Datasets:
ChemO release 1.0, included ICHO 2025 MAE Problems and Solutions, ChemO Dataset (well-constructed JSON files)
b7dd1a0
verified
| [ | |
| { | |
| "name": "IChO-2025_7", | |
| "background": { | |
| "context": "The petroleum industry plays an important role in the UAE economy. The oil called 'Dubai Crude' is a benchmark for global oil prices. Crude oil is a complex mixture of organic compounds, mainly hydrocarbons, along with smaller amounts of S, N, and O-containing compounds.\n\nThe hydrocarbon composition of oil is characterised by the PONA number. The abbreviation stands for $P$ - paraffins (alkanes), $O$ - olefins (alkenes), $N$ - naphthenes (cycloalkanes), and $A$ - aromatics (arenes). One method to determine the composition of oil is gas chromatography–mass spectrometry (GC–MS)." | |
| }, | |
| "points": 22 | |
| }, | |
| { | |
| "name": "IChO-2025_7.1", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "points": 8, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Below are mass spectra (electron impact ionisation, $I$ – relative intensity) of four hydrocarbons 1–4 of Dubai Crude oil. They include linear alkane P, linear alkene O (no cis–trans isomers), monosubstituted cycloalkane N, and arene A. 1'–4' are selected fragmentation products. Give the SMILES string** for each compound (1–4) and each main fragment (1'–4'). If you cannot determine 1–4, write letter code (P/O/N/A) and molecular formula. Hint: species $3'$ is formed by a McLafferty rearrangement.", | |
| "requirement": "Your response should list SMILES for 1, 2, 3, 4, 1', 2', 3', and 4'.", | |
| "images": [ | |
| "images/7/7.1_1.png", | |
| "images/7/7.1_2.png", | |
| "images/7/7.1_3.png", | |
| "images/7/7.1_4.png" | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "step": 1, | |
| "content": "1 = ethylcyclohexane, SMILES: CCC1CCCCC1, class N, formula C8H16", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 2, | |
| "content": "2 = n-octane, SMILES: CCCCCCCC, class P, formula C8H18", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 3, | |
| "content": "3 = 1-octene, SMILES: C=CCCCCCC, class O, formula C8H16", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 4, | |
| "content": "4 = ethylbenzene, SMILES: CCC1=CC=CC=C1, class A, formula C8H10", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 5, | |
| "content": "1' = cyclohexyl cation fragment, SMILES: C1CCC[CH+]C1, formula C6H11+", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 6, | |
| "content": "2' = propyl or isopropyl cation, SMILES: CC[CH2+], formula C3H7+", | |
| "alternative_smiles": "C[CH+]C", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 7, | |
| "content": "3' = allylic McLafferty fragment from oct-1-ene, SMILES: C=CCCC+, formula C4H7+", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 8, | |
| "content": "4' = benzyl/tropylium cation, SMILES: [CH2+]C1=CC=CC=C1, formula C7H7+", | |
| "alternative_smiles": "C1=CC=CC=C[CH+]1", | |
| "points": 1 | |
| } | |
| ], | |
| "grading": { | |
| "criteria": { | |
| "for_compounds_1_to_4": { | |
| "full": "1 pt per correct SMILES match.", | |
| "partial": [ | |
| { | |
| "condition": "SMILES incorrect but molecular formula correct.", | |
| "points": 0.25 | |
| }, | |
| { | |
| "condition": "Compound belongs to the same P/O/N/A class.", | |
| "points": 0.25 | |
| }, | |
| { | |
| "condition": "No SMILES provided but molecular formula given.", | |
| "points": 0.25 | |
| }, | |
| { | |
| "condition": "Only the correct class letter (P/O/N/A) provided.", | |
| "points": 0.25 | |
| } | |
| ] | |
| }, | |
| "for_fragments_1prime_to_4prime": { | |
| "full": "1 pt per correct SMILES fragment (including ion).", | |
| "partial": [ | |
| { | |
| "condition": "SMILES incorrect but molecular formula correct.", | |
| "points": 0.25 | |
| }, | |
| { | |
| "condition": "Charge (“+” or “·+”) is explicitly indicated even if structure incorrect.", | |
| "points": 0.25 | |
| } | |
| ] | |
| } | |
| } | |
| } | |
| }, | |
| { | |
| "name": "IChO-2025_7.2", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "points": 2, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Two mass spectra of branched alkanes 5 and 6 are shown. Give the SMILES of 5 and 6.", | |
