Mol-LLaMA SFT
Collection
RCR_RP: Reagents Prediction; RCR_CP: Catalyst Prediction; RCR_SP: Solvent Prediction; HTE_RAS: Reagent Selection • 17 items • Updated
instruction stringlengths 39 871 | input stringclasses 1 value | output stringlengths 2 23 |
|---|---|---|
Can you tell me the molecular formula of CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 ? | C23H30ClN3O | |
Please provide the molecular formula for NOCC(=O)O . | C2H5NO3 | |
CN1CCCC1c1ccc[n+](C)c1 is the representation of a molecule. What is its molecular formula? | C11H17N2+ | |
Can you tell me the molecular formula of CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO ? | C40H66O | |
What is the formula of the molecule CCCCCCCCCCCC(O)CC(=O)OC1C(N)C(OP(=O)(O)OP(=O)(O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)OC(CO)C1O ? | C29H51N3O18P2 | |
What is the molecular formula of CCN(CC)CCCCNc1ncc2cc(-c3cc(OC)cc(OC)c3)c(NC(=O)NC(C)(C)C)nc2n1 ? | C28H41N7O3 | |
Please provide the molecular formula for Cc1ccccc1-n1c(CF)nc2ccc(N)cc2c1=O . | C16H14FN3O | |
Please write the molecular formula of the molecule CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C . | C20H30 | |
COC(=O)C1CSC2(c3ccccc3)c3ccccc3C(=O)N12 is the representation of a molecule. What is its molecular formula? | C18H15NO3S | |
Considering the code CCC(C)C1NC(=O)C(c2cn(OC)c3ccccc23)NC(=O)C(CCCCCC(=O)OC)NC(=O)C2CCCCN2C1=O, can you determine the corresponding molecular formula? | C32H45N5O7 | |
What is the molecular formula for the molecule denoted by O=C(NNCS(=O)(=O)O)c1ccncc1 ? | C7H9N3O4S | |
What is the formula of the molecule C#CCOS(=O)OC1CCCCC1Oc1ccc(C(C)(C)C)cc1 ? | C19H26O4S | |
I'd like to know the molecular formula of COC1CC2CCC(C)C(O)(O2)C(=O)C(=O)N2CCCCC2C(=O)OC(C(C)CC2CCC(O)C(OC)C2)CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C1C . Can you tell me? | C51H79NO13 | |
Convert the representation of a molecule O=S(=O)(c1ccccc1)c1ccc(Cl)cc1 into molecular formula. | C12H9ClO2S | |
I'd like to know the molecular formula of c1ccc(-c2cnc(-c3ccccc3)o2)cc1 . Can you tell me? | C15H11NO | |
Convert the representation of a molecule Cc1nc2ccccc2s1 into molecular formula. | C8H7NS | |
What is the molecular formula for the molecule denoted by COP(=S)(OC)OC ? | C3H9O3PS | |
CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1 is the representation of a molecule. What is its molecular formula? | C11H14ClN5 | |
Convert the representation of a molecule O=C=NCC(F)(F)C(F)(F)C(F)(F)F into molecular formula. | C5H2F7NO | |
What is the molecular formula for the molecule denoted by CC(C)CS ? | C4H10S | |
What is the molecular formula for the molecule denoted by CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC ? | C32H66 | |
Please write the molecular formula of the molecule c1ccc2c(c1)Cc1ccccc1C2 . | C14H12 | |
What is the molecular formula for the molecule denoted by CCOC(=O)N(CC)N=O ? | C5H10N2O3 | |
I'd like to know the molecular formula of Oc1ccc(Br)cc1Br . Can you tell me? | C6H4Br2O | |
Given the representation O=c1cc[nH]cc1, what would be its molecular formula? | C5H5NO | |
What is the molecular formula of Cc1cc(Oc2c(I)cc(CCO)cc2I)cc(C)c1O ? | C16H16I2O3 | |
Can you tell me the molecular formula of CCC12COP(OC1)OC2 ? | C6H11O3P | |
Please write the molecular formula of the molecule CCCCCCCC(Cl)CC . | C10H21Cl | |
Considering the code CN(C(=S)Oc1ccc2ccccc2c1)c1cccc2ccccc12, can you determine the corresponding molecular formula? | C22H17NOS | |
Given the representation Cc1cc(C(=O)NNCc2ccccc2)on1, what would be its molecular formula? | C12H13N3O2 | |
