Dataset Viewer
Auto-converted to Parquet Duplicate
messages
listlengths
2
44
images
sequencelengths
1
1
[ { "content": "<image>Can you give me the locations for all the elements in the figure?", "role": "user" }, { "content": "[[626, 82, 967, 322], [32, 213, 350, 390], [355, 292, 597, 439], [66, 399, 305, 671], [507, 464, 826, 591], [353, 612, 618, 917]]", "role": "assistant" }, { "content": "What information can be found at the location [507, 464, 826, 591]?", "role": "user" }, { "content": "120.0 CELSIUS stirring CUSTOM stirred at ambient temperature for 1 h", "role": "assistant" }, { "content": "What is the SMILES notation for the molecule at the specified location [66, 399, 305, 671]?", "role": "user" }, { "content": "C1CC2(N([H])C3C(=C(O)C=CC=3C(C3C=CC=CC=3)=O)OC2)CC1", "role": "assistant" }, { "content": "[626, 82, 967, 322]", "role": "user" }, { "content": "CN1N=C(C(N([E])/N=C\\C2C=CC(OCC#N)=CC=2)=O)C2C(=CC=C([HfIn18])C=2)C1=O", "role": "assistant" }, { "content": "[355, 292, 597, 439]", "role": "user" }, { "content": "CC1OC(=O)N(C2([R6])CCN(C(C3C([H])=NN(C)C=3[NO2])=O)CC2)C1", "role": "assistant" }, { "content": "[353, 612, 618, 917]", "role": "user" }, { "content": "C([H])([H])([H])C1N(C2C([(Au16)18])=CC(I)=C([Ar])C=2)C(C)=CC(=C(C2SC3C(=CC=CC=3)N=2)C2SC3C(=CC=CC=3)N=2)C=1", "role": "assistant" }, { "content": "[32, 213, 350, 390]", "role": "user" }, { "content": "CC1N(C2C=CC(C)=C([H])C=2)CCN(S(C2C(C)=NN(C)C=2Cl)(=O)=O)C1([Na(BeeBa)])[A]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_94.png" ]
[ { "content": "<image>Identify and output the coordinates of each molecule and text in the figure.", "role": "user" }, { "content": "[[433, 39, 973, 315], [26, 331, 294, 480], [300, 373, 619, 652], [240, 688, 508, 960]]", "role": "assistant" }, { "content": "Please enumerate all the molecules and text depicted in the picture.", "role": "user" }, { "content": "molecules:\n1. C1CCCCC=C(C(C([R3])CCCCCCCCCCC(Cc2cc([Sb19])ccc2)=O)=O)CCCCC1\n2. C([Yb])COC1C([A])=CC(N2C(C)=C(C3N4C(=CC(C)=N4)NC4CC(C)(C)CC(=O)C3=4)C=C2C)=CC=1\ntexts:\n1. temperature: AMBIENT CUSTOM The reaction mixture was stirred at room temperature for 5 hours\n2. 30.0 CELSIUS CUSTOM is stirred at 40° C. overnight under nitrogen", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_35.png" ]
[ { "content": "<image>Can you identify the molecule present at location [99, 30, 384, 622]?", "role": "user" }, { "content": "C1[C@@H]2[C@@]3([Ar])CCC(=O)[C@H]3[C@H]2C(=O)C1", "role": "assistant" }, { "content": "[326, 709, 637, 969]", "role": "user" }, { "content": "C/C(/CN1C(=O)C2C(=CC=CC=2)C1=O)=N/NC(OC(C)(C)C([Mc])[R11])=O", "role": "assistant" }, { "content": "What information can be found at the location [467, 237, 900, 562]?", "role": "user" }, { "content": "temperature: 0.0 CELSIUS CUSTOM The mixture was stirred at 0° C. for 2 hours", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_60.png" ]
[ { "content": "<image>What are the coordinates of the molecules in the illustration?", "role": "user" }, { "content": "[[56, 307, 369, 511], [636, 380, 943, 746], [391, 412, 580, 572], [351, 599, 619, 906]]", "role": "assistant" }, { "content": "What is the SMILES code for the item situated at [351, 599, 619, 906]?", "role": "user" }, { "content": "C[MeN]C1C([PH2]([Ph])C2C([Mc])=CC=CC=2)=CC=CC=1", "role": "assistant" }, { "content": "[391, 412, 580, 572]", "role": "user" }, { "content": "N1([n-Bu])CCN(C2C3C(=CC=CC=3)SN=2)C(Br)C1[R8]", "role": "assistant" }, { "content": "[56, 307, 369, 511]", "role": "user" }, { "content": "C([Ph])c1cc(Br)c(O)c(C=Nc2ccc3c4c(oc3c2)cc([Hk14])cc4)c1", "role": "assistant" }, { "content": "[636, 380, 943, 746]", "role": "user" }, { "content": "CC1C=CC(C(NC(C(NCCO)=O)=CC2OC(C3C=CC([N+]([O-])=O)=CC=3)=CC=2[Kr14])=O)=C([Y])C=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_102.png" ]
[ { "content": "<image>Would you mind sharing the coordinates of each item in the figure?", "role": "user" }, { "content": "[[311, 139, 600, 376], [341, 391, 834, 570], [54, 594, 442, 857], [551, 634, 945, 860]]", "role": "assistant" }, { "content": "Could you list every molecule that is present in the image?", "role": "user" }, { "content": "1. C([Yb])COC1C=CC(CN2CC([R])C(C(N3CCN(C4C(OCC)=CC=CC=4)CC3)=O)CC2)=CC=1\n2. CC(N([R6])C(C(O)=O)=CC1C=C(I)C(OCC2C=CC=C(Cl)C=2)=C(I)C=1[(He15)])=O\n3. C1([Ra])C=CC(CCN2N=CC3C4N(C(N)=NC2=3)N=C(C2C=CC=CC=2)N=4)=CC=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_43.png" ]
[ { "content": "<image>What molecule is detected at the location [216, 131, 658, 437]?", "role": "user" }, { "content": "C1C=CC(C=CC(O)C2C(C(F)(F)F)=CC([H])=C([R11])C=2C(F)(F)F)=CC=1[H]", "role": "assistant" }, { "content": "[502, 493, 902, 813]", "role": "user" }, { "content": "CC1C(C(O[Z])=O)=CC(S(Cl)(=O)=O)=C(F)C=1", "role": "assistant" }, { "content": "Please output all the text in the figure and their corresponding coordinates.", "role": "user" }, { "content": "1. -70.0 CELSIUS stirring = CUSTOM The mixture was stirred for 1 hour at -70° C [97, 509, 411, 868]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_9.png" ]
[ { "content": "<image>Which molecule is at the location marked as [124, 678, 514, 914]?", "role": "user" }, { "content": "C1([R12])OC2C=C(NC(C(C)SC3N=NC(C4C=CC=CC=4)=C(C4C=CC=CC=4)N=3)=O)C=CC=2O1", "role": "assistant" }, { "content": "Can you describe the content at location [407, 85, 875, 414]?", "role": "user" }, { "content": "10.0 CELSIUS stirring CUSTOM the mixture is stirred at 10° C. for 20 min", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_135.png" ]
[ { "content": "<image>What's stored at the place indicated by [158, 71, 629, 457]?", "role": "user" }, { "content": "CCOCC([Th3(Ba)])CN1C(SCC(NCCOC)=O)=NC2SC(C)=C(C)C=2C1=O", "role": "assistant" }, { "content": "[402, 653, 841, 928]", "role": "user" }, { "content": "80.0 CELSIUS CUSTOM The flask stirred at 80° C. in a pre-heated oil bath for 20 h", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_118.png" ]
[ { "content": "<image>Could you detail the coordinates for all the objects in the image?", "role": "user" }, { "content": "[[326, 125, 819, 304], [146, 430, 853, 874]]", "role": "assistant" }, { "content": "Provide all the written information found in the image.", "role": "user" }, { "content": "1. -78.0 CELSIUS stirring CUSTOM with stirring", "role": "assistant" }, { "content": "List the SMILES corresponding to the molecules in the illustration.", "role": "user" }, { "content": "1. CC1(C)C(=O)N(C2C=CC(OC)=CC=2)[C@H]1C1OC=CC=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_0.png" ]
[ { "content": "<image>Please enumerate the coordinates of every molecule in the picture.", "role": "user" }, { "content": "[[153, 59, 628, 246], [78, 614, 661, 940]]", "role": "assistant" }, { "content": "Can you tell me the SMILES for the object present at [153, 59, 628, 246]?", "role": "user" }, { "content": "C([R4])/C(/CC(NC1CCCCCC1)=O)=N\\NC(C1C=CN=CC=1)=O", "role": "assistant" }, { "content": "[78, 614, 661, 940]", "role": "user" }, { "content": "CC1C=CC(C)=C(OCC(OC2C=CC(CC[C@]3(C)NC(=O)NC3=O)=CC=2)=O)C=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_17.png" ]
[ { "content": "<image>Please share the coordinates of all molecules and text from the figure.", "role": "user" }, { "content": "[[35, 89, 245, 291], [562, 135, 755, 238], [314, 215, 526, 291], [733, 249, 856, 354], [582, 253, 722, 382], [264, 310, 521, 559], [789, 365, 950, 500], [536, 502, 753, 624], [759, 554, 964, 693], [179, 609, 330, 731], [431, 645, 587, 757], [647, 723, 831, 910]]", "role": "assistant" }, { "content": "Can you provide details on what's located at [789, 365, 950, 500]?", "role": "user" }, { "content": "C1CC(C(O)(C(NCC2([R6])C3CN(CC4C=CC=NC=4)CC23)=O)C2C=CC=CC=2)CC1", "role": "assistant" }, { "content": "[759, 554, 964, 693]", "role": "user" }, { "content": "CC(NC1C=CC(S(N2CCN(CC3C(C(F)(F)F)=CC=CC=3)CC2)(=O)=O)=CC=1)=O", "role": "assistant" }, { "content": "[431, 645, 587, 757]", "role": "user" }, { "content": "C[C@@H](NC(NNC(C1CCN(C2C([NO2])=CC=CC=2)CC1)=O)=S)C[MeO]", "role": "assistant" }, { "content": "[536, 502, 753, 624]", "role": "user" }, { "content": "temperature = 35.0 CELSIUS CUSTOM The mixture was stirred at 35° C. until a clear solution", "role": "assistant" }, { "content": "[264, 310, 521, 559]", "role": "user" }, { "content": "CCCC([MeN]C([C@@H](NC([C@H](NC([C@@H](NC(CNC(C[MeN]C(C)=O)=O)=O)CCC(N)=O)=O)[C@H](CC)C)=O)[C@H](O)C)=O)C(N[C@H](C(N[C@H](C(N1[C@H](C(N[C@@H](C(N)=O)C)=O)CCC1)=O)CCCN=C(N)N)=O)[C@]([R10])(C[Me])C[Nb16])=O", "role": "assistant" }, { "content": "[35, 89, 245, 291]", "role": "user" }, { "content": "-10.0 CELSIUS stirring = CUSTOM the mixture was stirred at -40° C. for an hour and at -10° C. for 45 minutes", "role": "assistant" }, { "content": "[314, 215, 526, 291]", "role": "user" }, { "content": "50.0 CELSIUS stirring CUSTOM agitating for 2 hours", "role": "assistant" }, { "content": "[179, 609, 330, 731]", "role": "user" }, { "content": "CC1C=C(OCC(N/N=C\\C2N3C=C([BaAmW])SC3=NC=2Cl)=O)C=C(C)C=1", "role": "assistant" }, { "content": "[733, 249, 856, 354]", "role": "user" }, { "content": "C([Me])CCC([Hf9])C(C(C[Y])(C)C)(C)C", "role": "assistant" }, { "content": "[562, 135, 755, 238]", "role": "user" }, { "content": "C[C@@H]([NH2+]CC(NC1C=C(C(NC)=O)C=CC=1)=O)C1C=CC(F)=C(F)C=1", "role": "assistant" }, { "content": "[582, 253, 722, 382]", "role": "user" }, { "content": "temperature -70.0 CELSIUS CUSTOM The mixture is stirred at −70° C. for 2 hr", "role": "assistant" }, { "content": "[647, 723, 831, 910]", "role": "user" }, { "content": "temperature AMBIENT CUSTOM The mixture was stirred at room temperature for 4 hours before it", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_101.png" ]
[ { "content": "<image>Please detail the locations of each molecule in the figure.", "role": "user" }, { "content": "[[412, 43, 677, 248], [132, 125, 341, 270], [319, 300, 520, 537], [41, 350, 238, 466], [74, 469, 255, 575], [271, 538, 470, 639], [517, 571, 728, 729], [222, 682, 465, 956]]", "role": "assistant" }, { "content": "Can you tell me the SMILES for the object present at [517, 571, 728, 729]?", "role": "user" }, { "content": "C1CN(/C(/NC(Nc2c([R2])cccc2)=O)=C\\C#N)CC1", "role": "assistant" }, { "content": "[412, 43, 677, 248]", "role": "user" }, { "content": "C1S[C@@H](c2ccc(C(Nc3cc(Cl)cc(Cl)c3)=O)c([TeH])c2)N(CCc2c([Q])cccc2)C1=O", "role": "assistant" }, { "content": "[132, 125, 341, 270]", "role": "user" }, { "content": "C([n-Pr])C1(CCC2(C)SCC([R4])S2)SCCS1", "role": "assistant" }, { "content": "[271, 538, 470, 639]", "role": "user" }, { "content": "C1C=CC(C(NN=CC2C=CC(OCC(NC3C=CC(F)=C([X])C=3)=O)=C(Cl)C=2)=O)=CC=1", "role": "assistant" }, { "content": "[74, 469, 255, 575]", "role": "user" }, { "content": "CC(C(Nc1[n][n]c2c3cc(S(N4C([Ar])COCC4)(=O)=O)ccc3[nH]c2[n]1)=O)C", "role": "assistant" }, { "content": "[41, 350, 238, 466]", "role": "user" }, { "content": "C1([OCH3])C=CC(NC2SC(C3C(=O)OC4C=CC(OC)=CC=4C=3[Be])=NN=2)=CC=1[Rb]", "role": "assistant" }, { "content": "[222, 682, 465, 956]", "role": "user" }, { "content": "C([R11])C1[C@H]2C([OAc])C3(OC3(C)C)CC([NbTb])C(=C)[C@@H]2CC=1", "role": "assistant" }, { "content": "[319, 300, 520, 537]", "role": "user" }, { "content": "C1([H3CO])C([Es9])=C(C2N(C3SC4C([Q])=C(Cl)C=CC=4N=3)C(=O)C(O)=C2C(C2OC=CC=2)=O)C=C(Br)C=1O[H]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_109.png" ]
[ { "content": "<image>Could you list the coordinates of all molecules in the image?", "role": "user" }, { "content": "[[139, 30, 373, 352], [335, 366, 621, 534], [672, 468, 979, 787]]", "role": "assistant" }, { "content": "What is the SMILES format for the object found at [672, 468, 979, 787]?", "role": "user" }, { "content": "CC1(C([H])([H])[H])C(=C)C1([R4])C1C=C(Cl)C=C(Cl)C=1", "role": "assistant" }, { "content": "[139, 30, 373, 352]", "role": "user" }, { "content": "CCC1C=CC(N2C(=O)CS[C@@H]2C2C=CC=C(NC(C3C=CC=CC=3)=O)C=2)=CC=1", "role": "assistant" }, { "content": "[335, 366, 621, 534]", "role": "user" }, { "content": "C[n]1c(SCC(N([H])c2ccc(C([MeO])=O)cc2)=O)[n][n]c1-c1ccc[n]c1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_25.png" ]
[ { "content": "<image>Can you fetch all the text from the figure along with its coordinate details?", "role": "user" }, { "content": "1. temperature: 45.0 CELSIUS stirring = CUSTOM The resulting mixture was stirred at 45° C. overnight [268, 62, 554, 287]\n2. temperature: AMBIENT CUSTOM is stirred at room temperature for 16 hours [603, 76, 856, 279]\n3. temperature AMBIENT stirring: CUSTOM stirred at room temperature for 19 hours [12, 365, 306, 509]", "role": "assistant" }, { "content": "List every molecule in the diagram and include their coordinates.", "role": "user" }, { "content": "1. C([MoD])COC(C1[C@@H](C2C=CC=CC=2[R11])NC(=O)NC=1COC1C=CC(C(OC)=O)=CC=1)=O [407, 303, 643, 495]\n2. C1C2C(=CC=CC=2)N(CCCN)C(=O)C1 [703, 365, 987, 650]\n3. C[C@H](NC(COC(C1C=CC(N)=CC=1[Yb7])=O)=O)C1C=CC2OCOC=2C=1 [359, 523, 660, 696]\n4. c1([R9])cc(F)cc(COc2cc(P)c(C=O)cc2)c1 [647, 715, 883, 937]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_67.png" ]
[ { "content": "<image>Please enumerate all the molecules and text depicted in the picture.", "role": "user" }, { "content": "molecules:\n1. N1([Ms])C2C=CC(C(COC(C3C=CN=CC=3)=O)=O)=CC=2CC1\n2. CC1C=C(N=C([Eus])C2C=CC([NO2])=CC=2)C(=O)NN=1\ntexts:\n1. temperature = 120.0 CELSIUS stirring = CUSTOM was stirred at 120° C. for 1.5 hr under an argon atmosphere", "role": "assistant" }, { "content": "What are the locations of the molecules in the illustration?", "role": "user" }, { "content": "[[569, 133, 982, 410], [229, 589, 635, 866]]", "role": "assistant" }, { "content": "Please show the positions of every text block in the figure.", "role": "user" }, { "content": "[[17, 216, 497, 485]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_134.png" ]
[ { "content": "<image>Please recognize all items in the figure", "role": "user" }, { "content": "molecules:\n1. C([Re])CN1C(=NC2C=CC(OCC)=C([H])C=2)S/C(=C\\C2SC(C)=CC=2)/C1=O\ntexts:\n1. temperature: 25.0 CELSIUS stirring CUSTOM stirred the reaction mixture at 25° C. for 1 h", "role": "assistant" }, { "content": "Can you provide the locations of each molecule shown in the diagram?", "role": "user" }, { "content": "[[151, 642, 693, 870]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_117.png" ]
[ { "content": "<image>Please itemize the molecules illustrated and their associated coordinates.", "role": "user" }, { "content": "1. C1[C@@H](C2C=CC(CO)=CC=2)O[C@@H](C2C=C(C3C=C(CN[Suc])C=CC=3)C=CC=2)O[C@H]1CSC1N(C2C=CC(O)=CC=2)N=NN=1 [482, 402, 909, 783]\n2. CC1(C)O[C@@]2([Tb9])[C@@H]([C@@H](OC([t-Bu])=O)[C@@H]([C@@H]3OC(=S)OC3)O2)O1 [90, 588, 409, 880]", "role": "assistant" }, { "content": "Can you show me all the text in the figure with the coordinates for each listed?", "role": "user" }, { "content": "1. temperature: AMBIENT stirring CUSTOM the mixture was stirred under an argon atmosphere at room temperature for 1.5 days [372, 119, 709, 389]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_33.png" ]
