rem
stringlengths
1
53.3k
add
stringlengths
0
80.5k
context
stringlengths
6
326k
meta
stringlengths
141
403
input_ids
list
attention_mask
list
labels
list
InfoWebSiteSection infoWebSiteSection = Cloner .copyIWebSiteSection2InfoWebSiteSection(webSiteSection);
public Boolean run(final Integer sectionCode, InfoWebSiteItem lastInfoWebSiteItem) throws FenixServiceException { try { ISuportePersistente persistentSupport = PersistenceSupportFactory.getDefaultPersistenceSupport(); IPersistentWebSiteSection persistentWebSiteSection = persistentSupport .getIPersistentWebSiteSection(); IPersistentWebSiteItem persistentWebSiteItem = persistentSupport.getIPersistentWebSiteItem(); List sections = new ArrayList(); if (sectionCode == null) { // in case of configuration we have to update all sections sections = persistentWebSiteSection.readAll(); } else { IWebSiteSection webSiteSectionTmp; webSiteSectionTmp = (IWebSiteSection) persistentWebSiteSection.readByOID( WebSiteSection.class, sectionCode); sections.add(webSiteSectionTmp); } Iterator iterSections = sections.iterator(); while (iterSections.hasNext()) { IWebSiteSection webSiteSection = (IWebSiteSection) iterSections.next(); List webSiteItems = persistentWebSiteItem .readPublishedWebSiteItemsByWebSiteSection(webSiteSection); List infoWebSiteItems = (List) CollectionUtils.collect(webSiteItems, new Transformer() { public Object transform(Object arg0) { IWebSiteItem webSiteItem = (IWebSiteItem) arg0; InfoWebSiteItem infoWebSiteItem = Cloner .copyIWebSiteItem2InfoWebSiteItem(webSiteItem); return infoWebSiteItem; } }); InfoWebSiteSection infoWebSiteSection = Cloner .copyIWebSiteSection2InfoWebSiteSection(webSiteSection); infoWebSiteSection.setInfoItemsList(infoWebSiteItems); BeanComparator beanComparator = getBeanComparator(infoWebSiteSection); Collections.sort(infoWebSiteSection.getInfoItemsList(), beanComparator); if (infoWebSiteSection.getSortingOrder().equals("descendent")) { Collections.reverse(infoWebSiteSection.getInfoItemsList()); } Calendar currentMonth = Calendar.getInstance(); String currentMonthFileName = infoWebSiteSection.getFtpName() + ".html"; //------------------------------------------------//------------------------------------------------- // create excerpts file; this file has those items whose // publication // date has today's date // and the number of items to show is limited by size of section List excerptsList = new ArrayList(); excerptsList.addAll(infoWebSiteSection.getInfoItemsList()); // beginning of file String excerptsFile = new String(); if (excerptsList.size() == 0) { // build no items file excerptsFile = excerptsFile.concat("<p>\n\t\t"); excerptsFile = excerptsFile.concat("No existem " + infoWebSiteSection.getName() + "\n"); excerptsFile = excerptsFile.concat("</p>\n"); } else { // limits number of items to mandatory section size in // website if (excerptsList.size() > infoWebSiteSection.getSize().intValue()) { Calendar today = Calendar.getInstance(); List limitedList = new ArrayList(); int i = 0; ListIterator iterItems = excerptsList.listIterator(); while (i < infoWebSiteSection.getSize().intValue() && iterItems.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterItems.next(); // show only published items that have to be // published // today: according to online begin and end day if (!infoWebSiteItem.getOnlineBeginDay().after(today.getTime()) && !infoWebSiteItem.getOnlineEndDay().before(today.getTime())) { limitedList.add(infoWebSiteItem); i++; } } excerptsList = (ArrayList) limitedList; // be sure that we have at least one excerpt if (excerptsList.size() == 0) { excerptsList.add(infoWebSiteSection.getInfoItemsList().get(0)); } } Iterator iterItems = excerptsList.iterator(); while (iterItems.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterItems.next(); excerptsFile = putBegginingOfItem(excerptsFile, infoWebSiteItem); excerptsFile = putExcerpt(infoWebSiteSection, excerptsFile, infoWebSiteItem, currentMonth, currentMonthFileName); } } // build file File excerpts; try { excerpts = buildFile(excerptsFile, infoWebSiteSection.getFtpName() + "_excerpts.html"); } catch (Exception e) { e.printStackTrace(); return Boolean.FALSE; } try { // send file to server by ftp // Ftp.enviarFicheiro("/IstFtpServerConfig.properties", // excerpts.getName(), // infoWebSiteSection.getFtpName() + "/"); Ftp.enviarFicheiroScp("/IstFtpServerConfig.properties", excerpts.getName(), infoWebSiteSection.getFtpName() + "/"); } catch (IOException e1) { throw new FenixServiceException(); } // delete created file excerpts.delete(); //------------------------------------------------//------------------------------------------------- // create file of month corresponding to item created or // create all files in case this item is from a new month or in // case // some item was deleted List items = new ArrayList(); items.addAll(infoWebSiteSection.getInfoItemsList()); List monthList = new ArrayList(); HashMap monthsToCreateLinks = new HashMap(); HashMap monthsToCreateFiles = new HashMap(); Calendar calendarCycle = Calendar.getInstance(); Calendar calendarLast = Calendar.getInstance(); if (lastInfoWebSiteItem != null) { // need to know what to sort calendarLast.setTime(dateToSort(infoWebSiteSection, lastInfoWebSiteItem)); // get items with the same month as last inserted Iterator iterItems = infoWebSiteSection.getInfoItemsList().iterator(); while (iterItems.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterItems.next(); calendarCycle.clear(); calendarCycle.setTime(dateToSort(infoWebSiteSection, infoWebSiteItem)); if (calendarCycle.get(Calendar.MONTH) == calendarLast.get(Calendar.MONTH) && calendarCycle.get(Calendar.YEAR) == calendarLast.get(Calendar.YEAR)) { monthList.add(infoWebSiteItem); } findMonthsForArchive(monthsToCreateLinks, calendarCycle); } if (monthList.size() > 1) { // file already exists so only this file needs to be // refreshed List monthToRefresh = new ArrayList(); monthToRefresh.add(new Integer(calendarLast.get(Calendar.MONTH))); monthsToCreateFiles.put(new Integer(calendarLast.get(Calendar.YEAR)), monthToRefresh); items = monthList; } else { // there is a new month to send to server, so build file // and // refresh links on other files copyNewHashmapForFiles(monthsToCreateLinks, monthsToCreateFiles); } } else { Iterator iterItems = infoWebSiteSection.getInfoItemsList().iterator(); while (iterItems.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterItems.next(); calendarCycle.clear(); calendarCycle.setTime(dateToSort(infoWebSiteSection, infoWebSiteItem)); findMonthsForArchive(monthsToCreateLinks, calendarCycle); } copyNewHashmapForFiles(monthsToCreateLinks, monthsToCreateFiles); } List monthLinks = null; Integer year = null; Iterator iterYears = monthsToCreateFiles.entrySet().iterator(); while (iterYears.hasNext()) { Map.Entry monthMap = (Map.Entry) iterYears.next(); year = (Integer) monthMap.getKey(); monthLinks = (List) monthMap.getValue(); Iterator iterLinks = monthLinks.iterator(); while (iterLinks.hasNext()) { Integer monthLink = (Integer) iterLinks.next(); //Mes thisMonthString = new Mes(monthLink.intValue() + // 1); String fileName = infoWebSiteSection.getFtpName() + year.toString() + "_" + new Integer(monthLink.intValue() + 1).toString() + ".html"; List thisMonthList = new ArrayList(); // if month of last item is new we have to recreate all // files for other months if (monthList.size() <= 1) { Iterator iterAllItems = items.iterator(); while (iterAllItems.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterAllItems.next(); calendarCycle.clear(); calendarCycle.setTime(dateToSort(infoWebSiteSection, infoWebSiteItem)); if (calendarCycle.get(Calendar.MONTH) == monthLink.intValue() && calendarCycle.get(Calendar.YEAR) == year.intValue()) { thisMonthList.add(infoWebSiteItem); } } } else { thisMonthList = monthList; } String keywordsList = createKeywordsList(thisMonthList); // build body for items String itemsFile = new String(); itemsFile = putBegginingOfItemFile(itemsFile, infoWebSiteSection, keywordsList); itemsFile = itemsFile.concat("<h1>" + infoWebSiteSection.getName() + "</h1>"); itemsFile = itemsFile.concat("\n<br />\n"); Iterator iterItemsForFile = thisMonthList.iterator(); while (iterItemsForFile.hasNext()) { InfoWebSiteItem infoWebSiteItem = (InfoWebSiteItem) iterItemsForFile.next(); itemsFile = putBegginingOfItem(itemsFile, infoWebSiteItem); itemsFile = putItem(itemsFile, infoWebSiteItem); } itemsFile = itemsFile.concat("<p>\n\t"); itemsFile = itemsFile.concat("<span class=\"greytxt\">"); itemsFile = itemsFile .concat("Eventuais incoerncias nesta pgina devero ser comunicadas afim de se efectuar a respectiva correco."); itemsFile = itemsFile.concat("</span>"); itemsFile = itemsFile.concat("\n</p>\n"); itemsFile = itemsFile.concat("<h2>Arquivo de " + infoWebSiteSection.getName() + "</h2>\n<p>\n"); itemsFile = buildLinksForArchive(infoWebSiteSection, currentMonth, currentMonthFileName, monthsToCreateLinks, year, monthLink, itemsFile); itemsFile = itemsFile.concat("</p>"); itemsFile = putEndOfItemFile(itemsFile); // prepare file for transfer File itemsFileToTransfer; try { if (monthLink.intValue() == currentMonth.get(Calendar.MONTH) && year.intValue() == currentMonth.get(Calendar.YEAR)) { itemsFileToTransfer = buildFile(itemsFile, currentMonthFileName); } else { itemsFileToTransfer = buildFile(itemsFile, fileName); } } catch (Exception e) { e.printStackTrace(); return Boolean.FALSE; } try { // Ftp.enviarFicheiro("/IstFtpServerConfig.properties", // itemsFileToTransfer // .getName(), infoWebSiteSection.getFtpName() + // "/"); Ftp.enviarFicheiroScp("/IstFtpServerConfig.properties", itemsFileToTransfer .getName(), infoWebSiteSection.getFtpName() + "/"); } catch (IOException e2) { throw new FenixServiceException(e2); } // delete created file itemsFileToTransfer.delete(); } } } } catch (ExcepcaoPersistencia excepcaoPersistencia) { throw new FenixServiceException(excepcaoPersistencia); } return Boolean.TRUE; }
2645 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2645/7364f3387905cb3ecc901e3ddd523492a9536f75/SendWebSiteSectionFileToServer.java/buggy/src/net/sourceforge/fenixedu/applicationTier/Servico/webSiteManager/SendWebSiteSectionFileToServer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3411, 1086, 12, 6385, 2144, 2442, 1085, 16, 3807, 4079, 4956, 1180, 1142, 966, 4079, 4956, 1180, 13, 5411, 1216, 478, 275, 697, 15133, 288, 3639, 775, 288, 5411, 467, 3088, 499, 73,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3411, 1086, 12, 6385, 2144, 2442, 1085, 16, 3807, 4079, 4956, 1180, 1142, 966, 4079, 4956, 1180, 13, 5411, 1216, 478, 275, 697, 15133, 288, 3639, 775, 288, 5411, 467, 3088, 499, 73,...
for (int i = 0; i < internalUris.length; i++) { if (internalUris[i].equals(uri)) {
for (int i = 0; i < uris.length; i++) { if (uris[i].equals(uri)) {
public boolean mapsToURI(String uri) { for (int i = 0; i < internalUris.length; i++) { if (internalUris[i].equals(uri)) { return true; } } return false; }
47932 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47932/8e31766454d3acf9f96ea841e0330731b9f6afe5/DefaultGrailsControllerClass.java/buggy/grails/src/commons/org/codehaus/groovy/grails/commons/DefaultGrailsControllerClass.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 7565, 774, 3098, 12, 780, 2003, 13, 288, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 2713, 23900, 18, 2469, 31, 277, 27245, 288, 1082, 202, 430, 261, 7236, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 7565, 774, 3098, 12, 780, 2003, 13, 288, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 2713, 23900, 18, 2469, 31, 277, 27245, 288, 1082, 202, 430, 261, 7236, ...
ErrorLogger.log("search error", this); ErrorLogger.log(status);
MylarStatusHandler.log("search error", this); MylarStatusHandler.log(status);
private BugzillaResultCollector search(String url, IProgressMonitor monitor){ // set the initial number of matches to 0 int matches = 0; // setup the progress monitor and start the search collector.setProgressMonitor(monitor); BugzillaSearchEngine engine = new BugzillaSearchEngine(url); try { // perform the search status = engine.search(collector, matches, maxHits); // check the status so that we don't keep searching if there // is a problem if (status.getCode() == IStatus.CANCEL) { ErrorLogger.log("search cancelled", this); return null; } else if (!status.isOK()) { ErrorLogger.log("search error", this); ErrorLogger.log(status); return null; } isMaxReached = engine.isMaxReached(); return collector; } catch (LoginException e) { //save this exception to throw later this.loginException = e; } return null; }
51151 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51151/5fee268477d34fc0e1b9e54dd641c0715fae348c/BugzillaCategorySearchOperation.java/buggy/org.eclipse.mylyn.bugzilla.ui/src/org/eclipse/mylyn/bugzilla/ui/tasklist/BugzillaCategorySearchOperation.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 16907, 15990, 1253, 7134, 1623, 12, 780, 880, 16, 467, 5491, 7187, 6438, 15329, 202, 565, 368, 444, 326, 2172, 1300, 434, 1885, 358, 374, 3639, 509, 1885, 273, 374, 31, 202, 565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 16907, 15990, 1253, 7134, 1623, 12, 780, 880, 16, 467, 5491, 7187, 6438, 15329, 202, 565, 368, 444, 326, 2172, 1300, 434, 1885, 358, 374, 3639, 509, 1885, 273, 374, 31, 202, 565, ...
stringBuffer.append(TEXT_393);
stringBuffer.append(TEXT_396);
public String generate(Object argument) { StringBuffer stringBuffer = new StringBuffer(); /** * <copyright> * * Copyright (c) 2002-2005 IBM Corporation and others. * All rights reserved. This program and the accompanying materials * are made available under the terms of the Eclipse Public License v1.0 * which accompanies this distribution, and is available at * http://www.eclipse.org/legal/epl-v10.html * * Contributors: * IBM - Initial API and implementation * * </copyright> */ GenPackage genPackage = (GenPackage)((Object[])argument)[0]; GenModel genModel=genPackage.getGenModel(); boolean isInterface = Boolean.TRUE.equals(((Object[])argument)[1]); boolean isImplementation = Boolean.TRUE.equals(((Object[])argument)[2]); String publicStaticFinalFlag = isImplementation ? "public static final " : ""; stringBuffer.append(TEXT_1); stringBuffer.append(TEXT_2); stringBuffer.append("$"); stringBuffer.append(TEXT_3); stringBuffer.append("$"); stringBuffer.append(TEXT_4); if (isImplementation && !genModel.isSuppressInterfaces()) { stringBuffer.append(TEXT_5); stringBuffer.append(genPackage.getClassPackageName()); stringBuffer.append(TEXT_6); } else { stringBuffer.append(TEXT_7); stringBuffer.append(genPackage.getReflectionPackageName()); stringBuffer.append(TEXT_8); } stringBuffer.append(TEXT_9); genModel.markImportLocation(stringBuffer, genPackage); if (isImplementation) { genModel.addPseudoImport("org.eclipse.emf.ecore.EPackage.Registry"); genModel.addPseudoImport("org.eclipse.emf.ecore.EPackage.Descriptor"); if (genPackage.isLiteralsInterface()) { genModel.addPseudoImport(genPackage.getQualifiedPackageInterfaceName() + ".Literals"); } for (Iterator i=genPackage.getOrderedGenClassifiers().iterator(); i.hasNext();) genModel.addPseudoImport(genPackage.getQualifiedPackageInterfaceName() + "." + genPackage.getClassifierID((GenClassifier)i.next())); } if (isInterface) { stringBuffer.append(TEXT_10); if (genPackage.hasDocumentation()) { stringBuffer.append(TEXT_11); stringBuffer.append(genPackage.getDocumentation(genModel.getIndentation(stringBuffer))); stringBuffer.append(TEXT_12); } stringBuffer.append(TEXT_13); stringBuffer.append(genPackage.getQualifiedFactoryInterfaceName()); if (!genModel.isSuppressEMFModelTags()) { boolean first = true; for (StringTokenizer stringTokenizer = new StringTokenizer(genPackage.getModelInfo(), "\n\r"); stringTokenizer.hasMoreTokens(); ) { String modelInfo = stringTokenizer.nextToken(); if (first) { first = false; stringBuffer.append(TEXT_14); stringBuffer.append(modelInfo); } else { stringBuffer.append(TEXT_15); stringBuffer.append(modelInfo); }} if (first) { stringBuffer.append(TEXT_16); }} stringBuffer.append(TEXT_17); } else { stringBuffer.append(TEXT_18); } if (isImplementation) { stringBuffer.append(TEXT_19); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_20); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.impl.EPackageImpl")); if (!isInterface){ stringBuffer.append(TEXT_21); stringBuffer.append(genPackage.getImportedPackageInterfaceName()); } } else { stringBuffer.append(TEXT_22); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_23); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); } stringBuffer.append(TEXT_24); if (genModel.getCopyrightText() != null) { stringBuffer.append(TEXT_25); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genModel.getImportedName("java.lang.String")); stringBuffer.append(TEXT_26); stringBuffer.append(genModel.getCopyrightText()); stringBuffer.append(TEXT_27); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_28); } if (isInterface) { stringBuffer.append(TEXT_29); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genModel.getImportedName("java.lang.String")); stringBuffer.append(TEXT_30); stringBuffer.append(genPackage.getPackageName()); stringBuffer.append(TEXT_31); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_32); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genModel.getImportedName("java.lang.String")); stringBuffer.append(TEXT_33); stringBuffer.append(genPackage.getNSURI()); stringBuffer.append(TEXT_34); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_35); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genModel.getImportedName("java.lang.String")); stringBuffer.append(TEXT_36); stringBuffer.append(genPackage.getNSName()); stringBuffer.append(TEXT_37); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_38); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_39); stringBuffer.append(genPackage.getQualifiedPackageClassName()); stringBuffer.append(TEXT_40); for (Iterator i=genPackage.getOrderedGenClassifiers().iterator(); i.hasNext();) { GenClassifier genClassifier = (GenClassifier)i.next(); stringBuffer.append(TEXT_41); if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; if (!genClass.isInterface()) { stringBuffer.append(TEXT_42); stringBuffer.append(genClass.getQualifiedClassName()); stringBuffer.append(TEXT_43); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_44); stringBuffer.append(genClass.getQualifiedClassName()); } else { stringBuffer.append(TEXT_45); stringBuffer.append(genClass.getQualifiedInterfaceName()); stringBuffer.append(TEXT_46); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_47); stringBuffer.append(genClass.getQualifiedInterfaceName()); } } else if (genClassifier instanceof GenEnum) { GenEnum genEnum = (GenEnum)genClassifier; stringBuffer.append(TEXT_48); stringBuffer.append(genEnum.getQualifiedName()); stringBuffer.append(TEXT_49); stringBuffer.append(genEnum.getFormattedName()); stringBuffer.append(TEXT_50); stringBuffer.append(genEnum.getQualifiedName()); } else if (genClassifier instanceof GenDataType) { GenDataType genDataType = (GenDataType)genClassifier; stringBuffer.append(TEXT_51); stringBuffer.append(genDataType.getFormattedName()); stringBuffer.append(TEXT_52); if (!genDataType.isPrimitiveType() && !genDataType.isArrayType()) { stringBuffer.append(TEXT_53); stringBuffer.append(genDataType.getQualifiedInstanceClassName()); } } stringBuffer.append(TEXT_54); stringBuffer.append(genPackage.getQualifiedPackageClassName()); stringBuffer.append(TEXT_55); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_56); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(TEXT_57); stringBuffer.append(genPackage.getClassifierID(genClassifier)); stringBuffer.append(TEXT_58); stringBuffer.append(genPackage.getClassifierValue(genClassifier)); stringBuffer.append(TEXT_59); if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; for (Iterator f=genClass.getAllGenFeatures().iterator(); f.hasNext();) { GenFeature genFeature = (GenFeature)f.next(); stringBuffer.append(TEXT_60); stringBuffer.append(genFeature.getFormattedName()); stringBuffer.append(TEXT_61); stringBuffer.append(genFeature.getFeatureKind()); stringBuffer.append(TEXT_62); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(TEXT_63); stringBuffer.append(genClass.getFeatureID(genFeature)); stringBuffer.append(TEXT_64); stringBuffer.append(genClass.getFeatureValue(genFeature)); stringBuffer.append(TEXT_65); } stringBuffer.append(TEXT_66); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_67); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(TEXT_68); stringBuffer.append(genClass.getFeatureCountID()); stringBuffer.append(TEXT_69); stringBuffer.append(genClass.getFeatureCountValue()); stringBuffer.append(TEXT_70); } } } if (isImplementation) { if (genPackage.isLoadingInitialization()) { stringBuffer.append(TEXT_71); stringBuffer.append(genPackage.getSerializedPackageFilename()); stringBuffer.append(TEXT_72); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_73); } for (Iterator i=genPackage.getGenClassifiers().iterator(); i.hasNext();) { GenClassifier genClassifier = (GenClassifier)i.next(); stringBuffer.append(TEXT_74); stringBuffer.append(genClassifier.getImportedMetaType()); stringBuffer.append(TEXT_75); stringBuffer.append(genClassifier.getClassifierInstanceName()); stringBuffer.append(TEXT_76); } stringBuffer.append(TEXT_77); stringBuffer.append(genPackage.getQualifiedPackageInterfaceName()); stringBuffer.append(TEXT_78); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_79); stringBuffer.append(genPackage.getQualifiedEFactoryInstanceAccessor()); stringBuffer.append(TEXT_80); if (!genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_81); } stringBuffer.append(TEXT_82); stringBuffer.append(genPackage.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_83); stringBuffer.append(genPackage.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_84); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_85); stringBuffer.append(genPackage.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_86); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_87); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_88); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_89); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_90); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_91); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_92); stringBuffer.append(genPackage.getPackageClassName()); stringBuffer.append(TEXT_93); if (!genPackage.getPackageSimpleDependencies().isEmpty()) { stringBuffer.append(TEXT_94); for (Iterator p=genPackage.getPackageSimpleDependencies().iterator(); p.hasNext();) { GenPackage dep = (GenPackage)p.next(); stringBuffer.append(TEXT_95); stringBuffer.append(dep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_96); } stringBuffer.append(TEXT_97); } if (!genPackage.getPackageInterDependencies().isEmpty()) { stringBuffer.append(TEXT_98); for (Iterator p=genPackage.getPackageInterDependencies().iterator(); p.hasNext();) { GenPackage interdep = (GenPackage)p.next(); stringBuffer.append(TEXT_99); stringBuffer.append(interdep.getImportedPackageClassName()); stringBuffer.append(TEXT_100); stringBuffer.append(genPackage.getPackageInstanceVariable(interdep)); stringBuffer.append(TEXT_101); stringBuffer.append(interdep.getImportedPackageClassName()); stringBuffer.append(TEXT_102); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_103); stringBuffer.append(interdep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_104); stringBuffer.append(interdep.getImportedPackageClassName()); stringBuffer.append(TEXT_105); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_106); stringBuffer.append(interdep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_107); stringBuffer.append(interdep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_108); } stringBuffer.append(TEXT_109); } if (genPackage.isLoadedInitialization() || !genPackage.getPackageLoadInterDependencies().isEmpty()) { stringBuffer.append(TEXT_110); if (genPackage.isLoadingInitialization()) { stringBuffer.append(TEXT_111); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_112); } for (Iterator p=genPackage.getPackageLoadInterDependencies().iterator(); p.hasNext();) { GenPackage interdep = (GenPackage)p.next(); if (interdep.isLoadingInitialization()) { stringBuffer.append(TEXT_113); stringBuffer.append(genPackage.getPackageInstanceVariable(interdep)); stringBuffer.append(TEXT_114); } } stringBuffer.append(TEXT_115); } if (!genPackage.isLoadedInitialization() || !genPackage.getPackageBuildInterDependencies().isEmpty()) { stringBuffer.append(TEXT_116); if (!genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_117); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_118); } for (Iterator p=genPackage.getPackageBuildInterDependencies().iterator(); p.hasNext();) { GenPackage interdep = (GenPackage)p.next(); stringBuffer.append(TEXT_119); stringBuffer.append(genPackage.getPackageInstanceVariable(interdep)); stringBuffer.append(TEXT_120); } stringBuffer.append(TEXT_121); if (!genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_122); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_123); } for (Iterator p=genPackage.getPackageBuildInterDependencies().iterator(); p.hasNext();) { GenPackage interdep = (GenPackage)p.next(); stringBuffer.append(TEXT_124); stringBuffer.append(genPackage.getPackageInstanceVariable(interdep)); stringBuffer.append(TEXT_125); } stringBuffer.append(TEXT_126); } if (genPackage.isLoadedInitialization() || !genPackage.getPackageLoadInterDependencies().isEmpty()) { stringBuffer.append(TEXT_127); if (genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_128); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_129); } for (Iterator p=genPackage.getPackageLoadInterDependencies().iterator(); p.hasNext();) { GenPackage interdep = (GenPackage)p.next(); stringBuffer.append(TEXT_130); stringBuffer.append(genPackage.getPackageInstanceVariable(interdep)); stringBuffer.append(TEXT_131); } stringBuffer.append(TEXT_132); } if (genPackage.hasConstraints()) { stringBuffer.append(TEXT_133); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EValidator")); stringBuffer.append(TEXT_134); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_135); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EValidator")); stringBuffer.append(TEXT_136); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EValidator")); stringBuffer.append(TEXT_137); stringBuffer.append(genPackage.getImportedValidatorClassName()); stringBuffer.append(TEXT_138); } if (!genPackage.isEcorePackage()) { stringBuffer.append(TEXT_139); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_140); } stringBuffer.append(TEXT_141); stringBuffer.append(genPackage.getPackageInterfaceName()); stringBuffer.append(TEXT_142); } if (isInterface) { // TODO REMOVE THIS BOGUS EMPTY LINE stringBuffer.append(TEXT_143); } for (Iterator i=genPackage.getGenClassifiers().iterator(); i.hasNext();) { GenClassifier genClassifier = (GenClassifier)i.next(); if (isInterface) { stringBuffer.append(TEXT_144); if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; stringBuffer.append(TEXT_145); stringBuffer.append(genClass.getQualifiedInterfaceName()); stringBuffer.append(TEXT_146); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_147); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_148); stringBuffer.append(genClass.getQualifiedInterfaceName()); if (!genModel.isSuppressEMFModelTags() && (genClass.isExternalInterface() || genClass.isDynamic())) { boolean first = true; for (StringTokenizer stringTokenizer = new StringTokenizer(genClass.getModelInfo(), "\n\r"); stringTokenizer.hasMoreTokens(); ) { String modelInfo = stringTokenizer.nextToken(); if (first) { first = false; stringBuffer.append(TEXT_149); stringBuffer.append(modelInfo); } else { stringBuffer.append(TEXT_150); stringBuffer.append(modelInfo); }} if (first) { stringBuffer.append(TEXT_151); }} } else if (genClassifier instanceof GenEnum) { GenEnum genEnum = (GenEnum)genClassifier; stringBuffer.append(TEXT_152); stringBuffer.append(genEnum.getQualifiedName()); stringBuffer.append(TEXT_153); stringBuffer.append(genEnum.getFormattedName()); stringBuffer.append(TEXT_154); stringBuffer.append(genEnum.getFormattedName()); stringBuffer.append(TEXT_155); stringBuffer.append(genEnum.getQualifiedName()); } else if (genClassifier instanceof GenDataType) { GenDataType genDataType = (GenDataType)genClassifier; if (genDataType.isPrimitiveType() || genDataType.isArrayType()) { stringBuffer.append(TEXT_156); stringBuffer.append(genDataType.getFormattedName()); stringBuffer.append(TEXT_157); } else { stringBuffer.append(TEXT_158); stringBuffer.append(genDataType.getQualifiedInstanceClassName()); stringBuffer.append(TEXT_159); stringBuffer.append(genDataType.getFormattedName()); stringBuffer.append(TEXT_160); } stringBuffer.append(TEXT_161); stringBuffer.append(genDataType.getFormattedName()); stringBuffer.append(TEXT_162); if (!genDataType.isPrimitiveType() && !genDataType.isArrayType()) { stringBuffer.append(TEXT_163); stringBuffer.append(genDataType.getQualifiedInstanceClassName()); } if (!genModel.isSuppressEMFModelTags()) {boolean first = true; for (StringTokenizer stringTokenizer = new StringTokenizer(genDataType.getModelInfo(), "\n\r"); stringTokenizer.hasMoreTokens(); ) { String modelInfo = stringTokenizer.nextToken(); if (first) { first = false; stringBuffer.append(TEXT_164); stringBuffer.append(modelInfo); } else { stringBuffer.append(TEXT_165); stringBuffer.append(modelInfo); }} if (first) { stringBuffer.append(TEXT_166); }} } stringBuffer.append(TEXT_167); } else { stringBuffer.append(TEXT_168); } if (isImplementation) { stringBuffer.append(TEXT_169); stringBuffer.append(genClassifier.getImportedMetaType()); stringBuffer.append(TEXT_170); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_171); if (genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_172); stringBuffer.append(genClassifier.getClassifierInstanceName()); stringBuffer.append(TEXT_173); stringBuffer.append(genClassifier.getClassifierInstanceName()); stringBuffer.append(TEXT_174); stringBuffer.append(genClassifier.getImportedMetaType()); stringBuffer.append(TEXT_175); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_176); stringBuffer.append(genPackage.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_177); stringBuffer.append(genPackage.getLocalClassifierIndex(genClassifier)); stringBuffer.append(TEXT_178); } stringBuffer.append(TEXT_179); stringBuffer.append(genClassifier.getClassifierInstanceName()); stringBuffer.append(TEXT_180); } else { stringBuffer.append(TEXT_181); stringBuffer.append(genClassifier.getImportedMetaType()); stringBuffer.append(TEXT_182); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_183); } if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; for (Iterator f=genClass.getGenFeatures().iterator(); f.hasNext();) { GenFeature genFeature = (GenFeature)f.next(); if (isInterface) { stringBuffer.append(TEXT_184); stringBuffer.append(genFeature.getFeatureKind()); stringBuffer.append(TEXT_185); stringBuffer.append(genClass.getQualifiedInterfaceName()); if (!genClass.isMapEntry() && !genFeature.isSuppressedGetVisibility()) { stringBuffer.append(TEXT_186); stringBuffer.append(genFeature.getGetAccessor()); } stringBuffer.append(TEXT_187); stringBuffer.append(genFeature.getFormattedName()); stringBuffer.append(TEXT_188); stringBuffer.append(genFeature.getFeatureKind()); stringBuffer.append(TEXT_189); stringBuffer.append(genFeature.getFormattedName()); stringBuffer.append(TEXT_190); stringBuffer.append(genClass.getQualifiedInterfaceName()); if (!genClass.isMapEntry() && !genFeature.isSuppressedGetVisibility()) { stringBuffer.append(TEXT_191); stringBuffer.append(genFeature.getGetAccessor()); stringBuffer.append(TEXT_192); } stringBuffer.append(TEXT_193); stringBuffer.append(genClass.getClassifierAccessorName()); stringBuffer.append(TEXT_194); } else { stringBuffer.append(TEXT_195); } if (isImplementation) { stringBuffer.append(TEXT_196); stringBuffer.append(genFeature.getImportedMetaType()); stringBuffer.append(TEXT_197); stringBuffer.append(genFeature.getFeatureAccessorName()); stringBuffer.append(TEXT_198); if (!genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_199); stringBuffer.append(genFeature.getImportedMetaType()); stringBuffer.append(TEXT_200); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_201); stringBuffer.append(genClass.getLocalFeatureIndex(genFeature)); stringBuffer.append(TEXT_202); } else { stringBuffer.append(TEXT_203); stringBuffer.append(genFeature.getImportedMetaType()); stringBuffer.append(TEXT_204); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_205); stringBuffer.append(genClass.getLocalFeatureIndex(genFeature)); stringBuffer.append(TEXT_206); } stringBuffer.append(TEXT_207); } else { stringBuffer.append(TEXT_208); stringBuffer.append(genFeature.getImportedMetaType()); stringBuffer.append(TEXT_209); stringBuffer.append(genFeature.getFeatureAccessorName()); stringBuffer.append(TEXT_210); } stringBuffer.append(TEXT_211); } } } if (isInterface) { stringBuffer.append(TEXT_212); } else { stringBuffer.append(TEXT_213); } if (isImplementation) { stringBuffer.append(TEXT_214); stringBuffer.append(genPackage.getImportedFactoryInterfaceName()); stringBuffer.append(TEXT_215); stringBuffer.append(genPackage.getFactoryInterfaceName()); stringBuffer.append(TEXT_216); stringBuffer.append(genPackage.getImportedFactoryInterfaceName()); stringBuffer.append(TEXT_217); } else { stringBuffer.append(TEXT_218); stringBuffer.append(genPackage.getFactoryInterfaceName()); stringBuffer.append(TEXT_219); stringBuffer.append(genPackage.getFactoryInterfaceName()); stringBuffer.append(TEXT_220); } stringBuffer.append(TEXT_221); if (isImplementation) { if (!genPackage.isLoadedInitialization()) { stringBuffer.append(TEXT_222); if (!genPackage.getGenClasses().isEmpty()) { stringBuffer.append(TEXT_223); for (Iterator c=genPackage.getGenClasses().iterator(); c.hasNext();) { GenClass genClass = (GenClass)c.next(); stringBuffer.append(TEXT_224); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_225); stringBuffer.append(genClass.getMetaType()); stringBuffer.append(TEXT_226); stringBuffer.append(genClass.getClassifierID()); stringBuffer.append(TEXT_227); for (Iterator f=genClass.getGenFeatures().iterator(); f.hasNext();) { GenFeature genFeature = (GenFeature)f.next(); stringBuffer.append(TEXT_228); stringBuffer.append(genFeature.getMetaType()); stringBuffer.append(TEXT_229); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_230); stringBuffer.append(genClass.getFeatureID(genFeature)); stringBuffer.append(TEXT_231); } if (c.hasNext()) { stringBuffer.append(TEXT_232); } } } if (!genPackage.getGenEnums().isEmpty()) { stringBuffer.append(TEXT_233); for (Iterator e=genPackage.getGenEnums().iterator(); e.hasNext();) { GenEnum genEnum = (GenEnum)e.next(); stringBuffer.append(TEXT_234); stringBuffer.append(genEnum.getClassifierInstanceName()); stringBuffer.append(TEXT_235); stringBuffer.append(genEnum.getClassifierID()); stringBuffer.append(TEXT_236); } } if (!genPackage.getGenDataTypes().isEmpty()) { stringBuffer.append(TEXT_237); for (Iterator d=genPackage.getGenDataTypes().iterator(); d.hasNext();) { GenDataType genDataType = (GenDataType)d.next(); stringBuffer.append(TEXT_238); stringBuffer.append(genDataType.getClassifierInstanceName()); stringBuffer.append(TEXT_239); stringBuffer.append(genDataType.getClassifierID()); stringBuffer.append(TEXT_240); } } stringBuffer.append(TEXT_241); if (!genPackage.getPackageInitializationDependencies().isEmpty()) { stringBuffer.append(TEXT_242); for (Iterator p=genPackage.getPackageInitializationDependencies().iterator(); p.hasNext();) { GenPackage dep = (GenPackage)p.next(); stringBuffer.append(TEXT_243); stringBuffer.append(dep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_244); stringBuffer.append(genPackage.getPackageInstanceVariable(dep)); stringBuffer.append(TEXT_245); stringBuffer.append(dep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_246); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_247); stringBuffer.append(dep.getImportedPackageInterfaceName()); stringBuffer.append(TEXT_248); } } if (!genPackage.getSubGenPackages().isEmpty()) { stringBuffer.append(TEXT_249); for (Iterator p=genPackage.getSubGenPackages().iterator(); p.hasNext();) { GenPackage sub = (GenPackage)p.next(); stringBuffer.append(TEXT_250); stringBuffer.append(genPackage.getPackageInstanceVariable(sub)); stringBuffer.append(TEXT_251); } } if (!genPackage.getGenClasses().isEmpty()) { boolean firstOperationAssignment = true; stringBuffer.append(TEXT_252); for (Iterator c=genPackage.getGenClasses().iterator(); c.hasNext();) { GenClass genClass = (GenClass)c.next(); for (Iterator b=genClass.getBaseGenClasses().iterator(); b.hasNext();) { GenClass baseGenClass = (GenClass)b.next(); stringBuffer.append(TEXT_253); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_254); stringBuffer.append(genPackage.getPackageInstanceVariable(baseGenClass.getGenPackage())); stringBuffer.append(TEXT_255); stringBuffer.append(baseGenClass.getClassifierAccessorName()); stringBuffer.append(TEXT_256); } } stringBuffer.append(TEXT_257); for (Iterator c=genPackage.getGenClasses().iterator(); c.hasNext();) { GenClass genClass = (GenClass)c.next(); stringBuffer.append(TEXT_258); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_259); if (genClass.isDynamic()) { stringBuffer.append(TEXT_260); } else { stringBuffer.append(genClass.getImportedInterfaceName()); stringBuffer.append(TEXT_261); } stringBuffer.append(TEXT_262); stringBuffer.append(genClass.getName()); stringBuffer.append(TEXT_263); stringBuffer.append(genClass.getAbstractFlag()); stringBuffer.append(TEXT_264); stringBuffer.append(genClass.getInterfaceFlag()); stringBuffer.append(TEXT_265); stringBuffer.append(genClass.getGeneratedInstanceClassFlag()); stringBuffer.append(TEXT_266); stringBuffer.append(genModel.getNonNLS()); for (Iterator f=genClass.getGenFeatures().iterator(); f.hasNext();) { GenFeature genFeature = (GenFeature)f.next(); if (genFeature.isReferenceType()) { GenFeature reverseGenFeature = genFeature.getReverse(); String reverse = reverseGenFeature == null ? "null" : genPackage.getPackageInstanceVariable(reverseGenFeature.getGenPackage()) + ".get" + reverseGenFeature.getFeatureAccessorName() + "()"; stringBuffer.append(TEXT_267); stringBuffer.append(genFeature.getFeatureAccessorName()); stringBuffer.append(TEXT_268); stringBuffer.append(genPackage.getPackageInstanceVariable(genFeature.getTypeGenPackage())); stringBuffer.append(TEXT_269); stringBuffer.append(genFeature.getTypeClassifierAccessorName()); stringBuffer.append(TEXT_270); stringBuffer.append(reverse); stringBuffer.append(TEXT_271); stringBuffer.append(genFeature.getName()); stringBuffer.append(TEXT_272); stringBuffer.append(genFeature.getDefaultValue()); stringBuffer.append(TEXT_273); stringBuffer.append(genFeature.getLowerBound()); stringBuffer.append(TEXT_274); stringBuffer.append(genFeature.getUpperBound()); stringBuffer.append(TEXT_275); stringBuffer.append(genFeature.getContainerClass()); stringBuffer.append(TEXT_276); stringBuffer.append(genFeature.getTransientFlag()); stringBuffer.append(TEXT_277); stringBuffer.append(genFeature.getVolatileFlag()); stringBuffer.append(TEXT_278); stringBuffer.append(genFeature.getChangeableFlag()); stringBuffer.append(TEXT_279); stringBuffer.append(genFeature.getContainmentFlag()); stringBuffer.append(TEXT_280); stringBuffer.append(genFeature.getResolveProxiesFlag()); stringBuffer.append(TEXT_281); stringBuffer.append(genFeature.getUnsettableFlag()); stringBuffer.append(TEXT_282); stringBuffer.append(genFeature.getUniqueFlag()); stringBuffer.append(TEXT_283); stringBuffer.append(genFeature.getDerivedFlag()); stringBuffer.append(TEXT_284); stringBuffer.append(genFeature.getOrderedFlag()); stringBuffer.append(TEXT_285); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(genModel.getNonNLS(genFeature.getDefaultValue(), 2)); } else { stringBuffer.append(TEXT_286); stringBuffer.append(genFeature.getFeatureAccessorName()); stringBuffer.append(TEXT_287); stringBuffer.append(genPackage.getPackageInstanceVariable(genFeature.getTypeGenPackage())); stringBuffer.append(TEXT_288); stringBuffer.append(genFeature.getTypeClassifierAccessorName()); stringBuffer.append(TEXT_289); stringBuffer.append(genFeature.getName()); stringBuffer.append(TEXT_290); stringBuffer.append(genFeature.getDefaultValue()); stringBuffer.append(TEXT_291); stringBuffer.append(genFeature.getLowerBound()); stringBuffer.append(TEXT_292); stringBuffer.append(genFeature.getUpperBound()); stringBuffer.append(TEXT_293); stringBuffer.append(genFeature.getContainerClass()); stringBuffer.append(TEXT_294); stringBuffer.append(genFeature.getTransientFlag()); stringBuffer.append(TEXT_295); stringBuffer.append(genFeature.getVolatileFlag()); stringBuffer.append(TEXT_296); stringBuffer.append(genFeature.getChangeableFlag()); stringBuffer.append(TEXT_297); stringBuffer.append(genFeature.getUnsettableFlag()); stringBuffer.append(TEXT_298); stringBuffer.append(genFeature.getIDFlag()); stringBuffer.append(TEXT_299); stringBuffer.append(genFeature.getUniqueFlag()); stringBuffer.append(TEXT_300); stringBuffer.append(genFeature.getDerivedFlag()); stringBuffer.append(TEXT_301); stringBuffer.append(genFeature.getOrderedFlag()); stringBuffer.append(TEXT_302); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(genModel.getNonNLS(genFeature.getDefaultValue(), 2)); } } for (Iterator o=genClass.getGenOperations().iterator(); o.hasNext();) { GenOperation genOperation = (GenOperation)o.next(); String prefix = ""; if (!genOperation.getGenParameters().isEmpty() || !genOperation.getGenExceptions().isEmpty()) { if (firstOperationAssignment) { firstOperationAssignment = false; prefix = genModel.getImportedName("org.eclipse.emf.ecore.EOperation") + " op = "; } else { prefix = "op = "; }} stringBuffer.append(TEXT_303); if (!genOperation.isVoid()) { stringBuffer.append(TEXT_304); stringBuffer.append(prefix); stringBuffer.append(TEXT_305); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_306); stringBuffer.append(genPackage.getPackageInstanceVariable(genOperation.getTypeGenPackage())); stringBuffer.append(TEXT_307); stringBuffer.append(genOperation.getTypeClassifierAccessorName()); stringBuffer.append(TEXT_308); stringBuffer.append(genOperation.getName()); stringBuffer.append(TEXT_309); stringBuffer.append(genModel.getNonNLS()); } else { stringBuffer.append(TEXT_310); stringBuffer.append(prefix); stringBuffer.append(TEXT_311); stringBuffer.append(genClass.getClassifierInstanceName()); stringBuffer.append(TEXT_312); stringBuffer.append(genOperation.getName()); stringBuffer.append(TEXT_313); stringBuffer.append(genModel.getNonNLS()); } for (Iterator p=genOperation.getGenParameters().iterator(); p.hasNext();) { GenParameter genParameter = (GenParameter)p.next(); stringBuffer.append(TEXT_314); stringBuffer.append(genPackage.getPackageInstanceVariable(genParameter.getTypeGenPackage())); stringBuffer.append(TEXT_315); stringBuffer.append(genParameter.getTypeClassifierAccessorName()); stringBuffer.append(TEXT_316); stringBuffer.append(genParameter.getName()); stringBuffer.append(TEXT_317); stringBuffer.append(genModel.getNonNLS()); } for (Iterator p=genOperation.getGenExceptions().iterator(); p.hasNext();) { GenClassifier genException = (GenClassifier)p.next(); stringBuffer.append(TEXT_318); stringBuffer.append(genPackage.getPackageInstanceVariable(genException.getGenPackage())); stringBuffer.append(TEXT_319); stringBuffer.append(genException.getClassifierAccessorName()); stringBuffer.append(TEXT_320); } } if (c.hasNext()) { stringBuffer.append(TEXT_321); } } } if (!genPackage.getGenEnums().isEmpty()) { stringBuffer.append(TEXT_322); for (Iterator e=genPackage.getGenEnums().iterator(); e.hasNext();) { GenEnum genEnum = (GenEnum)e.next(); stringBuffer.append(TEXT_323); stringBuffer.append(genEnum.getClassifierInstanceName()); stringBuffer.append(TEXT_324); stringBuffer.append(genEnum.getImportedName()); stringBuffer.append(TEXT_325); stringBuffer.append(genEnum.getName()); stringBuffer.append(TEXT_326); stringBuffer.append(genModel.getNonNLS()); for (Iterator l=genEnum.getGenEnumLiterals().iterator(); l.hasNext();) { GenEnumLiteral genEnumLiteral = (GenEnumLiteral)l.next(); stringBuffer.append(TEXT_327); stringBuffer.append(genEnum.getClassifierInstanceName()); stringBuffer.append(TEXT_328); stringBuffer.append(genEnum.getImportedName().equals(genEnum.getClassifierID()) ? genEnum.getQualifiedName() : genEnum.getImportedName()); stringBuffer.append(TEXT_329); stringBuffer.append(genEnumLiteral.getEnumLiteralID()); stringBuffer.append(TEXT_330); } if (e.hasNext()) { stringBuffer.append(TEXT_331); } } } if (!genPackage.getGenDataTypes().isEmpty()) { stringBuffer.append(TEXT_332); for (Iterator d=genPackage.getGenDataTypes().iterator(); d.hasNext();) { GenDataType genDataType = (GenDataType)d.next(); stringBuffer.append(TEXT_333); stringBuffer.append(genDataType.getClassifierInstanceName()); stringBuffer.append(TEXT_334); stringBuffer.append(genDataType.getImportedInstanceClassName()); stringBuffer.append(TEXT_335); stringBuffer.append(genDataType.getName()); stringBuffer.append(TEXT_336); stringBuffer.append(genDataType.getSerializableFlag()); stringBuffer.append(TEXT_337); stringBuffer.append(genDataType.getGeneratedInstanceClassFlag()); stringBuffer.append(TEXT_338); stringBuffer.append(genModel.getNonNLS()); } } if (genPackage.getSuperGenPackage() == null) { stringBuffer.append(TEXT_339); } if (!genPackage.getAnnotationSources().isEmpty()) { stringBuffer.append(TEXT_340); for (Iterator i = genPackage.getAnnotationSources().iterator(); i.hasNext();) { String annotationSource = (String)i.next(); stringBuffer.append(TEXT_341); stringBuffer.append(annotationSource); stringBuffer.append(TEXT_342); stringBuffer.append(genPackage.getAnnotationSourceIdentifier(annotationSource)); stringBuffer.append(TEXT_343); } } stringBuffer.append(TEXT_344); for (Iterator i = genPackage.getAnnotationSources().iterator(); i.hasNext();) { String annotationSource = (String)i.next(); stringBuffer.append(TEXT_345); stringBuffer.append(annotationSource); stringBuffer.append(TEXT_346); stringBuffer.append(genPackage.getAnnotationSourceIdentifier(annotationSource)); stringBuffer.append(TEXT_347); if (annotationSource == null) { stringBuffer.append(TEXT_348); } else { stringBuffer.append(TEXT_349); stringBuffer.append(annotationSource); stringBuffer.append(TEXT_350); stringBuffer.append(genModel.getNonNLS()); } for (Iterator j = genPackage.getAllAnnotations().iterator(); j.hasNext();) { EAnnotation eAnnotation = (EAnnotation)j.next(); stringBuffer.append(TEXT_351); if (annotationSource == null ? eAnnotation.getSource() == null : annotationSource.equals(eAnnotation.getSource())) { stringBuffer.append(TEXT_352); stringBuffer.append(genPackage.getAnnotatedModelElementAccessor(eAnnotation)); stringBuffer.append(TEXT_353); for (Iterator k = eAnnotation.getDetails().iterator(); k.hasNext();) { Map.Entry detail = (Map.Entry)k.next(); String key = Literals.toStringLiteral((String)detail.getKey(), genModel); String value = Literals.toStringLiteral((String)detail.getValue(), genModel); stringBuffer.append(TEXT_354); stringBuffer.append(key); stringBuffer.append(TEXT_355); stringBuffer.append(value); stringBuffer.append(k.hasNext() ? "," : ""); stringBuffer.append(genModel.getNonNLS(key + value)); } stringBuffer.append(TEXT_356); } } stringBuffer.append(TEXT_357); } } else { if (genPackage.isLoadingInitialization()) { stringBuffer.append(TEXT_358); stringBuffer.append(genModel.getImportedName("java.net.URL")); stringBuffer.append(TEXT_359); stringBuffer.append(genModel.getNonNLS()); stringBuffer.append(TEXT_360); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.common.util.URI")); stringBuffer.append(TEXT_361); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.common.util.URI")); stringBuffer.append(TEXT_362); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.resource.Resource")); stringBuffer.append(TEXT_363); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.xmi.impl.EcoreResourceFactoryImpl")); stringBuffer.append(TEXT_364); stringBuffer.append(genModel.getImportedName("java.io.IOException")); stringBuffer.append(TEXT_365); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.common.util.WrappedException")); stringBuffer.append(TEXT_366); stringBuffer.append(genModel.getImportedName("org.eclipse.emf.ecore.EPackage")); stringBuffer.append(TEXT_367); } stringBuffer.append(TEXT_368); } } if (isInterface && genPackage.isLiteralsInterface()) { stringBuffer.append(TEXT_369); if (isImplementation) { stringBuffer.append(TEXT_370); } stringBuffer.append(TEXT_371); for (Iterator i=genPackage.getGenClassifiers().iterator(); i.hasNext();) { GenClassifier genClassifier = (GenClassifier)i.next(); stringBuffer.append(TEXT_372); if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; if (!genClass.isInterface()) { stringBuffer.append(TEXT_373); stringBuffer.append(genClass.getQualifiedClassName()); stringBuffer.append(TEXT_374); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_375); stringBuffer.append(genClass.getQualifiedClassName()); } else { stringBuffer.append(TEXT_376); stringBuffer.append(genClass.getQualifiedInterfaceName()); stringBuffer.append(TEXT_377); stringBuffer.append(genClass.getFormattedName()); stringBuffer.append(TEXT_378); stringBuffer.append(genClass.getQualifiedInterfaceName()); } } else if (genClassifier instanceof GenEnum) { GenEnum genEnum = (GenEnum)genClassifier; stringBuffer.append(TEXT_379); stringBuffer.append(genEnum.getQualifiedName()); stringBuffer.append(TEXT_380); stringBuffer.append(genEnum.getFormattedName()); stringBuffer.append(TEXT_381); stringBuffer.append(genEnum.getQualifiedName()); } else if (genClassifier instanceof GenDataType) { GenDataType genDataType = (GenDataType)genClassifier; stringBuffer.append(TEXT_382); stringBuffer.append(genDataType.getFormattedName()); stringBuffer.append(TEXT_383); if (!genDataType.isPrimitiveType() && !genDataType.isArrayType()) { stringBuffer.append(TEXT_384); stringBuffer.append(genDataType.getQualifiedInstanceClassName()); } } stringBuffer.append(TEXT_385); stringBuffer.append(genPackage.getQualifiedPackageClassName()); stringBuffer.append(TEXT_386); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_387); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genClassifier.getImportedMetaType()); stringBuffer.append(TEXT_388); stringBuffer.append(genPackage.getClassifierID(genClassifier)); stringBuffer.append(TEXT_389); stringBuffer.append(genClassifier.getClassifierAccessorName()); stringBuffer.append(TEXT_390); if (genClassifier instanceof GenClass) { GenClass genClass = (GenClass)genClassifier; for (Iterator f=genClass.getGenFeatures().iterator(); f.hasNext();) { GenFeature genFeature = (GenFeature)f.next(); stringBuffer.append(TEXT_391); stringBuffer.append(genFeature.getFormattedName()); stringBuffer.append(TEXT_392); stringBuffer.append(genFeature.getFeatureKind()); stringBuffer.append(TEXT_393); stringBuffer.append(publicStaticFinalFlag); stringBuffer.append(genFeature.getImportedMetaType()); stringBuffer.append(TEXT_394); stringBuffer.append(genClass.getFeatureID(genFeature)); stringBuffer.append(TEXT_395); stringBuffer.append(genFeature.getFeatureAccessorName()); stringBuffer.append(TEXT_396); } } } stringBuffer.append(TEXT_397); } stringBuffer.append(TEXT_398); stringBuffer.append(isInterface ? genPackage.getPackageInterfaceName() : genPackage.getPackageClassName()); genModel.emitSortedImports(); stringBuffer.append(TEXT_399); return stringBuffer.toString(); }
11224 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11224/0b0b12471172d8ffd6c8d0e09d49f9f9847ba791/PackageClass.java/clean/plugins/org.eclipse.emf.codegen.ecore/src/org/eclipse/emf/codegen/ecore/templates/model/PackageClass.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 2103, 12, 921, 1237, 13, 225, 288, 565, 6674, 533, 1892, 273, 394, 6674, 5621, 565, 1783, 380, 411, 29187, 34, 380, 380, 25417, 261, 71, 13, 4044, 22, 17, 6976, 25, 23450, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 2103, 12, 921, 1237, 13, 225, 288, 565, 6674, 533, 1892, 273, 394, 6674, 5621, 565, 1783, 380, 411, 29187, 34, 380, 380, 25417, 261, 71, 13, 4044, 22, 17, 6976, 25, 23450, ...
long secs = (new java.util.Date().getTime() - date.getTime()) / 1000;
long secs = Math.abs((now.getTime() - date.getTime()) / 1000);
public String formatTime(TextProvider tp, java.util.Date date) { StringBuffer sb = new StringBuffer(); List args = new ArrayList(); long secs = (new java.util.Date().getTime() - date.getTime()) / 1000; long mins = secs / 60; int min = (int) mins % 60; long hours = mins / 60; int hour = (int) hours % 24; int days = (int) hours / 24; int day = days % 365; int years = days / 365; if (Math.abs(secs) < 60) { args.add(new Long(secs)); args.add(sb); args.add(null); sb.append(tp.getText(DATETAG_PROPERTY_SECONDS, DATETAG_DEFAULT_SECONDS, args)); } else if (hours == 0) { args.add(new Long(min)); args.add(sb); args.add(null); sb.append(tp.getText(DATETAG_PROPERTY_MINUTES, DATETAG_DEFAULT_MINUTES, args)); } else if (days == 0) { args.add(new Long(hour)); args.add(new Long(min)); args.add(sb); args.add(null); sb.append(tp.getText(DATETAG_PROPERTY_HOURS, DATETAG_DEFAULT_HOURS, args)); } else if (years == 0) { args.add(new Long(days)); args.add(new Long(hour)); args.add(sb); args.add(null); sb.append(tp.getText(DATETAG_PROPERTY_DAYS, DATETAG_DEFAULT_DAYS, args)); } else { args.add(new Object[]{new Long(years)}); args.add(new Object[]{new Long(day)}); args.add(sb); args.add(null); sb.append(tp.getText(DATETAG_PROPERTY_YEARS, DATETAG_DEFAULT_YEARS, args)); } args.clear(); args.add(sb.toString()); if (date.before(new java.util.Date())) { //looks like this date is passed return tp.getText(DATETAG_PROPERTY_PAST, DATETAG_DEFAULT_PAST, args); } else { return tp.getText(DATETAG_PROPERTY_FUTURE, DATETAG_DEFAULT_FUTURE, args); } }
15560 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/15560/962bd99afb13efb2d05c9ae127badb6e815b4438/Date.java/clean/src/java/com/opensymphony/webwork/components/Date.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 740, 950, 12, 1528, 2249, 8071, 16, 2252, 18, 1367, 18, 1626, 1509, 13, 288, 3639, 6674, 2393, 273, 394, 6674, 5621, 3639, 987, 833, 273, 394, 2407, 5621, 3639, 1525, 18043, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 740, 950, 12, 1528, 2249, 8071, 16, 2252, 18, 1367, 18, 1626, 1509, 13, 288, 3639, 6674, 2393, 273, 394, 6674, 5621, 3639, 987, 833, 273, 394, 2407, 5621, 3639, 1525, 18043, ...
StringBuffer result = new StringBuffer(); int start = lineStart; if (start >= offset) { if (otherStart < otherEnd) result.append(otherBuffer, otherStart, otherEnd - otherStart); start = 0; } result.append(buffer, start, offset - start);
String getLine() { StringBuffer result = new StringBuffer(); int start = lineStart; if (start >= offset) { // the line begins somewhere in the other buffer; get that first. if (otherStart < otherEnd) // if a line ending was seen in the other buffer... otherwise // just ignore this strange case. result.append(otherBuffer, otherStart, otherEnd - otherStart); start = 0; } // get the part of the line in the current buffer. result.append(buffer, start, offset - start); // Get the remainder of the line. int i = offset; while(true) { if (i == buffer.length) { // we're out of buffer, let's just expand it. We do // this instead of reading into a StringBuffer to // preserve the stream for later reads. char[] newBuffer = new char[buffer.length * 2]; System.arraycopy(buffer, 0, newBuffer, 0, buffer.length); buffer = newBuffer; int charsRead = 0; try { charsRead = in.read(buffer, end, buffer.length - end); } catch (IOException ioe) { // ignore it, we're already displaying an error... } if (charsRead < 0) break; end += charsRead; } int c = buffer[i]; if ((c & EOL_HINT_MASK) == 0 && eolChar(c)) break; i++; } result.append(buffer, offset, i - offset); return result.toString(); }
54155 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54155/091a93a0a477a3678d94e8451637147067cc12da/LineBuffer.java/clean/js/rhino/src/org/mozilla/javascript/LineBuffer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 514, 9851, 1435, 288, 3639, 6674, 563, 273, 394, 6674, 5621, 3639, 509, 787, 273, 29208, 31, 3639, 309, 261, 1937, 1545, 1384, 13, 288, 5411, 368, 326, 980, 17874, 22234, 316, 326, 1308, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 514, 9851, 1435, 288, 3639, 6674, 563, 273, 394, 6674, 5621, 3639, 509, 787, 273, 29208, 31, 3639, 309, 261, 1937, 1545, 1384, 13, 288, 5411, 368, 326, 980, 17874, 22234, 316, 326, 1308, ...
allTypes = new Vector(); lookupHash = new Hashtable();
EquipmentType.allTypes = new Vector(); EquipmentType.lookupHash = new Hashtable();
public static void initializeTypes() { allTypes = new Vector(); lookupHash = new Hashtable(); // will I need any others? WeaponType.initializeTypes(); AmmoType.initializeTypes(); MiscType.initializeTypes(); }
3464 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3464/8f548b606dba7b87ba0d08336d8e13af983cba65/EquipmentType.java/clean/megamek/src/megamek/common/EquipmentType.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 4046, 2016, 1435, 288, 3639, 777, 2016, 273, 394, 5589, 5621, 3639, 3689, 2310, 273, 394, 18559, 5621, 7734, 368, 903, 467, 1608, 1281, 10654, 35, 3639, 1660, 28629, 559, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 4046, 2016, 1435, 288, 3639, 777, 2016, 273, 394, 5589, 5621, 3639, 3689, 2310, 273, 394, 18559, 5621, 7734, 368, 903, 467, 1608, 1281, 10654, 35, 3639, 1660, 28629, 559, ...
spMinutesStateChanged(evt); }
spMinutesStateChanged(evt); }
public void stateChanged(javax.swing.event.ChangeEvent evt) { spMinutesStateChanged(evt); }
4241 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4241/ddfa85a65b901e7f171a2e3ba5d20311cec593a7/MoveTimeDialog.java/buggy/src/org/cesilko/rachota/gui/MoveTimeDialog.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1850, 1071, 918, 919, 5033, 12, 28384, 18, 5328, 310, 18, 2575, 18, 20930, 6324, 13, 288, 5411, 1694, 13050, 1119, 5033, 12, 73, 11734, 1769, 540, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1850, 1071, 918, 919, 5033, 12, 28384, 18, 5328, 310, 18, 2575, 18, 20930, 6324, 13, 288, 5411, 1694, 13050, 1119, 5033, 12, 73, 11734, 1769, 540, 289, 2, -100, -100, -100, -100, -100, -100, ...
private boolean matchOutVerb(String source, String target, Verb verb) { Object[] verbs = acps.getOutgoingVerbs(source, target); if( verbs[0].toString()=="*" ) { //if(debug) System.out.println("SecurityAspect: got OUT * verb, so blocking "+verb+" for " + source); return true; } if(verb == null || verbs.length == 0) { if(debug)System.out.println("SecurityAspect: no out verbs for " + source + ", " + target + ", " + verb ); return false; // we have no policy so return } for(int i = 0; i < verbs.length; i++) { Verb v = null; try{ v = (Verb)verbs[i]; } catch(Exception e){ //probably a cast error, quietly skip } if (v==null) continue; if(verb.equals(v)) { if(debug)System.out.println("SecurityAspect: matched out verbs " + verbs[i] + " == " + verb); return true; // we found a match so return success } } return false; // we found no matches so return false }
12869 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12869/dc9fd5855e50eaadd5520fad9ce9335764830777/SecurityAspect.java/buggy/securityservices/src/com/nai/security/crypto/SecurityAspect.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 6494, 1916, 1182, 16281, 12, 780, 3168, 16, 780, 3299, 16, 16281, 16629, 15329, 921, 8526, 502, 2038, 33, 1077, 1121, 18, 588, 24866, 3945, 2038, 12, 3168, 16, 3299, 1769, 430, 12, 502, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 6494, 1916, 1182, 16281, 12, 780, 3168, 16, 780, 3299, 16, 16281, 16629, 15329, 921, 8526, 502, 2038, 33, 1077, 1121, 18, 588, 24866, 3945, 2038, 12, 3168, 16, 3299, 1769, 430, 12, 502, ...
ImageFileMetaData imagefile = new ImageFileMetaData( new File( file_path, image_ref ) );
ImageFileMetaData imagefile = new ImageFileMetaData( new FileInputStream( new File( file_path, image_ref ) ), image_ref );
public void doPost( HttpServletRequest req, HttpServletResponse res ) throws ServletException, IOException { IMCServiceInterface imcref = ApplicationServer.getIMCServiceInterface(); File file_path = Utility.getDomainPrefPath( "image_path" ); Utility.setDefaultHtmlContentType( res ); int length = req.getContentLength(); ServletInputStream in = req.getInputStream(); PrintWriter out = res.getWriter(); HttpSession session = req.getSession( true ); byte[] buffer = new byte[length]; int bytes_read = 0; while ( bytes_read < length ) { bytes_read += in.read( buffer, bytes_read, length - bytes_read ); } String contentType = req.getContentType(); MultipartFormdataParser mp = new MultipartFormdataParser( new String( buffer, "8859_1" ), contentType ); String file = mp.getParameter( "file" ); String filename = mp.getFilename( "file" ); String label = mp.getParameter( "label" ); if ( label == null ) { label = ""; } if ( file.equals( "" ) ) { res.sendRedirect( "ChangeImage?meta_id=" + mp.getParameter( "meta_id" ) + "&img_no=" + mp.getParameter( "img_no" ) + "&label=" + label ); return; } String folder = mp.getParameter( "folder" ); if ( folder == null ) folder = ""; //submitted with Browse Images button, no ImageUpload (M Wallin) if ( mp.getParameter( "browse_images" ) != null ) { // Browse Image Library res.sendRedirect( "ImageBrowse" ); } if ( mp.getParameter( "ok" ) == null ) { doGet( req, res ); return; } int meta_id = Integer.parseInt( mp.getParameter( "meta_id" ) ); int img_no = Integer.parseInt( mp.getParameter( "img_no" ) ); // extraParameter, presets imagepath... set by ImageBrowse filename = filename.substring( filename.lastIndexOf( '/' ) + 1 ); filename = filename.substring( filename.lastIndexOf( '\\' ) + 1 ); File fn = new File( new File( file_path, folder ), filename ); UserDomainObject user = Utility.getLoggedOnUser( req ); if ( file.length() > 0 ) { if ( fn.exists() ) { Vector vec = new Vector(); vec.add( "#back#" ); vec.add( "ChangeImage?meta_id=" + meta_id + "&img_no=" + img_no + "?label=" + label ); vec.add( "#meta_id#" ); vec.add( String.valueOf( meta_id ) ); vec.add( "#img_no#" ); vec.add( String.valueOf( img_no ) ); vec.add( "#label#" ); vec.add( label ); String htmlStr = imcref.getAdminTemplate( "file_exists.html", user, vec ); out.println( htmlStr ); return; } FileOutputStream fos = new FileOutputStream( fn ); fos.write( file.getBytes( "8859_1" ) ); fos.close(); } String folderOptList = (String)session.getAttribute( "imageFolderOptionList" ); StringBuffer buff = new StringBuffer( folderOptList ); int countX = folderOptList.indexOf( folder ); if ( countX > 0 ) buff.insert( countX + folder.length() + 1, "selected" ); //String htmlStr = imcref.interpretAdminTemplate(meta_id,user,"change_img.html",img_no,0,0,0) ; //out.println(htmlStr) ; String image_ref = fn.getCanonicalPath(); image_ref = image_ref.substring( file_path.getCanonicalPath().length() + 1 ); image_ref = image_ref.replace( '\\', '/' ); ImageFileMetaData imagefile = new ImageFileMetaData( new File( file_path, image_ref ) ); int width = imagefile.getWidth(); int height = imagefile.getHeight(); Vector vec = new Vector(); vec.add( "#keep_aspect#" ); vec.add( "checked" ); vec.add( "#imgUrl#" ); vec.add( imcref.getImageUrl() ); vec.add( "#imgName#" ); vec.add( "" ); vec.add( "#imgRef#" ); vec.add( image_ref ); vec.add( "#imgWidth#" ); vec.add( "" + width ); vec.add( "#imgHeight#" ); vec.add( "" + height ); vec.add( "#origW#" ); vec.add( "" + width ); vec.add( "#origH#" ); vec.add( "" + height ); vec.add( "#imgBorder#" ); vec.add( "0" ); vec.add( "#imgVerticalSpace#" ); vec.add( "0" ); vec.add( "#imgHorizontalSpace#" ); vec.add( "0" ); vec.add( "#target_name#" ); vec.add( "" ); vec.add( "#self_checked#" ); vec.add( "selected" ); vec.add( "#top_selected#" ); vec.add( "selected" ); vec.add( "#imgAltText#" ); vec.add( "" ); vec.add( "#imgLowScr#" ); vec.add( "" ); vec.add( "#imgRefLink#" ); vec.add( "" ); vec.add( "#getMetaId#" ); vec.add( String.valueOf( meta_id ) ); vec.add( "#img_no#" ); vec.add( String.valueOf( img_no ) ); vec.add( "#label#" ); vec.add( label ); vec.add( "#folders#" ); vec.add( buff.toString() ); String htmlStr = imcref.getAdminTemplate( "change_img.html", user, vec ); out.print( htmlStr ); return; }
8781 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8781/ff9b2edfb82af582993934591d4051e42e2887ab/ImageUpload.java/clean/server/src/com/imcode/imcms/servlet/admin/ImageUpload.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 741, 3349, 12, 9984, 1111, 16, 12446, 400, 262, 1216, 16517, 16, 1860, 288, 3639, 6246, 39, 18348, 709, 71, 1734, 273, 4257, 2081, 18, 588, 3445, 39, 18348, 5621, 3639, 1387, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 741, 3349, 12, 9984, 1111, 16, 12446, 400, 262, 1216, 16517, 16, 1860, 288, 3639, 6246, 39, 18348, 709, 71, 1734, 273, 4257, 2081, 18, 588, 3445, 39, 18348, 5621, 3639, 1387, ...
System.out.println("fib(" + n + ") in " + (end-start) + " ms");
public void test3(int n) { System.out.println("test 3"); ATermAppl N = tzero; for(int i=0 ; i<n ; i++) { N = factory.makeAppl(suc,N); } //System.out.println("N = " + N); long start = System.currentTimeMillis(); ATermAppl res = normalizeFib(factory.makeAppl(fib,N)); long end = System.currentTimeMillis(); //System.out.println("fib(" + n + ") = " + res); System.out.println("fib(" + n + ") in " + (end-start) + " ms"); //System.out.println(factory); }
3664 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3664/6e9f73b855168534d6951e9c589de4d382b8423d/TestFib.java/buggy/aterm-java/test/TestFib.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 23, 12, 474, 290, 13, 288, 565, 2332, 18, 659, 18, 8222, 2932, 3813, 890, 8863, 5411, 432, 4065, 1294, 412, 423, 273, 6016, 2439, 31, 565, 364, 12, 474, 277, 33, 20, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1842, 23, 12, 474, 290, 13, 288, 565, 2332, 18, 659, 18, 8222, 2932, 3813, 890, 8863, 5411, 432, 4065, 1294, 412, 423, 273, 6016, 2439, 31, 565, 364, 12, 474, 277, 33, 20, ...
EditorCell editorCell = stack.isEmpty() ? null : stack.peek(); return editorCell;
return stack.isEmpty() ? null : stack.peek();
public EditorCell getCurrentAttributedCellWithRole(Class attributeClass) { Stack<EditorCell> stack = myAttributedClassesToAttributedCellStacksMap.get(attributeClass); if (stack == null) { stack = new Stack<EditorCell>(); myAttributedClassesToAttributedCellStacksMap.put(attributeClass, stack); } EditorCell editorCell = stack.isEmpty() ? null : stack.peek(); // todo don't return null return editorCell; }
14939 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/14939/738489fd86b15052d875aa88d12f825baaf86c0b/EditorManager.java/clean/source/jetbrains/mps/nodeEditor/EditorManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 18451, 4020, 5175, 861, 11050, 4020, 1190, 2996, 12, 797, 1566, 797, 13, 288, 565, 7283, 32, 6946, 4020, 34, 2110, 273, 3399, 861, 11050, 4818, 774, 861, 11050, 4020, 28090, 863, 18...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 18451, 4020, 5175, 861, 11050, 4020, 1190, 2996, 12, 797, 1566, 797, 13, 288, 565, 7283, 32, 6946, 4020, 34, 2110, 273, 3399, 861, 11050, 4818, 774, 861, 11050, 4020, 28090, 863, 18...
public void translateTo(ClassGenerator classGen, MethodGenerator methodGen,
public void translateTo(ClassGenerator classGen, MethodGenerator methodGen,
public void translateTo(ClassGenerator classGen, MethodGenerator methodGen, Type type) { if (type == Type.String) { translateTo(classGen, methodGen, (StringType) type); } else if (type == Type.Real) { translateTo(classGen, methodGen, (RealType) type); } else if (type == Type.Boolean) { translateTo(classGen, methodGen, (BooleanType) type); } else if (type == Type.NodeSet) { translateTo(classGen, methodGen, (NodeSetType) type); } else if (type == Type.Node) { translateTo(classGen, methodGen, (NodeType) type); } else if (type == Type.ResultTree) { translateTo(classGen, methodGen, (ResultTreeType) type); } else if (type == Type.Object) { translateTo(classGen, methodGen, (ObjectType) type); } else { ErrorMsg err = new ErrorMsg(ErrorMsg.INTERNAL_ERR, type.toString()); classGen.getParser().reportError(Constants.FATAL, err); } }
2723 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2723/7a57729197797cf992fd71a8b574ee875930a638/ReferenceType.java/clean/src/org/apache/xalan/xsltc/compiler/util/ReferenceType.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4204, 774, 12, 797, 3908, 667, 7642, 16, 2985, 3908, 707, 7642, 16, 4697, 565, 1412, 618, 13, 288, 202, 430, 261, 723, 422, 1412, 18, 780, 13, 288, 202, 565, 4204, 774, 12,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 4204, 774, 12, 797, 3908, 667, 7642, 16, 2985, 3908, 707, 7642, 16, 4697, 565, 1412, 618, 13, 288, 202, 430, 261, 723, 422, 1412, 18, 780, 13, 288, 202, 565, 4204, 774, 12,...
rule.setTestExpression( DEUtil.resolveNull( expression .getText( ) ) );
rule.setTestExpression( DEUtil.resolveNull( expression.getText( ) ) );
protected void okPressed( ) { try { String familyValue = getRawFontFamily( ); String sizeValue = getRawFontSize( ); int colorValue = DEUtil.getRGBInt( color.getRGB( ) ); int backColorValue = DEUtil.getRGBInt( backColor.getRGB( ) ); String italicValue = italic.getSelection( ) ? DesignChoiceConstants.FONT_STYLE_ITALIC : DesignChoiceConstants.FONT_STYLE_NORMAL; String weightValue = bold.getSelection( ) ? DesignChoiceConstants.FONT_WEIGHT_BOLD : DesignChoiceConstants.FONT_WEIGHT_NORMAL; String underlineValue = underline.getSelection( ) ? DesignChoiceConstants.TEXT_UNDERLINE_UNDERLINE : DesignChoiceConstants.TEXT_UNDERLINE_NONE; String lingthroughValue = linethrough.getSelection( ) ? DesignChoiceConstants.TEXT_LINE_THROUGH_LINE_THROUGH : DesignChoiceConstants.TEXT_LINE_THROUGH_NONE; // provider.setTestExpression( DEUtil.resolveNull( // expression.getText( ) ) ); if ( handle == null ) { HighlightRule rule = StructureFactory.createHighlightRule( ); rule.setProperty( HighlightRule.OPERATOR_MEMBER, DEUtil.resolveNull( getValueForOperator( operator .getText( ) ) ) ); rule.setProperty( HighlightRule.VALUE1_MEMBER, DEUtil .resolveNull( value1.getText( ) ) ); rule.setProperty( HighlightRule.VALUE2_MEMBER, DEUtil .resolveNull( value2.getText( ) ) ); /** * Sets our necessary style properties. */ if ( color.getRGB( ) != null ) { rule.setProperty( HighlightRule.COLOR_MEMBER, new Integer( colorValue ) ); } if ( backColor.getRGB( ) != null ) { rule.setProperty( HighlightRule.BACKGROUND_COLOR_MEMBER, new Integer( backColorValue ) ); } if ( familyValue != null ) { rule.setProperty( HighlightRule.FONT_FAMILY_MEMBER, familyValue ); } if ( sizeValue != null ) { rule .setProperty( HighlightRule.FONT_SIZE_MEMBER, sizeValue ); } if ( isItalicChanged ) { rule.setProperty( HighlightRule.FONT_STYLE_MEMBER, italicValue ); } if ( isBoldChanged ) { rule.setProperty( HighlightRule.FONT_WEIGHT_MEMBER, weightValue ); } if ( isLinethroughChanged ) { rule.setProperty( HighlightRule.TEXT_LINE_THROUGH_MEMBER, lingthroughValue ); } if ( isUnderlineChanged ) { rule.setProperty( HighlightRule.TEXT_UNDERLINE_MEMBER, underlineValue ); } // set test expression into highlight rule. rule.setTestExpression( DEUtil.resolveNull( expression .getText( ) ) ); handle = provider.doAddItem( rule, handleCount ); } else { handle .setOperator( DEUtil .resolveNull( getValueForOperator( operator .getText( ) ) ) ); handle.setValue1( DEUtil.resolveNull( value1.getText( ) ) ); handle.setValue2( DEUtil.resolveNull( value2.getText( ) ) ); handle.getFontFamilyHandle( ).setStringValue( DEUtil.resolveNull( familyValue ) ); handle.getFontSize( ).setStringValue( DEUtil.resolveNull( sizeValue ) ); if ( color.getRGB( ) != null ) { handle.getColor( ).setRGB( colorValue ); } else { handle.getColor( ).setValue( null ); } if ( backColor.getRGB( ) != null ) { handle.getBackgroundColor( ).setRGB( backColorValue ); } else { handle.getBackgroundColor( ).setValue( null ); } if ( isItalicChanged ) { handle.setFontStyle( italicValue ); } if ( isBoldChanged ) { handle.setFontWeight( weightValue ); } if ( isUnderlineChanged ) { handle.setTextUnderline( underlineValue ); } if ( isLinethroughChanged ) { handle.setTextLineThrough( lingthroughValue ); } // set test expression into highlight rule. handle.setTestExpression( DEUtil.resolveNull( expression .getText( ) ) ); } } catch ( Exception e ) { WidgetUtil.processError( getShell( ), e ); } super.okPressed( ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/79315b368296e47fc6aa276a9db24d8570b2b6c9/HighlightRuleBuilder.java/buggy/UI/org.eclipse.birt.report.designer.ui/src/org/eclipse/birt/report/designer/ui/dialogs/HighlightRuleBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 1529, 24624, 12, 262, 202, 95, 202, 202, 698, 202, 202, 95, 1082, 202, 780, 6755, 620, 273, 10547, 5711, 9203, 12, 11272, 1082, 202, 780, 963, 620, 273, 10547, 22688, 12...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 1529, 24624, 12, 262, 202, 95, 202, 202, 698, 202, 202, 95, 1082, 202, 780, 6755, 620, 273, 10547, 5711, 9203, 12, 11272, 1082, 202, 780, 963, 620, 273, 10547, 22688, 12...
