rem
stringlengths
1
53.3k
add
stringlengths
0
80.5k
context
stringlengths
6
326k
meta
stringlengths
141
403
input_ids
list
attention_mask
list
labels
list
case AttributePackage.EMBEDDED_IMAGE__TYPE : unsetType( ); return; case AttributePackage.EMBEDDED_IMAGE__URL : setURL( URL_EDEFAULT ); return;
public void eUnset( EStructuralFeature eFeature ) { switch ( eDerivedStructuralFeatureID( eFeature ) ) { case AttributePackage.EMBEDDED_IMAGE__TYPE : unsetType( ); return; case AttributePackage.EMBEDDED_IMAGE__URL : setURL( URL_EDEFAULT ); return; case AttributePackage.EMBEDDED_IMAGE__DATA : setData( DATA_EDEFAULT ); return; } eDynamicUnset( eFeature ); }
12803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12803/036e8c78765730b146e5854b9d6c397a296fed86/EmbeddedImageImpl.java/clean/chart/org.eclipse.birt.chart.engine/src/org/eclipse/birt/chart/model/attribute/impl/EmbeddedImageImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19698, 12, 512, 14372, 4595, 425, 4595, 262, 202, 95, 202, 202, 9610, 261, 425, 21007, 14372, 4595, 734, 12, 425, 4595, 262, 262, 202, 202, 95, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 2399, 294, 9506, 202, 18579, 559, 12, 11272, 9506, 202, 2463, 31, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 1785, 294, 9506, 202, 542, 1785, 12, 1976, 67, 11236, 11272, 9506, 202, 2463, 31, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 4883, 294, 9506, 202, 542, 751, 12, 8730, 67, 11236, 11272, 9506, 202, 2463, 31, 202, 202, 97, 202, 202, 73, 9791, 13250, 12, 425, 4595, 11272, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 19698, 12, 512, 14372, 4595, 425, 4595, 262, 202, 95, 202, 202, 9610, 261, 425, 21007, 14372, 4595, 734, 12, 425, 4595, 262, 262, 202, 202, 95, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 2399, 294, 9506, 202, 18579, 559, 12, 11272, 9506, 202, 2463, 31, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 1785, 294, 9506, 202, 542, 1785, 12, 1976, 67, 11236, 11272, 9506, 202, 2463, 31, 1082, 202, 3593, 3601, 2261, 18, 3375, 22235, 7660, 67, 13603, 972, 4883, 294, 9506, 202, 542, 751, 12, 8730, 67, 11236, 11272, 9506, 202, 2463, 31, 202, 202, 97, 202, 202, 73, 9791, 13250, 12, 425, 2 ]
_items.addElement(item); _numChecks++; }
_items.addElement(item); _numChecks++; }
public void addItem(CheckItem item) { _items.addElement(item); _numChecks++; }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/ca3bcb5d6dd283c4553bcbfe50b108dc5d499768/ChecklistStatus.java/clean/src_new/org/argouml/cognitive/checklist/ChecklistStatus.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 15009, 12, 1564, 1180, 761, 13, 288, 565, 389, 3319, 18, 1289, 1046, 12, 1726, 1769, 565, 389, 2107, 4081, 9904, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 15009, 12, 1564, 1180, 761, 13, 288, 565, 389, 3319, 18, 1289, 1046, 12, 1726, 1769, 565, 389, 2107, 4081, 9904, 31, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public void prepare() { Assert.UNREACHABLE(); }
public void prepare() { }
public void prepare() { Assert.UNREACHABLE(); }
3029 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3029/8d44c729f3a97e0c1bbbff2ae4cf1b4945163634/jq_Reference.java/buggy/joeq_core/joeq/Class/jq_Reference.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 918, 2911, 1435, 288, 5452, 18, 2124, 862, 18133, 2782, 5621, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 918, 2911, 1435, 288, 5452, 18, 2124, 862, 18133, 2782, 5621, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
for (int i = 0; i < projectContentProviders.length; i++) { if (((NavigatorContentProvider) projectContentProviders[i])
INavigatorContentExtension ext; for (Iterator i = projectContentExtensions.iterator(); i.hasNext(); ) { ext = (INavigatorContentExtension) i.next(); if (((SafeDelegateTreeContentProvider) ext.getContentProvider())
public void testFindValidExtensions() { contentService.activateExtensions(new String[] { TEST_EXTENSION_ID, RESOURCE_EXTENSION_ID }, true); ITreeContentProvider contentServiceContentProvider = contentService .createCommonContentProvider(); ILabelProvider contentServiceLabelProvider = contentService .createCommonLabelProvider(); ITreeContentProvider[] rootContentProviders = ((NavigatorContentService) contentService) .findRootContentProviders(ResourcesPlugin.getWorkspace() .getRoot()); assertEquals("Ensure there is only one root content provider.", 1, rootContentProviders.length); ITreeContentProvider[] projectContentProviders = ((NavigatorContentService) contentService) .findRelevantContentProviders(project); assertEquals("Ensure there are two content providers for an IProject.", 2, projectContentProviders.length); boolean found = false; for (int i = 0; i < projectContentProviders.length; i++) { if (((NavigatorContentProvider) projectContentProviders[i]) .getDelegateContentProvider() instanceof TestContentProvider) { TestContentProvider testContentProvider = (TestContentProvider) ((NavigatorContentProvider) projectContentProviders[i]) .getDelegateContentProvider(); Object[] projectChildren = testContentProvider .getChildren(project); assertEquals( "There should be one test-type child of the project.", 1, projectChildren.length); assertEquals("Parent", contentServiceLabelProvider .getText(projectChildren[0])); Object[] testRootChildren = contentServiceContentProvider .getChildren(projectChildren[0]); assertEquals( "There should be one test-type child of the root test-type item.", 3, testRootChildren.length); found = true; } } assertTrue("The test content provider was not found.", found); }
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/c93d807ed962723d90daba76fc2003e2c1801cbc/INavigatorContentServiceTests.java/buggy/tests/org.eclipse.ui.tests.navigator/src/org/eclipse/ui/tests/navigator/INavigatorContentServiceTests.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 3125, 1556, 7513, 1435, 288, 202, 202, 1745, 1179, 18, 10014, 7513, 12, 2704, 514, 8526, 288, 22130, 67, 12796, 67, 734, 16, 9506, 202, 11395, 67, 12796, 67, 734, 19879, 638, 1769, 202, 202, 1285, 992, 1350, 2249, 913, 1179, 1350, 2249, 273, 913, 1179, 9506, 202, 18, 2640, 6517, 1350, 2249, 5621, 202, 202, 45, 2224, 2249, 913, 1179, 2224, 2249, 273, 913, 1179, 9506, 202, 18, 2640, 6517, 2224, 2249, 5621, 202, 202, 1285, 992, 1350, 2249, 8526, 1365, 1350, 10672, 273, 14015, 22817, 1350, 1179, 13, 913, 1179, 13, 9506, 202, 18, 4720, 2375, 1350, 10672, 12, 3805, 3773, 18, 588, 8241, 1435, 25083, 202, 18, 588, 2375, 10663, 202, 202, 11231, 8867, 2932, 12512, 1915, 353, 1338, 1245, 1365, 913, 2893, 1199, 16, 404, 16, 9506, 202, 3085, 1350, 10672, 18, 2469, 1769, 202, 202, 1285, 992, 1350, 2249, 8526, 1984, 1350, 10672, 273, 14015, 22817, 1350, 1179, 13, 913, 1179, 13, 9506, 202, 18, 4720, 17018, 7445, 1350, 10672, 12, 4406, 1769, 202, 202, 11231, 8867, 2932, 12512, 1915, 854, 2795, 913, 9165, 364, 392, 467, 4109, 1199, 16, 9506, 202, 22, 16, 1984, 1350, 10672, 18, 2469, 1769, 202, 202, 6494, 1392, 273, 629, 31, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 1984, 1350, 10672, 18, 2469, 31, 277, 27245, 288, 1082, 202, 430, 261, 12443, 22817, 1350, 2249, 13, 1984, 1350, 10672, 63, 77, 5717, 6862, 202, 18, 588, 9586, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 3125, 1556, 7513, 1435, 288, 202, 202, 1745, 1179, 18, 10014, 7513, 12, 2704, 514, 8526, 288, 22130, 67, 12796, 67, 734, 16, 9506, 202, 11395, 67, 12796, 67, 734, 19879, 638, 1769, 202, 202, 1285, 992, 1350, 2249, 913, 1179, 1350, 2249, 273, 913, 1179, 9506, 202, 18, 2640, 6517, 1350, 2249, 5621, 202, 202, 45, 2224, 2249, 913, 1179, 2224, 2249, 273, 913, 1179, 9506, 202, 18, 2640, 6517, 2224, 2249, 5621, 202, 202, 1285, 992, 1350, 2249, 8526, 1365, 1350, 10672, 273, 14015, 22817, 1350, 1179, 13, 913, 1179, 13, 9506, 202, 18, 4720, 2375, 1350, 10672, 12, 3805, 3773, 18, 588, 8241, 1435, 25083, 202, 18, 588, 2375, 10663, 202, 2 ]
maxWidth = Math.max(maxWidth, pixelX - x);
pixelX += metrics.charsWidth(buffer, end - count, count);
public static final int getTabbedTextWidth(Segment s, FontMetrics metrics, int x, TabExpander e, int startOffset) { // This buffers the chars to be drawn. char[] buffer = s.array; // The current x coordinate. int pixelX = x; // The current maximum width. int maxWidth = 0; for (int offset = s.offset; offset < (s.offset + s.count); ++offset) { switch (buffer[offset]) { case '\t': // In case we have a tab, we just 'jump' over the tab. // When we have no tab expander we just use the width of 'm'. if (e != null) pixelX = (int) e.nextTabStop(pixelX, startOffset + offset - s.offset); else pixelX += metrics.charWidth(' '); break; case '\n': // In case we have a newline, we must 'draw' // the buffer and jump on the next line. pixelX += metrics.charWidth(buffer[offset]); maxWidth = Math.max(maxWidth, pixelX - x); pixelX = x; break; default: // Here we draw the char. pixelX += metrics.charWidth(buffer[offset]); break; } } // Take the last line into account. maxWidth = Math.max(maxWidth, pixelX - x); return maxWidth; }
1056 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1056/ba862f89183b5347853381927a04e1e399fae5db/Utilities.java/buggy/core/src/classpath/javax/javax/swing/text/Utilities.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 727, 509, 3181, 378, 2992, 1528, 2384, 12, 4131, 272, 16, 10063, 5653, 4309, 16, 4766, 2398, 509, 619, 16, 9483, 12271, 264, 425, 16, 4766, 2398, 509, 18245, 13, 225, 288, 565, 368, 1220, 9664, 326, 5230, 358, 506, 19377, 18, 565, 1149, 8526, 1613, 273, 272, 18, 1126, 31, 565, 368, 1021, 783, 619, 7799, 18, 565, 509, 4957, 60, 273, 619, 31, 565, 368, 1021, 783, 4207, 1835, 18, 565, 509, 17681, 273, 374, 31, 565, 364, 261, 474, 1384, 273, 272, 18, 3348, 31, 1384, 411, 261, 87, 18, 3348, 397, 272, 18, 1883, 1769, 965, 3348, 13, 1377, 288, 202, 9610, 261, 4106, 63, 3348, 5717, 202, 225, 288, 202, 225, 648, 2337, 88, 4278, 202, 565, 368, 657, 648, 732, 1240, 279, 3246, 16, 732, 2537, 296, 24574, 11, 1879, 326, 3246, 18, 202, 565, 368, 5203, 732, 1240, 1158, 3246, 4542, 264, 732, 2537, 999, 326, 1835, 434, 296, 81, 10332, 202, 565, 309, 261, 73, 480, 446, 13, 202, 1377, 4957, 60, 273, 261, 474, 13, 425, 18, 4285, 5661, 4947, 12, 11743, 60, 16, 25083, 282, 18245, 397, 1384, 300, 272, 18, 3348, 1769, 202, 565, 469, 202, 1377, 4957, 60, 1011, 4309, 18, 3001, 2384, 2668, 28005, 202, 565, 898, 31, 202, 225, 648, 2337, 82, 4278, 202, 565, 368, 657, 648, 732, 1240, 279, 9472, 16, 732, 1297, 296, 9446, 11, 202, 565, 368, 326, 1613, 471, 11833, 603, 326, 1024, 980, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 727, 509, 3181, 378, 2992, 1528, 2384, 12, 4131, 272, 16, 10063, 5653, 4309, 16, 4766, 2398, 509, 619, 16, 9483, 12271, 264, 425, 16, 4766, 2398, 509, 18245, 13, 225, 288, 565, 368, 1220, 9664, 326, 5230, 358, 506, 19377, 18, 565, 1149, 8526, 1613, 273, 272, 18, 1126, 31, 565, 368, 1021, 783, 619, 7799, 18, 565, 509, 4957, 60, 273, 619, 31, 565, 368, 1021, 783, 4207, 1835, 18, 565, 509, 17681, 273, 374, 31, 565, 364, 261, 474, 1384, 273, 272, 18, 3348, 31, 1384, 411, 261, 87, 18, 3348, 397, 272, 18, 1883, 1769, 965, 3348, 13, 1377, 288, 202, 9610, 261, 4106, 63, 3348, 5717, 202, 225, 288, 202, 225, 2 ]
Record r = (Record) rrs.elementAt(0);
getType() { if (rrs.size() == 0) return 0; Record r = (Record) rrs.elementAt(0); return r.getType();}
4227 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4227/ef360d4956ad97017932cf2e1075cd4fed56c5e2/RRset.java/buggy/org/xbill/DNS/RRset.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3130, 1435, 288, 202, 430, 261, 523, 87, 18, 1467, 1435, 422, 374, 13, 202, 202, 2463, 374, 31, 202, 2115, 436, 273, 225, 261, 2115, 13, 436, 5453, 18, 2956, 861, 12, 20, 1769, 202, 2463, 436, 18, 588, 559, 5621, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3130, 1435, 288, 202, 430, 261, 523, 87, 18, 1467, 1435, 422, 374, 13, 202, 202, 2463, 374, 31, 202, 2115, 436, 273, 225, 261, 2115, 13, 436, 5453, 18, 2956, 861, 12, 20, 1769, 202, 2463, 436, 18, 588, 559, 5621, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public BaseDomElementNode getRootElement() {
public DomFileElementNode getRootElement() {
public BaseDomElementNode getRootElement() { return createRoot(myFileElement); }
17306 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/17306/cdcb733436d5b1eebe1b2d8aac3f4d4462ab690a/DomModelTreeStructure.java/buggy/source/com/intellij/util/xml/tree/DomModelTreeStructure.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 12965, 812, 1046, 907, 7656, 1046, 1435, 288, 565, 327, 752, 2375, 12, 4811, 812, 1046, 1769, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 12965, 812, 1046, 907, 7656, 1046, 1435, 288, 565, 327, 752, 2375, 12, 4811, 812, 1046, 1769, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
void splitKeyVal(byte [] line, Text key, Text val) throws IOException { int pos=-1; if(keyCols_ != ALL_COLS) { pos = UTF8ByteArrayUtils.findTab(line);
void splitKeyVal(byte[] line, Text key, Text val) throws IOException { int pos = -1; if (keyCols_ != ALL_COLS) { pos = UTF8ByteArrayUtils.findTab(line);
void splitKeyVal(byte [] line, Text key, Text val) throws IOException { int pos=-1; if(keyCols_ != ALL_COLS) { pos = UTF8ByteArrayUtils.findTab(line); } try { if(pos == -1) { key.set(line); val.set(""); } else { UTF8ByteArrayUtils.splitKeyVal(line, key, val, pos); } } catch (CharacterCodingException e) { LOG.warn(e); StringUtils.stringifyException(e); } }
50370 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50370/e10b40e8014547113799b2653164e8c990d41209/PipeMapRed.java/buggy/src/contrib/streaming/src/java/org/apache/hadoop/streaming/PipeMapRed.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 918, 1416, 653, 3053, 12, 7229, 5378, 980, 16, 3867, 498, 16, 3867, 1244, 13, 1216, 1860, 225, 288, 565, 509, 949, 29711, 21, 31, 565, 309, 12, 856, 8011, 67, 480, 8061, 67, 4935, 55, 13, 288, 3639, 949, 273, 6380, 28, 8826, 1989, 18, 4720, 5661, 12, 1369, 1769, 565, 289, 565, 775, 288, 3639, 309, 12, 917, 422, 300, 21, 13, 288, 5411, 498, 18, 542, 12, 1369, 1769, 5411, 1244, 18, 542, 2932, 8863, 3639, 289, 469, 288, 5411, 6380, 28, 8826, 1989, 18, 4939, 653, 3053, 12, 1369, 16, 498, 16, 1244, 16, 949, 1769, 3639, 289, 565, 289, 1044, 261, 7069, 30315, 503, 425, 13, 288, 3639, 2018, 18, 8935, 12, 73, 1769, 3639, 5778, 18, 25650, 503, 12, 73, 1769, 565, 289, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 918, 1416, 653, 3053, 12, 7229, 5378, 980, 16, 3867, 498, 16, 3867, 1244, 13, 1216, 1860, 225, 288, 565, 509, 949, 29711, 21, 31, 565, 309, 12, 856, 8011, 67, 480, 8061, 67, 4935, 55, 13, 288, 3639, 949, 273, 6380, 28, 8826, 1989, 18, 4720, 5661, 12, 1369, 1769, 565, 289, 565, 775, 288, 3639, 309, 12, 917, 422, 300, 21, 13, 288, 5411, 498, 18, 542, 12, 1369, 1769, 5411, 1244, 18, 542, 2932, 8863, 3639, 289, 469, 288, 5411, 6380, 28, 8826, 1989, 18, 4939, 653, 3053, 12, 1369, 16, 498, 16, 1244, 16, 949, 1769, 3639, 289, 565, 289, 1044, 261, 7069, 30315, 503, 425, 13, 288, 3639, 2018, 18, 8935, 12, 73, 2 ]
util.dprintln(4, "quality q1");
logger.debug("quality q1");
public void setQuality(int qual) { quality = qual; // setup interpolation quality if (qual > 1) { util.dprintln(4, "quality q2"); interpol = Interpolation.getInstance(Interpolation.INTERP_BICUBIC); } else if (qual == 1) { util.dprintln(4, "quality q1"); interpol = Interpolation.getInstance(Interpolation.INTERP_BILINEAR); } else { util.dprintln(4, "quality q0"); interpol = Interpolation.getInstance(Interpolation.INTERP_NEAREST); } }
53488 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/53488/a15bccbb1f38458138bc2da842bfc1f95800141c/JAIDocuImage.java/buggy/servlet/src/digilib/image/JAIDocuImage.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 444, 14846, 12, 474, 4544, 13, 288, 202, 202, 16495, 273, 4544, 31, 202, 202, 759, 3875, 12851, 9312, 202, 202, 430, 261, 3369, 405, 404, 13, 288, 1082, 202, 1367, 18, 72, 8222, 12, 24, 16, 315, 16495, 1043, 22, 8863, 1082, 202, 18676, 273, 24301, 367, 18, 588, 1442, 12, 31516, 18, 9125, 52, 67, 38, 2871, 3457, 2871, 1769, 202, 202, 97, 469, 309, 261, 3369, 422, 404, 13, 288, 1082, 202, 1367, 18, 72, 8222, 12, 24, 16, 315, 16495, 1043, 21, 8863, 1082, 202, 18676, 273, 24301, 367, 18, 588, 1442, 12, 31516, 18, 9125, 52, 67, 38, 30690, 985, 1769, 202, 202, 97, 469, 288, 1082, 202, 1367, 18, 72, 8222, 12, 24, 16, 315, 16495, 1043, 20, 8863, 1082, 202, 18676, 273, 24301, 367, 18, 588, 1442, 12, 31516, 18, 9125, 52, 67, 5407, 9332, 882, 1769, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 444, 14846, 12, 474, 4544, 13, 288, 202, 202, 16495, 273, 4544, 31, 202, 202, 759, 3875, 12851, 9312, 202, 202, 430, 261, 3369, 405, 404, 13, 288, 1082, 202, 1367, 18, 72, 8222, 12, 24, 16, 315, 16495, 1043, 22, 8863, 1082, 202, 18676, 273, 24301, 367, 18, 588, 1442, 12, 31516, 18, 9125, 52, 67, 38, 2871, 3457, 2871, 1769, 202, 202, 97, 469, 309, 261, 3369, 422, 404, 13, 288, 1082, 202, 1367, 18, 72, 8222, 12, 24, 16, 315, 16495, 1043, 21, 8863, 1082, 202, 18676, 273, 24301, 367, 18, 588, 1442, 12, 31516, 18, 9125, 52, 67, 38, 30690, 985, 1769, 202, 202, 97, 469, 288, 1082, 202, 1367, 18, 2 ]
doc.setIndexListener(listener);
doc.getMetadata().setIndexListener(listener);
public Sequence eval(Sequence contextSequence, Item contextItem) throws XPathException { if (context.getProfiler().isEnabled()) { context.getProfiler().start(this); context.getProfiler().message(this, Profiler.DEPENDENCIES, "DEPENDENCIES", Dependency.getDependenciesName(this.getDependencies())); if (contextSequence != null) context.getProfiler().message(this, Profiler.START_SEQUENCES, "CONTEXT SEQUENCE", contextSequence); if (contextItem != null) context.getProfiler().message(this, Profiler.START_SEQUENCES, "CONTEXT ITEM", contextItem.toSequence()); } if (contextItem != null) contextSequence = contextItem.toSequence(); Sequence inSeq = select.eval(contextSequence); if (!Type.subTypeOf(inSeq.getItemType(), Type.NODE)) throw new XPathException(getASTNode(), Messages.getMessage(Error.UPDATE_SELECT_TYPE)); if (inSeq.getLength() > 0) { TransactionManager transact = context.getBroker().getBrokerPool().getTransactionManager(); Txn transaction = transact.beginTransaction(); try { NotificationService notifier = context.getBroker().getBrokerPool().getNotificationService(); StoredNode[] ql = selectAndLock(inSeq.toNodeSet()); IndexListener listener = new IndexListener(ql); NodeImpl node; NodeImpl parent; DocumentImpl doc = null; DocumentSet modifiedDocs = new DocumentSet(); for (int i = 0; i < ql.length; i++) { node = ql[i]; doc = (DocumentImpl) node.getOwnerDocument(); if (!doc.getPermissions().validate(context.getUser(), Permission.UPDATE)) { transact.abort(transaction); throw new XPathException(getASTNode(), "permission to update document denied"); } doc.setIndexListener(listener); modifiedDocs.add(doc); parent = (StoredNode) node.getParentNode(); if (parent.getNodeType() != Node.ELEMENT_NODE) { LOG.debug("parent = " + parent.getNodeType() + "; " + parent.getNodeName()); transact.abort(transaction); throw new XPathException(getASTNode(), "you cannot remove the document element. Use update " + "instead"); } else parent.removeChild(transaction, node); doc.clearIndexListener(); doc.setLastModified(System.currentTimeMillis()); context.getBroker().storeDocument(transaction, doc); notifier.notifyUpdate(doc, UpdateListener.UPDATE); } checkFragmentation(transaction, modifiedDocs); transact.commit(transaction); } catch (EXistException e) { transact.abort(transaction); throw new XPathException(getASTNode(), e.getMessage(), e); } catch (PermissionDeniedException e) { transact.abort(transaction); throw new XPathException(getASTNode(), e.getMessage(), e); } catch (LockException e) { transact.abort(transaction); throw new XPathException(getASTNode(), e.getMessage(), e); } finally { unlockDocuments(); } } if (context.getProfiler().isEnabled()) context.getProfiler().end(this, "", Sequence.EMPTY_SEQUENCE); return Sequence.EMPTY_SEQUENCE; }
2909 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2909/c5d2790bdab1765017391c0ebb965d6c8cddd989/Delete.java/clean/src/org/exist/xquery/update/Delete.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 8370, 5302, 12, 4021, 819, 4021, 16, 4342, 819, 1180, 13, 1216, 10172, 503, 288, 3639, 309, 261, 2472, 18, 588, 22060, 7675, 291, 1526, 10756, 288, 5411, 819, 18, 588, 22060, 7675, 1937, 12, 2211, 1769, 10402, 819, 18, 588, 22060, 7675, 2150, 12, 2211, 16, 28338, 18, 1639, 25690, 1157, 7266, 3991, 16, 315, 1639, 25690, 1157, 7266, 3991, 3113, 11993, 18, 588, 8053, 461, 12, 2211, 18, 588, 8053, 1435, 10019, 5411, 309, 261, 2472, 4021, 480, 446, 13, 7734, 819, 18, 588, 22060, 7675, 2150, 12, 2211, 16, 28338, 18, 7570, 67, 25330, 55, 16, 315, 13181, 27118, 3113, 819, 4021, 1769, 5411, 309, 261, 2472, 1180, 480, 446, 13, 7734, 819, 18, 588, 22060, 7675, 2150, 12, 2211, 16, 28338, 18, 7570, 67, 25330, 55, 16, 315, 13181, 25504, 3113, 819, 1180, 18, 869, 4021, 10663, 3639, 289, 540, 202, 202, 430, 261, 2472, 1180, 480, 446, 13, 1082, 202, 2472, 4021, 273, 819, 1180, 18, 869, 4021, 5621, 540, 202, 202, 4021, 316, 6926, 273, 2027, 18, 8622, 12, 2472, 4021, 1769, 3639, 309, 16051, 559, 18, 1717, 559, 951, 12, 267, 6926, 18, 588, 22580, 9334, 1412, 18, 8744, 3719, 5411, 604, 394, 10172, 503, 12, 588, 9053, 907, 9334, 4838, 18, 24906, 12, 668, 18, 8217, 67, 4803, 67, 2399, 10019, 540, 202, 202, 430, 261, 267, 6926, 18, 588, 1782, 1435, 405, 374, 13, 288, 5411, 5947, 1318, 906, 621, 273, 819, 18, 588, 11194, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 8370, 5302, 12, 4021, 819, 4021, 16, 4342, 819, 1180, 13, 1216, 10172, 503, 288, 3639, 309, 261, 2472, 18, 588, 22060, 7675, 291, 1526, 10756, 288, 5411, 819, 18, 588, 22060, 7675, 1937, 12, 2211, 1769, 10402, 819, 18, 588, 22060, 7675, 2150, 12, 2211, 16, 28338, 18, 1639, 25690, 1157, 7266, 3991, 16, 315, 1639, 25690, 1157, 7266, 3991, 3113, 11993, 18, 588, 8053, 461, 12, 2211, 18, 588, 8053, 1435, 10019, 5411, 309, 261, 2472, 4021, 480, 446, 13, 7734, 819, 18, 588, 22060, 7675, 2150, 12, 2211, 16, 28338, 18, 7570, 67, 25330, 55, 16, 315, 13181, 27118, 3113, 819, 4021, 1769, 5411, 309, 261, 2472, 1180, 480, 446, 13, 7734, 819, 2 ]
Vault.releaseDbConnection(dbConn);
if(m_dbConnection!=dbConn && dbConn!=null) Vault.releaseDbConnection(dbConn);
public static Element[] getElementsLike(String elementLabel) throws SQLException, MapsException { final String sqlQuery = "SELECT * FROM element WHERE elementlabel LIKE ?"; Connection dbConn = Vault.getDbConnection(); PreparedStatement statement = dbConn.prepareStatement(sqlQuery); elementLabel = "%" + elementLabel + "%"; statement.setString(1, elementLabel); ResultSet rs = statement.executeQuery(); Vector elements = rs2ElementVector(rs); Element[] el = new Element[elements.size()]; el=(Element[])elements.toArray(el); rs.close(); statement.close(); Vault.releaseDbConnection(dbConn); return el; }
47678 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47678/069d0e7b3a96289b7c94aecc6c8a14fee3498895/Factory.java/clean/opennms-webapp/src/main/java/org/opennms/web/map/db/Factory.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 3010, 8526, 8886, 8804, 12, 780, 930, 2224, 13, 1850, 1216, 6483, 16, 19837, 503, 288, 1377, 727, 514, 24451, 273, 315, 4803, 380, 4571, 930, 4852, 930, 1925, 13161, 692, 14432, 1377, 4050, 30795, 273, 17329, 18, 588, 4331, 1952, 5621, 1377, 16913, 3021, 273, 30795, 18, 9366, 3406, 12, 4669, 1138, 1769, 1377, 930, 2224, 273, 20880, 397, 930, 2224, 397, 2213, 14432, 1377, 3021, 18, 542, 780, 12, 21, 16, 930, 2224, 1769, 1377, 10842, 3597, 273, 3021, 18, 8837, 1138, 5621, 1377, 5589, 2186, 273, 3597, 22, 1046, 5018, 12, 5453, 1769, 1377, 3010, 8526, 415, 273, 394, 3010, 63, 6274, 18, 1467, 1435, 15533, 1377, 415, 28657, 1046, 63, 5717, 6274, 18, 31447, 12, 292, 1769, 1377, 3597, 18, 4412, 5621, 1377, 3021, 18, 4412, 5621, 1377, 309, 12, 81, 67, 1966, 1952, 5, 33, 1966, 3543, 597, 30795, 5, 33, 2011, 13, 17329, 18, 9340, 4331, 1952, 12, 1966, 3543, 1769, 1377, 327, 415, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 3010, 8526, 8886, 8804, 12, 780, 930, 2224, 13, 1850, 1216, 6483, 16, 19837, 503, 288, 1377, 727, 514, 24451, 273, 315, 4803, 380, 4571, 930, 4852, 930, 1925, 13161, 692, 14432, 1377, 4050, 30795, 273, 17329, 18, 588, 4331, 1952, 5621, 1377, 16913, 3021, 273, 30795, 18, 9366, 3406, 12, 4669, 1138, 1769, 1377, 930, 2224, 273, 20880, 397, 930, 2224, 397, 2213, 14432, 1377, 3021, 18, 542, 780, 12, 21, 16, 930, 2224, 1769, 1377, 10842, 3597, 273, 3021, 18, 8837, 1138, 5621, 1377, 5589, 2186, 273, 3597, 22, 1046, 5018, 12, 5453, 1769, 1377, 3010, 8526, 415, 273, 394, 3010, 63, 6274, 18, 1467, 1435, 15533, 1377, 415, 28657, 1046, 63, 5717, 6274, 2 ]
System.err.println("Usage: jlgen [-t token_func] [-c ConstClass] <input file>\nwhere:\n"+ "\t-t <func>\tfunction will accept an int and return a token\n"+
System.err.println("Usage: jlgen [-c ConstClass] <input file>\nwhere:\n"+
public static void usage() { System.err.println("Usage: jlgen [-t token_func] [-c ConstClass] <input file>\nwhere:\n"+ "\t-t <func>\tfunction will accept an int and return a token\n"+ "\t-c <Class>\tclass prepended to token names to pass to <func>\n"+ "\t<input>\ta JLgen or CUP source file\n"); System.exit(1); }
11982 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11982/26fc4d1a48a61b4891d4596c06f484a628c04cb1/PPG.java/clean/tools/ppg/src/ppg/PPG.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 4084, 1435, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 5357, 30, 525, 80, 4507, 23059, 88, 1147, 67, 644, 65, 23059, 71, 9333, 797, 65, 411, 2630, 585, 5333, 82, 6051, 5581, 82, 6, 15, 6862, 1082, 282, 1548, 88, 17, 88, 411, 644, 5333, 88, 915, 903, 2791, 392, 509, 471, 327, 279, 1147, 64, 82, 6, 15, 6862, 1082, 282, 1548, 88, 17, 71, 411, 797, 5333, 88, 1106, 26989, 358, 1147, 1257, 358, 1342, 358, 411, 644, 5333, 82, 6, 15, 6862, 1082, 282, 1548, 88, 32, 2630, 5333, 2351, 804, 48, 4507, 578, 385, 3079, 1084, 585, 64, 82, 8863, 202, 202, 3163, 18, 8593, 12, 21, 1769, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 4084, 1435, 288, 202, 202, 3163, 18, 370, 18, 8222, 2932, 5357, 30, 525, 80, 4507, 23059, 88, 1147, 67, 644, 65, 23059, 71, 9333, 797, 65, 411, 2630, 585, 5333, 82, 6051, 5581, 82, 6, 15, 6862, 1082, 282, 1548, 88, 17, 88, 411, 644, 5333, 88, 915, 903, 2791, 392, 509, 471, 327, 279, 1147, 64, 82, 6, 15, 6862, 1082, 282, 1548, 88, 17, 71, 411, 797, 5333, 88, 1106, 26989, 358, 1147, 1257, 358, 1342, 358, 411, 644, 5333, 82, 6, 15, 6862, 1082, 282, 1548, 88, 32, 2630, 5333, 2351, 804, 48, 4507, 578, 385, 3079, 1084, 585, 64, 82, 8863, 202, 202, 3163, 18, 8593, 12, 21, 1769, 2 ]
searchTextName = name; searchTextId = null; isFocusedSearch = true;
searchText = name; searchType = RegistrySearchMenu.NAME_SEARCH;
public void setNameSearch(String name) { if (name == null || name.length() == 0) { isFocusedSearch = false; return; } searchTextName = name; searchTextId = null; isFocusedSearch = true; }
14404 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/14404/d0dd0aaf734d95da88aa209249a887a791d32211/RegistryBrowserContentProvider.java/buggy/ui/org.eclipse.pde.runtime/src/org/eclipse/pde/internal/runtime/registry/RegistryBrowserContentProvider.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 6788, 2979, 12, 780, 508, 13, 288, 202, 202, 430, 261, 529, 422, 446, 747, 508, 18, 2469, 1435, 422, 374, 13, 288, 1082, 202, 291, 30946, 2979, 273, 629, 31, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 3072, 1528, 461, 273, 508, 31, 202, 202, 3072, 1528, 548, 273, 446, 31, 202, 202, 291, 30946, 2979, 273, 638, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 6788, 2979, 12, 780, 508, 13, 288, 202, 202, 430, 261, 529, 422, 446, 747, 508, 18, 2469, 1435, 422, 374, 13, 288, 1082, 202, 291, 30946, 2979, 273, 629, 31, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 3072, 1528, 461, 273, 508, 31, 202, 202, 3072, 1528, 548, 273, 446, 31, 202, 202, 291, 30946, 2979, 273, 638, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
retval.append(" "+XMLHandler.addTagValue("zipped", zipped));
public String getXML() { StringBuffer retval=new StringBuffer(); retval.append(" "+XMLHandler.addTagValue("separator", separator)); retval.append(" "+XMLHandler.addTagValue("enclosure", enclosure)); retval.append(" "+XMLHandler.addTagValue("enclosure_forced", enclosureForced)); retval.append(" "+XMLHandler.addTagValue("header", headerEnabled)); retval.append(" "+XMLHandler.addTagValue("footer", footerEnabled)); retval.append(" "+XMLHandler.addTagValue("format", fileFormat)); retval.append(" "+XMLHandler.addTagValue("encoding", encoding)); retval.append(" "+XMLHandler.addTagValue("endedLine", endedLine)); retval.append(" <file>"+Const.CR); retval.append(" "+XMLHandler.addTagValue("name", fileName)); retval.append(" "+XMLHandler.addTagValue("extention", extension)); retval.append(" "+XMLHandler.addTagValue("append", fileAppended)); retval.append(" "+XMLHandler.addTagValue("split", stepNrInFilename)); retval.append(" "+XMLHandler.addTagValue("add_date", dateInFilename)); retval.append(" "+XMLHandler.addTagValue("add_time", timeInFilename)); retval.append(" "+XMLHandler.addTagValue("zipped", zipped)); retval.append(" "+XMLHandler.addTagValue("pad", padded)); retval.append(" "+XMLHandler.addTagValue("splitevery", splitEvery)); retval.append(" </file>"+Const.CR); retval.append(" <fields>"+Const.CR); for (int i=0;i<outputFields.length;i++) { TextFileField field = outputFields[i]; if (field.getName()!=null && field.getName().length()!=0) { retval.append(" <field>"+Const.CR); retval.append(" "+XMLHandler.addTagValue("name", field.getName())); retval.append(" "+XMLHandler.addTagValue("type", field.getTypeDesc())); retval.append(" "+XMLHandler.addTagValue("format", field.getFormat())); retval.append(" "+XMLHandler.addTagValue("currency", field.getCurrencySymbol())); retval.append(" "+XMLHandler.addTagValue("decimal", field.getDecimalSymbol())); retval.append(" "+XMLHandler.addTagValue("group", field.getGroupingSymbol())); retval.append(" "+XMLHandler.addTagValue("nullif", field.getNullString())); retval.append(" "+XMLHandler.addTagValue("length", field.getLength())); retval.append(" "+XMLHandler.addTagValue("precision", field.getPrecision())); retval.append(" </field>"+Const.CR); } } retval.append(" </fields>"+Const.CR); return retval.toString(); }
58146 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58146/cb2af596873094d7ad894c834d670dd279d866ac/TextFileOutputMeta.java/clean/kettle/src/be/ibridge/kettle/trans/step/textfileoutput/TextFileOutputMeta.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 336, 4201, 1435, 202, 95, 202, 202, 780, 1892, 5221, 33, 2704, 6674, 5621, 9506, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 11287, 3113, 4182, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 1331, 5919, 3113, 23423, 10019, 3639, 5221, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 1331, 5919, 67, 19778, 3113, 23423, 1290, 3263, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 3374, 3113, 565, 1446, 1526, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 14723, 3113, 565, 9860, 1526, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 2139, 3113, 565, 585, 1630, 10019, 3639, 5221, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 5999, 3113, 225, 2688, 10019, 3639, 5221, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 3934, 1670, 3113, 225, 16926, 1670, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 411, 768, 2984, 15, 9661, 18, 5093, 1769, 202, 202, 18341, 18, 6923, 2932, 1377, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 529, 3113, 4202, 3968, 10019, 202, 202, 18341, 18, 6923, 2932, 1377, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 408, 5054, 3113, 225, 2710, 10019, 202, 202, 18341, 18, 6923, 2932, 1377, 13773, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 514, 336, 4201, 1435, 202, 95, 202, 202, 780, 1892, 5221, 33, 2704, 6674, 5621, 9506, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 11287, 3113, 4182, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 1331, 5919, 3113, 23423, 10019, 3639, 5221, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 1331, 5919, 67, 19778, 3113, 23423, 1290, 3263, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 3374, 3113, 565, 1446, 1526, 10019, 202, 202, 18341, 18, 6923, 2932, 565, 13773, 4201, 1503, 18, 1289, 1805, 620, 2932, 14723, 3113, 565, 2 ]
String temp[][] = IMCServiceRMI.sqlQueryMulti(imcserver,"select simple_name,count(meta_id),t.template_id from templates t left join text_docs td on td.template_id = t.template_id where lang_prefix = '"+lang+"' group by t.template_id,simple_name order by simple_name") ;
String temp[][] = imcref.sqlQueryMulti("select simple_name,count(meta_id),t.template_id from templates t left join text_docs td on td.template_id = t.template_id where lang_prefix = '"+lang+"' group by t.template_id,simple_name order by simple_name") ;
public void doPost ( HttpServletRequest req, HttpServletResponse res ) throws ServletException, IOException { String host = req.getHeader("Host") ; String imcserver = Utility.getDomainPref("adminserver",host) ; String start_url = Utility.getDomainPref( "start_url",host ) ; // Check if user logged on User user ; if ( (user=Check.userLoggedOn(req,res,start_url))==null ) { return ; } // Is user superadmin? String sqlStr = "select role_id from users,user_roles_crossref\n" ; sqlStr += "where users.user_id = user_roles_crossref.user_id\n" ; sqlStr += "and user_roles_crossref.role_id = 0\n" ; sqlStr += "and users.user_id = " + user.getInt("user_id") ; if ( IMCServiceRMI.sqlQuery(imcserver,sqlStr).length == 0 ) { Utility.redirect(req,res,start_url) ; return ; } res.setContentType("text/html") ;// res.setHeader("Cache-Control","no-cache; must-revalidate;") ;// res.setHeader("Pragma","no-cache;") ; PrintWriter out = res.getWriter() ; String lang_prefix = IMCServiceRMI.sqlQueryStr(imcserver, "select lang_prefix from lang_prefixes where lang_id = "+user.getInt("lang_id")) ; String lang = req.getParameter("language") ; String htmlStr = null ; if ( req.getParameter("cancel") != null ) { Utility.redirect(req,res,"AdminManager") ; return ; } else if ( req.getParameter("add_template") != null ) { Vector vec = new Vector() ; String temp[] ; temp = IMCServiceRMI.sqlProcedure(imcserver, "getTemplategroups") ; String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } vec.add("#templategroups#") ; vec.add(temps); vec.add("#language#") ; vec.add(lang) ; htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_upload.html",lang_prefix) ; } else if ( req.getParameter("add_demotemplate") != null ) { String list[] ; list = IMCServiceRMI.getDemoTemplateList(imcserver) ; String temp[] ; temp = IMCServiceRMI.sqlQuery(imcserver, "select template_id, simple_name from templates where lang_prefix = '"+lang+"' order by simple_name") ; Vector vec = new Vector() ; vec.add("#language#") ; vec.add(lang) ; if ( temp.length > 0 ) { String temps = "" ; for (int i = 0; i < temp.length; i+=2) { int tmp = Integer.parseInt(temp[i]) ; for ( int j = 0 ; j < list.length ; j++ ) { if ( Integer.parseInt(list[j]) == tmp ) { temp[i+1] = "*" + temp[i+1] ; break ; } } temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } vec.add("#templates#") ; vec.add(temps); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "templatedemo_upload.html",lang_prefix) ; } else { htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_no_langtemplates.html",lang_prefix) ; } } else if ( req.getParameter("delete_template") != null ) { String temp[][] = IMCServiceRMI.sqlQueryMulti(imcserver,"select simple_name,count(meta_id),t.template_id from templates t left join text_docs td on td.template_id = t.template_id where lang_prefix = '"+lang+"' group by t.template_id,simple_name order by simple_name") ; //String temp[] ; htmlStr = "" ; Vector vec ; for ( int i = 0 ; i<temp.length ; i++ ) { vec = new Vector() ; vec.add("#template_name#") ; vec.add(temp[i][0]) ; vec.add("#docs#") ; vec.add(temp[i][1]) ; vec.add("#template_id#") ; vec.add(temp[i][2]) ; htmlStr += IMCServiceRMI.parseDoc(imcserver,vec,"template_list_row.html",lang_prefix) ; } //temp = IMCServiceRMI.sqlQuery(imcserver, "select template_id, simple_name from templates where lang_prefix = '"+lang+"' order by simple_name") ; vec = new Vector() ; vec.add("#language#") ; vec.add(lang) ; if ( temp.length > 0 ) {// String temps = "" ;// for (int i = 0; i < temp.length; i+=2) {// temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ;// } vec.add("#templates#") ; vec.add(htmlStr); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_delete.html",lang_prefix) ; } else { htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_no_langtemplates.html",lang_prefix) ; } } else if ( req.getParameter("rename_template") != null ) { String temp[] ; temp = IMCServiceRMI.sqlQuery(imcserver, "select template_id, simple_name from templates where lang_prefix = '"+lang+"' order by simple_name") ; Vector vec = new Vector() ; vec.add("#language#") ; vec.add(lang) ; if ( temp.length > 0 ) { String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } vec.add("#templates#") ; vec.add(temps); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_rename.html",lang_prefix) ; } else { htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_no_langtemplates.html",lang_prefix) ; } } else if ( req.getParameter("get_template") != null ) { String temp[] ; temp = IMCServiceRMI.sqlQuery(imcserver, "select template_id, simple_name from templates where lang_prefix = '"+lang+"' order by simple_name") ; Vector vec = new Vector() ; vec.add("#language#") ; vec.add(lang) ; if ( temp.length > 0 ) { String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } vec.add("#templates#") ; vec.add(temps); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_get.html",lang_prefix) ; } else { htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_no_langtemplates.html",lang_prefix) ; } } else if ( req.getParameter("add_group") != null ) { htmlStr = IMCServiceRMI.parseDoc(imcserver, null, "templategroup_add.html",lang_prefix) ; } else if ( req.getParameter("delete_group") != null ) { String temp[] ; temp = IMCServiceRMI.sqlProcedure(imcserver, "getTemplategroups") ; String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } Vector vec = new Vector() ; vec.add("#templategroups#") ; vec.add(temps); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "templategroup_delete.html",lang_prefix) ; } else if ( req.getParameter("rename_group") != null ) { String temp[] ; temp = IMCServiceRMI.sqlProcedure(imcserver, "getTemplategroups") ; String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } Vector vec = new Vector() ; vec.add("#templategroups#") ; vec.add(temps); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "templategroup_rename.html",lang_prefix) ; } else if ( req.getParameter("assign_group") != null ) { String temp[] ; temp = IMCServiceRMI.sqlQuery(imcserver,"select template_id from templates where lang_prefix = '"+lang+"'") ; Vector vec = new Vector() ; vec.add("#language#") ; vec.add(lang) ; if ( temp.length > 0 ) { temp = IMCServiceRMI.sqlProcedure(imcserver, "getTemplategroups") ; String temps = "" ; for (int i = 0; i < temp.length; i+=2) { temps += "<option value=\""+temp[i]+"\">"+temp[i+1]+"</option>" ; } vec.add("#templategroups#") ; vec.add(temps); vec.add("#assigned#") ; vec.add(""); vec.add("#unassigned#") ; vec.add(""); vec.add("#group#") ; vec.add(""); vec.add("#group_id#") ; vec.add(""); htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_assign.html",lang_prefix) ; } else { htmlStr = IMCServiceRMI.parseDoc(imcserver, vec, "template_no_langtemplates.html",lang_prefix) ; } } else if ( req.getParameter("show_templates") != null ) { String temp[][] = IMCServiceRMI.sqlQueryMulti(imcserver,"select simple_name,count(meta_id),t.template_id from templates t left join text_docs td on td.template_id = t.template_id where lang_prefix = '"+lang+"' group by t.template_id,simple_name order by simple_name") ; htmlStr = "" ; //IMCServiceRMI.parseDoc(imcserver,null,"template_list_head.html",lang_prefix) ; for ( int i = 0 ; i<temp.length ; i++ ) { Vector vec = new Vector() ; vec.add("#template_name#") ; vec.add(temp[i][0]) ; vec.add("#docs#") ; vec.add(temp[i][1]) ; vec.add("#template_id#") ; vec.add(temp[i][2]) ; htmlStr += IMCServiceRMI.parseDoc(imcserver,vec,"template_list_row.html",lang_prefix) ; }// htmlStr += IMCServiceRMI.parseDoc(imcserver,null,"template_list_tail.html",lang_prefix) ; Vector vec = new Vector() ; vec.add("#template_list#") ; vec.add(htmlStr) ; vec.add("#language#") ; vec.add(lang) ; htmlStr = IMCServiceRMI.parseDoc(imcserver,vec,"template_list.html",lang_prefix) ; } out.print(htmlStr) ; }
8781 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8781/a270627916b37a677a391dd9f45c54d3d6f12503/TemplateAdmin.java/clean/servlets/TemplateAdmin.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 741, 3349, 261, 9984, 1111, 16, 12446, 400, 262, 1216, 16517, 16, 1860, 288, 202, 202, 780, 1479, 4697, 202, 33, 1111, 18, 588, 1864, 2932, 2594, 7923, 274, 202, 202, 780, 709, 71, 3567, 1875, 202, 33, 13134, 18, 588, 3748, 23218, 2932, 3666, 3567, 3113, 2564, 13, 274, 202, 202, 780, 787, 67, 718, 540, 202, 33, 13134, 18, 588, 3748, 23218, 12, 315, 1937, 67, 718, 3113, 2564, 262, 274, 202, 202, 759, 2073, 309, 729, 7545, 603, 202, 202, 1299, 729, 274, 9506, 202, 430, 261, 261, 1355, 33, 1564, 18, 1355, 19862, 1398, 12, 3658, 16, 455, 16, 1937, 67, 718, 3719, 631, 2011, 262, 288, 1082, 202, 2463, 274, 202, 202, 97, 3196, 202, 759, 2585, 729, 2240, 3666, 35, 202, 202, 780, 1847, 1585, 225, 273, 315, 4025, 2478, 67, 350, 628, 3677, 16, 1355, 67, 7774, 67, 14653, 1734, 64, 82, 6, 274, 202, 202, 4669, 1585, 1011, 315, 6051, 3677, 18, 1355, 67, 350, 273, 729, 67, 7774, 67, 14653, 1734, 18, 1355, 67, 350, 64, 82, 6, 274, 202, 202, 4669, 1585, 1011, 315, 464, 729, 67, 7774, 67, 14653, 1734, 18, 4615, 67, 350, 273, 374, 64, 82, 6, 274, 202, 202, 4669, 1585, 1011, 315, 464, 3677, 18, 1355, 67, 350, 273, 315, 397, 729, 18, 588, 1702, 2932, 1355, 67, 350, 7923, 274, 9506, 202, 430, 261, 6246, 39, 1179, 54, 7492, 18, 4669, 1138, 12, 381, 71, 3567, 16, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 741, 3349, 261, 9984, 1111, 16, 12446, 400, 262, 1216, 16517, 16, 1860, 288, 202, 202, 780, 1479, 4697, 202, 33, 1111, 18, 588, 1864, 2932, 2594, 7923, 274, 202, 202, 780, 709, 71, 3567, 1875, 202, 33, 13134, 18, 588, 3748, 23218, 2932, 3666, 3567, 3113, 2564, 13, 274, 202, 202, 780, 787, 67, 718, 540, 202, 33, 13134, 18, 588, 3748, 23218, 12, 315, 1937, 67, 718, 3113, 2564, 262, 274, 202, 202, 759, 2073, 309, 729, 7545, 603, 202, 202, 1299, 729, 274, 9506, 202, 430, 261, 261, 1355, 33, 1564, 18, 1355, 19862, 1398, 12, 3658, 16, 455, 16, 1937, 67, 718, 3719, 631, 2011, 262, 288, 1082, 202, 2463, 274, 2 ]