[ { "content": "<image>Could you output the coordinates for each text snippet in the graphic?", "role": "user" }, { "content": "[[241, 391, 479, 545], [603, 445, 935, 631], [591, 647, 884, 787]]", "role": "assistant" }, { "content": "Please detail the locations of each molecule in the figure.", "role": "user" }, { "content": "[[494, 88, 749, 442], [64, 564, 275, 782], [297, 626, 540, 911]]", "role": "assistant" }, { "content": "What does the text at [591, 647, 884, 787] contain?", "role": "user" }, { "content": "45.0 CELSIUS stirring: CUSTOM The reaction mixture was stirred at 45° C. for 4 h", "role": "assistant" }, { "content": "[603, 445, 935, 631]", "role": "user" }, { "content": "50.0 CELSIUS stirring: CUSTOM with stirring at 50° C. until a homogenous solution", "role": "assistant" }, { "content": "[241, 391, 479, 545]", "role": "user" }, { "content": "temperature = AMBIENT CUSTOM the mixture was stirred for 4 days at room temperature", "role": "assistant" }, { "content": "Can you provide the SMILES representation for the molecule located at [494, 88, 749, 442]?", "role": "user" }, { "content": "CC1NC(=O)N[C@@H](c2ccc(O)c(OC)c2[Ar])C=1C(OC1([H])CCCC([H])([H])CC1)=O", "role": "assistant" }, { "content": "[297, 626, 540, 911]", "role": "user" }, { "content": "CC(C[C@H](NC([C@@H](NC([C@H]1N(C([C@@H](NC([C@H]2NCCC2([H])[H])=O)CCC(N)=O)=O)CCC1)=O)CCC(O)=O)=O)C(N1[C@H](C(NC([CO2H])Cc2ccc(O[Rb])cc2)=O)CCC1)=O)C", "role": "assistant" }, { "content": "[64, 564, 275, 782]", "role": "user" }, { "content": "CC1C[C@@H](C(N2CCN(CCC3C=CC=CC=3)CC2)=O)[C@H](C(O)=O)CC=1C", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_58.png" ]
[ { "content": "<image>What are the SMILES notations for the molecules in the illustration?", "role": "user" }, { "content": "1. CC(C1C=C(O)C(C([N-]C2C=CC=CC=2[R])=O)=C(C(C)(C)C)C=1)(C)C\n2. CN1C(N([S(LiK)16Rn5])C2C=CC(Cl)=CC=2[R1])=NC2C(=CC=CC=2)C1=O", "role": "assistant" }, { "content": "Kindly extract all the text from the image.", "role": "user" }, { "content": "1. temperature: AMBIENT stirring: CUSTOM The resulting solution was stirred at room temperature overnight", "role": "assistant" }, { "content": "What are the coordinates of molecules CC(C1C=C(O)C(C([N-]C2C=CC=CC=2[R])=O)=C(C(C)(C)C)C=1)(C)C in the provided figure?", "role": "user" }, { "content": "[577, 376, 985, 659]", "role": "assistant" }, { "content": "CN1C(N([S(LiK)16Rn5])C2C=CC(Cl)=CC=2[R1])=NC2C(=CC=CC=2)C1=O", "role": "user" }, { "content": "[115, 584, 514, 918]", "role": "assistant" }, { "content": "Please share the positions for the text 'temperature: AMBIENT stirring: CUSTOM The resulting solution was stirred at room temperature overnight'.", "role": "user" }, { "content": "[14, 81, 568, 313]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_16.png" ]
[ { "content": "<image>Would you list the locations of all items in the illustration?", "role": "user" }, { "content": "[[320, 46, 956, 254], [126, 262, 602, 520], [43, 532, 489, 953]]", "role": "assistant" }, { "content": "What can you output the text at location [320, 46, 956, 254]?", "role": "user" }, { "content": "temperature 50.0 CELSIUS CUSTOM shaken at 50° C. for 20 h", "role": "assistant" }, { "content": "Can you provide the SMILES representation for the molecule located at [126, 262, 602, 520]?", "role": "user" }, { "content": "C1CC2C=C(NC(CN3CCN(C4N=CC=CC=4)CC3)=O)C=CC=2C1", "role": "assistant" }, { "content": "[43, 532, 489, 953]", "role": "user" }, { "content": "CN(C(C1C=CC(C2C(NCC([Pd])C3NC=NC=3)=NC=NC=2)=CC=1)=O)C", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_100.png" ]
[ { "content": "<image>Could you detail the coordinates for all the objects in the image?", "role": "user" }, { "content": "[[158, 117, 983, 284], [16, 464, 452, 882]]", "role": "assistant" }, { "content": "What text appears at the specified position [158, 117, 983, 284]?", "role": "user" }, { "content": "AMBIENT CUSTOM The reaction is stirred at ambient temperature overnight", "role": "assistant" }, { "content": "Could you tell me the SMILES for the molecule found at [16, 464, 452, 882]?", "role": "user" }, { "content": "CC(c1ccc(OC)c(CN2CCCC([Be])([R12])C2)c1)=NN", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_125.png" ]
[ { "content": "<image>Please point out all the molecules and text shown in the image.", "role": "user" }, { "content": "molecules:\n1. CC([Er])[S@@](C1C(C(OCC(NC2C=CC=C([N+]([O-])=O)C=2)=O)=O)=CC=CC=1)=O\n2. COC1C=CC(N2C(=O)C[C@]([AlH2])(NC(C3C(F)=CC=CC=3F)=O)C2)=C([H])C=1\n3. CC1N=C(NC(CCN2C(=O)[C@@H]3[C@@H](CCCC3[Rc])C2=O)=O)SC=1C[PbH]\n4. [H3CO]C1C=CC(=CC=1)C(N1CCN(C)CC1)C1=NN=NN1C[Ts]\n5. C1([H3CO])C2C(N([(V6)])C(=O)C=2C(C([MeO])=O)=C(OC[R6])C=1)=O\ntexts:\n1. temperature: -8.0 CELSIUS CUSTOM the mixture was stirred at 20° C. overnight\n2. temperature: -10.0 CELSIUS CUSTOM The reaction mixture was stirred at −10° C. for 0.5 h\n3. 102.5 2.5 CELSIUS CUSTOM stirred for 1 hour\n4. 80.0 CELSIUS CUSTOM it was stirred for five hours", "role": "assistant" }, { "content": "Can you detail the coordinates of every text element in the figure?", "role": "user" }, { "content": "[[551, 106, 940, 337], [53, 290, 259, 510], [497, 353, 781, 453], [170, 755, 382, 882]]", "role": "assistant" }, { "content": "What are the locations of the molecules in the illustration?", "role": "user" }, { "content": "[[239, 81, 480, 285], [378, 478, 654, 692], [141, 529, 354, 717], [685, 562, 946, 863], [415, 700, 599, 918]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_108.png" ]
[ { "content": "<image>Can you pinpoint the coordinates of the text 'temperature = -10.0 CELSIUS stirring = CUSTOM The mixture is stirred during 15 min at -10° C.' within the graphic?", "role": "user" }, { "content": "[491, 550, 806, 738]", "role": "assistant" }, { "content": "temperature 20.0 CELSIUS stirring = CUSTOM the mixture was stirred at 20° C. for 16 hours", "role": "user" }, { "content": "[35, 554, 383, 731]", "role": "assistant" }, { "content": "temperature = 50.0 CELSIUS stirring CUSTOM the reaction mixture is stirred at 50° C. for 3 h", "role": "user" }, { "content": "[559, 745, 964, 903]", "role": "assistant" }, { "content": "List the molecules displayed in the diagram along with their coordinate data.", "role": "user" }, { "content": "1. CC1C(=O)C2N3[C@@]([OCH3])([C@H](COC(N)=O)C=2C(=O)C=1N[SiX])[C@H]1N[C@H]1C3 [112, 25, 464, 410]\n2. CNC1C2C(=CC=CC=2[H])N=C2C=1CN(CC1C=CC=CC=1)CC2 [469, 314, 837, 518]\n3. [OMe]C1C=CC(=CC=1[OCH3])C1=CC(C(F)(F)F)=NC(=N1)SCC(=O)NCCC([R8])N([Et])CC [74, 756, 429, 974]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_66.png" ]
[ { "content": "<image>What are all the molecules that can be seen in the image?", "role": "user" }, { "content": "1. COc1cc([Kr])c(/C=C2\\C([n]3c(S\\2)[n][n]c3-c2ccc(OC[R])c(OC)c2)=O)cc1OC", "role": "assistant" }, { "content": "List every text element that appears in the image.", "role": "user" }, { "content": "1. CUSTOM stirred at 50 C for 90 minutes", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_7.png" ]
[ { "content": "<image>What text is located at the specified coordinates [25, 79, 446, 403]?", "role": "user" }, { "content": "195.0 CELSIUS stirring: CUSTOM while stirring the resulting mass for 1 h", "role": "assistant" }, { "content": "Could you specify the molecule at position [177, 416, 520, 854]?", "role": "user" }, { "content": "C[C@@]1([GeH3])C(=O)N(C)[C@@]([Rb])(CO)CC2C=CC(OC)=CC1=2", "role": "assistant" }, { "content": "[576, 508, 974, 920]", "role": "user" }, { "content": "C[C@]1([Lrl])O[C@H](C)C([H])([H])N(C(CSC2N(C3C=C(C)C=C([A])C=3)N=NN=2)=O)C1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_32.png" ]
[ { "content": "<image>Extract every piece of text visible in the image.", "role": "user" }, { "content": "1. stirring = CUSTOM was stirred for 3 hr", "role": "assistant" }, { "content": "Where is the text 'stirring = CUSTOM was stirred for 3 hr' situated in the figure? I need its coordinates.", "role": "user" }, { "content": "[157, 475, 765, 916]", "role": "assistant" }, { "content": "Generate the SMILES codes for the molecules shown in the diagram.", "role": "user" }, { "content": "1. [MeS]C1OC(C(O[A])C(O)C1O)C([i-Pr])NC(C1N([Ra])CCC(CCCOCCF)C1)=O", "role": "assistant" }, { "content": "Can you provide the precise coordinates for molecules [MeS]C1OC(C(O[A])C(O)C1O)C([i-Pr])NC(C1N([Ra])CCC(CCCOCCF)C1)=O in the diagram?", "role": "user" }, { "content": "[234, 83, 842, 441]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_107.png" ]
[ { "content": "<image>Would you list the locations of all items in the illustration?", "role": "user" }, { "content": "[[100, 39, 324, 297], [399, 77, 775, 312], [51, 336, 343, 633], [377, 436, 619, 779], [626, 532, 948, 960]]", "role": "assistant" }, { "content": "What is the item at this position: [626, 532, 948, 960]?", "role": "user" }, { "content": "temperature AMBIENT CUSTOM the reaction mixture was stirred under argon at room temperature for 20 hours", "role": "assistant" }, { "content": "[399, 77, 775, 312]", "role": "user" }, { "content": "CUSTOM the suspension was agitated under 50 psi of H2 for 20 h", "role": "assistant" }, { "content": "Which molecule is at the location marked as [377, 436, 619, 779]?", "role": "user" }, { "content": "N1([Me])C2CC(N=C(NC3C=CC=C(Cl)C=3Cl)N)CCC2(C2C=CC([OCH3])=C(OC[Fl(Ts9)])C=2)CC1", "role": "assistant" }, { "content": "[100, 39, 324, 297]", "role": "user" }, { "content": "CC1C=CC=C(NC(CN(CC(N[Ph])=O)CCOC)=O)C=1C", "role": "assistant" }, { "content": "[51, 336, 343, 633]", "role": "user" }, { "content": "c1([EtO])c(N2CCN(C(COc3cc([Tsf])c(Cl)c(C)c3)=O)CC2)cccc1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_6.png" ]
[ { "content": "<image>Please output the SMILES corresponding to each molecule in the figure.", "role": "user" }, { "content": "1. C([C2H5])CCC([GeH3])C#CCCC(C)=O\n2. CC([Rd])CCC([TsB])CCCCOC(C(F)(F)C(F)(F)C(F)(F)F)=O", "role": "assistant" }, { "content": "Can you give me the positions for items '85.0 CELSIUS stirring: CUSTOM The solution was stirred for 1 hour at 85° C.', as illustrated in the figure?", "role": "user" }, { "content": "[138, 529, 626, 856]", "role": "assistant" }, { "content": "CC([Rd])CCC([TsB])CCCCOC(C(F)(F)C(F)(F)C(F)(F)F)=O", "role": "user" }, { "content": "[123, 369, 527, 516]", "role": "assistant" }, { "content": "C([C2H5])CCC([GeH3])C#CCCC(C)=O", "role": "user" }, { "content": "[554, 143, 876, 348]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_140.png" ]
[ { "content": "<image>What text is noted at the location [577, 627, 989, 827]?", "role": "user" }, { "content": "temperature = AMBIENT stirring CUSTOM is stirred at ambient temperature for 4 hours", "role": "assistant" }, { "content": "[500, 254, 781, 424]", "role": "user" }, { "content": "temperature: AMBIENT CUSTOM the reaction mixture was stirred for 10 min. at RT", "role": "assistant" }, { "content": "[517, 434, 766, 586]", "role": "user" }, { "content": "temperature = 60.0 CELSIUS stirring = CUSTOM the reaction mixture was stirred at 60° C. for 10.5 hours", "role": "assistant" }, { "content": "Show me all the molecules in the figure along with where they're located in terms of coordinates.", "role": "user" }, { "content": "1. CC1N=C(C2C=CC=C(Cl)C=2)SC=1C(N1CC([H])([H])N(C([R6])CN2CC([((NHeM)15)])CC2)CC1)=O [200, 62, 479, 277]\n2. CC(O[C@H]1C([OAc])[C@@H](OC(C)=O)[P@@](OC)(=O)OC1[Tb])=O [10, 306, 204, 575]\n3. CC(C(NC1SC([H])=C(C2C=CC(F)=C(F)C=2)N=1)=O)(C)C[Rd] [219, 483, 486, 696]\n4. CC([C@@H](N1C(=S)S/C(=C\\C2C([H])=CC([N+]([O-])=O)=CC=2)/C1=O)C(O)=O)C [143, 729, 382, 937]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_14.png" ]
[ { "content": "<image>Can you pull all the text from the figure?", "role": "user" }, { "content": "1. AMBIENT CUSTOM The reaction mixture is then stirred for 1 hour at room temperature", "role": "assistant" }, { "content": "Identify all the molecular structures in the image.", "role": "user" }, { "content": "1. CN([R])C(COC(C1C=C([H])C(S(N2CCOCC2)(=O)=O)=CC=1)=O)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_98.png" ]
[ { "content": "<image>Identify the SMILES for each molecule present in the image.", "role": "user" }, { "content": "1. C1([R4])CCN(S(C2C=CC(C=CC(OCC(NCC(F)(F)F)=O)=O)=CC=2)(=O)=O)CCC1\n2. CC1C(=O)N(CCCN2C(=O)N([C@@H]3O[C@H](CO[Si]([t-Bu])(C)C)[C@@]4(OS(=O)(=O)C=C4N)[C@H]3O[Si](C(C)(C)C)(C)C)C=C(C)C2=O)C(=O)N([C@@H]2O[C@H](COP(O[Ph])(NC(C([H3CO])=O)C)=O)C=C2)C=1", "role": "assistant" }, { "content": "Extract all the text available in the figure.", "role": "user" }, { "content": "1. temperature: 100.0 CELSIUS CUSTOM stirred for 3 h under nitrogen", "role": "assistant" }, { "content": "Please retrieve the locations of elements 'CC1C(=O)N(CCCN2C(=O)N([C@@H]3O[C@H](CO[Si]([t-Bu])(C)C)[C@@]4(OS(=O)(=O)C=C4N)[C@H]3O[Si](C(C)(C)C)(C)C)C=C(C)C2=O)C(=O)N([C@@H]2O[C@H](COP(O[Ph])(NC(C([H3CO])=O)C)=O)C=C2)C=1', as indicated in the figure.", "role": "user" }, { "content": "[482, 337, 979, 859]", "role": "assistant" }, { "content": "temperature: 100.0 CELSIUS CUSTOM stirred for 3 h under nitrogen", "role": "user" }, { "content": "[20, 321, 317, 588]", "role": "assistant" }, { "content": "C1([R4])CCN(S(C2C=CC(C=CC(OCC(NCC(F)(F)F)=O)=O)=CC=2)(=O)=O)CCC1", "role": "user" }, { "content": "[77, 140, 430, 308]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_39.png" ]
[ { "content": "<image>Please extract the SMILES and coordinates of all molecules in the visual.", "role": "user" }, { "content": "1. CC1SC(/C(/[Re12])=N\\N([H])C2C([R8])=CC(S(N)(=O)=O)=CC=2[N+]([O-])=O)=CC=1 [618, 48, 818, 256]\n2. [NH+]([C2H5])(CC(NC([Me])(C)C)=O)C([H])([H])C(NC1C=CC(C(N[Kr])=O)=CC=1[R4])=O [649, 283, 855, 460]\n3. COC1C=C(/C=N/NC(C2SC3CCCCC=3C=2)=O)C=CC=1OC(C1OC=CC=1)=O [16, 406, 228, 608]\n4. CCC1C([R9])=CC(CN(C(CNC(CC23CC4CC(CC(C4)C2)C3[NpTa])=O)=O)C)=CC=1 [711, 490, 983, 722]\n5. C1([C2H5])C=CC=C2C(/C=C(/[CN])/C(NCCC3C([Rd])=C(Br)C=CC=3)=O)=CNC=12 [148, 611, 383, 791]\n6. CC(CCC(NC1C=CC(C(NC2C=CC([OCH3])=CC=2)=O)=CC=1)=O)=O [375, 803, 588, 963]", "role": "assistant" }, { "content": "Please output the coordinates of text 'temperature: AMBIENT stirring: CUSTOM was stirred for 5 h at RT' in the figure.", "role": "user" }, { "content": "[259, 36, 519, 181]", "role": "assistant" }, { "content": "stirring CUSTOM The resulting mixture was stirred at between 0 and 5° C. for 1.5 h", "role": "user" }, { "content": "[646, 737, 936, 933]", "role": "assistant" }, { "content": "temperature: 95.0 CELSIUS CUSTOM The resulting mixture was stirred at 95° C. for 12 h", "role": "user" }, { "content": "[286, 277, 618, 500]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_106.png" ]
[ { "content": "<image>Find and recognize all molecules and textual elements in the image.", "role": "user" }, { "content": "molecules:\n1. C[C@@H]1[C@H](C)[C@H](NC(CSc2[n](-c3cc(C)c([Asj])cc3OC)[n][n][n]2)=O)CCC1\n2. CC1N(C)N=C(C)C=1NC([C@H](OC(C1C(SCC(N(C([H])([H])[H])C)=O)=CC=CC=1)=O)C)=O\ntexts:\n1. AMBIENT stirring = CUSTOM The reaction mixture was then stirred at RT for 3 h", "role": "assistant" }, { "content": "What are the positions of the molecules shown in the graphic?", "role": "user" }, { "content": "[[375, 116, 730, 536], [44, 140, 335, 515]]", "role": "assistant" }, { "content": "List the coordinates of all textual elements in the figure.", "role": "user" }, { "content": "[[601, 585, 955, 883]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_22.png" ]
