rem
stringlengths
1
53.3k
add
stringlengths
0
80.5k
context
stringlengths
6
326k
meta
stringlengths
141
403
input_ids
list
attention_mask
list
labels
list
IVParameterSpec iv = new IVParameterSpec( new byte[]{ (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00 } ); Cipher cipher = token.getCipherContext(EncryptionAlgorithm.DES_CBC_PAD); cipher.initEncrypt(key, iv); byte[] plaintext = new byte[] { (byte)0xff, (byte)0x00 }; byte[] ciphertext = cipher.doFinal(plaintext); cipher.initDecrypt(key, iv); byte[] recovered = cipher.doFinal(ciphertext); if( recovered.length != plaintext.length ) { throw new Exception("Recovered plaintext has different length ("+ recovered.length+") than original ("+plaintext.length+")"); } for(int i=0; i < recovered.length; i++) { if( plaintext[i] != recovered[i] ) { throw new Exception("Recovered plaintext differs from original" + " at position "+i); } } System.out.println("DES encryption succeeded");
key = skg.genPBEKey(PBEAlgorithm.PBE_MD2_DES_CBC, SymmetricKey.DES, 56); skg.cipherTest(key, EncryptionAlgorithm.DES_CBC_PAD); skg.cipherTest(key, EncryptionAlgorithm.DES_CBC); skg.cipherTest(key, EncryptionAlgorithm.DES_ECB);
public static void main(String args[]) { try { CryptoManager.initialize("."); CryptoManager cm = CryptoManager.getInstance(); CryptoToken token = cm.getInternalCryptoToken(); byte[] keyData; // DES key KeyGenerator kg = token.getKeyGenerator(KeyGenAlgorithm.DES); SymmetricKey key = kg.generate(); if( key.getType() != SymmetricKey.DES ) { throw new Exception("wrong algorithm"); } if( ! key.getOwningToken().equals( token ) ) { throw new Exception("wrong token"); } if( key.getStrength() != 56 ) { throw new Exception("wrong strength"); } keyData = key.getKeyData(); if( keyData.length != 8 ) { throw new Exception("key data wrong length: " + keyData.length); } System.out.println("DES key is correct"); IVParameterSpec iv = new IVParameterSpec( new byte[]{ (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00 } ); Cipher cipher = token.getCipherContext(EncryptionAlgorithm.DES_CBC_PAD); cipher.initEncrypt(key, iv); byte[] plaintext = new byte[] { (byte)0xff, (byte)0x00 }; byte[] ciphertext = cipher.doFinal(plaintext); cipher.initDecrypt(key, iv); byte[] recovered = cipher.doFinal(ciphertext); if( recovered.length != plaintext.length ) { throw new Exception("Recovered plaintext has different length ("+ recovered.length+") than original ("+plaintext.length+")"); } for(int i=0; i < recovered.length; i++) { if( plaintext[i] != recovered[i] ) { throw new Exception("Recovered plaintext differs from original" + " at position "+i); } } System.out.println("DES encryption succeeded"); // DES3 key kg = token.getKeyGenerator(KeyGenAlgorithm.DES3); key = kg.generate(); if( key.getType() != SymmetricKey.DES3 ) { throw new Exception("wrong algorithm"); } if( ! key.getOwningToken().equals( token ) ) { throw new Exception("wrong token"); } if( key.getStrength() != 168 ) { throw new Exception("wrong strength"); } keyData = key.getKeyData(); if( keyData.length != 24 ) { throw new Exception("key data wrong length: " + keyData.length); } System.out.println("DES3 key is correct"); // RC4 key kg = token.getKeyGenerator(KeyGenAlgorithm.RC4); kg.initialize(128); key = kg.generate(); if( key.getType() != SymmetricKey.RC4 ) { throw new Exception("wrong algorithm"); } if( ! key.getOwningToken().equals( token ) ) { throw new Exception("wrong token"); } if( key.getStrength() != 128 ) { throw new Exception("wrong strength"); } keyData = key.getKeyData(); if( keyData.length != 16 ) { throw new Exception("key data wrong length: " + keyData.length); } System.out.println("RC4 key is correct"); // PBE MD5 DES CBC kg = token.getKeyGenerator(PBEAlgorithm.PBE_MD5_DES_CBC); try { kg.initialize(56); throw new Exception("ERROR: Initializing PBE key with strength "+ "succeeded"); } catch( InvalidAlgorithmParameterException e) { } Password pass = new Password( ("passwd").toCharArray() ); byte[] salt = new byte[] { (byte)0xff, (byte)0x00, (byte)0xff }; PBEKeyGenParams kgp = new PBEKeyGenParams(pass, salt, 2); kg.initialize(kgp); key = kg.generate(); if( key.getType() != SymmetricKey.DES ) { throw new Exception("Wrong key type: "+key.getType()); } if( ! key.getOwningToken().equals( token ) ) { throw new Exception("wrong token"); } if( key.getStrength() != 56 && key.getStrength() != 64) { throw new Exception("wrong strength: "+key.getStrength()); } keyData = key.getKeyData(); if( keyData.length != 8 ) { throw new Exception("key data wrong length: " + keyData.length); } System.out.println("PBE key is correct"); } catch(Exception e) { e.printStackTrace(); } }
51996 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51996/0afeff61103891a3e7d2e000be212b29859901ff/SymKeyGen.java/clean/security/jss/org/mozilla/jss/tests/SymKeyGen.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 833, 63, 5717, 288, 1377, 775, 288, 3639, 15629, 1318, 18, 11160, 2932, 1199, 1769, 3639, 15629, 1318, 5003, 273, 15629, 1318, 18, 588, 1442, 5621, 3639, 15629, 1345, 1147, 273, 5003, 18, 588, 3061, 18048, 1345, 5621, 3639, 1160, 8526, 498, 751, 31, 3639, 368, 2030, 55, 498, 3639, 1929, 3908, 417, 75, 273, 1147, 18, 588, 653, 3908, 12, 653, 7642, 6801, 18, 26463, 1769, 3639, 10042, 6899, 653, 498, 273, 417, 75, 18, 7163, 5621, 3639, 309, 12, 498, 18, 588, 559, 1435, 480, 10042, 6899, 653, 18, 26463, 262, 288, 5411, 604, 394, 1185, 2932, 21530, 4886, 8863, 3639, 289, 3639, 309, 12, 401, 498, 18, 588, 3494, 2093, 1345, 7675, 14963, 12, 1147, 262, 262, 288, 5411, 604, 394, 1185, 2932, 21530, 1147, 8863, 3639, 289, 3639, 309, 12, 498, 18, 588, 27624, 1435, 480, 13850, 262, 288, 5411, 604, 394, 1185, 2932, 21530, 21638, 8863, 3639, 289, 3639, 498, 751, 273, 498, 18, 588, 653, 751, 5621, 3639, 309, 12, 498, 751, 18, 2469, 480, 1725, 262, 288, 5411, 604, 394, 1185, 2932, 856, 501, 7194, 769, 30, 315, 397, 498, 751, 18, 2469, 1769, 3639, 289, 3639, 2332, 18, 659, 18, 8222, 2932, 26463, 498, 353, 3434, 8863, 3639, 21602, 1662, 1990, 4674, 273, 394, 21602, 1662, 1990, 12, 5411, 394, 1160, 63, 7073, 261, 7229, 13, 20, 5297, 16, 261, 7229, 13, 20, 92, 713, 16, 261, 7229, 13, 20, 5297, 16, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 833, 63, 5717, 288, 1377, 775, 288, 3639, 15629, 1318, 18, 11160, 2932, 1199, 1769, 3639, 15629, 1318, 5003, 273, 15629, 1318, 18, 588, 1442, 5621, 3639, 15629, 1345, 1147, 273, 5003, 18, 588, 3061, 18048, 1345, 5621, 3639, 1160, 8526, 498, 751, 31, 3639, 368, 2030, 55, 498, 3639, 1929, 3908, 417, 75, 273, 1147, 18, 588, 653, 3908, 12, 653, 7642, 6801, 18, 26463, 1769, 3639, 10042, 6899, 653, 498, 273, 417, 75, 18, 7163, 5621, 3639, 309, 12, 498, 18, 588, 559, 1435, 480, 10042, 6899, 653, 18, 26463, 262, 288, 5411, 604, 394, 1185, 2932, 21530, 4886, 8863, 3639, 289, 3639, 309, 12, 401, 498, 18, 588, 3494, 2 ]
if (contribution != null) return contribution.getLocalId();
if (contribution != null) { return contribution.getLocalId(); }
public String getLocalId() { IPluginContribution contribution = getPluginContribution(); if (contribution != null) return contribution.getLocalId(); return wizardElement.getId(); }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/fa4a8cff0e027f8d3c6b1fcb92b30f46767dd191/NewWizardShortcutAction.java/clean/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/actions/NewWizardShortcutAction.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 6993, 548, 1435, 288, 377, 202, 45, 3773, 442, 4027, 24880, 273, 16319, 442, 4027, 5621, 377, 202, 430, 261, 591, 4027, 480, 446, 13, 377, 202, 202, 2463, 24880, 18, 588, 2042, 548, 5621, 377, 202, 2463, 24204, 1046, 18, 26321, 5621, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 6993, 548, 1435, 288, 377, 202, 45, 3773, 442, 4027, 24880, 273, 16319, 442, 4027, 5621, 377, 202, 430, 261, 591, 4027, 480, 446, 13, 377, 202, 202, 2463, 24880, 18, 588, 2042, 548, 5621, 377, 202, 2463, 24204, 1046, 18, 26321, 5621, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public org.quickfix.field.LegCurrency getLegCurrency() throws FieldNotFound { org.quickfix.field.LegCurrency value = new org.quickfix.field.LegCurrency();
public quickfix.field.LegCurrency getLegCurrency() throws FieldNotFound { quickfix.field.LegCurrency value = new quickfix.field.LegCurrency();
public org.quickfix.field.LegCurrency getLegCurrency() throws FieldNotFound { org.quickfix.field.LegCurrency value = new org.quickfix.field.LegCurrency(); getField(value); return value; }
8803 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8803/fecc27f98261270772ff182a1d4dfd94b5daa73d/CollateralRequest.java/buggy/src/java/src/quickfix/fix44/CollateralRequest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 336, 8329, 7623, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 5621, 565, 5031, 12, 1132, 1769, 327, 460, 31, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 336, 8329, 7623, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 8329, 7623, 5621, 565, 5031, 12, 1132, 1769, 327, 460, 31, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
updating = true;
public void removeElement(int index) { updating = true; try { Object oldValue = elements.remove(index); fireChangeEvent(ChangeEvent.REMOVE, oldValue, null, index); } finally { updating = false; } }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/d804a21873abe29f796d07f8e0997a19f438e904/ListUpdatableCollection.java/clean/bundles/org.eclipse.jface.databinding/src/org/eclipse/jface/internal/databinding/ListUpdatableCollection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 22015, 12, 474, 770, 13, 288, 202, 202, 5533, 1776, 273, 638, 31, 202, 202, 698, 288, 1082, 202, 921, 11144, 273, 2186, 18, 4479, 12, 1615, 1769, 1082, 202, 12179, 20930, 12, 20930, 18, 22122, 16, 11144, 16, 446, 16, 770, 1769, 202, 202, 97, 3095, 288, 1082, 202, 5533, 1776, 273, 629, 31, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 22015, 12, 474, 770, 13, 288, 202, 202, 5533, 1776, 273, 638, 31, 202, 202, 698, 288, 1082, 202, 921, 11144, 273, 2186, 18, 4479, 12, 1615, 1769, 1082, 202, 12179, 20930, 12, 20930, 18, 22122, 16, 11144, 16, 446, 16, 770, 1769, 202, 202, 97, 3095, 288, 1082, 202, 5533, 1776, 273, 629, 31, 202, 202, 97, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
for (int i = 0; i < methods.length; i++) { exportMethod(methods[i].toId(), noex); } }
for (int i = 0; i < methods.length; i++) { exportMethod(methods[i].toId(), noex); } }
public void setMethodVisibility(RubyObject[] methods, int noex) { if (getRuby().getSecurityLevel() >= 4 && !isTaint()) { throw new RubySecurityException( getRuby(), "Insecure: can't change method visibility"); } for (int i = 0; i < methods.length; i++) { exportMethod(methods[i].toId(), noex); } }
52337 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52337/0a7181933af700ea8025a4197f3a5ebcc08333c3/RubyModule.java/clean/org/jruby/RubyModule.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19539, 10135, 12, 54, 10340, 921, 8526, 2590, 16, 509, 1158, 338, 13, 288, 202, 202, 430, 261, 588, 54, 10340, 7675, 588, 4368, 2355, 1435, 1545, 1059, 597, 401, 291, 29048, 10756, 288, 1082, 202, 12849, 394, 19817, 24918, 12, 9506, 202, 588, 54, 10340, 9334, 9506, 202, 6, 382, 8869, 30, 848, 1404, 2549, 707, 9478, 8863, 202, 202, 97, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 2590, 18, 2469, 31, 277, 27245, 288, 1082, 202, 6530, 1305, 12, 5163, 63, 77, 8009, 869, 548, 9334, 1158, 338, 1769, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19539, 10135, 12, 54, 10340, 921, 8526, 2590, 16, 509, 1158, 338, 13, 288, 202, 202, 430, 261, 588, 54, 10340, 7675, 588, 4368, 2355, 1435, 1545, 1059, 597, 401, 291, 29048, 10756, 288, 1082, 202, 12849, 394, 19817, 24918, 12, 9506, 202, 588, 54, 10340, 9334, 9506, 202, 6, 382, 8869, 30, 848, 1404, 2549, 707, 9478, 8863, 202, 202, 97, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 2590, 18, 2469, 31, 277, 27245, 288, 1082, 202, 6530, 1305, 12, 5163, 63, 77, 8009, 869, 548, 9334, 1158, 338, 1769, 202, 202, 97, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
String jobName = context.getJobDetail().getFullName(); _log.info("Executing job: " + jobName + " executing at " + new Date()); }
String jobName = context.getJobDetail().getFullName(); _log.info("Executing job: " + jobName + " executing at " + new Date()); }
public void execute(JobExecutionContext context) throws JobExecutionException { // This job simply prints out its job name and the // date and time that it is running String jobName = context.getJobDetail().getFullName(); _log.info("Executing job: " + jobName + " executing at " + new Date()); }
3431 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3431/8441c8be6e16f3f87693ab6cfeae2bf90caf7159/SimpleJob.java/buggy/examples/src/java/org/quartz/examples/example10/SimpleJob.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1836, 12, 31498, 1042, 819, 13, 1082, 202, 15069, 3956, 14576, 288, 202, 202, 759, 1220, 1719, 8616, 14971, 596, 2097, 1719, 508, 471, 326, 202, 202, 759, 1509, 471, 813, 716, 518, 353, 3549, 202, 202, 780, 17833, 273, 819, 18, 588, 2278, 6109, 7675, 588, 19223, 5621, 202, 202, 67, 1330, 18, 1376, 2932, 22134, 1719, 30, 315, 397, 17833, 397, 315, 11274, 622, 315, 397, 394, 2167, 10663, 1082, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1836, 12, 31498, 1042, 819, 13, 1082, 202, 15069, 3956, 14576, 288, 202, 202, 759, 1220, 1719, 8616, 14971, 596, 2097, 1719, 508, 471, 326, 202, 202, 759, 1509, 471, 813, 716, 518, 353, 3549, 202, 202, 780, 17833, 273, 819, 18, 588, 2278, 6109, 7675, 588, 19223, 5621, 202, 202, 67, 1330, 18, 1376, 2932, 22134, 1719, 30, 315, 397, 17833, 397, 315, 11274, 622, 315, 397, 394, 2167, 10663, 1082, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
synchronizationManager = new RepositorySynchronizationManager();
public void run() { try { TasksUiExtensionReader.initExtensions(taskListWriter); taskRepositoryManager.readRepositories(getRepositoriesFilePath()); // Must be called after repositories read readOfflineReportsFile(); taskListManager.init(); taskListManager.addActivityListener(CONTEXT_TASK_ACTIVITY_LISTENER); taskListManager.readExistingOrCreateNewList(); initialized = true; PlatformUI.getWorkbench().addWindowListener(WINDOW_LISTENER); taskListNotificationManager = new TaskListNotificationManager(); taskListNotificationManager.addNotificationProvider(REMINDER_NOTIFICATION_PROVIDER); taskListNotificationManager.addNotificationProvider(INCOMING_NOTIFICATION_PROVIDER); taskListNotificationManager.startNotification(NOTIFICATION_DELAY); getPreferenceStore().addPropertyChangeListener(taskListNotificationManager); taskListBackupManager = new TaskListBackupManager(); getPreferenceStore().addPropertyChangeListener(taskListBackupManager); synchronizationManager = new RepositorySynchronizationManager(); synchronizationScheduler = new TaskListSynchronizationScheduler(true); synchronizationScheduler.startSynchJob(); taskListSaveManager = new TaskListSaveManager(); taskListManager.getTaskList().addChangeListener(taskListSaveManager); ContextCorePlugin.getDefault().getPluginPreferences().addPropertyChangeListener( PREFERENCE_LISTENER); getPreferenceStore().addPropertyChangeListener(synchronizationScheduler); getPreferenceStore().addPropertyChangeListener(taskListManager); } catch (Exception e) { MylarStatusHandler.fail(e, "Mylar Tasks UI start failed", false); } }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/2c6161dafa5740c2810b9ef436250eb1cba0da8b/TasksUiPlugin.java/clean/org.eclipse.mylyn.tasks.ui/src/org/eclipse/mylyn/tasks/ui/TasksUiPlugin.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4697, 202, 482, 918, 1086, 1435, 288, 6862, 202, 698, 288, 25083, 202, 6685, 13943, 3625, 2514, 18, 2738, 7513, 12, 4146, 682, 2289, 1769, 25083, 202, 4146, 3305, 1318, 18, 896, 18429, 12, 588, 18429, 5598, 10663, 25083, 202, 759, 6753, 506, 2566, 1839, 14531, 855, 25083, 202, 896, 23106, 18631, 812, 5621, 6862, 6862, 9506, 202, 4146, 682, 1318, 18, 2738, 5621, 25083, 202, 4146, 682, 1318, 18, 1289, 6193, 2223, 12, 13181, 67, 15580, 67, 22271, 4107, 67, 26421, 1769, 25083, 202, 4146, 682, 1318, 18, 896, 9895, 17717, 1908, 682, 5621, 25083, 202, 13227, 273, 638, 31, 25083, 202, 8201, 5370, 18, 588, 2421, 22144, 7675, 1289, 3829, 2223, 12, 23407, 67, 26421, 1769, 25083, 202, 4146, 682, 4386, 1318, 273, 394, 3837, 682, 4386, 1318, 5621, 25083, 202, 4146, 682, 4386, 1318, 18, 1289, 4386, 2249, 12, 862, 49, 14822, 67, 4400, 14865, 67, 26413, 1769, 25083, 202, 4146, 682, 4386, 1318, 18, 1289, 4386, 2249, 12, 706, 4208, 1360, 67, 4400, 14865, 67, 26413, 1769, 25083, 202, 4146, 682, 4386, 1318, 18, 1937, 4386, 12, 4400, 14865, 67, 26101, 1769, 25083, 202, 588, 9624, 2257, 7675, 1289, 1396, 15744, 12, 4146, 682, 4386, 1318, 1769, 25083, 202, 4146, 682, 6248, 1318, 273, 394, 3837, 682, 6248, 1318, 5621, 25083, 202, 588, 9624, 2257, 7675, 1289, 1396, 15744, 12, 4146, 682, 6248, 1318, 1769, 25083, 202, 87, 2600, 1588, 1318, 273, 394, 6281, 30196, 1318, 5621, 6862, 6862, 9506, 202, 87, 2600, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4697, 202, 482, 918, 1086, 1435, 288, 6862, 202, 698, 288, 25083, 202, 6685, 13943, 3625, 2514, 18, 2738, 7513, 12, 4146, 682, 2289, 1769, 25083, 202, 4146, 3305, 1318, 18, 896, 18429, 12, 588, 18429, 5598, 10663, 25083, 202, 759, 6753, 506, 2566, 1839, 14531, 855, 25083, 202, 896, 23106, 18631, 812, 5621, 6862, 6862, 9506, 202, 4146, 682, 1318, 18, 2738, 5621, 25083, 202, 4146, 682, 1318, 18, 1289, 6193, 2223, 12, 13181, 67, 15580, 67, 22271, 4107, 67, 26421, 1769, 25083, 202, 4146, 682, 1318, 18, 896, 9895, 17717, 1908, 682, 5621, 25083, 202, 13227, 273, 638, 31, 25083, 202, 8201, 5370, 18, 588, 2421, 22144, 7675, 1289, 3829, 2223, 12, 23407, 67, 26421, 1769, 25083, 2 ]
break;
continue Loop;
static Object interpret(Context cx, Scriptable scope, Scriptable thisObj, Object[] args, double[] argsDbl, int argShift, int argCount, NativeFunction fnOrScript, InterpreterData idata) throws JavaScriptException { if (cx.interpreterSecurityDomain != idata.securityDomain) { if (argsDbl != null) { args = getArgsArray(args, argsDbl, argShift, argCount); } SecurityController sc = idata.securityController; Object savedDomain = cx.interpreterSecurityDomain; cx.interpreterSecurityDomain = idata.securityDomain; try { return sc.callWithDomain(idata.securityDomain, cx, fnOrScript, scope, thisObj, args); } finally { cx.interpreterSecurityDomain = savedDomain; } } final Object DBL_MRK = Interpreter.DBL_MRK; final Scriptable undefined = Undefined.instance; final int VAR_SHFT = 0; final int maxVars = idata.itsMaxVars; final int LOCAL_SHFT = VAR_SHFT + maxVars; final int STACK_SHFT = LOCAL_SHFT + idata.itsMaxLocals;// stack[VAR_SHFT <= i < LOCAL_SHFT]: variables// stack[LOCAL_SHFT <= i < TRY_STACK_SHFT]: used for newtemp/usetemp// stack[STACK_SHFT <= i < STACK_SHFT + idata.itsMaxStack]: stack data// sDbl[i]: if stack[i] is DBL_MRK, sDbl[i] holds the number value int maxFrameArray = idata.itsMaxFrameArray; if (maxFrameArray != STACK_SHFT + idata.itsMaxStack) Kit.codeBug(); Object[] stack = new Object[maxFrameArray]; double[] sDbl = new double[maxFrameArray]; int stackTop = STACK_SHFT - 1; int withDepth = 0; int definedArgs = fnOrScript.argCount; if (definedArgs > argCount) { definedArgs = argCount; } for (int i = 0; i != definedArgs; ++i) { Object arg = args[argShift + i]; stack[VAR_SHFT + i] = arg; if (arg == DBL_MRK) { sDbl[VAR_SHFT + i] = argsDbl[argShift + i]; } } for (int i = definedArgs; i != maxVars; ++i) { stack[VAR_SHFT + i] = undefined; } DebugFrame debuggerFrame = null; if (cx.debugger != null) { debuggerFrame = cx.debugger.getFrame(cx, idata); } if (idata.itsFunctionType != 0) { InterpretedFunction f = (InterpretedFunction)fnOrScript; if (!idata.useDynamicScope) { scope = fnOrScript.getParentScope(); } if (idata.itsCheckThis) { thisObj = ScriptRuntime.getThis(thisObj); } if (idata.itsNeedsActivation) { if (argsDbl != null) { args = getArgsArray(args, argsDbl, argShift, argCount); argShift = 0; argsDbl = null; } scope = ScriptRuntime.initVarObj(cx, scope, fnOrScript, thisObj, args); } } else { ScriptRuntime.initScript(cx, scope, fnOrScript, thisObj, idata.itsFromEvalCode); } if (idata.itsNestedFunctions != null) { if (idata.itsFunctionType != 0 && !idata.itsNeedsActivation) Kit.codeBug(); for (int i = 0; i < idata.itsNestedFunctions.length; i++) { InterpreterData fdata = idata.itsNestedFunctions[i]; if (fdata.itsFunctionType == FunctionNode.FUNCTION_STATEMENT) { createFunction(cx, scope, fdata, idata.itsFromEvalCode); } } } // Wrapped regexps for functions are stored in InterpretedFunction // but for script which should not contain references to scope // the regexps re-wrapped during each script execution Scriptable[] scriptRegExps = null; boolean useActivationVars = false; if (debuggerFrame != null) { if (argsDbl != null) { args = getArgsArray(args, argsDbl, argShift, argCount); argShift = 0; argsDbl = null; } if (idata.itsFunctionType != 0 && !idata.itsNeedsActivation) { useActivationVars = true; scope = ScriptRuntime.initVarObj(cx, scope, fnOrScript, thisObj, args); } debuggerFrame.onEnter(cx, scope, thisObj, args); } InterpreterData savedData = cx.interpreterData; cx.interpreterData = idata; Object result = undefined; // If javaException != null on exit, it will be throw instead of // normal return Throwable javaException = null; int exceptionPC = -1; byte[] iCode = idata.itsICode; String[] strings = idata.itsStringTable; int pc = 0; int pcPrevBranch = pc; final int instructionThreshold = cx.instructionThreshold; // During function call this will be set to -1 so catch can properly // adjust it int instructionCount = cx.instructionCount; // arbitrary number to add to instructionCount when calling // other functions final int INVOCATION_COST = 100; Loop: for (;;) { try { int op = 0xFF & iCode[pc++]; switch (op) { // Back indent to ease imlementation reading case Icode_CATCH: { // The following code should be executed inside try/catch inside main // loop, not in the loop catch block itself to deal with exceptions // from observeInstructionCount. A special bytecode is used only to // simplify logic. if (javaException == null) Kit.codeBug(); int pcNew = -1; boolean doCatch = false; int handlerOffset = getExceptionHandler(idata.itsExceptionTable, exceptionPC); if (handlerOffset >= 0) { final int SCRIPT_CAN_CATCH = 0, ONLY_FINALLY = 1, OTHER = 2; int exType; if (javaException instanceof JavaScriptException) { exType = SCRIPT_CAN_CATCH; } else if (javaException instanceof EcmaError) { // an offical ECMA error object, exType = SCRIPT_CAN_CATCH; } else if (javaException instanceof EvaluatorException) { exType = SCRIPT_CAN_CATCH; } else if (javaException instanceof RuntimeException) { exType = ONLY_FINALLY; } else { // Error instance exType = OTHER; } if (exType != OTHER) { // Do not allow for JS to interfere with Error instances // (exType == OTHER), as they can be used to terminate // long running script if (exType == SCRIPT_CAN_CATCH) { // Allow JS to catch only JavaScriptException and // EcmaError pcNew = idata.itsExceptionTable[handlerOffset + EXCEPTION_CATCH_SLOT]; if (pcNew >= 0) { // Has catch block doCatch = true; } } if (pcNew < 0) { pcNew = idata.itsExceptionTable[handlerOffset + EXCEPTION_FINALLY_SLOT]; } } } if (debuggerFrame != null && !(javaException instanceof Error)) { debuggerFrame.onExceptionThrown(cx, javaException); } if (pcNew < 0) { break Loop; } // We caught an exception // restore scope at try point int tryWithDepth = idata.itsExceptionTable[ handlerOffset + EXCEPTION_WITH_DEPTH_SLOT]; while (tryWithDepth != withDepth) { if (scope == null) Kit.codeBug(); scope = ScriptRuntime.leaveWith(scope); --withDepth; } if (doCatch) { stackTop = STACK_SHFT - 1; int exLocal = idata.itsExceptionTable[ handlerOffset + EXCEPTION_LOCAL_SLOT]; stack[LOCAL_SHFT + exLocal] = ScriptRuntime.getCatchObject( cx, scope, javaException); } else { stackTop = STACK_SHFT; // Call finally handler with javaException on stack top to // distinguish from normal invocation through GOSUB // which would contain DBL_MRK on the stack stack[stackTop] = javaException; } // clear exception javaException = null; // Notify instruction observer if necessary // and point pc and pcPrevBranch to start of catch/finally block if (instructionThreshold != 0) { if (instructionCount > instructionThreshold) { // Note: this can throw Error cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = pcNew; continue Loop; } case Token.THROW: { Object value = stack[stackTop]; if (value == DBL_MRK) value = doubleWrap(sDbl[stackTop]); --stackTop; int sourceLine = getShort(iCode, pc); javaException = new JavaScriptException(value, idata.itsSourceFile, sourceLine); exceptionPC = pc - 1; if (instructionThreshold != 0) { instructionCount += pc - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getJavaCatchPC(iCode); continue Loop; } case Token.GE : { --stackTop; Object rhs = stack[stackTop + 1]; Object lhs = stack[stackTop]; boolean valBln; if (rhs == DBL_MRK || lhs == DBL_MRK) { double rDbl = stack_double(stack, sDbl, stackTop + 1); double lDbl = stack_double(stack, sDbl, stackTop); valBln = (rDbl <= lDbl); } else { valBln = ScriptRuntime.cmp_LE(rhs, lhs); } stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.LE : { --stackTop; Object rhs = stack[stackTop + 1]; Object lhs = stack[stackTop]; boolean valBln; if (rhs == DBL_MRK || lhs == DBL_MRK) { double rDbl = stack_double(stack, sDbl, stackTop + 1); double lDbl = stack_double(stack, sDbl, stackTop); valBln = (lDbl <= rDbl); } else { valBln = ScriptRuntime.cmp_LE(lhs, rhs); } stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.GT : { --stackTop; Object rhs = stack[stackTop + 1]; Object lhs = stack[stackTop]; boolean valBln; if (rhs == DBL_MRK || lhs == DBL_MRK) { double rDbl = stack_double(stack, sDbl, stackTop + 1); double lDbl = stack_double(stack, sDbl, stackTop); valBln = (rDbl < lDbl); } else { valBln = ScriptRuntime.cmp_LT(rhs, lhs); } stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.LT : { --stackTop; Object rhs = stack[stackTop + 1]; Object lhs = stack[stackTop]; boolean valBln; if (rhs == DBL_MRK || lhs == DBL_MRK) { double rDbl = stack_double(stack, sDbl, stackTop + 1); double lDbl = stack_double(stack, sDbl, stackTop); valBln = (lDbl < rDbl); } else { valBln = ScriptRuntime.cmp_LT(lhs, rhs); } stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.IN : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); boolean valBln = ScriptRuntime.in(lhs, rhs, scope); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.INSTANCEOF : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); boolean valBln = ScriptRuntime.instanceOf(lhs, rhs, scope); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.EQ : { --stackTop; boolean valBln = do_eq(stack, sDbl, stackTop); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.NE : { --stackTop; boolean valBln = !do_eq(stack, sDbl, stackTop); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.SHEQ : { --stackTop; boolean valBln = do_sheq(stack, sDbl, stackTop); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.SHNE : { --stackTop; boolean valBln = !do_sheq(stack, sDbl, stackTop); stack[stackTop] = valBln ? Boolean.TRUE : Boolean.FALSE; break; } case Token.IFNE : { boolean valBln = stack_boolean(stack, sDbl, stackTop); --stackTop; if (!valBln) { if (instructionThreshold != 0) { instructionCount += pc + 2 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getTarget(iCode, pc); continue Loop; } pc += 2; break; } case Token.IFEQ : { boolean valBln = stack_boolean(stack, sDbl, stackTop); --stackTop; if (valBln) { if (instructionThreshold != 0) { instructionCount += pc + 2 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getTarget(iCode, pc); continue Loop; } pc += 2; break; } case Icode_IFEQ_POP : { boolean valBln = stack_boolean(stack, sDbl, stackTop); --stackTop; if (valBln) { if (instructionThreshold != 0) { instructionCount += pc + 2 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getTarget(iCode, pc); stack[stackTop--] = null; continue Loop; } pc += 2; break; } case Token.GOTO : if (instructionThreshold != 0) { instructionCount += pc + 2 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getTarget(iCode, pc); continue Loop; case Icode_GOSUB : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = pc + 2; if (instructionThreshold != 0) { instructionCount += pc + 2 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } pcPrevBranch = pc = getTarget(iCode, pc); continue Loop; case Icode_RETSUB : { int slot = (iCode[pc] & 0xFF); if (instructionThreshold != 0) { instructionCount += pc + 1 - pcPrevBranch; if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } } int newPC; Object value = stack[LOCAL_SHFT + slot]; if (value != DBL_MRK) { // Invocation from exception handler, restore object to rethrow javaException = (Throwable)value; exceptionPC = pc - 1; newPC = getJavaCatchPC(iCode); } else { // Normal return from GOSUB newPC = (int)sDbl[LOCAL_SHFT + slot]; } pcPrevBranch = pc = newPC; continue Loop; } case Token.POP : stack[stackTop] = null; stackTop--; break; case Icode_DUP : stack[stackTop + 1] = stack[stackTop]; sDbl[stackTop + 1] = sDbl[stackTop]; stackTop++; break; case Icode_DUPSECOND : { stack[stackTop + 1] = stack[stackTop - 1]; sDbl[stackTop + 1] = sDbl[stackTop - 1]; stackTop++; break; } case Icode_SWAP : { Object o = stack[stackTop]; stack[stackTop] = stack[stackTop - 1]; stack[stackTop - 1] = o; double d = sDbl[stackTop]; sDbl[stackTop] = sDbl[stackTop - 1]; sDbl[stackTop - 1] = d; break; } case Token.POPV : result = stack[stackTop]; if (result == DBL_MRK) result = doubleWrap(sDbl[stackTop]); stack[stackTop] = null; --stackTop; break; case Token.RETURN : result = stack[stackTop]; if (result == DBL_MRK) result = doubleWrap(sDbl[stackTop]); --stackTop; break Loop; case Token.RETURN_POPV : break Loop; case Icode_RETUNDEF : result = undefined; break Loop; case Token.BITNOT : { int rIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = ~rIntValue; break; } case Token.BITAND : { int rIntValue = stack_int32(stack, sDbl, stackTop); --stackTop; int lIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lIntValue & rIntValue; break; } case Token.BITOR : { int rIntValue = stack_int32(stack, sDbl, stackTop); --stackTop; int lIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lIntValue | rIntValue; break; } case Token.BITXOR : { int rIntValue = stack_int32(stack, sDbl, stackTop); --stackTop; int lIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lIntValue ^ rIntValue; break; } case Token.LSH : { int rIntValue = stack_int32(stack, sDbl, stackTop); --stackTop; int lIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lIntValue << rIntValue; break; } case Token.RSH : { int rIntValue = stack_int32(stack, sDbl, stackTop); --stackTop; int lIntValue = stack_int32(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lIntValue >> rIntValue; break; } case Token.URSH : { int rIntValue = stack_int32(stack, sDbl, stackTop) & 0x1F; --stackTop; double lDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = ScriptRuntime.toUint32(lDbl) >>> rIntValue; break; } case Token.ADD : --stackTop; do_add(stack, sDbl, stackTop); break; case Token.SUB : { double rDbl = stack_double(stack, sDbl, stackTop); --stackTop; double lDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lDbl - rDbl; break; } case Token.NEG : { double rDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = -rDbl; break; } case Token.POS : { double rDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = rDbl; break; } case Token.MUL : { double rDbl = stack_double(stack, sDbl, stackTop); --stackTop; double lDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lDbl * rDbl; break; } case Token.DIV : { double rDbl = stack_double(stack, sDbl, stackTop); --stackTop; double lDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; // Detect the divide by zero or let Java do it ? sDbl[stackTop] = lDbl / rDbl; break; } case Token.MOD : { double rDbl = stack_double(stack, sDbl, stackTop); --stackTop; double lDbl = stack_double(stack, sDbl, stackTop); stack[stackTop] = DBL_MRK; sDbl[stackTop] = lDbl % rDbl; break; } case Token.NOT : { stack[stackTop] = stack_boolean(stack, sDbl, stackTop) ? Boolean.FALSE : Boolean.TRUE; break; } case Token.BINDNAME : { String name = strings[getIndex(iCode, pc)]; stack[++stackTop] = ScriptRuntime.bind(scope, name); pc += 2; break; } case Token.SETNAME : { String name = strings[getIndex(iCode, pc)]; Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Scriptable lhs = (Scriptable)stack[stackTop]; stack[stackTop] = ScriptRuntime.setName(lhs, rhs, scope, name); pc += 2; break; } case Token.DELPROP : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.delete(cx, scope, lhs, rhs); break; } case Token.GETPROP : { String name = (String)stack[stackTop]; --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.getProp(lhs, name, scope); break; } case Token.SETPROP : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; String name = (String)stack[stackTop]; --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.setProp(lhs, name, rhs, scope); break; } case Token.GETELEM : do_getElem(cx, stack, sDbl, stackTop, scope); --stackTop; break; case Token.SETELEM : do_setElem(cx, stack, sDbl, stackTop, scope); stackTop -= 2; break; case Icode_PROPINC : case Icode_PROPDEC : { String name = (String)stack[stackTop]; --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.postIncrDecr(lhs, name, scope, op == Icode_PROPINC); break; } case Icode_ELEMINC : case Icode_ELEMDEC : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.postIncrDecrElem(lhs, rhs, scope, op == Icode_ELEMINC); break; } case Token.LOCAL_SAVE : { int slot = (iCode[pc] & 0xFF); stack[LOCAL_SHFT + slot] = stack[stackTop]; sDbl[LOCAL_SHFT + slot] = sDbl[stackTop]; --stackTop; ++pc; break; } case Token.LOCAL_LOAD : { int slot = (iCode[pc] & 0xFF); ++stackTop; stack[stackTop] = stack[LOCAL_SHFT + slot]; sDbl[stackTop] = sDbl[LOCAL_SHFT + slot]; ++pc; break; } case Icode_CALLSPECIAL : { if (instructionThreshold != 0) { instructionCount += INVOCATION_COST; cx.instructionCount = instructionCount; instructionCount = -1; } int callType = iCode[pc] & 0xFF; boolean isNew = (iCode[pc + 1] != 0); int sourceLine = getShort(iCode, pc + 2); int count = getIndex(iCode, pc + 4); stackTop -= count; Object[] outArgs = getArgsArray(stack, sDbl, stackTop + 1, count); Object functionThis; if (isNew) { functionThis = null; } else { functionThis = stack[stackTop]; if (functionThis == DBL_MRK) { functionThis = doubleWrap(sDbl[stackTop]); } --stackTop; } Object function = stack[stackTop]; if (function == DBL_MRK) function = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.callSpecial( cx, function, isNew, functionThis, outArgs, scope, thisObj, callType, idata.itsSourceFile, sourceLine); instructionCount = cx.instructionCount; pc += 6; break; } case Token.CALL : { if (instructionThreshold != 0) { instructionCount += INVOCATION_COST; cx.instructionCount = instructionCount; instructionCount = -1; } int count = getIndex(iCode, pc + 2); stackTop -= count; int calleeArgShft = stackTop + 1; Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; Scriptable calleeScope = scope; if (idata.itsNeedsActivation) { calleeScope = ScriptableObject.getTopLevelScope(scope); } Scriptable calleeThis; if (rhs instanceof Scriptable || rhs == null) { calleeThis = (Scriptable)rhs; } else { calleeThis = ScriptRuntime.toObject(cx, calleeScope, rhs); } if (lhs instanceof InterpretedFunction) { // Inlining of InterpretedFunction.call not to create // argument array InterpretedFunction f = (InterpretedFunction)lhs; stack[stackTop] = interpret(cx, calleeScope, calleeThis, stack, sDbl, calleeArgShft, count, f, f.itsData); } else if (lhs instanceof Function) { Function f = (Function)lhs; Object[] outArgs = getArgsArray(stack, sDbl, calleeArgShft, count); stack[stackTop] = f.call(cx, calleeScope, calleeThis, outArgs); } else { if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); else if (lhs == undefined) { // special code for better error message for call // to undefined lhs = strings[getIndex(iCode, pc)]; if (lhs == null) lhs = undefined; } throw ScriptRuntime.typeError1("msg.isnt.function", ScriptRuntime.toString(lhs)); } instructionCount = cx.instructionCount; pc += 4; break; } case Token.NEW : { if (instructionThreshold != 0) { instructionCount += INVOCATION_COST; cx.instructionCount = instructionCount; instructionCount = -1; } int count = getIndex(iCode, pc + 2); stackTop -= count; int calleeArgShft = stackTop + 1; Object lhs = stack[stackTop]; if (lhs instanceof InterpretedFunction) { // Inlining of InterpretedFunction.construct not to create // argument array InterpretedFunction f = (InterpretedFunction)lhs; Scriptable newInstance = f.createObject(cx, scope); Object callResult = interpret(cx, scope, newInstance, stack, sDbl, calleeArgShft, count, f, f.itsData); if (callResult instanceof Scriptable && callResult != undefined) { stack[stackTop] = callResult; } else { stack[stackTop] = newInstance; } } else if (lhs instanceof Function) { Function f = (Function)lhs; Object[] outArgs = getArgsArray(stack, sDbl, calleeArgShft, count); stack[stackTop] = f.construct(cx, scope, outArgs); } else { if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); else if (lhs == undefined) { // special code for better error message for call // to undefined lhs = strings[getIndex(iCode, pc)]; if (lhs == null) lhs = undefined; } throw ScriptRuntime.typeError1("msg.isnt.function", ScriptRuntime.toString(lhs)); } instructionCount = cx.instructionCount; pc += 4; break; } case Token.TYPEOF : { Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[stackTop] = ScriptRuntime.typeof(lhs); break; } case Icode_TYPEOFNAME : { String name = strings[getIndex(iCode, pc)]; stack[++stackTop] = ScriptRuntime.typeofName(scope, name); pc += 2; break; } case Icode_NAME_AND_THIS : { String name = strings[getIndex(iCode, pc)]; boolean skipGetThis = (0 != iCode[pc + 2]); stackTop = do_nameAndThis(stack, stackTop, scope, name, skipGetThis); pc += 3; break; } case Token.STRING : stack[++stackTop] = strings[getIndex(iCode, pc)]; pc += 2; break; case Icode_SHORTNUMBER : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = getShort(iCode, pc); pc += 2; break; case Icode_INTNUMBER : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = getInt(iCode, pc); pc += 4; break; case Token.NUMBER : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = idata.itsDoubleTable[getIndex(iCode, pc)]; pc += 2; break; case Token.NAME : { String name = strings[getIndex(iCode, pc)]; stack[++stackTop] = ScriptRuntime.name(scope, name); pc += 2; break; } case Icode_NAMEINC : case Icode_NAMEDEC : { String name = strings[getIndex(iCode, pc)]; stack[++stackTop] = ScriptRuntime.postIncrDecr(scope, name, op == Icode_NAMEINC); pc += 2; break; } case Token.SETVAR : { int slot = (iCode[pc] & 0xFF); if (!useActivationVars) { stack[VAR_SHFT + slot] = stack[stackTop]; sDbl[VAR_SHFT + slot] = sDbl[stackTop]; } else { Object val = stack[stackTop]; if (val == DBL_MRK) val = doubleWrap(sDbl[stackTop]); activationPut(fnOrScript, scope, slot, val); } ++pc; break; } case Token.GETVAR : { int slot = (iCode[pc] & 0xFF); ++stackTop; if (!useActivationVars) { stack[stackTop] = stack[VAR_SHFT + slot]; sDbl[stackTop] = sDbl[VAR_SHFT + slot]; } else { stack[stackTop] = activationGet(fnOrScript, scope, slot); } ++pc; break; } case Icode_VARINC : case Icode_VARDEC : { int slot = (iCode[pc] & 0xFF); ++stackTop; if (!useActivationVars) { Object val = stack[VAR_SHFT + slot]; stack[stackTop] = val; double d; if (val == DBL_MRK) { d = sDbl[VAR_SHFT + slot]; sDbl[stackTop] = d; } else { d = ScriptRuntime.toNumber(val); } stack[VAR_SHFT + slot] = DBL_MRK; sDbl[VAR_SHFT + slot] = (op == Icode_VARINC) ? d + 1.0 : d - 1.0; } else { Object val = activationGet(fnOrScript, scope, slot); stack[stackTop] = val; double d = ScriptRuntime.toNumber(val); val = doubleWrap((op == Icode_VARINC) ? d + 1.0 : d - 1.0); activationPut(fnOrScript, scope, slot, val); } ++pc; break; } case Token.ZERO : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = 0; break; case Token.ONE : ++stackTop; stack[stackTop] = DBL_MRK; sDbl[stackTop] = 1; break; case Token.NULL : stack[++stackTop] = null; break; case Token.THIS : stack[++stackTop] = thisObj; break; case Token.THISFN : stack[++stackTop] = fnOrScript; break; case Token.FALSE : stack[++stackTop] = Boolean.FALSE; break; case Token.TRUE : stack[++stackTop] = Boolean.TRUE; break; case Token.UNDEFINED : stack[++stackTop] = Undefined.instance; break; case Token.ENTERWITH : { Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); --stackTop; scope = ScriptRuntime.enterWith(lhs, scope); ++withDepth; break; } case Token.LEAVEWITH : scope = ScriptRuntime.leaveWith(scope); --withDepth; break; case Token.CATCH_SCOPE : { String name = strings[getIndex(iCode, pc)]; stack[stackTop] = ScriptRuntime.newCatchScope(name, stack[stackTop]); pc += 2; break; } case Token.ENUM_INIT : { int slot = (iCode[pc] & 0xFF); Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); --stackTop; stack[LOCAL_SHFT + slot] = ScriptRuntime.enumInit(lhs, scope); ++pc; break; } case Token.ENUM_NEXT : case Token.ENUM_ID : { int slot = (iCode[pc] & 0xFF); Object val = stack[LOCAL_SHFT + slot]; ++stackTop; stack[stackTop] = (op == Token.ENUM_NEXT) ? (Object)ScriptRuntime.enumNext(val) : (Object)ScriptRuntime.enumId(val); ++pc; break; } case Icode_PUSH_PARENT : { Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); stack[++stackTop] = ScriptRuntime.getParent(lhs); break; } case Icode_GETPROTO : case Icode_GETSCOPEPARENT : { Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); Object val; if (op == Icode_GETPROTO) { val = ScriptRuntime.getProto(lhs, scope); } else { val = ScriptRuntime.getParent(lhs, scope); } stack[stackTop] = val; break; } case Icode_SETPROTO : case Icode_SETPARENT : { Object rhs = stack[stackTop]; if (rhs == DBL_MRK) rhs = doubleWrap(sDbl[stackTop]); --stackTop; Object lhs = stack[stackTop]; if (lhs == DBL_MRK) lhs = doubleWrap(sDbl[stackTop]); Object val; if (op == Icode_SETPROTO) { val = ScriptRuntime.setProto(lhs, rhs, scope); } else { val = ScriptRuntime.setParent(lhs, rhs, scope); } stack[stackTop] = val; break; } case Icode_SCOPE : stack[++stackTop] = scope; break; case Icode_CLOSURE : { int i = getIndex(iCode, pc); InterpreterData closureData = idata.itsNestedFunctions[i]; stack[++stackTop] = createFunction(cx, scope, closureData, idata.itsFromEvalCode); pc += 2; break; } case Token.REGEXP : { int i = getIndex(iCode, pc); Scriptable regexp; if (idata.itsFunctionType != 0) { regexp = ((InterpretedFunction)fnOrScript).itsRegExps[i]; } else { if (scriptRegExps == null) { scriptRegExps = wrapRegExps(cx, scope, idata); } regexp = scriptRegExps[i]; } stack[++stackTop] = regexp; pc += 2; break; } case Icode_LITERAL_NEW : { int i = getInt(iCode, pc); ++stackTop; stack[stackTop] = new Object[i]; sDbl[stackTop] = 0; pc += 4; break; } case Icode_LITERAL_SET : { Object value = stack[stackTop]; if (value == DBL_MRK) value = doubleWrap(sDbl[stackTop]); --stackTop; int i = (int)sDbl[stackTop]; ((Object[])stack[stackTop])[i] = value; sDbl[stackTop] = i + 1; break; } case Token.ARRAYLIT : case Token.OBJECTLIT : { int offset = getInt(iCode, pc); Object[] data = (Object[])stack[stackTop]; Object val; if (op == Token.ARRAYLIT) { int[] skipIndexces = null; if (offset >= 0) { skipIndexces = (int[])idata.literalIds[offset]; } val = ScriptRuntime.newArrayLiteral(data, skipIndexces, cx, scope); } else { Object[] ids = (Object[])idata.literalIds[offset]; val = ScriptRuntime.newObjectLiteral(ids, data, cx, scope); } stack[stackTop] = val; pc += 4; break; } case Icode_LINE : { cx.interpreterLineIndex = pc; if (debuggerFrame != null) { int line = getShort(iCode, pc); debuggerFrame.onLineChange(cx, line); } pc += 2; break; } default : { dumpICode(idata); throw new RuntimeException("Unknown icode : "+op+" @ pc : "+(pc-1)); } // end of interpreter switch } } catch (Throwable ex) { if (instructionThreshold != 0) { if (instructionCount < 0) { // throw during function call instructionCount = cx.instructionCount; } else { // throw during any other operation instructionCount += pc - pcPrevBranch; cx.instructionCount = instructionCount; } } javaException = ex; exceptionPC = pc; pc = getJavaCatchPC(iCode); continue Loop; } } cx.interpreterData = savedData; if (debuggerFrame != null) { if (javaException != null) { debuggerFrame.onExit(cx, true, javaException); } else { debuggerFrame.onExit(cx, false, result); } } if (idata.itsNeedsActivation || debuggerFrame != null) { ScriptRuntime.popActivation(cx); } if (instructionThreshold != 0) { if (instructionCount > instructionThreshold) { cx.observeInstructionCount(instructionCount); instructionCount = 0; } cx.instructionCount = instructionCount; } if (javaException != null) { if (javaException instanceof JavaScriptException) { throw (JavaScriptException)javaException; } else if (javaException instanceof RuntimeException) { throw (RuntimeException)javaException; } else { // Must be instance of Error or code bug throw (Error)javaException; } } return result; }
19042 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/19042/369d8e109106915195bef3af1282543ab09e3869/Interpreter.java/clean/src/org/mozilla/javascript/Interpreter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 1033, 10634, 12, 1042, 9494, 16, 22780, 2146, 16, 22780, 15261, 16, 18701, 1033, 8526, 833, 16, 1645, 8526, 833, 40, 3083, 16, 18701, 509, 1501, 10544, 16, 509, 1501, 1380, 16, 18701, 16717, 2083, 2295, 1162, 3651, 16, 18701, 5294, 11599, 751, 612, 396, 13, 3639, 1216, 11905, 503, 565, 288, 3639, 309, 261, 71, 92, 18, 2761, 11599, 4368, 3748, 480, 612, 396, 18, 7462, 3748, 13, 288, 5411, 309, 261, 1968, 40, 3083, 480, 446, 13, 288, 7734, 833, 273, 30169, 1076, 12, 1968, 16, 833, 40, 3083, 16, 1501, 10544, 16, 1501, 1380, 1769, 5411, 289, 5411, 6036, 2933, 888, 273, 612, 396, 18, 7462, 2933, 31, 5411, 1033, 5198, 3748, 273, 9494, 18, 2761, 11599, 4368, 3748, 31, 5411, 9494, 18, 2761, 11599, 4368, 3748, 273, 612, 396, 18, 7462, 3748, 31, 5411, 775, 288, 7734, 327, 888, 18, 1991, 1190, 3748, 12, 350, 396, 18, 7462, 3748, 16, 9494, 16, 2295, 1162, 3651, 16, 29159, 2146, 16, 15261, 16, 833, 1769, 5411, 289, 3095, 288, 7734, 9494, 18, 2761, 11599, 4368, 3748, 273, 5198, 3748, 31, 5411, 289, 3639, 289, 3639, 727, 1033, 2383, 48, 67, 23464, 47, 273, 5294, 11599, 18, 2290, 48, 67, 23464, 47, 31, 3639, 727, 22780, 3109, 273, 22243, 18, 1336, 31, 3639, 727, 509, 8350, 67, 2664, 4464, 273, 374, 31, 3639, 727, 509, 943, 5555, 273, 612, 396, 18, 1282, 2747, 5555, 31, 3639, 727, 509, 15234, 67, 2664, 4464, 273, 8350, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 1033, 10634, 12, 1042, 9494, 16, 22780, 2146, 16, 22780, 15261, 16, 18701, 1033, 8526, 833, 16, 1645, 8526, 833, 40, 3083, 16, 18701, 509, 1501, 10544, 16, 509, 1501, 1380, 16, 18701, 16717, 2083, 2295, 1162, 3651, 16, 18701, 5294, 11599, 751, 612, 396, 13, 3639, 1216, 11905, 503, 565, 288, 3639, 309, 261, 71, 92, 18, 2761, 11599, 4368, 3748, 480, 612, 396, 18, 7462, 3748, 13, 288, 5411, 309, 261, 1968, 40, 3083, 480, 446, 13, 288, 7734, 833, 273, 30169, 1076, 12, 1968, 16, 833, 40, 3083, 16, 1501, 10544, 16, 1501, 1380, 1769, 5411, 289, 5411, 6036, 2933, 888, 273, 612, 396, 18, 7462, 2933, 31, 5411, 1033, 5198, 3748, 273, 9494, 2 ]
mocker.verifyExpectations(); }
mocker.verifyExpectations(); }
public void testIsVoidSetsVoidStub() { mocker.setStubType.setExpected(VoidStub.class); assertNotNull("Should be expectation builder", builder.isVoid()); mocker.verifyExpectations(); }
54028 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54028/c26c57f3ac4851e6bc9c5df8515ac73f4045eebf/InvocationMockerBuilderTest.java/buggy/jmock/core/src/test/jmock/builder/InvocationMockerBuilderTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 2520, 19038, 2785, 19038, 11974, 1435, 288, 202, 202, 81, 6203, 18, 542, 11974, 559, 18, 542, 6861, 12, 19038, 11974, 18, 1106, 1769, 202, 202, 11231, 5962, 2932, 14309, 506, 17733, 2089, 3113, 2089, 18, 291, 19038, 10663, 202, 202, 81, 6203, 18, 8705, 11988, 1012, 5621, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 2520, 19038, 2785, 19038, 11974, 1435, 288, 202, 202, 81, 6203, 18, 542, 11974, 559, 18, 542, 6861, 12, 19038, 11974, 18, 1106, 1769, 202, 202, 11231, 5962, 2932, 14309, 506, 17733, 2089, 3113, 2089, 18, 291, 19038, 10663, 202, 202, 81, 6203, 18, 8705, 11988, 1012, 5621, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
{ SAXParseException fatal; fatal = new SAXParseException (message, this); errorHandler.fatalError (fatal);
{ SAXParseException fatal; fatal = new SAXParseException(message, this); errorHandler.fatalError(fatal);
void fatal (String message) throws SAXException { SAXParseException fatal; fatal = new SAXParseException (message, this); errorHandler.fatalError (fatal); // Even if the application can continue ... we can't! throw fatal; }
1023 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1023/7fb7568e63c3fe14af521de4699cb37898923ca7/SAXDriver.java/buggy/libjava/gnu/xml/aelfred2/SAXDriver.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 10081, 261, 780, 883, 13, 565, 1216, 14366, 565, 288, 202, 55, 2501, 13047, 10081, 31, 202, 202, 30709, 273, 394, 10168, 13047, 261, 2150, 16, 333, 1769, 202, 1636, 1503, 18, 30709, 668, 261, 30709, 1769, 202, 759, 25067, 309, 326, 2521, 848, 1324, 1372, 732, 848, 1404, 5, 202, 12849, 10081, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 10081, 261, 780, 883, 13, 565, 1216, 14366, 565, 288, 202, 55, 2501, 13047, 10081, 31, 202, 202, 30709, 273, 394, 10168, 13047, 261, 2150, 16, 333, 1769, 202, 1636, 1503, 18, 30709, 668, 261, 30709, 1769, 202, 759, 25067, 309, 326, 2521, 848, 1324, 1372, 732, 848, 1404, 5, 202, 12849, 10081, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
FactHandleImpl [] factHandles = (FactHandleImpl[])tuple.getFactHandles(); for(int i = 0; i < factHandles.length; i++){
FactHandleImpl[] factHandles = (FactHandleImpl[]) tuple .getFactHandles(); for (int i = 0; i < factHandles.length; i++) {
public void assertTuple(LeapsTuple tuple, Rule rule) { PropagationContext context = tuple.getContext(); // if the current Rule is no-loop and the origin rule is the same then // return if (rule.getNoLoop() && rule.equals(context.getRuleOrigin())) { return; } Duration dur = rule.getDuration(); Activation agendaItem; if (dur != null && dur.getDuration(tuple) > 0) { agendaItem = new ScheduledAgendaItem(context .getPropagationNumber(), tuple, this.agenda, context, rule); this.agenda.scheduleItem((ScheduledAgendaItem) agendaItem); tuple.setActivation(agendaItem); agendaItem.setActivated(true); this.getAgendaEventSupport().fireActivationCreated(agendaItem); } else { // ----------------- // Lazy instantiation and addition to the Agenda of AgendGroup // implementations // ---------------- AgendaGroupImpl agendaGroup = null; if (rule.getAgendaGroup() == null || rule.getAgendaGroup().equals("") || rule.getAgendaGroup().equals(AgendaGroup.MAIN)) { // Is the Rule AgendaGroup undefined? If it is use MAIN, which // is added to the Agenda by default agendaGroup = (AgendaGroupImpl) this.agenda .getAgendaGroup(AgendaGroup.MAIN); } else { // AgendaGroup is defined, so try and get the AgendaGroup from // the Agenda agendaGroup = (AgendaGroupImpl) this.agenda.getAgendaGroup(rule .getAgendaGroup()); } if (agendaGroup == null) { // The AgendaGroup is defined but not yet added to the Agenda, // so create the AgendaGroup and add to the Agenda. agendaGroup = new AgendaGroupImpl(rule.getAgendaGroup()); this.agenda.addAgendaGroup(agendaGroup); } // set the focus if rule autoFocus is true if (rule.getAutoFocus()) { this.agenda.setFocus(agendaGroup); } ActivationQueue queue = agendaGroup.getActivationQueue(rule .getSalience()); agendaItem = new AgendaItem(context .getPropagationNumber(), tuple, context, rule, queue); queue.add(agendaItem); // Makes sure the Lifo is added to the AgendaGroup priority queue // If the AgendaGroup is already in the priority queue it just // returns. agendaGroup.addToAgenda(queue); tuple.setActivation(agendaItem); agendaItem.setActivated(true); this.getAgendaEventSupport().fireActivationCreated(agendaItem); // retract support FactHandleImpl [] factHandles = (FactHandleImpl[])tuple.getFactHandles(); for(int i = 0; i < factHandles.length; i++){ factHandles[i].addActivatedTuple(tuple); } } }
5490 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5490/fdcfb072ff129fe9333a5cb3c55a2660b41233e3/WorkingMemoryImpl.java/buggy/drools-core/src/main/java/org/drools/leaps/WorkingMemoryImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1815, 9038, 12, 1682, 6679, 9038, 3193, 16, 6781, 1720, 13, 288, 202, 202, 14225, 1042, 819, 273, 3193, 18, 29120, 5621, 202, 202, 759, 309, 326, 783, 6781, 353, 1158, 17, 6498, 471, 326, 4026, 1720, 353, 326, 1967, 1508, 202, 202, 759, 327, 202, 202, 430, 261, 5345, 18, 588, 2279, 6452, 1435, 597, 1720, 18, 14963, 12, 2472, 18, 588, 2175, 7571, 1435, 3719, 288, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 5326, 15929, 273, 1720, 18, 588, 5326, 5621, 202, 202, 14857, 28809, 1180, 31, 202, 202, 430, 261, 31747, 480, 446, 597, 15929, 18, 588, 5326, 12, 8052, 13, 405, 374, 13, 288, 1082, 202, 346, 18883, 1180, 273, 394, 17286, 2577, 18883, 1180, 12, 2472, 6862, 202, 18, 588, 14225, 1854, 9334, 3193, 16, 333, 18, 346, 18883, 16, 819, 16, 1720, 1769, 1082, 202, 2211, 18, 346, 18883, 18, 10676, 1180, 12443, 10660, 2577, 18883, 1180, 13, 28809, 1180, 1769, 1082, 202, 8052, 18, 542, 14857, 12, 346, 18883, 1180, 1769, 1082, 202, 346, 18883, 1180, 18, 542, 28724, 12, 3767, 1769, 1082, 202, 2211, 18, 588, 2577, 18883, 1133, 6289, 7675, 12179, 14857, 6119, 12, 346, 18883, 1180, 1769, 202, 202, 97, 469, 288, 1082, 202, 759, 12146, 1082, 202, 759, 12805, 28380, 471, 2719, 358, 326, 5495, 18883, 434, 5495, 409, 1114, 1082, 202, 759, 16164, 1082, 202, 759, 300, 18753, 1082, 202, 2577, 18883, 1114, 2828, 28809, 1114, 273, 446, 31, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1815, 9038, 12, 1682, 6679, 9038, 3193, 16, 6781, 1720, 13, 288, 202, 202, 14225, 1042, 819, 273, 3193, 18, 29120, 5621, 202, 202, 759, 309, 326, 783, 6781, 353, 1158, 17, 6498, 471, 326, 4026, 1720, 353, 326, 1967, 1508, 202, 202, 759, 327, 202, 202, 430, 261, 5345, 18, 588, 2279, 6452, 1435, 597, 1720, 18, 14963, 12, 2472, 18, 588, 2175, 7571, 1435, 3719, 288, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 5326, 15929, 273, 1720, 18, 588, 5326, 5621, 202, 202, 14857, 28809, 1180, 31, 202, 202, 430, 261, 31747, 480, 446, 597, 15929, 18, 588, 5326, 12, 8052, 13, 405, 374, 13, 288, 1082, 202, 346, 18883, 1180, 2 ]
Log.log(Log.ERROR, MODULE, "This version of Mac OS X does not support the Apple EAWT. Application Menu handling has been disabled (" + e + ")");
Log.log(Log.LEVEL_ERROR, MODULE, "This version of Mac OS X does not support the Apple EAWT. Application Menu handling has been disabled (" + e + ")");
public void handlePreferences(ApplicationEvent ae) { if (mainApplication != null) { try { Class caller = Class.forName(mainApplication.getClass().getName()); Method callMethod = caller.getDeclaredMethod(preferencesMethod, null); if (callMethod != null) { callMethod.invoke(mainApplication, null); } ae.setHandled(true); } catch (NoClassDefFoundError e) { Log.log(Log.ERROR, MODULE, "This version of Mac OS X does not support the Apple EAWT. Application Menu handling has been disabled (" + e + ")"); } catch (ClassNotFoundException e) { Log.log(Log.ERROR, MODULE, "This version of Mac OS X does not support the Apple EAWT. Application Menu handling has been disabled (" + e + ")"); } catch (Exception e) { Log.log(Log.ERROR, MODULE, "Exception while loading the MacOSXAdapter:"); e.printStackTrace(); } } else { throw new IllegalStateException("handlePreferences: mainApplication instance detached"); } }
5431 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5431/1faa1edcd69ba6f773ebcc5a8a21f029bd9e2263/MacOSXAdapter.java/buggy/gallery_remote/com/gallery/GalleryRemote/util/MacOSXAdapter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1640, 12377, 12, 3208, 1133, 14221, 13, 288, 202, 202, 430, 261, 5254, 3208, 480, 446, 13, 288, 1082, 202, 698, 288, 9506, 202, 797, 4894, 273, 1659, 18, 1884, 461, 12, 5254, 3208, 18, 588, 797, 7675, 17994, 10663, 9506, 202, 1305, 745, 1305, 273, 4894, 18, 588, 18888, 1305, 12, 23219, 1305, 16, 446, 1769, 9506, 202, 430, 261, 1991, 1305, 480, 446, 13, 288, 6862, 202, 1991, 1305, 18, 14407, 12, 5254, 3208, 16, 446, 1769, 9506, 202, 97, 9506, 202, 8906, 18, 542, 23186, 12, 3767, 1769, 1082, 202, 97, 1044, 261, 2279, 797, 3262, 2043, 668, 425, 13, 288, 9506, 202, 1343, 18, 1330, 12, 1343, 18, 3589, 16, 14057, 16, 315, 2503, 1177, 434, 13217, 5932, 1139, 1552, 486, 2865, 326, 1716, 1802, 512, 37, 8588, 18, 225, 4257, 9809, 5057, 711, 2118, 5673, 7566, 397, 425, 397, 7310, 1769, 1082, 202, 97, 1044, 261, 797, 3990, 425, 13, 288, 9506, 202, 1343, 18, 1330, 12, 1343, 18, 3589, 16, 14057, 16, 315, 2503, 1177, 434, 13217, 5932, 1139, 1552, 486, 2865, 326, 1716, 1802, 512, 37, 8588, 18, 225, 4257, 9809, 5057, 711, 2118, 5673, 7566, 397, 425, 397, 7310, 1769, 1082, 202, 97, 1044, 261, 503, 425, 13, 288, 9506, 202, 1343, 18, 1330, 12, 1343, 18, 3589, 16, 14057, 16, 315, 503, 1323, 7153, 326, 13217, 4618, 60, 4216, 2773, 1769, 9506, 202, 73, 18, 1188, 6332, 5621, 1082, 202, 97, 202, 202, 97, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1640, 12377, 12, 3208, 1133, 14221, 13, 288, 202, 202, 430, 261, 5254, 3208, 480, 446, 13, 288, 1082, 202, 698, 288, 9506, 202, 797, 4894, 273, 1659, 18, 1884, 461, 12, 5254, 3208, 18, 588, 797, 7675, 17994, 10663, 9506, 202, 1305, 745, 1305, 273, 4894, 18, 588, 18888, 1305, 12, 23219, 1305, 16, 446, 1769, 9506, 202, 430, 261, 1991, 1305, 480, 446, 13, 288, 6862, 202, 1991, 1305, 18, 14407, 12, 5254, 3208, 16, 446, 1769, 9506, 202, 97, 9506, 202, 8906, 18, 542, 23186, 12, 3767, 1769, 1082, 202, 97, 1044, 261, 2279, 797, 3262, 2043, 668, 425, 13, 288, 9506, 202, 1343, 18, 1330, 12, 1343, 18, 3589, 16, 14057, 2 ]
{if (true) return list.toArray(new TypeParameter[0]);}
{if (true) return (TypeParameter[]) list.toArray(new TypeParameter[0]);}
final public TypeParameter[] TypeParametersLookahead() throws ParseException { List<TypeParameter> list = new LinkedList<TypeParameter>(); TypeParameter temp; jj_consume_token(LESS); temp = TypeParameter(); list.add(temp); label_76: while (true) { switch ((jj_ntk==-1)?jj_ntk():jj_ntk) { case COMMA: ; break; default: jj_la1[210] = jj_gen; break label_76; } jj_consume_token(COMMA); temp = TypeParameter(); list.add(temp); } RightAngledBracket(); {if (true) return list.toArray(new TypeParameter[0]);} throw new Error("Missing return statement in function"); }
11192 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11192/9aa0c6bec51662a685ea4b86bc02a52c9e593d8a/Parser.java/clean/dynamicjava/src/koala/dynamicjava/parser/Parser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 1071, 1412, 1662, 8526, 1412, 2402, 9794, 11617, 1435, 1216, 10616, 288, 565, 987, 32, 16920, 34, 666, 273, 394, 10688, 32, 16920, 34, 5621, 565, 1412, 1662, 1906, 31, 565, 10684, 67, 21224, 67, 2316, 12, 26005, 1769, 565, 1906, 273, 1412, 1662, 5621, 1171, 9079, 666, 18, 1289, 12, 5814, 1769, 565, 1433, 67, 6669, 30, 565, 1323, 261, 3767, 13, 288, 1377, 1620, 14015, 78, 78, 67, 496, 79, 631, 17, 21, 9945, 78, 78, 67, 496, 79, 13332, 78, 78, 67, 496, 79, 13, 288, 1377, 648, 17373, 30, 3639, 274, 3639, 898, 31, 1377, 805, 30, 3639, 10684, 67, 11821, 21, 63, 22, 2163, 65, 273, 10684, 67, 4507, 31, 3639, 898, 1433, 67, 6669, 31, 1377, 289, 1377, 10684, 67, 21224, 67, 2316, 12, 4208, 5535, 1769, 1377, 1906, 273, 1412, 1662, 5621, 17311, 666, 18, 1289, 12, 5814, 1769, 565, 289, 565, 13009, 22757, 1259, 11450, 5621, 1377, 288, 430, 261, 3767, 13, 327, 261, 16920, 63, 5717, 666, 18, 31447, 12, 2704, 1412, 1662, 63, 20, 19226, 97, 565, 604, 394, 1068, 2932, 4841, 327, 3021, 316, 445, 8863, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 1071, 1412, 1662, 8526, 1412, 2402, 9794, 11617, 1435, 1216, 10616, 288, 565, 987, 32, 16920, 34, 666, 273, 394, 10688, 32, 16920, 34, 5621, 565, 1412, 1662, 1906, 31, 565, 10684, 67, 21224, 67, 2316, 12, 26005, 1769, 565, 1906, 273, 1412, 1662, 5621, 1171, 9079, 666, 18, 1289, 12, 5814, 1769, 565, 1433, 67, 6669, 30, 565, 1323, 261, 3767, 13, 288, 1377, 1620, 14015, 78, 78, 67, 496, 79, 631, 17, 21, 9945, 78, 78, 67, 496, 79, 13332, 78, 78, 67, 496, 79, 13, 288, 1377, 648, 17373, 30, 3639, 274, 3639, 898, 31, 1377, 805, 30, 3639, 10684, 67, 11821, 21, 63, 22, 2163, 65, 273, 10684, 67, 4507, 31, 3639, 898, 2 ]
for (int i = 0; i != fFilters.size(); i++) fViewer.addFilter((ViewerFilter) fFilters.get(i));
for (int i = 0; i != fFilters.size(); i++) { fViewer.addFilter((ViewerFilter) fFilters.get(i)); }
protected CheckboxTreeViewer createTreeViewer(Composite parent) { if (fContainerMode) { fViewer = new ContainerCheckedTreeViewer(parent, SWT.BORDER); } else { fViewer = new CheckboxTreeViewer(parent, SWT.BORDER); } fViewer.setContentProvider(fContentProvider); fViewer.setLabelProvider(fLabelProvider); fViewer.addCheckStateListener(new ICheckStateListener() { public void checkStateChanged(CheckStateChangedEvent event) { updateOKStatus(); } }); fViewer.setSorter(fSorter); if (fFilters != null) { for (int i = 0; i != fFilters.size(); i++) fViewer.addFilter((ViewerFilter) fFilters.get(i)); } fViewer.setInput(fInput); return fViewer; }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/fa4a8cff0e027f8d3c6b1fcb92b30f46767dd191/CheckedTreeSelectionDialog.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/dialogs/CheckedTreeSelectionDialog.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 29213, 2471, 18415, 752, 2471, 18415, 12, 9400, 982, 13, 288, 3639, 309, 261, 74, 2170, 2309, 13, 288, 5411, 284, 18415, 273, 394, 4039, 11454, 2471, 18415, 12, 2938, 16, 348, 8588, 18, 38, 7954, 1769, 3639, 289, 469, 288, 5411, 284, 18415, 273, 394, 29213, 2471, 18415, 12, 2938, 16, 348, 8588, 18, 38, 7954, 1769, 3639, 289, 3639, 284, 18415, 18, 542, 1350, 2249, 12, 74, 1350, 2249, 1769, 3639, 284, 18415, 18, 542, 2224, 2249, 12, 74, 2224, 2249, 1769, 3639, 284, 18415, 18, 1289, 1564, 1119, 2223, 12, 2704, 467, 1564, 1119, 2223, 1435, 288, 5411, 1071, 918, 13632, 5033, 12, 1564, 1119, 27553, 871, 13, 288, 7734, 1089, 3141, 1482, 5621, 5411, 289, 3639, 15549, 3639, 284, 18415, 18, 542, 24952, 12, 74, 24952, 1769, 3639, 309, 261, 74, 5422, 480, 446, 13, 288, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 480, 284, 5422, 18, 1467, 5621, 277, 27245, 7734, 284, 18415, 18, 1289, 1586, 12443, 18415, 1586, 13, 284, 5422, 18, 588, 12, 77, 10019, 3639, 289, 3639, 284, 18415, 18, 542, 1210, 12, 74, 1210, 1769, 3639, 327, 284, 18415, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 29213, 2471, 18415, 752, 2471, 18415, 12, 9400, 982, 13, 288, 3639, 309, 261, 74, 2170, 2309, 13, 288, 5411, 284, 18415, 273, 394, 4039, 11454, 2471, 18415, 12, 2938, 16, 348, 8588, 18, 38, 7954, 1769, 3639, 289, 469, 288, 5411, 284, 18415, 273, 394, 29213, 2471, 18415, 12, 2938, 16, 348, 8588, 18, 38, 7954, 1769, 3639, 289, 3639, 284, 18415, 18, 542, 1350, 2249, 12, 74, 1350, 2249, 1769, 3639, 284, 18415, 18, 542, 2224, 2249, 12, 74, 2224, 2249, 1769, 3639, 284, 18415, 18, 1289, 1564, 1119, 2223, 12, 2704, 467, 1564, 1119, 2223, 1435, 288, 5411, 1071, 918, 13632, 5033, 12, 1564, 1119, 27553, 871, 13, 288, 7734, 1089, 3141, 1482, 5621, 2 ]
if (! this.targetdir.endsWith (File.separator))
if (!this.targetdir.endsWith(File.separator))
public void setTargetDir (String targetDir) throws CompilerException { if (targetDir == null) { if (this.src != null) throw new CompilerException ("target for file " + src + " missing!"); else throw new CompilerException ("target for file missing!"); } this.targetfile = null; this.targetdir = targetDir; if (! this.targetdir.endsWith (File.separator)) { this.targetdir = this.targetdir + File.separatorChar; } }
58440 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58440/47db88bfea6b64e47a33aa3c937b2ce6e8640d56/Compiler.java/buggy/izpack-src/trunk/src/lib/com/izforge/izpack/compiler/Compiler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 18367, 1621, 261, 780, 19410, 13, 1216, 28227, 565, 288, 1377, 309, 261, 3299, 1621, 422, 446, 13, 1377, 288, 3639, 309, 261, 2211, 18, 4816, 480, 446, 13, 1850, 604, 394, 28227, 7566, 3299, 364, 585, 315, 397, 1705, 397, 315, 3315, 4442, 1769, 3639, 469, 1850, 604, 394, 28227, 7566, 3299, 364, 585, 3315, 4442, 1769, 1377, 289, 1377, 333, 18, 3299, 768, 273, 446, 31, 1377, 333, 18, 3299, 1214, 273, 19410, 31, 1377, 309, 16051, 2211, 18, 3299, 1214, 18, 5839, 1190, 12, 812, 18, 11287, 3719, 1377, 288, 3639, 333, 18, 3299, 1214, 273, 333, 18, 3299, 1214, 397, 1387, 18, 11287, 2156, 31, 1377, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 18367, 1621, 261, 780, 19410, 13, 1216, 28227, 565, 288, 1377, 309, 261, 3299, 1621, 422, 446, 13, 1377, 288, 3639, 309, 261, 2211, 18, 4816, 480, 446, 13, 1850, 604, 394, 28227, 7566, 3299, 364, 585, 315, 397, 1705, 397, 315, 3315, 4442, 1769, 3639, 469, 1850, 604, 394, 28227, 7566, 3299, 364, 585, 3315, 4442, 1769, 1377, 289, 1377, 333, 18, 3299, 768, 273, 446, 31, 1377, 333, 18, 3299, 1214, 273, 19410, 31, 1377, 309, 16051, 2211, 18, 3299, 1214, 18, 5839, 1190, 12, 812, 18, 11287, 3719, 1377, 288, 3639, 333, 18, 3299, 1214, 273, 333, 18, 3299, 1214, 397, 1387, 18, 11287, 2156, 31, 1377, 289, 565, 289, 2, -100, -100, -100 ]
if (addresses.length > 0) { Address addr = addresses[0]; if (addr instanceof InternetAddress) { emailAddress = (InternetAddress)addr; } } if (!UtilValidate.isEmpty(emailAddress)) { map = new HashMap(); map.put("address", emailAddress.getAddress()); map.put("userLogin", userLogin); result = dispatcher.runSync("findPartyFromEmailAddress", map); } return result;
if (addresses.length > 0) { Address addr = addresses[0]; if (addr instanceof InternetAddress) { emailAddress = (InternetAddress)addr; } } if (!UtilValidate.isEmpty(emailAddress)) { map = new HashMap(); map.put("address", emailAddress.getAddress()); map.put("userLogin", userLogin); result = dispatcher.runSync("findPartyFromEmailAddress", map); } return result;
private static Map getParyInfoFromEmailAddress(Address [] addresses, GenericValue userLogin, LocalDispatcher dispatcher) throws GenericServiceException { InternetAddress emailAddress = null; Map map = null; Map result = null; if (addresses == null) return null; if (addresses.length > 0) { Address addr = addresses[0]; if (addr instanceof InternetAddress) { emailAddress = (InternetAddress)addr; } } if (!UtilValidate.isEmpty(emailAddress)) { map = new HashMap(); map.put("address", emailAddress.getAddress()); map.put("userLogin", userLogin); result = dispatcher.runSync("findPartyFromEmailAddress", map); } return result; }
55411 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55411/b4faeeb158fa324acd5f491c56beae17d821d9e3/EmailServices.java/buggy/applications/content/src/org/ofbiz/content/email/EmailServices.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 1635, 1689, 814, 966, 1265, 23590, 12, 1887, 5378, 6138, 16, 7928, 620, 729, 5358, 16, 3566, 6681, 7393, 13, 1216, 7928, 15133, 565, 288, 377, 202, 26562, 1887, 28748, 273, 446, 31, 377, 202, 863, 852, 273, 446, 31, 377, 202, 863, 563, 273, 446, 31, 7734, 309, 261, 13277, 422, 446, 13, 327, 446, 31, 377, 202, 377, 202, 430, 261, 13277, 18, 2469, 405, 374, 13, 288, 377, 202, 202, 1887, 3091, 273, 6138, 63, 20, 15533, 377, 202, 202, 430, 261, 4793, 1276, 21352, 1887, 13, 288, 377, 1082, 202, 3652, 1887, 273, 261, 26562, 1887, 13, 4793, 31, 377, 202, 202, 97, 377, 202, 97, 377, 202, 377, 202, 430, 16051, 1304, 4270, 18, 291, 1921, 12, 3652, 1887, 3719, 288, 377, 202, 202, 1458, 273, 394, 4317, 5621, 377, 202, 202, 1458, 18, 458, 2932, 2867, 3113, 28748, 18, 588, 1887, 10663, 377, 202, 202, 1458, 18, 458, 2932, 1355, 5358, 3113, 729, 5358, 1769, 377, 202, 202, 2088, 273, 7393, 18, 2681, 4047, 2932, 4720, 17619, 1265, 23590, 3113, 852, 1769, 377, 1082, 377, 202, 97, 377, 202, 377, 202, 377, 202, 2463, 563, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 1635, 1689, 814, 966, 1265, 23590, 12, 1887, 5378, 6138, 16, 7928, 620, 729, 5358, 16, 3566, 6681, 7393, 13, 1216, 7928, 15133, 565, 288, 377, 202, 26562, 1887, 28748, 273, 446, 31, 377, 202, 863, 852, 273, 446, 31, 377, 202, 863, 563, 273, 446, 31, 7734, 309, 261, 13277, 422, 446, 13, 327, 446, 31, 377, 202, 377, 202, 430, 261, 13277, 18, 2469, 405, 374, 13, 288, 377, 202, 202, 1887, 3091, 273, 6138, 63, 20, 15533, 377, 202, 202, 430, 261, 4793, 1276, 21352, 1887, 13, 288, 377, 1082, 202, 3652, 1887, 273, 261, 26562, 1887, 13, 4793, 31, 377, 202, 202, 97, 377, 202, 97, 377, 202, 377, 202, 430, 16051, 2 ]