if (b == null) SnmpCollectionTrackerTest.fail("Expected value is "+a+" but actual value is null");
if (b == null) fail("Expected value is "+a+" but actual value is null");
private void assertArrayEquals(int[] a, int[] b) { if (a == null) { assertNull("expected value is null but actual value is "+b, b); } else { if (b == null) SnmpCollectionTrackerTest.fail("Expected value is "+a+" but actual value is null"); assertEquals("arrays have different length", a.length, b.length); for(int i = 0; i < a.length; i++) { assertEquals("array differ at index "+i+" expected: "+a+", actual: "+b, a[i], b[i]); } } }
47678 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47678/7d3dd9c5c505cae507a7524a6d4504bb28f24852/SnmpObjIdTest.java/clean/src/services/org/opennms/netmgt/snmp/SnmpObjIdTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1815, 1076, 8867, 12, 474, 8526, 279, 16, 509, 8526, 324, 13, 288, 3639, 309, 261, 69, 422, 446, 13, 288, 5411, 1815, 2041, 2932, 3825, 460, 353, 446, 1496, 3214, 460, 353, 13773, 70, 16, 324, 1769, 3639, 289, 469, 288, 5411, 309, 261, 70, 422, 446, 13, 2321, 2932, 6861, 460, 353, 13773, 69, 9078, 1496, 3214, 460, 353, 446, 8863, 2398, 1815, 8867, 2932, 16223, 1240, 3775, 769, 3113, 279, 18, 2469, 16, 324, 18, 2469, 1769, 5411, 364, 12, 474, 277, 273, 374, 31, 277, 411, 279, 18, 2469, 31, 277, 27245, 288, 7734, 1815, 8867, 2932, 1126, 15221, 622, 770, 13773, 77, 9078, 2665, 30, 13773, 69, 15, 3113, 3214, 30, 13773, 70, 16, 279, 63, 77, 6487, 324, 63, 77, 19226, 5411, 289, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1815, 1076, 8867, 12, 474, 8526, 279, 16, 509, 8526, 324, 13, 288, 3639, 309, 261, 69, 422, 446, 13, 288, 5411, 1815, 2041, 2932, 3825, 460, 353, 446, 1496, 3214, 460, 353, 13773, 70, 16, 324, 1769, 3639, 289, 469, 288, 5411, 309, 261, 70, 422, 446, 13, 2321, 2932, 6861, 460, 353, 13773, 69, 9078, 1496, 3214, 460, 353, 446, 8863, 2398, 1815, 8867, 2932, 16223, 1240, 3775, 769, 3113, 279, 18, 2469, 16, 324, 18, 2469, 1769, 5411, 364, 12, 474, 277, 273, 374, 31, 277, 411, 279, 18, 2469, 31, 277, 27245, 288, 7734, 1815, 8867, 2932, 1126, 15221, 622, 770, 13773, 77, 9078, 2665, 30, 13773, 69, 15, 3113, 3214, 30, 2 ]
if((!multiLevel) || (idx = key.indexOf(MULTI_LEVEL_CHAR)) == -1) {
if((!multiLevel) || ((idx = key.indexOf(MULTI_LEVEL_CHAR)) == -1)) {
public void remove(String key) { int idx; if((!multiLevel) || (idx = key.indexOf(MULTI_LEVEL_CHAR)) == -1) { map.remove(key); } else { String before = key.substring(0, idx); String after = key.substring(idx+1); SimpleFieldSet fs = (SimpleFieldSet) (map.get(before)); if(fs == null) { return; } fs.remove(after); if(fs.isEmpty()) map.remove(before); } }
51738 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51738/ca136843ae9ecb30cadada58a33a5dc2cf8ad064/SimpleFieldSet.java/clean/src/freenet/support/SimpleFieldSet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1206, 12, 780, 498, 13, 288, 202, 202, 474, 2067, 31, 202, 202, 430, 12443, 5, 7027, 2355, 13, 747, 261, 3465, 273, 498, 18, 31806, 12, 26588, 67, 10398, 67, 7305, 3719, 422, 300, 21, 13, 288, 1082, 202, 1458, 18, 4479, 12, 856, 1769, 202, 202, 97, 469, 288, 1082, 202, 780, 1865, 273, 498, 18, 28023, 12, 20, 16, 2067, 1769, 1082, 202, 780, 1839, 273, 498, 18, 28023, 12, 3465, 15, 21, 1769, 1082, 202, 5784, 974, 694, 2662, 273, 261, 5784, 974, 694, 13, 261, 1458, 18, 588, 12, 5771, 10019, 1082, 202, 430, 12, 2556, 422, 446, 13, 288, 9506, 202, 2463, 31, 1082, 202, 97, 1082, 202, 2556, 18, 4479, 12, 5205, 1769, 1082, 202, 430, 12, 2556, 18, 291, 1921, 10756, 9506, 202, 1458, 18, 4479, 12, 5771, 1769, 202, 202, 97, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1206, 12, 780, 498, 13, 288, 202, 202, 474, 2067, 31, 202, 202, 430, 12443, 5, 7027, 2355, 13, 747, 261, 3465, 273, 498, 18, 31806, 12, 26588, 67, 10398, 67, 7305, 3719, 422, 300, 21, 13, 288, 1082, 202, 1458, 18, 4479, 12, 856, 1769, 202, 202, 97, 469, 288, 1082, 202, 780, 1865, 273, 498, 18, 28023, 12, 20, 16, 2067, 1769, 1082, 202, 780, 1839, 273, 498, 18, 28023, 12, 3465, 15, 21, 1769, 1082, 202, 5784, 974, 694, 2662, 273, 261, 5784, 974, 694, 13, 261, 1458, 18, 588, 12, 5771, 10019, 1082, 202, 430, 12, 2556, 422, 446, 13, 288, 9506, 202, 2463, 31, 1082, 202, 97, 1082, 202, 2556, 2 ]
if (myIsBroken) return EMPTY_ICON;
if (isLoaderDisabled()) return EMPTY_ICON;
private synchronized Icon getRealIcon() { if (myIsBroken) return EMPTY_ICON; Icon icon; if (myRealIcon != null) { icon = myRealIcon.get(); if (icon != null) return icon; } Image image = ImageLoader.loadFromURL(myURL); if (image == null) { myIsBroken = true; return EMPTY_ICON; } icon = new ImageIcon(image); myRealIcon = new SoftReference<Icon>(icon); return icon; }
12814 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12814/daf2dc40e961b18200f1bed61683463b8465650e/IconLoader.java/clean/util/src/com/intellij/openapi/util/IconLoader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 3238, 3852, 16011, 12361, 5554, 1435, 288, 5411, 309, 261, 291, 2886, 8853, 10756, 327, 8984, 67, 21745, 31, 5411, 16011, 4126, 31, 5411, 309, 261, 4811, 6955, 5554, 480, 446, 13, 288, 7734, 4126, 273, 3399, 6955, 5554, 18, 588, 5621, 7734, 309, 261, 3950, 480, 446, 13, 327, 4126, 31, 5411, 289, 5411, 3421, 1316, 273, 3421, 2886, 18, 945, 1265, 1785, 12, 4811, 1785, 1769, 5411, 309, 261, 2730, 422, 446, 13, 288, 7734, 3399, 2520, 29559, 273, 638, 31, 7734, 327, 8984, 67, 21745, 31, 5411, 289, 5411, 4126, 273, 394, 3421, 5554, 12, 2730, 1769, 5411, 3399, 6955, 5554, 273, 394, 12438, 2404, 32, 5554, 34, 12, 3950, 1769, 5411, 327, 4126, 31, 3639, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 3238, 3852, 16011, 12361, 5554, 1435, 288, 5411, 309, 261, 291, 2886, 8853, 10756, 327, 8984, 67, 21745, 31, 5411, 16011, 4126, 31, 5411, 309, 261, 4811, 6955, 5554, 480, 446, 13, 288, 7734, 4126, 273, 3399, 6955, 5554, 18, 588, 5621, 7734, 309, 261, 3950, 480, 446, 13, 327, 4126, 31, 5411, 289, 5411, 3421, 1316, 273, 3421, 2886, 18, 945, 1265, 1785, 12, 4811, 1785, 1769, 5411, 309, 261, 2730, 422, 446, 13, 288, 7734, 3399, 2520, 29559, 273, 638, 31, 7734, 327, 8984, 67, 21745, 31, 5411, 289, 5411, 4126, 273, 394, 3421, 5554, 12, 2730, 1769, 5411, 3399, 6955, 5554, 273, 394, 12438, 2404, 32, 5554, 34, 12, 3950, 1769, 5411, 327, 4126, 31, 2 ]
addJButton.setToolTipText("<html><b>Add New Row</b> - Use this button to insert new rows in a table.</html>");
addJButton.setToolTipText("<html><b>Add New Row</b> - Use this button to insert a new row at a selected point in the table.<br>Hold down the shift key when clicking in order to insert at the end of the table.</html>");
private void initComponents() {//GEN-BEGIN:initComponents java.awt.GridBagConstraints gridBagConstraints; contentJPanel = new javax.swing.JPanel(); tableJPanel = new javax.swing.JPanel(); entryJScrollPane = new javax.swing.JScrollPane(); entryJTable = mColoredJTable; addJButton = new javax.swing.JButton(); removeJButton = new javax.swing.JButton(); fillJButton = new javax.swing.JButton(); detailJScrollPane = new javax.swing.JScrollPane(); detailJTextArea = new javax.swing.JTextArea(); setLayout(new java.awt.GridBagLayout()); contentJPanel.setLayout(new java.awt.GridBagLayout()); tableJPanel.setLayout(new java.awt.GridBagLayout()); tableJPanel.setMinimumSize(new java.awt.Dimension(40, 40)); entryJScrollPane.setVerticalScrollBarPolicy(javax.swing.ScrollPaneConstants.VERTICAL_SCROLLBAR_ALWAYS); entryJScrollPane.setDoubleBuffered(true); entryJTable.setBackground(new java.awt.Color(213, 213, 226)); entryJTable.setAutoResizeMode(javax.swing.JTable.AUTO_RESIZE_OFF); entryJTable.setDoubleBuffered(true); entryJScrollPane.setViewportView(entryJTable); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 1; gridBagConstraints.gridy = 0; gridBagConstraints.gridheight = 3; gridBagConstraints.fill = java.awt.GridBagConstraints.BOTH; gridBagConstraints.weightx = 1.0; gridBagConstraints.weighty = 1.0; tableJPanel.add(entryJScrollPane, gridBagConstraints); addJButton.setFont(new java.awt.Font("Dialog", 0, 12)); addJButton.setIcon(new javax.swing.ImageIcon(getClass().getResource("/com/metavize/gui/widgets/editTable/IconPlus24x24.png"))); addJButton.setToolTipText("<html><b>Add New Row</b> - Use this button to insert new rows in a table.</html>"); addJButton.setDoubleBuffered(true); addJButton.setFocusPainted(false); addJButton.setFocusable(false); addJButton.setHorizontalTextPosition(javax.swing.SwingConstants.CENTER); addJButton.setIconTextGap(0); addJButton.setMargin(new java.awt.Insets(0, 0, 0, 0)); addJButton.setMaximumSize(new java.awt.Dimension(32, 32)); addJButton.setMinimumSize(new java.awt.Dimension(32, 32)); addJButton.setPreferredSize(new java.awt.Dimension(32, 32)); addJButton.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { addJButtonActionPerformed(evt); } }); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 0; gridBagConstraints.gridy = 0; gridBagConstraints.anchor = java.awt.GridBagConstraints.SOUTH; gridBagConstraints.weighty = 0.5; gridBagConstraints.insets = new java.awt.Insets(0, 0, 3, 4); tableJPanel.add(addJButton, gridBagConstraints); removeJButton.setFont(new java.awt.Font("Dialog", 0, 12)); removeJButton.setIcon(new javax.swing.ImageIcon(getClass().getResource("/com/metavize/gui/widgets/editTable/IconMinus24x24.png"))); removeJButton.setToolTipText("<html><b>Remove Row</b> - Use this button to remove a row in a table.</html>"); removeJButton.setDoubleBuffered(true); removeJButton.setFocusPainted(false); removeJButton.setFocusable(false); removeJButton.setHorizontalTextPosition(javax.swing.SwingConstants.CENTER); removeJButton.setIconTextGap(0); removeJButton.setMargin(new java.awt.Insets(0, 0, 0, 0)); removeJButton.setMaximumSize(new java.awt.Dimension(32, 32)); removeJButton.setMinimumSize(new java.awt.Dimension(32, 32)); removeJButton.setPreferredSize(new java.awt.Dimension(32, 32)); removeJButton.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { removeJButtonActionPerformed(evt); } }); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 0; gridBagConstraints.gridy = 1; gridBagConstraints.anchor = java.awt.GridBagConstraints.NORTH; gridBagConstraints.weighty = 0.5; gridBagConstraints.insets = new java.awt.Insets(2, 0, 0, 4); tableJPanel.add(removeJButton, gridBagConstraints); fillJButton.setFont(new java.awt.Font("Dialog", 0, 12)); fillJButton.setIcon(new javax.swing.ImageIcon(getClass().getResource("/com/metavize/gui/widgets/editTable/IconFill24x24.png"))); fillJButton.setToolTipText("<html><b>Fill Check Boxes</b> - Use this button to check or uncheck all the checkboxes in a column.</html>"); fillJButton.setDoubleBuffered(true); fillJButton.setFocusPainted(false); fillJButton.setFocusable(false); fillJButton.setHorizontalTextPosition(javax.swing.SwingConstants.CENTER); fillJButton.setIconTextGap(0); fillJButton.setMargin(new java.awt.Insets(0, 0, 0, 0)); fillJButton.setMaximumSize(new java.awt.Dimension(32, 32)); fillJButton.setMinimumSize(new java.awt.Dimension(32, 32)); fillJButton.setPreferredSize(new java.awt.Dimension(32, 32)); fillJButton.addActionListener(new java.awt.event.ActionListener() { public void actionPerformed(java.awt.event.ActionEvent evt) { fillJButtonActionPerformed(evt); } }); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 0; gridBagConstraints.gridy = 2; gridBagConstraints.anchor = java.awt.GridBagConstraints.NORTH; gridBagConstraints.weighty = 0.5; gridBagConstraints.insets = new java.awt.Insets(2, 0, 0, 4); tableJPanel.add(fillJButton, gridBagConstraints); detailJScrollPane.setBorder(new javax.swing.border.EtchedBorder()); detailJScrollPane.setHorizontalScrollBarPolicy(javax.swing.ScrollPaneConstants.HORIZONTAL_SCROLLBAR_NEVER); detailJScrollPane.setDoubleBuffered(true); detailJScrollPane.setFocusable(false); detailJScrollPane.setMinimumSize(new java.awt.Dimension(31, 50)); detailJScrollPane.setOpaque(false); detailJScrollPane.setPreferredSize(new java.awt.Dimension(104, 50)); detailJTextArea.setBackground(new java.awt.Color(204, 204, 204)); detailJTextArea.setEditable(false); detailJTextArea.setLineWrap(true); detailJTextArea.setWrapStyleWord(true); detailJTextArea.setBorder(null); detailJTextArea.setFocusable(false); detailJTextArea.setMargin(new java.awt.Insets(2, 2, 2, 2)); detailJTextArea.setMinimumSize(new java.awt.Dimension(100, 50)); detailJTextArea.setOpaque(false); detailJTextArea.setPreferredSize(null); detailJScrollPane.setViewportView(detailJTextArea); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 1; gridBagConstraints.gridy = 3; gridBagConstraints.fill = java.awt.GridBagConstraints.BOTH; gridBagConstraints.weightx = 1.0; gridBagConstraints.insets = new java.awt.Insets(5, 0, 0, 0); tableJPanel.add(detailJScrollPane, gridBagConstraints); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 0; gridBagConstraints.gridy = 0; gridBagConstraints.fill = java.awt.GridBagConstraints.BOTH; gridBagConstraints.weightx = 1.0; gridBagConstraints.weighty = 1.0; contentJPanel.add(tableJPanel, gridBagConstraints); gridBagConstraints = new java.awt.GridBagConstraints(); gridBagConstraints.gridx = 0; gridBagConstraints.gridy = 0; gridBagConstraints.fill = java.awt.GridBagConstraints.BOTH; gridBagConstraints.weightx = 1.0; gridBagConstraints.weighty = 1.0; add(contentJPanel, gridBagConstraints); }//GEN-END:initComponents
49954 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49954/5403f1d860e7746918ff21bb9eeb733d12086bd7/MEditTableJPanel.java/buggy/gui/main/com/metavize/gui/widgets/editTable/MEditTableJPanel.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 759, 16652, 17, 16061, 30, 2738, 7171, 3639, 2252, 18, 2219, 88, 18, 6313, 6852, 8747, 31, 3639, 913, 46, 5537, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 1014, 46, 5537, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 1241, 46, 26360, 273, 394, 6863, 18, 5328, 310, 18, 46, 26360, 5621, 3639, 1241, 46, 1388, 273, 312, 914, 7653, 46, 1388, 31, 3639, 527, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 1206, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 3636, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 7664, 46, 26360, 273, 394, 6863, 18, 5328, 310, 18, 46, 26360, 5621, 3639, 7664, 46, 1528, 5484, 273, 394, 6863, 18, 5328, 310, 18, 46, 1528, 5484, 5621, 3639, 18479, 12, 2704, 2252, 18, 2219, 88, 18, 6313, 5013, 3744, 10663, 3639, 913, 46, 5537, 18, 542, 3744, 12, 2704, 2252, 18, 2219, 88, 18, 6313, 5013, 3744, 10663, 3639, 1014, 46, 5537, 18, 542, 3744, 12, 2704, 2252, 18, 2219, 88, 18, 6313, 5013, 3744, 10663, 3639, 1014, 46, 5537, 18, 542, 13042, 1225, 12, 2704, 2252, 18, 2219, 88, 18, 8611, 12, 7132, 16, 8063, 10019, 3639, 1241, 46, 26360, 18, 542, 15704, 6806, 5190, 2582, 12, 28384, 18, 5328, 310, 18, 26360, 2918, 18, 21654, 10109, 67, 2312, 14555, 21908, 67, 1013, 29295, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 1208, 7171, 1435, 288, 759, 16652, 17, 16061, 30, 2738, 7171, 3639, 2252, 18, 2219, 88, 18, 6313, 6852, 8747, 31, 3639, 913, 46, 5537, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 1014, 46, 5537, 273, 394, 6863, 18, 5328, 310, 18, 46, 5537, 5621, 3639, 1241, 46, 26360, 273, 394, 6863, 18, 5328, 310, 18, 46, 26360, 5621, 3639, 1241, 46, 1388, 273, 312, 914, 7653, 46, 1388, 31, 3639, 527, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 1206, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 3639, 3636, 46, 3616, 273, 394, 6863, 18, 5328, 310, 18, 46, 3616, 5621, 2 ]
schedulePaint = false; }
protected void paintFigure(Graphics graphics) { Rectangle bounds = getBounds().getCopy(); graphics.translate(getLocation()); graphics.setXORMode(true); graphics.setForegroundColor(ColorConstants.white); graphics.setBackgroundColor(ColorConstants.black); graphics.setLineStyle(Graphics.LINE_DOT); int[] points = new int[6]; points[0] = 0 + offset; points[1] = 0; points[2] = bounds.width - 1; points[3] = 0; points[4] = bounds.width - 1; points[5] = bounds.height - 1; graphics.drawPolyline(points); points[0] = 0; points[1] = 0 + offset; points[2] = 0; points[3] = bounds.height - 1; points[4] = bounds.width - 1; points[5] = bounds.height - 1; graphics.drawPolyline(points); graphics.translate(getLocation().getNegated()); if (schedulePaint) { Display.getCurrent().timerExec(DELAY, new Runnable() { public void run() { offset++; if (offset > 5) offset = 0; schedulePaint = true; repaint(); } }); } schedulePaint = false;}
11225 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11225/d80e4fa740f642cdd3a61ad97df93cf8c61bc0fa/MarqueeSelectionTool.java/buggy/org.eclipse.gef/src/org/eclipse/gef/tools/MarqueeSelectionTool.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4750, 918, 12574, 42, 15906, 12, 17558, 17313, 13, 288, 202, 202, 19463, 4972, 273, 22107, 7675, 588, 2951, 5621, 202, 31586, 18, 13929, 12, 588, 2735, 10663, 202, 202, 31586, 18, 542, 60, 916, 2309, 12, 3767, 1769, 202, 31586, 18, 542, 23206, 2957, 12, 2957, 2918, 18, 14739, 1769, 202, 31586, 18, 542, 21699, 12, 2957, 2918, 18, 11223, 1769, 202, 202, 31586, 18, 542, 1670, 2885, 12, 17558, 18, 5997, 67, 17591, 1769, 202, 202, 474, 8526, 3143, 273, 394, 509, 63, 26, 15533, 202, 202, 4139, 63, 20, 65, 273, 374, 397, 1384, 31, 202, 4139, 63, 21, 65, 273, 374, 31, 202, 4139, 63, 22, 65, 273, 4972, 18, 2819, 300, 404, 31, 202, 4139, 63, 23, 65, 273, 374, 31, 202, 4139, 63, 24, 65, 273, 4972, 18, 2819, 300, 404, 31, 202, 4139, 63, 25, 65, 273, 4972, 18, 4210, 300, 404, 31, 202, 202, 31586, 18, 9446, 25519, 12, 4139, 1769, 202, 202, 4139, 63, 20, 65, 273, 374, 31, 202, 4139, 63, 21, 65, 273, 374, 397, 1384, 31, 202, 4139, 63, 22, 65, 273, 374, 31, 202, 4139, 63, 23, 65, 273, 4972, 18, 4210, 300, 404, 31, 202, 4139, 63, 24, 65, 273, 4972, 18, 2819, 300, 404, 31, 202, 4139, 63, 25, 65, 273, 4972, 18, 4210, 300, 404, 31, 202, 202, 31586, 18, 9446, 25519, 12, 4139, 1769, 202, 202, 31586, 18, 13929, 12, 588, 2735, 7675, 588, 14337, 690, 10663, 202, 202, 430, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4750, 918, 12574, 42, 15906, 12, 17558, 17313, 13, 288, 202, 202, 19463, 4972, 273, 22107, 7675, 588, 2951, 5621, 202, 31586, 18, 13929, 12, 588, 2735, 10663, 202, 202, 31586, 18, 542, 60, 916, 2309, 12, 3767, 1769, 202, 31586, 18, 542, 23206, 2957, 12, 2957, 2918, 18, 14739, 1769, 202, 31586, 18, 542, 21699, 12, 2957, 2918, 18, 11223, 1769, 202, 202, 31586, 18, 542, 1670, 2885, 12, 17558, 18, 5997, 67, 17591, 1769, 202, 202, 474, 8526, 3143, 273, 394, 509, 63, 26, 15533, 202, 202, 4139, 63, 20, 65, 273, 374, 397, 1384, 31, 202, 4139, 63, 21, 65, 273, 374, 31, 202, 4139, 63, 22, 65, 273, 4972, 18, 2819, 300, 404, 31, 202, 2 ]
setParamTarget(target);
setParamTarget(target);
private boolean performCopyOperation(boolean isFolder) throws CmsException { // on folder copy display "please wait" screen, not for simple file copy if (isFolder && ! DIALOG_WAIT.equals(getParamAction())) { // return false, this will trigger the "please wait" screen return false; } // get the copy mode from request parameter int copyMode = I_CmsConstants.C_COPY_PRESERVE_SIBLING; try { copyMode = Integer.parseInt(getParamCopymode()); } catch (Exception e) { // can usually be ignored if (LOG.isInfoEnabled()) { LOG.info(e.getLocalizedMessage()); } } // calculate the target name String target = getParamTarget(); if (target == null) { target = ""; } boolean restoreSiteRoot = false; try { // check if a site root was added to the target name String sitePrefix = ""; if (CmsSiteManager.getSiteRoot(target) != null) { String siteRootFolder = getCms().getRequestContext().getSiteRoot(); if (siteRootFolder.endsWith("/")) { siteRootFolder = siteRootFolder.substring(0, siteRootFolder.length()-1); } sitePrefix = siteRootFolder; getCms().getRequestContext().saveSiteRoot(); getCms().getRequestContext().setSiteRoot("/"); restoreSiteRoot = true; } // calculate the target name target = CmsLinkManager.getAbsoluteUri(target, CmsResource.getParentFolder(getParamResource())); if (target.equals(getParamResource())) { throw new CmsVfsException(Messages.get().container(Messages.ERR_COPY_ONTO_ITSELF_1, target)); } try { CmsResource res = getCms().readResource(target, CmsResourceFilter.ALL); if (res.isFolder()) { // target folder already exists, so we add the current folder name if (! target.endsWith("/")) { target += "/"; } target = target + CmsResource.getName(getParamResource()); } } catch (CmsVfsResourceNotFoundException e) { // target folder does not already exist, so target name is o.k. if (LOG.isInfoEnabled()) { LOG.info(e.getLocalizedMessage()); } } // set the target parameter value setParamTarget(target); // delete existing target resource if confirmed by the user if (DIALOG_CONFIRMED.equals(getParamAction())) { getCms().deleteResource(target, I_CmsConstants.C_DELETE_OPTION_PRESERVE_SIBLINGS); } // copy the resource getCms().copyResource(sitePrefix + getParamResource(), target, copyMode); } finally { if (restoreSiteRoot) { getCms().getRequestContext().restoreSiteRoot(); } } return true; }
8585 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8585/2fa0efcae8f9aa5971c7763269a3b033e9256d4b/CmsCopy.java/buggy/src/org/opencms/workplace/commons/CmsCopy.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 3073, 2951, 2988, 12, 6494, 31137, 13, 1216, 11228, 288, 3639, 368, 603, 3009, 1610, 2562, 315, 1802, 448, 2529, 6, 5518, 16, 486, 364, 4143, 585, 1610, 3639, 309, 261, 291, 3899, 597, 401, 3690, 18683, 67, 19046, 18, 14963, 12, 588, 786, 1803, 1435, 3719, 288, 5411, 368, 327, 629, 16, 333, 903, 3080, 326, 315, 1802, 448, 2529, 6, 5518, 5411, 327, 629, 31, 3639, 289, 7734, 368, 336, 326, 1610, 1965, 628, 590, 1569, 3639, 509, 1610, 2309, 273, 467, 67, 4747, 2918, 18, 39, 67, 24875, 67, 3670, 2123, 3412, 67, 9894, 26789, 31, 3639, 775, 288, 5411, 1610, 2309, 273, 2144, 18, 2670, 1702, 12, 588, 786, 2951, 3188, 10663, 3639, 289, 1044, 261, 503, 425, 13, 288, 5411, 368, 848, 11234, 506, 5455, 5411, 309, 261, 4842, 18, 291, 966, 1526, 10756, 288, 7734, 2018, 18, 1376, 12, 73, 18, 588, 2042, 1235, 1079, 10663, 5411, 289, 3639, 289, 3639, 368, 4604, 326, 1018, 508, 3639, 514, 1018, 273, 9027, 2326, 5621, 3639, 309, 261, 3299, 422, 446, 13, 288, 5411, 1018, 273, 1408, 31, 3639, 289, 7734, 1250, 5217, 21889, 273, 629, 31, 3639, 775, 288, 5411, 368, 866, 309, 279, 2834, 1365, 1703, 3096, 358, 326, 1018, 508, 5411, 514, 2834, 2244, 273, 1408, 31, 5411, 309, 261, 4747, 4956, 1318, 18, 588, 21889, 12, 3299, 13, 480, 446, 13, 288, 1171, 514, 25512, 3899, 273, 14413, 7675, 588, 21426, 7675, 588, 21889, 5621, 7734, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 3073, 2951, 2988, 12, 6494, 31137, 13, 1216, 11228, 288, 3639, 368, 603, 3009, 1610, 2562, 315, 1802, 448, 2529, 6, 5518, 16, 486, 364, 4143, 585, 1610, 3639, 309, 261, 291, 3899, 597, 401, 3690, 18683, 67, 19046, 18, 14963, 12, 588, 786, 1803, 1435, 3719, 288, 5411, 368, 327, 629, 16, 333, 903, 3080, 326, 315, 1802, 448, 2529, 6, 5518, 5411, 327, 629, 31, 3639, 289, 7734, 368, 336, 326, 1610, 1965, 628, 590, 1569, 3639, 509, 1610, 2309, 273, 467, 67, 4747, 2918, 18, 39, 67, 24875, 67, 3670, 2123, 3412, 67, 9894, 26789, 31, 3639, 775, 288, 5411, 1610, 2309, 273, 2144, 18, 2670, 1702, 12, 588, 786, 2951, 3188, 10663, 2 ]
String duration = iregexFind(counter, originalTimeExpression);
String duration = iregexFind(counter, timeExpression);
public long textToTime(String text) throws WTFException, NumberFormatException { Pattern when = Pattern.compile(timeExpressionPattern, Pattern.CASE_INSENSITIVE); Matcher matcher = when.matcher(text); if (!matcher.find()) throw new WTFException("I can't figure out when to send that."); this.originalTimeExpression = matcher.group(); if (iregex("^in ", originalTimeExpression)) { long unit = 0; String unitWord = ""; if (iregex(secondUnit, originalTimeExpression)) { unit = 1000; unitWord = "second"; } else if (iregex(minuteUnit, originalTimeExpression)) { unit = 1000 * 60; unitWord = "minute"; } else if (iregex(hourUnit, originalTimeExpression)) { unit = 1000 * 60 * 60; unitWord = "hour"; } else if (iregex(dayUnit, originalTimeExpression)) { unit = 1000 * 60 * 60 * 24; unitWord = "day"; } else if (iregex(weekUnit, originalTimeExpression)) { unit = 1000 * 60 * 60 * 24 * 7; unitWord = "week"; } else if (iregex(monthUnit, originalTimeExpression)) { unit = 1000 * 60 * 60 * 24 * 30; unitWord = "month"; } else if (iregex(yearUnit, originalTimeExpression)) { unit = 1000 * 60 * 60 * 24 * 365; unitWord = "year"; } else { //default to minutes unit = 1000 * 60; unitWord = "minute"; } String duration = iregexFind(counter, originalTimeExpression); int dur = wordToInt(duration); if (dur != 1) unitWord += "s"; timeExpression = "in " + duration + " " + unitWord; return System.currentTimeMillis() + unit * dur; } throw new WTFException("I recognize '" + this.originalTimeExpression + "', but I haven't learned what it means yet."); }
4867 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4867/3638a746a2592ad5b3199cb255f20f0f84776698/ParseTime.java/buggy/ParseTime.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1525, 977, 774, 950, 12, 780, 977, 13, 1216, 678, 17963, 503, 16, 1875, 282, 12100, 288, 202, 202, 3234, 1347, 273, 6830, 18, 11100, 12, 957, 2300, 3234, 16, 6830, 18, 13415, 67, 706, 26753, 16325, 1769, 202, 202, 6286, 4546, 273, 1347, 18, 22761, 12, 955, 1769, 202, 202, 430, 16051, 22761, 18, 4720, 10756, 1082, 202, 12849, 394, 678, 17963, 503, 2932, 45, 848, 1404, 7837, 596, 1347, 358, 1366, 716, 1199, 1769, 202, 202, 2211, 18, 8830, 950, 2300, 273, 4546, 18, 1655, 5621, 202, 202, 430, 261, 577, 75, 338, 2932, 66, 267, 3104, 2282, 950, 2300, 3719, 288, 1082, 202, 5748, 2836, 273, 374, 31, 1082, 202, 780, 2836, 3944, 273, 1408, 31, 1082, 202, 430, 261, 577, 75, 338, 12, 8538, 2802, 16, 2282, 950, 2300, 3719, 288, 9506, 202, 4873, 273, 4336, 31, 9506, 202, 4873, 3944, 273, 315, 8538, 14432, 1082, 202, 97, 469, 309, 261, 577, 75, 338, 12, 17637, 2802, 16, 2282, 950, 2300, 3719, 288, 9506, 202, 4873, 273, 4336, 380, 4752, 31, 9506, 202, 4873, 3944, 273, 315, 17637, 14432, 1082, 202, 97, 469, 309, 261, 577, 75, 338, 12, 12091, 2802, 16, 2282, 950, 2300, 3719, 288, 9506, 202, 4873, 273, 4336, 380, 4752, 380, 4752, 31, 9506, 202, 4873, 3944, 273, 315, 12091, 14432, 1082, 202, 97, 469, 309, 261, 577, 75, 338, 12, 2881, 2802, 16, 2282, 950, 2300, 3719, 288, 9506, 202, 4873, 273, 4336, 380, 4752, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1525, 977, 774, 950, 12, 780, 977, 13, 1216, 678, 17963, 503, 16, 1875, 282, 12100, 288, 202, 202, 3234, 1347, 273, 6830, 18, 11100, 12, 957, 2300, 3234, 16, 6830, 18, 13415, 67, 706, 26753, 16325, 1769, 202, 202, 6286, 4546, 273, 1347, 18, 22761, 12, 955, 1769, 202, 202, 430, 16051, 22761, 18, 4720, 10756, 1082, 202, 12849, 394, 678, 17963, 503, 2932, 45, 848, 1404, 7837, 596, 1347, 358, 1366, 716, 1199, 1769, 202, 202, 2211, 18, 8830, 950, 2300, 273, 4546, 18, 1655, 5621, 202, 202, 430, 261, 577, 75, 338, 2932, 66, 267, 3104, 2282, 950, 2300, 3719, 288, 1082, 202, 5748, 2836, 273, 374, 31, 1082, 202, 780, 2836, 3944, 2 ]
size.setDefaultUnit( designHandle.getPropertyHandle( StyleHandle.FONT_SIZE_PROP ) .getDefaultUnit( ) );
size.setDefaultUnit( designHandle.getPropertyHandle( StyleHandle.FONT_SIZE_PROP ).getDefaultUnit( ) );
protected Control createContents( Composite parent ) { GridData gdata; GridLayout glayout; createTitleArea( parent ); Composite composite = new Composite( parent, 0 ); glayout = new GridLayout( ); glayout.marginHeight = 0; glayout.marginWidth = 0; glayout.verticalSpacing = 0; composite.setLayout( glayout ); composite.setLayoutData( new GridData( GridData.FILL_BOTH ) ); applyDialogFont( composite ); initializeDialogUnits( composite ); Composite innerParent = (Composite) createDialogArea( composite ); createButtonBar( composite ); Label lb = new Label( innerParent, SWT.NONE ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Condition" ) ); //$NON-NLS-1$ Composite condition = new Composite( innerParent, SWT.NONE ); condition.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); glayout = new GridLayout( 5, false ); condition.setLayout( glayout ); expression = new Combo( condition, SWT.NONE ); gdata = new GridData( ); gdata.widthHint = 100; expression.setLayoutData( gdata ); fillExpression( expression ); expression.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { if ( expression.getText( ).equals( VALUE_OF_THIS_DATA_ITEM ) && designHandle instanceof DataItemHandle ) { expression.setText( DEUtil.getColumnExpression( ( (DataItemHandle) designHandle ).getName( ) ) ); } updateButtons( ); } } ); expression.addModifyListener( new ModifyListener( ) { public void modifyText( ModifyEvent e ) { updateButtons( ); } } ); Button expBuilder = new Button( condition, SWT.PUSH ); expBuilder.setText( "..." ); //$NON-NLS-1$ gdata = new GridData( ); gdata.heightHint = 20; gdata.widthHint = 20; expBuilder.setLayoutData( gdata ); expBuilder.setToolTipText( Messages.getString( "HighlightRuleBuilderDialog.tooltip.ExpBuilder" ) ); //$NON-NLS-1$ expBuilder.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { editValue( expression ); } } ); operator = new Combo( condition, SWT.READ_ONLY ); for ( int i = 0; i < OPERATOR.length; i++ ) { operator.add( OPERATOR[i][0] ); } operator.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { String value = getValueForOperator( operator.getText( ) ); int vv = determineValueVisible( value ); if ( vv == 0 ) { value1.setVisible( false ); value2.setVisible( false ); valBuilder1.setVisible( false ); valBuilder2.setVisible( false ); andLable.setVisible( false ); } else if ( vv == 1 ) { value1.setVisible( true ); valBuilder1.setVisible( true ); value2.setVisible( false ); valBuilder2.setVisible( false ); andLable.setVisible( false ); } else if ( vv == 2 ) { value1.setVisible( true ); value2.setVisible( true ); valBuilder1.setVisible( true ); valBuilder2.setVisible( true ); andLable.setVisible( true ); } updateButtons( ); } } ); value1 = createText( condition ); value1.addModifyListener( new ModifyListener( ) { public void modifyText( ModifyEvent e ) { updateButtons( ); } } ); valBuilder1 = new Button( condition, SWT.PUSH ); valBuilder1.setText( "..." ); //$NON-NLS-1$ gdata = new GridData( ); gdata.heightHint = 20; gdata.widthHint = 20; valBuilder1.setLayoutData( gdata ); valBuilder1.setToolTipText( Messages.getString( "HighlightRuleBuilderDialog.tooltip.ExpBuilder" ) ); //$NON-NLS-1$ valBuilder1.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { editValue( value1 ); } } ); createDummy( condition, 3 ); andLable = new Label( condition, SWT.NONE ); andLable.setText( Messages.getString( "HighlightRuleBuilderDialog.text.AND" ) ); //$NON-NLS-1$ andLable.setVisible( false ); createDummy( condition, 1 ); createDummy( condition, 3 ); value2 = createText( condition ); value2.addModifyListener( new ModifyListener( ) { public void modifyText( ModifyEvent e ) { updateButtons( ); } } ); value2.setVisible( false ); valBuilder2 = new Button( condition, SWT.PUSH ); valBuilder2.setText( "..." ); //$NON-NLS-1$ gdata = new GridData( ); gdata.heightHint = 20; gdata.widthHint = 20; valBuilder2.setLayoutData( gdata ); valBuilder2.setToolTipText( Messages.getString( "HighlightRuleBuilderDialog.tooltip.ExpBuilder" ) ); //$NON-NLS-1$ valBuilder2.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { editValue( value2 ); } } ); valBuilder2.setVisible( false ); if ( operator.getItemCount( ) > 0 ) { operator.select( 0 ); } lb = new Label( innerParent, SWT.NONE ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Format" ) ); //$NON-NLS-1$ Composite format = new Composite( innerParent, SWT.NONE ); format.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); glayout = new GridLayout( 7, false ); format.setLayout( glayout ); lb = new Label( format, 0 ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Font" ) ); //$NON-NLS-1$ lb = new Label( format, 0 ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Size" ) ); //$NON-NLS-1$ lb = new Label( format, 0 ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Color" ) ); //$NON-NLS-1$ createDummy( format, 4 ); font = new Combo( format, SWT.READ_ONLY ); gdata = new GridData( ); gdata.widthHint = 100; font.setLayoutData( gdata ); IChoiceSet fontSet = ChoiceSetFactory.getElementChoiceSet( ReportDesignConstants.STYLE_ELEMENT, StyleHandle.FONT_FAMILY_PROP ); font.setData( fontSet ); font.setItems( ChoiceSetFactory.getDisplayNamefromChoiceSet( fontSet, new AlphabeticallyComparator( ) ) ); if ( SYSTEM_FONT_LIST != null && SYSTEM_FONT_LIST.length > 0 ) { for ( int i = 0; i < SYSTEM_FONT_LIST.length; i++ ) { font.add( SYSTEM_FONT_LIST[i] ); } } font.add( DEFAULT_CHOICE, 0 ); font.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { updatePreview( ); } } ); if ( font.getItemCount( ) > 0 ) { font.select( 0 ); } size = new FontSizeBuilder( format, SWT.None ); if ( designHandle != null ) { size.setDefaultUnit( designHandle.getPropertyHandle( StyleHandle.FONT_SIZE_PROP ) .getDefaultUnit( ) ); } gdata = new GridData( ); gdata.widthHint = 120; size.setLayoutData( gdata ); size.setFontSizeValue( null ); size.addListener( SWT.Modify, new Listener( ) { public void handleEvent( Event event ) { updatePreview( ); } } ); color = new ColorBuilder( format, 0 ); gdata = new GridData( ); gdata.widthHint = 50; color.setLayoutData( gdata ); color.setChoiceSet( ChoiceSetFactory.getElementChoiceSet( ReportDesignConstants.STYLE_ELEMENT, StyleHandle.COLOR_PROP ) ); color.setRGB( null ); color.addListener( SWT.Modify, new Listener( ) { public void handleEvent( Event event ) { previewLabel.setForeground( ColorManager.getColor( color.getRGB( ) ) ); previewLabel.redraw( ); } } ); Composite fstyle = new Composite( format, 0 ); gdata = new GridData( ); gdata.horizontalSpan = 4; fstyle.setLayoutData( gdata ); fstyle.setLayout( new GridLayout( 4, false ) ); bold = createToggleButton( fstyle ); bold.setImage( ReportPlatformUIImages.getImage( AttributeConstant.FONT_WIDTH ) ); bold.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { isBoldChanged = true; updatePreview( ); } } ); italic = createToggleButton( fstyle ); italic.setImage( ReportPlatformUIImages.getImage( AttributeConstant.FONT_STYLE ) ); italic.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { isItalicChanged = true; updatePreview( ); } } ); underline = createToggleButton( fstyle ); underline.setImage( ReportPlatformUIImages.getImage( AttributeConstant.TEXT_UNDERLINE ) ); underline.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { isUnderlineChanged = true; previewLabel.setUnderline( underline.getSelection( ) ); previewLabel.redraw( ); } } ); linethrough = createToggleButton( fstyle ); linethrough.setImage( ReportPlatformUIImages.getImage( AttributeConstant.TEXT_LINE_THROUGH ) ); linethrough.addSelectionListener( new SelectionAdapter( ) { public void widgetSelected( SelectionEvent e ) { isLinethroughChanged = true; previewLabel.setLinethrough( linethrough.getSelection( ) ); previewLabel.redraw( ); } } ); Composite back = new Composite( innerParent, SWT.NONE ); back.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); glayout = new GridLayout( 1, false ); back.setLayout( glayout ); lb = new Label( back, 0 ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.BackgroundColor" ) ); //$NON-NLS-1$ backColor = new ColorBuilder( back, 0 ); gdata = new GridData( ); gdata.widthHint = 50; backColor.setLayoutData( gdata ); backColor.setChoiceSet( ChoiceSetFactory.getElementChoiceSet( ReportDesignConstants.STYLE_ELEMENT, StyleHandle.BACKGROUND_COLOR_PROP ) ); backColor.setRGB( null ); backColor.addListener( SWT.Modify, new Listener( ) { public void handleEvent( Event event ) { previewLabel.setBackground( ColorManager.getColor( backColor.getRGB( ) ) ); previewLabel.redraw( ); } } ); Composite preview = new Composite( innerParent, SWT.NONE ); glayout = new GridLayout( ); preview.setLayout( glayout ); gdata = new GridData( GridData.FILL_BOTH ); preview.setLayoutData( gdata ); lb = new Label( preview, SWT.NONE ); lb.setText( Messages.getString( "HighlightRuleBuilderDialog.text.Preview" ) ); //$NON-NLS-1$ Composite previewPane = new Composite( preview, SWT.BORDER ); glayout = new GridLayout( ); glayout.marginWidth = 0; glayout.marginHeight = 0; previewPane.setLayout( glayout ); gdata = new GridData( GridData.FILL_BOTH ); gdata.heightHint = 60; previewPane.setLayoutData( gdata ); previewLabel = new PreviewLabel( previewPane, 0 ); previewLabel.setText( Messages.getString( "HighlightRuleBuilderDialog.text.PreviewContent" ) ); //$NON-NLS-1$ gdata = new GridData( GridData.FILL_BOTH ); previewLabel.setLayoutData( gdata ); updatePreview( ); lb = new Label( innerParent, SWT.SEPARATOR | SWT.HORIZONTAL ); lb.setLayoutData( new GridData( GridData.FILL_HORIZONTAL ) ); syncViewProperties( ); updatePreview( ); updateButtons( ); return composite; }
46013 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46013/e2b6eafcb11806e8cec2333182f81de479004998/HighlightRuleBuilder.java/clean/UI/org.eclipse.birt.report.designer.ui/src/org/eclipse/birt/report/designer/ui/dialogs/HighlightRuleBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 8888, 752, 6323, 12, 14728, 982, 262, 202, 95, 202, 202, 6313, 751, 314, 892, 31, 202, 202, 6313, 3744, 5118, 2012, 31, 202, 202, 2640, 4247, 5484, 12, 982, 11272, 202, 202, 9400, 9635, 273, 394, 14728, 12, 982, 16, 374, 11272, 202, 202, 75, 6741, 273, 394, 7145, 3744, 12, 11272, 202, 202, 75, 6741, 18, 10107, 2686, 273, 374, 31, 202, 202, 75, 6741, 18, 10107, 2384, 273, 374, 31, 202, 202, 75, 6741, 18, 17824, 18006, 273, 374, 31, 202, 202, 27676, 18, 542, 3744, 12, 5118, 2012, 11272, 202, 202, 27676, 18, 542, 3744, 751, 12, 394, 7145, 751, 12, 7145, 751, 18, 29818, 67, 38, 18307, 262, 11272, 202, 202, 9010, 6353, 5711, 12, 9635, 11272, 202, 202, 11160, 6353, 7537, 12, 9635, 11272, 202, 202, 9400, 3443, 3054, 273, 261, 9400, 13, 752, 6353, 5484, 12, 9635, 11272, 202, 202, 2640, 3616, 5190, 12, 9635, 11272, 202, 202, 2224, 7831, 273, 394, 5287, 12, 3443, 3054, 16, 348, 8588, 18, 9826, 11272, 202, 202, 20404, 18, 542, 1528, 12, 4838, 18, 588, 780, 12, 315, 16205, 2175, 1263, 6353, 18, 955, 18, 3418, 6, 262, 11272, 4329, 3993, 17, 5106, 17, 21, 8, 202, 202, 9400, 2269, 273, 394, 14728, 12, 3443, 3054, 16, 348, 8588, 18, 9826, 11272, 202, 202, 4175, 18, 542, 3744, 751, 12, 394, 7145, 751, 12, 7145, 751, 18, 29818, 67, 44, 20344, 262, 11272, 202, 202, 75, 6741, 273, 394, 7145, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 8888, 752, 6323, 12, 14728, 982, 262, 202, 95, 202, 202, 6313, 751, 314, 892, 31, 202, 202, 6313, 3744, 5118, 2012, 31, 202, 202, 2640, 4247, 5484, 12, 982, 11272, 202, 202, 9400, 9635, 273, 394, 14728, 12, 982, 16, 374, 11272, 202, 202, 75, 6741, 273, 394, 7145, 3744, 12, 11272, 202, 202, 75, 6741, 18, 10107, 2686, 273, 374, 31, 202, 202, 75, 6741, 18, 10107, 2384, 273, 374, 31, 202, 202, 75, 6741, 18, 17824, 18006, 273, 374, 31, 202, 202, 27676, 18, 542, 3744, 12, 5118, 2012, 11272, 202, 202, 27676, 18, 542, 3744, 751, 12, 394, 7145, 751, 12, 7145, 751, 18, 29818, 67, 38, 18307, 262, 11272, 202, 202, 2 ]
logger.debug("id: " + propertyValue);
if (debug) logger.debug("id: " + propertyValue);
