rem
stringlengths
2
226k
add
stringlengths
0
227k
context
stringlengths
8
228k
meta
stringlengths
156
215
input_ids
list
attention_mask
list
labels
list
def test_rigid_organics_C2H6(self): StructureTest(dir="rigid_organics", test="C2H6")
def test_rigid_organics_C2H6(self): StructureTest(dir="rigid_organics", test="C2H6")
1b04cff6e27f660e98e628b425c09e2c157b0350 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11221/1b04cff6e27f660e98e628b425c09e2c157b0350/tests.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 86, 28542, 67, 22543, 2102, 67, 39, 22, 44, 26, 12, 2890, 4672, 13348, 4709, 12, 1214, 1546, 86, 28542, 67, 22543, 2102, 3113, 1842, 1546, 39, 22, 44, 26, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 86, 28542, 67, 22543, 2102, 67, 39, 22, 44, 26, 12, 2890, 4672, 13348, 4709, 12, 1214, 1546, 86, 28542, 67, 22543, 2102, 3113, 1842, 1546, 39, 22, 44, 26, 7923, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
inodes.append(adjustnode)
def optimize_tightloop(self, node): if not isinstance(node, ComplexNode): return node
b7aa0ef0102558dadc414a45ccdc4d8e270adb78 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/2040/b7aa0ef0102558dadc414a45ccdc4d8e270adb78/esotope-bfc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10979, 67, 88, 750, 6498, 12, 2890, 16, 756, 4672, 309, 486, 1549, 12, 2159, 16, 16060, 907, 4672, 327, 756, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10979, 67, 88, 750, 6498, 12, 2890, 16, 756, 4672, 309, 486, 1549, 12, 2159, 16, 16060, 907, 4672, 327, 756, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
l.complete = TodolistPkg.objects.filter(list=l.id,complete=False).count() == 0
l.complete = TodolistPkg.objects.filter( list=l.id,complete=False).count() == 0
def list(request): lists = Todolist.objects.order_by('-date_added') for l in lists: l.complete = TodolistPkg.objects.filter(list=l.id,complete=False).count() == 0 return render_response(request, 'todolists/list.html', {'lists':lists})
4184dae7c46a95ede489f7b20b5befc69b3a20ba /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11256/4184dae7c46a95ede489f7b20b5befc69b3a20ba/views.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 666, 12, 2293, 4672, 6035, 273, 399, 369, 355, 376, 18, 6911, 18, 1019, 67, 1637, 2668, 17, 712, 67, 9665, 6134, 364, 328, 316, 6035, 30, 328, 18, 6226, 273, 399, 369, 355, 376, 11264, 18, 6911, 18, 2188, 12, 666, 33, 80, 18, 350, 16, 6226, 33, 8381, 2934, 1883, 1435, 422, 374, 327, 1743, 67, 2740, 12, 2293, 16, 296, 88, 369, 355, 1486, 19, 1098, 18, 2620, 2187, 13666, 9772, 4278, 9772, 6792, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 666, 12, 2293, 4672, 6035, 273, 399, 369, 355, 376, 18, 6911, 18, 1019, 67, 1637, 2668, 17, 712, 67, 9665, 6134, 364, 328, 316, 6035, 30, 328, 18, 6226, 273, 399, 369, 355, 376, 11264, 18, 6911, 18, 2188, 12, 666, 33, 80, 18, 350, 16, 6226, 33, 8381, 2934, 1883, 1435, 422, 374, 327, 1743, 67, 2740, 12, 2293, 16, 296, 88, 369, 355, 1486, 19, 1098, 18, 2620, 2187, 13666, 9772, 4278, 9772, 6792, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.assertEqual(check_line('f(a=1)', REPORTER), None)
self.assertEqual(check_line('f(a=1)'), None)
def test_known_values_opspace_4(self): self.assertEqual(check_line('f(a=1)', REPORTER), None)
455beb61539a40eb35dfd637d0cd015a7cbec7a0 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/928/455beb61539a40eb35dfd637d0cd015a7cbec7a0/test_format.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 2994, 67, 2372, 67, 556, 2981, 67, 24, 12, 2890, 4672, 365, 18, 11231, 5812, 12, 1893, 67, 1369, 2668, 74, 12, 69, 33, 21, 13, 2187, 2438, 52, 916, 2560, 3631, 599, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 2994, 67, 2372, 67, 556, 2981, 67, 24, 12, 2890, 4672, 365, 18, 11231, 5812, 12, 1893, 67, 1369, 2668, 74, 12, 69, 33, 21, 13, 2187, 2438, 52, 916, 2560, 3631, 599, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
dc.SetPen(wx.Pen(wx.WHITE, 1))
dc.SetPen(self.whitePen)
def Draw(self, dc, styles, selected, leftSideCutoff=False, rightSideCutOff=False): # @@@ add a general cutoff parameter? event = self.event # recurring items, when deleted or stamped non-Calendar, are sometimes # passed to Draw before wxSynchronize is called, ignore those items if (event.itsItem.isDeleted() or not has_stamp(event, Calendar.EventStamp)): return isAnyTimeOrAllDay = Calendar.isDayEvent(event) textOffset = self.textOffset minHeightToShowTime = (styles.eventLabelMeasurements.height + styles.eventTimeMeasurements.height + 3 * textOffset.y + TIME_BOTTOM_MARGIN - 1)
97fca281eb784fa0a7e3354e2bf9cea97de8397d /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9228/97fca281eb784fa0a7e3354e2bf9cea97de8397d/CalendarCanvas.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10184, 12, 2890, 16, 6744, 16, 5687, 16, 3170, 16, 2002, 8895, 15812, 3674, 33, 8381, 16, 2145, 8895, 15812, 7210, 33, 8381, 4672, 468, 22175, 36, 527, 279, 7470, 13383, 1569, 35, 871, 273, 365, 18, 2575, 468, 26043, 1516, 16, 1347, 4282, 578, 14429, 329, 1661, 17, 7335, 16, 854, 16594, 468, 2275, 358, 10184, 1865, 7075, 19298, 554, 353, 2566, 16, 2305, 5348, 1516, 225, 309, 261, 2575, 18, 1282, 1180, 18, 291, 7977, 1435, 578, 486, 711, 67, 14317, 12, 2575, 16, 5542, 18, 1133, 8860, 3719, 30, 327, 3484, 950, 1162, 1595, 4245, 273, 5542, 18, 291, 4245, 1133, 12, 2575, 13, 977, 2335, 273, 365, 18, 955, 2335, 1131, 2686, 774, 5706, 950, 273, 261, 10218, 18, 2575, 2224, 7197, 1346, 18, 4210, 397, 5687, 18, 2575, 950, 7197, 1346, 18, 4210, 397, 890, 380, 977, 2335, 18, 93, 397, 8721, 67, 28891, 67, 19772, 7702, 300, 404, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10184, 12, 2890, 16, 6744, 16, 5687, 16, 3170, 16, 2002, 8895, 15812, 3674, 33, 8381, 16, 2145, 8895, 15812, 7210, 33, 8381, 4672, 468, 22175, 36, 527, 279, 7470, 13383, 1569, 35, 871, 273, 365, 18, 2575, 468, 26043, 1516, 16, 1347, 4282, 578, 14429, 329, 1661, 17, 7335, 16, 854, 16594, 468, 2275, 358, 10184, 1865, 7075, 19298, 554, 353, 2566, 16, 2305, 5348, 1516, 225, 309, 261, 2575, 18, 1282, 1180, 18, 291, 7977, 1435, 578, 486, 711, 67, 14317, 12, 2575, 16, 5542, 18, 1133, 8860, 3719, 30, 327, 3484, 950, 1162, 1595, 4245, 273, 5542, 18, 291, 4245, 1133, 12, 2575, 13, 977, 2335, 273, 365, 18, 955, 2335, 1131, 2686, 774, 5706, 2 ]
return ('%s<ol%s>\n%s%s</ol>\n' %
return ('%s<ol start="%s">\n%s%s</ol>\n' %
def _to_html(self, tree, linker, directory, docindex, context, indent=0, seclevel=0): if isinstance(tree, basestring): return plaintext_to_html(tree)
6205c076eaccf0d7412bee51a7bf0e83814f236a /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/3512/6205c076eaccf0d7412bee51a7bf0e83814f236a/epytext.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 869, 67, 2620, 12, 2890, 16, 2151, 16, 28058, 16, 1867, 16, 997, 1615, 16, 819, 16, 3504, 33, 20, 16, 1428, 2815, 33, 20, 4672, 309, 1549, 12, 3413, 16, 10699, 4672, 327, 11917, 67, 869, 67, 2620, 12, 3413, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 869, 67, 2620, 12, 2890, 16, 2151, 16, 28058, 16, 1867, 16, 997, 1615, 16, 819, 16, 3504, 33, 20, 16, 1428, 2815, 33, 20, 4672, 309, 1549, 12, 3413, 16, 10699, 4672, 327, 11917, 67, 869, 67, 2620, 12, 3413, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
end_string_suffix = (r'(?:(?=$)|(?=[- \n.,:;!?%s]))'
end_string_suffix = (r'(?:(?=$)|(?=[-/:.,;!? \n%s]))'
def parse(self, text, lineno, memo, parent): """ Return 2 lists: nodes (text and inline elements), and system_messages.
9e3d15a8a5423c3b786979fd60c66132b47c14e6 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5620/9e3d15a8a5423c3b786979fd60c66132b47c14e6/states.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 12, 2890, 16, 977, 16, 7586, 16, 11063, 16, 982, 4672, 3536, 2000, 576, 6035, 30, 2199, 261, 955, 471, 6370, 2186, 3631, 471, 2619, 67, 6833, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 12, 2890, 16, 977, 16, 7586, 16, 11063, 16, 982, 4672, 3536, 2000, 576, 6035, 30, 2199, 261, 955, 471, 6370, 2186, 3631, 471, 2619, 67, 6833, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
isinf.unwrap_spec = [ObjSpace, float, float]
isinf.unwrap_spec = [ObjSpace, float]
def isinf(space, x): """Return True if x is infinity.""" return space.wrap(rarithmetic.isinf(x))
0b4d1fbfacfc215bde17fab2b9dfd5311737d576 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6934/0b4d1fbfacfc215bde17fab2b9dfd5311737d576/interp_math.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 353, 10625, 12, 2981, 16, 619, 4672, 3536, 990, 1053, 309, 619, 353, 27272, 12123, 327, 3476, 18, 4113, 12, 86, 297, 16368, 18, 291, 10625, 12, 92, 3719, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 353, 10625, 12, 2981, 16, 619, 4672, 3536, 990, 1053, 309, 619, 353, 27272, 12123, 327, 3476, 18, 4113, 12, 86, 297, 16368, 18, 291, 10625, 12, 92, 3719, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return self.folder().subscriber_list[:]
return list(self.folder().subscriber_list)
def _getSubscribers(self, parent=0): """ Return (a copy of!) this page's subscriber list. With parent flag, manage the parent folder's subscriber list instead. """ if AUTO_UPGRADE: self._upgradeSubscribers() if parent: if hasattr(self.folder(),'subscriber_list'): return self.folder().subscriber_list[:] else: return [] else: return self.subscriber_list[:]
b4e8fb9ba160855c9e87f030ce900461d0764a23 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5225/b4e8fb9ba160855c9e87f030ce900461d0764a23/Mail.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 588, 26141, 12, 2890, 16, 982, 33, 20, 4672, 3536, 2000, 261, 69, 1610, 434, 24949, 333, 1363, 1807, 9467, 666, 18, 225, 3423, 982, 2982, 16, 10680, 326, 982, 3009, 1807, 9467, 666, 3560, 18, 3536, 309, 17191, 67, 3079, 24554, 1639, 30, 365, 6315, 15097, 26141, 1435, 309, 982, 30, 309, 3859, 12, 2890, 18, 5609, 9334, 11, 26410, 67, 1098, 11, 4672, 327, 666, 12, 2890, 18, 5609, 7675, 26410, 67, 1098, 13, 469, 30, 327, 5378, 469, 30, 327, 365, 18, 26410, 67, 1098, 10531, 65, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 588, 26141, 12, 2890, 16, 982, 33, 20, 4672, 3536, 2000, 261, 69, 1610, 434, 24949, 333, 1363, 1807, 9467, 666, 18, 225, 3423, 982, 2982, 16, 10680, 326, 982, 3009, 1807, 9467, 666, 3560, 18, 3536, 309, 17191, 67, 3079, 24554, 1639, 30, 365, 6315, 15097, 26141, 1435, 309, 982, 30, 309, 3859, 12, 2890, 18, 5609, 9334, 11, 26410, 67, 1098, 11, 4672, 327, 666, 12, 2890, 18, 5609, 7675, 26410, 67, 1098, 13, 469, 30, 327, 5378, 469, 30, 327, 365, 18, 26410, 67, 1098, 10531, 65, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
('create', re.compile('create index .*\son\s+"?([a-z_0-9]+)"?[\s\(]', re.I)),
('create', re.compile('create or replace view\s+"?([a-z_0-9]+)"?[\s\(]', re.I)), ('create', re.compile('create (?:unique )?index .*\son\s+"?([a-z_0-9]+)"?[\s\(]', re.I)), ('drop', re.compile(r'drop view\s+"?([a-z_0-9]+)"?\s', re.I)),
def undecimalize(symb, cr): if symb is None: return None return float(symb)
a3d11ecee8b69ee4bbd64355f9bc2b4929913e2a /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12853/a3d11ecee8b69ee4bbd64355f9bc2b4929913e2a/sql_db.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 640, 12586, 554, 12, 9009, 1627, 16, 4422, 4672, 309, 1393, 1627, 353, 599, 30, 327, 599, 327, 1431, 12, 9009, 1627, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 640, 12586, 554, 12, 9009, 1627, 16, 4422, 4672, 309, 1393, 1627, 353, 599, 30, 327, 599, 327, 1431, 12, 9009, 1627, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
cmd.append('f77_opt_path=%s' % self.scons_fcompiler_path)
cmd.append('f77_opt_path=%s' % self.scons_fcompiler_path)
def _call_scons(self, scons_exec, sconscript, pkg_name, bootstrapping): # XXX: when a scons script is missing, scons only prints warnings, and # does not return a failure (status is 0). We have to detect this from # distutils (this cannot work for recursive scons builds...)