if(!password.equals(getValue(EndEntityProfile.PASSWORD,0)));
if(!password.equals(getValue(EndEntityProfile.PASSWORD,0)))
public void doesPasswordFulfillEndEntityProfile(String password, boolean clearpwd) throws UserDoesntFullfillEndEntityProfile{ boolean fullfillsprofile = true; if(useAutoGeneratedPasswd()){ if(password !=null) throw new UserDoesntFullfillEndEntityProfile("Autogenerated password must have password==null"); }else{ if(!isModifyable(EndEntityProfile.PASSWORD,0)){ if(!password.equals(getValue(EndEntityProfile.PASSWORD,0))); fullfillsprofile=false; } else if(isRequired(EndEntityProfile.PASSWORD,0)){ if((!clearpwd && password == null) || (password != null && password.trim().equals(""))) fullfillsprofile=false; } } if(clearpwd && isRequired(EndEntityProfile.CLEARTEXTPASSWORD,0) && getValue(EndEntityProfile.CLEARTEXTPASSWORD,0).equals(EndEntityProfile.FALSE)){ fullfillsprofile=false; } if(!fullfillsprofile) throw new UserDoesntFullfillEndEntityProfile("Password doesn't fullfill profile."); }
4109 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4109/54de5950e52c40e012a2f7a9904c067a8e37fe29/EndEntityProfile.java/clean/src/java/se/anatom/ejbca/ra/raadmin/EndEntityProfile.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1552, 3913, 23747, 5935, 1638, 1943, 4029, 12, 780, 2201, 16, 1250, 2424, 27487, 13, 1377, 1216, 2177, 10154, 496, 5080, 5935, 1638, 1943, 4029, 95, 377, 1082, 202, 6494, 1983, 5935, 87, 5040, 273, 638, 31, 202, 202, 430, 12, 1202, 4965, 7823, 6433, 3623, 10756, 95, 1082, 225, 309, 12, 3664, 480, 2011, 13, 1082, 202, 12849, 394, 2177, 10154, 496, 5080, 5935, 1638, 1943, 4029, 2932, 7150, 717, 7489, 2201, 1297, 1240, 2201, 631, 2011, 8863, 202, 202, 97, 12107, 95, 5411, 1082, 2398, 1082, 309, 12, 5, 291, 11047, 429, 12, 1638, 1943, 4029, 18, 13784, 16, 20, 3719, 95, 1082, 282, 309, 12, 5, 3664, 18, 14963, 12, 24805, 12, 1638, 1943, 4029, 18, 13784, 16, 20, 3719, 1769, 1082, 565, 9506, 1983, 5935, 87, 5040, 33, 5743, 31, 1082, 289, 1875, 469, 1082, 282, 309, 12, 291, 3705, 12, 1638, 1943, 4029, 18, 13784, 16, 20, 3719, 95, 9506, 309, 12443, 5, 8507, 27487, 597, 2201, 422, 446, 13, 747, 261, 3664, 480, 446, 597, 2201, 18, 5290, 7675, 14963, 2932, 6, 20349, 6862, 1082, 282, 1983, 5935, 87, 5040, 33, 5743, 31, 1082, 282, 289, 202, 202, 97, 5411, 1082, 309, 12, 8507, 27487, 597, 14967, 12, 1638, 1943, 4029, 18, 23181, 985, 5151, 13784, 16, 20, 13, 597, 2366, 12, 1638, 1943, 4029, 18, 23181, 985, 5151, 13784, 16, 20, 2934, 14963, 12, 1638, 1943, 4029, 18, 21053, 3719, 95, 1082, 4405, 1983, 5935, 87, 5040, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1552, 3913, 23747, 5935, 1638, 1943, 4029, 12, 780, 2201, 16, 1250, 2424, 27487, 13, 1377, 1216, 2177, 10154, 496, 5080, 5935, 1638, 1943, 4029, 95, 377, 1082, 202, 6494, 1983, 5935, 87, 5040, 273, 638, 31, 202, 202, 430, 12, 1202, 4965, 7823, 6433, 3623, 10756, 95, 1082, 225, 309, 12, 3664, 480, 2011, 13, 1082, 202, 12849, 394, 2177, 10154, 496, 5080, 5935, 1638, 1943, 4029, 2932, 7150, 717, 7489, 2201, 1297, 1240, 2201, 631, 2011, 8863, 202, 202, 97, 12107, 95, 5411, 1082, 2398, 1082, 309, 12, 5, 291, 11047, 429, 12, 1638, 1943, 4029, 18, 13784, 16, 20, 3719, 95, 1082, 282, 309, 12, 5, 3664, 18, 14963, 12, 24805, 12, 1638, 2 ]
addDOMPath(name);
addDOMPath(name, "0", CacheConfiguration.UNKNOWN);
public void newRevision(String name, String number, String added, String removed) { name = repositoryFileManager.relativeToAbsolutePath(name); if (document == null) { try { buildRoot(); } catch (ParserConfigurationException e) { document = null; } } if (document != null) { currentPath = findDOMPath(name); if (currentPath == null) { // changes currentPath to new one addDOMPath(name); } addDOMRevision(number, added, removed, "FALSE"); } }
49097 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49097/4988f36e074300907505f8c9b5030fa8378a0ff2/CacheBuilder.java/buggy/src/net/sf/statcvs/input/CacheBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 394, 7939, 12, 780, 508, 16, 514, 1300, 16, 514, 3096, 16, 1082, 202, 780, 3723, 13, 288, 202, 202, 529, 273, 3352, 812, 1318, 18, 11626, 774, 10368, 743, 12, 529, 1769, 202, 202, 430, 261, 5457, 422, 446, 13, 288, 1082, 202, 698, 288, 9506, 202, 3510, 2375, 5621, 1082, 202, 97, 1044, 261, 2678, 10737, 425, 13, 288, 9506, 202, 5457, 273, 446, 31, 1082, 202, 97, 202, 202, 97, 202, 202, 430, 261, 5457, 480, 446, 13, 288, 1082, 202, 2972, 743, 273, 1104, 8168, 743, 12, 529, 1769, 1082, 202, 430, 261, 2972, 743, 422, 446, 13, 288, 9506, 202, 759, 3478, 18027, 358, 394, 1245, 9506, 202, 1289, 8168, 743, 12, 529, 1769, 1082, 202, 97, 1082, 202, 1289, 8168, 7939, 12, 2696, 16, 3096, 16, 3723, 16, 315, 21053, 8863, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 394, 7939, 12, 780, 508, 16, 514, 1300, 16, 514, 3096, 16, 1082, 202, 780, 3723, 13, 288, 202, 202, 529, 273, 3352, 812, 1318, 18, 11626, 774, 10368, 743, 12, 529, 1769, 202, 202, 430, 261, 5457, 422, 446, 13, 288, 1082, 202, 698, 288, 9506, 202, 3510, 2375, 5621, 1082, 202, 97, 1044, 261, 2678, 10737, 425, 13, 288, 9506, 202, 5457, 273, 446, 31, 1082, 202, 97, 202, 202, 97, 202, 202, 430, 261, 5457, 480, 446, 13, 288, 1082, 202, 2972, 743, 273, 1104, 8168, 743, 12, 529, 1769, 1082, 202, 430, 261, 2972, 743, 422, 446, 13, 288, 9506, 202, 759, 3478, 18027, 358, 394, 1245, 9506, 202, 1289, 8168, 2 ]
public String getEnumeratedId(String name) {
public String getEnumeratedId(String name) throws BuildException {
public String getEnumeratedId(String name) { if (name == null) return null; Set idSet = getEnumNameMap().keySet(); Iterator iter = idSet.iterator(); while (iter.hasNext()) { String id = (String) iter.next(); String enumName = (String) getEnumNameMap().get(id); if (name.equals(enumName)) { return id; } } return null; }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/18b49394c46cbbecf041078a70e83e4975d004a7/Option.java/buggy/build/org.eclipse.cdt.managedbuilder.core/src/org/eclipse/cdt/managedbuilder/internal/core/Option.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 26813, 19007, 548, 12, 780, 508, 13, 288, 202, 202, 430, 261, 529, 422, 446, 13, 327, 446, 31, 202, 202, 694, 612, 694, 273, 26813, 461, 863, 7675, 856, 694, 5621, 202, 202, 3198, 1400, 273, 612, 694, 18, 9838, 5621, 202, 202, 17523, 261, 2165, 18, 5332, 2134, 10756, 288, 1082, 202, 780, 612, 273, 261, 780, 13, 1400, 18, 4285, 5621, 1082, 202, 780, 2792, 461, 273, 261, 780, 13, 26813, 461, 863, 7675, 588, 12, 350, 1769, 1082, 202, 430, 261, 529, 18, 14963, 12, 7924, 461, 3719, 288, 9506, 202, 2463, 612, 31, 1082, 202, 97, 202, 202, 97, 202, 202, 2463, 446, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 26813, 19007, 548, 12, 780, 508, 13, 288, 202, 202, 430, 261, 529, 422, 446, 13, 327, 446, 31, 202, 202, 694, 612, 694, 273, 26813, 461, 863, 7675, 856, 694, 5621, 202, 202, 3198, 1400, 273, 612, 694, 18, 9838, 5621, 202, 202, 17523, 261, 2165, 18, 5332, 2134, 10756, 288, 1082, 202, 780, 612, 273, 261, 780, 13, 1400, 18, 4285, 5621, 1082, 202, 780, 2792, 461, 273, 261, 780, 13, 26813, 461, 863, 7675, 588, 12, 350, 1769, 1082, 202, 430, 261, 529, 18, 14963, 12, 7924, 461, 3719, 288, 9506, 202, 2463, 612, 31, 1082, 202, 97, 202, 202, 97, 202, 202, 2463, 446, 31, 202, 97, 2, -100, -100, -100, -100 ]
public void finish() {
public IRubyObject finish() throws Exception { StringBuffer result = new StringBuffer(); byte[] outp = new byte[1024]; byte[] buf = collected.toString().getBytes("ISO8859_1"); collected = new StringBuffer(); flater.setInput(buf);
public void finish() { flater.finish(); }
49476 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49476/510a41b06f3103200e881725915b7cc1a5a10b39/ZlibDeflate.java/buggy/src/org/jruby/util/ZlibDeflate.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 4076, 1435, 1216, 1185, 288, 6674, 563, 273, 394, 6674, 5621, 1160, 8526, 596, 84, 273, 394, 1160, 63, 2163, 3247, 15533, 1160, 8526, 1681, 273, 12230, 18, 10492, 7675, 588, 2160, 2932, 12609, 17258, 67, 21, 8863, 12230, 273, 394, 6674, 5621, 1183, 2045, 18, 542, 1210, 12, 4385, 1769, 3639, 1183, 2045, 18, 13749, 5621, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 15908, 10340, 921, 4076, 1435, 1216, 1185, 288, 6674, 563, 273, 394, 6674, 5621, 1160, 8526, 596, 84, 273, 394, 1160, 63, 2163, 3247, 15533, 1160, 8526, 1681, 273, 12230, 18, 10492, 7675, 588, 2160, 2932, 12609, 17258, 67, 21, 8863, 12230, 273, 394, 6674, 5621, 1183, 2045, 18, 542, 1210, 12, 4385, 1769, 3639, 1183, 2045, 18, 13749, 5621, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
checkForCircularNodeAutoCreation(defaultENT, definingNTs);
checkForCircularNodeAutoCreation(defaultENT, definingNTs, anEntCache, aRegisteredNTDefCache);
private EffectiveNodeType validateNodeTypeDef(NodeTypeDef ntd) throws InvalidNodeTypeDefException, RepositoryException { /** * the effective (i.e. merged and resolved) node type resulting from * the specified node type definition; * the effective node type will finally be created after the definition * has been verified and checked for conflicts etc.; in some cases it * will be created already at an earlier stage during the validation * of child node definitions */ EffectiveNodeType ent = null; QName name = ntd.getName(); if (name == null) { String msg = "no name specified"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } checkNamespace(name); // validate supertypes QName[] supertypes = ntd.getSupertypes(); if (supertypes != null && supertypes.length > 0) { for (int i = 0; i < supertypes.length; i++) { checkNamespace(supertypes[i]); /** * simple check for infinite recursion * (won't trap recursion on a deeper inheritance level) */ if (name.equals(supertypes[i])) { String msg = "[" + name + "] invalid supertype: " + supertypes[i] + " (infinite recursion))"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } if (!registeredNTDefs.containsKey(supertypes[i])) { String msg = "[" + name + "] invalid supertype: " + supertypes[i]; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } /** * check for circularity in inheritance chain * ('a' extends 'b' extends 'a') */ Stack inheritanceChain = new Stack(); inheritanceChain.push(name); checkForCircularInheritance(supertypes, inheritanceChain); } /** * note that infinite recursion through inheritance is automatically * being checked by the following call to getEffectiveNodeType() * as it's impossible to register a node type definition which * references a supertype that isn't registered yet... */ /** * build effective (i.e. merged and resolved) node type from supertypes * and check for conflicts */ if (supertypes != null && supertypes.length > 0) { try { EffectiveNodeType est = getEffectiveNodeType(supertypes); // make sure that all primary types except nt:base extend from nt:base if (!ntd.isMixin() && !QName.NT_BASE.equals(ntd.getName()) && !est.includesNodeType(QName.NT_BASE)) { String msg = "[" + name + "] all primary node types except" + " nt:base itself must be (directly or indirectly) derived from nt:base"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } catch (NodeTypeConflictException ntce) { String msg = "[" + name + "] failed to validate supertypes"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, ntce); } catch (NoSuchNodeTypeException nsnte) { String msg = "[" + name + "] failed to validate supertypes"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, nsnte); } } else { // no supertypes specified: has to be either a mixin type or nt:base if (!ntd.isMixin() && !QName.NT_BASE.equals(ntd.getName())) { String msg = "[" + name + "] all primary node types except nt:base itself must be (directly or indirectly) derived from nt:base"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } checkNamespace(ntd.getPrimaryItemName()); // validate property definitions PropDef[] pda = ntd.getPropertyDefs(); for (int i = 0; i < pda.length; i++) { PropDef pd = pda[i]; /** * sanity check: * make sure declaring node type matches name of node type definition */ if (!name.equals(pd.getDeclaringNodeType())) { String msg = "[" + name + "#" + pd.getName() + "] invalid declaring node type specified"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } checkNamespace(pd.getName()); // check that auto-created properties specify a name if (pd.definesResidual() && pd.isAutoCreated()) { String msg = "[" + name + "#" + pd.getName() + "] auto-created properties must specify a name"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } // check that auto-created properties specify a type if (pd.getRequiredType() == PropertyType.UNDEFINED && pd.isAutoCreated()) { String msg = "[" + name + "#" + pd.getName() + "] auto-created properties must specify a type"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } /** * check default values: * make sure type of value is consistent with required property type */ InternalValue[] defVals = pd.getDefaultValues(); if (defVals != null && defVals.length != 0) { int reqType = pd.getRequiredType(); for (int j = 0; j < defVals.length; j++) { if (reqType == PropertyType.UNDEFINED) { reqType = defVals[j].getType(); } else { if (defVals[j].getType() != reqType) { String msg = "[" + name + "#" + pd.getName() + "] type of default value(s) is not consistent with required property type"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } } } else { // no default values specified if (checkAutoCreatePropHasDefault) { // auto-created properties must have a default value if (pd.isAutoCreated()) { String msg = "[" + name + "#" + pd.getName() + "] auto-created property must have a default value"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } } // check that default values satisfy value constraints ValueConstraint[] constraints = pd.getValueConstraints(); if (constraints != null && constraints.length > 0) { if (defVals != null && defVals.length > 0) { // check value constraints on every value for (int j = 0; j < defVals.length; j++) { // constraints are OR-ed together boolean satisfied = false; ConstraintViolationException cve = null; for (int k = 0; k < constraints.length; k++) { try { constraints[k].check(defVals[j]); // at least one constraint is satisfied satisfied = true; break; } catch (ConstraintViolationException e) { cve = e; continue; } } if (!satisfied) { // report last exception we encountered String msg = "[" + name + "#" + pd.getName() + "] default value does not satisfy value constraint"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, cve); } } } /** * ReferenceConstraint: * the specified node type must be registered, with one notable * exception: the node type just being registered */ if (pd.getRequiredType() == PropertyType.REFERENCE) { for (int j = 0; j < constraints.length; j++) { ReferenceConstraint rc = (ReferenceConstraint) constraints[j]; QName ntName = rc.getNodeTypeName(); if (!name.equals(ntName) && !registeredNTDefs.containsKey(ntName)) { String msg = "[" + name + "#" + pd.getName() + "] invalid REFERENCE value constraint '" + ntName + "' (unknown node type)"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } } } } } // validate child-node definitions NodeDef[] cnda = ntd.getChildNodeDefs(); for (int i = 0; i < cnda.length; i++) { NodeDef cnd = cnda[i]; /** * sanity check: * make sure declaring node type matches name of node type definition */ if (!name.equals(cnd.getDeclaringNodeType())) { String msg = "[" + name + "#" + cnd.getName() + "] invalid declaring node type specified"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } checkNamespace(cnd.getName()); // check that auto-created child-nodes specify a name if (cnd.definesResidual() && cnd.isAutoCreated()) { String msg = "[" + name + "#" + cnd.getName() + "] auto-created child-nodes must specify a name"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } // check that auto-created child-nodes specify a default primary type if (cnd.getDefaultPrimaryType() == null && cnd.isAutoCreated()) { String msg = "[" + name + "#" + cnd.getName() + "] auto-created child-nodes must specify a default primary type"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } // check default primary type QName dpt = cnd.getDefaultPrimaryType(); checkNamespace(dpt); boolean referenceToSelf = false; EffectiveNodeType defaultENT = null; if (dpt != null) { // check if this node type specifies itself as default primary type if (name.equals(dpt)) { referenceToSelf = true; } /** * the default primary type must be registered, with one notable * exception: the node type just being registered */ if (!name.equals(dpt) && !registeredNTDefs.containsKey(dpt)) { String msg = "[" + name + "#" + cnd.getName() + "] invalid default primary type '" + dpt + "'"; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } /** * build effective (i.e. merged and resolved) node type from * default primary type and check for conflicts */ try { if (!referenceToSelf) { defaultENT = getEffectiveNodeType(dpt); } else { /** * the default primary type is identical with the node * type just being registered; we have to instantiate it * 'manually' */ ent = EffectiveNodeType.create(this, ntd); defaultENT = ent; } if (cnd.isAutoCreated()) { /** * check for circularity through default primary types * of auto-created child nodes (node type 'a' defines * auto-created child node with default primary type 'a') */ Stack definingNTs = new Stack(); definingNTs.push(name); checkForCircularNodeAutoCreation(defaultENT, definingNTs); } } catch (NodeTypeConflictException ntce) { String msg = "[" + name + "#" + cnd.getName() + "] failed to validate default primary type"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, ntce); } catch (NoSuchNodeTypeException nsnte) { String msg = "[" + name + "#" + cnd.getName() + "] failed to validate default primary type"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, nsnte); } } // check required primary types QName[] reqTypes = cnd.getRequiredPrimaryTypes(); if (reqTypes != null && reqTypes.length > 0) { for (int n = 0; n < reqTypes.length; n++) { QName rpt = reqTypes[n]; checkNamespace(rpt); referenceToSelf = false; /** * check if this node type specifies itself as required * primary type */ if (name.equals(rpt)) { referenceToSelf = true; } /** * the required primary type must be registered, with one * notable exception: the node type just being registered */ if (!name.equals(rpt) && !registeredNTDefs.containsKey(rpt)) { String msg = "[" + name + "#" + cnd.getName() + "] invalid required primary type: " + rpt; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } /** * check if default primary type satisfies the required * primary type constraint */ if (defaultENT != null && !defaultENT.includesNodeType(rpt)) { String msg = "[" + name + "#" + cnd.getName() + "] default primary type does not satisfy required primary type constraint " + rpt; log.debug(msg); throw new InvalidNodeTypeDefException(msg); } /** * build effective (i.e. merged and resolved) node type from * required primary type constraint and check for conflicts */ try { if (!referenceToSelf) { getEffectiveNodeType(rpt); } else { /** * the required primary type is identical with the * node type just being registered; we have to * instantiate it 'manually' */ if (ent == null) { ent = EffectiveNodeType.create(this, ntd); } } } catch (NodeTypeConflictException ntce) { String msg = "[" + name + "#" + cnd.getName() + "] failed to validate required primary type constraint"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, ntce); } catch (NoSuchNodeTypeException nsnte) { String msg = "[" + name + "#" + cnd.getName() + "] failed to validate required primary type constraint"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, nsnte); } } } } /** * now build effective (i.e. merged and resolved) node type from * this node type definition; this will potentially detect more * conflicts or problems */ if (ent == null) { try { ent = EffectiveNodeType.create(this, ntd); } catch (NodeTypeConflictException ntce) { String msg = "[" + name + "] failed to resolve node type definition"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, ntce); } catch (NoSuchNodeTypeException nsnte) { String msg = "[" + name + "] failed to resolve node type definition"; log.debug(msg); throw new InvalidNodeTypeDefException(msg, nsnte); } } return ent; }
48761 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48761/ee35f7e21d97a3a01b69ff1ed3117ccc709d3c66/NodeTypeRegistry.java/buggy/jackrabbit/src/main/java/org/apache/jackrabbit/core/nodetype/NodeTypeRegistry.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 512, 21446, 15101, 1954, 15101, 3262, 12, 15101, 3262, 290, 4465, 13, 5411, 1216, 1962, 15101, 3262, 503, 16, 13367, 288, 3639, 1783, 540, 380, 326, 11448, 261, 77, 18, 73, 18, 5384, 471, 4640, 13, 756, 618, 8156, 628, 540, 380, 326, 1269, 756, 618, 2379, 31, 540, 380, 326, 11448, 756, 618, 903, 3095, 506, 2522, 1839, 326, 2379, 540, 380, 711, 2118, 13808, 471, 5950, 364, 14450, 5527, 18, 31, 316, 2690, 6088, 518, 540, 380, 903, 506, 2522, 1818, 622, 392, 13805, 6009, 4982, 326, 3379, 540, 380, 434, 1151, 756, 6377, 540, 1195, 3639, 512, 21446, 15101, 3281, 273, 446, 31, 3639, 16723, 508, 273, 290, 4465, 18, 17994, 5621, 3639, 309, 261, 529, 422, 446, 13, 288, 5411, 514, 1234, 273, 315, 2135, 508, 1269, 14432, 5411, 613, 18, 4148, 12, 3576, 1769, 5411, 604, 394, 1962, 15101, 3262, 503, 12, 3576, 1769, 3639, 289, 3639, 866, 3402, 12, 529, 1769, 3639, 368, 1954, 1169, 1051, 989, 3639, 16723, 8526, 1169, 1051, 989, 273, 290, 4465, 18, 588, 3088, 1051, 989, 5621, 3639, 309, 261, 2859, 1051, 989, 480, 446, 597, 1169, 1051, 989, 18, 2469, 405, 374, 13, 288, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 411, 1169, 1051, 989, 18, 2469, 31, 277, 27245, 288, 7734, 866, 3402, 12, 2859, 1051, 989, 63, 77, 19226, 7734, 1783, 1171, 380, 4143, 866, 364, 14853, 13917, 1171, 380, 261, 91, 265, 1404, 23034, 13917, 603, 279, 31554, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 512, 21446, 15101, 1954, 15101, 3262, 12, 15101, 3262, 290, 4465, 13, 5411, 1216, 1962, 15101, 3262, 503, 16, 13367, 288, 3639, 1783, 540, 380, 326, 11448, 261, 77, 18, 73, 18, 5384, 471, 4640, 13, 756, 618, 8156, 628, 540, 380, 326, 1269, 756, 618, 2379, 31, 540, 380, 326, 11448, 756, 618, 903, 3095, 506, 2522, 1839, 326, 2379, 540, 380, 711, 2118, 13808, 471, 5950, 364, 14450, 5527, 18, 31, 316, 2690, 6088, 518, 540, 380, 903, 506, 2522, 1818, 622, 392, 13805, 6009, 4982, 326, 3379, 540, 380, 434, 1151, 756, 6377, 540, 1195, 3639, 512, 21446, 15101, 3281, 273, 446, 31, 3639, 16723, 508, 273, 290, 4465, 18, 17994, 5621, 3639, 309, 2 ]
VM.sysWrite(right(hex(i),6) + "| "); VM.sysWrite(right("", PREFIX_AREA_SIZE) + " "); VM.sysWrite( left(op, OP_AREA_SIZE));
i = begin(i, op);
final void RARR (int i, String op, int d, byte R0, byte R2) { VM.sysWrite(right(hex(i),6) + "| "); VM.sysWrite(right("", PREFIX_AREA_SIZE) + " "); VM.sysWrite( left(op, OP_AREA_SIZE)); VM.sysWrite(right(isFP(op)?FPR_NAMES[R0]:GPR_NAMES[R0] + " ", DEST_AREA_SIZE)); VM.sysWrite(right("[" + hex(d) + "]", SOURCE_AREA_SIZE)); VM.sysWrite(right(isFP(op)?FPR_NAMES[R2]:GPR_NAMES[R2] + " ", SOURCE_AREA_SIZE) + " | "); asm.writeLastInstruction(i); VM.sysWrite("\n"); }
4011 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4011/1ad569337ec77cad23ab2e215870563ee6b7b90a/VM_Lister.java/clean/rvm/src/vm/arch/intel/assembler/VM_Lister.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 918, 534, 985, 54, 261, 474, 277, 16, 514, 1061, 16, 509, 302, 16, 1160, 534, 20, 16, 1160, 534, 22, 13, 288, 565, 8251, 18, 9499, 3067, 12, 4083, 12, 7118, 12, 77, 3631, 26, 13, 397, 11747, 315, 1769, 565, 8251, 18, 9499, 3067, 12, 4083, 2932, 3113, 17154, 67, 20933, 67, 4574, 13, 397, 315, 315, 1769, 565, 8251, 18, 9499, 3067, 12, 2002, 12, 556, 16, 7247, 67, 20933, 67, 4574, 10019, 565, 8251, 18, 9499, 3067, 12, 4083, 12, 291, 30246, 12, 556, 9945, 42, 8025, 67, 16257, 63, 54, 20, 14542, 43, 8025, 67, 16257, 63, 54, 20, 65, 397, 315, 3104, 2030, 882, 67, 20933, 67, 4574, 10019, 565, 8251, 18, 9499, 3067, 12, 4083, 2932, 9614, 397, 3827, 12, 72, 13, 397, 9850, 3113, 16088, 67, 20933, 67, 4574, 10019, 565, 8251, 18, 9499, 3067, 12, 4083, 12, 291, 30246, 12, 556, 9945, 42, 8025, 67, 16257, 63, 54, 22, 14542, 43, 8025, 67, 16257, 63, 54, 22, 65, 397, 315, 3104, 16088, 67, 20933, 67, 4574, 13, 397, 315, 571, 315, 1769, 565, 20415, 18, 2626, 3024, 11983, 12, 77, 1769, 565, 8251, 18, 9499, 3067, 31458, 82, 8863, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 918, 534, 985, 54, 261, 474, 277, 16, 514, 1061, 16, 509, 302, 16, 1160, 534, 20, 16, 1160, 534, 22, 13, 288, 565, 8251, 18, 9499, 3067, 12, 4083, 12, 7118, 12, 77, 3631, 26, 13, 397, 11747, 315, 1769, 565, 8251, 18, 9499, 3067, 12, 4083, 2932, 3113, 17154, 67, 20933, 67, 4574, 13, 397, 315, 315, 1769, 565, 8251, 18, 9499, 3067, 12, 2002, 12, 556, 16, 7247, 67, 20933, 67, 4574, 10019, 565, 8251, 18, 9499, 3067, 12, 4083, 12, 291, 30246, 12, 556, 9945, 42, 8025, 67, 16257, 63, 54, 20, 14542, 43, 8025, 67, 16257, 63, 54, 20, 65, 397, 315, 3104, 2030, 882, 67, 20933, 67, 4574, 10019, 565, 8251, 2 ]
if (getFastViewBar() != null) { getFastViewBar().update(true); } }
if (getFastViewBar() != null) { getFastViewBar().update(true); } }
public void updateFastViewBar() { if (getFastViewBar() != null) { getFastViewBar().update(true); } }
55805 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55805/97610ef9afbe6c924e048d8d60c2f4721860850b/WorkbenchWindow.java/clean/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/WorkbenchWindow.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1089, 12305, 1767, 5190, 1435, 288, 3639, 309, 261, 588, 12305, 1767, 5190, 1435, 480, 446, 13, 288, 5411, 2812, 689, 1767, 5190, 7675, 2725, 12, 3767, 1769, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1089, 12305, 1767, 5190, 1435, 288, 3639, 309, 261, 588, 12305, 1767, 5190, 1435, 480, 446, 13, 288, 5411, 2812, 689, 1767, 5190, 7675, 2725, 12, 3767, 1769, 3639, 289, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
}
} tableHistoryViewer.refresh(); selectRevision(revisionId);
public void run() { if(entries != null && tableHistoryViewer != null && ! tableHistoryViewer.getTable().isDisposed()) { // once we got the entries, we refresh the table ISelection selection = tableHistoryViewer.getSelection(); tableHistoryViewer.refresh(); tableHistoryViewer.setSelection(selection); if (entries.length > 0) { lastEntry = entries[entries.length - 1]; long lastEntryNumber = lastEntry.getRevision().getNumber(); revisionStart = new SVNRevision.Number(lastEntryNumber - 1); } } }
6016 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6016/11479778a7bf66b2a76bfd7171d571bf38b19984/HistoryView.java/clean/subclipse/ui/src/org/tigris/subversion/subclipse/ui/history/HistoryView.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 9944, 202, 482, 918, 1086, 1435, 288, 6862, 1082, 202, 430, 12, 8219, 480, 446, 597, 1014, 5623, 18415, 480, 446, 597, 401, 1014, 5623, 18415, 18, 588, 1388, 7675, 291, 1669, 7423, 10756, 288, 27573, 368, 3647, 732, 2363, 326, 3222, 16, 732, 4460, 326, 1014, 20982, 202, 45, 6233, 4421, 273, 1014, 5623, 18415, 18, 588, 6233, 5621, 27573, 1014, 5623, 18415, 18, 9144, 5621, 27573, 1014, 5623, 18415, 18, 542, 6233, 12, 10705, 1769, 6862, 9506, 202, 430, 261, 8219, 18, 2469, 405, 374, 13, 288, 6862, 6862, 202, 2722, 1622, 273, 3222, 63, 8219, 18, 2469, 300, 404, 15533, 6862, 6862, 202, 5748, 1142, 1622, 1854, 273, 1142, 1622, 18, 588, 7939, 7675, 588, 1854, 5621, 6862, 6862, 202, 13057, 1685, 273, 394, 29537, 50, 7939, 18, 1854, 12, 2722, 1622, 1854, 300, 404, 1769, 6862, 9506, 202, 97, 6862, 1082, 202, 97, 25083, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 9944, 202, 482, 918, 1086, 1435, 288, 6862, 1082, 202, 430, 12, 8219, 480, 446, 597, 1014, 5623, 18415, 480, 446, 597, 401, 1014, 5623, 18415, 18, 588, 1388, 7675, 291, 1669, 7423, 10756, 288, 27573, 368, 3647, 732, 2363, 326, 3222, 16, 732, 4460, 326, 1014, 20982, 202, 45, 6233, 4421, 273, 1014, 5623, 18415, 18, 588, 6233, 5621, 27573, 1014, 5623, 18415, 18, 9144, 5621, 27573, 1014, 5623, 18415, 18, 542, 6233, 12, 10705, 1769, 6862, 9506, 202, 430, 261, 8219, 18, 2469, 405, 374, 13, 288, 6862, 6862, 202, 2722, 1622, 273, 3222, 63, 8219, 18, 2469, 300, 404, 15533, 6862, 6862, 202, 5748, 1142, 1622, 1854, 273, 1142, 1622, 18, 588, 7939, 7675, 588, 1854, 2 ]
PropertyType.SCRIPT_TYPE );
IPropertyType.SCRIPT_TYPE );
public List getLocalMethods( ) { return getPropertyListWithType( getLocalProperties( ), PropertyType.SCRIPT_TYPE ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/d802c33711e0d111551ae23575895cd060f085b6/ElementDefn.java/buggy/model/org.eclipse.birt.report.model/src/org/eclipse/birt/report/model/metadata/ElementDefn.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 987, 6993, 4712, 12, 262, 202, 95, 202, 202, 2463, 3911, 682, 1190, 559, 12, 6993, 2297, 12, 262, 16, 9506, 202, 22802, 18, 10885, 67, 2399, 11272, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 987, 6993, 4712, 12, 262, 202, 95, 202, 202, 2463, 3911, 682, 1190, 559, 12, 6993, 2297, 12, 262, 16, 9506, 202, 22802, 18, 10885, 67, 2399, 11272, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
IStudent student = sp.getIPersistentStudent()
if (student == null) { student = sp.getIPersistentStudent()
public InfoCandidateRegistration run(Integer candidateID, Integer branchID, Integer studentNumber) throws FenixServiceException { ISuportePersistente sp = null; IStudentCurricularPlan studentCurricularPlanResult = null; IMasterDegreeCandidate masterDegreeCandidate = null; try { sp = SuportePersistenteOJB.getInstance(); if (studentNumber != null) { IStudent student = sp.getIPersistentStudent() .readStudentByNumberAndDegreeType(studentNumber, TipoCurso.MESTRADO_OBJ); if (student != null) { throw new ExistingServiceException(); } } masterDegreeCandidate = (IMasterDegreeCandidate) sp .getIPersistentMasterDegreeCandidate().readByOID( MasterDegreeCandidate.class, candidateID); if (!validSituation(masterDegreeCandidate .getActiveCandidateSituation())) { throw new InvalidChangeServiceException(); } // Check if a Master Degree Student Already Exists IStudent student = sp.getIPersistentStudent() .readByPersonAndDegreeType( masterDegreeCandidate.getPerson(), TipoCurso.MESTRADO_OBJ); IRole role = new Role(); role.setRoleType(RoleType.MASTER_DEGREE_CANDIDATE); IPersonRole personRole = sp.getIPersistentPersonRole() .readByPersonAndRole(masterDegreeCandidate.getPerson(), role); if (personRole != null) { sp.getIPersistentPersonRole().deleteByOID(PersonRole.class, personRole.getIdInternal()); } Integer newStudentNumber = null; newStudentNumber = sp.getIPersistentStudent() .generateStudentNumber(TipoCurso.MESTRADO_OBJ); if (studentNumber != null && studentNumber.intValue() > newStudentNumber.intValue()) throw new InvalidStudentNumberServiceException(); if (student == null) { student = new Student(); sp.getIPersistentStudent().simpleLockWrite(student); student.setDegreeType(TipoCurso.MESTRADO_OBJ); student.setPerson(masterDegreeCandidate.getPerson()); student.setState(new StudentState(StudentState.INSCRITO)); if (studentNumber == null) { student.setNumber(newStudentNumber); } else { student.setNumber(studentNumber); } IStudentKind studentKind = sp.getIPersistentStudentKind() .readByStudentType(new StudentType(StudentType.NORMAL)); student.setStudentKind(studentKind); List roles = new ArrayList(); Iterator iterator = masterDegreeCandidate.getPerson() .getPersonRoles().iterator(); while (iterator.hasNext()) { roles.add(Cloner .copyIRole2InfoRole((IRole) iterator.next())); } // Give The Student Role if Necessary if (!AuthorizationUtils.containsRole(roles, RoleType.STUDENT)) { personRole = new PersonRole(); sp.getIPersistentPersonRole().simpleLockWrite(personRole); personRole.setPerson(masterDegreeCandidate.getPerson()); role = sp.getIPersistentRole().readByRoleType( RoleType.STUDENT); personRole.setRole(role); } } IStudentCurricularPlan studentCurricularPlanOld = sp .getIStudentCurricularPlanPersistente() .readActiveStudentCurricularPlan(student.getNumber(), TipoCurso.MESTRADO_OBJ); if ((studentCurricularPlanOld != null) && (studentCurricularPlanOld.getCurrentState() .equals(StudentCurricularPlanState.ACTIVE_OBJ))) { sp.getIStudentCurricularPlanPersistente().simpleLockWrite( studentCurricularPlanOld); // System.out.println("------------- MASTER DEGREE STUDENT WITH // ACTIVE CURRICULAR PLAN ----------------"); // System.out.println(" -- STUDENT NUMBER: " + // studentCurricularPlanOld.getStudent().getNumber() + "[id: " + // studentCurricularPlanOld.getStudent().getIdInternal() + "]"); // System.out.println(" -- STUDENT CURRICULAR PLAN ID : " + // studentCurricularPlanOld.getIdInternal()); // System.out.println("--------------------------------------------------------------------------------"); throw new ActiveStudentCurricularPlanAlreadyExistsServiceException(); } IStudentCurricularPlan studentCurricularPlan = new StudentCurricularPlan(); sp.getIStudentCurricularPlanPersistente().simpleLockWrite( studentCurricularPlan); IBranch branch = (IBranch) sp.getIPersistentBranch().readByOID( Branch.class, branchID); studentCurricularPlan.setBranch(branch); studentCurricularPlan .setCurrentState(StudentCurricularPlanState.ACTIVE_OBJ); studentCurricularPlan.setDegreeCurricularPlan(masterDegreeCandidate .getExecutionDegree().getCurricularPlan()); studentCurricularPlan.setGivenCredits(masterDegreeCandidate .getGivenCredits()); studentCurricularPlan.setSpecialization(masterDegreeCandidate .getSpecialization()); studentCurricularPlan .setStartDate(Calendar.getInstance().getTime()); studentCurricularPlan.setStudent(student); // Get the Candidate Enrolments List candidateEnrolments = sp.getIPersistentCandidateEnrolment() .readByMDCandidate(masterDegreeCandidate); Iterator iterator = candidateEnrolments.iterator(); while (iterator.hasNext()) { ICandidateEnrolment candidateEnrolment = (ICandidateEnrolment) iterator .next(); IEnrollment enrolment = new Enrolment(); sp.getIPersistentEnrolment().simpleLockWrite(enrolment); //enrolment.setCurricularCourseScope(candidateEnrolment.getCurricularCourseScope()); enrolment.setCurricularCourse(candidateEnrolment .getCurricularCourse()); enrolment .setEnrolmentEvaluationType(new EnrolmentEvaluationType( EnrolmentEvaluationType.NORMAL)); enrolment.setEnrollmentState(EnrollmentState.ENROLLED); enrolment.setExecutionPeriod(sp.getIPersistentExecutionPeriod() .readActualExecutionPeriod()); enrolment.setStudentCurricularPlan(studentCurricularPlan); enrolment.setEvaluations(new ArrayList()); enrolment.setCondition(EnrollmentCondition.FINAL); IEnrolmentEvaluation enrolmentEvaluation = new EnrolmentEvaluation(); sp.getIPersistentEnrolmentEvaluation().simpleLockWrite( enrolmentEvaluation); enrolmentEvaluation.setEnrolment(enrolment); enrolmentEvaluation .setEnrolmentEvaluationState(EnrolmentEvaluationState.TEMPORARY_OBJ); enrolmentEvaluation .setEnrolmentEvaluationType(new EnrolmentEvaluationType( EnrolmentEvaluationType.NORMAL)); enrolment.getEvaluations().add(enrolmentEvaluation); } // Change the Candidate Situation ICandidateSituation oldCandidateSituation = (ICandidateSituation) sp .getIPersistentCandidateSituation().readByOID( CandidateSituation.class, masterDegreeCandidate.getActiveCandidateSituation() .getIdInternal(), true); oldCandidateSituation.setValidation(new State(State.INACTIVE)); ICandidateSituation candidateSituation = new CandidateSituation(); sp.getIPersistentCandidateSituation().simpleLockWrite( candidateSituation); candidateSituation.setDate(Calendar.getInstance().getTime()); candidateSituation.setMasterDegreeCandidate(masterDegreeCandidate); candidateSituation.setValidation(new State(State.ACTIVE)); candidateSituation.setSituation(SituationName.ENROLLED_OBJ); // Inicial Gratuity State IGratuity gratuity = new Gratuity(); sp.getIPersistentGratuity().simpleLockWrite(gratuity); gratuity.setDate(Calendar.getInstance().getTime()); gratuity.setGratuityState(GratuityState.NOT_PAYED); gratuity.setState(new State(State.ACTIVE)); gratuity.setStudentCurricularPlan(studentCurricularPlan); // Copy Qualifications IQualification qualification = new Qualification(); sp.getIPersistentQualification().simpleLockWrite(qualification); if (masterDegreeCandidate.getAverage() != null) { qualification.setMark(masterDegreeCandidate.getAverage() .toString()); } qualification.setPerson(masterDegreeCandidate.getPerson()); if (masterDegreeCandidate.getMajorDegreeSchool() == null) { qualification.setSchool(""); } else { qualification.setSchool(masterDegreeCandidate .getMajorDegreeSchool()); } qualification.setTitle(masterDegreeCandidate.getMajorDegree()); Calendar calendar = Calendar.getInstance(); if (masterDegreeCandidate.getMajorDegreeYear() == null) { qualification.setDate(calendar.getTime()); } else { calendar.set(Calendar.YEAR, masterDegreeCandidate .getMajorDegreeYear().intValue()); qualification.setDate(calendar.getTime()); } qualification.setDegree(masterDegreeCandidate.getMajorDegree()); sp.confirmarTransaccao(); sp.iniciarTransaccao(); // Change the Username If neccessary changeUsernameIfNeccessary(studentCurricularPlan.getStudent()); studentCurricularPlanResult = sp .getIStudentCurricularPlanPersistente() .readActiveStudentCurricularPlan(student.getNumber(), TipoCurso.MESTRADO_OBJ); } catch (ExcepcaoPersistencia ex) { FenixServiceException newEx = new FenixServiceException( "Persistence layer error"); //newEx.fillInStackTrace(); throw newEx; } InfoCandidateRegistration infoCandidateRegistration = new InfoCandidateRegistration(); infoCandidateRegistration .setInfoMasterDegreeCandidate(Cloner .copyIMasterDegreeCandidate2InfoMasterDegreCandidate(masterDegreeCandidate)); infoCandidateRegistration .setInfoStudentCurricularPlan(Cloner .copyIStudentCurricularPlan2InfoStudentCurricularPlan(studentCurricularPlanResult)); infoCandidateRegistration.setEnrolments(new ArrayList()); Iterator iterator = studentCurricularPlanResult.getEnrolments() .iterator(); while (iterator.hasNext()) { Enrolment enrolment = (Enrolment) iterator.next(); infoCandidateRegistration.getEnrolments().add( Cloner.copyIEnrolment2InfoEnrolment(enrolment)); } return infoCandidateRegistration; }
2645 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2645/2cde26bf19ef61182cadba3f1a07cb4bf725d18e/RegisterCandidate.java/buggy/src/ServidorAplicacao/Servico/masterDegree/administrativeOffice/candidate/RegisterCandidate.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3807, 11910, 7843, 1086, 12, 4522, 5500, 734, 16, 2144, 3803, 734, 16, 5411, 2144, 18110, 1854, 13, 1216, 478, 275, 697, 15133, 288, 3639, 467, 3088, 499, 73, 11906, 73, 1694, 273, 446, 31, 3639, 467, 19943, 319, 2408, 1512, 2490, 5365, 18110, 2408, 1512, 2490, 5365, 1253, 273, 446, 31, 3639, 6246, 2440, 22885, 11910, 4171, 22885, 11910, 273, 446, 31, 3639, 775, 288, 5411, 1694, 273, 3425, 499, 73, 11906, 73, 51, 8877, 18, 588, 1442, 5621, 5411, 309, 261, 26240, 1854, 480, 446, 13, 288, 7734, 309, 261, 26240, 422, 446, 13, 288, 18110, 273, 1694, 18, 588, 2579, 6572, 19943, 319, 1435, 13491, 263, 896, 19943, 319, 858, 1854, 1876, 22885, 559, 12, 26240, 1854, 16, 27573, 399, 625, 83, 2408, 2048, 18, 958, 3902, 1880, 51, 67, 24547, 1769, 7734, 309, 261, 26240, 480, 446, 13, 288, 10792, 604, 394, 28257, 15133, 5621, 7734, 289, 5411, 289, 5411, 4171, 22885, 11910, 273, 261, 3445, 2440, 22885, 11910, 13, 1694, 10792, 263, 588, 2579, 6572, 7786, 22885, 11910, 7675, 896, 858, 12945, 12, 18701, 13453, 22885, 11910, 18, 1106, 16, 5500, 734, 1769, 5411, 309, 16051, 877, 55, 305, 11407, 12, 7525, 22885, 11910, 10792, 263, 588, 3896, 11910, 55, 305, 11407, 1435, 3719, 288, 7734, 604, 394, 1962, 3043, 15133, 5621, 5411, 289, 5411, 368, 2073, 309, 279, 13453, 463, 1332, 992, 934, 1100, 319, 17009, 17277, 5411, 309, 261, 26240, 422, 446, 13, 288, 18110, 273, 1694, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3807, 11910, 7843, 1086, 12, 4522, 5500, 734, 16, 2144, 3803, 734, 16, 5411, 2144, 18110, 1854, 13, 1216, 478, 275, 697, 15133, 288, 3639, 467, 3088, 499, 73, 11906, 73, 1694, 273, 446, 31, 3639, 467, 19943, 319, 2408, 1512, 2490, 5365, 18110, 2408, 1512, 2490, 5365, 1253, 273, 446, 31, 3639, 6246, 2440, 22885, 11910, 4171, 22885, 11910, 273, 446, 31, 3639, 775, 288, 5411, 1694, 273, 3425, 499, 73, 11906, 73, 51, 8877, 18, 588, 1442, 5621, 5411, 309, 261, 26240, 1854, 480, 446, 13, 288, 7734, 309, 261, 26240, 422, 446, 13, 288, 18110, 273, 1694, 18, 588, 2579, 6572, 19943, 319, 1435, 13491, 263, 896, 19943, 319, 858, 1854, 1876, 22885, 559, 2 ]
public void testCaseInsensitiveNameMapping() throws Exception { for( int i = 0; i < input.length; i++ ) {
public void testCaseInsensitiveNameMapping() throws Exception { for (int i = 0; i < input.length; i++) {
public void testCaseInsensitiveNameMapping() throws Exception { for( int i = 0; i < input.length; i++ ) { input[i] = input[i].toLowerCase(); } for( int i = 0; i < input.length; i++ ) { File jar = new File( input[i] ); assertEquals( output[i], mojo.getArtifactIdForJar( jar ) ); } }
47899 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47899/24da5e85af5a5436d87052b0eb6b01bb40e0457c/TestBootstrapMojo.java/clean/maven2/maven-wobootstrap-plugin/src/test/java/org/objectstyle/woproject/maven2/wobootstrap/TestBootstrapMojo.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 2449, 21931, 461, 3233, 1435, 1216, 1185, 202, 95, 202, 202, 1884, 12, 509, 277, 273, 374, 31, 277, 411, 810, 18, 2469, 31, 277, 9904, 262, 202, 202, 95, 1082, 202, 2630, 63, 77, 65, 273, 810, 63, 77, 8009, 869, 5630, 5621, 202, 202, 97, 202, 202, 1884, 12, 509, 277, 273, 374, 31, 277, 411, 810, 18, 2469, 31, 277, 9904, 262, 202, 202, 95, 1082, 202, 812, 7334, 273, 394, 1387, 12, 810, 63, 77, 65, 11272, 1082, 202, 11231, 8867, 12, 876, 63, 77, 6487, 312, 10007, 18, 588, 7581, 548, 1290, 10813, 12, 7334, 262, 11272, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 2449, 21931, 461, 3233, 1435, 1216, 1185, 202, 95, 202, 202, 1884, 12, 509, 277, 273, 374, 31, 277, 411, 810, 18, 2469, 31, 277, 9904, 262, 202, 202, 95, 1082, 202, 2630, 63, 77, 65, 273, 810, 63, 77, 8009, 869, 5630, 5621, 202, 202, 97, 202, 202, 1884, 12, 509, 277, 273, 374, 31, 277, 411, 810, 18, 2469, 31, 277, 9904, 262, 202, 202, 95, 1082, 202, 812, 7334, 273, 394, 1387, 12, 810, 63, 77, 65, 11272, 1082, 202, 11231, 8867, 12, 876, 63, 77, 6487, 312, 10007, 18, 588, 7581, 548, 1290, 10813, 12, 7334, 262, 11272, 202, 202, 97, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100 ]
super.rejectValue(errors,MAX_LENGTH_CONSTRAINT + EXCEEDED_SUFFIX,args,getDefaultMessage(DEFAULT_INVALID_MAX_LENGTH_MESSAGE_CODE, args));
return;
protected void processValidate(Object target, Object propertyValue, Errors errors) { Object[] args = new Object[] { constraintPropertyName, constraintOwningClass, propertyValue, new Integer(maxSize) }; if(propertyValue == null) { super.rejectValue(errors,MAX_LENGTH_CONSTRAINT + EXCEEDED_SUFFIX,args,getDefaultMessage(DEFAULT_INVALID_MAX_LENGTH_MESSAGE_CODE, args)); } else if(propertyValue.getClass().isArray()) { int length = Array.getLength( propertyValue ); if(length > maxSize) { super.rejectValue(errors,MAX_LENGTH_CONSTRAINT + EXCEEDED_SUFFIX,args,getDefaultMessage(DEFAULT_INVALID_MAX_LENGTH_MESSAGE_CODE, args)); } } else if(propertyValue instanceof Collection) { if (((Collection) propertyValue).size() > maxSize) { super.rejectValue(errors, MAX_SIZE_CONSTRAINT + EXCEEDED_SUFFIX, args, getDefaultMessage(DEFAULT_INVALID_MAX_SIZE_MESSAGE_CODE, args)); } else if (propertyValue instanceof Number) { int numberSize = ((Number) propertyValue).intValue(); if (numberSize > maxSize) { super.rejectValue(errors, MAX_SIZE_CONSTRAINT + EXCEEDED_SUFFIX, args, getDefaultMessage(DEFAULT_INVALID_MAX_SIZE_MESSAGE_CODE, args)); } } } else if (propertyValue instanceof String) { if (((String) propertyValue).length() > maxSize) { super.rejectValue(errors, MAX_LENGTH_CONSTRAINT + EXCEEDED_SUFFIX, args, getDefaultMessage(DEFAULT_INVALID_MAX_LENGTH_MESSAGE_CODE, args)); } } }
51826 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51826/49f52885c725208c5119f0543739f1548bbe79e3/ConstrainedProperty.java/clean/src/commons/org/codehaus/groovy/grails/validation/ConstrainedProperty.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 918, 1207, 4270, 12, 921, 1018, 16, 1033, 12337, 16, 9372, 1334, 13, 288, 5411, 1033, 8526, 833, 273, 394, 1033, 8526, 288, 4954, 13073, 16, 4954, 3494, 2093, 797, 16, 12337, 16, 394, 2144, 12, 1896, 1225, 13, 289, 31, 5411, 309, 12, 4468, 620, 422, 446, 13, 288, 1171, 327, 31, 5411, 289, 5411, 469, 309, 12, 4468, 620, 18, 588, 797, 7675, 291, 1076, 10756, 288, 7734, 509, 769, 273, 1510, 18, 588, 1782, 12, 12337, 11272, 7734, 309, 12, 2469, 405, 14777, 13, 288, 5397, 327, 31, 7734, 289, 5411, 289, 5411, 469, 309, 12, 4468, 620, 1276, 2200, 13, 288, 7734, 309, 261, 12443, 2532, 13, 12337, 2934, 1467, 1435, 405, 14777, 13, 288, 10792, 2240, 18, 24163, 620, 12, 4324, 16, 4552, 67, 4574, 67, 15199, 397, 5675, 26031, 67, 14964, 16, 833, 16, 4829, 1079, 12, 5280, 67, 9347, 67, 6694, 67, 4574, 67, 8723, 67, 5572, 16, 833, 10019, 7734, 289, 469, 309, 261, 4468, 620, 1276, 3588, 13, 288, 10792, 509, 1300, 1225, 273, 14015, 1854, 13, 12337, 2934, 474, 620, 5621, 10792, 309, 261, 2696, 1225, 405, 14777, 13, 288, 13491, 2240, 18, 24163, 620, 12, 4324, 16, 4552, 67, 4574, 67, 15199, 397, 5675, 26031, 67, 14964, 16, 833, 16, 4829, 1079, 12, 5280, 67, 9347, 67, 6694, 67, 4574, 67, 8723, 67, 5572, 16, 833, 10019, 10792, 289, 7734, 289, 5411, 289, 5411, 469, 309, 261, 4468, 620, 1276, 514, 13, 288, 7734, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 918, 1207, 4270, 12, 921, 1018, 16, 1033, 12337, 16, 9372, 1334, 13, 288, 5411, 1033, 8526, 833, 273, 394, 1033, 8526, 288, 4954, 13073, 16, 4954, 3494, 2093, 797, 16, 12337, 16, 394, 2144, 12, 1896, 1225, 13, 289, 31, 5411, 309, 12, 4468, 620, 422, 446, 13, 288, 1171, 327, 31, 5411, 289, 5411, 469, 309, 12, 4468, 620, 18, 588, 797, 7675, 291, 1076, 10756, 288, 7734, 509, 769, 273, 1510, 18, 588, 1782, 12, 12337, 11272, 7734, 309, 12, 2469, 405, 14777, 13, 288, 5397, 327, 31, 7734, 289, 5411, 289, 5411, 469, 309, 12, 4468, 620, 1276, 2200, 13, 288, 7734, 309, 261, 12443, 2532, 13, 12337, 2934, 1467, 1435, 405, 14777, 2 ]
if (Pooka.isDebug()) System.out.println("firing MessageCountEvent on " + getFolderID());
public void fireMessageCountEvent(MessageCountEvent mce) { if (Pooka.isDebug()) System.out.println("firing MessageCountEvent on " + getFolderID()); // from the EventListenerList javadoc, including comments. // Guaranteed to return a non-null array Object[] listeners = eventListeners.getListenerList(); // Process the listeners last to first, notifying // those that are interested in this event if (mce.getType() == MessageCountEvent.ADDED) { for (int i = listeners.length-2; i>=0; i-=2) { if (Pooka.isDebug()) System.out.println("listeners[" + i + "] is " + listeners[i] ); if (listeners[i]==MessageCountListener.class) { if (Pooka.isDebug()) System.out.println("check. running messagesAdded on listener."); ((MessageCountListener)listeners[i+1]).messagesAdded(mce); } } } else if (mce.getType() == MessageCountEvent.REMOVED) { for (int i = listeners.length-2; i>=0; i-=2) { if (Pooka.isDebug()) System.out.println("listeners[" + i + "] is " + listeners[i] ); if (listeners[i]==MessageCountListener.class) { if (Pooka.isDebug()) System.out.println("check. running messagesRemoved on listener " + listeners[i+1] ); ((MessageCountListener)listeners[i+1]).messagesRemoved(mce); } } } }
967 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/967/c1008b218bc1736154ead634a19f63e9045c202a/FolderInfo.java/buggy/net/suberic/pooka/FolderInfo.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 4452, 1079, 1380, 1133, 12, 1079, 1380, 1133, 312, 311, 13, 288, 3639, 309, 261, 52, 1184, 69, 18, 291, 2829, 10756, 1377, 2332, 18, 659, 18, 8222, 2932, 74, 11256, 2350, 1380, 1133, 603, 315, 397, 29001, 734, 10663, 3639, 368, 628, 326, 22090, 682, 30829, 16, 6508, 5678, 18, 3639, 368, 6467, 30164, 358, 327, 279, 1661, 17, 2011, 526, 565, 1033, 8526, 4679, 273, 871, 5583, 18, 588, 2223, 682, 5621, 565, 368, 4389, 326, 4679, 1142, 358, 1122, 16, 5066, 310, 565, 368, 5348, 716, 854, 20506, 316, 333, 871, 3639, 309, 261, 81, 311, 18, 588, 559, 1435, 422, 2350, 1380, 1133, 18, 1880, 7660, 13, 288, 1377, 364, 261, 474, 277, 273, 4679, 18, 2469, 17, 22, 31, 277, 34, 33, 20, 31, 277, 17, 33, 22, 13, 288, 202, 430, 261, 52, 1184, 69, 18, 291, 2829, 10756, 202, 225, 2332, 18, 659, 18, 8222, 2932, 16072, 9614, 397, 277, 397, 9850, 353, 315, 397, 4679, 63, 77, 65, 11272, 202, 430, 261, 16072, 63, 77, 65, 631, 1079, 1380, 2223, 18, 1106, 13, 288, 202, 225, 309, 261, 52, 1184, 69, 18, 291, 2829, 10756, 202, 565, 2332, 18, 659, 18, 8222, 2932, 1893, 18, 225, 3549, 2743, 8602, 603, 2991, 1199, 1769, 202, 21114, 225, 14015, 1079, 1380, 2223, 13, 16072, 63, 77, 15, 21, 65, 2934, 6833, 8602, 12, 81, 311, 1769, 202, 97, 10792, 289, 565, 289, 469, 309, 261, 81, 311, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 4452, 1079, 1380, 1133, 12, 1079, 1380, 1133, 312, 311, 13, 288, 3639, 309, 261, 52, 1184, 69, 18, 291, 2829, 10756, 1377, 2332, 18, 659, 18, 8222, 2932, 74, 11256, 2350, 1380, 1133, 603, 315, 397, 29001, 734, 10663, 3639, 368, 628, 326, 22090, 682, 30829, 16, 6508, 5678, 18, 3639, 368, 6467, 30164, 358, 327, 279, 1661, 17, 2011, 526, 565, 1033, 8526, 4679, 273, 871, 5583, 18, 588, 2223, 682, 5621, 565, 368, 4389, 326, 4679, 1142, 358, 1122, 16, 5066, 310, 565, 368, 5348, 716, 854, 20506, 316, 333, 871, 3639, 309, 261, 81, 311, 18, 588, 559, 1435, 422, 2350, 1380, 1133, 18, 1880, 7660, 13, 288, 1377, 364, 261, 474, 2 ]
Connection c = DriverManager.getConnection("jdbc:hsqldb:mem:test", "sa", "");
String dbURL = "jdbc:hsqldb:mem:"+m_dbName; Connection c = DriverManager.getConnection(dbURL, "sa", "");
public Connection getConnection() throws SQLException { Connection c = DriverManager.getConnection("jdbc:hsqldb:mem:test", "sa", ""); return c; }
11849 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11849/7fc2867031a646336a69eb6ad11ecd8b103f983e/MockDatabase.java/buggy/src/services/org/opennms/netmgt/mock/MockDatabase.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 4050, 6742, 1435, 1216, 6483, 288, 3639, 514, 1319, 1785, 273, 315, 24687, 30, 4487, 1217, 1966, 30, 3917, 2773, 15, 81, 67, 1966, 461, 31, 225, 4050, 276, 273, 9396, 1318, 18, 588, 1952, 12, 1966, 1785, 16, 315, 13098, 3113, 1408, 1769, 3639, 327, 276, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 4050, 6742, 1435, 1216, 6483, 288, 3639, 514, 1319, 1785, 273, 315, 24687, 30, 4487, 1217, 1966, 30, 3917, 2773, 15, 81, 67, 1966, 461, 31, 225, 4050, 276, 273, 9396, 1318, 18, 588, 1952, 12, 1966, 1785, 16, 315, 13098, 3113, 1408, 1769, 3639, 327, 276, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Point point){
Point point) {
protected Point isAreaClearBW(int xPoint, int yPoint, Point point){ Debug.message("declutterdetail", "Decluttering: Checking both ways..."); // Check to see if it's totally offscreen. If it is, keep it // there.. Also check to see if the first location is good // (isClear) if (!indexes.setFromPixels(xPoint, yPoint) || isClear(indexes, true)){ point.x = xPoint; point.y = yPoint; return point; } // Guess not. Step our way to the left to see if anything is // available... // We're going to test the right, and then work our way left // until the original spot is the rightmost spot. int leftMostIndex = indexes.origXIndex - indexes.origIndexLength; // Start by keeping track of clear vertical cells. If we get // a run of them that equals the origIndexLength, then we have // space right there. int count = 0; int currentXIndex = indexes.origXIndex + indexes.origIndexLength; while (count < indexes.origIndexLength && currentXIndex > leftMostIndex){ if (!indexes.set(currentXIndex, indexes.origYIndex)){ // Still off the matrix count = 0; currentXIndex--; continue; } if (currentXIndex >= 0 && currentXIndex <= maxx){ if(!isMatrixLocationTaken(currentXIndex, indexes.yStart, indexes.yEnd - indexes.yStart + 1)){ count++; // clear column } else { count = 0; // Start counting again } } else { // If we are off the matrix, check and see if we want // to consider those space as open autmatically. if (allowPartials) { count++; } else { // This will not, Because it makes it look like // we ran out of space. count = 0; } } if (count < indexes.origIndexLength){ currentXIndex--; } } // So, either we ran out of space, or we found a space big // enough for the text. if (count >= indexes.origIndexLength){ point.x = currentXIndex * x_pix_interval; point.y = yPoint; indexes.xStart = currentXIndex; setTaken(indexes); Debug.message("declutterdetail", "Decluttering: found a spot"); return point; } // Ran out of space. return null; }
3071 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3071/bd3246ddacb315557bb4a27bccc72e866994de80/DeclutterMatrix.java/clean/src/openmap/com/bbn/openmap/layer/DeclutterMatrix.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 4686, 353, 5484, 9094, 38, 59, 12, 474, 619, 2148, 16, 509, 677, 2148, 16, 21394, 4686, 1634, 13, 288, 3639, 4015, 18, 2150, 2932, 8840, 18220, 8992, 3113, 15604, 315, 3456, 18220, 310, 30, 24471, 3937, 16226, 7070, 1769, 7734, 368, 2073, 358, 2621, 309, 518, 1807, 9997, 1230, 3397, 9252, 18, 225, 971, 518, 353, 16, 3455, 518, 3639, 368, 1915, 838, 225, 8080, 866, 358, 2621, 309, 326, 1122, 2117, 353, 7494, 3639, 368, 261, 291, 9094, 13, 3639, 309, 16051, 11265, 18, 542, 1265, 18079, 12, 92, 2148, 16, 677, 2148, 13, 225, 747, 353, 9094, 12, 11265, 16, 638, 3719, 95, 5411, 1634, 18, 92, 273, 619, 2148, 31, 5411, 1634, 18, 93, 273, 677, 2148, 31, 5411, 327, 1634, 31, 3639, 289, 3639, 368, 30282, 486, 18, 225, 8693, 3134, 4031, 358, 326, 2002, 358, 2621, 309, 6967, 353, 3639, 368, 2319, 2777, 3639, 368, 1660, 4565, 8554, 358, 1842, 326, 2145, 16, 471, 1508, 1440, 3134, 4031, 2002, 3639, 368, 3180, 326, 2282, 16463, 353, 326, 2145, 10329, 16463, 18, 3639, 509, 2002, 18714, 1016, 273, 5596, 18, 4949, 60, 1016, 300, 5596, 18, 4949, 1016, 1782, 31, 3639, 368, 3603, 635, 19966, 3298, 434, 2424, 9768, 5983, 18, 225, 971, 732, 336, 3639, 368, 279, 1086, 434, 2182, 716, 1606, 326, 1647, 1016, 1782, 16, 1508, 732, 1240, 3639, 368, 3476, 2145, 1915, 18, 3639, 509, 1056, 273, 374, 31, 3639, 509, 783, 60, 1016, 273, 5596, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 4686, 353, 5484, 9094, 38, 59, 12, 474, 619, 2148, 16, 509, 677, 2148, 16, 21394, 4686, 1634, 13, 288, 3639, 4015, 18, 2150, 2932, 8840, 18220, 8992, 3113, 15604, 315, 3456, 18220, 310, 30, 24471, 3937, 16226, 7070, 1769, 7734, 368, 2073, 358, 2621, 309, 518, 1807, 9997, 1230, 3397, 9252, 18, 225, 971, 518, 353, 16, 3455, 518, 3639, 368, 1915, 838, 225, 8080, 866, 358, 2621, 309, 326, 1122, 2117, 353, 7494, 3639, 368, 261, 291, 9094, 13, 3639, 309, 16051, 11265, 18, 542, 1265, 18079, 12, 92, 2148, 16, 677, 2148, 13, 225, 747, 353, 9094, 12, 11265, 16, 638, 3719, 95, 5411, 1634, 18, 92, 273, 619, 2148, 31, 5411, 1634, 18, 2 ]
public ArrayList()
public ArrayList(int iCapacity)
public ArrayList() { this(DEFAULT_CAPACITY); }
47947 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47947/06d33409f65045a9ed8e15bb4583c8099c6eb3e6/ArrayList.java/buggy/java/util/ArrayList.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2407, 12, 474, 277, 7437, 13, 225, 288, 565, 333, 12, 5280, 67, 17296, 30041, 1769, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2407, 12, 474, 277, 7437, 13, 225, 288, 565, 333, 12, 5280, 67, 17296, 30041, 1769, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
System.err.println("Backoffice getContentDefinitionConstructor: Invocation target exception!"); ite.printStackTrace();
if (A_OpenCms.isLogging()) { A_OpenCms.log(C_OPENCMS_INFO, getClassName() + ": Backoffice: Invocation target exception!"); }
private Object getContentDefinitionConstructor(CmsObject cms, Class cdClass, Integer id) { Object o = null; try { Constructor c = cdClass.getConstructor(new Class[] {CmsObject.class, Integer.class}); o = c.newInstance(new Object[] {cms, id}); } catch (InvocationTargetException ite) { System.err.println("Backoffice getContentDefinitionConstructor: Invocation target exception!"); ite.printStackTrace(); } catch (NoSuchMethodException nsm) { System.err.println("Backoffice getContentDefinitionConstructor: Requested method was not found!"); } catch (InstantiationException ie) { System.err.println("Backoffice getContentDefinitionConstructor: the class is abstract!!"); } catch (Exception e) { System.err.println("Backoffice getContentDefinitionConstructor: Output section throwed an exception!"); e.printStackTrace(); } return o;}
51784 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51784/cdbe660ff2369bbca40eb27640604aa9a452cef3/A_Backoffice.java/clean/src/com/opencms/defaults/A_Backoffice.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 1033, 5154, 1852, 6293, 12, 4747, 921, 6166, 16, 1659, 7976, 797, 16, 2144, 612, 13, 288, 202, 921, 320, 273, 446, 31, 202, 698, 288, 202, 202, 6293, 276, 273, 7976, 797, 18, 588, 6293, 12, 2704, 1659, 8526, 288, 4747, 921, 18, 1106, 16, 2144, 18, 1106, 22938, 202, 202, 83, 273, 276, 18, 2704, 1442, 12, 2704, 1033, 8526, 288, 6851, 16, 612, 22938, 202, 97, 1044, 261, 9267, 14950, 518, 73, 13, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 16757, 1812, 5154, 1852, 6293, 30, 11298, 1018, 1520, 4442, 1769, 202, 202, 1137, 18, 1188, 6332, 5621, 202, 97, 1044, 261, 28341, 14513, 3153, 81, 13, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 16757, 1812, 5154, 1852, 6293, 30, 25829, 707, 1703, 486, 1392, 4442, 1769, 202, 97, 1044, 261, 10675, 7072, 503, 9228, 13, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 16757, 1812, 5154, 1852, 6293, 30, 326, 667, 353, 8770, 5, 4442, 1769, 202, 97, 1044, 261, 503, 425, 13, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 16757, 1812, 5154, 1852, 6293, 30, 3633, 2442, 604, 329, 392, 1520, 4442, 1769, 202, 202, 73, 18, 1188, 6332, 5621, 202, 97, 202, 2463, 320, 31, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 1033, 5154, 1852, 6293, 12, 4747, 921, 6166, 16, 1659, 7976, 797, 16, 2144, 612, 13, 288, 202, 921, 320, 273, 446, 31, 202, 698, 288, 202, 202, 6293, 276, 273, 7976, 797, 18, 588, 6293, 12, 2704, 1659, 8526, 288, 4747, 921, 18, 1106, 16, 2144, 18, 1106, 22938, 202, 202, 83, 273, 276, 18, 2704, 1442, 12, 2704, 1033, 8526, 288, 6851, 16, 612, 22938, 202, 97, 1044, 261, 9267, 14950, 518, 73, 13, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 16757, 1812, 5154, 1852, 6293, 30, 11298, 1018, 1520, 4442, 1769, 202, 202, 1137, 18, 1188, 6332, 5621, 202, 97, 1044, 261, 28341, 14513, 3153, 81, 13, 288, 202, 202, 3163, 18, 370, 2 ]
public String word() throws RecognitionException { String word; Token id=null; Token str=null; word = null; try { // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:475:17: (id= ID | 'import' | 'use' | 'rule' | 'salience' | 'no-loop' | 'when' | 'then' | 'end' | str= STRING ) int alt38=10; switch ( input.LA(1) ) { case ID: alt38=1; break; case 17: alt38=2; break; case 43: alt38=3; break; case 19: alt38=4; break; case 26: alt38=5; break; case 27: alt38=6; break; case 20: alt38=7; break; case 23: alt38=8; break; case 24: alt38=9; break; case STRING: alt38=10; break; default: NoViableAltException nvae = new NoViableAltException("471:1: word returns [String word] : (id= ID | \'import\' | \'use\' | \'rule\' | \'salience\' | \'no-loop\' | \'when\' | \'then\' | \'end\' | str= STRING );", 38, 0, input); throw nvae; } switch (alt38) { case 1 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:475:17: id= ID { id=(Token)input.LT(1); match(input,ID,FOLLOW_ID_in_word1713); word=id.getText(); } break; case 2 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:476:17: 'import' { match(input,17,FOLLOW_17_in_word1725); word="import"; } break; case 3 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:477:17: 'use' { match(input,43,FOLLOW_43_in_word1734); word="use"; } break; case 4 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:478:17: 'rule' { match(input,19,FOLLOW_19_in_word1746); word="rule"; } break; case 5 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:479:17: 'salience' { match(input,26,FOLLOW_26_in_word1757); word="salience"; } break; case 6 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:480:17: 'no-loop' { match(input,27,FOLLOW_27_in_word1765); word="no-loop"; } break; case 7 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:481:17: 'when' { match(input,20,FOLLOW_20_in_word1773); word="when"; } break; case 8 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:482:17: 'then' { match(input,23,FOLLOW_23_in_word1784); word="then"; } break; case 9 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:483:17: 'end' { match(input,24,FOLLOW_24_in_word1795); word="end"; } break; case 10 : // /Users/bob/Documents/workspace/jbossrules/drools-compiler/src/main/java/org/drools/lang/drl.g:484:17: str= STRING { str=(Token)input.LT(1); match(input,STRING,FOLLOW_STRING_in_word1809); word=str.getText(); word=word.substring( 1, word.length()-1 ); } break; } } catch (RecognitionException re) { reportError(re); recover(input,re); } finally { } return word; }
6736 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6736/59894e8a22b2183840bd9c2486282d6f4f6932d0/RuleParser.java/clean/drools-compiler/src/main/java/org/drools/lang/RuleParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 2076, 1435, 1216, 9539, 288, 6647, 514, 2076, 31, 3639, 3155, 612, 33, 2011, 31, 3639, 3155, 609, 33, 2011, 31, 540, 202, 202, 1095, 273, 446, 31, 540, 202, 3639, 775, 288, 5411, 368, 342, 6588, 19, 70, 947, 19, 12922, 19, 14915, 19, 10649, 8464, 7482, 19, 12215, 17, 9576, 19, 4816, 19, 5254, 19, 6290, 19, 3341, 19, 12215, 19, 4936, 19, 72, 1321, 18, 75, 30, 24, 5877, 30, 4033, 30, 261, 350, 33, 1599, 571, 296, 5666, 11, 571, 296, 1202, 11, 571, 296, 5345, 11, 571, 296, 21982, 6254, 11, 571, 296, 2135, 17, 6498, 11, 571, 296, 13723, 11, 571, 296, 15991, 11, 571, 296, 409, 11, 571, 609, 33, 9469, 262, 5411, 509, 3770, 7414, 33, 2163, 31, 5411, 1620, 261, 810, 18, 2534, 12, 21, 13, 262, 288, 5411, 648, 1599, 30, 7734, 3770, 7414, 33, 21, 31, 7734, 898, 31, 5411, 648, 8043, 30, 7734, 3770, 7414, 33, 22, 31, 7734, 898, 31, 5411, 648, 21193, 30, 7734, 3770, 7414, 33, 23, 31, 7734, 898, 31, 5411, 648, 5342, 30, 7734, 3770, 7414, 33, 24, 31, 7734, 898, 31, 5411, 648, 10659, 30, 7734, 3770, 7414, 33, 25, 31, 7734, 898, 31, 5411, 648, 12732, 30, 7734, 3770, 7414, 33, 26, 31, 7734, 898, 31, 5411, 648, 4200, 30, 7734, 3770, 7414, 33, 27, 31, 7734, 898, 31, 5411, 648, 10213, 30, 7734, 3770, 7414, 33, 28, 31, 7734, 898, 31, 5411, 648, 4248, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 2076, 1435, 1216, 9539, 288, 6647, 514, 2076, 31, 3639, 3155, 612, 33, 2011, 31, 3639, 3155, 609, 33, 2011, 31, 540, 202, 202, 1095, 273, 446, 31, 540, 202, 3639, 775, 288, 5411, 368, 342, 6588, 19, 70, 947, 19, 12922, 19, 14915, 19, 10649, 8464, 7482, 19, 12215, 17, 9576, 19, 4816, 19, 5254, 19, 6290, 19, 3341, 19, 12215, 19, 4936, 19, 72, 1321, 18, 75, 30, 24, 5877, 30, 4033, 30, 261, 350, 33, 1599, 571, 296, 5666, 11, 571, 296, 1202, 11, 571, 296, 5345, 11, 571, 296, 21982, 6254, 11, 571, 296, 2135, 17, 6498, 11, 571, 296, 13723, 11, 571, 296, 15991, 11, 571, 296, 409, 11, 571, 609, 2 ]
public char getIndexArray()[]
public char[] getIndexArray()
public char getIndexArray()[] { return indices; }
5620 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5620/07b76ae6a3a7d748b531bd4495276f4e8a7e8284/CompactByteArray.java/buggy/icu4j/src/com/ibm/icu/util/CompactByteArray.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1149, 8526, 8088, 1076, 1435, 565, 288, 3639, 327, 4295, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1149, 8526, 8088, 1076, 1435, 565, 288, 3639, 327, 4295, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return engine.isPropertySetted(Properties.MAX_WIDTH); }
return engine.isPropertySetted(Properties.MAX_WIDTH); }
public final boolean isMaxWidthSetted() { return engine.isPropertySetted(Properties.MAX_WIDTH); }
6232 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6232/1f1850be471d4b8bfd2f3c50aa61bc39bf91259a/DataColumnComponent.java/buggy/org.rcfaces.core/src/org/rcfaces/core/component/DataColumnComponent.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 727, 1250, 353, 2747, 2384, 694, 2344, 1435, 288, 3639, 327, 4073, 18, 291, 1396, 694, 2344, 12, 2297, 18, 6694, 67, 10023, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 727, 1250, 353, 2747, 2384, 694, 2344, 1435, 288, 3639, 327, 4073, 18, 291, 1396, 694, 2344, 12, 2297, 18, 6694, 67, 10023, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (getCoolBarManager() != null) { CoolBarManager coolBarMgr = getCoolBarManager();
ICoolBarManager coolBarMgr = getCoolBarManager2(); if (coolBarMgr != null) {