[ { "content": "<image>Can you output the coordinates of all molecules and any text in the image?", "role": "user" }, { "content": "[[253, 54, 626, 383], [618, 424, 937, 555], [62, 520, 471, 782], [230, 785, 530, 945]]", "role": "assistant" }, { "content": "What is the molecule found at these coordinates: [62, 520, 471, 782]?", "role": "user" }, { "content": "CC(C1C=CC(NC(OC[C@@H]2[NH+]3C[C@H](C#C)[C@@H](CC3)C2[Sy2])=O)=CC=1)=O", "role": "assistant" }, { "content": "[253, 54, 626, 383]", "role": "user" }, { "content": "CC=C1CCN(C(P(O[Ar])(O)=O)P(O)(O)=O)CC1", "role": "assistant" }, { "content": "What text is displayed at the location [230, 785, 530, 945]?", "role": "user" }, { "content": "temperature: 0.0 CELSIUS stirring CUSTOM stirred at 0° C. for 10 min", "role": "assistant" }, { "content": "[618, 424, 937, 555]", "role": "user" }, { "content": "CUSTOM with the mixture stirring", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_131.png" ]
[ { "content": "<image>Give the SMILES codes for the molecules shown in the figure.", "role": "user" }, { "content": "1. [NO2]C1C=CC(=CC=1)CON=C1C2[C@H]3[C@](OCC=C)(OC4C=CC(OC5C=C(C=O)C([Cr])=CC=5)=CC=4[C@H]3[C@H](CCCCO[X])[C@@H](CCCCO)C=2)[C@H](C1)N(CCOCCO)C([EtO])=O", "role": "assistant" }, { "content": "Please extract and display all text from the figure.", "role": "user" }, { "content": "1. temperature = 0.0 CELSIUS stirring = CUSTOM the mixture was stirred at 0° C. for 2 hours", "role": "assistant" }, { "content": "I'd like to know the positions of molecules [NO2]C1C=CC(=CC=1)CON=C1C2[C@H]3[C@](OCC=C)(OC4C=CC(OC5C=C(C=O)C([Cr])=CC=5)=CC=4[C@H]3[C@H](CCCCO[X])[C@@H](CCCCO)C=2)[C@H](C1)N(CCOCCO)C([EtO])=O shown in the visual.", "role": "user" }, { "content": "[89, 306, 579, 904]", "role": "assistant" }, { "content": "Can you pinpoint the coordinates of the text 'temperature = 0.0 CELSIUS stirring = CUSTOM the mixture was stirred at 0° C. for 2 hours' within the graphic?", "role": "user" }, { "content": "[621, 95, 910, 381]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_72.png" ]
[ { "content": "<image>List all the molecules that appear in the picture.", "role": "user" }, { "content": "1. c1([Me])ccc(NC(CN2C(=O)C(=O)N(c3cc(Cl)ccc3[OMe])C=C2)=O)cc1\n2. COC1C([GaH2])=CC(C([R5])C([OMe])=O)=C([OBn])C=1", "role": "assistant" }, { "content": "List every text element that appears in the image.", "role": "user" }, { "content": "1. AMBIENT stirring = CUSTOM by stirring at room temperature for 20 minutes", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_122.png" ]
[ { "content": "<image>Generate the SMILES codes for the molecules shown in the diagram.", "role": "user" }, { "content": "1. CC1C=CC(C)=C(NC(C2C(OCC[iPr])=CC=CC=2)=O)C=1\n2. CCCCOC(C1C2C([BrT])=C(Cl)C=CC=2N=C(C2C=CC(O[Me])=CC=2)C=1)=O", "role": "assistant" }, { "content": "Could you identify the positions of elements temperature = AMBIENT CUSTOM was stirred at rt for 16 hours", "role": "user" }, { "content": "[50, 244, 371, 390]", "role": "assistant" }, { "content": "CC1C=CC(C)=C(NC(C2C(OCC[iPr])=CC=CC=2)=O)C=1", "role": "user" }, { "content": "[423, 85, 724, 356]", "role": "assistant" }, { "content": "50.0 CELSIUS stirring CUSTOM the mixture was agitated under 20 psi of argon at 50° C. for 20 min", "role": "user" }, { "content": "[611, 420, 949, 734]", "role": "assistant" }, { "content": "CCCCOC(C1C2C([BrT])=C(Cl)C=CC=2N=C(C2C=CC(O[Me])=CC=2)C=1)=O", "role": "user" }, { "content": "[242, 560, 539, 914]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_21.png" ]
[ { "content": "<image>What is written at the coordinates [643, 404, 833, 598]?", "role": "user" }, { "content": "CUSTOM the mixture was stirred for 5 hours under a nitrogen atmosphere", "role": "assistant" }, { "content": "[11, 304, 354, 476]", "role": "user" }, { "content": "AMBIENT stirring CUSTOM The reaction mixture was stirred for 1 hour at room temperature under nitrogen", "role": "assistant" }, { "content": "List all the molecules depicted in the figure along with their coordinates.", "role": "user" }, { "content": "1. CC1OC(C=C[Ph])=CC=1 [204, 73, 532, 214]\n2. CC(C1C=CC(OCCN2CCOCC2)=CC=1)(C1C=CC=CC=1)C [670, 143, 988, 271]\n3. C1C[NH+](CC2N=C3N(C=CS3)C(=O)C=2[Tb])C[C@@H](C2SC3C(=CC=CC=3)N=2)C1 [365, 234, 625, 397]\n4. C1C=C2C(C(NCCC3C([Rf])=CC(Cl)=CC=3)=O)=CC(C3C=CC=NC=3[H])=NC2=CC=1 [442, 624, 823, 926]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_88.png" ]
[ { "content": "<image>Output all molecules and text found within the figure, making sure to represent the molecules by their SMILES strings.", "role": "user" }, { "content": "molecules:\n1. C([Bn])(NC(CC1C2C=CC(O)=CC=2OC(=O)C=1)=O)C([O-])=O\n2. CC([Si]([iPr])(C([Me])C)C#C/C(/CO)=C(/C#C[Si]([i-Pr])(C(C)C)C([Me])([Pmu])C)\\CO)C\n3. C([At3])C1C(C([H3CO])=O)=CC(S(C)(=O)=O)=C(C2C=CC(Cl)=CC=2Cl)C=1\ntexts:\n1. temperature: AMBIENT stirring CUSTOM the reaction was stirred at ambient temperature for 16 h\n2. temperature: 70.0 CELSIUS stirring CUSTOM the reaction mixture was stirred at 70° C. overnight", "role": "assistant" }, { "content": "Can you provide the coordinates for every molecule and the text present in the figure?", "role": "user" }, { "content": "[[20, 93, 295, 305], [343, 114, 671, 298], [196, 313, 678, 525], [185, 559, 556, 813], [595, 587, 979, 906]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_37.png" ]
[ { "content": "<image>Can you provide the coordinates for every molecule and the text present in the figure?", "role": "user" }, { "content": "[[53, 102, 302, 289], [326, 112, 555, 374], [272, 432, 518, 792], [592, 442, 946, 897]]", "role": "assistant" }, { "content": "What is the SMILES notation for the molecule at the specified location [326, 112, 555, 374]?", "role": "user" }, { "content": "c1ccc([C@@H](Sc2[n]c(-c3[s]ccc3[Tc])[nH][n]2)c2ccc(Cl)cc2)cc1", "role": "assistant" }, { "content": "[592, 442, 946, 897]", "role": "user" }, { "content": "C([C2H5])CCOC1C([R4])=CC(C2N(CC3C=CC=CC=3)C(=O)C(=O)/C/2=C(/O)\\C2C=CC(C([H])([H])[H])=CC=2)=CC=1[OMe]", "role": "assistant" }, { "content": "Can you reveal what's at the position [53, 102, 302, 289]?", "role": "user" }, { "content": "CUSTOM the mixture is kept stirred for 2 hours while the temperature", "role": "assistant" }, { "content": "[272, 432, 518, 792]", "role": "user" }, { "content": "temperature = 100.0 CELSIUS stirring: CUSTOM was stirred at 100° C. for 1 hour under nitrogen atmosphere", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_79.png" ]
[ { "content": "<image>Could you specify the locations for every element in the image?", "role": "user" }, { "content": "[[46, 85, 368, 237], [513, 100, 900, 238], [347, 261, 684, 400], [76, 385, 332, 492], [585, 415, 953, 610], [286, 625, 679, 914]]", "role": "assistant" }, { "content": "Please output the elements situated at the site of [286, 625, 679, 914].", "role": "user" }, { "content": "C1([CO2Et])C(C2C=CC3OCOC=3C=2)N2C(/C(/SC2=NC=1[Me])=C\\C1C(O)=CC=CC=1)=O", "role": "assistant" }, { "content": "[585, 415, 953, 610]", "role": "user" }, { "content": "C([Na])[NH+](CC(N[C@@H](C1C=CC(OC(F)F)=CC=1)C1C([Rd])=CC=CC=1)=O)CC1OC=CC=1", "role": "assistant" }, { "content": "[347, 261, 684, 400]", "role": "user" }, { "content": "temperature: 0.0 CELSIUS stirring: CUSTOM The mixture was stirred under nitrogen at 0° C", "role": "assistant" }, { "content": "[46, 85, 368, 237]", "role": "user" }, { "content": "N([Bu])(CC1([R12])C(=O)c2c(c(C)c(Cl)c3NC(=O)CCc32)CC1)CCC[Me]", "role": "assistant" }, { "content": "[76, 385, 332, 492]", "role": "user" }, { "content": "60.0 CELSIUS CUSTOM was stirred at 60° C. under N2 overnight", "role": "assistant" }, { "content": "[513, 100, 900, 238]", "role": "user" }, { "content": "temperature = 110.0 CELSIUS CUSTOM stirred at 110° C. for 24 hours", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_10.png" ]
[ { "content": "<image>What are the SMILES notations for the molecules in the provided image?", "role": "user" }, { "content": "1. C([Rd])C1Cc2[s]c(NC(Nc3cc([H])[s]c3C([OCH3])=O)=S)c(C([OCH3])=O)c2CC1\n2. CC1N=C(C2C([CAl])=CC=CC=2)C=C2C=CN(C3C=CC(OC)=C([MeO])C=3)C(=O)C=12", "role": "assistant" }, { "content": "Please display the complete text from the image.", "role": "user" }, { "content": "1. 20.0 CELSIUS CUSTOM The mixture is stirred at 20° C. for 3 h\n2. temperature AMBIENT stirring: CUSTOM The reaction was stirred at ambient temperature for 1.5 hours", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_3.png" ]
[ { "content": "<image>Can you extract and present all items in the image, including their location coordinates?", "role": "user" }, { "content": "molecules:\n1. CC1C=CC(C(N(C[Ph])C[Co9])=O)=CC=1 [400, 581, 914, 937]\ntexts:\n1. temperature: 2.5 2.5 CELSIUS stirring CUSTOM with stirring at 0-5° C. under N2 atmosphere portion-wise over a period of 30 minutes [85, 62, 641, 398]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_70.png" ]
[ { "content": "<image>Identify and output all the molecules and text within the figure, ensuring molecules are shown in SMILES format.", "role": "user" }, { "content": "molecules:\n1. CCN([LakHg])C(N([R7])C(CSC1SC(SC)=NN=1)=O)=O\n2. C[C@@]([(Es12)])(NC(CN1C(=O)N[C@](C2C=CC=C([A])C=2)(C([Ph])([H])[H])C1=O)=O)CCC(C)C\ntexts:\n1. 40.0 CELSIUS CUSTOM was stirred for 4 hours at 40° C", "role": "assistant" }, { "content": "I need the coordinates for every object depicted in the illustration.", "role": "user" }, { "content": "[[94, 124, 582, 318], [387, 321, 702, 505], [476, 553, 905, 875]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_28.png" ]
[ { "content": "<image>List the SMILES for each molecule displayed in the image.", "role": "user" }, { "content": "1. CC([R])(COC1C=C2N(C([H])([H])C([O(Bs)])C3C2=CC(OC)=C(OC)C=3)C(=O)N=1)C\n2. C1N(CC(NC2C=CC(OC3C=CC=CC=3)=CC=2)=O)C([Ho])CN(S(C2C=CC(F)=C([R8])C=2)(=O)=O)C1\n3. C([Me])(O)[C@H](NC([C@@H](NC([C@@H](NC([C@H]1N(C([C@@H](N)CS)=O)CCC1)=O)CC(C)C)=O)CCCN=C(N)N)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(NC([COOH])CS)=O)[C@H](O)C)=O)CC1NC=NC=1)=O)C([R3])O)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_53.png" ]
[ { "content": "<image>Identify all the molecules and text present in the image.", "role": "user" }, { "content": "molecules:\n1. C1C2C(C3SC4C(=CC=C([Es19])C=4)C=3)CN(C2)C1([H])[H]\n2. N1([Ph])C(=C(C(Nc2c(Cl)cccc2)=O)C#N)SC(Cc2ccc(Cl)c(Cl)c2)C1=O\n3. [OCH3]C1C=C(C2C3C(N([Me])C(N(C)C=3[N+]([R12])=C(N[S2])C=2C#N)=O)=O)C=CC=1[OEt]\n4. C[C@@H](O)[C@H](NC([C@@H](NC([C@@H](NC([C@@H](N)CCCC([Ra])N)=O)CC(C)C)=O)CC(C)C)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)CCC(N)=O)=O)C(C)C)=O)Cc1ccccc1)=O)Cc1ccc(O)cc1)=O)CCC(N)=O)=O\ntexts:\n1. stirring = CUSTOM the resulting biphasic mixture was vigorously stirred for 8.5 h\n2. stirring: CUSTOM The reaction was stirred overnight under N2", "role": "assistant" }, { "content": "I'd appreciate it if you could give me the positions for the text 'stirring: CUSTOM The reaction was stirred overnight under N2'.", "role": "user" }, { "content": "[735, 269, 957, 443]", "role": "assistant" }, { "content": "stirring = CUSTOM the resulting biphasic mixture was vigorously stirred for 8.5 h", "role": "user" }, { "content": "[42, 93, 259, 293]", "role": "assistant" }, { "content": "Give the coordinates correspond to molecules C1C2C(C3SC4C(=CC=C([Es19])C=4)C=3)CN(C2)C1([H])[H] as illustrated in the figure.", "role": "user" }, { "content": "[445, 98, 614, 182]", "role": "assistant" }, { "content": "C[C@@H](O)[C@H](NC([C@@H](NC([C@@H](NC([C@@H](N)CCCC([Ra])N)=O)CC(C)C)=O)CC(C)C)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)CCC(N)=O)=O)C(C)C)=O)Cc1ccccc1)=O)Cc1ccc(O)cc1)=O)CCC(N)=O)=O", "role": "user" }, { "content": "[494, 599, 783, 906]", "role": "assistant" }, { "content": "[OCH3]C1C=C(C2C3C(N([Me])C(N(C)C=3[N+]([R12])=C(N[S2])C=2C#N)=O)=O)C=CC=1[OEt]", "role": "user" }, { "content": "[154, 356, 412, 647]", "role": "assistant" }, { "content": "N1([Ph])C(=C(C(Nc2c(Cl)cccc2)=O)C#N)SC(Cc2ccc(Cl)c(Cl)c2)C1=O", "role": "user" }, { "content": "[422, 241, 705, 565]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_11.png" ]
[ { "content": "<image>Please output the entire textual content from the figure.", "role": "user" }, { "content": "1. AMBIENT stirring: CUSTOM was stirred under nitrogen at room temperature for 48 hrs", "role": "assistant" }, { "content": "Can you pinpoint the coordinates of the text 'AMBIENT stirring: CUSTOM was stirred under nitrogen at room temperature for 48 hrs' within the graphic?", "role": "user" }, { "content": "[17, 79, 525, 358]", "role": "assistant" }, { "content": "Please convert each molecule in the figure to its SMILES representation.", "role": "user" }, { "content": "1. CC(N(S(C1C=CC(Cl)=CC=1)(=O)=O)C1C=CC(OC[Er])=C([R10])C=1[MeO])C1N(N2CC[MeN]CC2)C(=O)C2C(=CC=CC=2)N=1", "role": "assistant" }, { "content": "Output the spatial coordinates of molecules CC(N(S(C1C=CC(Cl)=CC=1)(=O)=O)C1C=CC(OC[Er])=C([R10])C=1[MeO])C1N(N2CC[MeN]CC2)C(=O)C2C(=CC=CC=2)N=1 in the diagram.", "role": "user" }, { "content": "[505, 444, 982, 920]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_103.png" ]
[ { "content": "<image>Show all the written content from the picture.", "role": "user" }, { "content": "1. AMBIENT CUSTOM The resulting solution is stirred at room temperature for another 1.5 hours\n2. 10.0 CELSIUS stirring = CUSTOM the mixture is stirred for an additional 15 min in a semi\n3. temperature = AMBIENT stirring = CUSTOM was stirred at ambient temperature for 4 hours\n4. temperature: AMBIENT CUSTOM The solution is then stirred rt overnight", "role": "assistant" }, { "content": "Identify all the molecular structures in the image.", "role": "user" }, { "content": "1. CC1C2C(N)=C(C(C3C([Rc])=CC=C(Cl)C=3)=O)SC=2N=C(C)C=1\n2. C1C=CC(CCC(C2C(C3C=CC(Cl)=CC=3Cl)N(CC3C([Lv])=CC=CC=3)C(=O)C=2O)=O)=CC=1\n3. C([Ph])NC1SC=C(C(OCC(NCC2C(F)=CC=CC=2)=O)=O)N=1\n4. C([OEt])(c1c(-c2ccccc2)c2c(ccc(Cl)c2)[n]c1C)=O", "role": "assistant" }, { "content": "I would like to know the positions of the text 'AMBIENT CUSTOM The resulting solution is stirred at room temperature for another 1.5 hours'.", "role": "user" }, { "content": "[26, 114, 301, 255]", "role": "assistant" }, { "content": "temperature = AMBIENT stirring = CUSTOM was stirred at ambient temperature for 4 hours", "role": "user" }, { "content": "[205, 383, 419, 528]", "role": "assistant" }, { "content": "10.0 CELSIUS stirring = CUSTOM the mixture is stirred for an additional 15 min in a semi", "role": "user" }, { "content": "[546, 167, 726, 363]", "role": "assistant" }, { "content": "temperature: AMBIENT CUSTOM The solution is then stirred rt overnight", "role": "user" }, { "content": "[417, 735, 730, 902]", "role": "assistant" }, { "content": "Kindly provide the locations of molecules C([Ph])NC1SC=C(C(OCC(NCC2C(F)=CC=CC=2)=O)=O)N=1 as outlined in the figure.", "role": "user" }, { "content": "[423, 407, 603, 502]", "role": "assistant" }, { "content": "CC1C2C(N)=C(C(C3C([Rc])=CC=C(Cl)C=3)=O)SC=2N=C(C)C=1", "role": "user" }, { "content": "[326, 90, 534, 343]", "role": "assistant" }, { "content": "C1C=CC(CCC(C2C(C3C=CC(Cl)=CC=3Cl)N(CC3C([Lv])=CC=CC=3)C(=O)C=2O)=O)=CC=1", "role": "user" }, { "content": "[711, 385, 973, 693]", "role": "assistant" }, { "content": "C([OEt])(c1c(-c2ccccc2)c2c(ccc(Cl)c2)[n]c1C)=O", "role": "user" }, { "content": "[129, 552, 343, 909]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_86.png" ]
