messages listlengths 2 44 | images sequencelengths 1 1 |
|---|---|
[
{
"content": "<image>Can you give me the locations for all the elements in the figure?",
"role": "user"
},
{
"content": "[[626, 82, 967, 322], [32, 213, 350, 390], [355, 292, 597, 439], [66, 399, 305, 671], [507, 464, 826, 591], [353, 612, 618, 917]]",
"role": "assistant"
},
{
"content":... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_94.png"
] |
[
{
"content": "<image>Identify and output the coordinates of each molecule and text in the figure.",
"role": "user"
},
{
"content": "[[433, 39, 973, 315], [26, 331, 294, 480], [300, 373, 619, 652], [240, 688, 508, 960]]",
"role": "assistant"
},
{
"content": "Please enumerate all the molec... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_35.png"
] |
[
{
"content": "<image>Can you identify the molecule present at location [99, 30, 384, 622]?",
"role": "user"
},
{
"content": "C1[C@@H]2[C@@]3([Ar])CCC(=O)[C@H]3[C@H]2C(=O)C1",
"role": "assistant"
},
{
"content": "[326, 709, 637, 969]",
"role": "user"
},
{
"content": "C/C(/CN1C... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_60.png"
] |
[
{
"content": "<image>What are the coordinates of the molecules in the illustration?",
"role": "user"
},
{
"content": "[[56, 307, 369, 511], [636, 380, 943, 746], [391, 412, 580, 572], [351, 599, 619, 906]]",
"role": "assistant"
},
{
"content": "What is the SMILES code for the item situat... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_102.png"
] |
[
{
"content": "<image>Would you mind sharing the coordinates of each item in the figure?",
"role": "user"
},
{
"content": "[[311, 139, 600, 376], [341, 391, 834, 570], [54, 594, 442, 857], [551, 634, 945, 860]]",
"role": "assistant"
},
{
"content": "Could you list every molecule that is p... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_43.png"
] |
[
{
"content": "<image>What molecule is detected at the location [216, 131, 658, 437]?",
"role": "user"
},
{
"content": "C1C=CC(C=CC(O)C2C(C(F)(F)F)=CC([H])=C([R11])C=2C(F)(F)F)=CC=1[H]",
"role": "assistant"
},
{
"content": "[502, 493, 902, 813]",
"role": "user"
},
{
"content":... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_9.png"
] |
[
{
"content": "<image>Which molecule is at the location marked as [124, 678, 514, 914]?",
"role": "user"
},
{
"content": "C1([R12])OC2C=C(NC(C(C)SC3N=NC(C4C=CC=CC=4)=C(C4C=CC=CC=4)N=3)=O)C=CC=2O1",
"role": "assistant"
},
{
"content": "Can you describe the content at location [407, 85, 875... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_135.png"
] |
[
{
"content": "<image>What's stored at the place indicated by [158, 71, 629, 457]?",
"role": "user"
},
{
"content": "CCOCC([Th3(Ba)])CN1C(SCC(NCCOC)=O)=NC2SC(C)=C(C)C=2C1=O",
"role": "assistant"
},
{
"content": "[402, 653, 841, 928]",
"role": "user"
},
{
"content": "80.0 CELSI... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_118.png"
] |
[
{
"content": "<image>Could you detail the coordinates for all the objects in the image?",
"role": "user"
},
{
"content": "[[326, 125, 819, 304], [146, 430, 853, 874]]",
"role": "assistant"
},
{
"content": "Provide all the written information found in the image.",
"role": "user"
},
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_0.png"
] |
[
{
"content": "<image>Please enumerate the coordinates of every molecule in the picture.",
"role": "user"
},
{
"content": "[[153, 59, 628, 246], [78, 614, 661, 940]]",
"role": "assistant"
},
{
"content": "Can you tell me the SMILES for the object present at [153, 59, 628, 246]?",
"rol... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_17.png"
] |
[
{
"content": "<image>Please share the coordinates of all molecules and text from the figure.",
"role": "user"
},
{
"content": "[[35, 89, 245, 291], [562, 135, 755, 238], [314, 215, 526, 291], [733, 249, 856, 354], [582, 253, 722, 382], [264, 310, 521, 559], [789, 365, 950, 500], [536, 502, 753, 624]... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_101.png"
] |
[
{
"content": "<image>Please detail the locations of each molecule in the figure.",
"role": "user"
},
{
"content": "[[412, 43, 677, 248], [132, 125, 341, 270], [319, 300, 520, 537], [41, 350, 238, 466], [74, 469, 255, 575], [271, 538, 470, 639], [517, 571, 728, 729], [222, 682, 465, 956]]",
"role... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_109.png"
] |
[
{
"content": "<image>Could you list the coordinates of all molecules in the image?",
"role": "user"
},
{
"content": "[[139, 30, 373, 352], [335, 366, 621, 534], [672, 468, 979, 787]]",