String name = req.getParameter( PARAMETER__NAME ).trim(); if ( documentMapper.isUniqueCategoryTypeName( name ) ) { formBean.setUniqueCategoryTypeName( true );
String newName = req.getParameter( PARAMETER__NAME ).trim(); if ( !newName.equals(categoryTypeToEdit.getName()) ) { formBean.setUniqueCategoryTypeName( documentMapper.isUniqueCategoryTypeName( newName ) ); } if (formBean.isUniqueCategoryTypeName()){
private void editCategoryType( CategoryTypeDomainObject categoryTypeToEdit, HttpServletRequest req, Page formBean, DocumentMapper documentMapper ) { formBean.setMode(PARAMETER_MODE__EDIT_CATEGORY_TYPE) ; if ( req.getParameter( PARAMETER_CATEGORY_TYPE_SAVE ) != null ) { String name = req.getParameter( PARAMETER__NAME ).trim(); if ( documentMapper.isUniqueCategoryTypeName( name ) ) { formBean.setUniqueCategoryTypeName( true ); int maxChoices = Integer.parseInt( req.getParameter( "max_choices" ) ); categoryTypeToEdit.setName( name ); categoryTypeToEdit.setMaxChoices( maxChoices ); documentMapper.updateCategoryType( categoryTypeToEdit ); } else { formBean.setUniqueCategoryTypeName( false ); } } formBean.setCategoryTypeToEdit( categoryTypeToEdit ); }
8781 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8781/296e89387abccc3155b1b71d83133cbd6bc931f3/AdminCategories.java/buggy/server/src/com/imcode/imcms/servlet/superadmin/AdminCategories.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 3874, 4457, 559, 12, 9856, 559, 3748, 921, 3150, 559, 774, 4666, 16, 9984, 1111, 16, 4766, 282, 3460, 646, 3381, 16, 4319, 4597, 1668, 4597, 262, 288, 3639, 646, 3381, 18, 54...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 3874, 4457, 559, 12, 9856, 559, 3748, 921, 3150, 559, 774, 4666, 16, 9984, 1111, 16, 4766, 282, 3460, 646, 3381, 16, 4319, 4597, 1668, 4597, 262, 288, 3639, 646, 3381, 18, 54...
summarySection.setClient(summaryContainer);
summarySection.setClient(summaryContainer);
private void createSummarySection(Composite parent, FormToolkit toolkit) { Section summarySection = toolkit.createSection(parent, ExpandableComposite.TITLE_BAR); summarySection.setText("Mylar Task Planner"); summarySection.setLayout(new TableWrapLayout()); summarySection.setLayoutData(new TableWrapData(TableWrapData.FILL_GRAB)); Composite summaryContainer = toolkit.createComposite(summarySection); summarySection.setClient(summaryContainer); TableWrapLayout layout = new TableWrapLayout(); layout.numColumns = 1; summaryContainer.setLayout(layout); int length = editorInput.getCompletedTasks().size(); String numComplete = "Number of completed tasks: " + editorInput.getCompletedTasks().size(); Label label = toolkit.createLabel(summaryContainer, numComplete, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); String avgTime = "Average time spent per completed task: "; if (length > 0) { avgTime = avgTime + DateUtil.getFormattedDuration(editorInput.getTotalTimeSpentOnCompletedTasks() / editorInput.getCompletedTasks().size()); } else { avgTime = avgTime + 0; } label = toolkit.createLabel(summaryContainer, avgTime, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); String totalCompletedTaskTime = "Total time spent on completed tasks: " + DateUtil.getFormattedDuration(editorInput.getTotalTimeSpentOnCompletedTasks()); label = toolkit.createLabel(summaryContainer, totalCompletedTaskTime, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); String numInProgress = "Number of tasks in progress: " + editorInput.getInProgressTasks().size(); label = toolkit.createLabel(summaryContainer, numInProgress, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); String totalInProgressTaskTime = "Total time spent on tasks in progress: " + DateUtil.getFormattedDuration(editorInput.getTotalTimeSpentOnInProgressTasks()); label = toolkit.createLabel(summaryContainer, totalInProgressTaskTime, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); String grandTotalTime = "Total time spent on all tasks: " + DateUtil.getFormattedDuration(editorInput.getTotalTimeSpentOnCompletedTasks() + editorInput.getTotalTimeSpentOnInProgressTasks()); label = toolkit.createLabel(summaryContainer, grandTotalTime, SWT.NULL); label.setForeground(toolkit.getColors().getColor(FormColors.TITLE)); }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/92f83f5f3b5a64a9ecf81dc04a4195948196d480/MylarTaskPlannerEditorPart.java/buggy/org.eclipse.mylyn.tasks.ui/src/org/eclipse/mylyn/tasklist/planner/ui/MylarTaskPlannerEditorPart.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 752, 4733, 5285, 12, 9400, 982, 16, 2748, 6364, 8691, 5226, 8691, 13, 288, 202, 202, 5285, 4916, 5285, 273, 5226, 8691, 18, 2640, 5285, 12, 2938, 16, 16429, 429, 9400, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 752, 4733, 5285, 12, 9400, 982, 16, 2748, 6364, 8691, 5226, 8691, 13, 288, 202, 202, 5285, 4916, 5285, 273, 5226, 8691, 18, 2640, 5285, 12, 2938, 16, 16429, 429, 9400, 1...
public Headers parseHeaders(MIMEParsingInputStream stream, MIMESource streamSource, HeaderFieldFactory fieldFactory, MIMEPolicy policy) throws IOException, InvalidHeaderDataException, HeaderParseException { m_logger.debug("Begin Parsing Headers"); int startPos = (int) stream.position();//TODO: bscott Someday w/ big emails this cast will haunt me. List<HeaderField> headersInOrder = new ArrayList<HeaderField>(); Map<LCString, List<HeaderField>> headersByName = new HashMap<LCString, List<HeaderField>>(); //These members are reset each time we encounter //a new header List<Line> currentLines = null; int valueStartOffset = 0; String headerName = null; int linesRead = 0; try { while(true) { //Assume this is either a blank line, or the start of a header Line line = stream.readLine(policy.getMaxHeaderLineLen()); // m_logger.debug("(read line) \"" + bbToString(line.getBuffer()) + "\""); if(line == null) { break; } //Check for policy violation if(linesRead++ > policy.getMaxHeaderLines()) { //XXXX bscott I think this exception should be some "policy vioilation" // or "attack suspected" exception. throw new InvalidHeaderDataException("Number of header lines exceeded: \"" + policy.getMaxHeaderLines() + "\""); } //Get the byte buffer for this line. Check if it //is blank, starts with LWS, or is "normal". ByteBuffer bb = line.getBuffer(false); if(bb.remaining() == 0) { //Blank line. This terminates the set of headers. Note if there //was a trailing header, it is dealt with outside this loop. break; } if(isNextLWS(bb)) {//BEGIN Starts with LWS //Check boundary case where entire line is LWS if(isAllLWS(bb)) {//BEGIN All Blank Line if(policy.isLwsLineTerminatesHeaders()) { //OK. We'll treat this (bad) line as a terminator //for the header set m_logger.warn("Encountered a LWS line while parsing headers. " + "Treating as blank line as per policy (line " + linesRead + ")"); break; } else { //We either need to append to the previous //Line, or this was the first line in which case we //ignore it. if(currentLines == null) { m_logger.warn("Encountered a LWS line as first line in headers. Ignore " + "(line " + linesRead + ")"); } else { m_logger.warn("Encountered a LWS line in headers. Append " + "to previous header as-per policy (line " + linesRead + ")"); currentLines.add(line); } continue;//Redundant } }//ENDOF All Blank Line else {//BEGIN Not all Blank line eatWhitespace(bb, false); if(currentLines == null) {//BEGIN First Line not all LWS //Odd case. This nasty line is the first line of the headers. //By policy, we *may* consider this part of the //headers, or body. Note we break out granular cases below //for better logging. String badHeaderName = HeaderFieldFactory.readHeaderFieldName(bb); if(badHeaderName == null) { //We cannot consider this a header line, regardless of policy stream.unreadLine(line); m_logger.warn("Encountered a non-conformant header line as first line " + "of header set: \"" + bbToString(line.getBuffer(false)) + "\"" + ". Consider this start of the body (line " + linesRead + ")"); break; } else { if(policy.isIgnoreFoldedFirstLine()) { m_logger.warn("As per policy, starting Headers with ill-formed " + "first line: \"" + bbToString(line.getBuffer(false)) + "\" (line " + linesRead + ")"); currentLines = new ArrayList<Line>(); currentLines.add(line); valueStartOffset = bb.position(); headerName = badHeaderName; continue;//redundant } else { m_logger.warn("Encountered folded line as first line of headers " + "which may be a header line: \"" + bbToString(line.getBuffer(false)) + "\"" + ". Treat this as part of the body (line " + linesRead + ")"); stream.unreadLine(line); break; } } }//ENDOF First Line not all LWS else { //Append this fold to the current currentLines.add(line); continue;//redundant } }//ENDOF Not all Blank line }//ENDOF Starts with LWS else {//BEGIN Starts with non LWS //Complete previous header, if it exists if(currentLines != null) { HeaderField newField = fieldFactory.createHeaderField(headerName); newField.assignFromLines(new RawHeaderField( (Line[]) currentLines.toArray(new Line[currentLines.size()]), valueStartOffset), false); headersInOrder.add(newField); List<HeaderField> headerHolder = headersByName.get(newField.getNameLC()); if(headerHolder == null) { headerHolder = new ArrayList<HeaderField>(); headersByName.put(newField.getNameLC(), headerHolder); } headerHolder.add(newField); m_logger.debug("Added HeaderField with name \"" + newField.getName() + "\""); currentLines = null; } //Reead the header name headerName = HeaderFieldFactory.readHeaderFieldName(bb); if(headerName == null) { //Edge case. We either ignore this line alltogether, //or consider it the start of the body switch(policy.getNonHeaderLineInHeadersPolicy()) { case TREAT_AS_BODY: m_logger.warn("Encountered non-header line in headers: \"" + bbToString(line.getBuffer(false)) + "\". Treat as part " + "of body as-per policy (line " + linesRead + ")"); stream.unreadLine(line); break; case IGNORE: m_logger.warn("Encountered non-header line in headers: \"" + bbToString(line.getBuffer(false)) + "\". Ignore" + " as-per policy (line " + linesRead + ")"); break; case RAISE_EXCEPTION: //XXXX bscott I think this exception should be some "policy vioilation" // or "attack suspected" exception. throw new InvalidHeaderDataException("Invalid line: \"" + bbToString(line.getBuffer(false)) + " Encountered (line " + linesRead + ")"); } break; } else { //Start a new header currentLines = new ArrayList<Line>(); currentLines.add(line); valueStartOffset = bb.position(); } }//ENDOF Starts with non LWS } } catch(LineTooLongException ltl) { throw new InvalidHeaderDataException("Header line exceeds length \"" + policy.getMaxHeaderLineLen() + "\" set by policy (line " + linesRead + ")", ltl); } //Clean-up the remaing header if(currentLines != null) { HeaderField newField = fieldFactory.createHeaderField(headerName); newField.assignFromLines(new RawHeaderField( (Line[]) currentLines.toArray(new Line[currentLines.size()]), valueStartOffset), false); headersInOrder.add(newField); List<HeaderField> headerHolder = headersByName.get(newField.getNameLC()); if(headerHolder == null) { headerHolder = new ArrayList<HeaderField>(); headersByName.put(newField.getNameLC(), headerHolder); } headerHolder.add(newField); m_logger.debug("Added HeaderField with name \"" + newField.getName() + "\""); } return fieldFactory.createHeaders(streamSource, startPos, (int) (stream.position() - startPos), headersInOrder, headersByName); }
49954 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49954/c3bae82d6481acb858b7fffd40defbb0a35107b1/HeadersParser.java/clean/mvvm/main/com/metavize/tran/mime/HeadersParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 12158, 1109, 3121, 12, 18178, 13963, 4348, 1407, 16, 565, 13195, 1830, 1407, 1830, 16, 565, 4304, 974, 1733, 652, 1733, 16, 565, 13195, 2582, 3329, 13, 565, 1216, 1860, 16, 4202, 19...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 12158, 1109, 3121, 12, 18178, 13963, 4348, 1407, 16, 565, 13195, 1830, 1407, 1830, 16, 565, 4304, 974, 1733, 652, 1733, 16, 565, 13195, 2582, 3329, 13, 565, 1216, 1860, 16, 4202, 19...
currentSetOfMolecules.addMolecule(currentMolecule);
currentSetOfMolecules.addMolecule(currentMolecule);
public void endDocument() { currentSetOfMolecules.addMolecule(currentMolecule); currentChemModel.setSetOfMolecules(currentSetOfMolecules); currentChemSequence.addChemModel(currentChemModel); this.addChemSequence(currentChemSequence); if (debug) System.out.println("Molecule added"); };
1306 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1306/e04a2bbd6afdac34488441c1ce22ad5f73d254ff/ChemFileCDO.java/clean/org/openscience/cdk/io/ChemFileCDO.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 2519, 1435, 288, 202, 565, 783, 694, 951, 49, 29466, 18, 1289, 29669, 12, 2972, 29669, 1769, 202, 377, 202, 565, 783, 20200, 1488, 18, 542, 694, 951, 49, 29466, 12, 2972...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 2519, 1435, 288, 202, 565, 783, 694, 951, 49, 29466, 18, 1289, 29669, 12, 2972, 29669, 1769, 202, 377, 202, 565, 783, 20200, 1488, 18, 542, 694, 951, 49, 29466, 12, 2972...
cat2 = new TaskCategory("Second Category");
cat2 = new TaskCategory("Second Category", manager.getTaskList());
public void setUp() throws PartInitException { try { MylarTaskListPlugin.getDefault().getWorkbench().getActiveWorkbenchWindow().getActivePage().showView( "org.eclipse.mylar.tasks.ui.views.TaskListView"); TaskListManager manager = MylarTaskListPlugin.getTaskListManager(); cat1 = new TaskCategory("First Category"); cat1task1 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 1", true); cat1task1.setPriority(Task.PriorityLevel.P1.toString()); cat1task1.setCompleted(true); cat1task1.setCategory(cat1); manager.getTaskList().moveToCategory(cat1, cat1task1); cat1task1sub1 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "sub task 1", true); cat1task1sub1.setPriority(Task.PriorityLevel.P1.toString()); cat1task1sub1.setCompleted(true); cat1task1sub1.setParent(cat1task1); cat1task1.addSubTask(cat1task1sub1); cat1task2 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 2", true); cat1task2.setPriority(Task.PriorityLevel.P2.toString()); cat1task2.setCategory(cat1); manager.getTaskList().moveToCategory(cat1, cat1task2); cat1task3 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 3", true); cat1task3.setPriority(Task.PriorityLevel.P3.toString()); cat1task3.setCompleted(true); cat1task3.setCategory(cat1); manager.getTaskList().moveToCategory(cat1, cat1task3); cat1task4 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 4", true); cat1task4.setPriority(Task.PriorityLevel.P4.toString()); cat1task4.setCategory(cat1); manager.getTaskList().moveToCategory(cat1, cat1task4); cat1task5 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 5", true); cat1task5.setPriority(Task.PriorityLevel.P5.toString()); cat1task5.setCompleted(true); cat1task5.setCategory(cat1); manager.getTaskList().moveToCategory(cat1, cat1task5); manager.getTaskList().addCategory(cat1); assertEquals(cat1.getChildren().size(), 5); cat2 = new TaskCategory("Second Category"); cat2task1 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 1", true); cat2task1.setPriority(Task.PriorityLevel.P1.toString()); cat2task1.setCategory(cat2); manager.getTaskList().moveToCategory(cat2, cat2task1); cat2task1sub1 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "sub task 1", true); cat2task1sub1.setPriority(Task.PriorityLevel.P1.toString()); cat2task1sub1.setParent(cat2task1); cat2task1.addSubTask(cat2task1sub1); cat2task2 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 2", true); cat2task2.setPriority(Task.PriorityLevel.P2.toString()); cat2task2.setCompleted(true); cat2task2.setCategory(cat2); manager.getTaskList().moveToCategory(cat2, cat2task2); cat2task3 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 3", true); cat2task3.setPriority(Task.PriorityLevel.P3.toString()); cat2task3.setCategory(cat2); manager.getTaskList().moveToCategory(cat2, cat2task3); cat2task4 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 4", true); cat2task4.setPriority(Task.PriorityLevel.P4.toString()); cat2task4.setCompleted(true); cat2task4.setCategory(cat2); manager.getTaskList().moveToCategory(cat2, cat2task4); cat2task5 = new Task(MylarTaskListPlugin.getTaskListManager().genUniqueTaskHandle(), "task 5", true); cat2task5.setPriority(Task.PriorityLevel.P5.toString()); cat2task5.setCategory(cat2); manager.getTaskList().moveToCategory(cat2, cat2task5); manager.getTaskList().addCategory(cat2); manager.saveTaskList(); } catch (Exception e) { e.printStackTrace(); } }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/41f5ef9fe370f2cae870074ac5c17017be12a1fe/TaskListUiTest.java/clean/org.eclipse.mylyn.tasks.tests/src/org/eclipse/mylyn/tasklist/tests/TaskListUiTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 24292, 1435, 1216, 6393, 2570, 503, 288, 202, 202, 698, 288, 1082, 202, 12062, 7901, 2174, 682, 3773, 18, 588, 1868, 7675, 588, 2421, 22144, 7675, 588, 3896, 2421, 22144, 3...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 24292, 1435, 1216, 6393, 2570, 503, 288, 202, 202, 698, 288, 1082, 202, 12062, 7901, 2174, 682, 3773, 18, 588, 1868, 7675, 588, 2421, 22144, 7675, 588, 3896, 2421, 22144, 3...
else if(o.indexOf('.') > -1 && o.indexOf('E') == -1 && o.length() > 4)
else if((o.indexOf('.') > -1) && (o.indexOf('E') == -1) && (o.length() > 4))
public static String formatSize(long sz) { // First determine suffix String[] suffixes = {"B", "KiB","MiB","GiB","TiB","PiB","EiB","ZiB","YiB"}; long s = 1; int i; for(i=0;i<suffixes.length;i++) { s *= 1024; if(s > sz) { break; // Smaller than multiplier [i] - use the previous one } } s /= 1024; // we use the previous unit if (s == 1) // Bytes? Then we don't need real numbers with a comma { return sz + " " + suffixes[0]; } else { double mantissa = (double)sz / (double)s; String o = Double.toString(mantissa); if(o.indexOf('.') == 3) o = o.substring(0, 3); else if(o.indexOf('.') > -1 && o.indexOf('E') == -1 && o.length() > 4) o = o.substring(0, 4); o += " " + suffixes[i]; return o; } }
46035 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46035/ca136843ae9ecb30cadada58a33a5dc2cf8ad064/SizeUtil.java/clean/src/freenet/support/SizeUtil.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 514, 740, 1225, 12, 5748, 11262, 13, 288, 202, 202, 759, 5783, 4199, 3758, 9506, 202, 780, 8526, 18333, 273, 12528, 38, 3113, 315, 47, 17632, 15937, 49, 17632, 15937, 43, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 514, 740, 1225, 12, 5748, 11262, 13, 288, 202, 202, 759, 5783, 4199, 3758, 9506, 202, 780, 8526, 18333, 273, 12528, 38, 3113, 315, 47, 17632, 15937, 49, 17632, 15937, 43, ...
photoCollection = v; photoCollection.addPhotoCollectionChangeListener( this ); revalidate();
photoCollection = v; photoCollection.addPhotoCollectionChangeListener( this ); revalidate(); repaint();
public void setCollection(PhotoCollection v) { if ( photoCollection != null ) { photoCollection.removePhotoCollectionChangeListener( this ); } photoCollection = v; photoCollection.addPhotoCollectionChangeListener( this ); revalidate(); }
50360 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50360/72da1e8036ec42b409c89eb45568cb2d492e94f5/PhotoCollectionThumbView.java/buggy/src/photovault/swingui/PhotoCollectionThumbView.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 444, 2532, 12, 19934, 2532, 225, 331, 13, 288, 202, 565, 309, 261, 10701, 2532, 480, 446, 262, 288, 5411, 10701, 2532, 18, 4479, 19934, 2532, 15744, 12, 333, 11272, 202, 565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 444, 2532, 12, 19934, 2532, 225, 331, 13, 288, 202, 565, 309, 261, 10701, 2532, 480, 446, 262, 288, 5411, 10701, 2532, 18, 4479, 19934, 2532, 15744, 12, 333, 11272, 202, 565, ...
Object oldValue = getValue();
Object oldValue = computeValue();
public void setValue(Object value) { updating = true; try { Object oldValue = getValue(); Method writeMethod = propertyDescriptor.getWriteMethod(); if (!writeMethod.isAccessible()) { writeMethod.setAccessible(true); } writeMethod.invoke(object, new Object[] { value }); fireChangeEvent(ChangeEvent.CHANGE, oldValue, getValue()); } catch (Exception e) { e.printStackTrace(); } finally { updating = false; } }
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/0761e1ecd3419699cb01bfda9e914b2a545d7fac/JavaBeanUpdatableValue.java/clean/bundles/org.eclipse.jface.databinding/src/org/eclipse/jface/internal/databinding/beans/JavaBeanUpdatableValue.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 5524, 12, 921, 460, 13, 288, 202, 202, 5533, 1776, 273, 638, 31, 202, 202, 698, 288, 1082, 202, 921, 11144, 273, 2366, 5621, 1082, 202, 1305, 1045, 1305, 273, 1272, 3187,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 5524, 12, 921, 460, 13, 288, 202, 202, 5533, 1776, 273, 638, 31, 202, 202, 698, 288, 1082, 202, 921, 11144, 273, 2366, 5621, 1082, 202, 1305, 1045, 1305, 273, 1272, 3187,...
if (PROXY) { hostConf.setProxy(PROXY_HOST, PROXY_PORT);
if (useProxy) { hostConf.setProxy(proxyHost, proxyPort);
private static void configureClient() { // get a client isntance -- we just need one. client = new HttpClient(connectionManager); // Set up an HTTPS socket factory that accepts self-signed certs. Protocol dummyhttps = new Protocol("https", new DummySSLProtocolSocketFactory(), 443); Protocol.registerProtocol("https", dummyhttps); HttpConnectionManagerParams params = connectionManager.getParams(); params.setConnectionTimeout(TIMEOUT); params.setSoTimeout(TIMEOUT); params.setSendBufferSize(BUFFER_SIZE); params.setReceiveBufferSize(BUFFER_SIZE); params.setMaxTotalConnections(MAX_THREADS_TOTAL); if (MAX_THREADS_TOTAL > MAX_THREADS_PER_HOST) { params.setDefaultMaxConnectionsPerHost(MAX_THREADS_PER_HOST); } else { params.setDefaultMaxConnectionsPerHost(MAX_THREADS_TOTAL); } HostConfiguration hostConf = client.getHostConfiguration(); ArrayList headers = new ArrayList(); // prefer English headers.add(new Header("Accept-Language", "en-us,en-gb,en;q=0.7,*;q=0.3")); // prefer UTF-8 headers.add(new Header("Accept-Charset", "utf-8,ISO-8859-1;q=0.7,*;q=0.7")); // prefer understandable formats headers.add(new Header("Accept", "text/html,application/xml;q=0.9,application/xhtml+xml,text/xml;q=0.9,text/plain;q=0.8,image/png,*/*;q=0.5")); hostConf.getParams().setParameter("http.default-headers", headers); if (PROXY) { hostConf.setProxy(PROXY_HOST, PROXY_PORT); } if (NTLM_USERNAME.length() > 0) { Credentials ntCreds = new NTCredentials(NTLM_USERNAME, NTLM_PASSWORD, NTLM_HOST, NTLM_DOMAIN); client.getState().setCredentials(new AuthScope(NTLM_HOST, AuthScope.ANY_PORT), ntCreds); LOG.info("Added NTLM credentials for " + NTLM_USERNAME); } LOG.info("Configured Client"); }
50818 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50818/329ff64e9d7295aff108f85e9a8103f5e5f8f398/Http.java/buggy/src/plugin/protocol-httpclient/src/java/org/apache/nutch/protocol/httpclient/Http.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 760, 918, 5068, 1227, 1435, 288, 565, 368, 336, 279, 1004, 353, 496, 1359, 1493, 732, 2537, 1608, 1245, 18, 565, 1004, 273, 394, 16308, 12, 4071, 1318, 1769, 565, 368, 1000, 731, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 760, 918, 5068, 1227, 1435, 288, 565, 368, 336, 279, 1004, 353, 496, 1359, 1493, 732, 2537, 1608, 1245, 18, 565, 1004, 273, 394, 16308, 12, 4071, 1318, 1769, 565, 368, 1000, 731, ...
/* panel koji razdvaja imena signala i trenutne vrijednosti */ divider1.setPreferredSize(new Dimension(4, scale.getScaleEndPointInPixels())); divider1.setCursor(Cursor.getPredefinedCursor(Cursor.E_RESIZE_CURSOR)); divider1.setBackground(themeColor.getDivider()); divider1.addMouseMotionListener(firstDividerListener); /* panel koji razdvaja trenutne vrijednosti i valne oblike */ divider2.setPreferredSize(new Dimension(4, scale.getScaleEndPointInPixels())); divider2.setCursor(Cursor.getPredefinedCursor(Cursor.E_RESIZE_CURSOR)); divider2.setBackground(themeColor.getDivider()); divider2.addMouseMotionListener(secondDividerListener); /* svi scrollbarovi sadrzani u appletu */ horizontalScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, scale.getScaleEndPointInPixels()); horizontalScrollbar.addAdjustmentListener(horizontalScrollListener); verticalScrollbar = new JScrollBar(SwingConstants.VERTICAL, 0, 0, 0, waves.getPreferredSize().height); verticalScrollbar.addAdjustmentListener(verticalScrollListener); signalNamesScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, signalNames.getMaximumSize().width); signalNamesScrollbar.addAdjustmentListener(signalNamesScrollListener); signalValuesScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, signalValues.getMaximumSize().width); signalValuesScrollbar.addAdjustmentListener(signalValuesScrollListener); /* postavljanje komponenti na applet */ this.setFocusable(true); this.addKeyListener(keyListener); this.setLayout(new WaveLayoutManager()); this.setBackground(themeColor.getSignalNames()); this.add(toolbar, "toolbar"); this.add(cursorPanel, "cursorPanel"); this.add(search, "search"); this.add(interval, "interval"); this.add(signalNames, "signalNames"); this.add(divider1, "divider1"); this.add(divider2, "divider2"); this.add(signalValues, "signalValues"); this.add(waves, "waves"); this.add(scale, "scale"); this.add(verticalScrollbar, "verticalScrollbar"); this.add(horizontalScrollbar, "horizontalScrollbar"); this.add(signalNamesScrollbar, "signalNamesScrollbar"); this.add(signalValuesScrollbar, "valuesScrollbar");
public void setFileContent(FileContent content) { this.content = content; results.parseString(content.getContent()); scale.setContent(results); signalNames.setContent(results); waves.setContent(results, scale, scale.getDurationInPixels()[0], scale.getDurationInPixels()[0] + 100); signalValues.setContent(results); cursorPanel.setContent(scale.getScaleEndPointInPixels(), waves.getHorizontalOffset(), scale.getScaleStepInTime(), scale.getScaleStepInTime() * 2, scale.getDurationInPixels()[0], scale.getDurationInPixels()[0] + 100, scale.getMeasureUnitName()); helpPanel.setContent(waves.getShapes()); /* panel koji razdvaja imena signala i trenutne vrijednosti */ divider1.setPreferredSize(new Dimension(4, scale.getScaleEndPointInPixels())); divider1.setCursor(Cursor.getPredefinedCursor(Cursor.E_RESIZE_CURSOR)); divider1.setBackground(themeColor.getDivider()); divider1.addMouseMotionListener(firstDividerListener); /* panel koji razdvaja trenutne vrijednosti i valne oblike */ divider2.setPreferredSize(new Dimension(4, scale.getScaleEndPointInPixels())); divider2.setCursor(Cursor.getPredefinedCursor(Cursor.E_RESIZE_CURSOR)); divider2.setBackground(themeColor.getDivider()); divider2.addMouseMotionListener(secondDividerListener); /* svi scrollbarovi sadrzani u appletu */ horizontalScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, scale.getScaleEndPointInPixels()); horizontalScrollbar.addAdjustmentListener(horizontalScrollListener); verticalScrollbar = new JScrollBar(SwingConstants.VERTICAL, 0, 0, 0, waves.getPreferredSize().height); verticalScrollbar.addAdjustmentListener(verticalScrollListener); signalNamesScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, signalNames.getMaximumSize().width); signalNamesScrollbar.addAdjustmentListener(signalNamesScrollListener); signalValuesScrollbar = new JScrollBar(SwingConstants.HORIZONTAL, 0, 0, 0, signalValues.getMaximumSize().width); signalValuesScrollbar.addAdjustmentListener(signalValuesScrollListener); /* postavljanje komponenti na applet */ this.setFocusable(true); this.addKeyListener(keyListener); this.setLayout(new WaveLayoutManager()); this.setBackground(themeColor.getSignalNames()); this.add(toolbar, "toolbar"); //this.add(textField, "textField"); this.add(cursorPanel, "cursorPanel"); this.add(search, "search"); this.add(interval, "interval"); this.add(signalNames, "signalNames"); this.add(divider1, "divider1"); this.add(divider2, "divider2"); this.add(signalValues, "signalValues"); this.add(waves, "waves"); this.add(scale, "scale"); this.add(verticalScrollbar, "verticalScrollbar"); this.add(horizontalScrollbar, "horizontalScrollbar"); this.add(signalNamesScrollbar, "signalNamesScrollbar"); this.add(signalValuesScrollbar, "valuesScrollbar"); }
48076 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48076/bc23b41efb133ec280631d587aeb0f036378beb1/WaveApplet.java/buggy/src/web/onClient/hr/fer/zemris/vhdllab/applets/simulations/WaveApplet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19658, 1350, 12, 25391, 913, 13, 202, 95, 202, 202, 2211, 18, 1745, 273, 913, 31, 202, 202, 4717, 18, 2670, 780, 12, 1745, 18, 588, 1350, 10663, 202, 202, 5864, 18, 542...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19658, 1350, 12, 25391, 913, 13, 202, 95, 202, 202, 2211, 18, 1745, 273, 913, 31, 202, 202, 4717, 18, 2670, 780, 12, 1745, 18, 588, 1350, 10663, 202, 202, 5864, 18, 542...