[ { "content": "<image>Please share the coordinates of all molecules and text from the figure.", "role": "user" }, { "content": "[[104, 149, 727, 371], [367, 444, 895, 850]]", "role": "assistant" }, { "content": "Please output the elements situated at the site of [367, 444, 895, 850].", "role": "user" }, { "content": "CC1C=CC(S(N(C2C=CC(Cl)=C(C(F)(F)F)C=2)CC(NC2CC2)=O)(=O)=O)=CC=1", "role": "assistant" }, { "content": "[104, 149, 727, 371]", "role": "user" }, { "content": "temperature = 25.0 CELSIUS CUSTOM was stirred at 25° C. for 0.5 hour", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_44.png" ]
[ { "content": "<image>Can you specify where the text '80.0 CELSIUS stirring = CUSTOM After stirring for one hour' is located in the figure?", "role": "user" }, { "content": "[405, 592, 567, 840]", "role": "assistant" }, { "content": "temperature 90.0 CELSIUS CUSTOM stirred for 18 hours under air atmosphere while air", "role": "user" }, { "content": "[599, 116, 885, 341]", "role": "assistant" }, { "content": "temperature: 80.0 CELSIUS CUSTOM The reaction mixture was stirred at 80° C. for 1 hour", "role": "user" }, { "content": "[336, 23, 577, 341]", "role": "assistant" }, { "content": "Outline the molecules in the image and their corresponding locations in coordinate form.", "role": "user" }, { "content": "1. C([i-Bu])(NC(NCC1C=CC([R7])=CC=1)=S)=O [274, 341, 565, 586]\n2. [Ph]C([Ph])(c1ccccc1)SCC([NHBoc])CN1CCN([C@@H]2c3[n]cc(Br)cc3CCc3cc(Cl)ccc23)CC1[Ar] [618, 569, 944, 976]\n3. COC1C=CC(OC([R8])CN2CCC(C3SC4C(=CC=CC=4)N=3)CC2)=CC=1[Og3] [55, 595, 327, 791]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_111.png" ]
[ { "content": "<image>Can you enumerate the coordinates of the molecules in the picture?", "role": "user" }, { "content": "[[343, 37, 543, 229], [609, 171, 796, 280], [143, 249, 291, 385], [544, 380, 761, 582], [112, 459, 299, 560], [22, 579, 208, 787], [431, 599, 653, 713], [746, 660, 977, 962], [270, 743, 522, 920]]", "role": "assistant" }, { "content": "Can you enumerate the coordinates of all text in the picture?", "role": "user" }, { "content": "[[313, 229, 537, 424], [787, 527, 967, 632]]", "role": "assistant" }, { "content": "Please provide the SMILES for the item at [609, 171, 796, 280].", "role": "user" }, { "content": "CN(S(c1c([Rc])cc([N+]([O-])=O)cc1)(=O)=O)CCCC(NNC(c1[n]cccc1)=O)=O", "role": "assistant" }, { "content": "[22, 579, 208, 787]", "role": "user" }, { "content": "C([LvC3])COC1C=CC(C(OCC2C([NC])=CC=CC=2)=O)=CC=1OC([R10])C", "role": "assistant" }, { "content": "[746, 660, 977, 962]", "role": "user" }, { "content": "[OCH3]C1C=C2C(=CC=1[OCH3])CC[N+]1(CC=C[Eu])C2C2C(CC1[A])=CC=CC=2", "role": "assistant" }, { "content": "[544, 380, 761, 582]", "role": "user" }, { "content": "COC(OC)CCOCC1C=C([H])C=C([Y])C=1[GaH2]", "role": "assistant" }, { "content": "[270, 743, 522, 920]", "role": "user" }, { "content": "Cc1cccc(CCNc2[n]3c([n]c4c3cccc4[(NhQ)No])c([NC])c(C)c2)c1", "role": "assistant" }, { "content": "[143, 249, 291, 385]", "role": "user" }, { "content": "C1C=C(CC([CN])C(O)=O)C(O)=CC=1", "role": "assistant" }, { "content": "[431, 599, 653, 713]", "role": "user" }, { "content": "CC1N(C2C=CC(C([O-])=O)=C([R3])C=2)C([Me])=C(/C=C2\\C(NC(N(C([SrAm17])C[MeO])C\\2=O)=S)=O)C=1", "role": "assistant" }, { "content": "[343, 37, 543, 229]", "role": "user" }, { "content": "CC(S(/C(/C#N)=C\\N/N=C\\C1C(Cl)=CC=CC=1Cl)(=O)=O)(C)C", "role": "assistant" }, { "content": "[112, 459, 299, 560]", "role": "user" }, { "content": "CC1C=C([R6])C(S(N[C@@H](C(OCC(NC2C=C(C)ON=2)=O)=O)CC([Me])C)(=O)=O)=CC=1", "role": "assistant" }, { "content": "Please tell me the text present at [787, 527, 967, 632].", "role": "user" }, { "content": "CUSTOM the whole was stirred for 5 hrs", "role": "assistant" }, { "content": "[313, 229, 537, 424]", "role": "user" }, { "content": "temperature = AMBIENT CUSTOM The mixture was stirred overnight at room temperature after which time the resulting solution", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_104.png" ]
[ { "content": "<image>Please recognize all the molecules and text in the image.Please output all objects in the figure, where molecules should be represented by their corresponding SMILES.", "role": "user" }, { "content": "molecules:\n1. [Me][C@@]12CCC(=O)[C@@](C)([C@H]1C([R12])CC1C2=COC=1)CCC([Et])=O\n2. CC(N1CCC(S(C2C=CC(OC)=CC=2)(=O)=O)(C(NO[DyCe])=O)CC1)(C[R10])C\n3. C1C2C(C(NC3C=C([Sg16])C(Br)=CC=3)=O)CN(CC2)C1\n4. [OCH3]C1C=CC(=CC=1[H3CO])C(=O)N=C1N(C2C=CC([N+]([O-])=O)=C([BaT])C=2S1)CC[H3CO]\n5. CC1C=CC(CN(C(C2OC3C(OC)=CC=CC=3C=2)=O)[C@H]2[C@H](O)[C@@]([R5])(OC3C(I)=C([H])C(C=O)=CC=3[OCH3])C=C(C(NCCO)=O)C2)=CC=1\n6. C([R10])C1NC=NC=1CC1C(=O)C2C3C(N(C)C=2CCC1)=CC=C([Rn(B18Bi)7])C=3\n7. C1([Er])C=NC=C(C2SC(N)=NC=2C2C=CC(O)=C([H])C=2)C=1\ntexts:\n1. temperature: -78.0 CELSIUS CUSTOM The resulting yellow mixture was stirred at -78° C. for 45 min\n2. stirring = CUSTOM the mixture was stirred 2 hrs", "role": "assistant" }, { "content": "Can you show the positions of all text found in the picture?", "role": "user" }, { "content": "[[619, 162, 974, 325], [251, 241, 472, 351]]", "role": "assistant" }, { "content": "Identify the positions of all molecules shown in the graphic.", "role": "user" }, { "content": "[[321, 76, 510, 227], [50, 227, 227, 385], [723, 347, 923, 477], [510, 379, 715, 546], [25, 409, 321, 666], [586, 558, 790, 728], [304, 688, 530, 923]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_92.png" ]
[ { "content": "<image>Please output all the molecules and text in the figure, where the molecules should be represented by their corresponding SMILES.", "role": "user" }, { "content": "molecules:\n1. CC1OC(=O)C2C(C3C=CC(OC)=C([H3CO])C=3)C([N+]([O-])=O)=C(N)OC=2C=1\n2. CC(O[Si](C[A])(C)C)(C1C=CC=NC=1)C#CC1C=CC=CC=1\n3. CCCCSC([Cm12])([Q])/C(/C)=C/Cl\n4. CC1C=CC(NC(NC(C([Cs])N(CC(NC2C(C)=CC=CC=2C)=O)C)=O)=O)=C(C)C=1\n5. CC(N(S(C)(=O)=O)C1C([R12])=CC(F)=CC=1)C(NC1C=CC=NC=1)=O\n6. C1([MeO])C=C([R1])C(C2N3N=CC4C(SC3=NN=2)=NC2C(=CC([At])=CC=2)C=4)=CC=1\ntexts:\n1. temperature: AMBIENT CUSTOM kept stirring for 2 hours under nitrogen\n2. AMBIENT CUSTOM The reaction was stirred over 14 h\n3. temperature AMBIENT CUSTOM was stirred at room temperature under nitrogen for 3 1/2 hours\n4. temperature 100.0 CELSIUS CUSTOM the mixture was stirred at 100° C. for 1.5 hours under argon atmosphere\n5. -10.0 CELSIUS CUSTOM with stirring over about ten minutes\n6. temperature = 5.0 CELSIUS CUSTOM stirred for 1 h", "role": "assistant" }, { "content": "What are the positions of the molecules in the provided illustration?", "role": "user" }, { "content": "[[578, 69, 844, 342], [103, 237, 304, 494], [386, 409, 532, 501], [615, 659, 874, 767], [12, 684, 249, 857], [590, 779, 828, 930]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_110.png" ]
[ { "content": "<image>I need the coordinates of every molecule and text shown in the figure.", "role": "user" }, { "content": "[[83, 93, 420, 194], [232, 239, 642, 490], [389, 501, 926, 906], [73, 512, 347, 723]]", "role": "assistant" }, { "content": "List all molecules and text found in the figure, using SMILES notation for the molecules.", "role": "user" }, { "content": "molecules:\n1. [Ph]C1C=CC([MeO])=C(NC2C3CC4CC(C3)CC2C4)C=1\n2. [MeS]C1N=C(SC2C(NC(C3C([Ra])=CC(Cl)=C(Cl)C=3)=O)=CC=CC=2)C(=CN=1)C(=O)O[C2H5]\ntexts:\n1. CUSTOM Solution was stirred overnight\n2. stirring: CUSTOM The mixture is stirred at 0° for 0.5 hour", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_51.png" ]
[ { "content": "<image>Please share the coordinates of all molecules and text from the figure.", "role": "user" }, { "content": "[[149, 127, 468, 514], [539, 291, 932, 457], [67, 558, 518, 872]]", "role": "assistant" }, { "content": "Identify each molecule present in the picture.", "role": "user" }, { "content": "1. C1([MeN]C([CN])[C@H]2C3C(=C([PrSb])C([H])=CC=3)C[C@@H]2/C=C/SC2C=CC=CC=2)C=CC=CC=1\n2. CC12C3C(OC(C4(C)OC(=O)C5(O)C64OC(OC3([H])[H])(C3C(CC5)C4(C)C(CC=C([BiH2])C4=O)=C([Ra])C3)C(=O)C61)C2)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_65.png" ]
[ { "content": "<image>Could you specify the locations for every element in the image?", "role": "user" }, { "content": "[[530, 73, 860, 452], [72, 96, 444, 538], [545, 479, 927, 926], [165, 584, 459, 894]]", "role": "assistant" }, { "content": "Identify every object shown in the illustration.", "role": "user" }, { "content": "molecules:\n1. CC(S[C@@H]1O[C@@H]2COC([Ph])O[C@@H]2C([OAc])[C@H]1O[C@@H]1OCC([OBz])[C@H](OC([Ph])=O)C1[OBz])C\n2. COC1C2C(=CC([Rh])=CC=2)C(C2N=C(N(C(/C=C/C3OC=CC=3)=O)CC3C=CC=CC=3)SC=2)=CC=1\ntexts:\n1. temperature: 20.0 CELSIUS CUSTOM After stirring overnight at a temperature in the region of 20° C.\n2. stirring: CUSTOM the reaction mixture was stirred for about 30 minutes", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_38.png" ]
[ { "content": "<image>Please output all the molecules and text in the figure, where the molecules should be represented by their corresponding SMILES.", "role": "user" }, { "content": "molecules:\n1. C1N(C(C2C([HfTs])=CC=C(NC(C(C3C=CC=CC=3)C3C=C([H])C=CC=3)=O)C=2)=O)CCOC1\n2. C([Me])(NC([C@H](O)CNC(C)C)=O)[C@]1([H])OC2C(=CC=C([R])C=2)OC1\n3. [OCH3]C(=O)/C=C1\\SC(N(C([Eu])Cc2[s]cc([R2])c2)C\\1=O)=Nc1ccc([CO2Et])cc1\n4. C([Me])OC1C=C(/C=N\\NC(C2C(OC([La])C3C=CC=CC=3)=CC([Ra])=CC=2)=O)C=CC=1O[Bz]\n5. C([Ar])C([Me])([ScpPd])CC(O[C@@H]1[C@@H](C([Me])(O[C@@H]2OC[C@@H](OC(C)=O)C([OAc])C2[OAc])C)C[C@@]2(C)[C@@H](CCC2)C(=C)C1)=O\n6. CC1C2COC(C3C=CC=CC=3)C(C2)C(=CCC=C(C)C)C1\ntexts:\n1. CUSTOM after stirring for 0.67 hours\n2. AMBIENT CUSTOM The reaction was stirred overnight at room temperature\n3. temperature: -78.0 CELSIUS stirring = CUSTOM The resulting solution was stirred for 10 minutes\n4. temperature = 85.0 CELSIUS CUSTOM The reaction mixture was stirred at 85° C. for 6 h", "role": "assistant" }, { "content": "Please extract the coordinates of the objects AMBIENT CUSTOM The reaction was stirred overnight at room temperature from the figure.", "role": "user" }, { "content": "[131, 416, 288, 516]", "role": "assistant" }, { "content": "C([Ar])C([Me])([ScpPd])CC(O[C@@H]1[C@@H](C([Me])(O[C@@H]2OC[C@@H](OC(C)=O)C([OAc])C2[OAc])C)C[C@@]2(C)[C@@H](CCC2)C(=C)C1)=O", "role": "user" }, { "content": "[719, 495, 991, 750]", "role": "assistant" }, { "content": "[OCH3]C(=O)/C=C1\\SC(N(C([Eu])Cc2[s]cc([R2])c2)C\\1=O)=Nc1ccc([CO2Et])cc1", "role": "user" }, { "content": "[683, 272, 905, 431]", "role": "assistant" }, { "content": "C([Me])(NC([C@H](O)CNC(C)C)=O)[C@]1([H])OC2C(=CC=C([R])C=2)OC1", "role": "user" }, { "content": "[293, 247, 497, 349]", "role": "assistant" }, { "content": "CUSTOM after stirring for 0.67 hours", "role": "user" }, { "content": "[64, 324, 263, 396]", "role": "assistant" }, { "content": "CC1C2COC(C3C=CC=CC=3)C(C2)C(=CCC=C(C)C)C1", "role": "user" }, { "content": "[380, 763, 598, 963]", "role": "assistant" }, { "content": "temperature: -78.0 CELSIUS stirring = CUSTOM The resulting solution was stirred for 10 minutes", "role": "user" }, { "content": "[8, 609, 204, 735]", "role": "assistant" }, { "content": "temperature = 85.0 CELSIUS CUSTOM The reaction mixture was stirred at 85° C. for 6 h", "role": "user" }, { "content": "[221, 609, 390, 753]", "role": "assistant" }, { "content": "C1N(C(C2C([HfTs])=CC=C(NC(C(C3C=CC=CC=3)C3C=C([H])C=CC=3)=O)C=2)=O)CCOC1", "role": "user" }, { "content": "[528, 36, 738, 234]", "role": "assistant" }, { "content": "C([Me])OC1C=C(/C=N\\NC(C2C(OC([La])C3C=CC=CC=3)=CC([Ra])=CC=2)=O)C=CC=1O[Bz]", "role": "user" }, { "content": "[339, 377, 627, 568]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_45.png" ]
[ { "content": "<image>Please provide the SMILES of the molecules shown in the illustration and their respective coordinates.", "role": "user" }, { "content": "1. C/C(/CC(N([H])C1C([SnH])=C2C(C3C(O2)=CC=CC=3[R7])=CC=1[OMe])=O)=N\\NC(C1C(Cl)=CC=CC=1)=O [743, 58, 989, 218]\n2. C([Am])CN(C(O[Me])=O)CN1C(C(F)(F)F)=NC2C1=C1OC(F)(F)C(F)(F)OC1=CC=2Br [512, 170, 738, 495]\n3. C1C([R2])=C(C(NCC2OC=CC=2)=O)C(NC(CSCC2C=CC([O2N])=CC=2)=O)=C([Xe])C=1 [58, 177, 241, 303]\n4. c1c([H])c(/C=C/C(c2cc(Cl)ccc2OC(c2occc2)=O)=O)c(F)cc1 [61, 306, 238, 515]\n5. c1[n]c[n](-c2cc3N(C[COOH])C(C(Nc3cc2[O2N])=O)=O)c1 [405, 542, 614, 764]\n6. C[C@@H]1[C@@]2(C)C[C@H](C(C(O)=O)=C)CC(=O)[C@H]2CCC1 [170, 570, 345, 786]", "role": "assistant" }, { "content": "Could you show me where the text 'temperature 31.0 CELSIUS stirring CUSTOM The reaction mixture was stirred for 16 h at 31° C' is positioned in the figure?", "role": "user" }, { "content": "[394, 771, 615, 941]", "role": "assistant" }, { "content": "-78.0 CELSIUS stirring CUSTOM stir bar", "role": "user" }, { "content": "[346, 80, 498, 162]", "role": "assistant" }, { "content": "temperature = 5.0 CELSIUS CUSTOM of stirring at 5° C", "role": "user" }, { "content": "[10, 540, 157, 629]", "role": "assistant" }, { "content": "AMBIENT CUSTOM the reaction was stirred at room temperature under N2 for 48 h", "role": "user" }, { "content": "[280, 170, 474, 286]", "role": "assistant" }, { "content": "140.0 CELSIUS stirring = CUSTOM The resulting solution was stirred for 3 hours at 140° C.", "role": "user" }, { "content": "[256, 377, 462, 517]", "role": "assistant" }, { "content": "temperature AMBIENT stirring CUSTOM the reaction mixture is stirred for about 20 hours at room temperature", "role": "user" }, { "content": "[685, 538, 967, 685]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_105.png" ]
[ { "content": "<image>Extract every piece of text visible in the image.", "role": "user" }, { "content": "1. temperature: 40.0 CELSIUS stirring CUSTOM The whole mixture was stirred for 15 minutes\n2. temperature = 23.0 CELSIUS stirring = CUSTOM was stirred", "role": "assistant" }, { "content": "Please output the coordinates of text 'temperature: 40.0 CELSIUS stirring CUSTOM The whole mixture was stirred for 15 minutes' in the figure.", "role": "user" }, { "content": "[372, 108, 701, 262]", "role": "assistant" }, { "content": "temperature = 23.0 CELSIUS stirring = CUSTOM was stirred", "role": "user" }, { "content": "[521, 290, 751, 459]", "role": "assistant" }, { "content": "List the SMILES for each molecule displayed in the image.", "role": "user" }, { "content": "1. CC1C=CC(N2C(SCC(NC3C=CC(OC)=C(OC)C=3)=O)=NN=C2C2C=CN=CC=2)=CC=1\n2. CC([H])([H])OC(C([CO2Et])NC1C=CC(C[Ga16AumC])=C(C)C=1)=O\n3. C1([R8])C(C[C@H](NC(CNC([C@@H](NC([C@@H](N)CCCN=C(N)N)=O)CC([H])([H])C(N)=O)=O)=O)C(O)=O)=CC=C(O)C=1", "role": "assistant" }, { "content": "Output the positions for molecules CC1C=CC(N2C(SCC(NC3C=CC(OC)=C(OC)C=3)=O)=NN=C2C2C=CN=CC=2)=CC=1 in the illustration.", "role": "user" }, { "content": "[9, 403, 286, 587]", "role": "assistant" }, { "content": "CC([H])([H])OC(C([CO2Et])NC1C=CC(C[Ga16AumC])=C(C)C=1)=O", "role": "user" }, { "content": "[310, 466, 598, 628]", "role": "assistant" }, { "content": "C1([R8])C(C[C@H](NC(CNC([C@@H](NC([C@@H](N)CCCN=C(N)N)=O)CC([H])([H])C(N)=O)=O)=O)C(O)=O)=CC=C(O)C=1", "role": "user" }, { "content": "[637, 598, 990, 891]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_83.png" ]