Can you tell me the molecular formula of C[Si](Cl)(Cl)CCCC#N ? | C5H9Cl2NSi | |
The representation c1ccc(C(c2ccccc2)(c2ccccc2)N2CCOCC2)cc1 represents a specific molecule. Can you reveal its molecular formula? | C23H23NO | |
What is the molecular formula of C=C(CC)CCCC ? | C8H16 | |
What is the molecular formula for the molecule denoted by C=CC(=O)OC(C)(C)C ? | C7H12O2 | |
Convert the representation of a molecule NC(=O)Cn1c(=O)n(CC(N)=O)c(=O)n(CC(N)=O)c1=O into molecular formula. | C9H12N6O6 | |
N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl is the representation of a molecule. What is its molecular formula? | C8Cl4N2 | |
Please provide the molecular formula for CC(CCl)OC(=O)Nc1cccc(Cl)c1 . | C10H11Cl2NO2 | |
Can you give the molecular molecular formula of NC(=O)N[Hg]c1ccccc1 ? | C7H8HgN2O | |
Can you give the molecular molecular formula of Clc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 ? | C21H14ClN3 | |
What is the molecular formula for the molecule denoted by NC(CCN1CCCCCC1)=NO ? | C9H19N3O | |
What is the formula of the molecule CCOc1ccc(Oc2nc3ccccc3n2CCN(CC)CC)cc1 ? | C21H27N3O2 | |
Please provide the molecular formula for CC(=O)Oc1ccccc1Cl . | C8H7ClO2 | |
Please write the molecular formula of the molecule CC(Cc1c[nH]c2ccc(SCc3ccccc3)cc12)N(C)C . | C20H24N2S | |
Convert the representation of a molecule CCN(CC)CCN(c1ccccc1)C(C)C into molecular formula. | C15H26N2 | |
Given the representation CCOC(=O)N(CCCl)N=O, what would be its molecular formula? | C5H9ClN2O3 | |
What is the formula of the molecule Cl[Fe]Cl ? | Cl2Fe | |
What is the molecular formula of COC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1 ? | C16H16N2O4 | |
What is the molecular formula of Oc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc(OCCN2CCCCC2)cc1 ? | C29H31NO2 | |
What is the molecular formula of CC(=O)c1ccc(NC2OC(CO)C(O)C(O)C2O)cc1 ? | C14H19NO6 | |
Please write the molecular formula of the molecule N#CC(C#N)=CC#Cc1ccccc1 . | C12H6N2 | |
What is the molecular formula of C=CCc1ccc(OC(=O)NC)c(OC)c1 ? | C12H15NO3 | |
Please write the molecular formula of the molecule COc1cc(N)ccc1OCCCCCc1ccccc1 . | C18H23NO2 | |
Can you tell me the molecular formula of CC(C)C(=O)OCC(C)(C)C(OC(=O)c1ccccc1C(=O)OCc1ccccc1)C(C)C ? | C27H34O6 | |
Convert the representation of a molecule CCOCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O into molecular formula. | C17H14O5 | |
What is the formula of the molecule COc1ccc2c(c1)OC(C)(C)C=C2 ? | C12H14O2 | |
Given the representation CCCCCCCCCCCCCCCCCCCC(=O)OCC, what would be its molecular formula? | C22H44O2 | |
Please provide the molecular formula for CCCC1COC(C(C)C)OC1 . | C10H20O2 | |
The representation CS(=O)(=O)OCCO represents a specific molecule. Can you reveal its molecular formula? | C3H8O4S | |
Please provide the molecular formula for CCOC(=O)C(C)(CCOC)C(=O)OCC . | C11H20O5 | |
Can you tell me the molecular formula of CCSCC(N)C(=O)O ? | C5H11NO2S | |
The representation CCCCCCCCC=O represents a specific molecule. Can you reveal its molecular formula? | C9H18O | |
What is the formula of the molecule COc1ccccc1N1CCN(C(=O)CC(c2ccccc2)c2ccc(Cl)cc2)CC1 ? | C26H27ClN2O2 | |
Can you give the molecular molecular formula of CNc1cccc2c(OC)c(OC)ccc12 ? | C13H15NO2 | |
Please write the molecular formula of the molecule CCCC[As](Sc1ccccc1)c1ccccc1 . | C16H19AsS | |
Please write the molecular formula of the molecule CCCN(CCC)c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 . | C11H14Cl6N4 | |
