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2c(O)c3cccc(-c4ccccc4)c3oc2=O)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1NC(NN=Cc2ccccc2)=NC1=Cc1ccc(Cl)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)N1CNC(=O)C12CCN(CC1COc3ccccc3O1)CC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#Cc1c(N)n(-c2nc3ccccc3s2)c(=O)c2cc([N+](=O)[O-])ccc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)CNCC(C)(O)C(=O)NC(C)(C)CNCC(C)(O)C(=O)N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)Cc1sc(=O)[nH]c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NP(N)(=O)Nc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=C1NC=CC(S)N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1ccccc1S(=O)c1ccccc1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)CC(=O)NC=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)Cc1cc(C(=O)C=Cc2ccc(Br)cc2)cc(CN(C)C)c1O.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#Cc1c(N)c2c(c(-c3ccccc3)c1-c1ccccc1)C(=O)N(NC(=O)c1ccccc1)C2=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1nc[nH]c1S
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C(=Cc1ccccc1)CC(C)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CNC(C)C(NC)c1ccccc1.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(=Cc2ccc(Cl)cc2)CNCC1=Cc1ccc(Cl)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=CC(=C1C=Cc2cc([N+](=O)[O-])ccc2S1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1ccc(C2OC3(CCCC4CC43)OC2c2ccccc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)OC(=O)[N+](=[N-])C(=O)C1CCC(=O)N1C(=O)OCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(-c2[nH]c(C(=O)O)cc2I)on1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C=CSC(C)(C)C(N)C(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(OCCN1CCCC12CCCCC2)C(c1ccccc1)C1CCCC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: OC(C=Cc1ccccc1)Cc1nc2ccccc2[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(c1nsc(Cl)c1Cl)N1CCCCC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCCCC1CCCNC1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CC1CCCC1=NO
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(S(=O)(=O)O)cc1-n1nc(C(=O)Nc2ccccc2)n[n+]1-c1cc(S(=O)(O)=[OH+])ccc1OC.[NaH]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)Oc1c(C(C)C)cc2c(c1OC(C)=O)CC1(C)OC(=O)CC(C)(C)C1=CC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C(C(=NN)C(=O)Nc1cccc(O)c1)c1nc2ccccc2nc1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccccc1N1C(=O)N[N+](C)(C)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S(=O)(O)SCNCNCCSCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=C(C(=O)N(C(C)C)C(C)C)CC(C(=O)N(C(C)C)C(C)C)=C(C)N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Clc1ccccc1C=NCC1CCC(CN=Cc2ccccc2Cl)CC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1OC2(OC2c2ccc(Cl)cc2)c2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(Cc1ccccc1)NN1C(=O)C(Cl)C1c1ccccc1Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1CCC2(OC1)OC1CC3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(O)C7O)C(O)C6OC6OC(C)C(O)C(O)C6O)C(O)CC5(C)C4CCC3(C)C1C2C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1cc([N+](=O)[O-])c(C=Cc2ccc(Cl)c(Cl)c2)cc1C=Cc1ccc(Cl)c(Cl)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1ncnc2c1S(=O)(=O)NCN2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C1Cc2cc3c(cc2C1=O)CCCC3
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CS(=O)(=O)c1cc([N+](=O)[O-])c(C(N)=O)cc1N(CCCl)CCCl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NC(=S)NN=Cc1c(O)nc2ccc(Cl)cc2c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccccc1C=C1NC(=S)N(C=C2C(=O)Oc3ccccc3C2=O)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C(=Cc1ccccc1)C[PH](c1ccccc1)(c1ccccc1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1oc2ccccc2c(O)c1C(c1cnc2ccccc2c1)c1c(O)c2ccccc2oc1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)CCC(=O)CC(=O)C(=O)Nc1ccc(F)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1csc(-c2ccc(-c3ccc(-c4cccs4)s3)s2)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(O)nc(NNC(C#N)c2ccccc2O)n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(=Cc2c(-c3ccccc3)nn(-c3ccccc3)c2O)C(c2ccccc2)=NN1c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCSc1c2ccccc2nc2c(OC)ccc(OC)c12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1sc2ccccc2n1CCSSCCn1c(=O)sc2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)c2ccccc2-c2nc3ccccc3c3c2C1OC3=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(Nc2nc3cc(C(F)(F)F)ccc3nc2C)cc(OC)c1OC.