public void setObjectProperty(String objectType, String propertyType, String propertyValue) { logger.debug("objectType: " + objectType); logger.debug("propType: " + propertyType); logger.debug("property: " + propertyValue); if (objectType == null) { logger.error("Cannot add property for null object"); return; } if (propertyType == null) { logger.error("Cannot add property for null property type"); return; } if (propertyValue == null) { logger.warn("Will not add null property"); return; } if (objectType.equals("Molecule")) { if (propertyType.equals("id")) { currentMolecule.setID(propertyValue); } } else if (objectType.equals("PseudoAtom")) { if (propertyType.equals("label")) { if (!(currentAtom instanceof PseudoAtom)) { currentAtom = new PseudoAtom(currentAtom); } ((PseudoAtom)currentAtom).setLabel(propertyValue); } } else if (objectType.equals("Atom")) { if (propertyType.equals("type")) { if (propertyValue.equals("R") && !(currentAtom instanceof PseudoAtom)) { currentAtom = new PseudoAtom(currentAtom); } currentAtom.setSymbol(propertyValue); } else if (propertyType.equals("x2")) { currentAtom.setX2D(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("y2")) { currentAtom.setY2D(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("x3")) { currentAtom.setX3D(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("y3")) { currentAtom.setY3D(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("z3")) { currentAtom.setZ3D(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("formalCharge")) { currentAtom.setFormalCharge(new Integer(propertyValue).intValue()); } else if (propertyType.equals("charge")) { currentAtom.setCharge(new Double(propertyValue).doubleValue()); } else if (propertyType.equals("hydrogenCount")) { currentAtom.setHydrogenCount(new Integer(propertyValue).intValue()); } else if (propertyType.equals("dictRef")) { currentAtom.setProperty("org.openscience.cdk.dict", propertyValue); } else if (propertyType.equals("atomicNumber")) { currentAtom.setAtomicNumber(Integer.parseInt(propertyValue)); } else if (propertyType.equals("massNumber")) { currentAtom.setMassNumber(Integer.parseInt(propertyValue)); } else if (propertyType.equals("id")) { logger.debug("id" + propertyValue); currentAtom.setID(propertyValue); atomEnumeration.put(propertyValue, new Integer(numberOfAtoms)); } } else if (objectType.equals("Bond")) { if (propertyType.equals("atom1")) { bond_a1 = new Integer(propertyValue).intValue(); } else if (propertyType.equals("atom2")) { bond_a2 = new Integer(propertyValue).intValue(); } else if (propertyType.equals("id")) { logger.debug("id: " + propertyValue); bond_id = propertyValue; } else if (propertyType.equals("order")) { try { bond_order = Double.parseDouble(propertyValue); } catch (Exception e) { logger.error("Cannot convert to double: " + propertyValue); bond_order = 1.0; } } else if (propertyType.equals("stereo")) { if (propertyValue.equals("H")) { bond_stereo = CDKConstants.STEREO_BOND_DOWN; } else if (propertyValue.equals("W")) { bond_stereo = CDKConstants.STEREO_BOND_UP; } } } else if (objectType.equals("Reaction")) { if (propertyType.equals("id")) { currentReaction.setID(propertyValue); } } else if (objectType.equals("SetOfReactions")) { if (propertyType.equals("id")) { currentSetOfReactions.setID(propertyValue); } } else if (objectType.equals("Reactant")) { if (propertyType.equals("id")) { currentMolecule.setID(propertyValue); } } else if (objectType.equals("Product")) { if (propertyType.equals("id")) { currentMolecule.setID(propertyValue); } } else if (objectType.equals("Crystal")) { // set these variables if (currentMolecule instanceof Crystal) { Crystal current = (Crystal)currentMolecule; if (propertyType.equals("spacegroup")) { logger.debug("Setting crystal spacegroup to: " + propertyValue); current.setSpaceGroup(propertyValue); } else if (propertyType.equals("z")) { try { logger.debug("Setting z to: " + propertyValue); current.setZ(Integer.parseInt(propertyValue)); } catch (NumberFormatException exception) { logger.error("Error in format of Z value"); } } } else { logger.warn("Cannot add crystal cell parameters to a non " + "Crystal class!"); } } else if (objectType.equals("a-axis") || objectType.equals("b-axis") || objectType.equals("c-axis")) { // set these variables if (currentMolecule instanceof Crystal) { Crystal current = (Crystal)currentMolecule; logger.debug("Setting axis (" + objectType + "): " + propertyValue); if (propertyType.equals("x")) { crystal_axis_x = Double.parseDouble(propertyValue); } else if (propertyType.equals("y")) { crystal_axis_y = Double.parseDouble(propertyValue); } else if (propertyType.equals("z")) { crystal_axis_z = Double.parseDouble(propertyValue); } } else { logger.warn("Cannot add crystal cell parameters to a non " + "Crystal class!"); } } logger.debug("Object property set..."); };
46046 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46046/85b1def8500569c307eef07a73f9886549ea9364/ChemFileCDO.java/clean/src/org/openscience/cdk/io/cml/ChemFileCDO.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 20530, 1396, 12, 780, 16400, 16, 514, 21076, 16, 21394, 514, 12337, 13, 288, 1377, 1194, 18, 4148, 2932, 1612, 559, 30, 315, 397, 16400, 1769, 1377, 1194, 18, 4148, 2932, 5986, 559, 30, 315, 397, 21076, 1769, 1377, 1194, 18, 4148, 2932, 4468, 30, 315, 397, 12337, 1769, 5411, 309, 261, 1612, 559, 422, 446, 13, 288, 1850, 1194, 18, 1636, 2932, 4515, 527, 1272, 364, 446, 733, 8863, 1850, 327, 31, 1377, 289, 1377, 309, 261, 4468, 559, 422, 446, 13, 288, 1850, 1194, 18, 1636, 2932, 4515, 527, 1272, 364, 446, 1272, 618, 8863, 1850, 327, 31, 1377, 289, 1377, 309, 261, 4468, 620, 422, 446, 13, 288, 1850, 1194, 18, 8935, 2932, 13670, 486, 527, 446, 1272, 8863, 1850, 327, 31, 1377, 289, 5411, 309, 261, 1612, 559, 18, 14963, 2932, 29669, 6, 3719, 288, 3639, 309, 261, 4468, 559, 18, 14963, 2932, 350, 6, 3719, 288, 1850, 783, 29669, 18, 542, 734, 12, 4468, 620, 1769, 3639, 289, 1377, 289, 469, 309, 261, 1612, 559, 18, 14963, 2932, 26716, 3641, 6, 3719, 288, 3639, 309, 261, 4468, 559, 18, 14963, 2932, 1925, 6, 3719, 288, 5411, 309, 16051, 12, 2972, 3641, 1276, 453, 9091, 3641, 3719, 288, 7734, 783, 3641, 273, 394, 453, 9091, 3641, 12, 2972, 3641, 1769, 5411, 289, 5411, 14015, 26716, 3641, 13, 2972, 3641, 2934, 542, 2224, 12, 4468, 620, 1769, 3639, 289, 1377, 289, 469, 309, 261, 1612, 559, 18, 14963, 2932, 3641, 6, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 20530, 1396, 12, 780, 16400, 16, 514, 21076, 16, 21394, 514, 12337, 13, 288, 1377, 1194, 18, 4148, 2932, 1612, 559, 30, 315, 397, 16400, 1769, 1377, 1194, 18, 4148, 2932, 5986, 559, 30, 315, 397, 21076, 1769, 1377, 1194, 18, 4148, 2932, 4468, 30, 315, 397, 12337, 1769, 5411, 309, 261, 1612, 559, 422, 446, 13, 288, 1850, 1194, 18, 1636, 2932, 4515, 527, 1272, 364, 446, 733, 8863, 1850, 327, 31, 1377, 289, 1377, 309, 261, 4468, 559, 422, 446, 13, 288, 1850, 1194, 18, 1636, 2932, 4515, 527, 1272, 364, 446, 1272, 618, 8863, 1850, 327, 31, 1377, 289, 1377, 309, 261, 4468, 620, 422, 446, 13, 288, 1850, 1194, 18, 8935, 2932, 2 ]
broker.addProducer(cs.getContext(), info); try { ss.addProducer(info); } catch (IllegalStateException e) { broker.removeProducer(cs.getContext(), info); }
broker.addProducer(cs.getContext(), info); try { ss.addProducer(info); } catch (IllegalStateException e) { broker.removeProducer(cs.getContext(), info); }
public Response processAddProducer(ProducerInfo info) throws Exception { SessionId sessionId = info.getProducerId().getParentId(); ConnectionId connectionId = sessionId.getParentId(); ConnectionState cs = lookupConnectionState(connectionId); SessionState ss = cs.getSessionState(sessionId); if( ss == null ) throw new IllegalStateException("Cannot add a producer to a session that had not been registered: "+sessionId); // Avoid replaying dup commands if( !ss.getProducerIds().contains(info.getProducerId()) ) { broker.addProducer(cs.getContext(), info); try { ss.addProducer(info); } catch (IllegalStateException e) { broker.removeProducer(cs.getContext(), info); } } return null; }
11783 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11783/cafe4cbcc4cf31839ff5bdfb5af7a55a682ef075/AbstractConnection.java/buggy/activemq-core/src/main/java/org/apache/activemq/broker/AbstractConnection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 2306, 1207, 986, 12140, 12, 12140, 966, 1123, 13, 1216, 1185, 288, 3639, 3877, 548, 10338, 273, 1123, 18, 588, 12140, 548, 7675, 588, 18847, 5621, 3639, 4050, 548, 1459, 548, 273, 10338, 18, 588, 18847, 5621, 7734, 4050, 1119, 2873, 273, 3689, 1952, 1119, 12, 4071, 548, 1769, 3639, 3877, 1119, 5202, 273, 2873, 18, 588, 2157, 1119, 12, 3184, 548, 1769, 3639, 309, 12, 5202, 422, 446, 262, 5411, 604, 394, 5477, 2932, 4515, 527, 279, 12608, 358, 279, 1339, 716, 9323, 486, 2118, 4104, 30, 13773, 3184, 548, 1769, 3639, 368, 17843, 16033, 310, 9417, 4364, 3639, 309, 12, 401, 1049, 18, 588, 12140, 2673, 7675, 12298, 12, 1376, 18, 588, 12140, 548, 10756, 262, 288, 202, 3639, 8625, 18, 1289, 12140, 12, 2143, 18, 29120, 9334, 1123, 1769, 202, 3639, 775, 288, 202, 5411, 5202, 18, 1289, 12140, 12, 1376, 1769, 1082, 202, 97, 1044, 261, 12195, 5060, 425, 13, 288, 9506, 202, 21722, 18, 4479, 12140, 12, 2143, 18, 29120, 9334, 1123, 1769, 1082, 202, 97, 3639, 289, 3639, 327, 446, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 2306, 1207, 986, 12140, 12, 12140, 966, 1123, 13, 1216, 1185, 288, 3639, 3877, 548, 10338, 273, 1123, 18, 588, 12140, 548, 7675, 588, 18847, 5621, 3639, 4050, 548, 1459, 548, 273, 10338, 18, 588, 18847, 5621, 7734, 4050, 1119, 2873, 273, 3689, 1952, 1119, 12, 4071, 548, 1769, 3639, 3877, 1119, 5202, 273, 2873, 18, 588, 2157, 1119, 12, 3184, 548, 1769, 3639, 309, 12, 5202, 422, 446, 262, 5411, 604, 394, 5477, 2932, 4515, 527, 279, 12608, 358, 279, 1339, 716, 9323, 486, 2118, 4104, 30, 13773, 3184, 548, 1769, 3639, 368, 17843, 16033, 310, 9417, 4364, 3639, 309, 12, 401, 1049, 18, 588, 12140, 2673, 7675, 12298, 12, 1376, 18, 588, 12140, 548, 10756, 2 ]
Debug.output( Debug.IMR | Debug.INFORMATION,
Debug.output( 4,
public void doWork( Object job ) { Process p = (Process) job; BufferedReader _in = new BufferedReader(new InputStreamReader(selector.getInputStream( p ))); String _line = null; try { // If we get null from readLine() we assume that the process has exited. // Unfortunately there is no exception thrown when trying to read from // a dead processes output stream. while((_line = _in.readLine()) != null) { System.out.println(out_prefix + _line); } _in.close(); } catch( Exception _e ) { _e.printStackTrace(); } Debug.output( Debug.IMR | Debug.INFORMATION, "A server process exited" ); }
46355 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46355/18367b9c8638a766302195ae097901c5637ea11f/ServerStartupDaemonImpl.java/clean/src/org/jacorb/imr/ServerStartupDaemonImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 741, 2421, 12, 1033, 1719, 262, 3639, 288, 5411, 4389, 293, 273, 261, 2227, 13, 1719, 31, 202, 565, 10633, 389, 267, 273, 394, 10633, 12, 2704, 15322, 12, 9663, 18, 588, 4348, 12, 293, 8623, 1769, 202, 565, 514, 389, 1369, 273, 446, 31, 202, 18701, 202, 565, 775, 5411, 288, 202, 202, 759, 971, 732, 336, 446, 628, 12273, 1435, 732, 6750, 716, 326, 1207, 711, 21590, 18, 202, 202, 759, 1351, 24233, 1915, 353, 1158, 1520, 6718, 1347, 8374, 358, 855, 628, 202, 202, 759, 279, 8363, 8488, 876, 1407, 18, 202, 202, 17523, 12443, 67, 1369, 273, 389, 267, 18, 896, 1670, 10756, 480, 446, 13, 7734, 288, 1082, 565, 2332, 18, 659, 18, 8222, 12, 659, 67, 3239, 397, 389, 1369, 1769, 7734, 289, 1082, 389, 267, 18, 4412, 5621, 202, 565, 289, 5411, 1044, 12, 1185, 389, 73, 262, 5411, 288, 202, 202, 67, 73, 18, 1188, 6332, 5621, 202, 565, 289, 202, 377, 202, 565, 4015, 18, 2844, 12, 1059, 16, 12900, 315, 37, 1438, 1207, 21590, 6, 11272, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 741, 2421, 12, 1033, 1719, 262, 3639, 288, 5411, 4389, 293, 273, 261, 2227, 13, 1719, 31, 202, 565, 10633, 389, 267, 273, 394, 10633, 12, 2704, 15322, 12, 9663, 18, 588, 4348, 12, 293, 8623, 1769, 202, 565, 514, 389, 1369, 273, 446, 31, 202, 18701, 202, 565, 775, 5411, 288, 202, 202, 759, 971, 732, 336, 446, 628, 12273, 1435, 732, 6750, 716, 326, 1207, 711, 21590, 18, 202, 202, 759, 1351, 24233, 1915, 353, 1158, 1520, 6718, 1347, 8374, 358, 855, 628, 202, 202, 759, 279, 8363, 8488, 876, 1407, 18, 202, 202, 17523, 12443, 67, 1369, 273, 389, 267, 18, 896, 1670, 10756, 480, 446, 13, 7734, 288, 1082, 565, 2332, 2 ]
Node nuChild = new Node(TO_OBJECT, child);
Node nuChild = new Node(Token.TO_OBJECT, child);
private void rewriteAsObjectChildren(Node n, Node child) { // Force optimized children to be objects while (child != null) { Node nextChild = child.getNext(); int type = rewriteForNumberVariables(child); if (type == NumberType) { if (!convertParameter(child)) { n.removeChild(child); Node nuChild = new Node(TO_OBJECT, child); if (nextChild == null) n.addChildToBack(nuChild); else n.addChildBefore(nuChild, nextChild); } } child = nextChild; } }
12564 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/12564/f534359b03da94ab48bfc8f2027296f3dc01e5a4/Optimizer.java/clean/src/org/mozilla/javascript/optimizer/Optimizer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 10738, 1463, 921, 4212, 12, 907, 290, 16, 2029, 1151, 13, 565, 288, 3639, 368, 11889, 15411, 2325, 358, 506, 2184, 3639, 1323, 261, 3624, 480, 446, 13, 288, 5411, 2029, 1024, 1763, 273, 1151, 18, 588, 2134, 5621, 5411, 509, 618, 273, 10738, 1290, 1854, 6158, 12, 3624, 1769, 5411, 309, 261, 723, 422, 3588, 559, 13, 288, 7734, 309, 16051, 6283, 1662, 12, 3624, 3719, 288, 10792, 290, 18, 4479, 1763, 12, 3624, 1769, 10792, 2029, 9244, 1763, 273, 394, 2029, 12, 1345, 18, 4296, 67, 9422, 16, 1151, 1769, 10792, 309, 261, 4285, 1763, 422, 446, 13, 13491, 290, 18, 1289, 1763, 774, 2711, 12, 13053, 1763, 1769, 10792, 469, 13491, 290, 18, 1289, 1763, 4649, 12, 13053, 1763, 16, 1024, 1763, 1769, 7734, 289, 5411, 289, 5411, 1151, 273, 1024, 1763, 31, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 10738, 1463, 921, 4212, 12, 907, 290, 16, 2029, 1151, 13, 565, 288, 3639, 368, 11889, 15411, 2325, 358, 506, 2184, 3639, 1323, 261, 3624, 480, 446, 13, 288, 5411, 2029, 1024, 1763, 273, 1151, 18, 588, 2134, 5621, 5411, 509, 618, 273, 10738, 1290, 1854, 6158, 12, 3624, 1769, 5411, 309, 261, 723, 422, 3588, 559, 13, 288, 7734, 309, 16051, 6283, 1662, 12, 3624, 3719, 288, 10792, 290, 18, 4479, 1763, 12, 3624, 1769, 10792, 2029, 9244, 1763, 273, 394, 2029, 12, 1345, 18, 4296, 67, 9422, 16, 1151, 1769, 10792, 309, 261, 4285, 1763, 422, 446, 13, 13491, 290, 18, 1289, 1763, 774, 2711, 12, 13053, 1763, 1769, 10792, 469, 13491, 290, 18, 2 ]
} Iterator iter = thePolls.values().iterator(); while(iter.hasNext()) { Poll p = (Poll)iter.next();
} Iterator iter = thePolls.values().iterator(); while(iter.hasNext()) { Poll p = (Poll)iter.next();
static ArchivalUnit checkForConflicts(Message msg) { ArchivalUnit url_set = null; String url = msg.getTargetUrl(); String regexp = msg.getRegExp(); int opcode = msg.getOpcode(); boolean isRegExp = regexp != null; // verify polls are never conflicts if((opcode == Message.VERIFY_POLL_REP)|| (opcode == Message.VERIFY_POLL_REQ)) { return null; } Iterator iter = thePolls.values().iterator(); while(iter.hasNext()) { Poll p = (Poll)iter.next(); Message p_msg = p.getMessage(); String p_url = p_msg.getTargetUrl(); String p_regexp = p_msg.getRegExp(); int p_opcode = p_msg.getOpcode(); boolean p_isRegExp = p_regexp != null; //XXX this should be handled by something else boolean alongside = p_url.equals(url); boolean below = (p_url.startsWith(url) && url.endsWith(File.separator)); boolean above = (url.startsWith(p_url) && p_url.endsWith(File.separator)); // check for content poll conflicts if((opcode == Message.CONTENT_POLL_REP) || (opcode == Message.CONTENT_POLL_REQ)) { if(alongside) { // only verify polls are allowed if((p_opcode == Message.VERIFY_POLL_REP)|| (p_opcode == Message.VERIFY_POLL_REQ)) { continue; } return p.getArchivalUnit(); } if(above || below) { // verify and regexp polls are allowed if((p_opcode == Message.VERIFY_POLL_REP)|| (p_opcode == Message.VERIFY_POLL_REQ)) { continue; } if((p_opcode == Message.CONTENT_POLL_REP) || (p_opcode == Message.CONTENT_POLL_REQ)) { if(p_isRegExp) { continue; } } return p.getArchivalUnit(); } } // check for name poll conflicts if((opcode == Message.NAME_POLL_REP) || (opcode == Message.NAME_POLL_REQ)) { if(alongside) { // only verify polls are allowed if((p_opcode == Message.VERIFY_POLL_REP)|| (p_opcode == Message.VERIFY_POLL_REQ)) { continue; } else { return p.getArchivalUnit(); } } if(above) { // only reg exp polls are allowed if((p_opcode == Message.CONTENT_POLL_REP) || (p_opcode == Message.CONTENT_POLL_REQ)) { if(p_isRegExp) { continue; } } return p.getArchivalUnit(); } if(below) { // always a conflict return p.getArchivalUnit(); } } } return url_set; }
8150 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8150/7a97866b8f8c386c7623af9868e552bd531f797f/Poll.java/clean/src/org/lockss/poller/Poll.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 760, 16959, 5162, 2802, 13855, 30897, 12, 1079, 1234, 13, 288, 202, 12269, 5162, 2802, 225, 880, 67, 542, 273, 446, 31, 202, 780, 880, 273, 1234, 18, 588, 2326, 1489, 5621, 202, 780, 7195, 273, 1234, 18, 588, 13673, 5621, 202, 474, 565, 11396, 273, 1234, 18, 588, 22808, 5621, 202, 6494, 353, 13673, 273, 7195, 480, 446, 31, 202, 759, 3929, 2952, 3251, 854, 5903, 14450, 202, 430, 12443, 556, 710, 422, 2350, 18, 23756, 67, 14232, 48, 67, 28879, 14047, 96, 202, 282, 261, 556, 710, 422, 2350, 18, 23756, 67, 14232, 48, 67, 20373, 3719, 288, 202, 225, 327, 446, 31, 202, 97, 202, 3198, 1400, 273, 326, 5850, 3251, 18, 2372, 7675, 9838, 5621, 202, 17523, 12, 2165, 18, 5332, 2134, 10756, 288, 202, 225, 19160, 293, 273, 261, 19085, 13, 2165, 18, 4285, 5621, 202, 225, 2350, 293, 67, 3576, 273, 293, 18, 24906, 5621, 202, 225, 514, 225, 293, 67, 718, 273, 293, 67, 3576, 18, 588, 2326, 1489, 5621, 202, 225, 514, 225, 293, 67, 17745, 273, 293, 67, 3576, 18, 588, 13673, 5621, 202, 225, 509, 377, 293, 67, 556, 710, 273, 293, 67, 3576, 18, 588, 22808, 5621, 202, 225, 1250, 293, 67, 291, 13673, 273, 293, 67, 17745, 480, 446, 31, 202, 225, 368, 15639, 333, 1410, 506, 7681, 635, 5943, 469, 202, 225, 1250, 524, 7260, 831, 273, 293, 67, 718, 18, 14963, 12, 718, 1769, 202, 225, 1250, 5712, 273, 261, 84, 67, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 760, 16959, 5162, 2802, 13855, 30897, 12, 1079, 1234, 13, 288, 202, 12269, 5162, 2802, 225, 880, 67, 542, 273, 446, 31, 202, 780, 880, 273, 1234, 18, 588, 2326, 1489, 5621, 202, 780, 7195, 273, 1234, 18, 588, 13673, 5621, 202, 474, 565, 11396, 273, 1234, 18, 588, 22808, 5621, 202, 6494, 353, 13673, 273, 7195, 480, 446, 31, 202, 759, 3929, 2952, 3251, 854, 5903, 14450, 202, 430, 12443, 556, 710, 422, 2350, 18, 23756, 67, 14232, 48, 67, 28879, 14047, 96, 202, 282, 261, 556, 710, 422, 2350, 18, 23756, 67, 14232, 48, 67, 20373, 3719, 288, 202, 225, 327, 446, 31, 202, 97, 202, 3198, 1400, 273, 326, 5850, 3251, 18, 2372, 7675, 9838, 2 ]
private DataSet parseDataSet(Element e) { DataSet data = new DataSet(); // read waypoints not contained in tracks or areas for (Object o : e.getChildren("wpt", GPX)) addNode(data, parseWaypoint((Element)o)); // read tracks for (Object trackElement : e.getChildren("trk", GPX)) parseTrack((Element)trackElement, data); return data; }
2204 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2204/ef9697037993516110184edb0d06997fb5ec30bb/GpxReader.java/buggy/src/org/openstreetmap/josm/io/GpxReader.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 14065, 1109, 13676, 12, 1046, 425, 13, 288, 202, 202, 13676, 501, 273, 394, 14065, 5621, 202, 202, 759, 855, 4031, 4139, 486, 7542, 316, 13933, 578, 15586, 202, 202, 1884, 261, 921, 320, 294, 425, 18, 588, 4212, 2932, 91, 337, 3113, 4948, 60, 3719, 1082, 202, 1289, 907, 12, 892, 16, 1109, 21831, 1153, 12443, 1046, 13, 83, 10019, 1082, 202, 759, 855, 13933, 202, 202, 1884, 261, 921, 3298, 1046, 294, 425, 18, 588, 4212, 2932, 313, 79, 3113, 4948, 60, 3719, 1082, 202, 2670, 4402, 12443, 1046, 13, 4101, 1046, 16, 501, 1769, 1082, 202, 2463, 501, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 14065, 1109, 13676, 12, 1046, 425, 13, 288, 202, 202, 13676, 501, 273, 394, 14065, 5621, 202, 202, 759, 855, 4031, 4139, 486, 7542, 316, 13933, 578, 15586, 202, 202, 1884, 261, 921, 320, 294, 425, 18, 588, 4212, 2932, 91, 337, 3113, 4948, 60, 3719, 1082, 202, 1289, 907, 12, 892, 16, 1109, 21831, 1153, 12443, 1046, 13, 83, 10019, 1082, 202, 759, 855, 13933, 202, 202, 1884, 261, 921, 3298, 1046, 294, 425, 18, 588, 4212, 2932, 313, 79, 3113, 4948, 60, 3719, 1082, 202, 2670, 4402, 12443, 1046, 13, 4101, 1046, 16, 501, 1769, 1082, 202, 2463, 501, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
parse("typedef void ( A:: * pFunction ) ( void ); ");
parse("typedef void ( A:: * pMethod ) ( void ); ");
public void testBug36290() throws Exception { parse("typedef void ( A:: * pFunction ) ( void ); "); parse("typedef void (boo) ( void ); "); parse("typedef void boo (void); "); }
54911 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54911/95b11e1171a42aa17e75357505c454086462f2ad/QuickParseASTTests.java/buggy/core/org.eclipse.cdt.core.tests/parser/org/eclipse/cdt/core/parser/tests/QuickParseASTTests.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 19865, 5718, 5540, 20, 1435, 1216, 1185, 288, 202, 202, 2670, 2932, 723, 536, 918, 261, 432, 2866, 380, 293, 2083, 262, 261, 918, 11272, 315, 1769, 202, 202, 2670, 2932, 723, 536, 918, 261, 1075, 83, 13, 261, 918, 11272, 315, 1769, 202, 202, 2670, 2932, 723, 536, 918, 800, 83, 261, 6459, 1769, 315, 1769, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 19865, 5718, 5540, 20, 1435, 1216, 1185, 288, 202, 202, 2670, 2932, 723, 536, 918, 261, 432, 2866, 380, 293, 2083, 262, 261, 918, 11272, 315, 1769, 202, 202, 2670, 2932, 723, 536, 918, 261, 1075, 83, 13, 261, 918, 11272, 315, 1769, 202, 202, 2670, 2932, 723, 536, 918, 800, 83, 261, 6459, 1769, 315, 1769, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
else if (b == '\r')
else if (b == '\n')
public void update( byte b) throws SignatureException { if (signatureType == PGPSignature.CANONICAL_TEXT_DOCUMENT) { if (b == '\n') { sig.update((byte)'\r'); sig.update((byte)'\n'); return; } else if (b == '\r') { return; } } sig.update(b); }
14767 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/14767/6348297b84b456e44c72ad80e3c7024fbda300ae/PGPSignature.java/clean/crypto/src/org/bouncycastle/openpgp/PGPSignature.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1089, 12, 3639, 1160, 565, 324, 13, 3639, 1216, 9249, 503, 565, 288, 3639, 309, 261, 8195, 559, 422, 21222, 5374, 18, 39, 1258, 673, 10109, 67, 5151, 67, 18450, 13, 3639, 288, 5411, 309, 261, 70, 422, 2337, 82, 6134, 5411, 288, 7734, 3553, 18, 2725, 12443, 7229, 2506, 64, 86, 8284, 7734, 3553, 18, 2725, 12443, 7229, 2506, 64, 82, 8284, 7734, 327, 31, 5411, 289, 5411, 469, 309, 261, 70, 422, 2337, 82, 6134, 5411, 288, 7734, 327, 31, 5411, 289, 3639, 289, 7734, 3553, 18, 2725, 12, 70, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1089, 12, 3639, 1160, 565, 324, 13, 3639, 1216, 9249, 503, 565, 288, 3639, 309, 261, 8195, 559, 422, 21222, 5374, 18, 39, 1258, 673, 10109, 67, 5151, 67, 18450, 13, 3639, 288, 5411, 309, 261, 70, 422, 2337, 82, 6134, 5411, 288, 7734, 3553, 18, 2725, 12443, 7229, 2506, 64, 86, 8284, 7734, 3553, 18, 2725, 12443, 7229, 2506, 64, 82, 8284, 7734, 327, 31, 5411, 289, 5411, 469, 309, 261, 70, 422, 2337, 82, 6134, 5411, 288, 7734, 327, 31, 5411, 289, 3639, 289, 7734, 3553, 18, 2725, 12, 70, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Object[] errArgs = { tokenToString(tt), tokenToString(this.pushbackToken) }; String message = Context.getMessage("msg.token.replaces.pushback", errArgs);
String message = Context.getMessage2("msg.token.replaces.pushback", tokenToString(tt), tokenToString(this.pushbackToken));
public void ungetToken(int tt) { if (this.pushbackToken != EOF && tt != ERROR) { Object[] errArgs = { tokenToString(tt), tokenToString(this.pushbackToken) }; String message = Context.getMessage("msg.token.replaces.pushback", errArgs); throw new RuntimeException(message); } this.pushbackToken = tt; tokenno--; }
54155 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54155/e737c6d867e82d4ba7fd00e7e388c9c8da824ff0/TokenStream.java/buggy/js/rhino/org/mozilla/javascript/TokenStream.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 640, 588, 1345, 12, 474, 3574, 13, 288, 3639, 309, 261, 2211, 18, 6206, 823, 1345, 480, 6431, 597, 3574, 480, 5475, 13, 288, 5411, 1033, 8526, 393, 2615, 273, 288, 1147, 5808, 12, 748, 3631, 4766, 1147, 5808, 12, 2211, 18, 6206, 823, 1345, 13, 289, 31, 5411, 514, 883, 273, 1772, 18, 24906, 2932, 3576, 18, 2316, 18, 266, 11350, 18, 6206, 823, 3113, 4766, 7734, 393, 2615, 1769, 5411, 604, 394, 3235, 12, 2150, 1769, 3639, 289, 3639, 333, 18, 6206, 823, 1345, 273, 3574, 31, 3639, 1147, 2135, 413, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 640, 588, 1345, 12, 474, 3574, 13, 288, 3639, 309, 261, 2211, 18, 6206, 823, 1345, 480, 6431, 597, 3574, 480, 5475, 13, 288, 5411, 1033, 8526, 393, 2615, 273, 288, 1147, 5808, 12, 748, 3631, 4766, 1147, 5808, 12, 2211, 18, 6206, 823, 1345, 13, 289, 31, 5411, 514, 883, 273, 1772, 18, 24906, 2932, 3576, 18, 2316, 18, 266, 11350, 18, 6206, 823, 3113, 4766, 7734, 393, 2615, 1769, 5411, 604, 394, 3235, 12, 2150, 1769, 3639, 289, 3639, 333, 18, 6206, 823, 1345, 273, 3574, 31, 3639, 1147, 2135, 413, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public void setUp() {
public void setUp() throws Exception { super.setUp();
public void setUp() { _mf = new MainFrame(); }
11192 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11192/edb148d96e488bb5de94fe3df6063e44425ab166/CommandLineTest.java/clean/drjava/src/edu/rice/cs/drjava/CommandLineTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 24292, 1435, 1216, 1185, 288, 2240, 18, 542, 1211, 5621, 565, 389, 16126, 273, 394, 12740, 3219, 5621, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 24292, 1435, 1216, 1185, 288, 2240, 18, 542, 1211, 5621, 565, 389, 16126, 273, 394, 12740, 3219, 5621, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
exportElementID( table, bookmark );
exportElementID( table, bookmark, "TABLE" );
public void startTable( ITableContent table ) { assert table != null; IStyle mergedStyle = table.getStyle( ); push( mergedStyle ); if ( isHidden( ) ) { return; } logger.log( Level.FINE, "[HTMLTableEmitter] Start table" ); //$NON-NLS-1$ DimensionType x = table.getX( ); DimensionType y = table.getY( ); StringBuffer styleBuffer = new StringBuffer( ); addDefaultTableStyles( styleBuffer ); writer.openTag( HTMLTags.TAG_TABLE ); // style string setStyleName( table.getStyleClass( ) ); int display = checkElementType( x, y, mergedStyle, styleBuffer ); setDisplayProperty( display, DISPLAY_INLINE, styleBuffer ); handleShrink( DISPLAY_BLOCK, mergedStyle, table.getHeight( ), table .getWidth( ), styleBuffer ); handleStyle( table, styleBuffer ); // bookmark String bookmark = table.getBookmark( ); if ( bookmark == null ) { bookmark = generateUniqueID( ); } setBookmark( null, bookmark ); exportElementID( table, bookmark ); // Instance ID InstanceID iid = table.getInstanceID( ); if ( iid != null ) { writer.attribute( "iid", iid.toString( ) ); } // table caption String caption = table.getCaption( ); if ( caption != null && caption.length( ) > 0 ) { writer.openTag( HTMLTags.TAG_CAPTION ); writer.text( caption ); writer.closeTag( HTMLTags.TAG_CAPTION ); } writeColumns( table ); }
5230 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5230/74754c20d43b56bf9e930c556ab5d06c61611daf/HTMLReportEmitter.java/clean/engine/org.eclipse.birt.report.engine.emitter.html/src/org/eclipse/birt/report/engine/emitter/html/HTMLReportEmitter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 787, 1388, 12, 467, 1388, 1350, 1014, 262, 202, 95, 202, 202, 11231, 1014, 480, 446, 31, 202, 202, 45, 2885, 5384, 2885, 273, 1014, 18, 588, 2885, 12, 11272, 202, 202, 6206, 12, 5384, 2885, 11272, 202, 202, 430, 261, 30713, 12, 262, 262, 202, 202, 95, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 4901, 18, 1330, 12, 4557, 18, 42, 3740, 16, 5158, 4870, 1388, 13476, 65, 3603, 1014, 6, 11272, 4329, 3993, 17, 5106, 17, 21, 8, 202, 202, 8611, 559, 619, 273, 1014, 18, 588, 60, 12, 11272, 202, 202, 8611, 559, 677, 273, 1014, 18, 588, 61, 12, 11272, 202, 202, 780, 1892, 2154, 1892, 273, 394, 6674, 12, 11272, 202, 202, 1289, 1868, 1388, 9725, 12, 2154, 1892, 11272, 202, 202, 6299, 18, 3190, 1805, 12, 3982, 3453, 18, 7927, 67, 7775, 11272, 202, 202, 759, 2154, 533, 202, 202, 542, 2885, 461, 12, 1014, 18, 588, 2885, 797, 12, 262, 11272, 202, 202, 474, 2562, 273, 866, 17481, 12, 619, 16, 677, 16, 5384, 2885, 16, 2154, 1892, 11272, 202, 202, 542, 4236, 1396, 12, 2562, 16, 25214, 67, 706, 5997, 16, 2154, 1892, 11272, 202, 202, 4110, 28747, 12, 25214, 67, 11403, 16, 5384, 2885, 16, 1014, 18, 588, 2686, 12, 262, 16, 1014, 9506, 202, 18, 588, 2384, 12, 262, 16, 2154, 1892, 11272, 202, 202, 4110, 2885, 12, 1014, 16, 2154, 1892, 11272, 202, 202, 759, 13696, 202, 202, 780, 13696, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 787, 1388, 12, 467, 1388, 1350, 1014, 262, 202, 95, 202, 202, 11231, 1014, 480, 446, 31, 202, 202, 45, 2885, 5384, 2885, 273, 1014, 18, 588, 2885, 12, 11272, 202, 202, 6206, 12, 5384, 2885, 11272, 202, 202, 430, 261, 30713, 12, 262, 262, 202, 202, 95, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 4901, 18, 1330, 12, 4557, 18, 42, 3740, 16, 5158, 4870, 1388, 13476, 65, 3603, 1014, 6, 11272, 4329, 3993, 17, 5106, 17, 21, 8, 202, 202, 8611, 559, 619, 273, 1014, 18, 588, 60, 12, 11272, 202, 202, 8611, 559, 677, 273, 1014, 18, 588, 61, 12, 11272, 202, 202, 780, 1892, 2154, 1892, 273, 394, 6674, 2 ]
NodeFilter.SHOW_ALL,
NodeFilter.SHOW_PROCESSING_INSTRUCTION,
protected void update() { Iterator it = components.iterator(); SVGDocument doc = svgCanvas.getSVGDocument(); while (it.hasNext()) { JComponent stylesheetMenu = (JComponent)it.next(); stylesheetMenu.removeAll(); stylesheetMenu.setEnabled(false); ButtonGroup buttonGroup = new ButtonGroup(); TreeWalker tw; tw = ((DocumentTraversal)doc).createTreeWalker (doc, NodeFilter.SHOW_ALL, null, true); for (Node n = tw.nextNode(); n != null; n = tw.nextNode()) { if (n instanceof StyleSheetProcessingInstruction) { StyleSheetProcessingInstruction sspi; sspi = (StyleSheetProcessingInstruction)n; HashTable attrs = sspi.getPseudoAttributes(); final String title = (String)attrs.get("title"); String alt = (String)attrs.get("alternate"); if (title != null && "yes".equals(alt)) { JRadioButtonMenuItem button; button = new JRadioButtonMenuItem(title); button.addActionListener (new java.awt.event.ActionListener() { public void actionPerformed(ActionEvent e) { SVGOMDocument doc; doc = (SVGOMDocument)svgCanvas.getSVGDocument(); doc.enableAlternateStyleSheet(title); doc.clearViewCSS(); svgCanvas.setSVGDocument(doc); } }); buttonGroup.add(button); stylesheetMenu.add(button); stylesheetMenu.setEnabled(true); } } } } }
46680 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46680/3e5f231c4423d8d1d1933851a6524d389bc950c2/JSVGViewerFrame.java/buggy/sources/org/apache/batik/apps/svgbrowser/JSVGViewerFrame.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 918, 1089, 1435, 288, 5411, 4498, 518, 273, 4085, 18, 9838, 5621, 5411, 11281, 2519, 997, 273, 9804, 12971, 18, 588, 26531, 2519, 5621, 5411, 1323, 261, 305, 18, 5332, 2134, 10756, 288, 7734, 29058, 13820, 4599, 273, 261, 46, 1841, 13, 305, 18, 4285, 5621, 7734, 13820, 4599, 18, 4479, 1595, 5621, 7734, 13820, 4599, 18, 542, 1526, 12, 5743, 1769, 7734, 12569, 1114, 3568, 1114, 273, 394, 12569, 1114, 5621, 7734, 4902, 16246, 2339, 31, 7734, 2339, 273, 14015, 2519, 25087, 13, 2434, 2934, 2640, 2471, 16246, 10792, 261, 2434, 16, 5397, 2029, 1586, 18, 16677, 67, 16560, 1360, 67, 706, 3902, 27035, 16, 5397, 446, 16, 5397, 638, 1769, 7734, 364, 261, 907, 290, 273, 2339, 18, 4285, 907, 5621, 290, 480, 446, 31, 290, 273, 2339, 18, 4285, 907, 10756, 288, 10792, 309, 261, 82, 1276, 9767, 8229, 7798, 11983, 13, 288, 13491, 9767, 8229, 7798, 11983, 272, 23617, 31, 13491, 272, 23617, 273, 261, 2885, 8229, 7798, 11983, 13, 82, 31, 13491, 2474, 1388, 3422, 273, 272, 23617, 18, 588, 26716, 2498, 5621, 13491, 727, 514, 2077, 273, 261, 780, 13, 7039, 18, 588, 2932, 2649, 8863, 13491, 514, 3770, 273, 261, 780, 13, 7039, 18, 588, 2932, 16025, 340, 8863, 13491, 309, 261, 2649, 480, 446, 597, 315, 9707, 9654, 14963, 12, 2390, 3719, 288, 18701, 804, 19984, 3616, 12958, 3568, 31, 18701, 3568, 273, 394, 804, 19984, 3616, 12958, 12, 2649, 1769, 4766, 13491, 3568, 18, 1289, 1803, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 4750, 918, 1089, 1435, 288, 5411, 4498, 518, 273, 4085, 18, 9838, 5621, 5411, 11281, 2519, 997, 273, 9804, 12971, 18, 588, 26531, 2519, 5621, 5411, 1323, 261, 305, 18, 5332, 2134, 10756, 288, 7734, 29058, 13820, 4599, 273, 261, 46, 1841, 13, 305, 18, 4285, 5621, 7734, 13820, 4599, 18, 4479, 1595, 5621, 7734, 13820, 4599, 18, 542, 1526, 12, 5743, 1769, 7734, 12569, 1114, 3568, 1114, 273, 394, 12569, 1114, 5621, 7734, 4902, 16246, 2339, 31, 7734, 2339, 273, 14015, 2519, 25087, 13, 2434, 2934, 2640, 2471, 16246, 10792, 261, 2434, 16, 5397, 2029, 1586, 18, 16677, 67, 16560, 1360, 67, 706, 3902, 27035, 16, 5397, 446, 16, 5397, 638, 1769, 7734, 364, 261, 907, 290, 2 ]
return null; } if (globalInspectionContext.isSuppressed(refEntity, getShortName())) {
public CommonProblemDescriptor[] checkElement(RefEntity refEntity, AnalysisScope analysisScope, InspectionManager inspectionManager, GlobalInspectionContext globalInspectionContext) { if (!(refEntity instanceof RefPackage)) { return null; } if (globalInspectionContext.isSuppressed(refEntity, getShortName())) { return null; } final RefPackage refPackage = (RefPackage) refEntity; int numClasses = 0; final List<RefEntity> children = refPackage.getChildren(); for (RefEntity child : children) { if(child instanceof RefClass) { numClasses++; } } if(numClasses<=limit) { return null; } final String errorString = InspectionGadgetsBundle.message("package.with.too.many.classes.problem.descriptor", refPackage.getQualifiedName(), numClasses, limit); return new CommonProblemDescriptor[]{inspectionManager.createProblemDescriptor(errorString)}; }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/35cfb92e90812fb89d3411c214b6e37d08f443fb/PackageWithTooManyClassesInspection.java/clean/plugins/InspectionGadgets/src/com/siyeh/ig/packaging/PackageWithTooManyClassesInspection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 5658, 13719, 3187, 8526, 866, 1046, 12, 1957, 1943, 1278, 1943, 16, 4766, 5375, 16318, 3876, 6285, 3876, 16, 4766, 5375, 22085, 7017, 1318, 2763, 7017, 1318, 16, 4766, 5375, 8510, 14985, 1042, 2552, 14985, 1042, 13, 288, 3639, 309, 16051, 12, 1734, 1943, 1276, 3941, 2261, 3719, 288, 5411, 327, 446, 31, 3639, 289, 3639, 309, 261, 6347, 14985, 1042, 18, 291, 3088, 10906, 12, 1734, 1943, 16, 23387, 1435, 3719, 288, 5411, 327, 446, 31, 3639, 289, 3639, 727, 3941, 2261, 1278, 2261, 273, 261, 1957, 2261, 13, 1278, 1943, 31, 3639, 509, 818, 4818, 273, 374, 31, 3639, 727, 987, 32, 1957, 1943, 34, 2325, 273, 1278, 2261, 18, 588, 4212, 5621, 3639, 364, 261, 1957, 1943, 1151, 294, 2325, 13, 288, 5411, 309, 12, 3624, 1276, 3941, 797, 13, 5411, 288, 7734, 818, 4818, 9904, 31, 5411, 289, 3639, 289, 3639, 309, 12, 2107, 4818, 32, 33, 3595, 13, 3639, 288, 5411, 327, 446, 31, 3639, 289, 3639, 727, 514, 555, 780, 273, 7734, 22085, 7017, 43, 361, 14665, 3405, 18, 2150, 2932, 5610, 18, 1918, 18, 16431, 18, 9353, 18, 4701, 18, 18968, 18, 12628, 3113, 1278, 2261, 18, 588, 12345, 9334, 818, 4818, 16, 1800, 1769, 3639, 327, 394, 5658, 13719, 3187, 63, 7073, 2679, 7017, 1318, 18, 2640, 13719, 3187, 12, 1636, 780, 16869, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 5658, 13719, 3187, 8526, 866, 1046, 12, 1957, 1943, 1278, 1943, 16, 4766, 5375, 16318, 3876, 6285, 3876, 16, 4766, 5375, 22085, 7017, 1318, 2763, 7017, 1318, 16, 4766, 5375, 8510, 14985, 1042, 2552, 14985, 1042, 13, 288, 3639, 309, 16051, 12, 1734, 1943, 1276, 3941, 2261, 3719, 288, 5411, 327, 446, 31, 3639, 289, 3639, 309, 261, 6347, 14985, 1042, 18, 291, 3088, 10906, 12, 1734, 1943, 16, 23387, 1435, 3719, 288, 5411, 327, 446, 31, 3639, 289, 3639, 727, 3941, 2261, 1278, 2261, 273, 261, 1957, 2261, 13, 1278, 1943, 31, 3639, 509, 818, 4818, 273, 374, 31, 3639, 727, 987, 32, 1957, 1943, 34, 2325, 273, 1278, 2261, 18, 588, 4212, 5621, 3639, 364, 2 ]
for (ITask task : tasks) { if (task.getHandle().equals(t.getHandle())) { tasks.remove(task); return true; } else { if (deleteTaskHelper(task.getChildren(), t)) return true; }
for (ITask task : tasks) { if (task.getHandleIdentifier().equals(t.getHandleIdentifier())) { tasks.remove(task); return true; } else { if (deleteTaskHelper(task.getChildren(), t)) return true; }
private boolean deleteTaskHelper(List<ITask> tasks, ITask t) { for (ITask task : tasks) { if (task.getHandle().equals(t.getHandle())) { tasks.remove(task); return true; } else { if (deleteTaskHelper(task.getChildren(), t)) return true; } } return false; }
51989 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51989/8bb2562e67033f820cbda60f5cf69d21ebe18834/TaskList.java/clean/org.eclipse.mylyn.tasks.ui/src/org/eclipse/mylyn/tasklist/internal/TaskList.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 1430, 2174, 2276, 12, 682, 32, 1285, 835, 34, 4592, 16, 467, 2174, 268, 13, 288, 377, 202, 1884, 261, 1285, 835, 1562, 294, 4592, 13, 288, 377, 202, 202, 430, 261, 4146, 18, 588, 3259, 7675, 14963, 12, 88, 18, 588, 3259, 1435, 3719, 288, 377, 1082, 202, 9416, 18, 4479, 12, 4146, 1769, 377, 1082, 202, 2463, 638, 31, 377, 202, 202, 97, 469, 288, 565, 9506, 202, 430, 261, 3733, 2174, 2276, 12, 4146, 18, 588, 4212, 9334, 268, 3719, 565, 6862, 202, 2463, 638, 31, 377, 202, 202, 97, 202, 202, 97, 377, 202, 2463, 629, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 1250, 1430, 2174, 2276, 12, 682, 32, 1285, 835, 34, 4592, 16, 467, 2174, 268, 13, 288, 377, 202, 1884, 261, 1285, 835, 1562, 294, 4592, 13, 288, 377, 202, 202, 430, 261, 4146, 18, 588, 3259, 7675, 14963, 12, 88, 18, 588, 3259, 1435, 3719, 288, 377, 1082, 202, 9416, 18, 4479, 12, 4146, 1769, 377, 1082, 202, 2463, 638, 31, 377, 202, 202, 97, 469, 288, 565, 9506, 202, 430, 261, 3733, 2174, 2276, 12, 4146, 18, 588, 4212, 9334, 268, 3719, 565, 6862, 202, 2463, 638, 31, 377, 202, 202, 97, 202, 202, 97, 377, 202, 2463, 629, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Asserts.isTrue(this != newNext);
assert this != newNext;
public void setNext(StackElement newNext) { Asserts.isTrue(this != newNext); this.next = (Block) newNext; }
47134 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47134/b72a2862ae5b2f01f9a767ef2ce248fd785857c4/Block.java/buggy/src/org/jruby/runtime/Block.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 27674, 12, 2624, 1046, 394, 2134, 13, 288, 3639, 1815, 333, 480, 394, 2134, 31, 3639, 333, 18, 4285, 273, 261, 1768, 13, 394, 2134, 31, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 27674, 12, 2624, 1046, 394, 2134, 13, 288, 3639, 1815, 333, 480, 394, 2134, 31, 3639, 333, 18, 4285, 273, 261, 1768, 13, 394, 2134, 31, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (qNodeName.equals("qualifier")) { Map qData = new HashMap();
if (qNodeName.equals("qualifier")) { Map qData = new HashMap();
static void loadFeatureData(String featureDataFile, Map featureData, Map qualifierData) { try { InputStream featureDataStream = EmblFileFormer.class.getClassLoader().getResourceAsStream(featureDataFile); if (featureDataStream == null) throw new BioError("Failed to find resource: " + featureDataFile); InputSource is = new InputSource(featureDataStream); DocumentBuilder parser = DocumentBuilderFactory.newInstance().newDocumentBuilder(); // Get document and then the root element Document doc = parser.parse(is); NodeList featureNodes = doc.getDocumentElement().getChildNodes(); // For nodes in root element (features) for (int i = 0; i < featureNodes.getLength(); i++) { Node featureNode = featureNodes.item(i); if (! (featureNode instanceof Element)) continue; Element feature = (Element) featureNode; String fNodeName = feature.getNodeName(); if (fNodeName.equals("feature")) { String featureKey = feature.getAttribute("key"); NodeList qualifierNodes = feature.getChildNodes(); // For nodes in each feature (qualifiers) for (int j = 0; j < qualifierNodes.getLength(); j++) { Node qualifierNode = qualifierNodes.item(j); if (! (qualifierNode instanceof Element)) continue; Element qualifier = (Element) qualifierNode; String qNodeName = qualifier.getNodeName(); if (qNodeName.equals("qualifier")) { Map qData = new HashMap(); qData.put("form", qualifier.getAttribute("form")); qData.put("mandatory", new Boolean(qualifier.getAttribute("mandatory"))); qualifierData.put(qualifier.getAttribute("name"), qData); } } featureData.put(featureKey, qualifierData.keySet()); } featureDataStream.close(); } } catch (IOException ioe) { ioe.printStackTrace(); } catch (SAXException se) { se.printStackTrace(); } catch (BioError be) { be.printStackTrace(); } catch (ParserConfigurationException ex) { ex.printStackTrace(); } }
50115 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50115/8dfcb8a9a7ad95d813441dc1c1c904bb2e267f57/AbstractGenEmblFileFormer.java/buggy/src/org/biojava/bio/seq/io/AbstractGenEmblFileFormer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 918, 1262, 4595, 751, 12, 780, 2572, 751, 812, 16, 9506, 202, 863, 565, 2572, 751, 16, 9506, 202, 863, 565, 12327, 751, 13, 565, 288, 202, 698, 202, 95, 202, 565, 5037, 2572, 751, 1228, 225, 273, 202, 202, 1514, 3083, 812, 1204, 264, 18, 1106, 18, 588, 7805, 7675, 588, 1420, 17052, 12, 7238, 751, 812, 1769, 202, 565, 309, 261, 7238, 751, 1228, 422, 446, 13, 202, 202, 12849, 394, 21209, 668, 2932, 2925, 358, 1104, 1058, 30, 315, 6862, 282, 397, 2572, 751, 812, 1769, 202, 565, 23699, 282, 353, 273, 394, 23699, 12, 7238, 751, 1228, 1769, 202, 565, 4319, 1263, 2082, 273, 30236, 18, 2704, 1442, 7675, 2704, 2519, 1263, 5621, 202, 565, 368, 968, 1668, 471, 1508, 326, 1365, 930, 202, 565, 4319, 997, 1850, 273, 2082, 18, 2670, 12, 291, 1769, 202, 565, 16781, 2572, 3205, 273, 997, 18, 588, 2519, 1046, 7675, 588, 22460, 5621, 202, 565, 368, 2457, 2199, 316, 1365, 930, 261, 7139, 13, 202, 565, 364, 261, 474, 277, 273, 374, 31, 277, 411, 2572, 3205, 18, 588, 1782, 5621, 277, 27245, 202, 565, 288, 202, 202, 907, 2572, 907, 273, 2572, 3205, 18, 1726, 12, 77, 1769, 202, 202, 430, 16051, 261, 7238, 907, 1276, 3010, 3719, 1082, 565, 1324, 31, 202, 202, 1046, 225, 2572, 273, 261, 1046, 13, 2572, 907, 31, 202, 202, 780, 284, 18948, 273, 2572, 18, 588, 18948, 5621, 202, 202, 430, 261, 74, 18948, 18, 14963, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 760, 918, 1262, 4595, 751, 12, 780, 2572, 751, 812, 16, 9506, 202, 863, 565, 2572, 751, 16, 9506, 202, 863, 565, 12327, 751, 13, 565, 288, 202, 698, 202, 95, 202, 565, 5037, 2572, 751, 1228, 225, 273, 202, 202, 1514, 3083, 812, 1204, 264, 18, 1106, 18, 588, 7805, 7675, 588, 1420, 17052, 12, 7238, 751, 812, 1769, 202, 565, 309, 261, 7238, 751, 1228, 422, 446, 13, 202, 202, 12849, 394, 21209, 668, 2932, 2925, 358, 1104, 1058, 30, 315, 6862, 282, 397, 2572, 751, 812, 1769, 202, 565, 23699, 282, 353, 273, 394, 23699, 12, 7238, 751, 1228, 1769, 202, 565, 4319, 1263, 2082, 273, 30236, 18, 2704, 1442, 7675, 2704, 2519, 1263, 5621, 2 ]
if ( (outputArray[i]==2) || (outputArray[i]==3) ||(outputArray[i]==16) )
if ( (outputArray[i]==2) || (outputArray[i]==3) ||(outputArray[i]==16) )