2f6604a638ca0c96f426a2010a0dc8e6e6e2c93f /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/14925/2f6604a638ca0c96f426a2010a0dc8e6e6e2c93f/scons.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 1991, 67, 87, 8559, 12, 2890, 16, 272, 8559, 67, 4177, 16, 272, 591, 4263, 16, 3475, 67, 529, 16, 7065, 1382, 4672, 468, 11329, 30, 1347, 279, 272, 8559, 2728, 353, 3315, 16, 272, 8559, 1338, 14971, 5599, 16, 471, 468, 1552, 486, 327, 279, 5166, 261, 2327, 353, 374, 2934, 1660, 1240, 358, 5966, 333, 628, 468, 2411, 5471, 261, 2211, 2780, 1440, 364, 5904, 272, 8559, 10736, 21846, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 1991, 67, 87, 8559, 12, 2890, 16, 272, 8559, 67, 4177, 16, 272, 591, 4263, 16, 3475, 67, 529, 16, 7065, 1382, 4672, 468, 11329, 30, 1347, 279, 272, 8559, 2728, 353, 3315, 16, 272, 8559, 1338, 14971, 5599, 16, 471, 468, 1552, 486, 327, 279, 5166, 261, 2327, 353, 374, 2934, 1660, 1240, 358, 5966, 333, 628, 468, 2411, 5471, 261, 2211, 2780, 1440, 364, 5904, 272, 8559, 10736, 21846, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
new=manager(f_obs = self.f_obs.deep_copy(),
return manager(f_obs = self.f_obs.deep_copy(),
def deep_copy(self): if(self.abcd is not None): abcd = self.abcd.deep_copy() else: abcd = None if(self.xray_structure is None): xrs = None else: xrs = self.xray_structure.deep_copy_scatterers() new=manager(f_obs = self.f_obs.deep_copy(), r_free_flags = self.r_free_flags.deep_copy(), b_cart = self.b_cart(), f_mask = self.f_mask().deep_copy(), k_sol = self.k_sol(), b_sol = self.b_sol(), sf_algorithm = self.sf_algorithm, sf_cos_sin_table = self.sf_cos_sin_table, target_name = self.target_name, abcd = abcd, alpha_beta_params = self.alpha_beta_params, xray_structure = xrs, f_calc = self.f_calc().deep_copy(), mask_params = self.mask_params, trust_xray_structure = True, update_xray_structure = False) new.f_ordered_solvent = self.f_ordered_solvent.deep_copy() new.f_ordered_solvent_dist = self.f_ordered_solvent_dist.deep_copy() new.n_ordered_water = self.n_ordered_water new.b_ordered_water = self.b_ordered_water return new
65c736cff24544f6f106f227d62f69c231be8261 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/696/65c736cff24544f6f106f227d62f69c231be8261/f_model.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4608, 67, 3530, 12, 2890, 4672, 309, 12, 2890, 18, 378, 4315, 353, 486, 599, 4672, 1223, 4315, 273, 365, 18, 378, 4315, 18, 16589, 67, 3530, 1435, 469, 30, 1223, 4315, 273, 599, 309, 12, 2890, 18, 92, 435, 67, 7627, 353, 599, 4672, 619, 5453, 273, 599, 469, 30, 619, 5453, 273, 365, 18, 92, 435, 67, 7627, 18, 16589, 67, 3530, 67, 31320, 414, 1435, 327, 3301, 12, 74, 67, 10992, 2868, 273, 365, 18, 74, 67, 10992, 18, 16589, 67, 3530, 9334, 436, 67, 9156, 67, 7133, 1850, 273, 365, 18, 86, 67, 9156, 67, 7133, 18, 16589, 67, 3530, 9334, 324, 67, 11848, 7734, 273, 365, 18, 70, 67, 11848, 9334, 284, 67, 4455, 7734, 273, 365, 18, 74, 67, 4455, 7675, 16589, 67, 3530, 9334, 417, 67, 18281, 1171, 273, 365, 18, 79, 67, 18281, 9334, 324, 67, 18281, 1171, 273, 365, 18, 70, 67, 18281, 9334, 9033, 67, 12743, 1850, 273, 365, 18, 21668, 67, 12743, 16, 9033, 67, 14445, 67, 21861, 67, 2121, 1377, 273, 365, 18, 21668, 67, 14445, 67, 21861, 67, 2121, 16, 1018, 67, 529, 6647, 273, 365, 18, 3299, 67, 529, 16, 1223, 4315, 5375, 273, 1223, 4315, 16, 4190, 67, 5758, 67, 2010, 377, 273, 365, 18, 5429, 67, 5758, 67, 2010, 16, 619, 435, 67, 7627, 3639, 273, 619, 5453, 16, 284, 67, 12448, 7734, 273, 365, 18, 74, 67, 12448, 7675, 16589, 67, 3530, 9334, 3066, 67, 2010, 6647, 273, 365, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4608, 67, 3530, 12, 2890, 4672, 309, 12, 2890, 18, 378, 4315, 353, 486, 599, 4672, 1223, 4315, 273, 365, 18, 378, 4315, 18, 16589, 67, 3530, 1435, 469, 30, 1223, 4315, 273, 599, 309, 12, 2890, 18, 92, 435, 67, 7627, 353, 599, 4672, 619, 5453, 273, 599, 469, 30, 619, 5453, 273, 365, 18, 92, 435, 67, 7627, 18, 16589, 67, 3530, 67, 31320, 414, 1435, 327, 3301, 12, 74, 67, 10992, 2868, 273, 365, 18, 74, 67, 10992, 18, 16589, 67, 3530, 9334, 436, 67, 9156, 67, 7133, 1850, 273, 365, 18, 86, 67, 9156, 67, 7133, 18, 16589, 67, 3530, 9334, 324, 67, 11848, 7734, 273, 365, 18, 70, 67, 11848, 9334, 284, 67, 2 ]
t += s[:i].replace('<','&lt;') + s[i+6:j]
t += format(s[:i]) + s[i+6:j]
def output_text(self, ncols=0, html=True): if ncols and not self.introspect(): s = word_wrap(self.__out, ncols=ncols) else: s = self.__out if html: # Everything not wrapped in <html> ... </html> # should have the <'s replaced by &lt;'s. t = '' while len(s) > 0: i = s.find('<html>') if i == -1: t += s.replace('<','&lt;') break j = s.find('</html>') if j == -1: t += s.replace('<','&lt;') break t += s[:i].replace('<','&lt;') + s[i+6:j] s = s[j+7:] s = t if not self.is_html() and len(s.strip()) > 0: s = '<pre class="shrunk">' + s + '</pre>' return s
2085e8271e2fac40e6923df66c0b13dc7c8f3319 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9890/2085e8271e2fac40e6923df66c0b13dc7c8f3319/cell.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 876, 67, 955, 12, 2890, 16, 21330, 33, 20, 16, 1729, 33, 5510, 4672, 309, 21330, 471, 486, 365, 18, 474, 26170, 13332, 272, 273, 2076, 67, 4113, 12, 2890, 16186, 659, 16, 21330, 33, 82, 6842, 13, 469, 30, 272, 273, 365, 16186, 659, 309, 1729, 30, 468, 26553, 486, 5805, 316, 411, 2620, 34, 1372, 7765, 2620, 34, 468, 1410, 1240, 326, 411, 11, 87, 8089, 635, 473, 5618, 4359, 87, 18, 268, 273, 875, 1323, 562, 12, 87, 13, 405, 374, 30, 277, 273, 272, 18, 4720, 2668, 32, 2620, 1870, 13, 309, 277, 422, 300, 21, 30, 268, 1011, 272, 18, 2079, 2668, 32, 17023, 10, 5618, 4359, 13, 898, 525, 273, 272, 18, 4720, 2668, 1757, 2620, 1870, 13, 309, 525, 422, 300, 21, 30, 268, 1011, 272, 18, 2079, 2668, 32, 17023, 10, 5618, 4359, 13, 898, 268, 1011, 740, 12, 87, 10531, 77, 5717, 397, 272, 63, 77, 15, 26, 30, 78, 65, 272, 273, 272, 63, 78, 15, 27, 26894, 272, 273, 268, 309, 486, 365, 18, 291, 67, 2620, 1435, 471, 562, 12, 87, 18, 6406, 10756, 405, 374, 30, 272, 273, 2368, 1484, 667, 1546, 674, 86, 1683, 7918, 397, 272, 397, 4357, 1484, 1870, 327, 272, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 876, 67, 955, 12, 2890, 16, 21330, 33, 20, 16, 1729, 33, 5510, 4672, 309, 21330, 471, 486, 365, 18, 474, 26170, 13332, 272, 273, 2076, 67, 4113, 12, 2890, 16186, 659, 16, 21330, 33, 82, 6842, 13, 469, 30, 272, 273, 365, 16186, 659, 309, 1729, 30, 468, 26553, 486, 5805, 316, 411, 2620, 34, 1372, 7765, 2620, 34, 468, 1410, 1240, 326, 411, 11, 87, 8089, 635, 473, 5618, 4359, 87, 18, 268, 273, 875, 1323, 562, 12, 87, 13, 405, 374, 30, 277, 273, 272, 18, 4720, 2668, 32, 2620, 1870, 13, 309, 277, 422, 300, 21, 30, 268, 1011, 272, 18, 2079, 2668, 32, 17023, 10, 5618, 4359, 13, 898, 525, 273, 272, 18, 2 ]
SIGNAL("stateChanged(int)"), self.toggleTexture)
SIGNAL("stateChanged(int)"), self.toggleTexture)
def connect_or_disconnect_signals(self, isConnect): """ Connect or disconnect widget signals sent to their slot methods. This can be overridden in subclasses. By default it does nothing. @param isConnect: If True the widget will send the signals to the slot method. @type isConnect: boolean """ #TODO: Fix for bug: When you invoke a temporary mode # entering such a temporary mode keeps the signals of #PM from the previous mode connected ( #but while exiting that temporary mode and reentering the #previous mode, it actually reconnects the signal! This gives rise to #lots of bugs. This needs more general fix in Temporary mode API. # -- Ninad 2008-01-09 (similar comment exists in MovePropertyManager.py #UPDATE: (comment copied and modifief from BuildNanotube_PropertyManager. #The general problem still remains -- Ninad 2008-06-25 if isConnect and self.isAlreadyConnected: if debug_flags.atom_debug: print_compact_stack("warning: attempt to connect widgets"\ "in this PM that are already connected." ) return if not isConnect and self.isAlreadyDisconnected: if debug_flags.atom_debug: print_compact_stack("warning: attempt to disconnect widgets"\ "in this PM that are already disconnected.") return self.isAlreadyConnected = isConnect self.isAlreadyDisconnected = not isConnect if isConnect: change_connect = self.win.connect else: change_connect = self.win.disconnect change_connect(self.pmPlacementOptions.buttonGroup, SIGNAL("buttonClicked(int)"), self.changePlanePlacement) change_connect(self.widthDblSpinBox, SIGNAL("valueChanged(double)"), self.change_plane_width) change_connect(self.heightDblSpinBox, SIGNAL("valueChanged(double)"), self.change_plane_height) change_connect(self.aspectRatioCheckBox, SIGNAL("stateChanged(int)"), self._enableAspectRatioSpinBox) #signal slot connection for imageDisplayCheckBox change_connect(self.imageDisplayCheckBox, SIGNAL("stateChanged(int)"), self.toggleFileChooserBehavior)
6ca1728879e65f379512b44ee2623ad89c7a92ac /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11221/6ca1728879e65f379512b44ee2623ad89c7a92ac/PlanePropertyManager.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3077, 67, 280, 67, 20177, 67, 29659, 12, 2890, 16, 353, 5215, 4672, 3536, 8289, 578, 9479, 3604, 11505, 3271, 358, 3675, 4694, 2590, 18, 1220, 848, 506, 11000, 316, 15320, 18, 2525, 805, 518, 1552, 5083, 18, 632, 891, 353, 5215, 30, 971, 1053, 326, 3604, 903, 1366, 326, 11505, 358, 326, 4694, 707, 18, 632, 723, 225, 353, 5215, 30, 1250, 3536, 468, 6241, 30, 12139, 364, 7934, 30, 5203, 1846, 4356, 279, 6269, 1965, 468, 19014, 4123, 279, 6269, 1965, 20948, 326, 11505, 434, 468, 12728, 628, 326, 2416, 1965, 5840, 261, 468, 12885, 1323, 15702, 716, 6269, 1965, 471, 283, 2328, 310, 326, 468, 11515, 1965, 16, 518, 6013, 11812, 87, 326, 4277, 5, 1220, 14758, 436, 784, 358, 468, 80, 6968, 225, 434, 22398, 18, 1220, 4260, 1898, 7470, 2917, 316, 22791, 1965, 1491, 18, 468, 1493, 423, 267, 361, 4044, 28, 17, 1611, 17, 5908, 261, 22985, 2879, 1704, 316, 9933, 1396, 1318, 18, 2074, 225, 468, 8217, 30, 261, 3469, 9268, 471, 681, 704, 10241, 628, 3998, 10312, 352, 4895, 67, 1396, 1318, 18, 468, 1986, 7470, 6199, 4859, 22632, 1493, 423, 267, 361, 4044, 28, 17, 7677, 17, 2947, 225, 309, 353, 5215, 471, 365, 18, 291, 9430, 8932, 30, 309, 1198, 67, 7133, 18, 7466, 67, 4148, 30, 1172, 67, 21038, 67, 3772, 2932, 8551, 30, 4395, 358, 3077, 10965, 12691, 315, 267, 333, 23544, 716, 854, 1818, 5840, 1199, 262, 327, 225, 309, 486, 353, 5215, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3077, 67, 280, 67, 20177, 67, 29659, 12, 2890, 16, 353, 5215, 4672, 3536, 8289, 578, 9479, 3604, 11505, 3271, 358, 3675, 4694, 2590, 18, 1220, 848, 506, 11000, 316, 15320, 18, 2525, 805, 518, 1552, 5083, 18, 632, 891, 353, 5215, 30, 971, 1053, 326, 3604, 903, 1366, 326, 11505, 358, 326, 4694, 707, 18, 632, 723, 225, 353, 5215, 30, 1250, 3536, 468, 6241, 30, 12139, 364, 7934, 30, 5203, 1846, 4356, 279, 6269, 1965, 468, 19014, 4123, 279, 6269, 1965, 20948, 326, 11505, 434, 468, 12728, 628, 326, 2416, 1965, 5840, 261, 468, 12885, 1323, 15702, 716, 6269, 1965, 471, 283, 2328, 310, 326, 468, 11515, 1965, 16, 518, 6013, 11812, 87, 326, 4277, 5, 2 ]