[ { "content": "<image>Give me the coordinates of all molecules depicted in the image.", "role": "user" }, { "content": "[[65, 130, 238, 331], [609, 186, 786, 352], [224, 368, 415, 536], [486, 421, 733, 720], [26, 559, 214, 743], [314, 782, 545, 985]]", "role": "assistant" }, { "content": "What molecule can be found at the coordinates [224, 368, 415, 536]?", "role": "user" }, { "content": "COC([C@@H]1NC2C=C([PuCZn])C(Br)=CC=2CC1)=O", "role": "assistant" }, { "content": "[26, 559, 214, 743]", "role": "user" }, { "content": "Cc1ccc(SCC(Nc2cc(C(F)(F)F)cc([Rc])c2)=O)c(C)c1", "role": "assistant" }, { "content": "[609, 186, 786, 352]", "role": "user" }, { "content": "CC1C=CC(C(NC(NC2C([COOH])=CC=CC=2)=S)=O)=CC=1", "role": "assistant" }, { "content": "[65, 130, 238, 331]", "role": "user" }, { "content": "CC1[C@@]([H])(/C=C/C(C)=O)C(C)(C)C[C@H](O)C=1", "role": "assistant" }, { "content": "[314, 782, 545, 985]", "role": "user" }, { "content": "C([C2H5])CN(C(CN(C(C1C=CC(C)=CC=1)=O)C([Et])C[SeY])=O)CC1N(CC2C=CC(Br)=CC=2)C=CC=1", "role": "assistant" }, { "content": "[486, 421, 733, 720]", "role": "user" }, { "content": "C1C(NCC2C([H])=CC(Cl)=CC=2Cl)=CC2C(=NN(CC(O)(C3C=CC(F)=CC=3F)CN3N=CN=C3)C=2)C=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_77.png" ]
[ { "content": "<image>Translate the structure of each molecule in the image into SMILES.", "role": "user" }, { "content": "1. CCOc1ccc2[nH]c3C(=O)N(CCc4ccc(F)cc4)C=Nc3c2c1\n2. CC1N2C(=NN=C2[C@@]([A])([NH3+])CC(C)C)N=C(C)C=1\n3. C([n-Bu])[C@H]([SH2+]([Ph])C[Ta])[C@H](C[HO2C])C\n4. C([Am])C1N(CC(O)CO)CC2C(N)=NC(N)=NC1=2", "role": "assistant" }, { "content": "Provide all the written information found in the image.", "role": "user" }, { "content": "1. temperature AMBIENT CUSTOM stirred at RT for 2 hrs", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_50.png" ]
[ { "content": "<image>Could you provide the coordinates for each object in the diagram?", "role": "user" }, { "content": "[[249, 30, 422, 160], [433, 178, 661, 323], [271, 187, 432, 307], [675, 195, 980, 314], [19, 305, 227, 377], [363, 336, 512, 439], [194, 378, 319, 567], [661, 384, 858, 628], [32, 394, 184, 507], [450, 452, 643, 664], [263, 570, 420, 680], [169, 703, 388, 969]]", "role": "assistant" }, { "content": "What are the SMILES strings for the molecules illustrated in the picture?", "role": "user" }, { "content": "1. C([(Yb12)])COC1C=CC(C(OCC(N2C[C@@H](C)C[C@@H](C)C2)=O)=O)=CC=1[O2N]\n2. CC[C@@]([Zrh])(C1C=CC=CC=1)CNC(C[NH+]1CCN(S(C2SC=CC=2)(=O)=O)CC1)=O\n3. CC1C2[C@@H](C3C=C(Br)C=CC=3O[Me])N3C(=NC=2N(C2C=C([Rd])C=CC=2)N=1)C(=O)NC1C3=CC=CC=1\n4. CC1OC(=O)CC1[NH+]([Bn])[R3]\n5. CC([R9])OC(C1C(C)=C(C(COC(CSCC2C(C)=NOC=2C)=O)=O)NC=1C)=O\n6. CC1N(C(/C=C/c2ccc(Cl)cc2CN2CCN(C)CC2)=O)CCN(Cc2ccc(F)cc2)C1", "role": "assistant" }, { "content": "Show all the written content from the picture.", "role": "user" }, { "content": "1. 0.0 CELSIUS stirring = CUSTOM stir for 30 minutes at 0° C. under N2\n2. -15.0 15.0 CELSIUS stirring: CUSTOM The mixture was stirred at −30 to 0° C. for 3 hours\n3. temperature: AMBIENT CUSTOM to stir for 5 min.\n4. stirring = CUSTOM The mixture was stirred (2 hours)\n5. temperature: 90.0 CELSIUS CUSTOM The resulting solution was stirred at 90° C. for 5 hours\n6. stirring CUSTOM stirred for 1 h under nitrogen atmosphere", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_113.png" ]
[ { "content": "<image>What text appears at the specified position [152, 300, 416, 491]?", "role": "user" }, { "content": "temperature: 110.0 CELSIUS stirring CUSTOM to be sufficiently stirred at a temperature of 110° C", "role": "assistant" }, { "content": "[722, 277, 929, 409]", "role": "user" }, { "content": "AMBIENT stirring CUSTOM was complete stirring at room temperature", "role": "assistant" }, { "content": "[265, 94, 491, 275]", "role": "user" }, { "content": "70.0 CELSIUS stirring = CUSTOM stirring the reaction mixture for 3 h at 70° C.", "role": "assistant" }, { "content": "[476, 336, 692, 403]", "role": "user" }, { "content": "stirring CUSTOM the mixture vigorously stirred", "role": "assistant" }, { "content": "Please specify the molecules represented in the figure and their coordinate positions.", "role": "user" }, { "content": "1. C1([OMe])C=CC(/C=C2/C(N(C3C([Rd])=CC4OCOC=4C=3)C(S/2)=N)=O)=CC=1OC [523, 130, 796, 266]\n2. CC1C(C(OCC(NC(C2C=CC(OC(F)F)=CC=2)=O)=O)=O)=C(C(C[R9])C)ON=1 [619, 432, 916, 596]\n3. [H3CO]CC(=O)N1C([MeN]C2C=CC=CC=2)=CC2([Ph])N(C3C1=CC=CC=3)C(=O)C2[H3CO] [70, 531, 371, 905]\n4. CCOC(C1C(C2SC=CC=2[(H)Ti])N2C(/C(/SC2=NC=1C)=C/C1C=C(Br)C(O)=C(Br)C=1)=O)=O [407, 596, 735, 797]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_126.png" ]
[ { "content": "<image>Extract and enumerate each entity from the figure, specifying molecules through their SMILES representations.", "role": "user" }, { "content": "molecules:\n1. C([Et])([DbTc13(EsH)Br6Fe])c1c(NC(N(C([Ph])C)C2C3=Nc4ccc(F)cc4C(=O)N3CCC2)=O)cccc1\n2. [O2N]c1ccc([Me])c(S(N2CCN(CC(Cl)=C)C([MgS])([Z])C2)(=O)=O)c1\n3. [Me]OC1C=C(/C=N\\NC([C@@H]2OC3C(=CC=CC=3)OC2)=O)C=CC=1OCC(=O)NC[Me]\n4. CC([UR])CN(S(c1c(C)cc(C[R3])cc1C)(=O)=O)CC(Nc1c(Oc2ccccc2)cccc1)=O\n5. C1N(C2C=CC(NC(C3SC4C5C(SC=4C=3)=C([H])C=CC=5)=O)=CC=2S(NC2C(Cl)=CC=CC=2)(=O)=O)CCOC1\n6. CCCC([H])([H])N1C(=O)/C(=C2/C(N(C([InH2])(C)C)C(S/2)=S)=O)/C2C=C(Br)C=CC1=2\ntexts:\n1. temperature: 60.0 CELSIUS stirring: CUSTOM with stirring at 60° C. for 4 days\n2. temperature 60.0 CELSIUS stirring = CUSTOM let stir overnight", "role": "assistant" }, { "content": "Identify the positions of all molecules shown in the graphic.", "role": "user" }, { "content": "[[602, 184, 927, 408], [371, 196, 583, 352], [366, 405, 586, 706], [109, 522, 319, 701], [602, 552, 903, 801], [368, 708, 568, 950]]", "role": "assistant" }, { "content": "Identify the coordinates for all text in the image.", "role": "user" }, { "content": "[[259, 49, 533, 186], [72, 380, 326, 501]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_34.png" ]
[ { "content": "<image>Generate the SMILES codes for the molecules shown in the diagram.", "role": "user" }, { "content": "1. C([Ph])C(Nc1ccc(F)cc1)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_91.png" ]
[ { "content": "<image>Would you mind sharing the coordinates of each item in the figure?", "role": "user" }, { "content": "[[103, 69, 354, 147], [677, 153, 946, 337], [320, 166, 642, 351], [77, 258, 311, 460], [449, 351, 571, 515], [254, 500, 443, 588], [53, 517, 247, 664], [455, 593, 701, 930]]", "role": "assistant" }, { "content": "Give the SMILES codes for the molecules shown in the figure.", "role": "user" }, { "content": "1. C([H])([H])([H])C1C(C(O[C@H](C(N([R10])C2N=CC(Cl)=CC=2Cl)=O)C[BKR])=O)=C(Cl)N=C(C)C=1\n2. c1ccc(-[n+]2cc(C([CN])=C=[N-])o[n]2)cc1\n3. CC(CC([Ph])NC(COC(CCC(C1C=CC(F)=C([ErEsa])C=1)=O)=O)=O)C\n4. CC1C=CC(O)=C(NC(N[C@H](NC(C2C(F)=CC=CC=2)=O)C(Cl)(Cl)Cl)=S)C=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_127.png" ]
[ { "content": "<image>List all the molecules that appear in the picture.", "role": "user" }, { "content": "1. CC(SC1C2C(=C(Br)C=CC=2)C=C2C=1C=CC=C2)(C)C\n2. C([H])([H])([H])CCCN(C(CN(C1C=CC2C(=CC=CC=2)C=1)C)=O)[C@H]1CS(=O)(=O)CC1\n3. Cc1[n](-c2cc([Hg])c(Cl)c(C(OCC(NCc3occc3)=O)=O)[n]2)[n]c(C)c1\n4. C=CCN1C(=O)SC(=CC2C=CC(OC([H])([H])C3C([PdtDsTi9])=CC=C(C(O)=O)C=3)=C(Br)C=2)C1=O\n5. CCN(C([Tev])CN1C2C(C3N=C(C)N(CC([Rd])N(CC)CC)C=3C(=O)C=2N=C1C)=O)CC\n6. C([TlH12])C1N=C(Cl)C2N(C=C([R4])N=2)C=1\n7. C1CN2c3c(C([R3])C([(PoN)12])C2=O)cc(S(N2CCC(C(N)=O)CC2)(=O)=O)cc3C1", "role": "assistant" }, { "content": "Show all the written content from the picture.", "role": "user" }, { "content": "1. temperature = 0.0 CELSIUS stirring: CUSTOM Mixture stirred at 0° C. for 40 minutes\n2. 160.0 CELSIUS stirring CUSTOM The reaction mixture was stirred for 90 min\n3. 45.0 CELSIUS stirring = CUSTOM After stirring for one hour the reaction", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_78.png" ]
[ { "content": "<image>Please outline the contents of the figure, including a list of items and their respective coordinates.", "role": "user" }, { "content": "molecules:\n1. C1C([Q])CN(C2CS(=O)(=O)CC2)C([Zng3])CC1 [549, 17, 700, 227]\n2. C([OMe])(C1C([R9])CN(C2C3C(=CC([(Es)8])=CC=3)S(=O)(=O)N=2)CC1)=O [29, 39, 224, 210]\n3. CC1C=CC(OC[Ba8ArNh])=C(COC(C2C(C(C3SC=CC=3)=O)=CC=CC=2)=O)C=1 [765, 124, 970, 395]\n4. CC1C=CC(C(OCN2NCC(=O)[N-]C2=O)=O)=CC=1 [70, 409, 235, 536]\n5. CN(C[Ph])CCNC(N([Rb])[C@H]1CN(C2C=C([CdRg])C=CC=2)C(=O)C1)=O [479, 424, 738, 607]\n6. C1CCC(Cl)/C(=N/O)/CCC1[F9] [219, 655, 416, 936]\ntexts:\n1. stirring: CUSTOM by stirring under positive argon pressure in the ice bath for 1-2 more minutes [249, 80, 503, 256]\n2. temperature = 40.0 CELSIUS CUSTOM After the introduction, the mixture was stirred at 40°-45° C. for two hours [245, 288, 433, 538]\n3. temperature AMBIENT stirring CUSTOM This was stirred at room temperature for 10 min [526, 612, 729, 792]\n4. temperature = AMBIENT CUSTOM The resulting mixture was stirred for 3 h at room temperature [536, 811, 780, 982]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_56.png" ]
[ { "content": "<image>I need the coordinates for each molecule and text shown in the figure.", "role": "user" }, { "content": "[[294, 76, 541, 303], [574, 175, 815, 293], [738, 311, 953, 385], [33, 313, 235, 464], [500, 341, 731, 466], [261, 427, 476, 577], [757, 471, 966, 617], [286, 592, 507, 737], [553, 656, 853, 923]]", "role": "assistant" }, { "content": "List the SMILES for each molecule displayed in the image.", "role": "user" }, { "content": "1. C([R5])C(c1cc(Br)ccc1Br)=O\n2. C([R10])C([H])([H])N1C(=O)C(=O)N(CC(NC2C(O[C2H5])=CC=CC=2)=O)CC1\n3. C/C(/c1ccc(OC[Cbm])c(OC)c1)=N\\NC(c1[n][n][n](-c2c(N)[n]o[n]2)c1CN1CCCCC1[R9])=O\n4. CCCCOC(/C(/C=C/C1C([R10])=CC=CC=1)=C(/[Hg])/C1C=CC=CC=1)=O\n5. CCOC1C=C(C2N(C3SC(SCC4C=CC(C)=CC=4)=NN=3)C(=O)C(=O)/C/2=C(/O)\\C2C=CC(C)=CC=2)C=CC=1OCCC(C)C", "role": "assistant" }, { "content": "Please list every piece of text from the image.", "role": "user" }, { "content": "1. temperature 0.0 CELSIUS stirring CUSTOM The reaction mixture was stirred overnight at about 0° C.\n2. stirring CUSTOM The reaction was stirred for 14 h\n3. temperature -78.0 CELSIUS CUSTOM After being stirred at −78° C. for 15 minutes\n4. AMBIENT stirring CUSTOM The solution was stirred at room temperature", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_69.png" ]
[ { "content": "<image>Generate the SMILES codes for the molecules shown in the diagram.", "role": "user" }, { "content": "1. CN1CC2SC3N([H])[C@H](C4C=CC(OC(/C=C\\C5C=CC(OC)=CC=5)=O)=CC=4)N([Ce])C(=O)C=3C=2CC1\n2. CC1N=C(SCC2C=CC(C(NN=CC3C=CSC=3)=O)=CC=2)N=C(C[R2])C=1\n3. C([EtO])(/C(/[R4])=C(\\OCC#C)/C)=O\n4. C1([Me])C(OC)=C(C)C=C(CS(C2OC(C3N(C)C=C([A])C=3)=NN=2)=O)C=1\n5. C1C=CC(C2SC(NC3C([Y])=C([H])N=CC=3)=NN=2)=CC=1\n6. C([(Zn)])C/C=C/C/C=C/C/C=C/CCCCCCCC(OC[C@H]1O[C@@H](OC2C(=O)C=COC=2)[C@H](O)[C@@H](O)[C@@H]1O)=O\n7. C1C([(Amo)19])=C(I)C=C(O[CF3])C=1\n8. c1cc(-c2c3SC(Oc3cc([E])c2OC(CCN2C(=S)S/C(=C(/[SeH])\\c3[s]ccc3)/C2=O)=O)=O)c(Cl)cc1\n9. C1C(c2ccccc2)CCN(c2c([Be2])c([H])c(C(N)=O)cc2NC(Nc2ccc([R2])cc2)=O)C1", "role": "assistant" }, { "content": "Please outline the coordinates of objects 'c1cc(-c2c3SC(Oc3cc([E])c2OC(CCN2C(=S)S/C(=C(/[SeH])\\c3[s]ccc3)/C2=O)=O)=O)c(Cl)cc1', as depicted in the figure.", "role": "user" }, { "content": "[233, 653, 402, 781]", "role": "assistant" }, { "content": "temperature: AMBIENT stirring = CUSTOM the solution was stirred for 15 minutes at room temperature", "role": "user" }, { "content": "[16, 397, 244, 533]", "role": "assistant" }, { "content": "temperature 5.0 CELSIUS CUSTOM stirred for 30 minutes", "role": "user" }, { "content": "[273, 548, 436, 635]", "role": "assistant" }, { "content": "CN1CC2SC3N([H])[C@H](C4C=CC(OC(/C=C\\C5C=CC(OC)=CC=5)=O)=CC=4)N([Ce])C(=O)C=3C=2CC1", "role": "user" }, { "content": "[329, 40, 577, 216]", "role": "assistant" }, { "content": "C1C=CC(C2SC(NC3C([Y])=C([H])N=CC=3)=NN=2)=CC=1", "role": "user" }, { "content": "[510, 412, 673, 515]", "role": "assistant" }, { "content": "45.0 CELSIUS stirring CUSTOM The mixture was stirred at 45° C. for 3.5 h", "role": "user" }, { "content": "[305, 377, 493, 531]", "role": "assistant" }, { "content": "C([EtO])(/C(/[R4])=C(\\OCC#C)/C)=O", "role": "user" }, { "content": "[585, 205, 775, 393]", "role": "assistant" }, { "content": "C([(Zn)])C/C=C/C/C=C/C/C=C/CCCCCCCC(OC[C@H]1O[C@@H](OC2C(=O)C=COC=2)[C@H](O)[C@@H](O)[C@@H]1O)=O", "role": "user" }, { "content": "[720, 421, 983, 560]", "role": "assistant" }, { "content": "C1([Me])C(OC)=C(C)C=C(CS(C2OC(C3N(C)C=C([A])C=3)=NN=2)=O)C=1", "role": "user" }, { "content": "[160, 267, 314, 375]", "role": "assistant" }, { "content": "CC1N=C(SCC2C=CC(C(NN=CC3C=CSC=3)=O)=CC=2)N=C(C[R2])C=1", "role": "user" }, { "content": "[68, 107, 274, 252]", "role": "assistant" }, { "content": "C1C(c2ccccc2)CCN(c2c([Be2])c([H])c(C(N)=O)cc2NC(Nc2ccc([R2])cc2)=O)C1", "role": "user" }, { "content": "[648, 673, 875, 959]", "role": "assistant" }, { "content": "C1C([(Amo)19])=C(I)C=C(O[CF3])C=1", "role": "user" }, { "content": "[458, 546, 615, 651]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_121.png" ]
[ { "content": "<image>Can you tell me the SMILES for the object present at [240, 551, 396, 694]?", "role": "user" }, { "content": "C1c2c(-c3c(C(F)(F)F)cccc3[Rb])[n][n](-c3c(F)cc([Ni])cc3)c2NC1", "role": "assistant" }, { "content": "[543, 229, 729, 363]", "role": "user" }, { "content": "CC[n]1c(SC(C(N(c2ccccc2)c2ccccc2)=O)C)[n][n]c1C([Pd])Nc1c(Cl)cccc1", "role": "assistant" }, { "content": "[311, 366, 516, 536]", "role": "user" }, { "content": "CC1C=CC2NC=CC=2N=1", "role": "assistant" }, { "content": "[413, 681, 655, 919]", "role": "user" }, { "content": "Cc1c([Pd(Cm)])cc(NC(C(N/N=C(\\c2ccc(Cl)c(Cl)c2[H])/C)=O)=O)cc1", "role": "assistant" }, { "content": "[60, 292, 283, 442]", "role": "user" }, { "content": "COC1C([Rb])=CC(C=C2C(=O)N(C3C=CC([(Se15Pr)Po2])=C(OC)C=3)C(=O)NC2=O)=CC=1[N+]([O-])=O", "role": "assistant" }, { "content": "[723, 422, 948, 653]", "role": "user" }, { "content": "Cc1ccc2C(COC(c3c([H])c([X])cc(OC(F)F)c3)=O)=CC(Oc2c1)=O", "role": "assistant" }, { "content": "[51, 516, 237, 649]", "role": "user" }, { "content": "C([IV9])SCCc1ccc(O)c(O)c1[Ar]", "role": "assistant" }, { "content": "Could you list the text and their positions from the figure?", "role": "user" }, { "content": "1. 0.0 CELSIUS stirring = CUSTOM The reaction mixture was stirred at 25° C. for 20 hours [507, 80, 712, 218]\n2. stirring = CUSTOM were stirred at +120° C. under nitrogen atmosphere [93, 179, 281, 283]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_29.png" ]
[ { "content": "<image>I need all the text in the figure, including the coordinates where each text appears.", "role": "user" }, { "content": "1. temperature 80.0 CELSIUS CUSTOM The mixture was stirred at 80° C. for 13 h [341, 267, 555, 357]", "role": "assistant" }, { "content": "List all the molecules depicted in the figure along with their coordinates.", "role": "user" }, { "content": "1. COc1cc2cc[n]c(Cc3c(N([H])C(c4[s]ccc4)=O)cc(OC)c([OMe])c3)c2cc1OC[PoTau6Ac] [54, 39, 306, 263]\n2. C1C=C2C=CC3SC(NC(CCl)=O)=NC=3C2=CC=1 [562, 186, 796, 277]\n3. C1[MeN]C(=O)N(CC(OCC(NC2C=CC(N3CCCCC3)=CC=2)=O)=O)C1=O [105, 384, 376, 522]\n4. C[C@@H]1C(=O)[C@@H](C(O)(CCl)C([Cd3])Cl)CC1([H])[H] [399, 385, 641, 578]\n5. C1[NBoc]CCOCCOCCOCC(F)N(C(OC(C)(C[R6])C)=O)CCC1 [704, 461, 968, 631]\n6. CC1C=CC(C([C@H](Br)[C@H](Br)C2C3OCOCC=3C=C(Br)C=2)=O)=C(O)C=1 [31, 524, 293, 669]\n7. CC1C(C2C3=NC(C=C3)=C(C3C(C)=CC([CN])=CC=3C)C3=NC(C=C3)=C(C3C(C)=C([H])C(C#N)=CC=3[Me])C3NC(=CC=3)C(C3C(C)=CC([CN])=CC=3C)=C3NC=2C=C3)=C(C)C=C([CN])C=1[Ag(Lr4(Co))9] [359, 622, 639, 960]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_76.png" ]