public IStatus restoreState(IMemento memento, IPerspectiveDescriptor activeDescriptor) { Assert.isNotNull(getShell()); MultiStatus result = new MultiStatus(PlatformUI.PLUGIN_ID, IStatus.OK, WorkbenchMessages.WorkbenchWindow_problemsRestoringWindow, null); // Restore the window advisor state. IMemento windowAdvisorState = memento .getChild(IWorkbenchConstants.TAG_WORKBENCH_WINDOW_ADVISOR); if (windowAdvisorState != null) result.add(getWindowAdvisor().restoreState(windowAdvisorState)); // Restore actionbar advisor state. IMemento actionBarAdvisorState = memento .getChild(IWorkbenchConstants.TAG_ACTION_BAR_ADVISOR); if (actionBarAdvisorState != null) result.add(getActionBarAdvisor() .restoreState(actionBarAdvisorState)); // Read window's bounds and state. Rectangle displayBounds = getShell().getDisplay().getBounds(); Rectangle shellBounds = new Rectangle(0, 0, 0, 0); IMemento fastViewMem = memento .getChild(IWorkbenchConstants.TAG_FAST_VIEW_DATA); if (fastViewMem != null) { if (fastViewBar != null) { fastViewBar.restoreState(fastViewMem); } } Integer bigInt = memento.getInteger(IWorkbenchConstants.TAG_X); shellBounds.x = bigInt == null ? 0 : bigInt.intValue(); bigInt = memento.getInteger(IWorkbenchConstants.TAG_Y); shellBounds.y = bigInt == null ? 0 : bigInt.intValue(); bigInt = memento.getInteger(IWorkbenchConstants.TAG_WIDTH); shellBounds.width = bigInt == null ? 0 : bigInt.intValue(); bigInt = memento.getInteger(IWorkbenchConstants.TAG_HEIGHT); shellBounds.height = bigInt == null ? 0 : bigInt.intValue(); if (!shellBounds.isEmpty()) { if (!shellBounds.intersects(displayBounds)) { Rectangle clientArea = getShell().getDisplay().getClientArea(); shellBounds.x = clientArea.x; shellBounds.y = clientArea.y; } getShell().setBounds(shellBounds); } if ("true".equals(memento.getString(IWorkbenchConstants.TAG_MAXIMIZED))) { //$NON-NLS-1$ getShell().setMaximized(true); } if ("true".equals(memento.getString(IWorkbenchConstants.TAG_MINIMIZED))) { //$NON-NLS-1$ // getShell().setMinimized(true); } // restore the width of the perspective bar if (perspectiveSwitcher != null) perspectiveSwitcher.restoreState(memento); // Restore the cool bar order by creating all the tool bar contribution // items // This needs to be done before pages are created to ensure proper // canonical creation // of cool items if (getCoolBarManager() != null) { CoolBarManager coolBarMgr = getCoolBarManager(); IMemento coolBarMem = memento .getChild(IWorkbenchConstants.TAG_COOLBAR_LAYOUT); if (coolBarMem != null) { // Check if the layout is locked Integer lockedInt = coolBarMem .getInteger(IWorkbenchConstants.TAG_LOCKED); if ((lockedInt != null) && (lockedInt.intValue() == 1)) { coolBarMgr.setLockLayout(true); } else { coolBarMgr.setLockLayout(false); } // The new layout of the cool bar manager ArrayList coolBarLayout = new ArrayList(); // Traverse through all the cool item in the memento IMemento contributionMems[] = coolBarMem .getChildren(IWorkbenchConstants.TAG_COOLITEM); for (int i = 0; i < contributionMems.length; i++) { IMemento contributionMem = contributionMems[i]; String type = contributionMem .getString(IWorkbenchConstants.TAG_ITEM_TYPE); if (type == null) { // Do not recognize that type continue; } String id = contributionMem .getString(IWorkbenchConstants.TAG_ID); // Prevent duplicate items from being read back in. IContributionItem existingItem = coolBarMgr.find(id); if ((id != null) && (existingItem != null)) { if (Policy.DEBUG_TOOLBAR_DISPOSAL) { System.out .println("Not loading duplicate cool bar item: " + id); //$NON-NLS-1$ } coolBarLayout.add(existingItem); continue; } IContributionItem newItem = null; if (type.equals(IWorkbenchConstants.TAG_TYPE_SEPARATOR)) { if (id != null) { newItem = new Separator(id); } else { newItem = new Separator(); } } else if (id != null) { if (type .equals(IWorkbenchConstants.TAG_TYPE_GROUPMARKER)) { newItem = new GroupMarker(id); } else if (type .equals(IWorkbenchConstants.TAG_TYPE_TOOLBARCONTRIBUTION) || type .equals(IWorkbenchConstants.TAG_TYPE_PLACEHOLDER)) { // Get Width and height Integer width = contributionMem .getInteger(IWorkbenchConstants.TAG_ITEM_X); Integer height = contributionMem .getInteger(IWorkbenchConstants.TAG_ITEM_Y); // Look for the object in the current cool bar // manager IContributionItem oldItem = coolBarMgr.find(id); // If a tool bar contribution item already exists // for this id then use the old object if (oldItem != null) { newItem = oldItem; } else { newItem = new ToolBarContributionItem( new ToolBarManager(coolBarMgr .getStyle()), id); if (type .equals(IWorkbenchConstants.TAG_TYPE_PLACEHOLDER)) { ToolBarContributionItem newToolBarItem = (ToolBarContributionItem) newItem; if (height != null) { newToolBarItem.setCurrentHeight(height .intValue()); } if (width != null) { newToolBarItem.setCurrentWidth(width .intValue()); } newItem = new PlaceholderContributionItem( newToolBarItem); } // make it invisible by default newItem.setVisible(false); // Need to add the item to the cool bar manager // so that its canonical order can be preserved IContributionItem refItem = findAlphabeticalOrder( IWorkbenchActionConstants.MB_ADDITIONS, id, coolBarMgr); if (refItem != null) { coolBarMgr.insertAfter(refItem.getId(), newItem); } else { coolBarMgr.add(newItem); } } // Set the current height and width if ((width != null) && (newItem instanceof ToolBarContributionItem)) { ((ToolBarContributionItem) newItem) .setCurrentWidth(width.intValue()); } if ((height != null) && (newItem instanceof ToolBarContributionItem)) { ((ToolBarContributionItem) newItem) .setCurrentHeight(height.intValue()); } } } // Add new item into cool bar manager if (newItem != null) { coolBarLayout.add(newItem); newItem.setParent(coolBarMgr); coolBarMgr.markDirty(); } } // We need to check if we have everything we need in the layout. final ArrayList finalLayout = new ArrayList(); IContributionItem[] existingItems = coolBarMgr.getItems(); for (int i = 0; i < existingItems.length; i++) { IContributionItem existingItem = existingItems[i]; /* * This line shouldn't be necessary, but is here for * robustness. */ if (existingItem == null) { continue; } boolean found = false; Iterator layoutItemItr = coolBarLayout.iterator(); while (layoutItemItr.hasNext()) { IContributionItem layoutItem = (IContributionItem) layoutItemItr .next(); if ((layoutItem != null) && (layoutItem.equals(existingItem))) { found = true; break; } } if (!found) { if (existingItem != null) { finalLayout.add(existingItem); } } } // Set the cool bar layout to the given layout. finalLayout.addAll(coolBarLayout); IContributionItem[] itemsToSet = new IContributionItem[finalLayout .size()]; finalLayout.toArray(itemsToSet); coolBarMgr.setItems(itemsToSet); } else { // For older workbenchs coolBarMem = memento .getChild(IWorkbenchConstants.TAG_TOOLBAR_LAYOUT); if (coolBarMem != null) { // Restore an older layout restoreOldCoolBar(coolBarMem); } } } // Recreate each page in the window. IWorkbenchPage newActivePage = null; IMemento[] pageArray = memento .getChildren(IWorkbenchConstants.TAG_PAGE); for (int i = 0; i < pageArray.length; i++) { IMemento pageMem = pageArray[i]; String strFocus = pageMem.getString(IWorkbenchConstants.TAG_FOCUS); if (strFocus == null || strFocus.length() == 0) continue; // Get the input factory. IAdaptable input = null; IMemento inputMem = pageMem.getChild(IWorkbenchConstants.TAG_INPUT); if (inputMem != null) { String factoryID = inputMem .getString(IWorkbenchConstants.TAG_FACTORY_ID); if (factoryID == null) { WorkbenchPlugin .log("Unable to restore page - no input factory ID."); //$NON-NLS-1$ result.add(unableToRestorePage(pageMem)); continue; } try { UIStats.start(UIStats.RESTORE_WORKBENCH, "WorkbenchPageFactory"); //$NON-NLS-1$ IElementFactory factory = PlatformUI.getWorkbench() .getElementFactory(factoryID); if (factory == null) { WorkbenchPlugin .log("Unable to restore page - cannot instantiate input factory: " + factoryID); //$NON-NLS-1$ result.add(unableToRestorePage(pageMem)); continue; } // Get the input element. input = factory.createElement(inputMem); if (input == null) { WorkbenchPlugin .log("Unable to restore page - cannot instantiate input element: " + factoryID); //$NON-NLS-1$ result.add(unableToRestorePage(pageMem)); continue; } } finally { UIStats.end(UIStats.RESTORE_WORKBENCH, factoryID, "WorkbenchPageFactory"); //$NON-NLS-1$ } } // Open the perspective. WorkbenchPage newPage = null; try { newPage = new WorkbenchPage(this, input); result.add(newPage.restoreState(pageMem, activeDescriptor)); pageList.add(newPage); firePageOpened(newPage); } catch (WorkbenchException e) { WorkbenchPlugin .log( "Unable to restore perspective - constructor failed.", e); //$NON-NLS-1$ result.add(e.getStatus()); continue; } if (strFocus != null && strFocus.length() > 0) newActivePage = newPage; } // If there are no pages create a default. if (pageList.isEmpty()) { try { String defPerspID = getWorkbenchImpl().getPerspectiveRegistry() .getDefaultPerspective(); if (defPerspID != null) { WorkbenchPage newPage = new WorkbenchPage(this, defPerspID, getDefaultPageInput()); pageList.add(newPage); firePageOpened(newPage); } } catch (WorkbenchException e) { WorkbenchPlugin .log( "Unable to create default perspective - constructor failed.", e); //$NON-NLS-1$ result.add(e.getStatus()); String productName = WorkbenchPlugin.getDefault() .getProductName(); if (productName == null) { productName = ""; //$NON-NLS-1$ } getShell().setText(productName); } } // Set active page. if (newActivePage == null) newActivePage = pageList.getNextActive(); setActivePage(newActivePage); IMemento introMem = memento.getChild(IWorkbenchConstants.TAG_INTRO); if (introMem != null) { getWorkbench() .getIntroManager() .showIntro( this, Boolean .valueOf( introMem .getString(IWorkbenchConstants.TAG_STANDBY)) .booleanValue()); } result.add(restoreTrimState(memento .getChild(IWorkbenchConstants.TAG_TRIM))); return result; }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/54532dbf350a8597a32c3325d699ca741a40ef83/WorkbenchWindow.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/WorkbenchWindow.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 5217, 1119, 12, 3445, 820, 83, 312, 820, 83, 16, 1082, 202, 2579, 414, 16772, 3187, 2695, 3187, 13, 288, 202, 202, 8213, 18, 291, 5962, 12, 588, 13220, 10663, 202, 202, 5002, 1482, 563, 273, 394, 5991, 1482, 12, 8201, 5370, 18, 19415, 67, 734, 16, 467, 1482, 18, 3141, 16, 9506, 202, 2421, 22144, 5058, 18, 2421, 22144, 3829, 67, 29812, 5188, 6053, 3829, 16, 446, 1769, 202, 202, 759, 11197, 326, 2742, 1261, 10227, 919, 18, 202, 202, 3445, 820, 83, 2742, 28087, 1119, 273, 312, 820, 83, 9506, 202, 18, 588, 1763, 12, 45, 2421, 22144, 2918, 18, 7927, 67, 10566, 38, 1157, 1792, 67, 23407, 67, 1880, 26780, 916, 1769, 202, 202, 430, 261, 5668, 28087, 1119, 480, 446, 13, 1082, 202, 2088, 18, 1289, 12, 588, 3829, 28087, 7675, 13991, 1119, 12, 5668, 28087, 1119, 10019, 202, 202, 759, 11197, 1301, 3215, 1261, 10227, 919, 18, 202, 202, 3445, 820, 83, 1301, 5190, 28087, 1119, 273, 312, 820, 83, 9506, 202, 18, 588, 1763, 12, 45, 2421, 22144, 2918, 18, 7927, 67, 12249, 67, 21908, 67, 1880, 26780, 916, 1769, 202, 202, 430, 261, 1128, 5190, 28087, 1119, 480, 446, 13, 1082, 202, 2088, 18, 1289, 12, 588, 1803, 5190, 28087, 1435, 6862, 202, 18, 13991, 1119, 12, 1128, 5190, 28087, 1119, 10019, 202, 202, 759, 2720, 2742, 1807, 4972, 471, 919, 18, 202, 202, 19463, 2562, 5694, 273, 7932, 1165, 7675, 588, 4236, 7675, 588, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 467, 1482, 5217, 1119, 12, 3445, 820, 83, 312, 820, 83, 16, 1082, 202, 2579, 414, 16772, 3187, 2695, 3187, 13, 288, 202, 202, 8213, 18, 291, 5962, 12, 588, 13220, 10663, 202, 202, 5002, 1482, 563, 273, 394, 5991, 1482, 12, 8201, 5370, 18, 19415, 67, 734, 16, 467, 1482, 18, 3141, 16, 9506, 202, 2421, 22144, 5058, 18, 2421, 22144, 3829, 67, 29812, 5188, 6053, 3829, 16, 446, 1769, 202, 202, 759, 11197, 326, 2742, 1261, 10227, 919, 18, 202, 202, 3445, 820, 83, 2742, 28087, 1119, 273, 312, 820, 83, 9506, 202, 18, 588, 1763, 12, 45, 2421, 22144, 2918, 18, 7927, 67, 10566, 38, 1157, 1792, 67, 23407, 67, 1880, 26780, 916, 2 ]
int i; values = new byte[UNICODECOUNT]; indices = new char[INDEXCOUNT]; hashes = new int[INDEXCOUNT]; for (i = 0; i < UNICODECOUNT; ++i) { values[i] = defaultValue; } for (i = 0; i < INDEXCOUNT; ++i) { indices[i] = (char)(i<<BLOCKSHIFT); hashes[i] = 0; } isCompact = false;
this((byte)0);
public CompactByteArray(byte defaultValue) { int i; values = new byte[UNICODECOUNT]; indices = new char[INDEXCOUNT]; hashes = new int[INDEXCOUNT]; for (i = 0; i < UNICODECOUNT; ++i) { values[i] = defaultValue; } for (i = 0; i < INDEXCOUNT; ++i) { indices[i] = (char)(i<<BLOCKSHIFT); hashes[i] = 0; } isCompact = false; }
5620 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5620/07b76ae6a3a7d748b531bd4495276f4e8a7e8284/CompactByteArray.java/buggy/icu4j/src/com/ibm/icu/util/CompactByteArray.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 23823, 8826, 12, 7229, 4593, 13, 565, 288, 3639, 509, 277, 31, 3639, 924, 273, 394, 1160, 63, 26642, 7240, 15533, 3639, 4295, 273, 394, 1149, 63, 9199, 7240, 15533, 3639, 9869, 273, 394, 509, 63, 9199, 7240, 15533, 3639, 364, 261, 77, 273, 374, 31, 277, 411, 5019, 19334, 7240, 31, 965, 77, 13, 288, 5411, 924, 63, 77, 65, 273, 4593, 31, 3639, 289, 3639, 364, 261, 77, 273, 374, 31, 277, 411, 12425, 7240, 31, 965, 77, 13, 288, 5411, 4295, 63, 77, 65, 273, 261, 3001, 21433, 77, 17685, 11403, 23191, 1769, 5411, 9869, 63, 77, 65, 273, 374, 31, 3639, 289, 3639, 353, 16863, 273, 629, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 23823, 8826, 12, 7229, 4593, 13, 565, 288, 3639, 509, 277, 31, 3639, 924, 273, 394, 1160, 63, 26642, 7240, 15533, 3639, 4295, 273, 394, 1149, 63, 9199, 7240, 15533, 3639, 9869, 273, 394, 509, 63, 9199, 7240, 15533, 3639, 364, 261, 77, 273, 374, 31, 277, 411, 5019, 19334, 7240, 31, 965, 77, 13, 288, 5411, 924, 63, 77, 65, 273, 4593, 31, 3639, 289, 3639, 364, 261, 77, 273, 374, 31, 277, 411, 12425, 7240, 31, 965, 77, 13, 288, 5411, 4295, 63, 77, 65, 273, 261, 3001, 21433, 77, 17685, 11403, 23191, 1769, 5411, 9869, 63, 77, 65, 273, 374, 31, 3639, 289, 3639, 353, 16863, 273, 629, 31, 565, 289, 2, -100, -100, -100 ]
Bundle[] myBundles = myItem.getBundles();
Bundle[] myBundles = myItem.getBundles("ORIGINAL"); boolean done = false;
public static void filterItem(Context c, Item myItem) throws Exception { // get 'original' bundles Bundle[] myBundles = myItem.getBundles(); for (int i = 0; i < myBundles.length; i++) { // could have multiple 'ORIGINAL' bundles (hmm, probably not) if ("ORIGINAL".equals(myBundles[i].getName())) { // now look at all of the bitstreams Bitstream[] myBitstreams = myBundles[i].getBitstreams(); for (int k = 0; k < myBitstreams.length; k++) { filterBitstream(c, myItem, myBitstreams[k]); } } } }
51882 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51882/023d79e6144ffc2d11960ed6775770e4300da5e6/MediaFilterManager.java/clean/dspace/src/org/dspace/app/mediafilter/MediaFilterManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1034, 1180, 12, 1042, 276, 16, 4342, 3399, 1180, 13, 1216, 1185, 565, 288, 3639, 368, 336, 296, 8830, 11, 11408, 3639, 8539, 8526, 3399, 16151, 273, 3399, 1180, 18, 588, 16151, 2932, 24685, 1013, 8863, 1250, 2731, 273, 629, 31, 4202, 364, 261, 474, 277, 273, 374, 31, 277, 411, 3399, 16151, 18, 2469, 31, 277, 27245, 3639, 288, 5411, 368, 3377, 1240, 3229, 296, 24685, 1013, 11, 11408, 261, 76, 7020, 16, 8656, 486, 13, 5411, 309, 7566, 24685, 1013, 9654, 14963, 12, 4811, 16151, 63, 77, 8009, 17994, 1435, 3719, 5411, 288, 7734, 368, 2037, 2324, 622, 777, 434, 326, 2831, 16320, 7734, 6539, 3256, 8526, 3399, 5775, 16320, 273, 3399, 16151, 63, 77, 8009, 588, 5775, 16320, 5621, 7734, 364, 261, 474, 417, 273, 374, 31, 417, 411, 3399, 5775, 16320, 18, 2469, 31, 417, 27245, 7734, 288, 10792, 1034, 5775, 3256, 12, 71, 16, 3399, 1180, 16, 3399, 5775, 16320, 63, 79, 19226, 7734, 289, 5411, 289, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1034, 1180, 12, 1042, 276, 16, 4342, 3399, 1180, 13, 1216, 1185, 565, 288, 3639, 368, 336, 296, 8830, 11, 11408, 3639, 8539, 8526, 3399, 16151, 273, 3399, 1180, 18, 588, 16151, 2932, 24685, 1013, 8863, 1250, 2731, 273, 629, 31, 4202, 364, 261, 474, 277, 273, 374, 31, 277, 411, 3399, 16151, 18, 2469, 31, 277, 27245, 3639, 288, 5411, 368, 3377, 1240, 3229, 296, 24685, 1013, 11, 11408, 261, 76, 7020, 16, 8656, 486, 13, 5411, 309, 7566, 24685, 1013, 9654, 14963, 12, 4811, 16151, 63, 77, 8009, 17994, 1435, 3719, 5411, 288, 7734, 368, 2037, 2324, 622, 777, 434, 326, 2831, 16320, 7734, 6539, 3256, 8526, 3399, 5775, 16320, 273, 3399, 16151, 2 ]
String tempDurable = (String) endpoint.getProperties().get("durable");
String tempDurable = (String) endpoint.getProperties().get(JmsConstants.DURABLE_PROPERTY);
protected void createConsumer() throws Exception { try { JmsSupport jmsSupport = this.connector.getJmsSupport(); // Create session if none exists if (session == null) { session = this.connector.getSession(endpoint); } // Create destination String resourceInfo = endpoint.getEndpointURI().getResourceInfo(); boolean topic = (resourceInfo != null && "topic".equalsIgnoreCase(resourceInfo)); //todo MULE20 remove resource Info support if(!topic) { topic = PropertiesHelper.getBooleanProperty(endpoint.getProperties(), "topic", false); } Destination dest = jmsSupport.createDestination(session, endpoint.getEndpointURI().getAddress(), topic); // Extract jms selector String selector = null; if (endpoint.getFilter() != null && endpoint.getFilter() instanceof JmsSelectorFilter) { selector = ((JmsSelectorFilter) endpoint.getFilter()).getExpression(); } else if (endpoint.getProperties() != null) { // still allow the selector to be set as a property on the endpoint // to be backward compatable selector = (String) endpoint.getProperties().get(JmsConstants.JMS_SELECTOR_PROPERTY); } String tempDurable = (String) endpoint.getProperties().get("durable"); boolean durable = connector.isDurable(); if (tempDurable != null) { durable = Boolean.valueOf(tempDurable).booleanValue(); } // Get the durable subscriber name if there is one String durableName = (String) endpoint.getProperties().get("durableName"); if (durableName == null && durable && dest instanceof Topic) { durableName = "mule." + connector.getName() + "." + endpoint.getEndpointURI().getAddress(); logger.debug("Jms Connector for this receiver is durable but no durable name has been specified. Defaulting to: " + durableName); } // Create consumer consumer = jmsSupport.createConsumer(session, dest, selector, connector.isNoLocal(), durableName); } catch (JMSException e) { throw new ConnectException(e, this); } }
2370 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2370/339ccc674e5ed4f0231505d3797c538a38c6fbd3/SingleJmsMessageReceiver.java/clean/providers/jms/src/java/org/mule/providers/jms/SingleJmsMessageReceiver.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 752, 5869, 1435, 1216, 1185, 565, 288, 377, 202, 698, 288, 202, 3639, 19870, 6289, 23007, 6289, 273, 333, 18, 23159, 18, 588, 23058, 6289, 5621, 202, 3639, 368, 1788, 1339, 309, 6555, 1704, 202, 3639, 309, 261, 3184, 422, 446, 13, 288, 202, 377, 202, 202, 3184, 273, 333, 18, 23159, 18, 588, 2157, 12, 8003, 1769, 202, 3639, 289, 202, 3639, 368, 1788, 2929, 202, 3639, 514, 1058, 966, 273, 2494, 18, 588, 3293, 3098, 7675, 588, 1420, 966, 5621, 202, 3639, 1250, 3958, 273, 261, 3146, 966, 480, 446, 597, 315, 10476, 9654, 14963, 5556, 12, 3146, 966, 10019, 5411, 368, 9012, 490, 5595, 3462, 1206, 1058, 3807, 2865, 5411, 309, 12, 5, 10476, 13, 288, 7734, 3958, 273, 6183, 2276, 18, 588, 5507, 1396, 12, 8003, 18, 588, 2297, 9334, 315, 10476, 3113, 629, 1769, 5411, 289, 202, 3639, 10691, 1570, 273, 23007, 6289, 18, 2640, 5683, 12, 3184, 16, 2494, 18, 588, 3293, 3098, 7675, 588, 1887, 9334, 3958, 1769, 202, 3639, 368, 8152, 23007, 3451, 202, 3639, 514, 3451, 273, 446, 31, 202, 3639, 309, 261, 8003, 18, 588, 1586, 1435, 480, 446, 597, 2494, 18, 588, 1586, 1435, 1276, 19870, 4320, 1586, 13, 288, 202, 5411, 3451, 273, 14015, 23058, 4320, 1586, 13, 2494, 18, 588, 1586, 1435, 2934, 588, 2300, 5621, 202, 3639, 289, 469, 309, 261, 8003, 18, 588, 2297, 1435, 480, 446, 13, 288, 202, 5411, 368, 4859, 1699, 326, 3451, 358, 506, 444, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 752, 5869, 1435, 1216, 1185, 565, 288, 377, 202, 698, 288, 202, 3639, 19870, 6289, 23007, 6289, 273, 333, 18, 23159, 18, 588, 23058, 6289, 5621, 202, 3639, 368, 1788, 1339, 309, 6555, 1704, 202, 3639, 309, 261, 3184, 422, 446, 13, 288, 202, 377, 202, 202, 3184, 273, 333, 18, 23159, 18, 588, 2157, 12, 8003, 1769, 202, 3639, 289, 202, 3639, 368, 1788, 2929, 202, 3639, 514, 1058, 966, 273, 2494, 18, 588, 3293, 3098, 7675, 588, 1420, 966, 5621, 202, 3639, 1250, 3958, 273, 261, 3146, 966, 480, 446, 597, 315, 10476, 9654, 14963, 5556, 12, 3146, 966, 10019, 5411, 368, 9012, 490, 5595, 3462, 1206, 1058, 3807, 2865, 5411, 309, 12, 5, 2 ]
return getActionName();
return getActionName() + " " + scopeName;
protected String getRealTitle() { return getActionName(); }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/6ad8a6da7e7e7d756d7c30d37d8cc6eb2b872389/ActionInfo.java/clean/source/com/intellij/openapi/vcs/update/ActionInfo.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 514, 12361, 4247, 1435, 288, 1850, 327, 12473, 461, 1435, 397, 315, 315, 397, 2146, 461, 31, 3639, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 514, 12361, 4247, 1435, 288, 1850, 327, 12473, 461, 1435, 397, 315, 315, 397, 2146, 461, 31, 3639, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
wrap(new String[] {
fold(new String[] {
public void testPeriodsToDate() { assertSetExprDependsOn("PeriodsToDate()", "{[Time]}"); assertSetExprDependsOn("PeriodsToDate([Time].[Year])", "{[Time]}"); assertSetExprDependsOn("PeriodsToDate([Time].[Year], [Time].[1997].[Q2].[5])", "{}"); assertAxisThrows( "PeriodsToDate([Product].[Product Family])", "Argument to function 'PeriodsToDate' must belong to Time hierarchy."); // two args assertAxisReturns( "PeriodsToDate([Time].[Quarter], [Time].[1997].[Q2].[5])", wrap(new String[] { "[Time].[1997].[Q2].[4]", "[Time].[1997].[Q2].[5]"})); // equivalent to above assertAxisReturns( "TopCount(" + " Descendants(" + " Ancestor(" + " [Time].[1997].[Q2].[5], [Time].[Quarter])," + " [Time].[1997].[Q2].[5].Level)," + " 1).Item(0) : [Time].[1997].[Q2].[5]", wrap(new String[] { "[Time].[1997].[Q2].[4]", "[Time].[1997].[Q2].[5]"})); // one arg assertQueryReturns( wrap(new String[] { "with member [Measures].[Foo] as ' SetToStr(PeriodsToDate([Time].[Quarter])) '", "select {[Measures].[Foo]} on columns", "from [Sales]", "where [Time].[1997].[Q2].[5]"}), wrap(new String[] { "Axis #0:", "{[Time].[1997].[Q2].[5]}", "Axis #1:", "{[Measures].[Foo]}", "Row #0: {[Time].[1997].[Q2].[4], [Time].[1997].[Q2].[5]}" + nl})); // zero args assertQueryReturns( wrap(new String[] { "with member [Measures].[Foo] as ' SetToStr(PeriodsToDate()) '", "select {[Measures].[Foo]} on columns", "from [Sales]", "where [Time].[1997].[Q2].[5]"}), wrap(new String[] { "Axis #0:", "{[Time].[1997].[Q2].[5]}", "Axis #1:", "{[Measures].[Foo]}", "Row #0: {[Time].[1997].[Q2].[4], [Time].[1997].[Q2].[5]}" + nl})); // zero args, evaluated at a member which is at the top level. // The default level is the level above the current member -- so // choosing a member at the highest level might trip up the // implementation. assertQueryReturns( wrap(new String[] { "with member [Measures].[Foo] as ' SetToStr(PeriodsToDate()) '", "select {[Measures].[Foo]} on columns", "from [Sales]", "where [Time].[1997]"}), wrap(new String[] { "Axis #0:", "{[Time].[1997]}", "Axis #1:", "{[Measures].[Foo]}", "Row #0: {}" + nl})); }
51263 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51263/bb703add381acf854e2d5aed1045911b7ab143b4/FunctionTest.java/clean/testsrc/main/mondrian/olap/fun/FunctionTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 5027, 11634, 1626, 1435, 288, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 1435, 3113, 4144, 63, 950, 20817, 1769, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 3816, 950, 8009, 63, 5593, 65, 2225, 16, 4144, 63, 950, 20817, 1769, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 3816, 950, 8009, 63, 5593, 6487, 306, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 25, 65, 2225, 16, 13034, 1769, 3639, 1815, 6558, 21845, 12, 7734, 315, 5027, 11634, 1626, 3816, 4133, 8009, 63, 4133, 19343, 65, 2225, 16, 7734, 315, 1379, 358, 445, 296, 5027, 11634, 1626, 11, 1297, 10957, 358, 2647, 9360, 1199, 1769, 3639, 368, 2795, 833, 3639, 1815, 6558, 1356, 12, 7734, 315, 5027, 11634, 1626, 3816, 950, 8009, 63, 928, 14153, 6487, 306, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 25, 65, 2225, 16, 7734, 11590, 12, 2704, 514, 8526, 288, 10792, 5158, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 24, 65, 3113, 10792, 5158, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 25, 4279, 6792, 1769, 3639, 368, 7680, 358, 5721, 3639, 1815, 6558, 1356, 12, 7734, 315, 3401, 1380, 2932, 397, 7734, 315, 225, 13913, 409, 4388, 2932, 397, 7734, 315, 565, 1922, 7248, 2932, 397, 7734, 315, 1377, 306, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 25, 6487, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 5027, 11634, 1626, 1435, 288, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 1435, 3113, 4144, 63, 950, 20817, 1769, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 3816, 950, 8009, 63, 5593, 65, 2225, 16, 4144, 63, 950, 20817, 1769, 3639, 1815, 694, 4742, 4584, 87, 1398, 2932, 5027, 11634, 1626, 3816, 950, 8009, 63, 5593, 6487, 306, 950, 8009, 63, 19818, 27, 8009, 63, 53, 22, 8009, 63, 25, 65, 2225, 16, 13034, 1769, 3639, 1815, 6558, 21845, 12, 7734, 315, 5027, 11634, 1626, 3816, 4133, 8009, 63, 4133, 19343, 65, 2225, 16, 7734, 315, 1379, 358, 445, 296, 5027, 11634, 1626, 11, 1297, 10957, 358, 2647, 2 ]
eaxListenerProperties = ByteBuffer.allocateDirect(EAXLISTENERPROPERTIES_SIZE); eaxListenerProperties.order(ByteOrder.nativeOrder()); }
eaxListenerProperties = ByteBuffer.allocateDirect(EAXLISTENERPROPERTIES_SIZE); eaxListenerProperties.order(ByteOrder.nativeOrder()); }
public EAXListenerProperties() { eaxListenerProperties = ByteBuffer.allocateDirect(EAXLISTENERPROPERTIES_SIZE); eaxListenerProperties.order(ByteOrder.nativeOrder()); }
5076 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5076/491133c7f15123821cd748396341e20a0e1c46d4/EAXListenerProperties.java/buggy/src/java/org/lwjgl/openal/eax/EAXListenerProperties.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 512, 2501, 2223, 2297, 1435, 288, 1377, 425, 651, 2223, 2297, 273, 7400, 18, 16247, 5368, 12, 41, 2501, 26421, 17421, 67, 4574, 1769, 1377, 425, 651, 2223, 2297, 18, 1019, 12, 3216, 2448, 18, 13635, 2448, 10663, 1850, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 512, 2501, 2223, 2297, 1435, 288, 1377, 425, 651, 2223, 2297, 273, 7400, 18, 16247, 5368, 12, 41, 2501, 26421, 17421, 67, 4574, 1769, 1377, 425, 651, 2223, 2297, 18, 1019, 12, 3216, 2448, 18, 13635, 2448, 10663, 1850, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
for (int i = start.intValue(); i < maxRow; i++) { ArticleListBean a = new ArticleListBean(String.valueOf(i), testHeadlines[i], testPublished[i], testAuthors[i], testStatus[i]); if (i == 5) { a.setTestStyle("color:red"); } _dataModel.set(a, i);
catch (IOException e) { e.printStackTrace();
public void updateDataModel(Integer start, Integer rows) { if (_dataModel == null) { _dataModel = new WFDataModel(); } int availableRows = testHeadlines.length; int nrOfRows = rows.intValue(); if (nrOfRows == 0) { nrOfRows = availableRows; } int maxRow = start.intValue() + nrOfRows; if (maxRow > availableRows) { maxRow = availableRows; } for (int i = start.intValue(); i < maxRow; i++) { ArticleListBean a = new ArticleListBean(String.valueOf(i), testHeadlines[i], testPublished[i], testAuthors[i], testStatus[i]); if (i == 5) { // set test style red a.setTestStyle("color:red"); } _dataModel.set(a, i); } _dataModel.setRowCount(availableRows); }
57000 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57000/2cd921b37179b60f73b08e496f3539f6703ee5c0/ArticleListBean.java/clean/src/java/com/idega/block/article/bean/ArticleListBean.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1089, 26349, 12, 4522, 787, 16, 2144, 2595, 13, 288, 202, 202, 430, 261, 67, 892, 1488, 422, 446, 13, 288, 1082, 202, 67, 892, 1488, 273, 394, 678, 42, 26349, 5621, 202, 202, 97, 202, 202, 474, 2319, 4300, 273, 1842, 1414, 3548, 18, 2469, 31, 202, 202, 474, 9884, 951, 4300, 273, 2595, 18, 474, 620, 5621, 202, 202, 430, 261, 11611, 951, 4300, 422, 374, 13, 288, 1082, 202, 11611, 951, 4300, 273, 2319, 4300, 31, 202, 202, 97, 202, 202, 474, 943, 1999, 273, 787, 18, 474, 620, 1435, 397, 9884, 951, 4300, 31, 202, 202, 430, 261, 1896, 1999, 405, 2319, 4300, 13, 288, 1082, 202, 1896, 1999, 273, 2319, 4300, 31, 202, 202, 97, 202, 202, 1884, 261, 474, 277, 273, 787, 18, 474, 620, 5621, 277, 411, 943, 1999, 31, 277, 27245, 288, 1082, 202, 7880, 682, 3381, 279, 273, 394, 17889, 682, 3381, 12, 780, 18, 1132, 951, 12, 77, 3631, 1842, 1414, 3548, 63, 77, 6487, 1842, 16451, 63, 77, 6487, 1842, 1730, 1383, 63, 77, 6487, 1842, 1482, 63, 77, 19226, 1082, 202, 430, 261, 77, 422, 1381, 13, 288, 9506, 202, 759, 444, 1842, 2154, 1755, 9506, 202, 69, 18, 542, 4709, 2885, 2932, 3266, 30, 1118, 8863, 1082, 202, 97, 1082, 202, 67, 892, 1488, 18, 542, 12, 69, 16, 277, 1769, 202, 202, 97, 202, 202, 67, 892, 1488, 18, 542, 26359, 12, 5699, 4300, 1769, 202, 97, 2, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1089, 26349, 12, 4522, 787, 16, 2144, 2595, 13, 288, 202, 202, 430, 261, 67, 892, 1488, 422, 446, 13, 288, 1082, 202, 67, 892, 1488, 273, 394, 678, 42, 26349, 5621, 202, 202, 97, 202, 202, 474, 2319, 4300, 273, 1842, 1414, 3548, 18, 2469, 31, 202, 202, 474, 9884, 951, 4300, 273, 2595, 18, 474, 620, 5621, 202, 202, 430, 261, 11611, 951, 4300, 422, 374, 13, 288, 1082, 202, 11611, 951, 4300, 273, 2319, 4300, 31, 202, 202, 97, 202, 202, 474, 943, 1999, 273, 787, 18, 474, 620, 1435, 397, 9884, 951, 4300, 31, 202, 202, 430, 261, 1896, 1999, 405, 2319, 4300, 13, 288, 1082, 202, 1896, 1999, 273, 2319, 2 ]
tf.setAttributeValues (attributeKey, "" + c.getDisplayValue(node));
tf.setAttributeValues (attributeKey, "" + c.getDisplayValue());
public ActionForward execute(ComponentContext context, ActionMapping mapping, ActionForm form, HttpServletRequest request, HttpServletResponse response) throws Exception { HttpSession session = request.getSession(); ServletContext servletContext = session.getServletContext(); Profile profile = (Profile) session.getAttribute(Constants.PROFILE); ObjectStore os = (ObjectStore) servletContext.getAttribute(Constants.OBJECTSTORE); ObjectStoreSummary oss = (ObjectStoreSummary) servletContext. getAttribute(Constants.OBJECT_STORE_SUMMARY); TemplateForm tf = (TemplateForm) form; TemplateQuery template = null; String queryName = request.getParameter("name"); String type = request.getParameter("type"); boolean populate = true; if (queryName == null) { queryName = request.getParameter("templateName"); } // look for request attribute "previewTemplate" which is set while building a template template = (TemplateQuery) request.getAttribute("previewTemplate"); if (context.getAttribute("builder") != null) { PathQuery query = (PathQuery) session.getAttribute(Constants.QUERY); PathQuery queryClone = (PathQuery) query.clone(); TemplateBuildState tbs = (TemplateBuildState) session.getAttribute(Constants.TEMPLATE_BUILD_STATE); template = TemplateHelper.buildTemplateQuery(tbs, query); request.setAttribute("previewTemplate", template); } if (queryName == null && template != null) { queryName = template.getName(); } else { if (type == null) { type = TemplateHelper.GLOBAL_TEMPLATE; } template = TemplateHelper.findTemplate(session, queryName, type); } if (template == null) { return null; } Map displayConstraints = new HashMap(); Map names = new HashMap(); Map constraints = new HashMap(); int j = 0; // For each node with an editable constraint, create a DisplayConstraint bean // and the human-readable "name" for each node (Department.company.name -> "Company namae") for (Iterator i = template.getNodes().iterator(); i.hasNext();) { PathNode node = (PathNode) i.next(); for (Iterator ci = template.getConstraints(node).iterator(); ci.hasNext();) { Constraint c = (Constraint) ci.next(); displayConstraints.put(c, new DisplayConstraint(node, os.getModel(), oss)); PathNode parent = (PathNode) template.getQuery().getNodes(). get(node.getPath().substring(0, node.getPath().lastIndexOf("."))); names.put(c, parent.getType() + " " + node.getPath().substring(node.getPath().lastIndexOf(".") + 1)); if (populate) { String attributeKey = "" + (j + 1); tf.setAttributeValues (attributeKey, "" + c.getDisplayValue(node)); tf.setAttributeOps(attributeKey, "" + c.getOp().getIndex()); if (c.getIdentifier() != null) { // If special request parameter key is present then we initialise // the form bean with the parameter value String paramName = c.getIdentifier() + "_value"; String constraintValue = request.getParameter(paramName); if (constraintValue != null) { tf.setAttributeValues(attributeKey, constraintValue); } } } j++; } constraints.put(node, template.getConstraints(node)); } tf.setTemplateName(queryName); tf.setTemplateType(type); request.setAttribute("templateQuery", template); request.setAttribute("names", names); request.setAttribute("constraints", constraints); request.setAttribute("displayConstraints", displayConstraints); if (profile.getSavedBags().size() > 0) { request.setAttribute("bagOps", MainHelper.mapOps(BagConstraint.VALID_OPS)); } return null; }
7196 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7196/fc91f69f7534eb56f4cee0bbeeca7bf5bd63437c/TemplateController.java/buggy/intermine/web/main/src/org/intermine/web/TemplateController.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 4382, 8514, 1836, 12, 1841, 1042, 819, 16, 4766, 4382, 3233, 2874, 16, 4766, 4382, 1204, 646, 16, 4766, 9984, 590, 16, 4766, 12446, 766, 13, 3639, 1216, 1185, 288, 3639, 26166, 1339, 273, 590, 18, 588, 2157, 5621, 3639, 22717, 20474, 273, 1339, 18, 588, 4745, 1042, 5621, 3639, 11357, 3042, 273, 261, 4029, 13, 1339, 18, 588, 1499, 12, 2918, 18, 22462, 1769, 3639, 1033, 2257, 1140, 273, 261, 921, 2257, 13, 20474, 18, 588, 1499, 12, 2918, 18, 9422, 13651, 1769, 3639, 1033, 2257, 4733, 320, 1049, 273, 261, 921, 2257, 4733, 13, 20474, 18, 4766, 9079, 4061, 12, 2918, 18, 9422, 67, 13651, 67, 14020, 11293, 1769, 3639, 5035, 1204, 3253, 273, 261, 2283, 1204, 13, 646, 31, 3639, 5035, 1138, 1542, 273, 446, 31, 3639, 514, 843, 461, 273, 590, 18, 588, 1662, 2932, 529, 8863, 3639, 514, 618, 273, 590, 18, 588, 1662, 2932, 723, 8863, 3639, 1250, 6490, 273, 638, 31, 7734, 309, 261, 2271, 461, 422, 446, 13, 288, 5411, 843, 461, 273, 590, 18, 588, 1662, 2932, 3202, 461, 8863, 3639, 289, 7734, 368, 2324, 364, 590, 1566, 315, 12102, 2283, 6, 1492, 353, 444, 1323, 10504, 279, 1542, 3639, 1542, 273, 261, 2283, 1138, 13, 590, 18, 588, 1499, 2932, 12102, 2283, 8863, 7734, 309, 261, 2472, 18, 588, 1499, 2932, 9574, 7923, 480, 446, 13, 288, 5411, 2666, 1138, 843, 273, 261, 743, 1138, 13, 1339, 18, 588, 1499, 12, 2918, 18, 10753, 1769, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 4382, 8514, 1836, 12, 1841, 1042, 819, 16, 4766, 4382, 3233, 2874, 16, 4766, 4382, 1204, 646, 16, 4766, 9984, 590, 16, 4766, 12446, 766, 13, 3639, 1216, 1185, 288, 3639, 26166, 1339, 273, 590, 18, 588, 2157, 5621, 3639, 22717, 20474, 273, 1339, 18, 588, 4745, 1042, 5621, 3639, 11357, 3042, 273, 261, 4029, 13, 1339, 18, 588, 1499, 12, 2918, 18, 22462, 1769, 3639, 1033, 2257, 1140, 273, 261, 921, 2257, 13, 20474, 18, 588, 1499, 12, 2918, 18, 9422, 13651, 1769, 3639, 1033, 2257, 4733, 320, 1049, 273, 261, 921, 2257, 4733, 13, 20474, 18, 4766, 9079, 4061, 12, 2918, 18, 9422, 67, 13651, 67, 14020, 11293, 1769, 3639, 5035, 1204, 3253, 273, 261, 2 ]
public void setAncestor(BugzillaReport newAncestor) {
public void setAncestor(RepositoryReport newAncestor) {
public void setAncestor(BugzillaReport newAncestor) { threeWay = (newAncestor != null); BugzillaCompareStructureCreator structureCreator = new BugzillaCompareStructureCreator(); ancestor = structureCreator.getStructure(newAncestor); }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/301e7fdca7d49939faf98d0931834c70f7220b4f/BugzillaCompareInput.java/clean/org.eclipse.mylyn.bugzilla.ui/src/org/eclipse/mylyn/internal/bugzilla/ui/BugzillaCompareInput.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 444, 15637, 12, 19865, 15990, 4820, 394, 15637, 13, 288, 202, 202, 451, 992, 21831, 273, 261, 2704, 15637, 480, 446, 1769, 202, 202, 19865, 15990, 8583, 6999, 10636, 3695, 10636, 273, 394, 16907, 15990, 8583, 6999, 10636, 5621, 202, 202, 28798, 273, 3695, 10636, 18, 588, 6999, 12, 2704, 15637, 1769, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 444, 15637, 12, 19865, 15990, 4820, 394, 15637, 13, 288, 202, 202, 451, 992, 21831, 273, 261, 2704, 15637, 480, 446, 1769, 202, 202, 19865, 15990, 8583, 6999, 10636, 3695, 10636, 273, 394, 16907, 15990, 8583, 6999, 10636, 5621, 202, 202, 28798, 273, 3695, 10636, 18, 588, 6999, 12, 2704, 15637, 1769, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
final ISourcePosition position = ruby.getPosition();
final ISourcePosition position = runtime.getPosition();
public static IRubyObject[] setupArgs(Ruby ruby, EvaluateVisitor visitor, INode node) { if (node == null) { return new IRubyObject[0]; } final ISourcePosition position = ruby.getPosition(); if (node instanceof ArrayNode) { final int size = ((ArrayNode) node).size(); final ArrayList list = new ArrayList(size); final Iterator iterator = ((ArrayNode) node).iterator(); for (int i = 0; i < size; i++) { final INode next = (INode) iterator.next(); if (next instanceof ExpandArrayNode) { list.addAll(((RubyArray) visitor.eval(next)).getList()); } else { list.add(visitor.eval(next)); } } ruby.setPosition(position); return (IRubyObject[]) list.toArray(new IRubyObject[list.size()]); } IRubyObject args = visitor.eval(node); ruby.setPosition(position); if (args instanceof RubyArray) { return ((RubyArray) args).toJavaArray(); } else { return new IRubyObject[] { args }; } }
50993 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50993/aa3fe2195e86c2c426f4012089ef8c66a66e925c/ArgsUtil.java/buggy/org/jruby/ast/util/ArgsUtil.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 15908, 10340, 921, 8526, 3875, 2615, 12, 54, 10340, 22155, 16, 18176, 7413, 8000, 16, 21176, 756, 13, 288, 3639, 309, 261, 2159, 422, 446, 13, 288, 5411, 327, 394, 15908, 10340, 921, 63, 20, 15533, 3639, 289, 3639, 727, 467, 1830, 2555, 1754, 273, 3099, 18, 588, 2555, 5621, 3639, 309, 261, 2159, 1276, 1510, 907, 13, 288, 5411, 727, 509, 963, 273, 14015, 1076, 907, 13, 756, 2934, 1467, 5621, 5411, 727, 2407, 666, 273, 394, 2407, 12, 1467, 1769, 5411, 727, 4498, 2775, 273, 14015, 1076, 907, 13, 756, 2934, 9838, 5621, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 411, 963, 31, 277, 27245, 288, 7734, 727, 21176, 1024, 273, 261, 23184, 13, 2775, 18, 4285, 5621, 7734, 309, 261, 4285, 1276, 16429, 1076, 907, 13, 288, 10792, 666, 18, 1289, 1595, 12443, 12, 54, 10340, 1076, 13, 8000, 18, 8622, 12, 4285, 13, 2934, 588, 682, 10663, 7734, 289, 469, 288, 10792, 666, 18, 1289, 12, 3516, 1811, 18, 8622, 12, 4285, 10019, 7734, 289, 5411, 289, 5411, 22155, 18, 542, 2555, 12, 3276, 1769, 5411, 327, 261, 7937, 10340, 921, 63, 5717, 666, 18, 31447, 12, 2704, 15908, 10340, 921, 63, 1098, 18, 1467, 1435, 19226, 3639, 289, 3639, 15908, 10340, 921, 833, 273, 8000, 18, 8622, 12, 2159, 1769, 3639, 22155, 18, 542, 2555, 12, 3276, 1769, 3639, 309, 261, 1968, 1276, 19817, 1076, 13, 288, 5411, 327, 14015, 54, 10340, 1076, 13, 833, 2934, 869, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 15908, 10340, 921, 8526, 3875, 2615, 12, 54, 10340, 22155, 16, 18176, 7413, 8000, 16, 21176, 756, 13, 288, 3639, 309, 261, 2159, 422, 446, 13, 288, 5411, 327, 394, 15908, 10340, 921, 63, 20, 15533, 3639, 289, 3639, 727, 467, 1830, 2555, 1754, 273, 3099, 18, 588, 2555, 5621, 3639, 309, 261, 2159, 1276, 1510, 907, 13, 288, 5411, 727, 509, 963, 273, 14015, 1076, 907, 13, 756, 2934, 1467, 5621, 5411, 727, 2407, 666, 273, 394, 2407, 12, 1467, 1769, 5411, 727, 4498, 2775, 273, 14015, 1076, 907, 13, 756, 2934, 9838, 5621, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 411, 963, 31, 277, 27245, 288, 7734, 727, 21176, 1024, 273, 261, 2 ]
System.err.println("************* Encoding " + dataBlockStatus.length + " -> " + checkBlockStatus.length + " *************");
private void realEncode(SplitfileBlock[] dataBlockStatus, SplitfileBlock[] checkBlockStatus, int blockLength, BucketFactory bf) throws IOException {// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization();// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization(); long memUsedAtStart = Runtime.getRuntime().totalMemory() - Runtime.getRuntime().freeMemory(); Logger.minor(this, "Memory in use at start: "+memUsedAtStart+" max="+Runtime.getRuntime().maxMemory()); System.err.println("************* Encoding " + dataBlockStatus.length + " -> " + checkBlockStatus.length + " *************"); Logger.minor(this, "Doing encode: " + dataBlockStatus.length + " data blocks, " + checkBlockStatus.length + " check blocks, block length " + blockLength + " with " + this); if (dataBlockStatus.length + checkBlockStatus.length != n) throw new IllegalArgumentException(); if (dataBlockStatus.length != k) throw new IllegalArgumentException(); Buffer[] dataPackets = new Buffer[k]; Buffer[] checkPackets = new Buffer[n - k]; Bucket[] buckets = new Bucket[n]; DataInputStream[] readers = new DataInputStream[k]; OutputStream[] writers = new OutputStream[n - k]; try { int[] toEncode = new int[n - k]; int numberToEncode = 0; // can be less than n-k byte[] realBuffer = new byte[n * STRIPE_SIZE]; for (int i = 0; i < k; i++) dataPackets[i] = new Buffer(realBuffer, i * STRIPE_SIZE, STRIPE_SIZE); for (int i = 0; i < n - k; i++) checkPackets[i] = new Buffer(realBuffer, (i + k) * STRIPE_SIZE, STRIPE_SIZE); for (int i = 0; i < dataBlockStatus.length; i++) { buckets[i] = dataBlockStatus[i].getData(); long sz = buckets[i].size(); if (sz < blockLength) { if (i != dataBlockStatus.length - 1) throw new IllegalArgumentException( "All buckets except the last must be the full size"); if (sz < blockLength) buckets[i] = pad(buckets[i], blockLength, bf, (int) sz); else throw new IllegalArgumentException("Too big: " + sz + " bigger than " + blockLength); } readers[i] = new DataInputStream(buckets[i].getInputStream()); } for (int i = 0; i < checkBlockStatus.length; i++) { buckets[i + k] = checkBlockStatus[i].getData(); if (buckets[i + k] == null) { buckets[i + k] = bf.makeBucket(blockLength); writers[i] = buckets[i + k].getOutputStream(); toEncode[numberToEncode++] = i + k; } else { writers[i] = null; } } if (numberToEncode > 0) { // Do the (striped) encode for (int offset = 0; offset < blockLength; offset += STRIPE_SIZE) { // Read the data in first for (int i = 0; i < k; i++) { readers[i].readFully(realBuffer, i * STRIPE_SIZE, STRIPE_SIZE); } // Do the encode // Not shuffled long startTime = System.currentTimeMillis();// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization();// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization(); long memUsedBeforeStripe = Runtime.getRuntime().totalMemory() - Runtime.getRuntime().freeMemory(); Logger.minor(this, "Memory in use before stripe: "+memUsedBeforeStripe); encoder.encode(dataPackets, checkPackets, toEncode);// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization();// Runtime.getRuntime().gc();// Runtime.getRuntime().runFinalization(); long memUsedAfterStripe = Runtime.getRuntime().totalMemory() - Runtime.getRuntime().freeMemory(); Logger.minor(this, "Memory in use after stripe: "+memUsedAfterStripe); long endTime = System.currentTimeMillis(); Logger.minor(this, "Stripe encode took " + (endTime - startTime) + " ms for k=" + k + ", n=" + n + ", stripeSize=" + STRIPE_SIZE); // Try to limit CPU usage!! try { Thread.sleep(endTime - startTime); } catch (InterruptedException e) { // Ignore } // packets now contains an array of decoded blocks, in order // Write the data out for (int i = k; i < n; i++) { if (writers[i - k] != null) writers[i - k].write(realBuffer, i * STRIPE_SIZE, STRIPE_SIZE); } } } } finally { for (int i = 0; i < k; i++) if (readers[i] != null) readers[i].close(); for (int i = 0; i < n - k; i++) if (writers[i] != null) writers[i].close(); } // Set new buckets only after have a successful decode. for (int i = 0; i < checkBlockStatus.length; i++) { Bucket data = buckets[i + k]; if (data == null) throw new NullPointerException(); checkBlockStatus[i].setData(data); } System.err.println("************* Encoded " + dataBlockStatus.length + " -> " + checkBlockStatus.length + " *************"); }
45341 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45341/308b196ee77f38c4a2c6b11b7182c054b6b5e3e6/StandardOnionFECCodec.java/clean/src/freenet/client/StandardOnionFECCodec.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 2863, 5509, 12, 5521, 768, 1768, 8526, 501, 1768, 1482, 16, 1082, 202, 5521, 768, 1768, 8526, 866, 1768, 1482, 16, 509, 25367, 16, 7408, 1733, 16222, 13, 1082, 202, 15069, 1860, 288, 759, 202, 202, 5576, 18, 588, 5576, 7675, 13241, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 2681, 7951, 1588, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 13241, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 2681, 7951, 1588, 5621, 202, 202, 5748, 1663, 6668, 861, 1685, 273, 2509, 18, 588, 5576, 7675, 4963, 6031, 1435, 300, 2509, 18, 588, 5576, 7675, 9156, 6031, 5621, 202, 202, 3328, 18, 17364, 12, 2211, 16, 315, 6031, 316, 999, 622, 787, 30, 13773, 3917, 6668, 861, 1685, 9078, 943, 1546, 15, 5576, 18, 588, 5576, 7675, 1896, 6031, 10663, 202, 202, 3163, 18, 370, 18, 8222, 2932, 1644, 23490, 13400, 315, 397, 501, 1768, 1482, 18, 2469, 9506, 202, 15, 315, 317, 315, 397, 866, 1768, 1482, 18, 2469, 397, 315, 380, 1644, 1007, 8863, 202, 202, 3328, 18, 17364, 12, 2211, 16, 315, 3244, 310, 2017, 30, 315, 397, 501, 1768, 1482, 18, 2469, 9506, 202, 15, 315, 501, 4398, 16, 315, 397, 866, 1768, 1482, 18, 2469, 9506, 202, 15, 315, 866, 4398, 16, 1203, 769, 315, 397, 25367, 397, 315, 598, 315, 9506, 202, 15, 333, 1769, 202, 202, 430, 261, 892, 1768, 1482, 18, 2469, 397, 866, 1768, 1482, 18, 2469, 480, 290, 13, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 2863, 5509, 12, 5521, 768, 1768, 8526, 501, 1768, 1482, 16, 1082, 202, 5521, 768, 1768, 8526, 866, 1768, 1482, 16, 509, 25367, 16, 7408, 1733, 16222, 13, 1082, 202, 15069, 1860, 288, 759, 202, 202, 5576, 18, 588, 5576, 7675, 13241, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 2681, 7951, 1588, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 13241, 5621, 759, 202, 202, 5576, 18, 588, 5576, 7675, 2681, 7951, 1588, 5621, 202, 202, 5748, 1663, 6668, 861, 1685, 273, 2509, 18, 588, 5576, 7675, 4963, 6031, 1435, 300, 2509, 18, 588, 5576, 7675, 9156, 6031, 5621, 202, 202, 3328, 18, 17364, 12, 2211, 16, 315, 6031, 316, 999, 622, 2 ]
for (Object selectedObject : ((IStructuredSelection) this.view.getViewer().getSelection()).toList()) {
for (Object selectedObject : selectedElements) {
public void run() { for (Object selectedObject : ((IStructuredSelection) this.view.getViewer().getSelection()).toList()) { if (selectedObject instanceof ITask) { TasksUiPlugin.getTaskListManager().getTaskList().markComplete(((ITask) selectedObject), true); } else if (selectedObject instanceof AbstractQueryHit) { ITask task = ((AbstractQueryHit)selectedObject).getCorrespondingTask(); if (task instanceof WebTask) { TasksUiPlugin.getTaskListManager().getTaskList().markComplete(task, true); } } } }
51151 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51151/e89782ac58a8954e125e3e88a6d014fbd48d86d6/MarkTaskCompleteAction.java/clean/org.eclipse.mylyn.tasks.ui/src/org/eclipse/mylyn/internal/tasks/ui/actions/MarkTaskCompleteAction.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1086, 1435, 288, 202, 202, 1884, 261, 921, 3170, 921, 294, 14015, 45, 30733, 6233, 13, 333, 18, 1945, 18, 588, 18415, 7675, 588, 6233, 1435, 2934, 869, 682, 10756, 288, 1082, 202, 430, 261, 8109, 921, 1276, 467, 2174, 13, 288, 9506, 202, 6685, 13943, 3773, 18, 588, 2174, 682, 1318, 7675, 588, 2174, 682, 7675, 3355, 6322, 12443, 12, 1285, 835, 13, 3170, 921, 3631, 638, 1769, 1082, 202, 97, 469, 309, 261, 8109, 921, 1276, 4115, 1138, 13616, 13, 288, 9506, 202, 1285, 835, 1562, 273, 14015, 7469, 1138, 13616, 13, 8109, 921, 2934, 588, 6217, 17863, 310, 2174, 5621, 9506, 202, 430, 261, 4146, 1276, 2999, 2174, 13, 288, 6862, 202, 6685, 13943, 3773, 18, 588, 2174, 682, 1318, 7675, 588, 2174, 682, 7675, 3355, 6322, 12, 4146, 16, 638, 1769, 25083, 202, 97, 1082, 202, 97, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1086, 1435, 288, 202, 202, 1884, 261, 921, 3170, 921, 294, 14015, 45, 30733, 6233, 13, 333, 18, 1945, 18, 588, 18415, 7675, 588, 6233, 1435, 2934, 869, 682, 10756, 288, 1082, 202, 430, 261, 8109, 921, 1276, 467, 2174, 13, 288, 9506, 202, 6685, 13943, 3773, 18, 588, 2174, 682, 1318, 7675, 588, 2174, 682, 7675, 3355, 6322, 12443, 12, 1285, 835, 13, 3170, 921, 3631, 638, 1769, 1082, 202, 97, 469, 309, 261, 8109, 921, 1276, 4115, 1138, 13616, 13, 288, 9506, 202, 1285, 835, 1562, 273, 14015, 7469, 1138, 13616, 13, 8109, 921, 2934, 588, 6217, 17863, 310, 2174, 5621, 9506, 202, 430, 261, 4146, 1276, 2999, 2174, 13, 288, 6862, 202, 2 ]
if (jj_3R_54()) return true;
if (jj_3R_20()) return true;
final private boolean jj_3R_44() { if (jj_3R_54()) return true; if (jj_la == 0 && jj_scanpos == jj_lastpos) return false; return false; }
9291 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/9291/e128e4125429834f73621c8aa67036ca877e731e/Parser.java/buggy/src/java/org/apache/velocity/runtime/parser/Parser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 3238, 1250, 10684, 67, 23, 54, 67, 6334, 1435, 288, 565, 309, 261, 78, 78, 67, 23, 54, 67, 3462, 10756, 327, 638, 31, 565, 309, 261, 78, 78, 67, 11821, 422, 374, 597, 10684, 67, 9871, 917, 422, 10684, 67, 2722, 917, 13, 327, 629, 31, 565, 327, 629, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 3238, 1250, 10684, 67, 23, 54, 67, 6334, 1435, 288, 565, 309, 261, 78, 78, 67, 23, 54, 67, 3462, 10756, 327, 638, 31, 565, 309, 261, 78, 78, 67, 11821, 422, 374, 597, 10684, 67, 9871, 917, 422, 10684, 67, 2722, 917, 13, 327, 629, 31, 565, 327, 629, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public org.quickfix.field.CashDistribAgentName getCashDistribAgentName() throws FieldNotFound { org.quickfix.field.CashDistribAgentName value = new org.quickfix.field.CashDistribAgentName();
public quickfix.field.CashDistribAgentName getCashDistribAgentName() throws FieldNotFound { quickfix.field.CashDistribAgentName value = new quickfix.field.CashDistribAgentName();
public org.quickfix.field.CashDistribAgentName getCashDistribAgentName() throws FieldNotFound { org.quickfix.field.CashDistribAgentName value = new org.quickfix.field.CashDistribAgentName(); getField(value); return value; }
5926 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5926/fecc27f98261270772ff182a1d4dfd94b5daa73d/RegistrationInstructions.java/buggy/src/java/src/quickfix/fix43/RegistrationInstructions.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 1927, 961, 1669, 665, 3630, 461, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 5621, 565, 5031, 12, 1132, 1769, 327, 460, 31, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 1927, 961, 1669, 665, 3630, 461, 1435, 1216, 2286, 2768, 225, 288, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 460, 273, 394, 2358, 18, 19525, 904, 18, 1518, 18, 39, 961, 1669, 665, 3630, 461, 5621, 565, 5031, 12, 1132, 1769, 327, 460, 31, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
protected void serveCachedCopy(File cacheFile, Writer out) {
protected void serveCachedCopy(File cacheFile, Writer out) throws JspTagException {
protected void serveCachedCopy(File cacheFile, Writer out) { BufferedReader in = null; try { in = new BufferedReader(new FileReader(cacheFile)); char[] cbuf = new char[8192]; while (true) { int charsRead = in.read(cbuf); if (charsRead == -1) { break; } out.write(cbuf, 0, charsRead); } in.close(); } catch (IOException e) { err(e); } }
52149 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52149/9009525d9afd9bf8870064e02e1aeee003cd75a0/XSLTag.java/clean/reporting/jsp/src/net/sourceforge/cruisecontrol/taglib/XSLTag.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 12175, 9839, 2951, 12, 812, 18748, 16, 5497, 596, 13, 1216, 19300, 1805, 503, 288, 3639, 10633, 316, 273, 446, 31, 3639, 775, 288, 5411, 316, 273, 394, 10633, 12, 2704, 23010, 12, 2493, 812, 10019, 5411, 1149, 8526, 2875, 696, 273, 394, 1149, 63, 28, 15561, 15533, 5411, 1323, 261, 3767, 13, 288, 7734, 509, 5230, 1994, 273, 316, 18, 896, 12, 71, 4385, 1769, 7734, 309, 261, 7549, 1994, 422, 300, 21, 13, 288, 10792, 898, 31, 7734, 289, 7734, 596, 18, 2626, 12, 71, 4385, 16, 374, 16, 5230, 1994, 1769, 5411, 289, 5411, 316, 18, 4412, 5621, 3639, 289, 1044, 261, 14106, 425, 13, 288, 5411, 393, 12, 73, 1769, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 12175, 9839, 2951, 12, 812, 18748, 16, 5497, 596, 13, 1216, 19300, 1805, 503, 288, 3639, 10633, 316, 273, 446, 31, 3639, 775, 288, 5411, 316, 273, 394, 10633, 12, 2704, 23010, 12, 2493, 812, 10019, 5411, 1149, 8526, 2875, 696, 273, 394, 1149, 63, 28, 15561, 15533, 5411, 1323, 261, 3767, 13, 288, 7734, 509, 5230, 1994, 273, 316, 18, 896, 12, 71, 4385, 1769, 7734, 309, 261, 7549, 1994, 422, 300, 21, 13, 288, 10792, 898, 31, 7734, 289, 7734, 596, 18, 2626, 12, 71, 4385, 16, 374, 16, 5230, 1994, 1769, 5411, 289, 5411, 316, 18, 4412, 5621, 3639, 289, 1044, 261, 14106, 425, 13, 288, 5411, 393, 12, 73, 1769, 3639, 289, 2 ]
synonym = createSynonym(dbEntryItem, synonymSourceId,
synonym = createSynonym(dbEntryItem, getSourceRef("embl"),
protected void translateBioEntity(Item srcItem, Item tgtItem) throws ObjectStoreException { Item gene = new Item(); Item vector = new Item(); Item synonym = new Item(); String s = null; String identifier = null; //prefetch done if (srcItem.hasReference("type")) { Item item = ItemHelper.convert(srcItemReader.getItemById( srcItem.getReference("type").getRefId())); if (item.hasAttribute("value")) { s = item.getAttribute("value").getValue(); if (s.equals("genomic_DNA")) { tgtItem.setClassName(tgtNs + "NuclearDNA"); } else if (s.equals("cDNA_clone")) { tgtItem.setClassName(tgtNs + "CDNAClone"); } else if (s.equals("vector")) { tgtItem.setClassName(tgtNs + "Vector"); } else { tgtItem = null; } } } // prefetch done if (srcItem.hasCollection("sequenceDatabases")) { ReferenceList rl = srcItem.getCollection("sequenceDatabases"); identifier = null; List geneList = new ArrayList(); List emblList = new ArrayList(); for (Iterator i = rl.getRefIds().iterator(); i.hasNext(); ) { Item dbEntryItem = ItemHelper.convert(srcItemReader. getItemById((String) i.next())); if (dbEntryItem.hasReference("database")) { Item dbItem = ItemHelper.convert(srcItemReader.getItemById( (String) dbEntryItem.getReference("database").getRefId())); String synonymSourceId = dbItem.getIdentifier(); if (dbItem.hasAttribute("name")) { String dbName = dbItem.getAttribute("name").getValue(); String organismDbId = dbEntryItem.getAttribute("accession").getValue(); if (dbName.equals("flybase") && organismDbId.startsWith("FBgn")) { gene = createGene(tgtNs + "Gene", "", dbEntryItem.getIdentifier(), organismDbId); geneList.add(dbItem.getIdentifier()); // } else if (dbName.equals("flybase") && organismDbId.startsWith("FBmc")) { // tgtItem.addAttribute(new Attribute("organismDbId", organismDbId)); } else if (dbName.equals("embl") && dbEntryItem.hasAttribute("accession")) { String accession = dbEntryItem.getAttribute("accession").getValue(); //make sure synonym only create once for same accession if (!synonymAccession.contains(accession)) { emblList.add(dbEntryItem.getIdentifier()); synonym = createSynonym(dbEntryItem, synonymSourceId, srcItem.getIdentifier()); synonymAccession.add(accession); //Set synonymMap.put(dbEntryItem.getIdentifier(), synonym); synonymAccessionMap.put(accession, synonym); } // result.add(synonym); } else { //getDatabaseRef(); } } } } if (!geneList.isEmpty()) { geneSet.add(gene); gene2BioEntity.put(gene.getIdentifier(), srcItem.getIdentifier()); } if (!emblList.isEmpty()) { ReferenceList synonymEmblRl = new ReferenceList("synonyms", emblList); tgtItem.addCollection(synonymEmblRl); } } if (tgtItem != null) { bioEntitySet.add(tgtItem); } }
29158 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/29158/6facc64d84ef54a3065128ae71928eddcc5b8200/MageDataTranslator.java/clean/flymine/model/mage/src/java/org/flymine/dataconversion/MageDataTranslator.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 4204, 38, 1594, 1943, 12, 1180, 1705, 1180, 16, 4342, 11680, 1180, 13, 3639, 1216, 1033, 21151, 288, 3639, 4342, 7529, 273, 394, 4342, 5621, 3639, 4342, 3806, 273, 394, 4342, 5621, 3639, 4342, 26308, 273, 394, 4342, 5621, 3639, 514, 272, 273, 446, 31, 3639, 514, 2756, 273, 446, 31, 3639, 368, 1484, 5754, 2731, 3639, 309, 261, 4816, 1180, 18, 5332, 2404, 2932, 723, 6, 3719, 288, 5411, 4342, 761, 273, 4342, 2276, 18, 6283, 12, 4816, 1180, 2514, 18, 588, 1180, 5132, 12, 1171, 9079, 1705, 1180, 18, 588, 2404, 2932, 723, 20387, 588, 1957, 548, 1435, 10019, 5411, 309, 261, 1726, 18, 5332, 1499, 2932, 1132, 6, 3719, 288, 7734, 272, 273, 761, 18, 588, 1499, 2932, 1132, 20387, 24805, 5621, 7734, 309, 261, 87, 18, 14963, 2932, 4507, 24721, 67, 8609, 37, 6, 3719, 288, 10402, 11680, 1180, 18, 542, 3834, 12, 29672, 10386, 397, 315, 50, 89, 8507, 8609, 37, 8863, 7734, 289, 469, 309, 261, 87, 18, 14963, 2932, 71, 8609, 37, 67, 14056, 6, 3719, 288, 10792, 11680, 1180, 18, 542, 3834, 12, 29672, 10386, 397, 315, 39, 8609, 37, 10930, 8863, 7734, 289, 469, 309, 261, 87, 18, 14963, 2932, 7737, 6, 3719, 288, 5397, 11680, 1180, 18, 542, 3834, 12, 29672, 10386, 397, 315, 5018, 8863, 7734, 289, 469, 288, 10792, 11680, 1180, 273, 446, 31, 7734, 289, 5411, 289, 3639, 289, 3639, 368, 17607, 2731, 3639, 309, 261, 4816, 1180, 18, 5332, 2532, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 4204, 38, 1594, 1943, 12, 1180, 1705, 1180, 16, 4342, 11680, 1180, 13, 3639, 1216, 1033, 21151, 288, 3639, 4342, 7529, 273, 394, 4342, 5621, 3639, 4342, 3806, 273, 394, 4342, 5621, 3639, 4342, 26308, 273, 394, 4342, 5621, 3639, 514, 272, 273, 446, 31, 3639, 514, 2756, 273, 446, 31, 3639, 368, 1484, 5754, 2731, 3639, 309, 261, 4816, 1180, 18, 5332, 2404, 2932, 723, 6, 3719, 288, 5411, 4342, 761, 273, 4342, 2276, 18, 6283, 12, 4816, 1180, 2514, 18, 588, 1180, 5132, 12, 1171, 9079, 1705, 1180, 18, 588, 2404, 2932, 723, 20387, 588, 1957, 548, 1435, 10019, 5411, 309, 261, 1726, 18, 5332, 1499, 2932, 1132, 6, 3719, 288, 7734, 272, 273, 2 ]
this.messageSource = source; }
this.messageSource = source; }
public void setMessageSource(MessageSource source) { this.messageSource = source; }
55385 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55385/975905c7e8c55e5fe91c94dc583c4269318ca341/ConstrainedProperty.java/clean/src/commons/org/codehaus/groovy/grails/validation/ConstrainedProperty.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 15227, 1830, 12, 1079, 1830, 1084, 13, 288, 202, 202, 2211, 18, 2150, 1830, 273, 1084, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 15227, 1830, 12, 1079, 1830, 1084, 13, 288, 202, 202, 2211, 18, 2150, 1830, 273, 1084, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
template.addSymbol( X );
factory.addSymbol( X );
public void test_14_3_2__2_NonTypeArgumentRestrictions() throws Exception{ newTable(); ITemplateSymbol template = table.newTemplateSymbol( "X" ); table.getCompilationUnit().addSymbol( template ); template.addTemplateParameter( table.newSymbol( "T", TypeInfo.t_templateParameter ) ); ISymbol param2 = table.newSymbol( "p", TypeInfo.t_templateParameter ); param2.getTypeInfo().setTemplateParameterType( TypeInfo.t_char ); param2.addPtrOperator( new PtrOp( PtrOp.t_pointer ) ); template.addTemplateParameter( param2 ); IDerivableContainerSymbol X = table.newDerivableContainerSymbol( "X", TypeInfo.t_class ); template.addSymbol( X ); List args = new LinkedList(); args.add( new TypeInfo( TypeInfo.t_int, 0, null ) ); args.add( new TypeInfo( TypeInfo.t_char, 0, null, new PtrOp( PtrOp.t_pointer ), "Studebaker" ) ); try{ table.getCompilationUnit().lookupTemplate( "X", args ); assertTrue( false ); } catch( ParserSymbolTableException e ){ assertEquals( e.reason, ParserSymbolTableException.r_BadTemplateArgument ); } ISymbol p = table.newSymbol( "p", TypeInfo.t_char ); p.addPtrOperator( new PtrOp( PtrOp.t_array ) ); table.getCompilationUnit().addSymbol( p ); args.clear(); args.add( new TypeInfo( TypeInfo.t_int, 0, null ) ); args.add( new TypeInfo( TypeInfo.t_type, 0, p ) ); ISymbol look = table.getCompilationUnit().lookupTemplate( "X", args ); assertTrue( look.isTemplateInstance() ); assertEquals( look.getInstantiatedSymbol(), X ); }
6192 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6192/5a0369683c183e148f3c496273fb138a89fe9911/ParserSymbolTableTemplateTests.java/clean/core/org.eclipse.cdt.core.tests/parser/org/eclipse/cdt/core/parser/tests/ParserSymbolTableTemplateTests.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 67, 3461, 67, 23, 67, 22, 972, 22, 67, 3989, 559, 1379, 26175, 1435, 1216, 1185, 95, 202, 202, 2704, 1388, 5621, 9506, 202, 1285, 29761, 5335, 1542, 273, 1014, 18, 2704, 2283, 5335, 12, 315, 60, 6, 11272, 202, 202, 2121, 18, 588, 19184, 2802, 7675, 1289, 5335, 12, 1542, 11272, 9506, 202, 3202, 18, 1289, 2283, 1662, 12, 1014, 18, 2704, 5335, 12, 315, 56, 3113, 1412, 966, 18, 88, 67, 3202, 1662, 262, 11272, 9506, 202, 5127, 3284, 579, 22, 273, 1014, 18, 2704, 5335, 12, 315, 84, 3113, 1412, 966, 18, 88, 67, 3202, 1662, 11272, 202, 202, 891, 22, 18, 588, 17305, 7675, 542, 2283, 28460, 12, 1412, 966, 18, 88, 67, 3001, 11272, 202, 202, 891, 22, 18, 1289, 5263, 5592, 12, 394, 14898, 3817, 12, 14898, 3817, 18, 88, 67, 10437, 262, 11272, 202, 202, 3202, 18, 1289, 2283, 1662, 12, 579, 22, 11272, 9506, 202, 734, 264, 427, 429, 2170, 5335, 1139, 273, 1014, 18, 2704, 26239, 429, 2170, 5335, 12, 315, 60, 3113, 1412, 966, 18, 88, 67, 1106, 11272, 202, 202, 3202, 18, 1289, 5335, 12, 1139, 11272, 9506, 202, 682, 833, 273, 394, 10688, 5621, 202, 202, 1968, 18, 1289, 12, 394, 1412, 966, 12, 1412, 966, 18, 88, 67, 474, 16, 374, 16, 446, 262, 11272, 202, 202, 1968, 18, 1289, 12, 394, 1412, 966, 12, 1412, 966, 18, 88, 67, 3001, 16, 374, 16, 446, 16, 394, 14898, 3817, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 67, 3461, 67, 23, 67, 22, 972, 22, 67, 3989, 559, 1379, 26175, 1435, 1216, 1185, 95, 202, 202, 2704, 1388, 5621, 9506, 202, 1285, 29761, 5335, 1542, 273, 1014, 18, 2704, 2283, 5335, 12, 315, 60, 6, 11272, 202, 202, 2121, 18, 588, 19184, 2802, 7675, 1289, 5335, 12, 1542, 11272, 9506, 202, 3202, 18, 1289, 2283, 1662, 12, 1014, 18, 2704, 5335, 12, 315, 56, 3113, 1412, 966, 18, 88, 67, 3202, 1662, 262, 11272, 9506, 202, 5127, 3284, 579, 22, 273, 1014, 18, 2704, 5335, 12, 315, 84, 3113, 1412, 966, 18, 88, 67, 3202, 1662, 11272, 202, 202, 891, 22, 18, 588, 17305, 7675, 542, 2283, 28460, 12, 1412, 966, 2 ]