print struct.size() offset += struct.size() buf = buf[offset:]
if rc > maxrows - 1: break buf = buf[struct.size():]
def render_HTMLUI(data): """Callback to render mysql stored data in HTML""" tmp = result.__class__(result) tmp.result = data return tmp
006976a5f252913f17c3c0fed6a24bb0302be5b9 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5568/006976a5f252913f17c3c0fed6a24bb0302be5b9/RevEng.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1743, 67, 4870, 5370, 12, 892, 4672, 3536, 2428, 358, 1743, 7219, 4041, 501, 316, 3982, 8395, 1853, 273, 563, 16186, 1106, 972, 12, 2088, 13, 1853, 18, 2088, 273, 501, 327, 1853, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1743, 67, 4870, 5370, 12, 892, 4672, 3536, 2428, 358, 1743, 7219, 4041, 501, 316, 3982, 8395, 1853, 273, 563, 16186, 1106, 972, 12, 2088, 13, 1853, 18, 2088, 273, 501, 327, 1853, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
""" Creates a new unique ID which can be assigned to an new project object.
""" Creates a new unique ID which can be assigned to an new Project object. Parameters: id -- an unique ID proposal. If it's already taken, a new one is generated. Returns: an unique ID suitable for a new Project.
def GenerateUniqueID(self, id = None): """ Creates a new unique ID which can be assigned to an new project object. """ if id != None: if id in self.___id_list: Globals.debug("Error: id", id, "already taken") else: self.___id_list.append(id) return id counter = 0 while True: if not counter in self.___id_list: self.___id_list.append(counter) return counter counter += 1
e2b4f4a534dc5054c26a7ac44730cd6e0c158de4 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/10033/e2b4f4a534dc5054c26a7ac44730cd6e0c158de4/Project.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6654, 31118, 12, 2890, 16, 612, 273, 599, 4672, 3536, 10210, 279, 394, 3089, 1599, 1492, 848, 506, 6958, 358, 392, 394, 5420, 733, 18, 225, 7012, 30, 612, 1493, 392, 3089, 1599, 14708, 18, 971, 518, 1807, 1818, 9830, 16, 279, 394, 1245, 353, 4374, 18, 225, 2860, 30, 392, 3089, 1599, 10631, 364, 279, 394, 5420, 18, 3536, 309, 612, 480, 599, 30, 309, 612, 316, 365, 16186, 67, 350, 67, 1098, 30, 18901, 1031, 18, 4148, 2932, 668, 30, 612, 3113, 612, 16, 315, 17583, 9830, 7923, 469, 30, 365, 16186, 67, 350, 67, 1098, 18, 6923, 12, 350, 13, 327, 612, 225, 3895, 273, 374, 1323, 1053, 30, 309, 486, 3895, 316, 365, 16186, 67, 350, 67, 1098, 30, 365, 16186, 67, 350, 67, 1098, 18, 6923, 12, 7476, 13, 327, 3895, 3895, 1011, 404, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6654, 31118, 12, 2890, 16, 612, 273, 599, 4672, 3536, 10210, 279, 394, 3089, 1599, 1492, 848, 506, 6958, 358, 392, 394, 5420, 733, 18, 225, 7012, 30, 612, 1493, 392, 3089, 1599, 14708, 18, 971, 518, 1807, 1818, 9830, 16, 279, 394, 1245, 353, 4374, 18, 225, 2860, 30, 392, 3089, 1599, 10631, 364, 279, 394, 5420, 18, 3536, 309, 612, 480, 599, 30, 309, 612, 316, 365, 16186, 67, 350, 67, 1098, 30, 18901, 1031, 18, 4148, 2932, 668, 30, 612, 3113, 612, 16, 315, 17583, 9830, 7923, 469, 30, 365, 16186, 67, 350, 67, 1098, 18, 6923, 12, 350, 13, 327, 612, 225, 3895, 273, 374, 1323, 1053, 30, 309, 486, 3895, 316, 365, 16186, 2 ]
while self.p2c_width( afont.metrics()['linespace']) > height: dh = self.p2c_width( afont.metrics()['linespace']) - height if dh > 3: cairo_size += int( 0.5*dh) else: cairo_size += 1
tk_font_linespace = self.p2c_width( afont.metrics()['linespace']) while abs(tk_font_linespace - asc - desc) > 0.1: dh = tk_font_linespace - asc - desc cairo_size += 0.8*dh
def _draw_text( self, item):
95e3205eeada3c2abe4f2df1129d3e4e784c3ff0 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/4298/95e3205eeada3c2abe4f2df1129d3e4e784c3ff0/tk2cairo.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9446, 67, 955, 12, 365, 16, 761, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9446, 67, 955, 12, 365, 16, 761, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self["VKeyIcon"] = Pixmap()
self["VKeyIcon"] = Boolean(False)
def __init__(self, session, networkinfo, essid=None, aplist=None): Screen.__init__(self, session) HelpableScreen.__init__(self) self.session = session if isinstance(networkinfo, (list, tuple)): self.iface = networkinfo[0] self.essid = networkinfo[1] self.aplist = networkinfo[2] else: self.iface = networkinfo self.essid = essid self.aplist = aplist self.extended = None self.applyConfigRef = None self.finished_cb = None self.oktext = _("Press OK on your remote control to continue.") self.oldInterfaceState = iNetwork.getAdapterAttribute(self.iface, "up")
f741c4cc282f2f99b86e6ec305604f27216087ba /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6652/f741c4cc282f2f99b86e6ec305604f27216087ba/NetworkSetup.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1339, 16, 2483, 1376, 16, 18518, 350, 33, 7036, 16, 279, 17842, 33, 7036, 4672, 10146, 16186, 2738, 972, 12, 2890, 16, 1339, 13, 11288, 429, 7956, 16186, 2738, 972, 12, 2890, 13, 365, 18, 3184, 273, 1339, 309, 1549, 12, 5185, 1376, 16, 261, 1098, 16, 3193, 3719, 30, 365, 18, 31479, 273, 2483, 1376, 63, 20, 65, 365, 18, 403, 350, 273, 2483, 1376, 63, 21, 65, 365, 18, 69, 17842, 273, 2483, 1376, 63, 22, 65, 469, 30, 365, 18, 31479, 273, 2483, 1376, 365, 18, 403, 350, 273, 18518, 350, 365, 18, 69, 17842, 273, 279, 17842, 365, 18, 14948, 273, 599, 365, 18, 9010, 809, 1957, 273, 599, 365, 18, 13527, 67, 7358, 273, 599, 365, 18, 601, 955, 273, 389, 2932, 11840, 7791, 603, 3433, 2632, 3325, 358, 1324, 1199, 13, 365, 18, 1673, 1358, 1119, 273, 277, 3906, 18, 588, 4216, 1499, 12, 2890, 18, 31479, 16, 315, 416, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1339, 16, 2483, 1376, 16, 18518, 350, 33, 7036, 16, 279, 17842, 33, 7036, 4672, 10146, 16186, 2738, 972, 12, 2890, 16, 1339, 13, 11288, 429, 7956, 16186, 2738, 972, 12, 2890, 13, 365, 18, 3184, 273, 1339, 309, 1549, 12, 5185, 1376, 16, 261, 1098, 16, 3193, 3719, 30, 365, 18, 31479, 273, 2483, 1376, 63, 20, 65, 365, 18, 403, 350, 273, 2483, 1376, 63, 21, 65, 365, 18, 69, 17842, 273, 2483, 1376, 63, 22, 65, 469, 30, 365, 18, 31479, 273, 2483, 1376, 365, 18, 403, 350, 273, 18518, 350, 365, 18, 69, 17842, 273, 279, 17842, 365, 18, 14948, 273, 599, 365, 18, 9010, 809, 1957, 273, 2 ]
return os.path.splitext(basename)[0]
while 1: new_basename = os.path.splitext(basename)[0] if basename == new_basename: break else: basename = new_basename return basename
def ExtractModuleName(infile_path): """Infers the module name from the input file path. The input filename is supposed to be in the form "ModuleName.sigs". This function splits the filename from the extention on that basename of the path and returns that as the module name. Args: infile_path: String holding the path to the input file. Returns: The module name as a string. """ basename = os.path.basename(infile_path) return os.path.splitext(basename)[0]
6ef2067c287ffbe78bf193f72fd12cf9ce57f08a /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9392/6ef2067c287ffbe78bf193f72fd12cf9ce57f08a/generate_stubs.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 8152, 22542, 12, 267, 768, 67, 803, 4672, 3536, 13149, 414, 326, 1605, 508, 628, 326, 810, 585, 589, 18, 225, 1021, 810, 1544, 353, 18405, 358, 506, 316, 326, 646, 315, 22542, 18, 7340, 87, 9654, 1220, 445, 11019, 326, 1544, 628, 326, 1110, 5054, 603, 716, 4882, 434, 326, 589, 471, 1135, 716, 487, 326, 1605, 508, 18, 225, 6634, 30, 14568, 67, 803, 30, 514, 19918, 326, 589, 358, 326, 810, 585, 18, 225, 2860, 30, 1021, 1605, 508, 487, 279, 533, 18, 3536, 4882, 273, 1140, 18, 803, 18, 13909, 12, 267, 768, 67, 803, 13, 565, 1323, 404, 30, 394, 67, 13909, 273, 1140, 18, 803, 18, 4939, 408, 12, 13909, 25146, 20, 65, 309, 4882, 422, 394, 67, 13909, 30, 898, 469, 30, 4882, 273, 394, 67, 13909, 327, 4882, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 8152, 22542, 12, 267, 768, 67, 803, 4672, 3536, 13149, 414, 326, 1605, 508, 628, 326, 810, 585, 589, 18, 225, 1021, 810, 1544, 353, 18405, 358, 506, 316, 326, 646, 315, 22542, 18, 7340, 87, 9654, 1220, 445, 11019, 326, 1544, 628, 326, 1110, 5054, 603, 716, 4882, 434, 326, 589, 471, 1135, 716, 487, 326, 1605, 508, 18, 225, 6634, 30, 14568, 67, 803, 30, 514, 19918, 326, 589, 358, 326, 810, 585, 18, 225, 2860, 30, 1021, 1605, 508, 487, 279, 533, 18, 3536, 4882, 273, 1140, 18, 803, 18, 13909, 12, 267, 768, 67, 803, 13, 565, 1323, 404, 30, 394, 67, 13909, 273, 1140, 18, 803, 18, 4939, 408, 12, 13909, 25146, 20, 2 ]
def tearDown(self): GettextBaseTest.tearDown(self)
def tearDown(self): GettextBaseTest.tearDown(self)
fd9faa3ac7888182ec34b24c7543303b502dd440 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/fd9faa3ac7888182ec34b24c7543303b502dd440/test_gettext.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 268, 2091, 4164, 12, 2890, 4672, 968, 955, 2171, 4709, 18, 736, 297, 4164, 12, 2890, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 268, 2091, 4164, 12, 2890, 4672, 968, 955, 2171, 4709, 18, 736, 297, 4164, 12, 2890, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.copyHtmlFile(libraryName, versionName, variant.name, buildTarget, demoBrowserBase, qxVersion)