public SerialMessage createOutPacket() { // Count the number of DLE's to be inserted int nOutBytes = numOutputCards() * (bitsPerCard/8); int nDLE = 0; for (int i=0; i<nOutBytes; i++) { if ( (outputArray[i]==2) || (outputArray[i]==3) ||(outputArray[i]==16) ) nDLE ++; } // Create a Serial message and add initial bytes SerialMessage m = new SerialMessage(nOutBytes + nDLE + 2); m.setElement(0,nodeAddress+65); // node address m.setElement(1,84); // 'T' // Add output bytes int k = 2; for (int i=0; i<nOutBytes; i++) { // perform C/MRI required DLE processing if ( (outputArray[i]==2) || (outputArray[i]==3) ||(outputArray[i]==16) ) { m.setElement(k,16); // DLE k ++; } // add output byte m.setElement(k, outputArray[i]); k ++; } return m; }
2652 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2652/0e88aee0db365025f01e28eeccebf419ffaa4686/SerialNode.java/buggy/jmri/jmrix/cmri/serial/SerialNode.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 7366, 1079, 752, 1182, 6667, 1435, 288, 3639, 368, 6974, 326, 1300, 434, 463, 900, 1807, 358, 506, 9564, 3639, 509, 290, 1182, 2160, 273, 818, 1447, 30492, 1435, 380, 261, 6789, 2173, 6415, 19, 28, 1769, 3639, 509, 290, 40, 900, 273, 374, 31, 3639, 364, 261, 474, 277, 33, 20, 31, 277, 32, 82, 1182, 2160, 31, 277, 27245, 288, 5411, 309, 261, 261, 2844, 1076, 63, 77, 65, 631, 22, 13, 747, 261, 2844, 1076, 63, 77, 65, 631, 23, 13, 747, 12, 2844, 1076, 63, 77, 65, 631, 2313, 13, 262, 1171, 290, 40, 900, 965, 31, 3639, 289, 3639, 368, 1788, 279, 7366, 883, 471, 527, 2172, 1731, 3639, 7366, 1079, 312, 273, 394, 7366, 1079, 12, 82, 1182, 2160, 397, 290, 40, 900, 397, 576, 1769, 3639, 312, 18, 542, 1046, 12, 20, 16, 2159, 1887, 15, 9222, 1769, 368, 756, 1758, 3639, 312, 18, 542, 1046, 12, 21, 16, 5193, 1769, 2398, 368, 296, 56, 11, 3639, 368, 1436, 876, 1731, 3639, 509, 417, 273, 576, 31, 3639, 364, 261, 474, 277, 33, 20, 31, 277, 32, 82, 1182, 2160, 31, 277, 27245, 288, 5411, 368, 3073, 385, 19, 49, 2259, 1931, 463, 900, 4929, 5411, 309, 261, 261, 2844, 1076, 63, 77, 65, 631, 22, 13, 747, 261, 2844, 1076, 63, 77, 65, 631, 23, 13, 747, 12, 2844, 1076, 63, 77, 65, 631, 2313, 13, 262, 288, 7734, 312, 18, 542, 1046, 12, 79, 16, 2313, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 7366, 1079, 752, 1182, 6667, 1435, 288, 3639, 368, 6974, 326, 1300, 434, 463, 900, 1807, 358, 506, 9564, 3639, 509, 290, 1182, 2160, 273, 818, 1447, 30492, 1435, 380, 261, 6789, 2173, 6415, 19, 28, 1769, 3639, 509, 290, 40, 900, 273, 374, 31, 3639, 364, 261, 474, 277, 33, 20, 31, 277, 32, 82, 1182, 2160, 31, 277, 27245, 288, 5411, 309, 261, 261, 2844, 1076, 63, 77, 65, 631, 22, 13, 747, 261, 2844, 1076, 63, 77, 65, 631, 23, 13, 747, 12, 2844, 1076, 63, 77, 65, 631, 2313, 13, 262, 1171, 290, 40, 900, 965, 31, 3639, 289, 3639, 368, 1788, 279, 7366, 883, 471, 527, 2172, 1731, 3639, 7366, 1079, 312, 2 ]
if (_canContainAttribute(name, namespace, groupTag)) return true;
if (_canContainAttribute(name, namespace, groupTag,visited)) return true;
private boolean _canContainAttribute(String name, String namespace, XmlTag tag) { if (XmlNSDescriptorImpl.equalsToSchemaName(tag, "anyAttribute")) { String ns = tag.getAttributeValue("namespace"); if ("##other".equals(ns)) { return !namespace.equals(myDocumentDescriptor.getDefaultNamespace()); } return true; } else if (XmlNSDescriptorImpl.equalsToSchemaName(tag, "attributeGroup")) { String ref = tag.getAttributeValue("ref"); if (ref != null) { XmlTag groupTag = myDocumentDescriptor.findGroup(ref); if (groupTag != null) { if (_canContainAttribute(name, namespace, groupTag)) return true; } } } else if (XmlNSDescriptorImpl.equalsToSchemaName(tag, "restriction") || XmlNSDescriptorImpl.equalsToSchemaName(tag, "extension")) { String base = tag.getAttributeValue("base"); if (base != null) { TypeDescriptor descriptor = myDocumentDescriptor.findTypeDescriptor( myDocumentDescriptor.myFile.getDocument().getRootTag(), base); if (descriptor instanceof ComplexTypeDescriptor) { ComplexTypeDescriptor complexTypeDescriptor = (ComplexTypeDescriptor)descriptor; if (complexTypeDescriptor.canContainAttribute(name, namespace)) return true; } } } XmlTag[] subTags = tag.getSubTags(); for (int i = 0; i < subTags.length; i++) { XmlTag subTag = subTags[i]; if (_canContainAttribute(name, namespace, subTag)) return true; } return false; }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/93f24e478a2a8f468fb3738aa8544716a48b46bf/ComplexTypeDescriptor.java/buggy/source/com/intellij/xml/impl/schema/ComplexTypeDescriptor.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 1250, 389, 4169, 22928, 1499, 12, 780, 508, 16, 514, 1981, 16, 5714, 1805, 1047, 13, 288, 565, 309, 261, 4432, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 2273, 1499, 6, 3719, 288, 1377, 514, 3153, 273, 1047, 18, 588, 14942, 2932, 4937, 8863, 1377, 309, 7566, 1189, 3011, 9654, 14963, 12, 2387, 3719, 288, 3639, 327, 401, 4937, 18, 14963, 12, 4811, 2519, 3187, 18, 588, 1868, 3402, 10663, 1377, 289, 1377, 327, 638, 31, 565, 289, 565, 469, 309, 261, 4432, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 4589, 1114, 6, 3719, 288, 1377, 514, 1278, 273, 1047, 18, 588, 14942, 2932, 1734, 8863, 1377, 309, 261, 1734, 480, 446, 13, 288, 3639, 5714, 1805, 1041, 1805, 273, 3399, 2519, 3187, 18, 4720, 1114, 12, 1734, 1769, 3639, 309, 261, 1655, 1805, 480, 446, 13, 288, 1850, 309, 261, 67, 4169, 22928, 1499, 12, 529, 16, 1981, 16, 1041, 1805, 16, 30129, 3719, 327, 638, 31, 3639, 289, 1377, 289, 565, 289, 565, 469, 309, 261, 4432, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 23954, 7923, 747, 1377, 5714, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 6447, 6, 3719, 288, 1377, 514, 1026, 273, 1047, 18, 588, 14942, 2932, 1969, 8863, 1377, 309, 261, 1969, 480, 446, 13, 288, 3639, 1412, 3187, 4950, 273, 3399, 2519, 3187, 18, 4720, 559, 3187, 12, 1850, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 1250, 389, 4169, 22928, 1499, 12, 780, 508, 16, 514, 1981, 16, 5714, 1805, 1047, 13, 288, 565, 309, 261, 4432, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 2273, 1499, 6, 3719, 288, 1377, 514, 3153, 273, 1047, 18, 588, 14942, 2932, 4937, 8863, 1377, 309, 7566, 1189, 3011, 9654, 14963, 12, 2387, 3719, 288, 3639, 327, 401, 4937, 18, 14963, 12, 4811, 2519, 3187, 18, 588, 1868, 3402, 10663, 1377, 289, 1377, 327, 638, 31, 565, 289, 565, 469, 309, 261, 4432, 3156, 3187, 2828, 18, 14963, 774, 3078, 461, 12, 2692, 16, 315, 4589, 1114, 6, 3719, 288, 1377, 514, 1278, 273, 1047, 18, 588, 14942, 2932, 1734, 8863, 1377, 2 ]
runInterpreterOnFile(args[0]);
runInterpreterOnFile(args[i]);
public static void main (String args[]) { System.out.println(); System.out.println("----------------------------------------------------"); System.out.println("--- WARNING this is an ALPHA version of JRuby!!! ---"); System.out.println("----------------------------------------------------"); System.out.println(); if (args.length == 0) { printUsage(); } else { int lenArg = args.length; for (int i = 0; i < lenArg; i++) { if (args[i].equals("-h") || args[i].equals("-help")) { printUsage(); } else if (args[i].equals("-e")) { if (i++ >= lenArg) { System.err.println("invalid argument " + i); System.err.println(" -e must be followed by an expression to evaluate"); printUsage(); } else { runInterpreter(args[i], "command line " + i); } } else { runInterpreterOnFile(args[0]); } } } }
45753 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45753/03950522a75c28f406bd4cb011cb1916a662366d/Main.java/clean/org/jruby/Main.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 261, 780, 833, 63, 5717, 288, 3639, 2332, 18, 659, 18, 8222, 5621, 3639, 2332, 18, 659, 18, 8222, 2932, 9634, 553, 8863, 3639, 2332, 18, 659, 18, 8222, 2932, 6062, 9744, 333, 353, 392, 29432, 37, 1177, 434, 27974, 10340, 25885, 9948, 8863, 3639, 2332, 18, 659, 18, 8222, 2932, 9634, 553, 8863, 3639, 2332, 18, 659, 18, 8222, 5621, 7734, 309, 261, 1968, 18, 2469, 422, 374, 13, 288, 5411, 1172, 5357, 5621, 3639, 289, 469, 288, 5411, 509, 562, 4117, 273, 833, 18, 2469, 31, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 411, 562, 4117, 31, 277, 27245, 288, 7734, 309, 261, 1968, 63, 77, 8009, 14963, 2932, 17, 76, 7923, 747, 833, 63, 77, 8009, 14963, 2932, 17, 5201, 6, 3719, 288, 10792, 1172, 5357, 5621, 7734, 289, 469, 309, 261, 1968, 63, 77, 8009, 14963, 2932, 17, 73, 6, 3719, 288, 10792, 309, 261, 77, 9904, 1545, 562, 4117, 13, 288, 13491, 2332, 18, 370, 18, 8222, 2932, 5387, 1237, 315, 397, 277, 1769, 13491, 2332, 18, 370, 18, 8222, 2932, 300, 73, 1297, 506, 10860, 635, 392, 2652, 358, 5956, 8863, 13491, 1172, 5357, 5621, 10792, 289, 469, 288, 13491, 1086, 30010, 12, 1968, 63, 77, 6487, 315, 3076, 980, 315, 397, 277, 1769, 10792, 289, 7734, 289, 469, 288, 10792, 1086, 30010, 1398, 812, 12, 1968, 63, 77, 19226, 7734, 289, 5411, 289, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 760, 918, 2774, 261, 780, 833, 63, 5717, 288, 3639, 2332, 18, 659, 18, 8222, 5621, 3639, 2332, 18, 659, 18, 8222, 2932, 9634, 553, 8863, 3639, 2332, 18, 659, 18, 8222, 2932, 6062, 9744, 333, 353, 392, 29432, 37, 1177, 434, 27974, 10340, 25885, 9948, 8863, 3639, 2332, 18, 659, 18, 8222, 2932, 9634, 553, 8863, 3639, 2332, 18, 659, 18, 8222, 5621, 7734, 309, 261, 1968, 18, 2469, 422, 374, 13, 288, 5411, 1172, 5357, 5621, 3639, 289, 469, 288, 5411, 509, 562, 4117, 273, 833, 18, 2469, 31, 5411, 364, 261, 474, 277, 273, 374, 31, 277, 411, 562, 4117, 31, 277, 27245, 288, 7734, 309, 261, 1968, 63, 77, 8009, 14963, 2932, 17, 2 ]
assertTrue(smiles3.equals("[H][C@]12(CC(O)[C@](O)(C)[C@]3(O)(C(O)CC(C)[C@]3([C@]2([C@]1(C)(C))([H]))([H])))"));
public void testSmilesGenerator() { SmilesGenerator sg = new SmilesGenerator(); Molecule mol1 = MoleculeFactory.makeEthylPropylPhenantren(); Molecule mol2 = MoleculeFactory.makeAlphaPinene(); Molecule mol3=null; try{ String tillsmol="\n Marvin 07230205422D\n\n 22 24 0 0 0 0 0 0 0 0999 V2000\n 9.1628 -4.1392 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.0889 -4.9609 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.8475 -5.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3904 -4.6639 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.9671 -3.9556 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.3251 -3.2122 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.9671 -2.4690 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.1628 -2.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5178 -2.7999 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5178 -3.6249 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.7899 -2.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5096 -2.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n11.1000 -1.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7744 -3.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0155 -4.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7492 -3.8213 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0868 -3.2791 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0900 -1.6532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7819 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5501 -3.3171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2711 -4.3697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3877 -5.3798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 15 1 6 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 1 1 0 0 0 0\n 10 14 1 6 0 0 0\n 11 6 1 0 0 0 0\n 11 7 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 13 1 1 0 0 0\n 5 16 1 1 0 0 0\n 6 17 1 6 0 0 0\n 7 18 1 6 0 0 0\n 9 19 1 1 0 0 0\n 10 20 1 1 0 0 0\n 1 21 1 6 0 0 0\n 2 22 1 1 0 0 0\nM END"; MDLReader mdlreader = new MDLReader(new StringReader(tillsmol)); mol3 = (Molecule) mdlreader.read(new Molecule()); } catch(Exception ex){ ex.printStackTrace(); } fixCarbonHCount(mol2); fixCarbonHCount(mol1); String smiles1 = null, smiles2 = null, smiles3 = null; if (standAlone) display(mol2); try { smiles1 = sg.createSMILES(mol1); smiles2 = sg.createSMILES(mol2); smiles3 = sg.createSMILES(mol3,true,true); } catch(Exception exc) { System.out.println(exc); } if (standAlone) System.err.println("SMILES 1: " + smiles1); if (standAlone) System.err.println("SMILES 2: " + smiles2); if (standAlone) System.err.println("SMILES 3: " + smiles3); assertTrue(smiles1.equals("c2cc1c3ccc(cc3ccc1c(c2)CC)CCC")); assertTrue(smiles2.equals("C1=C(C)C2CC(C1)C2(C)(C)")); assertTrue(smiles3.equals("[H][C@]12(CC(O)[C@](O)(C)[C@]3(O)(C(O)CC(C)[C@]3([C@]2([C@]1(C)(C))([H]))([H])))")); }
45254 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45254/3d447e83897efc5981ad5bd727a15920e5db7572/SmilesGeneratorTest.java/clean/src/org/openscience/cdk/test/smiles/SmilesGeneratorTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9552, 1449, 3908, 1435, 202, 95, 202, 202, 9552, 1449, 3908, 11150, 273, 394, 9425, 1449, 3908, 5621, 202, 202, 29669, 12629, 21, 273, 490, 10545, 1733, 18, 6540, 41, 451, 93, 80, 626, 2074, 80, 3731, 6602, 1187, 5621, 202, 202, 29669, 12629, 22, 273, 490, 10545, 1733, 18, 6540, 9690, 12178, 4009, 5621, 565, 490, 10545, 12629, 23, 33, 2011, 31, 565, 775, 95, 1377, 514, 21364, 4808, 355, 1546, 64, 82, 225, 490, 297, 21529, 225, 10934, 4366, 3103, 6260, 24, 3787, 40, 64, 82, 64, 82, 11201, 4248, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 11984, 776, 17172, 64, 82, 565, 2468, 18, 2313, 6030, 282, 300, 24, 18, 3437, 9975, 565, 374, 18, 2787, 385, 282, 374, 225, 374, 225, 576, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 64, 82, 565, 2468, 18, 20, 5482, 29, 282, 300, 24, 18, 29, 4848, 29, 565, 374, 18, 2787, 385, 282, 374, 225, 374, 225, 404, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 64, 82, 565, 2468, 18, 5193, 5877, 282, 300, 25, 18, 6030, 9401, 565, 374, 18, 2787, 385, 282, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 64, 82, 282, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 9552, 1449, 3908, 1435, 202, 95, 202, 202, 9552, 1449, 3908, 11150, 273, 394, 9425, 1449, 3908, 5621, 202, 202, 29669, 12629, 21, 273, 490, 10545, 1733, 18, 6540, 41, 451, 93, 80, 626, 2074, 80, 3731, 6602, 1187, 5621, 202, 202, 29669, 12629, 22, 273, 490, 10545, 1733, 18, 6540, 9690, 12178, 4009, 5621, 565, 490, 10545, 12629, 23, 33, 2011, 31, 565, 775, 95, 1377, 514, 21364, 4808, 355, 1546, 64, 82, 225, 490, 297, 21529, 225, 10934, 4366, 3103, 6260, 24, 3787, 40, 64, 82, 64, 82, 11201, 4248, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 225, 374, 11984, 776, 17172, 64, 82, 565, 2 ]
BooleanWrapper bw = (BooleanWrapper)fileTransferDeployedStatus.get(node.getNodeInformation().getName()); if(bw !=null) bw.booleanValue();
public Node getNode() throws NodeException { //try first to get the Node from the createdNodes array to be continued Node node; waitForNodeCreation(); if (!createdNodes.isEmpty()) { node = (Node) createdNodes.get(lastNodeIndex); increaseNodeIndex(); return node; } else { throw new NodeException("Cannot get the node " + this.name); } }
50951 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50951/efad12ff223250b786d8e78eee36a4cdbeaad898/VirtualNodeImpl.java/buggy/src/org/objectweb/proactive/core/descriptor/data/VirtualNodeImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 1071, 225, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 2029, 225, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 5973, 1435, 225, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 31954, 1482, 18, 588, 12, 2159, 18, 588, 907, 5369, 7675, 17994, 10663, 309, 12, 70, 91, 480, 2011, 13, 12986, 18, 6494, 620, 5621, 282, 3411, 3611, 12986, 273, 261, 5507, 3611, 13, 768, 5912, 2 ]
this.loginTimeout = loginTimeout;
this.loginTimeout = String.valueOf(loginTimeout);
public void setLoginTimeout(int loginTimeout) throws SQLException { this.loginTimeout = loginTimeout; }
439 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/439/46ef66accff537de298be9d3a92c4b9b3690cc5d/JtdsDataSource.java/buggy/trunk/jtds/src/main/net/sourceforge/jtds/jdbcx/JtdsDataSource.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 444, 5358, 2694, 12, 474, 3925, 2694, 13, 1216, 6483, 288, 3639, 333, 18, 5819, 2694, 273, 514, 18, 1132, 951, 12, 5819, 2694, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 444, 5358, 2694, 12, 474, 3925, 2694, 13, 1216, 6483, 288, 3639, 333, 18, 5819, 2694, 273, 514, 18, 1132, 951, 12, 5819, 2694, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (model.isArmed() && model.isPressed())
if ((model.isArmed() && model.isPressed()) || (comboBox.isFocusOwner() && !comboBox.isPopupVisible()))
public void paintComponent(Graphics g) { super.paintComponent(g); Insets insets = this.getInsets(); int w = getWidth() - (insets.left + insets.right); int h = getHeight() - (insets.top + insets.bottom); if (h > 0 && w > 0) { int x1 = insets.left; int y1 = insets.top; int x2 = x1 + (w - 1); int y2 = y1 + (h - 1); int iconWidth = 0; int iconX = x2; if (comboIcon != null) { iconWidth = comboIcon.getIconWidth(); int iconHeight = comboIcon.getIconHeight(); int iconY; if (iconOnly) { iconX = getWidth() / 2 - iconWidth / 2; iconY = getHeight() / 2 - iconHeight / 2; } else { iconX = x1 + (w - 1) - iconWidth; iconY = y1 + (y2 - y1) / 2 - iconHeight / 2; } comboIcon.paintIcon(this, g, iconX, iconY); if (this.hasFocus()) { g.setColor(MetalLookAndFeel.getFocusColor()); g.drawRect(x1 - 1, y1 - 1, w + 3, h + 1); } } if (! iconOnly && comboBox != null) { ListCellRenderer renderer = comboBox.getRenderer(); boolean pressed = this.getModel().isPressed(); Component comp = renderer.getListCellRendererComponent(listBox, comboBox.getSelectedItem(), -1, false, false); comp.setFont(rendererPane.getFont()); if (model.isArmed() && model.isPressed()) { if (isOpaque()) { comp.setBackground(UIManager.getColor("Button.select")); comp.setForeground(comboBox.getForeground()); } } else if (! comboBox.isEnabled()) { if (this.isOpaque()) { Color dbg = UIManager.getColor("ComboBox.disabledBackground"); comp.setBackground(dbg); Color dfg = UIManager.getColor("ComboBox.disabledForeground"); comp.setForeground(dfg); } } else { comp.setForeground(comboBox.getForeground()); comp.setBackground(comboBox.getBackground()); } int wr = w - (insets.right + iconWidth); rendererPane.paintComponent(g, comp, this, x1, y1, wr, h); } } }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/ff4d557efcee4a2c3a25a9cac2252bc626fb10fe/MetalComboBoxButton.java/buggy/core/src/classpath/javax/javax/swing/plaf/metal/MetalComboBoxButton.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 12574, 1841, 12, 17558, 314, 13, 225, 288, 565, 2240, 18, 84, 1598, 1841, 12, 75, 1769, 565, 22300, 23576, 273, 333, 18, 588, 382, 4424, 5621, 565, 509, 341, 273, 8557, 1435, 300, 261, 267, 4424, 18, 4482, 397, 23576, 18, 4083, 1769, 565, 509, 366, 273, 9263, 1435, 300, 261, 267, 4424, 18, 3669, 397, 23576, 18, 9176, 1769, 565, 309, 261, 76, 405, 374, 597, 341, 405, 374, 13, 1377, 288, 3639, 509, 619, 21, 273, 23576, 18, 4482, 31, 3639, 509, 677, 21, 273, 23576, 18, 3669, 31, 3639, 509, 619, 22, 273, 619, 21, 397, 261, 91, 300, 404, 1769, 3639, 509, 677, 22, 273, 677, 21, 397, 261, 76, 300, 404, 1769, 3639, 509, 4126, 2384, 273, 374, 31, 3639, 509, 4126, 60, 273, 619, 22, 31, 3639, 309, 261, 25053, 5554, 480, 446, 13, 1850, 288, 5411, 4126, 2384, 273, 16778, 5554, 18, 588, 5554, 2384, 5621, 5411, 509, 4126, 2686, 273, 16778, 5554, 18, 588, 5554, 2686, 5621, 5411, 509, 4126, 61, 31, 565, 309, 261, 3950, 3386, 13, 1377, 288, 7734, 4126, 60, 273, 8557, 1435, 342, 576, 300, 4126, 2384, 342, 576, 31, 7734, 4126, 61, 273, 9263, 1435, 342, 576, 300, 4126, 2686, 342, 576, 31, 1377, 289, 565, 469, 1377, 288, 7734, 4126, 60, 273, 619, 21, 397, 261, 91, 300, 404, 13, 300, 4126, 2384, 31, 7734, 4126, 61, 273, 677, 21, 397, 261, 93, 22, 300, 677, 21, 13, 342, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 12574, 1841, 12, 17558, 314, 13, 225, 288, 565, 2240, 18, 84, 1598, 1841, 12, 75, 1769, 565, 22300, 23576, 273, 333, 18, 588, 382, 4424, 5621, 565, 509, 341, 273, 8557, 1435, 300, 261, 267, 4424, 18, 4482, 397, 23576, 18, 4083, 1769, 565, 509, 366, 273, 9263, 1435, 300, 261, 267, 4424, 18, 3669, 397, 23576, 18, 9176, 1769, 565, 309, 261, 76, 405, 374, 597, 341, 405, 374, 13, 1377, 288, 3639, 509, 619, 21, 273, 23576, 18, 4482, 31, 3639, 509, 677, 21, 273, 23576, 18, 3669, 31, 3639, 509, 619, 22, 273, 619, 21, 397, 261, 91, 300, 404, 1769, 3639, 509, 677, 22, 273, 677, 21, 397, 261, 76, 300, 2 ]
public void mTokens() throws RecognitionException { // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:10: ( T15 | T16 | T17 | T18 | T19 | T20 | T21 | T22 | T23 | T24 | T25 | T26 | T27 | T28 | T29 | T30 | T31 | T32 | T33 | T34 | T35 | T36 | T37 | T38 | T39 | T40 | T41 | T42 | T43 | T44 | T45 | T46 | T47 | T48 | T49 | T50 | T51 | T52 | T53 | T54 | T55 | T56 | MISC | WS | EOL | INT | FLOAT | STRING | BOOL | ID | SH_STYLE_SINGLE_LINE_COMMENT | C_STYLE_SINGLE_LINE_COMMENT | MULTI_LINE_COMMENT ) int alt15=53; alt15 = dfa15.predict(input); if (failed) return ; switch (alt15) { case 1 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:10: T15 { mT15(); if (failed) return ; } break; case 2 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:14: T16 { mT16(); if (failed) return ; } break; case 3 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:18: T17 { mT17(); if (failed) return ; } break; case 4 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:22: T18 { mT18(); if (failed) return ; } break; case 5 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:26: T19 { mT19(); if (failed) return ; } break; case 6 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:30: T20 { mT20(); if (failed) return ; } break; case 7 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:34: T21 { mT21(); if (failed) return ; } break; case 8 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:38: T22 { mT22(); if (failed) return ; } break; case 9 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:42: T23 { mT23(); if (failed) return ; } break; case 10 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:46: T24 { mT24(); if (failed) return ; } break; case 11 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:50: T25 { mT25(); if (failed) return ; } break; case 12 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:54: T26 { mT26(); if (failed) return ; } break; case 13 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:58: T27 { mT27(); if (failed) return ; } break; case 14 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:62: T28 { mT28(); if (failed) return ; } break; case 15 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:66: T29 { mT29(); if (failed) return ; } break; case 16 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:70: T30 { mT30(); if (failed) return ; } break; case 17 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:74: T31 { mT31(); if (failed) return ; } break; case 18 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:78: T32 { mT32(); if (failed) return ; } break; case 19 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:82: T33 { mT33(); if (failed) return ; } break; case 20 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:86: T34 { mT34(); if (failed) return ; } break; case 21 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:90: T35 { mT35(); if (failed) return ; } break; case 22 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:94: T36 { mT36(); if (failed) return ; } break; case 23 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:98: T37 { mT37(); if (failed) return ; } break; case 24 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:102: T38 { mT38(); if (failed) return ; } break; case 25 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:106: T39 { mT39(); if (failed) return ; } break; case 26 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:110: T40 { mT40(); if (failed) return ; } break; case 27 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:114: T41 { mT41(); if (failed) return ; } break; case 28 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:118: T42 { mT42(); if (failed) return ; } break; case 29 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:122: T43 { mT43(); if (failed) return ; } break; case 30 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:126: T44 { mT44(); if (failed) return ; } break; case 31 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:130: T45 { mT45(); if (failed) return ; } break; case 32 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:134: T46 { mT46(); if (failed) return ; } break; case 33 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:138: T47 { mT47(); if (failed) return ; } break; case 34 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:142: T48 { mT48(); if (failed) return ; } break; case 35 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:146: T49 { mT49(); if (failed) return ; } break; case 36 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:150: T50 { mT50(); if (failed) return ; } break; case 37 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:154: T51 { mT51(); if (failed) return ; } break; case 38 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:158: T52 { mT52(); if (failed) return ; } break; case 39 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:162: T53 { mT53(); if (failed) return ; } break; case 40 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:166: T54 { mT54(); if (failed) return ; } break; case 41 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:170: T55 { mT55(); if (failed) return ; } break; case 42 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:174: T56 { mT56(); if (failed) return ; } break; case 43 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:178: MISC { mMISC(); if (failed) return ; } break; case 44 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:183: WS { mWS(); if (failed) return ; } break; case 45 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:186: EOL { mEOL(); if (failed) return ; } break; case 46 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:190: INT { mINT(); if (failed) return ; } break; case 47 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:194: FLOAT { mFLOAT(); if (failed) return ; } break; case 48 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:200: STRING { mSTRING(); if (failed) return ; } break; case 49 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:207: BOOL { mBOOL(); if (failed) return ; } break; case 50 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:212: ID { mID(); if (failed) return ; } break; case 51 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:215: SH_STYLE_SINGLE_LINE_COMMENT { mSH_STYLE_SINGLE_LINE_COMMENT(); if (failed) return ; } break; case 52 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:244: C_STYLE_SINGLE_LINE_COMMENT { mC_STYLE_SINGLE_LINE_COMMENT(); if (failed) return ; } break; case 53 : // C:\Projects\jboss-rules-new\drools-compiler\src\main\resources\org\drools\lang\drl.g:1:272: MULTI_LINE_COMMENT { mMULTI_LINE_COMMENT(); if (failed) return ; } break; } }
5490 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5490/bf3305a89ef5e916acbab744c38aaaec83bf67ff/RuleParserLexer.java/buggy/drools-compiler/src/main/java/org/drools/lang/RuleParserLexer.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 5157, 1435, 1216, 9539, 288, 3639, 368, 385, 5581, 15298, 64, 10649, 8464, 17, 7482, 17, 2704, 64, 12215, 17, 9576, 64, 4816, 64, 5254, 64, 4683, 64, 3341, 64, 12215, 64, 4936, 64, 72, 1321, 18, 75, 30, 21, 30, 2163, 30, 261, 399, 3600, 571, 399, 2313, 571, 399, 4033, 571, 399, 2643, 571, 399, 3657, 571, 399, 3462, 571, 399, 5340, 571, 399, 3787, 571, 399, 4366, 571, 399, 3247, 571, 399, 2947, 571, 399, 5558, 571, 399, 5324, 571, 399, 6030, 571, 399, 5540, 571, 399, 5082, 571, 399, 6938, 571, 399, 1578, 571, 399, 3707, 571, 399, 5026, 571, 399, 4763, 571, 399, 5718, 571, 399, 6418, 571, 399, 7414, 571, 399, 5520, 571, 399, 7132, 571, 399, 9803, 571, 399, 9452, 571, 399, 8942, 571, 399, 6334, 571, 399, 7950, 571, 399, 8749, 571, 399, 9462, 571, 399, 8875, 571, 399, 7616, 571, 399, 3361, 571, 399, 10593, 571, 399, 9401, 571, 399, 8643, 571, 399, 6564, 571, 399, 2539, 571, 399, 4313, 571, 20806, 2312, 571, 7649, 571, 19995, 571, 6137, 571, 15483, 571, 9469, 571, 9784, 1741, 571, 1599, 571, 6122, 67, 15066, 67, 20184, 67, 5997, 67, 12200, 571, 385, 67, 15066, 67, 20184, 67, 5997, 67, 12200, 571, 27125, 67, 5997, 67, 12200, 262, 3639, 509, 3770, 3600, 33, 8643, 31, 3639, 3770, 3600, 273, 23074, 3600, 18, 14491, 12, 2630, 1769, 309, 261, 7307, 13, 327, 274, 3639, 1620, 261, 2390, 3600, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 312, 5157, 1435, 1216, 9539, 288, 3639, 368, 385, 5581, 15298, 64, 10649, 8464, 17, 7482, 17, 2704, 64, 12215, 17, 9576, 64, 4816, 64, 5254, 64, 4683, 64, 3341, 64, 12215, 64, 4936, 64, 72, 1321, 18, 75, 30, 21, 30, 2163, 30, 261, 399, 3600, 571, 399, 2313, 571, 399, 4033, 571, 399, 2643, 571, 399, 3657, 571, 399, 3462, 571, 399, 5340, 571, 399, 3787, 571, 399, 4366, 571, 399, 3247, 571, 399, 2947, 571, 399, 5558, 571, 399, 5324, 571, 399, 6030, 571, 399, 5540, 571, 399, 5082, 571, 399, 6938, 571, 399, 1578, 571, 399, 3707, 571, 399, 5026, 571, 399, 4763, 571, 399, 5718, 571, 399, 6418, 571, 399, 7414, 2 ]
setEnabled(false);
if (!enabled) return; this.enabled = false; if (peer != null) ((MenuItemPeer) peer).setEnabled (false);
disable(){ setEnabled(false);}
45163 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45163/3fe1c14284ce32b79d0e66441aec6a45a77ff684/MenuItem.java/clean/libjava/java/awt/MenuItem.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4056, 1435, 95, 225, 12888, 12, 5743, 1769, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 4056, 1435, 95, 225, 12888, 12, 5743, 1769, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return new ChemFile();
return new DebugChemFile();
public org.openscience.cdk.interfaces.IChemFile newChemFile() { return new ChemFile(); }
46046 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/46046/a6318b3c903d5db8b6bc699fc60e65d7d3afeae6/DebugChemObjectBuilder.java/clean/src/org/openscience/cdk/debug/DebugChemObjectBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2358, 18, 20346, 71, 6254, 18, 71, 2883, 18, 15898, 18, 45, 20200, 812, 394, 20200, 812, 1435, 288, 202, 202, 2463, 394, 26542, 812, 5621, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 2358, 18, 20346, 71, 6254, 18, 71, 2883, 18, 15898, 18, 45, 20200, 812, 394, 20200, 812, 1435, 288, 202, 202, 2463, 394, 26542, 812, 5621, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return s;
return typeClassName.substring(typeClassName.lastIndexOf(".")+1, typeClassName.length());
private String getShortTypeName(String typeClassName){ if (typeClassName.endsWith("[]")){ typeClassName = typeClassName.substring(0,typeClassName.lastIndexOf("[")); } String s = typeClassName.substring(typeClassName.lastIndexOf(".")+1, typeClassName.length()); return s; }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/e8f5c7d7855abf207dc29d6fece4c8d279a920ed/JavaBeanWriter.java/clean/modules/codegen/src/org/apache/axis2/schema/writer/JavaBeanWriter.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 514, 13157, 7947, 12, 780, 618, 3834, 15329, 3639, 309, 261, 723, 3834, 18, 5839, 1190, 2932, 63, 4279, 3719, 95, 5411, 618, 3834, 273, 618, 3834, 18, 28023, 12, 20, 16, 723, 3834, 18, 2722, 31985, 2932, 63, 7923, 1769, 3639, 289, 3639, 514, 272, 273, 618, 3834, 18, 28023, 12, 723, 3834, 18, 2722, 31985, 2932, 1199, 27921, 21, 16, 618, 3834, 18, 2469, 10663, 3639, 327, 618, 3834, 18, 28023, 12, 723, 3834, 18, 2722, 31985, 2932, 1199, 27921, 21, 16, 618, 3834, 18, 2469, 10663, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 514, 13157, 7947, 12, 780, 618, 3834, 15329, 3639, 309, 261, 723, 3834, 18, 5839, 1190, 2932, 63, 4279, 3719, 95, 5411, 618, 3834, 273, 618, 3834, 18, 28023, 12, 20, 16, 723, 3834, 18, 2722, 31985, 2932, 63, 7923, 1769, 3639, 289, 3639, 514, 272, 273, 618, 3834, 18, 28023, 12, 723, 3834, 18, 2722, 31985, 2932, 1199, 27921, 21, 16, 618, 3834, 18, 2469, 10663, 3639, 327, 618, 3834, 18, 28023, 12, 723, 3834, 18, 2722, 31985, 2932, 1199, 27921, 21, 16, 618, 3834, 18, 2469, 10663, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
asm.emitSTAddr (PROCESSOR_REGISTER, frameSize - JNI_PR_OFFSET, FP);
public static synchronized VM_CompiledMethod compile (VM_NativeMethod method) { VM_JNICompiledMethod cm = (VM_JNICompiledMethod)VM_CompiledMethods.createCompiledMethod(method, VM_CompiledMethod.JNI); int compiledMethodId = cm.getId(); VM_Assembler asm = new VM_Assembler(0); int frameSize = VM_Compiler.getFrameSize(method); VM_Class klass = method.getDeclaringClass(); /* initialization */ if (VM.VerifyAssertions) VM._assert(T3 <= LAST_VOLATILE_GPR); // need 4 gp temps if (VM.VerifyAssertions) VM._assert(F3 <= LAST_VOLATILE_FPR); // need 4 fp temps if (VM.VerifyAssertions) VM._assert(S0 < S1 && S1 <= LAST_SCRATCH_GPR); // need 2 scratch VM_Address nativeIP = method.getNativeIP(); VM_Address nativeTOC = method.getNativeTOC(); // NOTE: this must be done before the condition VM_Thread.hasNativeStackFrame() become true // so that the first Java to C transition will be allowed to resize the stack // (currently, this is true when the JNIRefsTop index has been incremented from 0) asm.emitNativeStackOverflowCheck(frameSize + 14); // add at least 14 for C frame (header + spill) int parameterAreaSize = method.getParameterWords() << LOG_BYTES_IN_STACKSLOT; // number of bytes of arguments // save return address in caller frame asm.emitMFLR(0); asm.emitSTAddr(0, STACKFRAME_NEXT_INSTRUCTION_OFFSET, FP); //-#if RVM_FOR_LINUX || RVM_FOR_OSX // buy mini frame (2) asm.emitSTAddrU (FP, -JNI_SAVE_AREA_SIZE, FP); asm.emitLVAL (S0, compiledMethodId); // save jni method id at mini frame (2) asm.emitSTW (S0, STACKFRAME_METHOD_ID_OFFSET, FP); // buy mini frame (1), the total size equals to frameSize asm.emitSTAddrU (FP, -frameSize + JNI_SAVE_AREA_SIZE, FP); //-#endif //-#if RVM_FOR_AIX asm.emitSTAddrU (FP, -frameSize, FP); // get transition frame on stack asm.emitLVAL (S0, compiledMethodId); // save jni method id asm.emitSTW (S0, STACKFRAME_METHOD_ID_OFFSET, FP); //-#endif asm.emitSTAddr (JTOC, frameSize - JNI_JTOC_OFFSET, FP); // save RVM JTOC in frame asm.emitSTAddr (PROCESSOR_REGISTER, frameSize - JNI_PR_OFFSET, FP); // save PR in frame // establish S1 -> VM_Thread, S0 -> threads JNIEnv structure asm.emitLAddr(S1, VM_Entrypoints.activeThreadField.getOffset(), PROCESSOR_REGISTER); asm.emitLAddr(S0, VM_Entrypoints.jniEnvField.getOffset(), S1); // save the TI & PR registers in the JNIEnvironment object for possible calls back into Java asm.emitSTAddr(TI, VM_Entrypoints.JNIEnvSavedTIField.getOffset(), S0); asm.emitSTAddr(PROCESSOR_REGISTER, VM_Entrypoints.JNIEnvSavedPRField.getOffset(), S0); // save current frame pointer in JNIEnv, JNITopJavaFP, which will be the frame // to start scanning this stack during GC, if top of stack is still executing in C //-#if RVM_FOR_LINUX || RVM_FOR_OSX // for Linux, save mini (2) frame pointer, which has method id asm.emitLAddr (PROCESSOR_REGISTER, 0, FP); asm.emitSTAddr(PROCESSOR_REGISTER, VM_Entrypoints.JNITopJavaFPField.getOffset(), S0); //-#elif RVM_FOR_AIX asm.emitSTAddr(FP, VM_Entrypoints.JNITopJavaFPField.getOffset(), S0); //-#endif // save the RVM nonvolatile registers, to be scanned by GC stack mapper // remember to skip past the saved JTOC by starting with offset = JNI_RVM_NONVOLATILE_OFFSET // for (int i = LAST_NONVOLATILE_GPR, offset = JNI_RVM_NONVOLATILE_OFFSET; i >= FIRST_NONVOLATILE_GPR; --i, offset+=BYTES_IN_STACKSLOT) { asm.emitSTAddr(i, frameSize - offset, FP); } // clear the GC flag on entry to native code asm.emitLVAL(PROCESSOR_REGISTER,0); // use PR as scratch asm.emitSTW(PROCESSOR_REGISTER, frameSize-JNI_GC_FLAG_OFFSET, FP); // generate the code to map the parameters to AIX convention and add the // second parameter 2 (either the "this" ptr or class if a static method). // The JNI Function ptr first parameter is set before making the call. // Opens a new frame in the JNIRefs table to register the references // Assumes S0 set to JNIEnv, kills TI, S1 & PROCESSOR_REGISTER // On return, S0 is still valid. //-#if RVM_FOR_LINUX storeParametersForLinux(asm, frameSize, method, klass); //-#elif RVM_FOR_OSX storeParametersForOSX(asm, frameSize, method, klass); //-#elif RVM_FOR_AIX storeParametersForAIX(asm, frameSize, method, klass); //-#endif // Get address of out_of_line prolog into S1, before setting TOC reg. asm.emitLAddr (S1, VM_Entrypoints.invokeNativeFunctionInstructionsField.getOffset(), JTOC); asm.emitMTLR (S1); // set the TOC and IP for branch to out_of_line code asm.emitLVALAddr (JTOC, nativeTOC); // load TOC for native function into TOC reg asm.emitLVALAddr (TI, nativeIP); // load TI with address of native code // go to VM_OutOfLineMachineCode.invokeNativeFunctionInstructions // It will change the Processor status to "in_native" and transfer to the native code. // On return it will change the state back to "in_java" (waiting if blocked). // // The native address entrypoint is in register TI // The native TOC has been loaded into the TOC register // S0 still points to threads JNIEnvironment // asm.emitBCLRL(); // check if GC has occurred, If GC did not occur, then // VM NON_VOLATILE regs were restored by AIX and are valid. If GC did occur // objects referenced by these restored regs may have moved, in this case we // restore the nonvolatile registers from our savearea, // where any object references would have been relocated during GC. // use T2 as scratch (not needed any more on return from call) // asm.emitLWZ(T2, frameSize - JNI_GC_FLAG_OFFSET, FP); asm.emitCMPI(T2,0); VM_ForwardReference fr1 = asm.emitForwardBC(EQ); for (int i = LAST_NONVOLATILE_GPR, offset = JNI_RVM_NONVOLATILE_OFFSET; i >= FIRST_NONVOLATILE_GPR; --i, offset+=BYTES_IN_STACKSLOT) { asm.emitLAddr(i, frameSize - offset, FP); } fr1.resolve(asm); asm.emitLAddr(S0, VM_Entrypoints.activeThreadField.getOffset(), PROCESSOR_REGISTER); // S0 holds thread pointer // reestablish S0 to hold pointer to VM_JNIEnvironment asm.emitLAddr(S0, VM_Entrypoints.jniEnvField.getOffset(), S0); // pop jrefs frame off the JNIRefs stack, "reopen" the previous top jref frame // use S1 as scratch before it's restored, also use T2, T3 for scratch which are no longer needed asm.emitLAddr(S1, VM_Entrypoints.JNIRefsField.getOffset(), S0); // load base of JNIRefs array asm.emitLInt (T2, VM_Entrypoints.JNIRefsSavedFPField.getOffset(), S0); // get saved offset for JNIRefs frame ptr previously pushed onto JNIRefs array asm.emitADDI (T3, -BYTES_IN_STACKSLOT, T2); // compute offset for new TOP asm.emitSTW (T3, VM_Entrypoints.JNIRefsTopField.getOffset(), S0); // store new offset for TOP into JNIEnv asm.emitLIntX(T2, S1, T2); // retrieve the previous frame ptr asm.emitSTW (T2, VM_Entrypoints.JNIRefsSavedFPField.getOffset(), S0); // store new offset for JNIRefs frame ptr into JNIEnv // Restore the return value R3-R4 saved in the glue frame spill area before the migration if (VM.BuildFor64Addr) { asm.emitLD(T0, NATIVE_FRAME_HEADER_SIZE, FP); } else { asm.emitLWZ(T0, NATIVE_FRAME_HEADER_SIZE, FP); asm.emitLWZ(T1, NATIVE_FRAME_HEADER_SIZE+BYTES_IN_STACKSLOT, FP); } // if the the return type is a reference, the native C is returning a jref // which is a byte offset from the beginning of the threads JNIRefs stack/array // of the corresponding ref. In this case, emit code to replace the returned // offset (in R3) with the ref from the JNIRefs array VM_TypeReference returnType = method.getReturnType(); if (returnType.isReferenceType()) { // use returned offset to load ref from JNIRefs into R3 asm.emitLAddrX (T0, S1, T0); // S1 is still the base of the JNIRefs array } // reload TI value saved in JNIEnv asm.emitLAddr(TI, VM_Entrypoints.JNIEnvSavedTIField.getOffset(), S0); // pop the glue stack frame, restore the Java caller frame asm.emitADDI (FP, +frameSize, FP); // remove linkage area // C return value is already where caller expected it (R3, R4 or F0) // and S1 is a scratch register, so we actually don't have to // restore it and/or pop arguments off it. // So, just restore the return address to the link register. asm.emitLAddr(0, STACKFRAME_NEXT_INSTRUCTION_OFFSET, FP); asm.emitMTLR (0); // restore return address // CHECK EXCEPTION AND BRANCH TO ATHROW CODE OR RETURN NORMALLY asm.emitLAddr (T2, VM_Entrypoints.JNIPendingExceptionField.getOffset(), S0); // get pending exception from JNIEnv asm.emitLVAL (T3, 0); // get a null value to compare asm.emitSTAddr(T3, VM_Entrypoints.JNIPendingExceptionField.getOffset(), S0); // clear the current pending exception asm.emitCMPAddr(T2, T3); VM_ForwardReference fr3 = asm.emitForwardBC(NE); asm.emitBCLR(); // if no pending exception, proceed to return to caller fr3.resolve(asm); // An exception is pending, deliver the exception to the caller as if executing an athrow in the caller // at the location of the call to the native method asm.emitLAddrToc(T3, VM_Entrypoints.athrowMethod.getOffset()); asm.emitMTCTR(T3); // point LR to the exception delivery code asm.emitMR (T0, T2); // copy the saved exception to T0 asm.emitBCCTR(); // then branch to the exception delivery code, does not return VM_MachineCode machineCode = asm.makeMachineCode(); cm.compileComplete(machineCode.getInstructions()); return cm; }