public void ruleAction(int ruleNumber) { switch (ruleNumber) { // // Rule 1: TypeName ::= TypeName . ErrorId // case 1: { //#line 6 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name TypeName = (Name) getRhsSym(1); //#line 8 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), TypeName, "*")); break; } // // Rule 2: PackageName ::= PackageName . ErrorId // case 2: { //#line 16 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name PackageName = (Name) getRhsSym(1); //#line 18 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), PackageName, "*")); break; } // // Rule 3: ExpressionName ::= AmbiguousName . ErrorId // case 3: { //#line 26 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 28 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, "*")); break; } // // Rule 4: MethodName ::= AmbiguousName . ErrorId // case 4: { //#line 36 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 38 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, "*")); break; } // // Rule 5: PackageOrTypeName ::= PackageOrTypeName . ErrorId // case 5: { //#line 46 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name PackageOrTypeName = (Name) getRhsSym(1); //#line 48 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), PackageOrTypeName, "*")); break; } // // Rule 6: AmbiguousName ::= AmbiguousName . ErrorId // case 6: { //#line 56 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 58 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, "*")); break; } // // Rule 7: FieldAccess ::= Primary . ErrorId // case 7: { //#line 66 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Expr Primary = (Expr) getRhsSym(1); //#line 68 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(nf.Field(pos(), Primary, "*")); break; } // // Rule 8: FieldAccess ::= super . ErrorId // case 8: { //#line 73 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getLeftSpan())), "*")); break; } // // Rule 9: FieldAccess ::= ClassName . super$sup . ErrorId // case 9: { //#line 76 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name ClassName = (Name) getRhsSym(1); //#line 76 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" IToken sup = (IToken) getRhsIToken(3); //#line 78 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getRhsFirstTokenIndex(3)), ClassName.toType()), "*")); break; } // // Rule 10: MethodInvocation ::= MethodPrimaryPrefix ( ArgumentListopt ) // case 10: { //#line 82 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Object MethodPrimaryPrefix = (Object) getRhsSym(1); //#line 82 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" List ArgumentListopt = (List) getRhsSym(3); //#line 84 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Expr Primary = (Expr) ((Object[]) MethodPrimaryPrefix)[0]; polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) ((Object[]) MethodPrimaryPrefix)[1]; setResult(nf.Call(pos(), Primary, identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 11: MethodInvocation ::= MethodSuperPrefix ( ArgumentListopt ) // case 11: { //#line 89 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" polyglot.lex.Identifier MethodSuperPrefix = (polyglot.lex.Identifier) getRhsSym(1); //#line 89 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" List ArgumentListopt = (List) getRhsSym(3); //#line 91 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" polyglot.lex.Identifier identifier = MethodSuperPrefix; setResult(nf.Call(pos(), nf.Super(pos(getLeftSpan())), identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 12: MethodInvocation ::= MethodClassNameSuperPrefix ( ArgumentListopt ) // case 12: { //#line 95 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Object MethodClassNameSuperPrefix = (Object) getRhsSym(1); //#line 95 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" List ArgumentListopt = (List) getRhsSym(3); //#line 97 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name ClassName = (Name) ((Object[]) MethodClassNameSuperPrefix)[0]; JPGPosition super_pos = (JPGPosition) ((Object[]) MethodClassNameSuperPrefix)[1]; polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) ((Object[]) MethodClassNameSuperPrefix)[2]; setResult(nf.Call(pos(), nf.Super(super_pos, ClassName.toType()), identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 13: MethodPrimaryPrefix ::= Primary . ErrorId$ErrorId // case 13: { //#line 104 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Expr Primary = (Expr) getRhsSym(1); //#line 104 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" IToken ErrorId = (IToken) getRhsIToken(3); //#line 106 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Object[] a = new Object[2]; a[0] = Primary; a[1] = id(getRhsFirstTokenIndex(3)); setResult(a); break; } // // Rule 14: MethodSuperPrefix ::= super . ErrorId$ErrorId // case 14: { //#line 112 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" IToken ErrorId = (IToken) getRhsIToken(3); //#line 114 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" setResult(id(getRhsFirstTokenIndex(3))); break; } // // Rule 15: MethodClassNameSuperPrefix ::= ClassName . super$sup . ErrorId$ErrorId // case 15: { //#line 117 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Name ClassName = (Name) getRhsSym(1); //#line 117 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" IToken sup = (IToken) getRhsIToken(3); //#line 117 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" IToken ErrorId = (IToken) getRhsIToken(5); //#line 119 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/MissingId.gi" Object[] a = new Object[3]; a[0] = ClassName; a[1] = pos(getRhsFirstTokenIndex(3)); a[2] = id(getRhsFirstTokenIndex(5)); setResult(a); break; } // // Rule 16: identifier ::= IDENTIFIER$ident // case 16: { //#line 94 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken ident = (IToken) getRhsIToken(1); //#line 96 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ident.setKind(X10Parsersym.TK_IDENTIFIER); setResult(id(getRhsFirstTokenIndex(1))); break; } // // Rule 19: IntegralType ::= byte // case 19: { //#line 121 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Byte())); break; } // // Rule 20: IntegralType ::= char // case 20: { //#line 126 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Char())); break; } // // Rule 21: IntegralType ::= short // case 21: { //#line 131 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Short())); break; } // // Rule 22: IntegralType ::= int // case 22: { //#line 136 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Int())); break; } // // Rule 23: IntegralType ::= long // case 23: { //#line 141 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Long())); break; } // // Rule 24: FloatingPointType ::= float // case 24: { //#line 147 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Float())); break; } // // Rule 25: FloatingPointType ::= double // case 25: { //#line 152 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Double())); break; } // // Rule 28: TypeName ::= identifier // case 28: { //#line 175 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 177 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 29: TypeName ::= TypeName . identifier // case 29: { //#line 180 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name TypeName = (Name) getRhsSym(1); //#line 180 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 182 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), TypeName, identifier.getIdentifier())); break; } // // Rule 31: ArrayType ::= Type [ ] // case 31: { //#line 194 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(1); //#line 196 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.array(Type, pos(), 1)); break; } // // Rule 32: PackageName ::= identifier // case 32: { //#line 241 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 243 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 33: PackageName ::= PackageName . identifier // case 33: { //#line 246 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name PackageName = (Name) getRhsSym(1); //#line 246 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 248 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), PackageName, identifier.getIdentifier())); break; } // // Rule 34: ExpressionName ::= identifier // case 34: { //#line 262 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 264 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 35: ExpressionName ::= AmbiguousName . identifier // case 35: { //#line 267 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 267 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 269 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, identifier.getIdentifier())); break; } // // Rule 36: MethodName ::= identifier // case 36: { //#line 277 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 279 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 37: MethodName ::= AmbiguousName . identifier // case 37: { //#line 282 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 282 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 284 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, identifier.getIdentifier())); break; } // // Rule 38: PackageOrTypeName ::= identifier // case 38: { //#line 292 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 294 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 39: PackageOrTypeName ::= PackageOrTypeName . identifier // case 39: { //#line 297 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name PackageOrTypeName = (Name) getRhsSym(1); //#line 297 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 299 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), PackageOrTypeName, identifier.getIdentifier())); break; } // // Rule 40: AmbiguousName ::= identifier // case 40: { //#line 307 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 309 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 41: AmbiguousName ::= AmbiguousName . identifier // case 41: { //#line 312 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name AmbiguousName = (Name) getRhsSym(1); //#line 312 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 314 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(getLeftSpan(), getRightSpan()), AmbiguousName, identifier.getIdentifier())); break; } // // Rule 42: CompilationUnit ::= PackageDeclarationopt ImportDeclarationsopt TypeDeclarationsopt // case 42: { //#line 324 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" PackageNode PackageDeclarationopt = (PackageNode) getRhsSym(1); //#line 324 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ImportDeclarationsopt = (List) getRhsSym(2); //#line 324 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List TypeDeclarationsopt = (List) getRhsSym(3); //#line 326 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // Add import x10.lang.* by default. Name x10 = new Name(nf, ts, pos(), "x10"); Name x10Lang = new Name(nf, ts, pos(), x10, "lang"); int token_pos = (ImportDeclarationsopt.size() == 0 ? TypeDeclarationsopt.size() == 0 ? super.getSize() - 1 : getPrevious(getRhsFirstTokenIndex(3)) : getRhsLastTokenIndex(2) ); Import x10LangImport = nf.Import(pos(token_pos), Import.PACKAGE, x10Lang.toString()); ImportDeclarationsopt.add(x10LangImport); setResult(nf.SourceFile(pos(getLeftSpan(), getRightSpan()), PackageDeclarationopt, ImportDeclarationsopt, TypeDeclarationsopt)); break; } // // Rule 43: ImportDeclarations ::= ImportDeclaration // case 43: { //#line 342 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Import ImportDeclaration = (Import) getRhsSym(1); //#line 344 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Import.class, false); l.add(ImportDeclaration); setResult(l); break; } // // Rule 44: ImportDeclarations ::= ImportDeclarations ImportDeclaration // case 44: { //#line 349 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ImportDeclarations = (List) getRhsSym(1); //#line 349 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Import ImportDeclaration = (Import) getRhsSym(2); //#line 351 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (ImportDeclaration != null) ImportDeclarations.add(ImportDeclaration); //setResult(l); break; } // // Rule 45: TypeDeclarations ::= TypeDeclaration // case 45: { //#line 357 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl TypeDeclaration = (ClassDecl) getRhsSym(1); //#line 359 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), TopLevelDecl.class, false); if (TypeDeclaration != null) l.add(TypeDeclaration); setResult(l); break; } // // Rule 46: TypeDeclarations ::= TypeDeclarations TypeDeclaration // case 46: { //#line 365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List TypeDeclarations = (List) getRhsSym(1); //#line 365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl TypeDeclaration = (ClassDecl) getRhsSym(2); //#line 367 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (TypeDeclaration != null) TypeDeclarations.add(TypeDeclaration); //setResult(l); break; } // // Rule 49: SingleTypeImportDeclaration ::= import TypeName ; // case 49: { //#line 380 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name TypeName = (Name) getRhsSym(2); //#line 382 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Import(pos(getLeftSpan(), getRightSpan()), Import.CLASS, TypeName.toString())); break; } // // Rule 50: TypeImportOnDemandDeclaration ::= import PackageOrTypeName . * ; // case 50: { //#line 386 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name PackageOrTypeName = (Name) getRhsSym(2); //#line 388 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Import(pos(getLeftSpan(), getRightSpan()), Import.PACKAGE, PackageOrTypeName.toString())); break; } // // Rule 53: TypeDeclaration ::= ; // case 53: { //#line 402 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(null); break; } // // Rule 56: ClassModifiers ::= ClassModifiers ClassModifier // case 56: { //#line 414 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ClassModifiers = (Flags) getRhsSym(1); //#line 414 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ClassModifier = (Flags) getRhsSym(2); //#line 416 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ClassModifiers.set(ClassModifier)); break; } // // Rule 57: ClassModifier ::= public // case 57: { //#line 424 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 58: ClassModifier ::= protected // case 58: { //#line 429 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PROTECTED); break; } // // Rule 59: ClassModifier ::= private // case 59: { //#line 434 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PRIVATE); break; } // // Rule 60: ClassModifier ::= abstract // case 60: { //#line 439 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.ABSTRACT); break; } // // Rule 61: ClassModifier ::= static // case 61: { //#line 444 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STATIC); break; } // // Rule 62: ClassModifier ::= final // case 62: { //#line 449 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.FINAL); break; } // // Rule 63: ClassModifier ::= strictfp // case 63: { //#line 454 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STRICTFP); break; } // // Rule 64: Super ::= extends ClassType // case 64: { //#line 466 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode ClassType = (TypeNode) getRhsSym(2); //#line 468 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ClassType); break; } // // Rule 65: Interfaces ::= implements InterfaceTypeList // case 65: { //#line 477 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List InterfaceTypeList = (List) getRhsSym(2); //#line 479 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(InterfaceTypeList); break; } // // Rule 66: InterfaceTypeList ::= InterfaceType // case 66: { //#line 483 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode InterfaceType = (TypeNode) getRhsSym(1); //#line 485 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), TypeNode.class, false); l.add(InterfaceType); setResult(l); break; } // // Rule 67: InterfaceTypeList ::= InterfaceTypeList , InterfaceType // case 67: { //#line 490 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List InterfaceTypeList = (List) getRhsSym(1); //#line 490 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode InterfaceType = (TypeNode) getRhsSym(3); //#line 492 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" InterfaceTypeList.add(InterfaceType); setResult(InterfaceTypeList); break; } // // Rule 68: ClassBody ::= { ClassBodyDeclarationsopt } // case 68: { //#line 502 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ClassBodyDeclarationsopt = (List) getRhsSym(2); //#line 504 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.ClassBody(pos(getLeftSpan(), getRightSpan()), ClassBodyDeclarationsopt)); break; } // // Rule 70: ClassBodyDeclarations ::= ClassBodyDeclarations ClassBodyDeclaration // case 70: { //#line 509 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ClassBodyDeclarations = (List) getRhsSym(1); //#line 509 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ClassBodyDeclaration = (List) getRhsSym(2); //#line 511 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassBodyDeclarations.addAll(ClassBodyDeclaration); // setResult(a); break; } // // Rule 72: ClassBodyDeclaration ::= InstanceInitializer // case 72: { //#line 517 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block InstanceInitializer = (Block) getRhsSym(1); //#line 519 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(nf.Initializer(pos(), Flags.NONE, InstanceInitializer)); setResult(l); break; } // // Rule 73: ClassBodyDeclaration ::= StaticInitializer // case 73: { //#line 524 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block StaticInitializer = (Block) getRhsSym(1); //#line 526 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(nf.Initializer(pos(), Flags.STATIC, StaticInitializer)); setResult(l); break; } // // Rule 74: ClassBodyDeclaration ::= ConstructorDeclaration // case 74: { //#line 531 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ConstructorDecl ConstructorDeclaration = (ConstructorDecl) getRhsSym(1); //#line 533 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(ConstructorDeclaration); setResult(l); break; } // // Rule 76: ClassMemberDeclaration ::= MethodDeclaration // case 76: { //#line 540 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" MethodDecl MethodDeclaration = (MethodDecl) getRhsSym(1); //#line 542 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(MethodDeclaration); setResult(l); break; } // // Rule 77: ClassMemberDeclaration ::= ClassDeclaration // case 77: { //#line 547 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl ClassDeclaration = (ClassDecl) getRhsSym(1); //#line 549 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(ClassDeclaration); setResult(l); break; } // // Rule 78: ClassMemberDeclaration ::= InterfaceDeclaration // case 78: { //#line 554 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl InterfaceDeclaration = (ClassDecl) getRhsSym(1); //#line 556 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(InterfaceDeclaration); setResult(l); break; } // // Rule 79: ClassMemberDeclaration ::= ; // case 79: { //#line 563 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); setResult(l); break; } // // Rule 80: VariableDeclarators ::= VariableDeclarator // case 80: { //#line 571 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" VarDeclarator VariableDeclarator = (VarDeclarator) getRhsSym(1); //#line 573 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), X10VarDeclarator.class, false); l.add(VariableDeclarator); setResult(l); break; } // // Rule 81: VariableDeclarators ::= VariableDeclarators , VariableDeclarator // case 81: { //#line 578 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List VariableDeclarators = (List) getRhsSym(1); //#line 578 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" VarDeclarator VariableDeclarator = (VarDeclarator) getRhsSym(3); //#line 580 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" VariableDeclarators.add(VariableDeclarator); // setResult(VariableDeclarators); break; } // // Rule 83: VariableDeclarator ::= VariableDeclaratorId = VariableInitializer // case 83: { //#line 586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10VarDeclarator VariableDeclaratorId = (X10VarDeclarator) getRhsSym(1); //#line 586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr VariableInitializer = (Expr) getRhsSym(3); //#line 588 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" VariableDeclaratorId.init = VariableInitializer; VariableDeclaratorId.position(pos()); // setResult(VariableDeclaratorId); break; } // // Rule 84: TraditionalVariableDeclaratorId ::= identifier // case 84: { //#line 594 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 596 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new X10VarDeclarator(pos(), identifier.getIdentifier())); break; } // // Rule 85: TraditionalVariableDeclaratorId ::= TraditionalVariableDeclaratorId [ ] // case 85: { //#line 599 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10VarDeclarator TraditionalVariableDeclaratorId = (X10VarDeclarator) getRhsSym(1); //#line 601 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TraditionalVariableDeclaratorId.dims++; TraditionalVariableDeclaratorId.position(pos()); // setResult(a); break; } // // Rule 87: VariableDeclaratorId ::= identifier [ IdentifierList ] // case 87: { //#line 608 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 608 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List IdentifierList = (List) getRhsSym(3); //#line 610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new X10VarDeclarator(pos(), identifier.getIdentifier(), IdentifierList)); break; } // // Rule 88: VariableDeclaratorId ::= [ IdentifierList ] // case 88: { //#line 613 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List IdentifierList = (List) getRhsSym(2); //#line 615 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new X10VarDeclarator(pos(), IdentifierList)); break; } // // Rule 92: FieldModifiers ::= FieldModifiers FieldModifier // case 92: { //#line 623 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags FieldModifiers = (Flags) getRhsSym(1); //#line 623 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags FieldModifier = (Flags) getRhsSym(2); //#line 625 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(FieldModifiers.set(FieldModifier)); break; } // // Rule 93: FieldModifier ::= public // case 93: { //#line 633 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 94: FieldModifier ::= protected // case 94: { //#line 638 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PROTECTED); break; } // // Rule 95: FieldModifier ::= private // case 95: { //#line 643 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PRIVATE); break; } // // Rule 96: FieldModifier ::= static // case 96: { //#line 648 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STATIC); break; } // // Rule 97: FieldModifier ::= final // case 97: { //#line 653 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.FINAL); break; } // // Rule 98: FieldModifier ::= transient // case 98: { //#line 658 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.TRANSIENT); break; } // // Rule 100: ResultType ::= void // case 100: { //#line 675 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.CanonicalTypeNode(pos(), ts.Void())); break; } // // Rule 101: FormalParameterList ::= LastFormalParameter // case 101: { //#line 695 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Formal LastFormalParameter = (Formal) getRhsSym(1); //#line 697 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Formal.class, false); l.add(LastFormalParameter); setResult(l); break; } // // Rule 102: FormalParameterList ::= FormalParameters , LastFormalParameter // case 102: { //#line 702 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List FormalParameters = (List) getRhsSym(1); //#line 702 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Formal LastFormalParameter = (Formal) getRhsSym(3); //#line 704 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" FormalParameters.add(LastFormalParameter); // setResult(FormalParameters); break; } // // Rule 103: FormalParameters ::= FormalParameter // case 103: { //#line 709 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10Formal FormalParameter = (X10Formal) getRhsSym(1); //#line 711 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Formal.class, false); l.add(FormalParameter); setResult(l); break; } // // Rule 104: FormalParameters ::= FormalParameters , FormalParameter // case 104: { //#line 716 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List FormalParameters = (List) getRhsSym(1); //#line 716 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 718 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" FormalParameters.add(FormalParameter); // setResult(FormalParameters); break; } // // Rule 105: FormalParameter ::= VariableModifiersopt Type VariableDeclaratorId // case 105: { //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags VariableModifiersopt = (Flags) getRhsSym(1); //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(2); //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10VarDeclarator VariableDeclaratorId = (X10VarDeclarator) getRhsSym(3); //#line 725 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (VariableDeclaratorId != null) setResult(nf.Formal(pos(), VariableModifiersopt, nf.array(Type, pos(getRhsFirstTokenIndex(2), getRhsLastTokenIndex(2)), VariableDeclaratorId.dims), VariableDeclaratorId.name, VariableDeclaratorId.names())); else setResult(nf.Formal(pos(), VariableModifiersopt, nf.array(Type, pos(getRhsFirstTokenIndex(2), getRhsLastTokenIndex(2)), 1), "", new AmbExpr[0])); break; } // // Rule 107: VariableModifiers ::= VariableModifiers VariableModifier // case 107: { //#line 733 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags VariableModifiers = (Flags) getRhsSym(1); //#line 733 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags VariableModifier = (Flags) getRhsSym(2); //#line 735 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(VariableModifiers.set(VariableModifier)); break; } // // Rule 108: VariableModifier ::= final // case 108: { //#line 741 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.FINAL); break; } // // Rule 109: LastFormalParameter ::= VariableModifiersopt Type ...opt$opt VariableDeclaratorId // case 109: { //#line 747 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags VariableModifiersopt = (Flags) getRhsSym(1); //#line 747 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(2); //#line 747 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Object opt = (Object) getRhsSym(3); //#line 747 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10VarDeclarator VariableDeclaratorId = (X10VarDeclarator) getRhsSym(4); //#line 749 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" assert(opt == null); setResult(nf.Formal(pos(), VariableModifiersopt, nf.array(Type, pos(getRhsFirstTokenIndex(2), getRhsLastTokenIndex(2)), VariableDeclaratorId.dims), VariableDeclaratorId.name, VariableDeclaratorId.names())); break; } // // Rule 111: MethodModifiers ::= MethodModifiers MethodModifier // case 111: { //#line 761 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags MethodModifiers = (Flags) getRhsSym(1); //#line 761 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags MethodModifier = (Flags) getRhsSym(2); //#line 763 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(MethodModifiers.set(MethodModifier)); break; } // // Rule 112: MethodModifier ::= public // case 112: { //#line 771 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 113: MethodModifier ::= protected // case 113: { //#line 776 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PROTECTED); break; } // // Rule 114: MethodModifier ::= private // case 114: { //#line 781 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PRIVATE); break; } // // Rule 115: MethodModifier ::= abstract // case 115: { //#line 786 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.ABSTRACT); break; } // // Rule 116: MethodModifier ::= static // case 116: { //#line 791 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STATIC); break; } // // Rule 117: MethodModifier ::= final // case 117: { //#line 796 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.FINAL); break; } // // Rule 118: MethodModifier ::= native // case 118: { //#line 806 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NATIVE); break; } // // Rule 119: MethodModifier ::= strictfp // case 119: { //#line 811 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STRICTFP); break; } // // Rule 120: Throws ::= throws ExceptionTypeList // case 120: { //#line 815 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ExceptionTypeList = (List) getRhsSym(2); //#line 817 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ExceptionTypeList); break; } // // Rule 121: ExceptionTypeList ::= ExceptionType // case 121: { //#line 821 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode ExceptionType = (TypeNode) getRhsSym(1); //#line 823 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), TypeNode.class, false); l.add(ExceptionType); setResult(l); break; } // // Rule 122: ExceptionTypeList ::= ExceptionTypeList , ExceptionType // case 122: { //#line 828 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ExceptionTypeList = (List) getRhsSym(1); //#line 828 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode ExceptionType = (TypeNode) getRhsSym(3); //#line 830 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ExceptionTypeList.add(ExceptionType); // setResult(ExceptionTypeList); break; } // // Rule 125: MethodBody ::= ; // case 125: setResult(null); break; // // Rule 127: StaticInitializer ::= static Block // case 127: { //#line 850 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Block = (Block) getRhsSym(2); //#line 852 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Block); break; } // // Rule 128: SimpleTypeName ::= identifier // case 128: { //#line 867 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 869 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 130: ConstructorModifiers ::= ConstructorModifiers ConstructorModifier // case 130: { //#line 874 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ConstructorModifiers = (Flags) getRhsSym(1); //#line 874 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ConstructorModifier = (Flags) getRhsSym(2); //#line 876 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ConstructorModifiers.set(ConstructorModifier)); break; } // // Rule 131: ConstructorModifier ::= public // case 131: { //#line 884 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 132: ConstructorModifier ::= protected // case 132: { //#line 889 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PROTECTED); break; } // // Rule 133: ConstructorModifier ::= private // case 133: { //#line 894 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PRIVATE); break; } // // Rule 134: ConstructorBody ::= { ExplicitConstructorInvocationopt BlockStatementsopt } // case 134: { //#line 898 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt ExplicitConstructorInvocationopt = (Stmt) getRhsSym(2); //#line 898 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatementsopt = (List) getRhsSym(3); //#line 900 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l; l = new TypedList(new LinkedList(), Stmt.class, false); if (ExplicitConstructorInvocationopt == null) { l.add(nf.SuperCall(pos(), Collections.EMPTY_LIST)); } else { l.add(ExplicitConstructorInvocationopt); } l.addAll(BlockStatementsopt); setResult(nf.Block(pos(), l)); break; } // // Rule 135: Arguments ::= ( ArgumentListopt ) // case 135: { //#line 933 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ArgumentListopt = (List) getRhsSym(2); //#line 935 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ArgumentListopt); break; } // // Rule 138: InterfaceModifiers ::= InterfaceModifiers InterfaceModifier // case 138: { //#line 951 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags InterfaceModifiers = (Flags) getRhsSym(1); //#line 951 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags InterfaceModifier = (Flags) getRhsSym(2); //#line 953 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(InterfaceModifiers.set(InterfaceModifier)); break; } // // Rule 139: InterfaceModifier ::= public // case 139: { //#line 961 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 140: InterfaceModifier ::= protected // case 140: { //#line 966 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PROTECTED); break; } // // Rule 141: InterfaceModifier ::= private // case 141: { //#line 971 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PRIVATE); break; } // // Rule 142: InterfaceModifier ::= abstract // case 142: { //#line 976 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.ABSTRACT); break; } // // Rule 143: InterfaceModifier ::= static // case 143: { //#line 981 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STATIC); break; } // // Rule 144: InterfaceModifier ::= strictfp // case 144: { //#line 986 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STRICTFP); break; } // // Rule 145: ExtendsInterfaces ::= extends InterfaceType // case 145: { //#line 990 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode InterfaceType = (TypeNode) getRhsSym(2); //#line 992 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), TypeNode.class, false); l.add(InterfaceType); setResult(l); break; } // // Rule 146: ExtendsInterfaces ::= ExtendsInterfaces , InterfaceType // case 146: { //#line 997 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ExtendsInterfaces = (List) getRhsSym(1); //#line 997 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode InterfaceType = (TypeNode) getRhsSym(3); //#line 999 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ExtendsInterfaces.add(InterfaceType); // setResult(ExtendsInterfaces); break; } // // Rule 147: InterfaceBody ::= { InterfaceMemberDeclarationsopt } // case 147: { //#line 1009 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List InterfaceMemberDeclarationsopt = (List) getRhsSym(2); //#line 1011 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.ClassBody(pos(), InterfaceMemberDeclarationsopt)); break; } // // Rule 149: InterfaceMemberDeclarations ::= InterfaceMemberDeclarations InterfaceMemberDeclaration // case 149: { //#line 1016 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List InterfaceMemberDeclarations = (List) getRhsSym(1); //#line 1016 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List InterfaceMemberDeclaration = (List) getRhsSym(2); //#line 1018 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" InterfaceMemberDeclarations.addAll(InterfaceMemberDeclaration); // setResult(l); break; } // // Rule 151: InterfaceMemberDeclaration ::= AbstractMethodDeclaration // case 151: { //#line 1024 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" MethodDecl AbstractMethodDeclaration = (MethodDecl) getRhsSym(1); //#line 1026 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(AbstractMethodDeclaration); setResult(l); break; } // // Rule 152: InterfaceMemberDeclaration ::= ClassDeclaration // case 152: { //#line 1031 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl ClassDeclaration = (ClassDecl) getRhsSym(1); //#line 1033 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(ClassDeclaration); setResult(l); break; } // // Rule 153: InterfaceMemberDeclaration ::= InterfaceDeclaration // case 153: { //#line 1038 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl InterfaceDeclaration = (ClassDecl) getRhsSym(1); //#line 1040 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); l.add(InterfaceDeclaration); setResult(l); break; } // // Rule 154: InterfaceMemberDeclaration ::= ; // case 154: { //#line 1047 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Collections.EMPTY_LIST); break; } // // Rule 155: ConstantDeclaration ::= ConstantModifiersopt Type VariableDeclarators // case 155: { //#line 1051 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ConstantModifiersopt = (Flags) getRhsSym(1); //#line 1051 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(2); //#line 1051 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List VariableDeclarators = (List) getRhsSym(3); //#line 1053 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ClassMember.class, false); for (Iterator i = VariableDeclarators.iterator(); i.hasNext();) { X10VarDeclarator d = (X10VarDeclarator) i.next(); if (d.hasExplodedVars()) // TODO: Report this exception correctly. throw new Error("Field Declarations may not have exploded variables." + pos()); l.add(nf.FieldDecl(pos(getRhsFirstTokenIndex(2), getRightSpan()), ConstantModifiersopt, nf.array(Type, pos(getRhsFirstTokenIndex(2), getRhsLastTokenIndex(2)), d.dims), d.name, d.init)); } setResult(l); break; } // // Rule 157: ConstantModifiers ::= ConstantModifiers ConstantModifier // case 157: { //#line 1071 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ConstantModifiers = (Flags) getRhsSym(1); //#line 1071 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags ConstantModifier = (Flags) getRhsSym(2); //#line 1073 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ConstantModifiers.set(ConstantModifier)); break; } // // Rule 158: ConstantModifier ::= public // case 158: { //#line 1081 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 159: ConstantModifier ::= static // case 159: { //#line 1086 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.STATIC); break; } // // Rule 160: ConstantModifier ::= final // case 160: { //#line 1091 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.FINAL); break; } // // Rule 162: AbstractMethodModifiers ::= AbstractMethodModifiers AbstractMethodModifier // case 162: { //#line 1098 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags AbstractMethodModifiers = (Flags) getRhsSym(1); //#line 1098 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags AbstractMethodModifier = (Flags) getRhsSym(2); //#line 1100 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(AbstractMethodModifiers.set(AbstractMethodModifier)); break; } // // Rule 163: AbstractMethodModifier ::= public // case 163: { //#line 1108 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.PUBLIC); break; } // // Rule 164: AbstractMethodModifier ::= abstract // case 164: { //#line 1113 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.ABSTRACT); break; } // // Rule 165: SimpleName ::= identifier // case 165: { //#line 1169 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 1171 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 166: ArrayInitializer ::= { VariableInitializersopt ,opt$opt } // case 166: { //#line 1198 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List VariableInitializersopt = (List) getRhsSym(2); //#line 1198 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Object opt = (Object) getRhsSym(3); //#line 1200 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (VariableInitializersopt == null) setResult(nf.ArrayInit(pos())); else setResult(nf.ArrayInit(pos(), VariableInitializersopt)); break; } // // Rule 167: VariableInitializers ::= VariableInitializer // case 167: { //#line 1206 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr VariableInitializer = (Expr) getRhsSym(1); //#line 1208 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Expr.class, false); l.add(VariableInitializer); setResult(l); break; } // // Rule 168: VariableInitializers ::= VariableInitializers , VariableInitializer // case 168: { //#line 1213 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List VariableInitializers = (List) getRhsSym(1); //#line 1213 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr VariableInitializer = (Expr) getRhsSym(3); //#line 1215 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" VariableInitializers.add(VariableInitializer); //setResult(VariableInitializers); break; } // // Rule 169: Block ::= { BlockStatementsopt } // case 169: { //#line 1234 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatementsopt = (List) getRhsSym(2); //#line 1236 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Block(pos(), BlockStatementsopt)); break; } // // Rule 170: BlockStatements ::= BlockStatement // case 170: { //#line 1240 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatement = (List) getRhsSym(1); //#line 1242 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Stmt.class, false); l.addAll(BlockStatement); setResult(l); break; } // // Rule 171: BlockStatements ::= BlockStatements BlockStatement // case 171: { //#line 1247 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatements = (List) getRhsSym(1); //#line 1247 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatement = (List) getRhsSym(2); //#line 1249 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" BlockStatements.addAll(BlockStatement); //setResult(l); break; } // // Rule 173: BlockStatement ::= ClassDeclaration // case 173: { //#line 1255 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ClassDecl ClassDeclaration = (ClassDecl) getRhsSym(1); //#line 1257 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Stmt.class, false); l.add(nf.LocalClassDecl(pos(), ClassDeclaration)); setResult(l); break; } // // Rule 174: BlockStatement ::= Statement // case 174: { //#line 1262 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(1); //#line 1264 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Stmt.class, false); l.add(Statement); setResult(l); break; } // // Rule 176: LocalVariableDeclaration ::= VariableModifiersopt Type VariableDeclarators // case 176: { //#line 1272 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Flags VariableModifiersopt = (Flags) getRhsSym(1); //#line 1272 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(2); //#line 1272 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List VariableDeclarators = (List) getRhsSym(3); //#line 1274 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), LocalDecl.class, false); List s = new TypedList(new LinkedList(), Stmt.class, false); if (VariableDeclarators != null) { for (Iterator i = VariableDeclarators.iterator(); i.hasNext(); ) { X10VarDeclarator d = (X10VarDeclarator) i.next(); d.setFlag(VariableModifiersopt); // use d.flags below and not flags, setFlag may change it. l.add(nf.LocalDecl(d.pos, d.flags, nf.array(Type, pos(d), d.dims), d.name, d.init)); // [IP] TODO: Add X10Local with exploded variables if (d.hasExplodedVars()) s.addAll(X10Formal_c.explode(nf, ts, d.name, pos(d), d.flags, d.names())); } } l.addAll(s); setResult(l); break; } // // Rule 200: IfThenStatement ::= if ( Expression ) Statement // case 200: { //#line 1335 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1335 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(5); //#line 1337 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.If(pos(), Expression, Statement)); break; } // // Rule 201: IfThenElseStatement ::= if ( Expression ) StatementNoShortIf else Statement // case 201: { //#line 1341 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1341 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt StatementNoShortIf = (Stmt) getRhsSym(5); //#line 1341 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(7); //#line 1343 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.If(pos(), Expression, StatementNoShortIf, Statement)); break; } // // Rule 202: IfThenElseStatementNoShortIf ::= if ( Expression ) StatementNoShortIf$true_stmt else StatementNoShortIf$false_stmt // case 202: { //#line 1347 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1347 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt true_stmt = (Stmt) getRhsSym(5); //#line 1347 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt false_stmt = (Stmt) getRhsSym(7); //#line 1349 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.If(pos(), Expression, true_stmt, false_stmt)); break; } // // Rule 203: EmptyStatement ::= ; // case 203: { //#line 1355 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Empty(pos())); break; } // // Rule 204: LabeledStatement ::= identifier : Statement // case 204: { //#line 1359 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 1359 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(3); //#line 1361 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Labeled(pos(), identifier.getIdentifier(), Statement)); break; } // // Rule 205: LabeledStatementNoShortIf ::= identifier : StatementNoShortIf // case 205: { //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt StatementNoShortIf = (Stmt) getRhsSym(3); //#line 1367 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Labeled(pos(), identifier.getIdentifier(), StatementNoShortIf)); break; } // // Rule 206: ExpressionStatement ::= StatementExpression ; // case 206: { //#line 1370 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr StatementExpression = (Expr) getRhsSym(1); //#line 1372 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Eval(pos(), StatementExpression)); break; } // // Rule 214: AssertStatement ::= assert Expression ; // case 214: { //#line 1393 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(2); //#line 1395 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Assert(pos(), Expression)); break; } // // Rule 215: AssertStatement ::= assert Expression$expr1 : Expression$expr2 ; // case 215: { //#line 1398 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr expr1 = (Expr) getRhsSym(2); //#line 1398 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr expr2 = (Expr) getRhsSym(4); //#line 1400 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Assert(pos(), expr1, expr2)); break; } // // Rule 216: SwitchStatement ::= switch ( Expression ) SwitchBlock // case 216: { //#line 1404 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1404 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchBlock = (List) getRhsSym(5); //#line 1406 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Switch(pos(), Expression, SwitchBlock)); break; } // // Rule 217: SwitchBlock ::= { SwitchBlockStatementGroupsopt SwitchLabelsopt } // case 217: { //#line 1410 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchBlockStatementGroupsopt = (List) getRhsSym(2); //#line 1410 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchLabelsopt = (List) getRhsSym(3); //#line 1412 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" SwitchBlockStatementGroupsopt.addAll(SwitchLabelsopt); setResult(SwitchBlockStatementGroupsopt); break; } // // Rule 219: SwitchBlockStatementGroups ::= SwitchBlockStatementGroups SwitchBlockStatementGroup // case 219: { //#line 1418 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchBlockStatementGroups = (List) getRhsSym(1); //#line 1418 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchBlockStatementGroup = (List) getRhsSym(2); //#line 1420 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" SwitchBlockStatementGroups.addAll(SwitchBlockStatementGroup); // setResult(SwitchBlockStatementGroups); break; } // // Rule 220: SwitchBlockStatementGroup ::= SwitchLabels BlockStatements // case 220: { //#line 1425 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchLabels = (List) getRhsSym(1); //#line 1425 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List BlockStatements = (List) getRhsSym(2); //#line 1427 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), SwitchElement.class, false); l.addAll(SwitchLabels); l.add(nf.SwitchBlock(pos(), BlockStatements)); setResult(l); break; } // // Rule 221: SwitchLabels ::= SwitchLabel // case 221: { //#line 1434 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Case SwitchLabel = (Case) getRhsSym(1); //#line 1436 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Case.class, false); l.add(SwitchLabel); setResult(l); break; } // // Rule 222: SwitchLabels ::= SwitchLabels SwitchLabel // case 222: { //#line 1441 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List SwitchLabels = (List) getRhsSym(1); //#line 1441 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Case SwitchLabel = (Case) getRhsSym(2); //#line 1443 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" SwitchLabels.add(SwitchLabel); //setResult(SwitchLabels); break; } // // Rule 223: SwitchLabel ::= case ConstantExpression : // case 223: { //#line 1448 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConstantExpression = (Expr) getRhsSym(2); //#line 1450 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Case(pos(), ConstantExpression)); break; } // // Rule 224: SwitchLabel ::= default : // case 224: { //#line 1457 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Default(pos())); break; } // // Rule 225: WhileStatement ::= while ( Expression ) Statement // case 225: { //#line 1464 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1464 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(5); //#line 1466 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.While(pos(), Expression, Statement)); break; } // // Rule 226: WhileStatementNoShortIf ::= while ( Expression ) StatementNoShortIf // case 226: { //#line 1470 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1470 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt StatementNoShortIf = (Stmt) getRhsSym(5); //#line 1472 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.While(pos(), Expression, StatementNoShortIf)); break; } // // Rule 227: DoStatement ::= do Statement while ( Expression ) ; // case 227: { //#line 1476 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(2); //#line 1476 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(5); //#line 1478 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Do(pos(), Statement, Expression)); break; } // // Rule 230: BasicForStatement ::= for ( ForInitopt ; Expressionopt ; ForUpdateopt ) Statement // case 230: { //#line 1485 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ForInitopt = (List) getRhsSym(3); //#line 1485 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expressionopt = (Expr) getRhsSym(5); //#line 1485 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ForUpdateopt = (List) getRhsSym(7); //#line 1485 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt Statement = (Stmt) getRhsSym(9); //#line 1487 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.For(pos(), ForInitopt, Expressionopt, ForUpdateopt, Statement)); break; } // // Rule 231: ForStatementNoShortIf ::= for ( ForInitopt ; Expressionopt ; ForUpdateopt ) StatementNoShortIf // case 231: { //#line 1491 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ForInitopt = (List) getRhsSym(3); //#line 1491 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expressionopt = (Expr) getRhsSym(5); //#line 1491 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ForUpdateopt = (List) getRhsSym(7); //#line 1491 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Stmt StatementNoShortIf = (Stmt) getRhsSym(9); //#line 1493 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.For(pos(), ForInitopt, Expressionopt, ForUpdateopt, StatementNoShortIf)); break; } // // Rule 233: ForInit ::= LocalVariableDeclaration // case 233: { //#line 1498 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List LocalVariableDeclaration = (List) getRhsSym(1); //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), ForInit.class, false); l.addAll(LocalVariableDeclaration); //setResult(l); break; } // // Rule 235: StatementExpressionList ::= StatementExpression // case 235: { //#line 1508 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr StatementExpression = (Expr) getRhsSym(1); //#line 1510 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Eval.class, false); l.add(nf.Eval(pos(), StatementExpression)); setResult(l); break; } // // Rule 236: StatementExpressionList ::= StatementExpressionList , StatementExpression // case 236: { //#line 1515 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List StatementExpressionList = (List) getRhsSym(1); //#line 1515 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr StatementExpression = (Expr) getRhsSym(3); //#line 1517 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" StatementExpressionList.add(nf.Eval(pos(), StatementExpression)); //setResult(StatementExpressionList); break; } // // Rule 237: BreakStatement ::= break identifieropt ; // case 237: { //#line 1525 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name identifieropt = (Name) getRhsSym(2); //#line 1527 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (identifieropt == null) setResult(nf.Break(pos())); else setResult(nf.Break(pos(), identifieropt.toString())); break; } // // Rule 238: ContinueStatement ::= continue identifieropt ; // case 238: { //#line 1533 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name identifieropt = (Name) getRhsSym(2); //#line 1535 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (identifieropt == null) setResult(nf.Continue(pos())); else setResult(nf.Continue(pos(), identifieropt.toString())); break; } // // Rule 239: ReturnStatement ::= return Expressionopt ; // case 239: { //#line 1541 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expressionopt = (Expr) getRhsSym(2); //#line 1543 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Return(pos(), Expressionopt)); break; } // // Rule 240: ThrowStatement ::= throw Expression ; // case 240: { //#line 1547 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(2); //#line 1549 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Throw(pos(), Expression)); break; } // // Rule 241: TryStatement ::= try Block Catches // case 241: { //#line 1559 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Block = (Block) getRhsSym(2); //#line 1559 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List Catches = (List) getRhsSym(3); //#line 1561 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Try(pos(), Block, Catches)); break; } // // Rule 242: TryStatement ::= try Block Catchesopt Finally // case 242: { //#line 1564 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Block = (Block) getRhsSym(2); //#line 1564 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List Catchesopt = (List) getRhsSym(3); //#line 1564 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Finally = (Block) getRhsSym(4); //#line 1566 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Try(pos(), Block, Catchesopt, Finally)); break; } // // Rule 243: Catches ::= CatchClause // case 243: { //#line 1570 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Catch CatchClause = (Catch) getRhsSym(1); //#line 1572 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Catch.class, false); l.add(CatchClause); setResult(l); break; } // // Rule 244: Catches ::= Catches CatchClause // case 244: { //#line 1577 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List Catches = (List) getRhsSym(1); //#line 1577 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Catch CatchClause = (Catch) getRhsSym(2); //#line 1579 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Catches.add(CatchClause); //setResult(Catches); break; } // // Rule 245: CatchClause ::= catch ( FormalParameter ) Block // case 245: { //#line 1584 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1584 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Block = (Block) getRhsSym(5); //#line 1586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Catch(pos(), FormalParameter, Block)); break; } // // Rule 246: Finally ::= finally Block // case 246: { //#line 1590 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Block Block = (Block) getRhsSym(2); //#line 1592 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Block); break; } // // Rule 250: PrimaryNoNewArray ::= Type . class // case 250: { //#line 1610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1612 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" if (Type instanceof Name) { Name a = (Name) Type; setResult(nf.ClassLit(pos(), a.toType())); } else if (Type instanceof TypeNode) { setResult(nf.ClassLit(pos(), Type)); } else if (Type instanceof CanonicalTypeNode) { CanonicalTypeNode a = (CanonicalTypeNode) Type; setResult(nf.ClassLit(pos(), a)); } else assert(false); break; } // // Rule 251: PrimaryNoNewArray ::= void . class // case 251: { //#line 1631 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.ClassLit(pos(), nf.CanonicalTypeNode(pos(getLeftSpan()), ts.Void()))); break; } // // Rule 252: PrimaryNoNewArray ::= this // case 252: { //#line 1637 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.This(pos())); break; } // // Rule 253: PrimaryNoNewArray ::= ClassName . this // case 253: { //#line 1640 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name ClassName = (Name) getRhsSym(1); //#line 1642 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.This(pos(), ClassName.toType())); break; } // // Rule 254: PrimaryNoNewArray ::= ( Expression ) // case 254: { //#line 1645 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(2); //#line 1647 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.ParExpr(pos(), Expression)); break; } // // Rule 259: Literal ::= IntegerLiteral$IntegerLiteral // case 259: { //#line 1655 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken IntegerLiteral = (IToken) getRhsIToken(1); //#line 1657 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.IntegerLiteral a = int_lit(getRhsFirstTokenIndex(1)); setResult(nf.IntLit(pos(), IntLit.INT, a.getValue().intValue())); break; } // // Rule 260: Literal ::= LongLiteral$LongLiteral // case 260: { //#line 1661 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken LongLiteral = (IToken) getRhsIToken(1); //#line 1663 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.LongLiteral a = long_lit(getRhsFirstTokenIndex(1)); setResult(nf.IntLit(pos(), IntLit.LONG, a.getValue().longValue())); break; } // // Rule 261: Literal ::= FloatingPointLiteral$FloatLiteral // case 261: { //#line 1667 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken FloatLiteral = (IToken) getRhsIToken(1); //#line 1669 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.FloatLiteral a = float_lit(getRhsFirstTokenIndex(1)); setResult(nf.FloatLit(pos(), FloatLit.FLOAT, a.getValue().floatValue())); break; } // // Rule 262: Literal ::= DoubleLiteral$DoubleLiteral // case 262: { //#line 1673 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken DoubleLiteral = (IToken) getRhsIToken(1); //#line 1675 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.DoubleLiteral a = double_lit(getRhsFirstTokenIndex(1)); setResult(nf.FloatLit(pos(), FloatLit.DOUBLE, a.getValue().doubleValue())); break; } // // Rule 263: Literal ::= BooleanLiteral // case 263: { //#line 1679 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.BooleanLiteral BooleanLiteral = (polyglot.lex.BooleanLiteral) getRhsSym(1); //#line 1681 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.BooleanLit(pos(), BooleanLiteral.getValue().booleanValue())); break; } // // Rule 264: Literal ::= CharacterLiteral$CharacterLiteral // case 264: { //#line 1684 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken CharacterLiteral = (IToken) getRhsIToken(1); //#line 1686 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.CharacterLiteral a = char_lit(getRhsFirstTokenIndex(1)); setResult(nf.CharLit(pos(), a.getValue().charValue())); break; } // // Rule 265: Literal ::= StringLiteral$str // case 265: { //#line 1690 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken str = (IToken) getRhsIToken(1); //#line 1692 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.StringLiteral a = string_lit(getRhsFirstTokenIndex(1)); setResult(nf.StringLit(pos(), a.getValue())); break; } // // Rule 266: Literal ::= null // case 266: { //#line 1698 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.NullLit(pos())); break; } // // Rule 267: BooleanLiteral ::= true$trueLiteral // case 267: { //#line 1702 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken trueLiteral = (IToken) getRhsIToken(1); //#line 1704 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(boolean_lit(getRhsFirstTokenIndex(1))); break; } // // Rule 268: BooleanLiteral ::= false$falseLiteral // case 268: { //#line 1707 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken falseLiteral = (IToken) getRhsIToken(1); //#line 1709 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(boolean_lit(getRhsFirstTokenIndex(1))); break; } // // Rule 269: ArgumentList ::= Expression // case 269: { //#line 1722 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(1); //#line 1724 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Expr.class, false); l.add(Expression); setResult(l); break; } // // Rule 270: ArgumentList ::= ArgumentList , Expression // case 270: { //#line 1729 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ArgumentList = (List) getRhsSym(1); //#line 1729 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 1731 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" ArgumentList.add(Expression); //setResult(ArgumentList); break; } // // Rule 271: DimExprs ::= DimExpr // case 271: { //#line 1765 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr DimExpr = (Expr) getRhsSym(1); //#line 1767 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List l = new TypedList(new LinkedList(), Expr.class, false); l.add(DimExpr); setResult(l); break; } // // Rule 272: DimExprs ::= DimExprs DimExpr // case 272: { //#line 1772 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List DimExprs = (List) getRhsSym(1); //#line 1772 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr DimExpr = (Expr) getRhsSym(2); //#line 1774 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" DimExprs.add(DimExpr); //setResult(DimExprs); break; } // // Rule 273: DimExpr ::= [ Expression ] // case 273: { //#line 1779 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(2); //#line 1781 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Expression.position(pos())); break; } // // Rule 274: Dims ::= [ ] // case 274: { //#line 1787 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Integer(1)); break; } // // Rule 275: Dims ::= Dims [ ] // case 275: { //#line 1790 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Integer Dims = (Integer) getRhsSym(1); //#line 1792 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Integer(Dims.intValue() + 1)); break; } // // Rule 276: FieldAccess ::= Primary . identifier // case 276: { //#line 1796 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Primary = (Expr) getRhsSym(1); //#line 1796 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1798 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Field(pos(), Primary, identifier.getIdentifier())); break; } // // Rule 277: FieldAccess ::= super . identifier // case 277: { //#line 1801 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1803 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getLeftSpan())), identifier.getIdentifier())); break; } // // Rule 278: FieldAccess ::= ClassName . super$sup . identifier // case 278: { //#line 1806 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name ClassName = (Name) getRhsSym(1); //#line 1806 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" IToken sup = (IToken) getRhsIToken(3); //#line 1806 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(5); //#line 1808 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getRhsFirstTokenIndex(3)), ClassName.toType()), identifier.getIdentifier())); break; } // // Rule 279: MethodInvocation ::= MethodName ( ArgumentListopt ) // case 279: { //#line 1812 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name MethodName = (Name) getRhsSym(1); //#line 1812 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" List ArgumentListopt = (List) getRhsSym(3); //#line 1814 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Call(pos(), MethodName.prefix == null ? null : MethodName.prefix.toReceiver(), MethodName.name, ArgumentListopt)); break; } // // Rule 281: PostfixExpression ::= ExpressionName // case 281: { //#line 1837 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name ExpressionName = (Name) getRhsSym(1); //#line 1839 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ExpressionName.toExpr()); break; } // // Rule 284: PostIncrementExpression ::= PostfixExpression ++ // case 284: { //#line 1845 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr PostfixExpression = (Expr) getRhsSym(1); //#line 1847 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), PostfixExpression, Unary.POST_INC)); break; } // // Rule 285: PostDecrementExpression ::= PostfixExpression -- // case 285: { //#line 1851 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr PostfixExpression = (Expr) getRhsSym(1); //#line 1853 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), PostfixExpression, Unary.POST_DEC)); break; } // // Rule 288: UnaryExpression ::= + UnaryExpression // case 288: { //#line 1859 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1861 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.POS, UnaryExpression)); break; } // // Rule 289: UnaryExpression ::= - UnaryExpression // case 289: { //#line 1864 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1866 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.NEG, UnaryExpression)); break; } // // Rule 291: PreIncrementExpression ::= ++ UnaryExpression // case 291: { //#line 1871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1873 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.PRE_INC, UnaryExpression)); break; } // // Rule 292: PreDecrementExpression ::= -- UnaryExpression // case 292: { //#line 1877 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1879 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.PRE_DEC, UnaryExpression)); break; } // // Rule 294: UnaryExpressionNotPlusMinus ::= ~ UnaryExpression // case 294: { //#line 1884 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1886 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.BIT_NOT, UnaryExpression)); break; } // // Rule 295: UnaryExpressionNotPlusMinus ::= ! UnaryExpression // case 295: { //#line 1889 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(2); //#line 1891 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Unary(pos(), Unary.NOT, UnaryExpression)); break; } // // Rule 298: MultiplicativeExpression ::= MultiplicativeExpression * UnaryExpression // case 298: { //#line 1903 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr MultiplicativeExpression = (Expr) getRhsSym(1); //#line 1903 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(3); //#line 1905 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), MultiplicativeExpression, Binary.MUL, UnaryExpression)); break; } // // Rule 299: MultiplicativeExpression ::= MultiplicativeExpression / UnaryExpression // case 299: { //#line 1908 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr MultiplicativeExpression = (Expr) getRhsSym(1); //#line 1908 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(3); //#line 1910 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), MultiplicativeExpression, Binary.DIV, UnaryExpression)); break; } // // Rule 300: MultiplicativeExpression ::= MultiplicativeExpression % UnaryExpression // case 300: { //#line 1913 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr MultiplicativeExpression = (Expr) getRhsSym(1); //#line 1913 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr UnaryExpression = (Expr) getRhsSym(3); //#line 1915 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), MultiplicativeExpression, Binary.MOD, UnaryExpression)); break; } // // Rule 302: AdditiveExpression ::= AdditiveExpression + MultiplicativeExpression // case 302: { //#line 1920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AdditiveExpression = (Expr) getRhsSym(1); //#line 1920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr MultiplicativeExpression = (Expr) getRhsSym(3); //#line 1922 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), AdditiveExpression, Binary.ADD, MultiplicativeExpression)); break; } // // Rule 303: AdditiveExpression ::= AdditiveExpression - MultiplicativeExpression // case 303: { //#line 1925 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AdditiveExpression = (Expr) getRhsSym(1); //#line 1925 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr MultiplicativeExpression = (Expr) getRhsSym(3); //#line 1927 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), AdditiveExpression, Binary.SUB, MultiplicativeExpression)); break; } // // Rule 305: ShiftExpression ::= ShiftExpression << AdditiveExpression // case 305: { //#line 1932 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(1); //#line 1932 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AdditiveExpression = (Expr) getRhsSym(3); //#line 1934 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), ShiftExpression, Binary.SHL, AdditiveExpression)); break; } // // Rule 306: ShiftExpression ::= ShiftExpression > > AdditiveExpression // case 306: { //#line 1937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(1); //#line 1937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AdditiveExpression = (Expr) getRhsSym(4); //#line 1939 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // TODO: make sure that there is no space after the ">" signs setResult(nf.Binary(pos(), ShiftExpression, Binary.SHR, AdditiveExpression)); break; } // // Rule 307: ShiftExpression ::= ShiftExpression > > > AdditiveExpression // case 307: { //#line 1943 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(1); //#line 1943 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AdditiveExpression = (Expr) getRhsSym(5); //#line 1945 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // TODO: make sure that there is no space after the ">" signs setResult(nf.Binary(pos(), ShiftExpression, Binary.USHR, AdditiveExpression)); break; } // // Rule 309: RelationalExpression ::= RelationalExpression < ShiftExpression // case 309: { //#line 1951 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(1); //#line 1951 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(3); //#line 1953 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), RelationalExpression, Binary.LT, ShiftExpression)); break; } // // Rule 310: RelationalExpression ::= RelationalExpression > ShiftExpression // case 310: { //#line 1956 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(1); //#line 1956 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(3); //#line 1958 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), RelationalExpression, Binary.GT, ShiftExpression)); break; } // // Rule 311: RelationalExpression ::= RelationalExpression <= ShiftExpression // case 311: { //#line 1961 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(1); //#line 1961 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(3); //#line 1963 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), RelationalExpression, Binary.LE, ShiftExpression)); break; } // // Rule 312: RelationalExpression ::= RelationalExpression > = ShiftExpression // case 312: { //#line 1966 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(1); //#line 1966 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ShiftExpression = (Expr) getRhsSym(4); //#line 1968 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // TODO: make sure that there is no space after the ">" signs setResult(nf.Binary(pos(), RelationalExpression, Binary.GE, ShiftExpression)); break; } // // Rule 314: EqualityExpression ::= EqualityExpression == RelationalExpression // case 314: { //#line 1982 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr EqualityExpression = (Expr) getRhsSym(1); //#line 1982 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(3); //#line 1984 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), EqualityExpression, Binary.EQ, RelationalExpression)); break; } // // Rule 315: EqualityExpression ::= EqualityExpression != RelationalExpression // case 315: { //#line 1987 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr EqualityExpression = (Expr) getRhsSym(1); //#line 1987 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr RelationalExpression = (Expr) getRhsSym(3); //#line 1989 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), EqualityExpression, Binary.NE, RelationalExpression)); break; } // // Rule 317: AndExpression ::= AndExpression & EqualityExpression // case 317: { //#line 1994 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AndExpression = (Expr) getRhsSym(1); //#line 1994 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr EqualityExpression = (Expr) getRhsSym(3); //#line 1996 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), AndExpression, Binary.BIT_AND, EqualityExpression)); break; } // // Rule 319: ExclusiveOrExpression ::= ExclusiveOrExpression ^ AndExpression // case 319: { //#line 2001 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ExclusiveOrExpression = (Expr) getRhsSym(1); //#line 2001 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AndExpression = (Expr) getRhsSym(3); //#line 2003 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), ExclusiveOrExpression, Binary.BIT_XOR, AndExpression)); break; } // // Rule 321: InclusiveOrExpression ::= InclusiveOrExpression | ExclusiveOrExpression // case 321: { //#line 2008 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr InclusiveOrExpression = (Expr) getRhsSym(1); //#line 2008 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ExclusiveOrExpression = (Expr) getRhsSym(3); //#line 2010 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), InclusiveOrExpression, Binary.BIT_OR, ExclusiveOrExpression)); break; } // // Rule 323: ConditionalAndExpression ::= ConditionalAndExpression && InclusiveOrExpression // case 323: { //#line 2015 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConditionalAndExpression = (Expr) getRhsSym(1); //#line 2015 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr InclusiveOrExpression = (Expr) getRhsSym(3); //#line 2017 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), ConditionalAndExpression, Binary.COND_AND, InclusiveOrExpression)); break; } // // Rule 325: ConditionalOrExpression ::= ConditionalOrExpression || ConditionalAndExpression // case 325: { //#line 2022 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConditionalOrExpression = (Expr) getRhsSym(1); //#line 2022 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConditionalAndExpression = (Expr) getRhsSym(3); //#line 2024 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Binary(pos(), ConditionalOrExpression, Binary.COND_OR, ConditionalAndExpression)); break; } // // Rule 327: ConditionalExpression ::= ConditionalOrExpression ? Expression : ConditionalExpression // case 327: { //#line 2029 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConditionalOrExpression = (Expr) getRhsSym(1); //#line 2029 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr Expression = (Expr) getRhsSym(3); //#line 2029 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr ConditionalExpression = (Expr) getRhsSym(5); //#line 2031 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Conditional(pos(), ConditionalOrExpression, Expression, ConditionalExpression)); break; } // // Rule 