def buildAllDemos(self, buildTarget="build", demoBrowser=None, copyDemos=False): if demoBrowser: demoBrowser = os.path.abspath(demoBrowser) console.info("Generating demos for all known libraries") repositoryData = [] console.indent() for libraryName in self.libraries: library = self.libraries[libraryName] libraryData = { "classname": libraryName, "children" : [] } validDemo = False for versionName in library: version = library[versionName] versionData = { "classname" : versionName, #"tags" : [libraryName], "tests" : [], "manifest" : version.getManifest() } qxVersions = version.getManifest()["info"]["qooxdoo-versions"] #for ver in qxVersions: # versionData["tags"].append("qxVersion_" + ver) # getting the library's top-level readme here since we only have path # information for the library versions if not "readme" in libraryData: libDir = os.path.dirname(version.path) readme = self.getReadmeContent(libDir) if readme: libraryData["readme"] = readme else: libraryData["readme"] = "No readme file found." # get the version's readme if not "readme" in versionData: readme = self.getReadmeContent(version.path) if readme: versionData["readme"] = readme else: versionData["readme"] = "No readme file found." if not version.hasDemoDir: continue buildStatus = [] for variant in version.demos: if buildTarget == "build": #get the compatible qooxdoo versions of the library version for qxVersion in qxVersions: macro = { "BUILD_PATH" : "./" + qxVersion, "QOOXDOO_PATH" : "../../../../qooxdoo/" + qxVersion } status = variant.build("build", macro) #DEBUG #status = {"buildError" : None} status["qxVersion"] = qxVersion status["variant"] = variant.name buildStatus.append(status) else: status = variant.build(buildTarget) buildStatus.append(status) if demoBrowser: if copyDemos: demoBrowserBase = os.path.split(demoBrowser)[0] for demoStatus in buildStatus: qxVersion = demoStatus["qxVersion"] if demoStatus["buildError"]: console.warn("%s %s demo %s %s generation against qooxdoo %s failed!" %(libraryName, versionName, variant.name, buildTarget, qxVersion)) console.warn(demoStatus["buildError"]) continue sourceDir = os.path.join(version.path, "demo", variant.name, qxVersion) targetDir = os.path.join(demoBrowser, "demo", libraryName, versionName, variant.name) console.debug("Copying from %s to %s" %(sourceDir, targetDir)) try: copier = CopyTool() copier.parse_args(["-u", sourceDir, targetDir]) copier.do_work() except IOError, e: console.error("Couldn't copy demo: " + str(e)) demoManifest = version.getDemoManifest(variant.name) demoData = self.getDemoData(libraryName, versionName, variant.name, qxVersion) demoData["manifest"] = demoManifest versionData["tests"].append(demoData) else: demoManifest = version.getDemoManifest(variant.name) demoBrowserBase = os.path.split(demoBrowser)[0] for qxVersion in qxVersions: self.copyHtmlFile(libraryName, versionName, variant.name, buildTarget, demoBrowserBase, qxVersion) demoData = self.getDemoData(libraryName, versionName, variant.name, qxVersion) versionData["tests"].append(demoData) libraryData["children"].append(versionData) repositoryData.append(libraryData)
3902061437c031778044bcaa375e1d2f03ae6d4f /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/5718/3902061437c031778044bcaa375e1d2f03ae6d4f/repository.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1361, 1595, 15058, 538, 12, 2890, 16, 1361, 2326, 1546, 3510, 3113, 21477, 9132, 33, 7036, 16, 1610, 15058, 538, 33, 8381, 4672, 309, 21477, 9132, 30, 21477, 9132, 273, 1140, 18, 803, 18, 5113, 803, 12, 27928, 9132, 13, 2983, 18, 1376, 2932, 21755, 9626, 538, 364, 777, 4846, 14732, 7923, 3352, 751, 273, 5378, 2983, 18, 9355, 1435, 225, 364, 5313, 461, 316, 365, 18, 31417, 30, 5313, 273, 365, 18, 31417, 63, 12083, 461, 65, 5313, 751, 273, 288, 315, 18340, 6877, 5313, 461, 16, 315, 5906, 6, 294, 5378, 289, 225, 923, 27126, 273, 1083, 364, 1177, 461, 316, 5313, 30, 1177, 273, 5313, 63, 1589, 461, 65, 225, 1177, 751, 273, 288, 315, 18340, 6, 294, 1177, 461, 16, 31526, 4156, 6, 294, 306, 12083, 461, 6487, 315, 16341, 6, 294, 5378, 16, 315, 14357, 6, 294, 1177, 18, 588, 9121, 1435, 289, 225, 1043, 92, 5940, 273, 1177, 18, 588, 9121, 1435, 9614, 1376, 6, 6362, 6, 85, 83, 2409, 2896, 83, 17, 10169, 11929, 468, 1884, 1924, 316, 1043, 92, 5940, 30, 468, 225, 1177, 751, 9614, 4156, 6, 8009, 6923, 2932, 85, 92, 1444, 9548, 397, 1924, 13, 225, 468, 8742, 326, 5313, 1807, 1760, 17, 2815, 24778, 2674, 3241, 732, 1338, 1240, 589, 468, 1779, 364, 326, 5313, 5244, 309, 486, 315, 896, 3501, 6, 316, 5313, 751, 30, 2561, 1621, 273, 1140, 18, 803, 18, 12287, 12, 1589, 18, 803, 13, 24778, 273, 365, 18, 588, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1361, 1595, 15058, 538, 12, 2890, 16, 1361, 2326, 1546, 3510, 3113, 21477, 9132, 33, 7036, 16, 1610, 15058, 538, 33, 8381, 4672, 309, 21477, 9132, 30, 21477, 9132, 273, 1140, 18, 803, 18, 5113, 803, 12, 27928, 9132, 13, 2983, 18, 1376, 2932, 21755, 9626, 538, 364, 777, 4846, 14732, 7923, 3352, 751, 273, 5378, 2983, 18, 9355, 1435, 225, 364, 5313, 461, 316, 365, 18, 31417, 30, 5313, 273, 365, 18, 31417, 63, 12083, 461, 65, 5313, 751, 273, 288, 315, 18340, 6877, 5313, 461, 16, 315, 5906, 6, 294, 5378, 289, 225, 923, 27126, 273, 1083, 364, 1177, 461, 316, 5313, 30, 1177, 273, 5313, 63, 1589, 461, 65, 225, 1177, 751, 273, 288, 315, 2 ]
return timestep def writeToDB(self, filepath, server, username, password): """ Writes the vistrail to eXist database given the full path to the file""" tempTimestamp = 0 tagElements = [] macroElements = [] update = UpdateFunctions(server, username, password) if(update.docExists(filepath)): tempDoc = update.getDom(filepath) actionElements = tempDoc.getElementsByTagName("action") tempLen = len(actionElements) tempTimestamp = 0 for act in actionElements: t = act.getAttribute("time") if t > tempTimestamp: tempTimestamp = t tagElements = tempDoc.getElementsByTagName("tag") macroElements = tempDoc.getElementsByTagName("macro") source = """(""" actionLen = len(self.actionMap.values()) tagLen = len(self.tagMap.items()) macroLen = len(self.macroMap.values()) i = 0 for (time, action) in self.actionMap.items(): if(int(time) > int(tempTimestamp)): if(i == actionLen-1): if(tagLen == 0): source = source + action.writeToDB() else: source = source + action.writeToDB() + """,""" else: source = source + action.writeToDB() + """,""" i = i + 1 i = 0 for (name, time) in self.tagMap.items(): if(self.hasTagDBHelper(str(time), tagElements) == 0): if(i == tagLen-1): if(macroLen == 0): source = source + """<tag name=\"""" + str(name) + """\" time=\"""" + str(time) + """\" />""" else: source = source + """<tag name=\"""" + str(name) + """\" time=\"""" + str(time) + """\" />,""" else: source = source + """<tag name=\"""" + str(name) + """\" time=\"""" + str(time) + """\" />,""" i = i + 1 i = 0 for (name, macro) in self.macroMap.items(): if(self.hasMacroDBHelper(str(name), macroElements) == 0): if(i == macroLen-1): source = source + macro.writeToDB() else: source = source + macro.writeToDB() + """,""" i = i + 1 source = source + """)""" if(source != """()"""): if(update.docExists(filepath) == False): update.createNewDoc(filepath) update.addActions(source, "/db/" + filepath) def hasTagDBHelper(self, time, tagElements): for tag in tagElements: if(tag.getAttribute("time") == time): return 1 return 0 def hasMacroDBHelper(self, name, macroElements): for macro in macroElements: if(macro.getAttribute("name") == name): return 1 return 0
return timestep
def getLastCommonVersion(self, v): """Returns the last version that is common to both v1 and v2
0d08a982cb8d26e26f2e6ab32b89ef18e54df8fb /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6341/0d08a982cb8d26e26f2e6ab32b89ef18e54df8fb/__init__.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7595, 6517, 1444, 12, 2890, 16, 331, 4672, 3536, 1356, 326, 1142, 1177, 716, 353, 2975, 358, 3937, 331, 21, 471, 331, 22, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7595, 6517, 1444, 12, 2890, 16, 331, 4672, 3536, 1356, 326, 1142, 1177, 716, 353, 2975, 358, 3937, 331, 21, 471, 331, 22, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
gclient_scm.CreateSCM(webkit_path, self.root_dir, 'foo/third_party/WebKit').AndReturn(gclient_scm.CreateSCM) gclient_scm.CreateSCM.RunCommand('update', options, self.args, [])
gclient.gclient_scm.CreateSCM(webkit_path, self.root_dir, 'foo/third_party/WebKit').AndReturn(gclient.gclient_scm.CreateSCM) gclient.gclient_scm.CreateSCM.RunCommand('update', options, self.args, [])
def testRunOnDepsSuccessCustomVars(self): # Fake .gclient file. name = 'testRunOnDepsSuccessCustomVars_solution_name' gclient_config = """solutions = [ {
90ba161b70b445eba62b2a376e4fa2f508854e13 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6076/90ba161b70b445eba62b2a376e4fa2f508854e13/gclient_test.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1997, 1398, 14430, 4510, 3802, 5555, 12, 2890, 4672, 468, 11551, 263, 75, 2625, 585, 18, 508, 273, 296, 3813, 1997, 1398, 14430, 4510, 3802, 5555, 67, 13385, 67, 529, 11, 314, 2625, 67, 1425, 273, 3536, 18281, 6170, 273, 306, 288, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1997, 1398, 14430, 4510, 3802, 5555, 12, 2890, 4672, 468, 11551, 263, 75, 2625, 585, 18, 508, 273, 296, 3813, 1997, 1398, 14430, 4510, 3802, 5555, 67, 13385, 67, 529, 11, 314, 2625, 67, 1425, 273, 3536, 18281, 6170, 273, 306, 288, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
contents=open(os.path.normpath(myroot+"var/db/pkg/"+category+"/"+pkgname+"/CONTENTS"))
contents=open(os.path.normpath(root+"var/db/pkg/"+category+"/"+pkgname+"/CONTENTS"))