"role": "assistant"
},
{
"content": "What is the SMILES format for the object found at [672, 468, 979, ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_25.png"
] |
[
{
"content": "<image>Can you fetch all the text from the figure along with its coordinate details?",
"role": "user"
},
{
"content": "1. temperature: 45.0 CELSIUS stirring = CUSTOM The resulting mixture was stirred at 45° C. overnight [268, 62, 554, 287]\n2. temperature: AMBIENT CUSTOM is stirred at ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_67.png"
] |
[
{
"content": "<image>Please enumerate all the molecules and text depicted in the picture.",
"role": "user"
},
{
"content": "molecules:\n1. N1([Ms])C2C=CC(C(COC(C3C=CN=CC=3)=O)=O)=CC=2CC1\n2. CC1C=C(N=C([Eus])C2C=CC([NO2])=CC=2)C(=O)NN=1\ntexts:\n1. temperature = 120.0 CELSIUS stirring = CUSTOM was s... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_134.png"
] |
[
{
"content": "<image>Please recognize all items in the figure",
"role": "user"
},
{
"content": "molecules:\n1. C([Re])CN1C(=NC2C=CC(OCC)=C([H])C=2)S/C(=C\\C2SC(C)=CC=2)/C1=O\ntexts:\n1. temperature: 25.0 CELSIUS stirring CUSTOM stirred the reaction mixture at 25° C. for 1 h",
"role": "assistant"... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_117.png"
] |
[
{
"content": "<image>Please itemize the molecules illustrated and their associated coordinates.",
"role": "user"
},
{
"content": "1. C1[C@@H](C2C=CC(CO)=CC=2)O[C@@H](C2C=C(C3C=C(CN[Suc])C=CC=3)C=CC=2)O[C@H]1CSC1N(C2C=CC(O)=CC=2)N=NN=1 [482, 402, 909, 783]\n2. CC1(C)O[C@@]2([Tb9])[C@@H]([C@@H](OC([t-... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_33.png"
] |
[
{
"content": "<image>Could you output the coordinates for each text snippet in the graphic?",
"role": "user"
},
{
"content": "[[241, 391, 479, 545], [603, 445, 935, 631], [591, 647, 884, 787]]",
"role": "assistant"
},
{
"content": "Please detail the locations of each molecule in the figu... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_58.png"
] |
[
{
"content": "<image>What are the SMILES notations for the molecules in the illustration?",
"role": "user"
},
{
"content": "1. CC(C1C=C(O)C(C([N-]C2C=CC=CC=2[R])=O)=C(C(C)(C)C)C=1)(C)C\n2. CN1C(N([S(LiK)16Rn5])C2C=CC(Cl)=CC=2[R1])=NC2C(=CC=CC=2)C1=O",
"role": "assistant"
},
{
"content": ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_16.png"
] |
[
{
"content": "<image>Would you list the locations of all items in the illustration?",
"role": "user"
},
{
"content": "[[320, 46, 956, 254], [126, 262, 602, 520], [43, 532, 489, 953]]",
"role": "assistant"
},
{
"content": "What can you output the text at location [320, 46, 956, 254]?",
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_100.png"
] |
[
{
"content": "<image>Could you detail the coordinates for all the objects in the image?",
"role": "user"
},
{
"content": "[[158, 117, 983, 284], [16, 464, 452, 882]]",
"role": "assistant"
},
{
"content": "What text appears at the specified position [158, 117, 983, 284]?",
"role": "us... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_125.png"
] |
[
{
"content": "<image>Please point out all the molecules and text shown in the image.",
"role": "user"
},
{
"content": "molecules:\n1. CC([Er])[S@@](C1C(C(OCC(NC2C=CC=C([N+]([O-])=O)C=2)=O)=O)=CC=CC=1)=O\n2. COC1C=CC(N2C(=O)C[C@]([AlH2])(NC(C3C(F)=CC=CC=3F)=O)C2)=C([H])C=1\n3. CC1N=C(NC(CCN2C(=O)[C@@... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_108.png"
] |
[
{
"content": "<image>Can you pinpoint the coordinates of the text 'temperature = -10.0 CELSIUS stirring = CUSTOM The mixture is stirred during 15 min at -10° C.' within the graphic?",
"role": "user"
},
{
"content": "[491, 550, 806, 738]",
"role": "assistant"
},
{
"content": "temperature ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_66.png"
] |
[
{
"content": "<image>What are all the molecules that can be seen in the image?",
"role": "user"
},
{
"content": "1. COc1cc([Kr])c(/C=C2\\C([n]3c(S\\2)[n][n]c3-c2ccc(OC[R])c(OC)c2)=O)cc1OC",
"role": "assistant"
},
{
"content": "List every text element that appears in the image.",
"rol... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_7.png"
] |
[
{
"content": "<image>What text is located at the specified coordinates [25, 79, 446, 403]?",
"role": "user"
},
{
"content": "195.0 CELSIUS stirring: CUSTOM while stirring the resulting mass for 1 h",
"role": "assistant"
},
{
"content": "Could you specify the molecule at position [177, 41... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_32.png"
] |
[
{