330: Assignment ::= LeftHandSide AssignmentOperator AssignmentExpression // case 330: { //#line 2038 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr LeftHandSide = (Expr) getRhsSym(1); //#line 2038 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Assign.Operator AssignmentOperator = (Assign.Operator) getRhsSym(2); //#line 2038 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Expr AssignmentExpression = (Expr) getRhsSym(3); //#line 2040 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(nf.Assign(pos(), LeftHandSide, AssignmentOperator, AssignmentExpression)); break; } // // Rule 331: LeftHandSide ::= ExpressionName // case 331: { //#line 2044 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" Name ExpressionName = (Name) getRhsSym(1); //#line 2046 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(ExpressionName.toExpr()); break; } // // Rule 334: AssignmentOperator ::= = // case 334: { //#line 2054 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.ASSIGN); break; } // // Rule 335: AssignmentOperator ::= *= // case 335: { //#line 2059 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.MUL_ASSIGN); break; } // // Rule 336: AssignmentOperator ::= /= // case 336: { //#line 2064 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.DIV_ASSIGN); break; } // // Rule 337: AssignmentOperator ::= %= // case 337: { //#line 2069 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.MOD_ASSIGN); break; } // // Rule 338: AssignmentOperator ::= += // case 338: { //#line 2074 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.ADD_ASSIGN); break; } // // Rule 339: AssignmentOperator ::= -= // case 339: { //#line 2079 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.SUB_ASSIGN); break; } // // Rule 340: AssignmentOperator ::= <<= // case 340: { //#line 2084 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.SHL_ASSIGN); break; } // // Rule 341: AssignmentOperator ::= > > = // case 341: { //#line 2089 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // TODO: make sure that there is no space after the ">" signs setResult(Assign.SHR_ASSIGN); break; } // // Rule 342: AssignmentOperator ::= > > > = // case 342: { //#line 2095 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" // TODO: make sure that there is no space after the ">" signs setResult(Assign.USHR_ASSIGN); break; } // // Rule 343: AssignmentOperator ::= &= // case 343: { //#line 2101 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.BIT_AND_ASSIGN); break; } // // Rule 344: AssignmentOperator ::= ^= // case 344: { //#line 2106 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.BIT_XOR_ASSIGN); break; } // // Rule 345: AssignmentOperator ::= |= // case 345: { //#line 2111 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Assign.BIT_OR_ASSIGN); break; } // // Rule 348: Dimsopt ::= $Empty // case 348: { //#line 2124 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Integer(0)); break; } // // Rule 350: Catchesopt ::= $Empty // case 350: { //#line 2131 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Catch.class, false)); break; } // // Rule 352: identifieropt ::= $Empty // case 352: setResult(null); break; // // Rule 353: identifieropt ::= identifier // case 353: { //#line 2138 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 2140 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 354: ForUpdateopt ::= $Empty // case 354: { //#line 2146 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), ForUpdate.class, false)); break; } // // Rule 356: Expressionopt ::= $Empty // case 356: setResult(null); break; // // Rule 358: ForInitopt ::= $Empty // case 358: { //#line 2157 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), ForInit.class, false)); break; } // // Rule 360: SwitchLabelsopt ::= $Empty // case 360: { //#line 2164 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Case.class, false)); break; } // // Rule 362: SwitchBlockStatementGroupsopt ::= $Empty // case 362: { //#line 2171 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), SwitchElement.class, false)); break; } // // Rule 364: VariableModifiersopt ::= $Empty // case 364: { //#line 2178 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 366: VariableInitializersopt ::= $Empty // case 366: setResult(null); break; // // Rule 368: AbstractMethodModifiersopt ::= $Empty // case 368: { //#line 2208 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 370: ConstantModifiersopt ::= $Empty // case 370: { //#line 2215 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 372: InterfaceMemberDeclarationsopt ::= $Empty // case 372: { //#line 2222 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), ClassMember.class, false)); break; } // // Rule 374: ExtendsInterfacesopt ::= $Empty // case 374: { //#line 2229 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), TypeNode.class, false)); break; } // // Rule 376: InterfaceModifiersopt ::= $Empty // case 376: { //#line 2236 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 378: ClassBodyopt ::= $Empty // case 378: setResult(null); break; // // Rule 380: Argumentsopt ::= $Empty // case 380: setResult(null); break; // // Rule 381: Argumentsopt ::= Arguments // case 381: throw new Error("No action specified for rule " + 381); // // Rule 382: ,opt ::= $Empty // case 382: setResult(null); break; // // Rule 384: ArgumentListopt ::= $Empty // case 384: { //#line 2266 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Catch.class, false)); break; } // // Rule 386: BlockStatementsopt ::= $Empty // case 386: { //#line 2273 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Stmt.class, false)); break; } // // Rule 388: ExplicitConstructorInvocationopt ::= $Empty // case 388: setResult(null); break; // // Rule 390: ConstructorModifiersopt ::= $Empty // case 390: { //#line 2284 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 392: ...opt ::= $Empty // case 392: setResult(null); break; // // Rule 394: FormalParameterListopt ::= $Empty // case 394: { //#line 2295 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Formal.class, false)); break; } // // Rule 396: Throwsopt ::= $Empty // case 396: { //#line 2302 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), TypeNode.class, false)); break; } // // Rule 398: MethodModifiersopt ::= $Empty // case 398: { //#line 2309 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 400: FieldModifiersopt ::= $Empty // case 400: { //#line 2316 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 402: ClassBodyDeclarationsopt ::= $Empty // case 402: { //#line 2323 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), ClassMember.class, false)); break; } // // Rule 404: Interfacesopt ::= $Empty // case 404: { //#line 2330 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), TypeNode.class, false)); break; } // // Rule 406: Superopt ::= $Empty // case 406: { //#line 2337 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new Name(nf, ts, pos(), "x10.lang.Object").toType()); break; } // // Rule 408: ClassModifiersopt ::= $Empty // case 408: { //#line 2348 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(Flags.NONE); break; } // // Rule 410: TypeDeclarationsopt ::= $Empty // case 410: { //#line 2360 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), TopLevelDecl.class, false)); break; } // // Rule 412: ImportDeclarationsopt ::= $Empty // case 412: { //#line 2367 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/GJavaParserForX10.gi" setResult(new TypedList(new LinkedList(), Import.class, false)); break; } // // Rule 414: PackageDeclarationopt ::= $Empty // case 414: setResult(null); break; // // Rule 416: ClassType ::= TypeName DepParametersopt PlaceTypeSpecifieropt // case 416: { //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name TypeName = (Name) getRhsSym(1); //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object PlaceTypeSpecifieropt = (Object) getRhsSym(3); //#line 725 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DepParametersopt == null ? TypeName.toType() : ((X10TypeNode) TypeName.toType()).dep(null, DepParametersopt)); break; } // // Rule 417: InterfaceType ::= TypeName DepParametersopt PlaceTypeSpecifieropt // case 417: { //#line 732 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name TypeName = (Name) getRhsSym(1); //#line 732 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 732 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object PlaceTypeSpecifieropt = (Object) getRhsSym(3); //#line 734 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DepParametersopt == null ? TypeName.toType() : ((X10TypeNode) TypeName.toType()).dep(null, DepParametersopt)); break; } // // Rule 418: PackageDeclaration ::= package PackageName ; // case 418: { //#line 740 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name PackageName = (Name) getRhsSym(2); //#line 742 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(PackageName.toPackage()); break; } // // Rule 419: NormalClassDeclaration ::= X10ClassModifiersopt class identifier PropertyListopt Superopt Interfacesopt ClassBody // case 419: { //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags X10ClassModifiersopt = (X10Flags) getRhsSym(1); //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] PropertyListopt = (Object[]) getRhsSym(4); //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Superopt = (TypeNode) getRhsSym(5); //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Interfacesopt = (List) getRhsSym(6); //#line 746 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBody = (ClassBody) getRhsSym(7); //#line 748 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" checkTypeName(identifier); List/*<PropertyDecl>*/ props = PropertyListopt == null ? null : (List) PropertyListopt[0]; Expr ci = PropertyListopt == null ? null : (Expr) PropertyListopt[1]; setResult(X10Flags.isValue(X10ClassModifiersopt) ? nf.ValueClassDecl(pos(), X10ClassModifiersopt, identifier.getIdentifier(), props, ci, Superopt, Interfacesopt, ClassBody) : nf.ClassDecl(pos(), X10ClassModifiersopt, identifier.getIdentifier(), props, ci, Superopt, Interfacesopt, ClassBody)); break; } // // Rule 421: X10ClassModifiers ::= X10ClassModifiers X10ClassModifier // case 421: { //#line 761 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags X10ClassModifiers = (X10Flags) getRhsSym(1); //#line 761 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags X10ClassModifier = (X10Flags) getRhsSym(2); //#line 763 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags result = X10ClassModifiers.setX(X10ClassModifier); setResult(result); break; } // // Rule 422: X10ClassModifier ::= ClassModifier // case 422: { //#line 769 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags ClassModifier = (Flags) getRhsSym(1); //#line 771 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.toX10Flags(ClassModifier)); break; } // // Rule 423: X10ClassModifier ::= safe // case 423: { //#line 776 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.SAFE); break; } // // Rule 424: PropertyList ::= ( Properties WhereClauseopt ) // case 424: { //#line 780 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Properties = (List) getRhsSym(2); //#line 780 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClauseopt = (Expr) getRhsSym(3); //#line 782 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] result = new Object[2]; result[0] = Properties; result[1] = WhereClauseopt; setResult(result); break; } // // Rule 425: PropertyList ::= ( WhereClause ) // case 425: { //#line 787 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClause = (Expr) getRhsSym(2); //#line 789 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] result = new Object[2]; result[0] = null; result[1] = WhereClause; setResult(result); break; } // // Rule 426: Properties ::= Property // case 426: { //#line 796 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" PropertyDecl Property = (PropertyDecl) getRhsSym(1); //#line 798 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List l = new TypedList(new LinkedList(), PropertyDecl.class, false); l.add(Property); setResult(l); break; } // // Rule 427: Properties ::= Properties , Property // case 427: { //#line 803 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Properties = (List) getRhsSym(1); //#line 803 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" PropertyDecl Property = (PropertyDecl) getRhsSym(3); //#line 805 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Properties.add(Property); // setResult(FormalParameters); break; } // // Rule 428: Property ::= Type identifier // case 428: { //#line 811 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 811 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(2); //#line 813 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.PropertyDecl(pos(), Flags.PUBLIC.Final(), Type, identifier.getIdentifier())); break; } // // Rule 429: MethodDeclaration ::= ThisClauseopt MethodModifiersopt ResultType MethodDeclarator Throwsopt MethodBody // case 429: { //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr ThisClauseopt = (DepParameterExpr) getRhsSym(1); //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags MethodModifiersopt = (Flags) getRhsSym(2); //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ResultType = (TypeNode) getRhsSym(3); //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] MethodDeclarator = (Object[]) getRhsSym(4); //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Throwsopt = (List) getRhsSym(5); //#line 826 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Block MethodBody = (Block) getRhsSym(6); //#line 828 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name c = (MethodDeclarator != null) ? (Name) MethodDeclarator[0] : null; List d = (MethodDeclarator != null) ? (List) MethodDeclarator[1] : null; Integer e = (MethodDeclarator != null) ? (Integer) MethodDeclarator[2] : null; Expr where = (MethodDeclarator != null) ? (Expr) MethodDeclarator[3] : null; if (ResultType.type() == ts.Void() && e != null && e.intValue() > 0) { // TODO: error!!! System.err.println("Fix me - encountered method returning void but with non-zero rank?"); } setResult(nf.MethodDecl(pos(getRhsFirstTokenIndex(3), getRhsLastTokenIndex(4)), ThisClauseopt, MethodModifiersopt, nf.array((TypeNode) ResultType, pos(getRhsFirstTokenIndex(3), getRhsLastTokenIndex(3)), e != null ? e.intValue() : 1), c != null ? c.toString() : "", d, where, Throwsopt, MethodBody)); break; } // // Rule 430: ExplicitConstructorInvocation ::= this ( ArgumentListopt ) ; // case 430: { //#line 850 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(3); //#line 852 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ThisCall(pos(), ArgumentListopt)); break; } // // Rule 431: ExplicitConstructorInvocation ::= super ( ArgumentListopt ) ; // case 431: { //#line 855 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(3); //#line 857 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.SuperCall(pos(), ArgumentListopt)); break; } // // Rule 432: ExplicitConstructorInvocation ::= Primary . this ( ArgumentListopt ) ; // case 432: { //#line 860 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Primary = (Expr) getRhsSym(1); //#line 860 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(5); //#line 862 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ThisCall(pos(), Primary, ArgumentListopt)); break; } // // Rule 433: ExplicitConstructorInvocation ::= Primary . super ( ArgumentListopt ) ; // case 433: { //#line 865 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Primary = (Expr) getRhsSym(1); //#line 865 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(5); //#line 867 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.SuperCall(pos(), Primary, ArgumentListopt)); break; } // // Rule 434: NormalInterfaceDeclaration ::= InterfaceModifiersopt interface identifier PropertyListopt ExtendsInterfacesopt InterfaceBody // case 434: { //#line 871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags InterfaceModifiersopt = (Flags) getRhsSym(1); //#line 871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] PropertyListopt = (Object[]) getRhsSym(4); //#line 871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ExtendsInterfacesopt = (List) getRhsSym(5); //#line 871 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody InterfaceBody = (ClassBody) getRhsSym(6); //#line 873 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" checkTypeName(identifier); List/*<PropertyDecl>*/ props = PropertyListopt == null ? null : (List) PropertyListopt[0]; Expr ci = PropertyListopt == null ? null : (Expr) PropertyListopt[1]; setResult(nf.ClassDecl(pos(), InterfaceModifiersopt.Interface(), identifier.getIdentifier(), props, ci, null, ExtendsInterfacesopt, InterfaceBody)); break; } // // Rule 435: AbstractMethodDeclaration ::= ThisClauseopt AbstractMethodModifiersopt ResultType MethodDeclarator Throwsopt ; // case 435: { //#line 888 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr ThisClauseopt = (DepParameterExpr) getRhsSym(1); //#line 888 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags AbstractMethodModifiersopt = (Flags) getRhsSym(2); //#line 888 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ResultType = (TypeNode) getRhsSym(3); //#line 888 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] MethodDeclarator = (Object[]) getRhsSym(4); //#line 888 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Throwsopt = (List) getRhsSym(5); //#line 890 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name c = (Name) MethodDeclarator[0]; List d = (List) MethodDeclarator[1]; Integer e = (Integer) MethodDeclarator[2]; Expr where = (Expr) MethodDeclarator[3]; if (ResultType.type() == ts.Void() && e.intValue() > 0) { // TODO: error!!! assert(false); } setResult(nf.MethodDecl(pos(getRhsFirstTokenIndex(3), getRhsLastTokenIndex(4)), ThisClauseopt, AbstractMethodModifiersopt , nf.array((TypeNode) ResultType, pos(getRhsFirstTokenIndex(3), getRhsLastTokenIndex(3)), e.intValue()), c.toString(), d, where, Throwsopt, null)); break; } // // Rule 436: ClassInstanceCreationExpression ::= new ClassOrInterfaceType ( ArgumentListopt ) ClassBodyopt // case 436: { //#line 913 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ClassOrInterfaceType = (TypeNode) getRhsSym(2); //#line 913 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(4); //#line 913 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBodyopt = (ClassBody) getRhsSym(6); //#line 915 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" if (ClassBodyopt == null) setResult(nf.New(pos(), ClassOrInterfaceType, ArgumentListopt)); else setResult(nf.New(pos(), ClassOrInterfaceType, ArgumentListopt, ClassBodyopt)); break; } // // Rule 437: ClassInstanceCreationExpression ::= Primary . new identifier ( ArgumentListopt ) ClassBodyopt // case 437: { //#line 920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Primary = (Expr) getRhsSym(1); //#line 920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(4); //#line 920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(6); //#line 920 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBodyopt = (ClassBody) getRhsSym(8); //#line 922 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name b = new Name(nf, ts, pos(), identifier.getIdentifier()); if (ClassBodyopt == null) setResult(nf.New(pos(), Primary, b.toType(), ArgumentListopt)); else setResult(nf.New(pos(), Primary, b.toType(), ArgumentListopt, ClassBodyopt)); break; } // // Rule 438: ClassInstanceCreationExpression ::= AmbiguousName . new identifier ( ArgumentListopt ) ClassBodyopt // case 438: { //#line 928 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name AmbiguousName = (Name) getRhsSym(1); //#line 928 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(4); //#line 928 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(6); //#line 928 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBodyopt = (ClassBody) getRhsSym(8); //#line 930 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name b = new Name(nf, ts, pos(), identifier.getIdentifier()); if (ClassBodyopt == null) setResult(nf.New(pos(), AmbiguousName.toExpr(), b.toType(), ArgumentListopt)); else setResult(nf.New(pos(), AmbiguousName.toExpr(), b.toType(), ArgumentListopt, ClassBodyopt)); break; } // // Rule 439: MethodInvocation ::= Primary . identifier ( ArgumentListopt ) // case 439: { //#line 937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Primary = (Expr) getRhsSym(1); //#line 937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(5); //#line 939 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Call(pos(), Primary, identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 440: MethodInvocation ::= super . identifier ( ArgumentListopt ) // case 440: { //#line 942 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 942 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(5); //#line 944 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Call(pos(), nf.Super(pos(getLeftSpan())), identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 441: MethodInvocation ::= ClassName . super$sup . identifier ( ArgumentListopt ) // case 441: { //#line 947 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name ClassName = (Name) getRhsSym(1); //#line 947 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IToken sup = (IToken) getRhsIToken(3); //#line 947 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(5); //#line 947 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentListopt = (List) getRhsSym(7); //#line 949 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Call(pos(), nf.Super(pos(getRhsFirstTokenIndex(3)), ClassName.toType()), identifier.getIdentifier(), ArgumentListopt)); break; } // // Rule 443: AssignPropertyCall ::= property ( ArgumentList ) // case 443: { //#line 954 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentList = (List) getRhsSym(3); //#line 956 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.AssignPropertyCall(pos(), ArgumentList)); break; } // // Rule 444: Type ::= DataType // case 444: { //#line 965 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode DataType = (TypeNode) getRhsSym(1); //#line 967 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DataType); break; } // // Rule 445: Type ::= nullable < Type > DepParametersopt // case 445: { //#line 970 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 970 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(5); //#line 972 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10TypeNode t = nf.Nullable(pos(), Type); setResult(DepParametersopt == null ? t : t.dep(null, DepParametersopt)); break; } // // Rule 446: Type ::= future < Type > // case 446: { //#line 978 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 980 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Future(pos(), Type)); break; } // // Rule 450: PrimitiveType ::= NumericType DepParametersopt // case 450: { //#line 995 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode NumericType = (TypeNode) getRhsSym(1); //#line 995 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 997 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // System.out.println("Parser: parsed PrimitiveType |" + NumericType + "| |" + DepParametersopt +"|"); setResult(DepParametersopt == null ? NumericType : ((X10TypeNode) NumericType).dep(null, DepParametersopt)); break; } // // Rule 451: PrimitiveType ::= boolean DepParametersopt // case 451: { //#line 1003 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 1005 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10TypeNode res = (X10TypeNode) nf.CanonicalTypeNode(pos(), ts.Boolean()); setResult(DepParametersopt==null ? res : res.dep(null, DepParametersopt)); break; } // // Rule 456: ClassOrInterfaceType ::= TypeName DepParametersopt PlaceTypeSpecifieropt // case 456: { //#line 1017 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name TypeName = (Name) getRhsSym(1); //#line 1017 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 1017 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object PlaceTypeSpecifieropt = (Object) getRhsSym(3); //#line 1019 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10TypeNode type; if (ts.isPrimitiveTypeName(TypeName.name)) { try { type= (X10TypeNode) nf.CanonicalTypeNode(pos(), ts.primitiveForName(TypeName.name)); } catch (SemanticException e) { throw new InternalCompilerError("Unable to create primitive type for '" + TypeName.name + "'!"); } } else type= (X10TypeNode) TypeName.toType(); // System.out.println("Parser: parsed ClassOrInterfaceType |" + TypeName + "| |" + DepParametersopt +"|"); setResult(DepParametersopt == null ? type : type.dep(null, DepParametersopt)); break; } // // Rule 457: DepParameters ::= ( DepParameterExpr ) // case 457: { //#line 1036 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParameterExpr = (DepParameterExpr) getRhsSym(2); //#line 1038 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DepParameterExpr); break; } // // Rule 458: DepParameterExpr ::= ArgumentList WhereClauseopt // case 458: { //#line 1042 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentList = (List) getRhsSym(1); //#line 1042 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClauseopt = (Expr) getRhsSym(2); //#line 1044 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.DepParameterExpr(pos(), ArgumentList, WhereClauseopt)); break; } // // Rule 459: DepParameterExpr ::= WhereClause // case 459: { //#line 1047 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClause = (Expr) getRhsSym(1); //#line 1049 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.DepParameterExpr(pos(), Collections.EMPTY_LIST, WhereClause)); break; } // // Rule 460: WhereClause ::= : ConstExpression // case 460: { //#line 1053 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExpression = (Expr) getRhsSym(2); //#line 1055 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstExpression); break; } // // Rule 461: ConstPrimary ::= Literal // case 461: { //#line 1060 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.ast.Lit Literal = (polyglot.ast.Lit) getRhsSym(1); //#line 1062 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(Literal); break; } // // Rule 462: ConstPrimary ::= Type . class // case 462: { //#line 1065 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1067 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" if (Type instanceof Name) { Name a = (Name) Type; setResult(nf.ClassLit(pos(), a.toType())); } else if (Type instanceof TypeNode) { setResult(nf.ClassLit(pos(), Type)); } else if (Type instanceof CanonicalTypeNode) { CanonicalTypeNode a = (CanonicalTypeNode) Type; setResult(nf.ClassLit(pos(), a)); } else assert(false); break; } // // Rule 463: ConstPrimary ::= void . class // case 463: { //#line 1086 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ClassLit(pos(), nf.CanonicalTypeNode(pos(getLeftSpan()), ts.Void()))); break; } // // Rule 464: ConstPrimary ::= this // case 464: { //#line 1092 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.This(pos())); break; } // // Rule 465: ConstPrimary ::= here // case 465: { //#line 1097 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Here(pos())); break; } // // Rule 466: ConstPrimary ::= ClassName . this // case 466: { //#line 1100 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name ClassName = (Name) getRhsSym(1); //#line 1102 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.This(pos(), ClassName.toType())); break; } // // Rule 467: ConstPrimary ::= ( ConstExpression ) // case 467: { //#line 1105 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExpression = (Expr) getRhsSym(2); //#line 1107 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstExpression); break; } // // Rule 469: ConstPrimary ::= self // case 469: { //#line 1113 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Self(pos())); break; } // // Rule 470: ConstPostfixExpression ::= ConstPrimary // case 470: { //#line 1119 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstPrimary = (Expr) getRhsSym(1); //#line 1121 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstPrimary); break; } // // Rule 471: ConstPostfixExpression ::= ExpressionName // case 471: { //#line 1124 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name ExpressionName = (Name) getRhsSym(1); //#line 1126 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ExpressionName.toExpr()); break; } // // Rule 472: ConstUnaryExpression ::= ConstPostfixExpression // case 472: { //#line 1129 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstPostfixExpression = (Expr) getRhsSym(1); //#line 1131 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstPostfixExpression); break; } // // Rule 473: ConstUnaryExpression ::= + ConstUnaryExpression // case 473: { //#line 1134 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(2); //#line 1136 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Unary(pos(), Unary.POS, ConstUnaryExpression)); break; } // // Rule 474: ConstUnaryExpression ::= - ConstUnaryExpression // case 474: { //#line 1139 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(2); //#line 1141 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Unary(pos(), Unary.NEG, ConstUnaryExpression)); break; } // // Rule 475: ConstUnaryExpression ::= ! ConstUnaryExpression // case 475: { //#line 1144 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(2); //#line 1146 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Unary(pos(), Unary.NOT, ConstUnaryExpression)); break; } // // Rule 476: ConstMultiplicativeExpression ::= ConstUnaryExpression // case 476: { //#line 1150 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(1); //#line 1152 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstUnaryExpression); break; } // // Rule 477: ConstMultiplicativeExpression ::= ConstMultiplicativeExpression * ConstUnaryExpression // case 477: { //#line 1155 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(1); //#line 1155 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(3); //#line 1157 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstMultiplicativeExpression, Binary.MUL, ConstUnaryExpression)); break; } // // Rule 478: ConstMultiplicativeExpression ::= ConstMultiplicativeExpression / ConstUnaryExpression // case 478: { //#line 1160 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(1); //#line 1160 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(3); //#line 1162 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstMultiplicativeExpression, Binary.DIV, ConstUnaryExpression)); break; } // // Rule 479: ConstMultiplicativeExpression ::= ConstMultiplicativeExpression % ConstUnaryExpression // case 479: { //#line 1165 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(1); //#line 1165 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstUnaryExpression = (Expr) getRhsSym(3); //#line 1167 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstMultiplicativeExpression, Binary.MOD, ConstUnaryExpression)); break; } // // Rule 480: ConstAdditiveExpression ::= ConstMultiplicativeExpression // case 480: { //#line 1171 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(1); //#line 1173 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstMultiplicativeExpression); break; } // // Rule 481: ConstAdditiveExpression ::= ConstAdditiveExpression + ConstMultiplicativeExpression // case 481: { //#line 1176 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(1); //#line 1176 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(3); //#line 1178 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstAdditiveExpression, Binary.ADD, ConstMultiplicativeExpression)); break; } // // Rule 482: ConstAdditiveExpression ::= ConstAdditiveExpression - ConstMultiplicativeExpression // case 482: { //#line 1181 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(1); //#line 1181 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstMultiplicativeExpression = (Expr) getRhsSym(3); //#line 1183 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstAdditiveExpression, Binary.SUB, ConstMultiplicativeExpression)); break; } // // Rule 483: ConstRelationalExpression ::= ConstAdditiveExpression // case 483: { //#line 1188 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(1); //#line 1190 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstAdditiveExpression); break; } // // Rule 484: ConstRelationalExpression ::= ConstRelationalExpression < ConstAdditiveExpression // case 484: { //#line 1193 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(1); //#line 1193 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(3); //#line 1195 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstRelationalExpression, Binary.LT, ConstAdditiveExpression)); break; } // // Rule 485: ConstRelationalExpression ::= ConstRelationalExpression > ConstAdditiveExpression // case 485: { //#line 1198 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(1); //#line 1198 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(3); //#line 1200 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstRelationalExpression, Binary.GT, ConstAdditiveExpression)); break; } // // Rule 486: ConstRelationalExpression ::= ConstRelationalExpression <= ConstAdditiveExpression // case 486: { //#line 1203 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(1); //#line 1203 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(3); //#line 1205 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstRelationalExpression, Binary.LE, ConstAdditiveExpression)); break; } // // Rule 487: ConstRelationalExpression ::= ConstRelationalExpression > = ConstAdditiveExpression // case 487: { //#line 1208 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(1); //#line 1208 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAdditiveExpression = (Expr) getRhsSym(4); //#line 1210 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstRelationalExpression, Binary.GE, ConstAdditiveExpression)); break; } // // Rule 488: ConstEqualityExpression ::= ConstRelationalExpression // case 488: { //#line 1214 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(1); //#line 1216 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstRelationalExpression); break; } // // Rule 489: ConstEqualityExpression ::= ConstEqualityExpression == ConstRelationalExpression // case 489: { //#line 1219 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstEqualityExpression = (Expr) getRhsSym(1); //#line 1219 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(3); //#line 1221 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstEqualityExpression, Binary.EQ, ConstRelationalExpression)); break; } // // Rule 490: ConstEqualityExpression ::= ConstEqualityExpression != ConstRelationalExpression // case 490: { //#line 1224 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstEqualityExpression = (Expr) getRhsSym(1); //#line 1224 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstRelationalExpression = (Expr) getRhsSym(3); //#line 1226 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstEqualityExpression, Binary.NE, ConstRelationalExpression)); break; } // // Rule 491: ConstAndExpression ::= ConstEqualityExpression // case 491: { //#line 1230 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstEqualityExpression = (Expr) getRhsSym(1); //#line 1232 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstEqualityExpression); break; } // // Rule 492: ConstAndExpression ::= ConstAndExpression && ConstEqualityExpression // case 492: { //#line 1235 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAndExpression = (Expr) getRhsSym(1); //#line 1235 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstEqualityExpression = (Expr) getRhsSym(3); //#line 1237 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstAndExpression, Binary.COND_AND, ConstEqualityExpression)); break; } // // Rule 493: ConstExclusiveOrExpression ::= ConstAndExpression // case 493: { //#line 1241 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAndExpression = (Expr) getRhsSym(1); //#line 1243 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstAndExpression); break; } // // Rule 494: ConstExclusiveOrExpression ::= ConstExclusiveOrExpression ^ ConstAndExpression // case 494: { //#line 1246 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExclusiveOrExpression = (Expr) getRhsSym(1); //#line 1246 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstAndExpression = (Expr) getRhsSym(3); //#line 1248 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstExclusiveOrExpression, Binary.BIT_XOR, ConstAndExpression)); break; } // // Rule 495: ConstInclusiveOrExpression ::= ConstExclusiveOrExpression // case 495: { //#line 1252 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExclusiveOrExpression = (Expr) getRhsSym(1); //#line 1254 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstExclusiveOrExpression); break; } // // Rule 496: ConstInclusiveOrExpression ::= ConstInclusiveOrExpression || ConstExclusiveOrExpression // case 496: { //#line 1257 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstInclusiveOrExpression = (Expr) getRhsSym(1); //#line 1257 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExclusiveOrExpression = (Expr) getRhsSym(3); //#line 1259 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Binary(pos(), ConstInclusiveOrExpression, Binary.COND_OR, ConstExclusiveOrExpression)); break; } // // Rule 497: ConstExpression ::= ConstInclusiveOrExpression // case 497: { //#line 1263 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstInclusiveOrExpression = (Expr) getRhsSym(1); //#line 1265 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ConstInclusiveOrExpression); break; } // // Rule 498: ConstExpression ::= ConstInclusiveOrExpression ? ConstExpression$first : ConstExpression // case 498: { //#line 1268 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstInclusiveOrExpression = (Expr) getRhsSym(1); //#line 1268 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr first = (Expr) getRhsSym(3); //#line 1268 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstExpression = (Expr) getRhsSym(5); //#line 1270 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Conditional(pos(), ConstInclusiveOrExpression, first, ConstExpression)); break; } // // Rule 499: ConstFieldAccess ::= ConstPrimary . identifier // case 499: { //#line 1275 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr ConstPrimary = (Expr) getRhsSym(1); //#line 1275 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1277 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Field(pos(), ConstPrimary, identifier.getIdentifier())); break; } // // Rule 500: ConstFieldAccess ::= super . identifier // case 500: { //#line 1280 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1282 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getLeftSpan())), identifier.getIdentifier())); break; } // // Rule 501: ConstFieldAccess ::= ClassName . super$sup . identifier // case 501: { //#line 1285 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name ClassName = (Name) getRhsSym(1); //#line 1285 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IToken sup = (IToken) getRhsIToken(3); //#line 1285 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(5); //#line 1287 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Field(pos(getRightSpan()), nf.Super(pos(getRhsFirstTokenIndex(3)), ClassName.toType()), identifier.getIdentifier())); break; } // // Rule 503: X10ArrayType ::= Type [ . ] // case 503: { //#line 1303 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1305 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.X10ArrayTypeNode(pos(), Type, false, null)); break; } // // Rule 504: X10ArrayType ::= Type value [ . ] // case 504: { //#line 1308 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1310 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.X10ArrayTypeNode(pos(), Type, true, null)); break; } // // Rule 505: X10ArrayType ::= Type [ DepParameterExpr ] // case 505: { //#line 1313 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1313 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParameterExpr = (DepParameterExpr) getRhsSym(3); //#line 1315 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.X10ArrayTypeNode(pos(), Type, false, DepParameterExpr)); break; } // // Rule 506: X10ArrayType ::= Type value [ DepParameterExpr ] // case 506: { //#line 1318 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(1); //#line 1318 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParameterExpr = (DepParameterExpr) getRhsSym(4); //#line 1320 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.X10ArrayTypeNode(pos(), Type, true, DepParameterExpr)); break; } // // Rule 507: ObjectKind ::= value // case 507: throw new Error("No action specified for rule " + 507); // // Rule 508: ObjectKind ::= reference // case 508: throw new Error("No action specified for rule " + 508); // // Rule 509: MethodModifier ::= atomic // case 509: { //#line 1334 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.ATOMIC); break; } // // Rule 510: MethodModifier ::= extern // case 510: { //#line 1339 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(Flags.NATIVE); break; } // // Rule 511: MethodModifier ::= safe // case 511: { //#line 1344 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.SAFE); break; } // // Rule 512: MethodModifier ::= sequential // case 512: { //#line 1349 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.SEQUENTIAL); break; } // // Rule 513: MethodModifier ::= local // case 513: { //#line 1354 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.LOCAL); break; } // // Rule 514: MethodModifier ::= nonblocking // case 514: { //#line 1359 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.NON_BLOCKING); break; } // // Rule 516: ValueClassDeclaration ::= X10ClassModifiersopt value identifier PropertyListopt Superopt Interfacesopt ClassBody // case 516: { //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags X10ClassModifiersopt = (X10Flags) getRhsSym(1); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] PropertyListopt = (Object[]) getRhsSym(4); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Superopt = (TypeNode) getRhsSym(5); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Interfacesopt = (List) getRhsSym(6); //#line 1365 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBody = (ClassBody) getRhsSym(7); //#line 1367 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" checkTypeName(identifier); List/*<PropertyDecl>*/ props = PropertyListopt==null ? null : (List) PropertyListopt[0]; Expr ci = PropertyListopt==null ? null : (Expr) PropertyListopt[1]; setResult(nf.ValueClassDecl(pos(getLeftSpan(), getRightSpan()), X10ClassModifiersopt, identifier.getIdentifier(), props, ci, Superopt, Interfacesopt, ClassBody)); break; } // // Rule 517: ValueClassDeclaration ::= X10ClassModifiersopt value class identifier PropertyListopt Superopt Interfacesopt ClassBody // case 517: { //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Flags X10ClassModifiersopt = (X10Flags) getRhsSym(1); //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(4); //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] PropertyListopt = (Object[]) getRhsSym(5); //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Superopt = (TypeNode) getRhsSym(6); //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Interfacesopt = (List) getRhsSym(7); //#line 1375 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClassBody ClassBody = (ClassBody) getRhsSym(8); //#line 1377 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" checkTypeName(identifier); List/*<PropertyDecl>*/ props = PropertyListopt==null ? null : (List) PropertyListopt[0]; Expr ci = PropertyListopt==null ? null : (Expr) PropertyListopt[1]; setResult(nf.ValueClassDecl(pos(getLeftSpan(), getRightSpan()), X10ClassModifiersopt, identifier.getIdentifier(), props, ci, Superopt, Interfacesopt, ClassBody)); break; } // // Rule 518: ConstructorDeclaration ::= ConstructorModifiersopt ConstructorDeclarator Throwsopt ConstructorBody // case 518: { //#line 1386 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags ConstructorModifiersopt = (Flags) getRhsSym(1); //#line 1386 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] ConstructorDeclarator = (Object[]) getRhsSym(2); //#line 1386 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List Throwsopt = (List) getRhsSym(3); //#line 1386 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Block ConstructorBody = (Block) getRhsSym(4); //#line 1388 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name a = (Name) ConstructorDeclarator[1]; DepParameterExpr c = (DepParameterExpr) ConstructorDeclarator[2]; List b = (List) ConstructorDeclarator[3]; Expr e = (Expr) ConstructorDeclarator[4]; setResult(nf.ConstructorDecl(pos(), ConstructorModifiersopt, a.toString(), c, b, e, Throwsopt, ConstructorBody)); break; } // // Rule 519: ConstructorDeclarator ::= SimpleTypeName DepParametersopt ( FormalParameterListopt WhereClauseopt ) // case 519: { //#line 1396 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name SimpleTypeName = (Name) getRhsSym(1); //#line 1396 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParametersopt = (DepParameterExpr) getRhsSym(2); //#line 1396 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List FormalParameterListopt = (List) getRhsSym(4); //#line 1396 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClauseopt = (Expr) getRhsSym(5); //#line 1398 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] a = new Object[5]; a[1] = SimpleTypeName; a[2] = DepParametersopt; a[3] = FormalParameterListopt; a[4] = WhereClauseopt; setResult(a); break; } // // Rule 520: ThisClause ::= this DepParameters // case 520: { //#line 1406 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr DepParameters = (DepParameterExpr) getRhsSym(2); //#line 1408 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DepParameters); break; } // // Rule 521: Super ::= extends DataType // case 521: { //#line 1412 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode DataType = (TypeNode) getRhsSym(2); //#line 1414 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(DataType); break; } // // Rule 522: MethodDeclarator ::= identifier ( FormalParameterListopt WhereClauseopt ) // case 522: { //#line 1418 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 1418 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List FormalParameterListopt = (List) getRhsSym(3); //#line 1418 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr WhereClauseopt = (Expr) getRhsSym(4); //#line 1420 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // System.out.println("Parsing methoddeclarator..."); Object[] a = new Object[5]; a[0] = new Name(nf, ts, pos(), identifier.getIdentifier()); a[1] = FormalParameterListopt; a[2] = new Integer(0); a[3] = WhereClauseopt; setResult(a); break; } // // Rule 523: MethodDeclarator ::= MethodDeclarator [ ] // case 523: { //#line 1430 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object[] MethodDeclarator = (Object[]) getRhsSym(1); //#line 1432 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" MethodDeclarator[2] = new Integer(((Integer) MethodDeclarator[2]).intValue() + 1); // setResult(MethodDeclarator); break; } // // Rule 524: FieldDeclaration ::= ThisClauseopt FieldModifiersopt Type VariableDeclarators ; // case 524: { //#line 1438 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" DepParameterExpr ThisClauseopt = (DepParameterExpr) getRhsSym(1); //#line 1438 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Flags FieldModifiersopt = (Flags) getRhsSym(2); //#line 1438 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 1438 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List VariableDeclarators = (List) getRhsSym(4); //#line 1440 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List l = new TypedList(new LinkedList(), ClassMember.class, false); if (VariableDeclarators != null && VariableDeclarators.size() > 0) { for (Iterator i = VariableDeclarators.iterator(); i.hasNext();) { X10VarDeclarator d = (X10VarDeclarator) i.next(); if (d.hasExplodedVars()) // TODO: Report this exception correctly. throw new Error("Field Declarations may not have exploded variables." + pos()); d.setFlag(FieldModifiersopt); l.add(nf.FieldDecl(d.position(), ThisClauseopt, d.flags, nf.array(Type, Type.position(), d.dims), d.name, d.init)); } } setResult(l); break; } // // Rule 525: ArrayCreationExpression ::= new ArrayBaseType Unsafeopt Dims ArrayInitializer // case 525: { //#line 1474 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1474 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(3); //#line 1474 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Integer Dims = (Integer) getRhsSym(4); //#line 1474 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ArrayInit ArrayInitializer = (ArrayInit) getRhsSym(5); //#line 1476 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // setResult(nf.ArrayConstructor(pos(), a, false, null, d)); setResult(nf.NewArray(pos(), ArrayBaseType, Dims.intValue(), ArrayInitializer)); break; } // // Rule 526: ArrayCreationExpression ::= new ArrayBaseType Unsafeopt DimExpr Dims // case 526: { //#line 1480 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1480 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(3); //#line 1480 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr DimExpr = (Expr) getRhsSym(4); //#line 1480 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Integer Dims = (Integer) getRhsSym(5); //#line 1482 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // setResult(nf.ArrayConstructor(pos(), a, false, null, d)); setResult(nf.NewArray(pos(), ArrayBaseType, Collections.singletonList(DimExpr), Dims.intValue())); break; } // // Rule 527: ArrayCreationExpression ::= new ArrayBaseType Unsafeopt DimExpr DimExprs Dimsopt // case 527: { //#line 1486 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1486 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(3); //#line 1486 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr DimExpr = (Expr) getRhsSym(4); //#line 1486 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List DimExprs = (List) getRhsSym(5); //#line 1486 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Integer Dimsopt = (Integer) getRhsSym(6); //#line 1488 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // setResult(nf.ArrayConstructor(pos(), a, false, null, d)); List l = new TypedList(new LinkedList(), Expr.class, false); l.add(DimExpr); l.addAll(DimExprs); setResult(nf.NewArray(pos(), ArrayBaseType, l, Dimsopt.intValue())); break; } // // Rule 528: ArrayCreationExpression ::= new ArrayBaseType Valueopt Unsafeopt [ Expression ] // case 528: { //#line 1495 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1495 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Valueopt = (Object) getRhsSym(3); //#line 1495 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(4); //#line 1495 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(6); //#line 1497 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ArrayConstructor(pos(), ArrayBaseType, Unsafeopt != null, Valueopt != null, Expression, null)); break; } // // Rule 529: ArrayCreationExpression ::= new ArrayBaseType Valueopt Unsafeopt [ Expression$distr ] Expression$initializer // case 529: { //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Valueopt = (Object) getRhsSym(3); //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(4); //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr distr = (Expr) getRhsSym(6); //#line 1500 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr initializer = (Expr) getRhsSym(8); //#line 1502 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ArrayConstructor(pos(), ArrayBaseType, Unsafeopt != null, Valueopt != null, distr, initializer)); break; } // // Rule 530: ArrayCreationExpression ::= new ArrayBaseType Valueopt Unsafeopt [ Expression ] ($lparen FormalParameter ) MethodBody // case 530: { //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode ArrayBaseType = (TypeNode) getRhsSym(2); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Valueopt = (Object) getRhsSym(3); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Object Unsafeopt = (Object) getRhsSym(4); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(6); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IToken lparen = (IToken) getRhsIToken(8); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(9); //#line 1505 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Block MethodBody = (Block) getRhsSym(11); //#line 1507 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr initializer = makeInitializer( pos(getRhsFirstTokenIndex(8), getRightSpan()), ArrayBaseType, FormalParameter, MethodBody ); setResult(nf.ArrayConstructor(pos(), ArrayBaseType, Unsafeopt != null, Valueopt != null, Expression, initializer)); break; } // // Rule 531: Valueopt ::= $Empty // case 531: setResult(null); break; // // Rule 532: Valueopt ::= value // case 532: { //#line 1516 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // any value distinct from null setResult(this); break; } // // Rule 535: ArrayBaseType ::= nullable < Type > // case 535: { //#line 1523 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 1525 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Nullable(pos(), Type)); break; } // // Rule 536: ArrayBaseType ::= future < Type > // case 536: { //#line 1528 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 1530 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Future(pos(), Type)); break; } // // Rule 537: ArrayBaseType ::= ( Type ) // case 537: { //#line 1533 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(2); //#line 1535 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(Type); break; } // // Rule 538: ArrayAccess ::= ExpressionName [ ArgumentList ] // case 538: { //#line 1539 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name ExpressionName = (Name) getRhsSym(1); //#line 1539 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentList = (List) getRhsSym(3); //#line 1541 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" if (ArgumentList.size() == 1) setResult(nf.X10ArrayAccess1(pos(), ExpressionName.toExpr(), (Expr) ArgumentList.get(0))); else setResult(nf.X10ArrayAccess(pos(), ExpressionName.toExpr(), ArgumentList)); break; } // // Rule 539: ArrayAccess ::= PrimaryNoNewArray [ ArgumentList ] // case 539: { //#line 1546 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PrimaryNoNewArray = (Expr) getRhsSym(1); //#line 1546 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ArgumentList = (List) getRhsSym(3); //#line 1548 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" if (ArgumentList.size() == 1) setResult(nf.X10ArrayAccess1(pos(), PrimaryNoNewArray, (Expr) ArgumentList.get(0))); else setResult(nf.X10ArrayAccess(pos(), PrimaryNoNewArray, ArgumentList)); break; } // // Rule 556: NowStatement ::= now ( Clock ) Statement // case 556: { //#line 1574 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Clock = (Expr) getRhsSym(3); //#line 1574 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(5); //#line 1576 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Now(pos(), Clock, Statement)); break; } // // Rule 557: ClockedClause ::= clocked ( ClockList ) // case 557: { //#line 1580 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockList = (List) getRhsSym(3); //#line 1582 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(ClockList); break; } // // Rule 558: AsyncStatement ::= async PlaceExpressionSingleListopt ClockedClauseopt Statement // case 558: { //#line 1586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PlaceExpressionSingleListopt = (Expr) getRhsSym(2); //#line 1586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(3); //#line 1586 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(4); //#line 1588 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Async(pos(), (PlaceExpressionSingleListopt == null ? nf.Here(pos(getLeftSpan())) : PlaceExpressionSingleListopt), ClockedClauseopt, Statement)); break; } // // Rule 559: AtomicStatement ::= atomic PlaceExpressionSingleListopt Statement // case 559: { //#line 1596 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PlaceExpressionSingleListopt = (Expr) getRhsSym(2); //#line 1596 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(3); //#line 1598 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Atomic(pos(), (PlaceExpressionSingleListopt == null ? nf.Here(pos(getLeftSpan())) : PlaceExpressionSingleListopt), Statement)); break; } // // Rule 560: WhenStatement ::= when ( Expression ) Statement // case 560: { //#line 1605 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(3); //#line 1605 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(5); //#line 1607 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.When(pos(), Expression, Statement)); break; } // // Rule 561: WhenStatement ::= WhenStatement or$or ( Expression ) Statement // case 561: { //#line 1610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" When WhenStatement = (When) getRhsSym(1); //#line 1610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IToken or = (IToken) getRhsIToken(2); //#line 1610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(4); //#line 1610 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(6); //#line 1612 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" WhenStatement.addBranch(pos(getRhsFirstTokenIndex(2), getRightSpan()), Expression, Statement); setResult(WhenStatement); break; } // // Rule 562: ForEachStatement ::= foreach ( FormalParameter : Expression ) ClockedClauseopt Statement // case 562: { //#line 1617 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1617 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1617 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(7); //#line 1617 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(8); //#line 1619 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ForEach(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, ClockedClauseopt, Statement)); break; } // // Rule 563: AtEachStatement ::= ateach ( FormalParameter : Expression ) ClockedClauseopt Statement // case 563: { //#line 1627 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1627 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1627 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(7); //#line 1627 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(8); //#line 1629 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.AtEach(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, ClockedClauseopt, Statement)); break; } // // Rule 564: EnhancedForStatement ::= for ( FormalParameter : Expression ) Statement // case 564: { //#line 1637 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1637 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1637 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(7); //#line 1639 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ForLoop(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, Statement)); break; } // // Rule 565: FinishStatement ::= finish Statement // case 565: { //#line 1646 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt Statement = (Stmt) getRhsSym(2); //#line 1648 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Finish(pos(), Statement)); break; } // // Rule 566: NowStatementNoShortIf ::= now ( Clock ) StatementNoShortIf // case 566: { //#line 1653 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Clock = (Expr) getRhsSym(3); //#line 1653 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(5); //#line 1655 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Now(pos(), Clock, StatementNoShortIf)); break; } // // Rule 567: AsyncStatementNoShortIf ::= async PlaceExpressionSingleListopt ClockedClauseopt StatementNoShortIf // case 567: { //#line 1659 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PlaceExpressionSingleListopt = (Expr) getRhsSym(2); //#line 1659 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(3); //#line 1659 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(4); //#line 1661 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Async(pos(), (PlaceExpressionSingleListopt == null ? nf.Here(pos(getLeftSpan())) : PlaceExpressionSingleListopt), ClockedClauseopt, StatementNoShortIf)); break; } // // Rule 568: AtomicStatementNoShortIf ::= atomic StatementNoShortIf // case 568: { //#line 1668 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(2); //#line 1670 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Atomic(pos(), nf.Here(pos(getLeftSpan())), StatementNoShortIf)); break; } // // Rule 569: WhenStatementNoShortIf ::= when ( Expression ) StatementNoShortIf // case 569: { //#line 1674 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(3); //#line 1674 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(5); //#line 1676 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.When(pos(), Expression, StatementNoShortIf)); break; } // // Rule 570: WhenStatementNoShortIf ::= WhenStatement or$or ( Expression ) StatementNoShortIf // case 570: { //#line 1679 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" When WhenStatement = (When) getRhsSym(1); //#line 1679 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IToken or = (IToken) getRhsIToken(2); //#line 1679 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(4); //#line 1679 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(6); //#line 1681 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" WhenStatement.addBranch(pos(getRhsFirstTokenIndex(2), getRightSpan()), Expression, StatementNoShortIf); setResult(WhenStatement); break; } // // Rule 571: ForEachStatementNoShortIf ::= foreach ( FormalParameter : Expression ) ClockedClauseopt StatementNoShortIf // case 571: { //#line 1686 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1686 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1686 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(7); //#line 1686 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(8); //#line 1688 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ForEach(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, ClockedClauseopt, StatementNoShortIf)); break; } // // Rule 572: AtEachStatementNoShortIf ::= ateach ( FormalParameter : Expression ) ClockedClauseopt StatementNoShortIf // case 572: { //#line 1697 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1697 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1697 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockedClauseopt = (List) getRhsSym(7); //#line 1697 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(8); //#line 1699 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.AtEach(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, ClockedClauseopt, StatementNoShortIf)); break; } // // Rule 573: EnhancedForStatementNoShortIf ::= for ( FormalParameter : Expression ) StatementNoShortIf // case 573: { //#line 1707 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" X10Formal FormalParameter = (X10Formal) getRhsSym(3); //#line 1707 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(5); //#line 1707 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(7); //#line 1709 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.ForLoop(pos(), FormalParameter.flags(FormalParameter.flags().Final()), Expression, StatementNoShortIf)); break; } // // Rule 574: FinishStatementNoShortIf ::= finish StatementNoShortIf // case 574: { //#line 1716 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Stmt StatementNoShortIf = (Stmt) getRhsSym(2); //#line 1718 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Finish(pos(), StatementNoShortIf)); break; } // // Rule 575: PlaceExpressionSingleList ::= ( PlaceExpression ) // case 575: { //#line 1723 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PlaceExpression = (Expr) getRhsSym(2); //#line 1725 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(PlaceExpression); break; } // // Rule 577: NextStatement ::= next ; // case 577: { //#line 1733 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Next(pos())); break; } // // Rule 578: AwaitStatement ::= await Expression ; // case 578: { //#line 1737 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(2); //#line 1739 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Await(pos(), Expression)); break; } // // Rule 579: ClockList ::= Clock // case 579: { //#line 1743 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Clock = (Expr) getRhsSym(1); //#line 1745 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List l = new TypedList(new LinkedList(), Expr.class, false); l.add(Clock); setResult(l); break; } // // Rule 580: ClockList ::= ClockList , Clock // case 580: { //#line 1750 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List ClockList = (List) getRhsSym(1); //#line 1750 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Clock = (Expr) getRhsSym(3); //#line 1752 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ClockList.add(Clock); setResult(ClockList); break; } // // Rule 581: Clock ::= Expression // case 581: { //#line 1758 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(1); //#line 1760 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(Expression); break; } // // Rule 582: CastExpression ::= ( Type ) UnaryExpressionNotPlusMinus // case 582: { //#line 1770 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(2); //#line 1770 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr UnaryExpressionNotPlusMinus = (Expr) getRhsSym(4); //#line 1772 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Cast(pos(), Type, UnaryExpressionNotPlusMinus)); break; } // // Rule 583: CastExpression ::= ( @ Expression ) UnaryExpressionNotPlusMinus // case 583: { //#line 1775 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(3); //#line 1775 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr UnaryExpressionNotPlusMinus = (Expr) getRhsSym(5); //#line 1777 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.PlaceCast(pos(), Expression, UnaryExpressionNotPlusMinus)); break; } // // Rule 584: RelationalExpression ::= RelationalExpression instanceof Type // case 584: { //#line 1787 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr RelationalExpression = (Expr) getRhsSym(1); //#line 1787 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" TypeNode Type = (TypeNode) getRhsSym(3); //#line 1789 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Instanceof(pos(), RelationalExpression, Type)); break; } // // Rule 585: IdentifierList ::= identifier // case 585: { //#line 1795 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 1797 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List l = new TypedList(new LinkedList(), Name.class, false); l.add(new Name(nf, ts, pos(), identifier.getIdentifier())); setResult(l); break; } // // Rule 586: IdentifierList ::= IdentifierList , identifier // case 586: { //#line 1802 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List IdentifierList = (List) getRhsSym(1); //#line 1802 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(3); //#line 1804 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" IdentifierList.add(new Name(nf, ts, pos(), identifier.getIdentifier())); setResult(IdentifierList); break; } // // Rule 587: Primary ::= here // case 587: { //#line 1811 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(((X10NodeFactory) nf).Here(pos()));//// A "here" expression used to be treated as an ExpressionName instead// of as a primary.//// setResult(new Name(nf, ts, pos(), "here"){// public Expr toExpr() {// return ((X10NodeFactory) nf).Here(pos);// }// }); break; } // // Rule 590: RegionExpression ::= Expression$expr1 : Expression$expr2 // case 590: { //#line 1827 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr expr1 = (Expr) getRhsSym(1); //#line 1827 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr expr2 = (Expr) getRhsSym(3); //#line 1829 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" /*Name x10 = new Name(nf, ts, pos(), "x10"); Name x10Lang = new Name(nf, ts, pos(), x10, "lang"); Name x10LangRegion = new Name(nf, ts, pos(), x10Lang, "region"); Name x10LangRegionFactory = new Name(nf, ts, pos(), x10LangRegion, "factory"); Name x10LangRegionFactoryRegion = new Name(nf, ts, pos(), x10LangRegionFactory, "region"); List l = new TypedList(new LinkedList(), Expr.class, false); l.add(expr1); l.add(expr2); Call regionCall = nf.Call( pos(), x10LangRegionFactoryRegion.prefix.toReceiver(), "region", l ); */ Call regionCall = nf.RegionMaker(pos(), expr1, expr2); setResult(regionCall); break; } // // Rule 591: RegionExpressionList ::= RegionExpression // case 591: { //#line 1845 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr RegionExpression = (Expr) getRhsSym(1); //#line 1847 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List l = new TypedList(new LinkedList(), Expr.class, false); l.add(RegionExpression); setResult(l); break; } // // Rule 592: RegionExpressionList ::= RegionExpressionList , RegionExpression // case 592: { //#line 1852 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List RegionExpressionList = (List) getRhsSym(1); //#line 1852 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr RegionExpression = (Expr) getRhsSym(3); //#line 1854 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" RegionExpressionList.add(RegionExpression); //setResult(RegionExpressionList); break; } // // Rule 593: Primary ::= [ RegionExpressionList ] // case 593: { //#line 1859 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" List RegionExpressionList = (List) getRhsSym(2); //#line 1861 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Name x10 = new Name(nf, ts, pos(), "x10"); Name x10Lang = new Name(nf, ts, pos(), x10, "lang"); Name x10LangRegion = new Name(nf, ts, pos(), x10Lang, "region"); Name x10LangRegionFactory = new Name(nf, ts, pos(), x10LangRegion, "factory"); Name x10LangRegionFactoryRegion = new Name(nf, ts, pos(), x10LangRegionFactory, "region"); Name x10LangPoint = new Name(nf, ts, pos(), x10Lang, "point"); Name x10LangPointFactory = new Name(nf, ts, pos(), x10LangPoint, "factory"); Name x10LangPointFactoryPoint = new Name(nf, ts, pos(), x10LangPointFactory, "point"); Tuple tuple = nf.Tuple(pos(), x10LangPointFactoryPoint, x10LangRegionFactoryRegion, RegionExpressionList); setResult(tuple); break; } // // Rule 594: AssignmentExpression ::= Expression$expr1 -> Expression$expr2 // case 594: { //#line 1875 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr expr1 = (Expr) getRhsSym(1); //#line 1875 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr expr2 = (Expr) getRhsSym(3); //#line 1877 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" ConstantDistMaker call = nf.ConstantDistMaker(pos(), expr1, expr2); setResult(call); break; } // // Rule 595: FutureExpression ::= future PlaceExpressionSingleListopt { Expression } // case 595: { //#line 1882 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr PlaceExpressionSingleListopt = (Expr) getRhsSym(2); //#line 1882 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(4); //#line 1884 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(nf.Future(pos(), (PlaceExpressionSingleListopt == null ? nf.Here(pos(getLeftSpan())) : PlaceExpressionSingleListopt), Expression)); break; } // // Rule 596: FieldModifier ::= mutable // case 596: { //#line 1892 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.MUTABLE); break; } // // Rule 597: FieldModifier ::= const // case 597: { //#line 1897 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(Flags.PUBLIC.set(Flags.STATIC).set(Flags.FINAL)); break; } // // Rule 598: FunExpression ::= fun Type ( FormalParameterListopt ) { Expression } // case 598: throw new Error("No action specified for rule " + 598); // // Rule 599: MethodInvocation ::= MethodName ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) // case 599: throw new Error("No action specified for rule " + 599); // // Rule 600: MethodInvocation ::= Primary . identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) // case 600: throw new Error("No action specified for rule " + 600); // // Rule 601: MethodInvocation ::= super . identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) // case 601: throw new Error("No action specified for rule " + 601); // // Rule 602: MethodInvocation ::= ClassName . super . identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) // case 602: throw new Error("No action specified for rule " + 602); // // Rule 603: MethodInvocation ::= TypeName . identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) // case 603: throw new Error("No action specified for rule " + 603); // // Rule 604: ClassInstanceCreationExpression ::= new ClassOrInterfaceType ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) ClassBodyopt // case 604: throw new Error("No action specified for rule " + 604); // // Rule 605: ClassInstanceCreationExpression ::= Primary . new identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) ClassBodyopt // case 605: throw new Error("No action specified for rule " + 605); // // Rule 606: ClassInstanceCreationExpression ::= AmbiguousName . new identifier ( ArgumentListopt$args1 ) ( ArgumentListopt$args2 ) ClassBodyopt // case 606: throw new Error("No action specified for rule " + 606); // // Rule 607: MethodModifier ::= synchronized // case 607: { //#line 1928 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" unrecoverableSyntaxError = true; eq.enqueue(ErrorInfo.SYNTAX_ERROR, "\"synchronized\" is an invalid X10 Method Modifier", getErrorPosition(getLeftSpan(), getRightSpan())); setResult(Flags.SYNCHRONIZED); break; } // // Rule 608: FieldModifier ::= volatile // case 608: { //#line 1937 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" unrecoverableSyntaxError = true; eq.enqueue(ErrorInfo.SYNTAX_ERROR, "\"volatile\" is an invalid X10 Field Modifier", getErrorPosition(getLeftSpan(), getRightSpan())); setResult(Flags.VOLATILE); break; } // // Rule 609: SynchronizedStatement ::= synchronized ( Expression ) Block // case 609: { //#line 1944 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Expr Expression = (Expr) getRhsSym(3); //#line 1944 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" Block Block = (Block) getRhsSym(5); //#line 1946 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" unrecoverableSyntaxError = true; eq.enqueue(ErrorInfo.SYNTAX_ERROR, "Synchronized Statement is invalid in X10", getErrorPosition(getLeftSpan(), getRightSpan())); setResult(nf.Synchronized(pos(), Expression, Block)); break; } // // Rule 610: ThisClauseopt ::= $Empty // case 610: setResult(null); break; // // Rule 612: PlaceTypeSpecifieropt ::= $Empty // case 612: setResult(null); break; // // Rule 614: DepParametersopt ::= $Empty // case 614: setResult(null); break; // // Rule 616: PropertyListopt ::= $Empty // case 616: setResult(null); break; // // Rule 618: WhereClauseopt ::= $Empty // case 618: setResult(null); break; // // Rule 620: ObjectKindopt ::= $Empty // case 620: setResult(null); break; // // Rule 622: ArrayInitializeropt ::= $Empty // case 622: setResult(null); break; // // Rule 624: PlaceExpressionSingleListopt ::= $Empty // case 624: setResult(null); break; // // Rule 626: ArgumentListopt ::= $Empty // case 626: setResult(null); break; // // Rule 628: X10ClassModifiersopt ::= $Empty // case 628: { //#line 1992 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(X10Flags.toX10Flags(Flags.NONE)); break; } // // Rule 630: DepParametersopt ::= $Empty // case 630: setResult(null); break; // // Rule 632: Unsafeopt ::= $Empty // case 632: setResult(null); break; // // Rule 633: Unsafeopt ::= unsafe // case 633: { //#line 2004 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" // any value distinct from null setResult(this); break; } // // Rule 634: ParamIdopt ::= $Empty // case 634: setResult(null); break; // // Rule 635: ParamIdopt ::= identifier // case 635: { //#line 2011 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" polyglot.lex.Identifier identifier = (polyglot.lex.Identifier) getRhsSym(1); //#line 2013 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(new Name(nf, ts, pos(), identifier.getIdentifier())); break; } // // Rule 636: ClockedClauseopt ::= $Empty // case 636: { //#line 2019 "C:/Docume~1/Administrator/MyDocu~1/work/x10/cvs/x10.compiler/src/x10/parser/x10.g" setResult(new TypedList(new LinkedList(), Expr.class, false)); break; } default: break; } return; }
