molecules
dict
messages
listlengths
3
3
{ "smiles": [ "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It impacts cancer treatm...
{ "smiles": [ "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cancer tr...
{ "smiles": [ "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cancer...
{ "smiles": [ "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It belongs to the cancer treatment class ...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a inflammatory and fa...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storage and energy storage, an...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a fat st...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a membrane ...
{ "smiles": [ "Cl.NNc1nncc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule has Odorless.", "role": "assistant"...
{ "smiles": [ "Cl.NNc1nncc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule has Odorless.", "role"...
{ "smiles": [ "Cl.NNc1nncc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule has Odorless."...
{ "smiles": [ "Cl.NNc1nncc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule has Odorless.",...
{ "smiles": [ "Cl.NNc1nncc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule has Odorless.", "role": ...
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrie...
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that im...
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that im...
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impac...
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphor...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizin...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a choles...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochr...
{ "smiles": [ "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a anti alle...
{ "smiles": [ "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is both a asth...
{ "smiles": [ "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It belongs to both the asthma treatment a...
{ "smiles": [ "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is both a asthma treatme...
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "It influences breast cancer...
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrie...
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient ...
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and chole...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mito...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It impacts aging. The molecule is a proto...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It impacts agi...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It impacts barth syndrome. ...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabil...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a proton tr...
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a cholesterol transloca...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxi...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis,...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is both a cholesterol...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholester...
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton tra...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidati...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis and a stabi...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabili...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a choles...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "O=C(O)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "Thermal ...
{ "smiles": [ "O=C(O)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "Thermal decomposition pr...
{ "smiles": [ "O=C(O)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "Thermal decomposition products include ca...
{ "smiles": [ "O=C(O)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "Thermal decomposition products include ca...
{ "smiles": [ "O=C(O)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "Thermal decomposition produ...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizi...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizin...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase tha...
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a proton tr...
{ "smiles": [ "NC1(Cc2ccccc2)NC(=O)NC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a anti infl...
{ "smiles": [ "NC1(Cc2ccccc2)NC(=O)NC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is both a anti allergic an...
{ "smiles": [ "NC1(Cc2ccccc2)NC(=O)NC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti allergic an...
{ "smiles": [ "NC1(Cc2ccccc2)NC(=O)NC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti infla...
{ "smiles": [ "NC1(Cc2ccccc2)NC(=O)NC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to both the anti allergic ...
{ "smiles": [ "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy...
{ "smiles": [ "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source, a...
{ "smiles": [ "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source, membrane stabilizer...
{ "smiles": [ "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy so...
{ "smiles": [ "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a liquid cry...
{ "smiles": [ "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the liquid crystal clas...
{ "smiles": [ "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a liquid crystal.", ...
{ "smiles": [ "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a liquid crystal.", ...
{ "smiles": [ "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is both a jak ...
{ "smiles": [ "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a prot...
{ "smiles": [ "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is both a protein kinase i...
{ "smiles": [ "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a p...
{ "smiles": [ "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is both a protein kinase inhibitor and ...
{ "smiles": [ "C=C(OCC)c1cn(C)nc1N1CCOCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a rsv inhibitor.",...
{ "smiles": [ "C=C(OCC)c1cn(C)nc1N1CCOCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a rsv inhib...
{ "smiles": [ "C=C(OCC)c1cn(C)nc1N1CCOCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "C=C(OCC)c1cn(C)nc1N1CCOCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a rsv inhibitor.", ...
{ "smiles": [ "C=C(OCC)c1cn(C)nc1N1CCOCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy so...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The mole...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a surfactan...
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule i...
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts both parkinson's disease a...
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that im...
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient ...
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that impacts a...
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient. It impacts ...