"content": "<image>Extract every piece of text visible in the image.",
"role": "user"
},
{
"content": "1. stirring = CUSTOM was stirred for 3 hr",
"role": "assistant"
},
{
"content": "Where is the text 'stirring = CUSTOM was stirred for 3 hr' situated in the figure? I need its coordina... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_107.png"
] |
[
{
"content": "<image>Would you list the locations of all items in the illustration?",
"role": "user"
},
{
"content": "[[100, 39, 324, 297], [399, 77, 775, 312], [51, 336, 343, 633], [377, 436, 619, 779], [626, 532, 948, 960]]",
"role": "assistant"
},
{
"content": "What is the item at thi... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_6.png"
] |
[
{
"content": "<image>Please output the SMILES corresponding to each molecule in the figure.",
"role": "user"
},
{
"content": "1. C([C2H5])CCC([GeH3])C#CCCC(C)=O\n2. CC([Rd])CCC([TsB])CCCCOC(C(F)(F)C(F)(F)C(F)(F)F)=O",
"role": "assistant"
},
{
"content": "Can you give me the positions for... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_140.png"
] |
[
{
"content": "<image>What text is noted at the location [577, 627, 989, 827]?",
"role": "user"
},
{
"content": "temperature = AMBIENT stirring CUSTOM is stirred at ambient temperature for 4 hours",
"role": "assistant"
},
{
"content": "[500, 254, 781, 424]",
"role": "user"
},
{
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_14.png"
] |
[
{
"content": "<image>Can you pull all the text from the figure?",
"role": "user"
},
{
"content": "1. AMBIENT CUSTOM The reaction mixture is then stirred for 1 hour at room temperature",
"role": "assistant"
},
{
"content": "Identify all the molecular structures in the image.",
"role":... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_98.png"
] |
[
{
"content": "<image>Identify the SMILES for each molecule present in the image.",
"role": "user"
},
{
"content": "1. C1([R4])CCN(S(C2C=CC(C=CC(OCC(NCC(F)(F)F)=O)=O)=CC=2)(=O)=O)CCC1\n2. CC1C(=O)N(CCCN2C(=O)N([C@@H]3O[C@H](CO[Si]([t-Bu])(C)C)[C@@]4(OS(=O)(=O)C=C4N)[C@H]3O[Si](C(C)(C)C)(C)C)C=C(C)C2=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_39.png"
] |
[
{
"content": "<image>Please extract the SMILES and coordinates of all molecules in the visual.",
"role": "user"
},
{
"content": "1. CC1SC(/C(/[Re12])=N\\N([H])C2C([R8])=CC(S(N)(=O)=O)=CC=2[N+]([O-])=O)=CC=1 [618, 48, 818, 256]\n2. [NH+]([C2H5])(CC(NC([Me])(C)C)=O)C([H])([H])C(NC1C=CC(C(N[Kr])=O)=CC=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_106.png"
] |
[
{
"content": "<image>Find and recognize all molecules and textual elements in the image.",
"role": "user"
},
{
"content": "molecules:\n1. C[C@@H]1[C@H](C)[C@H](NC(CSc2[n](-c3cc(C)c([Asj])cc3OC)[n][n][n]2)=O)CCC1\n2. CC1N(C)N=C(C)C=1NC([C@H](OC(C1C(SCC(N(C([H])([H])[H])C)=O)=CC=CC=1)=O)C)=O\ntexts:\n... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_22.png"
] |
[
{
"content": "<image>Can you output the coordinates of all molecules and any text in the image?",
"role": "user"
},
{
"content": "[[253, 54, 626, 383], [618, 424, 937, 555], [62, 520, 471, 782], [230, 785, 530, 945]]",
"role": "assistant"
},
{
"content": "What is the molecule found at th... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_131.png"
] |
[
{
"content": "<image>Give the SMILES codes for the molecules shown in the figure.",
"role": "user"
},
{
"content": "1. [NO2]C1C=CC(=CC=1)CON=C1C2[C@H]3[C@](OCC=C)(OC4C=CC(OC5C=C(C=O)C([Cr])=CC=5)=CC=4[C@H]3[C@H](CCCCO[X])[C@@H](CCCCO)C=2)[C@H](C1)N(CCOCCO)C([EtO])=O",
"role": "assistant"
},
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_72.png"
] |
[
{
"content": "<image>List all the molecules that appear in the picture.",
"role": "user"
},
{
"content": "1. c1([Me])ccc(NC(CN2C(=O)C(=O)N(c3cc(Cl)ccc3[OMe])C=C2)=O)cc1\n2. COC1C([GaH2])=CC(C([R5])C([OMe])=O)=C([OBn])C=1",
"role": "assistant"
},
{
"content": "List every text element that... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_122.png"
] |
[
{
"content": "<image>Generate the SMILES codes for the molecules shown in the diagram.",
"role": "user"
},
{
"content": "1. CC1C=CC(C)=C(NC(C2C(OCC[iPr])=CC=CC=2)=O)C=1\n2. CCCCOC(C1C2C([BrT])=C(Cl)C=CC=2N=C(C2C=CC(O[Me])=CC=2)C=1)=O",
"role": "assistant"
},
{
"content": "Could you ident... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_21.png"
] |
[
{
"content": "<image>What is written at the coordinates [643, 404, 833, 598]?",
"role": "user"
},
{
"content": "CUSTOM the mixture was stirred for 5 hours under a nitrogen atmosphere",
"role": "assistant"
},
{
"content": "[11, 304, 354, 476]",