1769 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1769/c6a9c5919552b91fb0c4af00afd67a30f78acfc4/X10Parser.java/buggy/x10.compiler/src/x10/parser/X10Parser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1720, 1803, 12, 474, 1720, 1854, 13, 565, 288, 3639, 1620, 261, 5345, 1854, 13, 3639, 288, 2398, 368, 5411, 368, 6781, 404, 30, 225, 21036, 493, 33, 21036, 263, 1068, 548, 5411, 368, 5411, 648, 404, 30, 288, 7734, 368, 7, 1369, 1666, 315, 39, 27824, 1759, 2066, 98, 21, 19, 4446, 14207, 19, 12062, 1759, 89, 98, 21, 19, 1252, 19, 92, 2163, 19, 71, 6904, 19, 92, 2163, 18, 9576, 19, 4816, 19, 92, 2163, 19, 4288, 19, 4841, 548, 18, 10052, 6, 7734, 1770, 21036, 273, 261, 461, 13, 4170, 4487, 11901, 12, 21, 1769, 7734, 368, 7, 1369, 1725, 315, 39, 27824, 1759, 2066, 98, 21, 19, 4446, 14207, 19, 12062, 1759, 89, 98, 21, 19, 1252, 19, 92, 2163, 19, 71, 6904, 19, 92, 2163, 18, 9576, 19, 4816, 19, 92, 2163, 19, 4288, 19, 4841, 548, 18, 10052, 6, 10792, 21582, 12, 2704, 1770, 12, 82, 74, 16, 4766, 1377, 3742, 16, 4766, 1377, 949, 12, 588, 3910, 6952, 9334, 16609, 6952, 1435, 3631, 4766, 1377, 21036, 16, 4766, 1377, 10971, 10019, 10792, 898, 31, 5411, 289, 5397, 368, 5411, 368, 6781, 576, 30, 225, 7508, 461, 493, 33, 7508, 461, 263, 1068, 548, 5411, 368, 5411, 648, 576, 30, 288, 7734, 368, 7, 1369, 2872, 315, 39, 27824, 1759, 2066, 98, 21, 19, 4446, 14207, 19, 12062, 1759, 89, 98, 21, 19, 1252, 19, 92, 2163, 19, 71, 6904, 19, 92, 2163, 18, 9576, 19, 4816, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1720, 1803, 12, 474, 1720, 1854, 13, 565, 288, 3639, 1620, 261, 5345, 1854, 13, 3639, 288, 2398, 368, 5411, 368, 6781, 404, 30, 225, 21036, 493, 33, 21036, 263, 1068, 548, 5411, 368, 5411, 648, 404, 30, 288, 7734, 368, 7, 1369, 1666, 315, 39, 27824, 1759, 2066, 98, 21, 19, 4446, 14207, 19, 12062, 1759, 89, 98, 21, 19, 1252, 19, 92, 2163, 19, 71, 6904, 19, 92, 2163, 18, 9576, 19, 4816, 19, 92, 2163, 19, 4288, 19, 4841, 548, 18, 10052, 6, 7734, 1770, 21036, 273, 261, 461, 13, 4170, 4487, 11901, 12, 21, 1769, 7734, 368, 7, 1369, 1725, 315, 39, 27824, 1759, 2066, 98, 21, 19, 4446, 14207, 19, 12062, 2 ]
try { open(declNames[0]); } catch (CoreException e) { CUIPlugin.getDefault().log(e); } }
try { open(path, offset, length); } catch (CoreException e) { CUIPlugin.getDefault().log(e); } }
public void run() { try { open(declNames[0]); } catch (CoreException e) { CUIPlugin.getDefault().log(e); } }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/3dfef1cc0583d46e74aa5b97cffed9a285d8db01/OpenDeclarationsAction.java/buggy/core/org.eclipse.cdt.ui/src/org/eclipse/cdt/internal/ui/search/actions/OpenDeclarationsAction.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 20982, 202, 482, 918, 1086, 1435, 288, 6862, 6862, 202, 698, 288, 6862, 25083, 202, 3190, 12, 8840, 1557, 63, 20, 19226, 6862, 6862, 202, 97, 1044, 261, 25341, 425, 13, 288, 6862, 25083, 202, 39, 5370, 3773, 18, 588, 1868, 7675, 1330, 12, 73, 1769, 6862, 6862, 202, 97, 6862, 9506, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 20982, 202, 482, 918, 1086, 1435, 288, 6862, 6862, 202, 698, 288, 6862, 25083, 202, 3190, 12, 8840, 1557, 63, 20, 19226, 6862, 6862, 202, 97, 1044, 261, 25341, 425, 13, 288, 6862, 25083, 202, 39, 5370, 3773, 18, 588, 1868, 7675, 1330, 12, 73, 1769, 6862, 6862, 202, 97, 6862, 9506, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if(loggingService.isDebugEnabled()) { loggingService.debug(" Error Multiple capabilities object on blackboard MnRQueryReceiver Plugin in agent::" + myAddress.toString()); loggingService.debug("CONFUSION ...... CONFUSION!!!!!!!!!!!!! Exiting !!!!!!!!:");
if(loggingService.isErrorEnabled()) { loggingService.error("Multiple capabilities object on blackboard MnRQueryReceiver Plugin in agent:" + myAddress.toString());
protected void execute () { MRAgentLookUp Agentlookupquery; CapabilitiesObject capabilities=null; Iterator relayiterator=null; boolean capabilitiesChanged=false; if ((capabilitiesobject == null) || (queryRelays == null) || (querymapping == null)) { return; } loggingService.debug("Execute of mnRQueryreceiver called :"+ myAddress.toString()); if(queryRelays.hasChanged()) { loggingService.debug("queryRelays.hasChanged() :"+ myAddress.toString()); Collection capabilitiesobj_col=capabilitiesobject.getChangedCollection(); if( capabilitiesobj_col.isEmpty()) { loggingService.debug("Changed collection is empty for capabilities object :@@@@@@ getting complete collection "); // look up query relays that require constant updates capabilitiesobj_col=capabilitiesobject.getCollection(); } ArrayList list=new ArrayList(capabilitiesobj_col); if((list==null)||(list.size()==0)){ if(loggingService.isDebugEnabled()){ loggingService.debug("No capabilities object present in MnRQuery Receiver: RETURNING !!!!!!!!!!!" + myAddress.toString()); return; } } if(list.size()>1) { if(loggingService.isDebugEnabled()) { loggingService.debug(" Error Multiple capabilities object on blackboard MnRQueryReceiver Plugin in agent::" + myAddress.toString()); loggingService.debug("CONFUSION ...... CONFUSION!!!!!!!!!!!!! Exiting !!!!!!!!:"); } return; } capabilities=(CapabilitiesObject)list.get(firstobject); Collection coll= queryRelays.getAddedCollection(); relayiterator = coll.iterator(); loggingService.debug("added collection relay size is:"+coll.size()); } if(capabilitiesobject.hasChanged()) { capabilitiesChanged=true; Collection capabilitiesobj_col=capabilitiesobject.getChangedCollection(); if( capabilitiesobj_col.isEmpty()) { loggingService.debug(" Changed collection is empty though capabilitiesobject.hasChanged returned true "); loggingService.debug(" returning !!!!"); return ; } ArrayList list=new ArrayList(capabilitiesobj_col); if((list==null)||(list.size()==0)){ if(loggingService.isDebugEnabled()){ loggingService.debug("Got capabilities object change bit the list is empty returning" + myAddress.toString()); return; } } if(list.size()>1) { if(loggingService.isDebugEnabled()) { loggingService.debug("In capabilitiesobject.hasChanged Error Multiple capabilities object on blackboard MnRQueryReceiver Plugin agent is::" + myAddress.toString()); loggingService.debug("CONFUSION ...... CONFUSION!!!!!!!!!!!!! Returning !!!!!!!!:"); } return; } loggingService.debug("Capabilities object has changed so getting all query relays :"); capabilities=(CapabilitiesObject)list.get(firstobject); relayiterator = queryRelays.getCollection().iterator(); } updateRelayedQuery(relayiterator,capabilities,capabilitiesChanged); }
12869 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12869/897d126c9e6df9dc20d9edbd30206c25faa77371/MnRQueryReceiverPlugin.java/buggy/securityservices/src/org/cougaar/core/security/monitoring/plugin/MnRQueryReceiverPlugin.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 918, 1836, 1832, 288, 565, 490, 54, 3630, 9794, 1211, 8669, 8664, 2271, 31, 565, 24797, 921, 12359, 33, 2011, 31, 565, 4498, 18874, 9838, 33, 2011, 31, 565, 1250, 12359, 5033, 33, 5743, 31, 565, 309, 14015, 22140, 1612, 422, 446, 13, 747, 261, 2271, 1971, 8271, 422, 446, 13, 747, 261, 2271, 6770, 422, 446, 3719, 288, 1377, 327, 31, 565, 289, 565, 2907, 1179, 18, 4148, 2932, 5289, 434, 12883, 54, 1138, 24454, 2566, 20514, 15, 225, 3399, 1887, 18, 10492, 10663, 565, 309, 12, 2271, 1971, 8271, 18, 5332, 5033, 10756, 288, 1377, 2907, 1179, 18, 4148, 2932, 2271, 1971, 8271, 18, 5332, 5033, 1435, 20514, 15, 225, 3399, 1887, 18, 10492, 10663, 1377, 2200, 225, 12359, 2603, 67, 1293, 33, 22140, 1612, 18, 588, 5033, 2532, 5621, 1377, 309, 12, 12359, 2603, 67, 1293, 18, 291, 1921, 10756, 288, 202, 11167, 1179, 18, 4148, 2932, 5033, 1849, 353, 1008, 364, 12359, 733, 294, 30989, 30989, 30989, 8742, 3912, 1849, 315, 1769, 202, 759, 2324, 731, 843, 1279, 8271, 716, 2583, 5381, 4533, 202, 22140, 2603, 67, 1293, 33, 22140, 1612, 18, 588, 2532, 5621, 1377, 289, 1377, 2407, 666, 33, 2704, 2407, 12, 22140, 2603, 67, 1293, 1769, 1377, 309, 12443, 1098, 631, 2011, 14047, 96, 12, 1098, 18, 1467, 1435, 631, 20, 3719, 95, 202, 430, 12, 11167, 1179, 18, 291, 2829, 1526, 10756, 95, 202, 225, 2907, 1179, 18, 4148, 2932, 2279, 12359, 733, 3430, 316, 23851, 54, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 918, 1836, 1832, 288, 565, 490, 54, 3630, 9794, 1211, 8669, 8664, 2271, 31, 565, 24797, 921, 12359, 33, 2011, 31, 565, 4498, 18874, 9838, 33, 2011, 31, 565, 1250, 12359, 5033, 33, 5743, 31, 565, 309, 14015, 22140, 1612, 422, 446, 13, 747, 261, 2271, 1971, 8271, 422, 446, 13, 747, 261, 2271, 6770, 422, 446, 3719, 288, 1377, 327, 31, 565, 289, 565, 2907, 1179, 18, 4148, 2932, 5289, 434, 12883, 54, 1138, 24454, 2566, 20514, 15, 225, 3399, 1887, 18, 10492, 10663, 565, 309, 12, 2271, 1971, 8271, 18, 5332, 5033, 10756, 288, 1377, 2907, 1179, 18, 4148, 2932, 2271, 1971, 8271, 18, 5332, 5033, 1435, 20514, 15, 225, 3399, 1887, 18, 10492, 10663, 2 ]
scanAttributeValue(this.fTempString, fTempString2, fAttributeQName.rawname, attributes, oldLen, isVC,fCurrentElement.rawname); String value = fTempString.toString(); attributes.setValue(oldLen, value); attributes.setNonNormalizedValue(oldLen, fTempString2.toString()); attributes.setSpecified(oldLen, true);
scanAttributeValue( this.fTempString, fTempString2, fAttributeQName.rawname, attributes, oldLen, isVC, fCurrentElement.rawname); String value = fTempString.toString(); attributes.setValue(oldLen, value); attributes.setNonNormalizedValue(oldLen, fTempString2.toString()); attributes.setSpecified(oldLen, true);
protected void scanAttribute(XMLAttributesImpl attributes) throws IOException, XNIException { if (DEBUG_CONTENT_SCANNING) System.out.println(">>> scanAttribute()"); // name fEntityScanner.scanQName(fAttributeQName); // equals fEntityScanner.skipSpaces(); if (!fEntityScanner.skipChar('=')) { reportFatalError("EqRequiredInAttribute", new Object[]{fCurrentElement.rawname,fAttributeQName.rawname}); } fEntityScanner.skipSpaces(); // content int oldLen = attributes.getLength(); attributes.addAttribute(fAttributeQName, XMLSymbols.fCDATASymbol, null); // WFC: Unique Att Spec if (oldLen == attributes.getLength()) { reportFatalError("AttributeNotUnique", new Object[]{fCurrentElement.rawname, fAttributeQName.rawname}); } //REVISIT: one more case needs to be included: external PE and standalone is no boolean isVC = fHasExternalDTD && !fStandalone; // REVISIT: it seems that this function should not take attributes, and length scanAttributeValue(this.fTempString, fTempString2, fAttributeQName.rawname, attributes, oldLen, isVC,fCurrentElement.rawname); String value = fTempString.toString(); attributes.setValue(oldLen, value); attributes.setNonNormalizedValue(oldLen, fTempString2.toString()); attributes.setSpecified(oldLen, true); // record namespace declarations if any. if (fBindNamespaces) { String localpart = fAttributeQName.localpart; String prefix = fAttributeQName.prefix != null ? fAttributeQName.prefix : XMLSymbols.EMPTY_STRING; // when it's of form xmlns="..." or xmlns:prefix="...", // it's a namespace declaration. but prefix:xmlns="..." isn't. if (prefix == XMLSymbols.PREFIX_XMLNS || prefix == XMLSymbols.EMPTY_STRING && localpart == XMLSymbols.PREFIX_XMLNS) { // get the internalized value of this attribute String uri = fSymbolTable.addSymbol(value); // 1. "xmlns" can't be bound to any namespace if (prefix == XMLSymbols.PREFIX_XMLNS && localpart == XMLSymbols.PREFIX_XMLNS) { fErrorReporter.reportError(XMLMessageFormatter.XMLNS_DOMAIN, "CantBindXMLNS", new Object[]{fAttributeQName}, XMLErrorReporter.SEVERITY_FATAL_ERROR); } // 2. the namespace for "xmlns" can't be bound to any prefix if (uri == NamespaceContext.XMLNS_URI) { fErrorReporter.reportError(XMLMessageFormatter.XMLNS_DOMAIN, "CantBindXMLNS", new Object[]{fAttributeQName}, XMLErrorReporter.SEVERITY_FATAL_ERROR); } // 3. "xml" can't be bound to any other namespace than it's own if (localpart == XMLSymbols.PREFIX_XML) { if (uri != NamespaceContext.XML_URI) { fErrorReporter.reportError(XMLMessageFormatter.XMLNS_DOMAIN, "CantBindXML", new Object[]{fAttributeQName}, XMLErrorReporter.SEVERITY_FATAL_ERROR); } } // 4. the namespace for "xml" can't be bound to any other prefix else { if (uri ==NamespaceContext.XML_URI) { fErrorReporter.reportError(XMLMessageFormatter.XMLNS_DOMAIN, "CantBindXML", new Object[]{fAttributeQName}, XMLErrorReporter.SEVERITY_FATAL_ERROR); } } prefix = localpart != XMLSymbols.PREFIX_XMLNS ? localpart : XMLSymbols.EMPTY_STRING; // Declare prefix in context. Removing the association between a prefix and a // namespace name is permitted in XML 1.1, so if the uri value is the empty string, // the prefix is being unbound. -- mrglavas fNamespaceContext.declarePrefix(prefix, uri.length() != 0 ? uri : null); // bind namespace attribute to a namespace attributes.setURI(oldLen, fNamespaceContext.getURI(XMLSymbols.PREFIX_XMLNS)); } else { // attempt to bind attribute if (fAttributeQName.prefix != null) { attributes.setURI(oldLen, fNamespaceContext.getURI(fAttributeQName.prefix)); } } } if (DEBUG_CONTENT_SCANNING) System.out.println("<<< scanAttribute()"); } // scanAttribute(XMLAttributes)
6373 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6373/3da96c599064fc1cad81a428d259454eef6d382a/XML11NSDocumentScannerImpl.java/buggy/src/org/apache/xerces/impl/XML11NSDocumentScannerImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 4135, 1499, 12, 4201, 2498, 2828, 1677, 13, 202, 15069, 1860, 16, 1139, 50, 45, 503, 288, 202, 202, 430, 261, 9394, 67, 9689, 67, 2312, 11489, 1360, 13, 2332, 18, 659, 18, 8222, 2932, 23012, 4135, 1499, 1435, 8863, 202, 202, 759, 508, 202, 202, 74, 1943, 11338, 18, 9871, 13688, 12, 74, 1499, 13688, 1769, 202, 202, 759, 1606, 202, 202, 74, 1943, 11338, 18, 7457, 12077, 5621, 202, 202, 430, 16051, 74, 1943, 11338, 18, 7457, 2156, 2668, 2218, 3719, 288, 1082, 202, 6006, 19593, 668, 2932, 19508, 3705, 382, 1499, 3113, 6862, 9506, 394, 1033, 63, 7073, 74, 3935, 1046, 18, 1899, 529, 16, 74, 1499, 13688, 18, 1899, 529, 22938, 202, 202, 97, 202, 202, 74, 1943, 11338, 18, 7457, 12077, 5621, 202, 202, 759, 913, 202, 202, 474, 1592, 2891, 273, 1677, 18, 588, 1782, 5621, 202, 202, 4350, 18, 1289, 1499, 12, 74, 1499, 13688, 16, 3167, 14821, 18, 74, 10160, 789, 3033, 3284, 16, 446, 1769, 202, 202, 759, 678, 4488, 30, 14584, 6020, 4185, 202, 202, 430, 261, 1673, 2891, 422, 1677, 18, 588, 1782, 10756, 288, 1082, 202, 6006, 19593, 668, 2932, 1499, 1248, 6303, 3113, 6862, 9506, 394, 1033, 63, 7073, 74, 3935, 1046, 18, 1899, 529, 16, 6862, 6862, 284, 1499, 13688, 18, 1899, 529, 22938, 202, 202, 97, 202, 202, 759, 862, 26780, 1285, 30, 1245, 1898, 648, 4260, 358, 506, 5849, 30, 3903, 16628, 471, 17676, 353, 1158, 202, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 4135, 1499, 12, 4201, 2498, 2828, 1677, 13, 202, 15069, 1860, 16, 1139, 50, 45, 503, 288, 202, 202, 430, 261, 9394, 67, 9689, 67, 2312, 11489, 1360, 13, 2332, 18, 659, 18, 8222, 2932, 23012, 4135, 1499, 1435, 8863, 202, 202, 759, 508, 202, 202, 74, 1943, 11338, 18, 9871, 13688, 12, 74, 1499, 13688, 1769, 202, 202, 759, 1606, 202, 202, 74, 1943, 11338, 18, 7457, 12077, 5621, 202, 202, 430, 16051, 74, 1943, 11338, 18, 7457, 2156, 2668, 2218, 3719, 288, 1082, 202, 6006, 19593, 668, 2932, 19508, 3705, 382, 1499, 3113, 6862, 9506, 394, 1033, 63, 7073, 74, 3935, 1046, 18, 1899, 529, 16, 74, 1499, 13688, 18, 1899, 529, 22938, 2 ]
if (prefix.equals(this.namespacePrefix)) { } else if (inWidgetElement) {
if (inWidgetElement) {
public void endPrefixMapping(String prefix) throws SAXException { if (prefix.equals(this.namespacePrefix)) { // We consume this namespace completely } else if (inWidgetElement) { saxBuffer.endPrefixMapping(prefix); } else { super.endPrefixMapping(prefix); } }
46428 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46428/aadec6903e8b2c95164761d56ea1ab798dcbf22f/WidgetReplacingPipe.java/clean/src/blocks/woody/java/org/apache/cocoon/woody/transformation/WidgetReplacingPipe.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 2244, 3233, 12, 780, 1633, 13, 5411, 1216, 14366, 288, 3639, 309, 261, 3239, 18, 14963, 12, 2211, 18, 4937, 2244, 3719, 288, 5411, 368, 1660, 7865, 333, 1981, 14416, 3639, 289, 469, 309, 261, 267, 4609, 1046, 13, 288, 5411, 20319, 1892, 18, 409, 2244, 3233, 12, 3239, 1769, 3639, 289, 469, 288, 5411, 2240, 18, 409, 2244, 3233, 12, 3239, 1769, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 2244, 3233, 12, 780, 1633, 13, 5411, 1216, 14366, 288, 3639, 309, 261, 3239, 18, 14963, 12, 2211, 18, 4937, 2244, 3719, 288, 5411, 368, 1660, 7865, 333, 1981, 14416, 3639, 289, 469, 309, 261, 267, 4609, 1046, 13, 288, 5411, 20319, 1892, 18, 409, 2244, 3233, 12, 3239, 1769, 3639, 289, 469, 288, 5411, 2240, 18, 409, 2244, 3233, 12, 3239, 1769, 3639, 289, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public void mOctalEscape() throws RecognitionException { try { ruleNestingLevel++; // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:9: ( '\\\\' ( '0' .. '3' ) ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) ) int alt14=3; int LA14_0 = input.LA(1); if ( (LA14_0=='\\') ) { int LA14_1 = input.LA(2); if ( ((LA14_1>='0' && LA14_1<='3')) ) { int LA14_2 = input.LA(3); if ( ((LA14_2>='0' && LA14_2<='7')) ) { int LA14_4 = input.LA(4); if ( ((LA14_4>='0' && LA14_4<='7')) ) { alt14=1; } else { alt14=2;} } else { alt14=3;} } else if ( ((LA14_1>='4' && LA14_1<='7')) ) { int LA14_3 = input.LA(3); if ( ((LA14_3>='0' && LA14_3<='7')) ) { alt14=2; } else { alt14=3;} } else { if (backtracking>0) {failed=true; return ;} NoViableAltException nvae = new NoViableAltException("1351:1: fragment OctalEscape : ( '\\\\' ( '0' .. '3' ) ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) );", 14, 1, input); throw nvae; } } else { if (backtracking>0) {failed=true; return ;} NoViableAltException nvae = new NoViableAltException("1351:1: fragment OctalEscape : ( '\\\\' ( '0' .. '3' ) ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) ( '0' .. '7' ) | '\\\\' ( '0' .. '7' ) );", 14, 0, input); throw nvae; } switch (alt14) { case 1 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:9: '\\\\' ( '0' .. '3' ) ( '0' .. '7' ) ( '0' .. '7' ) { match('\\'); if (failed) return ; // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:14: ( '0' .. '3' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:15: '0' .. '3' { matchRange('0','3'); if (failed) return ; } // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:25: ( '0' .. '7' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:26: '0' .. '7' { matchRange('0','7'); if (failed) return ; } // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:36: ( '0' .. '7' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1353:37: '0' .. '7' { matchRange('0','7'); if (failed) return ; } } break; case 2 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:9: '\\\\' ( '0' .. '7' ) ( '0' .. '7' ) { match('\\'); if (failed) return ; // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:14: ( '0' .. '7' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:15: '0' .. '7' { matchRange('0','7'); if (failed) return ; } // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:25: ( '0' .. '7' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:26: '0' .. '7' { matchRange('0','7'); if (failed) return ; } } break; case 3 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1355:9: '\\\\' ( '0' .. '7' ) { match('\\'); if (failed) return ; // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1355:14: ( '0' .. '7' ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1355:15: '0' .. '7' { matchRange('0','7'); if (failed) return ; } } break; } } finally { ruleNestingLevel--; } }
5490 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5490/63bc7036e62ae854cec463d59712c173f74e984c/DRLLexer.java/buggy/drools-compiler/src/main/java/org/drools/lang/DRLLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 19320, 287, 8448, 1435, 1216, 9539, 288, 3639, 775, 288, 5411, 1720, 50, 10100, 2355, 9904, 31, 5411, 368, 463, 31027, 14915, 1695, 10649, 8464, 1695, 10649, 8464, 7482, 1695, 12215, 17, 9576, 1695, 4816, 1695, 5254, 1695, 4683, 1695, 3341, 1695, 12215, 1695, 4936, 1695, 16483, 18, 75, 30, 3437, 8643, 30, 29, 30, 261, 25215, 261, 296, 20, 11, 6116, 296, 23, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 571, 25215, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 571, 25215, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 262, 5411, 509, 3770, 3461, 33, 23, 31, 5411, 509, 2928, 3461, 67, 20, 273, 810, 18, 2534, 12, 21, 1769, 5411, 309, 261, 261, 2534, 3461, 67, 20, 18920, 1695, 6134, 262, 288, 7734, 509, 2928, 3461, 67, 21, 273, 810, 18, 2534, 12, 22, 1769, 7734, 309, 261, 14015, 2534, 3461, 67, 21, 34, 2218, 20, 11, 597, 2928, 3461, 67, 21, 32, 2218, 23, 26112, 262, 288, 10792, 509, 2928, 3461, 67, 22, 273, 810, 18, 2534, 12, 23, 1769, 10792, 309, 261, 14015, 2534, 3461, 67, 22, 34, 2218, 20, 11, 597, 2928, 3461, 67, 22, 32, 2218, 27, 26112, 262, 288, 13491, 509, 2928, 3461, 67, 24, 273, 810, 18, 2534, 12, 24, 1769, 13491, 309, 261, 14015, 2534, 3461, 67, 24, 34, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 19320, 287, 8448, 1435, 1216, 9539, 288, 3639, 775, 288, 5411, 1720, 50, 10100, 2355, 9904, 31, 5411, 368, 463, 31027, 14915, 1695, 10649, 8464, 1695, 10649, 8464, 7482, 1695, 12215, 17, 9576, 1695, 4816, 1695, 5254, 1695, 4683, 1695, 3341, 1695, 12215, 1695, 4936, 1695, 16483, 18, 75, 30, 3437, 8643, 30, 29, 30, 261, 25215, 261, 296, 20, 11, 6116, 296, 23, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 571, 25215, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 571, 25215, 261, 296, 20, 11, 6116, 296, 27, 11, 262, 2 ]
public void testMemoryLeak() throws InterruptedException{ _memLeakCounter=0; FinalizationListener<DefinitionsDocument> fl = new FinalizationListener<DefinitionsDocument>() { public void finalized(FinalizationEvent<DefinitionsDocument> fe) { _memLeakCounter++; } }; // Adding the listeners will load the document into the cache OpenDefinitionsDocument doc1 = _model.newFile(); doc1.addFinalizationListener(fl); OpenDefinitionsDocument doc2 = _model.newFile(); doc2.addFinalizationListener(fl); OpenDefinitionsDocument doc3 = _model.newFile(); doc3.addFinalizationListener(fl); OpenDefinitionsDocument doc4 = _model.newFile(); doc4.addFinalizationListener(fl); OpenDefinitionsDocument doc5 = _model.newFile(); doc5.addFinalizationListener(fl); System.gc(); Thread.sleep(100); assertEquals("One doc should have been collected", 1, _memLeakCounter); doc1.getLength(); doc2.getLength(); doc3.getLength(); doc4.getLength(); doc5.getLength(); System.gc(); Thread.sleep(100); assertEquals("several docs should have been collected", 6, _memLeakCounter); }
11192 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11192/c73227da8024bfd14e7a2df3af6435d7a78133b3/DocumentCacheTest.java/buggy/drjava/src/edu/rice/cs/drjava/model/cache/DocumentCacheTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 282, 918, 282, 1842, 6031, 1682, 581, 1435, 282, 1216, 282, 7558, 95, 5411, 389, 3917, 1682, 581, 4789, 33, 20, 31, 5411, 16269, 1588, 2223, 32, 7130, 2519, 34, 282, 1183, 282, 273, 282, 394, 282, 16269, 1588, 2223, 32, 7130, 2519, 34, 1435, 282, 288, 5375, 1071, 282, 918, 282, 727, 1235, 12, 7951, 1588, 1133, 32, 7130, 2519, 34, 282, 1656, 13, 282, 288, 13491, 389, 3917, 1682, 581, 4789, 9904, 31, 5375, 289, 5411, 289, 31, 5411, 368, 282, 21240, 282, 326, 282, 4679, 282, 903, 282, 1262, 282, 326, 282, 1668, 282, 1368, 282, 326, 282, 1247, 5411, 3502, 7130, 2519, 282, 997, 21, 282, 273, 282, 389, 2284, 18, 2704, 812, 5621, 5411, 997, 21, 18, 1289, 7951, 1588, 2223, 12, 2242, 1769, 9079, 3502, 7130, 2519, 282, 997, 22, 282, 273, 282, 389, 2284, 18, 2704, 812, 5621, 5411, 997, 22, 18, 1289, 7951, 1588, 2223, 12, 2242, 1769, 5411, 3502, 7130, 2519, 282, 997, 23, 282, 273, 282, 389, 2284, 18, 2704, 812, 5621, 5411, 997, 23, 18, 1289, 7951, 1588, 2223, 12, 2242, 1769, 5411, 3502, 7130, 2519, 282, 997, 24, 282, 273, 282, 389, 2284, 18, 2704, 812, 5621, 5411, 997, 24, 18, 1289, 7951, 1588, 2223, 12, 2242, 1769, 5411, 3502, 7130, 2519, 282, 997, 25, 282, 273, 282, 389, 2284, 18, 2704, 812, 5621, 5411, 997, 25, 18, 1289, 7951, 1588, 2223, 12, 2242, 1769, 13491, 2332, 18, 13241, 5621, 5411, 4884, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 282, 918, 282, 1842, 6031, 1682, 581, 1435, 282, 1216, 282, 7558, 95, 5411, 389, 3917, 1682, 581, 4789, 33, 20, 31, 5411, 16269, 1588, 2223, 32, 7130, 2519, 34, 282, 1183, 282, 273, 282, 394, 282, 16269, 1588, 2223, 32, 7130, 2519, 34, 1435, 282, 288, 5375, 1071, 282, 918, 282, 727, 1235, 12, 7951, 1588, 1133, 32, 7130, 2519, 34, 282, 1656, 13, 282, 288, 13491, 389, 3917, 1682, 581, 4789, 9904, 31, 5375, 289, 5411, 289, 31, 5411, 368, 282, 21240, 282, 326, 282, 4679, 282, 903, 282, 1262, 282, 326, 282, 1668, 282, 1368, 282, 326, 282, 1247, 5411, 3502, 7130, 2519, 282, 997, 21, 282, 273, 282, 389, 2284, 18, 2704, 812, 2 ]
return java.lang.reflect.Array.getInt(longDataArray.get(longIndex), shortIndex);
return java.lang.reflect.Array.getInt(longDataArray.get(longIndex+1), shortIndex);
public int getIntData (Locator locator) throws NoDataException { int longIndex = getLongArrayIndex(locator); int shortIndex = getShortArrayIndex(locator); try { if (java.lang.reflect.Array.getByte(longDataArray.get(longIndex), shortIndex) !=1) throw new NoDataException(); //the location we try to access contains noDataValue return java.lang.reflect.Array.getInt(longDataArray.get(longIndex), shortIndex); } catch (Exception e) { //the location we try to access is not allocated, //i.e., no data in the cell throw new NoDataException(); } }
4483 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4483/7829c1e6b0c38cc610aa1c76af7f8f8c5c1e19e2/DataCube.java/buggy/src/gov/nasa/gsfc/adc/xdf/DataCube.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 1071, 509, 8145, 751, 261, 5786, 8871, 13, 565, 1216, 2631, 22480, 282, 288, 540, 509, 1525, 1016, 273, 11105, 1076, 1016, 12, 20048, 1769, 1377, 509, 3025, 1016, 273, 13157, 1076, 1016, 12, 20048, 1769, 540, 775, 288, 540, 309, 261, 6290, 18, 4936, 18, 1734, 1582, 18, 1076, 18, 588, 3216, 12, 5748, 751, 1076, 18, 588, 12, 5748, 1016, 3631, 3025, 1016, 13, 480, 21, 13, 5411, 604, 394, 2631, 22480, 5621, 225, 368, 5787, 2117, 732, 775, 358, 2006, 1914, 1158, 28013, 5411, 327, 2252, 18, 4936, 18, 1734, 1582, 18, 1076, 18, 588, 1702, 12, 5748, 751, 1076, 18, 588, 12, 5748, 1016, 15, 21, 3631, 3025, 1016, 1769, 1377, 289, 1377, 1044, 261, 503, 425, 13, 288, 225, 368, 5787, 2117, 732, 775, 358, 2006, 353, 486, 11977, 16, 1850, 368, 77, 18, 73, 12990, 1158, 501, 316, 326, 2484, 1850, 604, 394, 2631, 22480, 5621, 1377, 289, 1377, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 1071, 509, 8145, 751, 261, 5786, 8871, 13, 565, 1216, 2631, 22480, 282, 288, 540, 509, 1525, 1016, 273, 11105, 1076, 1016, 12, 20048, 1769, 1377, 509, 3025, 1016, 273, 13157, 1076, 1016, 12, 20048, 1769, 540, 775, 288, 540, 309, 261, 6290, 18, 4936, 18, 1734, 1582, 18, 1076, 18, 588, 3216, 12, 5748, 751, 1076, 18, 588, 12, 5748, 1016, 3631, 3025, 1016, 13, 480, 21, 13, 5411, 604, 394, 2631, 22480, 5621, 225, 368, 5787, 2117, 732, 775, 358, 2006, 1914, 1158, 28013, 5411, 327, 2252, 18, 4936, 18, 1734, 1582, 18, 1076, 18, 588, 1702, 12, 5748, 751, 1076, 18, 588, 12, 5748, 1016, 15, 21, 3631, 3025, 1016, 1769, 1377, 289, 1377, 1044, 2 ]
public void createActions() { if (Configuration.isTrue("xr.use.listeners", true)) { SelectionMouseListener ma = new SelectionMouseListener(); root.panel.view.addMouseListener(ma); root.panel.view.addMouseMotionListener(ma); // XXX Is this necessary? Basically identical code // appears in XHTMLPanel.setupListeners(). HoverListener hl = new HoverListener(root.panel.view); root.panel.view.addMouseListener(hl); root.panel.view.addMouseMotionListener(hl); LinkListener ll = new LinkListener(root.panel.view); root.panel.view.addMouseListener(ll); root.panel.view.addMouseMotionListener(ll); } }
52947 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52947/9a4ed9a276ff3906598aa1c6aa55aeb8a2745a6e/BrowserMenuBar.java/clean/demos/browser/src/java/org/xhtmlrenderer/demo/browser/BrowserMenuBar.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 752, 6100, 1435, 288, 3639, 309, 261, 1750, 18, 291, 5510, 2932, 92, 86, 18, 1202, 18, 16072, 3113, 638, 3719, 288, 5411, 12977, 9186, 2223, 10843, 273, 394, 12977, 9186, 2223, 5621, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 2223, 12, 2540, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 29360, 2223, 12, 2540, 1769, 7734, 368, 11329, 2585, 333, 4573, 35, 225, 7651, 1230, 12529, 981, 5411, 368, 14606, 316, 30551, 5537, 18, 8401, 5583, 7675, 5411, 670, 1643, 2223, 16043, 273, 394, 670, 1643, 2223, 12, 3085, 18, 13916, 18, 1945, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 2223, 12, 25356, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 29360, 2223, 12, 25356, 1769, 5411, 4048, 2223, 6579, 273, 394, 4048, 2223, 12, 3085, 18, 13916, 18, 1945, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 2223, 12, 2906, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 29360, 2223, 12, 2906, 1769, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 752, 6100, 1435, 288, 3639, 309, 261, 1750, 18, 291, 5510, 2932, 92, 86, 18, 1202, 18, 16072, 3113, 638, 3719, 288, 5411, 12977, 9186, 2223, 10843, 273, 394, 12977, 9186, 2223, 5621, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 2223, 12, 2540, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 29360, 2223, 12, 2540, 1769, 7734, 368, 11329, 2585, 333, 4573, 35, 225, 7651, 1230, 12529, 981, 5411, 368, 14606, 316, 30551, 5537, 18, 8401, 5583, 7675, 5411, 670, 1643, 2223, 16043, 273, 394, 670, 1643, 2223, 12, 3085, 18, 13916, 18, 1945, 1769, 5411, 1365, 18, 13916, 18, 1945, 18, 1289, 9186, 2223, 12, 25356, 1769, 5411, 1365, 18, 13916, 2 ]
ServerSocketChannel serverSocketChannel = ServerSocketChannel.open(); serverSocket = serverSocketChannel.socket();
if (useChannels) { ServerSocketChannel serverSocketChannel = ServerSocketChannel.open(); serverSocket = serverSocketChannel.socket(); } else { serverSocket = new ServerSocket(); }
private static ServerSocket newBoundServerSocket(String address, int port, boolean ssl) throws IOException { ServerSocket serverSocket = null; InetAddress bindAddress = null; if (address != null && address.length() > 0) { bindAddress = InetAddress.getByName(address); } if (!ssl) { ServerSocketChannel serverSocketChannel = ServerSocketChannel.open(); serverSocket = serverSocketChannel.socket(); } else { SSLServerSocketFactory fact = (SSLServerSocketFactory) SSLServerSocketFactory.getDefault(); serverSocket = fact.createServerSocket(); } serverSocket.setReuseAddress(true); InetSocketAddress isa = new InetSocketAddress(bindAddress, port); serverSocket.bind(isa, 1024); return serverSocket; }
6965 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6965/7e254912e5b1780f251b70da052369107290b44a/NetUtil.java/buggy/ZimbraServer/src/java/com/zimbra/cs/util/NetUtil.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 3224, 4534, 394, 3499, 2081, 4534, 12, 780, 1758, 16, 509, 1756, 16, 1250, 5832, 13, 1216, 1860, 288, 3639, 3224, 4534, 1438, 4534, 273, 446, 31, 3639, 14218, 1993, 1887, 273, 446, 31, 3639, 309, 261, 2867, 480, 446, 597, 1758, 18, 2469, 1435, 405, 374, 13, 288, 5411, 1993, 1887, 273, 14218, 18, 588, 5911, 12, 2867, 1769, 3639, 289, 3639, 309, 16051, 8157, 13, 288, 5411, 3224, 4534, 2909, 1438, 4534, 2909, 273, 3224, 4534, 2909, 18, 3190, 5621, 5411, 1438, 4534, 273, 1438, 4534, 2909, 18, 7814, 5621, 3639, 289, 469, 288, 5411, 7419, 2081, 4534, 1733, 5410, 273, 261, 6745, 2081, 4534, 1733, 13, 5411, 7419, 2081, 4534, 1733, 18, 588, 1868, 5621, 5411, 1438, 4534, 273, 5410, 18, 2640, 2081, 4534, 5621, 3639, 289, 3639, 1438, 4534, 18, 542, 31704, 1887, 12, 3767, 1769, 3639, 17943, 353, 69, 273, 394, 17943, 12, 4376, 1887, 16, 1756, 1769, 3639, 1438, 4534, 18, 4376, 12, 291, 69, 16, 6250, 1769, 3639, 327, 1438, 4534, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 3224, 4534, 394, 3499, 2081, 4534, 12, 780, 1758, 16, 509, 1756, 16, 1250, 5832, 13, 1216, 1860, 288, 3639, 3224, 4534, 1438, 4534, 273, 446, 31, 3639, 14218, 1993, 1887, 273, 446, 31, 3639, 309, 261, 2867, 480, 446, 597, 1758, 18, 2469, 1435, 405, 374, 13, 288, 5411, 1993, 1887, 273, 14218, 18, 588, 5911, 12, 2867, 1769, 3639, 289, 3639, 309, 16051, 8157, 13, 288, 5411, 3224, 4534, 2909, 1438, 4534, 2909, 273, 3224, 4534, 2909, 18, 3190, 5621, 5411, 1438, 4534, 273, 1438, 4534, 2909, 18, 7814, 5621, 3639, 289, 469, 288, 5411, 7419, 2081, 4534, 1733, 5410, 273, 261, 6745, 2081, 4534, 1733, 13, 5411, 7419, 2081, 4534, 1733, 18, 588, 2 ]
} else if (traceState.EQ(TRACE_TIB_VALUE) || traceState.EQ(TRACE_DEATH_TIME) || traceState.EQ(TRACE_STATIC_TARGET)) {
} else if (traceState.EQ(TRACE_TIB_VALUE) || traceState.EQ(TRACE_DEATH_TIME) || traceState.EQ(TRACE_STATIC_TARGET)) {
public final void process() { Word traceState = TRACE_NEW_RECORD; int entriesNotFlushed = 0; /* First we must flush any remaining data */ Log.writeln(); /* Process through the entire buffer. */ while (checkDequeue(1)) { /* For speed and efficiency, we will actually process the data buffer by buffer and not by dequeue-ing each entry. */ while (!bufferOffset(head).isZero()) { head = head.minus(BYTES_IN_ADDRESS); Word val = head.loadWord(); if (traceState.EQ(TRACE_NEW_RECORD)) { if (val.EQ(TRACE_GCSTART)) { Log.write('G'); Log.write('C'); Log.writeln('B', true); } else if (val.EQ(TRACE_GCEND)) { Log.write('G'); Log.write('C'); Log.writeln('E', true); } else { traceState = val; } } else { if (traceState.EQ(TRACE_EXACT_ALLOC) || traceState.EQ(TRACE_ALLOC)) { Log.write( (traceState.EQ(TRACE_EXACT_ALLOC)) ? 'A' : 'a'); Log.write(' '); Log.write(val); traceState = TRACE_ALLOC_SIZE; } else if (traceState.EQ(TRACE_EXACT_IMMORTAL_ALLOC) || traceState.EQ(TRACE_IMMORTAL_ALLOC)) { Log.write( (traceState.EQ(TRACE_EXACT_IMMORTAL_ALLOC)) ? 'I' : 'i'); Log.write(' '); Log.write(val); traceState = TRACE_ALLOC_SIZE; } else if (traceState.EQ(TRACE_BOOT_ALLOC)) { Log.write('B'); Log.write(' '); Log.write(val); traceState = TRACE_BOOT_ALLOC_SIZE; } else if (traceState.EQ(TRACE_DEATH)) { Log.write('D'); Log.write(' '); Log.write(val); traceState = TRACE_DEATH_TIME; } else if (traceState.EQ(TRACE_BOOT_ALLOC_SIZE)) { Log.write(val); traceState = TRACE_NEW_RECORD; } else if (traceState.EQ(TRACE_ALLOC_SIZE)) { Log.write(val); traceState = TRACE_ALLOC_FP; } else if (traceState.EQ(TRACE_ALLOC_FP)) { Log.write(val); traceState = TRACE_ALLOC_THREAD; } else if (traceState.EQ(TRACE_ALLOC_THREAD)) { Log.write(val); traceState = TRACE_NEW_RECORD; } else if (traceState.EQ(TRACE_TIB_SET)) { Log.write('T'); Log.write(' '); Log.write(val); traceState = TRACE_TIB_VALUE; } else if (traceState.EQ(TRACE_STATIC_SET)) { Log.write('S'); Log.write(' '); Log.write(val); traceState = TRACE_STATIC_TARGET; } else if (traceState.EQ(TRACE_TIB_VALUE) || traceState.EQ(TRACE_DEATH_TIME) || traceState.EQ(TRACE_STATIC_TARGET)) { Log.write(val); traceState = TRACE_NEW_RECORD; } else if (traceState.EQ(TRACE_FIELD_SET) || traceState.EQ(TRACE_ARRAY_SET)) { Log.write('U'); Log.write(' '); Log.write(val); traceState = TRACE_FIELD_SLOT; } else if (traceState.EQ(TRACE_FIELD_TARGET) || traceState.EQ(TRACE_ARRAY_TARGET)) { Log.write(val); traceState = TRACE_NEW_RECORD; } else if (traceState.EQ(TRACE_FIELD_SLOT) || traceState.EQ(TRACE_ARRAY_ELEMENT)) { Log.write(val); traceState = TRACE_FIELD_TARGET; } else Assert.fail("Cannot understand directive!\n"); if (traceState.EQ(TRACE_NEW_RECORD)) { entriesNotFlushed++; Log.writeln(); } else { Log.write(' '); } } if (entriesNotFlushed == 10) { Log.flush(); entriesNotFlushed = 0; } } } resetLocal(); }
5245 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5245/4c66aa27cec27f8dd5902baec018ff86d7f49ee2/TraceBuffer.java/buggy/MMTk/src/org/mmtk/utility/deque/TraceBuffer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 727, 918, 1207, 1435, 288, 565, 9926, 2606, 1119, 273, 12734, 67, 12917, 67, 22261, 31, 565, 509, 3222, 1248, 8207, 329, 273, 374, 31, 565, 1748, 5783, 732, 1297, 3663, 1281, 4463, 501, 1195, 565, 1827, 18, 5363, 292, 82, 5621, 3639, 1748, 4389, 3059, 326, 7278, 1613, 18, 1195, 565, 1323, 261, 1893, 758, 4000, 12, 21, 3719, 288, 1377, 1748, 2457, 8632, 471, 30325, 16, 732, 903, 6013, 1207, 326, 501, 1613, 635, 1850, 1613, 471, 486, 635, 29964, 17, 310, 1517, 1241, 18, 1195, 1377, 1323, 16051, 4106, 2335, 12, 1978, 2934, 291, 7170, 10756, 288, 3639, 910, 273, 910, 18, 19601, 12, 13718, 67, 706, 67, 15140, 1769, 3639, 9926, 1244, 273, 910, 18, 945, 3944, 5621, 3639, 309, 261, 5129, 1119, 18, 27247, 12, 23827, 67, 12917, 67, 22261, 3719, 288, 1850, 309, 261, 1125, 18, 27247, 12, 23827, 67, 15396, 7570, 3719, 288, 5411, 1827, 18, 2626, 2668, 43, 8284, 5411, 1827, 18, 2626, 2668, 39, 8284, 5411, 1827, 18, 5363, 292, 82, 2668, 38, 2187, 638, 1769, 1850, 289, 469, 309, 261, 1125, 18, 27247, 12, 23827, 67, 15396, 4415, 3719, 288, 5411, 1827, 18, 2626, 2668, 43, 8284, 5411, 1827, 18, 2626, 2668, 39, 8284, 5411, 1827, 18, 5363, 292, 82, 2668, 41, 2187, 638, 1769, 1850, 289, 469, 288, 5411, 2606, 1119, 273, 1244, 31, 1850, 289, 3639, 289, 469, 288, 1850, 309, 261, 5129, 1119, 18, 27247, 12, 23827, 67, 2294, 6526, 67, 1013, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 727, 918, 1207, 1435, 288, 565, 9926, 2606, 1119, 273, 12734, 67, 12917, 67, 22261, 31, 565, 509, 3222, 1248, 8207, 329, 273, 374, 31, 565, 1748, 5783, 732, 1297, 3663, 1281, 4463, 501, 1195, 565, 1827, 18, 5363, 292, 82, 5621, 3639, 1748, 4389, 3059, 326, 7278, 1613, 18, 1195, 565, 1323, 261, 1893, 758, 4000, 12, 21, 3719, 288, 1377, 1748, 2457, 8632, 471, 30325, 16, 732, 903, 6013, 1207, 326, 501, 1613, 635, 1850, 1613, 471, 486, 635, 29964, 17, 310, 1517, 1241, 18, 1195, 1377, 1323, 16051, 4106, 2335, 12, 1978, 2934, 291, 7170, 10756, 288, 3639, 910, 273, 910, 18, 19601, 12, 13718, 67, 706, 67, 15140, 1769, 3639, 9926, 1244, 273, 2 ]
public boolean fire(Player player, SpeakerNPC engine) { return player.hasQuest("weapons_collector") && ! player.isQuestCompleted("weapons_collector"); }
public void fire(Player player, String text, SpeakerNPC engine) { List<String> missing = missingWeapons(player, false); if (missing.contains(text)) { if (player.drop(text)) { String doneText = player.getQuest("weapons_collector"); player.setQuest("weapons_collector", doneText + ";" + text); missing = missingWeapons(player, true); if (missing.size() > 0) { engine.say("Thank you very much! Do you have anything else for me?"); } else { Item iceSword = StendhalRPWorld.get().getRuleManager().getEntityManager().getItem("ice_sword"); player.equip(iceSword, true); player.addXP(1000); engine.say("At last, my collection is complete! Thank you very much; here, take this #ice #sword in exchange!"); player.setQuest("weapons_collector", "done"); player.notifyWorldAboutChanges(); } } else { engine.say("I may be old, but I'm not senile, and you clearly don't have " + Grammar.a_noun(text) + ". What do you really have for me?"); } } else { engine.say("I already have that one. Do you have any other weapon for me?"); } }
public boolean fire(Player player, SpeakerNPC engine) { return player.hasQuest("weapons_collector") && ! player.isQuestCompleted("weapons_collector"); }
4438 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4438/81b0f3d72482d33d1d9eab93ed20ed2ba6e4476c/WeaponsCollector.java/buggy/src/games/stendhal/server/maps/quests/WeaponsCollector.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4405, 202, 482, 1250, 4452, 12, 12148, 7291, 16, 348, 347, 6388, 50, 3513, 4073, 13, 288, 25083, 202, 2463, 7291, 18, 5332, 30791, 2932, 1814, 438, 7008, 67, 21356, 7923, 6862, 9506, 202, 10, 10, 401, 7291, 18, 291, 30791, 9556, 2932, 1814, 438, 7008, 67, 21356, 8863, 6862, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4405, 202, 482, 1250, 4452, 12, 12148, 7291, 16, 348, 347, 6388, 50, 3513, 4073, 13, 288, 25083, 202, 2463, 7291, 18, 5332, 30791, 2932, 1814, 438, 7008, 67, 21356, 7923, 6862, 9506, 202, 10, 10, 401, 7291, 18, 291, 30791, 9556, 2932, 1814, 438, 7008, 67, 21356, 8863, 6862, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
}
}
public void scanElementType(XMLEntityHandler.EntityReader entityReader, char fastchar, QName element) throws Exception { if (!fNamespacesEnabled) { element.clear(); element.localpart = entityReader.scanName(fastchar); element.rawname = element.localpart; } else { entityReader.scanQName(fastchar, element); if (entityReader.lookingAtChar(':', false)) { fErrorReporter.reportError(fErrorReporter.getLocator(), XMLMessages.XML_DOMAIN, XMLMessages.MSG_TWO_COLONS_IN_QNAME, XMLMessages.P5_INVALID_CHARACTER, null, XMLErrorReporter.ERRORTYPE_FATAL_ERROR); entityReader.skipPastNmtoken(' '); } } } // scanElementType(XMLEntityHandler.EntityReader,char,QName)
4434 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4434/f2b9ad84920b2015a53c9a67b4dfb5460fa0465e/XMLValidator.java/clean/src/org/apache/xerces/validators/common/XMLValidator.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4135, 17481, 12, 60, 9687, 1628, 1503, 18, 1943, 2514, 1522, 2514, 16, 4766, 1149, 4797, 3001, 16, 16723, 930, 13, 1216, 1185, 288, 3639, 309, 16051, 74, 13180, 1526, 13, 288, 5411, 930, 18, 8507, 5621, 5411, 930, 18, 3729, 2680, 273, 1522, 2514, 18, 9871, 461, 12, 8076, 3001, 1769, 5411, 930, 18, 1899, 529, 273, 930, 18, 3729, 2680, 31, 3639, 289, 469, 288, 5411, 1522, 2514, 18, 9871, 13688, 12, 8076, 3001, 16, 930, 1769, 5411, 309, 261, 1096, 2514, 18, 7330, 310, 861, 2156, 2668, 30, 2187, 629, 3719, 288, 7734, 284, 668, 13289, 18, 6006, 668, 12, 74, 668, 13289, 18, 588, 5786, 9334, 4766, 6647, 3167, 5058, 18, 4201, 67, 18192, 16, 4766, 6647, 3167, 5058, 18, 11210, 67, 18869, 51, 67, 4935, 673, 55, 67, 706, 67, 16032, 16, 4766, 6647, 3167, 5058, 18, 52, 25, 67, 9347, 67, 27858, 16, 4766, 6647, 446, 16, 4766, 6647, 3167, 668, 13289, 18, 3589, 2399, 67, 29891, 67, 3589, 1769, 7734, 1522, 2514, 18, 7457, 52, 689, 50, 1010, 969, 2668, 28005, 5411, 289, 3639, 289, 565, 289, 368, 4135, 17481, 12, 60, 9687, 1628, 1503, 18, 1943, 2514, 16, 3001, 16, 13688, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4135, 17481, 12, 60, 9687, 1628, 1503, 18, 1943, 2514, 1522, 2514, 16, 4766, 1149, 4797, 3001, 16, 16723, 930, 13, 1216, 1185, 288, 3639, 309, 16051, 74, 13180, 1526, 13, 288, 5411, 930, 18, 8507, 5621, 5411, 930, 18, 3729, 2680, 273, 1522, 2514, 18, 9871, 461, 12, 8076, 3001, 1769, 5411, 930, 18, 1899, 529, 273, 930, 18, 3729, 2680, 31, 3639, 289, 469, 288, 5411, 1522, 2514, 18, 9871, 13688, 12, 8076, 3001, 16, 930, 1769, 5411, 309, 261, 1096, 2514, 18, 7330, 310, 861, 2156, 2668, 30, 2187, 629, 3719, 288, 7734, 284, 668, 13289, 18, 6006, 668, 12, 74, 668, 13289, 18, 588, 5786, 9334, 4766, 6647, 3167, 5058, 18, 4201, 2 ]
assertTrue(smiles1.equals("[H]OC(=O)[C@](F)(C([H])([H])[H])N([H])[H]"));
assertEquals("[H]OC(=O)[C@](F)(C([H])([H])[H])N([H])[H]", smiles1);
public void testAlanin() { HydrogenPlacer hydrogenPlacer = new HydrogenPlacer(); Molecule mol1 = new Molecule(); SmilesGenerator sg = new SmilesGenerator(mol1.getBuilder()); mol1.addAtom(new Atom("N", new Point2d(1, 0))); // 1 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 2 mol1.addAtom(new Atom("F", new Point2d(1, 2))); // 3 mol1.addAtom(new Atom("C", new Point2d(0, 0))); // 4 mol1.addAtom(new Atom("C", new Point2d(1, 4))); // 5 mol1.addAtom(new Atom("O", new Point2d(1, 5))); // 6 mol1.addAtom(new Atom("O", new Point2d(1, 6))); // 7 mol1.addBond(0, 1, 1); // 1 mol1.addBond(1, 2, 1, CDKConstants.STEREO_BOND_UP); // 2 mol1.addBond(1, 3, 1, CDKConstants.STEREO_BOND_DOWN); // 3 mol1.addBond(1, 4, 1); // 4 mol1.addBond(4, 5, 1); // 5 mol1.addBond(4, 6, 2); // 6 try { new HydrogenAdder().addHydrogensToSatisfyValency(mol1); hydrogenPlacer.placeHydrogens2D(mol1, 1.0); IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder()); ifac.configureAtoms(mol1); } catch (Exception ex) { fail(); } String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]OC(=O)[C@](F)(N([H])[H])C([H])([H])[H]")); mol1.getBondAt(1).setStereo(CDKConstants.STEREO_BOND_DOWN); mol1.getBondAt(2).setStereo(CDKConstants.STEREO_BOND_UP); try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]OC(=O)[C@](F)(C([H])([H])[H])N([H])[H]")); }
45254 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45254/5901c3218304395fccef66f9ad165bb3d7c49c9f/SmilesGeneratorTest.java/buggy/src/org/openscience/cdk/test/smiles/SmilesGeneratorTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 1067, 304, 267, 1435, 202, 95, 202, 202, 17507, 24096, 1749, 10598, 4855, 24096, 1749, 10598, 273, 394, 14881, 24096, 1749, 10598, 5621, 3639, 490, 10545, 12629, 21, 273, 394, 490, 10545, 5621, 202, 202, 9552, 1449, 3908, 11150, 273, 394, 9425, 1449, 3908, 12, 21260, 21, 18, 588, 1263, 10663, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 50, 3113, 394, 4686, 22, 72, 12, 21, 16, 374, 3719, 1769, 202, 202, 759, 404, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 39, 3113, 394, 4686, 22, 72, 12, 21, 16, 576, 3719, 1769, 202, 202, 759, 576, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 42, 3113, 394, 4686, 22, 72, 12, 21, 16, 576, 3719, 1769, 202, 202, 759, 890, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 39, 3113, 394, 4686, 22, 72, 12, 20, 16, 374, 3719, 1769, 202, 202, 759, 1059, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 39, 3113, 394, 4686, 22, 72, 12, 21, 16, 1059, 3719, 1769, 202, 202, 759, 1381, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 51, 3113, 394, 4686, 22, 72, 12, 21, 16, 1381, 3719, 1769, 202, 202, 759, 1666, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 51, 3113, 394, 4686, 22, 72, 12, 21, 16, 1666, 3719, 1769, 202, 202, 759, 2371, 202, 202, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 1067, 304, 267, 1435, 202, 95, 202, 202, 17507, 24096, 1749, 10598, 4855, 24096, 1749, 10598, 273, 394, 14881, 24096, 1749, 10598, 5621, 3639, 490, 10545, 12629, 21, 273, 394, 490, 10545, 5621, 202, 202, 9552, 1449, 3908, 11150, 273, 394, 9425, 1449, 3908, 12, 21260, 21, 18, 588, 1263, 10663, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 50, 3113, 394, 4686, 22, 72, 12, 21, 16, 374, 3719, 1769, 202, 202, 759, 404, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 7149, 2932, 39, 3113, 394, 4686, 22, 72, 12, 21, 16, 576, 3719, 1769, 202, 202, 759, 576, 202, 202, 21260, 21, 18, 1289, 3641, 12, 2704, 2 ]
if (VM_Interface.VerifyAssertions) VM_Interface._assert(bytes < LOS_SIZE_THRESHOLD);
if (VM_Interface.VerifyAssertions) VM_Interface._assert(bytes <= LOS_SIZE_THRESHOLD);
public final VM_Address allocCopy(VM_Address original, int bytes, boolean isScalar) throws VM_PragmaInline { if (VM_Interface.VerifyAssertions) VM_Interface._assert(bytes < LOS_SIZE_THRESHOLD); VM_Address result = ss.alloc(isScalar, bytes); return result; }
49871 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49871/b140a2b7371955b80cf503a0ee6b25d60caef46b/Plan.java/clean/rvm/src/vm/memoryManagers/JMTk/plan/semiSpace/Plan.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 727, 8251, 67, 1887, 4767, 2951, 12, 7397, 67, 1887, 2282, 16, 509, 1731, 16, 4405, 565, 1250, 11604, 3473, 13, 377, 1216, 8251, 67, 2050, 9454, 10870, 288, 565, 309, 261, 7397, 67, 1358, 18, 8097, 8213, 1115, 13, 8251, 67, 1358, 6315, 11231, 12, 3890, 1648, 1806, 55, 67, 4574, 67, 23840, 1769, 565, 8251, 67, 1887, 563, 273, 5202, 18, 9853, 12, 291, 13639, 16, 1731, 1769, 565, 327, 563, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 727, 8251, 67, 1887, 4767, 2951, 12, 7397, 67, 1887, 2282, 16, 509, 1731, 16, 4405, 565, 1250, 11604, 3473, 13, 377, 1216, 8251, 67, 2050, 9454, 10870, 288, 565, 309, 261, 7397, 67, 1358, 18, 8097, 8213, 1115, 13, 8251, 67, 1358, 6315, 11231, 12, 3890, 1648, 1806, 55, 67, 4574, 67, 23840, 1769, 565, 8251, 67, 1887, 563, 273, 5202, 18, 9853, 12, 291, 13639, 16, 1731, 1769, 565, 327, 563, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
u = new UdpSocketManager(port); } catch (SocketException e) {
u = new UdpSocketManager(port, InetAddress.getByName(bindto)); } catch (Exception e) {
private Node(Config config, RandomSource random) throws NodeInitException { // Easy stuff arkPutter = new MyARKInserter(); startupTime = System.currentTimeMillis(); throttleWindow = new ThrottleWindowManager(2.0); alerts = new UserAlertManager(); recentlyCompletedIDs = new LRUQueue(); this.config = config; this.random = random; cachedPubKeys = new LRUHashtable(); lm = new LocationManager(random); try { localhostAddress = InetAddress.getByName("127.0.0.1"); } catch (UnknownHostException e3) { // Does not do a reverse lookup, so this is impossible throw new Error(e3); } ipDetector = new IPAddressDetector(10*1000, this); requestSenders = new HashMap(); transferringRequestSenders = new HashMap(); insertSenders = new HashMap(); runningUIDs = new HashSet(); ps = new PacketSender(this); // FIXME maybe these should persist? They need to be private though, so after the node/peers split. (bug 51). decrementAtMax = random.nextDouble() <= DECREMENT_AT_MAX_PROB; decrementAtMin = random.nextDouble() <= DECREMENT_AT_MIN_PROB; bootID = random.nextLong(); throttledPacketSendAverage = new TimeDecayingRunningAverage(1, 60000 /* should be significantly longer than a typical transfer */, 0, Long.MAX_VALUE); // Setup node-specific configuration SubConfig nodeConfig = new SubConfig("node", config); // IP address override nodeConfig.register("ipAddressOverride", "", 0, true, "IP address override", "IP address override (not usually needed)", new StringCallback() { public String get() { if(overrideIPAddress == null) return ""; else return overrideIPAddress.toString(); } public void set(String val) throws InvalidConfigValueException { // FIXME do we need to tell anyone? if(val.length() == 0) { // Set to null overrideIPAddress = null; lastIPAddress = null; redetectAddress(); shouldInsertARK(); return; } FreenetInetAddress addr; try { addr = new FreenetInetAddress(val, false); } catch (UnknownHostException e) { throw new InvalidConfigValueException("Unknown host: "+e.getMessage()); } overrideIPAddress = addr; lastIPAddress = null; redetectAddress(); shouldInsertARK(); } }); String ipOverrideString = nodeConfig.getString("ipAddressOverride"); if(ipOverrideString.length() == 0) overrideIPAddress = null; else { try { overrideIPAddress = new FreenetInetAddress(ipOverrideString, false); } catch (UnknownHostException e) { String msg = "Unknown host: "+ipOverrideString+" in config: "+e.getMessage(); Logger.error(this, msg); System.err.println(msg+" but starting up anyway with no IP override"); overrideIPAddress = null; } } // Determine the port number nodeConfig.register("listenPort", -1 /* means random */, 1, true, "FNP port number (UDP)", "UDP port for node-to-node communications (Freenet Node Protocol)", new IntCallback() { public int get() { return portNumber; } public void set(int val) throws InvalidConfigValueException { // FIXME implement on the fly listenPort changing // Note that this sort of thing should be the exception rather than the rule!!!! String msg = "Switching listenPort on the fly not yet supported!"; Logger.error(this, msg); throw new InvalidConfigValueException(msg); } }); int port=-1; try{ port=nodeConfig.getInt("listenPort"); }catch (Exception e){ Logger.error(this, "Caught "+e, e); System.err.println(e); e.printStackTrace(); port=-1; } UdpSocketManager u = null; if(port > 65535) { throw new NodeInitException(EXIT_IMPOSSIBLE_USM_PORT, "Impossible port number: "+port); } else if(port == -1) { // Pick a random port for(int i=0;i<200000;i++) { int portNo = 1024 + random.nextInt(65535-1024); try { u = new UdpSocketManager(portNo); port = u.getPortNumber(); break; } catch (SocketException e) { Logger.normal(this, "Could not use port: "+portNo+": "+e, e); System.err.println("Could not use port: "+portNo+": "+e); e.printStackTrace(); continue; } } if(u == null) throw new NodeInitException(EXIT_NO_AVAILABLE_UDP_PORTS, "Could not find an available UDP port number for FNP (none specified)"); } else { try { u = new UdpSocketManager(port); } catch (SocketException e) { throw new NodeInitException(EXIT_IMPOSSIBLE_USM_PORT, "Could not bind to port: "+port+" (node already running?)"); } } usm = u; System.out.println("Port number: "+port); portNumber = port; Logger.normal(Node.class, "Creating node..."); // Bandwidth limit // FIXME These should not be static !!!! Need a context object for BT for bwlimiting. // See bug 77 nodeConfig.register("outputBandwidthLimit", "15K", 3, false, "Output bandwidth limit", "Hard output bandwidth limit (bytes/sec); the node should almost never exceed this", new IntCallback() { public int get() { return BlockTransmitter.getHardBandwidthLimit(); } public void set(int val) throws InvalidConfigValueException { BlockTransmitter.setHardBandwidthLimit(val); } }); int obwLimit = nodeConfig.getInt("outputBandwidthLimit"); BlockTransmitter.setHardBandwidthLimit(obwLimit); // FIXME add an averaging/long-term/soft bandwidth limit. (bug 76) // There is already untested support for this in BlockTransmitter. // No long-term limit for now. BlockTransmitter.setSoftBandwidthLimit(0, 0); // SwapRequestInterval nodeConfig.register("swapRequestSendInterval", 2000, 4, true, "Swap request send interval (ms)", "Interval between swap attempting to send swap requests in milliseconds. Leave this alone!", new IntCallback() { public int get() { return swapInterval.fixedInterval; } public void set(int val) throws InvalidConfigValueException { swapInterval.set(val); } }); swapInterval = new StaticSwapRequestInterval(nodeConfig.getInt("swapRequestSendInterval")); // Testnet. // Cannot be enabled/disabled on the fly. // If enabled, forces certain other config options. if((testnetHandler = TestnetHandler.maybeCreate(this, config)) != null) { String msg = "WARNING: ENABLING TESTNET CODE! This WILL seriously jeopardize your anonymity!"; Logger.error(this, msg); System.err.println(msg); testnetEnabled = true; if(logConfigHandler.getFileLoggerHook() == null) { System.err.println("Forcing logging enabled (essential for testnet)"); logConfigHandler.forceEnableLogging(); } int x = Logger.globalGetThreshold(); if(!(x == Logger.MINOR || x == Logger.DEBUG)) { System.err.println("Forcing log threshold to MINOR for testnet, was "+x); Logger.globalSetThreshold(Logger.MINOR); } if(logConfigHandler.getMaxZippedLogFiles() < TESTNET_MIN_MAX_ZIPPED_LOGFILES) { System.err.println("Forcing max zipped logfiles space to 256MB for testnet"); try { logConfigHandler.setMaxZippedLogFiles(TESTNET_MIN_MAX_ZIPPED_LOGFILES_STRING); } catch (InvalidConfigValueException e) { throw new Error("Impossible: "+e); } } } else { String s = "Testnet mode DISABLED. You may have some level of anonymity. :)\n"+ "Note that while we no longer have explicit back-doors enabled, this version of Freenet is still a very early alpha, and may well have numerous bugs and design flaws.\n"+ "In particular: YOU ARE WIDE OPEN TO YOUR IMMEDIATE DARKNET PEERS! They can eavesdrop on your requests with relatively little difficulty at present (correlation attacks etc)."; Logger.normal(this, s); System.err.println(s); testnetEnabled = false; FileLoggerHook flh = logConfigHandler.getFileLoggerHook(); if(flh != null) flh.deleteAllOldLogFiles(); } if(wasTestnet != testnetEnabled) { Logger.error(this, "Switched from testnet mode to non-testnet mode or vice versa! Regenerating pubkey, privkey, and deleting logs."); this.myCryptoGroup = Global.DSAgroupBigA; this.myPrivKey = new DSAPrivateKey(myCryptoGroup, random); this.myPubKey = new DSAPublicKey(myCryptoGroup, myPrivKey); } // Directory for node-related files other than store nodeConfig.register("nodeDir", ".", 6, true, "Node directory", "Name of directory to put node-related files e.g. peers list in", new StringCallback() { public String get() { return nodeDir.getPath(); } public void set(String val) throws InvalidConfigValueException { if(nodeDir.equals(new File(val))) return; // FIXME throw new InvalidConfigValueException("Moving node directory on the fly not supported at present"); } }); nodeDir = new File(nodeConfig.getString("nodeDir")); if(!((nodeDir.exists() && nodeDir.isDirectory()) || (nodeDir.mkdir()))) { String msg = "Could not find or create datastore directory"; throw new NodeInitException(EXIT_BAD_NODE_DIR, msg); } // After we have set up testnet and IP address, load the node file try { // FIXME should take file directly? readNodeFile(new File(nodeDir, "node-"+portNumber).getPath(), random); } catch (IOException e) { try { readNodeFile(new File("node-"+portNumber+".bak").getPath(), random); } catch (IOException e1) { initNodeFileSettings(random); } } // Then read the peers peers = new PeerManager(this, new File(nodeDir, "peers-"+portNumber).getPath()); peers.writePeers(); peers.checkEmpty(); nodePinger = new NodePinger(this); usm.setDispatcher(dispatcher=new NodeDispatcher(this)); usm.setLowLevelFilter(packetMangler = new FNPPacketMangler(this)); // Temp files nodeConfig.register("tempDir", new File(nodeDir, "temp-"+portNumber).toString(), 6, true, "Temp files directory", "Name of directory to put temporary files in", new StringCallback() { public String get() { return tempDir.getPath(); } public void set(String val) throws InvalidConfigValueException { if(tempDir.equals(new File(val))) return; // FIXME throw new InvalidConfigValueException("Moving temp directory on the fly not supported at present"); } }); tempDir = new File(nodeConfig.getString("tempDir")); if(!((tempDir.exists() && tempDir.isDirectory()) || (tempDir.mkdir()))) { String msg = "Could not find or create temporary directory"; throw new NodeInitException(EXIT_BAD_TEMP_DIR, msg); } try { tempFilenameGenerator = new FilenameGenerator(random, true, tempDir, "temp-"); } catch (IOException e) { String msg = "Could not find or create temporary directory (filename generator)"; throw new NodeInitException(EXIT_BAD_TEMP_DIR, msg); } tempBucketFactory = new PaddedEphemerallyEncryptedBucketFactory(new TempBucketFactory(tempFilenameGenerator), random, 1024); // Persistent temp files nodeConfig.register("persistentTempDir", new File(nodeDir, "persistent-temp-"+portNumber).toString(), 7, true, "Persistent temp files directory", "Name of directory to put persistent temp files in", new StringCallback() { public String get() { return persistentTempBucketFactory.getDir().toString(); } public void set(String val) throws InvalidConfigValueException { if(!get().equals(val)) return; // FIXME throw new InvalidConfigValueException("Moving persistent temp directory on the fly not supported at present"); } }); try { persistentTempBucketFactory = new PersistentTempBucketFactory(new File(nodeConfig.getString("persistentTempDir")), "freenet-temp-", random); } catch (IOException e2) { String msg = "Could not find or create persistent temporary directory"; throw new NodeInitException(EXIT_BAD_TEMP_DIR, msg); } // Datastore nodeConfig.register("storeSize", "1G", 8, false, "Store size in bytes", "Store size in bytes", new LongCallback() { public long get() { return maxStoreKeys * sizePerKey; } public void set(long storeSize) throws InvalidConfigValueException { if(storeSize < 0 || storeSize < (32 * 1024 * 1024)) throw new InvalidConfigValueException("Invalid store size"); long newMaxStoreKeys = storeSize / sizePerKey; if(newMaxStoreKeys == maxStoreKeys) return; // Update each datastore maxStoreKeys = newMaxStoreKeys; chkDatastore.setMaxKeys(maxStoreKeys); sskDatastore.setMaxKeys(maxStoreKeys); pubKeyDatastore.setMaxKeys(maxStoreKeys); } }); long storeSize = nodeConfig.getLong("storeSize"); if(/*storeSize < 0 || */storeSize < (32 * 1024 * 1024)) { // totally arbitrary minimum! throw new NodeInitException(EXIT_INVALID_STORE_SIZE, "Invalid store size"); } maxStoreKeys = storeSize / sizePerKey; nodeConfig.register("storeDir", ".", 9, true, "Store directory", "Name of directory to put store files in", new StringCallback() { public String get() { return storeDir.getPath(); } public void set(String val) throws InvalidConfigValueException { if(storeDir.equals(new File(val))) return; // FIXME throw new InvalidConfigValueException("Moving datastore on the fly not supported at present"); } }); storeDir = new File(nodeConfig.getString("storeDir")); if(!((storeDir.exists() && storeDir.isDirectory()) || (storeDir.mkdir()))) { String msg = "Could not find or create datastore directory"; throw new NodeInitException(EXIT_STORE_OTHER, msg); } try { chkDatastore = new BerkeleyDBFreenetStore(storeDir.getPath()+File.separator+"store-"+portNumber, maxStoreKeys, 32768, CHKBlock.TOTAL_HEADERS_LENGTH); sskDatastore = new BerkeleyDBFreenetStore(storeDir.getPath()+File.separator+"sskstore-"+portNumber, maxStoreKeys, 1024, SSKBlock.TOTAL_HEADERS_LENGTH); pubKeyDatastore = new BerkeleyDBFreenetStore(storeDir.getPath()+File.separator+"pubkeystore-"+portNumber, maxStoreKeys, DSAPublicKey.PADDED_SIZE, 0); } catch (FileNotFoundException e1) { String msg = "Could not open datastore: "+e1; Logger.error(this, msg, e1); System.err.println(msg); throw new NodeInitException(EXIT_STORE_FILE_NOT_FOUND, msg); } catch (IOException e1) { String msg = "Could not open datastore: "+e1; Logger.error(this, msg, e1); System.err.println(msg); throw new NodeInitException(EXIT_STORE_IOEXCEPTION, msg); } catch (Exception e1) { String msg = "Could not open datastore: "+e1; Logger.error(this, msg, e1); System.err.println(msg); throw new NodeInitException(EXIT_STORE_OTHER, msg); } // Downloads directory nodeConfig.register("downloadsDir", "downloads", 10, false, "Default download directory", "The directory to save downloaded files into by default", new StringCallback() { public String get() { return downloadDir.getPath(); } public void set(String val) throws InvalidConfigValueException { if(downloadDir.equals(new File(val))) return; File f = new File(val); if(!((f.exists() && f.isDirectory()) || (f.mkdir()))) { throw new InvalidConfigValueException("Could not find or create directory"); } downloadDir = new File(val); } }); String val = nodeConfig.getString("downloadsDir"); downloadDir = new File(val); if(!((downloadDir.exists() && downloadDir.isDirectory()) || (downloadDir.mkdir()))) { throw new NodeInitException(EXIT_BAD_DOWNLOADS_DIR, "Could not find or create default downloads directory"); } // Name nodeConfig.register("name", myName, 11, false, "Node name for darknet", "Node name; you may want to set this to something descriptive if running on darknet e.g. Fred Blogg's Node; it is visible to any connecting node", new NodeNameCallback(this)); nodeNameUserAlert = new MeaningfulNodeNameUserAlert(); myName = nodeConfig.getString("name"); nodeConfig.finishedInitialization(); writeNodeFile(); // FIXME make all the below arbitrary constants configurable! archiveManager = new ArchiveManager(MAX_ARCHIVE_HANDLERS, MAX_CACHED_ARCHIVE_DATA, MAX_ARCHIVE_SIZE, MAX_ARCHIVED_FILE_SIZE, MAX_CACHED_ELEMENTS, random, tempFilenameGenerator); chkRequestThrottle = new MyRequestThrottle(throttleWindow, 5000, "CHK Request"); chkRequestStarter = new RequestStarter(this, chkRequestThrottle, "CHK Request starter ("+portNumber+")"); chkFetchScheduler = new ClientRequestScheduler(false, false, random, chkRequestStarter, this); chkRequestStarter.setScheduler(chkFetchScheduler); chkRequestStarter.start(); //insertThrottle = new ChainedRequestThrottle(10000, 2.0F, requestThrottle); // FIXME reenable the above chkInsertThrottle = new MyRequestThrottle(throttleWindow, 10000, "CHK Insert"); chkInsertStarter = new RequestStarter(this, chkInsertThrottle, "CHK Insert starter ("+portNumber+")"); chkPutScheduler = new ClientRequestScheduler(true, false, random, chkInsertStarter, this); chkInsertStarter.setScheduler(chkPutScheduler); chkInsertStarter.start(); sskRequestThrottle = new MyRequestThrottle(throttleWindow, 5000, "SSK Request"); sskRequestStarter = new RequestStarter(this, sskRequestThrottle, "SSK Request starter ("+portNumber+")"); sskFetchScheduler = new ClientRequestScheduler(false, true, random, sskRequestStarter, this); sskRequestStarter.setScheduler(sskFetchScheduler); sskRequestStarter.start(); //insertThrottle = new ChainedRequestThrottle(10000, 2.0F, requestThrottle); // FIXME reenable the above sskInsertThrottle = new MyRequestThrottle(throttleWindow, 10000, "SSK Insert"); sskInsertStarter = new RequestStarter(this, sskInsertThrottle, "SSK Insert starter ("+portNumber+")"); sskPutScheduler = new ClientRequestScheduler(true, true, random, sskInsertStarter, this); sskInsertStarter.setScheduler(sskPutScheduler); sskInsertStarter.start(); uskManager = new USKManager(this); // And finally, Initialize the plugin manager pluginManager = new PluginManager(this); FetcherContext ctx = makeClient((short)0).getFetcherContext(); ctx.allowSplitfiles = false; ctx.dontEnterImplicitArchives = true; ctx.maxArchiveRestarts = 0; ctx.maxMetadataSize = 256; ctx.maxNonSplitfileRetries = 10; ctx.maxOutputLength = 4096; ctx.maxRecursionLevel = 2; ctx.maxTempLength = 4096; this.arkFetcherContext = ctx; }