def unmerge(myroot,category,pkgname): if myroot=="": myroot="/" if os.path.isdir(os.path.normpath(myroot+"var/db/pkg/"+category+"/"+pkgname)): if myroot=="/": print "Unmerging",pkgname+"..." else: print "Unmerging",pkgname,"from",myroot+"..." print else: print pkgname,"not installed" return try: contents=open(os.path.normpath(myroot+"var/db/pkg/"+category+"/"+pkgname+"/CONTENTS")) except: print "Error -- could not open CONTENTS file for", pkgname+". Aborting." return pkgfiles={} for line in contents.readlines(): mydat=string.split(line) # we do this so we can remove from non-root filesystems # (use the ROOT var to allow maintenance on other partitions) mydat[1]=os.path.normpath(myroot+mydat[1][1:]) if mydat[0]=="obj": #format: type, mtime, md5sum pkgfiles[mydat[1]]=[mydat[0], mydat[3], mydat[2]] elif mydat[0]=="dir": #format: type pkgfiles[mydat[1]]=[mydat[0] ] elif mydat[0]=="sym": #format: type, mtime, dest pkgfiles[mydat[1]]=[mydat[0], mydat[4], mydat[3]] elif mydat[0]=="dev": #format: type pkgfiles[mydat[1]]=[mydat[0] ] elif mydat[0]=="fif": #format: type pkgfiles[mydat[1]]=[mydat[0]] else: print "Error -- CONTENTS file for", pkgname, "is corrupt." print ">>> "+line return # we don't want to automatically remove the ebuild file listed # in the CONTENTS file. We'll do after everything else has # completed successfully. myebuildfile=os.path.normpath(myroot+"var/db/pkg/"+category+"/"+pkgname+"/"+pkgname+".ebuild") if pkgfiles.has_key(myebuildfile): del pkgfiles[myebuildfile] mykeys=pkgfiles.keys() mykeys.sort() mykeys.reverse() #prerm script pkgscript("prerm",myebuildfile) for obj in mykeys: obj=os.path.normpath(obj) if not os.path.islink(obj): #we skip this if we're dealing with a symlink #because os.path.exists() will operate on the #link target rather than the link itself. if not os.path.exists(obj): print "--- !found", pkgfiles[obj][0], obj continue if (pkgfiles[obj][0] not in ("dir","fif","dev")) and (getmtime(obj) != pkgfiles[obj][1]): print "--- !mtime", pkgfiles[obj][0], obj continue if pkgfiles[obj][0]=="dir": if not os.path.isdir(obj): print "--- !dir ","dir", obj continue if os.listdir(obj): print "--- !empty","dir", obj continue os.rmdir(obj) print "<<< ","dir",obj elif pkgfiles[obj][0]=="sym": if not os.path.islink(obj): print "--- !sym ","sym", obj continue mydest=os.readlink(obj) if os.path.exists(os.path.normpath(myroot+mydest)): if mydest != pkgfiles[obj][2]: print "--- !destn","sym", obj continue os.unlink(obj) print "<<< ","sym",obj elif pkgfiles[obj][0]=="obj": if not os.path.isfile(obj): print "--- !obj ","obj", obj continue mymd5=md5(obj) if mymd5 != string.upper(pkgfiles[obj][2]): print "--- !md5 ","obj", obj continue os.unlink(obj) print "<<< ","obj",obj elif pkgfiles[obj][0]=="fif": if not isfifo(obj): print "--- !fif ","fif", obj continue os.unlink(obj) print "<<< ","fif",obj elif pkgfiles[obj][0]=="dev": if not isdev(obj): print "--- !dev ","dev", obj continue os.unlink(obj) print "<<< ","dev",obj #postrm script pkgscript("postrm",myebuildfile) #recursive cleanup for thing in os.listdir(myroot+"var/db/pkg/"+category+"/"+pkgname): os.unlink(myroot+"var/db/pkg/"+category+"/"+pkgname+"/"+thing) os.rmdir(myroot+"var/db/pkg/"+category+"/"+pkgname) print if myroot=="/": print pkgname,"unmerged." else: print pkgname,"unmerged from",myroot+"."
37ec033936cd148abafc52a24966a719023ae65c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2807/37ec033936cd148abafc52a24966a719023ae65c/portage.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 640, 2702, 12, 4811, 3085, 16, 4743, 16, 10657, 529, 4672, 309, 3399, 3085, 631, 3660, 30, 3399, 3085, 1546, 4898, 309, 1140, 18, 803, 18, 291, 1214, 12, 538, 18, 803, 18, 7959, 803, 12, 4811, 3085, 9078, 1401, 19, 1966, 19, 10657, 4898, 15, 4743, 9078, 4898, 15, 10657, 529, 3719, 30, 309, 3399, 3085, 31713, 4898, 30, 1172, 315, 984, 6592, 1998, 3113, 10657, 529, 9078, 7070, 469, 30, 1172, 315, 984, 6592, 1998, 3113, 10657, 529, 10837, 2080, 3113, 4811, 3085, 9078, 7070, 1172, 469, 30, 1172, 29348, 10837, 902, 5876, 6, 327, 775, 30, 2939, 33, 3190, 12, 538, 18, 803, 18, 7959, 803, 12, 3085, 9078, 1401, 19, 1966, 19, 10657, 4898, 15, 4743, 9078, 4898, 15, 10657, 529, 9078, 19, 9689, 55, 6, 3719, 1335, 30, 1172, 315, 668, 1493, 3377, 486, 1696, 12577, 55, 585, 364, 3113, 29348, 9078, 18, 225, 14263, 310, 1199, 327, 3475, 2354, 12938, 364, 980, 316, 2939, 18, 896, 3548, 13332, 3399, 3404, 33, 1080, 18, 4939, 12, 1369, 13, 468, 732, 741, 333, 1427, 732, 848, 1206, 628, 1661, 17, 3085, 6496, 87, 468, 261, 1202, 326, 11011, 569, 358, 1699, 18388, 603, 1308, 10060, 13, 3399, 3404, 63, 21, 65, 33, 538, 18, 803, 18, 7959, 803, 12, 4811, 3085, 15, 4811, 3404, 63, 21, 6362, 21, 30, 5717, 309, 3399, 3404, 63, 20, 65, 31713, 2603, 6877, 468, 2139, 30, 618, 16, 13158, 16, 3481, 25, 1364, 3475, 2354, 63, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 640, 2702, 12, 4811, 3085, 16, 4743, 16, 10657, 529, 4672, 309, 3399, 3085, 631, 3660, 30, 3399, 3085, 1546, 4898, 309, 1140, 18, 803, 18, 291, 1214, 12, 538, 18, 803, 18, 7959, 803, 12, 4811, 3085, 9078, 1401, 19, 1966, 19, 10657, 4898, 15, 4743, 9078, 4898, 15, 10657, 529, 3719, 30, 309, 3399, 3085, 31713, 4898, 30, 1172, 315, 984, 6592, 1998, 3113, 10657, 529, 9078, 7070, 469, 30, 1172, 315, 984, 6592, 1998, 3113, 10657, 529, 10837, 2080, 3113, 4811, 3085, 9078, 7070, 1172, 469, 30, 1172, 29348, 10837, 902, 5876, 6, 327, 775, 30, 2939, 33, 3190, 12, 538, 18, 803, 18, 7959, 803, 12, 3085, 9078, 1401, 19, 1966, 19, 10657, 4898, 2 ]
libtorrent_so = os.path.join("Miro.app", "Contents", "Resources", "lib", "python%s" % PYTHON_VERSION, "lib-dynload", "libtorrent.so")
libtorrent_so = os.path.join("Miro.app", "Contents", "Resources", "lib", "python%s" % PYTHON_VERSION, "lib-dynload", "miro", "libtorrent.so")
def fix_install_names(self): py_install_name = os.path.join("@executable_path", "..", "Frameworks", "Python.framework", "Versions", PYTHON_VERSION, "Python")
138509122776841361fb1ffb1d95a5c51e74b437 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12354/138509122776841361fb1ffb1d95a5c51e74b437/setup.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2917, 67, 5425, 67, 1973, 12, 2890, 4672, 2395, 67, 5425, 67, 529, 273, 1140, 18, 803, 18, 5701, 2932, 36, 17751, 67, 803, 3113, 315, 838, 3113, 315, 13701, 87, 3113, 315, 15774, 18, 12303, 3113, 315, 5940, 3113, 12191, 20131, 67, 5757, 16, 315, 15774, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2917, 67, 5425, 67, 1973, 12, 2890, 4672, 2395, 67, 5425, 67, 529, 273, 1140, 18, 803, 18, 5701, 2932, 36, 17751, 67, 803, 3113, 315, 838, 3113, 315, 13701, 87, 3113, 315, 15774, 18, 12303, 3113, 315, 5940, 3113, 12191, 20131, 67, 5757, 16, 315, 15774, 7923, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Subwidget Class --------- ----- incr Button decr Button entry Entry label Label"""
Subwidget Class --------- ----- incr Button decr Button entry Entry label Label"""
def pick(self, index):
22710823fb554a796dc96c44885d7a9389426824 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8546/22710823fb554a796dc96c44885d7a9389426824/Tix.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6002, 12, 2890, 16, 770, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6002, 12, 2890, 16, 770, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
""" Test adding a property to any component """
"""Test adding a property to any component. """
def test_add_property(self): """ Test adding a property to any component """ cal = self.cal2 event = cal.get_components('VEVENT')[1]
4284d14984f2a4b3da93b77281110353f761aa67 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12681/4284d14984f2a4b3da93b77281110353f761aa67/test_ical.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 1289, 67, 4468, 12, 2890, 4672, 3536, 4709, 6534, 279, 1272, 358, 1281, 1794, 18, 3536, 1443, 273, 365, 18, 771, 22, 871, 273, 1443, 18, 588, 67, 8119, 2668, 3412, 6465, 6134, 63, 21, 65, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 1289, 67, 4468, 12, 2890, 4672, 3536, 4709, 6534, 279, 1272, 358, 1281, 1794, 18, 3536, 1443, 273, 365, 18, 771, 22, 871, 273, 1443, 18, 588, 67, 8119, 2668, 3412, 6465, 6134, 63, 21, 65, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def onPageChanging(self, event): inspector = self.inspectors[event.GetOldSelection()] if inspector is not None: inspector.willBeClosed() inspector = self.inspectors[event.GetSelection()] if inspector is not None: inspector.willBeShown()
def onShowInspector(self, event): for inspector in self._activeInspectors: if inspector.toolbarId == event.GetId(): self._lastClickedInspectorClass = inspector.__class__ self.setActiveInspector(inspector) break
def onPageChanging(self, event): inspector = self.inspectors[event.GetOldSelection()] if inspector is not None: inspector.willBeClosed() inspector = self.inspectors[event.GetSelection()] if inspector is not None: inspector.willBeShown()
853364df34a3a5ee0851c87290c96a6e9b16b8f5 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6368/853364df34a3a5ee0851c87290c96a6e9b16b8f5/InspectorFrame.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 5706, 19443, 12, 2890, 16, 871, 4672, 364, 22700, 316, 365, 6315, 3535, 12073, 1383, 30, 309, 22700, 18, 18849, 548, 422, 871, 18, 967, 548, 13332, 365, 6315, 2722, 27633, 19443, 797, 273, 22700, 16186, 1106, 972, 365, 18, 542, 3896, 19443, 12, 12009, 280, 13, 898, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 5706, 19443, 12, 2890, 16, 871, 4672, 364, 22700, 316, 365, 6315, 3535, 12073, 1383, 30, 309, 22700, 18, 18849, 548, 422, 871, 18, 967, 548, 13332, 365, 6315, 2722, 27633, 19443, 797, 273, 22700, 16186, 1106, 972, 365, 18, 542, 3896, 19443, 12, 12009, 280, 13, 898, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
pass
self.__child = None if hasattr(self, 'item') and self.item: PLAY_END.post(self.item)
def child_finished(self): """ Callback when the child is finished. Override this method to react when the child is finished. """ pass
6c6f757d74971379853d8a2bd5aa70177e48d2f1 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11399/6c6f757d74971379853d8a2bd5aa70177e48d2f1/childapp.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1151, 67, 13527, 12, 2890, 4672, 3536, 8444, 1347, 326, 1151, 353, 6708, 18, 1439, 333, 707, 358, 13417, 1347, 326, 1151, 353, 6708, 18, 3536, 1342, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1151, 67, 13527, 12, 2890, 4672, 3536, 8444, 1347, 326, 1151, 353, 6708, 18, 1439, 333, 707, 358, 13417, 1347, 326, 1151, 353, 6708, 18, 3536, 1342, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def __init__(self, app):
def __init__(self, rootapp=None, **apps):
def __init__(self, app): trace("ISAPIThreadPoolHandler.__init__") self.app = app