"role": "user"
},
{
"content": "... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_88.png"
] |
[
{
"content": "<image>Output all molecules and text found within the figure, making sure to represent the molecules by their SMILES strings.",
"role": "user"
},
{
"content": "molecules:\n1. C([Bn])(NC(CC1C2C=CC(O)=CC=2OC(=O)C=1)=O)C([O-])=O\n2. CC([Si]([iPr])(C([Me])C)C#C/C(/CO)=C(/C#C[Si]([i-Pr])(C(... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_37.png"
] |
[
{
"content": "<image>Can you provide the coordinates for every molecule and the text present in the figure?",
"role": "user"
},
{
"content": "[[53, 102, 302, 289], [326, 112, 555, 374], [272, 432, 518, 792], [592, 442, 946, 897]]",
"role": "assistant"
},
{
"content": "What is the SMILES ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_79.png"
] |
[
{
"content": "<image>Could you specify the locations for every element in the image?",
"role": "user"
},
{
"content": "[[46, 85, 368, 237], [513, 100, 900, 238], [347, 261, 684, 400], [76, 385, 332, 492], [585, 415, 953, 610], [286, 625, 679, 914]]",
"role": "assistant"
},
{
"content": "... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_10.png"
] |
[
{
"content": "<image>What are the SMILES notations for the molecules in the provided image?",
"role": "user"
},
{
"content": "1. C([Rd])C1Cc2[s]c(NC(Nc3cc([H])[s]c3C([OCH3])=O)=S)c(C([OCH3])=O)c2CC1\n2. CC1N=C(C2C([CAl])=CC=CC=2)C=C2C=CN(C3C=CC(OC)=C([MeO])C=3)C(=O)C=12",
"role": "assistant"
}... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_3.png"
] |
[
{
"content": "<image>Can you extract and present all items in the image, including their location coordinates?",
"role": "user"
},
{
"content": "molecules:\n1. CC1C=CC(C(N(C[Ph])C[Co9])=O)=CC=1 [400, 581, 914, 937]\ntexts:\n1. temperature: 2.5 2.5 CELSIUS stirring CUSTOM with stirring at 0-5° C. und... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_70.png"
] |
[
{
"content": "<image>Identify and output all the molecules and text within the figure, ensuring molecules are shown in SMILES format.",
"role": "user"
},
{
"content": "molecules:\n1. CCN([LakHg])C(N([R7])C(CSC1SC(SC)=NN=1)=O)=O\n2. C[C@@]([(Es12)])(NC(CN1C(=O)N[C@](C2C=CC=C([A])C=2)(C([Ph])([H])[H])... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_28.png"
] |
[
{
"content": "<image>List the SMILES for each molecule displayed in the image.",
"role": "user"
},
{
"content": "1. CC([R])(COC1C=C2N(C([H])([H])C([O(Bs)])C3C2=CC(OC)=C(OC)C=3)C(=O)N=1)C\n2. C1N(CC(NC2C=CC(OC3C=CC=CC=3)=CC=2)=O)C([Ho])CN(S(C2C=CC(F)=C([R8])C=2)(=O)=O)C1\n3. C([Me])(O)[C@H](NC([C@@H]... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_53.png"
] |
[
{
"content": "<image>Identify all the molecules and text present in the image.",
"role": "user"
},
{
"content": "molecules:\n1. C1C2C(C3SC4C(=CC=C([Es19])C=4)C=3)CN(C2)C1([H])[H]\n2. N1([Ph])C(=C(C(Nc2c(Cl)cccc2)=O)C#N)SC(Cc2ccc(Cl)c(Cl)c2)C1=O\n3. [OCH3]C1C=C(C2C3C(N([Me])C(N(C)C=3[N+]([R12])=C(N[S... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_11.png"
] |
[
{
"content": "<image>Please output the entire textual content from the figure.",
"role": "user"
},
{
"content": "1. AMBIENT stirring: CUSTOM was stirred under nitrogen at room temperature for 48 hrs",
"role": "assistant"
},
{
"content": "Can you pinpoint the coordinates of the text 'AMBI... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_103.png"
] |
[
{
"content": "<image>Show all the written content from the picture.",
"role": "user"
},
{
"content": "1. AMBIENT CUSTOM The resulting solution is stirred at room temperature for another 1.5 hours\n2. 10.0 CELSIUS stirring = CUSTOM the mixture is stirred for an additional 15 min in a semi\n3. tempera... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_86.png"
] |
[
{
"content": "<image>Please share the coordinates of all molecules and text from the figure.",
"role": "user"
},
{
"content": "[[104, 149, 727, 371], [367, 444, 895, 850]]",
"role": "assistant"
},
{
"content": "Please output the elements situated at the site of [367, 444, 895, 850].",
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_44.png"
] |
[
{
"content": "<image>Can you specify where the text '80.0 CELSIUS stirring = CUSTOM After stirring for one hour' is located in the figure?",
"role": "user"
},
{
"content": "[405, 592, 567, 840]",
"role": "assistant"
},
{
"content": "temperature 90.0 CELSIUS CUSTOM stirred for 18 hours un... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_111.png"
] |
[
{
"content": "<image>Can you enumerate the coordinates of the molecules in the picture?",