| "images": [ | |
| "images/7/7.2_5.png", | |
| "images/7/7.2_6.png" | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "step": 1, | |
| "content": "5 = 2-methylbutane (isopentane). SMILES: CC(CC)C", | |
| "formula": "C5H12", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 2, | |
| "content": "6 = 2,2-dimethylpropane (neopentane). SMILES: CC(C)(C)C", | |
| "formula": "C5H12", | |
| "points": 1 | |
| } | |
| ], | |
| "grading": { | |
| "per_compound": { | |
| "5": { | |
| "full_credit": "1 pt for correct SMILES (any valid equivalent).", | |
| "partial_credit": [ | |
| { | |
| "condition": "Only the correct molecular formula (C5H12) is given.", | |
| "points": 0.5 | |
| } | |
| ] | |
| }, | |
| "6": { | |
| "full_credit": "1 pt for correct SMILES (any valid equivalent).", | |
| "partial_credit": [ | |
| { | |
| "condition": "Gives 2,2,3,3-tetramethylbutane instead of 2,2-dimethylpropane.", | |
| "points": 0.5 | |
| }, | |
| { | |
| "condition": "Only the correct molecular formula (C5H12) is given.", | |
| "points": 0.5 | |
| } | |
| ] | |
| } | |
| }, | |
| "special_case": "If the two structures (5 and 6) are swapped, award a TOTAL of 1 pt." | |
| } | |
| }, | |
| { | |
| "name": "IChO-2025_7.3", | |
| "modality": "text", | |
| "type": "Quantitative Calculation", | |
| "evaluation": "Numeric Verification", | |
| "points": 3, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "A $V = 115\\,\\mu\\mathrm{L}$ sample of Dubai Crude (density $\\rho = 871\\,\\mathrm{g\\,dm^{-3}}$) is completely burnt. The gases are passed through $\\mathrm{H_2O_2}$ with excess $\\mathrm{Ba(OH)_2}$ to form a white precipitate of mass $m = 1.395\\,\\mathrm{g}$. Upon acidification with $\\mathrm{HNO_3}$ the precipitate mass decreases by $98.95\\%$. Calculate the sulfur content $w(\\mathrm{S})$ (wt%)." | |
| }, | |
| "answer": [ | |
| { | |
| "step": 1, | |
| "content": "Only $\\mathrm{BaSO_4}$ remains after acidification. $n(\\mathrm{BaSO_4}) = (1 - 0.9895) \\times \\frac{1.395\\,\\mathrm{g}}{233.39\\,\\mathrm{g\\,mol^{-1}}} = 6.276 \\times 10^{-5}\\,\\mathrm{mol}$, hence $n(\\mathrm{S}) = 6.276 \\times 10^{-5}\\,\\mathrm{mol}$.", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 2, | |
| "content": "Mass of S in sample: $m(\\mathrm{S}) = n \\cdot M(\\mathrm{S}) = 6.276 \\times 10^{-5}\\,\\mathrm{mol} \\times 32.06\\,\\mathrm{g\\,mol^{-1}} = 2.01 \\times 10^{-3}\\,\\mathrm{g}$.", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 3, | |
| "content": "Sample mass: $m_{\\text{sample}} = 115 \\times 10^{-6}\\,\\mathrm{dm^3} \\times 871\\,\\mathrm{g\\,dm^{-3}} = 0.100\\,\\mathrm{g}$. Therefore $w(\\mathrm{S}) = 2.01\\%$ (sour oil).", | |
| "points": 1 | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_7.4", | |
| "modality": "multiple choice", | |
| "type": "Qualitative Identification", | |
| "evaluation": "Selection Check", | |
| "points": 1, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "In addition to sulfur, crude oil contains trace amounts of selenium, which transfers into the water used during refining. In aqueous solutions, selenium exists as $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$. The concentration of $\\mathrm{SeO_3^{2-}}$ can be determined chromatographically by its selective reaction with diamine **X** under acidic conditions, forming piazoselenol **Y**. This reaction is complete only at the right pH range. X and Y elute at different times (t) on the chromatogram shown below. The absorption spectra (1 mAbs corresponds to absorbance $A = 0.001$ ) of X and Y are also provided.", | |
| "images": [ | |
| "images/7/7.4_1.png", | |
| "images/7/7.4_1.png" | |
| ], | |
| "reaction_scheme": { | |
| "reactions": [ | |
| { | |
| "reactant_name": "X", | |
| "reactant_smiles": "NC1=CC=C(N)C(N)=C1", | |
| "conditions": [ | |
| { | |
| "step": 1, | |
| "reagents": [ | |
| "H2SeO3", | |
| "H+" | |
| ] | |
| } | |
| ], | |
| "product_name": "Y", | |
| "product_smiles": "O=[N+](C1=CC2=N[Se]N=C2C=C1)[O-]" | |
| } | |
| ] | |
| }, | |
| "question_text": "Choose the optimal wavelength $(\\lambda)$ for the absorbance measurements in the chromatogram.", | |
| "options": { | |
| "A": "270 nm", | |
| "B": "300 nm", | |