742beb9f59a980a41b87dc069bb870643ade7d03 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/4963/742beb9f59a980a41b87dc069bb870643ade7d03/isapi_wsgi.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1365, 2910, 33, 7036, 16, 2826, 11411, 4672, 2606, 2932, 5127, 2557, 20621, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1365, 2910, 33, 7036, 16, 2826, 11411, 4672, 2606, 2932, 5127, 2557, 20621, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
level=zLOG.DEBUG)
level=zLOG.TRACE)
def message_input(self, message): """Decoding an incoming message and dispatch it""" # XXX Not sure what to do with errors that reach this level. # Need to catch ZRPCErrors in handle_reply() and # handle_request() so that they get back to the client. try: msgid, flags, name, args = self.marshal.decode(message) except DecodingError, msg: return self.return_error(None, None, DecodingError, msg)
8d7c57665d46df0cacc46068195732bd4e94a4b5 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/10048/8d7c57665d46df0cacc46068195732bd4e94a4b5/connection.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 883, 67, 2630, 12, 2890, 16, 883, 4672, 3536, 1799, 4751, 392, 6935, 883, 471, 3435, 518, 8395, 468, 11329, 2288, 3071, 4121, 358, 741, 598, 1334, 716, 9287, 333, 1801, 18, 468, 12324, 358, 1044, 2285, 8087, 4229, 316, 1640, 67, 10629, 1435, 471, 468, 1640, 67, 2293, 1435, 1427, 716, 2898, 336, 1473, 358, 326, 1004, 18, 775, 30, 24389, 16, 2943, 16, 508, 16, 833, 273, 365, 18, 3108, 18, 3922, 12, 2150, 13, 1335, 3416, 4751, 668, 16, 1234, 30, 327, 365, 18, 2463, 67, 1636, 12, 7036, 16, 599, 16, 3416, 4751, 668, 16, 1234, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 883, 67, 2630, 12, 2890, 16, 883, 4672, 3536, 1799, 4751, 392, 6935, 883, 471, 3435, 518, 8395, 468, 11329, 2288, 3071, 4121, 358, 741, 598, 1334, 716, 9287, 333, 1801, 18, 468, 12324, 358, 1044, 2285, 8087, 4229, 316, 1640, 67, 10629, 1435, 471, 468, 1640, 67, 2293, 1435, 1427, 716, 2898, 336, 1473, 358, 326, 1004, 18, 775, 30, 24389, 16, 2943, 16, 508, 16, 833, 273, 365, 18, 3108, 18, 3922, 12, 2150, 13, 1335, 3416, 4751, 668, 16, 1234, 30, 327, 365, 18, 2463, 67, 1636, 12, 7036, 16, 599, 16, 3416, 4751, 668, 16, 1234, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def dumb_consensus(self, threshold = .7, ambiguous = "N",
def dumb_consensus(self, threshold = .7, ambiguous = "X",
def dumb_consensus(self, threshold = .7, ambiguous = "N", consensus_alpha = None, require_multiple = 0): """Output a fast consensus sequence of the alignment.
0ec07d8e8c9dce51e4fa14a6ed64e9dcf93ab5b9 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7167/0ec07d8e8c9dce51e4fa14a6ed64e9dcf93ab5b9/AlignInfo.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 302, 3592, 67, 29220, 12, 2890, 16, 5573, 273, 263, 27, 16, 20399, 273, 315, 60, 3113, 18318, 67, 5429, 273, 599, 16, 2583, 67, 9622, 273, 374, 4672, 3536, 1447, 279, 4797, 18318, 3102, 434, 326, 8710, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 302, 3592, 67, 29220, 12, 2890, 16, 5573, 273, 263, 27, 16, 20399, 273, 315, 60, 3113, 18318, 67, 5429, 273, 599, 16, 2583, 67, 9622, 273, 374, 4672, 3536, 1447, 279, 4797, 18318, 3102, 434, 326, 8710, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if options['colorbar']:
if options.get('colorbar', False):
def _render_on_subplot(self, subplot): """ TESTS:
b930bde638c3418aac0325b1169327bc9ca7176c /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9417/b930bde638c3418aac0325b1169327bc9ca7176c/contour_plot.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5902, 67, 265, 67, 24523, 12, 2890, 16, 19826, 4672, 3536, 22130, 55, 30, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5902, 67, 265, 67, 24523, 12, 2890, 16, 19826, 4672, 3536, 22130, 55, 30, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def act_final_query(query, verbose_message):
def act_final_query(query, verbose_message):
def act_final_query(query, verbose_message): """ Either print or execute the given query """ if options.print_only: print query else: update_cursor = master_connection.cursor() try: try: update_cursor.execute(query) verbose(verbose_message) except: print_error("error executing: %s" % query) finally: update_cursor.close()
4742f48980dc812a72089f810c0c66c5b52fec74 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/10338/4742f48980dc812a72089f810c0c66c5b52fec74/oak-purge-master-logs.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 6385, 67, 2271, 12, 2271, 16, 3988, 67, 2150, 4672, 3536, 14635, 1172, 578, 1836, 326, 864, 843, 3536, 309, 702, 18, 1188, 67, 3700, 30, 1172, 843, 469, 30, 1089, 67, 9216, 273, 4171, 67, 4071, 18, 9216, 1435, 775, 30, 775, 30, 1089, 67, 9216, 18, 8837, 12, 2271, 13, 3988, 12, 11369, 67, 2150, 13, 1335, 30, 1172, 67, 1636, 2932, 1636, 11274, 30, 738, 87, 6, 738, 843, 13, 3095, 30, 1089, 67, 9216, 18, 4412, 1435, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 6385, 67, 2271, 12, 2271, 16, 3988, 67, 2150, 4672, 3536, 14635, 1172, 578, 1836, 326, 864, 843, 3536, 309, 702, 18, 1188, 67, 3700, 30, 1172, 843, 469, 30, 1089, 67, 9216, 273, 4171, 67, 4071, 18, 9216, 1435, 775, 30, 775, 30, 1089, 67, 9216, 18, 8837, 12, 2271, 13, 3988, 12, 11369, 67, 2150, 13, 1335, 30, 1172, 67, 1636, 2932, 1636, 11274, 30, 738, 87, 6, 738, 843, 13, 3095, 30, 1089, 67, 9216, 18, 4412, 1435, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def _pprint_var_value(self, var, multiline=1, summary_linelen=0):
def _pprint_var_value(self, var, multiline=1, summary_linelen=0): """ @return: A string representation of the value of the variable C{var}, suitable for use in a C{<pre>...</pre>} HTML block. @type var: L{Lar} """
def _pprint_var_value(self, var, multiline=1, summary_linelen=0): if not var.has_value(): return '' val = var.uid().value()
b57986399a2595e7095d7d67227b7bcda199a18b /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11420/b57986399a2595e7095d7d67227b7bcda199a18b/html.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 84, 1188, 67, 1401, 67, 1132, 12, 2890, 16, 569, 16, 19431, 33, 21, 16, 4916, 67, 7511, 292, 275, 33, 20, 4672, 3536, 632, 2463, 30, 432, 533, 4335, 434, 326, 460, 434, 326, 2190, 385, 95, 1401, 5779, 10631, 364, 999, 316, 279, 385, 95, 32, 1484, 34, 2777, 1757, 1484, 26114, 3982, 1203, 18, 632, 723, 569, 30, 511, 95, 14256, 97, 3536, 309, 486, 569, 18, 5332, 67, 1132, 13332, 327, 875, 1244, 273, 569, 18, 1911, 7675, 1132, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 84, 1188, 67, 1401, 67, 1132, 12, 2890, 16, 569, 16, 19431, 33, 21, 16, 4916, 67, 7511, 292, 275, 33, 20, 4672, 3536, 632, 2463, 30, 432, 533, 4335, 434, 326, 460, 434, 326, 2190, 385, 95, 1401, 5779, 10631, 364, 999, 316, 279, 385, 95, 32, 1484, 34, 2777, 1757, 1484, 26114, 3982, 1203, 18, 632, 723, 569, 30, 511, 95, 14256, 97, 3536, 309, 486, 569, 18, 5332, 67, 1132, 13332, 327, 875, 1244, 273, 569, 18, 1911, 7675, 1132, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.command_help(['set'])
self.command_help('set')
def command_set(self, arg): """ /set <option> [value] """ args = arg.split() if len(args) != 2 and len(args) != 1: self.command_help(['set']) return option = args[0] if len(args) == 2: value = args[1] else: value = '' config.set_and_save(option, value) msg = "%s=%s" % (option, value) room = self.current_room() self.add_message_to_room(room, msg)
7fbeef6a239c2c1f0ffd0a2f80fa994d6004fa9f /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9814/7fbeef6a239c2c1f0ffd0a2f80fa994d6004fa9f/gui.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1296, 67, 542, 12, 2890, 16, 1501, 4672, 3536, 342, 542, 411, 3482, 34, 306, 1132, 65, 3536, 833, 273, 1501, 18, 4939, 1435, 309, 562, 12, 1968, 13, 480, 576, 471, 562, 12, 1968, 13, 480, 404, 30, 365, 18, 3076, 67, 5201, 2668, 542, 6134, 327, 1456, 273, 833, 63, 20, 65, 309, 562, 12, 1968, 13, 422, 576, 30, 460, 273, 833, 63, 21, 65, 469, 30, 460, 273, 875, 642, 18, 542, 67, 464, 67, 5688, 12, 3482, 16, 460, 13, 1234, 273, 2213, 87, 5095, 87, 6, 738, 261, 3482, 16, 460, 13, 7725, 273, 365, 18, 2972, 67, 13924, 1435, 365, 18, 1289, 67, 2150, 67, 869, 67, 13924, 12, 13924, 16, 1234, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1296, 67, 542, 12, 2890, 16, 1501, 4672, 3536, 342, 542, 411, 3482, 34, 306, 1132, 65, 3536, 833, 273, 1501, 18, 4939, 1435, 309, 562, 12, 1968, 13, 480, 576, 471, 562, 12, 1968, 13, 480, 404, 30, 365, 18, 3076, 67, 5201, 2668, 542, 6134, 327, 1456, 273, 833, 63, 20, 65, 309, 562, 12, 1968, 13, 422, 576, 30, 460, 273, 833, 63, 21, 65, 469, 30, 460, 273, 875, 642, 18, 542, 67, 464, 67, 5688, 12, 3482, 16, 460, 13, 1234, 273, 2213, 87, 5095, 87, 6, 738, 261, 3482, 16, 460, 13, 7725, 273, 365, 18, 2972, 67, 13924, 1435, 365, 18, 1289, 67, 2150, 67, 869, 67, 13924, 12, 13924, 16, 2 ]
sys.stderr.write('!!!Error importing %s: %s\n!!!', (mname, e))
sys.stderr.write('!!!Error importing %s: %s\n!!!' % (name, e))