5245 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5245/1ff8f8ca555b39087faa7a6c8d3062f7ccc7dd72/VM_JNICompiler.java/clean/rvm/src/vm/arch/powerPC/jni/VM_JNICompiler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 3852, 8251, 67, 20733, 1305, 4074, 261, 7397, 67, 9220, 1305, 707, 13, 288, 565, 8251, 67, 46, 50, 45, 20733, 1305, 5003, 273, 261, 7397, 67, 46, 50, 45, 20733, 1305, 13, 7397, 67, 20733, 4712, 18, 2640, 20733, 1305, 12, 2039, 16, 8251, 67, 20733, 1305, 18, 46, 50, 45, 1769, 565, 509, 7743, 30793, 273, 5003, 18, 26321, 5621, 565, 8251, 67, 1463, 5747, 749, 20415, 202, 33, 394, 8251, 67, 1463, 5747, 749, 12, 20, 1769, 565, 509, 2623, 1225, 202, 33, 8251, 67, 9213, 18, 588, 3219, 1225, 12, 2039, 1769, 565, 8251, 67, 797, 7352, 202, 33, 707, 18, 588, 3456, 14682, 5621, 565, 1748, 10313, 1195, 565, 309, 261, 7397, 18, 8097, 8213, 1115, 13, 8251, 6315, 11231, 12, 56, 23, 1648, 15612, 67, 29439, 67, 43, 8025, 1769, 6647, 368, 1608, 1059, 4178, 1022, 1121, 565, 309, 261, 7397, 18, 8097, 8213, 1115, 13, 8251, 6315, 11231, 12, 42, 23, 1648, 15612, 67, 29439, 67, 42, 8025, 1769, 6647, 368, 1608, 1059, 4253, 1022, 1121, 565, 309, 261, 7397, 18, 8097, 8213, 1115, 13, 8251, 6315, 11231, 12, 55, 20, 411, 348, 21, 597, 348, 21, 1648, 15612, 67, 2312, 54, 5858, 67, 43, 8025, 1769, 368, 1608, 576, 15289, 565, 8251, 67, 1887, 6448, 2579, 225, 273, 707, 18, 588, 9220, 2579, 5621, 565, 8251, 67, 1887, 6448, 4296, 39, 273, 707, 18, 588, 9220, 4296, 39, 5621, 565, 368, 5219, 30, 225, 333, 1297, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 760, 3852, 8251, 67, 20733, 1305, 4074, 261, 7397, 67, 9220, 1305, 707, 13, 288, 565, 8251, 67, 46, 50, 45, 20733, 1305, 5003, 273, 261, 7397, 67, 46, 50, 45, 20733, 1305, 13, 7397, 67, 20733, 4712, 18, 2640, 20733, 1305, 12, 2039, 16, 8251, 67, 20733, 1305, 18, 46, 50, 45, 1769, 565, 509, 7743, 30793, 273, 5003, 18, 26321, 5621, 565, 8251, 67, 1463, 5747, 749, 20415, 202, 33, 394, 8251, 67, 1463, 5747, 749, 12, 20, 1769, 565, 509, 2623, 1225, 202, 33, 8251, 67, 9213, 18, 588, 3219, 1225, 12, 2039, 1769, 565, 8251, 67, 797, 7352, 202, 33, 707, 18, 588, 3456, 14682, 5621, 565, 1748, 10313, 1195, 565, 309, 261, 2 ]
throw new PSQLException("postgresql.prep.range", PSQLState.PARAMETER_ERROR);
throw new PSQLException("postgresql.prep.range", PSQLState.INVALID_PARAMETER_VALUE);
private void bind(int paramIndex, Object s, String type) throws SQLException { if (paramIndex < 1 || paramIndex > m_binds.length) throw new PSQLException("postgresql.prep.range", PSQLState.PARAMETER_ERROR); if (paramIndex == 1 && isFunction) // need to registerOut instead throw new PSQLException ("postgresql.call.funcover"); m_binds[paramIndex - 1] = s; m_bindTypes[paramIndex - 1] = type; }
11803 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11803/509a9cd3f922c38c19d35e81bb1427d663ba4aba/AbstractJdbc1Statement.java/clean/src/interfaces/jdbc/org/postgresql/jdbc1/AbstractJdbc1Statement.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1993, 12, 474, 579, 1016, 16, 1033, 272, 16, 514, 618, 13, 1216, 6483, 202, 95, 202, 202, 430, 261, 891, 1016, 411, 404, 747, 579, 1016, 405, 312, 67, 4376, 87, 18, 2469, 13, 1082, 202, 12849, 394, 453, 23116, 2932, 2767, 24330, 18, 19109, 18, 3676, 3113, 453, 3997, 1119, 18, 9819, 67, 3589, 1769, 202, 202, 430, 261, 891, 1016, 422, 404, 597, 11233, 13, 368, 1608, 358, 1744, 1182, 3560, 1082, 202, 12849, 394, 453, 23116, 7566, 2767, 24330, 18, 1991, 18, 644, 1643, 8863, 202, 202, 81, 67, 4376, 87, 63, 891, 1016, 300, 404, 65, 273, 272, 31, 202, 202, 81, 67, 4376, 2016, 63, 891, 1016, 300, 404, 65, 273, 618, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1993, 12, 474, 579, 1016, 16, 1033, 272, 16, 514, 618, 13, 1216, 6483, 202, 95, 202, 202, 430, 261, 891, 1016, 411, 404, 747, 579, 1016, 405, 312, 67, 4376, 87, 18, 2469, 13, 1082, 202, 12849, 394, 453, 23116, 2932, 2767, 24330, 18, 19109, 18, 3676, 3113, 453, 3997, 1119, 18, 9819, 67, 3589, 1769, 202, 202, 430, 261, 891, 1016, 422, 404, 597, 11233, 13, 368, 1608, 358, 1744, 1182, 3560, 1082, 202, 12849, 394, 453, 23116, 7566, 2767, 24330, 18, 1991, 18, 644, 1643, 8863, 202, 202, 81, 67, 4376, 87, 63, 891, 1016, 300, 404, 65, 273, 272, 31, 202, 202, 81, 67, 4376, 2016, 63, 891, 1016, 300, 404, 2 ]
pw.print(" <code>");
pw.print(" ");
public void testDumpFunctions() throws IOException { final List funInfoList = new ArrayList(); funInfoList.addAll(BuiltinFunTable.instance().getFunInfoList()); // Add some UDFs. funInfoList.add(new FunInfo(new UdfResolver(new CurrentDateMemberExactUdf()))); funInfoList.add(new FunInfo(new UdfResolver(new CurrentDateMemberUdf()))); funInfoList.add(new FunInfo(new UdfResolver(new CurrentDateStringUdf()))); Collections.sort(funInfoList); final File file = new File("functions.html"); final FileOutputStream os = new FileOutputStream(file); final PrintWriter pw = new PrintWriter(os); pw.println("<table border='1'>"); pw.println("<tr>"); pw.println("<th>Name</th>"); pw.println("<th>Description</th>"); pw.println("</tr>"); for (int i = 0; i < funInfoList.size(); i++) { FunInfo funInfo = (FunInfo) funInfoList.get(i); pw.println("<tr>"); pw.print(" <td valign=top>"); printHtml(pw, funInfo.getName()); pw.println("</td>"); pw.print(" <td>"); if (funInfo.getDescription() != null) { printHtml(pw, funInfo.getDescription()); } final String[] signatures = funInfo.getSignatures(); if (signatures != null) { pw.println(" <p><b>Syntax</b></p>"); for (int j = 0; j < signatures.length; j++) { String signature = signatures[j]; pw.print(" <code>"); printHtml(pw, signature); pw.println("</code><br/>"); } } pw.println(" </td>"); pw.println("</tr>"); } pw.println("</table>"); pw.close(); }
4891 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4891/cd432d3847a85b9433f4815ee3ddf68ad23bc1c8/FunctionTest.java/buggy/testsrc/main/mondrian/olap/fun/FunctionTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 10628, 7503, 1435, 1216, 1860, 288, 3639, 727, 987, 9831, 17914, 273, 394, 2407, 5621, 3639, 9831, 17914, 18, 1289, 1595, 12, 28032, 22783, 1388, 18, 1336, 7675, 588, 22783, 17914, 10663, 3639, 368, 1436, 2690, 28670, 87, 18, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 4419, 14332, 57, 2180, 1435, 3719, 1769, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 4419, 57, 2180, 1435, 3719, 1769, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 780, 57, 2180, 1435, 3719, 1769, 3639, 5737, 18, 3804, 12, 12125, 17914, 1769, 3639, 727, 1387, 585, 273, 394, 1387, 2932, 10722, 18, 2620, 8863, 3639, 727, 12942, 1140, 273, 394, 12942, 12, 768, 1769, 3639, 727, 14071, 8772, 273, 394, 14071, 12, 538, 1769, 3639, 8772, 18, 8222, 2932, 32, 2121, 5795, 2218, 21, 28533, 1769, 3639, 8772, 18, 8222, 2932, 32, 313, 2984, 1769, 3639, 8772, 18, 8222, 2932, 32, 451, 34, 461, 1757, 451, 2984, 1769, 3639, 8772, 18, 8222, 2932, 32, 451, 34, 3291, 1757, 451, 2984, 1769, 3639, 8772, 18, 8222, 2932, 1757, 313, 2984, 1769, 3639, 364, 261, 474, 277, 273, 374, 31, 277, 411, 9831, 17914, 18, 1467, 5621, 277, 27245, 288, 5411, 478, 318, 966, 9831, 966, 273, 261, 22783, 966, 13, 9831, 17914, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 10628, 7503, 1435, 1216, 1860, 288, 3639, 727, 987, 9831, 17914, 273, 394, 2407, 5621, 3639, 9831, 17914, 18, 1289, 1595, 12, 28032, 22783, 1388, 18, 1336, 7675, 588, 22783, 17914, 10663, 3639, 368, 1436, 2690, 28670, 87, 18, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 4419, 14332, 57, 2180, 1435, 3719, 1769, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 4419, 57, 2180, 1435, 3719, 1769, 3639, 9831, 17914, 18, 1289, 12, 2704, 478, 318, 966, 12, 2704, 587, 2180, 4301, 12, 2704, 6562, 1626, 780, 57, 2180, 1435, 3719, 1769, 2 ]
config = UtilServer.start(Constants.TESTING_PATH + "MTOM-enabledRepository");
UtilServer.start(Constants.TESTING_PATH + "MTOM-enabledRepository");
protected void setUp() throws Exception { config = UtilServer.start(Constants.TESTING_PATH + "MTOM-enabledRepository"); service = Utils.createSimpleService(serviceName, Echo.class.getName(), operationName); UtilServer.deployService(service); serviceContext = service.getParent().getServiceGroupContext(config).getServiceContext(service.getName().getLocalPart()); }
49300 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49300/11fa656780ad5c4458b9e88be6933f57ae37b3ae/EchoRawMTOMLoadTest.java/clean/modules/integration/test/org/apache/axis2/mtom/EchoRawMTOMLoadTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 24292, 1435, 1216, 1185, 288, 3639, 3564, 2081, 18, 1937, 12, 2918, 18, 16961, 1360, 67, 4211, 397, 315, 6152, 1872, 17, 5745, 3305, 8863, 3639, 1156, 273, 6091, 18, 2640, 5784, 1179, 12, 15423, 16, 28995, 18, 1106, 18, 17994, 9334, 7734, 22697, 1769, 3639, 3564, 2081, 18, 12411, 1179, 12, 3278, 1769, 3639, 1156, 1042, 273, 1156, 18, 588, 3054, 7675, 588, 1179, 1114, 1042, 12, 1425, 2934, 588, 1179, 1042, 12, 3278, 18, 17994, 7675, 588, 2042, 1988, 10663, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 24292, 1435, 1216, 1185, 288, 3639, 3564, 2081, 18, 1937, 12, 2918, 18, 16961, 1360, 67, 4211, 397, 315, 6152, 1872, 17, 5745, 3305, 8863, 3639, 1156, 273, 6091, 18, 2640, 5784, 1179, 12, 15423, 16, 28995, 18, 1106, 18, 17994, 9334, 7734, 22697, 1769, 3639, 3564, 2081, 18, 12411, 1179, 12, 3278, 1769, 3639, 1156, 1042, 273, 1156, 18, 588, 3054, 7675, 588, 1179, 1114, 1042, 12, 1425, 2934, 588, 1179, 1042, 12, 3278, 18, 17994, 7675, 588, 2042, 1988, 10663, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (taskString == null || taskString.length() == 0) {
if (taskString == null) {
void refresh() { if (isDisposed()) { return; } progressLabel.setText(getMainTitle()); int percentDone = getPercentDone(); JobInfo[] infos = getJobInfos(); if (isRunning()) { if (progressBar == null) { if (percentDone == IProgressMonitor.UNKNOWN) { // Only do it if there is an indeterminate task // There may be no task so we don't want to create it // until we know for sure for (int i = 0; i < infos.length; i++) { if (infos[i].hasTaskInfo() && infos[i].getTaskInfo().totalWork == IProgressMonitor.UNKNOWN) { createProgressBar(SWT.INDETERMINATE); break; } } } else { createProgressBar(SWT.NONE); progressBar.setMinimum(0); progressBar.setMaximum(100); } } // Protect against bad counters if (percentDone >= 0 && percentDone <= 100 && percentDone != progressBar.getSelection()) { progressBar.setSelection(percentDone); } } else if (isCompleted()) { if (progressBar != null) { progressBar.dispose(); progressBar = null; } setLayoutsForNoProgress(); } for (int i = 0; i < infos.length; i++) { JobInfo jobInfo = infos[i]; if (jobInfo.hasTaskInfo()) { String taskString = jobInfo.getTaskInfo().getTaskName(); String subTaskString = null; Object[] jobChildren = jobInfo.getChildren(); if (jobChildren.length > 0) { subTaskString = ((JobTreeElement) jobChildren[0]) .getDisplayString(); } if (subTaskString != null) { if (taskString == null || taskString.length() == 0) { taskString = subTaskString; } else { taskString = NLS.bind( ProgressMessages.JobInfo_DoneNoProgressMessage, taskString, subTaskString); } } if (taskString != null) { setLinkText(infos[i].getJob(), taskString, i); } } else {// Check for the finished job state Job job = jobInfo.getJob(); if (job.getResult() != null) { IStatus result = job.getResult(); String message = EMPTY_STRING; if (result != null) { message = result.getMessage(); } setLinkText(job, message, i); } } setColor(currentIndex); } // Remove completed tasks if (infos.length < taskEntries.size()) { for (int i = infos.length; i < taskEntries.size(); i++) { ((Link) taskEntries.get(i)).dispose(); } if (infos.length > 1) taskEntries = taskEntries.subList(0, infos.length - 1); else taskEntries.clear(); } updateToolBarValues(); }
58148 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/58148/491346160f65caf9de2ac417722d6db718be3976/ProgressInfoItem.java/clean/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/progress/ProgressInfoItem.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 4460, 1435, 288, 202, 202, 430, 261, 291, 1669, 7423, 10756, 288, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 8298, 2224, 18, 542, 1528, 12, 588, 6376, 4247, 10663, 202, 202, 474, 5551, 7387, 273, 22612, 2998, 7387, 5621, 202, 202, 2278, 966, 8526, 10626, 273, 13024, 7655, 5621, 202, 202, 430, 261, 291, 7051, 10756, 288, 1082, 202, 430, 261, 8298, 5190, 422, 446, 13, 288, 9506, 202, 430, 261, 8849, 7387, 422, 467, 5491, 7187, 18, 14737, 13, 288, 6862, 202, 759, 5098, 741, 518, 309, 1915, 353, 392, 1547, 4443, 340, 1562, 6862, 202, 759, 6149, 2026, 506, 1158, 1562, 1427, 732, 2727, 1404, 2545, 358, 752, 518, 6862, 202, 759, 3180, 732, 5055, 364, 3071, 6862, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 10626, 18, 2469, 31, 277, 27245, 288, 25083, 202, 430, 261, 18227, 63, 77, 8009, 5332, 2174, 966, 1435, 6862, 9506, 202, 10, 10, 10626, 63, 77, 8009, 588, 2174, 966, 7675, 4963, 2421, 422, 467, 5491, 7187, 18, 14737, 13, 288, 6862, 1082, 202, 2640, 31547, 12, 55, 8588, 18, 2356, 1584, 654, 6236, 1777, 1769, 6862, 1082, 202, 8820, 31, 25083, 202, 97, 6862, 202, 97, 9506, 202, 97, 469, 288, 6862, 202, 2640, 31547, 12, 55, 8588, 18, 9826, 1769, 6862, 202, 8298, 5190, 18, 542, 13042, 12, 20, 1769, 6862, 202, 8298, 5190, 18, 542, 13528, 12, 6625, 1769, 9506, 202, 97, 1082, 202, 97, 1082, 202, 759, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 4460, 1435, 288, 202, 202, 430, 261, 291, 1669, 7423, 10756, 288, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 8298, 2224, 18, 542, 1528, 12, 588, 6376, 4247, 10663, 202, 202, 474, 5551, 7387, 273, 22612, 2998, 7387, 5621, 202, 202, 2278, 966, 8526, 10626, 273, 13024, 7655, 5621, 202, 202, 430, 261, 291, 7051, 10756, 288, 1082, 202, 430, 261, 8298, 5190, 422, 446, 13, 288, 9506, 202, 430, 261, 8849, 7387, 422, 467, 5491, 7187, 18, 14737, 13, 288, 6862, 202, 759, 5098, 741, 518, 309, 1915, 353, 392, 1547, 4443, 340, 1562, 6862, 202, 759, 6149, 2026, 506, 1158, 1562, 1427, 732, 2727, 1404, 2545, 358, 752, 518, 6862, 202, 759, 2 ]
StringBuffer out){
StringBuffer out, String contentType){
private void replaceIteratorNext(PsiElement element, String contentVariableName, String iteratorName, PsiElement childToSkip, StringBuffer out){ if(isIteratorNext(element, iteratorName)){ out.append(contentVariableName); } else{ final PsiElement[] children = element.getChildren(); if(children.length == 0){ out.append(element.getText()); } else{ boolean skippingWhiteSpace = false; for(final PsiElement child : children){ if(child.equals(childToSkip)){ skippingWhiteSpace = true; } else if(child instanceof PsiWhiteSpace && skippingWhiteSpace){ //don't do anything } else{ skippingWhiteSpace = false; replaceIteratorNext(child, contentVariableName, iteratorName, childToSkip, out); } } } } }
17306 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/17306/e6983cb36c95e7afb9e79e30eeec5a696dab046e/ForCanBeForeachInspection.java/clean/plugins/InspectionGadgets/src/com/siyeh/ig/verbose/ForCanBeForeachInspection.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 3238, 918, 1453, 3198, 2134, 12, 52, 7722, 1046, 930, 16, 29159, 514, 913, 21519, 16, 29159, 514, 2775, 461, 16, 29159, 453, 7722, 1046, 1151, 774, 6368, 16, 29159, 6674, 596, 16, 514, 5064, 15329, 5411, 309, 12, 291, 3198, 2134, 12, 2956, 16, 2775, 461, 3719, 95, 7734, 596, 18, 6923, 12, 1745, 21519, 1769, 5411, 289, 469, 95, 7734, 727, 453, 7722, 1046, 8526, 2325, 273, 930, 18, 588, 4212, 5621, 7734, 309, 12, 5906, 18, 2469, 422, 374, 15329, 10792, 596, 18, 6923, 12, 2956, 18, 588, 1528, 10663, 7734, 289, 469, 95, 10792, 1250, 14195, 23108, 273, 629, 31, 10792, 364, 12, 6385, 453, 7722, 1046, 1151, 294, 2325, 15329, 13491, 309, 12, 3624, 18, 14963, 12, 3624, 774, 6368, 3719, 95, 18701, 14195, 23108, 273, 638, 31, 13491, 289, 469, 309, 12, 3624, 1276, 453, 7722, 23108, 597, 27573, 14195, 23108, 15329, 18701, 368, 19752, 1404, 741, 6967, 13491, 289, 469, 95, 18701, 14195, 23108, 273, 629, 31, 18701, 1453, 3198, 2134, 12, 3624, 16, 913, 21519, 16, 4766, 7734, 2775, 461, 16, 4766, 7734, 1151, 774, 6368, 16, 596, 1769, 13491, 289, 10792, 289, 7734, 289, 5411, 289, 3639, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 3238, 918, 1453, 3198, 2134, 12, 52, 7722, 1046, 930, 16, 29159, 514, 913, 21519, 16, 29159, 514, 2775, 461, 16, 29159, 453, 7722, 1046, 1151, 774, 6368, 16, 29159, 6674, 596, 16, 514, 5064, 15329, 5411, 309, 12, 291, 3198, 2134, 12, 2956, 16, 2775, 461, 3719, 95, 7734, 596, 18, 6923, 12, 1745, 21519, 1769, 5411, 289, 469, 95, 7734, 727, 453, 7722, 1046, 8526, 2325, 273, 930, 18, 588, 4212, 5621, 7734, 309, 12, 5906, 18, 2469, 422, 374, 15329, 10792, 596, 18, 6923, 12, 2956, 18, 588, 1528, 10663, 7734, 289, 469, 95, 10792, 1250, 14195, 23108, 273, 629, 31, 10792, 364, 12, 6385, 453, 7722, 1046, 1151, 294, 2325, 15329, 13491, 309, 12, 2 ]
void setSelected(PageNode node) {
void setSelected(DagNode dagNode) {
void setSelected(PageNode node) { if (selected != null) { selected.setSelected(false); } selected = node; selected.setSelected(true); }
11225 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11225/8f98d4d5dda5b9e2d22515cb91cc8ff59e75e181/DagViewerImpl.java/buggy/org.eclipse.zest.core/src/org/eclipse/zest/core/internal/treegraphviewer/DagViewerImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 23006, 12, 1964, 907, 756, 13, 288, 202, 202, 430, 261, 8109, 480, 446, 13, 288, 1082, 202, 8109, 18, 542, 7416, 12, 5743, 1769, 202, 202, 97, 202, 202, 8109, 273, 756, 31, 202, 202, 8109, 18, 542, 7416, 12, 3767, 1769, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 23006, 12, 1964, 907, 756, 13, 288, 202, 202, 430, 261, 8109, 480, 446, 13, 288, 1082, 202, 8109, 18, 542, 7416, 12, 5743, 1769, 202, 202, 97, 202, 202, 8109, 273, 756, 31, 202, 202, 8109, 18, 542, 7416, 12, 3767, 1769, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public void warn(SourcePosition position, String message) {
public final void warn(SourcePosition position, String message) {
public void warn(SourcePosition position, String message) { RubyPlugin.log(message, getClass()); }
13291 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13291/615094576784f8eacf0891411a5b25d98778892b/TestRubyParser.java/clean/src/org/jedit/ruby/test/TestRubyParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 727, 918, 1894, 12, 1830, 2555, 1754, 16, 514, 883, 13, 288, 5411, 19817, 3773, 18, 1330, 12, 2150, 16, 2900, 10663, 3639, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 540, 1071, 727, 918, 1894, 12, 1830, 2555, 1754, 16, 514, 883, 13, 288, 5411, 19817, 3773, 18, 1330, 12, 2150, 16, 2900, 10663, 3639, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (provider.equals(GENERIC_PROVIDER) || provider.equals(ORACLE_PROVIDER)) {
if (provider.equals(GENERIC_PROVIDER) || provider.equals(ORACLE_PROVIDER) || provider.equals(MAXDB_PROVIDER)) {
public boolean setDbParamaters(HttpServletRequest request, String provider) { String conStr = request.getParameter("dbCreateConStr"); boolean isFormSubmitted = ((request.getParameter("submit") != null) && (conStr != null)); String database = ""; if (provider.equals(MYSQL_PROVIDER)) { database = request.getParameter("db"); } else if (provider.equals(POSTGRESQL_PROVIDER)) { database = request.getParameter("dbName"); } if (provider.equals(MYSQL_PROVIDER) || provider.equals(POSTGRESQL_PROVIDER)) { isFormSubmitted = (isFormSubmitted && (database != null)); } if (isInitialized()) { String createDb = request.getParameter("createDb"); if (createDb == null) { createDb = ""; } String createTables = request.getParameter("createTables"); if (createTables == null) { createTables = ""; } if (isFormSubmitted) { if (provider.equals(POSTGRESQL_PROVIDER)) { setDb(database); String templateDb = request.getParameter("templateDb"); setDbProperty(getDatabase() + ".templateDb", templateDb); if ((conStr != null) && (!conStr.endsWith("/"))) { conStr += "/"; } setDbProperty(getDatabase() + ".constr", conStr + getDbProperty(getDatabase() + ".templateDb")); } else if (provider.equals(MYSQL_PROVIDER) || provider.equals(POSTGRESQL_PROVIDER)) { if (!conStr.endsWith("/")) { conStr += "/"; } conStr += database; } setDbWorkConStr(conStr); if (provider.equals(POSTGRESQL_PROVIDER)) { setDb(database); } String dbCreateUser = request.getParameter("dbCreateUser"); String dbCreatePwd = request.getParameter("dbCreatePwd"); String dbWorkUser = request.getParameter("dbWorkUser"); String dbWorkPwd = request.getParameter("dbWorkPwd"); setDbCreateUser(dbCreateUser); setDbCreatePwd(dbCreatePwd); if (dbWorkUser.equals("")) { dbWorkUser = request.getContextPath(); } if (dbWorkUser.equals("")) { dbWorkUser = "opencms"; } if (dbWorkUser.startsWith("/")) { dbWorkUser = dbWorkUser.substring(1, dbWorkUser.length()); } setDbWorkUser(dbWorkUser); setDbWorkPwd(dbWorkPwd); if (provider.equals(ORACLE_PROVIDER)) { String dbDefaultTablespace = request.getParameter("dbDefaultTablespace"); String dbTemporaryTablespace = request.getParameter("dbTemporaryTablespace"); String dbIndexTablespace = request.getParameter("dbIndexTablespace"); setDbProperty(getDatabase() + ".defaultTablespace", dbDefaultTablespace); setDbProperty(getDatabase() + ".temporaryTablespace", dbTemporaryTablespace); setDbProperty(getDatabase() + ".indexTablespace", dbIndexTablespace); } Map replacer = new HashMap(); if (!provider.equals(MYSQL_PROVIDER)) { replacer.put("${user}", dbWorkUser); replacer.put("${password}", dbWorkPwd); } if (provider.equals(MYSQL_PROVIDER) || provider.equals(POSTGRESQL_PROVIDER)) { replacer.put("${database}", database); } if (provider.equals(ORACLE_PROVIDER)) { replacer.put("${defaultTablespace}", getDbProperty(getDatabase() + ".defaultTablespace")); replacer.put("${indexTablespace}", getDbProperty(getDatabase() + ".indexTablespace")); replacer.put("${temporaryTablespace}", getDbProperty(getDatabase() + ".temporaryTablespace")); } setReplacer(replacer); if (provider.equals(GENERIC_PROVIDER) || provider.equals(ORACLE_PROVIDER)) { request.getSession().setAttribute("createTables", createTables); } request.getSession().setAttribute("createDb", createDb); } else { String dbName = "opencms"; // initialize the database name with the app name if (CmsStringUtil.isNotEmptyOrWhitespaceOnly(request.getContextPath())) { dbName = request.getContextPath().substring(1); } if (provider.equals(ORACLE_PROVIDER) || provider.equals(POSTGRESQL_PROVIDER)) { setDbWorkUser(dbName); } else { setDb(dbName); } } } return isFormSubmitted; }
51784 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51784/feb7737a52ef484aa149b11b44837884465aa199/CmsSetupBean.java/buggy/src/org/opencms/setup/CmsSetupBean.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 444, 4331, 786, 31302, 12, 2940, 18572, 590, 16, 514, 2893, 13, 288, 3639, 514, 356, 1585, 273, 590, 18, 588, 1662, 2932, 1966, 1684, 442, 1585, 8863, 3639, 1250, 353, 1204, 28882, 273, 14015, 2293, 18, 588, 1662, 2932, 9297, 7923, 480, 446, 13, 597, 261, 591, 1585, 480, 446, 10019, 3639, 514, 2063, 273, 1408, 31, 3639, 309, 261, 6778, 18, 14963, 12, 22114, 3997, 67, 26413, 3719, 288, 5411, 2063, 273, 590, 18, 588, 1662, 2932, 1966, 8863, 3639, 289, 469, 309, 261, 6778, 18, 14963, 12, 3798, 43, 862, 3997, 67, 26413, 3719, 288, 5411, 2063, 273, 590, 18, 588, 1662, 2932, 1966, 461, 8863, 3639, 289, 3639, 309, 261, 6778, 18, 14963, 12, 22114, 3997, 67, 26413, 13, 747, 2893, 18, 14963, 12, 3798, 43, 862, 3997, 67, 26413, 3719, 288, 5411, 353, 1204, 28882, 273, 261, 291, 1204, 28882, 597, 261, 6231, 480, 446, 10019, 3639, 289, 3639, 309, 261, 291, 11459, 10756, 288, 5411, 514, 752, 4331, 273, 590, 18, 588, 1662, 2932, 2640, 4331, 8863, 5411, 309, 261, 2640, 4331, 422, 446, 13, 288, 7734, 752, 4331, 273, 1408, 31, 5411, 289, 5411, 514, 752, 6905, 273, 590, 18, 588, 1662, 2932, 2640, 6905, 8863, 5411, 309, 261, 2640, 6905, 422, 446, 13, 288, 7734, 752, 6905, 273, 1408, 31, 5411, 289, 5411, 309, 261, 291, 1204, 28882, 13, 288, 7734, 309, 261, 6778, 18, 14963, 12, 3798, 43, 862, 3997, 67, 26413, 3719, 288, 10792, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1250, 444, 4331, 786, 31302, 12, 2940, 18572, 590, 16, 514, 2893, 13, 288, 3639, 514, 356, 1585, 273, 590, 18, 588, 1662, 2932, 1966, 1684, 442, 1585, 8863, 3639, 1250, 353, 1204, 28882, 273, 14015, 2293, 18, 588, 1662, 2932, 9297, 7923, 480, 446, 13, 597, 261, 591, 1585, 480, 446, 10019, 3639, 514, 2063, 273, 1408, 31, 3639, 309, 261, 6778, 18, 14963, 12, 22114, 3997, 67, 26413, 3719, 288, 5411, 2063, 273, 590, 18, 588, 1662, 2932, 1966, 8863, 3639, 289, 469, 309, 261, 6778, 18, 14963, 12, 3798, 43, 862, 3997, 67, 26413, 3719, 288, 5411, 2063, 273, 590, 18, 588, 1662, 2932, 1966, 461, 8863, 3639, 289, 3639, 309, 261, 6778, 18, 2 ]
result = eval("hash = {'a', 100}; p hash"); assertEquals("{\"a\"=>100}", result); result = eval("hash = Hash['b', 200]; p hash"); assertEquals("{\"b\"=>200}", result); result = eval("hash = Hash.new(); p hash['test']"); assertEquals("nil", result); result = eval("hash = Hash.new('default'); p hash['test']"); assertEquals("\"default\"", result);
result = eval("hash = {'a', 100}; p hash"); assertEquals("{\"a\"=>100}", result); result = eval("hash = Hash['b', 200]; p hash"); assertEquals("{\"b\"=>200}", result); result = eval("hash = Hash.new(); p hash['test']"); assertEquals("nil", result); result = eval("hash = Hash.new('default'); p hash['test']"); assertEquals("\"default\"", result);
public void testConstructors() { result = eval("hash = {'a', 100}; p hash"); assertEquals("{\"a\"=>100}", result); result = eval("hash = Hash['b', 200]; p hash"); assertEquals("{\"b\"=>200}", result); result = eval("hash = Hash.new(); p hash['test']"); assertEquals("nil", result); result = eval("hash = Hash.new('default'); p hash['test']"); assertEquals("\"default\"", result); }
47619 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47619/2f13ba47385b7584839c7f6f6f1abfee251cbe53/TestRubyHash.java/buggy/org/jruby/test/TestRubyHash.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 29590, 1435, 288, 202, 2088, 273, 5302, 2932, 2816, 273, 13666, 69, 2187, 2130, 20451, 293, 1651, 8863, 202, 11231, 8867, 2932, 95, 2412, 69, 2412, 9207, 6625, 1532, 16, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 3292, 70, 2187, 4044, 15533, 293, 1651, 8863, 202, 11231, 8867, 2932, 95, 2412, 70, 2412, 9207, 6976, 1532, 16, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 18, 2704, 5621, 293, 1651, 3292, 3813, 3546, 8863, 202, 11231, 8867, 2932, 20154, 3113, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 18, 2704, 2668, 1886, 8284, 293, 1651, 3292, 3813, 3546, 8863, 202, 11231, 8867, 2932, 2412, 1886, 2412, 3113, 563, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 29590, 1435, 288, 202, 2088, 273, 5302, 2932, 2816, 273, 13666, 69, 2187, 2130, 20451, 293, 1651, 8863, 202, 11231, 8867, 2932, 95, 2412, 69, 2412, 9207, 6625, 1532, 16, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 3292, 70, 2187, 4044, 15533, 293, 1651, 8863, 202, 11231, 8867, 2932, 95, 2412, 70, 2412, 9207, 6976, 1532, 16, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 18, 2704, 5621, 293, 1651, 3292, 3813, 3546, 8863, 202, 11231, 8867, 2932, 20154, 3113, 563, 1769, 202, 2088, 273, 5302, 2932, 2816, 273, 2474, 18, 2704, 2668, 1886, 8284, 293, 1651, 3292, 3813, 3546, 8863, 202, 11231, 8867, 2932, 2412, 1886, 2412, 3113, 563, 2 ]
if(selected){
if (selected && hasFocus) {
public ActionsTree() { myRoot = new DefaultMutableTreeNode(ROOT); myTree = new JTree(new MyModel(myRoot)); myTree.setCellRenderer(new ColoredTreeCellRenderer(){ public void customizeCellRenderer(JTree tree, Object value, boolean selected, boolean expanded, boolean leaf, int row, boolean hasFocus) { Keymap originalKeymap = myKeymap != null ? myKeymap.getParent() : null; Icon icon = null; String text; if (value instanceof DefaultMutableTreeNode) { Object userObject = ((DefaultMutableTreeNode)value).getUserObject(); boolean changed; if (userObject instanceof Group) { Group group = (Group)userObject; text = group.getName(); changed = originalKeymap != null && isGroupChanged(group, originalKeymap, myKeymap); icon = expanded ? group.getOpenIcon() : group.getIcon(); if (icon == null){ icon = expanded ? OPEN_ICON : CLOSE_ICON; } } else if (userObject instanceof String) { String actionId = (String)userObject; AnAction action = ActionManager.getInstance().getActionOrStub(actionId); text = action != null ? action.getTemplatePresentation().getText() : actionId; if (action != null) { Icon actionIcon = action.getTemplatePresentation().getIcon(); if (actionIcon != null) { icon = actionIcon; } } changed = originalKeymap != null && isActionChanged(actionId, originalKeymap, myKeymap); } else if (userObject instanceof QuickList) { QuickList list = (QuickList)userObject; icon = QUICK_LIST_ICON; text = list.getDisplayName(); changed = originalKeymap != null && isActionChanged(list.getActionId(), originalKeymap, myKeymap); } else if (userObject instanceof Separator) { // TODO[vova,anton]: beautify changed = false; text = "-------------"; } else { throw new IllegalArgumentException("unknown userObject: " + userObject); } LayeredIcon layeredIcon = new LayeredIcon(2); layeredIcon.setIcon(EMPTY_ICON, 0); if (icon != null){ layeredIcon.setIcon(icon, 1, (- icon.getIconWidth() + EMPTY_ICON.getIconWidth())/2, (EMPTY_ICON.getIconHeight() - icon.getIconHeight())/2); } setIcon(layeredIcon); Color foreground; if(selected){ foreground = UIUtil.getTreeSelectionForeground(); }else{ if(changed){ foreground = Color.BLUE; }else{ foreground = UIUtil.getTreeForeground(); } } SearchUtil.appendFragments(myFilter, text, Font.PLAIN, foreground, selected ? UIUtil.getTreeSelectionBackground() : UIUtil.getTreeTextBackground(), this); } } }); myTree.getSelectionModel().setSelectionMode(ListSelectionModel.SINGLE_SELECTION); myComponent = ScrollPaneFactory.createScrollPane(myTree); }
56598 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56598/31c240a0a5812feaae28785a2c3c9258bae32c53/ActionsTree.java/buggy/action-system/impl/com/intellij/openapi/keymap/impl/ui/ActionsTree.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 18765, 2471, 1435, 288, 565, 3399, 2375, 273, 394, 2989, 19536, 12513, 12, 9185, 1769, 565, 3399, 2471, 273, 394, 804, 2471, 12, 2704, 8005, 1488, 12, 4811, 2375, 10019, 565, 3399, 2471, 18, 542, 4020, 6747, 12, 2704, 1558, 7653, 2471, 4020, 6747, 1435, 95, 1377, 1071, 918, 20236, 4020, 6747, 12, 46, 2471, 2151, 16, 1033, 460, 16, 1250, 3170, 16, 1250, 8406, 16, 1250, 7839, 16, 509, 1027, 16, 1250, 711, 9233, 13, 288, 3639, 1929, 1458, 2282, 653, 1458, 273, 3399, 653, 1458, 480, 446, 692, 3399, 653, 1458, 18, 588, 3054, 1435, 294, 446, 31, 3639, 16011, 4126, 273, 446, 31, 3639, 514, 977, 31, 3639, 309, 261, 1132, 1276, 2989, 19536, 12513, 13, 288, 1850, 1033, 729, 921, 273, 14015, 1868, 19536, 12513, 13, 1132, 2934, 588, 1299, 921, 5621, 1850, 1250, 3550, 31, 1850, 309, 261, 1355, 921, 1276, 3756, 13, 288, 5411, 3756, 1041, 273, 261, 1114, 13, 1355, 921, 31, 5411, 977, 273, 1041, 18, 17994, 5621, 5411, 3550, 273, 2282, 653, 1458, 480, 446, 597, 353, 1114, 5033, 12, 1655, 16, 2282, 653, 1458, 16, 3399, 653, 1458, 1769, 5411, 4126, 273, 8406, 692, 1041, 18, 588, 3678, 5554, 1435, 294, 1041, 18, 588, 5554, 5621, 5411, 309, 261, 3950, 422, 446, 15329, 2868, 4126, 273, 8406, 692, 11919, 67, 21745, 294, 14435, 67, 21745, 31, 5411, 289, 1850, 289, 1850, 469, 309, 261, 1355, 921, 1276, 514, 13, 288, 5411, 514, 1301, 548, 273, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 18765, 2471, 1435, 288, 565, 3399, 2375, 273, 394, 2989, 19536, 12513, 12, 9185, 1769, 565, 3399, 2471, 273, 394, 804, 2471, 12, 2704, 8005, 1488, 12, 4811, 2375, 10019, 565, 3399, 2471, 18, 542, 4020, 6747, 12, 2704, 1558, 7653, 2471, 4020, 6747, 1435, 95, 1377, 1071, 918, 20236, 4020, 6747, 12, 46, 2471, 2151, 16, 1033, 460, 16, 1250, 3170, 16, 1250, 8406, 16, 1250, 7839, 16, 509, 1027, 16, 1250, 711, 9233, 13, 288, 3639, 1929, 1458, 2282, 653, 1458, 273, 3399, 653, 1458, 480, 446, 692, 3399, 653, 1458, 18, 588, 3054, 1435, 294, 446, 31, 3639, 16011, 4126, 273, 446, 31, 3639, 514, 977, 31, 3639, 309, 261, 1132, 1276, 2989, 19536, 2 ]
superblock.setState(Ext2Constants.EXT2_VALID_FS);
public void close() throws IOException { super.close(); //mark the filesystem clean superblock.setState(Ext2Constants.EXT2_VALID_FS); }
1056 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/1056/30321f676495c45e6c397890dcaf38df297c4bfc/Ext2FileSystem.java/buggy/fs/src/fs/org/jnode/fs/ext2/Ext2FileSystem.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1746, 1435, 1216, 1860, 288, 202, 202, 9565, 18, 4412, 5621, 9506, 202, 759, 3355, 326, 6496, 2721, 202, 202, 9565, 2629, 18, 542, 1119, 12, 2482, 22, 2918, 18, 4142, 22, 67, 5063, 67, 4931, 1769, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1746, 1435, 1216, 1860, 288, 202, 202, 9565, 18, 4412, 5621, 9506, 202, 759, 3355, 326, 6496, 2721, 202, 202, 9565, 2629, 18, 542, 1119, 12, 2482, 22, 2918, 18, 4142, 22, 67, 5063, 67, 4931, 1769, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if(log.isErrorEnabled()) log.error(Util.getStackTrace(x));
log.error(Util.getStackTrace(x));
public Object handle(Message req) { Object body=null; MethodCall method_call; if(server_obj == null) { if(log.isErrorEnabled()) log.error("no method handler is registered. Discarding request."); return null; } if(req == null || req.getLength() == 0) { if(log.isErrorEnabled()) log.error("message or message buffer is null"); return null; } try { body=marshaller != null? marshaller.objectFromByteBuffer(req.getBuffer()) : req.getObject(); } catch(Throwable e) { if(log.isErrorEnabled()) log.error("exception=" + e); return e; } if(body == null || !(body instanceof MethodCall)) { if(log.isErrorEnabled()) log.error("message does not contain a MethodCall object"); return null; } method_call=(MethodCall)body; try { if(log.isDebugEnabled()) log.debug("[sender=" + req.getSrc() + "], method_call: " + method_call); return method_call.invoke(server_obj, method_lookup); } catch(Throwable x) { if(log.isErrorEnabled()) log.error(Util.getStackTrace(x)); return x; } }
47927 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47927/175fd8a771e8b81204f514668d38560e33300e9d/RpcDispatcher.java/clean/src/org/jgroups/blocks/RpcDispatcher.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1033, 1640, 12, 1079, 1111, 13, 288, 3639, 1033, 1377, 1417, 33, 2011, 31, 3639, 2985, 1477, 225, 707, 67, 1991, 31, 3639, 309, 12, 3567, 67, 2603, 422, 446, 13, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 2135, 707, 1838, 353, 4104, 18, 21643, 310, 590, 1199, 1769, 5411, 327, 446, 31, 3639, 289, 3639, 309, 12, 3658, 422, 446, 747, 1111, 18, 588, 1782, 1435, 422, 374, 13, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 2150, 578, 883, 1613, 353, 446, 8863, 5411, 327, 446, 31, 3639, 289, 3639, 775, 288, 5411, 1417, 33, 27296, 480, 446, 35, 19927, 18, 1612, 1265, 12242, 12, 3658, 18, 588, 1892, 10756, 294, 1111, 18, 588, 921, 5621, 3639, 289, 3639, 1044, 12, 15155, 425, 13, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 4064, 1546, 397, 425, 1769, 5411, 327, 425, 31, 3639, 289, 3639, 309, 12, 3432, 422, 446, 747, 401, 12, 3432, 1276, 2985, 1477, 3719, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 2150, 1552, 486, 912, 279, 2985, 1477, 733, 8863, 5411, 327, 446, 31, 3639, 289, 3639, 707, 67, 1991, 28657, 12592, 13, 3432, 31, 3639, 775, 288, 7734, 309, 12, 1330, 18, 291, 2829, 1526, 10756, 613, 18, 4148, 2932, 63, 15330, 1546, 397, 1111, 18, 588, 7740, 1435, 397, 315, 6487, 707, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 1033, 1640, 12, 1079, 1111, 13, 288, 3639, 1033, 1377, 1417, 33, 2011, 31, 3639, 2985, 1477, 225, 707, 67, 1991, 31, 3639, 309, 12, 3567, 67, 2603, 422, 446, 13, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 2135, 707, 1838, 353, 4104, 18, 21643, 310, 590, 1199, 1769, 5411, 327, 446, 31, 3639, 289, 3639, 309, 12, 3658, 422, 446, 747, 1111, 18, 588, 1782, 1435, 422, 374, 13, 288, 5411, 309, 12, 1330, 18, 291, 668, 1526, 10756, 613, 18, 1636, 2932, 2150, 578, 883, 1613, 353, 446, 8863, 5411, 327, 446, 31, 3639, 289, 3639, 775, 288, 5411, 1417, 33, 27296, 480, 446, 35, 19927, 18, 1612, 2 ]
public abstract Collection getPublicPhotos(String userId, int perPage, int page) throws IOException, SAXException, FlickrException;
public Collection getPublicPhotos(String userId, int perPage, int page) throws IOException, SAXException, FlickrException { List photos = new ArrayList(); List parameters = new ArrayList(); parameters.add(new Parameter("method", METHOD_GET_PUBLIC_PHOTOS)); parameters.add(new Parameter("api_key", apiKey)); parameters.add(new Parameter("user_id", userId)); if (perPage > 0) { parameters.add(new Parameter("per_page", new Integer(perPage))); } if (page > 0) { parameters.add(new Parameter("page", new Integer(page))); } Response response = transportAPI.get("/services/rest/", parameters); if (response.isError()) { throw new FlickrException(response.getErrorCode(), response.getErrorMessage()); } Element photosElement = response.getPayload(); NodeList photoNodes = photosElement.getElementsByTagName("photo"); for (int i = 0; i < photoNodes.getLength(); i++) { Element photoElement = (Element) photoNodes.item(i); Photo photo = new Photo(); photo.setId(photoElement.getAttribute("id")); User owner = new User(); owner.setId(photoElement.getAttribute("owner")); photo.setOwner(owner); photo.setSecret(photoElement.getAttribute("secret")); photo.setServer(photoElement.getAttribute("server")); photo.setTitle(photoElement.getAttribute("name")); photo.setPublicFlag("1".equals(photoElement.getAttribute("ispublic"))); photo.setFriendFlag("1".equals(photoElement.getAttribute("isfriend"))); photo.setFamilyFlag("1".equals(photoElement.getAttribute("isfamily"))); photos.add(photo); } return photos; }
public abstract Collection getPublicPhotos(String userId, int perPage, int page) throws IOException, SAXException, FlickrException;
5074 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5074/985c9277c3e4733f93e5878e5695c8f4713e265f/PeopleInterface.java/buggy/src/com/aetrion/flickr/people/PeopleInterface.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 8770, 2200, 17426, 3731, 12440, 12, 780, 6249, 16, 509, 16326, 16, 509, 1363, 13, 1216, 1860, 16, 14366, 16, 565, 29458, 503, 31, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 8770, 2200, 17426, 3731, 12440, 12, 780, 6249, 16, 509, 16326, 16, 509, 1363, 13, 1216, 1860, 16, 14366, 16, 565, 29458, 503, 31, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public WorkbenchSiteProgressService(PartSite partSite) {
public WorkbenchSiteProgressService(final PartSite partSite) {
public WorkbenchSiteProgressService(PartSite partSite) { site = partSite; }
55805 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/55805/fc7008c8b3623a62b191667f8fb1db2144a12300/WorkbenchSiteProgressService.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/progress/WorkbenchSiteProgressService.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 4147, 22144, 4956, 5491, 1179, 12, 1988, 4956, 1087, 4956, 13, 288, 202, 202, 4256, 273, 1087, 4956, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 4147, 22144, 4956, 5491, 1179, 12, 1988, 4956, 1087, 4956, 13, 288, 202, 202, 4256, 273, 1087, 4956, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
auth.setUser(tok.nextToken());
user = value;
private void doAUTHINFO(StringTokenizer tok) { String command = tok.nextToken().toUpperCase(Locale.US); if ( command.equals("USER") ) { auth.setUser(tok.nextToken()); writer.println("381 More authentication information required"); } else if ( command.equals("PASS") ) { auth.setPassword(tok.nextToken()); if ( auth.isAuthenticated() ) { writer.println("281 Authentication accepted"); } else { writer.println("482 Authentication rejected"); } } }
47102 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47102/eaf1e2e50312ac91b0249dbd8234f496042864ba/NNTPHandler.java/buggy/trunk/src/java/org/apache/james/nntpserver/NNTPHandler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 741, 7131, 5923, 12, 780, 10524, 946, 13, 288, 3639, 514, 1296, 273, 946, 18, 4285, 1345, 7675, 869, 8915, 12, 3916, 18, 3378, 1769, 3639, 309, 261, 1296, 18, 14963, 2932, 4714, 7923, 262, 288, 5411, 729, 273, 460, 31, 5411, 2633, 18, 8222, 2932, 7414, 21, 16053, 5107, 1779, 1931, 8863, 3639, 289, 469, 309, 261, 1296, 18, 14963, 2932, 10884, 7923, 262, 288, 5411, 1357, 18, 542, 3913, 12, 17692, 18, 4285, 1345, 10663, 5411, 309, 261, 1357, 18, 291, 15606, 1435, 262, 288, 7734, 2633, 18, 8222, 2932, 6030, 21, 8665, 8494, 8863, 5411, 289, 5411, 469, 288, 7734, 2633, 18, 8222, 2932, 8875, 22, 8665, 11876, 8863, 5411, 289, 3639, 289, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 3238, 918, 741, 7131, 5923, 12, 780, 10524, 946, 13, 288, 3639, 514, 1296, 273, 946, 18, 4285, 1345, 7675, 869, 8915, 12, 3916, 18, 3378, 1769, 3639, 309, 261, 1296, 18, 14963, 2932, 4714, 7923, 262, 288, 5411, 729, 273, 460, 31, 5411, 2633, 18, 8222, 2932, 7414, 21, 16053, 5107, 1779, 1931, 8863, 3639, 289, 469, 309, 261, 1296, 18, 14963, 2932, 10884, 7923, 262, 288, 5411, 1357, 18, 542, 3913, 12, 17692, 18, 4285, 1345, 10663, 5411, 309, 261, 1357, 18, 291, 15606, 1435, 262, 288, 7734, 2633, 18, 8222, 2932, 6030, 21, 8665, 8494, 8863, 5411, 289, 5411, 469, 288, 7734, 2633, 18, 8222, 2932, 8875, 22, 8665, 11876, 8863, 5411, 289, 3639, 289, 2 ]
if(backoff > 0 && backoff < 1000 )
if((backoff > 0) && (backoff < 1000) )