[ { "content": "<image>Please share the positions for the text 'temperature: AMBIENT CUSTOM stir for 16 hours'.", "role": "user" }, { "content": "[508, 360, 782, 513]", "role": "assistant" }, { "content": "What molecules are in the figure, and where are they located?", "role": "user" }, { "content": "1. CC(C([Fm])C(NC([R12])(NC1C=CC=C(I)C=1)C(Cl)(Cl)Cl)=O)C [480, 28, 803, 341]\n2. CC([H])([H])OC1OC(C(N/N=C/C2C=CC=NC=2[WCo])=O)=NC=1 [67, 430, 423, 670]\n3. CC([Rc])OC1([EtO])OC2C(CCCCC=2)=C1 [599, 606, 932, 818]\n4. C1C(C2C=CC(N/N=C3/C(C4C(N)=CC(S([O-])(=O)=O)=CC=4C=C/3S([O-])(=O)=O)=O)=CC=2)=CC=C(N/N=C2/C(C3C(N)=CC(S([O-])(=O)=O)=CC=3C=C/2S([O-])(=O)=O)=O)C=1 [104, 701, 554, 971]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_142.png" ]
[ { "content": "<image>Please extract the text from the figure, detailing the coordinates for each entry.", "role": "user" }, { "content": "1. stirring CUSTOM The mixture was then stirred for another 20 minutes [264, 287, 427, 405]\n2. AMBIENT stirring CUSTOM The reaction mixture was stirred at ambient temperature for 2.5 h [738, 382, 968, 550]\n3. temperature 120.0 CELSIUS CUSTOM stirred at 120° C. for 3 hours [410, 424, 637, 535]", "role": "assistant" }, { "content": "Identify the various molecules in the image and their specific positions.", "role": "user" }, { "content": "1. C=C1[C@H]2Oc3c(O)ccc4c3[C@@]32CCN(CC2CC2)[C@H](C4)[C@]3(O)CC1 [530, 40, 767, 349]\n2. C([Ac])C(O[C@@]1([H])O[C@@]2(C)[C@@H]([C@]3(C)C(CC2)C(C)(C)CCC3)C1)=O [276, 63, 500, 226]\n3. CCC(C1C(=O)NC(=O)N(C2C=CC(OC)=CC=2)C=1O)=NCCCO [31, 170, 253, 291]\n4. C([Ph])(N/C(/C(NC([H])([H])CC[n]1c[n]cc1)=O)=C/c1c(F)cccc1)=O [33, 328, 227, 524]\n5. CCOC(C([Ta])SC1N(CC=C)C(C2C([H])=CN=CC=2)=NN=1)=O [172, 540, 384, 698]\n6. C([H])([H])([H])C([Cna4])N1C(SCC(NC23CC4CC(CC(C4[Ra])C2)C3)=O)=NC2C=C(S(N(CC)CC)(=O)=O)C=CC1=2 [465, 563, 705, 750]\n7. COC(C1C(C([OCH3])=O)=NC2C(=CC([H])=CC=2)C=1C1N=NN(C2C=CC([F3C])=CC=2)C=1)=O [86, 710, 328, 959]\n8. CCC1(CC)NC(=O)N(CC(N(C2C=C(C)C=CC=2)CC2C=CC=CC=2)=O)C1=O [414, 752, 586, 943]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_112.png" ]
[ { "content": "<image>What are the locations of the molecules in the illustration?", "role": "user" }, { "content": "[[137, 169, 363, 384], [692, 173, 848, 345], [434, 199, 626, 409], [737, 377, 949, 579], [380, 457, 530, 600], [288, 661, 459, 780], [403, 793, 607, 941]]", "role": "assistant" }, { "content": "Translate the structure of each molecule in the image into SMILES.", "role": "user" }, { "content": "1. CC1C=CC(N(C(C2SN=C(C(NC3CCCCC3)=O)C=2N)=O)CC(NC2CCC([H])([H])CC2)=O)=C([R1])C=1\n2. C1C=C(S(O)(=O)=O)C2C(C3C=CC(O)=C(O)C=3C(=O)C=2C=1[H])=O\n3. COC1C=CC(S(NC2C=C(Cl)C=CC=2N2CCCCCC2)(=O)=O)=CC=1[H3CO]\n4. C1CC(N([H])C(NC23CC4CC(CC(C4)C2)C3)=O)CC1\n5. C([X])C([H])(O)C1(C)OC1(C)C\n6. COC(C1C=CC(CNC(CO/N=C\\C2C=CC=C([N+]([O-])=O)C=2)=O)=CC=1)=O\n7. C1([OMe])C=CC(C(CCN2CCC(C3C([R])=CC=CC=3)CC2)=O)=CC=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_115.png" ]
[ { "content": "<image>Please provide the location details for the text 'AMBIENT stirring = CUSTOM the mixture is stirred at room temperature for 45 days'.", "role": "user" }, { "content": "[117, 224, 355, 454]", "role": "assistant" }, { "content": "80.0 CELSIUS stirring: CUSTOM stirred at 80° C. in a sealed tube for 16 hours", "role": "user" }, { "content": "[684, 312, 978, 563]", "role": "assistant" }, { "content": "AMBIENT CUSTOM the mixture was stirred for 18 hours at room temperature under an inert atmosphere", "role": "user" }, { "content": "[21, 524, 332, 775]", "role": "assistant" }, { "content": "temperature: 150.0 CELSIUS CUSTOM was stirred at 150° C. for 16 hours", "role": "user" }, { "content": "[675, 763, 885, 951]", "role": "assistant" }, { "content": "Please list the molecules in the figure along with their respective coordinate information.", "role": "user" }, { "content": "1. C1([Et])C([R9])=C(N)C=CC=1C#C[Si](C)(C)C [517, 33, 794, 266]\n2. COC(C([Rc])C1ON=C(C2C=CC(C([OCH3])=N)=CC=2)C=1)=O [299, 85, 486, 212]\n3. C1([H])C=C(C(N(CC([Cf])([Ra])Cl)CCCl)=O)OC=1 [370, 297, 574, 530]\n4. CC1(C)CC(=O)C2C(C3OC(C4C=CC(F)=CC=4)=CC=3)C3N=C(N)OC=3C=2C1 [357, 566, 653, 966]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_89.png" ]
[ { "content": "<image>What are the SMILES strings for the molecules illustrated in the picture?", "role": "user" }, { "content": "1. C([MeO])(COC1C=C(/C=C/C2C=CC3C(=CC=CC=3)N=2)C=C([H])C=1)=O\n2. C([Ph])C([X])N1C(=O)C(=O)C2C1=CC=CC=2\n3. C([TsoAl14])OC1C=CC(CCN2C(=S)S/C(=C/C3C4C(=CC=CC=4)C([R])=CC=3)/C2=O)=CC=1OC\n4. C[C@H](NC(C[NH+](C([Al17])C1SC=CC=1)C)=O)C1OC2C(=CC=CC=2)C=1\n5. C1([OMe])C=CC(S(N2CC([R])C(C(NC3C(Cl)=C([H])C=C([Yb])C=3)=O)CC2)(=O)=O)=CC=1\n6. C([PbTa])C(N=[N+]=[N-])/C(/C[R10])=C(/C#C)\\C\n7. CC1C=CC(C2N=C3N(C(C)=C(CCNC(C4OC=CC=4)=O)S3)N=2)=CC=1\n8. [MeO]C(=O)/C(/C(C(OC)=O)/C=C1/C=C(O)C(C=C/1OC)=O)=C/c1c([MeO])cc(O)c(O)c1", "role": "assistant" }, { "content": "Kindly extract all the text from the image.", "role": "user" }, { "content": "1. CUSTOM the reaction solution was stirred at the same temperature for one hour\n2. temperature = 160.0 CELSIUS stirring: CUSTOM the mixture was stirred at 160° C. for 1.5 h under microwave irradiation\n3. 22.0 CELSIUS stirring: CUSTOM stir for 1.5 hours\n4. 150.0 CELSIUS stirring: CUSTOM The reaction mixture was stirred at 150° C. for 1 h\n5. stirring CUSTOM finally the mixture is subsequently stirred at 90°-95° C. for 30 minutes\n6. 20.0 CELSIUS stirring: CUSTOM The reactor contents are stirred for 2 hours at 20° C\n7. AMBIENT stirring: CUSTOM After being stirred at room temperature until the starting material\n8. 0.0 CELSIUS stirring = CUSTOM The mixture was stirred at -78° C. for 30 minutes and at 0° C. for 10 minutes", "role": "assistant" }, { "content": "I need the coordinates of objects '[MeO]C(=O)/C(/C(C(OC)=O)/C=C1/C=C(O)C(C=C/1OC)=O)=C/c1c([MeO])cc(O)c(O)c1'.", "role": "user" }, { "content": "[329, 676, 539, 937]", "role": "assistant" }, { "content": "temperature = 160.0 CELSIUS stirring: CUSTOM the mixture was stirred at 160° C. for 1.5 h under microwave irradiation", "role": "user" }, { "content": "[47, 228, 267, 341]", "role": "assistant" }, { "content": "0.0 CELSIUS stirring = CUSTOM The mixture was stirred at -78° C. for 30 minutes and at 0° C. for 10 minutes", "role": "user" }, { "content": "[95, 553, 278, 680]", "role": "assistant" }, { "content": "C([PbTa])C(N=[N+]=[N-])/C(/C[R10])=C(/C#C)\\C", "role": "user" }, { "content": "[163, 363, 275, 437]", "role": "assistant" }, { "content": "20.0 CELSIUS stirring: CUSTOM The reactor contents are stirred for 2 hours at 20° C", "role": "user" }, { "content": "[551, 442, 711, 543]", "role": "assistant" }, { "content": "AMBIENT stirring: CUSTOM After being stirred at room temperature until the starting material", "role": "user" }, { "content": "[691, 551, 952, 645]", "role": "assistant" }, { "content": "C([TsoAl14])OC1C=CC(CCN2C(=S)S/C(=C/C3C4C(=CC=CC=4)C([R])=CC=3)/C2=O)=CC=1OC", "role": "user" }, { "content": "[412, 254, 556, 336]", "role": "assistant" }, { "content": "C[C@H](NC(C[NH+](C([Al17])C1SC=CC=1)C)=O)C1OC2C(=CC=CC=2)C=1", "role": "user" }, { "content": "[458, 342, 598, 431]", "role": "assistant" }, { "content": "CUSTOM the reaction solution was stirred at the same temperature for one hour", "role": "user" }, { "content": "[417, 62, 539, 180]", "role": "assistant" }, { "content": "stirring CUSTOM finally the mixture is subsequently stirred at 90°-95° C. for 30 minutes", "role": "user" }, { "content": "[287, 426, 430, 535]", "role": "assistant" }, { "content": "C1([OMe])C=CC(S(N2CC([R])C(C(NC3C(Cl)=C([H])C=C([Yb])C=3)=O)CC2)(=O)=O)=CC=1", "role": "user" }, { "content": "[300, 345, 426, 412]", "role": "assistant" }, { "content": "CC1C=CC(C2N=C3N(C(C)=C(CCNC(C4OC=CC=4)=O)S3)N=2)=CC=1", "role": "user" }, { "content": "[387, 565, 577, 662]", "role": "assistant" }, { "content": "150.0 CELSIUS stirring: CUSTOM The reaction mixture was stirred at 150° C. for 1 h", "role": "user" }, { "content": "[732, 422, 888, 494]", "role": "assistant" }, { "content": "22.0 CELSIUS stirring: CUSTOM stir for 1.5 hours", "role": "user" }, { "content": "[634, 341, 822, 397]", "role": "assistant" }, { "content": "C([Ph])C([X])N1C(=O)C(=O)C2C1=CC=CC=2", "role": "user" }, { "content": "[268, 199, 398, 335]", "role": "assistant" }, { "content": "C([MeO])(COC1C=C(/C=C/C2C=CC3C(=CC=CC=3)N=2)C=C([H])C=1)=O", "role": "user" }, { "content": "[584, 172, 707, 242]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_61.png" ]
[ { "content": "<image>Could you provide the coordinates for each object in the diagram?", "role": "user" }, { "content": "[[642, 48, 830, 172], [407, 75, 541, 167], [16, 125, 204, 292], [417, 172, 612, 241], [635, 206, 792, 333], [219, 217, 389, 356], [414, 327, 602, 386], [617, 338, 748, 453], [69, 377, 237, 467], [782, 386, 983, 466], [261, 403, 444, 536], [739, 480, 907, 586], [545, 491, 735, 679], [248, 539, 399, 672], [43, 613, 246, 741], [401, 702, 582, 951]]", "role": "assistant" }, { "content": "What is the SMILES code for the item situated at [407, 75, 541, 167]?", "role": "user" }, { "content": "CC1ON=C(NC(CSC2[MeN]C(=O)C3C4C([R])CC([RfRa])C=4SC=3N=2)=O)C=1", "role": "assistant" }, { "content": "[16, 125, 204, 292]", "role": "user" }, { "content": "C([(BTSg(At)W)6Ag13])OC(C1C(C(OC)=O)=CN([CHO])CCCC=1[R6])=O", "role": "assistant" }, { "content": "[43, 613, 246, 741]", "role": "user" }, { "content": "[CN]C([CO2Et])=C([Q])NC1C([H])=CC(N2N=C(Br)C(Br)=C2Br)=C([(Th)])C=1", "role": "assistant" }, { "content": "[545, 491, 735, 679]", "role": "user" }, { "content": "C1C(C2C(F)=C(F)C(F)=C(F)C=2F)=C([Na9])C(Br)=CC=1C1C(F)=C(F)C(F)=C(F)C=1F", "role": "assistant" }, { "content": "[782, 386, 983, 466]", "role": "user" }, { "content": "C([Me])(SC1OC(C2C=CC(F)=CC=2)=NN=1)C(N[C@H]1C([PbH])S(=O)(=O)CC1)=O", "role": "assistant" }, { "content": "[635, 206, 792, 333]", "role": "user" }, { "content": "C[C@@H](NS(C1C(C#N)=CC=CC=1)(=O)=O)C1C=CC(Br)=CC=1", "role": "assistant" }, { "content": "[401, 702, 582, 951]", "role": "user" }, { "content": "CC1CCC2(OC3C(O[Me])=CC=CC=3C3C=C(C4OC=CC=4)NN23)CC1", "role": "assistant" }, { "content": "[69, 377, 237, 467]", "role": "user" }, { "content": "CCOc1ccc(CNC([X])c2ccc3[s]c(C(N([H])c4c(N)cccc4)=O)cc3c2)cc1", "role": "assistant" }, { "content": "[219, 217, 389, 356]", "role": "user" }, { "content": "C([CO2Et])OC1C([Ar])=CC(C(C2C=C(Cl)C(O)=C(CN(C)C)C=2)=O)=C(Cl)C=1Cl", "role": "assistant" }, { "content": "What text appears at the specified position [248, 539, 399, 672]?", "role": "user" }, { "content": "AMBIENT stirring = CUSTOM After stirring the resulting mixture at room temperature for 3 hours", "role": "assistant" }, { "content": "[617, 338, 748, 453]", "role": "user" }, { "content": "AMBIENT CUSTOM The mixture was stirred for 18 hr at room temperature", "role": "assistant" }, { "content": "[261, 403, 444, 536]", "role": "user" }, { "content": "temperature 70.0 CELSIUS CUSTOM the mixture was stirred at 70° C. for 16 hours", "role": "assistant" }, { "content": "[414, 327, 602, 386]", "role": "user" }, { "content": "stirring CUSTOM stirred vigorously for 4 days", "role": "assistant" }, { "content": "[417, 172, 612, 241]", "role": "user" }, { "content": "60.0 CELSIUS CUSTOM with stirring on an ice-water bath", "role": "assistant" }, { "content": "[642, 48, 830, 172]", "role": "user" }, { "content": "temperature AMBIENT stirring: CUSTOM the mixture was stirred at room temperature for 15 hours", "role": "assistant" }, { "content": "[739, 480, 907, 586]", "role": "user" }, { "content": "temperature AMBIENT stirring = CUSTOM the reaction was stirred 20 min at room temperature", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_87.png" ]
[ { "content": "<image>What text is located at the specified coordinates [24, 614, 386, 889]?", "role": "user" }, { "content": "temperature = 0.0 CELSIUS CUSTOM After stirring at 0° C. for an additional 2 hrs", "role": "assistant" }, { "content": "Which molecule is located at [299, 342, 767, 608]?", "role": "user" }, { "content": "Cc1ccc(/C=N/NC(CN(S(c2ccc([R3])cc2)(=O)=O)c2c(C)cccc2)=O)cc1", "role": "assistant" }, { "content": "[249, 23, 680, 292]", "role": "user" }, { "content": "C1CCN(S(C2C=C(C(NNC([C@H]3OC4C(=CC=CC=4)OC3)=O)=O)C=CC=2)(=O)=O)CCC1", "role": "assistant" }, { "content": "[494, 640, 975, 976]", "role": "user" }, { "content": "C1C2([Sg])N(Cc3ccoc3)C(CC(N3c4c(cccc4)Sc4cc(C(N5CC(O)CC5)=O)ccc34)C2)C1", "role": "assistant" }, { "content": "[41, 330, 273, 547]", "role": "user" }, { "content": "C[CH-][Na]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_80.png" ]
[ { "content": "<image>What's written at the coordinates [438, 38, 618, 145]?", "role": "user" }, { "content": "temperature AMBIENT stirring: CUSTOM the resulting mixture was stirred at room temperature overnight", "role": "assistant" }, { "content": "[225, 13, 397, 160]", "role": "user" }, { "content": "temperature: 95.0 CELSIUS CUSTOM The reaction mixture was then stirred at 95° C. for 3 hours", "role": "assistant" }, { "content": "[706, 381, 902, 439]", "role": "user" }, { "content": "40.0 CELSIUS CUSTOM stirred for 12 hr", "role": "assistant" }, { "content": "Can you provide a list of all molecules in the figure and their exact positions?", "role": "user" }, { "content": "1. c1c(N([H])/N=C2\\C(S([O-])(=O)=O)=Cc3cc(S([O-])(=O)=O)cc(N/N=C4\\C=CC(/C(/C\\4=O)=N/Nc4cc([N+]([O-])=O)ccc4O[Rf])=O)c3C\\2=O)ccc([O2N])c1 [762, 116, 988, 348]\n2. CC1N(CN2CC([Nb])N(C3C=CC=CC=3)CC2)C(=S)C([NC])=C(C[Rd])C=1 [574, 145, 725, 275]\n3. C[C@@]12C(=O)CC[C@H]1[C@@H]1C[C@H]3OC[C@@](C([HO2C])[Bh])([C@H]1CC2)[C@]3(Cl)C[CO2H] [315, 179, 483, 338]\n4. CC(NC(N([Rd])C1C=CC(O[F3C])=CC=1)=S)C(C)(C)C [155, 216, 315, 310]\n5. C[C@@H](NC(C[NH+]1CCN(C2C(O)=CC=CC=2)CC1)=O)C1C=CC2OCCOC=2C=1 [516, 324, 695, 453]\n6. C1([EtO])C=CC(CCN2C(=O)[C@H]3[C@H]([C@H]4C=C[C@@H]3C4)C2=O)=CC=1OC([Me])[IY] [252, 378, 461, 538]\n7. C[C@H]1N(CC(NC2C=CC=C(I)C=2)=O)CC([Rd])CC1 [464, 477, 651, 680]\n8. C=C1NN(c2ccc(I)cc2)C(=O)/C/1=C\\c1ccc(Cl)c([N+]([O-])=O)c1[H] [11, 480, 223, 681]\n9. [H3CO][C@]1(C)[C@H](O)[C@@H](C)O[C@@H](C1[R6])O[C@@]1([Tb13])[C@@H](C)C(OC([C2H5])[C@@]2(C)OC(=O)N(CCC3C=CC(Cl)=C(Cl)C=3)[C@@H]2[C@H](C)C([C@H](C)C[C@@]([OCH3])(C)[C@H](O[C@H]2O[C@@H](C)C[C@@H](N(C(C)C)CC3(C)CC3)[C@@H]2O)[C@H]1C)=O)=O [683, 699, 925, 986]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_13.png" ]
[ { "content": "<image>Please display the complete text from the image.", "role": "user" }, { "content": "1. temperature AMBIENT stirring CUSTOM The mixture was stirred at RT for 16 hours", "role": "assistant" }, { "content": "Can you identify the positions of the text 'temperature AMBIENT stirring CUSTOM The mixture was stirred at RT for 16 hours' within the graphic?", "role": "user" }, { "content": "[92, 162, 508, 348]", "role": "assistant" }, { "content": "What are the SMILES notations for the molecules in the illustration?", "role": "user" }, { "content": "1. C1C=CC(C(N2C([CN])C3C(=C(CC#N)C=C([H])C=3)C=C2)=O)=CC=1\n2. N([n-Pr])(C(C1C=CC(Br)=CC=1)=O)C(C1N(C2C=C(C)C=CC=2)C(=O)C2C(=C([R3])C=CC=2)N=1)C([Pa9])C\n3. CC([Ds])CCC#C/C=C\\C", "role": "assistant" }, { "content": "Please output the coordinates of molecules C1C=CC(C(N2C([CN])C3C(=C(CC#N)C=C([H])C=3)C=C2)=O)=CC=1 in the figure.", "role": "user" }, { "content": "[563, 115, 925, 471]", "role": "assistant" }, { "content": "CC([Ds])CCC#C/C=C\\C", "role": "user" }, { "content": "[545, 756, 766, 884]", "role": "assistant" }, { "content": "N([n-Pr])(C(C1C=CC(Br)=CC=1)=O)C(C1N(C2C=C(C)C=CC=2)C(=O)C2C(=C([R3])C=CC=2)N=1)C([Pa9])C", "role": "user" }, { "content": "[74, 416, 448, 737]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_148.png" ]