def document(options, progress, cancel): """ Create the documentation for C{modules}, using the options specified by C{options}. C{document} is designed to be started in its own thread by L{EpydocGUI._go}. @param options: The options to use for generating documentation. This includes keyword options that can be given to L{html.HTMLFormatter}, as well as the option C{outdir}, which controls where the output is written to. @type options: C{dictionary} @param progress: This first element of this list will be modified by C{document} to reflect its progress. This first element will be a number between 0 and 1 while C{document} is creating the documentation; and the string C{"done"} once it finishes creating the documentation. @type progress: C{list} """ progress[0] = 0.02 from epydoc.html import HTMLFormatter from epydoc.objdoc import DocMap from epydoc.imports import import_module, find_modules try: # Import the modules. modnames = options['modules'] # First, expand packages. for name in modnames[:]: if os.path.isdir(name): modnames.remove(name) new_modules = find_modules(name) if new_modules: modnames += new_modules sys.stderr.write('!!!Error: %r is not a pacakge\n!!!' % name) modules = [] for (name, num) in zip(modnames, range(len(modnames))): if cancel[0]: exit_thread() sys.stderr.write('***Importing %s\n***' % name) try: module = import_module(name) if module not in modules: modules.append(module) except ImportError, e: sys.stderr.write('!!!Error importing %s: %s\n!!!', (mname, e)) progress[0] += (IMPORT_PROGRESS*0.98)/len(modnames) # Create the documentation map. d = DocMap() # Build the documentation. for (module, num) in zip(modules, range(len(modules))): if cancel[0]: exit_thread() sys.stderr.write('***Building docs for %s\n***' % module.__name__) d.add(module) progress[0] += (BUILD_PROGRESS*0.98)/len(modules) htmldoc = HTMLFormatter(d, **options) numfiles = htmldoc.num_files() # Set up the progress callback. n = htmldoc.num_files() def progress_callback(path, doc, numfiles=numfiles, progress=progress, cancel=cancel, num=[1]): if cancel[0]: exit_thread() # Find the short name of the file we're writing. (dir, file) = os.path.split(path) (root, d) = os.path.split(dir) if d in ('public', 'private'): fname = os.path.join(d, file) else: fname = file sys.stderr.write('***Writing %s\n***' % fname) progress[0] += (WRITE_PROGRESS*0.98)/numfiles num[0] += 1 # Write the documentation. htmldoc.write(options.get('outdir', 'html'), progress_callback) # We're done. sys.stderr.write('***Finished!\n***') progress[0] = 'done' except SystemExit: # Cancel. sys.stderr.write('!!!Cancel!\n!!!') progress[0] = 'cancel' raise except Exception, e: # We failed. sys.stderr.write('!!!Internal error: %s\n!!!' % e) progress[0] = 'cancel' raise except: # We failed. sys.stderr.write('!!!Internal error\n!!!') progress[0] = 'cancel' raise
64f9726f3191683c24571daf68e581ad7ef3b87e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11420/64f9726f3191683c24571daf68e581ad7ef3b87e/gui.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1668, 12, 2116, 16, 4007, 16, 3755, 4672, 3536, 1788, 326, 7323, 364, 385, 95, 6400, 5779, 1450, 326, 702, 1269, 635, 385, 95, 2116, 5496, 225, 385, 95, 5457, 97, 353, 26584, 358, 506, 5746, 316, 2097, 4953, 2650, 635, 511, 95, 41, 2074, 2434, 43, 5370, 6315, 3240, 5496, 225, 632, 891, 702, 30, 1021, 702, 358, 999, 364, 12516, 7323, 18, 1220, 6104, 4932, 702, 716, 848, 506, 864, 358, 511, 95, 2620, 18, 4870, 5074, 5779, 487, 5492, 487, 326, 1456, 385, 95, 659, 1214, 5779, 1492, 11022, 1625, 326, 876, 353, 5941, 358, 18, 632, 723, 702, 30, 385, 95, 15556, 97, 632, 891, 4007, 30, 1220, 1122, 930, 434, 333, 666, 903, 506, 4358, 635, 385, 95, 5457, 97, 358, 3037, 2097, 4007, 18, 225, 1220, 1122, 930, 903, 506, 279, 1300, 3086, 374, 471, 404, 1323, 385, 95, 5457, 97, 353, 4979, 326, 7323, 31, 471, 326, 533, 385, 16711, 8734, 6, 97, 3647, 518, 27609, 4979, 326, 7323, 18, 632, 723, 4007, 30, 385, 95, 1098, 97, 3536, 4007, 63, 20, 65, 273, 374, 18, 3103, 628, 425, 2074, 2434, 18, 2620, 1930, 3982, 5074, 628, 425, 2074, 2434, 18, 2603, 2434, 1930, 3521, 863, 628, 425, 2074, 2434, 18, 21350, 1930, 1930, 67, 2978, 16, 1104, 67, 6400, 225, 775, 30, 468, 6164, 326, 4381, 18, 681, 1973, 273, 702, 3292, 6400, 3546, 468, 5783, 16, 4542, 5907, 18, 364, 508, 316, 681, 1973, 10531, 14542, 309, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1668, 12, 2116, 16, 4007, 16, 3755, 4672, 3536, 1788, 326, 7323, 364, 385, 95, 6400, 5779, 1450, 326, 702, 1269, 635, 385, 95, 2116, 5496, 225, 385, 95, 5457, 97, 353, 26584, 358, 506, 5746, 316, 2097, 4953, 2650, 635, 511, 95, 41, 2074, 2434, 43, 5370, 6315, 3240, 5496, 225, 632, 891, 702, 30, 1021, 702, 358, 999, 364, 12516, 7323, 18, 1220, 6104, 4932, 702, 716, 848, 506, 864, 358, 511, 95, 2620, 18, 4870, 5074, 5779, 487, 5492, 487, 326, 1456, 385, 95, 659, 1214, 5779, 1492, 11022, 1625, 326, 876, 353, 5941, 358, 18, 632, 723, 702, 30, 385, 95, 15556, 97, 632, 891, 4007, 30, 1220, 1122, 930, 434, 333, 666, 903, 2 ]
other = LIGOTimeGPS(other)
try: other = LIGOTimeGPS(other) except: return 1
def __cmp__(self, other): """ Compare a value to a LIGOTimeGPS. If the value being compared to the LIGOTimeGPS is not also a LIGOTimeGPS, then an attempt is made to convert it to a LIGOTimeGPS.
b2e11ba06e87aefa73c9cfb4263c686ab3b0f91f /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3589/b2e11ba06e87aefa73c9cfb4263c686ab3b0f91f/lal.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 9625, 972, 12, 2890, 16, 1308, 4672, 3536, 11051, 279, 460, 358, 279, 511, 3047, 51, 950, 28983, 18, 225, 971, 326, 460, 3832, 15843, 358, 326, 511, 3047, 51, 950, 28983, 353, 486, 2546, 279, 511, 3047, 51, 950, 28983, 16, 1508, 392, 4395, 353, 7165, 358, 1765, 518, 358, 279, 511, 3047, 51, 950, 28983, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 9625, 972, 12, 2890, 16, 1308, 4672, 3536, 11051, 279, 460, 358, 279, 511, 3047, 51, 950, 28983, 18, 225, 971, 326, 460, 3832, 15843, 358, 326, 511, 3047, 51, 950, 28983, 353, 486, 2546, 279, 511, 3047, 51, 950, 28983, 16, 1508, 392, 4395, 353, 7165, 358, 1765, 518, 358, 279, 511, 3047, 51, 950, 28983, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
d = clientCreator.connectTCP("127.0.0.1", portNum)
d2 = clientCreator.connectTCP("127.0.0.1", portNum)
def _rememberProtocolInstance(addr): protocol = buildProtocol(addr) self.serverProtocol = protocol.wrappedProtocol return protocol
6dc2595124ed21d282576cfb553463fbb3d540f3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12595/6dc2595124ed21d282576cfb553463fbb3d540f3/test_ftp.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 28155, 5752, 1442, 12, 4793, 4672, 1771, 273, 1361, 5752, 12, 4793, 13, 365, 18, 3567, 5752, 273, 1771, 18, 18704, 5752, 327, 1771, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 28155, 5752, 1442, 12, 4793, 4672, 1771, 273, 1361, 5752, 12, 4793, 13, 365, 18, 3567, 5752, 273, 1771, 18, 18704, 5752, 327, 1771, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
for whitespace in whitespace_string: format = format.replace(whitespace, r'\s*')
whitespace_replacement = re_compile('\s+') format = whitespace_replacement.sub('\s*', format)
def pattern(self, format): """Return re pattern for the format string.""" processed_format = '' for whitespace in whitespace_string: format = format.replace(whitespace, r'\s*') while format.find('%') != -1: directive_index = format.index('%')+1 processed_format = "%s%s%s" % (processed_format, format[:directive_index-1], self[format[directive_index]]) format = format[directive_index+1:] return "%s%s" % (processed_format, format)
80cebc16aa800ec5740e4b9c8b6508bae4cca434 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8546/80cebc16aa800ec5740e4b9c8b6508bae4cca434/_strptime.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1936, 12, 2890, 16, 740, 4672, 3536, 990, 283, 1936, 364, 326, 740, 533, 12123, 5204, 67, 2139, 273, 875, 7983, 67, 24394, 273, 283, 67, 11100, 2668, 64, 87, 15, 6134, 740, 273, 7983, 67, 24394, 18, 1717, 2668, 64, 87, 14, 2187, 740, 13, 1323, 740, 18, 4720, 29909, 6134, 480, 300, 21, 30, 8655, 67, 1615, 273, 740, 18, 1615, 29909, 6134, 15, 21, 5204, 67, 2139, 273, 2213, 87, 9, 87, 9, 87, 6, 738, 261, 11005, 67, 2139, 16, 740, 10531, 22347, 67, 1615, 17, 21, 6487, 365, 63, 2139, 63, 22347, 67, 1615, 65, 5717, 740, 273, 740, 63, 22347, 67, 1615, 15, 21, 26894, 327, 2213, 87, 9, 87, 6, 738, 261, 11005, 67, 2139, 16, 740, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1936, 12, 2890, 16, 740, 4672, 3536, 990, 283, 1936, 364, 326, 740, 533, 12123, 5204, 67, 2139, 273, 875, 7983, 67, 24394, 273, 283, 67, 11100, 2668, 64, 87, 15, 6134, 740, 273, 7983, 67, 24394, 18, 1717, 2668, 64, 87, 14, 2187, 740, 13, 1323, 740, 18, 4720, 29909, 6134, 480, 300, 21, 30, 8655, 67, 1615, 273, 740, 18, 1615, 29909, 6134, 15, 21, 5204, 67, 2139, 273, 2213, 87, 9, 87, 9, 87, 6, 738, 261, 11005, 67, 2139, 16, 740, 10531, 22347, 67, 1615, 17, 21, 6487, 365, 63, 2139, 63, 22347, 67, 1615, 65, 5717, 740, 273, 740, 63, 22347, 67, 1615, 15, 21, 26894, 327, 2213, 87, 9, 87, 6, 738, 2 ]
av.detachNode()
if (av.getParent().compareTo(self) == 0): av.detachNode()
def removeObjectFromGrid(self, av): # TODO: WHAT LOCATION SHOULD WE SET THIS TO? #av.reparentTo(hidden) av.detachNode() #av.b_setLocation(0,0)
fa4d2a16a3c98e46cac499b7b7878a5859b858fd /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8543/fa4d2a16a3c98e46cac499b7b7878a5859b858fd/DistributedCartesianGrid.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 921, 1265, 6313, 12, 2890, 16, 1712, 4672, 468, 2660, 30, 14735, 789, 22960, 6122, 31090, 13880, 7855, 20676, 8493, 35, 468, 842, 18, 266, 2938, 774, 12, 6345, 13, 309, 261, 842, 18, 588, 3054, 7675, 9877, 774, 12, 2890, 13, 422, 374, 4672, 225, 1712, 18, 8238, 497, 907, 1435, 468, 842, 18, 70, 67, 542, 2735, 12, 20, 16, 20, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 921, 1265, 6313, 12, 2890, 16, 1712, 4672, 468, 2660, 30, 14735, 789, 22960, 6122, 31090, 13880, 7855, 20676, 8493, 35, 468, 842, 18, 266, 2938, 774, 12, 6345, 13, 309, 261, 842, 18, 588, 3054, 7675, 9877, 774, 12, 2890, 13, 422, 374, 4672, 225, 1712, 18, 8238, 497, 907, 1435, 468, 842, 18, 70, 67, 542, 2735, 12, 20, 16, 20, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
""" dtermine if the requested folder path is legal and exists """
""" determine if the requested folder path is legal and exists """ trimmedFolderBasePath = os.path.normpath(self.folder)
def validFolder(self, REQUEST=None): """ dtermine if the requested folder path is legal and exists """
6abd6fb096b7cf9709c9fedce9b68c0d3cd973d8 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/1807/6abd6fb096b7cf9709c9fedce9b68c0d3cd973d8/PloneLocalFolderNG.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 923, 3899, 12, 2890, 16, 225, 12492, 33, 7036, 4672, 3536, 302, 387, 3081, 309, 326, 3764, 3009, 589, 353, 19286, 471, 1704, 3536, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 923, 3899, 12, 2890, 16, 225, 12492, 33, 7036, 4672, 3536, 302, 387, 3081, 309, 326, 3764, 3009, 589, 353, 19286, 471, 1704, 3536, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.__maxheaderlen = maxheaderlen
self._maxheaderlen = maxheaderlen
def __init__(self, outfp, mangle_from_=True, maxheaderlen=78): """Create the generator for message flattening.