yaccValue = "[]=";
yaccValue = new Token("[]=", getPosition(null, false));
private int yylex() { char c; boolean spaceSeen = false; boolean commandState; if (lex_strterm != null) { int tok = lex_strterm.parseString(this, src); if (tok == Tokens.tSTRING_END || tok == Tokens.tREGEXP_END) { lex_strterm = null; lex_state = LexState.EXPR_END; } return tok; } currentPos = src.getPosition(); commandState = commandStart; commandStart = false; retry: for(;;) { c = src.read(); switch(c) { case '\004': /* ^D */ case '\032': /* ^Z */ case 0: /* end of script. */ return 0; /* white spaces */ case ' ': case '\t': case '\f': case '\r': case '\13': /* '\v' */ spaceSeen = true; continue retry; case '#': /* it's a comment */ while ((c = src.read()) != '\n') { if (c == EOF) { return 0; } } /* fall through */ case '\n': // Replace a string of newlines with a single one while((c = src.read()) == '\n') { currentPos = src.getPosition(); } src.unread( c ); if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT || lex_state == LexState.EXPR_CLASS) { continue retry; } commandStart = true; lex_state = LexState.EXPR_BEG; return '\n'; case '*': if ((c = src.read()) == '*') { if ((c = src.read()) == '=') { yaccValue = "**"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } yaccValue = "**"; src.unread(c); c = Tokens.tPOW; } else { if (c == '=') { yaccValue = "*"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); if (lex_state.isArgument() && spaceSeen && !Character.isWhitespace(c)) { warnings.warning(src.getPosition(), "`*' interpreted as argument prefix"); c = Tokens.tSTAR; } else if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { c = Tokens.tSTAR; } else { c = Tokens.tSTAR2; } } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "*"; return c; case '!': lex_state = LexState.EXPR_BEG; if ((c = src.read()) == '=') { return Tokens.tNEQ; } if (c == '~') { return Tokens.tNMATCH; } src.unread(c); return Tokens.tBANG; case '=': // Skip documentation nodes if (src.wasBeginOfLine()) { /* skip embedded rd document */ if (isNextNoCase("begin")) { c = src.read(); if (Character.isWhitespace(c)) { // In case last next was the newline. src.unread(c); for (;;) { c = src.read(); // If a line is followed by a blank line put // it back. while (c == '\n') { c = src.read(); } if (c == EOF) { throw new SyntaxException(src.getPosition(), "embedded document meets end of file"); } if (c != '=') continue; if (src.wasBeginOfLine() && isNextNoCase("end")) { //if (src.peek('\n')) { // break; //} //c = src.read(); //if (Character.isWhitespace(c)) { src.readLine(); break; //} //src.unread(c); } } continue retry; } src.unread(c); } } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } c = src.read(); if (c == '=') { c = src.read(); if (c == '=') { yaccValue = "==="; return Tokens.tEQQ; } src.unread(c); yaccValue = "=="; return Tokens.tEQ; } if (c == '~') { yaccValue = "=~"; return Tokens.tMATCH; } else if (c == '>') { return Tokens.tASSOC; } src.unread(c); return '='; case '<': c = src.read(); if (c == '<' && lex_state != LexState.EXPR_END && lex_state != LexState.EXPR_DOT && lex_state != LexState.EXPR_ENDARG && lex_state != LexState.EXPR_CLASS && (!lex_state.isArgument() || spaceSeen)) { int tok = hereDocumentIdentifier(); if (tok != 0) return tok; } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } if (c == '=') { if ((c = src.read()) == '>') { yaccValue = "<=>"; return Tokens.tCMP; } yaccValue = "<="; src.unread(c); return Tokens.tLEQ; } if (c == '<') { yaccValue = "<<"; if ((c = src.read()) == '=') { lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); return Tokens.tLSHFT; } yaccValue = "<"; src.unread(c); return Tokens.tLT; case '>': if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } if ((c = src.read()) == '=') { yaccValue = ">="; return Tokens.tGEQ; } if (c == '>') { yaccValue = ">>"; if ((c = src.read()) == '=') { lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); return Tokens.tRSHFT; } yaccValue = ">"; src.unread(c); return Tokens.tGT; case '"': lex_strterm = new StringTerm(str_dquote, '"', '\0'); return Tokens.tSTRING_BEG; case '`': yaccValue = "`"; if (lex_state == LexState.EXPR_FNAME) { lex_state = LexState.EXPR_END; return Tokens.tBACK_REF2; } if (lex_state == LexState.EXPR_DOT) { if (commandState) { lex_state = LexState.EXPR_CMDARG; } else { lex_state = LexState.EXPR_ARG; } return Tokens.tBACK_REF2; } lex_strterm = new StringTerm(str_xquote, '`', '\0'); return Tokens.tXSTRING_BEG; case '\'': lex_strterm = new StringTerm(str_squote, '\'', '\0'); return Tokens.tSTRING_BEG; case '?': if (lex_state == LexState.EXPR_END || lex_state == LexState.EXPR_ENDARG) { lex_state = LexState.EXPR_BEG; return '?'; } c = src.read(); if (c == EOF) { throw new SyntaxException(src.getPosition(), "incomplete character syntax"); } if (Character.isWhitespace(c)){ if (!lex_state.isArgument()){ int c2 = 0; switch (c) { case ' ': c2 = 's'; break; case '\n': c2 = 'n'; break; case '\t': c2 = 't'; break; /* What is \v in C? case '\v': c2 = 'v'; break; */ case '\r': c2 = 'r'; break; case '\f': c2 = 'f'; break; } if (c2 != 0) { warnings.warn(src.getPosition(), "invalid character syntax; use ?\\" + c2); } } src.unread(c); lex_state = LexState.EXPR_BEG; return '?'; /*} else if (ismbchar(c)) { // ruby - we don't support them either? rb_warn("multibyte character literal not supported yet; use ?\\" + c); support.unread(c); lexState = LexState.EXPR_BEG; return '?';*/ } else if ((Character.isLetterOrDigit(c) || c == '_') && !src.peek('\n') && isNext_identchar()) { src.unread(c); lex_state = LexState.EXPR_BEG; return '?'; } else if (c == '\\') { c = src.readEscape(); } c &= 0xff; lex_state = LexState.EXPR_END; yaccValue = new Long(c); return Tokens.tINTEGER; case '&': if ((c = src.read()) == '&') { lex_state = LexState.EXPR_BEG; if ((c = src.read()) == '=') { yaccValue = "&&"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); return Tokens.tANDOP; } else if (c == '=') { yaccValue = "&"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); if (lex_state.isArgument() && spaceSeen && !Character.isWhitespace(c)){ warnings.warning(src.getPosition(), "`&' interpreted as argument prefix"); c = Tokens.tAMPER; } else if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { c = Tokens.tAMPER; } else { c = Tokens.tAMPER2; } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "&"; return c; case '|': if ((c = src.read()) == '|') { lex_state = LexState.EXPR_BEG; if ((c = src.read()) == '=') { yaccValue = "||"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); return Tokens.tOROP; } if (c == '=') { yaccValue = "|"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "|"; src.unread(c); return Tokens.tPIPE; case '+': c = src.read(); if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; if (c == '@') { yaccValue = "@+"; return Tokens.tUPLUS; } yaccValue = "+"; src.unread(c); return Tokens.tPLUS; } if (c == '=') { yaccValue = "+"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID || (lex_state.isArgument() && spaceSeen && !Character.isWhitespace(c))) { if (lex_state.isArgument()) arg_ambiguous(); lex_state = LexState.EXPR_BEG; src.unread(c); if (Character.isDigit(c)) { c = '+'; return parseNumber(c); } return Tokens.tUPLUS; } lex_state = LexState.EXPR_BEG; src.unread(c); return Tokens.tPLUS; case '-': c = src.read(); if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; if (c == '@') { yaccValue = "@-"; return Tokens.tUMINUS; } yaccValue = "-"; src.unread(c); return Tokens.tMINUS; } if (c == '=') { yaccValue = "-"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID || (lex_state.isArgument() && spaceSeen && !Character.isWhitespace(c))) { if (lex_state.isArgument()) arg_ambiguous(); lex_state = LexState.EXPR_BEG; src.unread(c); if (Character.isDigit(c)) { return Tokens.tUMINUS_NUM; } return Tokens.tUMINUS; } lex_state = LexState.EXPR_BEG; src.unread(c); return Tokens.tMINUS; case '.': lex_state = LexState.EXPR_BEG; if ((c = src.read()) == '.') { if ((c = src.read()) == '.') { return Tokens.tDOT3; } src.unread(c); return Tokens.tDOT2; } src.unread(c); if (Character.isDigit(c)) { throw new SyntaxException(src.getPosition(), "no .<digit> floating literal anymore; put 0 before dot"); } lex_state = LexState.EXPR_DOT; return Tokens.tDOT; case '0' : case '1' : case '2' : case '3' : case '4' : case '5' : case '6' : case '7' : case '8' : case '9' : return parseNumber(c); case ']': case '}': case ')': conditionState.restart(); cmdArgumentState.restart(); lex_state = LexState.EXPR_END; return c; case ':': c = src.read(); if (c == ':') { if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID || lex_state == LexState.EXPR_CLASS || (lex_state.isArgument() && spaceSeen)) { lex_state = LexState.EXPR_BEG; return Tokens.tCOLON3; } lex_state = LexState.EXPR_DOT; return Tokens.tCOLON2; } if (lex_state == LexState.EXPR_END || lex_state == LexState.EXPR_ENDARG || Character.isWhitespace(c)) { src.unread(c); lex_state = LexState.EXPR_BEG; return ':'; } switch (c) { case '\'': lex_strterm = new StringTerm(str_ssym, c, '\0'); break; case '"': lex_strterm = new StringTerm(str_dsym, c, '\0'); break; default: src.unread(c); break; } lex_state = LexState.EXPR_FNAME; return Tokens.tSYMBEG; case '/': if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { lex_strterm = new StringTerm(str_regexp, '/', '\0'); return Tokens.tREGEXP_BEG; } if ((c = src.read()) == '=') { yaccValue = "/"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } src.unread(c); if (lex_state.isArgument() && spaceSeen) { if (!Character.isWhitespace(c)) { arg_ambiguous(); lex_strterm = new StringTerm(str_regexp, '/', '\0'); return Tokens.tREGEXP_BEG; } } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "/"; return Tokens.tDIVIDE; case '^': yaccValue = "^"; if ((c = src.read()) == '=') { lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } src.unread(c); return Tokens.tCARET; case ';': commandStart = true; case ',': lex_state = LexState.EXPR_BEG; return c; case '~': if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { if ((c = src.read()) != '@') { src.unread(c); } } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "~"; return Tokens.tTILDE; case '(': c = Tokens.tLPAREN2; commandStart = true; if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { c = Tokens.tLPAREN; } else if (spaceSeen) { if (lex_state == LexState.EXPR_CMDARG) { c = Tokens.tLPAREN_ARG; } else if (lex_state == LexState.EXPR_ARG) { warnings.warn(src.getPosition(), "don't put space before argument parentheses"); c = Tokens.tLPAREN2; } } conditionState.stop(); cmdArgumentState.stop(); lex_state = LexState.EXPR_BEG; return c; case '[': if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; if ((c = src.read()) == ']') { if ((c = src.read()) == '=') { yaccValue = "[]="; return Tokens.tASET; } yaccValue = "[]"; src.unread(c); return Tokens.tAREF; } src.unread(c); return '['; } else if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { c = Tokens.tLBRACK; } else if (lex_state.isArgument() && spaceSeen) { c = Tokens.tLBRACK; } lex_state = LexState.EXPR_BEG; conditionState.stop(); cmdArgumentState.stop(); return c; case '{': c = Tokens.tLCURLY; if (lex_state.isArgument() || lex_state == LexState.EXPR_END) { c = Tokens.tLCURLY; /* block (primary) */ } else if (lex_state == LexState.EXPR_ENDARG) { c = Tokens.tLBRACE_ARG; /* block (expr) */ } else { c = Tokens.tLBRACE; /* hash */ } conditionState.stop(); cmdArgumentState.stop(); lex_state = LexState.EXPR_BEG; return c; case '\\': c = src.read(); if (c == '\n') { spaceSeen = true; continue retry; /* skip \\n */ } src.unread(c); return '\\'; case '%': if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID) { return parseQuote(src.read()); } if ((c = src.read()) == '=') { yaccValue = "%"; lex_state = LexState.EXPR_BEG; return Tokens.tOP_ASGN; } if (lex_state.isArgument() && spaceSeen && !Character.isWhitespace(c)) { return parseQuote(c); } if (lex_state == LexState.EXPR_FNAME || lex_state == LexState.EXPR_DOT) { lex_state = LexState.EXPR_ARG; } else { lex_state = LexState.EXPR_BEG; } yaccValue = "%"; src.unread(c); return Tokens.tPERCENT; case '$': lex_state = LexState.EXPR_END; tokenBuffer.setLength(0); c = src.read(); switch (c) { case '_': /* $_: last read line string */ c = src.read(); if (isIdentifierChar(c)) { tokenBuffer.append('$'); tokenBuffer.append('_'); break; } src.unread(c); c = '_'; /* fall through */ case '*': /* $*: argv */ case '$': /* $$: pid */ case '?': /* $?: last status */ case '!': /* $!: error string */ case '@': /* $@: error position */ case '/': /* $/: input record separator */ case '\\': /* $\: output record separator */ case ';': /* $;: field separator */ case ',': /* $,: output field separator */ case '.': /* $.: last read line number */ case '=': /* $=: ignorecase */ case ':': /* $:: load path */ case '<': /* $<: reading filename */ case '>': /* $>: default output handle */ case '\"': /* $": already loaded files */ tokenBuffer.append('$'); tokenBuffer.append(c); yaccValue = tokenBuffer.toString(); return Tokens.tGVAR; case '-': tokenBuffer.append('$'); tokenBuffer.append(c); c = src.read(); tokenBuffer.append(c); yaccValue = tokenBuffer.toString(); /* xxx shouldn't check if valid option variable */ return Tokens.tGVAR; case '~': /* $~: match-data */ case '&': /* $&: last match */ case '`': /* $`: string before last match */ case '\'': /* $': string after last match */ case '+': /* $+: string matches last paren. */ yaccValue = new BackRefNode(src.getPosition(), c); return Tokens.tBACK_REF; case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': tokenBuffer.append('$'); do { tokenBuffer.append(c); c = src.read(); } while (Character.isDigit(c)); src.unread(c); yaccValue = new NthRefNode(src.getPosition(), Integer.parseInt(tokenBuffer.substring(1))); return Tokens.tNTH_REF; default: if (!isIdentifierChar(c)) { src.unread(c); return '$'; } case '0': tokenBuffer.append('$'); } break; case '@': c = src.read(); tokenBuffer.setLength(0); tokenBuffer.append('@'); if (c == '@') { tokenBuffer.append('@'); c = src.read(); } if (Character.isDigit(c)) { if (tokenBuffer.length() == 1) { throw new SyntaxException(src.getPosition(), "`@" + c + "' is not allowed as an instance variable name"); } throw new SyntaxException(src.getPosition(), "`@@" + c + "' is not allowed as a class variable name"); } if (!isIdentifierChar(c)) { src.unread(c); return '@'; } break; case '_': if (src.wasBeginOfLine() && src.matchString("_END__\n", false)) { parserSupport.getResult().setEndSeen(true); return 0; } tokenBuffer.setLength(0); break; default: if (!isIdentifierChar(c)) { throw new SyntaxException(src.getPosition(), "Invalid char `\\" + new PrintfFormat("%.3o").sprintf(c) + "' in expression"); } tokenBuffer.setLength(0); break; } do { tokenBuffer.append(c); /* no special multibyte character handling is needed in Java * if (ismbchar(c)) { int i, len = mbclen(c)-1; for (i = 0; i < len; i++) { c = src.read(); tokenBuffer.append(c); } }*/ c = src.read(); } while (isIdentifierChar(c)); char peek = src.read(); if ((c == '!' || c == '?') && isIdentifierChar(tokenBuffer.charAt(0)) && peek != '=') { src.unread(peek); tokenBuffer.append(c); } else { src.unread(peek); src.unread(c); } int result = 0; switch (tokenBuffer.charAt(0)) { case '$': lex_state = LexState.EXPR_END; result = Tokens.tGVAR; break; case '@': lex_state = LexState.EXPR_END; if (tokenBuffer.charAt(1) == '@') { result = Tokens.tCVAR; } else { result = Tokens.tIVAR; } break; default: char last = tokenBuffer.charAt(tokenBuffer.length() - 1); if (last == '!' || last == '?') { result = Tokens.tFID; } else { if (lex_state == LexState.EXPR_FNAME) { /* // Enebo: This should be equivalent to below without // so much read/unread action. if ((c = src.read()) == '=') { char c2 = src.read(); if (c2 != '~' && c2 != '>' && (c2 != '=' || (c2 == '\n' && src.peek('>')))) { result = Token.tIDENTIFIER; tokenBuffer.append(c); } else { src.unread(c2); src.unread(c); } } else { src.unread(c); } */ if ((c = src.read()) == '=' && !src.peek('~') && !src.peek('>') && (!src.peek('=') || (src.peek('\n') && src.getCharAt(1) == '>'))) { result = Tokens.tIDENTIFIER; tokenBuffer.append(c); } else { src.unread(c); } } if (result == 0 && ISUPPER(tokenBuffer.charAt(0))) { result = Tokens.tCONSTANT; } else { result = Tokens.tIDENTIFIER; } } if (lex_state != LexState.EXPR_DOT) { /* See if it is a reserved word. */ Keyword keyword = Keyword.getKeyword(tokenBuffer.toString(), tokenBuffer.length()); if (keyword != null) { // enum lex_state LexState state = lex_state; lex_state = keyword.state; if (state.isExprFName()) { yaccValue = keyword.name; } if (keyword.id0 == Tokens.kDO) { if (conditionState.isInState()) { return Tokens.kDO_COND; } if (cmdArgumentState.isInState() && state != LexState.EXPR_CMDARG) { return Tokens.kDO_BLOCK; } if (state == LexState.EXPR_ENDARG) { return Tokens.kDO_BLOCK; } return Tokens.kDO; } if (state == LexState.EXPR_BEG) { return keyword.id0; } if (keyword.id0 != keyword.id1) { lex_state = LexState.EXPR_BEG; } return keyword.id1; } } if (lex_state == LexState.EXPR_BEG || lex_state == LexState.EXPR_MID || lex_state == LexState.EXPR_DOT || lex_state == LexState.EXPR_ARG || lex_state == LexState.EXPR_CMDARG) { if (commandState) { lex_state = LexState.EXPR_CMDARG; } else { lex_state = LexState.EXPR_ARG; } } else { lex_state = LexState.EXPR_END; } } yaccValue = tokenBuffer.toString(); // Lame: parsing logic made it into lexer in ruby...So we // are emulating if (IdUtil.isLocal((String)yaccValue) && ((((LocalNamesElement) parserSupport.getLocalNames().peek()).isInBlock() && ((BlockNamesElement) parserSupport.getBlockNames().peek()).isDefined((String) yaccValue)) || ((LocalNamesElement) parserSupport.getLocalNames().peek()).isLocalRegistered((String) yaccValue))) { lex_state = LexState.EXPR_END; } return result; } }
46454 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46454/b1293eda8454686e846e2a9837b348e2983bb423/RubyYaccLexer.java/buggy/src/org/jruby/lexer/yacc/RubyYaccLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 509, 677, 1362, 92, 1435, 288, 3639, 1149, 276, 31, 3639, 1250, 3476, 15160, 273, 629, 31, 3639, 1250, 1296, 1119, 31, 7734, 309, 261, 4149, 67, 701, 6408, 480, 446, 13, 288, 1082...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 509, 677, 1362, 92, 1435, 288, 3639, 1149, 276, 31, 3639, 1250, 3476, 15160, 273, 629, 31, 3639, 1250, 1296, 1119, 31, 7734, 309, 261, 4149, 67, 701, 6408, 480, 446, 13, 288, 1082...
public GraphicsNode nodeHitAt(Point2D p, GraphicsNodeRenderContext rc) { Rectangle2D bounds = getBounds(rc); if (count > 0 && bounds != null && bounds.contains(p)) { // // Go backward because the children are in rendering order // Point2D pt = null; Point2D cp = null; // Propagated to children for (int i=count-1; i >= 0; --i) { AffineTransform t = children[i].getInverseTransform(); if(t != null){ pt = t.transform(p, pt); cp = pt; } else{ cp = p; } GraphicsNode node = children[i].nodeHitAt(cp, rc); if (node != null) { return node; } } } return null; }
45946 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45946/32fa5d6f134dbc7519ade5bde79d3c0386deef5e/CompositeGraphicsNode.java/buggy/sources/org/apache/batik/gvt/CompositeGraphicsNode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 17558, 50, 369, 20680, 13616, 861, 12, 2148, 22, 40, 84, 16, 17558, 907, 3420, 660, 14523, 71, 15329, 19463, 22, 40, 10576, 33, 588, 5694, 12, 1310, 1769, 430, 12, 1883, 34, 20, 10, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 17558, 50, 369, 20680, 13616, 861, 12, 2148, 22, 40, 84, 16, 17558, 907, 3420, 660, 14523, 71, 15329, 19463, 22, 40, 10576, 33, 588, 5694, 12, 1310, 1769, 430, 12, 1883, 34, 20, 10, ...
Logger.error(this, "Could not parse extra peer data: "+e2+"\n"+fs.toString(),e2);
Logger.error(this, "Could not parse extra peer data: "+e2+ '\n' +fs.toString(),e2);
public boolean readExtraPeerDataFile(File extraPeerDataFile, int fileNumber) { boolean gotError = false; if(!extraPeerDataFile.exists()) { return false; } Logger.normal(this, "extraPeerDataFile: "+extraPeerDataFile.getPath()); FileInputStream fis; try { fis = new FileInputStream(extraPeerDataFile); } catch (FileNotFoundException e1) { Logger.normal(this, "Extra peer data file not found: "+extraPeerDataFile.getPath()); return false; } InputStreamReader isr = new InputStreamReader(fis); BufferedReader br = new BufferedReader(isr); try { // Read in the single SimpleFieldSet SimpleFieldSet fs; fs = new SimpleFieldSet(br); boolean parseResult = false; try { parseResult = parseExtraPeerData(fs, extraPeerDataFile, fileNumber); if(!parseResult) { gotError = true; } } catch (FSParseException e2) { Logger.error(this, "Could not parse extra peer data: "+e2+"\n"+fs.toString(),e2); gotError = true; } } catch (EOFException e3) { // End of file, fine } catch (IOException e4) { Logger.error(this, "Could not read extra peer data file: "+e4, e4); } finally { try { br.close(); } catch (IOException e5) { Logger.error(this, "Ignoring "+e5+" caught reading "+extraPeerDataFile.getPath(), e5); } } return !gotError; }
45341 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45341/62fd59041864b4ed1f43adc676de6bfb5ea977f3/PeerNode.java/buggy/src/freenet/node/PeerNode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 855, 7800, 6813, 751, 812, 12, 812, 2870, 6813, 751, 812, 16, 509, 585, 1854, 13, 288, 202, 202, 6494, 2363, 668, 273, 629, 31, 202, 225, 202, 430, 12, 5, 7763, 6813, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1250, 855, 7800, 6813, 751, 812, 12, 812, 2870, 6813, 751, 812, 16, 509, 585, 1854, 13, 288, 202, 202, 6494, 2363, 668, 273, 629, 31, 202, 225, 202, 430, 12, 5, 7763, 6813, ...
assert transcriptLine.matches(".* \\(" + utteranceFilename + "\\)$") : "File name in transcript and control file have to match";
assert transcriptLine.matches(".*[ \t]\\(" + utteranceFilename + "\\)$") : "File name in transcript \"" + transcriptLine + "\" and control file \"" + utteranceFilename + "\" have to match.";
public Utterance nextUtterance() { String utteranceLine = (String) audioFileIterator.next(); Utterance utterance = new SimpleUtterance(utteranceLine); String utteranceFilename = utteranceLine.replaceFirst("^.*/", "").replaceFirst("\\..*$", ""); String transcriptLine = (String) transcriptFileIterator.next(); // Finds out if the audio file name is part of the transcript line assert transcriptLine.matches(".* \\(" + utteranceFilename + "\\)$") : "File name in transcript and control file have to match"; // Removes the filename from the transcript line. // The transcript line is of the form: // She washed her dark suit (st002) String transcript = transcriptLine.replaceFirst(" \\(.*\\)$", ""); utterance.add(transcript, dictionary, false, wordSeparator); return utterance; }
8350 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8350/c4669b8bf06f74898353733b4ae67e7008ffcdb2/SimpleControlFile.java/clean/edu/cmu/sphinx/trainer/SimpleControlFile.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 587, 88, 387, 1359, 1024, 57, 88, 387, 1359, 1435, 288, 202, 780, 31297, 1670, 273, 261, 780, 13, 7447, 812, 3198, 18, 4285, 5621, 202, 57, 88, 387, 1359, 31297, 273, 394, 4477, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 587, 88, 387, 1359, 1024, 57, 88, 387, 1359, 1435, 288, 202, 780, 31297, 1670, 273, 261, 780, 13, 7447, 812, 3198, 18, 4285, 5621, 202, 57, 88, 387, 1359, 31297, 273, 394, 4477, ...
XmlDocument document = getElement().getDocument(); if (document != null && document.getRootTag() != null) { Collection<StructureViewTreeElement> rootTags = new ArrayList<StructureViewTreeElement>();
final Collection<StructureViewTreeElement> rootTags = new ArrayList<StructureViewTreeElement>(); final XmlDocument document = getElement().getDocument(); if (document != null)
public Collection<StructureViewTreeElement> getChildrenBase() { XmlDocument document = getElement().getDocument(); if (document != null && document.getRootTag() != null) { Collection<StructureViewTreeElement> rootTags = new ArrayList<StructureViewTreeElement>(); for (PsiElement element : document.getChildren()) if (element instanceof XmlTag) rootTags.add(new XmlTagTreeElement((XmlTag)element)); return rootTags; } return Collections.EMPTY_LIST; }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/94f86051d97f2215e70fee24654a2aba30754bb6/XmlFileTreeElement.java/buggy/source/com/intellij/ide/structureView/impl/xml/XmlFileTreeElement.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2200, 32, 6999, 1767, 2471, 1046, 34, 10268, 2171, 1435, 288, 565, 5714, 2519, 1668, 273, 7426, 7675, 588, 2519, 5621, 565, 309, 261, 5457, 480, 446, 597, 1668, 18, 588, 2375, 1805,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 2200, 32, 6999, 1767, 2471, 1046, 34, 10268, 2171, 1435, 288, 565, 5714, 2519, 1668, 273, 7426, 7675, 588, 2519, 5621, 565, 309, 261, 5457, 480, 446, 597, 1668, 18, 588, 2375, 1805,...
protected void fireContentsChanged(Object source, int startIndex, int endIndex)
protected void fireContentsChanged(Object source, int startIndex, int endIndex)
protected void fireContentsChanged(Object source, int startIndex, int endIndex) { // Variables ListDataEvent event; ListDataListener[] listeners; ListDataListener listener; int index; // Create Event event = new ListDataEvent(source, ListDataEvent.CONTENTS_CHANGED, startIndex, endIndex); // Get Listeners listeners = getListDataListeners (); // Process Listeners for (index = 0; index < listeners.length; index++) { listener = (ListDataListener) listeners[index]; listener.contentsChanged(event); } }
1056 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1056/0788b89b7368770a1157f825d60dd8c5a9df183e/AbstractListModel.java/clean/core/src/classpath/javax/javax/swing/AbstractListModel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 918, 4452, 6323, 5033, 12, 921, 1084, 16, 509, 10588, 16, 509, 13818, 13, 225, 288, 565, 368, 23536, 565, 987, 751, 1133, 871, 31, 565, 987, 751, 2223, 8526, 4679, 31, 565, 987, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 918, 4452, 6323, 5033, 12, 921, 1084, 16, 509, 10588, 16, 509, 13818, 13, 225, 288, 565, 368, 23536, 565, 987, 751, 1133, 871, 31, 565, 987, 751, 2223, 8526, 4679, 31, 565, 987, ...
match(input,INT,FOLLOW_INT_in_salience893); if (failed) return d; pushFollow(FOLLOW_opt_semicolon_in_salience895);
match(input,INT,FOLLOW_INT_in_salience892); if (failed) return d; pushFollow(FOLLOW_opt_semicolon_in_salience894);
public AttributeDescr salience() throws RecognitionException { AttributeDescr d = null; Token loc=null; Token i=null; d = null; try { // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:530:3: (loc= 'salience' i= INT opt_semicolon ) // D:\\workspace\\jboss\\jbossrules\\drools-compiler\\src\\main\\resources\\org\\drools\\lang\\DRL.g:530:3: loc= 'salience' i= INT opt_semicolon { loc=(Token)input.LT(1); match(input,41,FOLLOW_41_in_salience889); if (failed) return d; i=(Token)input.LT(1); match(input,INT,FOLLOW_INT_in_salience893); if (failed) return d; pushFollow(FOLLOW_opt_semicolon_in_salience895); opt_semicolon(); _fsp--; if (failed) return d; if ( backtracking==0 ) { d = new AttributeDescr( "salience", i.getText() ); d.setLocation( offset(loc.getLine()), loc.getCharPositionInLine() ); } } } catch (RecognitionException re) { reportError(re); recover(input,re); } finally { } return d; }
5490 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5490/63bc7036e62ae854cec463d59712c173f74e984c/DRLParser.java/clean/drools-compiler/src/main/java/org/drools/lang/DRLParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3601, 16198, 12814, 6254, 1435, 1216, 9539, 288, 6647, 3601, 16198, 302, 273, 446, 31, 3639, 3155, 1515, 33, 2011, 31, 3639, 3155, 277, 33, 2011, 31, 1171, 202, 202, 72, 273, 446, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3601, 16198, 12814, 6254, 1435, 1216, 9539, 288, 6647, 3601, 16198, 302, 273, 446, 31, 3639, 3155, 1515, 33, 2011, 31, 3639, 3155, 277, 33, 2011, 31, 1171, 202, 202, 72, 273, 446, ...
throws Throwable
public Value evalNew(Env env, Expr []args) throws Throwable { Value object = _classDef.evalNew(env, args); if (object != null) return object; object = newInstance(env); AbstractFunction fun = findConstructor(); if (fun != null) { fun.evalMethod(env, object, args); } return object; }
3863 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3863/87fa828f676c349c54c585677eb7eeab11f5627f/QuercusClass.java/buggy/quercus/src/main/java/com/caucho/quercus/env/QuercusClass.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 1445, 5302, 1908, 12, 3491, 1550, 16, 8074, 5378, 1968, 13, 377, 288, 565, 1445, 733, 273, 389, 1106, 3262, 18, 8622, 1908, 12, 3074, 16, 833, 1769, 565, 309, 261, 1612, 480, 446,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 1445, 5302, 1908, 12, 3491, 1550, 16, 8074, 5378, 1968, 13, 377, 288, 565, 1445, 733, 273, 389, 1106, 3262, 18, 8622, 1908, 12, 3074, 16, 833, 1769, 565, 309, 261, 1612, 480, 446,...
Log.debug("Start.startupDialog() loadFilename is " + loadFilename);
static void startupDialog(Game game, CommandLine cl) { net.sf.colossus.util.Options options = game.getOptions(); options.loadOptions();Log.debug("load:" + options.toString()); clearNonPersistentOptions(options);Log.debug("clear: " + options.toString()); new GetPlayers(new JFrame(), options); String loadFilename = options.getStringOption(Constants.loadGame);Log.debug("after dialog: " + options.toString()); if (options.isEmpty()) {Log.debug("Start.startupDialog() options.isEmpty()"); // Bad input, or user selected Quit. game.dispose(); } // See if user hit the Load game button, and we should // load a game instead of starting a new one. else if (loadFilename != null && loadFilename.length() > 0) {Log.debug("Start.startupDialog() loadFilename is " + loadFilename); options.clearPlayerInfo(); game.loadGame(loadFilename); } // See if user hit the Run client button, and we should abort // the server and run the client. else if (options.getOption(Constants.runClient)) {Log.debug("Start.startupDialog() runClient"); startClient(cl); } else {Log.debug("Start.startupDialog() newGame"); game.newGame(); } }
51862 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51862/a1c4e54c64e730ea97fb3d86facc70b7990a6ceb/Start.java/buggy/Colossus/net/sf/colossus/server/Start.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 918, 11850, 6353, 12, 12496, 7920, 16, 15893, 927, 13, 565, 288, 3639, 2901, 18, 21668, 18, 1293, 8464, 407, 18, 1367, 18, 1320, 702, 273, 7920, 18, 588, 1320, 5621, 3639, 702, 18,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 918, 11850, 6353, 12, 12496, 7920, 16, 15893, 927, 13, 565, 288, 3639, 2901, 18, 21668, 18, 1293, 8464, 407, 18, 1367, 18, 1320, 702, 273, 7920, 18, 588, 1320, 5621, 3639, 702, 18,...
return cancelFunctionName() + "()"; }
return cancelFunctionName() + "()"; }
public String cancelFunctionCall() { return cancelFunctionName() + "()"; }
22541 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/22541/18cd1e043ec46b2050d90832a89d9f0a7a16da82/AjaxInPlace.java/buggy/Ajax/Ajax/Sources/er/ajax/AjaxInPlace.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 3755, 2083, 1477, 1435, 288, 202, 225, 327, 3755, 25258, 1435, 397, 315, 10031, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 3755, 2083, 1477, 1435, 288, 202, 225, 327, 3755, 25258, 1435, 397, 315, 10031, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -...
new ResourceValueAnalysis<Resource>(methodGen, resourceTracker, resource);
new ResourceValueAnalysis<Resource>(methodGen, resourceTracker, resource, bugReporter);
public void visitClassContext(ClassContext classContext) { try { final JavaClass jclass = classContext.getJavaClass(); Method[] methodList = jclass.getMethods(); for (int i = 0; i < methodList.length; ++i) { Method method = methodList[i]; if (method.isAbstract() || method.isNative()) continue; if (!prescreen(classContext, method)) continue; final ResourceTracker<Resource> resourceTracker = getResourceTracker(classContext, method); final MethodGen methodGen = classContext.getMethodGen(method); if (methodGen == null) continue; final CFG cfg = classContext.getCFG(method); new LocationScanner(cfg).scan(new LocationScanner.Callback() { public void visitLocation(Location location) { BasicBlock basicBlock = location.getBasicBlock(); InstructionHandle handle = location.getHandle(); Resource resource = resourceTracker.isResourceCreation(basicBlock, handle, methodGen.getConstantPool()); if (resource != null) { ResourceValueAnalysis<Resource> analysis = new ResourceValueAnalysis<Resource>(methodGen, resourceTracker, resource); Dataflow<ResourceValueFrame> dataflow = new Dataflow<ResourceValueFrame>(cfg, analysis); try { dataflow.execute(); inspectResult(jclass, methodGen, cfg, dataflow, resource); } catch (DataflowAnalysisException e) { throw new AnalysisException("FindOpenResource caught exception: " + e.toString(), e); } } } }); } } catch (CFGBuilderException e) { throw new AnalysisException(e.toString(), e); } catch (DataflowAnalysisException e) { throw new AnalysisException(e.toString(), e); } }
10715 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/10715/316dd9a4d12dd5084c16188710bec1a60084781e/ResourceTrackingDetector.java/buggy/findbugs/src/java/edu/umd/cs/findbugs/ResourceTrackingDetector.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 3757, 797, 1042, 12, 797, 1042, 667, 1042, 13, 288, 202, 202, 698, 288, 1082, 202, 6385, 29491, 525, 1106, 273, 667, 1042, 18, 588, 5852, 797, 5621, 1082, 202, 1305, 8526...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 3757, 797, 1042, 12, 797, 1042, 667, 1042, 13, 288, 202, 202, 698, 288, 1082, 202, 6385, 29491, 525, 1106, 273, 667, 1042, 18, 588, 5852, 797, 5621, 1082, 202, 1305, 8526...
serviceLog.debug("Async error occurred: "+e,e);
serviceLog.debug("Async error occurred: "+e,e);
public void serviceException(Throwable e) { // are we a transport exception such as not being able to dispatch // synchronously to a transport if (e instanceof IOException) { serviceTransportException((IOException) e); } // Handle the case where the broker is stopped // But the client is still connected. else if (e.getClass() == BrokerStoppedException.class ) { if( !disposed ) { if( serviceLog.isDebugEnabled() ) serviceLog.debug("Broker has been stopped. Notifying client and closing his connection."); ConnectionError ce = new ConnectionError(); ce.setException(e); dispatchSync(ce); // Wait a little bit to try to get the output buffer to flush the exption notification to the client. try { Thread.sleep(500); } catch (InterruptedException ie) { Thread.currentThread().interrupt(); } // Worst case is we just kill the connection before the notification gets to him. ServiceSupport.dispose(this); } } else if( !disposed && !inServiceException ) { inServiceException = true; try { if( serviceLog.isDebugEnabled() ) serviceLog.debug("Async error occurred: "+e,e); ConnectionError ce = new ConnectionError(); ce.setException(e); dispatchAsync(ce); } finally { inServiceException = false; } } }
11783 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11783/cafe4cbcc4cf31839ff5bdfb5af7a55a682ef075/AbstractConnection.java/buggy/activemq-core/src/main/java/org/apache/activemq/broker/AbstractConnection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1156, 503, 12, 15155, 425, 13, 288, 3639, 368, 854, 732, 279, 4736, 1520, 4123, 487, 486, 3832, 7752, 358, 3435, 3639, 368, 25970, 358, 279, 4736, 3639, 309, 261, 73, 1276, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1156, 503, 12, 15155, 425, 13, 288, 3639, 368, 854, 732, 279, 4736, 1520, 4123, 487, 486, 3832, 7752, 358, 3435, 3639, 368, 25970, 358, 279, 4736, 3639, 309, 261, 73, 1276, 1...
Map.Entry entry = (Map.Entry)iter.next(); newInterface.defineModuleFunction((String)entry.getKey(), new JavaInterfaceMethod((String)entry.getKey(), (Set)entry.getValue()));
Map.Entry entry = (Map.Entry) iter.next(); newInterface.defineModuleFunction((String) entry.getKey(), new JavaInterfaceMethod((String) entry.getKey(), (Set) entry.getValue()));
private RubyModule createRubyInterface(Class javaInterface, String rubyName) { RubyModule newInterface = ruby.defineModule(rubyName); Map methods = sortMethodsByName(Arrays.asList(javaInterface.getMethods())); for (Iterator iter = methods.entrySet().iterator(); iter.hasNext();) { Map.Entry entry = (Map.Entry)iter.next(); newInterface.defineModuleFunction((String)entry.getKey(), new JavaInterfaceMethod((String)entry.getKey(), (Set)entry.getValue())); } newInterface.defineModuleFunction("new" + rubyName, new JavaInterfaceConstructor(javaInterface)); return newInterface; }
50993 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50993/786cea08c1dd2092a02d1254b49fbee371ace5f9/JavaSupport.java/clean/org/jruby/javasupport/JavaSupport.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 19817, 3120, 752, 54, 10340, 1358, 12, 797, 2252, 1358, 16, 514, 22155, 461, 13, 288, 3639, 19817, 3120, 394, 1358, 273, 22155, 18, 11255, 3120, 12, 27768, 461, 1769, 7734, 1635, 25...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 19817, 3120, 752, 54, 10340, 1358, 12, 797, 2252, 1358, 16, 514, 22155, 461, 13, 288, 3639, 19817, 3120, 394, 1358, 273, 22155, 18, 11255, 3120, 12, 27768, 461, 1769, 7734, 1635, 25...