[ { "content": "<image>Can you detect every molecule and piece of text within the image?", "role": "user" }, { "content": "molecules:\n1. O([Et])C1C(N2N=C(C3C4C(=CC=CC=4)C=CC=3)C3CCCCNC2=3)=CC=CC=1\n2. CC([Me])(OC(c1[n](C)c(C([CaB])(c2[n](C)cc([R2])[n]2)c2[n](C)cc[n]2)[n]c1)=O)C\n3. CC([Si](OC([K])[C@@H]1[C@H]2CO[C@H]3[C@H](O)[C@@H]1C[C@@H]23)(C)C[Rd])(C)C\n4. C1C([Cn])=CC(CN2C3C(=CC=CC=3)C(C3N4C(=NC5C4=CC=CC=5)NC(N)=N3)=C2)=CC=1\ntexts:\n1. temperature = AMBIENT stirring CUSTOM After stirring at room temperature for 2 hours the reaction mixture\n2. stirring: CUSTOM The reaction is stirred at 0°-5° for 45 min", "role": "assistant" }, { "content": "List the positions of all molecules present in the diagram.", "role": "user" }, { "content": "[[717, 14, 964, 446], [35, 100, 319, 348], [61, 516, 282, 759], [537, 608, 822, 986]]", "role": "assistant" }, { "content": "Can you specify the coordinates of each text element in the picture?", "role": "user" }, { "content": "[[371, 319, 666, 551], [291, 559, 498, 772]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_141.png" ]
[ { "content": "<image>I would like to see all the molecules and text from the figure, along with the coordinates for each element.", "role": "user" }, { "content": "molecules:\n1. C1([Me])(C)C(C(O)=O)(C)CCC1C(N1CCCC([R12])C1)=O [273, 59, 452, 196]\n2. [C@]1([C2H5])(C)OCC[C@H]([C@H](C2C=CC(C)=CC=2)CC[NH3+])C1 [57, 262, 199, 408]\n3. CC1(C)CC(=O)C2[C@@H](C3C(C(F)(F)F)=CC=CC=3)CC(N(N(C)C[Rd])C=2C1)=O [360, 354, 506, 588]\n4. C1([OMe])C=C([H])C(N2N=C(C3C(Cl)=CC=CC=3)C=C2C(N([Rb])C(C2C=CC=CC=2)CC2C=CC=CC=2)=O)=CC=1[ErP17Dyu] [764, 458, 957, 723]\n5. C1C([R7])=C2C(C3C(=O)C4C(=CC=CC=4)C(=O)C=3C(=O)C2=C([Nb3])C=1)=O [42, 484, 180, 627]\n6. C1CCN(C(C2C=CC(N3CCC(N4C(=O)OCC5C4=CC=CC=5)CC3)=C([N+]([O-])=O)C=2)=O)CC1 [476, 592, 675, 758]\n7. C1([n-Bu])C(=O)O[C@](C(C[N+]2C([No12])=C(Br)C=C(Br)C=2)=O)(C)C1 [300, 597, 453, 726]\n8. C1C=C(Br)C=C(OCCON2N=NC3C=C([Y])C(Cl)=CC2=3)C=1[SbNCf] [135, 630, 291, 740]\n9. C1C([N+]([O-])=O)=CC2C=CN=CC=2C=1 [302, 737, 416, 838]\n10. CC(CC(NC1C=CC(C(COC2C=C([N+]([O-])=O)C=CC=2OC[R8])=O)=CC=1)=O)C [150, 755, 297, 892]\ntexts:\n1. temperature = -70.0 CELSIUS CUSTOM the mixture stirred a further 15 minutes at -70° C [628, 202, 800, 325]\n2. temperature AMBIENT CUSTOM The reaction mixture was stirred at ambient temperature for 18 hours [232, 203, 438, 324]\n3. AMBIENT CUSTOM stirred at rt for 6.5 h [456, 262, 609, 341]\n4. 80.0 CELSIUS stirring CUSTOM The resulting mixture was stirred at 80° C. for 5 hours [535, 348, 673, 440]\n5. 60.0 CELSIUS stirring CUSTOM After stirring for 3 h [208, 401, 348, 470]\n6. temperature = -78.0 CELSIUS stirring: CUSTOM The reaction mixture was stirred at −78° C. for 30 min [510, 448, 727, 573]\n7. CUSTOM After stirring for 15-30 minutes [572, 762, 670, 854]\n8. stirring = CUSTOM After stirring the solution for three days [424, 824, 555, 940]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_81.png" ]
[ { "content": "<image>Please output every piece of text in the figure and indicate its location.", "role": "user" }, { "content": "1. temperature = 60.0 CELSIUS CUSTOM while stirring for 30 min [121, 128, 860, 304]", "role": "assistant" }, { "content": "What is the SMILES format for the molecule located at [232, 682, 878, 871]?", "role": "user" }, { "content": "COC(C1C2CCCCC=2SC=1NC(CSC1OC(/C=C/C2SC([Mo])=CC=2)=NN=1)=O)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_90.png" ]
[ { "content": "<image>What are the SMILES strings for the molecules illustrated in the picture?", "role": "user" }, { "content": "1. C1CN(C(C2C=C(C3C=C([A])C=CC=3)C(=O)N3C=2C2SC=CC=2C=C3)=O)[C@@H](CO)C1\n2. C([Bu])C(CCCCC[Tl])=NO[Rd]\n3. C[C@H]1[C@@]2(COC(C([H])([H])[H])=O)CO[C@@H](c3ccc([OAc])c([MeO])c3)[C@H]([C@@]2([KE2])C)C(C)=C1\n4. [Me]C(=O)CC(C)C(=N[tBu])C([Pbb])CC[Me]\n5. CC(NC(COC(C1C2C(=CC=CC=2)N=C2C=1CCC/C/2=C\\C1C=CC=C(Cl)C=1Cl)=O)=O)C1C2CC(CC2)C1\n6. Cc1ccc(NC(Cc2ccc(NC3SC4C(CS(C4)(=O)=O)N=3)cc2)=O)c([R2])c1\n7. C1CC(NC(COC2C=C([NO2])C=CC=2[Ar])=O)(C#N)CC1\n8. CC1C=CC(C(NNC(CSC2C(C)=NN(C3C=CC=C([R7])C=3)C=2C)=O)=O)=C(C)C=1\n9. C[C@]([R])(OC(c1ccc(SC([H])([H])[H])cc1[RaCu])=O)C(N([C@H]1CS(=O)(=O)CC1)C)=O", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_46.png" ]
[ { "content": "<image>Extract and list all molecules and text present in the figure, converting each molecule to its SMILES string.", "role": "user" }, { "content": "molecules:\n1. [Ph][n]1[n]cc(c1)/C=C1\\C(NC(=O)N(C\\1=O)C[Ph])=O\n2. CC(C(NC1SC2C(CC(C3C=CC=CC=3)CC=2N=1)=O)=O)C\n3. CC(C(NC1C(OCC[NH+]2CCCCC2)=C(OC[He17])C2OC=C([H])C=2C=1OC)=O)C[R7]\n4. C1C(CCCCC2C3C(=NC(N)=NC=3N)OC=2)=CC=C(C(NC([CO2H])CC[HO2C])=O)C=1\ntexts:\n1. temperature AMBIENT stirring = CUSTOM The reaction mixture was stirred for 4 hr at room temperature", "role": "assistant" }, { "content": "List the positions of all molecules present in the diagram.", "role": "user" }, { "content": "[[229, 28, 552, 236], [593, 228, 961, 518], [38, 355, 342, 734], [374, 543, 760, 718]]", "role": "assistant" }, { "content": "Please give the positions for all text within the image.", "role": "user" }, { "content": "[[224, 757, 686, 971]]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_144.png" ]
[ { "content": "<image>Can you provide the coordinates for every molecule and the text present in the figure?", "role": "user" }, { "content": "[[776, 11, 964, 338], [594, 49, 709, 241], [400, 51, 543, 132], [298, 74, 398, 212], [419, 143, 580, 252], [248, 223, 384, 338], [418, 259, 560, 395], [71, 304, 215, 402], [618, 313, 759, 480], [253, 371, 406, 543], [442, 396, 601, 534], [758, 498, 931, 637], [619, 528, 735, 682], [311, 545, 462, 653], [489, 548, 601, 661], [35, 550, 231, 668], [341, 657, 483, 800], [164, 699, 335, 968], [515, 704, 654, 829], [700, 706, 872, 988]]", "role": "assistant" }, { "content": "Can you recognize the molecule at position [164, 699, 335, 968]?", "role": "user" }, { "content": "C1CCC(C2OC3C([H])=CC(Br)=CC=3C3CC(C4SC=C([Ts])C=4)=NN23)CC1", "role": "assistant" }, { "content": "[298, 74, 398, 212]", "role": "user" }, { "content": "CN1C(N=C[MeN]C[La])=NC2C([Z])=CNC=2C1=O", "role": "assistant" }, { "content": "[253, 371, 406, 543]", "role": "user" }, { "content": "C([Ho18Tb])([Rb])NC(C1C=CC(Cl)=NC=1Cl)=O", "role": "assistant" }, { "content": "[419, 143, 580, 252]", "role": "user" }, { "content": "C1C=C([R2])C(C([Ge6LaB18])CNC(COC2C=CC3C=C(Br)C=CC=3C=2Br)=O)=CC=1", "role": "assistant" }, { "content": "[700, 706, 872, 988]", "role": "user" }, { "content": "CCCOC1C=C([Q])C(C2N(CCCN3CCOCC3)C(=O)C(=O)/C/2=C(/O)\\C2C=CC3OCCOC=3C=2)=CC=1[EtO]", "role": "assistant" }, { "content": "[311, 545, 462, 653]", "role": "user" }, { "content": "C1C=CC(N/N=C\\C(O)C(O)C(O)C(O)CO)=CC=1[RnR]", "role": "assistant" }, { "content": "[594, 49, 709, 241]", "role": "user" }, { "content": "C1([NHAc])([R1])C(SC)OC(CO)C(O)C1O", "role": "assistant" }, { "content": "[619, 528, 735, 682]", "role": "user" }, { "content": "CC1C(N2C(=O)c3c(F)cc([R5])cc3C2=O)C1", "role": "assistant" }, { "content": "[776, 11, 964, 338]", "role": "user" }, { "content": "C([R4])[C@H]1[C@H](C2C=CC(O)=C([OCH3])C=2)C2C(=CC(O)=C(OC)C=2)C(=O)[C@H]1C", "role": "assistant" }, { "content": "[418, 259, 560, 395]", "role": "user" }, { "content": "CC1C2(NC(=O)N(CC(NC3C=C(Cl)C=C(Cl)C=3)=O)C2=O)CCCC1", "role": "assistant" }, { "content": "What text appears at the specified position [515, 704, 654, 829]?", "role": "user" }, { "content": "AMBIENT stirring = CUSTOM the reaction mixture stirred at R.T. for 18 h", "role": "assistant" }, { "content": "[71, 304, 215, 402]", "role": "user" }, { "content": "temperature = AMBIENT CUSTOM stirred in water overnight", "role": "assistant" }, { "content": "[341, 657, 483, 800]", "role": "user" }, { "content": "temperature = 60.0 CELSIUS stirring: CUSTOM with rapid stirring", "role": "assistant" }, { "content": "[758, 498, 931, 637]", "role": "user" }, { "content": "temperature AMBIENT CUSTOM the mixture is stirred for 30 min at room temperature", "role": "assistant" }, { "content": "[489, 548, 601, 661]", "role": "user" }, { "content": "AMBIENT CUSTOM Stir the resulting mixture at room temperature for 1 hr", "role": "assistant" }, { "content": "[248, 223, 384, 338]", "role": "user" }, { "content": "AMBIENT CUSTOM the solution stirred at room temperature for 2 hours", "role": "assistant" }, { "content": "[618, 313, 759, 480]", "role": "user" }, { "content": "temperature: AMBIENT stirring CUSTOM the reaction mixture stirred at RT over night", "role": "assistant" }, { "content": "[442, 396, 601, 534]", "role": "user" }, { "content": "temperature = 0.0 CELSIUS CUSTOM the mixture was stirred at 25° C. for 3 hr", "role": "assistant" }, { "content": "[400, 51, 543, 132]", "role": "user" }, { "content": "AMBIENT CUSTOM The mixture was stirred for 1 hour at r.t.", "role": "assistant" }, { "content": "[35, 550, 231, 668]", "role": "user" }, { "content": "AMBIENT stirring CUSTOM the orange solution was stirred at room temperature for 2 h", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_74.png" ]
[ { "content": "<image>Can you provide the SMILES notation for each molecule in the illustration?", "role": "user" }, { "content": "1. C[C@@H]([C@@]([H])(C(O)C1C=CC2OCOC=2C=1)C[R9])CC1C=CC2OCOC=2C=1\n2. C1([OEt])C=CC(C(N2CCN(CC3C=CC4OCCC=4C=3)CC2[A])=O)=CC=1OC\n3. CC1ON=C(C(N2C([R1])CN(S(C3C=CC4CCCCC=4C=3)(=O)=O)CC2)=O)C=1\n4. CC[C@@H](C(C1C=C([Ra8])C(C)=CC=1[R3])=O)C\n5. CN(C(COC(CC1C=CC(C2C=C([SbH2])C=CC=2)=CC=1)=O)=O)CC1C=CC=CC=1[Ar]\n6. CC[C@@H](O)[C@H](C([(Db)Hf])=C)CO\n7. CC([R11])(C(C(CO)(C)C)=O)C[SeH]\n8. C1C=CC(CC(NC(C2C=CC3C(=CC=CC=3[Og6])C=2)=O)C(NC2SC(C3C=CC([Q])=C(Cl)C=3)=NN=2)=O)=CC=1\n9. C1C=CC(CCNC(C(C#N)=C2SC(CC3C=CC(Br)=CC=3)C(=O)N2C2C=CC(F)=CC=2)=O)=CC=1\n10. CC1C=CC(F)=C(C(NC2C=NN(CCN3C(=O)C4C(=CC=CC=4)C3=O)C=2)=O)C=1", "role": "assistant" }, { "content": "List every text element that appears in the image.", "role": "user" }, { "content": "1. AMBIENT stirring = CUSTOM the mixture was stirred for 2 hours at ambient temperature\n2. temperature = -10.0 CELSIUS CUSTOM stirred for 2 days\n3. CUSTOM while stirring under argon\n4. temperature = 170.0 CELSIUS CUSTOM stirred for 7 hours\n5. stirring CUSTOM After stirring for 1 h 45 min", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_30.png" ]
[ { "content": "<image>Please outline the positions of all molecules in the provided image.", "role": "user" }, { "content": "[[570, 91, 788, 309], [382, 204, 535, 324], [241, 343, 440, 447], [624, 376, 890, 617], [111, 523, 437, 760], [692, 654, 956, 789]]", "role": "assistant" }, { "content": "List the coordinates of all textual elements in the figure.", "role": "user" }, { "content": "[[43, 237, 379, 341], [63, 345, 240, 511], [447, 349, 587, 494], [443, 725, 661, 908]]", "role": "assistant" }, { "content": "Please share the SMILES string for the molecule at location [241, 343, 440, 447].", "role": "user" }, { "content": "CC(NC(N1CCN(C2C=CC(F)=CC=2)CC1)=S)C", "role": "assistant" }, { "content": "[570, 91, 788, 309]", "role": "user" }, { "content": "C1([SiH3])C(=O)NC(=O)C([CF3])(N2C(=O)C3C(=CC=CC=3)C2=O)C1", "role": "assistant" }, { "content": "[111, 523, 437, 760]", "role": "user" }, { "content": "C[C@@H](O)[C@H](N)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)C[iPr])=O)CC(C)C)=O)[C@H](O)C[Q])=O)C)=O)CC(C)C)=O)C(C)C)=O)C)=O", "role": "assistant" }, { "content": "[624, 376, 890, 617]", "role": "user" }, { "content": "CC1CN(CC(N2CC(C)CCC2)CS(C2C=C([R])C(C)=CC=2)(=O)=O)CCC1", "role": "assistant" }, { "content": "[692, 654, 956, 789]", "role": "user" }, { "content": "CC1SC(N[C@@H](CO[Me])C)=NC=1C1C([R])=CC(OC[No])=CC=1", "role": "assistant" }, { "content": "[382, 204, 535, 324]", "role": "user" }, { "content": "C1C2C(=CC=CC=2)C1CN([Cn])CC(N)=O", "role": "assistant" }, { "content": "What's written at the coordinates [443, 725, 661, 908]?", "role": "user" }, { "content": "60.0 CELSIUS stirring = CUSTOM The resulting solution was stirred for 4 h at 60° C", "role": "assistant" }, { "content": "[43, 237, 379, 341]", "role": "user" }, { "content": "temperature: AMBIENT CUSTOM was stirred at room temperature for 18 h", "role": "assistant" }, { "content": "[447, 349, 587, 494]", "role": "user" }, { "content": "0.0 CELSIUS stirring: CUSTOM The reaction was stirred for 15 min", "role": "assistant" }, { "content": "[63, 345, 240, 511]", "role": "user" }, { "content": "AMBIENT stirring CUSTOM was stirred at RT under an N2 atmosphere for 8 h", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_12.png" ]
[ { "content": "<image>Could you list the coordinates of all molecules in the image?", "role": "user" }, { "content": "[[315, 85, 492, 257], [11, 291, 320, 592], [80, 610, 310, 868], [634, 654, 988, 914]]", "role": "assistant" }, { "content": "List all the molecules that appear in the picture.", "role": "user" }, { "content": "1. C1C2C(=CC=CC=2[H])CC2(O)C1C2\n2. C1C=C(C(F)(F)F)C(NC(N/N=C\\C2SC=CC=2)=S)=CC=1\n3. C1CC2CCCC(=NO[Rb])C2CC1\n4. C1C(NC([C@@H](OC(CNC(CNC(c2[s]ccc2)=O)=O)=O)c2ccccc2)=O)C1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_8.png" ]
[ { "content": "<image>Could you specify the locations for every element in the image?", "role": "user" }, { "content": "[[400, 23, 629, 142], [646, 119, 918, 323], [303, 193, 534, 331], [46, 224, 289, 409], [302, 333, 470, 395], [713, 343, 953, 491], [200, 421, 440, 485], [459, 454, 668, 645], [94, 493, 299, 656], [350, 680, 641, 976]]", "role": "assistant" }, { "content": "Can you give the SMILES for each molecule represented in the diagram?", "role": "user" }, { "content": "1. CC([A])COC1C=C(/C(/O)=C2/C(C3C=CC(O[Et])=C(O[Me])C=3)N(C3SC(C(OCC)=O)=C(C)N=3)C(C/2=O)=O)C=CC=1\n2. CC([C@H](NC(C1C=CC(Cl)=C([H])C=1Cl)=O)C(OCCOC1C=C([R2])C=CC=1)=O)C\n3. C[C@H](O)C1N(C2N=CC(C(F)(F)F)=CC=2Cl)C=CC=1\n4. O([Me])C1C(NC=C([CN])C2SC=C(C3C=CC=CC=3)N=2)=CC(OC)=C(Cl)C=1\n5. COC1C=CC(C(OC2C=C([(((H)17)Lu)])C(Br)=CC=2/C=N/NC(N([H])[H])=S)=O)=CC=1", "role": "assistant" }, { "content": "Please output all the text content in the figure.", "role": "user" }, { "content": "1. 0.0 CELSIUS stirring CUSTOM stirred at this temperature for a further 2 h\n2. AMBIENT stirring = CUSTOM The mixture was stirred at room temperature for 4 hours until LC-MS\n3. AMBIENT CUSTOM is stirred vigorously\n4. temperature = -78.0 CELSIUS stirring CUSTOM The solution was stirred for 5 minutes at −78° C.\n5. CUSTOM Stir the reaction mixture for 1 h", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_49.png" ]