| "C": "350 nm", | |
| "D": "510 nm" | |
| } | |
| }, | |
| "answer": [ | |
| { | |
| "correct_option": "C", | |
| "content": "The optimal wavelength for absorbance measurements is **350 nm**, as both X and Y absorb the most light at this wavelength.", | |
| "points": 1 | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_7.5", | |
| "modality": "text", | |
| "type": "Quantitative Calculation", | |
| "evaluation": "Numeric Verification", | |
| "points": 8, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Acidified water from the refining process, containing $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ (solution 1), was analysed as follows. A $9.50~\\mathrm{mL}$ sample was mixed with $0.50~\\mathrm{mL}$ of an aqueous solution of X ($300~\\mu\\mathrm{M}$, excess) to form solution 2. The chromatographic peak areas (S) were measured for compounds X and Y, which are proportional to their concentrations. For a blank sample, $S(X) = 0.825$ mAbs·min. For known $\\mathrm{SeO_3^{2-}}$ concentrations, $S(Y) = 1.21 \\times c(\\mathrm{Se})$ (in µM). The ratios $S(X)/S(Y)$ measured at different pH values for four strong acids are given below (assume equilibrium):", | |
| "table": { | |
| "headers": [ | |
| "pH", | |
| "HNO3", | |
| "HCl", | |
| "HBr", | |
| "HI" | |
| ], | |
| "rows": [ | |
| [ | |
| "3.0", | |
| "1.523", | |
| "0.634", | |
| "0.523", | |
| "1.722" | |
| ], | |
| [ | |
| "2.0", | |
| "3.334", | |
| "0.538", | |
| "0.377", | |
| "2.223" | |
| ], | |
| [ | |
| "1.5", | |
| "5.454", | |
| "0.523", | |
| "0.368", | |
| "5.114" | |
| ], | |
| [ | |
| "1.0", | |
| "7.783", | |
| "0.523", | |
| "0.368", | |
| "8.123" | |
| ], | |
| [ | |
| "0", | |
| "10.232", | |
| "0.581", | |
| "0.399", | |
| "11.736" | |
| ], | |
| [ | |
| "-0.50", | |
| "13.450", | |
| "0.782", | |
| "0.546", | |
| "15.780" | |
| ] | |
| ] | |
| }, | |
| "question_text": "Calculate the concentrations of selenium species ($c_{0}(\\mathrm{SeO_3^{2-}})$, $c_{0}(\\mathrm{SeO_4^{2-}})$ in µM) in solution 1." | |
| }, | |
| "answer": [ | |
| { | |
| "step": 1, | |
| "content": "At high [H+] (HNO3), $\\mathrm{SeO_3^{2-}}$ is oxidised to $\\mathrm{SeO_4^{2-}}$, leading to a high $S(X)/S(Y)$ ratio (minimal formation of Y). Conversely, HI reduces $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ to Se, again giving high ratios. HCl and HBr give optimal conditions (1 pt).", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 2, | |
| "content": "From the blank: $S(X) = 0.825$ mAbs·min for $c(X) = 15.0~\\mu\\mathrm{M}$ (since $300~\\mu\\mathrm{M} \\times 0.50~\\mathrm{mL} / (9.50 + 0.50)~\\mathrm{mL} = 15.0~\\mu\\mathrm{M}$). Therefore, the proportionality constant $k = 0.825 / 15.0 = 0.0550~\\mathrm{mAbs·min·\\mu M^{-1}}$ (1 pt).", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 3, | |
| "content": "For HCl medium: total Se species $= 15.0~\\mu\\mathrm{M}$.\n$$[X]_{\\mathrm{HCl}} + [\\mathrm{SeO_3^{2-}}] = 15.0$$\n$$0.523 = 0.0550 [X]_{\\mathrm{HCl}} / (1.21 [\\mathrm{SeO_3^{2-}}])$$ (1 pt)", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 4, | |
| "content": "For HBr medium, both $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ are present:\n$$[X]_{\\mathrm{HBr}} + [\\mathrm{SeO_3^{2-}}] + [\\mathrm{SeO_4^{2-}}] = 15.0$$\n$$0.368 = 0.0550 [X]_{\\mathrm{HBr}} / (1.21([\\mathrm{SeO_3^{2-}}] + [\\mathrm{SeO_4^{2-}}]))$$ (1 pt)", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 5, | |
| "content": "Solving these simultaneous equations:\n$$[\\mathrm{SeO_3^{2-}}] = 1.20~\\mu\\mathrm{M}, \\quad [\\mathrm{SeO_4^{2-}}] = 0.45~\\mu\\mathrm{M}.$$ (1 pt)", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 6, | |
| "content": "Before dilution correction:\n$$c(\\mathrm{SeO_3^{2-}})_0 = 1.20~\\mu\\mathrm{M} \\times 10~\\mathrm{mL}/9.5~\\mathrm{mL} = 1.26~\\mu\\mathrm{M},$$\n$$c(\\mathrm{SeO_4^{2-}})_0 = 0.45~\\mu\\mathrm{M} \\times 10~\\mathrm{mL}/9.5~\\mathrm{mL} = 0.47~\\mu\\mathrm{M}.$$ (1 pt)", | |
| "points": 1 | |
| }, | |
| { | |
| "step": 7, | |
| "content": "Final result: $c_0(\\mathrm{SeO_3^{2-}}) = 1.26~\\mu\\mathrm{M}$, $c_0(\\mathrm{SeO_4^{2-}}) = 0.47~\\mu\\mathrm{M}$.", | |
| "points": 2 | |
| } | |
| ] | |
| } | |
| ] | |