Control bar = super.createButtonBar(parent); GridData data = (GridData) bar.getLayoutData();
Composite composite = new Composite(parent, SWT.NONE); GridLayout layout = new GridLayout(); layout.numColumns = 0; layout.makeColumnsEqualWidth = true; layout.marginWidth = 0; layout.marginHeight = 0; layout.horizontalSpacing = convertHorizontalDLUsToPixels(IDialogConstants.HORIZONTAL_SPACING); layout.verticalSpacing = convertVerticalDLUsToPixels(IDialogConstants.VERTICAL_SPACING); composite.setLayout(layout); GridData data = new GridData( GridData.HORIZONTAL_ALIGN_END | GridData.VERTICAL_ALIGN_CENTER);
protected Control createButtonBar(Composite parent) { Control bar = super.createButtonBar(parent); GridData data = (GridData) bar.getLayoutData(); data.horizontalSpan = 2; return bar;}
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/0cb3536e72bb027f736817e2b2b61a12dd165f9f/MessageDialog.java/buggy/bundles/org.eclipse.ui/Eclipse JFace/org/eclipse/jface/dialogs/MessageDialog.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4750, 8888, 752, 3616, 5190, 12, 9400, 982, 13, 288, 202, 202, 3367, 4653, 273, 2240, 18, 2640, 3616, 5190, 12, 2938, 1769, 202, 6313, 751, 501, 273, 261, 6313, 751, 13, 4653, 18, 588, 3744,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4750, 8888, 752, 3616, 5190, 12, 9400, 982, 13, 288, 202, 202, 3367, 4653, 273, 2240, 18, 2640, 3616, 5190, 12, 2938, 1769, 202, 6313, 751, 501, 273, 261, 6313, 751, 13, 4653, 18, 588, 3744,...
isImage = false;
public void end(String uri, String localname, String qName) throws SAXException { final ContentHandler contentHandler = handlerContext.getController().getOutput(); final String effectiveId = handlerContext.getEffectiveId(elementAttributes); final XFormsControls.OutputControlInfo controlInfo = handlerContext.isGenerateTemplate() ? null : (XFormsControls.OutputControlInfo) containingDocument.getObjectById(pipelineContext, effectiveId); // xforms:label handleLabelHintHelpAlert(effectiveId, "label", controlInfo); final AttributesImpl newAttributes; final boolean isImage; final boolean isDateOrTime; final StringBuffer classes = new StringBuffer("xforms-control xforms-output"); if (!handlerContext.isGenerateTemplate()) { final String appearanceValue = elementAttributes.getValue("appearance"); final String appearanceLocalname = (appearanceValue == null) ? null : XMLUtils.localNameFromQName(appearanceValue); final String appearanceURI = (appearanceValue == null) ? null : uriFromQName(appearanceValue); final String mediaType = controlInfo.getMediaTypeAttribute(); final boolean isHTML = appearanceValue != null && XFormsConstants.XXFORMS_NAMESPACE_URI.equals(appearanceURI) && "html".equals(appearanceLocalname); isImage = mediaType != null && mediaType.startsWith("image/"); // Find classes to add if (isHTML) { classes.append(" xforms-output-html"); } else if (isImage) { classes.append(" xforms-output-image"); } isDateOrTime = isDateOrTime(controlInfo.getType()); if (isDateOrTime) { classes.append(" xforms-date"); } handleReadOnlyClass(classes, controlInfo); handleRelevantClass(classes, controlInfo); newAttributes = getAttributes(elementAttributes, classes.toString(), effectiveId); handleReadOnlyAttribute(newAttributes, controlInfo); } else { isImage = false; isDateOrTime = false; // Find classes to add newAttributes = getAttributes(elementAttributes, classes.toString(), effectiveId); } // Create xhtml:span final String xhtmlPrefix = handlerContext.findXHTMLPrefix(); final String spanQName = XMLUtils.buildQName(xhtmlPrefix, "span"); contentHandler.startElement(XMLConstants.XHTML_NAMESPACE_URI, "span", spanQName, newAttributes); if (!handlerContext.isGenerateTemplate()) { if (isImage) { // Case of image media type with URI final String imgQName = XMLUtils.buildQName(xhtmlPrefix, "img"); final AttributesImpl imgAttributes = new AttributesImpl(); // @src="..." imgAttributes.addAttribute("", "src", "src", ContentHandlerHelper.CDATA, controlInfo.getValue()); // @f:url-norewrite="true" final String formattingPrefix; final boolean isNewPrefix; { final String existingFormattingPrefix = handlerContext.findFormattingPrefix(); if (existingFormattingPrefix == null || "".equals(existingFormattingPrefix)) { // No prefix is currently mapped formattingPrefix = handlerContext.findNewPrefix(); isNewPrefix = true; } else { formattingPrefix = existingFormattingPrefix; isNewPrefix = false; } imgAttributes.addAttribute(XMLConstants.OPS_FORMATTING_URI, "url-norewrite", XMLUtils.buildQName(formattingPrefix, "url-norewrite"), ContentHandlerHelper.CDATA, "true"); } if (isNewPrefix) contentHandler.startPrefixMapping(formattingPrefix, XMLConstants.OPS_FORMATTING_URI); contentHandler.startElement(XMLConstants.XHTML_NAMESPACE_URI, "img", imgQName, imgAttributes); contentHandler.endElement(XMLConstants.XHTML_NAMESPACE_URI, "img", imgQName); if (isNewPrefix) contentHandler.endPrefixMapping(formattingPrefix); } else if (isDateOrTime) { // Display formatted value for dates final String displayValue = controlInfo.getDisplayValue(); contentHandler.characters(displayValue.toCharArray(), 0, displayValue.length()); } else { // Regular text case final String value = controlInfo.getValue(); if (value != null) contentHandler.characters(value.toCharArray(), 0, value.length()); } } contentHandler.endElement(XMLConstants.XHTML_NAMESPACE_URI, "span", spanQName); // xforms:help handleLabelHintHelpAlert(effectiveId, "help", controlInfo); // xforms:hint handleLabelHintHelpAlert(effectiveId, "hint", controlInfo); }
52783 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52783/be5df06f28b202fc38cd73bf04037c0ca691a9d6/XFormsOutputHandler.java/clean/src/java/org/orbeon/oxf/xforms/processor/handlers/XFormsOutputHandler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 12, 780, 2003, 16, 514, 1191, 529, 16, 514, 22914, 13, 1216, 14366, 288, 3639, 727, 3697, 1503, 913, 1503, 273, 1838, 1042, 18, 588, 2933, 7675, 588, 1447, 5621, 3639, 7...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 679, 12, 780, 2003, 16, 514, 1191, 529, 16, 514, 22914, 13, 1216, 14366, 288, 3639, 727, 3697, 1503, 913, 1503, 273, 1838, 1042, 18, 588, 2933, 7675, 588, 1447, 5621, 3639, 7...
log.error("Channel closed");
System.err.println("Channel closed");
public void start() throws Exception { Object obj; Message msg; View view; Vector tmp; UnicastTest2Info info, myinfo; Object sender; channel=new JChannel(props); channel.connect(groupname); System.out.println("[ready]"); while(true) { try { obj=channel.receive(0); if(obj instanceof View) { view=(View)obj; tmp=view.getMembers(); mbrs.removeAllElements(); for(int i=0; i < tmp.size(); i++) mbrs.addElement(tmp.elementAt(i)); for(Enumeration e=senders.keys(); e.hasMoreElements();) { sender=e.nextElement(); if(!mbrs.contains(sender)) { mbrs.removeElement(sender); } } if(mbrs.size() > 1) { if(writer == null) { writer=new Thread(this, "WriterThread"); writer.start(); } } else { if(writer != null) { running=false; writer.interrupt(); } writer=null; } } else if(obj instanceof Message) { msg=(Message)obj; info=(UnicastTest2Info)msg.getObject(); System.out.println("Received msg: " + info); myinfo=(UnicastTest2Info)senders.get(info.sender); if(myinfo == null) { // first msg if(info.msgno == 1) { // must be 1 senders.put(info.sender, info); } else { // error log.error("UnicastTest2.start(): first seqno must be 1"); } } else { if(info.msgno -1 != myinfo.msgno) { log.error("UnicastTest2.start(): received msg " + info.sender + ':' + info.msgno + ", but last received was " + myinfo.sender + ':' + myinfo.msgno); } else { System.out.println("UnicastTest2.start(): OK received " + info.sender + ':' + info.msgno + ", prev seqno=" + myinfo.sender + ':' + myinfo.msgno); myinfo.msgno++; } } } else ; } catch(ChannelClosedException closed) { log.error("Channel closed"); break; } catch(ChannelNotConnectedException not_conn) { log.error("Channel not connected"); break; } catch(Exception e) { log.error(e); } } }
51463 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51463/13de68466e3cf7fde6ee0bde0cee09a33e837e89/UnicastTest2.java/buggy/tests/other/org/jgroups/tests/UnicastTest2.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 787, 1435, 1216, 1185, 288, 202, 921, 5411, 1081, 31, 202, 1079, 6647, 1234, 31, 202, 1767, 2868, 1476, 31, 202, 5018, 5411, 1853, 31, 202, 984, 12544, 4709, 22, 966, 225, 11...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 787, 1435, 1216, 1185, 288, 202, 921, 5411, 1081, 31, 202, 1079, 6647, 1234, 31, 202, 1767, 2868, 1476, 31, 202, 5018, 5411, 1853, 31, 202, 984, 12544, 4709, 22, 966, 225, 11...
rootElement.appendChild(getBase64Elements(doc));
protected Document createDOMDocumentforSerialization( WSDLOperation operation, String portTypeName, WSDLBindingOperation bindingOperation) { Document doc = getEmptyDocument(); Element rootElement = doc.createElement("class"); addAttribute(doc, "package", configuration.getPackageName() + DATABINDING_PACKAGE_NAME_SUFFIX, rootElement); String localPart = operation.getName().getLocalPart(); addAttribute(doc, "name", portTypeName + localPart + DATABINDING_SUPPORTER_NAME_SUFFIX, rootElement); addAttribute(doc, "methodname", localPart, rootElement); addAttribute(doc, "namespace", operation.getName().getNamespaceURI(), rootElement); //Add the parameters to a map with their type as the key //this step is needed to remove repetitions Map parameterMap = new HashMap(); Element inputParamElement = getInputParamElement(doc, operation); if (inputParamElement!=null){ parameterMap.put(inputParamElement.getAttribute("type"),inputParamElement); } Element outputParamElement = getOutputParamElement(doc, operation); if (outputParamElement!=null){ parameterMap.put(outputParamElement.getAttribute("type"),outputParamElement); } Element newChild; if (bindingOperation!=null) { List headerParameterQNameList= new ArrayList(); addHeaderOperations(headerParameterQNameList,bindingOperation,true); List parameterElementList = getParameterElementList(doc,headerParameterQNameList, "header"); for (int i = 0; i < parameterElementList.size(); i++) { newChild = (Element) parameterElementList.get(i); parameterMap.put(newChild.getAttribute("type"),newChild); } headerParameterQNameList.clear(); parameterElementList.clear(); addHeaderOperations(headerParameterQNameList,bindingOperation,false); parameterElementList = getParameterElementList(doc,headerParameterQNameList, "header"); for (int i = 0; i < parameterElementList.size(); i++) { newChild = (Element) parameterElementList.get(i); parameterMap.put(newChild.getAttribute("type"),newChild); } } //Now run through the parameters and ad them to the root element Collection parameters = parameterMap.values(); for (Iterator iterator = parameters.iterator(); iterator.hasNext();) { rootElement.appendChild((Element)iterator.next()); } doc.appendChild(rootElement); return doc; }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/241d7be118c5327ce88302ff9c4b1291d0535c38/MultiLanguageClientEmitter.java/clean/modules/wsdl/src/org/apache/axis2/wsdl/codegen/emitter/MultiLanguageClientEmitter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 27575, 18, 6923, 1763, 12, 588, 2171, 1105, 3471, 12, 2434, 10019, 377, 27575, 18, 6923, 1763, 12, 588, 2171, 1105, 3471, 12, 2434, 10019, 377, 27575, 18, 6923, 1763, 12, 588, 2171, 1105,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 27575, 18, 6923, 1763, 12, 588, 2171, 1105, 3471, 12, 2434, 10019, 377, 27575, 18, 6923, 1763, 12, 588, 2171, 1105, 3471, 12, 2434, 10019, 377, 27575, 18, 6923, 1763, 12, 588, 2171, 1105,...
public void mT17() throws RecognitionException { int T17_StartIndex = input.index(); try { int type = T17; int start = getCharIndex(); int line = getLine(); int charPosition = getCharPositionInLine(); int channel = Token.DEFAULT_CHANNEL; if ( backtracking>0 && alreadyParsedRule(input, 3) ) { return ; } // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:8:7: ( 'import' ) // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:8:7: 'import' { match("import"); if (failed) return ; } if ( token==null ) {emit(type,line,charPosition,channel,start,getCharIndex()-1);} } finally { if ( backtracking>0 ) { memoize(input, 3, T17_StartIndex); } } }
31577 /local/tlutelli/issta_data/temp/all_java3context/java/2006_temp/2006/31577/bf3305a89ef5e916acbab744c38aaaec83bf67ff/RuleParserLexer.java/clean/drools-compiler/src/main/java/org/drools/lang/RuleParserLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 21115, 4033, 1435, 1216, 9539, 288, 3639, 509, 399, 4033, 67, 16792, 273, 810, 18, 1615, 5621, 3639, 775, 288, 5411, 509, 618, 273, 399, 4033, 31, 5411, 509, 787, 273, 23577, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 21115, 4033, 1435, 1216, 9539, 288, 3639, 509, 399, 4033, 67, 16792, 273, 810, 18, 1615, 5621, 3639, 775, 288, 5411, 509, 618, 273, 399, 4033, 31, 5411, 509, 787, 273, 23577, ...
assertTrue(p_this instanceof PrivateCredentialPermission);
public final void testImplies_01() { s_that = "a.b.Credential a.b.Principal \"duke\" a.c.Principal \"nuke\""; s_this = "a.b.Credential a.b.Principal \"duke\""; p_that = new PrivateCredentialPermission(s_that, "read"); p_this = new PrivateCredentialPermission(s_this, "read"); assertTrue(p_this instanceof PrivateCredentialPermission); assertTrue(p_this.implies(p_that)); assertTrue(p_this.implies(p_this)); }
54769 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54769/725ae047c421126dd0fcfebb60f514948e7cc007/PrivateCredentialPermissionTest.java/clean/modules/security/src/test/java/common/javax/security/auth/PrivateCredentialPermissionTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 727, 918, 1842, 2828, 606, 67, 1611, 1435, 288, 3639, 272, 67, 19056, 273, 315, 69, 18, 70, 18, 8605, 279, 18, 70, 18, 9155, 1239, 2544, 4491, 2412, 279, 18, 71, 18, 9155, 1239,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 727, 918, 1842, 2828, 606, 67, 1611, 1435, 288, 3639, 272, 67, 19056, 273, 315, 69, 18, 70, 18, 8605, 279, 18, 70, 18, 9155, 1239, 2544, 4491, 2412, 279, 18, 71, 18, 9155, 1239,...
int methodOffset = methodRef.peekResolvedMethod().getOffset();
Offset methodOffset = methodRef.peekResolvedMethod().getOffset();
protected final void emit_resolved_invokestatic(VM_MethodReference methodRef) { int methodOffset = methodRef.peekResolvedMethod().getOffset(); asm.emitLAddrToc(T0, methodOffset); asm.emitMTCTR(T0); genMoveParametersToRegisters(false, methodRef); asm.emitBCCTRL(); genPopParametersAndPushReturnValue(false, methodRef); }
4011 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4011/71f0481e0131f8f2137e2feea85ae32a28daffcc/VM_Compiler.java/clean/rvm/src/vm/arch/powerPC/compilers/baseline/VM_Compiler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 727, 918, 3626, 67, 11792, 67, 5768, 601, 395, 2126, 12, 7397, 67, 1305, 2404, 707, 1957, 13, 288, 565, 9874, 707, 2335, 273, 707, 1957, 18, 347, 3839, 12793, 1305, 7675, 588, 233...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 727, 918, 3626, 67, 11792, 67, 5768, 601, 395, 2126, 12, 7397, 67, 1305, 2404, 707, 1957, 13, 288, 565, 9874, 707, 2335, 273, 707, 1957, 18, 347, 3839, 12793, 1305, 7675, 588, 233...
con.clearWarnings();
con.setAutoCommit(autoCommit);
public Connection getConnection() throws SQLException { if (con == null) { throw new SQLException("This PooledConnection has already been closed!"); } // Only one connection can be open at a time from this PooledConnection. See JDBC 2.0 Optional Package spec section 6.2.3 if (last != null) { last.close(); if (!con.getAutoCommit()) { try { con.rollback(); } catch (SQLException e) {} } con.clearWarnings(); } con.setAutoCommit(autoCommit); ConnectionHandler handler = new ConnectionHandler(con); last = handler; Connection con = (Connection)Proxy.newProxyInstance(getClass().getClassLoader(), new Class[]{Connection.class, PGConnection.class}, handler); last.setProxy(con); return con; }
46597 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46597/9e29b32e782e38ebdcb41b217a18fafe3387371e/PooledConnectionImpl.java/clean/src/interfaces/jdbc/org/postgresql/jdbc2/optional/PooledConnectionImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 4050, 6742, 1435, 1216, 6483, 202, 95, 202, 202, 430, 261, 591, 422, 446, 13, 202, 202, 95, 1082, 202, 12849, 394, 6483, 2932, 2503, 453, 22167, 1952, 711, 1818, 2118, 4375, 4...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 4050, 6742, 1435, 1216, 6483, 202, 95, 202, 202, 430, 261, 591, 422, 446, 13, 202, 202, 95, 1082, 202, 12849, 394, 6483, 2932, 2503, 453, 22167, 1952, 711, 1818, 2118, 4375, 4...
loginInfoJPanel.setBorder(javax.swing.BorderFactory.createTitledBorder(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.LoginInfoTitle")));
java.util.ResourceBundle bundle = java.util.ResourceBundle.getBundle("localization/JPanel_Messages"); loginInfoJPanel.setBorder(javax.swing.BorderFactory.createTitledBorder(bundle.getString("LoginAvatar.LoginInfoTitle")));
private void initComponents() { javax.swing.JButton cancelJButton; javax.swing.JLabel eaJLabel; javax.swing.JPanel loginInfoJPanel; javax.swing.JButton nextJButton; javax.swing.JLabel passwordJLabel; javax.swing.JLabel usernameJLabel; loginInfoJPanel = new javax.swing.JPanel(); eaJLabel = LabelFactory.create(); usernameJLabel = LabelFactory.create(); passwordJLabel = LabelFactory.create(); usernameJTextField = TextFactory.create(); passwordJPasswordField = TextFactory.createPassword(); nextJButton = ButtonFactory.create(); cancelJButton = ButtonFactory.create(); loginInfoJPanel.setBorder(javax.swing.BorderFactory.createTitledBorder(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.LoginInfoTitle"))); loginInfoJPanel.setOpaque(false); eaJLabel.setText(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.EmbeddedAssistance")); usernameJLabel.setText(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.UsernameLabel")); passwordJLabel.setText(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.PasswordLabel")); passwordJPasswordField.setFont(usernameJTextField.getFont()); nextJButton.setText(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.LoginButton")); nextJButton.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent e) { nextJButtonActionPerformed(e); } }); cancelJButton.setText(java.util.ResourceBundle.getBundle("localization/JPanel_Messages").getString("LoginAvatar.CancelButton")); cancelJButton.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent e) { cancelJButtonActionPerformed(e); } }); org.jdesktop.layout.GroupLayout loginInfoJPanelLayout = new org.jdesktop.layout.GroupLayout(loginInfoJPanel); loginInfoJPanel.setLayout(loginInfoJPanelLayout); loginInfoJPanelLayout.setHorizontalGroup( loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(loginInfoJPanelLayout.createSequentialGroup() .addContainerGap() .add(loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(usernameJLabel) .add(passwordJLabel)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(usernameJTextField, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 213, Short.MAX_VALUE) .add(passwordJPasswordField, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 213, Short.MAX_VALUE)) .addContainerGap()) .add(loginInfoJPanelLayout.createSequentialGroup() .add(10, 10, 10) .add(eaJLabel, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, 269, Short.MAX_VALUE) .addContainerGap(10, Short.MAX_VALUE)) .add(org.jdesktop.layout.GroupLayout.TRAILING, loginInfoJPanelLayout.createSequentialGroup() .addContainerGap(151, Short.MAX_VALUE) .add(cancelJButton) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(nextJButton) .addContainerGap()) ); loginInfoJPanelLayout.setVerticalGroup( loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(loginInfoJPanelLayout.createSequentialGroup() .add(eaJLabel) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(usernameJLabel) .add(usernameJTextField, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED) .add(loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(passwordJLabel) .add(passwordJPasswordField, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.PREFERRED_SIZE)) .addPreferredGap(org.jdesktop.layout.LayoutStyle.RELATED, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, Short.MAX_VALUE) .add(loginInfoJPanelLayout.createParallelGroup(org.jdesktop.layout.GroupLayout.BASELINE) .add(nextJButton) .add(cancelJButton)) .addContainerGap()) ); org.jdesktop.layout.GroupLayout layout = new org.jdesktop.layout.GroupLayout(this); this.setLayout(layout); layout.setHorizontalGroup( layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(layout.createSequentialGroup() .addContainerGap() .add(loginInfoJPanel, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, Short.MAX_VALUE) .addContainerGap()) ); layout.setVerticalGroup( layout.createParallelGroup(org.jdesktop.layout.GroupLayout.LEADING) .add(layout.createSequentialGroup() .addContainerGap() .add(loginInfoJPanel, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, org.jdesktop.layout.GroupLayout.DEFAULT_SIZE, Short.MAX_VALUE) .addContainerGap()) ); }// </editor-fold>//GEN-END:initComponents
53635 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/53635/7309742621de24b3497604e2d6c032eef3529fc2/LoginAvatar.java/buggy/local/browser/src/main/java/com/thinkparity/ophelia/browser/platform/firstrun/LoginAvatar.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 3639, 6863, 18, 5328, 310, 18, 46, 3616, 3755, 46, 3616, 31, 3639, 6863, 18, 5328, 310, 18, 46, 2224, 24164, 46, 2224, 31, 3639, 6863, 18, 5328, 310, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 3639, 6863, 18, 5328, 310, 18, 46, 3616, 3755, 46, 3616, 31, 3639, 6863, 18, 5328, 310, 18, 46, 2224, 24164, 46, 2224, 31, 3639, 6863, 18, 5328, 310, ...
public Comment(String text) { this.text = text;
public Comment(StringBuffer buf) { text = buf.toString();
public Comment(String text) { this.text = text; }
13991 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13991/cc323a7cc819ef90c1be0849f6c8df50e43667e7/Comment.java/buggy/modules/edtplug/classes/netscape/plugin/composer/io/Comment.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 9821, 12, 780, 977, 13, 288, 565, 333, 18, 955, 273, 977, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 9821, 12, 780, 977, 13, 288, 565, 333, 18, 955, 273, 977, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -1...
if (aEvent.getValueIsAdjusting()) { return; }
if (aEvent.getValueIsAdjusting()) { return; }
public void valueChanged(ListSelectionEvent aEvent) { //Ignore extra messages. if (aEvent.getValueIsAdjusting()) { return; } final ListSelectionModel lsm = (ListSelectionModel) aEvent.getSource(); if (lsm.isSelectionEmpty()) { mDetails.setText("Nothing selected"); } else { final int selectedRow = lsm.getMinSelectionIndex(); final EventDetails e = mModel.getEventDetails(selectedRow); final Object[] args = { new Date(e.getTimeStamp()), e.getPriority(), escape(e.getThreadName()), escape(e.getNDC()), escape(e.getCategoryName()), escape(e.getLocationDetails()), escape(e.getMessage()), escape(getThrowableStrRep(e)) }; mDetails.setText(FORMATTER.format(args)); mDetails.setCaretPosition(0); } }
45952 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45952/9bea173ad0684cd425c468d55310cccc5a96e8a0/DetailPanel.java/buggy/src/java/org/apache/log4j/chainsaw/DetailPanel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 460, 5033, 12, 682, 6233, 1133, 279, 1133, 13, 288, 3639, 368, 3777, 2870, 2743, 18, 3639, 309, 261, 69, 1133, 18, 24805, 2520, 10952, 310, 10756, 288, 5411, 327, 31, 3639, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 460, 5033, 12, 682, 6233, 1133, 279, 1133, 13, 288, 3639, 368, 3777, 2870, 2743, 18, 3639, 309, 261, 69, 1133, 18, 24805, 2520, 10952, 310, 10756, 288, 5411, 327, 31, 3639, 2...
ServiceContext serviceContext = Utils.fillContextInformation(axisOperation, service, configContext);
public void testEchoXMLCompleteASync() throws Exception { ConfigurationContext configContext = UtilsMailServer.createClientConfigurationContext(); AxisService service = new AxisService(serviceName.getLocalPart()); AxisOperation axisOperation = new OutInAxisOperation(); axisOperation.setName(operationName); axisOperation.setMessageReceiver(new MessageReceiver() { public void receive(MessageContext messageCtx) { envelope = messageCtx.getEnvelope(); } }); service.addOperation(axisOperation); configContext.getAxisConfiguration().addService(service); ServiceContext serviceContext = Utils.fillContextInformation(axisOperation, service, configContext); Options options = new Options(); options.setTo(targetEPR); options.setTransportInProtocol(Constants.TRANSPORT_MAIL); options.setUseSeparateListener(true); Callback callback = new Callback() { public void onComplete(AsyncResult result) { try { result.getResponseEnvelope().serializeAndConsume( XMLOutputFactory.newInstance() .createXMLStreamWriter(System.out)); } catch (XMLStreamException e) { reportError(e); } finally { finish = true; } } public void reportError(Exception e) { log.info(e.getMessage()); finish = true; } }; ServiceClient sender = new ServiceClient(serviceContext); sender.setOptions(options); sender.setCurrentOperationName(operationName); options.setTo(targetEPR); sender.sendReceiveNonblocking(createEnvelope(), callback); int index = 0; while (!finish) { Thread.sleep(1000); index++; if (index > 10) { throw new AxisFault( "Async response is taking too long[10s+]. Server is being shut down."); } } sender.finalizeInvoke(); }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/8baa74e67adc60139306df51be4a393501d5b175/MailetRequestResponseRawXMLTest.java/clean/modules/integration/test/org/apache/axis2/mail/MailetRequestResponseRawXMLTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 19704, 4201, 6322, 3033, 1209, 1435, 1216, 1185, 288, 3639, 4659, 1042, 642, 1042, 273, 6091, 6759, 2081, 18, 2640, 1227, 1750, 1042, 5621, 3639, 15509, 1179, 1156, 273, 39...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 19704, 4201, 6322, 3033, 1209, 1435, 1216, 1185, 288, 3639, 4659, 1042, 642, 1042, 273, 6091, 6759, 2081, 18, 2640, 1227, 1750, 1042, 5621, 3639, 15509, 1179, 1156, 273, 39...
public int CDL3OUTSIDE_Lookback( ){ return 3;}
7231 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7231/1bccb7a13486c61b10e8ebdf0c938797539a3f3d/Core.java/clean/ta-lib/java/src/TA/Lib/Core.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 474, 39, 8914, 23, 5069, 26498, 67, 9794, 823, 1435, 95, 2463, 23, 31, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 474, 39, 8914, 23, 5069, 26498, 67, 9794, 823, 1435, 95, 2463, 23, 31, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, ...
String tagname = matres.group(1) ; String tagattributes = matres.group(2) ; Properties attributes = new Properties() ; PatternMatcherInput pminput = new PatternMatcherInput(tagattributes) ; while(patMat.contains(pminput,IMCMS_TAG_ATTRIBUTES_PATTERN)) { MatchResult attribute_matres = patMat.getMatch() ; attributes.setProperty(attribute_matres.group(1), attribute_matres.group(3)) ; } String result ;
String tagname = matres.group(1) ; String tagattributes = matres.group(2) ; Properties attributes = new Properties() ; PatternMatcherInput pminput = new PatternMatcherInput(tagattributes) ; while(patMat.contains(pminput,IMCMS_TAG_ATTRIBUTES_PATTERN)) { MatchResult attribute_matres = patMat.getMatch() ; attributes.setProperty(attribute_matres.group(1), attribute_matres.group(3)) ; } String result ;
public void appendSubstitution( StringBuffer sb, MatchResult matres, int sc, PatternMatcherInput originalInput, PatternMatcher patMat, Pattern pat) { String tagname = matres.group(1) ; String tagattributes = matres.group(2) ; Properties attributes = new Properties() ; PatternMatcherInput pminput = new PatternMatcherInput(tagattributes) ; while(patMat.contains(pminput,IMCMS_TAG_ATTRIBUTES_PATTERN)) { MatchResult attribute_matres = patMat.getMatch() ; attributes.setProperty(attribute_matres.group(1), attribute_matres.group(3)) ; } String result ; // FIXME: This is quickly growing ugly. // A better solution would be a class per tag (TagHandler's if you will), // with a known interface, looked up through some HashMap. // JSP already fixes this with tag-libs. if ("text".equals(tagname)) { result = tagText(attributes, patMat) ; } else if ("image".equals(tagname)) { result = tagImage(attributes, patMat) ; } else if ("include".equals(tagname)) { result = tagInclude(attributes, patMat) ; } else if ("metaid".equals(tagname)) { result = tagMetaId() ; } else if ("datetime".equals(tagname)) { result = tagDatetime(attributes) ; } else if ("section".equals(tagname)) { result= tagSection() ; } else if ("user".equals(tagname)) { result= tagUser(attributes) ; } else { result = matres.group(0) ; } /* If result equals something other than the empty string we have to handel pre and post attributes */ if (!"".equals(result)) { String tempAtt = null ; if ((tempAtt = attributes.getProperty("pre")) != null) { result = tempAtt + result ; } if ((tempAtt = attributes.getProperty("post")) != null) { result = result + tempAtt ; } } sb.append(result) ; }
8781 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8781/a6e12a67b6789cdc78abb66c11c98017ae883a46/ImcmsTagSubstitution.java/clean/server/src/imcode/server/parser/ImcmsTagSubstitution.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 714, 23798, 12, 6674, 2393, 16, 4639, 1253, 4834, 455, 16, 509, 888, 16, 6830, 6286, 1210, 2282, 1210, 16, 6830, 6286, 9670, 15947, 16, 6830, 9670, 13, 288, 202, 202, 780, 25...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 714, 23798, 12, 6674, 2393, 16, 4639, 1253, 4834, 455, 16, 509, 888, 16, 6830, 6286, 1210, 2282, 1210, 16, 6830, 6286, 9670, 15947, 16, 6830, 9670, 13, 288, 202, 202, 780, 25...
foeSerial = createFOE(processInstance);
foeSerial = createFOE(currentProcess);
private Map transitionTaskFromStack(ITaskInstance currentTask) throws TransitionException, DefinitionNotFoundException { if (log.isInfoEnabled()) { log.info("transitionTask is initialising for TaskInstance " + currentTask); } if (currentTask.getState() == ITaskInstance.STATE_INITIALISING) { // run the constructor try { doTaskConstruct(currentTask); } catch (Exception e) { String emsg = "Error during construction of Task " + currentTask; log.error(emsg, e); throw new TransitionException(emsg, e); } } else { runTask(currentTask); } // check the state of the task now it has been run if (currentTask.getState() != ITaskInstance.STATE_AWAITINGCOMPLETE) { // task has some state other than "completed" so exit if (log.isInfoEnabled()) { log .info("transitionTask - task will not be transitioned as it has a state of " + currentTask.getState() + " - GUID " + currentTask.getTaskInstanceId()); } return new HashMap(); } // do transition - get outbound routing, check for locks, etc // make a note of any TaskDef that is SyncLocked by this TaskDef - // SyncLocked tasks can be run once this task has completed ITaskDefinition taskDef = currentTask.getTaskDefinition(); List createList = runRouting(taskDef, currentTask); if (createList.size() == 0 && taskDef.getRoutingOut().size() > 0) { // routing exists, but none ran. try { ITransaction t = stateFactory.beginTransaction(); currentTask.setState(ITaskInstance.STATE_ERRORROUTING); stateFactory.saveObject(currentTask); t.commit(); } catch (Exception e) { log.error(e); throw new TransitionException(e); } throw new TransitionException("Routing exists for TaskInstance " + currentTask + " but none ran!"); } /* * we now have a list of tasks to create. Before we start creating them, * we need to LOCK the ProcessInstance from changes by other Engine * instances. As this can be a little costly (especially when plugged * into a DB states provider) there should probably be a config option * to specify whether multiple engines are in use to either * enable/disable this behaviour. */ Map createdTasks = new HashMap(); IProcessInstance processInstance = currentTask.getProcessInstance(); try { stateFactory.acquireLock(processInstance,this); } catch (LockException e) { String emsg = "Failed to aquire an exclusive lock on the Process Instance"; log.error(emsg,e); throw new TransitionException(emsg,e); } ITransaction t; try { t = stateFactory.beginTransaction(); } catch (Exception e) { String emsg = "Failure to create states transaction before creating new tasks"; log.error(emsg, e); throw new TransitionException(emsg, e); } IFOE foeSerial = null; for (Iterator it = createList.iterator(); it.hasNext();) { ITaskInstance newTaskInstance; IRoutingDefinition routingDef = (IRoutingDefinition) it.next(); ITaskDefinition newTaskDef = routingDef.getDestinationTaskDefinition(); try { IFOE foe; if (routingDef.getParallel()) { /* * a parallel routing always creates a new FOE */ foe = createFOE(processInstance); } else { /* * Serial routing always re-uses an existing FOE */ if (foeSerial == null) { if (taskDef.isSynchronised()) { /* * As we sync'd, there may be multiple FOEs that are * combining, so therefore we need to create a new * FOE for execution to continue down. */ foeSerial = createFOE(processInstance); } else { /* * use the FOE of the current task... */ foeSerial = currentTask.getFOE(); } } foe = foeSerial; } newTaskInstance = createTask(newTaskDef, processInstance, foe); } catch (Exception e) { // pokemon stylee... catch 'em all String emsg = "Failed to create new task Instance for task definition " + newTaskDef; log.error(emsg, e); throw new TransitionException(emsg, e); } /* * createTask may return an existing task instance in the case of a * sync task that is being hit by multiple routings, so we check * before we add it to the list of unique tasks created */ if (!createdTasks.containsKey(newTaskInstance.getTaskInstanceId())) { createdTasks.put(newTaskInstance.getTaskInstanceId(), newTaskInstance); } } /* * we need to see if there is an existing SyncTaskInstance that was * waiting for this task to complete This check is only necessary when * the route taken by the task removes its lock on the synctask, but * does not route toward the synctask (escape route) */ // get the list of sync tasks that this task can block Map syncList = taskSync.getPotentialTaskLocks(taskDef); // iterate over the processInstance's list of tasks, looking for a Sync // Task that is blocked by the current task for (Iterator it = currentTask.getProcessInstance().getTaskInstances() .iterator(); it.hasNext();) { ITaskInstance checkTask = (ITaskInstance) it.next(); if (syncList.containsKey(checkTask.getTaskDefinition().getId())) { // sync task found, so add to the create list if (!createdTasks.containsKey(checkTask.getTaskInstanceId())) { if (log.isInfoEnabled()) { log .info("adding SyncTask " + checkTask + " that may now be runnable due to completion of taskInstance " + currentTask); } createdTasks.put(checkTask.getTaskInstanceId(), checkTask); } } } // remove completed task try { currentTask.setState(ITaskInstance.STATE_COMPLETE); stateFactory.saveObject(currentTask); stateFactory.deleteObject(currentTask); t.commit(); } catch (Exception e) { String emsg = "Failed to commit new tasks and finalise task completion"; log.error(emsg, e); throw new TransitionException(emsg, e); } try { // unlock processInstance stateFactory.releaseLock(processInstance, this); } catch (LockException e) { String emsg = "Failed to release the exclusive lock on the Process Instance"; log.error(emsg, e); throw new TransitionException(emsg, e); } return createdTasks; }
9195 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/9195/1fc0c0a45dce898ed6fa68820a8dfc8b5ae0020e/Engine.java/buggy/zebra/src/java/zebra-core/src/java/com/anite/zebra/core/Engine.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 1635, 6007, 2174, 1265, 2624, 12, 1285, 835, 1442, 783, 2174, 13, 1082, 202, 15069, 16515, 503, 16, 10849, 3990, 288, 202, 202, 430, 261, 1330, 18, 291, 966, 1526, 10756, 288, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 1635, 6007, 2174, 1265, 2624, 12, 1285, 835, 1442, 783, 2174, 13, 1082, 202, 15069, 16515, 503, 16, 10849, 3990, 288, 202, 202, 430, 261, 1330, 18, 291, 966, 1526, 10756, 288, ...
styleTable.remove(name);
styles.removeAttribute(name);
public void removeStyle(String name) { styleTable.remove(name); }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/ba862f89183b5347853381927a04e1e399fae5db/StyleContext.java/buggy/core/src/classpath/javax/javax/swing/text/StyleContext.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1206, 2885, 12, 780, 508, 13, 225, 288, 565, 5687, 18, 4479, 1499, 12, 529, 1769, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1206, 2885, 12, 780, 508, 13, 225, 288, 565, 5687, 18, 4479, 1499, 12, 529, 1769, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -...
return Double.toString(f, true);
return VMDouble.toString(f, true);
public static String toString(float f) { return Double.toString(f, true); }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/4d952c1ff48838834c7dcd3b56acf7f236a00079/Float.java/clean/core/src/classpath/5.0/java/lang/Float.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 514, 1762, 12, 5659, 284, 13, 225, 288, 565, 327, 8251, 5265, 18, 10492, 12, 74, 16, 638, 1769, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 514, 1762, 12, 5659, 284, 13, 225, 288, 565, 327, 8251, 5265, 18, 10492, 12, 74, 16, 638, 1769, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100,...
MylarUiPlugin.getDefault().getEditorManager().setAsyncExecMode(false);
MylarIdePlugin.getDefault().getEditorManager().setAsyncExecMode(false);
protected void setUp() throws Exception { super.setUp(); page = Workbench.getInstance().getActiveWorkbenchWindow().getActivePage(); assertNotNull(page); view = PackageExplorerPart.openInActivePerspective(); assertNotNull(view); MylarUiPlugin.getDefault().getEditorManager().setAsyncExecMode(false); page.closeAllEditors(true);// WorkspaceModifyOperation op = new WorkspaceModifyOperation() {// protected void execute(IProgressMonitor monitor) throws CoreException {// for (int i = 0; i < page.getEditors().length; i++) {// IEditorPart editor = page.getEditors()[i];// if (editor instanceof AbstractDecoratedTextEditor) {// page.cl// ((AbstractDecoratedTextEditor)editor).close(true);// }// }// }// };// IProgressService service = PlatformUI.getWorkbench().getProgressService();// service.run(true, true, op); }
51151 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51151/8574dc9f4f67068513f179f3255b73c77454caa7/EditorManagementTest.java/buggy/org.eclipse.mylyn.java.tests/src/org/eclipse/mylyn/java/tests/EditorManagementTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 24292, 1435, 1216, 1185, 288, 202, 202, 9565, 18, 542, 1211, 5621, 1082, 202, 2433, 273, 4147, 22144, 18, 588, 1442, 7675, 588, 3896, 2421, 22144, 3829, 7675, 588, 3896, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 24292, 1435, 1216, 1185, 288, 202, 202, 9565, 18, 542, 1211, 5621, 1082, 202, 2433, 273, 4147, 22144, 18, 588, 1442, 7675, 588, 3896, 2421, 22144, 3829, 7675, 588, 3896, 1...
myLogger.error(getAgentIdentifier() + ": buildOpConInfos - no AdConRelationship.");
myLogger.error("buildOpConInfos - no AdConRelationship.");
private NonOverlappingTimeSpanSet buildOpConInfos(NonOverlappingTimeSpanSet orgActivities) { NonOverlappingTimeSpanSet opconInfos = new NonOverlappingTimeSpanSet(); String currentOpCon = null; Relationship adConRelationship = getAdConRelationship(); Organization adCon = null; if (adConRelationship == null) { myLogger.error(getAgentIdentifier() + ": buildOpConInfos - no AdConRelationship."); } else { adCon = (Organization) getSelfOrg().getRelationshipSchedule().getOther(adConRelationship); if (myLogger.isDebugEnabled()) { myLogger.debug(getAgentIdentifier() + ": adConRelationship = " + adConRelationship); } } String adconName = adCon.getItemIdentificationPG().getItemIdentification(); String opconName; long startTime; long endTime; if (orgActivities.isEmpty()) { if (adCon != null) { OpConInfo adconInfo = new OpConInfo(adconName, adConRelationship.getStartTime(), adConRelationship.getEndTime()); opconInfos.add(adconInfo); } return opconInfos; } OrgActivity firstOrgActivity = (OrgActivity) orgActivities.first(); if ((adCon!= null) && (firstOrgActivity.getStartTime() > adConRelationship.getStartTime())) { // Start with adcon Info opconName = adconName; startTime = adConRelationship.getStartTime(); endTime = adConRelationship.getEndTime(); } else { opconName = firstOrgActivity.getOpCon(); startTime = firstOrgActivity.getStartTime(); endTime = firstOrgActivity.getEndTime(); } for (Iterator iterator = orgActivities.iterator(); iterator.hasNext();) { OrgActivity orgActivity = (OrgActivity) iterator.next(); if (!orgActivity.getOpCon().equals(opconName)) { OpConInfo opConInfo = new OpConInfo(opconName, startTime, endTime); opconInfos.add(opConInfo); opconName = orgActivity.getOpCon(); startTime = orgActivity.getStartTime(); } endTime = orgActivity.getEndTime(); } if ((adCon == null) || (adConRelationship.getEndTime() < endTime)) { OpConInfo opConInfo = new OpConInfo(opconName, startTime, endTime); opconInfos.add(opConInfo); } else { if (!opconName.equals(adconName)) { OpConInfo opConInfo = new OpConInfo(opconName, startTime, endTime); opconInfos.add(opConInfo); startTime = endTime; } OpConInfo opConInfo = new OpConInfo(adconName, startTime, adConRelationship.getEndTime()); opconInfos.add(opConInfo); } if (myLogger.isDebugEnabled()) { myLogger.debug(getAgentIdentifier() + ": buildOpConInfos returning " + opconInfos); } return opconInfos; }
7171 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7171/b2150d9945e95d8b6f8630cf9fbc3fa0bea0e94d/OrgDataPlugin.java/clean/glm/src/org/cougaar/mlm/plugin/organization/OrgDataPlugin.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 3858, 17411, 1382, 950, 6952, 694, 1361, 3817, 442, 7655, 12, 3989, 17411, 1382, 950, 6952, 694, 2358, 21101, 13, 288, 565, 3858, 17411, 1382, 950, 6952, 694, 1061, 591, 7655, 273, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 3858, 17411, 1382, 950, 6952, 694, 1361, 3817, 442, 7655, 12, 3989, 17411, 1382, 950, 6952, 694, 2358, 21101, 13, 288, 565, 3858, 17411, 1382, 950, 6952, 694, 1061, 591, 7655, 273, ...
