molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"COc1cc(C(=O)CO)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"COc1cc(C(=O)CO)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a flavoring agent that is... |
{
"smiles": [
"COc1cc(C(=O)CO)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a flavoring agent, savory... |
{
"smiles": [
"COc1cc(C(=O)CO)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is meaty, sulfur, and sa... |
{
"smiles": [
"COc1cc(C(=O)CO)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a flavoring agent that is savory and... |
{
"smiles": [
"CC1(C)COCN1C(=O)n1nnc2ncccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a faah inhi... |
{
"smiles": [
"CC1(C)COCN1C(=O)n1nnc2ncccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a faah i... |
{
"smiles": [
"CC1(C)COCN1C(=O)n1nnc2ncccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CC1(C)COCN1C(=O)n1nnc2ncccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a faah inhi... |
{
"smiles": [
"CC1(C)COCN1C(=O)n1nnc2ncccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a faah inhibitor.",
... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for ... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation. The mol... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholestero... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholester... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, athe... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts c... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat stora... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient and is part ... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage and a nut... |
{
"smiles": [
"CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a anti canc... |
{
"smiles": [
"CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti cancer class o... |
{
"smiles": [
"CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti cancer.",
... |
{
"smiles": [
"CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is anti cancer... |
{
"smiles": [
"CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti cancer clas... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizi... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis. The molecule is a chole... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts non-alcoholic fatty liv... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts tangier disease. The molecule is a proton... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase tha... |
{
"smiles": [
"CC(=CC=CN)Cc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts can... |
{
"smiles": [
"CC(=CC=CN)Cc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the cancer... |
{
"smiles": [
"CC(=CC=CN)Cc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "ass... |
{
"smiles": [
"CC(=CC=CN)Cc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
... |
{
"smiles": [
"CC(=CC=CN)Cc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cancer treatment.... |
{
"smiles": [
"COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a hcv inhibitor and is ... |
{
"smiles": [
"COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a hcv inhibitor and is an... |
{
"smiles": [
"COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a hcv ... |
{
"smiles": [
"COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a hcv inhibitor and belon... |
{
"smiles": [
"COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a hcv in... |
{
"smiles": [
"C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "Hazardous decomposition pro... |
{
"smiles": [
"C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "Hazardou... |
{
"smiles": [
"C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "Hazardou... |
{
"smiles": [
"C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "Hazardou... |
{
"smiles": [
"C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "Hazardous decomposition pro... |
{
"smiles": [
"CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a anti fungal... |
{
"smiles": [
"CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a member of the anti ... |
{
"smiles": [
"CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti fungal that impacts hyperchol... |
{
"smiles": [
"CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a hyperc... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabil... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton tra... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitocho... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translo... |
{
"smiles": [
"COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti allergic agent... |
{
"smiles": [
"COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti allergic and b... |
{
"smiles": [
"COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is anti allergic and anti ... |
{
"smiles": [
"COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti a... |
{
"smiles": [
"COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti allergic member of the anti a... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It impacts thyroxine treatm... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat st... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, thyroxine... |
{
"smiles": [
"CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti bacterial.",
... |
{
"smiles": [
"CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti bacterial."... |
{
"smiles": [
"CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It belon... |
{
"smiles": [
"CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cyto... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cho... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondri... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxi... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient t... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts both metabolic syndrome... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that... |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts obesity. The molecule is a ene... |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts b... |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy... |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammato... |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, en... |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptos... |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton tr... |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizi... |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impac... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient ... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule i... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The mole... |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that im... |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a emulsifier, proton tr... |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a food addi... |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabili... |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a surfactan... |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a emulsifie... |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.