molecules
dict
messages
listlengths
3
3
{ "smiles": [ "COc1c(N(C)C)ccc(C)c1-c1c(C)ccc(N(C)C)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti oselective.", "role": "as...
{ "smiles": [ "COc1c(N(C)C)ccc(C)c1-c1c(C)ccc(N(C)C)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It belongs to ...
{ "smiles": [ "COc1c(N(C)C)ccc(C)c1-c1c(C)ccc(N(C)C)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti oselective.", ...
{ "smiles": [ "COc1c(N(C)C)ccc(C)c1-c1c(C)ccc(N(C)C)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti oselective.", "role": "as...
{ "smiles": [ "COc1c(N(C)C)ccc(C)c1-c1c(C)ccc(N(C)C)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrom...
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It impacts dia...
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholestero...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabil...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphor...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translo...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a choles...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholester...
{ "smiles": [ "Cc1cc(C(C)Nc2nccc(N3C(=O)OCC3C(C)C)n2)ncc1-c1ccnc(C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the cancer...
{ "smiles": [ "Cc1cc(C(C)Nc2nccc(N3C(=O)OCC3C(C)C)n2)ncc1-c1ccnc(C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the cancer treatment...
{ "smiles": [ "Cc1cc(C(C)Nc2nccc(N3C(=O)OCC3C(C)C)n2)ncc1-c1ccnc(C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cancer tr...
{ "smiles": [ "Cc1cc(C(C)Nc2nccc(N3C(=O)OCC3C(C)C)n2)ncc1-c1ccnc(C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a cancer treatment.", ...
{ "smiles": [ "Cc1cc(C(C)Nc2nccc(N3C(=O)OCC3C(C)C)n2)ncc1-c1ccnc(C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a cancer treatment.", ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocati...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "It impacts both aging and barth syndrome. The molecu...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis ...
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a fat stora...
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a fat storage that impact...
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrie...
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a fat storage that impa...
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It impacts both cardiovascu...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts aging. The molecule is a c...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "It impacts non-alcoholic fa...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cyto...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizin...
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cyto...
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a proton tr...
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It impacts aging. The molecule is a stabi...
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton...
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochr...
{ "smiles": [ "C=CCOC(=O)N1CCC(N2CC(C)N(S(C)(=O)=O)CC2Cc2ccc(Cl)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is asthma treat...
{ "smiles": [ "C=CCOC(=O)N1CCC(N2CC(C)N(S(C)(=O)=O)CC2Cc2ccc(Cl)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is asthma treatment and it i...
{ "smiles": [ "C=CCOC(=O)N1CCC(N2CC(C)N(S(C)(=O)=O)CC2Cc2ccc(Cl)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a member of the infla...
{ "smiles": [ "C=CCOC(=O)N1CCC(N2CC(C)N(S(C)(=O)=O)CC2Cc2ccc(Cl)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belon...
{ "smiles": [ "C=CCOC(=O)N1CCC(N2CC(C)N(S(C)(=O)=O)CC2Cc2ccc(Cl)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a inflammat...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing cytoch...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing mitochond...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis, proton trap ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a cholesterol transloca...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "It impacts both non-alcohol...
{ "smiles": [ "CCOC(=O)c1ccc(C(C)(C)C(=O)O)c(C(=O)c2ccccc2C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to both the gpr40 agoni...
{ "smiles": [ "CCOC(=O)c1ccc(C(C)(C)C(=O)O)c(C(=O)c2ccccc2C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a anti diabetic member ...
{ "smiles": [ "CCOC(=O)c1ccc(C(C)(C)C(=O)O)c(C(=O)c2ccccc2C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a anti diab...
{ "smiles": [ "CCOC(=O)c1ccc(C(C)(C)C(=O)O)c(C(=O)c2ccccc2C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a gpr40 ...
{ "smiles": [ "CCOC(=O)c1ccc(C(C)(C)C(=O)O)c(C(=O)c2ccccc2C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a anti d...
{ "smiles": [ "CCCc1ccc(-c2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)c(F)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is dielectr...
{ "smiles": [ "CCCc1ccc(-c2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)c(F)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is dielectric....
{ "smiles": [ "CCCc1ccc(-c2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)c(F)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is dielectric.", ...
{ "smiles": [ "CCCc1ccc(-c2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)c(F)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belon...
{ "smiles": [ "CCCc1ccc(-c2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)c(F)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a dielectric.", ...
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source and a membrane stabi...
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a fat storage and a mem...
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is both a energy source ...
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizin...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabil...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol tran...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholester...
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a membrane stabilizer...
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a fat storage and membr...
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a membrane stabili...
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient and energy s...
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a energy source that im...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts both cancer and pancreatit...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impac...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a thyrox...
{ "smiles": [ "CC(=O)C(CC=CCC(CC=O)C(C)C)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti hypertensive c...
{ "smiles": [ "CC(=O)C(CC=CCC(CC=O)C(C)C)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is anti hypertensive.", ...
{ "smiles": [ "CC(=O)C(CC=CCC(CC=O)C(C)C)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belon...
{ "smiles": [ "CC(=O)C(CC=CCC(CC=O)C(C)C)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti hypertensive class of molecul...
{ "smiles": [ "CC(=O)C(CC=CCC(CC=O)C(C)C)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is anti hypert...
{ "smiles": [ "Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)sc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)sc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is light-emitt...
{ "smiles": [ "Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)sc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is light-emitti...
{ "smiles": [ "Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)sc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It belongs to ...
{ "smiles": [ "Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)sc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is light-emitt...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage that impacts both a...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source an...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient. ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy so...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a membrane stabilizer, ...