AST __t1929 = _t; AST tmp1988_AST_in = (AST)_t;
AST __t1935 = _t; AST tmp2000_AST_in = (AST)_t;
public final void getstate(AST _t) throws RecognitionException { AST getstate_AST_in = (_t == ASTNULL) ? null : (AST)_t; AST __t1929 = _t; AST tmp1988_AST_in = (AST)_t; match(_t,GET); _t = _t.getFirstChild(); findwhich(_t); _t = _retTree; AST tmp1989_AST_in = (AST)_t; match(_t,ID); _t = _t.getNextSibling(); { _loop1931: do { if (_t==null) _t=ASTNULL; switch ( _t.getType()) { case EXCLUSIVELOCK: case NOLOCK: case SHARELOCK: { lockhow(_t); _t = _retTree; break; } case NOWAIT: { AST tmp1990_AST_in = (AST)_t; match(_t,NOWAIT); _t = _t.getNextSibling(); break; } default: { break _loop1931; } } } while (true); } state_end(_t); _t = _retTree; _t = __t1929; _t = _t.getNextSibling(); _retTree = _t; }
13952 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13952/daa15e07422d3491bbbb4d0060450c81983332a4/TreeParser01.java/buggy/trunk/org.prorefactor.core/src/org/prorefactor/treeparser01/TreeParser01.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 336, 2019, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 336, 2019, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, 446, 294, 261, 9053, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 336, 2019, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 336, 2019, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, 446, 294, 261, 9053, ...
TextViewer viewer = addRepositoryText(repository, sectionComposite, getRepositoryTaskData().getDescription(),
TextViewer viewer = addRepositoryTextViewer(repository, sectionComposite, getRepositoryTaskData().getDescription(),
protected void createDescriptionLayout(Composite composite) { final Section section = toolkit.createSection(composite, ExpandableComposite.TITLE_BAR | Section.TWISTIE); section.setText(LABEL_SECTION_DESCRIPTION); section.setExpanded(true); section.setLayout(new GridLayout()); section.setLayoutData(new GridData(GridData.FILL_HORIZONTAL)); section.addExpansionListener(new IExpansionListener() { public void expansionStateChanging(ExpansionEvent e) { form.reflow(true); } public void expansionStateChanged(ExpansionEvent e) { form.reflow(true); } }); final Composite sectionComposite = toolkit.createComposite(section); section.setClient(sectionComposite); GridLayout addCommentsLayout = new GridLayout(); addCommentsLayout.numColumns = 1; sectionComposite.setLayout(addCommentsLayout); GridData sectionCompositeData = new GridData(GridData.FILL_HORIZONTAL); sectionComposite.setLayoutData(sectionCompositeData); TextViewer viewer = addRepositoryText(repository, sectionComposite, getRepositoryTaskData().getDescription(), SWT.MULTI | SWT.WRAP); final StyledText styledText = viewer.getTextWidget(); styledText.addListener(SWT.FocusIn, new DescriptionListener()); styledText.setLayout(new GridLayout()); GridDataFactory.fillDefaults().hint(DESCRIPTION_WIDTH, SWT.DEFAULT).applyTo(styledText); texts.add(textsindex, styledText); textHash.put(getRepositoryTaskData().getDescription(), styledText); textsindex++; }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/3cadf1d4fe7ee5bfe2841c88dcb73dc0d1c1f333/AbstractRepositoryTaskEditor.java/clean/org.eclipse.mylyn.tasks.ui/src/org/eclipse/mylyn/internal/tasks/ui/editors/AbstractRepositoryTaskEditor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 752, 3291, 3744, 12, 9400, 9635, 13, 288, 202, 202, 6385, 10092, 2442, 273, 5226, 8691, 18, 2640, 5285, 12, 27676, 16, 16429, 429, 9400, 18, 14123, 67, 21908, 571, 10092, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 752, 3291, 3744, 12, 9400, 9635, 13, 288, 202, 202, 6385, 10092, 2442, 273, 5226, 8691, 18, 2640, 5285, 12, 27676, 16, 16429, 429, 9400, 18, 14123, 67, 21908, 571, 10092, ...
super.buildUI( parent ); container.setLayout( WidgetUtil.createGridLayout( 6 ) );
container = new ScrolledComposite( parent, SWT.H_SCROLL | SWT.V_SCROLL ); container.setLayoutData( new GridData( GridData.FILL_BOTH ) ); ((ScrolledComposite)container).setExpandHorizontal( true ); ((ScrolledComposite)container).setExpandVertical( true ); container.addControlListener( new ControlAdapter( ) { public void controlResized( ControlEvent e ) { computeSize( ); } } ); container.addDisposeListener( new DisposeListener( ) { public void widgetDisposed( DisposeEvent e ) { deRegisterListeners( ); } } ); composite = new Composite(container,SWT.NONE); composite.setLayoutData( new GridData(GridData.FILL_BOTH) ); if ( sections == null ) sections = new SortMap( ); composite.setLayout( WidgetUtil.createGridLayout( 6 ) );
public void buildUI( Composite parent ) { super.buildUI( parent ); container.setLayout( WidgetUtil.createGridLayout( 6 ) ); dataSetProvider = new DataSetDescriptorProvider( ); dataSetSection = new ComboAndButtonSection( dataSetProvider.getDisplayName( ), container, true ); dataSetSection.setProvider( dataSetProvider ); dataSetSection.addButtonSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { dataSetProvider.bindingDialog( ); } } ); dataSetSection.setWidth( 300 ); dataSetSection.setButtonText( BUTTON_BINDING ); dataSetSection.setGridPlaceholder( 2, true ); dataSetProvider.setComboAndButtonSection( dataSetSection ); addSection( PageSectionId.BINDING_DATASET, dataSetSection ); dataSetFormProvider = new DataSetColumnBindingsFormHandleProvider( ); dataSetFormSection = new FormSection( dataSetFormProvider.getDisplayName( ), container, true ); dataSetFormSection.setCustomForm( new DataSetColumnBindingsFormDescriptor( ) ); dataSetFormSection.setProvider( dataSetFormProvider ); dataSetFormSection.showDisplayLabel( true ); dataSetFormSection.setButtonWithDialog( true ); dataSetFormSection.setStyle( FormPropertyDescriptor.FULL_FUNCTION ); dataSetFormSection.setFillForm( true ); dataSetFormSection.setGridPlaceholder( 1, true ); addSection( PageSectionId.BINDING_DATASET_FORM, dataSetFormSection ); dataSetProvider.setDependedProvider( dataSetFormProvider ); createSections( ); layoutSections( ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/19cf940d7c0ea372fd90f700fb83579aca7f3913/BindingPage.java/clean/UI/org.eclipse.birt.report.designer.ui.views/src/org/eclipse/birt/report/designer/internal/ui/views/attributes/page/BindingPage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1361, 5370, 12, 14728, 982, 225, 262, 202, 95, 202, 202, 9565, 18, 3510, 5370, 12, 982, 11272, 202, 202, 3782, 18, 542, 3744, 12, 11103, 1304, 18, 2640, 6313, 3744, 12, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1361, 5370, 12, 14728, 982, 225, 262, 202, 95, 202, 202, 9565, 18, 3510, 5370, 12, 982, 11272, 202, 202, 3782, 18, 542, 3744, 12, 11103, 1304, 18, 2640, 6313, 3744, 12, ...
return new Token( s, 0, s.length(), token.type() );
return new Token( s, token.startOffset(), token.endOffset(), token.type());
public final Token next() throws IOException { if ( ( token = input.next() ) == null ) { return null; } // Check the exclusiontable else if ( exclusions != null && exclusions.contains( token.termText() ) ) { return token; } else { String s = stemmer.stem( token.termText() ); // If not stemmed, dont waste the time creating a new token if ( !s.equals( token.termText() ) ) { return new Token( s, 0, s.length(), token.type() ); } return token; } }
1514 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1514/70e1848949e9ac551af0e763313b17746dcf8c20/FrenchStemFilter.java/clean/sandbox/contributions/analyzers/src/java/org/apache/lucene/analysis/fr/FrenchStemFilter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 3155, 1024, 1435, 202, 202, 15069, 1860, 288, 202, 202, 430, 261, 261, 1147, 273, 810, 18, 4285, 1435, 262, 422, 446, 262, 288, 1082, 202, 2463, 446, 31, 202, 202, 97, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 3155, 1024, 1435, 202, 202, 15069, 1860, 288, 202, 202, 430, 261, 261, 1147, 273, 810, 18, 4285, 1435, 262, 422, 446, 262, 288, 1082, 202, 2463, 446, 31, 202, 202, 97, ...
checkStereotype(attr, ATTR11, "attrstereo2");
checkStereotype(attr, ATTR11, new String[] {"attrstereo2"}); attr = Model.getCoreFactory().buildAttribute(ns, intType); Model.getCoreHelper().setNamespace(attr, ns); checkStereotype(attr, ATTR13, new String[] {"attrstereo1", "attrstereo2"});
public void testAttributeStereotype() throws ParseException { Object attr; Object ns = ProjectManager.getManager().getCurrentProject().getModel(); Object intType = ProjectManager.getManager().getCurrentProject().findType("int"); attr = Model.getCoreFactory().buildAttribute(ns, intType); Model.getCoreHelper().setNamespace(attr, ns); softAddStereotype("attrstereo1", attr); softAddStereotype("attrstereo2", attr); attr = Model.getCoreFactory().buildAttribute(ns, intType); Model.getCoreHelper().setNamespace(attr, ns); checkStereotype(attr, ATTR01, null); attr = Model.getCoreFactory().buildAttribute(ns, intType); Model.getCoreHelper().setNamespace(attr, ns); checkStereotype(attr, ATTR10, "attrstereo1"); attr = Model.getCoreFactory().buildAttribute(ns, intType); Model.getCoreHelper().setNamespace(attr, ns); checkStereotype(attr, ATTR11, "attrstereo2");// checkStereotype(attr, ATTR01, "attrstereo2"); }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/8ba8acaf4914aba6e4c9d3a3691b9420ba04785f/TestParserDisplay.java/buggy/tests/org/argouml/uml/generator/TestParserDisplay.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 1499, 55, 387, 73, 10570, 1435, 1216, 10616, 288, 3639, 1033, 1604, 31, 3639, 1033, 3153, 273, 2868, 5420, 1318, 18, 588, 1318, 7675, 588, 3935, 4109, 7675, 588, 1488, 56...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 1499, 55, 387, 73, 10570, 1435, 1216, 10616, 288, 3639, 1033, 1604, 31, 3639, 1033, 3153, 273, 2868, 5420, 1318, 18, 588, 1318, 7675, 588, 3935, 4109, 7675, 588, 1488, 56...
getTab().deselectAll();
if (getTab() != null) getTab().deselectAll();
public void execute() throws Exception { restoreMainView(); getView().clear(); setTab(getMainTab()); getTab().deselectAll(); }
14127 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/14127/c462f3acd6413dc3933707dd09afba9d810e5b50/GoListAction.java/buggy/OpenXava/src/org/openxava/actions/GoListAction.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1836, 1435, 1216, 1185, 288, 202, 202, 13991, 6376, 1767, 5621, 202, 202, 588, 1767, 7675, 8507, 5621, 202, 202, 542, 5661, 12, 588, 6376, 5661, 10663, 202, 202, 588, 5661,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1836, 1435, 1216, 1185, 288, 202, 202, 13991, 6376, 1767, 5621, 202, 202, 588, 1767, 7675, 8507, 5621, 202, 202, 542, 5661, 12, 588, 6376, 5661, 10663, 202, 202, 588, 5661,...
IResourceDelta delta) throws CoreException {
IResourceDelta delta) {
public void invokeOldBuilder(int kind, Map args, IProgressMonitor monitor, IResourceDelta delta) throws CoreException { if (this.getProject() == null) { monitor.done(); return; } monitor.beginTask(AntBuildMessages.getString("Build.Monitor.Title"), WOAntBuilder.TOTAL_WORK_UNITS); if (!Preferences.getPREF_RUN_WOBUILDER_ON_BUILD() || getProject() == null || !getProject().exists()) { monitor.done(); return; } String aBuildFile = null; try { if (!projectNeedsAnUpdate(delta) && kind != IncrementalProjectBuilder.FULL_BUILD) { monitor.done(); return; } aBuildFile = this.buildFile(); if (checkIfBuildfileExist(aBuildFile)) { getProject().getFile(aBuildFile).deleteMarkers( BuilderPlugin.MARKER_TASK_GENERIC, false, IResource.DEPTH_ONE); this.execute(monitor, aBuildFile); } } catch (Exception e) { this.handleException(e); } aBuildFile = null; /* * monitor.beginTask( BuildMessages.getString("Build.Refresh.Title"), * WOAntBuilder.TOTAL_WORK_UNITS); */ // this.forgetLastBuiltState(); // getProject().refreshLocal(IProject.DEPTH_INFINITE, monitor); monitor.done(); }
50596 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50596/a9566de4a3396ad9c714bf76b76cad9058b19024/WOAntBuilder.java/buggy/wolips/plugins/org.objectstyle.wolips.builder/java/org/objectstyle/wolips/builder/internal/WOAntBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4356, 7617, 1263, 12, 474, 3846, 16, 1635, 833, 16, 467, 5491, 7187, 6438, 16, 1082, 202, 45, 1420, 9242, 3622, 13, 1216, 30015, 288, 202, 202, 430, 261, 2211, 18, 588, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 4356, 7617, 1263, 12, 474, 3846, 16, 1635, 833, 16, 467, 5491, 7187, 6438, 16, 1082, 202, 45, 1420, 9242, 3622, 13, 1216, 30015, 288, 202, 202, 430, 261, 2211, 18, 588, ...
if(expression instanceof PsiReferenceExpression) { final PsiElement referent = ((PsiReferenceExpression) expression).resolve(); if(referent instanceof PsiEnumConstant) return true;
if(expression instanceof PsiReferenceExpression){ final PsiElement referent = ((PsiReference) expression).resolve(); if(referent instanceof PsiEnumConstant){ return true; }
private static boolean canBeCaseLabel(PsiExpression expression){ if(expression == null){ return false; } if(expression instanceof PsiReferenceExpression) { final PsiElement referent = ((PsiReferenceExpression) expression).resolve(); if(referent instanceof PsiEnumConstant) return true; } final PsiType type = expression.getType(); if(type == null){ return false; } if(!type.equals(PsiType.INT) && !type.equals(PsiType.CHAR) && !type.equals(PsiType.LONG) && !type.equals(PsiType.SHORT)){ return false; } return PsiUtil.isConstantExpression(expression); }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/3837c95856454e21e9059f3aa91174a1e2c65526/CaseUtil.java/buggy/plugins/IntentionPowerPak/src/com/siyeh/ipp/switchtoif/CaseUtil.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 1250, 24978, 2449, 2224, 12, 52, 7722, 2300, 2652, 15329, 3639, 309, 12, 8692, 422, 446, 15329, 5411, 327, 629, 31, 3639, 289, 3639, 309, 12, 8692, 1276, 453, 7722, 2404, 2300,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 1250, 24978, 2449, 2224, 12, 52, 7722, 2300, 2652, 15329, 3639, 309, 12, 8692, 422, 446, 15329, 5411, 327, 629, 31, 3639, 289, 3639, 309, 12, 8692, 1276, 453, 7722, 2404, 2300,...
GenericValue invoiceItem = delegator.makeValue("InvoiceItem", UtilMisc.toMap("invoiceId", invoiceId, "invoiceItemSeqId", invoiceItemSeqId)); invoiceItem.set("invoiceItemTypeId", getInvoiceItemType(delegator, (orderItem == null ? null : orderItem.getString("orderItemTypeId")), (product == null ? null : product.getString("productTypeId")), invoiceType, "INV_FPROD_ITEM")); invoiceItem.set("description", orderItem.get("itemDescription")); invoiceItem.set("quantity", new Double(billingQuantity.doubleValue())); invoiceItem.set("amount", orderItem.get("unitPrice")); invoiceItem.set("productId", orderItem.get("productId")); invoiceItem.set("productFeatureId", orderItem.get("productFeatureId")); invoiceItem.set("overrideGlAccountId", orderItem.get("overrideGlAccountId"));
BigDecimal billingAmount = orderItem.getBigDecimal("unitPrice").setScale(decimals, rounding); Map createInvoiceItemContext = FastMap.newInstance(); createInvoiceItemContext.put("invoiceId", invoiceId); createInvoiceItemContext.put("invoiceItemSeqId", invoiceItemSeqId); createInvoiceItemContext.put("invoiceItemTypeId", getInvoiceItemType(delegator, (orderItem == null ? null : orderItem.getString("orderItemTypeId")), (product == null ? null : product.getString("productTypeId")), invoiceType, "INV_FPROD_ITEM")); createInvoiceItemContext.put("description", orderItem.get("itemDescription")); createInvoiceItemContext.put("quantity", new Double(billingQuantity.doubleValue())); createInvoiceItemContext.put("amount", new Double(billingAmount.doubleValue())); createInvoiceItemContext.put("productId", orderItem.get("productId")); createInvoiceItemContext.put("productFeatureId", orderItem.get("productFeatureId")); createInvoiceItemContext.put("overrideGlAccountId", orderItem.get("overrideGlAccountId")); createInvoiceItemContext.put("userLogin", userLogin);
public static Map createInvoiceForOrder(DispatchContext dctx, Map context) { GenericDelegator delegator = dctx.getDelegator(); LocalDispatcher dispatcher = dctx.getDispatcher(); GenericValue userLogin = (GenericValue) context.get("userLogin"); Locale locale = (Locale) context.get("locale"); if (decimals == -1 || rounding == -1) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingAritmeticPropertiesNotConfigured",locale)); } String orderId = (String) context.get("orderId"); List billItems = (List) context.get("billItems"); boolean previousInvoiceFound = false; if (billItems == null || billItems.size() == 0) { Debug.logVerbose("No order items to invoice; not creating invoice; returning success", module); return ServiceUtil.returnSuccess(UtilProperties.getMessage(resource,"AccountingNoOrderItemsToInvoice",locale)); } try { List toStore = new LinkedList(); GenericValue orderHeader = delegator.findByPrimaryKey("OrderHeader", UtilMisc.toMap("orderId", orderId)); if (orderHeader == null) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingNoOrderHeader",locale)); } // get list of previous invoices for the order List billedItems = delegator.findByAnd("OrderItemBilling", UtilMisc.toMap("orderId", orderId)); if (billedItems != null && billedItems.size() > 0) { boolean nonDigitalInvoice = false; Iterator bii = billedItems.iterator(); while (bii.hasNext() && !nonDigitalInvoice) { GenericValue orderItemBilling = (GenericValue) bii.next(); GenericValue invoiceItem = orderItemBilling.getRelatedOne("InvoiceItem"); if (invoiceItem != null) { String invoiceItemType = invoiceItem.getString("invoiceItemTypeId"); if (invoiceItemType != null) { if ("INV_FPROD_ITEM".equals(invoiceItemType) || "INV_PROD_FEATR_ITEM".equals(invoiceItemType)) { nonDigitalInvoice = true; } } } } if (nonDigitalInvoice) { previousInvoiceFound = true; } } // figure out the invoice type String invoiceType = null; String orderType = orderHeader.getString("orderTypeId"); if (orderType.equals("SALES_ORDER")) { invoiceType = "SALES_INVOICE"; } else if (orderType.equals("PURCHASE_ORDER")) { invoiceType = "PURCHASE_INVOICE"; } // Make an order read helper from the order OrderReadHelper orh = new OrderReadHelper(orderHeader); // get the product store GenericValue productStore = delegator.findByPrimaryKey("ProductStore", UtilMisc.toMap("productStoreId", orh.getProductStoreId())); // get the shipping adjustment mode (Y = Pro-Rate; N = First-Invoice) String prorateShipping = productStore.getString("prorateShipping"); if (prorateShipping == null) { prorateShipping = "Y"; } // get the billing parties String billToCustomerPartyId = orh.getBillToParty().getString("partyId"); String billFromVendorPartyId = orh.getBillFromParty().getString("partyId"); // get some quantity totals BigDecimal totalItemsInOrder = orh.getTotalOrderItemsQuantityBd(); // get some price totals BigDecimal shippableAmount = orh.getShippableTotalBd(null); BigDecimal orderSubTotal = orh.getOrderItemsSubTotalBd(); BigDecimal invoiceShipProRateAmount = ZERO; BigDecimal invoiceSubTotal = ZERO; BigDecimal invoiceQuantity = ZERO; GenericValue billingAccount = orderHeader.getRelatedOne("BillingAccount"); String billingAccountId = billingAccount != null ? billingAccount.getString("billingAccountId") : null; // TODO: ideally this should be the same time as when a shipment is sent and be passed in as a parameter Timestamp invoiceDate = UtilDateTime.nowTimestamp(); // TODO: perhaps consider billing account net days term as well? Long orderTermNetDays = orh.getOrderTermNetDays(); Timestamp dueDate = null; if (orderTermNetDays != null) { dueDate = UtilDateTime.getDayEnd(invoiceDate, orderTermNetDays.intValue()); } // create the invoice record Map createInvoiceContext = FastMap.newInstance(); createInvoiceContext.put("partyId", billToCustomerPartyId); createInvoiceContext.put("partyIdFrom", billFromVendorPartyId); createInvoiceContext.put("billingAccountId", billingAccountId); createInvoiceContext.put("invoiceDate", invoiceDate); createInvoiceContext.put("dueDate", dueDate); createInvoiceContext.put("invoiceTypeId", invoiceType); // start with INVOICE_IN_PROCESS, in the INVOICE_READY we can't change the invoice (or shouldn't be able to...) createInvoiceContext.put("statusId", "INVOICE_IN_PROCESS"); createInvoiceContext.put("currencyUomId", orderHeader.getString("currencyUom")); createInvoiceContext.put("userLogin", userLogin); // store the invoice first Map createInvoiceResult = dispatcher.runSync("createInvoice", createInvoiceContext); if (ServiceUtil.isError(createInvoiceResult)) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingErrorCreatingInvoiceFromOrder",locale), null, null, createInvoiceResult); } // call service, not direct entity op: delegator.create(invoice); String invoiceId = (String) createInvoiceResult.get("invoiceId"); // order roles to invoice roles List orderRoles = orderHeader.getRelated("OrderRole"); if (orderRoles != null) { Iterator orderRolesIt = orderRoles.iterator(); Map createInvoiceRoleContext = FastMap.newInstance(); createInvoiceRoleContext.put("invoiceId", invoiceId); createInvoiceRoleContext.put("userLogin", userLogin); while (orderRolesIt.hasNext()) { GenericValue orderRole = (GenericValue)orderRolesIt.next(); createInvoiceRoleContext.put("partyId", orderRole.getString("partyId")); createInvoiceRoleContext.put("roleTypeId", orderRole.getString("roleTypeId")); Map createInvoiceRoleResult = dispatcher.runSync("createInvoiceRole", createInvoiceRoleContext); if (ServiceUtil.isError(createInvoiceRoleResult)) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingErrorCreatingInvoiceFromOrder",locale), null, null, createInvoiceRoleResult); } } } // order terms to invoice terms. Implemented for purchase orders, although it may be useful // for sales orders as well. Later it might be nice to filter OrderTerms to only copy over financial terms. List orderTerms = orh.getOrderTerms(); toStore.addAll(createInvoiceTerms(delegator, invoiceId, orderTerms)); // billing accounts List billingAccountTerms = null; // for billing accounts we will use related information if (billingAccount != null) { // get the billing account terms billingAccountTerms = billingAccount.getRelated("BillingAccountTerm"); // set the invoice terms as defined for the billing account toStore.addAll(createInvoiceTerms(delegator, invoiceId, billingAccountTerms)); // set the invoice bill_to_customer from the billing account List billToRoles = billingAccount.getRelated("BillingAccountRole", UtilMisc.toMap("roleTypeId", "BILL_TO_CUSTOMER"), null); Iterator billToIter = billToRoles.iterator(); while (billToIter.hasNext()) { GenericValue billToRole = (GenericValue) billToIter.next(); if (!(billToRole.getString("partyId").equals(billToCustomerPartyId))) { GenericValue invoiceRole = delegator.makeValue("InvoiceRole", UtilMisc.toMap("invoiceId", invoiceId)); invoiceRole.set("partyId", billToRole.get("partyId")); invoiceRole.set("roleTypeId", "BILL_TO_CUSTOMER"); toStore.add(invoiceRole); } } // set the bill-to contact mech as the contact mech of the billing account if (UtilValidate.isNotEmpty(billingAccount.getString("contactMechId"))) { GenericValue billToContactMech = delegator.makeValue("InvoiceContactMech", UtilMisc.toMap("invoiceId", invoiceId)); billToContactMech.set("contactMechId", billingAccount.getString("contactMechId")); billToContactMech.set("contactMechPurposeTypeId", "BILLING_LOCATION"); toStore.add(billToContactMech); } } else { List billingLocations = orh.getBillingLocations(); if (billingLocations != null) { Iterator bli = billingLocations.iterator(); while (bli.hasNext()) { GenericValue ocm = (GenericValue) bli.next(); GenericValue billToContactMech = delegator.makeValue("InvoiceContactMech", UtilMisc.toMap("invoiceId", invoiceId)); billToContactMech.set("contactMechId", ocm.getString("contactMechId")); billToContactMech.set("contactMechPurposeTypeId", "BILLING_LOCATION"); toStore.add(billToContactMech); } } } // get a list of the payment method types //DEJ20050705 doesn't appear to be used: List paymentPreferences = orderHeader.getRelated("OrderPaymentPreference"); // create the bill-from (or pay-to) contact mech as the primary PAYMENT_LOCATION of the party from the store GenericValue payToAddress = null; if (invoiceType.equals("PURCHASE_INVOICE")) { // for purchase orders, the pay to address is the BILLING_LOCATION of the vendor GenericValue billFromVendor = orh.getPartyFromRole("BILL_FROM_VENDOR"); if (billFromVendor != null) { List billingContactMechs = billFromVendor.getRelatedOne("Party").getRelatedByAnd("PartyContactMechPurpose", UtilMisc.toMap("contactMechPurposeTypeId", "BILLING_LOCATION")); if ((billingContactMechs != null) && (billingContactMechs.size() > 0)) { payToAddress = (GenericValue) billingContactMechs.get(0); } } } else { // for sales orders, it is the payment address on file for the store payToAddress = PaymentWorker.getPaymentAddress(delegator, productStore.getString("payToPartyId")); } if (payToAddress != null) { GenericValue payToCm = delegator.makeValue("InvoiceContactMech", UtilMisc.toMap("invoiceId", invoiceId)); payToCm.set("contactMechId", payToAddress.getString("contactMechId")); payToCm.set("contactMechPurposeTypeId", "PAYMENT_LOCATION"); toStore.add(payToCm); } // sequence for items - all OrderItems or InventoryReservations + all Adjustments int invoiceItemSeqNum = 1; String invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); // create the item records if (billItems != null) { Iterator itemIter = billItems.iterator(); while (itemIter.hasNext()) { GenericValue itemIssuance = null; GenericValue orderItem = null; GenericValue shipmentReceipt = null; GenericValue currentValue = (GenericValue) itemIter.next(); if ("ItemIssuance".equals(currentValue.getEntityName())) { itemIssuance = currentValue; } else if ("OrderItem".equals(currentValue.getEntityName())) { orderItem = currentValue; } else if ("ShipmentReceipt".equals(currentValue.getEntityName())) { shipmentReceipt = currentValue; } else { Debug.logError("Unexpected entity " + currentValue + " of type " + currentValue.getEntityName(), module); } if (orderItem == null && itemIssuance != null) { orderItem = itemIssuance.getRelatedOne("OrderItem"); } else if ((orderItem == null) && (shipmentReceipt != null)) { orderItem = shipmentReceipt.getRelatedOne("OrderItem"); } else if ((orderItem == null) && (itemIssuance == null) && (shipmentReceipt == null)) { Debug.logError("Cannot create invoice when orderItem, itemIssuance, and shipmentReceipt are all null", module); return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingIllegalValuesPassedToCreateInvoiceService",locale)); } GenericValue product = null; if (orderItem.get("productId") != null) { product = orderItem.getRelatedOne("Product"); } // get some quantities BigDecimal orderedQuantity = orderItem.getBigDecimal("quantity"); BigDecimal billingQuantity = null; if (itemIssuance != null) { billingQuantity = itemIssuance.getBigDecimal("quantity"); } else if (shipmentReceipt != null) { billingQuantity = shipmentReceipt.getBigDecimal("quantityAccepted"); } else { billingQuantity = orderedQuantity; } if (orderedQuantity == null) orderedQuantity = ZERO; if (billingQuantity == null) billingQuantity = ZERO; // check if shipping applies to this item. Shipping is calculated for sales invoices, not purchase invoices. boolean shippingApplies = false; if ((product != null) && (ProductWorker.shippingApplies(product)) && (invoiceType.equals("SALES_INVOICE"))) { shippingApplies = true; } GenericValue invoiceItem = delegator.makeValue("InvoiceItem", UtilMisc.toMap("invoiceId", invoiceId, "invoiceItemSeqId", invoiceItemSeqId)); invoiceItem.set("invoiceItemTypeId", getInvoiceItemType(delegator, (orderItem == null ? null : orderItem.getString("orderItemTypeId")), (product == null ? null : product.getString("productTypeId")), invoiceType, "INV_FPROD_ITEM")); invoiceItem.set("description", orderItem.get("itemDescription")); invoiceItem.set("quantity", new Double(billingQuantity.doubleValue())); invoiceItem.set("amount", orderItem.get("unitPrice")); invoiceItem.set("productId", orderItem.get("productId")); invoiceItem.set("productFeatureId", orderItem.get("productFeatureId")); invoiceItem.set("overrideGlAccountId", orderItem.get("overrideGlAccountId")); //invoiceItem.set("uomId", ""); String itemIssuanceId = null; if (itemIssuance != null && itemIssuance.get("inventoryItemId") != null) { itemIssuanceId = itemIssuance.getString("itemIssuanceId"); invoiceItem.set("inventoryItemId", itemIssuance.get("inventoryItemId")); } // similarly, tax only for purchase invoices if ((product != null) && (invoiceType.equals("SALES_INVOICE"))) { invoiceItem.set("taxableFlag", product.get("taxable")); } toStore.add(invoiceItem); // this item total BigDecimal thisAmount = invoiceItem.getBigDecimal("amount").multiply(invoiceItem.getBigDecimal("quantity")).setScale(decimals, rounding); // add to the ship amount only if it applies to this item if (shippingApplies) { invoiceShipProRateAmount = invoiceShipProRateAmount.add(thisAmount).setScale(decimals, rounding); } // increment the invoice subtotal invoiceSubTotal = invoiceSubTotal.add(thisAmount).setScale(decimals, rounding); // increment the invoice quantity invoiceQuantity = invoiceQuantity.add(billingQuantity).setScale(decimals, rounding); // create the OrderItemBilling record GenericValue orderItemBill = delegator.makeValue("OrderItemBilling", UtilMisc.toMap("invoiceId", invoiceId, "invoiceItemSeqId", invoiceItemSeqId)); orderItemBill.set("orderId", orderItem.get("orderId")); orderItemBill.set("orderItemSeqId", orderItem.get("orderItemSeqId")); orderItemBill.set("itemIssuanceId", itemIssuanceId); if ((shipmentReceipt != null) && (shipmentReceipt.getString("receiptId") != null)) { orderItemBill.set("shipmentReceiptId", shipmentReceipt.getString("receiptId")); } orderItemBill.set("quantity", invoiceItem.get("quantity")); orderItemBill.set("amount", invoiceItem.get("amount")); toStore.add(orderItemBill); String parentInvoiceItemSeqId = invoiceItemSeqId; // increment the counter invoiceItemSeqNum++; invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); // create the item adjustment as line items List itemAdjustments = OrderReadHelper.getOrderItemAdjustmentList(orderItem, orh.getAdjustments()); Iterator itemAdjIter = itemAdjustments.iterator(); while (itemAdjIter.hasNext()) { GenericValue adj = (GenericValue) itemAdjIter.next(); if (adj.get("amount") != null) { // pro-rate the amount // set decimals = 100 means we don't round this intermediate value, which is very important BigDecimal amount = adj.getBigDecimal("amount").divide(orderItem.getBigDecimal("quantity"), 100, rounding); amount = amount.multiply(invoiceItem.getBigDecimal("quantity")); amount = amount.setScale(decimals, rounding); GenericValue adjInvItem = delegator.makeValue("InvoiceItem", UtilMisc.toMap("invoiceId", invoiceId, "invoiceItemSeqId", invoiceItemSeqId)); adjInvItem.set("invoiceItemTypeId", getInvoiceItemType(delegator, adj.getString("orderAdjustmentTypeId"), null, invoiceType, "INVOICE_ITM_ADJ")); adjInvItem.set("productId", orderItem.get("productId")); adjInvItem.set("productFeatureId", orderItem.get("productFeatureId")); adjInvItem.set("parentInvoiceId", invoiceId); adjInvItem.set("parentInvoiceItemSeqId", parentInvoiceItemSeqId); //adjInvItem.set("uomId", ""); // invoice items for sales tax are not taxable themselves // TODO: This is not an ideal solution. Instead, we need to use OrderAdjustment.includeInTax when it is implemented if (!(adj.getString("orderAdjustmentTypeId").equals("SALES_TAX"))) { adjInvItem.set("taxableFlag", product.get("taxable")); } adjInvItem.set("quantity", new Double(1)); adjInvItem.set("amount", new Double(amount.doubleValue())); adjInvItem.set("description", adj.get("description")); adjInvItem.set("taxAuthPartyId", adj.get("taxAuthPartyId")); adjInvItem.set("overrideGlAccountId", adj.get("overrideGlAccountId")); adjInvItem.set("taxAuthGeoId", adj.get("taxAuthGeoId")); adjInvItem.set("taxAuthorityRateSeqId", adj.get("taxAuthorityRateSeqId")); toStore.add(adjInvItem); // this adjustment amount BigDecimal thisAdjAmount = adjInvItem.getBigDecimal("amount").multiply(adjInvItem.getBigDecimal("quantity")).setScale(decimals, rounding); // adjustments only apply to totals when they are not tax or shipping adjustments if (!"SALES_TAX".equals(adj.getString("orderAdjustmentTypeId")) && !"SHIPPING_ADJUSTMENT".equals(adj.getString("orderAdjustmentTypeId"))) { // increment the invoice subtotal invoiceSubTotal = invoiceSubTotal.add(thisAdjAmount).setScale(decimals, rounding); // add to the ship amount only if it applies to this item if (shippingApplies) { invoiceShipProRateAmount = invoiceShipProRateAmount.add(thisAdjAmount).setScale(decimals, rounding); } } // increment the counter invoiceItemSeqNum++; invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); } } } } // create header adjustments as line items -- always to tax/shipping last List shipAdjustments = new ArrayList(); List taxAdjustments = new ArrayList(); List headerAdjustments = orh.getOrderHeaderAdjustments(); Iterator headerAdjIter = headerAdjustments.iterator(); while (headerAdjIter.hasNext()) { GenericValue adj = (GenericValue) headerAdjIter.next(); if ("SHIPPING_CHARGES".equals(adj.getString("orderAdjustmentTypeId"))) { shipAdjustments.add(adj); } else if ("SALES_TAX".equals(adj.getString("orderAdjustmentTypeId"))) { taxAdjustments.add(adj); } else { // these will effect the shipping pro-rate (unless commented) // other adjustment type BigDecimal adjAmount = calcHeaderAdj(delegator, adj, invoiceType, invoiceId, invoiceItemSeqId, toStore, orderSubTotal, invoiceSubTotal, invoiceQuantity, decimals, rounding); // invoiceShipProRateAmount += adjAmount; // do adjustments compound or are they based off subtotal? Here we will (unless commented) // invoiceSubTotal += adjAmount; // increment the counter invoiceItemSeqNum++; invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); } } // next do the shipping adjustments Iterator shipAdjIter = shipAdjustments.iterator(); while (shipAdjIter.hasNext()) { GenericValue adj = (GenericValue) shipAdjIter.next(); if ("N".equalsIgnoreCase(prorateShipping)) { if (previousInvoiceFound) { Debug.logInfo("Previous invoice found for this order [" + orderId + "]; shipping already billed", module); continue; } else { // this is the first invoice; bill it all now BigDecimal adjAmount = calcHeaderAdj(delegator, adj, invoiceType, invoiceId, invoiceItemSeqId, toStore, new BigDecimal("1"), new BigDecimal("1"), totalItemsInOrder, decimals, rounding); // should shipping effect the tax pro-rate? here we do, and we also update order sub total for this adjustment's value invoiceSubTotal = invoiceSubTotal.add(adjAmount).setScale(decimals, rounding); orderSubTotal = orderSubTotal.add(adj.getBigDecimal("amount")).setScale(decimals, rounding); // increment the counter invoiceItemSeqNum++; invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); } } else { // pro-rate the shipping amount based on shippable information BigDecimal adjAmount = calcHeaderAdj(delegator, adj, invoiceType, invoiceId, invoiceItemSeqId, toStore, shippableAmount, invoiceShipProRateAmount, invoiceQuantity, decimals, rounding); // should shipping effect the tax pro-rate? here we do, and we also update order sub total for this adjustment's value invoiceSubTotal = invoiceSubTotal.add(adjAmount).setScale(decimals, rounding); orderSubTotal = orderSubTotal.add(adj.getBigDecimal("amount")).setScale(decimals, rounding); // increment the counter invoiceItemSeqNum++; invoiceItemSeqId = UtilFormatOut.formatPaddedNumber(invoiceItemSeqNum, 2); } } // last do the tax adjustments Iterator taxAdjIter = taxAdjustments.iterator(); while (taxAdjIter.hasNext()) { GenericValue adj = (GenericValue) taxAdjIter.next(); BigDecimal adjAmount = calcHeaderAdj(delegator, adj, invoiceType, invoiceId, invoiceItemSeqId, toStore, orderSubTotal, invoiceSubTotal, invoiceQuantity, taxDecimals, taxRounding); // this doesn't really effect anything; but just for our totals invoiceSubTotal = invoiceSubTotal.add(adjAmount).setScale(decimals, rounding); } // check for previous order payments List orderPaymentPrefs = delegator.findByAnd("OrderPaymentPreference", UtilMisc.toMap("orderId", orderId)); if (orderPaymentPrefs != null) { List currentPayments = new ArrayList(); Iterator opi = orderPaymentPrefs.iterator(); while (opi.hasNext()) { GenericValue paymentPref = (GenericValue) opi.next(); List payments = paymentPref.getRelated("Payment"); currentPayments.addAll(payments); } if (currentPayments.size() > 0) { // apply these payments to the invoice; only if they haven't already been applied Iterator cpi = currentPayments.iterator(); while (cpi.hasNext()) { GenericValue payment = (GenericValue) cpi.next(); List currentApplications = null; currentApplications = payment.getRelated("PaymentApplication"); if (currentApplications == null || currentApplications.size() == 0) { // no applications; okay to apply Map appl = new HashMap(); appl.put("paymentId", payment.get("paymentId")); appl.put("invoiceId", invoiceId); appl.put("billingAccountId", billingAccountId); appl.put("amountApplied", payment.get("amount")); appl.put("userLogin", userLogin); Map createPayApplResult = dispatcher.runSync("createPaymentApplication", appl); if (ServiceUtil.isError(createPayApplResult)) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingErrorCreatingInvoiceFromOrder",locale), null, null, createPayApplResult); } } } } } // store value objects //Debug.log("Storing : " + toStore, module); // TODO BIG TIME: need to get rid of the storeAll/toStore stuff and call all services for these things rather than direct entity ops delegator.storeAll(toStore); // should all be in place now, so set status to INVOICE_READY (unless it's a purchase invoice, which we sets to INVOICE_IN_PROCESS) String nextStatusId = "INVOICE_READY"; if (invoiceType.equals("PURCHASE_INVOICE")) { nextStatusId = "INVOICE_IN_PROCESS"; } Map setInvoiceStatusResult = dispatcher.runSync("setInvoiceStatus", UtilMisc.toMap("invoiceId", invoiceId, "statusId", nextStatusId, "userLogin", userLogin)); if (ServiceUtil.isError(setInvoiceStatusResult)) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingErrorCreatingInvoiceFromOrder",locale), null, null, setInvoiceStatusResult); } // check to see if we are all paid up Map checkResp = dispatcher.runSync("checkInvoicePaymentApplications", UtilMisc.toMap("invoiceId", invoiceId, "userLogin", userLogin)); if (ServiceUtil.isError(checkResp)) { return ServiceUtil.returnError(UtilProperties.getMessage(resource,"AccountingErrorCreatingInvoiceFromOrderCheckPaymentAppl",locale), null, null, checkResp); } Map resp = ServiceUtil.returnSuccess(); resp.put("invoiceId", invoiceId); return resp; } catch (GenericEntityException e) { String errMsg = UtilProperties.getMessage(resource,"AccountingEntityDataProblemCreatingInvoiceFromOrderItems",UtilMisc.toMap("reason",e.toString()),locale); Debug.logError(e, errMsg, module); return ServiceUtil.returnError(errMsg); } catch (GenericServiceException e) { String errMsg = UtilProperties.getMessage(resource,"AccountingServiceOtherProblemCreatingInvoiceFromOrderItems",UtilMisc.toMap("reason",e.toString()),locale); Debug.logError(e, errMsg, module); return ServiceUtil.returnError(errMsg); } }
22229 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/22229/f69d9c6deaed6cb28670d72ef334daa488133ccd/InvoiceServices.java/buggy/applications/accounting/src/org/ofbiz/accounting/invoice/InvoiceServices.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 1635, 752, 10467, 1290, 2448, 12, 5325, 1042, 302, 5900, 16, 1635, 819, 13, 288, 3639, 7928, 15608, 639, 11158, 639, 273, 302, 5900, 18, 588, 15608, 639, 5621, 3639, 3566, 6681...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 1635, 752, 10467, 1290, 2448, 12, 5325, 1042, 302, 5900, 16, 1635, 819, 13, 288, 3639, 7928, 15608, 639, 11158, 639, 273, 302, 5900, 18, 588, 15608, 639, 5621, 3639, 3566, 6681...