"role": "user"
},
{
"content": "[[343, 37, 543, 229], [609, 171, 796, 280], [143, 249, 291, 385], [544, 380, 761, 582], [112, 459, 299, 560], [22, 579, 208, 787], [431, 599, 653, 713], [746, 660, 977, 962], [27... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_104.png"
] |
[
{
"content": "<image>Please recognize all the molecules and text in the image.Please output all objects in the figure, where molecules should be represented by their corresponding SMILES.",
"role": "user"
},
{
"content": "molecules:\n1. [Me][C@@]12CCC(=O)[C@@](C)([C@H]1C([R12])CC1C2=COC=1)CCC([Et])=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_92.png"
] |
[
{
"content": "<image>Please output all the molecules and text in the figure, where the molecules should be represented by their corresponding SMILES.",
"role": "user"
},
{
"content": "molecules:\n1. CC1OC(=O)C2C(C3C=CC(OC)=C([H3CO])C=3)C([N+]([O-])=O)=C(N)OC=2C=1\n2. CC(O[Si](C[A])(C)C)(C1C=CC=NC=1)... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_110.png"
] |
[
{
"content": "<image>I need the coordinates of every molecule and text shown in the figure.",
"role": "user"
},
{
"content": "[[83, 93, 420, 194], [232, 239, 642, 490], [389, 501, 926, 906], [73, 512, 347, 723]]",
"role": "assistant"
},
{
"content": "List all molecules and text found in ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_51.png"
] |
[
{
"content": "<image>Please share the coordinates of all molecules and text from the figure.",
"role": "user"
},
{
"content": "[[149, 127, 468, 514], [539, 291, 932, 457], [67, 558, 518, 872]]",
"role": "assistant"
},
{
"content": "Identify each molecule present in the picture.",
"ro... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_65.png"
] |
[
{
"content": "<image>Could you specify the locations for every element in the image?",
"role": "user"
},
{
"content": "[[530, 73, 860, 452], [72, 96, 444, 538], [545, 479, 927, 926], [165, 584, 459, 894]]",
"role": "assistant"
},
{
"content": "Identify every object shown in the illustrat... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_38.png"
] |
[
{
"content": "<image>Please output all the molecules and text in the figure, where the molecules should be represented by their corresponding SMILES.",
"role": "user"
},
{
"content": "molecules:\n1. C1N(C(C2C([HfTs])=CC=C(NC(C(C3C=CC=CC=3)C3C=C([H])C=CC=3)=O)C=2)=O)CCOC1\n2. C([Me])(NC([C@H](O)CNC(C... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_45.png"
] |
[
{
"content": "<image>Please provide the SMILES of the molecules shown in the illustration and their respective coordinates.",
"role": "user"
},
{
"content": "1. C/C(/CC(N([H])C1C([SnH])=C2C(C3C(O2)=CC=CC=3[R7])=CC=1[OMe])=O)=N\\NC(C1C(Cl)=CC=CC=1)=O [743, 58, 989, 218]\n2. C([Am])CN(C(O[Me])=O)CN1C(... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_105.png"
] |
[
{
"content": "<image>Extract every piece of text visible in the image.",
"role": "user"
},
{
"content": "1. temperature: 40.0 CELSIUS stirring CUSTOM The whole mixture was stirred for 15 minutes\n2. temperature = 23.0 CELSIUS stirring = CUSTOM was stirred",
"role": "assistant"
},
{
"cont... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_83.png"
] |
[
{
"content": "<image>Give me the coordinates of all molecules depicted in the image.",
"role": "user"
},
{
"content": "[[65, 130, 238, 331], [609, 186, 786, 352], [224, 368, 415, 536], [486, 421, 733, 720], [26, 559, 214, 743], [314, 782, 545, 985]]",
"role": "assistant"
},
{
"content": ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_77.png"
] |
[
{
"content": "<image>Translate the structure of each molecule in the image into SMILES.",
"role": "user"
},
{
"content": "1. CCOc1ccc2[nH]c3C(=O)N(CCc4ccc(F)cc4)C=Nc3c2c1\n2. CC1N2C(=NN=C2[C@@]([A])([NH3+])CC(C)C)N=C(C)C=1\n3. C([n-Bu])[C@H]([SH2+]([Ph])C[Ta])[C@H](C[HO2C])C\n4. C([Am])C1N(CC(O)CO)C... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_50.png"
] |
[
{
"content": "<image>Could you provide the coordinates for each object in the diagram?",
"role": "user"
},
{
"content": "[[249, 30, 422, 160], [433, 178, 661, 323], [271, 187, 432, 307], [675, 195, 980, 314], [19, 305, 227, 377], [363, 336, 512, 439], [194, 378, 319, 567], [661, 384, 858, 628], [32,... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_113.png"
] |
[
{
"content": "<image>What text appears at the specified position [152, 300, 416, 491]?",
"role": "user"
},
{
"content": "temperature: 110.0 CELSIUS stirring CUSTOM to be sufficiently stirred at a temperature of 110° C",