49933 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49933/a2140f6a34d967d0c7ae7bce5ad9faffbec7de3c/Node.java/buggy/src/freenet/node/Node.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 2029, 12, 809, 642, 16, 8072, 1830, 2744, 13, 1216, 2029, 2570, 503, 288, 377, 202, 377, 202, 759, 29442, 10769, 377, 202, 1313, 6426, 387, 273, 394, 8005, 9584, 382, 550, 387, 5621, 377, 202, 23939, 950, 273, 2332, 18, 2972, 28512, 5621, 377, 202, 27971, 298, 3829, 273, 394, 20640, 298, 3829, 1318, 12, 22, 18, 20, 1769, 3639, 24304, 273, 394, 2177, 13298, 1318, 5621, 3639, 19907, 9556, 5103, 273, 394, 511, 19866, 3183, 5621, 377, 202, 2211, 18, 1425, 273, 642, 31, 377, 202, 2211, 18, 9188, 273, 2744, 31, 377, 202, 7097, 9581, 2396, 273, 394, 511, 19866, 5582, 14544, 5621, 202, 202, 25972, 273, 394, 7050, 1318, 12, 9188, 1769, 377, 202, 698, 288, 1082, 202, 13014, 1887, 273, 14218, 18, 588, 5911, 2932, 14260, 18, 20, 18, 20, 18, 21, 8863, 202, 202, 97, 1044, 261, 4874, 29776, 425, 23, 13, 288, 1082, 202, 759, 9637, 486, 741, 279, 4219, 3689, 16, 1427, 333, 353, 23343, 1082, 202, 12849, 394, 1068, 12, 73, 23, 1769, 202, 202, 97, 3639, 2359, 12594, 273, 394, 23588, 12594, 12, 2163, 14, 18088, 16, 333, 1769, 3639, 590, 3826, 414, 273, 394, 4317, 5621, 3639, 906, 74, 20245, 691, 3826, 414, 273, 394, 4317, 5621, 3639, 2243, 3826, 414, 273, 394, 4317, 5621, 3639, 3549, 3060, 87, 273, 394, 6847, 5621, 3639, 4250, 273, 394, 11114, 12021, 12, 2211, 1769, 3639, 368, 9852, 6944, 4259, 1410, 3898, 35, 16448, 1608, 358, 506, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 2029, 12, 809, 642, 16, 8072, 1830, 2744, 13, 1216, 2029, 2570, 503, 288, 377, 202, 377, 202, 759, 29442, 10769, 377, 202, 1313, 6426, 387, 273, 394, 8005, 9584, 382, 550, 387, 5621, 377, 202, 23939, 950, 273, 2332, 18, 2972, 28512, 5621, 377, 202, 27971, 298, 3829, 273, 394, 20640, 298, 3829, 1318, 12, 22, 18, 20, 1769, 3639, 24304, 273, 394, 2177, 13298, 1318, 5621, 3639, 19907, 9556, 5103, 273, 394, 511, 19866, 3183, 5621, 377, 202, 2211, 18, 1425, 273, 642, 31, 377, 202, 2211, 18, 9188, 273, 2744, 31, 377, 202, 7097, 9581, 2396, 273, 394, 511, 19866, 5582, 14544, 5621, 202, 202, 25972, 273, 394, 7050, 1318, 12, 9188, 1769, 377, 2 ]
_compilerErrorModel = new CompilerErrorModel<CompilerError>(new CompilerError[0], _model);
_compilerErrorModel = new CompilerErrorModel(new CompilerError[0], _model);
public void resetCompilerErrors() { // TODO: see if we can get by without this function _compilerErrorModel = new CompilerErrorModel<CompilerError>(new CompilerError[0], _model); }
11192 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11192/77338216372080de4db082805b7e88fd5281f85c/DefaultCompilerModel.java/buggy/drjava/src/edu/rice/cs/drjava/model/compiler/DefaultCompilerModel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 2715, 9213, 4229, 1435, 288, 565, 368, 2660, 30, 2621, 309, 732, 848, 336, 635, 2887, 333, 445, 565, 389, 9576, 668, 1488, 273, 394, 12972, 668, 1488, 12, 2704, 12972, 668, 63, 20, 6487, 389, 2284, 1769, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 2715, 9213, 4229, 1435, 288, 565, 368, 2660, 30, 2621, 309, 732, 848, 336, 635, 2887, 333, 445, 565, 389, 9576, 668, 1488, 273, 394, 12972, 668, 1488, 12, 2704, 12972, 668, 63, 20, 6487, 389, 2284, 1769, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
suite.addTestSuite(groovy.bugs.Groovy770_Bug.class); suite.addTestSuite(groovy.bugs.Groovy779_Bug.class);
public static Test suite() { TestSuite suite = new TestSuite(); suite.addTestSuite(groovy.bugs.ArrayMethodCallBug.class); suite.addTestSuite(groovy.bugs.ClassGeneratorFixesTest.class); suite.addTestSuite(groovy.bugs.ClassInScriptBug.class); suite.addTestSuite(groovy.bugs.ClosuresInScriptBug.class); suite.addTestSuite(groovy.bugs.ClosureWithStaticVariablesBug.class); //todo suite.addTestSuite(groovy.bugs.ConstructorParameterBug.class); suite.addTestSuite(groovy.bugs.DoubleSizeParametersBug.class); suite.addTestSuite(groovy.bugs.Groovy278_Bug.class); suite.addTestSuite(groovy.bugs.Groovy303_Bug.class); suite.addTestSuite(groovy.bugs.Groovy770_Bug.class); // TODO //suite.addTestSuite(groovy.bugs.Groovy308_Bug.class); suite.addTestSuite(groovy.bugs.Groovy558_616_Bug.class); // TODO //suite.addTestSuite(groovy.bugs.Groovy593_Bug.class); suite.addTestSuite(groovy.bugs.Groovy666_Bug.class); // TODO //suite.addTestSuite(groovy.bugs.Groovy675_Bug.class); //todo suite.addTestSuite(groovy.bugs.IanMaceysBug.class); suite.addTestSuite(groovy.bugs.InterfaceImplBug.class); suite.addTestSuite(groovy.bugs.MarkupInScriptBug.class); suite.addTestSuite(groovy.bugs.PrimitivePropertyBug.class); suite.addTestSuite(groovy.bugs.ScriptBug.class); suite.addTestSuite(groovy.bugs.SeansBug.class); suite.addTestSuite(groovy.bugs.StaticMethodCallBug.class); //todo suite.addTestSuite(groovy.bugs.SubscriptOnPrimitiveTypeArrayBug.class); suite.addTestSuite(groovy.bugs.SubscriptOnStringArrayBug.class); suite.addTestSuite(groovy.lang.GroovyShellTest.class); suite.addTestSuite(groovy.lang.GStringTest.class); suite.addTestSuite(groovy.lang.IntRangeTest.class); suite.addTestSuite(groovy.lang.MetaClassTest.class); suite.addTestSuite(groovy.lang.RangeTest.class); //todo suite.addTestSuite(groovy.lang.ScriptIntegerDivideTest.class); suite.addTestSuite(groovy.lang.ScriptPrintTest.class); suite.addTestSuite(groovy.lang.ScriptTest.class); suite.addTestSuite(groovy.lang.SequenceTest.class); suite.addTestSuite(groovy.lang.TupleTest.class); suite.addTestSuite(groovy.mock.example.SandwichMakerTest.class); suite.addTestSuite(groovy.mock.MockTest.class); suite.addTestSuite(groovy.model.TableModelTest.class);//todo - error in some test environments suite.addTestSuite(groovy.security.RunAllGroovyScriptsSuite.class);//todo - error in some test environments suite.addTestSuite(groovy.security.RunOneGroovyScript.class);//todo - error in some test environments suite.addTestSuite(groovy.security.SecurityTest.class);//todo - error in some test environments suite.addTestSuite(groovy.security.SecurityTestSupport.class);//todo - error in some test environments suite.addTestSuite(groovy.security.SignedJarTest.class); suite.addTestSuite(groovy.sql.PersonTest.class); suite.addTestSuite(groovy.sql.SqlCompleteTest.class); suite.addTestSuite(groovy.sql.SqlCompleteWithoutDataSourceTest.class); suite.addTestSuite(groovy.sql.SqlTest.class); suite.addTestSuite(groovy.sql.SqlWithBuilderTest.class); suite.addTestSuite(groovy.sql.SqlWithTypedResultsTest.class); suite.addTestSuite(groovy.sql.SqlRowsTest.class); //todo suite.addTestSuite(groovy.text.TemplateTest.class); suite.addTestSuite(groovy.tree.NodePrinterTest.class); suite.addTestSuite(groovy.txn.TransactionTest.class); //todo suite.addTestSuite(groovy.util.EmptyScriptTest.class); suite.addTestSuite(groovy.util.MBeanTest.class); suite.addTestSuite(groovy.util.NodeTest.class); suite.addTestSuite(groovy.util.XmlParserTest.class); //todo suite.addTestSuite(groovy.util.BuilderSupportTest.class); // TODO //suite.addTestSuite(groovy.xml.dom.DOMTest.class); suite.addTestSuite(groovy.xml.DOMTest.class); suite.addTestSuite(groovy.xml.MarkupTest.class); suite.addTestSuite(groovy.xml.MarkupWithWriterTest.class); suite.addTestSuite(groovy.xml.NamespaceDOMTest.class); suite.addTestSuite(groovy.xml.SAXTest.class); suite.addTestSuite(groovy.xml.SmallNamespaceDOMTest.class); suite.addTestSuite(groovy.xml.VerboseDOMTest.class); suite.addTestSuite(groovy.xml.XmlTest.class); //suite.addTestSuite(groovy.swing.SwingBuilderTest.class); return suite; }
6462 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6462/66167153b3b638ff9fe321f03a75d455f0fe2e6e/UberTestCase2.java/buggy/src/test/UberTestCase2.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 1071, 30676, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 760, 30676, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 18, 1106, 1769, 565, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 20, 67, 19865, 18, 1106, 1769, 11371, 18, 1289, 4709, 13587, 12, 75, 12859, 18, 19381, 18, 43, 12859, 4700, 29, 67, 19865, 2 ]
private void extractFieldParameterTags( JavaClass javaClass, List rawParams )
private void extractFieldParameterTags( JavaClass javaClass, Map rawParams )
private void extractFieldParameterTags( JavaClass javaClass, List rawParams ) { // we have to add the parent fields first, so that they will be overwritten by the local fields if // that actually happens... JavaClass superClass = javaClass.getSuperJavaClass(); if ( superClass != null ) { extractFieldParameterTags( superClass, rawParams ); } JavaField[] classFields = javaClass.getFields(); if ( classFields != null ) { for ( int i = 0; i < classFields.length; i++ ) { JavaField field = classFields[i]; DocletTag paramTag = field.getTagByName( PARAMETER ); if ( paramTag != null ) { rawParams.add( field ); } } } }
47160 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47160/e771f3f56dba5a33ada238dc7d733f1b68fc5dd8/JavaMojoDescriptorExtractor.java/clean/maven-plugin-tools/maven-plugin-tools-java/src/main/java/org/apache/maven/tools/plugin/extractor/java/JavaMojoDescriptorExtractor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 2608, 974, 1662, 3453, 12, 29491, 2252, 797, 16, 1635, 1831, 1370, 262, 565, 288, 3639, 368, 732, 1240, 358, 527, 326, 982, 1466, 1122, 16, 1427, 716, 2898, 903, 506, 15345, 635, 326, 1191, 1466, 309, 3639, 368, 716, 6013, 10555, 2777, 3639, 29491, 18846, 273, 2252, 797, 18, 588, 8051, 5852, 797, 5621, 3639, 309, 261, 18846, 480, 446, 262, 3639, 288, 5411, 2608, 974, 1662, 3453, 12, 18846, 16, 1831, 1370, 11272, 3639, 289, 3639, 5110, 974, 8526, 667, 2314, 273, 2252, 797, 18, 588, 2314, 5621, 3639, 309, 261, 667, 2314, 480, 446, 262, 3639, 288, 5411, 364, 261, 509, 277, 273, 374, 31, 277, 411, 667, 2314, 18, 2469, 31, 277, 9904, 262, 5411, 288, 7734, 5110, 974, 652, 273, 667, 2314, 63, 77, 15533, 7734, 3521, 1810, 1805, 579, 1805, 273, 652, 18, 588, 1805, 5911, 12, 18120, 11272, 7734, 309, 261, 579, 1805, 480, 446, 262, 7734, 288, 10792, 1831, 1370, 18, 1289, 12, 652, 11272, 7734, 289, 5411, 289, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 2608, 974, 1662, 3453, 12, 29491, 2252, 797, 16, 1635, 1831, 1370, 262, 565, 288, 3639, 368, 732, 1240, 358, 527, 326, 982, 1466, 1122, 16, 1427, 716, 2898, 903, 506, 15345, 635, 326, 1191, 1466, 309, 3639, 368, 716, 6013, 10555, 2777, 3639, 29491, 18846, 273, 2252, 797, 18, 588, 8051, 5852, 797, 5621, 3639, 309, 261, 18846, 480, 446, 262, 3639, 288, 5411, 2608, 974, 1662, 3453, 12, 18846, 16, 1831, 1370, 11272, 3639, 289, 3639, 5110, 974, 8526, 667, 2314, 273, 2252, 797, 18, 588, 2314, 5621, 3639, 309, 261, 667, 2314, 480, 446, 262, 3639, 288, 5411, 364, 261, 509, 277, 273, 374, 31, 277, 411, 667, 2314, 18, 2469, 31, 277, 2 ]
public Icon getPressedIcon() { return pressed_button; }
public Icon getPressedIcon() { return pressed_icon; }
public Icon getPressedIcon() { return pressed_button; }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/2703ae3b51c371a2a79d28271cd57b4046c647d0/AbstractButton.java/buggy/core/src/classpath/javax/javax/swing/AbstractButton.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 16011, 1689, 4638, 5554, 1435, 288, 202, 202, 2463, 19504, 67, 5391, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 16011, 1689, 4638, 5554, 1435, 288, 202, 202, 2463, 19504, 67, 5391, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
d.process(fout);
d.process(fout, true);
public void testMain() throws IOException { System.out.println("main"); final String path = System.getProperty("java.io.tmpdir")+ File.separator + "wiztest.txt"; final String password = "testpwd"; final String wrongPassword = "wrongpwd"; // Please provide content with NO new lines (\n): final String content = "This is a dummy text!"; File fin = new File(path); fin.deleteOnExit(); // Write dummy content into the file PrintWriter pw = new PrintWriter(new FileWriter(fin)); pw.println(content); pw.close(); String[] arg = new String[]{"-e", "-p", password, path}; // Encryption Encrypt e = new Encrypt(); try { e.init(password); e.process(fin); } catch (InvalidKeyException ex) { fail(ex.getMessage()); } catch (NoSuchAlgorithmException ex) { fail(ex.getMessage()); } catch (NoSuchPaddingException ex) { fail(ex.getMessage()); } // Creation of fout File fout = new File(path+".wiz"); // Decryption Decrypt d = new Decrypt(); // test for wrong password try { d.init(wrongPassword); try { d.process(fout); fail("Cannot process for wrong supplied password!!!"); } catch (PasswordMismatchException ex) { // should be visited here; } } catch (InvalidKeyException ex) { fail(ex.getMessage()); } catch (NoSuchPaddingException ex) { fail(ex.getMessage()); } catch (NoSuchAlgorithmException ex) { fail(ex.getMessage()); } try { d.init(password); // Try processing file not ending with .wiz try{ d.process(new File(path+".xxx")); fail("Cannot process for file not ending with .wiz"); } catch(FileNotFoundException fnfe){ // should be visited here } catch(PasswordMismatchException ex){ fail(ex.getMessage()); } try{ d.process(fout); } catch (PasswordMismatchException ex) { fail(ex.getMessage()); } } catch (InvalidKeyException ex) { fail(ex.getMessage()); } catch (NoSuchAlgorithmException ex) { fail(ex.getMessage()); } catch (NoSuchPaddingException ex) { fail(ex.getMessage()); } // Read content to verify BufferedReader br = new BufferedReader(new FileReader(fin)); String str = br.readLine(); br.close(); assertEquals(content, str); }
56853 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56853/4bf4f5c84b3febb1cba973101273f3a9028b7d14/MainTest.java/buggy/trunk/src/test/java/org/wiztools/wizcrypt/MainTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 6376, 1435, 1216, 1860, 288, 3639, 2332, 18, 659, 18, 8222, 2932, 5254, 8863, 7734, 727, 514, 589, 273, 2332, 18, 588, 1396, 2932, 6290, 18, 1594, 18, 5645, 1214, 7923, 15, 7734, 1387, 18, 11287, 397, 315, 91, 452, 3813, 18, 5830, 14432, 7734, 727, 514, 2201, 273, 315, 3813, 27487, 14432, 7734, 727, 514, 7194, 3913, 273, 315, 21530, 27487, 14432, 7734, 368, 7801, 5615, 913, 598, 3741, 394, 2362, 17938, 82, 4672, 3639, 727, 514, 913, 273, 315, 2503, 353, 279, 9609, 977, 4442, 31, 7734, 1387, 574, 273, 394, 1387, 12, 803, 1769, 3639, 574, 18, 3733, 1398, 6767, 5621, 7734, 368, 2598, 9609, 913, 1368, 326, 585, 7734, 14071, 8772, 273, 394, 14071, 12, 2704, 24639, 12, 926, 10019, 3639, 8772, 18, 8222, 12, 1745, 1769, 3639, 8772, 18, 4412, 5621, 7734, 514, 8526, 1501, 273, 394, 514, 63, 7073, 6, 17, 73, 3113, 3701, 84, 3113, 2201, 16, 589, 20451, 7734, 368, 14585, 7734, 19612, 425, 273, 394, 19612, 5621, 7734, 775, 288, 5411, 425, 18, 2738, 12, 3664, 1769, 5411, 425, 18, 2567, 12, 926, 1769, 3639, 289, 1044, 261, 1941, 21914, 431, 13, 288, 5411, 2321, 12, 338, 18, 24906, 10663, 3639, 289, 1044, 261, 28341, 17293, 431, 13, 288, 5411, 2321, 12, 338, 18, 24906, 10663, 3639, 289, 1044, 261, 28341, 9485, 503, 431, 13, 288, 5411, 2321, 12, 338, 18, 24906, 10663, 3639, 289, 7734, 368, 18199, 434, 17382, 7734, 1387, 17382, 273, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 6376, 1435, 1216, 1860, 288, 3639, 2332, 18, 659, 18, 8222, 2932, 5254, 8863, 7734, 727, 514, 589, 273, 2332, 18, 588, 1396, 2932, 6290, 18, 1594, 18, 5645, 1214, 7923, 15, 7734, 1387, 18, 11287, 397, 315, 91, 452, 3813, 18, 5830, 14432, 7734, 727, 514, 2201, 273, 315, 3813, 27487, 14432, 7734, 727, 514, 7194, 3913, 273, 315, 21530, 27487, 14432, 7734, 368, 7801, 5615, 913, 598, 3741, 394, 2362, 17938, 82, 4672, 3639, 727, 514, 913, 273, 315, 2503, 353, 279, 9609, 977, 4442, 31, 7734, 1387, 574, 273, 394, 1387, 12, 803, 1769, 3639, 574, 18, 3733, 1398, 6767, 5621, 7734, 368, 2598, 9609, 913, 1368, 326, 585, 7734, 14071, 8772, 2 ]
private IStatus doShow(NIConsole console, IConsoleView view, IProgressMonitor monitor) throws PartInitException {
private IStatus doShow(IConsoleView view, IProgressMonitor monitor) throws PartInitException {
private IStatus doShow(NIConsole console, IConsoleView view, IProgressMonitor monitor) throws PartInitException { IWorkbenchPage page = getPage(); if (page == null || monitor.isCanceled()) { return Status.CANCEL_STATUS; } if (view == null) { String secId = console.getType() + System.currentTimeMillis(); // force creation view = (IConsoleView) page.showView(IConsoleConstants.ID_CONSOLE_VIEW, secId, IWorkbenchPage.VIEW_CREATE); } view.display(console); if (fActivate) { page.activate(view); } else { page.bringToTop(view); } return Status.OK_STATUS; }
47575 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47575/d3bba4266f35b585495a603d2b7a2630e87ff6c4/PageRegistry.java/clean/de.walware.statet.nico.ui/src/de/walware/statet/nico/ui/internal/PageRegistry.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 1152, 467, 1482, 741, 5706, 12, 50, 45, 10215, 2983, 16, 467, 10215, 1767, 1476, 16, 467, 5491, 7187, 6438, 13, 1216, 6393, 2570, 503, 288, 25083, 202, 45, 2421, 22144, 1964, 1363, 273, 8957, 5621, 1082, 202, 430, 261, 2433, 422, 446, 747, 6438, 18, 291, 23163, 10756, 288, 9506, 202, 2463, 2685, 18, 25268, 67, 8608, 31, 1082, 202, 97, 1082, 202, 430, 261, 1945, 422, 446, 13, 288, 9506, 202, 780, 1428, 548, 273, 2983, 18, 588, 559, 1435, 397, 2332, 18, 2972, 28512, 5621, 368, 2944, 6710, 9506, 202, 1945, 273, 261, 45, 10215, 1767, 13, 1363, 18, 4500, 1767, 12, 45, 10215, 2918, 18, 734, 67, 2248, 3584, 900, 67, 12145, 16, 1428, 548, 16, 467, 2421, 22144, 1964, 18, 12145, 67, 9344, 1769, 1082, 202, 97, 1082, 202, 1945, 18, 5417, 12, 8698, 1769, 1082, 202, 430, 261, 74, 21370, 13, 288, 9506, 202, 2433, 18, 10014, 12, 1945, 1769, 1082, 202, 97, 1082, 202, 12107, 288, 9506, 202, 2433, 18, 2848, 310, 774, 3401, 12, 1945, 1769, 1082, 202, 97, 1082, 202, 2463, 2685, 18, 3141, 67, 8608, 31, 202, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 1152, 467, 1482, 741, 5706, 12, 50, 45, 10215, 2983, 16, 467, 10215, 1767, 1476, 16, 467, 5491, 7187, 6438, 13, 1216, 6393, 2570, 503, 288, 25083, 202, 45, 2421, 22144, 1964, 1363, 273, 8957, 5621, 1082, 202, 430, 261, 2433, 422, 446, 747, 6438, 18, 291, 23163, 10756, 288, 9506, 202, 2463, 2685, 18, 25268, 67, 8608, 31, 1082, 202, 97, 1082, 202, 430, 261, 1945, 422, 446, 13, 288, 9506, 202, 780, 1428, 548, 273, 2983, 18, 588, 559, 1435, 397, 2332, 18, 2972, 28512, 5621, 368, 2944, 6710, 9506, 202, 1945, 273, 261, 45, 10215, 1767, 13, 1363, 18, 4500, 1767, 12, 45, 10215, 2918, 18, 734, 67, 2248, 3584, 900, 67, 12145, 16, 2 ]
System.out.println("[bestMult] min: "+histogram[0]+" max: "+histogram[threadCount-1]+" 10th-precentile: "+histogram[threadCount/10]);
System.out.println("[bestMult] [DWS] min: "+histogram[0]+" max: "+histogram[threadCount-1]);
public static int bestMult(int data_cache1, int data_cache2) { int threadCount = NodeEnumerator.getNumberOfNodes(); int min_mult;// = cache_size; int histogram[] = new int[threadCount]; for (int t = 0; t < threadCount; t++) { SIROperator oper = NodeEnumerator.getOperator(t); int dws = DataEstimate.estimateDWS(oper); int io = DataEstimate.estimateIOSize(oper); int avail = 0; // if dws < .8 * data_cahce1 if (dws / 8 * 10 < data_cache1) { avail = data_cache1 - dws; } else { avail = data_cache2 - dws; } if (io == 0) io = 1; int mult = avail / io; //System.out.println("DWS: "+dws+" Avail: "+avail+" IO: "+io+" Mult: "+mult); histogram[t] = mult; //if (mult < min_mult) { min_mult = mult; } } Arrays.sort(histogram); System.out.println("[bestMult] min: "+histogram[0]+" max: "+histogram[threadCount-1]+" 10th-precentile: "+histogram[threadCount/10]); min_mult = histogram[threadCount/10]; if (min_mult > 100) min_mult = 100; if (min_mult < 0) min_mult = 1; System.out.println("[bestMult] returning multiplicity : "+min_mult); return min_mult; }
5955 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5955/27a6931eed80e22f34097df73528fdc32def5326/FusionCode.java/clean/streams/src/at/dms/kjc/cluster/FusionCode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 509, 3796, 5049, 12, 474, 501, 67, 2493, 21, 16, 509, 501, 67, 2493, 22, 13, 288, 202, 474, 2650, 1380, 273, 2029, 3572, 7385, 18, 588, 9226, 3205, 5621, 202, 474, 1131, 67, 5421, 31, 759, 273, 1247, 67, 1467, 31, 202, 474, 8892, 8526, 273, 394, 509, 63, 5930, 1380, 15533, 202, 1884, 261, 474, 268, 273, 374, 31, 268, 411, 2650, 1380, 31, 268, 27245, 288, 202, 377, 202, 565, 5705, 1457, 457, 639, 2255, 273, 2029, 3572, 7385, 18, 588, 5592, 12, 88, 1769, 202, 565, 509, 302, 4749, 273, 1910, 13638, 18, 23562, 40, 2651, 12, 4063, 1769, 202, 565, 509, 2527, 273, 1910, 13638, 18, 23562, 4294, 1225, 12, 4063, 1769, 202, 565, 509, 15783, 273, 374, 31, 202, 565, 368, 309, 302, 4749, 411, 263, 28, 380, 501, 67, 5353, 76, 311, 21, 202, 565, 309, 261, 72, 4749, 342, 1725, 380, 1728, 411, 501, 67, 2493, 21, 13, 288, 202, 202, 842, 671, 273, 501, 67, 2493, 21, 300, 302, 4749, 31, 202, 565, 289, 469, 288, 202, 202, 842, 671, 273, 501, 67, 2493, 22, 300, 302, 4749, 31, 202, 565, 289, 202, 565, 309, 261, 1594, 422, 374, 13, 2527, 273, 404, 31, 202, 565, 509, 1778, 273, 15783, 342, 2527, 31, 202, 565, 368, 3163, 18, 659, 18, 8222, 2932, 40, 2651, 30, 13773, 72, 4749, 9078, 8789, 671, 30, 13773, 842, 671, 9078, 1665, 30, 13773, 1594, 9078, 7778, 30, 13773, 5421, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 509, 3796, 5049, 12, 474, 501, 67, 2493, 21, 16, 509, 501, 67, 2493, 22, 13, 288, 202, 474, 2650, 1380, 273, 2029, 3572, 7385, 18, 588, 9226, 3205, 5621, 202, 474, 1131, 67, 5421, 31, 759, 273, 1247, 67, 1467, 31, 202, 474, 8892, 8526, 273, 394, 509, 63, 5930, 1380, 15533, 202, 1884, 261, 474, 268, 273, 374, 31, 268, 411, 2650, 1380, 31, 268, 27245, 288, 202, 377, 202, 565, 5705, 1457, 457, 639, 2255, 273, 2029, 3572, 7385, 18, 588, 5592, 12, 88, 1769, 202, 565, 509, 302, 4749, 273, 1910, 13638, 18, 23562, 40, 2651, 12, 4063, 1769, 202, 565, 509, 2527, 273, 1910, 13638, 18, 23562, 4294, 1225, 12, 4063, 2 ]
if (provider == null) return editValue.toString();
if (provider == null) { return editValue.toString(); }
public String getValueAsString() { if (editValue == null) return "";//$NON-NLS-1$ ILabelProvider provider = descriptor.getLabelProvider(); if (provider == null) return editValue.toString(); String text = provider.getText(editValue); if(text == null) return "";//$NON-NLS-1$ return text; }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/3a23c3b9bac4db696a0452560047155775a707b7/PropertySheetEntry.java/buggy/bundles/org.eclipse.ui.views/src/org/eclipse/ui/views/properties/PropertySheetEntry.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 2366, 8092, 1435, 288, 3639, 309, 261, 4619, 620, 422, 446, 13, 5411, 327, 1408, 31, 759, 8, 3993, 17, 5106, 17, 21, 8, 3639, 467, 2224, 2249, 2893, 273, 4950, 18, 588, 2224, 2249, 5621, 3639, 309, 261, 6778, 422, 446, 13, 5411, 327, 3874, 620, 18, 10492, 5621, 3639, 514, 977, 273, 2893, 18, 588, 1528, 12, 4619, 620, 1769, 3639, 309, 12, 955, 422, 446, 13, 540, 202, 2463, 1408, 31, 759, 8, 3993, 17, 5106, 17, 21, 8, 3639, 327, 977, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 2366, 8092, 1435, 288, 3639, 309, 261, 4619, 620, 422, 446, 13, 5411, 327, 1408, 31, 759, 8, 3993, 17, 5106, 17, 21, 8, 3639, 467, 2224, 2249, 2893, 273, 4950, 18, 588, 2224, 2249, 5621, 3639, 309, 261, 6778, 422, 446, 13, 5411, 327, 3874, 620, 18, 10492, 5621, 3639, 514, 977, 273, 2893, 18, 588, 1528, 12, 4619, 620, 1769, 3639, 309, 12, 955, 422, 446, 13, 540, 202, 2463, 1408, 31, 759, 8, 3993, 17, 5106, 17, 21, 8, 3639, 327, 977, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return errorLine == null ? true : false;
return errorLine == null ? false : true;
protected boolean isErrorLineSaved() { return errorLine == null ? true : false; }
1179 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1179/712320ed131f97f335a7cc629aa6ad6b6b806652/ScreenPlanes.java/buggy/tn5250j/src/org/tn5250j/ScreenPlanes.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 1250, 14574, 1670, 16776, 1435, 288, 1377, 327, 555, 1670, 422, 446, 692, 629, 294, 638, 31, 282, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 1250, 14574, 1670, 16776, 1435, 288, 1377, 327, 555, 1670, 422, 446, 692, 629, 294, 638, 31, 282, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
String[] values1, String[] values2, PrintWriter out, int indent) { if(values1.length != values2.length) { if(out != null) { displayIndent(out, indent); out.println("Array " + name + ": size mismatch: " + values1.length + " vs " + values2.length + "."); } return false; }
String[] values1, String[] values2, PrintWriter out, int indent) { if(values1.length != values2.length) { if(out != null) { displayIndent(out, indent); out.println("Array " + name + ": size mismatch: " + values1.length + " vs " + values2.length + "."); } return false; }
protected static boolean displayStringArrayDiff(String name, String[] values1, String[] values2, PrintWriter out, int indent) { // Check array sizes if(values1.length != values2.length) { if(out != null) { displayIndent(out, indent); out.println("Array " + name + ": size mismatch: " + values1.length + " vs " + values2.length + "."); } return false; } // Check each member of the array boolean diff = true; for(int i=0; i<values1.length; i++) diff = diff && displayStringDiff(name + "[" + i + "]", values1[i], values2[i], out, indent); return diff; }
51263 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51263/b5b5168edc3af09cb74945a80b0c36e6630ed502/ElementDef.java/clean/src/main/mondrian/xom/ElementDef.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 760, 1250, 2562, 28547, 5938, 12, 780, 508, 16, 6862, 6862, 6862, 202, 780, 8526, 924, 21, 16, 6862, 6862, 6862, 202, 780, 8526, 924, 22, 16, 6862, 6862, 6862, 202, 5108, 2289, 596, 16, 509, 3504, 13, 202, 95, 202, 202, 759, 2073, 526, 8453, 202, 202, 430, 12, 2372, 21, 18, 2469, 480, 924, 22, 18, 2469, 13, 288, 1082, 202, 430, 12, 659, 480, 446, 13, 288, 9506, 202, 5417, 7790, 12, 659, 16, 3504, 1769, 9506, 202, 659, 18, 8222, 2932, 1076, 315, 397, 508, 397, 6398, 963, 13484, 30, 315, 6862, 1082, 202, 15, 924, 21, 18, 2469, 397, 315, 6195, 315, 6862, 1082, 202, 15, 924, 22, 18, 2469, 397, 4585, 1769, 1082, 202, 97, 25083, 202, 2463, 629, 31, 202, 202, 97, 202, 202, 759, 2073, 1517, 3140, 434, 326, 526, 202, 202, 6494, 3122, 273, 638, 31, 202, 202, 1884, 12, 474, 277, 33, 20, 31, 277, 32, 2372, 21, 18, 2469, 31, 277, 27245, 1082, 202, 5413, 273, 3122, 597, 2562, 780, 5938, 12, 529, 397, 13626, 397, 277, 397, 9850, 3113, 6862, 6862, 9506, 924, 21, 63, 77, 6487, 924, 22, 63, 77, 6487, 6862, 6862, 9506, 596, 16, 3504, 1769, 202, 202, 2463, 3122, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 760, 1250, 2562, 28547, 5938, 12, 780, 508, 16, 6862, 6862, 6862, 202, 780, 8526, 924, 21, 16, 6862, 6862, 6862, 202, 780, 8526, 924, 22, 16, 6862, 6862, 6862, 202, 5108, 2289, 596, 16, 509, 3504, 13, 202, 95, 202, 202, 759, 2073, 526, 8453, 202, 202, 430, 12, 2372, 21, 18, 2469, 480, 924, 22, 18, 2469, 13, 288, 1082, 202, 430, 12, 659, 480, 446, 13, 288, 9506, 202, 5417, 7790, 12, 659, 16, 3504, 1769, 9506, 202, 659, 18, 8222, 2932, 1076, 315, 397, 508, 397, 6398, 963, 13484, 30, 315, 6862, 1082, 202, 15, 924, 21, 18, 2469, 397, 315, 6195, 315, 6862, 1082, 202, 15, 924, 22, 18, 2469, 397, 2 ]
public void waitForMessages() {
public synchronized void waitForMessages() {
public void waitForMessages() { try { messageLatch.await(2, TimeUnit.SECONDS); } catch (InterruptedException e) { fail(e.getMessage()); } }
52526 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52526/0b33d8d694f45067a21706b035ee0f75b956f305/MultiAcceptorTest.java/buggy/core/src/test/java/quickfix/MultiAcceptorTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 3852, 918, 10712, 5058, 1435, 288, 5411, 775, 288, 7734, 883, 23463, 18, 30515, 12, 22, 16, 9206, 18, 11609, 1769, 5411, 289, 1044, 261, 24485, 503, 425, 13, 288, 7734, 2321, 12, 73, 18, 24906, 10663, 5411, 289, 3639, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 3852, 918, 10712, 5058, 1435, 288, 5411, 775, 288, 7734, 883, 23463, 18, 30515, 12, 22, 16, 9206, 18, 11609, 1769, 5411, 289, 1044, 261, 24485, 503, 425, 13, 288, 7734, 2321, 12, 73, 18, 24906, 10663, 5411, 289, 3639, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (obj instanceof KerberosPrincipal) {
if (!(obj instanceof KerberosPrincipal)) {
public boolean equals(Object obj) { if (obj == this) { return true; } if (obj instanceof KerberosPrincipal) { return false; } KerberosPrincipal that = (KerberosPrincipal)obj; return (that.name.equals(this.name) && that.type == this.type); }
54769 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54769/e2c3dbe0fb1fc86d377c8f9ee2fce5f3f5bf3ec3/KerberosPrincipal.java/clean/modules/auth/src/main/java/common/javax/security/auth/kerberos/KerberosPrincipal.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 1606, 12, 921, 1081, 13, 288, 3639, 309, 261, 2603, 422, 333, 13, 288, 5411, 327, 638, 31, 3639, 289, 3639, 309, 16051, 12, 2603, 1276, 1475, 24704, 9155, 3719, 288, 5411, 327, 629, 31, 3639, 289, 3639, 1475, 24704, 9155, 716, 273, 261, 47, 24704, 9155, 13, 2603, 31, 7734, 327, 261, 19056, 18, 529, 18, 14963, 12, 2211, 18, 529, 13, 597, 716, 18, 723, 422, 333, 18, 723, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 1606, 12, 921, 1081, 13, 288, 3639, 309, 261, 2603, 422, 333, 13, 288, 5411, 327, 638, 31, 3639, 289, 3639, 309, 16051, 12, 2603, 1276, 1475, 24704, 9155, 3719, 288, 5411, 327, 629, 31, 3639, 289, 3639, 1475, 24704, 9155, 716, 273, 261, 47, 24704, 9155, 13, 2603, 31, 7734, 327, 261, 19056, 18, 529, 18, 14963, 12, 2211, 18, 529, 13, 597, 716, 18, 723, 422, 333, 18, 723, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return (int) (dataLength - ptr);
int x = (int)(dataLength - ptr); return (x < 0) ? 0 : x;
public final int available() { return (int) (dataLength - ptr); }
50493 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50493/9b8cbcb349609f65aa19787b46e96d4716e2bbc0/PaddedEphemerallyEncryptedBucket.java/buggy/src/freenet/support/PaddedEphemerallyEncryptedBucket.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 727, 509, 2319, 1435, 288, 1082, 202, 2463, 261, 474, 13, 261, 892, 1782, 300, 6571, 1769, 202, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 727, 509, 2319, 1435, 288, 1082, 202, 2463, 261, 474, 13, 261, 892, 1782, 300, 6571, 1769, 202, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
removed = new Element[] { current };
private void insertContentTag(ElementSpec tag) { prepareContentInsertion(); int len = tag.getLength(); int dir = tag.getDirection(); if (dir == ElementSpec.JoinPreviousDirection) { // The mauve tests to this class show that a JoinPrevious insertion // does not add any edits to the document event. To me this means // that nothing is done here. The previous element naturally should // expand so that it covers the new characters. } else if (dir == ElementSpec.JoinNextDirection) { BranchElement paragraph = (BranchElement) elementStack.peek(); int currentIndex = paragraph.getElementIndex(offset); Element current = paragraph.getElement(currentIndex); Element next = paragraph.getElement(currentIndex + 1); Element newEl1 = createLeafElement(paragraph, current.getAttributes(), current.getStartOffset(), offset); Element newEl2 = createLeafElement(paragraph, current.getAttributes(), offset, next.getEndOffset()); Element[] add = new Element[] {newEl1, newEl2}; Element[] remove = new Element[] {current, next}; paragraph.replace(currentIndex, 2, add); // Add this action to the document event. addEdit(paragraph, currentIndex, remove, add); } else { BranchElement paragraph = (BranchElement) elementStack.peek(); int index = paragraph.getElementIndex(offset); Element current = paragraph.getElement(index); Element[] added; Element[] removed; Element[] splitRes = split(current, offset, length); // Special case for when offset == startOffset or offset == endOffset. if (splitRes[0] == null) { added = new Element[2]; added[0] = createLeafElement(paragraph, tag.getAttributes(), offset, offset + length); added[1] = splitRes[1]; removed = new Element[0]; index++; } else if (current.getStartOffset() == offset) { added = new Element[2]; added[0] = createLeafElement(paragraph, tag.getAttributes(), offset, offset + length); added[1] = splitRes[1]; removed = new Element[] { current }; } else if (current.getEndOffset() - length == offset) { added = new Element[2]; added[0] = splitRes[0]; added[1] = createLeafElement(paragraph, tag.getAttributes(), offset, offset + length); removed = new Element[] { current }; } else { added = new Element[3]; added[0] = splitRes[0]; added[1] = createLeafElement(paragraph, tag.getAttributes(), offset, offset + length); added[2] = splitRes[1]; removed = new Element[] { current }; } paragraph.replace(index, removed.length, added); addEdit(paragraph, index, removed, added); } offset += len; }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/a78ab2f492456918e4f5c52be600854882e139fc/DefaultStyledDocument.java/clean/core/src/classpath/javax/javax/swing/text/DefaultStyledDocument.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 2243, 1350, 1805, 12, 1046, 1990, 1047, 13, 565, 288, 1377, 2911, 1350, 29739, 5621, 1377, 509, 562, 273, 1047, 18, 588, 1782, 5621, 1377, 509, 1577, 273, 1047, 18, 588, 8212, 5621, 1377, 309, 261, 1214, 422, 3010, 1990, 18, 4572, 8351, 8212, 13, 3639, 288, 1850, 368, 1021, 312, 8377, 537, 7434, 358, 333, 667, 2405, 716, 279, 4214, 8351, 12626, 1850, 368, 1552, 486, 527, 1281, 24450, 358, 326, 1668, 871, 18, 2974, 1791, 333, 4696, 1850, 368, 716, 5083, 353, 2731, 2674, 18, 1021, 2416, 930, 10535, 295, 1230, 1410, 1850, 368, 4542, 1427, 716, 518, 25559, 326, 394, 3949, 18, 3639, 289, 1377, 469, 309, 261, 1214, 422, 3010, 1990, 18, 4572, 2134, 8212, 13, 3639, 288, 1850, 15449, 1046, 10190, 273, 261, 7108, 1046, 13, 930, 2624, 18, 347, 3839, 5621, 1850, 509, 17032, 273, 10190, 18, 21336, 1016, 12, 3348, 1769, 1850, 3010, 783, 273, 10190, 18, 21336, 12, 2972, 1016, 1769, 1850, 3010, 1024, 273, 10190, 18, 21336, 12, 2972, 1016, 397, 404, 1769, 1850, 3010, 394, 4958, 21, 273, 752, 9858, 1046, 12, 22445, 16, 4766, 2398, 783, 18, 588, 2498, 9334, 4766, 2398, 783, 18, 588, 1685, 2335, 9334, 4766, 2398, 1384, 1769, 1850, 3010, 394, 4958, 22, 273, 752, 9858, 1046, 12, 22445, 16, 4766, 2398, 783, 18, 588, 2498, 9334, 4766, 6647, 1384, 16, 4766, 6647, 1024, 18, 588, 1638, 2335, 10663, 1850, 3010, 8526, 527, 273, 394, 3010, 8526, 288, 2704, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 2243, 1350, 1805, 12, 1046, 1990, 1047, 13, 565, 288, 1377, 2911, 1350, 29739, 5621, 1377, 509, 562, 273, 1047, 18, 588, 1782, 5621, 1377, 509, 1577, 273, 1047, 18, 588, 8212, 5621, 1377, 309, 261, 1214, 422, 3010, 1990, 18, 4572, 8351, 8212, 13, 3639, 288, 1850, 368, 1021, 312, 8377, 537, 7434, 358, 333, 667, 2405, 716, 279, 4214, 8351, 12626, 1850, 368, 1552, 486, 527, 1281, 24450, 358, 326, 1668, 871, 18, 2974, 1791, 333, 4696, 1850, 368, 716, 5083, 353, 2731, 2674, 18, 1021, 2416, 930, 10535, 295, 1230, 1410, 1850, 368, 4542, 1427, 716, 518, 25559, 326, 394, 3949, 18, 3639, 289, 1377, 469, 309, 261, 1214, 422, 3010, 1990, 18, 2 ]
gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; Label lblClientside = new Label(container, SWT.NONE); lblClientside.setText(CodegenWizardPlugin
gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; clientSideCheckBoxButton = new Button(container, SWT.CHECK); clientSideCheckBoxButton.setLayoutData(gd); clientSideCheckBoxButton.setText(CodegenWizardPlugin
public void createControl(Composite parent) { container = new Composite(parent, SWT.NULL); GridLayout layout = new GridLayout(); container.setLayout(layout); layout.numColumns = 3; GridData gd = new GridData(GridData.FILL_HORIZONTAL); Label label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin.getResourceString("page2.options.desc")); label.setLayoutData(gd); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; codegenOptionSelectionComboBox = new Combo(container, SWT.DROP_DOWN| SWT.BORDER | SWT.READ_ONLY); // fill the combo this.fillCodegenOptionSelectionComboBox(); codegenOptionSelectionComboBox.setLayoutData(gd); settings.put(PREF_CODEGEN_OPTION_INDEX, codegenOptionSelectionComboBox .getSelectionIndex()); codegenOptionSelectionComboBox.select(settings.getInt(PREF_CODEGEN_OPTION_INDEX)); codegenOptionSelectionComboBox.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_CODEGEN_OPTION_INDEX, codegenOptionSelectionComboBox .getSelectionIndex()); if (codegenOptionSelectionComboBox .getSelectionIndex() == 0 ){ disableControls(); }else if (codegenOptionSelectionComboBox .getSelectionIndex() == 1){ enableControls(); } } public void widgetDefaultSelected(SelectionEvent e) { } }); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; Label label1 = new Label(container, SWT.NULL); label1.setText(CodegenWizardPlugin .getResourceString("page2.language.caption")); languageSelectionComboBox = new Combo(container, SWT.DROP_DOWN| SWT.BORDER | SWT.READ_ONLY); // fill the combo this.fillLanguageCombo(); languageSelectionComboBox.setLayoutData(gd); languageSelectionComboBox.select(settings.getInt(PREF_LANGUAGE_INDEX)); languageSelectionComboBox.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_LANGUAGE_INDEX, languageSelectionComboBox .getSelectionIndex()); } public void widgetDefaultSelected(SelectionEvent e) { } }); // service name label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin .getResourceString("page2.serviceName.caption")); serviceNameCombo = new Combo(container, SWT.DROP_DOWN | SWT.BORDER | SWT.READ_ONLY); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; serviceNameCombo.setLayoutData(gd); // serviceNameCombo.setText(settings.get(PREF_TEXT_SERVICENAME)); serviceNameCombo.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { // update the settings settings.put(PREF_COMBO_SERVICENAME_INDEX, serviceNameCombo .getSelectionIndex()); // reload the portName list loadPortNames(); } public void widgetDefaultSelected(SelectionEvent e) { } }); // port name label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin .getResourceString("page2.portName.caption")); portNameCombo = new Combo(container, SWT.DROP_DOWN | SWT.BORDER | SWT.READ_ONLY); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; portNameCombo.setLayoutData(gd); portNameCombo.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { // do something here } public void widgetDefaultSelected(SelectionEvent e) { } }); // Databinding label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin .getResourceString("page2.databindingCheck.caption")); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; databindingTypeCombo = new Combo(container, SWT.DROP_DOWN | SWT.BORDER | SWT.READ_ONLY); databindingTypeCombo.setLayoutData(gd); fillDatabinderCombo(); databindingTypeCombo.select(settings.getInt(PREF_DATABINDER_INDEX)); databindingTypeCombo.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_DATABINDER_INDEX, databindingTypeCombo .getSelectionIndex()); }; public void widgetDefaultSelected(SelectionEvent e) { }; }); // package name label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin .getResourceString("page2.package.caption")); packageText = new Text(container, SWT.BORDER); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 2; packageText.setLayoutData(gd); String packageName; String storedPackageName = settings.get(PREF_PACKAGE_NAME); this.defaultPackageName = storedPackageName; if (storedPackageName.equals("")) { packageName = URLProcessor.makePackageName(""); } else { packageName = storedPackageName; } //if the package name somehow turned out to be null set it to //default package if (packageName==null)packageName=URLProcessor.DEFAULT_PACKAGE; packageText.setText(packageName); // get this text from the // URLProcessor packageText.addModifyListener(new ModifyListener() { public void modifyText(ModifyEvent e) { settings.put(PREF_PACKAGE_NAME, packageText.getText()); } }); // generate test case option gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; testCaseCheckBoxButton = new Button(container, SWT.CHECK); testCaseCheckBoxButton.setLayoutData(gd); testCaseCheckBoxButton .setText(org.apache.axis2.tool.codegen.eclipse.plugin.CodegenWizardPlugin .getResourceString("page2.testcase.caption")); testCaseCheckBoxButton.setSelection(settings .getBoolean(PREF_CHECK_GENERATE_TESTCASE)); testCaseCheckBoxButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_CHECK_GENERATE_TESTCASE, testCaseCheckBoxButton.getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); //filling label gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; Label fillLabel = new Label(container, SWT.HORIZONTAL | SWT.SEPARATOR); fillLabel.setLayoutData(gd); //cleint side label gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; Label lblClientside = new Label(container, SWT.NONE); lblClientside.setText(CodegenWizardPlugin .getResourceString("page2.clientside.caption")); lblClientside.setLayoutData(gd); //client side buttons gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; syncAndAsyncRadioButton = new Button(container, SWT.RADIO); syncAndAsyncRadioButton.setLayoutData(gd); syncAndAsyncRadioButton.setText(CodegenWizardPlugin .getResourceString("page2.syncAsync.caption")); syncAndAsyncRadioButton.setSelection(settings .getBoolean(PREF_RADIO_SYNC_AND_ASYNC)); syncAndAsyncRadioButton.setVisible(true); syncAndAsyncRadioButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_RADIO_SYNC_AND_ASYNC, syncAndAsyncRadioButton .getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; syncOnlyRadioButton = new Button(container, SWT.RADIO); syncOnlyRadioButton.setLayoutData(gd); syncOnlyRadioButton.setText(CodegenWizardPlugin .getResourceString("page2.sync.caption")); syncOnlyRadioButton.setSelection(settings .getBoolean(PREF_RADIO_SYNC_ONLY)); syncOnlyRadioButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_RADIO_SYNC_ONLY, syncOnlyRadioButton .getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; asyncOnlyRadioButton = new Button(container, SWT.RADIO); asyncOnlyRadioButton.setLayoutData(gd); asyncOnlyRadioButton .setText(org.apache.axis2.tool.codegen.eclipse.plugin.CodegenWizardPlugin .getResourceString("page2.async.caption")); asyncOnlyRadioButton.setSelection(settings .getBoolean(PREF_RADIO_ASYNC_ONLY)); asyncOnlyRadioButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_RADIO_ASYNC_ONLY, asyncOnlyRadioButton .getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); //filling label gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; Label fillLabel1 = new Label(container, SWT.HORIZONTAL | SWT.SEPARATOR); fillLabel1.setLayoutData(gd); // Server side check box gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; serverSideCheckBoxButton = new Button(container, SWT.CHECK); serverSideCheckBoxButton.setLayoutData(gd); serverSideCheckBoxButton.setText(CodegenWizardPlugin .getResourceString("page2.serverside.caption")); serverSideCheckBoxButton.setSelection(settings .getBoolean(PREF_CHECK_GENERATE_SERVERSIDE)); serverSideCheckBoxButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { handleServersideSelection(); settings.put(PREF_CHECK_GENERATE_SERVERSIDE, serverSideCheckBoxButton.getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); // Server side services xml gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; serverXMLCheckBoxButton = new Button(container, SWT.CHECK); serverXMLCheckBoxButton.setLayoutData(gd); serverXMLCheckBoxButton.setSelection(settings .getBoolean(PREF_CHECK_GENERATE_SERVERCONFIG)); serverXMLCheckBoxButton.setText(CodegenWizardPlugin .getResourceString("page2.serviceXML.caption")); serverXMLCheckBoxButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_CHECK_GENERATE_SERVERCONFIG, serverXMLCheckBoxButton.getEnabled()); } public void widgetDefaultSelected(SelectionEvent e) { } }); // generate all generateAllCheckBoxButton = new Button(container, SWT.CHECK); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; generateAllCheckBoxButton.setLayoutData(gd); generateAllCheckBoxButton.setSelection(settings .getBoolean(PREF_GEN_ALL)); generateAllCheckBoxButton.setText(CodegenWizardPlugin .getResourceString("page2.genAll.caption")); generateAllCheckBoxButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_GEN_ALL, generateAllCheckBoxButton .getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); //the server side interface option generateServerSideInterfaceCheckBoxButton = new Button(container, SWT.CHECK); gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 1; generateServerSideInterfaceCheckBoxButton.setLayoutData(gd); generateServerSideInterfaceCheckBoxButton.setSelection(settings .getBoolean(PREF_GEN_SS_INTERFACE)); generateServerSideInterfaceCheckBoxButton.setText(CodegenWizardPlugin .getResourceString("page2.ssInterface.caption")); generateServerSideInterfaceCheckBoxButton.addSelectionListener(new SelectionListener() { public void widgetSelected(SelectionEvent e) { settings.put(PREF_GEN_SS_INTERFACE, generateServerSideInterfaceCheckBoxButton .getSelection()); } public void widgetDefaultSelected(SelectionEvent e) { } }); //filling label gd = new GridData(GridData.FILL_HORIZONTAL); gd.horizontalSpan = 3; Label fillLabel2 = new Label(container, SWT.HORIZONTAL | SWT.SEPARATOR); fillLabel2.setLayoutData(gd); // Databinding label = new Label(container, SWT.NULL); label.setText(CodegenWizardPlugin .getResourceString("page2.namespace2Pkg.caption")); //add a table to set namespace to package mapping gd = new GridData(GridData.FILL_BOTH); gd.horizontalSpan = 3; gd.verticalSpan = 5; namespace2packageTable = new Table(container,SWT.BORDER|SWT.MULTI); namespace2packageTable.setLinesVisible(true); namespace2packageTable.setHeaderVisible(true); namespace2packageTable.setEnabled(true); namespace2packageTable.setLayoutData(gd); declareColumn(namespace2packageTable, 350, //a default width until we adjust CodegenWizardPlugin .getResourceString("page2.namespace.caption")); declareColumn(namespace2packageTable, 200,//a default width until we adjust CodegenWizardPlugin .getResourceString("page2.package.caption")); namespace2packageTable.setVisible(true); // add the table editor final TableEditor editor = new TableEditor(namespace2packageTable); editor.setColumn(1); editor.horizontalAlignment = SWT.LEFT; editor.grabHorizontal = true; //This is the cute way of making the namespaces columns editable namespace2packageTable.addListener(SWT.MouseDown, new Listener() { public void handleEvent(Event event) { Rectangle clientArea = namespace2packageTable.getClientArea(); Point pt = new Point(event.x, event.y); int index = namespace2packageTable.getTopIndex(); while (index < namespace2packageTable.getItemCount()) { boolean visible = false; final TableItem item = namespace2packageTable.getItem(index); for (int i = 0; i < namespace2packageTable.getColumnCount(); i++) { Rectangle rect = item.getBounds(i); if (rect.contains(pt)) { final int column = i; final Text text = new Text(namespace2packageTable, SWT.NONE); Listener textListener = new Listener() { public void handleEvent(final Event e) { switch (e.type) { case SWT.FocusOut: item.setText(column, text.getText()); text.dispose(); break; case SWT.Traverse: switch (e.detail) { case SWT.TRAVERSE_RETURN: item .setText(column, text .getText()); // FALL THROUGH case SWT.TRAVERSE_ESCAPE: text.dispose(); e.doit = false; } break; } } }; text.addListener(SWT.FocusOut, textListener); text.addListener(SWT.Traverse, textListener); editor.setEditor(text, item, i); text.setText(item.getText(i)); text.selectAll(); text.setFocus(); return; } if (!visible && rect.intersects(clientArea)) { visible = true; } } if (!visible) return; index++; } } }); //adjust the width //adjustColumnWidth(namespace2packageTable); /* * Check the state of server-side selection, so we can enable/disable * the serverXML checkbox button. */ handleServersideSelection(); /* * try populating the combos and other information from the WSDL if this * is restored */ if (restoredFromPreviousSettings) { populateParamsFromWSDL(); selectDefaults(); } //first appearence Disable all the controls disableControls(); setControl(container); setPageComplete(true); }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/3d39f78be7e18d3e07f3ba04dae73c0e6ac0d238/OptionsPage.java/clean/modules/tool/axis2-eclipse-codegen-plugin/src/main/java/org/apache/axis2/tool/codegen/eclipse/ui/OptionsPage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 752, 3367, 12, 9400, 982, 13, 288, 202, 202, 3782, 273, 394, 14728, 12, 2938, 16, 348, 8588, 18, 8560, 1769, 202, 202, 6313, 3744, 3511, 273, 394, 7145, 3744, 5621, 202, 202, 3782, 18, 542, 3744, 12, 6741, 1769, 202, 202, 6741, 18, 2107, 3380, 273, 890, 31, 202, 202, 6313, 751, 15551, 273, 394, 7145, 751, 12, 6313, 751, 18, 29818, 67, 44, 20344, 1769, 202, 565, 5287, 1433, 273, 394, 5287, 12, 3782, 16, 348, 8588, 18, 8560, 1769, 202, 565, 1433, 18, 542, 1528, 12, 1085, 4507, 27130, 3773, 18, 588, 1420, 780, 2932, 2433, 22, 18, 2116, 18, 5569, 7923, 1769, 202, 565, 1433, 18, 542, 3744, 751, 12, 19016, 1769, 202, 377, 202, 540, 202, 202, 19016, 273, 394, 7145, 751, 12, 6313, 751, 18, 29818, 67, 44, 20344, 1769, 202, 202, 19016, 18, 18396, 6952, 273, 576, 31, 202, 202, 710, 4507, 1895, 6233, 22199, 273, 394, 1286, 1075, 12, 3782, 16, 348, 8588, 18, 18768, 67, 12711, 96, 348, 8588, 18, 38, 7954, 571, 348, 8588, 18, 6949, 67, 10857, 1769, 202, 202, 759, 3636, 326, 16778, 202, 202, 2211, 18, 5935, 1085, 4507, 1895, 6233, 22199, 5621, 202, 202, 710, 4507, 1895, 6233, 22199, 18, 542, 3744, 751, 12, 19016, 1769, 202, 202, 4272, 18, 458, 12, 3670, 42, 67, 5572, 16652, 67, 7425, 67, 9199, 16, 23198, 1895, 6233, 22199, 9506, 202, 18, 588, 6233, 1016, 10663, 202, 202, 710, 4507, 1895, 6233, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 752, 3367, 12, 9400, 982, 13, 288, 202, 202, 3782, 273, 394, 14728, 12, 2938, 16, 348, 8588, 18, 8560, 1769, 202, 202, 6313, 3744, 3511, 273, 394, 7145, 3744, 5621, 202, 202, 3782, 18, 542, 3744, 12, 6741, 1769, 202, 202, 6741, 18, 2107, 3380, 273, 890, 31, 202, 202, 6313, 751, 15551, 273, 394, 7145, 751, 12, 6313, 751, 18, 29818, 67, 44, 20344, 1769, 202, 565, 5287, 1433, 273, 394, 5287, 12, 3782, 16, 348, 8588, 18, 8560, 1769, 202, 565, 1433, 18, 542, 1528, 12, 1085, 4507, 27130, 3773, 18, 588, 1420, 780, 2932, 2433, 22, 18, 2116, 18, 5569, 7923, 1769, 202, 565, 1433, 18, 542, 3744, 751, 12, 19016, 2 ]
if ( this.currentCacheNo >= this.totalCacheNo ) this.currentCache = this.lastCache; else { LoadFromDisk( ); }
loadFromDisk( );
public Object get( int index ) { // If there are no cache if ( this.totalCacheNo == 0 ) { return this.currentCache.get( index ); } if ( index / CACHESIZE != this.currentCacheNo ) { this.currentCacheNo = index / CACHESIZE; if ( this.currentCacheNo >= this.totalCacheNo ) this.currentCache = this.lastCache; else { LoadFromDisk( ); } } return this.currentCache.get( index - this.currentCacheNo * CACHESIZE ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/fa82a2af56d763819340dcb4920363efb3a6b242/BasicCachedList.java/clean/data/org.eclipse.birt.data/src/org/eclipse/birt/data/engine/cache/BasicCachedList.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 336, 12, 509, 770, 262, 202, 95, 202, 202, 759, 971, 1915, 854, 1158, 1247, 202, 202, 430, 261, 333, 18, 4963, 1649, 2279, 422, 374, 262, 202, 202, 95, 1082, 202, 2463, 333, 18, 2972, 1649, 18, 588, 12, 770, 11272, 202, 202, 97, 202, 202, 430, 261, 770, 342, 13669, 4574, 480, 333, 18, 2972, 1649, 2279, 262, 202, 202, 95, 1082, 202, 2211, 18, 2972, 1649, 2279, 273, 770, 342, 13669, 4574, 31, 1082, 202, 430, 261, 333, 18, 2972, 1649, 2279, 1545, 333, 18, 4963, 1649, 2279, 262, 9506, 202, 2211, 18, 2972, 1649, 273, 333, 18, 2722, 1649, 31, 1082, 202, 12107, 1082, 202, 95, 9506, 202, 2563, 1265, 6247, 12, 11272, 1082, 202, 97, 202, 202, 97, 202, 202, 2463, 333, 18, 2972, 1649, 18, 588, 12, 770, 300, 333, 18, 2972, 1649, 2279, 380, 13669, 4574, 11272, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 336, 12, 509, 770, 262, 202, 95, 202, 202, 759, 971, 1915, 854, 1158, 1247, 202, 202, 430, 261, 333, 18, 4963, 1649, 2279, 422, 374, 262, 202, 202, 95, 1082, 202, 2463, 333, 18, 2972, 1649, 18, 588, 12, 770, 11272, 202, 202, 97, 202, 202, 430, 261, 770, 342, 13669, 4574, 480, 333, 18, 2972, 1649, 2279, 262, 202, 202, 95, 1082, 202, 2211, 18, 2972, 1649, 2279, 273, 770, 342, 13669, 4574, 31, 1082, 202, 430, 261, 333, 18, 2972, 1649, 2279, 1545, 333, 18, 4963, 1649, 2279, 262, 9506, 202, 2211, 18, 2972, 1649, 273, 333, 18, 2722, 1649, 31, 1082, 202, 12107, 1082, 202, 95, 9506, 202, 2563, 1265, 6247, 2 ]
public void mEscapeSequence() throws RecognitionException { try { ruleNestingLevel++; // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:9: ( '\\\\' ('b'|'t'|'n'|'f'|'r'|'\\\"'|'\\''|'\\\\') | UnicodeEscape | OctalEscape ) int alt11=3; int LA11_0 = input.LA(1); if ( (LA11_0=='\\') ) { switch ( input.LA(2) ) { case 'u': alt11=2; break; case '\"': case '\'': case '\\': case 'b': case 'f': case 'n': case 'r': case 't': alt11=1; break; case '0': case '1': case '2': case '3': case '4': case '5': case '6': case '7': alt11=3; break; default: if (backtracking>0) {failed=true; return ;} NoViableAltException nvae = new NoViableAltException("1352:1: fragment EscapeSequence : ( '\\\\' ('b'|'t'|'n'|'f'|'r'|'\\\"'|'\\''|'\\\\') | UnicodeEscape | OctalEscape );", 11, 1, input); throw nvae; } } else { if (backtracking>0) {failed=true; return ;} NoViableAltException nvae = new NoViableAltException("1352:1: fragment EscapeSequence : ( '\\\\' ('b'|'t'|'n'|'f'|'r'|'\\\"'|'\\''|'\\\\') | UnicodeEscape | OctalEscape );", 11, 0, input); throw nvae; } switch (alt11) { case 1 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1354:9: '\\\\' ('b'|'t'|'n'|'f'|'r'|'\\\"'|'\\''|'\\\\') { match('\\'); if (failed) return ; if ( input.LA(1)=='\"'||input.LA(1)=='\''||input.LA(1)=='\\'||input.LA(1)=='b'||input.LA(1)=='f'||input.LA(1)=='n'||input.LA(1)=='r'||input.LA(1)=='t' ) { input.consume(); failed=false; } else { if (backtracking>0) {failed=true; return ;} MismatchedSetException mse = new MismatchedSetException(null,input); recover(mse); throw mse; } } break; case 2 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1355:9: UnicodeEscape { mUnicodeEscape(); if (failed) return ; } break; case 3 : // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:1356:9: OctalEscape { mOctalEscape(); if (failed) return ; } break; } } finally { ruleNestingLevel--; } }
31577 /local/tlutelli/issta_data/temp/all_java3context/java/2006_temp/2006/31577/d92dc116c388103ddf04d98d53904a6fdc204af5/DRLLexer.java/buggy/drools-compiler/src/main/java/org/drools/lang/DRLLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 8448, 4021, 1435, 1216, 9539, 288, 3639, 775, 288, 5411, 1720, 50, 10100, 2355, 9904, 31, 5411, 368, 463, 31027, 14915, 1695, 10649, 8464, 1695, 10649, 8464, 7482, 1695, 12215, 17, 9576, 1695, 4816, 1695, 5254, 1695, 4683, 1695, 3341, 1695, 12215, 1695, 4936, 1695, 16483, 18, 75, 30, 3437, 6564, 30, 29, 30, 261, 25215, 7707, 70, 11, 16637, 88, 11, 16637, 82, 11, 16637, 74, 11, 16637, 86, 11, 16637, 1695, 2412, 11, 16637, 1695, 6309, 16637, 13011, 6134, 571, 9633, 8448, 571, 29482, 287, 8448, 262, 5411, 509, 3770, 2499, 33, 23, 31, 5411, 509, 2928, 2499, 67, 20, 273, 810, 18, 2534, 12, 21, 1769, 5411, 309, 261, 261, 2534, 2499, 67, 20, 18920, 1695, 6134, 262, 288, 7734, 1620, 261, 810, 18, 2534, 12, 22, 13, 262, 288, 7734, 648, 296, 89, 4278, 10792, 3770, 2499, 33, 22, 31, 10792, 898, 31, 7734, 648, 2337, 6, 4278, 7734, 648, 14118, 4278, 7734, 648, 3718, 4278, 7734, 648, 296, 70, 4278, 7734, 648, 296, 74, 4278, 7734, 648, 296, 82, 4278, 7734, 648, 296, 86, 4278, 7734, 648, 296, 88, 4278, 10792, 3770, 2499, 33, 21, 31, 10792, 898, 31, 7734, 648, 296, 20, 4278, 7734, 648, 296, 21, 4278, 7734, 648, 296, 22, 4278, 7734, 648, 296, 23, 4278, 7734, 648, 296, 24, 4278, 7734, 648, 296, 25, 4278, 7734, 648, 296, 26, 4278, 7734, 648, 296, 27, 4278, 10792, 3770, 2499, 33, 23, 31, 10792, 898, 31, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 8448, 4021, 1435, 1216, 9539, 288, 3639, 775, 288, 5411, 1720, 50, 10100, 2355, 9904, 31, 5411, 368, 463, 31027, 14915, 1695, 10649, 8464, 1695, 10649, 8464, 7482, 1695, 12215, 17, 9576, 1695, 4816, 1695, 5254, 1695, 4683, 1695, 3341, 1695, 12215, 1695, 4936, 1695, 16483, 18, 75, 30, 3437, 6564, 30, 29, 30, 261, 25215, 7707, 70, 11, 16637, 88, 11, 16637, 82, 11, 16637, 74, 11, 16637, 86, 11, 16637, 1695, 2412, 11, 16637, 1695, 6309, 16637, 13011, 6134, 571, 9633, 8448, 571, 29482, 287, 8448, 262, 5411, 509, 3770, 2499, 33, 23, 31, 5411, 509, 2928, 2499, 67, 20, 273, 810, 18, 2534, 12, 21, 1769, 5411, 309, 261, 261, 2534, 2499, 2 ]
void dump(DataOutput o) throws IOException { Ent[] ents = asArray(); Sort.sort(ents, compareFunc); o.writeShort(usedSlots); for(int i=0;i<ents.length;i++) { //System.err.println("" + ents[i].n + ": " + ents[i].debugToString()); ents[i].dump(o); } }
49918 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49918/f66abe529719f8fb7cc27c7ddbdbf7bad70c49c7/ConstantPool.java/clean/src/org/ibex/classgen/ConstantPool.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 4657, 12, 751, 1447, 320, 13, 1216, 1860, 288, 3639, 512, 496, 8526, 3281, 87, 273, 23545, 5621, 3639, 5928, 18, 3804, 12, 4877, 16, 3400, 2622, 1769, 3639, 320, 18, 2626, 4897, 12, 3668, 16266, 1769, 3639, 364, 12, 474, 277, 33, 20, 31, 77, 32, 4877, 18, 2469, 31, 77, 27245, 288, 5411, 368, 3163, 18, 370, 18, 8222, 2932, 6, 397, 3281, 87, 63, 77, 8009, 82, 397, 6398, 315, 397, 3281, 87, 63, 77, 8009, 4148, 5808, 10663, 5411, 3281, 87, 63, 77, 8009, 8481, 12, 83, 1769, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 4657, 12, 751, 1447, 320, 13, 1216, 1860, 288, 3639, 512, 496, 8526, 3281, 87, 273, 23545, 5621, 3639, 5928, 18, 3804, 12, 4877, 16, 3400, 2622, 1769, 3639, 320, 18, 2626, 4897, 12, 3668, 16266, 1769, 3639, 364, 12, 474, 277, 33, 20, 31, 77, 32, 4877, 18, 2469, 31, 77, 27245, 288, 5411, 368, 3163, 18, 370, 18, 8222, 2932, 6, 397, 3281, 87, 63, 77, 8009, 82, 397, 6398, 315, 397, 3281, 87, 63, 77, 8009, 4148, 5808, 10663, 5411, 3281, 87, 63, 77, 8009, 8481, 12, 83, 1769, 3639, 289, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (log.isDebugEnabled()) log .debug("run: no node id found for ip next hop address "
if (log.isInfoEnabled()) log .info("run: no node id found for ip next hop address "