while (j < end && dataBuffer [j] == ' ') { j++; } while (end > j && dataBuffer [end - 1] == ' ') { end --; } while (j < end) { char c = dataBuffer [j++]; if (c == ' ') { while (j < end && dataBuffer [j++] == ' ') continue; dataBuffer [i++] = ' '; dataBuffer [i++] = dataBuffer [j - 1]; } else { dataBuffer [i++] = c; } } dataBufferPos = i; }
while (j < end) { char c = dataBuffer[j++]; if (c == ' ') { while (j < end && dataBuffer[j++] == ' ') { continue; } dataBuffer[i++] = ' '; dataBuffer[i++] = dataBuffer[j - 1]; } else { dataBuffer[i++] = c; } } dataBufferPos = i; }
private void dataBufferNormalize () { int i = 0; int j = 0; int end = dataBufferPos; // Skip spaces at the start. while (j < end && dataBuffer [j] == ' ') { j++; } // Skip whitespace at the end. while (end > j && dataBuffer [end - 1] == ' ') { end --; } // Start copying to the left. while (j < end) { char c = dataBuffer [j++]; // Normalise all other spaces to // a single space. if (c == ' ') { while (j < end && dataBuffer [j++] == ' ') continue; dataBuffer [i++] = ' '; dataBuffer [i++] = dataBuffer [j - 1]; } else { dataBuffer [i++] = c; } } // The new length is <= the old one. dataBufferPos = i; }
1739 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1739/7fb7568e63c3fe14af521de4699cb37898923ca7/XmlParser.java/buggy/libjava/gnu/xml/aelfred2/XmlParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 501, 1892, 14380, 1832, 565, 288, 202, 474, 277, 273, 374, 31, 202, 474, 525, 273, 374, 31, 202, 474, 679, 273, 501, 1892, 1616, 31, 202, 759, 6611, 7292, 622, 326, 787, 18...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 501, 1892, 14380, 1832, 565, 288, 202, 474, 277, 273, 374, 31, 202, 474, 525, 273, 374, 31, 202, 474, 679, 273, 501, 1892, 1616, 31, 202, 759, 6611, 7292, 622, 326, 787, 18...
if (persp != null) return persp.getViewReferences(); else return new IViewReference[0];
if (persp != null) { return persp.getViewReferences(); } else { return new IViewReference[0]; }
public IViewReference[] getViewReferences() { Perspective persp = getActivePerspective(); if (persp != null) return persp.getViewReferences(); else return new IViewReference[0]; }
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/fa4a8cff0e027f8d3c6b1fcb92b30f46767dd191/WorkbenchPage.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/WorkbenchPage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 467, 1767, 2404, 8526, 8893, 8221, 1435, 288, 3639, 453, 414, 16772, 13508, 84, 273, 11960, 14781, 16772, 5621, 3639, 309, 261, 10422, 84, 480, 446, 13, 5411, 327, 13508, 84, 18, 58...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 467, 1767, 2404, 8526, 8893, 8221, 1435, 288, 3639, 453, 414, 16772, 13508, 84, 273, 11960, 14781, 16772, 5621, 3639, 309, 261, 10422, 84, 480, 446, 13, 5411, 327, 13508, 84, 18, 58...
DataOutputStream out = new DataOutputStream(new FileOutputStream(f)); if (ConfigIO.writeChunkDescDB (out, db, ConfigIO.DEFAULT)) { db.need_to_save = false; Core.consoleInfoMessage (component_name, "Saved ChunkDesc File: " + f); /* do some fixing up if the name changed */ db.setFile (f); renameDescDB (db, f.getName()); } else { Core.consoleErrorMessage (component_name, "Save failed: " +f); } return db.name;
ConfigIO.writeChunkDescDB (f, db, ConfigIO.DEFAULT); db.need_to_save = false; Core.consoleInfoMessage (component_name, "Saved ChunkDesc File: " + f); /* do some fixing up if the name changed */ db.setFile (f); renameDescDB (db, f.getName()); } catch (IOException e) { Core.consoleErrorMessage (component_name, "Save DescDB failed: " + f);
public String saveDescDBFile (ChunkDescDB db, File f) { if (f == null) return db.name; try { DataOutputStream out = new DataOutputStream(new FileOutputStream(f)); if (ConfigIO.writeChunkDescDB (out, db, ConfigIO.DEFAULT)) { db.need_to_save = false; Core.consoleInfoMessage (component_name, "Saved ChunkDesc File: " + f); /* do some fixing up if the name changed */ db.setFile (f); renameDescDB (db, f.getName()); } else { Core.consoleErrorMessage (component_name, "Save failed: " +f); } return db.name; } catch (IOException e) { Core.consoleErrorMessage (component_name, "IOerror saving file " + f); return db.name; } }
7933 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7933/10b854969f65413cc815bea5c04bca7665b8a67a/ConfigModule.java/clean/modules/jackal/editorgui/org/vrjuggler/jccl/editorgui/ConfigModule.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1923, 4217, 2290, 812, 261, 5579, 4217, 2290, 1319, 16, 1387, 284, 13, 288, 202, 430, 261, 74, 422, 446, 13, 202, 565, 327, 1319, 18, 529, 31, 202, 202, 698, 288, 202, 565,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1923, 4217, 2290, 812, 261, 5579, 4217, 2290, 1319, 16, 1387, 284, 13, 288, 202, 430, 261, 74, 422, 446, 13, 202, 565, 327, 1319, 18, 529, 31, 202, 202, 698, 288, 202, 565,...
private void show(KeyEvent e)
public static void show(KeyEvent e)
private void show(KeyEvent e) { System.out.println("keyCode: " + Integer.toBinaryString(e.keyCode)); System.out.println("character: " + Integer.toBinaryString(e.character)); System.out.println("stateMask: " + Integer.toBinaryString(e.stateMask)); }
36870 /local/tlutelli/issta_data/temp/all_java3context/java/2006_temp/2006/36870/250ab0b57383c119dd271f4d5cff804c36031c5b/SwtWindow.java/clean/gnu/jemacs/swt/SwtWindow.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 918, 2405, 12, 653, 1133, 425, 13, 225, 288, 565, 2332, 18, 659, 18, 8222, 2932, 856, 1085, 30, 282, 315, 397, 2144, 18, 869, 5905, 780, 12, 73, 18, 856, 1085, 10019, 565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 918, 2405, 12, 653, 1133, 425, 13, 225, 288, 565, 2332, 18, 659, 18, 8222, 2932, 856, 1085, 30, 282, 315, 397, 2144, 18, 869, 5905, 780, 12, 73, 18, 856, 1085, 10019, 565, ...
ObjectOutputStream out = new ObjectOutputStream(fout);
out = new ObjectOutputStream(new FileOutputStream(serFile));
public static void assertSerializationWorks(Object toSerialize) throws AssertionFailedError { if( !(toSerialize instanceof Serializable) ) { throw new AssertionFailedError("Object doesn't implement java.io.Serializable interface"); } FileOutputStream fout = null; FileInputStream fin = null; File serFile = null; try { serFile = new File(TEST_FILE); fout = new FileOutputStream(serFile); fin = new FileInputStream(serFile); ObjectOutputStream out = new ObjectOutputStream(fout); out.writeObject(toSerialize); out.flush(); ObjectInputStream in = new ObjectInputStream(fin); Object deserialized = in.readObject(); if( !(toSerialize.equals(deserialized))) { throw new AssertionFailedError("Reconstituted object is expected to be equal to serialized"); } } catch (AssertionFailedError e) { throw e; } catch (Exception e) { throw new AssertionFailedError("Exception while serializing: " + e); } finally { try { if( fout != null ) { fout.close(); } if( fin != null ) { fin.close(); } serFile.delete(); } catch (IOException e1) { // ignore } } }
53026 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/53026/f66923883131e3d1e639d25f5388e46631e28e3e/SerializationTest.java/buggy/tests/src/com/domainlanguage/testutil/SerializationTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1815, 16764, 16663, 12, 921, 358, 10343, 13, 1216, 9067, 2925, 668, 288, 3639, 309, 12, 401, 12, 869, 10343, 1276, 13687, 13, 262, 288, 5411, 604, 394, 9067, 2925, 668, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 1815, 16764, 16663, 12, 921, 358, 10343, 13, 1216, 9067, 2925, 668, 288, 3639, 309, 12, 401, 12, 869, 10343, 1276, 13687, 13, 262, 288, 5411, 604, 394, 9067, 2925, 668, ...
public Member getNode(String id) { if (id == null) {
public Member getNode(MemberInfo mInfo) { if (mInfo == null) {
public Member getNode(String id) { if (id == null) { return null; } if (mySelf.getId().equals(id)) { return mySelf; } return (Member) knownNodes.get(id); }
51438 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51438/1748cb20cb47ddeb395d9aa4094aa385923b8e90/NodeManager.java/buggy/src/main/de/dal33t/powerfolder/net/NodeManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 8596, 5973, 12, 780, 612, 13, 288, 3639, 309, 261, 350, 422, 446, 13, 288, 5411, 327, 446, 31, 3639, 289, 3639, 309, 261, 4811, 10084, 18, 26321, 7675, 14963, 12, 350, 3719, 288, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 8596, 5973, 12, 780, 612, 13, 288, 3639, 309, 261, 350, 422, 446, 13, 288, 5411, 327, 446, 31, 3639, 289, 3639, 309, 261, 4811, 10084, 18, 26321, 7675, 14963, 12, 350, 3719, 288, ...
if (DEBUG) { log.finest("abort-update " + hdr); }
log.log(Level.FINEST, "abort-update {0}", hdr);
public void abort() { if (DEBUG) { if (log.isLoggable(Level.FINEST)) { long[] abortCreateIDs = new long[createdIDs.size()]; int i = 0; for (long key : createdIDs) { abortCreateIDs[i++] = key; } Arrays.sort(abortCreateIDs); log.finest("trans nuking " + createdIDs.size() + " partial creates: " + Arrays.toString(abortCreateIDs)); } else { log.finer(txnID + " trans nuking " + createdIDs.size() + " partial creates"); } } Set<SGSUUID> listeners = new HashSet<SGSUUID>(); Set<Long> dataspaceLocks = new HashSet<Long>(); for (Long l : createdIDs) { try { if (! dataspaceLocks.contains(l)) { trans.lock(l); dataspaceLocks.add(l); } TSODataHeader hdr = (TSODataHeader) trans.read(l); listeners.addAll(hdr.availabilityListeners); if (DEBUG) { log.finest("destroy invalid " + hdr); } trans.destroy(hdr.objectID); trans.destroy(l); lockedObjectsMap.remove(l); } catch (Exception e) { // XXX Remember to throw something at the end e.printStackTrace(); } } for (Long l : deletedIDs) { try { if (! dataspaceLocks.contains(l)) { trans.lock(l); dataspaceLocks.add(l); } TSODataHeader hdr = (TSODataHeader) trans.read(l); listeners.addAll(hdr.availabilityListeners); hdr.free = true; trans.write(l, hdr); lockedObjectsMap.remove(l); if (DEBUG) { log.finest("abort-delete " + hdr); } } catch (Exception e) { // XXX Remember to throw something at the end e.printStackTrace(); } } for (Entry<Long, Serializable> entry : lockedObjectsMap.entrySet()) { Long l = entry.getKey(); try { if (! dataspaceLocks.contains(l)) { trans.lock(l); dataspaceLocks.add(l); } TSODataHeader hdr = (TSODataHeader) trans.read(l); listeners.addAll(hdr.availabilityListeners); hdr.free = true; //hdr.createNotCommitted = false; // not needed for everyone trans.write(l, hdr); if (DEBUG) { log.finest("abort-update " + hdr); } } catch (NonExistantObjectIDException e) { e.printStackTrace(); } } if (DEBUG) { log.finest("abort commiting txn " + txnID); } trans.commit(); peekedObjectsMap.clear(); lockedObjectsMap.clear(); createdIDs.clear(); deletedIDs.clear(); ostore.notifyAvailabilityListeners(new ArrayList<SGSUUID>(listeners)); ostore.deregisterActiveTransaction(this); }
48631 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48631/38cd635e4893bdb1f49db4d30432c11bf7409566/TSOTransaction.java/clean/src/com/sun/gi/objectstore/tso/TSOTransaction.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 6263, 1435, 288, 202, 430, 261, 9394, 13, 288, 202, 565, 309, 261, 1330, 18, 291, 1343, 8455, 12, 2355, 18, 42, 3740, 882, 3719, 288, 202, 202, 5748, 8526, 6263, 1684, 5103, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 6263, 1435, 288, 202, 430, 261, 9394, 13, 288, 202, 565, 309, 261, 1330, 18, 291, 1343, 8455, 12, 2355, 18, 42, 3740, 882, 3719, 288, 202, 202, 5748, 8526, 6263, 1684, 5103, ...
TimedWriter w=new TimedWriter(); InetAddress local=null; InetAddress remote=null; int port=0; Socket sock=null ; if(args.length != 3) { log.error("TimedWriter <local host> <remote host> <remote port>"); return; }
TimedWriter w=new TimedWriter(); InetAddress local=null; InetAddress remote=null; int port=0; Socket sock=null ;
public static void main(String[] args) { TimedWriter w=new TimedWriter(); InetAddress local=null; InetAddress remote=null; int port=0; Socket sock=null ; if(args.length != 3) { log.error("TimedWriter <local host> <remote host> <remote port>"); return; } try { local=InetAddress.getByName(args[0]); remote=InetAddress.getByName(args[1]); port=Integer.parseInt(args[2]); } catch(Exception e) { log.error("Could find host " + remote); return; } while(true) { try { sock=w.createSocket(local, remote, port, 3000); if(sock != null) { System.out.println("Connection created"); return; } } catch(TimedWriter.Timeout timeout) { log.error("Timed out creating socket"); } catch(Exception io_ex) { log.error("Connection could not be created, retrying"); Util.sleep(2000); } } }
48949 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48949/13de68466e3cf7fde6ee0bde0cee09a33e837e89/TimedWriter.java/clean/src/org/jgroups/util/TimedWriter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 202, 19336, 2289, 225, 341, 33, 2704, 23925, 2289, 5621, 202, 382, 278, 1887, 225, 1191, 33, 2011, 31, 202, 382, 278, 1887, 225, 2632,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 202, 19336, 2289, 225, 341, 33, 2704, 23925, 2289, 5621, 202, 382, 278, 1887, 225, 1191, 33, 2011, 31, 202, 382, 278, 1887, 225, 2632,...
CellEditor descriptionCellEditor = new TextCellEditor(tableViewer .getTable());
CellEditor descriptionCellEditor = new TextCellEditor(treeViewer .getTree());
public void createPartControl(Composite parent) { super.createPartControl(parent); TableViewer tableViewer = getViewer(); CellEditor cellEditors[] = new CellEditor[tableViewer.getTable() .getColumnCount()]; cellEditors[0] = new CheckboxCellEditor(tableViewer.getTable()); String[] priorities = new String[] { MarkerMessages.priority_high, MarkerMessages.priority_normal, MarkerMessages.priority_low }; cellEditors[1] = new ComboBoxCellEditor(tableViewer.getTable(), priorities, SWT.READ_ONLY); CellEditor descriptionCellEditor = new TextCellEditor(tableViewer .getTable()); cellEditors[2] = descriptionCellEditor; tableViewer.setCellEditors(cellEditors); tableViewer.setCellModifier(cellModifier); tableViewer.setColumnProperties(TABLE_COLUMN_PROPERTIES); cellEditorActionHandler = new CellEditorActionHandler(getViewSite() .getActionBars()); cellEditorActionHandler.addCellEditor(descriptionCellEditor); cellEditorActionHandler.setCopyAction(copyAction); cellEditorActionHandler.setPasteAction(pasteAction); cellEditorActionHandler.setDeleteAction(deleteAction); cellEditorActionHandler.setSelectAllAction(selectAllAction); }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/8c3ffe9ae7244f7684ed35186f5d1a1d97f9be97/TaskView.java/buggy/bundles/org.eclipse.ui.ide/src/org/eclipse/ui/views/markers/internal/TaskView.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 752, 1988, 3367, 12, 9400, 982, 13, 288, 3639, 2240, 18, 2640, 1988, 3367, 12, 2938, 1769, 3639, 3555, 18415, 1014, 18415, 273, 8893, 264, 5621, 3639, 8614, 6946, 2484, 4666, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 752, 1988, 3367, 12, 9400, 982, 13, 288, 3639, 2240, 18, 2640, 1988, 3367, 12, 2938, 1769, 3639, 3555, 18415, 1014, 18415, 273, 8893, 264, 5621, 3639, 8614, 6946, 2484, 4666, 1...
}
this.isExternal = isExternal; }
public ScannedEntity(String name, XMLResourceIdentifier entityLocation, InputStream stream, Reader reader, String encoding, boolean literal, boolean mayReadChunks) { super(name); this.entityLocation = entityLocation; this.stream = stream; this.reader = reader; this.encoding = encoding; this.literal = literal; this.mayReadChunks = mayReadChunks; } // <init>(StringXMLResourceIdentifier,InputStream,Reader,String,boolean)
1831 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1831/4cd0c4608f8d7fd80f94a7876330ddbcca9b2d9b/XMLEntityManager.java/buggy/src/org/apache/xerces/impl/XMLEntityManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 2850, 10041, 1943, 12, 780, 508, 16, 11794, 3167, 1420, 3004, 1522, 2735, 16, 11794, 5037, 1407, 16, 5393, 2949, 16, 11794, 514, 2688, 16, 1250, 7158, 16, 1250, 2026, 1994, 14975, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 2850, 10041, 1943, 12, 780, 508, 16, 11794, 3167, 1420, 3004, 1522, 2735, 16, 11794, 5037, 1407, 16, 5393, 2949, 16, 11794, 514, 2688, 16, 1250, 7158, 16, 1250, 2026, 1994, 14975, 1...
cfw.add(ByteCode.DUP); cfw.addALoad(contextArg); cfw.addALoad(scopeArg); cfw.addInvoke(ByteCode.INVOKESTATIC, mainClassName, REGEXP_INIT_METHOD_NAME, REGEXP_INIT_METHOD_SIGNATURE);
static void pushRegExpArray(ClassFileWriter cfw, ScriptOrFnNode n, int contextArg, int scopeArg) { // precompile all regexp literals int regexpCount = n.getRegexpCount(); if (regexpCount == 0) badTree(); cfw.addPush(regexpCount); cfw.add(ByteCode.ANEWARRAY, "java/lang/Object"); cfw.addALoad(contextArg); cfw.addInvoke(ByteCode.INVOKESTATIC, "org/mozilla/javascript/ScriptRuntime", "checkRegExpProxy", "(Lorg/mozilla/javascript/Context;" +")Lorg/mozilla/javascript/RegExpProxy;"); for (int i = 0; i != regexpCount; ++i) { cfw.add(ByteCode.DUP2); // Stack structure: proxy, array, proxy, array cfw.addALoad(contextArg); cfw.addALoad(scopeArg); cfw.addPush(n.getRegexpString(i)); String regexpFlags = n.getRegexpFlags(i); if (regexpFlags == null) { cfw.add(ByteCode.ACONST_NULL); } else { cfw.addPush(regexpFlags); } cfw.addInvoke(ByteCode.INVOKEINTERFACE, "org/mozilla/javascript/RegExpProxy", "newRegExp", "(Lorg/mozilla/javascript/Context;" +"Lorg/mozilla/javascript/Scriptable;" +"Ljava/lang/String;Ljava/lang/String;" +")Ljava/lang/Object;"); // Stack structure: result of newRegExp, array, proxy, array cfw.addPush(i); cfw.add(ByteCode.SWAP); cfw.add(ByteCode.AASTORE); // Stack structure: proxy, array } // remove proxy cfw.add(ByteCode.POP); }
19000 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/19000/0296900ea3f55089d4d3db653867340b23f3b63b/Codegen.java/buggy/src/org/mozilla/javascript/optimizer/Codegen.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 6080, 91, 18, 1289, 12, 3216, 1085, 18, 30387, 1769, 6080, 91, 18, 1289, 1013, 6189, 12, 2472, 4117, 1769, 6080, 91, 18, 1289, 1013, 6189, 12, 4887, 4117, 1769, 6080, 91, 18, 1289, 1096...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 6080, 91, 18, 1289, 12, 3216, 1085, 18, 30387, 1769, 6080, 91, 18, 1289, 1013, 6189, 12, 2472, 4117, 1769, 6080, 91, 18, 1289, 1013, 6189, 12, 4887, 4117, 1769, 6080, 91, 18, 1289, 1096...
return method.getGenericReturnType(); }
return (Type)s[1]; }
public Type fun(final Object[] s) { return method.getGenericReturnType(); }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/1669fe11665f7035d8fef416651a5891cd237f7d/GenericInfoImpl.java/buggy/source/com/intellij/util/xml/impl/GenericInfoImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 1412, 9831, 12, 6385, 1033, 8526, 272, 13, 288, 3639, 327, 707, 18, 588, 7014, 9102, 5621, 1377, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4202, 1071, 1412, 9831, 12, 6385, 1033, 8526, 272, 13, 288, 3639, 327, 707, 18, 588, 7014, 9102, 5621, 1377, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -10...
throw new SQLException(Messages.get("error.resultset.norow"), "24000");
throw new SQLException( Messages.get("error.resultset.norow"), "24000"); } if (SQL_ROW_DIRTY.equals(getRowStat())) { cursorFetch(FETCH_REPEAT, 1);
protected Object getColumn(int index) throws SQLException { if (index < 1 || index > columnCount) { throw new SQLException(Messages.get("error.resultset.colindex", Integer.toString(index)), "07009"); } if (onInsertRow || currentRow == null) { throw new SQLException(Messages.get("error.resultset.norow"), "24000"); } Object data = currentRow[index - 1]; wasNull = data == null; return data; }
2029 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2029/168c076b526e382d1d8046b2e691fa708d2e8073/MSCursorResultSet.java/buggy/src/main/net/sourceforge/jtds/jdbc/MSCursorResultSet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 1033, 6716, 12, 474, 770, 13, 1216, 6483, 288, 3639, 309, 261, 1615, 411, 404, 747, 770, 405, 22429, 13, 288, 5411, 604, 394, 6483, 12, 5058, 18, 588, 2932, 1636, 18, 2088, 542, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 1033, 6716, 12, 474, 770, 13, 1216, 6483, 288, 3639, 309, 261, 1615, 411, 404, 747, 770, 405, 22429, 13, 288, 5411, 604, 394, 6483, 12, 5058, 18, 588, 2932, 1636, 18, 2088, 542, ...
public static Set parseAuthorString(String authors) {
public static List parseAuthorString(String authors) {
public static Set parseAuthorString(String authors) { if (authors==null) throw new IllegalArgumentException("Authors string cannot be null"); String[] parts = authors.split(","); Set authSet = new HashSet(); for (int i = 0; i < parts.length; i++) authSet.add(new SimpleDocRefAuthor(parts[i])); return authSet; }
50397 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50397/88640d228841047db8c0dd29d58ebf88063e8cc0/DocRefAuthor.java/buggy/src/org/biojavax/DocRefAuthor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 760, 987, 1109, 3594, 780, 12, 780, 14494, 13, 288, 5411, 309, 261, 19368, 631, 2011, 13, 604, 394, 2754, 2932, 1730, 1383, 533, 2780, 506, 446, 8863, 5411, 514, 8526, 2140, 273, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 760, 987, 1109, 3594, 780, 12, 780, 14494, 13, 288, 5411, 309, 261, 19368, 631, 2011, 13, 604, 394, 2754, 2932, 1730, 1383, 533, 2780, 506, 446, 8863, 5411, 514, 8526, 2140, 273, ...
final Set bindings = new HashSet(); bindings.add(binding1); bindings.add(binding2); bindingManager.setBindings(bindings);
bindingManager.addBinding(binding2);
public void testSchemeOverrideDifferentContexts() throws NotDefinedException { final Context parentContext = contextManager.getContext("parent"); parentContext.define("parent", "description", null); final Context childContext = contextManager.getContext("child"); childContext.define("child", "description", null); final Scheme parentScheme = bindingManager.getScheme("parent"); parentScheme.define("parent", "parent scheme", null); final Scheme childScheme = bindingManager.getScheme("child"); childScheme.define("child", "child scheme", "parent"); bindingManager.setActiveScheme(childScheme); final Set activeContextIds = new HashSet(); activeContextIds.add(parentContext.getId()); activeContextIds.add(childContext.getId()); contextManager.setActiveContextIds(activeContextIds); final Binding binding1 = new TestBinding("parent", parentScheme.getId(), childContext.getId(), null, null, Binding.SYSTEM); final Binding binding2 = new TestBinding("child", childScheme.getId(), parentContext.getId(), null, null, Binding.SYSTEM); final Set bindings = new HashSet(); bindings.add(binding1); bindings.add(binding2); bindingManager.setBindings(bindings); assertEquals("The binding from the child scheme should be active", binding2.getCommandId(), bindingManager .getPerfectMatch(TestBinding.TRIGGER_SEQUENCE)); }
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/aaf24f9edb61f7e189ff821250cda3d6f0088de9/BindingInteractionsTest.java/clean/tests/org.eclipse.ui.tests/Eclipse UI Tests/org/eclipse/ui/tests/keys/BindingInteractionsTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9321, 6618, 26270, 15518, 1435, 1082, 202, 15069, 2288, 8116, 503, 288, 202, 202, 6385, 1772, 982, 1042, 273, 819, 1318, 18, 29120, 2932, 2938, 8863, 202, 202, 2938, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9321, 6618, 26270, 15518, 1435, 1082, 202, 15069, 2288, 8116, 503, 288, 202, 202, 6385, 1772, 982, 1042, 273, 819, 1318, 18, 29120, 2932, 2938, 8863, 202, 202, 2938, ...
jj_consume_token(THROW); if (jj_2_103(1)) { assignment_expression(); } else { ; } jj_consume_token(SEMICOLON);
jj_consume_token(THROW); if (jj_2_103(1)) { assignment_expression(); } else { ;
static final public void throw_statement() throws ParseException { jj_consume_token(THROW); if (jj_2_103(1)) { assignment_expression(); } else { ; } jj_consume_token(SEMICOLON); }
41673 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/41673/23e69d576250f417c265d779703b8da08a67aaed/CPPParser.java/clean/pmd/src/net/sourceforge/pmd/cpd/cppast/CPPParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 727, 1071, 918, 604, 67, 11516, 1435, 1216, 10616, 288, 3639, 10684, 67, 21224, 67, 2316, 12, 2455, 11226, 1769, 3639, 309, 261, 78, 78, 67, 22, 67, 23494, 12, 21, 3719, 288, 5411,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 727, 1071, 918, 604, 67, 11516, 1435, 1216, 10616, 288, 3639, 10684, 67, 21224, 67, 2316, 12, 2455, 11226, 1769, 3639, 309, 261, 78, 78, 67, 22, 67, 23494, 12, 21, 3719, 288, 5411,...
protected void handleNewObject( Object object ) { getFinalEventList().add(object); }
protected void handleNewObject(Object object) { getFinalEventList().add(object); }
protected void handleNewObject( Object object ) { getFinalEventList().add(object); }
55916 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55916/2224b49c445911182579708c97cbe27050123ac6/AbstractObjectTable.java/buggy/sandbox/src/main/java/org/springframework/richclient/table/support/AbstractObjectTable.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 1640, 1908, 921, 12, 1033, 733, 262, 288, 3639, 2812, 1490, 1133, 682, 7675, 1289, 12, 1612, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 1640, 1908, 921, 12, 1033, 733, 262, 288, 3639, 2812, 1490, 1133, 682, 7675, 1289, 12, 1612, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100...
selectedType = type;
selectedType = type;
private void switchTo( int type ) { if ( type == selectedType ) { return; } selectedType = type; Control[] controls = inputArea.getChildren( ); for ( int i = 0; i < controls.length; i++ ) { controls[i].dispose( ); } clearPreview( ); switch ( type ) { case URI_TYPE : swtichToExprType( ); break; case LIST_TYPE : swtichToListType( ); break; } inputArea.layout( ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/08f26fa5570453d836515b53d65281f78cb6f9bf/MarkerIconDialog.java/buggy/chart/org.eclipse.birt.chart.ui.extension/src/org/eclipse/birt/chart/ui/swt/composites/MarkerIconDialog.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1620, 774, 12, 509, 618, 262, 202, 95, 202, 202, 430, 261, 618, 422, 3170, 559, 262, 202, 202, 95, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 8109, 559, 273, 618, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1620, 774, 12, 509, 618, 262, 202, 95, 202, 202, 430, 261, 618, 422, 3170, 559, 262, 202, 202, 95, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 8109, 559, 273, 618, ...
"get(@Persistable int test.expression.AnnotationTarget.m_annotatedField) && !within(@Service)",
"get(@test.expression.IPersistable int test.expression.AnnotationTarget.m_annotatedField) && !within(@test.expression.IService)",
public void testAdvisedFieldAttributes() { assertTrue( new ExpressionInfo( "set(@Persistable java.lang.Object+ test.expression.AnnotationTarget.m_annotatedField)", NAMESPACE).getExpression().match( new ExpressionContext(PointcutType.SET, s_field, null) ) ); assertTrue( new ExpressionInfo( "set(!@Persistable int test.expression.AnnotationTarget.m_annotatedField)", NAMESPACE).getAdvisedClassFilterExpression().match( new ExpressionContext(PointcutType.SET, s_field, null) ) ); // HINT wrong field type assertFalse( new ExpressionInfo( "get(@Persistable int test.expression.AnnotationTarget.m_annotatedField) && !within(@Service)", NAMESPACE).getExpression().match( new ExpressionContext(PointcutType.GET, s_field, s_declaringType) ) ); // HINT field type ignored assertTrue( new ExpressionInfo( "get(@Persistable int test.expression.AnnotationTarget.m_annotatedField) && !within(@Service)", NAMESPACE).getAdvisedClassFilterExpression().match( new ExpressionContext(PointcutType.GET, s_field, s_declaringType) ) ); assertFalse( new ExpressionInfo( "get(@Persistable java.lang.Object m_innerField) && within(!@Service test.expression.*)", NAMESPACE).getExpression().match( new ExpressionContext(PointcutType.GET, s_innerField, s_innerType) ) ); // HINT annotations and types ignored assertTrue( new ExpressionInfo( "get(!@Persistable String m_innerField) && within(@Service test.expression.*)", NAMESPACE).getAdvisedClassFilterExpression().match( new ExpressionContext(PointcutType.GET, s_innerField, s_innerType) ) ); }
7954 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7954/8c7112c51b13e94abb47d989e72971c06cd32061/AdvisedClassFilterExpressionTest.java/buggy/aspectwerkz4/src/test/test/expression/AdvisedClassFilterExpressionTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 1871, 26779, 974, 2498, 1435, 288, 377, 202, 11231, 5510, 12, 7734, 394, 5371, 966, 12, 1171, 202, 202, 6, 542, 26964, 12771, 429, 2252, 18, 4936, 18, 921, 15, 1842, 18...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 1871, 26779, 974, 2498, 1435, 288, 377, 202, 11231, 5510, 12, 7734, 394, 5371, 966, 12, 1171, 202, 202, 6, 542, 26964, 12771, 429, 2252, 18, 4936, 18, 921, 15, 1842, 18...
throw new Error(MSG_);
throw new Error(MSG00_);
public long getLong(int d0) { throw new Error(MSG_); }
1769 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1769/acfeebc11baafec801adc2146699b1f17047c763/MemoryBlock.java/buggy/x10.runtime/src/x10/base/MemoryBlock.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1525, 11105, 12, 474, 302, 20, 13, 288, 3639, 604, 394, 1068, 12, 11210, 713, 67, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1525, 11105, 12, 474, 302, 20, 13, 288, 3639, 604, 394, 1068, 12, 11210, 713, 67, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, ...
while (i < count) { b1 = rawReadBuffer [i++]; if (b1 < 0) { if ((b1 & 0xe0) == 0xc0) { c = (char) (((b1 & 0x1f) << 6) | getNextUtf8Byte (i++, count)); if (c < 0x0080) encodingError ("Illegal two byte UTF-8 sequence", c, 0); if ((c == 0x0085 || c == 0x000a) && sawCR) continue; if(c == 0x0085 && xmlVersion == XML_11) readBuffer[j++] = '\r'; } else if ((b1 & 0xf0) == 0xe0) { c = (char) (((b1 & 0x0f) << 12) | (getNextUtf8Byte (i++, count) << 6) | getNextUtf8Byte (i++, count)); if(c == 0x2028 && xmlVersion == XML_11){ readBuffer[j++] = '\r'; sawCR = true; continue; } if (c < 0x0800 || (c >= 0xd800 && c <= 0xdfff)) encodingError ("Illegal three byte UTF-8 sequence", c, 0); } else if ((b1 & 0xf8) == 0xf0) { int iso646 = b1 & 07; iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); if (iso646 <= 0xffff) { encodingError ("Illegal four byte UTF-8 sequence", iso646, 0); } else { if (iso646 > 0x0010ffff) encodingError ( "UTF-8 value out of range for Unicode", iso646, 0); iso646 -= 0x010000; readBuffer [j++] = (char) (0xd800 | (iso646 >> 10)); readBuffer [j++] = (char) (0xdc00 | (iso646 & 0x03ff)); continue; } } else { encodingError ( "unsupported five or six byte UTF-8 sequence", 0xff & b1, i); c = 0; } } else { c = (char) b1; } readBuffer [j++] = c; if (c == '\r') sawCR = true; } readBufferLength = j; }
if (b1 < 0) { if ((b1 & 0xe0) == 0xc0) { c = (char) (((b1 & 0x1f) << 6) | getNextUtf8Byte(i++, count)); if (c < 0x0080) { encodingError("Illegal two byte UTF-8 sequence", c, 0); } if ((c == 0x0085 || c == 0x000a) && sawCR) { continue; } if (c == 0x0085 && xmlVersion == XML_11) { readBuffer[j++] = '\r'; } } else if ((b1 & 0xf0) == 0xe0) { c = (char) (((b1 & 0x0f) << 12) | (getNextUtf8Byte(i++, count) << 6) | getNextUtf8Byte(i++, count)); if (c == 0x2028 && xmlVersion == XML_11) { readBuffer[j++] = '\r'; sawCR = true; continue; } if (c < 0x0800 || (c >= 0xd800 && c <= 0xdfff)) { encodingError("Illegal three byte UTF-8 sequence", c, 0); } } else if ((b1 & 0xf8) == 0xf0) { int iso646 = b1 & 07; iso646 = (iso646 << 6) + getNextUtf8Byte(i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte(i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte(i++, count); if (iso646 <= 0xffff) { encodingError("Illegal four byte UTF-8 sequence", iso646, 0); } else { if (iso646 > 0x0010ffff) { encodingError("UTF-8 value out of range for Unicode", iso646, 0); } iso646 -= 0x010000; readBuffer[j++] = (char) (0xd800 | (iso646 >> 10)); readBuffer[j++] = (char) (0xdc00 | (iso646 & 0x03ff)); continue; } } else { encodingError("unsupported five or six byte UTF-8 sequence", 0xff & b1, i); c = 0; } } else { c = (char) b1; } readBuffer[j++] = c; if (c == '\r') { sawCR = true; } } readBufferLength = j; }
private void copyUtf8ReadBuffer (int count) throws SAXException, IOException { int i = 0; int j = readBufferPos; int b1; char c = 0; /* // check once, so the runtime won't (if it's smart enough) if (count < 0 || count > rawReadBuffer.length) throw new ArrayIndexOutOfBoundsException (Integer.toString (count)); */ while (i < count) { b1 = rawReadBuffer [i++]; // Determine whether we are dealing // with a one-, two-, three-, or four- // byte sequence. if (b1 < 0) { if ((b1 & 0xe0) == 0xc0) { // 2-byte sequence: 00000yyyyyxxxxxx = 110yyyyy 10xxxxxx c = (char) (((b1 & 0x1f) << 6) | getNextUtf8Byte (i++, count)); if (c < 0x0080) encodingError ("Illegal two byte UTF-8 sequence", c, 0); //Sec 2.11 // [1] the two-character sequence #xD #xA // [2] the two-character sequence #xD #x85 if ((c == 0x0085 || c == 0x000a) && sawCR) continue; // Sec 2.11 // [3] the single character #x85 if(c == 0x0085 && xmlVersion == XML_11) readBuffer[j++] = '\r'; } else if ((b1 & 0xf0) == 0xe0) { // 3-byte sequence: // zzzzyyyyyyxxxxxx = 1110zzzz 10yyyyyy 10xxxxxx // most CJKV characters c = (char) (((b1 & 0x0f) << 12) | (getNextUtf8Byte (i++, count) << 6) | getNextUtf8Byte (i++, count)); //sec 2.11 //[4] the single character #x2028 if(c == 0x2028 && xmlVersion == XML_11){ readBuffer[j++] = '\r'; sawCR = true; continue; } if (c < 0x0800 || (c >= 0xd800 && c <= 0xdfff)) encodingError ("Illegal three byte UTF-8 sequence", c, 0); } else if ((b1 & 0xf8) == 0xf0) { // 4-byte sequence: 11101110wwwwzzzzyy + 110111yyyyxxxxxx // = 11110uuu 10uuzzzz 10yyyyyy 10xxxxxx // (uuuuu = wwww + 1) // "Surrogate Pairs" ... from the "Astral Planes" // Unicode 3.1 assigned the first characters there int iso646 = b1 & 07; iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); iso646 = (iso646 << 6) + getNextUtf8Byte (i++, count); if (iso646 <= 0xffff) { encodingError ("Illegal four byte UTF-8 sequence", iso646, 0); } else { if (iso646 > 0x0010ffff) encodingError ( "UTF-8 value out of range for Unicode", iso646, 0); iso646 -= 0x010000; readBuffer [j++] = (char) (0xd800 | (iso646 >> 10)); readBuffer [j++] = (char) (0xdc00 | (iso646 & 0x03ff)); continue; } } else { // The five and six byte encodings aren't supported; // they exceed the Unicode (and XML) range. encodingError ( "unsupported five or six byte UTF-8 sequence", 0xff & b1, i); // NOTREACHED c = 0; } } else { // 1-byte sequence: 000000000xxxxxxx = 0xxxxxxx // (US-ASCII character, "common" case, one branch to here) c = (char) b1; } readBuffer [j++] = c; if (c == '\r') sawCR = true; } // How many characters have we read? readBufferLength = j; }
1043 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1043/7fb7568e63c3fe14af521de4699cb37898923ca7/XmlParser.java/clean/libjava/gnu/xml/aelfred2/XmlParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1610, 15230, 28, 1994, 1892, 261, 474, 1056, 13, 565, 1216, 14366, 16, 1860, 565, 288, 202, 474, 202, 77, 273, 374, 31, 202, 474, 202, 78, 273, 31404, 1616, 31, 202, 474, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1610, 15230, 28, 1994, 1892, 261, 474, 1056, 13, 565, 1216, 14366, 16, 1860, 565, 288, 202, 474, 202, 77, 273, 374, 31, 202, 474, 202, 78, 273, 31404, 1616, 31, 202, 474, 2...