public void handleGet(URI uri, ToadletContext ctx) throws ToadletContextClosedException, IOException, RedirectException { String path = uri.getPath(); if(path.endsWith("myref.txt")) { SimpleFieldSet fs = node.exportPublicFieldSet(); StringWriter sw = new StringWriter(); fs.writeTo(sw); this.writeReply(ctx, 200, "text/plain", "OK", sw.toString()); return; } StringBuffer buf = new StringBuffer(1024); //HTTPRequest request = new HTTPRequest(uri); final boolean advancedEnabled = node.getToadletContainer().isAdvancedDarknetEnabled(); /* gather connection statistics */ int numberOfConnected = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_CONNECTED); int numberOfRoutingBackedOff = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_ROUTING_BACKED_OFF); int numberOfTooNew = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_TOO_NEW); int numberOfTooOld = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_TOO_OLD); int numberOfDisconnected = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_DISCONNECTED); int numberOfNeverConnected = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_NEVER_CONNECTED); int numberOfDisabled = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_DISABLED); int numberOfListening = node.getPeerNodeStatusSize(Node.PEER_NODE_STATUS_LISTENING); int numberOfSimpleConnected = numberOfConnected + numberOfRoutingBackedOff; int numberOfNotConnected = numberOfTooNew + numberOfTooOld + numberOfDisconnected + numberOfNeverConnected + numberOfDisabled + numberOfListening; String titleCountString = null; if(advancedEnabled) { titleCountString = "(" + numberOfConnected + "/" + numberOfRoutingBackedOff + "/" + numberOfTooNew+numberOfTooOld + "/" + numberOfNotConnected + ")"; } else { titleCountString = new Integer(numberOfSimpleConnected).toString(); } String pageTitle = titleCountString + " Darknet Peers"; ctx.getPageMaker().makeHead(buf, pageTitle); // FIXME! We need some nice images PeerNode[] peerNodes = node.getDarknetConnections(); long now = System.currentTimeMillis(); node.alerts.toSummaryHtml(buf); /* node status values */ int bwlimitDelayTime = (int) node.getBwlimitDelayTime(); int nodeAveragePingTime = (int) node.getNodeAveragePingTime(); int networkSizeEstimate = (int) node.getNetworkSizeEstimate( 0 ); DecimalFormat fix4 = new DecimalFormat("0.0000"); double missRoutingDistance = node.missRoutingDistance.currentValue(); DecimalFormat fix1 = new DecimalFormat("##0.0%"); double backedoffPercent = node.backedoffPercent.currentValue(); String nodeUptimeString = timeIntervalToString(( now - node.startupTime ) / 1000); buf.append("<table class=\"column\"><tr><td class=\"first\">"); /* node status overview box */ if(advancedEnabled) { buf.append("<div class=\"infobox\">"); buf.append("<div class=\"infobox-header\">Node status overview</div>"); buf.append("<div class=\"infobox-content\">"); buf.append("<ul>"); buf.append("<li>bwlimitDelayTime:&nbsp;").append(bwlimitDelayTime).append("ms</li>"); buf.append("<li>nodeAveragePingTime:&nbsp;").append(nodeAveragePingTime).append("ms</li>"); buf.append("<li>networkSizeEstimate:&nbsp;").append(networkSizeEstimate).append("&nbsp;nodes</li>"); buf.append("<li>nodeUptime:&nbsp;").append(nodeUptimeString).append("</li>"); buf.append("<li>missRoutingDistance:&nbsp;").append(fix4.format(missRoutingDistance)).append("</li>"); buf.append("<li>backedoffPercent:&nbsp;").append(fix1.format(backedoffPercent)).append("</li>"); buf.append("</ul></div>"); buf.append("</div>\n"); buf.append("</td><td>"); } // Activity box int numInserts = node.getNumInserts(); int numRequests = node.getNumRequests(); int numTransferringRequests = node.getNumTransferringRequests(); int numARKFetchers = node.getNumARKFetchers(); buf.append("<div class=\"infobox\">\n"); buf.append("<div class=\"infobox-header\">\n"); buf.append("Current Activity\n"); buf.append("</div>\n"); buf.append("<div class=\"infobox-content\">\n"); if ((numInserts == 0) && (numRequests == 0) && (numTransferringRequests == 0) && (numARKFetchers == 0)) { buf.append("Your node is not processing any requests right now."); } else { buf.append("<ul id=\"activity\">\n"); if (numInserts > 0) { buf.append("<li>Inserts:&nbsp;").append(numInserts).append("</li>"); } if (numRequests > 0) { buf.append("<li>Requests:&nbsp;").append(numRequests).append("</li>"); } if (numTransferringRequests > 0) { buf.append("<li>Transferring&nbsp;Requests:&nbsp;").append(numTransferringRequests).append("</li>"); } if(advancedEnabled) { if (numARKFetchers > 0) { buf.append("<li>ARK&nbsp;Fetch&nbsp;Requests:&nbsp;").append(numARKFetchers).append("</li>"); } } buf.append("</ul>\n"); } buf.append("</div>\n"); buf.append("</div>\n"); buf.append("</td><td>"); // Peer statistics box buf.append("<div class=\"infobox\">"); buf.append("<div class=\"infobox-header\">Peer statistics</div>"); buf.append("<div class=\"infobox-content\">"); buf.append("<ul>"); if (numberOfConnected > 0) { buf.append("<li><span class=\"peer_connected\">Connected:&nbsp;").append(numberOfConnected).append("</span></li>"); } if (numberOfRoutingBackedOff > 0) { String backoffName = "Busy"; if(advancedEnabled) { backoffName = "Backed off"; } buf.append("<li><span class=\"peer_backedoff\">").append(backoffName).append(":&nbsp;").append(numberOfRoutingBackedOff).append("</span></li>"); } if (numberOfTooNew > 0) { buf.append("<li><span class=\"peer_too_new\">Too new:&nbsp;").append(numberOfTooNew).append("</span></li>"); } if (numberOfTooOld > 0) { buf.append("<li><span class=\"peer_too_old\">Too old:&nbsp;").append(numberOfTooOld).append("</span></li>"); } if (numberOfDisconnected > 0) { buf.append("<li><span class=\"peer_disconnected\">Disconnected:&nbsp;").append(numberOfDisconnected).append("</span></li>"); } if (numberOfNeverConnected > 0) { buf.append("<li><span class=\"peer_never_connected\">Never Connected:&nbsp;").append(numberOfNeverConnected).append("</span></li>"); } if (numberOfDisabled > 0) { buf.append("<li><span class=\"peer_never_connected\">Disabled:&nbsp;").append(numberOfDisabled).append("</span></li>"); // **FIXME** } if (numberOfListening > 0) { buf.append("<li><span class=\"peer_never_connected\">Listening:&nbsp;").append(numberOfListening).append("</span></li>"); // **FIXME** } buf.append("</ul>"); buf.append("</div>"); buf.append("</div>\n"); // Peer routing backoff reason box if(advancedEnabled) { buf.append("</td><td class=\"last\">"); buf.append("<div class=\"infobox\">"); buf.append("<div class=\"infobox-header\">Peer backoff reasons</div>"); buf.append("<div class=\"infobox-content\">"); String [] routingBackoffReasons = node.getPeerNodeRoutingBackoffReasons(); if(routingBackoffReasons.length == 0) { buf.append("Good, your node is not backed off from any peers!<br/>\n"); } else { buf.append("<ul>\n"); for(int i=0;i<routingBackoffReasons.length;i++) { int reasonCount = node.getPeerNodeRoutingBackoffReasonSize(routingBackoffReasons[i]); if(reasonCount > 0) { buf.append("<li>").append(routingBackoffReasons[i]).append(":&nbsp;").append(reasonCount).append("</li>\n"); } } buf.append("</ul>\n"); } buf.append("</div>"); buf.append("</div>\n"); } buf.append("</td></tr></table>\n"); buf.append("<div class=\"infobox infobox-normal\">\n"); buf.append("<div class=\"infobox-header\">\n"); buf.append("My Peers"); if(advancedEnabled) { if (!path.endsWith("displaymessagetypes.html")) { buf.append(" <a href=\"displaymessagetypes.html\">(more detailed)</a>"); } } buf.append("</div>\n"); buf.append("<div class=\"infobox-content\">\n"); buf.append("<form action=\".\" method=\"post\" enctype=\"multipart/form-data\">\n"); StringBuffer buf2 = new StringBuffer(1024); buf2.append("<table class=\"darknet_connections\">\n"); buf2.append(" <tr>\n"); buf2.append(" <th></th>\n"); buf2.append(" <th>Status</th>\n"); buf2.append(" <th><span title=\"Click on the nodename link to send a N2NTM\" style=\"border-bottom:1px dotted;cursor:help;\">Name</span></th>\n"); if(advancedEnabled) { buf2.append(" <th><span title=\"Address:Port\" style=\"border-bottom:1px dotted;cursor:help;\">Address</span></th>\n"); } buf2.append(" <th>Version</th>\n"); if(advancedEnabled) { buf2.append(" <th>Location</th>\n"); buf2.append(" <th><span title=\"Temporarily disconnected. Other node busy? Wait time(s) remaining/total\" style=\"border-bottom:1px dotted;cursor:help;\">Backoff</span></th>\n"); } buf2.append(" <th><span title=\"How long since the node was last seen\" style=\"border-bottom:1px dotted;cursor:help;\">Idle</span></th>\n"); buf2.append(" </tr>\n"); if (peerNodes.length == 0) { buf2.append("<tr><td colspan=\"8\">Freenet can't work - you have not added any peers so far. <a href=\"/\">Go here</a> and read the top infobox to see how it's done.</td></tr>\n"); buf2.append("</table>\n"); // buf.append(buf2); } else { // Create array Object[][] rows = new Object[peerNodes.length][]; for(int i=0;i<peerNodes.length;i++) { PeerNode pn = peerNodes[i]; long routingBackedOffUntil = pn.getRoutingBackedOffUntil(); int backoff = (int)(Math.max(routingBackedOffUntil - now, 0)); // Don't list the backoff as zero before it's actually zero if(backoff > 0 && backoff < 1000 ) backoff = 1000; // Elements must be HTML encoded. Object[] row = new Object[10]; // where [0] is the pn object and 9 is the node name only for sorting! rows[i] = row; Object status = new Integer(pn.getPeerNodeStatus()); long idle = pn.lastReceivedPacketTime(); if(((Integer) status).intValue() == Node.PEER_NODE_STATUS_NEVER_CONNECTED) idle = pn.getPeerAddedTime(); String lastBackoffReasonOutputString = ""; if(advancedEnabled) { String backoffReason = pn.getLastBackoffReason(); if( backoffReason != null ) { lastBackoffReasonOutputString = "/"+backoffReason; } else { lastBackoffReasonOutputString = "/"; } } String avgPingTimeString = ""; if(advancedEnabled) { if(pn.isConnected()) { avgPingTimeString = " ("+(int) pn.averagePingTime()+"ms)"; } } String versionPrefixString = ""; String versionString = ""; String versionSuffixString = ""; if(pn.publicInvalidVersion() || pn.publicReverseInvalidVersion()) { versionPrefixString = "<span class=\"peer_version_problem\">"; versionSuffixString = "</span>"; } String namePrefixString = ""; String nameSuffixString = ""; if(pn.isConnected()) { namePrefixString = "<a href=\"/send_n2ntm/?peernode_hashcode="+pn.hashCode()+"\">"; nameSuffixString = "</a>"; } if(advancedEnabled) { versionString = HTMLEncoder.encode(pn.getVersion()); } else { versionString = HTMLEncoder.encode(pn.getSimpleVersion()); } row[0] = pn; row[1] = "<input type=\"checkbox\" name=\"node_"+pn.hashCode()+"\" />"; row[2] = status; row[3] = namePrefixString+HTMLEncoder.encode(pn.getName())+nameSuffixString; row[4] = ( pn.getDetectedPeer() != null ? HTMLEncoder.encode(pn.getDetectedPeer().toString()) : "(address unknown)" ) + avgPingTimeString; row[5] = versionPrefixString+versionString+versionSuffixString; row[6] = new Double(pn.getLocation().getValue()); row[7] = fix1.format(pn.backedOffPercent.currentValue())+" "+backoff/1000 + "/" + pn.getRoutingBackoffLength()/1000+lastBackoffReasonOutputString; row[8] = idleToString(now, idle, ((Integer) status).intValue()); row[9] = HTMLEncoder.encode(pn.getName()); } // Sort array Arrays.sort(rows, new MyComparator()); // Convert status codes into status strings for(int i=0;i<rows.length;i++) { Object[] row = rows[i]; String arkAsterisk = ""; if(advancedEnabled) { if(((PeerNode) row[0]).isFetchingARK()) { arkAsterisk = "*"; } } String statusString = ((PeerNode) row[0]).getPeerNodeStatusString(); if(!advancedEnabled && ((PeerNode) row[0]).getPeerNodeStatus() == Node.PEER_NODE_STATUS_ROUTING_BACKED_OFF) { statusString = "BUSY"; } row[2] = "<span class=\""+((PeerNode) row[0]).getPeerNodeStatusCSSClassName()+"\">"+statusString+arkAsterisk+"</span>"; } // Turn array into HTML for(int i=0;i<rows.length;i++) { Object[] row = rows[i]; buf2.append("<tr>"); for(int j=1;j<row.length;j++) { // skip index 0 as it's the PeerNode object if(j == 9) { // skip index 9 as it's used for sorting purposes only continue; } if(!advancedEnabled) { // if not in advanced Darknet page output mode if( j == 4 || j == 6 || j == 7 ) { // skip IP address/name, location and backoff times continue; } } buf2.append("<td>"+row[j]+"</td>"); } buf2.append("</tr>\n"); if (path.endsWith("displaymessagetypes.html")) { buf2.append("<tr class=\"messagetypes\"><td colspan=\"8\">\n"); buf2.append("<table class=\"sentmessagetypes\">\n"); buf2.append("<tr><th>Sent Message Type</th><th>Count</th></tr>\n"); for (Enumeration keys=((PeerNode)row[0]).getLocalNodeSentMessagesToStatistic().keys(); keys.hasMoreElements(); ) { Object curkey = keys.nextElement(); buf2.append("<tr><td>"); buf2.append((String)curkey); buf2.append("</td><td>"); buf2.append(((Long)((PeerNode)row[0]).getLocalNodeSentMessagesToStatistic().get(curkey)) + ""); buf2.append("</td></tr>\n"); } buf2.append("</table>\n"); buf2.append("<table class=\"receivedmessagetypes\">\n"); buf2.append("<tr><th>Received Message Type</th><th>Count</th></tr>\n"); for (Enumeration keys=((PeerNode)row[0]).getLocalNodeReceivedMessagesFromStatistic().keys(); keys.hasMoreElements(); ) { Object curkey = keys.nextElement(); buf2.append("<tr><td>"); buf2.append((String)curkey); buf2.append("</td><td>"); buf2.append(((Long)((PeerNode)row[0]).getLocalNodeReceivedMessagesFromStatistic().get(curkey)) + ""); buf2.append("</td></tr>\n"); } buf2.append("</table>\n"); buf2.append("</td></tr>\n"); } } buf2.append("</table>\n"); // buf.append(buf2); // if(!advancedEnabled) { buf.append("<input type=\"submit\" name=\"remove\" value=\"Remove selected peers\" />"); } else { buf.append("<select name=\"action\">\n"); buf.append(" <option value=\"\">-- Select Action --</option>\n"); buf.append(" <option value=\"enable\">Enable Selected Peers</option>\n"); buf.append(" <option value=\"disable\">Disable Selected Peers</option>\n"); buf.append(" <option value=\"set_listen_only\">On Selected Peers, Set ListenOnly</option>\n"); buf.append(" <option value=\"clear_listen_only\">On Selected Peers, Clear ListenOnly</option>\n"); buf.append(" <option value=\"\">-- -- --</option>\n"); buf.append(" <option value=\"remove\">Remove Selected Peers</option>\n"); buf.append("</select>\n"); buf.append("<input type=\"submit\" name=\"submit\" value=\"Go\" />\n"); buf.append("&nbsp;&nbsp;&nbsp;<span class=\"darknet_connections\">* Requesting ARK</span>\n"); } buf.append("<input type=\"hidden\" name=\"formPassword\" value=\"").append(node.formPassword).append("\" />"); buf.append("</form>\n"); } buf.append("</div>\n"); buf.append("</div>\n"); // new peer addition box buf.append("<div class=\"infobox infobox-normal\">\n"); buf.append("<div class=\"infobox-header\">\n"); buf.append("Add another peer\n"); buf.append("</div>\n"); buf.append("<div class=\"infobox-content\">\n"); buf.append("<form action=\".\" method=\"post\" enctype=\"multipart/form-data\">\n"); buf.append("Reference:<br />\n"); buf.append("<textarea id=\"reftext\" name=\"ref\" rows=\"8\" cols=\"74\"></textarea>\n"); buf.append("<br />\n"); buf.append("or URL:\n"); buf.append("<input id=\"refurl\" type=\"text\" name=\"url\" />\n"); buf.append("<br />\n"); buf.append("or file:\n"); buf.append("<input id=\"reffile\" type=\"file\" name=\"reffile\" />\n"); buf.append("<br />\n"); buf.append("<input type=\"hidden\" name=\"formPassword\" value=\"").append(node.formPassword).append("\" />"); buf.append("<input type=\"submit\" name=\"add\" value=\"Add\" />\n"); buf.append("</form>\n"); buf.append("</div>\n"); buf.append("</div>\n"); // our reference buf.append("<div class=\"infobox infobox-normal\">\n"); buf.append("<div class=\"infobox-header\">\n"); buf.append("<a href=\"myref.txt\">My Reference</a>\n"); buf.append("</div>\n"); buf.append("<div class=\"infobox-content\">\n"); buf.append("<pre id=\"reference\">\n"); buf.append(HTMLEncoder.encode(this.node.exportPublicFieldSet().toString())); buf.append("</pre>\n"); buf.append("</div>\n"); buf.append("</div>\n"); ctx.getPageMaker().makeTail(buf); this.writeReply(ctx, 200, "text/html", "OK", buf.toString()); }
51738 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/51738/ca136843ae9ecb30cadada58a33a5dc2cf8ad064/DarknetConnectionsToadlet.java/buggy/src/freenet/clients/http/DarknetConnectionsToadlet.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1640, 967, 12, 3098, 2003, 16, 2974, 361, 1810, 1042, 1103, 13, 1216, 2974, 361, 1810, 1042, 7395, 503, 16, 1860, 16, 9942, 503, 288, 9506, 202, 780, 589, 273, 2003, 18, 588, 743, 5621, 202, 202, 430, 12, 803, 18, 5839, 1190, 2932, 4811, 1734, 18, 5830, 6, 3719, 288, 1082, 202, 5784, 974, 694, 2662, 273, 756, 18, 6530, 4782, 974, 694, 5621, 1082, 202, 780, 2289, 1352, 273, 394, 17436, 5621, 1082, 202, 2556, 18, 2626, 774, 12, 5328, 1769, 1082, 202, 2211, 18, 2626, 7817, 12, 5900, 16, 4044, 16, 315, 955, 19, 7446, 3113, 315, 3141, 3113, 1352, 18, 10492, 10663, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 780, 1892, 1681, 273, 394, 6674, 12, 2163, 3247, 1769, 9506, 202, 759, 23891, 590, 273, 394, 25238, 12, 1650, 1769, 9506, 202, 6385, 1250, 16111, 1526, 273, 756, 18, 588, 774, 361, 1810, 2170, 7675, 291, 23618, 40, 1313, 2758, 1526, 5621, 9506, 202, 20308, 11090, 1459, 7691, 1195, 202, 202, 474, 7922, 8932, 273, 756, 18, 588, 6813, 907, 1482, 1225, 12, 907, 18, 1423, 654, 67, 8744, 67, 8608, 67, 29011, 1769, 202, 202, 474, 7922, 13966, 2711, 329, 7210, 273, 756, 18, 588, 6813, 907, 1482, 1225, 12, 907, 18, 1423, 654, 67, 8744, 67, 8608, 67, 1457, 1693, 1360, 67, 8720, 2056, 67, 8797, 1769, 202, 202, 474, 7922, 10703, 1908, 273, 756, 18, 588, 6813, 907, 1482, 1225, 12, 907, 18, 1423, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1640, 967, 12, 3098, 2003, 16, 2974, 361, 1810, 1042, 1103, 13, 1216, 2974, 361, 1810, 1042, 7395, 503, 16, 1860, 16, 9942, 503, 288, 9506, 202, 780, 589, 273, 2003, 18, 588, 743, 5621, 202, 202, 430, 12, 803, 18, 5839, 1190, 2932, 4811, 1734, 18, 5830, 6, 3719, 288, 1082, 202, 5784, 974, 694, 2662, 273, 756, 18, 6530, 4782, 974, 694, 5621, 1082, 202, 780, 2289, 1352, 273, 394, 17436, 5621, 1082, 202, 2556, 18, 2626, 774, 12, 5328, 1769, 1082, 202, 2211, 18, 2626, 7817, 12, 5900, 16, 4044, 16, 315, 955, 19, 7446, 3113, 315, 3141, 3113, 1352, 18, 10492, 10663, 1082, 202, 2463, 31, 202, 202, 97, 202, 202, 2 ]
Object key = keys.nextElement(); Object val = copyValue(in.get(key));
Object key = keys.nextElement(); Object origVal = in.get(key); Object val = copyValue(origVal);
static public Hashtable copyDictionary(Dictionary in) { if(in == null) { return null; } Hashtable out = new Hashtable(); Enumeration keys = in.keys(); while(keys.hasMoreElements()) { Object key = keys.nextElement(); Object val = copyValue(in.get(key)); // The R3 tests prefers keys with different case to be // silently unified. We really prefer IllegalArgumentException String s = (String)key; String lower = s.toLowerCase(); if(!s.equals(lower)) { if(null != in.get(lower)) { if(Activator.r3TestCompliant()) { key = lower; } else { throw new IllegalArgumentException("same key exists with different case: " + key + "/" + lower); } } } out.put(key, val); } return out; }
13251 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13251/39c94c7a265db7932297ee89f34b774221d2a874/ConfigurationDictionary.java/buggy/osgi/bundles/cm/cm/src/org/knopflerfish/bundle/cm/ConfigurationDictionary.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 760, 1071, 18559, 1610, 10905, 12, 10905, 316, 13, 288, 565, 309, 12, 267, 422, 446, 13, 288, 1377, 327, 446, 31, 565, 289, 565, 18559, 596, 273, 394, 18559, 5621, 565, 13864, 1311, 273, 316, 18, 2452, 5621, 565, 1323, 12, 2452, 18, 5332, 7417, 3471, 10756, 288, 1377, 1033, 498, 273, 1311, 18, 4285, 1046, 5621, 1377, 1033, 1244, 273, 1610, 620, 12, 267, 18, 588, 12, 856, 10019, 1377, 368, 1021, 534, 23, 7434, 11307, 414, 1311, 598, 3775, 648, 358, 506, 1377, 368, 22274, 27136, 18, 1660, 8654, 13256, 2754, 1377, 514, 272, 377, 273, 261, 780, 13, 856, 31, 1377, 514, 2612, 273, 272, 18, 869, 5630, 5621, 1377, 309, 12, 5, 87, 18, 14963, 12, 8167, 3719, 288, 202, 430, 12, 2011, 480, 316, 18, 588, 12, 8167, 3719, 288, 202, 225, 309, 12, 12241, 639, 18, 86, 23, 4709, 799, 18515, 10756, 288, 202, 565, 498, 273, 2612, 31, 202, 225, 289, 469, 288, 202, 565, 604, 394, 2754, 2932, 14307, 498, 1704, 598, 3775, 648, 30, 315, 397, 498, 397, 4016, 397, 2612, 1769, 202, 225, 289, 202, 97, 1377, 289, 1377, 596, 18, 458, 12, 856, 16, 1244, 1769, 565, 289, 565, 327, 596, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 760, 1071, 18559, 1610, 10905, 12, 10905, 316, 13, 288, 565, 309, 12, 267, 422, 446, 13, 288, 1377, 327, 446, 31, 565, 289, 565, 18559, 596, 273, 394, 18559, 5621, 565, 13864, 1311, 273, 316, 18, 2452, 5621, 565, 1323, 12, 2452, 18, 5332, 7417, 3471, 10756, 288, 1377, 1033, 498, 273, 1311, 18, 4285, 1046, 5621, 1377, 1033, 1244, 273, 1610, 620, 12, 267, 18, 588, 12, 856, 10019, 1377, 368, 1021, 534, 23, 7434, 11307, 414, 1311, 598, 3775, 648, 358, 506, 1377, 368, 22274, 27136, 18, 1660, 8654, 13256, 2754, 1377, 514, 272, 377, 273, 261, 780, 13, 856, 31, 1377, 514, 2612, 273, 272, 18, 869, 5630, 5621, 1377, 309, 12, 5, 87, 2 ]
buf.append(leading).append(font().toString());
buf.append(leading).append(font.toString());
public String toString() { StringBuffer buf = new StringBuffer("<").append(ElementTags.PARAGRAPH).append(" ").append(ElementTags.LEADING).append("=\""); buf.append(leading).append(font().toString()); buf.append("\" ").append(ElementTags.ALIGN).append("=\""); buf.append(ElementTags.getAlignment(alignment)); if (indentationLeft != 0) { buf.append("\" ").append(ElementTags.INDENTATIONLEFT).append("=\""); buf.append(indentationLeft); } if (indentationRight != 0) { buf.append("\" ").append(ElementTags.INDENTATIONRIGHT).append("=\""); buf.append(indentationRight); } buf.append("\">"); for (Iterator i = iterator(); i.hasNext(); ) { buf.append(i.next().toString()); } buf.append("</").append(ElementTags.PARAGRAPH).append(">\n"); return buf.toString(); }
3011 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3011/3a2d835c3d93873589949d3bea5d004641372386/Paragraph.java/buggy/itext/src/com/lowagie/text/Paragraph.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1762, 1435, 288, 3639, 6674, 1681, 273, 394, 6674, 2932, 32, 20387, 6923, 12, 1046, 3453, 18, 2778, 1781, 54, 18045, 2934, 6923, 2932, 315, 2934, 6923, 12, 1046, 3453, 18, 900, 30118, 2934, 6923, 2932, 5189, 8863, 3639, 1681, 18, 6923, 12, 27200, 2934, 6923, 12, 5776, 18, 10492, 10663, 3639, 1681, 18, 6923, 2932, 2412, 315, 2934, 6923, 12, 1046, 3453, 18, 26439, 2934, 6923, 2932, 5189, 8863, 3639, 1681, 18, 6923, 12, 1046, 3453, 18, 588, 11535, 12, 14409, 10019, 3639, 309, 261, 9355, 367, 3910, 480, 374, 13, 288, 5411, 1681, 18, 6923, 2932, 2412, 315, 2934, 6923, 12, 1046, 3453, 18, 2356, 2222, 2689, 10066, 2934, 6923, 2932, 5189, 8863, 5411, 1681, 18, 6923, 12, 9355, 367, 3910, 1769, 3639, 289, 3639, 309, 261, 9355, 367, 4726, 480, 374, 13, 288, 5411, 1681, 18, 6923, 2932, 2412, 315, 2934, 6923, 12, 1046, 3453, 18, 2356, 2222, 2689, 11847, 2934, 6923, 2932, 5189, 8863, 5411, 1681, 18, 6923, 12, 9355, 367, 4726, 1769, 3639, 289, 3639, 1681, 18, 6923, 2932, 21121, 1769, 3639, 364, 261, 3198, 277, 273, 2775, 5621, 277, 18, 5332, 2134, 5621, 262, 288, 5411, 1681, 18, 6923, 12, 77, 18, 4285, 7675, 10492, 10663, 3639, 289, 3639, 1681, 18, 6923, 2932, 1757, 20387, 6923, 12, 1046, 3453, 18, 2778, 1781, 54, 18045, 2934, 6923, 2932, 5333, 82, 8863, 3639, 327, 1681, 18, 10492, 5621, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 1762, 1435, 288, 3639, 6674, 1681, 273, 394, 6674, 2932, 32, 20387, 6923, 12, 1046, 3453, 18, 2778, 1781, 54, 18045, 2934, 6923, 2932, 315, 2934, 6923, 12, 1046, 3453, 18, 900, 30118, 2934, 6923, 2932, 5189, 8863, 3639, 1681, 18, 6923, 12, 27200, 2934, 6923, 12, 5776, 18, 10492, 10663, 3639, 1681, 18, 6923, 2932, 2412, 315, 2934, 6923, 12, 1046, 3453, 18, 26439, 2934, 6923, 2932, 5189, 8863, 3639, 1681, 18, 6923, 12, 1046, 3453, 18, 588, 11535, 12, 14409, 10019, 3639, 309, 261, 9355, 367, 3910, 480, 374, 13, 288, 5411, 1681, 18, 6923, 2932, 2412, 315, 2934, 6923, 12, 1046, 3453, 18, 2356, 2222, 2689, 10066, 2934, 6923, 2932, 5189, 8863, 5411, 2 ]
return jjMoveStringLiteralDfa6_0(active0, 0x400000000400L);
return jjMoveStringLiteralDfa6_0(active0, 0x2000000000400L); case 79: case 111: return jjMoveStringLiteralDfa6_0(active0, 0x8000L);
private final int jjMoveStringLiteralDfa5_0(long old0, long active0){ if (((active0 &= old0)) == 0L) return jjStartNfa_0(3, old0); try { curChar = input_stream.readChar(); } catch(java.io.IOException e) { jjStopStringLiteralDfa_0(4, active0); return 5; } switch(curChar) { case 58: if ((active0 & 0x2000000L) != 0L) return jjStopAtPos(5, 25); else if ((active0 & 0x8000000L) != 0L) return jjStopAtPos(5, 27); else if ((active0 & 0x100000000000L) != 0L) return jjStopAtPos(5, 44); break; case 65: case 97: return jjMoveStringLiteralDfa6_0(active0, 0x800000040000L); case 67: case 99: return jjMoveStringLiteralDfa6_0(active0, 0x4000000800L); case 69: case 101: return jjMoveStringLiteralDfa6_0(active0, 0x40210000000L); case 71: case 103: return jjMoveStringLiteralDfa6_0(active0, 0x800000000L); case 72: case 104: return jjMoveStringLiteralDfa6_0(active0, 0x100000L); case 77: case 109: return jjMoveStringLiteralDfa6_0(active0, 0x18000000000L); case 78: case 110: return jjMoveStringLiteralDfa6_0(active0, 0x400000000400L); case 82: case 114: return jjMoveStringLiteralDfa6_0(active0, 0x280000000000L); case 83: case 115: return jjMoveStringLiteralDfa6_0(active0, 0x20000000000L); case 89: case 121: return jjMoveStringLiteralDfa6_0(active0, 0x2000000000000L); default : break; } return jjStartNfa_0(4, active0);}
6965 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6965/310be8d52869f0ee2c185cb657525fc655f30133/ZimbraQueryParserTokenManager.java/buggy/ZimbraServer/src/java/com/zimbra/cs/index/queryparser/ZimbraQueryParserTokenManager.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 727, 509, 10684, 7607, 28565, 40, 507, 25, 67, 20, 12, 5748, 1592, 20, 16, 1525, 2695, 20, 15329, 282, 309, 261, 12443, 3535, 20, 12058, 1592, 20, 3719, 422, 374, 48, 13, 1377, 327, 10684, 1685, 50, 507, 67, 20, 12, 23, 16, 1592, 20, 1769, 565, 775, 288, 662, 2156, 273, 810, 67, 3256, 18, 896, 2156, 5621, 289, 282, 1044, 12, 6290, 18, 1594, 18, 14106, 425, 13, 288, 1377, 10684, 4947, 28565, 40, 507, 67, 20, 12, 24, 16, 2695, 20, 1769, 1377, 327, 1381, 31, 282, 289, 282, 1620, 12, 1397, 2156, 13, 282, 288, 1377, 648, 17066, 30, 540, 309, 14015, 3535, 20, 473, 374, 92, 22, 9449, 48, 13, 480, 374, 48, 13, 5411, 327, 10684, 4947, 861, 1616, 12, 25, 16, 6969, 1769, 540, 469, 309, 14015, 3535, 20, 473, 374, 92, 28, 9449, 48, 13, 480, 374, 48, 13, 5411, 327, 10684, 4947, 861, 1616, 12, 25, 16, 12732, 1769, 540, 469, 309, 14015, 3535, 20, 473, 374, 92, 21, 12648, 3784, 48, 13, 480, 374, 48, 13, 5411, 327, 10684, 4947, 861, 1616, 12, 25, 16, 13291, 1769, 540, 898, 31, 1377, 648, 15892, 30, 1377, 648, 16340, 30, 540, 327, 10684, 7607, 28565, 40, 507, 26, 67, 20, 12, 3535, 20, 16, 374, 92, 28, 9449, 24, 2787, 48, 1769, 1377, 648, 21017, 30, 1377, 648, 14605, 30, 540, 327, 10684, 7607, 28565, 40, 507, 26, 67, 20, 12, 3535, 20, 16, 374, 92, 24, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3238, 727, 509, 10684, 7607, 28565, 40, 507, 25, 67, 20, 12, 5748, 1592, 20, 16, 1525, 2695, 20, 15329, 282, 309, 261, 12443, 3535, 20, 12058, 1592, 20, 3719, 422, 374, 48, 13, 1377, 327, 10684, 1685, 50, 507, 67, 20, 12, 23, 16, 1592, 20, 1769, 565, 775, 288, 662, 2156, 273, 810, 67, 3256, 18, 896, 2156, 5621, 289, 282, 1044, 12, 6290, 18, 1594, 18, 14106, 425, 13, 288, 1377, 10684, 4947, 28565, 40, 507, 67, 20, 12, 24, 16, 2695, 20, 1769, 1377, 327, 1381, 31, 282, 289, 282, 1620, 12, 1397, 2156, 13, 282, 288, 1377, 648, 17066, 30, 540, 309, 14015, 3535, 20, 473, 374, 92, 22, 9449, 48, 13, 480, 374, 2 ]
m_addr = dup(addr.getAddress());
m_addr = new byte[4]; m_addr[0] = 0; m_addr[1] = 0; m_addr[2] = 0; m_addr[3] = 0;
public IPv4Address(InetAddress addr) { m_addr = dup(addr.getAddress()); }
11849 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/11849/b3612967cb053036bdb295ee74cb2e369c6ca18d/IPv4Address.java/buggy/src/services/org/opennms/protocols/ip/IPv4Address.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 7853, 24, 1887, 12, 382, 278, 1887, 3091, 13, 202, 95, 202, 202, 81, 67, 4793, 273, 9417, 12, 4793, 18, 588, 1887, 10663, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 7853, 24, 1887, 12, 382, 278, 1887, 3091, 13, 202, 95, 202, 202, 81, 67, 4793, 273, 9417, 12, 4793, 18, 588, 1887, 10663, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
BigInteger p, q, g, x;
BigInteger version, p, q, g, x;
public PrivateKey decodePrivateKey(byte[] input) { if (input == null) throw new InvalidParameterException("Input bytes MUST NOT be null"); BigInteger p, q, g, x; DERReader der = new DERReader(input); try { DERValue derPKI = der.read(); checkIsConstructed(derPKI, "Wrong PrivateKeyInfo field"); DERValue derVersion = der.read(); if (! (derVersion.getValue() instanceof BigInteger)) throw new InvalidParameterException("Wrong Version field"); DERValue derAlgoritmID = der.read(); checkIsConstructed(derAlgoritmID, "Wrong AlgorithmIdentifier field"); DERValue derOID = der.read(); OID algOID = (OID) derOID.getValue(); if (! algOID.equals(DSA_ALG_OID)) throw new InvalidParameterException("Unexpected OID: " + algOID); DERValue derParams = der.read(); checkIsConstructed(derParams, "Wrong DSS Parameters field"); DERValue val = der.read(); checkIsBigInteger(val, "Wrong P field"); p = (BigInteger) val.getValue(); val = der.read(); checkIsBigInteger(val, "Wrong Q field"); q = (BigInteger) val.getValue(); val = der.read(); checkIsBigInteger(val, "Wrong G field"); g = (BigInteger) val.getValue(); val = der.read(); byte[] xBytes = (byte[]) val.getValue(); x = new BigInteger(1, xBytes); } catch (IOException e) { InvalidParameterException y = new InvalidParameterException(); y.initCause(e); throw y; } return new DSSPrivateKey(Registry.PKCS8_ENCODING_ID, p, q, g, x); }
47947 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47947/9460f315752210eeb2a38061e30cf2b9a9009ddf/DSSKeyPairPKCS8Codec.java/clean/gnu/java/security/key/dss/DSSKeyPairPKCS8Codec.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 14018, 2495, 10824, 12, 7229, 8526, 810, 13, 225, 288, 565, 309, 261, 2630, 422, 446, 13, 1377, 604, 394, 26669, 2932, 1210, 1731, 10685, 4269, 506, 446, 8863, 565, 10246, 1177, 16, 293, 16, 1043, 16, 314, 16, 619, 31, 565, 21801, 2514, 4854, 273, 394, 21801, 2514, 12, 2630, 1769, 565, 775, 1377, 288, 3639, 21801, 620, 4854, 8784, 45, 273, 4854, 18, 896, 5621, 3639, 866, 2520, 7249, 329, 12, 765, 8784, 45, 16, 315, 13634, 14018, 966, 652, 8863, 3639, 21801, 620, 4854, 1444, 273, 4854, 18, 896, 5621, 3639, 309, 16051, 261, 765, 1444, 18, 24805, 1435, 1276, 10246, 3719, 1850, 604, 394, 26669, 2932, 13634, 4049, 652, 8863, 3639, 21801, 620, 4854, 1067, 3022, 305, 81, 734, 273, 4854, 18, 896, 5621, 3639, 866, 2520, 7249, 329, 12, 765, 1067, 3022, 305, 81, 734, 16, 315, 13634, 15067, 3004, 652, 8863, 3639, 21801, 620, 4854, 12945, 273, 4854, 18, 896, 5621, 3639, 18026, 11989, 12945, 273, 261, 12945, 13, 4854, 12945, 18, 24805, 5621, 3639, 309, 16051, 11989, 12945, 18, 14963, 12, 19748, 67, 1013, 43, 67, 12945, 3719, 1850, 604, 394, 26669, 2932, 7762, 18026, 30, 315, 397, 11989, 12945, 1769, 3639, 21801, 620, 4854, 1370, 273, 4854, 18, 896, 5621, 3639, 866, 2520, 7249, 329, 12, 765, 1370, 16, 315, 13634, 463, 1260, 7012, 652, 8863, 3639, 21801, 620, 1244, 273, 4854, 18, 896, 5621, 3639, 866, 2520, 24198, 12, 1125, 16, 315, 13634, 453, 652, 8863, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 14018, 2495, 10824, 12, 7229, 8526, 810, 13, 225, 288, 565, 309, 261, 2630, 422, 446, 13, 1377, 604, 394, 26669, 2932, 1210, 1731, 10685, 4269, 506, 446, 8863, 565, 10246, 1177, 16, 293, 16, 1043, 16, 314, 16, 619, 31, 565, 21801, 2514, 4854, 273, 394, 21801, 2514, 12, 2630, 1769, 565, 775, 1377, 288, 3639, 21801, 620, 4854, 8784, 45, 273, 4854, 18, 896, 5621, 3639, 866, 2520, 7249, 329, 12, 765, 8784, 45, 16, 315, 13634, 14018, 966, 652, 8863, 3639, 21801, 620, 4854, 1444, 273, 4854, 18, 896, 5621, 3639, 309, 16051, 261, 765, 1444, 18, 24805, 1435, 1276, 10246, 3719, 1850, 604, 394, 26669, 2932, 13634, 4049, 652, 8863, 3639, 21801, 620, 2 ]
pc += 3 * ARG_LEN;
pc += 3 * INDEX_LEN;
executeREBytecode(REGlobalData gData, char[] chars, int end) { int pc = 0; byte program[] = gData.regexp.program; int op = program[pc++]; int currentContinuation_op; int currentContinuation_pc; boolean result = false; currentContinuation_pc = 0; currentContinuation_op = REOP_END;if (debug) {System.out.println("Input = \"" + new String(chars) + "\", start at " + gData.cp);} for (;;) {if (debug) {System.out.println("Testing at " + gData.cp + ", op = " + op);} switch (op) { case REOP_EMPTY: result = true; break; case REOP_BOL: if (gData.cp != 0) { if (gData.multiline || ((gData.regexp.flags & JSREG_MULTILINE) != 0)) { if (!isLineTerm(chars[gData.cp - 1])) { result = false; break; } } else { result = false; break; } } result = true; break; case REOP_EOL: if (gData.cp != end) { if (gData.multiline || ((gData.regexp.flags & JSREG_MULTILINE) != 0)) { if (!isLineTerm(chars[gData.cp])) { result = false; break; } } else { result = false; break; } } result = true; break; case REOP_WBDRY: result = ((gData.cp == 0 || !isWord(chars[gData.cp - 1])) ^ !((gData.cp < end) && isWord(chars[gData.cp]))); break; case REOP_WNONBDRY: result = ((gData.cp == 0 || !isWord(chars[gData.cp - 1])) ^ ((gData.cp < end) && isWord(chars[gData.cp]))); break; case REOP_DOT: result = (gData.cp != end && !isLineTerm(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_DIGIT: result = (gData.cp != end && isDigit(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_NONDIGIT: result = (gData.cp != end && !isDigit(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_SPACE: result = (gData.cp != end && isREWhiteSpace(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_NONSPACE: result = (gData.cp != end && !isREWhiteSpace(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_ALNUM: result = (gData.cp != end && isWord(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_NONALNUM: result = (gData.cp != end && !isWord(chars[gData.cp])); if (result) { gData.cp++; } break; case REOP_FLAT: { int offset = GET_ARG(program, pc); pc += ARG_LEN; int length = GET_ARG(program, pc); pc += ARG_LEN; result = flatNMatcher(gData, offset, length, chars, end); } break; case REOP_FLATi: { int offset = GET_ARG(program, pc); pc += ARG_LEN; int length = GET_ARG(program, pc); pc += ARG_LEN; result = flatNIMatcher(gData, offset, length, chars, end); } break; case REOP_FLAT1: { char matchCh = (char)(program[pc++] & 0xFF); result = (gData.cp != end && chars[gData.cp] == matchCh); if (result) { gData.cp++; } } break; case REOP_FLAT1i: { char matchCh = (char)(program[pc++] & 0xFF); result = (gData.cp != end && upcase(chars[gData.cp]) == upcase(matchCh)); if (result) { gData.cp++; } } break; case REOP_UCFLAT1: { char matchCh = (char)GET_ARG(program, pc); pc += ARG_LEN; result = (gData.cp != end && chars[gData.cp] == matchCh); if (result) { gData.cp++; } } break; case REOP_UCFLAT1i: { char matchCh = (char)GET_ARG(program, pc); pc += ARG_LEN; result = (gData.cp != end && upcase(chars[gData.cp]) == upcase(matchCh)); if (result) { gData.cp++; } } break; case REOP_ALT: { int nextpc; byte nextop; pushProgState(gData, 0, 0, null, currentContinuation_pc, currentContinuation_op); nextpc = pc + GET_OFFSET(program, pc); nextop = program[nextpc++]; pushBackTrackState(gData, nextop, nextpc); pc += ARG_LEN; op = program[pc++]; } continue; case REOP_JUMP: { int offset; REProgState state = popProgState(gData); currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; offset = GET_OFFSET(program, pc); pc += offset; op = program[pc++]; } continue; case REOP_LPAREN: { int parenIndex = GET_ARG(program, pc); pc += ARG_LEN; gData.set_parens(parenIndex, gData.cp, 0); op = program[pc++]; } continue; case REOP_RPAREN: { int cap_index; int parenIndex = GET_ARG(program, pc); pc += ARG_LEN; cap_index = gData.parens_index(parenIndex); gData.set_parens(parenIndex, cap_index, gData.cp - cap_index); if (parenIndex > gData.lastParen) gData.lastParen = parenIndex; op = program[pc++]; } continue; case REOP_BACKREF: { int parenIndex = GET_ARG(program, pc); pc += ARG_LEN; result = backrefMatcher(gData, parenIndex, chars, end); } break; case REOP_CLASS: { int index = GET_ARG(program, pc); pc += ARG_LEN; if (gData.cp != end) { if (classMatcher(gData, gData.regexp.classList[index], chars[gData.cp])) { gData.cp++; result = true; break; } } result = false; } break; case REOP_ASSERT: case REOP_ASSERT_NOT: { byte testOp; pushProgState(gData, 0, 0, gData.backTrackLast, currentContinuation_pc, currentContinuation_op); if (op == REOP_ASSERT) { testOp = REOP_ASSERTTEST; } else { testOp = REOP_ASSERTNOTTEST; } pushBackTrackState(gData, testOp, pc + GET_OFFSET(program, pc)); pc += ARG_LEN; op = program[pc++]; } continue; case REOP_ASSERTTEST: case REOP_ASSERTNOTTEST: { REProgState state = popProgState(gData); gData.cp = state.index; gData.backTrackLast = state.savedBackTrackLast; currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; if (result) { if (op == REOP_ASSERTTEST) { result = true; } else { result = false; } } else { if (op == REOP_ASSERTTEST) { // Do nothing } else { result = true; } } } break; case REOP_STAR: case REOP_PLUS: case REOP_OPT: case REOP_QUANT: case REOP_MINIMALSTAR: case REOP_MINIMALPLUS: case REOP_MINIMALOPT: case REOP_MINIMALQUANT: { int min, max; boolean greedy = false; switch (op) { case REOP_STAR: greedy = true; // fallthrough case REOP_MINIMALSTAR: min = 0; max = -1; break; case REOP_PLUS: greedy = true; // fallthrough case REOP_MINIMALPLUS: min = 1; max = -1; break; case REOP_OPT: greedy = true; // fallthrough case REOP_MINIMALOPT: min = 0; max = 1; break; case REOP_QUANT: greedy = true; // fallthrough case REOP_MINIMALQUANT: min = GET_ARG(program, pc); pc += ARG_LEN; max = GET_ARG(program, pc); pc += ARG_LEN; break; default: throw Kit.codeBug(); } pushProgState(gData, min, max, null, currentContinuation_pc, currentContinuation_op); if (greedy) { currentContinuation_op = REOP_REPEAT; currentContinuation_pc = pc; pushBackTrackState(gData, REOP_REPEAT, pc); /* Step over <parencount>, <parenindex> & <next> */ pc += 3 * ARG_LEN; op = program[pc++]; } else { if (min != 0) { currentContinuation_op = REOP_MINIMALREPEAT; currentContinuation_pc = pc; /* <parencount> <parenindex> & <next> */ pc += 3 * ARG_LEN; op = program[pc++]; } else { pushBackTrackState(gData, REOP_MINIMALREPEAT, pc); popProgState(gData); pc += 2 * ARG_LEN; // <parencount> & <parenindex> pc = pc + GET_OFFSET(program, pc); op = program[pc++]; } } } continue; case REOP_ENDCHILD: pc = currentContinuation_pc; op = currentContinuation_op; continue; case REOP_REPEAT: { REProgState state = popProgState(gData); if (!result) { // // There's been a failure, see if we have enough // children. // if (state.min == 0) result = true; currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; pc += 2 * ARG_LEN; /* <parencount> & <parenindex> */ pc = pc + GET_OFFSET(program, pc); break; } else { if (state.min == 0 && gData.cp == state.index) { // matched an empty string, that'll get us nowhere result = false; currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; pc += 2 * ARG_LEN; pc = pc + GET_OFFSET(program, pc); break; } int new_min = state.min, new_max = state.max; if (new_min != 0) new_min--; if (new_max != -1) new_max--; if (new_max == 0) { result = true; currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; pc += 2 * ARG_LEN; pc = pc + GET_OFFSET(program, pc); break; } pushProgState(gData, new_min, new_max, null, state.continuation_pc, state.continuation_op); currentContinuation_op = REOP_REPEAT; currentContinuation_pc = pc; pushBackTrackState(gData, REOP_REPEAT, pc); int parenCount = GET_ARG(program, pc); pc += ARG_LEN; int parenIndex = GET_ARG(program, pc); pc += 2 * ARG_LEN; op = program[pc++]; for (int k = 0; k < parenCount; k++) { gData.set_parens(parenIndex + k, -1, 0); } } } continue; case REOP_MINIMALREPEAT: { REProgState state = popProgState(gData); if (!result) { // // Non-greedy failure - try to consume another child. // if (state.max == -1 || state.max > 0) { pushProgState(gData, state.min, state.max, null, state.continuation_pc, state.continuation_op); currentContinuation_op = REOP_MINIMALREPEAT; currentContinuation_pc = pc; int parenCount = GET_ARG(program, pc); pc += ARG_LEN; int parenIndex = GET_ARG(program, pc); pc += 2 * ARG_LEN; for (int k = 0; k < parenCount; k++) { gData.set_parens(parenIndex + k, -1, 0); } op = program[pc++]; continue; } else { // Don't need to adjust pc since we're going to pop. currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; break; } } else { if (state.min == 0 && gData.cp == state.index) { // Matched an empty string, that'll get us nowhere. result = false; currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; break; } int new_min = state.min, new_max = state.max; if (new_min != 0) new_min--; if (new_max != -1) new_max--; pushProgState(gData, new_min, new_max, null, state.continuation_pc, state.continuation_op); if (new_min != 0) { currentContinuation_op = REOP_MINIMALREPEAT; currentContinuation_pc = pc; int parenCount = GET_ARG(program, pc); pc += ARG_LEN; int parenIndex = GET_ARG(program, pc); pc += 2 * ARG_LEN; for (int k = 0; k < parenCount; k++) { gData.set_parens(parenIndex + k, -1, 0); } op = program[pc++]; } else { currentContinuation_pc = state.continuation_pc; currentContinuation_op = state.continuation_op; pushBackTrackState(gData, REOP_MINIMALREPEAT, pc); popProgState(gData); pc += 2 * ARG_LEN; pc = pc + GET_OFFSET(program, pc); op = program[pc++]; } continue; } } case REOP_END: return true; default: throw Kit.codeBug(); } /* * If the match failed and there's a backtrack option, take it. * Otherwise this is a complete and utter failure. */ if (!result) { REBackTrackData backTrackData = gData.backTrackLast; if (backTrackData != null) { gData.backTrackLast = backTrackData.previous; gData.lastParen = backTrackData.lastParen; // XXX: If backTrackData will no longer be used, then // there is no need to clone backTrackData.parens if (backTrackData.parens != null) { gData.parens = (long[])backTrackData.parens.clone(); } gData.cp = backTrackData.cp; for (int k = 0; k < backTrackData.precedingStateTop; k++) gData.stateStack[k] = backTrackData.precedingState[k]; gData.stateStackTop = backTrackData.precedingStateTop + 1; gData.stateStack[gData.stateStackTop - 1] = backTrackData.currentState; currentContinuation_op = gData.stateStack[gData.stateStackTop - 1].continuation_op; currentContinuation_pc = gData.stateStack[gData.stateStackTop - 1].continuation_pc; pc = backTrackData.continuation_pc; op = backTrackData.continuation_op; continue; } else return false; } /* * Continue with the expression. If this the end of the child, use * the current continuation. */ op = program[pc++]; if (op == REOP_ENDCHILD) { pc = currentContinuation_pc; op = currentContinuation_op; } } }