[ { "content": "<image>Please retrieve all textual elements from the picture.", "role": "user" }, { "content": "1. 120.0 CELSIUS stirring = CUSTOM stirred for 4 h\n2. -78.0 CELSIUS CUSTOM The reaction was then stirred at −78° C. for 15 min\n3. 150.0 CELSIUS stirring: CUSTOM Under argon, the mixture was stirred under microwave irradiation for 1 h at 150° C\n4. CUSTOM The resulting milky suspension was stirred at 0°-5° C. and, after 1.5 hours\n5. stirring: CUSTOM While stirring at 0°-5° C.\n6. temperature = AMBIENT CUSTOM the reaction mixture was then stirred at room temperature\n7. CUSTOM was agitated at 60°-70° C. for 2 hours\n8. temperature AMBIENT stirring: CUSTOM the reaction was stirred at room temperature for 20 min\n9. CUSTOM The reaction mixture was continually stirred for 75 minutes at 0°-2°C", "role": "assistant" }, { "content": "Please enumerate all the molecules found in the image.", "role": "user" }, { "content": "1. C1N2C(=CC=C2)[C@H](C2C([Rd])=COC=2[Ta])N(C(C2C=CC=C(F)C=2)=O)C1\n2. C([Ho])COC(C(C1N=C(NC2C=CC=CC=2)SC=1)=NNC1C([N+]([O-])=O)=C([R5])C=CC=1)=O\n3. [Ph]C(=O)/C(/[Ph])=N/NC1C=CC([N+]([O-])=O)=CC=1\n4. C([PoH])CC1C=CC(OC2N=C3N(C=CC=C3C)C(=O)C=2/C=C(/[NC])\\C(OCC)=O)=CC=1\n5. C1CNc2[n]c(C([H])([H])CC(N3CCC(CC(c4cc([R1])cc(F)c4)CC(N)=O)CC3)=O)ccc2C1\n6. CC1(C(NC2CCCCCC2)=O)N(Cc2occc2F)C(=O)C([R1])C1\n7. COc1ccc(C(NC(N2CCCC2)C(Cl)(Cl)Cl)=O)cc1\n8. C1C2C(Br)C([Rd])(Br)C1C1C(=O)N(C3C4C(=CC=CC=4)C=CC=3)C(=O)C12\n9. CCOC1C=CC(N2C(SCC3C=CC=C([N+]([O-])=O)C=3)=NN=C2C2C=CN=C([H])C=2)=CC=1", "role": "assistant" }, { "content": "Where is the text 'temperature AMBIENT stirring: CUSTOM the reaction was stirred at room temperature for 20 min' situated in the figure? I need its coordinates.", "role": "user" }, { "content": "[302, 621, 483, 725]", "role": "assistant" }, { "content": "150.0 CELSIUS stirring: CUSTOM Under argon, the mixture was stirred under microwave irradiation for 1 h at 150° C", "role": "user" }, { "content": "[759, 233, 955, 355]", "role": "assistant" }, { "content": "CUSTOM The reaction mixture was continually stirred for 75 minutes at 0°-2°C", "role": "user" }, { "content": "[498, 624, 679, 731]", "role": "assistant" }, { "content": "CUSTOM was agitated at 60°-70° C. for 2 hours", "role": "user" }, { "content": "[220, 606, 283, 697]", "role": "assistant" }, { "content": "-78.0 CELSIUS CUSTOM The reaction was then stirred at −78° C. for 15 min", "role": "user" }, { "content": "[134, 226, 331, 333]", "role": "assistant" }, { "content": "120.0 CELSIUS stirring = CUSTOM stirred for 4 h", "role": "user" }, { "content": "[549, 223, 677, 292]", "role": "assistant" }, { "content": "stirring: CUSTOM While stirring at 0°-5° C.", "role": "user" }, { "content": "[472, 298, 541, 393]", "role": "assistant" }, { "content": "CUSTOM The resulting milky suspension was stirred at 0°-5° C. and, after 1.5 hours", "role": "user" }, { "content": "[332, 247, 451, 382]", "role": "assistant" }, { "content": "temperature = AMBIENT CUSTOM the reaction mixture was then stirred at room temperature", "role": "user" }, { "content": "[44, 347, 221, 444]", "role": "assistant" }, { "content": "Please output the coordinates of molecules C1CNc2[n]c(C([H])([H])CC(N3CCC(CC(c4cc([R1])cc(F)c4)CC(N)=O)CC3)=O)ccc2C1 as depicted in the chart.", "role": "user" }, { "content": "[763, 464, 947, 589]", "role": "assistant" }, { "content": "C1C2C(Br)C([Rd])(Br)C1C1C(=O)N(C3C4C(=CC=CC=4)C=CC=3)C(=O)C12", "role": "user" }, { "content": "[751, 613, 920, 778]", "role": "assistant" }, { "content": "C([Ho])COC(C(C1N=C(NC2C=CC=CC=2)SC=1)=NNC1C([N+]([O-])=O)=C([R5])C=CC=1)=O", "role": "user" }, { "content": "[574, 295, 721, 469]", "role": "assistant" }, { "content": "C1N2C(=CC=C2)[C@H](C2C([Rd])=COC=2[Ta])N(C(C2C=CC=C(F)C=2)=O)C1", "role": "user" }, { "content": "[475, 39, 625, 208]", "role": "assistant" }, { "content": "CCOC1C=CC(N2C(SCC3C=CC=C([N+]([O-])=O)C=3)=NN=C2C2C=CN=C([H])C=2)=CC=1", "role": "user" }, { "content": "[457, 732, 646, 960]", "role": "assistant" }, { "content": "[Ph]C(=O)/C(/[Ph])=N/NC1C=CC([N+]([O-])=O)=CC=1", "role": "user" }, { "content": "[84, 459, 261, 600]", "role": "assistant" }, { "content": "COc1ccc(C(NC(N2CCCC2)C(Cl)(Cl)Cl)=O)cc1", "role": "user" }, { "content": "[454, 483, 573, 587]", "role": "assistant" }, { "content": "CC1(C(NC2CCCCCC2)=O)N(Cc2occc2F)C(=O)C([R1])C1", "role": "user" }, { "content": "[583, 471, 720, 620]", "role": "assistant" }, { "content": "C([PoH])CC1C=CC(OC2N=C3N(C=CC=C3C)C(=O)C=2/C=C(/[NC])\\C(OCC)=O)=CC=1", "role": "user" }, { "content": "[283, 462, 442, 596]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_59.png" ]
[ { "content": "<image>I'd appreciate a list of all text elements in the figure and the corresponding coordinates.", "role": "user" }, { "content": "1. temperature = AMBIENT stirring: CUSTOM After stirring 1 hour at room temperature the mixture [32, 79, 300, 256]\n2. temperature = AMBIENT stirring CUSTOM the mixture was stirred for 11/2 hr at room temperature [587, 120, 848, 302]\n3. stirring = CUSTOM to stir for 2 hrs [300, 345, 450, 455]", "role": "assistant" }, { "content": "Can you provide the SMILES and locations of molecules depicted in the diagram?", "role": "user" }, { "content": "1. C1C=C(OCC(O[(OgbRa)8])=O)C(Cl)=CC=1 [421, 26, 554, 141]\n2. CC([Me])NC(NC(COC([C@H]1CN(C2C=C(Cl)C=CC=2OC)C(=O)C1)=O)=O)=O [364, 161, 544, 316]\n3. C1C=C2C(CC(N([Pr3])C(C3C(Cl)=CC=CC=3)=O)C(OCC(NC3C=CC(SC(F)F)=CC=3)=O)=O)=CNC2=CC=1 [668, 321, 967, 630]\n4. CC1C2C(=C([R6])C([H])=CC=2)N=C(C2SC3C(=CC=CC=3)C=2C)C=1C [436, 505, 650, 755]\n5. C1C[NH+](CC2C3O/C(/C(=O)C=3C(Br)=CC=2O)=C\\C2C=CC(Br)=CC=2)CC1 [176, 580, 415, 973]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_26.png" ]
[ { "content": "<image>Could you provide the coordinates for each object in the diagram?", "role": "user" }, { "content": "[[118, 82, 364, 255], [579, 234, 974, 396], [56, 316, 263, 460], [310, 432, 602, 601], [25, 601, 445, 917]]", "role": "assistant" }, { "content": "What does the text say at the coordinates [118, 82, 364, 255]?", "role": "user" }, { "content": "AMBIENT CUSTOM they were stirred at room temperature for 4 hours", "role": "assistant" }, { "content": "[56, 316, 263, 460]", "role": "user" }, { "content": "AMBIENT CUSTOM was stirred for 16 hrs at room temperature", "role": "assistant" }, { "content": "Can you identify the molecule present at location [25, 601, 445, 917]?", "role": "user" }, { "content": "C([IHoz])=C1C2([R5])C(O[C@@H]3O[C@H](C([H])([H])O)[C@H](O)[C@H](O)[C@H]3O)OC=C(C(O)=O)C2CC1O", "role": "assistant" }, { "content": "[310, 432, 602, 601]", "role": "user" }, { "content": "CC(NC1C=C([Ra])C(OC)=CC=1NC(CSC1N=C(C2C=CC=C([H])C=2)NN=1)=O)=O", "role": "assistant" }, { "content": "[579, 234, 974, 396]", "role": "user" }, { "content": "C1C[C@]2([H])[C@@H](C([R5])N(C(C3([(Be)])CCN(C4C=CC(C(F)(F)F)=C[NH+]=4)CC3)=O)CC2)CC1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_84.png" ]
[ { "content": "<image>List all the molecules that appear in the picture.", "role": "user" }, { "content": "1. CCCCN(C(/C=C/C1C=CC=C([O2N])C=1)=O)C[Me]\n2. C[C@@H](N=C(NC1C=CC([NC])=CC=1)NC#N)C([Me])([Me])C([H])([H])[H]\n3. CC([Y])C1C=CC=C(CC)C=1N1C(=O)C[C@@H](C(OC2C(C)=CC=CC=2C)=O)C1\n4. CC([(SeCl3)19(U)])SC1N=C2N(C=CC=C2[Z])C=1S(NC(NC1N=C([H3CO])C=C([MeO])N=1)=O)(=O)=O\n5. C([Pr])N1C(CCCO)=NC2C1=CC([H])=CC=2", "role": "assistant" }, { "content": "Please indicate the coordinates for molecules C[C@@H](N=C(NC1C=CC([NC])=CC=1)NC#N)C([Me])([Me])C([H])([H])[H] in the diagram.", "role": "user" }, { "content": "[325, 445, 528, 572]", "role": "assistant" }, { "content": "CCCCN(C(/C=C/C1C=CC=C([O2N])C=1)=O)C[Me]", "role": "user" }, { "content": "[72, 306, 328, 439]", "role": "assistant" }, { "content": "CC([(SeCl3)19(U)])SC1N=C2N(C=CC=C2[Z])C=1S(NC(NC1N=C([H3CO])C=C([MeO])N=1)=O)(=O)=O", "role": "user" }, { "content": "[686, 486, 965, 710]", "role": "assistant" }, { "content": "C([Pr])N1C(CCCO)=NC2C1=CC([H])=CC=2", "role": "user" }, { "content": "[238, 747, 448, 915]", "role": "assistant" }, { "content": "CC([Y])C1C=CC=C(CC)C=1N1C(=O)C[C@@H](C(OC2C(C)=CC=CC=2C)=O)C1", "role": "user" }, { "content": "[34, 455, 277, 693]", "role": "assistant" }, { "content": "Provide all the written information found in the image.", "role": "user" }, { "content": "1. -70.0 CELSIUS stirring = CUSTOM the mixture was stirred at −70° C. for 30 min under nitrogen atmosphere\n2. stirring CUSTOM the reaction was stirred under an atmosphere of hydrogen for 16 hrs\n3. -78.0 CELSIUS stirring CUSTOM The mixture was stirred at −78° C. for 30 min", "role": "assistant" }, { "content": "Please point out the coordinates of the text '-70.0 CELSIUS stirring = CUSTOM the mixture was stirred at −70° C. for 30 min under nitrogen atmosphere'.", "role": "user" }, { "content": "[385, 84, 588, 310]", "role": "assistant" }, { "content": "stirring CUSTOM the reaction was stirred under an atmosphere of hydrogen for 16 hrs", "role": "user" }, { "content": "[560, 343, 813, 472]", "role": "assistant" }, { "content": "-78.0 CELSIUS stirring CUSTOM The mixture was stirred at −78° C. for 30 min", "role": "user" }, { "content": "[426, 579, 645, 718]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_124.png" ]
[ { "content": "<image>Could you detail the coordinates for all the objects in the image?", "role": "user" }, { "content": "[[45, 38, 323, 192], [430, 110, 693, 201], [276, 215, 516, 383], [528, 217, 723, 380], [41, 238, 239, 371], [742, 345, 958, 460], [191, 420, 391, 553], [401, 427, 604, 563], [42, 553, 305, 786], [491, 607, 780, 961]]", "role": "assistant" }, { "content": "Output all the words present in the figure.", "role": "user" }, { "content": "1. 0.0 CELSIUS CUSTOM the mixture is stirred at 0° C. for 25 min\n2. temperature = 23.0 CELSIUS stirring = CUSTOM to stir for 4 h at 23° C\n3. temperature 25.0 CELSIUS CUSTOM The mixture was stirred for 18 hours at 25° C.", "role": "assistant" }, { "content": "Translate the structure of each molecule in the image into SMILES.", "role": "user" }, { "content": "1. CC1C=C(C)C(N([RaJ])S(C2C=CC(NC(C=CC(O)=O)=O)=CC=2)(=O)=O)=C(C)C=1\n2. C([OEt])(/C(/Cl)=N\\NC1C=C(C(F)(F)F)C=CC=1)=O\n3. C([TeNp5])C[n]1c(O)c(N=NC(c2cc([H3CO])c(OC)c([H3CO])c2)=O)c2cc(OC[R])ccc12\n4. [OMe]C1=CC=CC(=C1[MeO])/C=C1\\C(NC(=S)N(C\\1=O)C1C=C([Ra])C([OCH3])=CC=1)=O\n5. O([C2H5])C(C(NC(Nc1c([R4])c(C(F)(F)F)ccc1)=O)C(F)(F)F)=O\n6. CCC1C=CC(C2C=C(C(NN3CC[NH+](C)CC3)=O)C3C(=CC=CC=3)N=2)=CC=1\n7. CC(C1C(O)=C(C(C)(C)C)C=C([C@H](N2CCN(CCO)CC2)C2C=CC([NMe]C)=CC=2)C=1)(C)C", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_1.png" ]
[ { "content": "<image>Could you specify the locations for every element in the image?", "role": "user" }, { "content": "[[386, 107, 719, 285], [449, 324, 791, 533], [127, 330, 349, 515], [79, 536, 376, 832], [390, 539, 721, 693], [594, 706, 920, 892]]", "role": "assistant" }, { "content": "Please output all the molecules and text in the figure, where the molecules should be represented by their corresponding SMILES.", "role": "user" }, { "content": "molecules:\n1. C1([EtO])C=CC(/C=N\\NC(C(NC2C=CC=C(Cl)C=2)=O)=O)=C(O[C2H5])C=1\n2. COC1C=CC2C(Cl)=C(C(N([RgXYz4Li])/N=C\\C3C=CC(C(OC)=O)=CC=3)=O)SC=2C=1\n3. C1C([E])=C([Ta])C(N2C(=S)S[C@H](CC3C=CC(Br)=CC=3)C2=O)=CC=1\ntexts:\n1. temperature AMBIENT stirring = CUSTOM the solution was stirred at room temperature for 13.5 hours\n2. CUSTOM was stirred in the cold for 1 hour\n3. AMBIENT stirring: CUSTOM by stirring for 0.5 hour", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_154.png" ]
[ { "content": "<image>What molecule can be found at the coordinates [380, 232, 579, 383]?", "role": "user" }, { "content": "CC1C=C([R10])C(N2C=NC(C(OC)=O)=C2)=CC=1", "role": "assistant" }, { "content": "[533, 728, 752, 934]", "role": "user" }, { "content": "CC1C2C(N(CC=C)C(SCC(NC3C=CC([MeO])=CC=3OC)=O)=NC=2SC=1C)=O", "role": "assistant" }, { "content": "[345, 673, 498, 846]", "role": "user" }, { "content": "c1c2C=Cc3c2c2c(C(C(C=Cc2c1)=O)=O)c([((O)15)])c3", "role": "assistant" }, { "content": "[235, 439, 447, 616]", "role": "user" }, { "content": "C1C=CC(N2C(SCC(NC3C(C(F)(F)F)=CC=CC=3)=O)=NN=C2C2C(Cl)=CC=CC=2)=CC=1", "role": "assistant" }, { "content": "[810, 531, 961, 675]", "role": "user" }, { "content": "C1([H3CO])C=CC(C(C2C(Cl)=NNN=2)=O)=C(O[SbH2])C=1", "role": "assistant" }, { "content": "[655, 641, 789, 719]", "role": "user" }, { "content": "C=C([U])C(NCCCCC([R3])CO)=O", "role": "assistant" }, { "content": "[351, 65, 547, 146]", "role": "user" }, { "content": "CC1C=CC(NC([C@@H](OC(/C=C/C2C=CC(OC(F)F)=CC=2)=O)C)=O)=CC=1F", "role": "assistant" }, { "content": "[734, 192, 922, 494]", "role": "user" }, { "content": "CCOC(COC1C(C2N(C(C)=O)N=C(C3C=CC(OC)=CC=3)C2)=CC([Zn])=CC=1)=O", "role": "assistant" }, { "content": "[38, 133, 278, 405]", "role": "user" }, { "content": "C([W])OC1C=CC(/C=C2/C(OC(C3C=CC=C(Cl)C=3)=N/2)=O)=CC=1[NO2]", "role": "assistant" }, { "content": "Please output every piece of text in the figure and indicate its location.", "role": "user" }, { "content": "1. temperature = 90.0 CELSIUS CUSTOM was stirred [579, 160, 701, 253]\n2. -20.0 CELSIUS stirring CUSTOM The resulting mixture was stirred for 2 hours at −20° C [475, 455, 663, 614]", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_128.png" ]
[ { "content": "<image>Could you extract and display the coordinates of all text and molecules in the figure?", "role": "user" }, { "content": "[[443, 89, 589, 254], [731, 226, 956, 385], [55, 283, 243, 406], [303, 387, 713, 474], [240, 501, 406, 646], [527, 511, 678, 634], [43, 652, 255, 910], [423, 652, 594, 817]]", "role": "assistant" }, { "content": "List every object depicted, using SMILES notation for all molecules.", "role": "user" }, { "content": "molecules:\n1. C1([MeO])C(C=NC2C([NpCd])=CC(OC3C=CC=CC=3)=C([H])C=2)=CC=CC=1[Q]\n2. CCC1C=CC(CC([H])([H])[H])=C(S(OCN2C(=O)C3C(=CC([Rc])=CC=3)C2=O)(=O)=O)C=1\n3. CC([WZrl])CCC(CP([EtO])([EtO])=O)CC\n4. [n]1([Ph])[n]c(-c2ccc[n]c2)c(/C=N/NC(c2cc(Cl)ccc2Cl)=O)c1\ntexts:\n1. temperature = -30.0 CELSIUS CUSTOM the mixture was stirred at −30° C. for 30 minutes\n2. 200.0 CELSIUS CUSTOM the mixture was stirred at 200° C. for 6 hours\n3. temperature: AMBIENT stirring CUSTOM stirred for another 30 minutes\n4. temperature = AMBIENT CUSTOM the resulting mixture is stirred overnight at ambient temperature", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_136.png" ]
[ { "content": "<image>Could you detail the locations of all molecules in the image?", "role": "user" }, { "content": "[[579, 96, 803, 255], [196, 112, 381, 359], [424, 267, 588, 399], [660, 339, 874, 560], [189, 413, 439, 606], [12, 467, 187, 670], [446, 499, 620, 690], [768, 616, 987, 873], [632, 638, 766, 748], [545, 784, 759, 903]]", "role": "assistant" }, { "content": "What are the SMILES notations for the molecules in the illustration?", "role": "user" }, { "content": "1. CC([NC])OC(CCN([Z])S(C1C=CC(F)=C(F)C=1)(=O)=O)=O\n2. CCOC(C(C(N1CCCCCC1)=O)C1CCCCC1[Na])=O\n3. CC(C[C@@H](N([P(Nh)2])C(COC(C1C=CC(NC)=C([N+]([O-])=O)C=1)=O)=O)C(OC)=O)C\n4. CCOC1C(N2CC[NH+]([C@@H](C(NC3C=CC4C(=CC=CC=4)C=3)=O)C([H])([H])[H])CC2)=CC=CC=1\n5. CN(S(NC1C=CC(OC2C3C(=CC(OC)=C(OC[R2])C=3)N=CN=2)=C(F)C=1)(=O)=O)CCC1C=CC=C([FrSe])C=1\n6. CC(C(C1(C)OCC(C(OC)=O)=CC(=O)C1[E])=C([H])[H])=C\n7. CCSCC1OC(N2C3C(=C(N)N=C(F)N=3)N=C2)C([H4])(O)C1O\n8. Cc1cc(Oc2[n]c(O[Me])cc([MeO])[n]2)ccc1NS(c1c(C(OC)=O)cccc1)(=O)=O\n9. C1([OAc])C=CC(/C=C/C2C=CN=CC=2[(Tm)Cl])=C([Rd])C=1\n10. CC1C=CC=C(OCC(NC(C(N([R8])N=CC2OC(C3C=CC([N+]([O-])=O)=CC=3C)=CC=2)=O)C[Hs7])=O)C=1", "role": "assistant" } ]
[ "/root/train_data/rxn_stage_1/images/mol_text_compose_123.png" ]
End of preview. Expand in Data Studio

No dataset card yet

Downloads last month
6