"role": "assistant"
},
{
"content": "[722, 277, 929, 409]",
"rol... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_126.png"
] |
[
{
"content": "<image>Extract and enumerate each entity from the figure, specifying molecules through their SMILES representations.",
"role": "user"
},
{
"content": "molecules:\n1. C([Et])([DbTc13(EsH)Br6Fe])c1c(NC(N(C([Ph])C)C2C3=Nc4ccc(F)cc4C(=O)N3CCC2)=O)cccc1\n2. [O2N]c1ccc([Me])c(S(N2CCN(CC(Cl)=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_34.png"
] |
[
{
"content": "<image>Generate the SMILES codes for the molecules shown in the diagram.",
"role": "user"
},
{
"content": "1. C([Ph])C(Nc1ccc(F)cc1)=O",
"role": "assistant"
}
] | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_91.png"
] |
[
{
"content": "<image>Would you mind sharing the coordinates of each item in the figure?",
"role": "user"
},
{
"content": "[[103, 69, 354, 147], [677, 153, 946, 337], [320, 166, 642, 351], [77, 258, 311, 460], [449, 351, 571, 515], [254, 500, 443, 588], [53, 517, 247, 664], [455, 593, 701, 930]]",
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_127.png"
] |
[
{
"content": "<image>List all the molecules that appear in the picture.",
"role": "user"
},
{
"content": "1. CC(SC1C2C(=C(Br)C=CC=2)C=C2C=1C=CC=C2)(C)C\n2. C([H])([H])([H])CCCN(C(CN(C1C=CC2C(=CC=CC=2)C=1)C)=O)[C@H]1CS(=O)(=O)CC1\n3. Cc1[n](-c2cc([Hg])c(Cl)c(C(OCC(NCc3occc3)=O)=O)[n]2)[n]c(C)c1\n4. C... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_78.png"
] |
[
{
"content": "<image>Please outline the contents of the figure, including a list of items and their respective coordinates.",
"role": "user"
},
{
"content": "molecules:\n1. C1C([Q])CN(C2CS(=O)(=O)CC2)C([Zng3])CC1 [549, 17, 700, 227]\n2. C([OMe])(C1C([R9])CN(C2C3C(=CC([(Es)8])=CC=3)S(=O)(=O)N=2)CC1)=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_56.png"
] |
[
{
"content": "<image>I need the coordinates for each molecule and text shown in the figure.",
"role": "user"
},
{
"content": "[[294, 76, 541, 303], [574, 175, 815, 293], [738, 311, 953, 385], [33, 313, 235, 464], [500, 341, 731, 466], [261, 427, 476, 577], [757, 471, 966, 617], [286, 592, 507, 737],... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_69.png"
] |
[
{
"content": "<image>Generate the SMILES codes for the molecules shown in the diagram.",
"role": "user"
},
{
"content": "1. CN1CC2SC3N([H])[C@H](C4C=CC(OC(/C=C\\C5C=CC(OC)=CC=5)=O)=CC=4)N([Ce])C(=O)C=3C=2CC1\n2. CC1N=C(SCC2C=CC(C(NN=CC3C=CSC=3)=O)=CC=2)N=C(C[R2])C=1\n3. C([EtO])(/C(/[R4])=C(\\OCC#C)... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_121.png"
] |
[
{
"content": "<image>Can you tell me the SMILES for the object present at [240, 551, 396, 694]?",
"role": "user"
},
{
"content": "C1c2c(-c3c(C(F)(F)F)cccc3[Rb])[n][n](-c3c(F)cc([Ni])cc3)c2NC1",
"role": "assistant"
},
{
"content": "[543, 229, 729, 363]",
"role": "user"
},
{
"c... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_29.png"
] |
[
{
"content": "<image>I need all the text in the figure, including the coordinates where each text appears.",
"role": "user"
},
{
"content": "1. temperature 80.0 CELSIUS CUSTOM The mixture was stirred at 80° C. for 13 h [341, 267, 555, 357]",
"role": "assistant"
},
{
"content": "List all ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_76.png"
] |
[
{
"content": "<image>Please share the positions for the text 'temperature: AMBIENT CUSTOM stir for 16 hours'.",
"role": "user"
},
{
"content": "[508, 360, 782, 513]",
"role": "assistant"
},
{
"content": "What molecules are in the figure, and where are they located?",
"role": "user"
... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_142.png"
] |
[
{
"content": "<image>Please extract the text from the figure, detailing the coordinates for each entry.",
"role": "user"
},
{
"content": "1. stirring CUSTOM The mixture was then stirred for another 20 minutes [264, 287, 427, 405]\n2. AMBIENT stirring CUSTOM The reaction mixture was stirred at ambien... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_112.png"
] |
[
{
"content": "<image>What are the locations of the molecules in the illustration?",
"role": "user"
},
{
"content": "[[137, 169, 363, 384], [692, 173, 848, 345], [434, 199, 626, 409], [737, 377, 949, 579], [380, 457, 530, 600], [288, 661, 459, 780], [403, 793, 607, 941]]",
"role": "assistant"
}... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_115.png"
] |
[
{
"content": "<image>Please provide the location details for the text 'AMBIENT stirring = CUSTOM the mixture is stirred at room temperature for 45 days'.",