IJ.showStatus("Getting database info.."); String[][] owners = OMERetrieve.retrieveExperimenters(df); Project[] projects = OMERetrieve.retrieveAllProjects(df); IJ.showStatus("Creating search panel..."); OMEDownPanel dp = null; try { dp = new OMEDownPanel(IJ.getInstance(), projects, owners); } catch (NullPointerException n) { return; } Image[] images = new Image[0]; IJ.showStatus("Searching for images..."); while (images.length == 0) { Object[] objects = dp.search(); if (objects == null) { cancelPlugin = true; pluginCancelled(); return; } images = OMERetrieve.retrieveImages(df, objects); if(images == null) images = new Image[0]; if (images.length == 0) { OMELoginPanel.infoShow(IJ.getInstance(), "No images matched the specified criteria.", "OME Download"); } else { images = getDownPicks(images,df, pf); if (cancelPlugin) { pluginCancelled(); return;
Experimenter user = OMERetrieve.getUser(df); IJ.showStatus("OmeUpload: Starting import..."); im.startImport(user); IJ.showProgress(0.15); Image omeImage = null; int omeID = ((Integer)metadata[0]).intValue(); if (omeID != 0) { omeImage = OMERetrieve.getImagefromID(df, omeID); } IJ.showStatus("OmeUpload: Finding repository..."); Repository rep = pf.findRepository(0); IJ.showProgress(0.18); IJ.showStatus("OmeUpload: Creating image entry..."); Image image; if (omeImage != null) { image = omeImage; } else { image = (Image) df.createNew(Image.class); image.setName(imageP.getTitle()); image.setOwner(user); image.setInserted("now"); image.setCreated("now"); image.setDescription("This image was uploaded from ImageJ"); } df.markForUpdate(image); int sizeX = imageP.getWidth(); int sizeY = imageP.getHeight(); int type = imageP.getType(); int bytesPerPix = 1; int sizeC = 1; boolean isFloat = false; switch (type) { case ImagePlus.COLOR_256: imageP = new ImagePlus(ip.getTitle(), new ColorProcessor( ((ByteProcessor) imageP.getProcessor()).createImage())); break; case ImagePlus.COLOR_RGB: sizeC = 3; break; case ImagePlus.GRAY16: bytesPerPix = 2; break; case ImagePlus.GRAY32: bytesPerPix = 4; isFloat = true; break; } int[] results = new int[] {domainIndex, imageP.getStackSize()}; results = setDomain(results); int sizeT = results[1]; int sizeZ = results[0]; IJ.showProgress(.25); IJ.showStatus("OmeUpload: Creating pixels file..."); ModuleExecution ii = im.getImageImportMEX(image); ii.setExperimenter(user); Pixels pix = pf.newPixels(rep, image, ii, sizeX, sizeY, sizeZ, sizeC, sizeT, bytesPerPix, isFloat, isFloat); byte [] r = new byte[sizeX*sizeY]; byte [] g = new byte[sizeX*sizeY]; byte [] b = new byte[sizeX*sizeY]; for (int t=0; t<sizeT; t++) { for (int z=0; z<sizeZ; z++) { for (int c=0; c<sizeC; c++) { byte[] pixels = new byte[sizeX * sizeY * bytesPerPix]; IJ.showStatus("OmeUpload: Loading data (t=" + t + ", z=" + z + ", c=" + c + ")..."); double progress = (double) (t*sizeC*sizeZ+z*sizeC+c)/(sizeT*sizeZ*sizeC); IJ.showProgress(.25+.25*progress); switch (type) { case ImagePlus.COLOR_RGB: ((ColorProcessor)imageP.getStack().getProcessor( Math.max(z,t)+1)).getRGB(r, g, b); switch (c) { case 2: pixels = r; break; case 1: pixels = g; break; case 0: pixels = b; break; } break; case ImagePlus.GRAY16: short[] pixsh = (short[]) imageP.getStack().getPixels(Math.max(z,t)+1); for (int i=0; i<pixsh.length; i++) { pixels[2*i] = (byte) ((pixsh[i] & 0xff00) >> 8); pixels[2*i+1] = (byte) (pixsh[i] & 0x00ff); } break; case ImagePlus.GRAY32: float[] pixsf = (float[]) imageP.getStack().getPixels(Math.max(z,t)+1); for (int i=0; i<pixsf.length; i++) { pixels[4*i] = (byte) ((Float.floatToRawIntBits(pixsf[i]) & 0xff000000)>>24); pixels[4*i+1] = (byte) ((Float.floatToRawIntBits(pixsf[i]) & 0x00ff0000)>>16); pixels[4*i+2] = (byte) ((Float.floatToRawIntBits(pixsf[i]) & 0x0000ff00)>>8); pixels[4*i+3] = (byte) (Float.floatToRawIntBits(pixsf[i]) & 0x000000ff); } break; default: byte[] pixsb = (byte[]) imageP.getStack().getPixels(Math.max(z,t)+1); System.arraycopy(pixsb, 0, pixels, 0, pixsb.length); } pf.setPlane(pix, z, c, t, pixels, true); LogicalChannel logical = (LogicalChannel) df.createNew("LogicalChannel"); logical.setImage(image); logical.setModuleExecution(ii); if (sizeC == 3) { switch(c) { case 0: logical.setFluor("Blue"); break; case 1: logical.setFluor("Green"); break; case 2: logical.setFluor("Red"); break; } logical.setPhotometricInterpretation("RGB"); } else { logical.setFluor("Gray"); logical.setPhotometricInterpretation("monochrome"); } df.markForUpdate(logical); PixelChannelComponent physical = (PixelChannelComponent) df.createNew("PixelChannelComponent"); physical.setImage(image); physical.setPixels(pix); physical.setIndex(new Integer(c)); physical.setLogicalChannel(logical); physical.setModuleExecution(ii); df.markForUpdate(physical);
public void run(OMESidePanel osp) { try { login(false); getHelpers(); //get database info to use in search IJ.showStatus("Getting database info.."); String[][] owners = OMERetrieve.retrieveExperimenters(df); Project[] projects = OMERetrieve.retrieveAllProjects(df); //create search panel IJ.showStatus("Creating search panel..."); OMEDownPanel dp = null; try { dp = new OMEDownPanel(IJ.getInstance(), projects, owners); } catch (NullPointerException n) { return; } Image[] images = new Image[0]; //do the image search IJ.showStatus("Searching for images..."); while (images.length == 0) { Object[] objects = dp.search(); if (objects == null) { cancelPlugin = true; pluginCancelled(); return; } //get search results images = OMERetrieve.retrieveImages(df, objects); if(images == null) images = new Image[0]; if (images.length == 0) { OMELoginPanel.infoShow(IJ.getInstance(), "No images matched the specified criteria.", "OME Download"); } else { //pick from results images = getDownPicks(images,df, pf); if (cancelPlugin) { pluginCancelled(); return; } } if (images == null) return; } //download into ImageJ for (int i=0; i<images.length; i++) { download(images[i], pf, osp, df); if (cancelPlugin) { pluginCancelled(); return; } } logout(); } catch(NullPointerException e) { e.printStackTrace(); pluginCancelled(); } catch(IllegalArgumentException f) { // do nothing; this means that the user cancelled the login procedure } catch (Exception exc) { finalCatch(exc); } upThread = null; IJ.showProgress(1); }
55303 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55303/368ea308fce009a55a7199efd8fac9e9e43a7fd1/OMETools.java/buggy/loci/plugins/ome/OMETools.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1086, 12, 51, 958, 8895, 5537, 23660, 13, 288, 565, 775, 288, 1377, 3925, 12, 5743, 1769, 1377, 336, 13375, 5621, 1377, 368, 588, 2063, 1123, 358, 999, 316, 1623, 1377, 467, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 1086, 12, 51, 958, 8895, 5537, 23660, 13, 288, 565, 775, 288, 1377, 3925, 12, 5743, 1769, 1377, 336, 13375, 5621, 1377, 368, 588, 2063, 1123, 358, 999, 316, 1623, 1377, 467, ...
setAction(ACTION_REPORT_UPDATE);
setAction(ACTION_REPORT_UPDATE);
protected void initWorkplaceRequestValues(CmsWorkplaceSettings settings, HttpServletRequest request) { // fill the parameter values in the get/set methods fillParamValues(request); // set the dialog type setParamDialogtype(DIALOG_TYPE); // set the action for the JSP switch if (DIALOG_SAVE_EDIT.equals(getParamAction())) { setAction(ACTION_SAVE_EDIT); } else if (REPORT_UPDATE.equals(getParamAction())) { setAction(ACTION_REPORT_UPDATE); } else if (REPORT_BEGIN.equals(getParamAction())) { setAction(ACTION_REPORT_BEGIN); } else if (REPORT_END.equals(getParamAction())) { setAction(ACTION_REPORT_END); } else if (DIALOG_CANCEL.equals(getParamAction())) { setAction(ACTION_CANCEL); } else { // set the default action setAction(ACTION_DEFAULT); setParamTitle(key("label.admin.history.clear")); } }
8585 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8585/41dcaa9d1a1b8f8fa6c1dd9a04fc8532eb83ebb7/CmsAdminHistoryClear.java/buggy/src-modules/org/opencms/workplace/tools/history/CmsAdminHistoryClear.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 1208, 16514, 691, 1972, 12, 4747, 16514, 2628, 1947, 16, 9984, 590, 13, 288, 3639, 368, 3636, 326, 1569, 924, 316, 326, 336, 19, 542, 2590, 3639, 3636, 786, 1972, 12, 2293, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 1208, 16514, 691, 1972, 12, 4747, 16514, 2628, 1947, 16, 9984, 590, 13, 288, 3639, 368, 3636, 326, 1569, 924, 316, 326, 336, 19, 542, 2590, 3639, 3636, 786, 1972, 12, 2293, 1...
public IStatus busyRestoreView(final IViewReference ref) { if (ref.getPart(false) != null) return new Status(IStatus.OK, PlatformUI.PLUGIN_ID, 0, "", null); //$NON-NLS-1$ final String key = getKey(ref); final IMemento stateMem = getViewState(key); mementoTable.remove(key); final boolean resetPart[] = { true }; final IStatus result[] = new IStatus[] { new Status(IStatus.OK, PlatformUI.PLUGIN_ID, 0, "", null) }; //$NON-NLS-1$ Platform.run(new SafeRunnable() { public void handleException(Throwable e) { if (resetPart[0]) { ViewReference viewRef = ((ViewReference) ref); viewRef.setPart(null); if (viewRef.getPane() != null) { page.hideView(ref); } } //Execption is already logged. result[0] = new Status( IStatus.ERROR, PlatformUI.PLUGIN_ID, 0, WorkbenchMessages .format( "Perspective.exceptionRestoringView", new String[] { key }), //$NON-NLS-1$ e); } public void run() { IViewDescriptor desc = viewReg.find(ref.getId()); if (desc == null) { result[0] = new Status( IStatus.ERROR, PlatformUI.PLUGIN_ID, 0, WorkbenchMessages .format( "ViewFactory.couldNotCreate", new Object[] { key }), //$NON-NLS-1$ null); return; } // Create the view. IViewPart view = null; String label = desc.getLabel(); try { try { UIStats.start(UIStats.CREATE_PART, label); view = desc.createView(); } finally { UIStats.end(UIStats.CREATE_PART, label); } ((ViewReference) ref).setPart(view); } catch (CoreException e) { PartPane pane = ((ViewReference) ref).getPane(); if (pane != null) { page.getPerspectivePresentation().removePart(pane); pane.dispose(); } result[0] = new Status( IStatus.ERROR, PlatformUI.PLUGIN_ID, 0, WorkbenchMessages .format( "ViewFactory.initException", new Object[] { desc.getID() }), //$NON-NLS-1$ e); return; } // Create site ViewSite site = new ViewSite(ref, view, page, desc); PartPane pane = ((ViewReference) ref).getPane(); if (pane == null) { pane = new ViewPane(ref, page); ((ViewReference) ref).setPane(pane); } site.setPane(pane); site.setActionBars(new ViewActionBars(page.getActionBars(), (ViewPane) pane)); try { try { UIStats.start(UIStats.INIT_PART, label); view.init(site, stateMem); } finally { UIStats.end(UIStats.INIT_PART, label); } } catch (PartInitException e) { releaseView(ref); result[0] = new Status( IStatus.ERROR, PlatformUI.PLUGIN_ID, 0, WorkbenchMessages .format( "Perspective.exceptionRestoringView", new String[] { key }), //$NON-NLS-1$ e); return; } if (view.getSite() != site) { releaseView(ref); result[0] = new Status( IStatus.ERROR, PlatformUI.PLUGIN_ID, 0, WorkbenchMessages .format( "ViewFactory.siteException", new Object[] { desc.getID() }), //$NON-NLS-1$ null); return; } resetPart[0] = false; Control ctrl = pane.getControl(); if (ctrl == null) pane.createControl(page.getClientComposite()); else pane.createChildControl(); result[0] = new Status(IStatus.OK, PlatformUI.PLUGIN_ID, 0, "", null); //$NON-NLS-1$ } }); return result[0]; }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/e2e72f41d609c693849ecfad695bc715dec0c34e/ViewFactory.java/clean/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/ViewFactory.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 467, 1482, 21697, 10874, 1767, 12, 6385, 467, 1767, 2404, 1278, 13, 288, 3639, 309, 261, 1734, 18, 588, 1988, 12, 5743, 13, 480, 446, 13, 5411, 327, 394, 2685, 12, 45, 1482, 18, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 467, 1482, 21697, 10874, 1767, 12, 6385, 467, 1767, 2404, 1278, 13, 288, 3639, 309, 261, 1734, 18, 588, 1988, 12, 5743, 13, 480, 446, 13, 5411, 327, 394, 2685, 12, 45, 1482, 18, ...
aProcess = Runtime.getRuntime().exec(new String[] { System.getProperty("jruby.shell"), "-c", aString.toString()});
{ if (!lShellProp.endsWith("sh")) lSwitch = "/c"; System.out.println("command: " + lShellProp + " " + lSwitch + " " + lCommand); aProcess = Runtime.getRuntime().exec(new String[] { lShellProp, lSwitch, lCommand}); }
public static RubyObject backquote(Ruby ruby, RubyObject recv, RubyString aString) { // XXX use other methods try { String lShellProp = System.getProperty("jruby.shell"); Process aProcess; if (lShellProp != null) aProcess = Runtime.getRuntime().exec(new String[] { System.getProperty("jruby.shell"), "-c", aString.toString()}); else aProcess = Runtime.getRuntime().exec(aString.toString()); final StringBuffer sb = new StringBuffer(); final BufferedReader reader = new BufferedReader(new InputStreamReader(aProcess.getInputStream())); String line; while ((line = reader.readLine()) != null) { sb.append(line).append('\n'); } aProcess.waitFor(); return RubyString.newString(ruby, sb.toString()); } catch (Exception excptn) { excptn.printStackTrace(); return RubyString.newString(ruby, ""); } }
50661 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50661/c2cc02999f957e5b4789133df1ab058f33a4a6cc/RubyGlobal.java/clean/org/jruby/RubyGlobal.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 19817, 921, 1473, 6889, 12, 54, 10340, 22155, 16, 19817, 921, 10665, 16, 19817, 780, 279, 780, 13, 288, 3639, 368, 11329, 999, 1308, 2590, 3639, 775, 288, 5411, 514, 328, 13220...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 19817, 921, 1473, 6889, 12, 54, 10340, 22155, 16, 19817, 921, 10665, 16, 19817, 780, 279, 780, 13, 288, 3639, 368, 11329, 999, 1308, 2590, 3639, 775, 288, 5411, 514, 328, 13220...
public void contextDestroyed(ServletContextEvent arg0) {
public void contextDestroyed(ServletContextEvent sce) {
public void contextDestroyed(ServletContextEvent arg0) { // Does nothing }
47226 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47226/1ea2830cd6fa94de7199a14aef58e99a40937d03/TextFilterListener.java/clean/src/main/java/org/osaf/cosmo/jackrabbit/query/TextFilterListener.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 819, 28414, 12, 4745, 1042, 1133, 272, 311, 13, 288, 3639, 368, 9637, 5083, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 819, 28414, 12, 4745, 1042, 1133, 272, 311, 13, 288, 3639, 368, 9637, 5083, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -10...
Debug.error("ScenarioGraphicLoader: problem with location file: " +
Debug.error("ScenarioGraphicLoader: problem finding the location file: " +
public synchronized ScenarioGraphicList createData() { ScenarioGraphicList list = new ScenarioGraphicList(); Hashtable library = new Hashtable(); // Create location data if (locationFile != null && nameIndex != -1) { Debug.message("scenario", "Reading location file..."); try { CSVFile locations = new CSVFile(locationFile); locations.loadData(); Iterator records = locations.iterator(); while (records.hasNext()) { String name = null; String icon = null; Vector record = (Vector) records.next(); name = (String)record.elementAt(nameIndex); if (iconIndex != -1) { icon = (String)record.elementAt(iconIndex); } if (name != null) { ScenarioPoint location = new ScenarioPoint(name, icon); location.setShowName(showNames); drawingAttributes.setTo(location); library.put(name.intern(), location); list.add(location); } else { Debug.error("ScenaroGraphicLoader: no name to use to create location: " + name); } } } catch (MalformedURLException murle) { Debug.error("ScenarioGraphicLoader: problem with location file: " + locationFile); return list; } catch (ArrayIndexOutOfBoundsException aioobe) { Debug.error("ScenarioGraphicLoader: problem parsing location file: " + locationFile); } catch (NullPointerException npe) { Debug.error("ScenarioGraphicLoader (" + getName() + ") null pointer exception, most likely a problem finding the organization data file"); } } else { Debug.error("ScenarioGraphicLoader(" + getName() + "): Location file (" + locationFile + ") not configured."); return list; } // OK, got the locations built up, need to fill up the scenario // Create location data if (activityFile != null && activityNameIndex != -1 && latIndex != -1 && lonIndex != -1 && timeIndex != -1) { Debug.message("scenario", "Reading activity file..."); try { CSVFile activities = new CSVFile(activityFile); activities.loadData(); // numbers as strings == false Iterator records = activities.iterator(); while (records.hasNext()) { String name = null; float lat; float lon; long time; Vector record = (Vector) records.next(); name = record.elementAt(activityNameIndex).toString().intern(); try { lat = ((Double)record.elementAt(latIndex)).floatValue(); lon = ((Double)record.elementAt(lonIndex)).floatValue(); // parse time from string, ending up with // milliseconds from time epoch. String timeString = (String)record.elementAt(timeIndex); timeDate = timeFormat.parse(timeString); time = timeDate.getTime(); if (time < startTime) { startTime = time; } if (time > endTime) { endTime = time; } dataBounds.add((double)lon, (double)lat); if (name != null) { ScenarioPoint point = (ScenarioPoint)library.get(name); if (point != null) { TimeStamp ts = new TimeStamp(lat, lon, time); point.addTimeStamp(ts); } else { Debug.error("SenaroGraphicLoader: ScenarioPoint not found for " + name + ", entry: " + record); } } else { Debug.error("SenaroGraphicLoader: no name to use to create activity point: " + name); } } catch (ClassCastException cce) { Object obj0 = record.elementAt(activityNameIndex); Object obj1 = record.elementAt(latIndex); Object obj2 = record.elementAt(lonIndex); Object obj3 = record.elementAt(timeIndex); Debug.error( "ScenarioGraphicLoader(" + getName() + ") has problem with indexes in activity file for " + obj0 + " (" + obj0.getClass().getName() + ")" + ":\n\tlat index = " + latIndex + ", value = " + obj1 + " (" + obj1.getClass().getName() + ")\n\t lon index = " + lonIndex + ", value = " + obj2 + " (" + obj2.getClass().getName() + ")\n\t time index = " + timeIndex + ", value = " + obj3 + " (" + obj3.getClass().getName() + ")"); } catch (ParseException pe) { Debug.output("ScenarioGraphicLoader(" + getName() + ") has problem with time format. " + pe.getMessage()); } } } catch (MalformedURLException murle) { Debug.error("ScenarioGraphicLoader: problem with activity file: " + activityFile); return list; } catch (NullPointerException npe) { Debug.error("ScenarioGraphicLoader (" + getName() + ") null pointer exception, most likely a problem finding the activites data file"); } } else { Debug.error("ScenarioGraphicLoader(" + getName() + "): Activity file (" + activityFile + ") not configured."); return list; } this.time = startTime; Debug.message("scenario", "Reading files OK"); return list; }
3071 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3071/96b1bb77f22226b8ff30eac5a3196e7150e17ac1/ScenarioGraphicLoader.java/buggy/src/openmap/com/bbn/openmap/graphicLoader/scenario/ScenarioGraphicLoader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3852, 2850, 7754, 29459, 682, 752, 751, 1435, 288, 3639, 2850, 7754, 29459, 682, 666, 273, 394, 2850, 7754, 29459, 682, 5621, 3639, 18559, 5313, 273, 394, 18559, 5621, 3639, 368, 1788...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 3852, 2850, 7754, 29459, 682, 752, 751, 1435, 288, 3639, 2850, 7754, 29459, 682, 666, 273, 394, 2850, 7754, 29459, 682, 5621, 3639, 18559, 5313, 273, 394, 18559, 5621, 3639, 368, 1788...
mipmapLevel,
private static TextureData newTextureDataImpl(File file, int mipmapLevel, int internalFormat, int pixelFormat, String fileSuffix) throws IOException { for (Iterator iter = textureProviders.iterator(); iter.hasNext(); ) { TextureProvider provider = (TextureProvider) iter.next(); TextureData data = provider.newTextureData(file, mipmapLevel, internalFormat, pixelFormat, fileSuffix); if (data != null) { return data; } } return null; }
47282 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47282/a295d66a868c897b71104f3dd4c94601c7463840/TextureIO.java/clean/src/classes/com/sun/opengl/utils/TextureIO.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 760, 28582, 751, 394, 10967, 751, 2828, 12, 812, 585, 16, 4766, 7734, 509, 4766, 7734, 509, 2713, 1630, 16, 4766, 7734, 509, 4957, 1630, 16, 4766, 7734, 514, 585, 5791, 13, 1216, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 760, 28582, 751, 394, 10967, 751, 2828, 12, 812, 585, 16, 4766, 7734, 509, 4766, 7734, 509, 2713, 1630, 16, 4766, 7734, 509, 4957, 1630, 16, 4766, 7734, 514, 585, 5791, 13, 1216, ...
@NotNull @Validate(Integer.class) Set ids, Map options)
@NotNull @Validate(Long.class) Set ids, Map options)
public Map getCollectionCount(@NotNull String type, @NotNull String property, @NotNull @Validate(Integer.class) Set ids, Map options) { Map results = new HashMap(); String alphaNumeric = "^\\w+$"; String alphaNumericDotted = "^\\w[.\\w]+$"; // TODO annotations if (!type.matches(alphaNumericDotted)) { throw new IllegalArgumentException("Type argument to getCollectionCount may ONLY be alpha-numeric with dots ("+alphaNumericDotted+")"); } if (!property.matches(alphaNumeric)) { throw new IllegalArgumentException("Property argument to getCollectionCount may ONLY be alpha-numeric ("+alphaNumeric+")"); } if (iQuery.checkType(type)) { throw new IllegalArgumentException(type+"."+property+" is an unknown type."); } if (iQuery.checkProperty(type,property)) { throw new IllegalArgumentException(type+"."+property+" is an unknown property on type "+type); } String query = "select size(table."+property+") from "+type+" table where table.id = ?"; // FIXME: optimize by doing new list(id,size(table.property)) ... group by id for (Iterator iter = ids.iterator(); iter.hasNext();) { Integer id = (Integer) iter.next(); Integer count = (Integer) iQuery.queryUnique(query,new Object[]{id}); results.put(id,count); } return results; }
54698 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54698/0b36a8e77f5bacb7e122d76ffce01866205b09d7/PojosImpl.java/clean/components/server/src/ome/logic/PojosImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1635, 12075, 1380, 26964, 5962, 514, 618, 16, 632, 5962, 514, 1272, 16, 2398, 632, 5962, 632, 4270, 12, 3708, 18, 1106, 13, 1000, 3258, 16, 1635, 702, 13, 565, 288, 7734, 1635, 16...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1635, 12075, 1380, 26964, 5962, 514, 618, 16, 632, 5962, 514, 1272, 16, 2398, 632, 5962, 632, 4270, 12, 3708, 18, 1106, 13, 1000, 3258, 16, 1635, 702, 13, 565, 288, 7734, 1635, 16...
}
}
public void resetLastActionCount() { lastAction = null; lastActionCount = 0; }
8690 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8690/e558666642895259956d98b00ac352973beb1d14/InputHandler.java/buggy/org/gjt/sp/jedit/gui/InputHandler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 2715, 3024, 1803, 1380, 1435, 202, 95, 202, 202, 2722, 1803, 273, 446, 31, 202, 202, 2722, 1803, 1380, 273, 374, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 2715, 3024, 1803, 1380, 1435, 202, 95, 202, 202, 2722, 1803, 273, 446, 31, 202, 202, 2722, 1803, 1380, 273, 374, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100,...
_t = __t359;
_t = __t363;
public final void accumulatestate(AST _t) throws RecognitionException { AST accumulatestate_AST_in = (_t == ASTNULL) ? null : (AST)_t; AST __t359 = _t; AST tmp246_AST_in = (AST)_t; match(_t,ACCUMULATE); _t = _t.getFirstChild(); { _loop361: do { if (_t==null) _t=ASTNULL; if ((_t.getType()==Form_item)) { display_item(_t); _t = _retTree; } else { break _loop361; } } while (true); } state_end(_t); _t = _retTree; _t = __t359; _t = _t.getNextSibling(); _retTree = _t; }
13952 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13952/daa15e07422d3491bbbb4d0060450c81983332a4/JPTreeParser.java/clean/trunk/org.prorefactor.core/src/org/prorefactor/treeparserbase/JPTreeParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 8822, 270, 395, 340, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 8822, 270, 395, 340, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 8822, 270, 395, 340, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 8822, 270, 395, 340, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, ...
if (selectedFileName != null) setDestinationValue(selectedFileName); }
if (selectedFileName != null) setDestinationValue(selectedFileName); }
protected void handleDestinationBrowseButtonPressed() { FileDialog dialog = new FileDialog(getContainer().getShell(), SWT.SAVE); dialog.setText(PreferencesMessages .getString("WizardPreferencesExportPage1.saveAs")); //$NON-NLS-1$ dialog.setFilterPath(getDestinationValue()); dialog.setFilterExtensions(new String[] { "*.epf" }); //$NON-NLS-1$ String selectedFileName = dialog.open(); if (selectedFileName != null) setDestinationValue(selectedFileName); }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/07624c67770db65cb83e43199aa059a496edb575/WizardPreferencesPage.java/buggy/bundles/org.eclipse.ui.ide/src/org/eclipse/ui/internal/wizards/preferences/WizardPreferencesPage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 1640, 5683, 27304, 3616, 24624, 1435, 288, 202, 202, 812, 6353, 6176, 273, 394, 1387, 6353, 12, 588, 2170, 7675, 588, 13220, 9334, 348, 8588, 18, 25242, 1769, 202, 202, 12...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 1640, 5683, 27304, 3616, 24624, 1435, 288, 202, 202, 812, 6353, 6176, 273, 394, 1387, 6353, 12, 588, 2170, 7675, 588, 13220, 9334, 348, 8588, 18, 25242, 1769, 202, 202, 12...
JavaType mappedType = typeToJavaType(cArgType, true, machDesc);
JavaType mappedType = typeToJavaType(cArgType, true, curMachDesc);
private MethodBinding bindFunction(FunctionSymbol sym, JavaType containingType, Type containingCType) { MethodBinding binding = new MethodBinding(sym, containingType, containingCType); binding.setRenamedMethodName(cfg.getJavaMethodRename(sym.getName())); if (cfg.returnsString(binding.getName())) { PointerType prt = sym.getReturnType().asPointer(); if (prt == null || prt.getTargetType().asInt() == null || prt.getTargetType().getSize(machDesc) != 1) { throw new RuntimeException( "Cannot apply ReturnsString configuration directive to \"" + sym + "\". ReturnsString requires native method to have return type \"char *\""); } binding.setJavaReturnType(javaType(java.lang.String.class)); } else { binding.setJavaReturnType(typeToJavaType(sym.getReturnType(), false, machDesc)); } // List of the indices of the arguments in this function that should be // converted from byte[] to String List stringArgIndices = cfg.stringArguments(binding.getName()); for (int i = 0; i < sym.getNumArguments(); i++) { Type cArgType = sym.getArgumentType(i); JavaType mappedType = typeToJavaType(cArgType, true, machDesc); //System.out.println("C arg type -> \"" + cArgType + "\"" ); //System.out.println(" Java -> \"" + mappedType + "\"" ); // Take into account any ArgumentIsString configuration directives that apply if (stringArgIndices != null && stringArgIndices.contains(new Integer(i))) { //System.out.println("Forcing conversion of " + binding.getName() + " arg #" + i + " from byte[] to String "); if (mappedType.isCVoidPointerType() || mappedType.isCCharPointerType() || (mappedType.isArray() && mappedType.getJavaClass() == ArrayTypes.byteBufferArrayClass)) { // convert mapped type from void* and byte[] to String, or ByteBuffer[] to String[] if (mappedType.getJavaClass() == ArrayTypes.byteBufferArrayClass) { mappedType = javaType(ArrayTypes.stringArrayClass); } else { mappedType = javaType(String.class); } } else { throw new RuntimeException( "Cannot apply ArgumentIsString configuration directive to " + "argument " + i + " of \"" + sym + "\": argument type is not " + "a \"void*\", \"char *\", or \"char**\" equivalent"); } } binding.addJavaArgumentType(mappedType); //System.out.println("During binding of [" + sym + "], added mapping from C type: " + cArgType + " to Java type: " + mappedType); } //System.err.println("---> " + binding); //System.err.println(" ---> " + binding.getCSymbol()); return binding; }
47282 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47282/875a3de8f54704604d006badf0f0747347319025/JavaEmitter.java/buggy/src/classes/com/sun/gluegen/JavaEmitter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 2985, 5250, 1993, 2083, 12, 2083, 5335, 5382, 16, 19694, 5110, 559, 4191, 559, 16, 19694, 1412, 4191, 39, 559, 13, 288, 565, 2985, 5250, 5085, 273, 394, 2985, 5250, 12, 8117, 16, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 2985, 5250, 1993, 2083, 12, 2083, 5335, 5382, 16, 19694, 5110, 559, 4191, 559, 16, 19694, 1412, 4191, 39, 559, 13, 288, 565, 2985, 5250, 5085, 273, 394, 2985, 5250, 12, 8117, 16, ...
if (x == null || x.equals("")) { if (y == null || y.equals("")) { return ""; } else { return y; } } else if (y == null || y.equals("")) { return x; } else { return x + ", " + y; } }
if (x == null || x.equals("")) { if (y == null || y.equals("")) { return ""; } else { return y; } } else if (y == null || y.equals("")) { return x; } else { return x + ", " + y; } }
private static String addLists(String x, String y) { if (x == null || x.equals("")) { if (y == null || y.equals("")) { return ""; } else { return y; } } else if (y == null || y.equals("")) { return x; } else { return x + ", " + y; } }
37907 /local/tlutelli/issta_data/temp/all_java3context/java/2006_temp/2006/37907/b5b5168edc3af09cb74945a80b0c36e6630ed502/XmlFileTask.java/clean/src/main/mondrian/resource/XmlFileTask.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 514, 527, 7432, 12, 780, 619, 16, 514, 677, 13, 288, 202, 202, 430, 261, 92, 422, 446, 747, 619, 18, 14963, 2932, 6, 3719, 288, 1082, 202, 430, 261, 93, 422, 446, 747, 67...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 760, 514, 527, 7432, 12, 780, 619, 16, 514, 677, 13, 288, 202, 202, 430, 261, 92, 422, 446, 747, 619, 18, 14963, 2932, 6, 3719, 288, 1082, 202, 430, 261, 93, 422, 446, 747, 67...
boolean enable = !ICDTLaunchConfigurationConstants.DEBUGGER_MODE_CORE.equals( configuration.getAttribute( ICDTLaunchConfigurationConstants.ATTR_DEBUGGER_START_MODE, "" ) );
boolean enable = !ICDTLaunchConfigurationConstants.DEBUGGER_MODE_CORE.equals( configuration.getAttribute( ICDTLaunchConfigurationConstants.ATTR_DEBUGGER_START_MODE, "" ) );
protected void initializeButtons( ILaunchConfiguration configuration ) { try { boolean enable = !ICDTLaunchConfigurationConstants.DEBUGGER_MODE_CORE.equals( configuration.getAttribute( ICDTLaunchConfigurationConstants.ATTR_DEBUGGER_START_MODE, "" ) ); if ( fAutoSoLibButton != null ) fAutoSoLibButton.setEnabled( enable ); if ( fStopOnSolibEventsButton != null ) fStopOnSolibEventsButton.setEnabled( enable ); } catch( CoreException e ) { } }
6192 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6192/ea9c35588917a0214a5924a0d7080932ed7fc249/GDBSolibBlock.java/clean/debug/org.eclipse.cdt.debug.mi.ui/src/org/eclipse/cdt/debug/mi/internal/ui/GDBSolibBlock.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 4046, 14388, 12, 467, 9569, 1750, 1664, 262, 202, 95, 202, 202, 698, 202, 202, 95, 1082, 202, 6494, 4237, 273, 401, 2871, 40, 5967, 4760, 1750, 2918, 18, 9394, 3101, 67,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 918, 4046, 14388, 12, 467, 9569, 1750, 1664, 262, 202, 95, 202, 202, 698, 202, 202, 95, 1082, 202, 6494, 4237, 273, 401, 2871, 40, 5967, 4760, 1750, 2918, 18, 9394, 3101, 67,...