public void run() { Category log = ThreadCategory.getInstance(getClass()); if (suspendCollection) { log.debug("DiscoveryLink.run: Suspended!"); } else { LinkableNode[] all_snmplinknodes = Linkd.getInstance() .getSnmpLinkableNodes(); Iterator ite = null; for (int i = 0; i < all_snmplinknodes.length; i++) { LinkableNode curNode = all_snmplinknodes[i]; if (curNode == null) { log.error("run: null linkable node found for iterator " + i); continue; } int curNodeId = curNode.getNodeId(); activenode.add(curNode); if (curNode.isBridgeNode) m_bridge.put(new Integer(curNodeId), curNode); if (curNode.hasCdpInterfaces()) cdpNodes.add(curNode); if (curNode.hasRouteInterfaces()) routerNodes.add(curNode); if (curNode.hasAtInterfaces()) { ite = curNode.getAtInterfaces().iterator(); while (ite.hasNext()) { AtInterface at = (AtInterface) ite.next(); String macAddress = at.getMacAddress(); macToAtinterface.put(macAddress, at); Integer node = new Integer(at.getNodeId()); java.util.Set<String> macs = new HashSet<String>(); if (nodeToMac.containsKey(node)) { macs = nodeToMac.get(node); } macs.add(macAddress); nodeToMac.put(node, macs); } } } if (log.isDebugEnabled()) log .debug("run: finding links among nodes using Cisco Discovery Protocol"); // First of all use quick methods to get backbone ports for speeding // up // the link discovery!!!!! // Try Cisco Discovery Protocol to found link among all nodes // Add CDP info for backbones // complete discovery!!!!! ite = cdpNodes.iterator(); while (ite.hasNext()) { LinkableNode curNode = (LinkableNode) ite.next(); int curCdpNodeId = curNode.getNodeId(); String curCdpIpAddr = curNode.getSnmpPrimaryIpAddr(); if (log.isDebugEnabled()) log.debug("run: parsing nodeid " + curCdpNodeId + " ip address " + curCdpIpAddr + " with " + curNode.getCdpInterfaces().size() + " Cdp Interfaces. "); Iterator sub_ite = curNode.getCdpInterfaces().iterator(); while (sub_ite.hasNext()) { CdpInterface cdpIface = (CdpInterface) sub_ite.next(); int cdpIfIndex = cdpIface.getCdpIfIndex(); if (cdpIfIndex < 0) { log.warn("run: found not valid CDP IfIndex " + cdpIfIndex + " . Skipping"); continue; } InetAddress targetIpAddr = cdpIface.getCdpTargetIpAddr(); int targetCdpNodeId = cdpIface.getCdpTargetNodeId(); if (targetCdpNodeId == -1) { if (log.isDebugEnabled()) log.debug("run: no node id found for ip address " + targetIpAddr.getHostAddress() + ". Skipping"); continue; } if (targetCdpNodeId == curCdpNodeId) { if (log.isDebugEnabled()) log.debug("run: node id found for ip address " + targetIpAddr.getHostAddress() + " is itself. Skipping"); continue; } int cdpDestIfindex = cdpIface.getCdpTargetIfIndex(); if (cdpDestIfindex < 0) { log .warn("run: found not valid CDP destination IfIndex " + cdpDestIfindex + " . Skipping"); continue; } if (log.isDebugEnabled()) log.debug("run: CDP link found: nodeid=" + curCdpNodeId + " ifindex=" + cdpIfIndex + " nodeparentid=" + targetCdpNodeId + " parentifindex=" + cdpDestIfindex); boolean add = true; if (curNode.isBridgeNode() && isBridgeNode(targetCdpNodeId)) { // adesso chiamo la routine che mi effettua il lavoro! LinkableNode targetNode = (LinkableNode) m_bridge .get(new Integer(targetCdpNodeId)); add = parseCdpLinkOn(curNode, cdpIfIndex,targetNode, cdpDestIfindex,log); } else if (curNode.isBridgeNode) { add = parseCdpLinkOn(curNode,cdpIfIndex,targetCdpNodeId,log); } else if (isBridgeNode(targetCdpNodeId)) { LinkableNode targetNode = (LinkableNode) m_bridge .get(new Integer(targetCdpNodeId)); add = parseCdpLinkOn(targetNode,cdpDestIfindex,curCdpNodeId,log); } // now add the cdp link if (add) { if (log.isDebugEnabled()) log.debug("run: try add CDP link found "); NodeToNodeLink lk = new NodeToNodeLink(targetCdpNodeId, cdpDestIfindex); lk.setNodeparentid(curCdpNodeId); lk.setParentifindex(cdpIfIndex); addNodetoNodeLink(lk, log); } } } // try get backbone links between switches using STP info // and store information in Bridge class if (log.isDebugEnabled()) log .debug("run: try to found backbone ethernet links among bridge nodes using Spanning Tree Protocol"); ite = m_bridge.values().iterator(); while (ite.hasNext()) { LinkableNode curNode = (LinkableNode) ite.next(); int curNodeId = curNode.getNodeId(); String cupIpAddr = curNode.getSnmpPrimaryIpAddr(); if (log.isDebugEnabled()) log.debug("run: parsing bridge nodeid " + curNodeId + " ip address " + cupIpAddr); Iterator sub_ite = curNode.getStpInterfaces().entrySet() .iterator(); if (log.isDebugEnabled()) log.debug("run: parsing " + curNode.getStpInterfaces().size() + " Vlan. "); while (sub_ite.hasNext()) { Map.Entry me = (Map.Entry) sub_ite.next(); String vlan = (String) me.getKey(); String curBaseBridgeAddress = curNode .getBridgeIdentifier(vlan); if (log.isDebugEnabled()) log.debug("run: found bridge identifier " + curBaseBridgeAddress); String designatedRoot = null; if (curNode.hasStpRoot(vlan)) { designatedRoot = curNode.getStpRoot(vlan); } else { if (log.isDebugEnabled()) log .debug("run: desigated root bridge identifier not found. Skipping" + curBaseBridgeAddress); continue; } if (designatedRoot.equals("0000000000000000")) { log.warn("run: designated root is invalid. Skipping"); continue; } // check if designated // bridge is it self // if bridge is STP root bridge itself exiting // searching on linkablesnmpnodes if (curNode.isBridgeIdentifier(designatedRoot.substring(4))) { if (log.isDebugEnabled()) log .debug("run: STP designated root is the bridge itself. Skipping"); continue; } Iterator stp_ite = ((List) me.getValue()).iterator(); // Now parse STP bridge port info to get designated bridge if (log.isDebugEnabled()) log .debug("run: STP designated root is another bridge. Parsing Stp Interface"); while (stp_ite.hasNext()) { BridgeStpInterface stpIface = (BridgeStpInterface) stp_ite .next(); // the bridge port number int stpbridgeport = stpIface.getBridgeport(); // if port is a backbone port continue if (curNode.isBackBoneBridgePort(stpbridgeport)) { if (log.isDebugEnabled()) log.debug("run: bridge port " + stpbridgeport + " already found .... Skipping"); continue; } String stpPortDesignatedPort = stpIface .getStpPortDesignatedPort(); String stpPortDesignatedBridge = stpIface .getStpPortDesignatedBridge(); if (log.isDebugEnabled()) log.debug("run: parsing bridge port " + stpbridgeport + " with stp designated bridge " + stpPortDesignatedBridge + " and with stp designated port " + stpPortDesignatedPort); if (stpPortDesignatedBridge.equals("0000000000000000")) { log.warn("run: designated bridge is invalid " + stpPortDesignatedBridge); continue; } if (curNode.isBridgeIdentifier(stpPortDesignatedBridge .substring(4))) { if (log.isDebugEnabled()) log.debug("run: designated bridge for port " + stpbridgeport + " is bridge itself "); continue; } if (stpPortDesignatedPort.equals("0000")) { log.warn("run: designated port is invalid " + stpPortDesignatedPort); continue; } //A Port Identifier shall be encoded as two octets, // taken to represent an unsigned binary number. If two // Port //Identifiers are numerically compared, the lesser // number denotes the Port of better priority. The more //significant octet of a Port Identifier is a settable // priority component that permits the relative priority // of Ports //on the same Bridge to be managed (17.13.7 and Clause // 14). The less significant twelve bits is the Port //Number expressed as an unsigned binary number. The // value 0 is not used as a Port Number. //NOTE�The number of bits that are considered to be // part of the Port Number (12 bits) differs from the // 1998 and prior //versions of this standard (formerly, the priority // component was 8 bits and the Port Number component // also 8 bits). This //change acknowledged that modern switched LAN // infrastructures call for increasingly large numbers // of Ports to be //supported in a single Bridge. To maintain management // compatibility with older implementations, the // priority //component is still considered, for management // purposes, to be an 8-bit value, but the values that // it can be set to are //restricted to those where the least significant 4 // bits are zero (i.e., only the most significant 4 bits // are settable). int designatedbridgeport = Integer.parseInt( stpPortDesignatedPort.substring(1), 16); // try to see if designated bridge is linkable // snmp node LinkableNode designatedNode = getNodeFromMacIdentifierOfBridgeNode(stpPortDesignatedBridge .substring(4)); if (designatedNode == null) { log .warn("run: no nodeid found for stp bridge address " + stpPortDesignatedBridge + " . Nothing to save to db"); continue; // no saving info if no nodeid } int designatednodeid = designatedNode.getNodeId(); if (log.isDebugEnabled()) log.debug("run: found designated nodeid " + designatednodeid); // test if there are other bridges between this link // USING MAC ADDRESS FORWARDING TABLE if (!isNearestBridgeLink(curNode, stpbridgeport, designatedNode, designatedbridgeport)) { if (log.isDebugEnabled()) log .debug("run: other bridge found between nodes. Nothing to save to db"); continue; // no saving info if no nodeid } // this is a backbone port so try adding to Bridge class // get the ifindex on node int curIfIndex = curNode.getIfindex(stpbridgeport); if (curIfIndex == -1) { log.warn("run: got invalid ifindex"); continue; } int designatedifindex = designatedNode .getIfindex(designatedbridgeport); if (designatedifindex == -1) { log .warn("run: got invalid ifindex on designated node"); continue; } if (log.isDebugEnabled()) log.debug("run: backbone port found for node " + curNodeId + ". Adding to bridge" + stpbridgeport); curNode.addBackBoneBridgePorts(stpbridgeport); m_bridge.put(new Integer(curNodeId), curNode); if (log.isDebugEnabled()) log.debug("run: backbone port found for node " + designatednodeid + " .Adding to helper class bb port " + " bridge port " + designatedbridgeport); designatedNode .addBackBoneBridgePorts(designatedbridgeport); m_bridge.put(new Integer(designatednodeid), designatedNode); if (log.isDebugEnabled()) log.debug("run: adding links on bb bridge port " + designatedbridgeport); addLinks(getMacsOnBridgeLink(curNode, stpbridgeport, designatedNode, designatedbridgeport),curNodeId,curIfIndex,log); // writing to db using class // DbDAtaLinkInterfaceEntry NodeToNodeLink lk = new NodeToNodeLink(curNodeId, curIfIndex); lk.setNodeparentid(designatednodeid); lk.setParentifindex(designatedifindex); addNodetoNodeLink(lk, log); } } } // finding backbone links using mac address on ports // Spanning Tree Running on Machine if (log.isDebugEnabled()) log .debug("run: try to found links using Mac Address Forwarding Table"); ite = m_bridge.values().iterator(); while (ite.hasNext()) { LinkableNode curNode = (LinkableNode) ite.next(); int curNodeId = curNode.getNodeId(); if (log.isDebugEnabled()) log.debug("run: parsing node bridge " + curNodeId); Iterator sub_ite = curNode.getPortMacs().keySet().iterator(); while (sub_ite.hasNext()) { Integer intePort = (Integer) sub_ite.next(); int curBridgePort = intePort.intValue(); if (log.isDebugEnabled()) log.debug("run: parsing bridge port " + curBridgePort + " with mac addresses " + curNode.getMacAddressesOnBridgePort( curBridgePort).toString()); if (curNode.isBackBoneBridgePort(curBridgePort)) { if (log.isDebugEnabled()) log.debug("run: parsing backbone bridge port " + curBridgePort + " .... Skipping"); continue; } // operazione A cerco ottengo la lista dei bridge sulla // porta Set macs = curNode.getMacAddressesOnBridgePort(curBridgePort); HashMap bridgesOnPort = new HashMap(); bridgesOnPort = getBridgesFromMacs(macs); if (bridgesOnPort.isEmpty()) { if (log.isDebugEnabled()) log.debug("run: no bridge info found on port " + curBridgePort + " .... Saving Macs"); int curIfIndex = curNode.getIfindex(curBridgePort); addLinks(macs, curNodeId, curIfIndex, log); } else { Iterator bridge_ite = bridgesOnPort.values().iterator(); BRIDGE: while (bridge_ite.hasNext()) { LinkableNode endNode = (LinkableNode) bridge_ite .next(); int endNodeid = endNode.getNodeId(); int endBridgePort = getBridgePortOnEndBridge( curNode, endNode); if (endNode.isBackBoneBridgePort(endBridgePort)) { if (log.isDebugEnabled()) log .debug("run: testing backbone bridge port " + endBridgePort + " .... Skipping"); continue; } if (log.isDebugEnabled()) log .debug("run: using mac address table found bridge port " + endBridgePort + " on node " + endNodeid); if (endBridgePort == -1) { if (log.isDebugEnabled()) log .debug("run: no port found on bridge nodeid " + endNodeid + " for node bridge identifiers nodeid " + curNodeId + " . .....Skipping"); continue; } while (true) { LinkableNode targetNode = findNearestBridgeLink( curNode, curBridgePort, endNode, endBridgePort); if (targetNode.getNodeId() == endNode .getNodeId()) { // port found save break; } else { endNode = targetNode; endNodeid = endNode.getNodeId(); endBridgePort = getBridgePortOnEndBridge( curNode, endNode); if (endNode .isBackBoneBridgePort(endBridgePort)) { if (log.isDebugEnabled()) log .debug("run: testing backbone bridge port " + endBridgePort + " .... Skipping"); continue BRIDGE; } if (log.isDebugEnabled()) log .debug("run: using mac address table found bridge port " + endBridgePort + " on node " + endNodeid); if (endBridgePort == -1) { if (log.isDebugEnabled()) log .debug("run: no port found on bridge nodeid " + endNodeid + " for node bridge identifiers nodeid " + curNodeId + " . .....Skipping"); continue BRIDGE; } if (log.isDebugEnabled()) log .debug("run: other bridge found between nodes. Iteration on bridge node"); } } // this is a backbone port so adding to Bridge class // get the ifindex int curIfIndex = curNode.getIfindex(curBridgePort); if (curIfIndex == -1) { log .warn("run: got invalid ifindex on bridge port " + curBridgePort); continue; } int endIfindex = endNode.getIfindex(endBridgePort); if (endIfindex == -1) { log .warn("run: got invalid ifindex o designated bridge port " + endBridgePort); continue; } if (log.isDebugEnabled()) log.debug("run: backbone port found for node " + curNodeId + ". Adding backbone port " + curBridgePort + " to bridge"); curNode.addBackBoneBridgePorts(curBridgePort); m_bridge.put(new Integer(curNodeId), curNode); if (log.isDebugEnabled()) log.debug("run: backbone port found for node " + endNodeid + " .Adding to helper class bb port " + " bridge port " + endBridgePort); endNode.addBackBoneBridgePorts(endBridgePort); m_bridge.put(new Integer(endNodeid), endNode); // finding links between two backbone ports addLinks(getMacsOnBridgeLink(curNode, curBridgePort, endNode, endBridgePort),curNodeId,curIfIndex,log); // writing to db using class // DbDAtaLinkInterfaceEntry NodeToNodeLink lk = new NodeToNodeLink(curNodeId, curIfIndex); lk.setNodeparentid(endNodeid); lk.setParentifindex(endIfindex); addNodetoNodeLink(lk, log); break BRIDGE; } } } } // now found remaing links (not yet parsed) present on one side of backbone link if (log.isDebugEnabled()) log .debug("run: try to found remaining links (Orfani!) on BackBoneBridgePort"); ite = m_bridge.values().iterator(); while (ite.hasNext()) { LinkableNode curNode = (LinkableNode) ite.next(); Iterator sub_ite = curNode.getBackBoneBridgePorts().iterator(); while (sub_ite.hasNext()) { Integer intePort = (Integer) sub_ite.next(); int bridgePort = intePort.intValue(); if (log.isDebugEnabled()) log.debug("run: parsing backbone bridge port " + bridgePort + " on node " + curNode.getSnmpPrimaryIpAddr()); if (!curNode.hasMacAddressesOnBridgePort(bridgePort)) { log .warn("run: bridge port has no mac address on. Skipping. "); continue; } int curIfIndex = curNode.getIfindex(bridgePort); if (curIfIndex == -1) { log .warn("run: got invalid ifindex on backbone bridge port " + bridgePort); continue; } addLinks(curNode.getMacAddressesOnBridgePort( bridgePort),curNode.getNodeId(),curIfIndex,log); } } // fourth find inter router links, // this part could have several special function to get inter router // links, but at the moment we worked much on switches. // In future we can try to extend this part. if (log.isDebugEnabled()) log .debug("run: try to found not ethernet links on Router nodes"); ite = routerNodes.iterator(); while (ite.hasNext()) { LinkableNode curNode = (LinkableNode) ite.next(); int curNodeId = curNode.getNodeId(); String curIpAddr = curNode.getSnmpPrimaryIpAddr(); if (log.isDebugEnabled()) log.debug("run: parsing router nodeid " + curNodeId + " ip address " + curIpAddr); Iterator sub_ite = curNode.getRouteInterfaces().iterator(); if (log.isDebugEnabled()) log.debug("run: parsing " + curNode.getRouteInterfaces().size() + " Route Interface. "); while (sub_ite.hasNext()) { RouterInterface routeIface = (RouterInterface) sub_ite .next(); if (routeIface.getMetric() == -1) { if (log.isDebugEnabled()) log .debug("run: Router interface has invalid metric " + routeIface.getMetric() + ". Skipping"); continue; } int snmpiftype = routeIface.getSnmpiftype(); if (snmpiftype == SNMP_IF_TYPE_ETHERNET) { if (log.isDebugEnabled()) log .debug("run: Ethernet interface for nodeid. Skipping "); continue; } else if (snmpiftype == SNMP_IF_TYPE_PROP_VIRTUAL) { if (log.isDebugEnabled()) log .debug("run: PropVirtual interface for nodeid. Skipping "); continue; } else if (snmpiftype == -1) { if (log.isDebugEnabled()) log.debug("store: interface has unknown snmpiftype " + snmpiftype + " . Skipping "); } InetAddress nexthop = routeIface.getNextHop(); if (nexthop.getHostAddress().equals("0.0.0.0")) { if (log.isDebugEnabled()) log .debug("run: nexthop address is broadcast address " + nexthop.getHostAddress() + " . Skipping "); //TODO this should be further analized // working on routeDestNet you can find hosts that // are directly connected with the dest network // This happens when routing is made in such a way: // route 10.3.2.0 255.255.255.0 Serial0 // so the router broadcasts on Serial0 continue; } if (nexthop.isLoopbackAddress()) { if (log.isDebugEnabled()) log .debug("run: nexthop address is localhost address " + nexthop.getHostAddress() + " . Skipping "); continue; } int nextHopNodeid = routeIface.getNextHopNodeid(); if (nextHopNodeid == -1) { if (log.isDebugEnabled()) log .debug("run: no node id found for ip next hop address " + nexthop.getHostAddress() + " , skipping "); continue; } if (nextHopNodeid == curNodeId) { if (log.isDebugEnabled()) log .debug("run: node id found for ip next hop address " + nexthop.getHostAddress() + " is itself, skipping "); continue; } int ifindex = routeIface.getIfindex(); if (ifindex == 0) { if (log.isDebugEnabled()) log .debug("run: route interface has ifindex " + ifindex + " . Processing"); ifindex = getIfIndexFromRouter(curNode, routeIface.getNextHopNet()); if (log.isDebugEnabled()) log .debug("run: found correct ifindex " + ifindex + " ."); } if (log.isDebugEnabled()) log .debug("run: saving route link"); // Saving link also when ifindex = -1 (not found) NodeToNodeLink lk = new NodeToNodeLink(nextHopNodeid, routeIface.getNextHopIfindex()); lk.setNodeparentid(curNodeId); lk.setParentifindex(ifindex); addNodetoNodeLink(lk, log); } } // making clean activenode.clear(); m_bridge.clear(); routerNodes.clear(); cdpNodes.clear(); macsParsed.clear(); macToAtinterface.clear(); nodeToMac.clear(); Linkd.getInstance().updateDiscoveryLinkCollection(this); links.clear(); maclinks.clear(); } // rescheduling activities isRunned = true; reschedule(); }
25465 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/25465/dcc8041babbe6b505a8156ae30c22e8e6da3ab29/DiscoveryLink.java/clean/opennms-services/src/main/java/org/opennms/netmgt/linkd/DiscoveryLink.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1086, 1435, 288, 202, 202, 4457, 613, 273, 4884, 4457, 18, 588, 1442, 12, 588, 797, 10663, 202, 202, 430, 261, 87, 18815, 2532, 13, 288, 1082, 202, 1330, 18, 4148, 2932, 11918, 2098, 18, 2681, 30, 348, 22942, 4442, 1769, 202, 202, 97, 469, 288, 1082, 202, 2098, 429, 907, 8526, 777, 67, 8134, 10514, 754, 4690, 273, 4048, 72, 18, 588, 1442, 1435, 6862, 202, 18, 588, 10461, 1291, 2098, 429, 3205, 5621, 1082, 202, 3198, 518, 73, 273, 446, 31, 1082, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 777, 67, 8134, 10514, 754, 4690, 18, 2469, 31, 277, 27245, 288, 9506, 202, 2098, 429, 907, 662, 907, 273, 777, 67, 8134, 10514, 754, 4690, 63, 77, 15533, 9506, 202, 430, 261, 1397, 907, 422, 446, 13, 288, 25083, 202, 1330, 18, 1636, 2932, 2681, 30, 446, 1692, 429, 756, 1392, 364, 2775, 315, 397, 277, 1769, 6862, 202, 17143, 31, 9506, 202, 97, 9506, 202, 474, 662, 15883, 273, 662, 907, 18, 588, 15883, 5621, 9506, 202, 621, 837, 390, 18, 1289, 12, 1397, 907, 1769, 9506, 202, 430, 261, 1397, 907, 18, 291, 13691, 907, 13, 6862, 202, 81, 67, 18337, 18, 458, 12, 2704, 2144, 12, 1397, 15883, 3631, 662, 907, 1769, 9506, 202, 430, 261, 1397, 907, 18, 5332, 39, 9295, 10273, 10756, 6862, 202, 4315, 84, 3205, 18, 1289, 12, 1397, 907, 1769, 9506, 202, 430, 261, 1397, 907, 18, 5332, 3255, 10273, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1086, 1435, 288, 202, 202, 4457, 613, 273, 4884, 4457, 18, 588, 1442, 12, 588, 797, 10663, 202, 202, 430, 261, 87, 18815, 2532, 13, 288, 1082, 202, 1330, 18, 4148, 2932, 11918, 2098, 18, 2681, 30, 348, 22942, 4442, 1769, 202, 202, 97, 469, 288, 1082, 202, 2098, 429, 907, 8526, 777, 67, 8134, 10514, 754, 4690, 273, 4048, 72, 18, 588, 1442, 1435, 6862, 202, 18, 588, 10461, 1291, 2098, 429, 3205, 5621, 1082, 202, 3198, 518, 73, 273, 446, 31, 1082, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 777, 67, 8134, 10514, 754, 4690, 18, 2469, 31, 277, 27245, 288, 9506, 202, 2098, 429, 907, 662, 907, 273, 777, 2 ]
.addContainerGap(13, Short.MAX_VALUE))
.add(11, 11, 11))
private void initComponents() { jLabel1 = new javax.swing.JLabel(); jPanel1 = new javax.swing.JPanel(); jButtonSave = new javax.swing.JButton(); jButtonUndo = new javax.swing.JButton(); jButtonClose = new javax.swing.JButton(); jPanel2 = new javax.swing.JPanel(); jPanel3 = new javax.swing.JPanel(); jButtonToBegin = new javax.swing.JButton(); jButtonOneRowM = new javax.swing.JButton(); jButtonOneRowP = new javax.swing.JButton(); jButtonToEnd = new javax.swing.JButton(); jLabel2 = new javax.swing.JLabel(); jLabel3 = new javax.swing.JLabel(); jLabel4 = new javax.swing.JLabel(); jLabel5 = new javax.swing.JLabel(); jTextField1 = new javax.swing.JTextField(); jTextField2 = new javax.swing.JTextField(); jTextField3 = new javax.swing.JTextField(); jScrollPane1 = new javax.swing.JScrollPane(); jTextArea1 = new javax.swing.JTextArea(); jLabel1.setText("jLabel1"); setDefaultCloseOperation(javax.swing.WindowConstants.DISPOSE_ON_CLOSE); jPanel1.setPreferredSize(new java.awt.Dimension(263, 33)); jButtonSave.setText("\u0421\u044a\u0445\u0440\u0430\u043d\u0438"); jButtonSave.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonSaveActionPerformed(evt); } }); jPanel1.add(jButtonSave); jButtonUndo.setText("\u041f\u0440\u0435\u0434\u0438\u0448\u043d\u0438"); jButtonUndo.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonUndoActionPerformed(evt); } }); jPanel1.add(jButtonUndo); jButtonClose.setText("\u0417\u0430\u0442\u0432\u043e\u0440\u0438"); jButtonClose.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonCloseActionPerformed(evt); } }); jPanel1.add(jButtonClose); getContentPane().add(jPanel1, java.awt.BorderLayout.SOUTH); jPanel2.setBorder(javax.swing.BorderFactory.createEtchedBorder()); jPanel2.setPreferredSize(new java.awt.Dimension(400, 300)); jPanel3.setBorder(javax.swing.BorderFactory.createTitledBorder("\u041d\u0430\u0432\u0438\u0433\u0430\u0446\u0438\u044f")); jPanel3.setPreferredSize(new java.awt.Dimension(230, 70)); jButtonToBegin.setText("<<"); jButtonToBegin.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonToBeginActionPerformed(evt); } }); jPanel3.add(jButtonToBegin); jButtonOneRowM.setText("<"); jButtonOneRowM.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonOneRowMActionPerformed(evt); } }); jPanel3.add(jButtonOneRowM); jButtonOneRowP.setText(">"); jButtonOneRowP.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonOneRowPActionPerformed(evt); } }); jPanel3.add(jButtonOneRowP); jButtonToEnd.setText(">>"); jButtonToEnd.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { jButtonToEndActionPerformed(evt); } }); jPanel3.add(jButtonToEnd); jLabel2.setText("\u041a\u043e\u0434:"); jLabel3.setText("\u041a\u043e\u0434 \u043b\u0430\u0442\u0438\u043d\u0438\u0446\u0430:"); jLabel4.setText("\u0418\u043c\u0435:"); jLabel5.setText("\u041a\u043e\u043c\u0435\u043d\u0442\u0430\u0440:"); jTextField1.setBorder(javax.swing.BorderFactory.createEtchedBorder(javax.swing.border.EtchedBorder.RAISED)); jTextField1.addFocusListener(new java.awt.event.FocusAdapter() { public void focusGained(java.awt.event.FocusEvent evt) { jTextField1FocusGained(evt); } public void focusLost(java.awt.event.FocusEvent evt) { jTextField1FocusLost(evt); } }); jTextField1.addKeyListener(new java.awt.event.KeyAdapter() { public void keyPressed(java.awt.event.KeyEvent evt) { jTextField1KeyPressed(evt); } }); jTextField2.setBorder(javax.swing.BorderFactory.createEtchedBorder(javax.swing.border.EtchedBorder.RAISED)); jTextField2.addFocusListener(new java.awt.event.FocusAdapter() { public void focusGained(java.awt.event.FocusEvent evt) { jTextField2FocusGained(evt); } public void focusLost(java.awt.event.FocusEvent evt) { jTextField2FocusLost(evt); } }); jTextField2.addKeyListener(new java.awt.event.KeyAdapter() { public void keyPressed(java.awt.event.KeyEvent evt) { jTextField2KeyPressed(evt); } }); jTextField3.setBorder(javax.swing.BorderFactory.createEtchedBorder(javax.swing.border.EtchedBorder.RAISED)); jTextField3.addFocusListener(new java.awt.event.FocusAdapter() { public void focusGained(java.awt.event.FocusEvent evt) { jTextField3FocusGained(evt); } public void focusLost(java.awt.event.FocusEvent evt) { jTextField3FocusLost(evt); } }); jTextField3.addKeyListener(new java.awt.event.KeyAdapter() { public void keyPressed(java.awt.event.KeyEvent evt) { jTextField3KeyPressed(evt); } }); jTextArea1.setColumns(20); jTextArea1.setRows(5); jTextArea1.setBorder(javax.swing.BorderFactory.createEtchedBorder(javax.swing.border.EtchedBorder.RAISED)); jScrollPane1.setViewportView(jTextArea1); org.jdesktop.layout.GroupLayout jPanel2Layout = new org.jdesktop.layout.GroupLayout(jPanel2); jPanel2.setLayout(jPanel2Layout); jPanel2Layout.setHorizontalGroup( jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(jPanel2Layout.createSequentialGroup() .addContainerGap() .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.TRAILING, false) .add(org.jdesktop.layout.GroupLayout.LEADING, jPanel3, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 362, Short.MAX_VALUE) .add(org.jdesktop.layout.GroupLayout.LEADING, jPanel2Layout.createSequentialGroup() .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.TRAILING, false) .add(org.jdesktop.layout.GroupLayout.LEADING, jLabel5, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 75, Short.MAX_VALUE) .add(org.jdesktop.layout.GroupLayout.LEADING, jLabel4, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 75, Short.MAX_VALUE) .add(org.jdesktop.layout.GroupLayout.LEADING, jLabel2, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 75, Short.MAX_VALUE) .add(jLabel3, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, Short.MAX_VALUE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING, false) .add(org.jdesktop.layout.GroupLayout.TRAILING, jTextField3, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 283, Short.MAX_VALUE) .add(jTextField2) .add(org.jdesktop.layout.GroupLayout.TRAILING, jTextField1, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 80, Short.MAX_VALUE)) .add(jScrollPane1, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 283, Short.MAX_VALUE)))) .addContainerGap(13, Short.MAX_VALUE)) ); jPanel2Layout.setVerticalGroup( jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(jPanel2Layout.createSequentialGroup() .addContainerGap() .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(jLabel2) .add(jTextField1, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(jLabel3) .add(jTextField2, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(jLabel4) .add(jTextField3, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(jPanel2Layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(jLabel5) .add(jScrollPane1, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED, 9, Short.MAX_VALUE) .add(jPanel3, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE) .addContainerGap()) ); getContentPane().add(jPanel2, java.awt.BorderLayout.CENTER); pack(); }// </editor-fold>//GEN-END:initComponents
12667 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12667/50a0209f41e3aac30ae99a749290346cccb2de83/aeMoney.java/buggy/src/nom/aeMoney.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 3639, 26538, 21, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 17871, 21, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 525, 3616, 4755, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 31224, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 4605, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 17871, 22, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 17871, 23, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 525, 3616, 774, 8149, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 3335, 1999, 49, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 3335, 1999, 52, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 774, 1638, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 26538, 22, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 26538, 23, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 26538, 24, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 26538, 25, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 525, 16157, 21, 273, 394, 6863, 18, 5328, 310, 18, 46, 16157, 5621, 3639, 525, 16157, 22, 273, 394, 6863, 18, 5328, 310, 18, 46, 16157, 5621, 3639, 525, 16157, 23, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 3639, 26538, 21, 273, 394, 6863, 18, 5328, 310, 18, 46, 2224, 5621, 3639, 17871, 21, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 525, 3616, 4755, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 31224, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 4605, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 17871, 22, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 17871, 23, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 525, 3616, 774, 8149, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 525, 3616, 2 ]
public Component getListCellRendererComponent(JList list,Object value,int index,boolean isSelected,boolean cellHasFocus) { setText(value.toString()); if(isSelected) { setForeground(list.getSelectionForeground()); setBackground(list.getSelectionBackground()); } else { if(value instanceof FeedbackListObject) { if(((FeedbackListObject)value).isGenerated()) { setForeground(green); } else { if(((FeedbackListObject)value).isError()) setForeground(Color.red); else setForeground(amber); }
public Component getListCellRendererComponent(JList list,Object value, int index, boolean isSelected, boolean cellHasFocus) { setText(value.toString()); if(isSelected) { setForeground(list.getSelectionForeground()); setBackground(list.getSelectionBackground()); } else { if(value instanceof FeedbackListObject) { if(((FeedbackListObject)value).isGenerated()) { setForeground(green); } else { if(((FeedbackListObject)value).isError()) setForeground(Color.red); else setForeground(amber); } } else setForeground(list.getForeground()); setBackground(list.getBackground()); } setBorder(emptyBorder); return this;
public Component getListCellRendererComponent(JList list,Object value,int index,boolean isSelected,boolean cellHasFocus) { setText(value.toString()); if(isSelected) { setForeground(list.getSelectionForeground()); setBackground(list.getSelectionBackground()); } else { if(value instanceof FeedbackListObject) { if(((FeedbackListObject)value).isGenerated()) { setForeground(green); } else { if(((FeedbackListObject)value).isError()) setForeground(Color.red); else setForeground(amber); } } else setForeground(list.getForeground()); setBackground(list.getBackground()); } setBorder(emptyBorder); return this; }
47007 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47007/410012748e80bb0d59859c62c7bf66beef8f5397/FeedbackList.java/clean/OldSoar/trunk/visualsoar/Source/edu/umich/visualsoar/misc/FeedbackList.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 5435, 10033, 4020, 6747, 1841, 12, 46, 682, 666, 16, 921, 460, 16, 474, 770, 16, 6494, 20956, 16, 6494, 2484, 5582, 9233, 13, 288, 1082, 202, 542, 1528, 12, 1132, 18, 10492, 10663, 1082, 202, 430, 12, 291, 7416, 13, 288, 9506, 202, 542, 23206, 12, 1098, 18, 588, 6233, 23206, 10663, 9506, 202, 542, 8199, 12, 1098, 18, 588, 6233, 8199, 10663, 1082, 202, 97, 1082, 202, 12107, 288, 9506, 202, 430, 12, 1132, 1276, 14013, 823, 682, 921, 13, 288, 1850, 309, 12443, 12, 15888, 682, 921, 13, 1132, 2934, 291, 7823, 10756, 288, 5411, 444, 23206, 12, 11571, 1769, 1850, 289, 1850, 469, 288, 25083, 225, 309, 12443, 12, 15888, 682, 921, 13, 1132, 2934, 291, 668, 10756, 6862, 1082, 225, 444, 23206, 12, 2957, 18, 1118, 1769, 25083, 225, 469, 6862, 1082, 225, 444, 23206, 12, 301, 744, 1769, 1850, 289, 3639, 289, 9506, 202, 12107, 6862, 202, 542, 23206, 12, 1098, 18, 588, 23206, 10663, 9506, 202, 542, 8199, 12, 1098, 18, 588, 8199, 10663, 1082, 202, 97, 25083, 202, 542, 8107, 12, 5531, 8107, 1769, 1082, 202, 2463, 333, 31, 202, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3196, 202, 482, 5435, 10033, 4020, 6747, 1841, 12, 46, 682, 666, 16, 921, 460, 16, 474, 770, 16, 6494, 20956, 16, 6494, 2484, 5582, 9233, 13, 288, 1082, 202, 542, 1528, 12, 1132, 18, 10492, 10663, 1082, 202, 430, 12, 291, 7416, 13, 288, 9506, 202, 542, 23206, 12, 1098, 18, 588, 6233, 23206, 10663, 9506, 202, 542, 8199, 12, 1098, 18, 588, 6233, 8199, 10663, 1082, 202, 97, 1082, 202, 12107, 288, 9506, 202, 430, 12, 1132, 1276, 14013, 823, 682, 921, 13, 288, 1850, 309, 12443, 12, 15888, 682, 921, 13, 1132, 2934, 291, 7823, 10756, 288, 5411, 444, 23206, 12, 11571, 1769, 1850, 289, 1850, 469, 288, 25083, 225, 309, 12443, 12, 15888, 682, 921, 2 ]
s = "This node is having trouble talking with it's peers quickly enough ("+nodeAveragePingTime+" > "+MAX_NODE_AVERAGE_PING_TIME_THRESHOLD+"). Decrease your output bandwidth limit and or remove som peers to improve the situation.";
s = "This node is having trouble talking with it's peers quickly enough ("+nodeAveragePingTime+" > "+MAX_NODE_AVERAGE_PING_TIME_THRESHOLD+"). Decrease your output bandwidth limit and/or remove some peers to improve the situation.";
public String getText() { String s; if(peers == 0) { s = "This node has no peers to connect to, therefore it will not " + "be able to function normally. Ideally you should connect to peers run by people you know " + "(if you are paranoid, then people you trust; if not, then at least people you've talked to)"; String end = " log on to irc.freenode.net channel #freenet-refs and ask around for somebody to connect to"; if(n.isTestnetEnabled()) s += ", but since this is a testnet node, we suggest that you " + end + "."; else s += ". You could " + end + ", but remember that you are vulnerable to " + "those you are directly connected to. (This is especially true in this early alpha of Freenet 0.7...)<br/>BE SURE THAT THE OTHER PERSON HAS ADDED YOUR REFERENCE, TOO, AS ONE-WAY CONNECTIONS WON'T WORK!"; }else if(conns == 0) { s = "This node has not been able to connect to any other nodes so far; it will not be able to function normally. " + "Hopefully some of your peers will connect soon; if not, try to get some more peers."; } else if(conns == 1) { s = "This node only has one connection. Performance will be impaired, and you have no anonymity nor even plausible deniability if that one person is malicious. " + "Your node is attached to the network like a 'leaf' and does not contribute to the network's health." + "Try to get at least 3 connected peers at any given time."; } else if(conns == 2) { s = "This node has only two connections. Performance and security will not be very good, and your node is not doing any routing for other nodes. " + "Your node is embedded like a 'chain' in the network and does not contribute to the network's health." + "Try to get at least 3 connected peers at any given time."; } else if((peers - conns) > MAX_DISCONN_PEER_THRESHOLD){ s = "This node has too many disconnected peers ("+(peers - conns)+" > "+MAX_DISCONN_PEER_THRESHOLD+"). This will have a impact your performance as disconnected peers also consume bandwidth and CPU. Consider \"cleaning up\" your peer list."; } else if(conns > MAX_CONN_THRESHOLD) { s = "This node has too many connections ("+conns+" > "+MAX_CONN_THRESHOLD+"). We don't encourage such a behaviour; Ubernodes are hurting the network."; } else if(peers > MAX_PEER_THRESHOLD) { s = "This node has too many peers ("+peers+" > "+MAX_PEER_THRESHOLD+"). This will impact your performance as all peers (connected or not) consume bandwidth and CPU. Consider \"cleaning up\" your peer list."; } else if(bwlimitDelayTime > MAX_BWLIMIT_DELAY_TIME_THRESHOLD) { s = "This node has to wait too long for available bandwidth ("+bwlimitDelayTime+" > "+MAX_BWLIMIT_DELAY_TIME_THRESHOLD+"). Increase your output bandwidth limit and/or remove some peers to improve the situation."; } else if(nodeAveragePingTime > MAX_NODE_AVERAGE_PING_TIME_THRESHOLD) { s = "This node is having trouble talking with it's peers quickly enough ("+nodeAveragePingTime+" > "+MAX_NODE_AVERAGE_PING_TIME_THRESHOLD+"). Decrease your output bandwidth limit and or remove som peers to improve the situation."; } else if(oldestNeverConnectedPeerAge > MAX_OLDEST_NEVER_CONNECTED_PEER_AGE_THRESHOLD) { s = "One or more of your node's peers have never connected in the two weeks since they were added. Consider removing them since they are affecting performance."; } else throw new IllegalArgumentException("Not valid"); return s; }
46731 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46731/6de126399558fb715146fc2528657ef21c38899f/PeerManagerUserAlert.java/buggy/src/freenet/node/useralerts/PeerManagerUserAlert.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 6701, 1435, 288, 202, 202, 780, 272, 31, 202, 202, 430, 12, 30502, 422, 374, 13, 288, 1082, 202, 87, 273, 315, 2503, 756, 711, 1158, 10082, 358, 3077, 358, 16, 13526, 518, 903, 486, 315, 397, 1082, 202, 6, 2196, 7752, 358, 445, 15849, 18, 23062, 1230, 1846, 1410, 3077, 358, 10082, 1086, 635, 16951, 1846, 5055, 315, 397, 1082, 202, 6, 12, 430, 1846, 854, 779, 304, 839, 16, 1508, 16951, 1846, 10267, 31, 309, 486, 16, 1508, 622, 4520, 16951, 1846, 8081, 26591, 329, 358, 2225, 31, 1082, 202, 780, 679, 273, 315, 613, 603, 358, 277, 1310, 18, 74, 2842, 390, 18, 2758, 1904, 468, 74, 2842, 278, 17, 9316, 471, 6827, 6740, 364, 2690, 3432, 358, 3077, 358, 14432, 1082, 202, 430, 12, 82, 18, 291, 4709, 2758, 1526, 10756, 9506, 202, 87, 1011, 3104, 1496, 3241, 333, 353, 279, 1842, 2758, 756, 16, 732, 19816, 716, 1846, 315, 397, 679, 397, 4585, 31, 1082, 202, 12107, 9506, 202, 87, 1011, 3552, 4554, 3377, 315, 397, 679, 397, 3104, 1496, 11586, 716, 1846, 854, 331, 19063, 429, 358, 315, 397, 9506, 202, 6, 451, 2584, 1846, 854, 5122, 5840, 358, 18, 261, 2503, 353, 29440, 638, 316, 333, 11646, 4190, 434, 478, 2842, 278, 374, 18, 27, 21846, 32, 2848, 21259, 5948, 348, 4830, 7662, 789, 12786, 22478, 10950, 1413, 21641, 11738, 7660, 1624, 51, 1099, 22898, 16, 8493, 51, 16, 5355, 15623, 17, 18098, 20695, 55, 678, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 6701, 1435, 288, 202, 202, 780, 272, 31, 202, 202, 430, 12, 30502, 422, 374, 13, 288, 1082, 202, 87, 273, 315, 2503, 756, 711, 1158, 10082, 358, 3077, 358, 16, 13526, 518, 903, 486, 315, 397, 1082, 202, 6, 2196, 7752, 358, 445, 15849, 18, 23062, 1230, 1846, 1410, 3077, 358, 10082, 1086, 635, 16951, 1846, 5055, 315, 397, 1082, 202, 6, 12, 430, 1846, 854, 779, 304, 839, 16, 1508, 16951, 1846, 10267, 31, 309, 486, 16, 1508, 622, 4520, 16951, 1846, 8081, 26591, 329, 358, 2225, 31, 1082, 202, 780, 679, 273, 315, 613, 603, 358, 277, 1310, 18, 74, 2842, 390, 18, 2758, 1904, 468, 74, 2842, 278, 17, 9316, 471, 2 ]
} int code = info.getJob().getState(); if (code == Job.RUNNING) cancelAction.setEnabled(true); else if (info.getErrorStatus() != null) {
if(info.getErrorStatus() != null) {
public void menuAboutToShow(IMenuManager manager) { cancelAction.setEnabled(false); deleteAction.setEnabled(false); showErrorAction.setEnabled(false); JobInfo info = getSelectedInfo(); if (info == null) { return; } int code = info.getJob().getState(); if (code == Job.RUNNING) cancelAction.setEnabled(true); else if (info.getErrorStatus() != null) { deleteAction.setEnabled(true); showErrorAction.setEnabled(true); } }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/3ab4184c71c4646a29fbf7c339fbfc10a77b2fc7/ProgressView.java/clean/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/progress/ProgressView.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1875, 202, 482, 918, 3824, 24813, 774, 5706, 12, 3445, 2104, 1318, 3301, 13, 288, 9506, 202, 10996, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 3733, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 4500, 668, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 2278, 966, 1123, 273, 16625, 966, 5621, 9506, 202, 430, 261, 1376, 422, 446, 13, 288, 6862, 202, 2463, 31, 9506, 202, 97, 9506, 202, 474, 981, 273, 1123, 18, 588, 2278, 7675, 588, 1119, 5621, 9506, 202, 430, 261, 710, 422, 3956, 18, 29358, 13, 6862, 202, 10996, 1803, 18, 542, 1526, 12, 3767, 1769, 9506, 202, 12107, 309, 261, 1376, 18, 588, 668, 1482, 1435, 480, 446, 13, 288, 6862, 202, 3733, 1803, 18, 542, 1526, 12, 3767, 1769, 6862, 202, 4500, 668, 1803, 18, 542, 1526, 12, 3767, 1769, 9506, 202, 97, 1082, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1875, 202, 482, 918, 3824, 24813, 774, 5706, 12, 3445, 2104, 1318, 3301, 13, 288, 9506, 202, 10996, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 3733, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 4500, 668, 1803, 18, 542, 1526, 12, 5743, 1769, 9506, 202, 2278, 966, 1123, 273, 16625, 966, 5621, 9506, 202, 430, 261, 1376, 422, 446, 13, 288, 6862, 202, 2463, 31, 9506, 202, 97, 9506, 202, 474, 981, 273, 1123, 18, 588, 2278, 7675, 588, 1119, 5621, 9506, 202, 430, 261, 710, 422, 3956, 18, 29358, 13, 6862, 202, 10996, 1803, 18, 542, 1526, 12, 3767, 1769, 9506, 202, 12107, 309, 261, 1376, 18, 588, 668, 1482, 1435, 480, 446, 13, 288, 2 ]
} catch (InvocationTargetException e) { throw WrappedException.wrapException(e); } catch (IllegalAccessException e) { throw WrappedException.wrapException(e);
} catch (Exception e) { throw ScriptRuntime.throwAsUncheckedException(e);
private void setBySetter(GetterSlot slot, Scriptable start, Object value) { if (start != this) { if (slot.delegateTo != null || !slot.setter.getDeclaringClass().isInstance(start)) { start.put(slot.stringKey, start, value); return; } } Object setterThis; Object[] args; Object setterResult; Context cx = Context.getContext(); Class pTypes[] = slot.setter.getParameterTypes(); Class desired = pTypes[pTypes.length - 1]; Object actualArg = FunctionObject.convertArg(cx, start, value, desired); if (slot.delegateTo == null) { setterThis = start; args = new Object[] { actualArg }; } else { if (start != this) Context.codeBug(); setterThis = slot.delegateTo; args = new Object[] { this, actualArg }; } // Check start is sealed: start is always instance of ScriptableObject // due to logic in if (start != this) above if (((ScriptableObject)start).isSealed()) { throw Context.reportRuntimeError1("msg.modify.sealed", slot.stringKey); } try { setterResult = slot.setter.invoke(setterThis, args); } catch (InvocationTargetException e) { throw WrappedException.wrapException(e); } catch (IllegalAccessException e) { throw WrappedException.wrapException(e); } if (slot.setterReturnsValue) { // Replace Getter slot by a simple one Slot replacement = new Slot(); replacement.intKey = slot.intKey; replacement.stringKey = slot.stringKey; replacement.attributes = slot.attributes; replacement.value = setterResult; synchronized (this) { int i = getSlotPosition(slots, slot.stringKey, slot.intKey); // Check slot was not deleted/replaced before synchronization if (i >= 0 && slots[i] == slot) { slots[i] = replacement; // It is important to make sure that lastAccess != slot // to prevent accessing the old slot via lastAccess and // then invoking setter one more time lastAccess = replacement; } } } }
12564 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12564/48b46eb3845fd6cf8fa13cd3def581f9a0ff4339/ScriptableObject.java/clean/src/org/mozilla/javascript/ScriptableObject.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 444, 858, 8465, 12, 8461, 8764, 4694, 16, 22780, 787, 16, 1033, 460, 13, 288, 3639, 309, 261, 1937, 480, 333, 13, 288, 5411, 309, 261, 14194, 18, 22216, 774, 480, 446, 7734, 747, 401, 14194, 18, 18062, 18, 588, 3456, 14682, 7675, 291, 1442, 12, 1937, 3719, 5411, 288, 7734, 787, 18, 458, 12, 14194, 18, 1080, 653, 16, 787, 16, 460, 1769, 7734, 327, 31, 5411, 289, 3639, 289, 3639, 1033, 7794, 2503, 31, 3639, 1033, 8526, 833, 31, 3639, 1033, 7794, 1253, 31, 3639, 1772, 9494, 273, 1772, 18, 29120, 5621, 3639, 1659, 293, 2016, 8526, 273, 4694, 18, 18062, 18, 588, 1662, 2016, 5621, 3639, 1659, 6049, 273, 293, 2016, 63, 84, 2016, 18, 2469, 300, 404, 15533, 3639, 1033, 3214, 4117, 7734, 273, 4284, 921, 18, 6283, 4117, 12, 71, 92, 16, 787, 16, 460, 16, 6049, 1769, 3639, 309, 261, 14194, 18, 22216, 774, 422, 446, 13, 288, 5411, 7794, 2503, 273, 787, 31, 5411, 833, 273, 394, 1033, 8526, 288, 3214, 4117, 289, 31, 3639, 289, 469, 288, 5411, 309, 261, 1937, 480, 333, 13, 1772, 18, 710, 19865, 5621, 5411, 7794, 2503, 273, 4694, 18, 22216, 774, 31, 5411, 833, 273, 394, 1033, 8526, 288, 333, 16, 3214, 4117, 289, 31, 3639, 289, 3639, 368, 2073, 787, 353, 695, 18931, 30, 787, 353, 3712, 791, 434, 22780, 921, 3639, 368, 6541, 358, 4058, 316, 309, 261, 1937, 480, 333, 13, 5721, 3639, 309, 261, 12443, 3651, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 444, 858, 8465, 12, 8461, 8764, 4694, 16, 22780, 787, 16, 1033, 460, 13, 288, 3639, 309, 261, 1937, 480, 333, 13, 288, 5411, 309, 261, 14194, 18, 22216, 774, 480, 446, 7734, 747, 401, 14194, 18, 18062, 18, 588, 3456, 14682, 7675, 291, 1442, 12, 1937, 3719, 5411, 288, 7734, 787, 18, 458, 12, 14194, 18, 1080, 653, 16, 787, 16, 460, 1769, 7734, 327, 31, 5411, 289, 3639, 289, 3639, 1033, 7794, 2503, 31, 3639, 1033, 8526, 833, 31, 3639, 1033, 7794, 1253, 31, 3639, 1772, 9494, 273, 1772, 18, 29120, 5621, 3639, 1659, 293, 2016, 8526, 273, 4694, 18, 18062, 18, 588, 1662, 2016, 5621, 3639, 1659, 6049, 273, 293, 2016, 63, 84, 2 ]
private void update() { String oldText = getText(); String newText = _property.getProperty(_container); // Update the text if we have changed from or to nothing, or if the old // and new text are different. if ((oldText == null) || (newText == null) || (!(oldText.equals(newText)))) { try { setText(newText); } catch (IllegalStateException il) {} } // Now look at the associated NSUML element and see if we need to do // anything special. Discard if we are null. As a start we need to mark // this for saving. _target = _container.getTarget(); if (_target == null) { return; } // Commented out for now, because this triggers from all over the // place. Project p = ProjectBrowser.TheInstance.getProject(); //p.setNeedsSave(true); // If we are a use case update all our extension points. if (_target instanceof MUseCase) { MUseCase useCase = (MUseCase) _target; useCase.setExtensionPoints(useCase.getExtensionPoints()); } // If we are an extension point update the extension points of our // owning use case. This could be null of course. else if (_target instanceof MExtensionPoint) { MUseCase useCase = ((MExtensionPoint) _target).getUseCase(); if (useCase != null) { useCase.setExtensionPoints(useCase.getExtensionPoints()); } } // If we are any other (non-use case) sort of classifier update all our // features. else if (_target instanceof MClassifier) { _classifier = (MClassifier) _target; if (_classifier == null) { return; } _classifier.setFeatures(_classifier.getFeatures()); } else if (_target instanceof MOperation) { _classifier = (MClassifier) ((MOperation) _target).getOwner(); if (_classifier == null) { return; } _classifier.setFeatures(_classifier.getFeatures()); } else if (_target instanceof MAttribute) { _classifier = (MClassifier) ((MAttribute) _target).getOwner(); // Argo.log.info("UMLTextField.update()..._classifier = " + _classifier); if (_classifier == null) { return; } _classifier.setFeatures(_classifier.getFeatures()); } else if (_target instanceof MParameter) { MBehavioralFeature feature = ((MParameter) _target).getBehavioralFeature(); // // check if we are dealing with a valid parameter... // if (feature == null) { return; } _classifier = (MClassifier) feature.getOwner(); if (_classifier == null) { return; } _classifier.setFeatures(_classifier.getFeatures()); } else if (_target instanceof MCallEvent) { // Argo.log.info("UMLTextField.update()...target = " + _target); } // else // Argo.log.info("UMLTextField.update()else...target = " + _target); }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/e880c0ae8a43aa3e3fdd70cec0416ad6de1f956a/UMLTextField.java/buggy/src_new/org/argouml/uml/ui/UMLTextField.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 6459, 2725, 1435, 95, 780, 1673, 1528, 33, 588, 1528, 5621, 780, 2704, 1528, 33, 67, 4468, 18, 588, 1396, 24899, 3782, 1769, 759, 1211, 3404, 546, 27830, 430, 1814, 21516, 6703, 2080, 499, 265, 352, 4018, 16, 280, 430, 5787, 1673, 759, 464, 2704, 955, 2258, 430, 3518, 18, 430, 12443, 1673, 1528, 631, 2011, 14047, 96, 12, 2704, 1528, 631, 2011, 14047, 96, 12, 5, 12, 1673, 1528, 18, 14963, 12, 2704, 1528, 3719, 3719, 95, 698, 95, 202, 542, 1528, 12, 2704, 1528, 1769, 97, 14683, 12, 12195, 5060, 330, 13, 2916, 97, 759, 8674, 7330, 270, 5787, 28441, 3156, 57, 1495, 2956, 464, 5946, 430, 91, 4009, 329, 9012, 759, 2273, 451, 899, 705, 649, 18, 14185, 430, 1814, 834, 2011, 18, 1463, 689, 485, 91, 4009, 329, 3599, 1313, 759, 2211, 74, 1383, 5339, 6315, 3299, 33, 67, 3782, 18, 588, 2326, 5621, 430, 24899, 3299, 631, 2011, 15329, 2463, 31, 97, 759, 4469, 329, 659, 1884, 3338, 16, 70, 26881, 407, 546, 3337, 8060, 2080, 287, 21896, 5787, 759, 964, 18, 4109, 84, 33, 4109, 9132, 18, 1986, 1442, 18, 588, 4109, 5621, 759, 84, 18, 542, 26419, 4755, 12, 3767, 1769, 759, 2047, 1814, 834, 1579, 3593, 2725, 287, 383, 594, 15239, 1451, 4139, 18, 430, 24899, 3299, 1336, 792, 49, 3727, 2449, 15329, 49, 3727, 2449, 1202, 2449, 28657, 49, 3727, 2449, 13, 67, 3299, 31, 1202, 2449, 18, 542, 3625, 5636, 12, 1202, 2449, 18, 588, 3625, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 6459, 2725, 1435, 95, 780, 1673, 1528, 33, 588, 1528, 5621, 780, 2704, 1528, 33, 67, 4468, 18, 588, 1396, 24899, 3782, 1769, 759, 1211, 3404, 546, 27830, 430, 1814, 21516, 6703, 2080, 499, 265, 352, 4018, 16, 280, 430, 5787, 1673, 759, 464, 2704, 955, 2258, 430, 3518, 18, 430, 12443, 1673, 1528, 631, 2011, 14047, 96, 12, 2704, 1528, 631, 2011, 14047, 96, 12, 5, 12, 1673, 1528, 18, 14963, 12, 2704, 1528, 3719, 3719, 95, 698, 95, 202, 542, 1528, 12, 2704, 1528, 1769, 97, 14683, 12, 12195, 5060, 330, 13, 2916, 97, 759, 8674, 7330, 270, 5787, 28441, 3156, 57, 1495, 2956, 464, 5946, 430, 91, 4009, 329, 9012, 759, 2273, 451, 899, 705, 2 ]
if(fIsCheckedFully) { XSConstraints.fullSchemaChecking(fGrammarBucket, fSubGroupHandler, fCMBuilder, fErrorReporter); }
SchemaGrammar loadSchema(XSDDescription desc, XMLInputSource source, Hashtable locationPairs) throws IOException, XNIException { // this should only be done once per invocation of this object; // unless application alters JAXPSource in the mean time. if(!fJAXPProcessed) { processJAXPSchemaSource(locationPairs); } SchemaGrammar grammar = fSchemaHandler.parseSchema(source, desc, locationPairs); // is full-checking enabled? If so, if we're preparsing we'll // need to let XSConstraints have a go at the new grammar. if(fIsCheckedFully) { XSConstraints.fullSchemaChecking(fGrammarBucket, fSubGroupHandler, fCMBuilder, fErrorReporter); } return grammar; } // loadSchema(XSDDescription, XMLInputSource): SchemaGrammar
46079 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46079/5c47a9fe6dbdb71d89292dae999e9056fd23efd0/XMLSchemaLoader.java/clean/src/org/apache/xerces/impl/xs/XMLSchemaLoader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4611, 18576, 1262, 3078, 12, 31244, 3291, 3044, 16, 5411, 3167, 1210, 1830, 1084, 16, 5411, 18559, 2117, 10409, 13, 1216, 1860, 16, 1139, 50, 45, 503, 288, 3639, 368, 333, 1410, 1338, 506, 2731, 3647, 1534, 9495, 434, 333, 733, 31, 3639, 368, 3308, 2521, 524, 5432, 7431, 52, 1830, 316, 326, 3722, 813, 18, 3639, 309, 12, 5, 74, 17368, 52, 13533, 13, 288, 5411, 1207, 17368, 52, 3078, 1830, 12, 3562, 10409, 1769, 3639, 289, 3639, 4611, 18576, 6473, 273, 284, 3078, 1503, 18, 2670, 3078, 12, 3168, 16, 3044, 16, 2117, 10409, 1769, 3639, 368, 353, 1983, 17, 24609, 3696, 35, 225, 971, 1427, 16, 309, 732, 4565, 675, 24979, 732, 5614, 3639, 368, 1608, 358, 2231, 1139, 55, 4878, 1240, 279, 1960, 622, 326, 394, 6473, 18, 3639, 309, 12, 74, 2520, 11454, 16999, 13, 288, 5411, 1139, 55, 4878, 18, 2854, 3078, 14294, 12, 74, 18576, 4103, 16, 284, 1676, 1114, 1503, 16, 284, 9611, 1263, 16, 284, 668, 13289, 1769, 3639, 289, 3639, 327, 6473, 31, 565, 289, 368, 1262, 3078, 12, 31244, 3291, 16, 3167, 1210, 1830, 4672, 225, 4611, 18576, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4611, 18576, 1262, 3078, 12, 31244, 3291, 3044, 16, 5411, 3167, 1210, 1830, 1084, 16, 5411, 18559, 2117, 10409, 13, 1216, 1860, 16, 1139, 50, 45, 503, 288, 3639, 368, 333, 1410, 1338, 506, 2731, 3647, 1534, 9495, 434, 333, 733, 31, 3639, 368, 3308, 2521, 524, 5432, 7431, 52, 1830, 316, 326, 3722, 813, 18, 3639, 309, 12, 5, 74, 17368, 52, 13533, 13, 288, 5411, 1207, 17368, 52, 3078, 1830, 12, 3562, 10409, 1769, 3639, 289, 3639, 4611, 18576, 6473, 273, 284, 3078, 1503, 18, 2670, 3078, 12, 3168, 16, 3044, 16, 2117, 10409, 1769, 3639, 368, 353, 1983, 17, 24609, 3696, 35, 225, 971, 1427, 16, 309, 732, 4565, 675, 24979, 732, 5614, 3639, 368, 2 ]
if (_nodeTestSeq != null) {
if (_childNodeTestSeq != null) {
public void compileApplyImports(ClassGenerator classGen, int min, int max) { final XSLTC xsltc = classGen.getParser().getXSLTC(); final ConstantPoolGen cpg = classGen.getConstantPool(); final Vector names = xsltc.getNamesIndex(); // Clear some datastructures _namedTemplates = new Hashtable(); _neededTemplates = new Hashtable(); _templateIHs = new Hashtable(); _templateILs = new Hashtable(); _patternGroups = new Vector[32]; _rootPattern = null; // IMPORTANT: Save orignal & complete set of templates!!!! Vector oldTemplates = _templates; // Gather templates that are within the scope of this import _templates = new Vector(); final Enumeration templates = oldTemplates.elements(); while (templates.hasMoreElements()) { final Template template = (Template)templates.nextElement(); final int prec = template.getImportPrecedence(); if ((prec >= min) && (prec < max)) addTemplate(template); } // Process all patterns from those templates processPatterns(_keys); // Create the applyTemplates() method final org.apache.bcel.generic.Type[] argTypes = new org.apache.bcel.generic.Type[3]; argTypes[0] = Util.getJCRefType(DOM_INTF_SIG); argTypes[1] = Util.getJCRefType(NODE_ITERATOR_SIG); argTypes[2] = Util.getJCRefType(TRANSLET_OUTPUT_SIG); final String[] argNames = new String[3]; argNames[0] = DOCUMENT_PNAME; argNames[1] = ITERATOR_PNAME; argNames[2] = TRANSLET_OUTPUT_PNAME; final InstructionList mainIL = new InstructionList(); final MethodGenerator methodGen = new MethodGenerator(ACC_PUBLIC | ACC_FINAL, org.apache.bcel.generic.Type.VOID, argTypes, argNames, functionName()+'_'+max, getClassName(), mainIL, classGen.getConstantPool()); methodGen.addException("org.apache.xalan.xsltc.TransletException"); // Create the local variable to hold the current node final LocalVariableGen current; current = methodGen.addLocalVariable2("current", org.apache.bcel.generic.Type.INT, mainIL.getEnd()); _currentIndex = current.getIndex(); // Create the "body" instruction list that will eventually hold the // code for the entire method (other ILs will be appended). final InstructionList body = new InstructionList(); body.append(NOP); // Create an instruction list that contains the default next-node // iteration final InstructionList ilLoop = new InstructionList(); ilLoop.append(methodGen.loadIterator()); ilLoop.append(methodGen.nextNode()); ilLoop.append(DUP); ilLoop.append(new ISTORE(_currentIndex)); // The body of this code can get very large - large than can be handled // by a single IFNE(body.getStart()) instruction - need workaround: final BranchHandle ifeq = ilLoop.append(new IFEQ(null)); final BranchHandle loop = ilLoop.append(new GOTO_W(null)); ifeq.setTarget(ilLoop.append(RETURN)); // applyTemplates() ends here! final InstructionHandle ihLoop = ilLoop.getStart(); // Compile default handling of elements (traverse children) InstructionList ilRecurse = compileDefaultRecursion(classGen, methodGen, ihLoop); InstructionHandle ihRecurse = ilRecurse.getStart(); // Compile default handling of text/attribute nodes (output text) InstructionList ilText = compileDefaultText(classGen, methodGen, ihLoop); InstructionHandle ihText = ilText.getStart(); // Distinguish attribute/element/namespace tests for further processing final int[] types = new int[DOM.NTYPES + names.size()]; for (int i = 0; i < types.length; i++) { types[i] = i; } final boolean[] isAttribute = new boolean[types.length]; final boolean[] isNamespace = new boolean[types.length]; for (int i = 0; i < names.size(); i++) { final String name = (String)names.elementAt(i); isAttribute[i+DOM.NTYPES] = isAttributeName(name); isNamespace[i+DOM.NTYPES] = isNamespaceName(name); } // Compile all templates - regardless of pattern type compileTemplateCalls(classGen, methodGen, ihLoop, min, max); // Handle template with explicit "*" pattern final TestSeq elemTest = _testSeq[DOM.ELEMENT]; InstructionHandle ihElem = ihRecurse; if (elemTest != null) { ihElem = elemTest.compile(classGen, methodGen, ihLoop); } // Handle template with explicit "@*" pattern final TestSeq attrTest = _testSeq[DOM.ATTRIBUTE]; InstructionHandle ihAttr = ihLoop; if (attrTest != null) { ihAttr = attrTest.compile(classGen, methodGen, ihAttr); } // Do tests for id() and key() patterns first InstructionList ilKey = null; if (_idxTestSeq != null) { loop.setTarget(_idxTestSeq.compile(classGen, methodGen, body.getStart())); ilKey = _idxTestSeq.getInstructionList(); } else { loop.setTarget(body.getStart()); } // If there is a match on node() we need to replace ihElem // and ihText if the priority of node() is higher if (_nodeTestSeq != null) { // Compare priorities of node() and "*" double nodePrio = _nodeTestSeq.getPriority(); int nodePos = _nodeTestSeq.getPosition(); double elemPrio = (0 - Double.MAX_VALUE); int elemPos = Integer.MIN_VALUE; if (elemTest != null) { elemPrio = elemTest.getPriority(); elemPos = elemTest.getPosition(); } if (elemPrio == Double.NaN || elemPrio < nodePrio || (elemPrio == nodePrio && elemPos < nodePos)) { ihElem = _nodeTestSeq.compile(classGen, methodGen, ihLoop); } // Compare priorities of node() and text() final TestSeq textTest = _testSeq[DOM.TEXT]; double textPrio = (0 - Double.MAX_VALUE); int textPos = Integer.MIN_VALUE; if (textTest != null) { textPrio = textTest.getPriority(); textPos = textTest.getPosition(); } if (textPrio == Double.NaN || textPrio < nodePrio || (textPrio == nodePrio && textPos < nodePos)) { ihText = _nodeTestSeq.compile(classGen, methodGen, ihLoop); _testSeq[DOM.TEXT] = _nodeTestSeq; } } // Handle templates with "ns:*" pattern InstructionHandle elemNamespaceHandle = ihElem; InstructionList nsElem = compileNamespaces(classGen, methodGen, isNamespace, isAttribute, false, ihElem); if (nsElem != null) elemNamespaceHandle = nsElem.getStart(); // Handle templates with "ns:@*" pattern InstructionList nsAttr = compileNamespaces(classGen, methodGen, isNamespace, isAttribute, true, ihAttr); InstructionHandle attrNamespaceHandle = ihAttr; if (nsAttr != null) attrNamespaceHandle = nsAttr.getStart(); // Handle templates with "ns:elem" or "ns:@attr" pattern final InstructionHandle[] targets = new InstructionHandle[types.length]; for (int i = DOM.NTYPES; i < targets.length; i++) { final TestSeq testSeq = _testSeq[i]; // Jump straight to namespace tests ? if (isNamespace[i]) { if (isAttribute[i]) targets[i] = attrNamespaceHandle; else targets[i] = elemNamespaceHandle; } // Test first, then jump to namespace tests else if (testSeq != null) { if (isAttribute[i]) targets[i] = testSeq.compile(classGen, methodGen, attrNamespaceHandle); else targets[i] = testSeq.compile(classGen, methodGen, elemNamespaceHandle); } else { targets[i] = ihLoop; } } // Handle pattern with match on root node - default: traverse children targets[DOM.ROOT] = _rootPattern != null ? getTemplateInstructionHandle(_rootPattern.getTemplate()) : ihRecurse; // Handle any pattern with match on text nodes - default: loop targets[DOM.TEXT] = _testSeq[DOM.TEXT] != null ? _testSeq[DOM.TEXT].compile(classGen, methodGen, ihText) : ihText; // This DOM-type is not in use - default: process next node targets[DOM.NAMESPACE] = ihLoop; // Match unknown element in DOM - default: check for namespace match targets[DOM.ELEMENT] = elemNamespaceHandle; // Match unknown attribute in DOM - default: check for namespace match targets[DOM.ATTRIBUTE] = attrNamespaceHandle; // Match on processing instruction - default: loop InstructionHandle ihPI = ihLoop; if (_nodeTestSeq != null) ihPI = ihElem; if (_testSeq[DOM.PROCESSING_INSTRUCTION] != null) { targets[DOM.PROCESSING_INSTRUCTION] = _testSeq[DOM.PROCESSING_INSTRUCTION]. compile(classGen, methodGen, ihPI); } else { targets[DOM.PROCESSING_INSTRUCTION] = ihPI; } // Match on comments - default: process next node InstructionHandle ihComment = ihLoop; if (_nodeTestSeq != null) ihComment = ihElem; targets[DOM.COMMENT] = _testSeq[DOM.COMMENT] != null ? _testSeq[DOM.COMMENT].compile(classGen, methodGen, ihComment) : ihComment; // Now compile test sequences for various match patterns: for (int i = DOM.NTYPES; i < targets.length; i++) { final TestSeq testSeq = _testSeq[i]; // Jump straight to namespace tests ? if ((testSeq == null) || (isNamespace[i])) { if (isAttribute[i]) targets[i] = attrNamespaceHandle; else targets[i] = elemNamespaceHandle; } // Match on node type else { if (isAttribute[i]) targets[i] = testSeq.compile(classGen, methodGen, attrNamespaceHandle); else targets[i] = testSeq.compile(classGen, methodGen, elemNamespaceHandle); } } if (ilKey != null) body.insert(ilKey); // Append first code in applyTemplates() - get type of current node final int getType = cpg.addInterfaceMethodref(DOM_INTF, "getType", "(I)I"); body.append(methodGen.loadDOM()); body.append(new ILOAD(_currentIndex)); body.append(new INVOKEINTERFACE(getType, 2)); // Append switch() statement - main dispatch loop in applyTemplates() InstructionHandle disp = body.append(new SWITCH(types,targets,ihLoop)); // Append all the "case:" statements appendTestSequences(body); // Append the actual template code appendTemplateCode(body); // Append NS:* node tests (if any) if (nsElem != null) body.append(nsElem); // Append NS:@* node tests (if any) if (nsAttr != null) body.append(nsAttr); // Append default action for element and root nodes body.append(ilRecurse); // Append default action for text and attribute nodes body.append(ilText); // putting together constituent instruction lists mainIL.append(new GOTO_W(ihLoop)); mainIL.append(body); // fall through to ilLoop mainIL.append(ilLoop); peepHoleOptimization(methodGen); methodGen.stripAttributes(true); methodGen.setMaxLocals(); methodGen.setMaxStack(); methodGen.removeNOPs(); classGen.addMethod(methodGen.getMethod()); // Restore original (complete) set of templates for this transformation _templates = oldTemplates; }
46591 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46591/3997d939907610b1342d6ed5a6c05ee671a0ee8c/Mode.java/clean/src/org/apache/xalan/xsltc/compiler/Mode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4074, 7001, 13347, 12, 797, 3908, 667, 7642, 16, 509, 1131, 16, 509, 943, 13, 288, 202, 6385, 17243, 15988, 20791, 5111, 273, 667, 7642, 18, 588, 2678, 7675, 588, 60, 4559, 15988, 5621, 202, 6385, 10551, 2864, 7642, 3283, 75, 273, 667, 7642, 18, 588, 6902, 2864, 5621, 202, 6385, 5589, 1257, 1377, 273, 20791, 5111, 18, 588, 1557, 1016, 5621, 202, 759, 10121, 2690, 5386, 8813, 1823, 202, 67, 13188, 8218, 273, 394, 18559, 5621, 202, 67, 17471, 8218, 273, 394, 18559, 5621, 202, 67, 3202, 45, 44, 87, 273, 394, 18559, 5621, 202, 67, 3202, 2627, 87, 273, 394, 18559, 5621, 202, 67, 4951, 3621, 273, 394, 5589, 63, 1578, 15533, 202, 67, 3085, 3234, 273, 446, 31, 202, 759, 21840, 6856, 30, 7074, 578, 724, 287, 473, 3912, 444, 434, 5539, 23045, 202, 5018, 1592, 8218, 273, 389, 8502, 31, 202, 759, 25868, 5539, 716, 854, 3470, 326, 2146, 434, 333, 1930, 202, 67, 8502, 273, 394, 5589, 5621, 202, 6385, 13864, 5539, 273, 1592, 8218, 18, 6274, 5621, 202, 17523, 261, 8502, 18, 5332, 7417, 3471, 10756, 288, 202, 565, 727, 5035, 1542, 273, 261, 2283, 13, 8502, 18, 4285, 1046, 5621, 202, 565, 727, 509, 13382, 273, 1542, 18, 588, 5010, 1386, 24092, 5621, 202, 565, 309, 14015, 4036, 1545, 1131, 13, 597, 261, 4036, 411, 943, 3719, 527, 2283, 12, 3202, 1769, 202, 97, 202, 759, 4389, 777, 6884, 628, 5348, 5539, 202, 2567, 11268, 24899, 2452, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4074, 7001, 13347, 12, 797, 3908, 667, 7642, 16, 509, 1131, 16, 509, 943, 13, 288, 202, 6385, 17243, 15988, 20791, 5111, 273, 667, 7642, 18, 588, 2678, 7675, 588, 60, 4559, 15988, 5621, 202, 6385, 10551, 2864, 7642, 3283, 75, 273, 667, 7642, 18, 588, 6902, 2864, 5621, 202, 6385, 5589, 1257, 1377, 273, 20791, 5111, 18, 588, 1557, 1016, 5621, 202, 759, 10121, 2690, 5386, 8813, 1823, 202, 67, 13188, 8218, 273, 394, 18559, 5621, 202, 67, 17471, 8218, 273, 394, 18559, 5621, 202, 67, 3202, 45, 44, 87, 273, 394, 18559, 5621, 202, 67, 3202, 2627, 87, 273, 394, 18559, 5621, 202, 67, 4951, 3621, 273, 394, 5589, 63, 1578, 15533, 202, 67, 2 ]
id_AST = astFactory.create(id);
if (inputState.guessing==0) { id_AST = astFactory.create(id); }
public final void parameterDeclaration() throws RecognitionException, TokenStreamException { returnAST = null; ASTPair currentAST = new ASTPair(); AST parameterDeclaration_AST = null; AST pm_AST = null; AST t_AST = null; Token id = null; AST id_AST = null; AST exp_AST = null; boolean spreadParam = false; parameterModifiersOpt(); pm_AST = (AST)returnAST; { if ((_tokenSet_25.member(LA(1))) && (_tokenSet_74.member(LA(2))) && (_tokenSet_75.member(LA(3)))) { typeSpec(false); t_AST = (AST)returnAST; } else if ((LA(1)==IDENT||LA(1)==TRIPLE_DOT) && (_tokenSet_76.member(LA(2))) && (_tokenSet_77.member(LA(3)))) { } else { throw new NoViableAltException(LT(1), getFilename()); } } { switch ( LA(1)) { case TRIPLE_DOT: { match(TRIPLE_DOT); if ( inputState.guessing==0 ) { spreadParam = true; } break; } case IDENT: { break; } default: { throw new NoViableAltException(LT(1), getFilename()); } } } id = LT(1); id_AST = astFactory.create(id); match(IDENT); { switch ( LA(1)) { case ASSIGN: { varInitializer(); exp_AST = (AST)returnAST; break; } case COMMA: case RPAREN: case NLS: case CLOSURE_OP: { break; } default: { throw new NoViableAltException(LT(1), getFilename()); } } } if ( inputState.guessing==0 ) { parameterDeclaration_AST = (AST)currentAST.root; if (spreadParam) { parameterDeclaration_AST = (AST)astFactory.make( (new ASTArray(5)).add(astFactory.create(VARIABLE_PARAMETER_DEF,"VARIABLE_PARAMETER_DEF")).add(pm_AST).add((AST)astFactory.make( (new ASTArray(2)).add(astFactory.create(TYPE,"TYPE")).add(t_AST))).add(id_AST).add(exp_AST)); } else { parameterDeclaration_AST = (AST)astFactory.make( (new ASTArray(5)).add(astFactory.create(PARAMETER_DEF,"PARAMETER_DEF")).add(pm_AST).add((AST)astFactory.make( (new ASTArray(2)).add(astFactory.create(TYPE,"TYPE")).add(t_AST))).add(id_AST).add(exp_AST)); } currentAST.root = parameterDeclaration_AST; currentAST.child = parameterDeclaration_AST!=null &&parameterDeclaration_AST.getFirstChild()!=null ? parameterDeclaration_AST.getFirstChild() : parameterDeclaration_AST; currentAST.advanceChildToEnd(); } returnAST = parameterDeclaration_AST; }
6462 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6462/27957314a380e54096257a6753ad9d316ee78892/GroovyRecognizer.java/buggy/src/main/org/codehaus/groovy/antlr/parser/GroovyRecognizer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 1569, 6094, 1435, 1216, 9539, 16, 3155, 1228, 503, 288, 9506, 202, 2463, 9053, 273, 446, 31, 202, 202, 9053, 4154, 783, 9053, 273, 394, 9183, 4154, 5621, 202, 202, 9053, 1569, 6094, 67, 9053, 273, 446, 31, 202, 202, 9053, 7430, 67, 9053, 273, 446, 31, 202, 202, 9053, 268, 67, 9053, 273, 446, 31, 202, 202, 1345, 225, 612, 273, 446, 31, 202, 202, 9053, 612, 67, 9053, 273, 446, 31, 202, 202, 9053, 1329, 67, 9053, 273, 446, 31, 202, 202, 6494, 15103, 786, 273, 629, 31, 9506, 202, 6775, 11948, 6179, 5621, 202, 202, 7755, 67, 9053, 273, 261, 9053, 13, 2463, 9053, 31, 202, 202, 95, 202, 202, 430, 14015, 67, 2316, 694, 67, 2947, 18, 5990, 12, 2534, 12, 21, 20349, 597, 261, 67, 2316, 694, 67, 5608, 18, 5990, 12, 2534, 12, 22, 20349, 597, 261, 67, 2316, 694, 67, 5877, 18, 5990, 12, 2534, 12, 23, 3719, 3719, 288, 1082, 202, 723, 1990, 12, 5743, 1769, 1082, 202, 88, 67, 9053, 273, 261, 9053, 13, 2463, 9053, 31, 202, 202, 97, 202, 202, 12107, 309, 14015, 2534, 12, 21, 13, 631, 13355, 20081, 2534, 12, 21, 13, 631, 6566, 30099, 67, 17591, 13, 597, 261, 67, 2316, 694, 67, 6669, 18, 5990, 12, 2534, 12, 22, 20349, 597, 261, 67, 2316, 694, 67, 4700, 18, 5990, 12, 2534, 12, 23, 3719, 3719, 288, 202, 202, 97, 202, 202, 12107, 288, 1082, 202, 12849, 394, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 1569, 6094, 1435, 1216, 9539, 16, 3155, 1228, 503, 288, 9506, 202, 2463, 9053, 273, 446, 31, 202, 202, 9053, 4154, 783, 9053, 273, 394, 9183, 4154, 5621, 202, 202, 9053, 1569, 6094, 67, 9053, 273, 446, 31, 202, 202, 9053, 7430, 67, 9053, 273, 446, 31, 202, 202, 9053, 268, 67, 9053, 273, 446, 31, 202, 202, 1345, 225, 612, 273, 446, 31, 202, 202, 9053, 612, 67, 9053, 273, 446, 31, 202, 202, 9053, 1329, 67, 9053, 273, 446, 31, 202, 202, 6494, 15103, 786, 273, 629, 31, 9506, 202, 6775, 11948, 6179, 5621, 202, 202, 7755, 67, 9053, 273, 261, 9053, 13, 2463, 9053, 31, 202, 202, 95, 202, 202, 430, 2 ]
if (verbose == 2) { incCounter = 0; while (!(tgt = incBuffer.pop()).isZero()) { rcCollector.incRC(tgt); incCounter++; } } else while (!(tgt = incBuffer.pop()).isZero()) rcCollector.incRC(tgt); }
while (!(tgt = incBuffer.pop()).isZero()) rcCollector.increment(tgt); }
private final void processIncBufs() { VM_Address tgt; if (verbose == 2) { incCounter = 0; while (!(tgt = incBuffer.pop()).isZero()) { rcCollector.incRC(tgt); incCounter++; } } else while (!(tgt = incBuffer.pop()).isZero()) rcCollector.incRC(tgt); }
5245 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5245/11520ece22c5304c2b4b604a6acbfdfd0fa4fc3c/Plan.java/clean/rvm/src/vm/memoryManagers/JMTk/plan/refCount/Plan.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 727, 918, 1207, 14559, 5503, 87, 1435, 288, 565, 8251, 67, 1887, 11680, 31, 565, 309, 261, 11369, 422, 576, 13, 288, 1377, 7290, 4789, 273, 374, 31, 1377, 1323, 16051, 12, 29672, 273, 7290, 1892, 18, 5120, 1435, 2934, 291, 7170, 10756, 288, 202, 1310, 7134, 18, 9523, 11529, 12, 29672, 1769, 202, 9523, 4789, 9904, 31, 1377, 289, 565, 289, 469, 1377, 1323, 16051, 12, 29672, 273, 7290, 1892, 18, 5120, 1435, 2934, 291, 7170, 10756, 202, 1310, 7134, 18, 9523, 11529, 12, 29672, 1769, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 727, 918, 1207, 14559, 5503, 87, 1435, 288, 565, 8251, 67, 1887, 11680, 31, 565, 309, 261, 11369, 422, 576, 13, 288, 1377, 7290, 4789, 273, 374, 31, 1377, 1323, 16051, 12, 29672, 273, 7290, 1892, 18, 5120, 1435, 2934, 291, 7170, 10756, 288, 202, 1310, 7134, 18, 9523, 11529, 12, 29672, 1769, 202, 9523, 4789, 9904, 31, 1377, 289, 565, 289, 469, 1377, 1323, 16051, 12, 29672, 273, 7290, 1892, 18, 5120, 1435, 2934, 291, 7170, 10756, 202, 1310, 7134, 18, 9523, 11529, 12, 29672, 1769, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]