"role": "user"
},
{
"content": "[117, 224, 355, 454]",
"role": "assistant"
},
{
"content": "80.0 CELSIUS stirring: CUSTOM stirred at... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_89.png"
] |
[
{
"content": "<image>What are the SMILES strings for the molecules illustrated in the picture?",
"role": "user"
},
{
"content": "1. C([MeO])(COC1C=C(/C=C/C2C=CC3C(=CC=CC=3)N=2)C=C([H])C=1)=O\n2. C([Ph])C([X])N1C(=O)C(=O)C2C1=CC=CC=2\n3. C([TsoAl14])OC1C=CC(CCN2C(=S)S/C(=C/C3C4C(=CC=CC=4)C([R])=CC=3)... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_61.png"
] |
[
{
"content": "<image>Could you provide the coordinates for each object in the diagram?",
"role": "user"
},
{
"content": "[[642, 48, 830, 172], [407, 75, 541, 167], [16, 125, 204, 292], [417, 172, 612, 241], [635, 206, 792, 333], [219, 217, 389, 356], [414, 327, 602, 386], [617, 338, 748, 453], [69, ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_87.png"
] |
[
{
"content": "<image>What text is located at the specified coordinates [24, 614, 386, 889]?",
"role": "user"
},
{
"content": "temperature = 0.0 CELSIUS CUSTOM After stirring at 0° C. for an additional 2 hrs",
"role": "assistant"
},
{
"content": "Which molecule is located at [299, 342, 76... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_80.png"
] |
[
{
"content": "<image>What's written at the coordinates [438, 38, 618, 145]?",
"role": "user"
},
{
"content": "temperature AMBIENT stirring: CUSTOM the resulting mixture was stirred at room temperature overnight",
"role": "assistant"
},
{
"content": "[225, 13, 397, 160]",
"role": "use... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_13.png"
] |
[
{
"content": "<image>Please display the complete text from the image.",
"role": "user"
},
{
"content": "1. temperature AMBIENT stirring CUSTOM The mixture was stirred at RT for 16 hours",
"role": "assistant"
},
{
"content": "Can you identify the positions of the text 'temperature AMBIENT... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_148.png"
] |
[
{
"content": "<image>Can you detect every molecule and piece of text within the image?",
"role": "user"
},
{
"content": "molecules:\n1. O([Et])C1C(N2N=C(C3C4C(=CC=CC=4)C=CC=3)C3CCCCNC2=3)=CC=CC=1\n2. CC([Me])(OC(c1[n](C)c(C([CaB])(c2[n](C)cc([R2])[n]2)c2[n](C)cc[n]2)[n]c1)=O)C\n3. CC([Si](OC([K])[C@... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_141.png"
] |
[
{
"content": "<image>I would like to see all the molecules and text from the figure, along with the coordinates for each element.",
"role": "user"
},
{
"content": "molecules:\n1. C1([Me])(C)C(C(O)=O)(C)CCC1C(N1CCCC([R12])C1)=O [273, 59, 452, 196]\n2. [C@]1([C2H5])(C)OCC[C@H]([C@H](C2C=CC(C)=CC=2)CC[... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_81.png"
] |
[
{
"content": "<image>Please output every piece of text in the figure and indicate its location.",
"role": "user"
},
{
"content": "1. temperature = 60.0 CELSIUS CUSTOM while stirring for 30 min [121, 128, 860, 304]",
"role": "assistant"
},
{
"content": "What is the SMILES format for the m... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_90.png"
] |
[
{
"content": "<image>What are the SMILES strings for the molecules illustrated in the picture?",
"role": "user"
},
{
"content": "1. C1CN(C(C2C=C(C3C=C([A])C=CC=3)C(=O)N3C=2C2SC=CC=2C=C3)=O)[C@@H](CO)C1\n2. C([Bu])C(CCCCC[Tl])=NO[Rd]\n3. C[C@H]1[C@@]2(COC(C([H])([H])[H])=O)CO[C@@H](c3ccc([OAc])c([MeO... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_46.png"
] |
[
{
"content": "<image>Extract and list all molecules and text present in the figure, converting each molecule to its SMILES string.",
"role": "user"
},
{
"content": "molecules:\n1. [Ph][n]1[n]cc(c1)/C=C1\\C(NC(=O)N(C\\1=O)C[Ph])=O\n2. CC(C(NC1SC2C(CC(C3C=CC=CC=3)CC=2N=1)=O)=O)C\n3. CC(C(NC1C(OCC[NH+]... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_144.png"
] |
[
{
"content": "<image>Can you provide the coordinates for every molecule and the text present in the figure?",
"role": "user"
},
{
"content": "[[776, 11, 964, 338], [594, 49, 709, 241], [400, 51, 543, 132], [298, 74, 398, 212], [419, 143, 580, 252], [248, 223, 384, 338], [418, 259, 560, 395], [71, 30... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_74.png"
] |
[
{
"content": "<image>Can you provide the SMILES notation for each molecule in the illustration?",
"role": "user"
},
{
"content": "1. C[C@@H]([C@@]([H])(C(O)C1C=CC2OCOC=2C=1)C[R9])CC1C=CC2OCOC=2C=1\n2. C1([OEt])C=CC(C(N2CCN(CC3C=CC4OCCC=4C=3)CC2[A])=O)=CC=1OC\n3. CC1ON=C(C(N2C([R1])CN(S(C3C=CC4CCCCC=... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_30.png"