Considering the code CCCCC(=O)C=C(C)OC, can you determine the corresponding molecular formula? | C9H16O2 | |
What is the formula of the molecule CCN(CC)C(=O)CC(O)C(Cl)(Cl)Cl ? | C8H14Cl3NO2 | |
Please write the molecular formula of the molecule [N-]=[N+]=Cc1nc(N)nc(N)n1 . | C4H5N7 | |
CSC(SC)c1nc(C)nc(C(Cl)Cl)n1 is the representation of a molecule. What is its molecular formula? | C8H11Cl2N3S2 | |
Convert the representation of a molecule O=C(C=Cc1ccccc1)NCCCl into molecular formula. | C11H12ClNO | |
Can you give the molecular molecular formula of CCCCOc1nc(C)nc(C(Cl)(Cl)Cl)n1 ? | C9H12Cl3N3O | |
What is the molecular formula for the molecule denoted by C=C(C)CNCCc1c(C)[nH]c2ccc(OC)c(C)c12 ? | C17H24N2O | |
Please provide the molecular formula for COc1cc(C=CC(=O)N2CCCO2)cc(OC)c1OC . | C15H19NO5 | |
What is the molecular formula of Cc1cc(N(C)C)c2ncnc-2c2nc(N)n(C)c12 ? | C13H16N6 | |
What is the formula of the molecule O=C(c1ccccc1)N(O)CN1CCOCC1 ? | C12H16N2O3 | |
What is the molecular formula for the molecule denoted by Cc1cccc2c1C(=O)N(C)C(C)C2c1ccccc1 ? | C18H19NO | |
Please provide the molecular formula for CCC1(C)COC(=O)C1 . | C7H12O2 | |
Can you give the molecular molecular formula of CCOC(=O)C(CN1CCCCC1)(C(=O)OCC)c1ccccc1 ? | C19H27NO4 | |
Convert the representation of a molecule CC(C=O)=CC(C)(C)C into molecular formula. | C8H14O | |
CN(SN1CCOCC1)C(=O)Oc1cccc2c1OC(C)(C)C2 is the representation of a molecule. What is its molecular formula? | C16H22N2O4S | |
Please write the molecular formula of the molecule CCOC(=O)c1c(C)cc2c(CO)n[nH]c(=O)c2c1C . | C14H16N2O4 | |
Can you give the molecular molecular formula of CC1(C)C(=O)CCC2CC(=O)CCC21C ? | C13H20O2 | |
C#CCOC(C)n1ccc2ccccc21 is the representation of a molecule. What is its molecular formula? | C13H13NO | |
The representation Cc1cccc(OC(=O)N(C)N=O)c1 represents a specific molecule. Can you reveal its molecular formula? | C9H10N2O3 | |
Given the representation COc1ccc(C(=O)c2ccccc2)c(OC)c1CN1CCCCC1, what would be its molecular formula? | C21H25NO3 | |
What is the molecular formula for the molecule denoted by CC(C)NCC(=O)NCC(=O)N(C)c1ccc(Cl)cc1C(=O)c1ccccc1Cl ? | C21H23Cl2N3O3 | |
Convert the representation of a molecule CN1CCN(c2c(N)c(=O)oc3ccccc23)CC1 into molecular formula. | C14H17N3O2 | |
Can you tell me the molecular formula of O=C(O)C(Cl)(Cl)c1ccccc1 ? | C8H6Cl2O2 | |
What is the molecular formula of Oc1cccc(F)c1C=NCCN=Cc1c(O)cccc1F ? | C16H14F2N2O2 | |
Please write the molecular formula of the molecule O=C(NN=C1SCCS1)c1ccccc1 . | C10H10N2OS2 | |
Given the representation CCCCCCOc1ccc(NC(=O)OC(C)CN(CC)CC)c(C)c1, what would be its molecular formula? | C21H36N2O3 | |
Can you tell me the molecular formula of CN(C)C(=O)Oc1ccc([N+](C)(C)CCO)cc1 ? | C13H21N2O3+ | |
What is the molecular formula for the molecule denoted by CC(=O)N(C(C)=O)C(C)(C)C ? | C8H15NO2 | |
Please provide the molecular formula for CN(C)CC12CC3CC(CC(C3)C1Br)C2 . | C13H22BrN | |
I'd like to know the molecular formula of OC1C=Cc2cc3c4ccccc4c4ccccc4c3cc2C1O . Can you tell me? | C22H16O2 | |
Can you tell me the molecular formula of CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 ? | C26H23F2NO4 | |
Can you give the molecular molecular formula of COc1cccc(C[N+](C)(C)C)c1 ? | C11H18NO+ | |
I'd like to know the molecular formula of C=Cc1cc(Cl)c(Cl)c(Cl)c1Cl . Can you tell me? | C8H4Cl4 | |
Please write the molecular formula of the molecule COc1cc(C=NO)cc(I)c1O . | C8H8INO3 | |
Given the representation CC(Cc1cccc(C(F)(F)F)c1)NCCOC(=O)CCc1ccccc1, what would be its molecular formula? | C21H24F3NO2 |