47345 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47345/7ee5a14c0cac11724d22286034567fd418e25797/NativeRegExp.java/buggy/src/org/mozilla/javascript/regexp/NativeRegExp.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1836, 862, 858, 16651, 12, 862, 5160, 751, 314, 751, 16, 1149, 8526, 5230, 16, 509, 679, 13, 565, 288, 3639, 509, 6125, 273, 374, 31, 3639, 1160, 5402, 8526, 273, 314, 751, 18, 17745, 18, 12890, 31, 3639, 509, 1061, 273, 5402, 63, 2436, 9904, 15533, 3639, 509, 783, 660, 23946, 67, 556, 31, 3639, 509, 783, 660, 23946, 67, 2436, 31, 3639, 1250, 563, 273, 629, 31, 3639, 783, 660, 23946, 67, 2436, 273, 374, 31, 3639, 783, 660, 23946, 67, 556, 273, 2438, 3665, 67, 4415, 31, 430, 261, 4148, 13, 288, 3163, 18, 659, 18, 8222, 2932, 1210, 273, 11843, 397, 394, 514, 12, 7549, 13, 397, 1548, 3113, 787, 622, 315, 397, 314, 751, 18, 4057, 1769, 97, 3639, 364, 261, 25708, 13, 288, 430, 261, 4148, 13, 288, 3163, 18, 659, 18, 8222, 2932, 22218, 622, 315, 397, 314, 751, 18, 4057, 397, 3104, 1061, 273, 315, 397, 1061, 1769, 97, 5411, 1620, 261, 556, 13, 288, 5411, 648, 2438, 3665, 67, 13625, 30, 7734, 563, 273, 638, 31, 7734, 898, 31, 5411, 648, 2438, 3665, 67, 38, 1741, 30, 7734, 309, 261, 75, 751, 18, 4057, 480, 374, 13, 288, 10792, 309, 261, 75, 751, 18, 5421, 12554, 747, 18701, 14015, 75, 751, 18, 17745, 18, 7133, 473, 6756, 5937, 67, 12845, 30690, 13, 480, 374, 3719, 288, 13491, 309, 16051, 291, 1670, 4065, 12, 7549, 63, 75, 751, 18, 4057, 300, 404, 22643, 288, 18701, 563, 273, 629, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1836, 862, 858, 16651, 12, 862, 5160, 751, 314, 751, 16, 1149, 8526, 5230, 16, 509, 679, 13, 565, 288, 3639, 509, 6125, 273, 374, 31, 3639, 1160, 5402, 8526, 273, 314, 751, 18, 17745, 18, 12890, 31, 3639, 509, 1061, 273, 5402, 63, 2436, 9904, 15533, 3639, 509, 783, 660, 23946, 67, 556, 31, 3639, 509, 783, 660, 23946, 67, 2436, 31, 3639, 1250, 563, 273, 629, 31, 3639, 783, 660, 23946, 67, 2436, 273, 374, 31, 3639, 783, 660, 23946, 67, 556, 273, 2438, 3665, 67, 4415, 31, 430, 261, 4148, 13, 288, 3163, 18, 659, 18, 8222, 2932, 1210, 273, 11843, 397, 394, 514, 12, 7549, 13, 397, 1548, 3113, 787, 622, 315, 397, 314, 2 ]
public TA_RetCode BBANDS( int startIdx, int endIdx, double inReal[], int optInTimePeriod, double optInNbDevUp, double optInNbDevDn, TA_MAType optInMAType, MInteger outBegIdx, MInteger outNbElement, double outRealUpperBand[], double outRealMiddleBand[], double outRealLowerBand[] ){ TA_RetCode retCode; int i; double tempReal, tempReal2; double []tempBuffer1 ; double []tempBuffer2 ; if( startIdx < 0 ) return TA_RetCode. TA_OUT_OF_RANGE_START_INDEX; if( (endIdx < 0) || (endIdx < startIdx)) return TA_RetCode. TA_OUT_OF_RANGE_END_INDEX; if( (int)optInTimePeriod == ( Integer.MIN_VALUE ) ) optInTimePeriod = 5; else if( ((int)optInTimePeriod < 2) || ((int)optInTimePeriod > 100000) ) return TA_RetCode. TA_BAD_PARAM; if( optInNbDevUp == (-4e+37) ) optInNbDevUp = 2.000000e+0; else if( (optInNbDevUp < -3.000000e+37) || (optInNbDevUp > 3.000000e+37) ) return TA_RetCode. TA_BAD_PARAM; if( optInNbDevDn == (-4e+37) ) optInNbDevDn = 2.000000e+0; else if( (optInNbDevDn < -3.000000e+37) || (optInNbDevDn > 3.000000e+37) ) return TA_RetCode. TA_BAD_PARAM; if( inReal == outRealUpperBand ) { tempBuffer1 = outRealMiddleBand; tempBuffer2 = outRealLowerBand; } else if( inReal == outRealLowerBand ) { tempBuffer1 = outRealMiddleBand; tempBuffer2 = outRealUpperBand; } else if( inReal == outRealMiddleBand ) { tempBuffer1 = outRealLowerBand; tempBuffer2 = outRealUpperBand; } else { tempBuffer1 = outRealMiddleBand; tempBuffer2 = outRealUpperBand; } if( (tempBuffer1 == inReal) || (tempBuffer2 == inReal) ) return TA_RetCode. TA_BAD_PARAM; retCode = MA ( startIdx, endIdx, inReal, optInTimePeriod, optInMAType, outBegIdx, outNbElement, tempBuffer1 ); if( (retCode != TA_RetCode. TA_SUCCESS ) || ((int) outNbElement.value == 0) ) { outNbElement.value = 0 ; return retCode; } if( optInMAType == TA_MAType. TA_MAType_SMA ) { INT_stddev_using_precalc_ma ( inReal, tempBuffer1, (int) outBegIdx.value , (int) outNbElement.value , optInTimePeriod, tempBuffer2 ); } else { retCode = STDDEV ( (int) outBegIdx.value , endIdx, inReal, optInTimePeriod, 1.0, outBegIdx, outNbElement, tempBuffer2 ); if( retCode != TA_RetCode. TA_SUCCESS ) { outNbElement.value = 0 ; return retCode; } } if( tempBuffer1 != outRealMiddleBand ) { System.arraycopy(tempBuffer1,0,outRealMiddleBand,0, outNbElement.value ) ; } if( optInNbDevUp == optInNbDevDn ) { if( optInNbDevUp == 1.0 ) { for( i=0; i < (int) outNbElement.value ; i++ ) { tempReal = tempBuffer2[i]; tempReal2 = outRealMiddleBand[i]; outRealUpperBand[i] = tempReal2 + tempReal; outRealLowerBand[i] = tempReal2 - tempReal; } } else { for( i=0; i < (int) outNbElement.value ; i++ ) { tempReal = tempBuffer2[i] * optInNbDevUp; tempReal2 = outRealMiddleBand[i]; outRealUpperBand[i] = tempReal2 + tempReal; outRealLowerBand[i] = tempReal2 - tempReal; } } } else if( optInNbDevUp == 1.0 ) { for( i=0; i < (int) outNbElement.value ; i++ ) { tempReal = tempBuffer2[i]; tempReal2 = outRealMiddleBand[i]; outRealUpperBand[i] = tempReal2 + tempReal; outRealLowerBand[i] = tempReal2 - (tempReal * optInNbDevDn); } } else if( optInNbDevDn == 1.0 ) { for( i=0; i < (int) outNbElement.value ; i++ ) { tempReal = tempBuffer2[i]; tempReal2 = outRealMiddleBand[i]; outRealLowerBand[i] = tempReal2 - tempReal; outRealUpperBand[i] = tempReal2 + (tempReal * optInNbDevUp); } } else { for( i=0; i < (int) outNbElement.value ; i++ ) { tempReal = tempBuffer2[i]; tempReal2 = outRealMiddleBand[i]; outRealUpperBand[i] = tempReal2 + (tempReal * optInNbDevUp); outRealLowerBand[i] = tempReal2 - (tempReal * optInNbDevDn); } } return TA_RetCode. TA_SUCCESS;}
2365 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2365/69e0567047ad75d101e30d35826ecbb51165ba43/Core.java/buggy/ta-lib/java/src/TA/Lib/Core.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 9833, 67, 7055, 1085, 9676, 1258, 3948, 12, 474, 1937, 4223, 16, 474, 409, 4223, 16, 9056, 267, 6955, 63, 6487, 474, 3838, 382, 26540, 16, 9056, 3838, 382, 22816, 8870, 1211, 16, 9056, 3838, 382, 22816, 8870, 19053, 16, 9833, 67, 5535, 559, 3838, 382, 5535, 559, 16, 49, 4522, 659, 24059, 4223, 16, 49, 4522, 659, 22816, 1046, 16, 9056, 659, 6955, 5988, 14231, 63, 6487, 9056, 659, 6955, 21924, 14231, 63, 6487, 9056, 659, 6955, 4070, 14231, 63, 5717, 95, 9833, 67, 7055, 39, 5350, 278, 1085, 31, 474, 77, 31, 2896, 440, 278, 30752, 6955, 16, 5814, 6955, 22, 31, 9056, 8526, 5814, 1892, 21, 31, 9056, 8526, 5814, 1892, 22, 31, 430, 12, 1937, 4223, 32, 20, 13, 2463, 9833, 67, 7055, 1085, 18, 9833, 67, 5069, 67, 3932, 67, 15928, 67, 7570, 67, 9199, 31, 430, 12443, 409, 4223, 32, 20, 14047, 96, 12, 409, 4223, 32, 1937, 4223, 3719, 2463, 9833, 67, 7055, 1085, 18, 9833, 67, 5069, 67, 3932, 67, 15928, 67, 4415, 67, 9199, 31, 430, 12443, 474, 13, 3838, 382, 26540, 631, 12, 4522, 18, 6236, 67, 4051, 3719, 3838, 382, 26540, 33, 25, 31, 12107, 430, 12443, 12, 474, 13, 3838, 382, 26540, 32, 22, 14047, 96, 12443, 474, 13, 3838, 382, 26540, 34, 21, 11706, 3719, 2463, 9833, 67, 7055, 1085, 18, 9833, 67, 16234, 67, 8388, 31, 430, 12, 3838, 382, 22816, 8870, 1211, 631, 19236, 24, 73, 15, 6418, 3719, 3838, 382, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 9833, 67, 7055, 1085, 9676, 1258, 3948, 12, 474, 1937, 4223, 16, 474, 409, 4223, 16, 9056, 267, 6955, 63, 6487, 474, 3838, 382, 26540, 16, 9056, 3838, 382, 22816, 8870, 1211, 16, 9056, 3838, 382, 22816, 8870, 19053, 16, 9833, 67, 5535, 559, 3838, 382, 5535, 559, 16, 49, 4522, 659, 24059, 4223, 16, 49, 4522, 659, 22816, 1046, 16, 9056, 659, 6955, 5988, 14231, 63, 6487, 9056, 659, 6955, 21924, 14231, 63, 6487, 9056, 659, 6955, 4070, 14231, 63, 5717, 95, 9833, 67, 7055, 39, 5350, 278, 1085, 31, 474, 77, 31, 2896, 440, 278, 30752, 6955, 16, 5814, 6955, 22, 31, 9056, 8526, 5814, 1892, 21, 31, 9056, 8526, 5814, 1892, 22, 31, 430, 12, 2 ]
this.renderer);
renderer);
public void setRenderer(ListCellRenderer aRenderer) { if (this.renderer != aRenderer) { ListCellRenderer oldRenderer = this.renderer; this.renderer = aRenderer; firePropertyChange(RENDERER_CHANGED_PROPERTY, oldRenderer, this.renderer); } }
47947 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/47947/afd5c0ff01c2742fd202b8024455897d82c40368/JComboBox.java/clean/javax/swing/JComboBox.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 6747, 12, 682, 4020, 6747, 279, 6747, 13, 225, 288, 565, 309, 261, 2211, 18, 14374, 480, 279, 6747, 13, 1377, 288, 202, 682, 4020, 6747, 1592, 6747, 273, 333, 18, 14374, 31, 202, 2211, 18, 14374, 273, 279, 6747, 31, 202, 12179, 1396, 3043, 12, 25230, 654, 67, 24435, 67, 9900, 16, 1592, 6747, 16, 202, 10402, 5690, 1769, 1377, 289, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 918, 444, 6747, 12, 682, 4020, 6747, 279, 6747, 13, 225, 288, 565, 309, 261, 2211, 18, 14374, 480, 279, 6747, 13, 1377, 288, 202, 682, 4020, 6747, 1592, 6747, 273, 333, 18, 14374, 31, 202, 2211, 18, 14374, 273, 279, 6747, 31, 202, 12179, 1396, 3043, 12, 25230, 654, 67, 24435, 67, 9900, 16, 1592, 6747, 16, 202, 10402, 5690, 1769, 1377, 289, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
GL11.glLightfv(
GL11.glLight(
public static void main(String[] args) { System.out.println("Vertex program supported: " + GLContext.GL_NV_vertex_program); IntBuffer int_buf = BufferUtils.createIntBuffer(1); NVVertexProgram.glGenProgramsNV(int_buf); if (int_buf.get(0) == 0) throw new RuntimeException("Could not allocate new vertex program id!"); program_handle = int_buf.get(0); byte[] program = loadFile("cg_grass2.vp"); ByteBuffer program_buf = BufferUtils.createByteBuffer(program.length); program_buf.order(ByteOrder.nativeOrder()); program_buf.put(program); program_buf.flip(); NVVertexProgram.glLoadProgramNV( NVVertexProgram.GL_VERTEX_PROGRAM_NV, program_handle, program_buf); /*GL11.glGetInteger(GL11.PROGRAM_ERROR_POSITION_NV, int_buf); System.out.println("error position: " + int_buf.get(0));*/ genMesh(); float[] LightDiffuse = { 1.0f, 0.0f, 0.0f, 1.0f }; float[] LightPosition = { 1.0f, 1.0f, 1.0f, 0.0f }; FloatBuffer light_buf_f = BufferUtils.createFloatBuffer(4); light_buf_f.put(LightDiffuse); light_buf_f.flip(); GL11.glLightfv( GL11.GL_LIGHT0, GL11.GL_DIFFUSE, light_buf_f); light_buf_f.clear(); light_buf_f.put(LightPosition); light_buf_f.flip(); GL11.glLightfv( GL11.GL_LIGHT0, GL11.GL_POSITION, light_buf_f); GL11.glEnable(GL11.GL_LIGHT0); GL11.glEnable(GL11.GL_LIGHTING); GL11.glEnable(GL11.GL_DEPTH_TEST); GL11.glBlendFunc(GL11.GL_SRC_ALPHA, GL11.GL_ONE_MINUS_SRC_ALPHA); GL11.glEnable(GL11.GL_BLEND); GL11.glMatrixMode(GL11.GL_PROJECTION); GLU.gluPerspective(40.0f, 1.0f, 1.0f, 50.0f); GL11.glMatrixMode(GL11.GL_MODELVIEW); GLU.gluLookAt(14.0f, 10.0f, -16.0f, 0.0f, 0.0f, 0.0f, 0.0f, 1.0f, 0.0f); aslod.angle = 2.6179935f; aslod.value = 0.2f; aslod.ripple = 0.0f; aslod.count = 0.0f; while (!finished) { if (Window.isCloseRequested()) { finished = true; } else if (!Window.isMinimized()) { keyPoll(); float degree = (1.0f + (aslod.value * 20.0f)) * 0.01745329f; degree *= (0.5 + myrand()); ptrAnimate(degree); GL11.glClear(GL11.GL_COLOR_BUFFER_BIT | GL11.GL_DEPTH_BUFFER_BIT); //ptrDraw(); grsDraw(); } Window.update(); } Window.destroy(); }
5076 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5076/351b8165ef9d3147224557195d93c4fee7940fc4/Grass.java/buggy/src/java/org/lwjgl/test/opengl/Grass.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 202, 202, 3163, 18, 659, 18, 8222, 2932, 6475, 5402, 3260, 30, 315, 397, 10252, 1042, 18, 11261, 67, 11679, 67, 15281, 67, 12890, 1769, 202, 202, 1702, 1892, 509, 67, 4385, 273, 3525, 1989, 18, 2640, 1702, 1892, 12, 21, 1769, 202, 202, 11679, 6475, 9459, 18, 7043, 7642, 9459, 87, 11679, 12, 474, 67, 4385, 1769, 202, 202, 430, 261, 474, 67, 4385, 18, 588, 12, 20, 13, 422, 374, 13, 1082, 202, 12849, 394, 3235, 2932, 4445, 486, 10101, 394, 5253, 5402, 612, 4442, 1769, 202, 202, 12890, 67, 4110, 273, 509, 67, 4385, 18, 588, 12, 20, 1769, 202, 202, 7229, 8526, 5402, 273, 26953, 2932, 26275, 67, 22120, 22, 18, 20106, 8863, 202, 202, 12242, 5402, 67, 4385, 273, 3525, 1989, 18, 2640, 12242, 12, 12890, 18, 2469, 1769, 202, 202, 12890, 67, 4385, 18, 1019, 12, 3216, 2448, 18, 13635, 2448, 10663, 202, 202, 12890, 67, 4385, 18, 458, 12, 12890, 1769, 202, 202, 12890, 67, 4385, 18, 12357, 5621, 202, 202, 11679, 6475, 9459, 18, 7043, 2563, 9459, 11679, 12, 1082, 202, 11679, 6475, 9459, 18, 11261, 67, 18937, 67, 21418, 67, 11679, 16, 1082, 202, 12890, 67, 4110, 16, 1082, 202, 12890, 67, 4385, 1769, 202, 202, 20308, 11261, 2499, 18, 7043, 967, 4522, 12, 11261, 2499, 18, 21418, 67, 3589, 67, 15258, 67, 11679, 16, 509, 67, 4385, 1769, 202, 202, 3163, 18, 659, 18, 8222, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 760, 918, 2774, 12, 780, 8526, 833, 13, 288, 202, 202, 3163, 18, 659, 18, 8222, 2932, 6475, 5402, 3260, 30, 315, 397, 10252, 1042, 18, 11261, 67, 11679, 67, 15281, 67, 12890, 1769, 202, 202, 1702, 1892, 509, 67, 4385, 273, 3525, 1989, 18, 2640, 1702, 1892, 12, 21, 1769, 202, 202, 11679, 6475, 9459, 18, 7043, 7642, 9459, 87, 11679, 12, 474, 67, 4385, 1769, 202, 202, 430, 261, 474, 67, 4385, 18, 588, 12, 20, 13, 422, 374, 13, 1082, 202, 12849, 394, 3235, 2932, 4445, 486, 10101, 394, 5253, 5402, 612, 4442, 1769, 202, 202, 12890, 67, 4110, 273, 509, 67, 4385, 18, 588, 12, 20, 1769, 202, 202, 7229, 8526, 5402, 2 ]
for (int i = 1; i < perspectiveBar.getControl().getItemCount(); i++) { rowHeight = Math.max(rowHeight, perspectiveBar.getControl().getItem(i).getBounds().height);
int rowHeight = 0; ToolItem[] toolItems = perspectiveBar.getControl().getItems(); for (int i = 0; i < toolItems.length; i++) { rowHeight = Math.max(rowHeight, toolItems[i].getBounds().height);
private void setCoolItemSize(final CoolItem coolItem) { // there is no coolItem when the bar is on the left if (currentLocation == LEFT) return; ToolBar toolbar = perspectiveBar.getControl(); if (toolbar == null) return; int rowHeight = toolbar.getItem(0).getBounds().height; // This gets the height of the tallest item. for (int i = 1; i < perspectiveBar.getControl().getItemCount(); i++) { rowHeight = Math.max(rowHeight, perspectiveBar.getControl().getItem(i).getBounds().height); } Rectangle area = perspectiveCoolBar.getClientArea(); int rows = rowHeight <= 0 ? 1 : (int)Math.max(1, Math.floor(area.height / rowHeight)); if (rows == 1 || (toolbar.getStyle() & SWT.WRAP) == 0 || currentLocation == TOP_LEFT) { Point p = toolbar.computeSize(SWT.DEFAULT, SWT.DEFAULT); coolItem.setSize(coolItem.computeSize(p.x, p.y)); return; } Point offset = coolItem.computeSize(0,0); Point wrappedSize = toolbar.computeSize(area.width - offset.x, SWT.DEFAULT); int h = rows * rowHeight; int w = wrappedSize.y <= h ? wrappedSize.x : wrappedSize.x + 1; coolItem.setSize(coolItem.computeSize(w, h)); }
56152 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56152/f770c05df0cc0ea3e7608e074e7602d4ad5dd3eb/PerspectiveSwitcher.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/internal/PerspectiveSwitcher.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 202, 1152, 918, 11440, 1371, 1180, 1225, 12, 6385, 385, 1371, 1180, 27367, 1180, 13, 288, 202, 202, 759, 1915, 353, 1158, 27367, 1180, 1347, 326, 4653, 353, 603, 326, 2002, 202, 202, 430, 261, 2972, 2735, 422, 9686, 13, 1082, 202, 2463, 31, 9506, 202, 6364, 5190, 12748, 273, 26651, 5190, 18, 588, 3367, 5621, 202, 202, 430, 261, 18849, 422, 446, 13, 1875, 202, 2463, 31, 202, 202, 474, 1027, 2686, 273, 12748, 18, 588, 1180, 12, 20, 2934, 588, 5694, 7675, 4210, 31, 9506, 202, 759, 1220, 5571, 326, 2072, 434, 326, 268, 454, 395, 761, 18, 202, 202, 1884, 261, 474, 277, 273, 404, 31, 277, 411, 26651, 5190, 18, 588, 3367, 7675, 588, 30687, 5621, 277, 27245, 288, 1082, 202, 492, 2686, 273, 2361, 18, 1896, 12, 492, 2686, 16, 26651, 5190, 18, 588, 3367, 7675, 588, 1180, 12, 77, 2934, 588, 5694, 7675, 4210, 1769, 202, 202, 97, 9506, 202, 19463, 5091, 273, 26651, 39, 1371, 5190, 18, 588, 1227, 5484, 5621, 202, 202, 474, 2595, 273, 1027, 2686, 1648, 374, 692, 404, 294, 261, 474, 13, 10477, 18, 1896, 12, 21, 16, 2361, 18, 74, 5807, 12, 5036, 18, 4210, 342, 1027, 2686, 10019, 202, 202, 430, 261, 3870, 422, 404, 747, 261, 18849, 18, 588, 2885, 1435, 473, 348, 8588, 18, 27664, 13, 422, 374, 747, 783, 2735, 422, 18680, 67, 10066, 13, 288, 1082, 202, 2148, 293, 273, 12748, 18, 9200, 1225, 12, 55, 8588, 18, 5280, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 202, 1152, 918, 11440, 1371, 1180, 1225, 12, 6385, 385, 1371, 1180, 27367, 1180, 13, 288, 202, 202, 759, 1915, 353, 1158, 27367, 1180, 1347, 326, 4653, 353, 603, 326, 2002, 202, 202, 430, 261, 2972, 2735, 422, 9686, 13, 1082, 202, 2463, 31, 9506, 202, 6364, 5190, 12748, 273, 26651, 5190, 18, 588, 3367, 5621, 202, 202, 430, 261, 18849, 422, 446, 13, 1875, 202, 2463, 31, 202, 202, 474, 1027, 2686, 273, 12748, 18, 588, 1180, 12, 20, 2934, 588, 5694, 7675, 4210, 31, 9506, 202, 759, 1220, 5571, 326, 2072, 434, 326, 268, 454, 395, 761, 18, 202, 202, 1884, 261, 474, 277, 273, 404, 31, 277, 411, 26651, 5190, 18, 588, 3367, 7675, 588, 2 ]
return mObjselect;
return getObjSelect();
public String getObjselect() { return mObjselect; }
506 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/506/6d9a0692313ea26e0d7eccf1be7e1d85d51c56a9/CCUnlock.java/clean/src/main/org/apache/tools/ant/taskdefs/optional/clearcase/CCUnlock.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 336, 2675, 4025, 1435, 288, 3639, 327, 336, 2675, 3391, 5621, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 514, 336, 2675, 4025, 1435, 288, 3639, 327, 336, 2675, 3391, 5621, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
super(LocalizerFactory.getLocalizer(HelpingException.class.getName()), "TTP.UndefinedToken", macro);
super( LocalizerFactory .getLocalizer(UndefinedControlSequenceException.class .getName()), "TTP.UndefinedToken", macro);
public UndefinedControlSequenceException(final String macro) { super(LocalizerFactory.getLocalizer(HelpingException.class.getName()), "TTP.UndefinedToken", macro); }
9123 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/9123/f25eee58222599610c4a44196c180ef6cc25292f/UndefinedControlSequenceException.java/buggy/ExTeX/src/java/de/dante/extex/interpreter/exception/helping/UndefinedControlSequenceException.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 22243, 3367, 4021, 503, 12, 6385, 514, 11522, 13, 288, 3639, 2240, 12, 2042, 1824, 1733, 18, 588, 2042, 1824, 12, 44, 292, 1382, 503, 18, 1106, 18, 17994, 1435, 3631, 7734, 315, 1774, 18, 10317, 1345, 3113, 11522, 1769, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 22243, 3367, 4021, 503, 12, 6385, 514, 11522, 13, 288, 3639, 2240, 12, 2042, 1824, 1733, 18, 588, 2042, 1824, 12, 44, 292, 1382, 503, 18, 1106, 18, 17994, 1435, 3631, 7734, 315, 1774, 18, 10317, 1345, 3113, 11522, 1769, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
public DefaultPostOffice(DataSource ds, TransactionManager tm, Properties sqlProperties, boolean createTablesOnStartup, int nodeId, String officeName, MessageStore ms, PersistenceManager pm, TransactionRepository tr, FilterFactory filterFactory, QueuedExecutorPool pool) { super (ds, tm, sqlProperties, createTablesOnStartup); lock = new WriterPreferenceReadWriteLock(); nameMaps = new LinkedHashMap(); conditionMap = new LinkedHashMap(); this.nodeId = nodeId; this.officeName = officeName; this.ms = ms; this.pm = pm; this.tr = tr; this.filterFactory = filterFactory; this.pool = pool;
public DefaultPostOffice() {
public DefaultPostOffice(DataSource ds, TransactionManager tm, Properties sqlProperties, boolean createTablesOnStartup, int nodeId, String officeName, MessageStore ms, PersistenceManager pm, TransactionRepository tr, FilterFactory filterFactory, QueuedExecutorPool pool) { super (ds, tm, sqlProperties, createTablesOnStartup); lock = new WriterPreferenceReadWriteLock(); nameMaps = new LinkedHashMap(); conditionMap = new LinkedHashMap(); this.nodeId = nodeId; this.officeName = officeName; this.ms = ms; this.pm = pm; this.tr = tr; this.filterFactory = filterFactory; this.pool = pool; }
3806 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/3806/671e5a3e8ed91a6300e1ca8269cceff9ee636476/DefaultPostOffice.java/buggy/src/main/org/jboss/messaging/core/plugin/postoffice/DefaultPostOffice.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 1071, 2989, 3349, 30126, 12, 8597, 3780, 16, 5947, 1318, 6118, 16, 6183, 1847, 2297, 16, 7682, 1250, 752, 6905, 1398, 22178, 16, 7682, 509, 11507, 16, 514, 3397, 1812, 461, 16, 2350, 2257, 4086, 16, 7682, 13381, 1318, 7430, 16, 7682, 5947, 3305, 433, 16, 4008, 1733, 1034, 1733, 16, 7682, 27949, 5957, 6325, 2864, 2845, 13, 282, 288, 5375, 2240, 261, 2377, 16, 6118, 16, 1847, 2297, 16, 752, 6905, 1398, 22178, 1769, 5411, 2176, 273, 394, 5497, 9624, 1994, 3067, 2531, 5621, 5411, 508, 8903, 273, 394, 13589, 5621, 2398, 2269, 863, 273, 394, 13589, 5621, 2398, 333, 18, 2159, 548, 273, 11507, 31, 5411, 333, 18, 19789, 461, 273, 3397, 1812, 461, 31, 5411, 333, 18, 959, 273, 4086, 31, 5411, 333, 18, 7755, 273, 7430, 31, 5411, 333, 18, 313, 273, 433, 31, 5411, 333, 18, 2188, 1733, 273, 1034, 1733, 31, 5411, 333, 18, 6011, 273, 2845, 31, 282, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 1071, 2989, 3349, 30126, 12, 8597, 3780, 16, 5947, 1318, 6118, 16, 6183, 1847, 2297, 16, 7682, 1250, 752, 6905, 1398, 22178, 16, 7682, 509, 11507, 16, 514, 3397, 1812, 461, 16, 2350, 2257, 4086, 16, 7682, 13381, 1318, 7430, 16, 7682, 5947, 3305, 433, 16, 4008, 1733, 1034, 1733, 16, 7682, 27949, 5957, 6325, 2864, 2845, 13, 282, 288, 5375, 2240, 261, 2377, 16, 6118, 16, 1847, 2297, 16, 752, 6905, 1398, 22178, 1769, 5411, 2176, 273, 394, 5497, 9624, 1994, 3067, 2531, 5621, 5411, 508, 8903, 273, 394, 13589, 5621, 2398, 2269, 863, 273, 394, 13589, 5621, 2398, 333, 18, 2159, 548, 273, 11507, 31, 5411, 333, 18, 19789, 461, 273, 3397, 1812, 461, 31, 5411, 2 ]
} catch(CmsException exc) {
} catch (CmsException exc) {
void init(I_CmsResourceBroker rb, I_CmsRequest req, I_CmsResponse resp, String user, String currentGroup, int currentProjectId, boolean streaming, CmsElementCache elementCache) throws CmsException { m_rb = rb; m_req = req; m_resp = resp; m_links = new Vector(); m_dependencies = new Vector(); try { m_user = m_rb.readUser(null, null, user); } catch (CmsException ex){ } // if no user found try to read webUser if (m_user == null) { m_user = m_rb.readWebUser(null, null, user); } // check, if the user is disabled if( m_user.getDisabled() == true ) { m_user = null; } // set current project, group and streaming proerties for this request try { setCurrentProject(currentProjectId); } catch(CmsException exc) { // there was a problem to set the needed project - using the online one setCurrentProject(I_CmsConstants.C_PROJECT_ONLINE_ID); } m_currentGroup = m_rb.readGroup(m_user, m_currentProject, currentGroup); m_streaming = streaming; m_elementCache = elementCache; // Analyze the user's preferred languages coming with the request if(req != null) { try{ HttpServletRequest httpReq = (HttpServletRequest)req.getOriginalRequest(); String accLangs = null; if(httpReq != null){ accLangs = httpReq.getHeader("Accept-Language"); } if(accLangs != null) { StringTokenizer toks = new StringTokenizer(accLangs, ","); while(toks.hasMoreTokens()) { // Loop through all languages and cut off trailing extensions String current = toks.nextToken().trim(); if(current.indexOf("-") > -1) { current = current.substring(0, current.indexOf("-")); } if(current.indexOf(";") > -1) { current = current.substring(0, current.indexOf(";")); } m_language.addElement(current); } } }catch(UnsupportedOperationException e){ } } }
8585 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/8585/5c27bc595df503fc5e3629ec92d99ba38b58a0e9/CmsRequestContext.java/clean/src/com/opencms/file/CmsRequestContext.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 1208, 12, 45, 67, 4747, 1420, 11194, 7138, 16, 467, 67, 4747, 691, 1111, 16, 467, 67, 4747, 1064, 1718, 16, 2868, 514, 729, 16, 514, 783, 1114, 16, 509, 783, 4109, 548, 16, 1250, 12833, 16, 2149, 1046, 1649, 930, 1649, 13, 3639, 1216, 11228, 288, 3639, 312, 67, 6731, 273, 7138, 31, 3639, 312, 67, 3658, 273, 1111, 31, 3639, 312, 67, 12243, 273, 1718, 31, 3639, 312, 67, 7135, 273, 394, 5589, 5621, 3639, 312, 67, 11037, 273, 394, 5589, 5621, 3639, 775, 288, 5411, 312, 67, 1355, 273, 312, 67, 6731, 18, 896, 1299, 12, 2011, 16, 446, 16, 729, 1769, 3639, 289, 1044, 261, 4747, 503, 431, 15329, 3639, 289, 3639, 368, 309, 1158, 729, 1392, 775, 358, 855, 3311, 1299, 3639, 309, 261, 81, 67, 1355, 422, 446, 13, 288, 5411, 312, 67, 1355, 273, 312, 67, 6731, 18, 896, 4079, 1299, 12, 2011, 16, 446, 16, 729, 1769, 3639, 289, 3639, 368, 866, 16, 309, 326, 729, 353, 5673, 3639, 309, 12, 312, 67, 1355, 18, 588, 8853, 1435, 422, 638, 262, 288, 5411, 312, 67, 1355, 273, 446, 31, 3639, 289, 3639, 368, 444, 783, 1984, 16, 1041, 471, 12833, 450, 1051, 606, 364, 333, 590, 3639, 775, 288, 5411, 12589, 4109, 12, 2972, 4109, 548, 1769, 3639, 289, 1044, 261, 4747, 503, 3533, 13, 288, 5411, 368, 1915, 1703, 279, 6199, 358, 444, 326, 3577, 1984, 300, 1450, 326, 12365, 1245, 5411, 12589, 4109, 12, 45, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 918, 1208, 12, 45, 67, 4747, 1420, 11194, 7138, 16, 467, 67, 4747, 691, 1111, 16, 467, 67, 4747, 1064, 1718, 16, 2868, 514, 729, 16, 514, 783, 1114, 16, 509, 783, 4109, 548, 16, 1250, 12833, 16, 2149, 1046, 1649, 930, 1649, 13, 3639, 1216, 11228, 288, 3639, 312, 67, 6731, 273, 7138, 31, 3639, 312, 67, 3658, 273, 1111, 31, 3639, 312, 67, 12243, 273, 1718, 31, 3639, 312, 67, 7135, 273, 394, 5589, 5621, 3639, 312, 67, 11037, 273, 394, 5589, 5621, 3639, 775, 288, 5411, 312, 67, 1355, 273, 312, 67, 6731, 18, 896, 1299, 12, 2011, 16, 446, 16, 729, 1769, 3639, 289, 1044, 261, 4747, 503, 431, 15329, 3639, 289, 3639, 368, 2 ]
mIndentCheck.indentationLog(aAst.getLineNo(), mTypeName + typeStr + " at indentation level "
mIndentCheck.indentationLog(aAst.getLineNo(), mTypeName + typeStr + " at indentation level "
protected void logError(DetailAST aAst, String aSubtypeName, int aActualLevel) { // TODO: i18n String typeStr = (aSubtypeName == "" ? "" : (" " + aSubtypeName)); mIndentCheck.indentationLog(aAst.getLineNo(), mTypeName + typeStr + " at indentation level " + aActualLevel + " not at correct indentation, " + getLevel()); }
31427 /local/tlutelli/issta_data/temp/all_java3context/java/2006_temp/2006/31427/a4d63db21d57ab53aff8a467f89df3867518ab91/ExpressionHandler.java/clean/src/checkstyle/com/puppycrawl/tools/checkstyle/checks/indentation/ExpressionHandler.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 20638, 12, 6109, 9053, 279, 21385, 16, 514, 279, 1676, 723, 461, 16, 540, 509, 279, 11266, 2355, 13, 377, 288, 3639, 368, 2660, 30, 277, 2643, 82, 3639, 514, 618, 1585, 273, 261, 69, 1676, 723, 461, 422, 1408, 692, 1408, 294, 7566, 315, 397, 279, 1676, 723, 461, 10019, 3639, 312, 7790, 1564, 18, 9355, 367, 1343, 12, 69, 21385, 18, 588, 1670, 2279, 9334, 312, 7947, 397, 618, 1585, 2398, 397, 315, 622, 12018, 1801, 315, 2398, 397, 279, 11266, 2355, 397, 315, 486, 622, 3434, 12018, 16, 315, 397, 17236, 10663, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4750, 918, 20638, 12, 6109, 9053, 279, 21385, 16, 514, 279, 1676, 723, 461, 16, 540, 509, 279, 11266, 2355, 13, 377, 288, 3639, 368, 2660, 30, 277, 2643, 82, 3639, 514, 618, 1585, 273, 261, 69, 1676, 723, 461, 422, 1408, 692, 1408, 294, 7566, 315, 397, 279, 1676, 723, 461, 10019, 3639, 312, 7790, 1564, 18, 9355, 367, 1343, 12, 69, 21385, 18, 588, 1670, 2279, 9334, 312, 7947, 397, 618, 1585, 2398, 397, 315, 622, 12018, 1801, 315, 2398, 397, 279, 11266, 2355, 397, 315, 486, 622, 3434, 12018, 16, 315, 397, 17236, 10663, 565, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
scaffoldingCell.getWizardPageDefinition().setToolId(scaffolding.getToolId().getValue());
protected void regenerateCells(Scaffolding scaffolding, boolean dirtyProgression) { List levels = scaffolding.getLevels(); List criteria = scaffolding.getCriteria(); Criterion criterion = new Criterion(); Level level = new Level(); Set cells = scaffolding.getScaffoldingCells(); boolean firstRow = true; boolean firstColumn = true; for (Iterator criteriaIterator = criteria.iterator(); criteriaIterator.hasNext();) { criterion = (Criterion) criteriaIterator.next(); for (Iterator levelsIterator = levels.iterator(); levelsIterator.hasNext();) { level = (Level) levelsIterator.next(); ScaffoldingCell scaffoldingCell = getScaffoldingCell(cells, criterion, level); String status = MatrixFunctionConstants.READY_STATUS; if ((scaffolding.getWorkflowOption() == Scaffolding.HORIZONTAL_PROGRESSION && !firstColumn) || (scaffolding.getWorkflowOption() == Scaffolding.VERTICAL_PROGRESSION && !firstRow) || (scaffolding.getWorkflowOption() == Scaffolding.MANUAL_PROGRESSION)) { status = MatrixFunctionConstants.LOCKED_STATUS; } if (scaffoldingCell == null) { scaffoldingCell = new ScaffoldingCell(criterion, level, status, scaffolding); scaffoldingCell.getWizardPageDefinition().setSiteId(scaffolding.getWorksiteId().getValue()); scaffoldingCell.getWizardPageDefinition().setToolId(scaffolding.getToolId().getValue()); scaffoldingCell.getWizardPageDefinition().setTitle(getDefaultTitle(scaffolding, criterion, level)); getMatrixManager().storeScaffoldingCell(scaffoldingCell); } else if (dirtyProgression){ scaffoldingCell.setInitialStatus(status); getMatrixManager().storeScaffoldingCell(scaffoldingCell); } firstColumn = false; } firstRow = false; //Need to reset firstColumn when moving to the next row firstColumn = true; } }
48996 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/48996/89a167b6612617c94a75278d12b4c1559f1ad945/BaseScaffoldingController.java/clean/matrix/tool/src/java/org/theospi/portfolio/matrix/control/BaseScaffoldingController.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 918, 20821, 10505, 12, 1541, 14847, 310, 20992, 310, 16, 1250, 9603, 5491, 285, 13, 288, 1377, 987, 7575, 273, 20992, 310, 18, 588, 12240, 5621, 1377, 987, 3582, 273, 20992, 310, 18, 588, 7231, 5621, 1377, 24085, 11498, 273, 394, 24085, 5621, 1377, 4557, 1801, 273, 394, 4557, 5621, 1377, 1000, 5983, 273, 20992, 310, 18, 588, 1541, 14847, 310, 10505, 5621, 1377, 1250, 1122, 1999, 273, 638, 31, 1377, 1250, 1122, 1494, 273, 638, 31, 5411, 364, 261, 3198, 3582, 3198, 273, 3582, 18, 9838, 5621, 3582, 3198, 18, 5332, 2134, 5621, 13, 288, 540, 11498, 273, 261, 13210, 13, 3582, 3198, 18, 4285, 5621, 540, 364, 261, 3198, 7575, 3198, 273, 7575, 18, 9838, 5621, 7575, 3198, 18, 5332, 2134, 5621, 13, 288, 5411, 1801, 273, 261, 2355, 13, 7575, 3198, 18, 4285, 5621, 5411, 2850, 14847, 310, 4020, 20992, 310, 4020, 273, 1322, 5353, 1403, 1673, 310, 4020, 12, 14741, 16, 11498, 16, 1801, 1769, 5411, 514, 1267, 273, 7298, 2083, 2918, 18, 20305, 67, 8608, 31, 5411, 309, 14015, 31105, 310, 18, 588, 8484, 1895, 1435, 422, 2850, 14847, 310, 18, 44, 20344, 67, 3373, 43, 862, 4475, 597, 401, 3645, 1494, 13, 747, 5375, 261, 31105, 310, 18, 588, 8484, 1895, 1435, 422, 2850, 14847, 310, 18, 21654, 10109, 67, 3373, 43, 862, 4475, 597, 401, 3645, 1999, 13, 747, 5375, 261, 31105, 310, 18, 588, 8484, 1895, 1435, 422, 2850, 14847, 310, 18, 9560, 14235, 67, 3373, 43, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 565, 4750, 918, 20821, 10505, 12, 1541, 14847, 310, 20992, 310, 16, 1250, 9603, 5491, 285, 13, 288, 1377, 987, 7575, 273, 20992, 310, 18, 588, 12240, 5621, 1377, 987, 3582, 273, 20992, 310, 18, 588, 7231, 5621, 1377, 24085, 11498, 273, 394, 24085, 5621, 1377, 4557, 1801, 273, 394, 4557, 5621, 1377, 1000, 5983, 273, 20992, 310, 18, 588, 1541, 14847, 310, 10505, 5621, 1377, 1250, 1122, 1999, 273, 638, 31, 1377, 1250, 1122, 1494, 273, 638, 31, 5411, 364, 261, 3198, 3582, 3198, 273, 3582, 18, 9838, 5621, 3582, 3198, 18, 5332, 2134, 5621, 13, 288, 540, 11498, 273, 261, 13210, 13, 3582, 3198, 18, 4285, 5621, 540, 364, 261, 3198, 7575, 3198, 273, 7575, 18, 9838, 2 ]
void appendPrimaryKeyWhereClause(GenericEntity entity, StringBuffer bufferToAppendTo) { //try { IDOEntityField[] fields = entity.getGenericEntityDefinition().getPrimaryKeyDefinition().getFields(); Object primaryKey = entity.getPrimaryKey(); Object value; bufferToAppendTo.append(" where "); for (int i = 0; i < fields.length; i++) { if (primaryKey instanceof IDOPrimaryKey) { value = ((IDOPrimaryKey) primaryKey).getPrimaryKeyValue(fields[i].getSQLFieldName()); } else { value = entity.getValue(fields[i].getSQLFieldName()); } bufferToAppendTo.append(fields[i].getSQLFieldName()); bufferToAppendTo.append("="); if(fields[0].getDataTypeClass() == Integer.class){ bufferToAppendTo.append(value); } else { bufferToAppendTo.append("'"); bufferToAppendTo.append(value); bufferToAppendTo.append("'"); } if ((i + 1) < fields.length) bufferToAppendTo.append(" and "); } //System.out.println(bufferToAppendTo.toString()); //} catch (java.rmi.RemoteException rme) { // throw new RuntimeException(rme.getMessage()); //} }
52001 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52001/a72e9e5217b7290ee5136c1efddb8aabdea08bf5/DatastoreInterface.java/clean/src/java/com/idega/data/DatastoreInterface.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 714, 11575, 5262, 7044, 12, 7014, 1943, 1522, 16, 6674, 1613, 774, 5736, 774, 13, 288, 202, 202, 759, 698, 288, 202, 202, 734, 51, 1943, 974, 8526, 1466, 273, 1522, 18, 588, 7014, 1943, 1852, 7675, 588, 11575, 1852, 7675, 588, 2314, 5621, 202, 202, 921, 8841, 273, 1522, 18, 588, 11575, 5621, 202, 202, 921, 460, 31, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 2932, 1625, 315, 1769, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 1466, 18, 2469, 31, 277, 27245, 288, 1082, 202, 430, 261, 8258, 653, 1276, 1599, 51, 11575, 13, 288, 9506, 202, 1132, 273, 14015, 734, 51, 11575, 13, 8841, 2934, 588, 11575, 620, 12, 2821, 63, 77, 8009, 588, 3997, 7287, 10663, 1082, 202, 97, 1082, 202, 12107, 288, 9506, 202, 1132, 273, 1522, 18, 24805, 12, 2821, 63, 77, 8009, 588, 3997, 7287, 10663, 1082, 202, 97, 1082, 202, 4106, 774, 5736, 774, 18, 6923, 12, 2821, 63, 77, 8009, 588, 3997, 7287, 10663, 1082, 202, 4106, 774, 5736, 774, 18, 6923, 2932, 1546, 1769, 1082, 202, 430, 12, 2821, 63, 20, 8009, 588, 6273, 797, 1435, 422, 2144, 18, 1106, 15329, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 12, 1132, 1769, 1082, 202, 97, 1082, 202, 12107, 288, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 2932, 4970, 1769, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 12, 1132, 1769, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 2932, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 6459, 714, 11575, 5262, 7044, 12, 7014, 1943, 1522, 16, 6674, 1613, 774, 5736, 774, 13, 288, 202, 202, 759, 698, 288, 202, 202, 734, 51, 1943, 974, 8526, 1466, 273, 1522, 18, 588, 7014, 1943, 1852, 7675, 588, 11575, 1852, 7675, 588, 2314, 5621, 202, 202, 921, 8841, 273, 1522, 18, 588, 11575, 5621, 202, 202, 921, 460, 31, 9506, 202, 4106, 774, 5736, 774, 18, 6923, 2932, 1625, 315, 1769, 202, 202, 1884, 261, 474, 277, 273, 374, 31, 277, 411, 1466, 18, 2469, 31, 277, 27245, 288, 1082, 202, 430, 261, 8258, 653, 1276, 1599, 51, 11575, 13, 288, 9506, 202, 1132, 273, 14015, 734, 51, 11575, 13, 8841, 2934, 588, 11575, 620, 12, 2 ]
g.setColor(darkShadow); g.drawRect(x, y, w - 2, h - 2);
if (c.isEnabled()) { g.setColor(darkShadow); g.drawRect(x, y, w - 2, h - 2);
public void paintBorder(Component c, Graphics g, int x, int y, int w, int h) { ButtonModel bmodel = null; if (c instanceof AbstractButton) bmodel = ((AbstractButton) c).getModel(); Color darkShadow = MetalLookAndFeel.getControlDarkShadow(); Color shadow = MetalLookAndFeel.getControlShadow(); Color light = MetalLookAndFeel.getWhite(); Color middle = MetalLookAndFeel.getControl(); // draw dark border g.setColor(darkShadow); g.drawRect(x, y, w - 2, h - 2); if (!bmodel.isPressed()) { // draw light border g.setColor(light); g.drawRect(x + 1, y + 1, w - 2, h - 2); // draw crossing pixels of both borders g.setColor(middle); g.drawRect(x + 1, y + h - 2, 0, 0); g.drawRect(x + w - 2, y + 1, 0, 0); } else { // draw light border g.setColor(light); g.drawLine(x + w - 1, y + 1, x + w - 1, y + h - 1); g.drawLine(x + 1, y + h - 1, x + w - 1, y + h - 1); // draw shadow border g.setColor(middle); g.drawLine(x + 1, y + 1, x + w - 2, y + 1); g.drawLine(x + 1, y + 1, x + 1, y + h - 2); // draw crossing pixels of both borders g.setColor(shadow); g.drawRect(x + 1, y + h - 2, 0, 0); g.drawRect(x + w - 2, y + 1, 0, 0); } }
50763 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/50763/3826e72d9ebe31a854c4d01d6c8f1ec65a8d80fe/MetalBorders.java/buggy/core/src/classpath/javax/javax/swing/plaf/metal/MetalBorders.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 12574, 8107, 12, 1841, 276, 16, 16830, 314, 16, 509, 619, 16, 509, 677, 16, 509, 341, 16, 18701, 509, 366, 13, 565, 288, 1377, 12569, 1488, 324, 2284, 273, 446, 31, 5411, 309, 261, 71, 1276, 4115, 3616, 13, 3639, 324, 2284, 273, 14015, 7469, 3616, 13, 276, 2934, 588, 1488, 5621, 1377, 5563, 23433, 12957, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 40, 1313, 12957, 5621, 1377, 5563, 10510, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 12957, 5621, 1377, 5563, 9052, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 13407, 5621, 1377, 5563, 7689, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 5621, 1377, 368, 3724, 23433, 5795, 1377, 314, 18, 542, 2957, 12, 25045, 12957, 1769, 1377, 314, 18, 9446, 6120, 12, 92, 16, 677, 16, 341, 300, 576, 16, 366, 300, 576, 1769, 1377, 309, 16051, 70, 2284, 18, 291, 24624, 10756, 3639, 288, 1850, 368, 3724, 9052, 5795, 1850, 314, 18, 542, 2957, 12, 5099, 1769, 1850, 314, 18, 9446, 6120, 12, 92, 397, 404, 16, 677, 397, 404, 16, 341, 300, 576, 16, 366, 300, 576, 1769, 1850, 368, 3724, 6828, 310, 8948, 434, 3937, 24028, 1850, 314, 18, 542, 2957, 12, 18661, 1769, 1850, 314, 18, 9446, 6120, 12, 92, 397, 404, 16, 677, 397, 366, 300, 576, 16, 374, 16, 374, 1769, 1850, 314, 18, 9446, 6120, 12, 92, 397, 341, 300, 576, 16, 677, 397, 404, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 12574, 8107, 12, 1841, 276, 16, 16830, 314, 16, 509, 619, 16, 509, 677, 16, 509, 341, 16, 18701, 509, 366, 13, 565, 288, 1377, 12569, 1488, 324, 2284, 273, 446, 31, 5411, 309, 261, 71, 1276, 4115, 3616, 13, 3639, 324, 2284, 273, 14015, 7469, 3616, 13, 276, 2934, 588, 1488, 5621, 1377, 5563, 23433, 12957, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 40, 1313, 12957, 5621, 1377, 5563, 10510, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 12957, 5621, 1377, 5563, 9052, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 13407, 5621, 1377, 5563, 7689, 273, 21604, 287, 9794, 1876, 2954, 292, 18, 588, 3367, 5621, 1377, 368, 2 ]
throws InlinePragma {
throws InlinePragma {
protected final void logMessage(int minVerbose, String message) throws InlinePragma { if (Options.verbose.getValue() >= minVerbose) { Log.prependThreadId(); Log.write(" "); Log.writeln(message); } }
5245 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/5245/4c66aa27cec27f8dd5902baec018ff86d7f49ee2/TraceLocal.java/buggy/MMTk/src/org/mmtk/plan/TraceLocal.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 727, 918, 19139, 12, 474, 1131, 14489, 16, 514, 883, 13, 565, 1216, 16355, 2050, 9454, 288, 565, 309, 261, 1320, 18, 11369, 18, 24805, 1435, 1545, 1131, 14489, 13, 288, 1377, 1827, 18, 23100, 3830, 548, 5621, 1377, 1827, 18, 2626, 2932, 565, 315, 1769, 1377, 1827, 18, 5363, 292, 82, 12, 2150, 1769, 565, 289, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 4750, 727, 918, 19139, 12, 474, 1131, 14489, 16, 514, 883, 13, 565, 1216, 16355, 2050, 9454, 288, 565, 309, 261, 1320, 18, 11369, 18, 24805, 1435, 1545, 1131, 14489, 13, 288, 1377, 1827, 18, 23100, 3830, 548, 5621, 1377, 1827, 18, 2626, 2932, 565, 315, 1769, 1377, 1827, 18, 5363, 292, 82, 12, 2150, 1769, 565, 289, 225, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Node languageAttribute = child.getAttributes().getNamedItem(LANGUAGE_ATTRIBUTE_NAME);
Node languageAttribute = child.getAttributes().getNamedItem(LANGUAGE_ATTRIBUTE_NAME);
public Label[] getLabels() { ArrayList labels = new ArrayList(); NodeList children = node.getChildNodes(); for (int i = 0; i < children.getLength(); i++) { NamedNodeMap attributes = children.item(i).getAttributes(); Node child = children.item(i); if ((child.getNodeType() == Node.ELEMENT_NODE) && child.getNodeName().equals(LABEL_NAME)) { String labelName = DocumentHelper.getSimpleElementText((Element) child); String labelLanguage = null; Node languageAttribute = child.getAttributes().getNamedItem(LANGUAGE_ATTRIBUTE_NAME); if (languageAttribute != null) { labelLanguage = languageAttribute.getNodeValue(); } labels.add(new Label(labelName, labelLanguage)); } } return (Label[]) labels.toArray(new Label[labels.size()]); }
45951 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45951/83e57983e924fc5578be94737b013d6a0923c57a/SiteTreeNodeImpl.java/clean/src/java/org/apache/lenya/cms/publication/SiteTreeNodeImpl.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 5287, 8526, 336, 5888, 1435, 288, 3639, 2407, 3249, 273, 394, 2407, 5621, 3639, 16781, 2325, 273, 756, 18, 588, 22460, 5621, 3639, 364, 261, 474, 277, 273, 374, 31, 277, 411, 2325, 18, 588, 1782, 5621, 277, 27245, 288, 5411, 9796, 907, 863, 1677, 273, 2325, 18, 1726, 12, 77, 2934, 588, 2498, 5621, 5411, 2029, 1151, 273, 2325, 18, 1726, 12, 77, 1769, 5411, 309, 14015, 3624, 18, 588, 15101, 1435, 422, 2029, 18, 10976, 67, 8744, 13, 597, 10792, 1151, 18, 588, 18948, 7675, 14963, 12, 13545, 67, 1985, 3719, 288, 7734, 514, 1433, 461, 273, 4319, 2276, 18, 588, 5784, 1046, 1528, 12443, 1046, 13, 1151, 1769, 7734, 514, 1433, 3779, 273, 446, 31, 7734, 2029, 2653, 1499, 273, 1151, 18, 588, 2498, 7675, 588, 7604, 1180, 12, 15547, 67, 11616, 67, 1985, 1769, 7734, 309, 261, 4923, 1499, 480, 446, 13, 288, 10792, 1433, 3779, 273, 2653, 1499, 18, 588, 907, 620, 5621, 7734, 289, 7734, 3249, 18, 1289, 12, 2704, 5287, 12, 1925, 461, 16, 1433, 3779, 10019, 5411, 289, 3639, 289, 3639, 327, 261, 2224, 63, 5717, 3249, 18, 31447, 12, 2704, 5287, 63, 5336, 18, 1467, 1435, 19226, 565, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 5287, 8526, 336, 5888, 1435, 288, 3639, 2407, 3249, 273, 394, 2407, 5621, 3639, 16781, 2325, 273, 756, 18, 588, 22460, 5621, 3639, 364, 261, 474, 277, 273, 374, 31, 277, 411, 2325, 18, 588, 1782, 5621, 277, 27245, 288, 5411, 9796, 907, 863, 1677, 273, 2325, 18, 1726, 12, 77, 2934, 588, 2498, 5621, 5411, 2029, 1151, 273, 2325, 18, 1726, 12, 77, 1769, 5411, 309, 14015, 3624, 18, 588, 15101, 1435, 422, 2029, 18, 10976, 67, 8744, 13, 597, 10792, 1151, 18, 588, 18948, 7675, 14963, 12, 13545, 67, 1985, 3719, 288, 7734, 514, 1433, 461, 273, 4319, 2276, 18, 588, 5784, 1046, 1528, 12443, 1046, 13, 1151, 1769, 7734, 514, 1433, 3779, 273, 446, 2 ]