] |
[
{
"content": "<image>Please outline the positions of all molecules in the provided image.",
"role": "user"
},
{
"content": "[[570, 91, 788, 309], [382, 204, 535, 324], [241, 343, 440, 447], [624, 376, 890, 617], [111, 523, 437, 760], [692, 654, 956, 789]]",
"role": "assistant"
},
{
"cont... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_12.png"
] |
[
{
"content": "<image>Could you list the coordinates of all molecules in the image?",
"role": "user"
},
{
"content": "[[315, 85, 492, 257], [11, 291, 320, 592], [80, 610, 310, 868], [634, 654, 988, 914]]",
"role": "assistant"
},
{
"content": "List all the molecules that appear in the pict... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_8.png"
] |
[
{
"content": "<image>Could you specify the locations for every element in the image?",
"role": "user"
},
{
"content": "[[400, 23, 629, 142], [646, 119, 918, 323], [303, 193, 534, 331], [46, 224, 289, 409], [302, 333, 470, 395], [713, 343, 953, 491], [200, 421, 440, 485], [459, 454, 668, 645], [94, 4... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_49.png"
] |
[
{
"content": "<image>Please retrieve all textual elements from the picture.",
"role": "user"
},
{
"content": "1. 120.0 CELSIUS stirring = CUSTOM stirred for 4 h\n2. -78.0 CELSIUS CUSTOM The reaction was then stirred at −78° C. for 15 min\n3. 150.0 CELSIUS stirring: CUSTOM Under argon, the mixture wa... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_59.png"
] |
[
{
"content": "<image>I'd appreciate a list of all text elements in the figure and the corresponding coordinates.",
"role": "user"
},
{
"content": "1. temperature = AMBIENT stirring: CUSTOM After stirring 1 hour at room temperature the mixture [32, 79, 300, 256]\n2. temperature = AMBIENT stirring CUS... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_26.png"
] |
[
{
"content": "<image>Could you provide the coordinates for each object in the diagram?",
"role": "user"
},
{
"content": "[[118, 82, 364, 255], [579, 234, 974, 396], [56, 316, 263, 460], [310, 432, 602, 601], [25, 601, 445, 917]]",
"role": "assistant"
},
{
"content": "What does the text s... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_84.png"
] |
[
{
"content": "<image>List all the molecules that appear in the picture.",
"role": "user"
},
{
"content": "1. CCCCN(C(/C=C/C1C=CC=C([O2N])C=1)=O)C[Me]\n2. C[C@@H](N=C(NC1C=CC([NC])=CC=1)NC#N)C([Me])([Me])C([H])([H])[H]\n3. CC([Y])C1C=CC=C(CC)C=1N1C(=O)C[C@@H](C(OC2C(C)=CC=CC=2C)=O)C1\n4. CC([(SeCl3)1... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_124.png"
] |
[
{
"content": "<image>Could you detail the coordinates for all the objects in the image?",
"role": "user"
},
{
"content": "[[45, 38, 323, 192], [430, 110, 693, 201], [276, 215, 516, 383], [528, 217, 723, 380], [41, 238, 239, 371], [742, 345, 958, 460], [191, 420, 391, 553], [401, 427, 604, 563], [42,... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_1.png"
] |
[
{
"content": "<image>Could you specify the locations for every element in the image?",
"role": "user"
},
{
"content": "[[386, 107, 719, 285], [449, 324, 791, 533], [127, 330, 349, 515], [79, 536, 376, 832], [390, 539, 721, 693], [594, 706, 920, 892]]",
"role": "assistant"
},
{
"content":... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_154.png"
] |
[
{
"content": "<image>What molecule can be found at the coordinates [380, 232, 579, 383]?",
"role": "user"
},
{
"content": "CC1C=C([R10])C(N2C=NC(C(OC)=O)=C2)=CC=1",
"role": "assistant"
},
{
"content": "[533, 728, 752, 934]",
"role": "user"
},
{
"content": "CC1C2C(N(CC=C)C(SCC... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_128.png"
] |
[
{
"content": "<image>Could you extract and display the coordinates of all text and molecules in the figure?",
"role": "user"
},
{
"content": "[[443, 89, 589, 254], [731, 226, 956, 385], [55, 283, 243, 406], [303, 387, 713, 474], [240, 501, 406, 646], [527, 511, 678, 634], [43, 652, 255, 910], [423, ... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_136.png"
] |
[
{
"content": "<image>Could you detail the locations of all molecules in the image?",
"role": "user"
},
{
"content": "[[579, 96, 803, 255], [196, 112, 381, 359], [424, 267, 588, 399], [660, 339, 874, 560], [189, 413, 439, 606], [12, 467, 187, 670], [446, 499, 620, 690], [768, 616, 987, 873], [632, 63... | [
"/root/train_data/rxn_stage_1/images/mol_text_compose_123.png"
] |
End of preview. Expand in Data Studio
No dataset card yet
- Downloads last month
- 3