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOc1ccc2nc(NC(=O)C(=O)C(C(=O)c3ccccc3F)C3OC(=O)c4ccccc43)sc2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1ccc2nc(NCCSSCCNc3cnc4ccccc4n3)cnc2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CCC(=O)Nc1ccccc1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(c1ccsc1)C(C(=O)OCC)c1cccs1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCc1cccc(C(C)C)c1NC(=O)C(=O)CC(=O)c1sc(Nc2c(CC)cccc2C(C)(C)C)nc1C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)C1NC(=O)c2ccccc2S1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CSCCC(N)P(C)(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CSc1nnc(Cc2ccccc2)o1)Nc1ccc(Cl)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)OCC1OC(Nc2nc(O)nc(O)c2N=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N=c1ccn(C2CSC(CO)CO2)c(=O)[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)OC1CCN(Cc2ccccc2)CC1CN(C(C)=O)C12CC3CC(CC(C3)C1)C2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(Oc3ccc(N4C(=O)c5ccc(C(=O)O)cc5C4=O)cc3)cc1)C2=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)C(=Cc1cccc(C#N)c1)C(C)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCN(CC)CCOC(=O)C(c1ccccc1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)CN(CC(=O)O)C(C(=O)O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(NC(=O)CC2SC(Nc3ccccc3C)=NC2=O)c([N+](=O)[O-])c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=C1c2cc(Cl)ccc2N=C(NC2CCCC2)C2CSCN12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCCN(C=O)CCCC(=CCCCC)[Si](C)(C)C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=C1C(OC(=O)C(C)C)C(O)C(=O)C(C)(C)C=CC(C)C(=O)C2(O)CC(C)C(OC(=O)CC)C2C1OC(=O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)NC(=S)NN=Cc1ccccn1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=CC(=O)C(=CNC(=S)Nc2ccccc2)C(=O)O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(Nc1ccn(CCOC(=O)c2ccccc2)c(=O)n1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(S(=O)(=O)N2CC2CCCCC=O)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(Cl)ccc1NC(=O)CCCC(=O)C1CCCC1=NNC(=O)CC#N
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1CCn2c(Br)ccc2C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)CC(C#N)(CC(=O)OCC)C(=O)OCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)C1=CC(CCC(=O)Nc2ccccc2[N+](=O)[O-])=NC(S)N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(SC(C)C(=O)NN=Cc1c[nH]c2ccccc12)C(=O)NN=Cc1c[nH]c2ccccc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2cnc3c4cc(OC(C)C)c(OC)cc4ccc3c2cc1OC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(NC(=S)NC=C(c2ccccc2)S(=O)Cc2ccccc2)c(C)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(C#N)=Cc1ccc(Cl)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)NNC(=S)NP(=O)(NC(=S)NNC(=O)OCC)NC(=S)NNC(=O)OCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CSc1nc(O)c2[nH]c(=N)n(C3OCC(O)C(O)C3O)c2n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)c1ccc2cc(O)c(O)cc2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc2nc3cc(Cl)ccc3c(Sc3ccc(NC(C)=O)cc3)c2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCC12CCC(O)C1(C)CCC(=O)C2=NN
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1c2ccccc2nc2ccc(C(=O)Nc3ccc(S(N)(=O)=O)cc3)cc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=c1sc2ccccc2n1CN1CCCC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCc1cc2c(c3c1CCCC3=O)CC1(Cc3ccc(C(=O)OC)cc3C1)C2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1ccn(C2C=C(CO)C(O)C2O)c(=O)[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(C=Cc1ccc(Br)cc1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cl[Pt-2]1(Cl)NC2CCCC2N1
Yes
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
10