if (fUpdateJob != null)
if (fUpdateJob != null) {
private void updateList() { fFilteredCount = filter(); fFoldedCount = fold(); if (fUpdateJob != null) fUpdateJob.cancel(); fUpdateJob = new TableUpdateJob(fList, fFoldedCount); fUpdateJob.schedule(); }
57470 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/57470/fa4a8cff0e027f8d3c6b1fcb92b30f46767dd191/FilteredList.java/buggy/bundles/org.eclipse.ui.workbench/Eclipse UI/org/eclipse/ui/dialogs/FilteredList.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1089, 682, 1435, 288, 202, 202, 74, 14478, 1380, 273, 1034, 5621, 202, 202, 74, 42, 355, 785, 1380, 273, 11590, 5621, 202, 202, 430, 261, 74, 1891, 2278, 480, 446, 13, 1082, 202, 74, 1891, 2278, 18, 10996, 5621, 202, 202, 74, 1891, 2278, 273, 394, 3555, 1891, 2278, 12, 74, 682, 16, 284, 42, 355, 785, 1380, 1769, 202, 202, 74, 1891, 2278, 18, 10676, 5621, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1152, 918, 1089, 682, 1435, 288, 202, 202, 74, 14478, 1380, 273, 1034, 5621, 202, 202, 74, 42, 355, 785, 1380, 273, 11590, 5621, 202, 202, 430, 261, 74, 1891, 2278, 480, 446, 13, 1082, 202, 74, 1891, 2278, 18, 10996, 5621, 202, 202, 74, 1891, 2278, 273, 394, 3555, 1891, 2278, 12, 74, 682, 16, 284, 42, 355, 785, 1380, 1769, 202, 202, 74, 1891, 2278, 18, 10676, 5621, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (obj instanceof Serializable)
if (osc != null && obj instanceof Serializable)
private Object processResolution(Object obj, int handle) throws IOException { if (obj instanceof Serializable) { Method m = null; try { Class classArgs[] = {}; m = getMethod(obj.getClass(), "readResolve", classArgs); obj = m.invoke(obj, new Object[] {}); } catch (NoSuchMethodException ignore) { } catch (IllegalAccessException ignore) { } catch (InvocationTargetException ignore) { } } if (this.resolveEnabled) obj = resolveObject(obj); this.objectLookupTable.put(new Integer(handle), new ObjectIdentityWrapper(obj)); return obj; }
56365 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/56365/287ecb3eab399e579158e4cbd037261f67ffbc1b/ObjectInputStream.java/buggy/libjava/java/io/ObjectInputStream.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 1033, 1207, 11098, 12, 921, 1081, 16, 509, 1640, 13, 565, 1216, 1860, 225, 288, 565, 309, 261, 538, 71, 480, 446, 597, 1081, 1276, 13687, 13, 1377, 288, 3639, 2985, 312, 273, 446, 31, 225, 202, 698, 202, 225, 288, 202, 565, 1659, 667, 2615, 8526, 273, 2618, 31, 202, 565, 312, 273, 6272, 12, 2603, 18, 588, 797, 9334, 315, 896, 8460, 3113, 667, 2615, 1769, 202, 565, 1081, 273, 312, 18, 14407, 12, 2603, 16, 394, 1033, 8526, 2618, 1769, 1082, 225, 289, 202, 14683, 261, 28341, 14513, 2305, 13, 202, 225, 288, 202, 225, 289, 202, 14683, 261, 12195, 9773, 2305, 13, 202, 225, 288, 202, 225, 289, 202, 14683, 261, 9267, 14950, 2305, 13, 202, 225, 288, 202, 225, 289, 1377, 289, 565, 309, 261, 2211, 18, 10828, 1526, 13, 1377, 1081, 273, 2245, 921, 12, 2603, 1769, 565, 333, 18, 1612, 6609, 1388, 18, 458, 12, 2704, 2144, 12, 4110, 3631, 9506, 4202, 394, 1033, 4334, 3611, 12, 2603, 10019, 565, 327, 1081, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 3238, 1033, 1207, 11098, 12, 921, 1081, 16, 509, 1640, 13, 565, 1216, 1860, 225, 288, 565, 309, 261, 538, 71, 480, 446, 597, 1081, 1276, 13687, 13, 1377, 288, 3639, 2985, 312, 273, 446, 31, 225, 202, 698, 202, 225, 288, 202, 565, 1659, 667, 2615, 8526, 273, 2618, 31, 202, 565, 312, 273, 6272, 12, 2603, 18, 588, 797, 9334, 315, 896, 8460, 3113, 667, 2615, 1769, 202, 565, 1081, 273, 312, 18, 14407, 12, 2603, 16, 394, 1033, 8526, 2618, 1769, 1082, 225, 289, 202, 14683, 261, 28341, 14513, 2305, 13, 202, 225, 288, 202, 225, 289, 202, 14683, 261, 12195, 9773, 2305, 13, 202, 225, 288, 202, 225, 289, 202, 14683, 261, 9267, 14950, 2 ]
public String toString() { final String lineSeparator = System.getProperty( "line.separator" ); final String brace = ": "; final StringBuffer sb = new StringBuffer( EXTENSION_NAME.toString() ); sb.append( brace ); sb.append( m_extensionName ); sb.append( lineSeparator ); if( null != m_specificationVersion ) { sb.append( SPECIFICATION_VERSION ); sb.append( brace ); sb.append( m_specificationVersion ); sb.append( lineSeparator ); } if( null != m_specificationVendor ) { sb.append( SPECIFICATION_VENDOR ); sb.append( brace ); sb.append( m_specificationVendor ); sb.append( lineSeparator ); } if( null != m_implementationVersion ) { sb.append( IMPLEMENTATION_VERSION ); sb.append( brace ); sb.append( m_implementationVersion ); sb.append( lineSeparator ); } if( null != m_implementationVendorID ) { sb.append( IMPLEMENTATION_VENDOR_ID ); sb.append( brace ); sb.append( m_implementationVendorID ); sb.append( lineSeparator ); } if( null != m_implementationVendor ) { sb.append( IMPLEMENTATION_VENDOR ); sb.append( brace ); sb.append( m_implementationVendor ); sb.append( lineSeparator ); } if( null != m_implementationURL ) { sb.append( IMPLEMENTATION_URL ); sb.append( brace ); sb.append( m_implementationURL ); sb.append( lineSeparator ); } return sb.toString(); }
2044 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2044/e622ff134f94da7c133006a05d0aab68115a1013/Extension.java/buggy/scm/loom/support/extension/src/java/org/realityforge/extension/Extension.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 780, 10492, 1435, 95, 6385, 780, 1369, 6581, 33, 3163, 18, 588, 1396, 2932, 1369, 18, 11287, 8863, 6385, 780, 70, 9963, 1546, 2773, 31, 6385, 780, 13699, 70, 33, 2704, 780, 1892, 12, 12796, 67, 1985, 18, 10492, 10663, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 6447, 461, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 430, 12, 2011, 5, 33, 81, 67, 31543, 1444, 15329, 18366, 18, 6923, 12, 13847, 14865, 67, 5757, 1769, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 31543, 1444, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 97, 430, 12, 2011, 5, 33, 81, 67, 31543, 14786, 15329, 18366, 18, 6923, 12, 13847, 14865, 67, 58, 30014, 1769, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 31543, 14786, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 97, 430, 12, 2011, 5, 33, 81, 67, 30810, 1444, 15329, 18366, 18, 6923, 12, 9883, 7618, 2689, 67, 5757, 1769, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 30810, 1444, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 97, 430, 12, 2011, 5, 33, 81, 67, 30810, 14786, 734, 15329, 18366, 18, 6923, 12, 9883, 7618, 2689, 67, 58, 30014, 67, 734, 1769, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 30810, 14786, 734, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 97, 430, 12, 2011, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1071, 780, 10492, 1435, 95, 6385, 780, 1369, 6581, 33, 3163, 18, 588, 1396, 2932, 1369, 18, 11287, 8863, 6385, 780, 70, 9963, 1546, 2773, 31, 6385, 780, 13699, 70, 33, 2704, 780, 1892, 12, 12796, 67, 1985, 18, 10492, 10663, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 6447, 461, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 430, 12, 2011, 5, 33, 81, 67, 31543, 1444, 15329, 18366, 18, 6923, 12, 13847, 14865, 67, 5757, 1769, 18366, 18, 6923, 12, 70, 9963, 1769, 18366, 18, 6923, 12, 81, 67, 31543, 1444, 1769, 18366, 18, 6923, 12, 1369, 6581, 1769, 97, 430, 12, 2011, 5, 33, 81, 67, 31543, 14786, 15329, 18366, 18, 2 ]
AST tmp270_AST_in = (AST)_t;
AST tmp269_AST_in = (AST)_t;
public final void block_opt(AST _t) throws RecognitionException { AST block_opt_AST_in = (_t == ASTNULL) ? null : (AST)_t; if (_t==null) _t=ASTNULL; switch ( _t.getType()) { case Block_iterator: { AST __t230 = _t; AST tmp265_AST_in = (AST)_t; match(_t,Block_iterator); _t = _t.getFirstChild(); field(_t); _t = _retTree; AST tmp266_AST_in = (AST)_t; match(_t,EQUAL); _t = _t.getNextSibling(); expression(_t); _t = _retTree; AST tmp267_AST_in = (AST)_t; match(_t,TO); _t = _t.getNextSibling(); expression(_t); _t = _retTree; { if (_t==null) _t=ASTNULL; switch ( _t.getType()) { case BY: { AST tmp268_AST_in = (AST)_t; match(_t,BY); _t = _t.getNextSibling(); constant(_t); _t = _retTree; break; } case 3: { break; } default: { throw new NoViableAltException(_t); } } } _t = __t230; _t = _t.getNextSibling(); break; } case QUERYTUNING: { querytuningphrase(_t); _t = _retTree; break; } case WHILE: { AST __t232 = _t; AST tmp269_AST_in = (AST)_t; match(_t,WHILE); _t = _t.getFirstChild(); expression(_t); _t = _retTree; _t = __t232; _t = _t.getNextSibling(); break; } case TRANSACTION: { AST tmp270_AST_in = (AST)_t; match(_t,TRANSACTION); _t = _t.getNextSibling(); break; } case ON: { on___phrase(_t); _t = _retTree; break; } case WITH: { framephrase(_t); _t = _retTree; break; } case BREAK: { AST tmp271_AST_in = (AST)_t; match(_t,BREAK); _t = _t.getNextSibling(); break; } case BY: { AST __t233 = _t; AST tmp272_AST_in = (AST)_t; match(_t,BY); _t = _t.getFirstChild(); expression(_t); _t = _retTree; { if (_t==null) _t=ASTNULL; switch ( _t.getType()) { case DESCENDING: { AST tmp273_AST_in = (AST)_t; match(_t,DESCENDING); _t = _t.getNextSibling(); break; } case 3: { break; } default: { throw new NoViableAltException(_t); } } } _t = __t233; _t = _t.getNextSibling(); break; } case COLLATE: { collatephrase(_t); _t = _retTree; break; } case GROUP: { AST __t235 = _t; AST tmp274_AST_in = (AST)_t; match(_t,GROUP); _t = _t.getFirstChild(); { int _cnt239=0; _loop239: do { if (_t==null) _t=ASTNULL; if ((_t.getType()==BY)) { AST __t237 = _t; AST tmp275_AST_in = (AST)_t; match(_t,BY); _t = _t.getFirstChild(); expression(_t); _t = _retTree; { if (_t==null) _t=ASTNULL; switch ( _t.getType()) { case DESCENDING: { AST tmp276_AST_in = (AST)_t; match(_t,DESCENDING); _t = _t.getNextSibling(); break; } case 3: { break; } default: { throw new NoViableAltException(_t); } } } _t = __t237; _t = _t.getNextSibling(); } else { if ( _cnt239>=1 ) { break _loop239; } else {throw new NoViableAltException(_t);} } _cnt239++; } while (true); } _t = __t235; _t = _t.getNextSibling(); break; } default: { throw new NoViableAltException(_t); } } _retTree = _t; }
13952 /local/tlutelli/issta_data/temp/all_java1context/java/2006_temp/2006/13952/daa15e07422d3491bbbb4d0060450c81983332a4/TreeParser03.java/clean/trunk/org.prorefactor.core/src/org/prorefactor/treeparser03/TreeParser03.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 1203, 67, 3838, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 1203, 67, 3838, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, 446, 294, 261, 9053, 13, 67, 88, 31, 9506, 202, 430, 261, 67, 88, 631, 2011, 13, 389, 88, 33, 9053, 8560, 31, 202, 202, 9610, 261, 389, 88, 18, 588, 559, 10756, 288, 202, 202, 3593, 3914, 67, 9838, 30, 202, 202, 95, 1082, 202, 9053, 1001, 88, 29157, 273, 389, 88, 31, 1082, 202, 9053, 1853, 30281, 67, 9053, 67, 267, 273, 261, 9053, 13, 67, 88, 31, 1082, 202, 1916, 24899, 88, 16, 1768, 67, 9838, 1769, 1082, 202, 67, 88, 273, 389, 88, 18, 588, 3759, 1763, 5621, 1082, 202, 1518, 24899, 88, 1769, 1082, 202, 67, 88, 273, 389, 1349, 2471, 31, 1082, 202, 9053, 1853, 5558, 26, 67, 9053, 67, 267, 273, 261, 9053, 13, 67, 88, 31, 1082, 202, 1916, 24899, 88, 16, 12853, 1769, 1082, 202, 67, 88, 273, 389, 88, 18, 588, 2134, 10291, 5621, 1082, 202, 8692, 24899, 88, 1769, 1082, 202, 67, 88, 273, 389, 1349, 2471, 31, 1082, 202, 9053, 1853, 5558, 27, 67, 9053, 67, 267, 273, 261, 9053, 13, 67, 88, 31, 1082, 202, 1916, 24899, 88, 16, 4296, 1769, 1082, 202, 67, 88, 273, 389, 88, 18, 588, 2134, 10291, 5621, 1082, 202, 8692, 24899, 88, 1769, 1082, 202, 67, 88, 273, 389, 1349, 2471, 31, 1082, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 727, 918, 1203, 67, 3838, 12, 9053, 389, 88, 13, 1216, 9539, 288, 9506, 202, 9053, 1203, 67, 3838, 67, 9053, 67, 267, 273, 261, 67, 88, 422, 9183, 8560, 13, 692, 446, 294, 261, 9053, 13, 67, 88, 31, 9506, 202, 430, 261, 67, 88, 631, 2011, 13, 389, 88, 33, 9053, 8560, 31, 202, 202, 9610, 261, 389, 88, 18, 588, 559, 10756, 288, 202, 202, 3593, 3914, 67, 9838, 30, 202, 202, 95, 1082, 202, 9053, 1001, 88, 29157, 273, 389, 88, 31, 1082, 202, 9053, 1853, 30281, 67, 9053, 67, 267, 273, 261, 9053, 13, 67, 88, 31, 1082, 202, 1916, 24899, 88, 16, 1768, 67, 9838, 1769, 1082, 202, 67, 88, 2 ]
assertEquals(true, new DateMidnight(TEST_TIME_NOW_UTC + 1).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC - 1).isAfter(null));
assertEquals(true, new DateMidnight(TEST_TIME_NOW_UTC + DateTimeConstants.MILLIS_PER_DAY, DateTimeZone.UTC).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC, DateTimeZone.UTC).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC - DateTimeConstants.MILLIS_PER_DAY, DateTimeZone.UTC).isAfter(null)); assertEquals(true, new DateMidnight(2004, 6, 9).isAfter(new DateTime(2004, 6, 8, 23, 59, 59, 999))); assertEquals(false, new DateMidnight(2004, 6, 9).isAfter(new DateTime(2004, 6, 9, 0, 0, 0, 0))); assertEquals(false, new DateMidnight(2004, 6, 9).isAfter(new DateTime(2004, 6, 9, 0, 0, 0, 1)));
public void testIsAfter() { DateMidnight test1 = new DateMidnight(TEST_TIME1_UTC); DateMidnight test1a = new DateMidnight(TEST_TIME1_UTC); assertEquals(false, test1.isAfter(test1a)); assertEquals(false, test1a.isAfter(test1)); assertEquals(false, test1.isAfter(test1)); assertEquals(false, test1a.isAfter(test1a)); DateMidnight test2 = new DateMidnight(TEST_TIME2_UTC); assertEquals(false, test1.isAfter(test2)); assertEquals(true, test2.isAfter(test1)); DateMidnight test3 = new DateMidnight(TEST_TIME2_UTC, GregorianChronology.getInstance(PARIS)); assertEquals(false, test1.isAfter(test3)); assertEquals(true, test3.isAfter(test1)); assertEquals(false, test3.isAfter(test2)); // midnight paris before london assertEquals(true, test2.isAfter(new MockInstant())); assertEquals(false, test1.isAfter(new MockInstant())); assertEquals(true, new DateMidnight(TEST_TIME_NOW_UTC + 1).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC).isAfter(null)); assertEquals(false, new DateMidnight(TEST_TIME_NOW_UTC - 1).isAfter(null)); }
52681 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/52681/65e7ca2ded288178ba13fa552ae61fd226cae8d0/TestDateMidnight_Basics.java/buggy/JodaTime/src/test/org/joda/time/TestDateMidnight_Basics.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 2520, 4436, 1435, 288, 3639, 2167, 20711, 18840, 1842, 21, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 21, 67, 11471, 1769, 3639, 2167, 20711, 18840, 1842, 21, 69, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 21, 67, 11471, 1769, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 21, 69, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 69, 18, 291, 4436, 12, 3813, 21, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 21, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 69, 18, 291, 4436, 12, 3813, 21, 69, 10019, 7734, 2167, 20711, 18840, 1842, 22, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 22, 67, 11471, 1769, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 22, 10019, 3639, 1815, 8867, 12, 3767, 16, 1842, 22, 18, 291, 4436, 12, 3813, 21, 10019, 7734, 2167, 20711, 18840, 1842, 23, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 22, 67, 11471, 16, 21913, 23809, 18, 588, 1442, 12, 2778, 5127, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 23, 10019, 3639, 1815, 8867, 12, 3767, 16, 1842, 23, 18, 291, 4436, 12, 3813, 21, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 23, 18, 291, 4436, 12, 3813, 22, 10019, 225, 368, 7501, 18840, 779, 291, 1865, 328, 1434, 265, 7734, 1815, 8867, 12, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 1071, 918, 1842, 2520, 4436, 1435, 288, 3639, 2167, 20711, 18840, 1842, 21, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 21, 67, 11471, 1769, 3639, 2167, 20711, 18840, 1842, 21, 69, 273, 394, 2167, 20711, 18840, 12, 16961, 67, 4684, 21, 67, 11471, 1769, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 21, 69, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 69, 18, 291, 4436, 12, 3813, 21, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 18, 291, 4436, 12, 3813, 21, 10019, 3639, 1815, 8867, 12, 5743, 16, 1842, 21, 69, 18, 291, 4436, 12, 3813, 21, 69, 10019, 7734, 2167, 20711, 18840, 1842, 22, 273, 394, 2 ]
public String generateClassifier(MClassifier cls) { String generatedName = generateName(cls.getName()); String classifierKeyword; if (cls instanceof MClassImpl) classifierKeyword = "class"; else if (cls instanceof MInterface) classifierKeyword = "interface"; else return ""; // actors and use cases StringBuffer sb = new StringBuffer(80); sb.append(DocumentationManager.getComments(cls)); // Add the comments for this classifier first. /* * Replaced 2001-09-26 STEFFEN ZSCHALER * * Was: * sb.append(DocumentationManager.getDocs(cls)).append("\n"); */ sb.append (generateConstraintEnrichedDocComment (cls)).append ("\n"); sb.append(generateVisibility(cls.getVisibility())); if (cls.isAbstract() && !(cls instanceof MInterface)) sb.append("abstract "); if (cls.isLeaf()) sb.append("final "); sb.append(classifierKeyword).append(" ").append(generatedName); String baseClass = generateGeneralzation(cls.getGeneralizations()); String tv = null; if (!baseClass.equals("")) sb.append(' ').append("extends ").append(baseClass); // nsuml: realizations! if (cls instanceof MClass) { String interfaces = generateSpecification((MClass)cls); if (!interfaces.equals("")) sb.append(' ').append("implements ").append(interfaces); } sb.append("\n{"); tv = generateTaggedValues(cls); if (tv != null && tv.length() > 0) sb.append(INDENT).append(tv); // sb.append(generateConstraints(cls)); Removed 2001-09-26 STEFFEN ZSCHALER Collection strs = MMUtil.SINGLETON.getAttributes(cls); if (strs != null) { sb.append('\n'); if (cls instanceof MClassImpl) sb.append(INDENT).append("// Attributes\n"); Iterator strEnum = strs.iterator(); while (strEnum.hasNext()) { MStructuralFeature sf = (MStructuralFeature) strEnum.next(); sb.append('\n').append(INDENT).append(generate(sf)); tv = generateTaggedValues(sf); if (tv != null && tv.length() > 0) sb.append(INDENT).append(tv).append('\n'); } } Collection ends = cls.getAssociationEnds(); if (ends != null) { sb.append('\n'); if (cls instanceof MClassImpl) sb.append(INDENT).append("// Associations\n"); Iterator endEnum = ends.iterator(); while (endEnum.hasNext()) { MAssociationEnd ae = (MAssociationEnd) endEnum.next(); MAssociation a = ae.getAssociation(); sb.append('\n').append(INDENT).append(generateAssociationFrom(a, ae)); tv = generateTaggedValues(a); if (tv != null && tv.length() > 0) sb.append(INDENT).append(tv); // sb.append(generateConstraints(a)); Removed 2001-09-26 STEFFEN ZSCHALER Why was this not in generateAssociationFrom ? } } // needs-more-work: constructors Collection behs = MMUtil.SINGLETON.getOperations(cls); if (behs != null) { sb.append('\n'); sb.append(INDENT).append("// Operations\n"); Iterator behEnum = behs.iterator(); String terminator1 = "\n" + INDENT + "{"; String terminator2 = INDENT + "}"; if (cls instanceof MInterface) { terminator1 = ";\n"; terminator2 = ""; } while (behEnum.hasNext()) { MBehavioralFeature bf = (MBehavioralFeature) behEnum.next(); sb.append('\n').append(INDENT).append(generate(bf)).append(terminator1); tv = generateTaggedValues((MModelElement)bf); if (tv.length() > 0) sb.append(INDENT).append(tv); // sb.append(generateConstraints((MModelElement)bf)); Removed 2001-09-26 STEFFEN ZSCHALER Why was this not in generateOperation / generateClassifier ? // there is no ReturnType in behavioral feature (nsuml) if (cls instanceof MClassImpl && bf instanceof MOperation) { sb.append(generateMethodBody((MOperation)bf)).append('\n'); } sb.append(terminator2).append('\n'); } } sb.append("} /* end ").append(classifierKeyword).append(' ').append(generatedName).append(" */\n"); return sb.toString(); }
7166 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/7166/ebbe913c702586f73c81ff016e794421e6055904/GeneratorJava.java/clean/src_new/org/argouml/language/java/generator/GeneratorJava.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 2103, 13860, 12, 49, 13860, 2028, 13, 288, 565, 514, 4374, 461, 273, 2103, 461, 12, 6429, 18, 17994, 10663, 565, 514, 14622, 8736, 31, 565, 309, 261, 6429, 1276, 490, 797, 2828, 13, 14622, 8736, 273, 315, 1106, 14432, 565, 469, 309, 261, 6429, 1276, 490, 1358, 13, 14622, 8736, 273, 315, 5831, 14432, 565, 469, 327, 1408, 31, 368, 27141, 471, 999, 6088, 565, 6674, 2393, 273, 394, 6674, 12, 3672, 1769, 565, 2393, 18, 6923, 12, 18905, 1318, 18, 588, 9051, 12, 6429, 10019, 225, 368, 1436, 326, 5678, 364, 333, 14622, 1122, 18, 565, 1748, 377, 380, 6910, 72, 4044, 21, 17, 5908, 17, 5558, 22839, 2246, 1157, 2285, 55, 1792, 1013, 654, 377, 380, 377, 380, 28938, 30, 377, 380, 565, 2393, 18, 6923, 12, 18905, 1318, 18, 588, 12656, 12, 6429, 13, 2934, 6923, 31458, 82, 8863, 377, 1195, 565, 2393, 18, 6923, 261, 7163, 5806, 664, 12761, 329, 1759, 4469, 261, 6429, 13, 2934, 6923, 7566, 64, 82, 8863, 565, 2393, 18, 6923, 12, 7163, 10135, 12, 6429, 18, 588, 10135, 1435, 10019, 565, 309, 261, 6429, 18, 291, 7469, 1435, 597, 401, 12, 6429, 1276, 490, 1358, 3719, 2393, 18, 6923, 2932, 17801, 315, 1769, 565, 309, 261, 6429, 18, 291, 9858, 10756, 2393, 18, 6923, 2932, 6385, 315, 1769, 565, 2393, 18, 6923, 12, 1106, 1251, 8736, 2934, 6923, 2932, 315, 2934, 6923, 12, 11168, 461, 1769, 565, 514, 23955, 273, 2103, 12580, 94, 367, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 1071, 514, 2103, 13860, 12, 49, 13860, 2028, 13, 288, 565, 514, 4374, 461, 273, 2103, 461, 12, 6429, 18, 17994, 10663, 565, 514, 14622, 8736, 31, 565, 309, 261, 6429, 1276, 490, 797, 2828, 13, 14622, 8736, 273, 315, 1106, 14432, 565, 469, 309, 261, 6429, 1276, 490, 1358, 13, 14622, 8736, 273, 315, 5831, 14432, 565, 469, 327, 1408, 31, 368, 27141, 471, 999, 6088, 565, 6674, 2393, 273, 394, 6674, 12, 3672, 1769, 565, 2393, 18, 6923, 12, 18905, 1318, 18, 588, 9051, 12, 6429, 10019, 225, 368, 1436, 326, 5678, 364, 333, 14622, 1122, 18, 565, 1748, 377, 380, 6910, 72, 4044, 21, 17, 5908, 17, 5558, 22839, 2246, 1157, 2285, 55, 1792, 1013, 2 ]
new Object[] { fXSDDescription.getLocationHints()[0] },
new Object[] { locationHints != null ? locationHints[0] : XMLSymbols.EMPTY_STRING },
SchemaGrammar findSchemaGrammar( short contextType, String namespace, QName enclosingElement, QName triggeringComponet, XMLAttributes attributes) { SchemaGrammar grammar = null; //get the grammar from local pool... grammar = fGrammarBucket.getGrammar(namespace); if (grammar == null) { fXSDDescription.reset(); fXSDDescription.fContextType = contextType; fXSDDescription.setNamespace(namespace); fXSDDescription.fEnclosedElementName = enclosingElement; fXSDDescription.fTriggeringComponent = triggeringComponet; fXSDDescription.fAttributes = attributes; if (fLocator != null) { fXSDDescription.setBaseSystemId(fLocator.getExpandedSystemId()); } String[] temp = null; Object locationArray = fLocationPairs.get(namespace == null ? XMLSymbols.EMPTY_STRING : namespace); if (locationArray != null) temp = ((XMLSchemaLoader.LocationArray) locationArray).getLocationArray(); if (temp != null && temp.length != 0) { fXSDDescription.fLocationHints = new String[temp.length]; System.arraycopy(temp, 0, fXSDDescription.fLocationHints, 0, temp.length); } // give a chance to application to be able to retreive the grammar. if (fGrammarPool != null) { grammar = (SchemaGrammar) fGrammarPool.retrieveGrammar(fXSDDescription); if (grammar != null) { // put this grammar into the bucket, along with grammars // imported by it (directly or indirectly) if (!fGrammarBucket.putGrammar(grammar, true)) { // REVISIT: a conflict between new grammar(s) and grammars // in the bucket. What to do? A warning? An exception? fXSIErrorReporter.fErrorReporter.reportError( XSMessageFormatter.SCHEMA_DOMAIN, "GrammarConflict", null, XMLErrorReporter.SEVERITY_WARNING); grammar = null; } } } if (grammar == null && !fUseGrammarPoolOnly) { // try to parse the grammar using location hints from that namespace.. try { XMLInputSource xis = XMLSchemaLoader.resolveDocument( fXSDDescription, fLocationPairs, fEntityResolver); grammar = fSchemaLoader.loadSchema(fXSDDescription, xis, fLocationPairs); } catch (IOException ex) { fXSIErrorReporter.fErrorReporter.reportError( XSMessageFormatter.SCHEMA_DOMAIN, "schema_reference.4", new Object[] { fXSDDescription.getLocationHints()[0] }, XMLErrorReporter.SEVERITY_WARNING); } } } return grammar; } //findSchemaGrammar
4434 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/4434/9231cb3a3675ca5bbd7fbbca689bf7b0fa258ee1/XMLSchemaValidator.java/clean/src/org/apache/xerces/impl/xs/XMLSchemaValidator.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4611, 18576, 1104, 3078, 18576, 12, 3639, 3025, 819, 559, 16, 3639, 514, 1981, 16, 3639, 16723, 16307, 1046, 16, 3639, 16723, 27411, 799, 500, 278, 16, 3639, 3167, 2498, 1677, 13, 288, 3639, 4611, 18576, 6473, 273, 446, 31, 3639, 368, 588, 326, 6473, 628, 1191, 2845, 2777, 3639, 6473, 273, 284, 18576, 4103, 18, 588, 18576, 12, 4937, 1769, 3639, 309, 261, 31628, 422, 446, 13, 288, 5411, 284, 31244, 3291, 18, 6208, 5621, 5411, 284, 31244, 3291, 18, 74, 1042, 559, 273, 819, 559, 31, 5411, 284, 31244, 3291, 18, 542, 3402, 12, 4937, 1769, 5411, 284, 31244, 3291, 18, 74, 4280, 13783, 30584, 273, 16307, 1046, 31, 5411, 284, 31244, 3291, 18, 74, 6518, 310, 1841, 273, 27411, 799, 500, 278, 31, 5411, 284, 31244, 3291, 18, 74, 2498, 273, 1677, 31, 5411, 309, 261, 74, 5786, 480, 446, 13, 288, 7734, 284, 31244, 3291, 18, 542, 2171, 3163, 548, 12, 74, 5786, 18, 588, 17957, 3163, 548, 10663, 5411, 289, 5411, 514, 8526, 1906, 273, 446, 31, 5411, 1033, 2117, 1076, 273, 7734, 284, 2735, 10409, 18, 588, 12, 4937, 422, 446, 692, 3167, 14821, 18, 13625, 67, 5804, 294, 1981, 1769, 5411, 309, 261, 3562, 1076, 480, 446, 13, 7734, 1906, 273, 14015, 4201, 3078, 2886, 18, 2735, 1076, 13, 2117, 1076, 2934, 588, 2735, 1076, 5621, 5411, 309, 261, 5814, 480, 446, 597, 1906, 18, 2469, 480, 374, 13, 288, 7734, 284, 31244, 3291, 18, 74, 2735, 13368, 273, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 377, 4611, 18576, 1104, 3078, 18576, 12, 3639, 3025, 819, 559, 16, 3639, 514, 1981, 16, 3639, 16723, 16307, 1046, 16, 3639, 16723, 27411, 799, 500, 278, 16, 3639, 3167, 2498, 1677, 13, 288, 3639, 4611, 18576, 6473, 273, 446, 31, 3639, 368, 588, 326, 6473, 628, 1191, 2845, 2777, 3639, 6473, 273, 284, 18576, 4103, 18, 588, 18576, 12, 4937, 1769, 3639, 309, 261, 31628, 422, 446, 13, 288, 5411, 284, 31244, 3291, 18, 6208, 5621, 5411, 284, 31244, 3291, 18, 74, 1042, 559, 273, 819, 559, 31, 5411, 284, 31244, 3291, 18, 542, 3402, 12, 4937, 1769, 5411, 284, 31244, 3291, 18, 74, 4280, 13783, 30584, 273, 16307, 1046, 31, 5411, 284, 31244, 3291, 18, 74, 6518, 2 ]
throw new MessageInvalidException(ProtocolErrorMessage.NO_SUCH_IDENTIFIER, "Not found", identifier);
throw new MessageInvalidException(ProtocolErrorMessage.NO_SUCH_IDENTIFIER, "Not found", identifier, isGlobalQueue);
public void removeByIdentifier(String identifier, boolean kill) throws MessageInvalidException { ClientRequest req; boolean logMINOR = Logger.shouldLog(Logger.MINOR, this); if(logMINOR) Logger.minor(this, "removeByIdentifier("+identifier+ ',' +kill+ ')'); synchronized(this) { req = (ClientRequest) clientRequestsByIdentifier.get(identifier); if(req == null) throw new MessageInvalidException(ProtocolErrorMessage.NO_SUCH_IDENTIFIER, "Not in hash", identifier); else if(!(runningPersistentRequests.remove(req) || completedUnackedRequests.remove(req))) throw new MessageInvalidException(ProtocolErrorMessage.NO_SUCH_IDENTIFIER, "Not found", identifier); clientRequestsByIdentifier.remove(identifier); } if(kill) { if(logMINOR) Logger.minor(this, "Killing request "+req); req.cancel(); } server.forceStorePersistentRequests(); }
49933 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/49933/bbb3c23ec38ea1c7abb48040a17f5fc7932248bc/FCPClient.java/buggy/src/freenet/node/fcp/FCPClient.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1206, 27498, 12, 780, 2756, 16, 1250, 8673, 13, 1216, 2350, 1941, 503, 288, 202, 202, 1227, 691, 1111, 31, 202, 202, 6494, 613, 6236, 916, 273, 4242, 18, 13139, 1343, 12, 3328, 18, 6236, 916, 16, 333, 1769, 202, 202, 430, 12, 1330, 6236, 916, 13, 4242, 18, 17364, 12, 2211, 16, 315, 4479, 27498, 2932, 15, 5644, 15, 3316, 397, 16418, 15, 5777, 1769, 202, 202, 22043, 12, 2211, 13, 288, 1082, 202, 3658, 273, 261, 1227, 691, 13, 1004, 6421, 27498, 18, 588, 12, 5644, 1769, 1082, 202, 430, 12, 3658, 422, 446, 13, 9506, 202, 12849, 394, 2350, 1941, 503, 12, 5752, 14935, 18, 3417, 67, 19958, 67, 16606, 16, 315, 1248, 316, 1651, 3113, 2756, 1769, 1082, 202, 12107, 309, 12, 5, 12, 8704, 11906, 6421, 18, 4479, 12, 3658, 13, 747, 5951, 984, 484, 329, 6421, 18, 4479, 12, 3658, 20349, 9506, 202, 12849, 394, 2350, 1941, 503, 12, 5752, 14935, 18, 3417, 67, 19958, 67, 16606, 16, 315, 1248, 1392, 3113, 2756, 1769, 1082, 202, 2625, 6421, 27498, 18, 4479, 12, 5644, 1769, 202, 202, 97, 202, 202, 430, 12, 16418, 13, 288, 1082, 202, 430, 12, 1330, 6236, 916, 13, 4242, 18, 17364, 12, 2211, 16, 315, 47, 5789, 590, 13773, 3658, 1769, 1082, 202, 3658, 18, 10996, 5621, 202, 202, 97, 202, 202, 3567, 18, 5734, 2257, 11906, 6421, 5621, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1206, 27498, 12, 780, 2756, 16, 1250, 8673, 13, 1216, 2350, 1941, 503, 288, 202, 202, 1227, 691, 1111, 31, 202, 202, 6494, 613, 6236, 916, 273, 4242, 18, 13139, 1343, 12, 3328, 18, 6236, 916, 16, 333, 1769, 202, 202, 430, 12, 1330, 6236, 916, 13, 4242, 18, 17364, 12, 2211, 16, 315, 4479, 27498, 2932, 15, 5644, 15, 3316, 397, 16418, 15, 5777, 1769, 202, 202, 22043, 12, 2211, 13, 288, 1082, 202, 3658, 273, 261, 1227, 691, 13, 1004, 6421, 27498, 18, 588, 12, 5644, 1769, 1082, 202, 430, 12, 3658, 422, 446, 13, 9506, 202, 12849, 394, 2350, 1941, 503, 12, 5752, 14935, 18, 3417, 67, 19958, 67, 16606, 16, 315, 2 ]
Iterator references = callback.getReferences().iterator(); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTFunctionReference) references.next()).getReferencedElement(), f2 );
assertAllReferences( 4, createTaskList( new Task( cl, 3 ), new Task( f2 )));
public void testPrimaryThis() throws Exception { Iterator i = parse ("class A{ int m(); }; A a; \n int f(void); \n int f(A * a); \n int A::m(){ int x = f(this); }").getDeclarations(); IASTClassSpecifier cl = (IASTClassSpecifier)((IASTAbstractTypeSpecifierDeclaration)i.next()).getTypeSpecifier(); Iterator members = getDeclarations(cl); IASTMethod method = (IASTMethod)members.next(); IASTVariable a = (IASTVariable) i.next(); IASTFunction f1 = (IASTFunction) i.next(); IASTFunction f2 = (IASTFunction) i.next(); IASTMethod m = (IASTMethod) i.next(); Iterator references = callback.getReferences().iterator(); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTClassReference) references.next()).getReferencedElement(), cl ); assertEquals( ((IASTFunctionReference) references.next()).getReferencedElement(), f2 ); }
6192 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/6192/02c194aaf46b86d6f7a904d6f531e535d47002ba/CompleteParseASTExpressionTest.java/buggy/core/org.eclipse.cdt.core.tests/parser/org/eclipse/cdt/core/parser/tests/CompleteParseASTExpressionTest.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 6793, 2503, 1435, 1216, 1185, 202, 95, 202, 202, 3198, 277, 273, 1109, 7566, 1106, 432, 95, 509, 312, 5621, 289, 31, 432, 279, 31, 225, 521, 82, 509, 284, 12, 6459, 1769, 521, 82, 509, 284, 12, 37, 380, 279, 1769, 521, 82, 509, 432, 2866, 81, 1435, 95, 509, 619, 273, 284, 12, 2211, 1769, 289, 20387, 588, 21408, 5621, 202, 202, 45, 9053, 797, 21416, 927, 273, 261, 45, 9053, 797, 21416, 13, 12443, 45, 9053, 7469, 559, 21416, 6094, 13, 77, 18, 4285, 1435, 2934, 588, 559, 21416, 5621, 202, 202, 3198, 4833, 273, 9072, 9642, 12, 830, 1769, 202, 202, 45, 9053, 1305, 707, 273, 261, 45, 9053, 1305, 13, 7640, 18, 4285, 5621, 202, 202, 45, 9053, 3092, 279, 225, 273, 261, 45, 9053, 3092, 13, 277, 18, 4285, 5621, 202, 202, 45, 9053, 2083, 284, 21, 273, 261, 45, 9053, 2083, 13, 277, 18, 4285, 5621, 202, 202, 45, 9053, 2083, 284, 22, 273, 261, 45, 9053, 2083, 13, 277, 18, 4285, 5621, 202, 202, 45, 9053, 1305, 282, 312, 225, 273, 261, 45, 9053, 1305, 13, 277, 18, 4285, 5621, 202, 202, 3198, 5351, 273, 1348, 18, 588, 8221, 7675, 9838, 5621, 202, 202, 11231, 8867, 12, 14015, 45, 9053, 797, 2404, 13, 5351, 18, 4285, 1435, 2934, 588, 22344, 1046, 9334, 927, 11272, 202, 202, 11231, 8867, 12, 14015, 45, 9053, 797, 2404, 13, 5351, 18, 4285, 1435, 2934, 588, 22344, 1046, 9334, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 918, 1842, 6793, 2503, 1435, 1216, 1185, 202, 95, 202, 202, 3198, 277, 273, 1109, 7566, 1106, 432, 95, 509, 312, 5621, 289, 31, 432, 279, 31, 225, 521, 82, 509, 284, 12, 6459, 1769, 521, 82, 509, 284, 12, 37, 380, 279, 1769, 521, 82, 509, 432, 2866, 81, 1435, 95, 509, 619, 273, 284, 12, 2211, 1769, 289, 20387, 588, 21408, 5621, 202, 202, 45, 9053, 797, 21416, 927, 273, 261, 45, 9053, 797, 21416, 13, 12443, 45, 9053, 7469, 559, 21416, 6094, 13, 77, 18, 4285, 1435, 2934, 588, 559, 21416, 5621, 202, 202, 3198, 4833, 273, 9072, 9642, 12, 830, 1769, 202, 202, 45, 9053, 1305, 707, 273, 261, 45, 9053, 1305, 2 ]
if (jj_3R_93()) {
if (jj_3R_94()) {
final private boolean jj_3R_62() { Token xsp; xsp = jj_scanpos; if (jj_3R_93()) { jj_scanpos = xsp; if (jj_3R_94()) return true; } if (jj_scan_token(IDENTIFIER)) return true; xsp = jj_scanpos; if (jj_3R_95()) jj_scanpos = xsp; xsp = jj_scanpos; if (jj_3R_96()) jj_scanpos = xsp; xsp = jj_scanpos; if (jj_3R_97()) jj_scanpos = xsp; if (jj_3R_98()) return true; return false; }
45569 /local/tlutelli/issta_data/temp/all_java4context/java/2006_temp/2006/45569/a180e9b19197c7613f1e73c6ec8a574a17011e5e/JavaParser.java/buggy/pmd/src/net/sourceforge/pmd/ast/JavaParser.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 3238, 1250, 10684, 67, 23, 54, 67, 8898, 1435, 288, 565, 3155, 619, 1752, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 11290, 10756, 288, 565, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 11290, 10756, 327, 638, 31, 565, 289, 565, 309, 261, 78, 78, 67, 9871, 67, 2316, 12, 16606, 3719, 327, 638, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 8778, 10756, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 10525, 10756, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 10580, 10756, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 10689, 10756, 327, 638, 31, 565, 327, 629, 31, 225, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 282, 727, 3238, 1250, 10684, 67, 23, 54, 67, 8898, 1435, 288, 565, 3155, 619, 1752, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 11290, 10756, 288, 565, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 11290, 10756, 327, 638, 31, 565, 289, 565, 309, 261, 78, 78, 67, 9871, 67, 2316, 12, 16606, 3719, 327, 638, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 78, 67, 23, 54, 67, 8778, 10756, 10684, 67, 9871, 917, 273, 619, 1752, 31, 565, 619, 1752, 273, 10684, 67, 9871, 917, 31, 565, 309, 261, 78, 2 ]
match(_tokenSet_8);
match(_tokenSet_11);
protected final void mSTRING_LITERAL(boolean _createToken) throws RecognitionException, CharStreamException, TokenStreamException { int _ttype; Token _token=null; int _begin=text.length(); _ttype = STRING_LITERAL; int _saveIndex; switch ( LA(1)) { case '"': { _saveIndex=text.length(); match('"'); text.setLength(_saveIndex); { _loop327: do { if ((LA(1)=='&') && (LA(2)=='a'||LA(2)=='g'||LA(2)=='l'||LA(2)=='q')) { mPREDEFINED_ENTITY_REF(false); } else if ((LA(1)=='&') && (LA(2)=='#')) { mCHAR_REF(false); } else if ((LA(1)=='"') && (LA(2)=='"')) { { _saveIndex=text.length(); match('"'); text.setLength(_saveIndex); match('"'); } } else if ((_tokenSet_7.member(LA(1)))) { { match(_tokenSet_7); } } else { break _loop327; } } while (true); } _saveIndex=text.length(); match('"'); text.setLength(_saveIndex); break; } case '\'': { _saveIndex=text.length(); match('\''); text.setLength(_saveIndex); { _loop331: do { if ((LA(1)=='&') && (LA(2)=='a'||LA(2)=='g'||LA(2)=='l'||LA(2)=='q')) { mPREDEFINED_ENTITY_REF(false); } else if ((LA(1)=='&') && (LA(2)=='#')) { mCHAR_REF(false); } else if ((LA(1)=='\'') && (LA(2)=='\'')) { { _saveIndex=text.length(); match('\''); text.setLength(_saveIndex); match('\''); } } else if ((_tokenSet_8.member(LA(1)))) { { match(_tokenSet_8); } } else { break _loop331; } } while (true); } _saveIndex=text.length(); match('\''); text.setLength(_saveIndex); break; } default: { throw new NoViableAltForCharException((char)LA(1), getFilename(), getLine(), getColumn()); } } if ( _createToken && _token==null && _ttype!=Token.SKIP ) { _token = makeToken(_ttype); _token.setText(new String(text.getBuffer(), _begin, text.length()-_begin)); } _returnToken = _token; }
2909 /local/tlutelli/issta_data/temp/all_java0context/java/2006_temp/2006/2909/542794bb5fd4ba67897c2c2677f4f663483ba69d/XPathLexer2.java/buggy/src/org/exist/parser/XPathLexer2.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 727, 918, 312, 5804, 67, 23225, 12, 6494, 389, 2640, 1345, 13, 1216, 9539, 16, 3703, 1228, 503, 16, 3155, 1228, 503, 288, 202, 202, 474, 389, 88, 723, 31, 3155, 389, 2316, 33, 2011, 31, 509, 389, 10086, 33, 955, 18, 2469, 5621, 202, 202, 67, 88, 723, 273, 9469, 67, 23225, 31, 202, 202, 474, 389, 5688, 1016, 31, 9506, 202, 9610, 261, 2928, 12, 21, 3719, 288, 202, 202, 3593, 2119, 4278, 202, 202, 95, 1082, 202, 67, 5688, 1016, 33, 955, 18, 2469, 5621, 1082, 202, 1916, 2668, 5187, 1769, 1082, 202, 955, 18, 542, 1782, 24899, 5688, 1016, 1769, 1082, 202, 95, 1082, 202, 67, 6498, 1578, 27, 30, 1082, 202, 2896, 288, 9506, 202, 430, 14015, 2534, 12, 21, 13, 18920, 10, 6134, 597, 261, 2534, 12, 22, 13, 18920, 69, 11, 20081, 2534, 12, 22, 13, 18920, 75, 11, 20081, 2534, 12, 22, 13, 18920, 80, 11, 20081, 2534, 12, 22, 13, 18920, 85, 26112, 288, 6862, 202, 81, 3670, 15544, 67, 11101, 67, 10771, 12, 5743, 1769, 9506, 202, 97, 9506, 202, 12107, 309, 14015, 2534, 12, 21, 13, 18920, 10, 6134, 597, 261, 2534, 12, 22, 13, 18920, 10038, 3719, 288, 6862, 202, 81, 7305, 67, 10771, 12, 5743, 1769, 9506, 202, 97, 9506, 202, 12107, 309, 14015, 2534, 12, 21, 13, 631, 4970, 6134, 597, 261, 2534, 12, 22, 13, 631, 4970, 26112, 288, 6862, 202, 95, 6862, 202, 67, 5688, 1016, 33, 955, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 1117, 727, 918, 312, 5804, 67, 23225, 12, 6494, 389, 2640, 1345, 13, 1216, 9539, 16, 3703, 1228, 503, 16, 3155, 1228, 503, 288, 202, 202, 474, 389, 88, 723, 31, 3155, 389, 2316, 33, 2011, 31, 509, 389, 10086, 33, 955, 18, 2469, 5621, 202, 202, 67, 88, 723, 273, 9469, 67, 23225, 31, 202, 202, 474, 389, 5688, 1016, 31, 9506, 202, 9610, 261, 2928, 12, 21, 3719, 288, 202, 202, 3593, 2119, 4278, 202, 202, 95, 1082, 202, 67, 5688, 1016, 33, 955, 18, 2469, 5621, 1082, 202, 1916, 2668, 5187, 1769, 1082, 202, 955, 18, 542, 1782, 24899, 5688, 1016, 1769, 1082, 202, 95, 1082, 202, 67, 6498, 1578, 27, 30, 1082, 202, 2 ]
endpointReferences.add((EndpointReference) digester.pop());
endpointReferences.add(digester.pop());
public void end(String endpointName, String endpointName1) throws Exception { endpointReferences.add((EndpointReference) digester.pop()); }
28323 /local/tlutelli/issta_data/temp/all_java2context/java/2006_temp/2006/28323/880b5fb3cb5124858c7368c29c07941df9496e68/MuleXmlConfigurationBuilder.java/buggy/mule/src/java/org/mule/config/builders/MuleXmlConfigurationBuilder.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 1071, 918, 679, 12, 780, 2494, 461, 16, 514, 2494, 461, 21, 13, 1216, 1185, 5411, 288, 7734, 2494, 8221, 18, 1289, 12, 5606, 7654, 18, 5120, 10663, 5411, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 2398, 1071, 918, 679, 12, 780, 2494, 461, 16, 514, 2494, 461, 21, 13, 1216, 1185, 5411, 288, 7734, 2494, 8221, 18, 1289, 12, 5606, 7654, 18, 5120, 10663, 5411, 289, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if (found == null || reloadPolicy.shouldReload(found.loadTime, clock.getCurrentTime())) { found = loadObject(theKey); } return found.value; }
if (found == null || reloadPolicy.shouldReload(found.loadTime, clock.getCurrentTime())) { found = loadObject(theKey); } return found.value; }
public Object lookup( Object theKey ) { TimestampedValue found = (TimestampedValue)cachedValues.get(theKey); if (found == null || reloadPolicy.shouldReload(found.loadTime, clock.getCurrentTime())) { found = loadObject(theKey); } return found.value; }
54028 /local/tlutelli/issta_data/temp/all_java5context/java/2006_temp/2006/54028/c26c57f3ac4851e6bc9c5df8515ac73f4045eebf/TimedCache.java/clean/jmock/examples/timed-cache/src/org/jmock/examples/timedcache/TimedCache.java
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 3689, 12, 1033, 326, 653, 262, 288, 202, 202, 4921, 329, 620, 1392, 273, 261, 4921, 329, 620, 13, 7097, 1972, 18, 588, 12, 5787, 653, 1769, 202, 202, 430, 261, 7015, 422, 446, 747, 7749, 2582, 18, 13139, 13013, 12, 7015, 18, 945, 950, 16, 7268, 18, 588, 3935, 950, 1435, 3719, 288, 1082, 202, 7015, 273, 31768, 12, 5787, 653, 1769, 202, 202, 97, 202, 202, 2463, 1392, 18, 1132, 31, 202, 97, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 225, 202, 482, 1033, 3689, 12, 1033, 326, 653, 262, 288, 202, 202, 4921, 329, 620, 1392, 273, 261, 4921, 329, 620, 13, 7097, 1972, 18, 588, 12, 5787, 653, 1769, 202, 202, 430, 261, 7015, 422, 446, 747, 7749, 2582, 18, 13139, 13013, 12, 7015, 18, 945, 950, 16, 7268, 18, 588, 3935, 950, 1435, 3719, 288, 1082, 202, 7015, 273, 31768, 12, 5787, 653, 1769, 202, 202, 97, 202, 202, 2463, 1392, 18, 1132, 31, 202, 97, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]