molecules
dict
messages
listlengths
3
3
{ "smiles": [ "CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It impacts both insulin resistance and ...
{ "smiles": [ "CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It impacts insulin resistance, cardiovasc...
{ "smiles": [ "CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrie...
{ "smiles": [ "CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "It impacts insulin resistance. The molecule is a nut...
{ "smiles": [ "CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "It impacts cardiovascular disease, insulin resistanc...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cyto...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitocho...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizin...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton tra...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structur...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and...
{ "smiles": [ "CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", ...
{ "smiles": [ "CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrie...
{ "smiles": [ "CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "ro...
{ "smiles": [ "CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient.", "role":...
{ "smiles": [ "CC(=O)c1c(O)cc(O)c(C2OC(COC(=O)c3cc(O)c(O)c(O)c3)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)c1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CC(=O)c1c(O)cc(O)c(C2OC(COC(=O)c3cc(O)c(O)c(O)c3)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)c1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient.", "role...
{ "smiles": [ "CC(=O)c1c(O)cc(O)c(C2OC(COC(=O)c3cc(O)c(O)c(O)c3)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)c1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient.", "role...
{ "smiles": [ "CC(=O)c1c(O)cc(O)c(C2OC(COC(=O)c3cc(O)c(O)c(O)c3)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)c1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant...
{ "smiles": [ "CC(=O)c1c(O)cc(O)c(C2OC(COC(=O)c3cc(O)c(O)c(O)c3)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)c1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient."...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabil...
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, a proton...
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrition...
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a food additive, stabiliz...
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholester...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochr...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidati...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondri...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis, a cholestero...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It impacts both diabetic heart disease ...
{ "smiles": [ "COc1cc2c(-c3cc4c(CC(CN)c5cccs5)ccnc4[nH]3)cn(C)c2cc1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a kinase inhibitor.", ...
{ "smiles": [ "COc1cc2c(-c3cc4c(CC(CN)c5cccs5)ccnc4[nH]3)cn(C)c2cc1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "COc1cc2c(-c3cc4c(CC(CN)c5cccs5)ccnc4[nH]3)cn(C)c2cc1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a kinase in...
{ "smiles": [ "COc1cc2c(-c3cc4c(CC(CN)c5cccs5)ccnc4[nH]3)cn(C)c2cc1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "COc1cc2c(-c3cc4c(CC(CN)c5cccs5)ccnc4[nH]3)cn(C)c2cc1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a kinase inhibitor.", "role": "a...
{ "smiles": [ "Cn1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts pain treatment.",...
{ "smiles": [ "Cn1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the pain t...
{ "smiles": [ "Cn1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the pain treatment clas...
{ "smiles": [ "Cn1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the pain treatment clas...
{ "smiles": [ "Cn1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It impacts pain treatment.", "role": ...
{ "smiles": [ "Cc1ccc(-c2ccc(CCc3ccc(-c4ccccc4)c(F)c3F)cc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a member of...
{ "smiles": [ "Cc1ccc(-c2ccc(CCc3ccc(-c4ccccc4)c(F)c3F)cc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "Cc1ccc(-c2ccc(CCc3ccc(-c4ccccc4)c(F)c3F)cc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "Cc1ccc(-c2ccc(CCc3ccc(-c4ccccc4)c(F)c3F)cc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a dielectric that impac...
{ "smiles": [ "Cc1ccc(-c2ccc(CCc3ccc(-c4ccccc4)c(F)c3F)cc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is dielectric and it ...
{ "smiles": [ "CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is light-emitting.", "...
{ "smiles": [ "CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is light-emitting.", "role": "assis...
{ "smiles": [ "CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is light-emitting.", "...
{ "smiles": [ "CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the light-emit...
{ "smiles": [ "CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belon...
{ "smiles": [ "COC(=O)C(CC(C)C)NC(=O)c1cc2ccccc2cc1NC(=O)Nc1c(C)cc(C)cc1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It impacts diabetes treatment.", "r...
{ "smiles": [ "COC(=O)C(CC(C)C)NC(=O)c1cc2ccccc2cc1NC(=O)Nc1c(C)cc(C)cc1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It impacts dia...
{ "smiles": [ "COC(=O)C(CC(C)C)NC(=O)c1cc2ccccc2cc1NC(=O)Nc1c(C)cc(C)cc1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a diabetes treatment....
{ "smiles": [ "COC(=O)C(CC(C)C)NC(=O)c1cc2ccccc2cc1NC(=O)Nc1c(C)cc(C)cc1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It belongs to ...
{ "smiles": [ "COC(=O)C(CC(C)C)NC(=O)c1cc2ccccc2cc1NC(=O)Nc1c(C)cc(C)cc1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is diabetes treatment.",...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, cholesterol translocati...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a pr...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a choles...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "Cc1cc(OCCC(C)O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the gpr40 agonist cl...
{ "smiles": [ "Cc1cc(OCCC(C)O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It belongs to ...
{ "smiles": [ "Cc1cc(OCCC(C)O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the gpr40 agon...
{ "smiles": [ "Cc1cc(OCCC(C)O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the gpr40 ago...
{ "smiles": [ "Cc1cc(OCCC(C)O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a gpr40 agonist.", "role": "assi...
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxi...
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabili...
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis...
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrom...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy so...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a inflammatory. The molec...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient belonging to the thyroxin...
{ "smiles": [ "COC1C=C2C(CCC(OC3OCC(O)C(O)C3O)C2(C)C)C2(C)CCC3(C)C(C(C)CCC=C(C)C)C(OC4OC(COC(C)=O)C(OC(C)=O)C(O)C4O)CC3(C)C12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a surfac...
{ "smiles": [ "COC1C=C2C(CCC(OC3OCC(O)C(O)C3O)C2(C)C)C2(C)CCC3(C)C(C(C)CCC=C(C)C)C(OC4OC(COC(C)=O)C(OC(C)=O)C(O)C4O)CC3(C)C12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a surfactant, nutrient, e...
{ "smiles": [ "COC1C=C2C(CCC(OC3OCC(O)C(O)C3O)C2(C)C)C2(C)CCC3(C)C(C(C)CCC=C(C)C)C(OC4OC(COC(C)=O)C(OC(C)=O)C(O)C4O)CC3(C)C12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "COC1C=C2C(CCC(OC3OCC(O)C(O)C3O)C2(C)C)C2(C)CCC3(C)C(C(C)CCC=C(C)C)C(OC4OC(COC(C)=O)C(OC(C)=O)C(O)C4O)CC3(C)C12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a energy storage, surfa...
{ "smiles": [ "COC1C=C2C(CCC(OC3OCC(O)C(O)C3O)C2(C)C)C2(C)CCC3(C)C(C(C)CCC=C(C)C)C(OC4OC(COC(C)=O)C(OC(C)=O)C(O)C4O)CC3(C)C12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a membrane stabilizer, ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storag...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a inflammato...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient and thyroxine treatment, ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "Cc1ccc2oc(CN)cc2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is anti bac...
{ "smiles": [ "Cc1ccc2oc(CN)cc2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a anti biot...
{ "smiles": [ "Cc1ccc2oc(CN)cc2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is anti biotic and anti bact...
{ "smiles": [ "Cc1ccc2oc(CN)cc2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is anti biotic...
{ "smiles": [ "Cc1ccc2oc(CN)cc2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a anti b...