bebf357b442a43365c8883f99b9f699444d75bc7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/bebf357b442a43365c8883f99b9f699444d75bc7/Generator.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 7944, 16, 312, 4341, 67, 2080, 67, 33, 5510, 16, 943, 3374, 1897, 33, 8285, 4672, 3536, 1684, 326, 4456, 364, 883, 5341, 310, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 7944, 16, 312, 4341, 67, 2080, 67, 33, 5510, 16, 943, 3374, 1897, 33, 8285, 4672, 3536, 1684, 326, 4456, 364, 883, 5341, 310, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if rspec.has_key('net_min_rate'):
MinRate = int(rspec.get("net_min_rate", default_MinRate)) if MinRate > int(.25 * default_MaxRate): MinRate = int(.25 * default_MaxRate) if MinRate != self.MinRate: self.MinRate = MinRate
def updateSliceAttributes(self, rspec): # Incase the limits have changed. if (self.MaxRate != default_MaxRate) or \ (self.Maxi2Rate != default_Maxi2Rate): self.MaxRate = int(bwlimit.get_bwcap() / 1000) self.Maxi2Rate = int(bwlimit.bwmax / 1000)
552d3ccba58387b6ad8cc621b0bd7f47d5faa132 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/6995/552d3ccba58387b6ad8cc621b0bd7f47d5faa132/bwmon.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 5959, 2498, 12, 2890, 16, 436, 2793, 4672, 468, 657, 3593, 326, 8181, 1240, 3550, 18, 309, 261, 2890, 18, 2747, 4727, 480, 805, 67, 2747, 4727, 13, 578, 521, 261, 2890, 18, 2747, 77, 22, 4727, 480, 805, 67, 2747, 77, 22, 4727, 4672, 365, 18, 2747, 4727, 273, 509, 12, 70, 91, 3595, 18, 588, 67, 70, 91, 5909, 1435, 342, 4336, 13, 365, 18, 2747, 77, 22, 4727, 273, 509, 12, 70, 91, 3595, 18, 70, 91, 1896, 342, 4336, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 5959, 2498, 12, 2890, 16, 436, 2793, 4672, 468, 657, 3593, 326, 8181, 1240, 3550, 18, 309, 261, 2890, 18, 2747, 4727, 480, 805, 67, 2747, 4727, 13, 578, 521, 261, 2890, 18, 2747, 77, 22, 4727, 480, 805, 67, 2747, 77, 22, 4727, 4672, 365, 18, 2747, 4727, 273, 509, 12, 70, 91, 3595, 18, 588, 67, 70, 91, 5909, 1435, 342, 4336, 13, 365, 18, 2747, 77, 22, 4727, 273, 509, 12, 70, 91, 3595, 18, 70, 91, 1896, 342, 4336, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
obj = models.AddressRange.create(form.cleaned_data['lo'], form.cleaned_data['hi'], parent=parent)
obj = models.AddressRange(form.cleaned_data['lo'], form.cleaned_data['hi'], parent=parent)
def prefix_split_view(request, pk): handle = request.session['handle'] prefix = get_object_or_404(models.AddressRange.objects, pk=pk) # ensure this resource range belongs to a parent of the current conf parent_set = get_parents_or_404(handle, prefix) if request.method == 'POST': form = forms.PrefixSplitForm(prefix, request.POST) if form.is_valid(): obj = models.AddressRange.create(form.cleaned_data['lo'], form.cleaned_data['hi'], parent=parent) obj.save() return http.HttpResponseRedirect(obj.get_absolute_url()) else: form = forms.PrefixSplitForm(prefix) return render('myrpki/prefix_view.html', { 'form': form, 'addr': prefix, 'form': form, 'parent': parent_set }, request)
67eda9c96f34b1466353c1cbe79a5755c985ac28 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/119/67eda9c96f34b1466353c1cbe79a5755c985ac28/views.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1633, 67, 4939, 67, 1945, 12, 2293, 16, 2365, 4672, 1640, 273, 590, 18, 3184, 3292, 4110, 3546, 1633, 273, 336, 67, 1612, 67, 280, 67, 11746, 12, 7665, 18, 1887, 2655, 18, 6911, 16, 2365, 33, 5465, 13, 468, 3387, 333, 1058, 1048, 11081, 358, 279, 982, 434, 326, 783, 2195, 982, 67, 542, 273, 336, 67, 12606, 67, 280, 67, 11746, 12, 4110, 16, 1633, 13, 225, 309, 590, 18, 2039, 422, 296, 3798, 4278, 646, 273, 10138, 18, 2244, 5521, 1204, 12, 3239, 16, 590, 18, 3798, 13, 309, 646, 18, 291, 67, 877, 13332, 1081, 273, 3679, 18, 1887, 2655, 12, 687, 18, 6200, 329, 67, 892, 3292, 383, 17337, 646, 18, 6200, 329, 67, 892, 3292, 12266, 17337, 982, 33, 2938, 13, 1081, 18, 5688, 1435, 327, 1062, 18, 19520, 5961, 12, 2603, 18, 588, 67, 12547, 67, 718, 10756, 469, 30, 646, 273, 10138, 18, 2244, 5521, 1204, 12, 3239, 13, 225, 327, 1743, 2668, 4811, 86, 5465, 77, 19, 3239, 67, 1945, 18, 2620, 2187, 288, 296, 687, 4278, 646, 16, 296, 4793, 4278, 1633, 16, 296, 687, 4278, 646, 16, 296, 2938, 4278, 982, 67, 542, 19879, 590, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1633, 67, 4939, 67, 1945, 12, 2293, 16, 2365, 4672, 1640, 273, 590, 18, 3184, 3292, 4110, 3546, 1633, 273, 336, 67, 1612, 67, 280, 67, 11746, 12, 7665, 18, 1887, 2655, 18, 6911, 16, 2365, 33, 5465, 13, 468, 3387, 333, 1058, 1048, 11081, 358, 279, 982, 434, 326, 783, 2195, 982, 67, 542, 273, 336, 67, 12606, 67, 280, 67, 11746, 12, 4110, 16, 1633, 13, 225, 309, 590, 18, 2039, 422, 296, 3798, 4278, 646, 273, 10138, 18, 2244, 5521, 1204, 12, 3239, 16, 590, 18, 3798, 13, 309, 646, 18, 291, 67, 877, 13332, 1081, 273, 3679, 18, 1887, 2655, 12, 687, 18, 6200, 329, 67, 892, 3292, 383, 17337, 646, 18, 6200, 329, 2 ]
if sys.stdin.isatty() and not self.conf.assumeyes:
if not sys.stdin.isatty() and not self.conf.assumeyes:
def gpgsigcheck(self, pkgs): '''Perform GPG signature verification on the given packages, installing keys if possible
13e9572b2c346b1871950069d1b98f459d5f88a7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5445/13e9572b2c346b1871950069d1b98f459d5f88a7/cli.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4178, 564, 360, 1893, 12, 2890, 16, 16922, 4672, 9163, 4990, 28378, 3372, 11805, 603, 326, 864, 5907, 16, 3799, 310, 1311, 309, 3323, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4178, 564, 360, 1893, 12, 2890, 16, 16922, 4672, 9163, 4990, 28378, 3372, 11805, 603, 326, 864, 5907, 16, 3799, 310, 1311, 309, 3323, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
print >> sys.stderr, msg print >> sys.stderr, __doc__
print(msg, file=sys.stderr) print(__doc__, file=sys.stderr)
def usage(msg=None): if msg is not None: print >> sys.stderr, msg print >> sys.stderr, __doc__
4b4b89427d87518d9ad192a0b272bc7895013afc /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12029/4b4b89427d87518d9ad192a0b272bc7895013afc/reindent.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4084, 12, 3576, 33, 7036, 4672, 309, 1234, 353, 486, 599, 30, 1172, 12, 3576, 16, 585, 33, 9499, 18, 11241, 13, 1172, 12, 972, 2434, 972, 16, 585, 33, 9499, 18, 11241, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4084, 12, 3576, 33, 7036, 4672, 309, 1234, 353, 486, 599, 30, 1172, 12, 3576, 16, 585, 33, 9499, 18, 11241, 13, 1172, 12, 972, 2434, 972, 16, 585, 33, 9499, 18, 11241, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def __init__(self, postr):
def __init__(self, postr, upload_queue):
def __init__(self, postr): threading.Thread.__init__(self) self.setDaemon(True) self.postr = postr
ae707731ea27e583eef75e3f658dc191f133b44f /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11023/ae707731ea27e583eef75e3f658dc191f133b44f/postr.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 949, 313, 16, 3617, 67, 4000, 4672, 17254, 18, 3830, 16186, 2738, 972, 12, 2890, 13, 365, 18, 542, 12858, 12, 5510, 13, 365, 18, 917, 313, 273, 949, 313, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 949, 313, 16, 3617, 67, 4000, 4672, 17254, 18, 3830, 16186, 2738, 972, 12, 2890, 13, 365, 18, 542, 12858, 12, 5510, 13, 365, 18, 917, 313, 273, 949, 313, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
velocity = self.__oldPosDelta*(1.0/self.__oldDt)
if self.__oldDt == 0: velocity = 0 else: velocity = self.__oldPosDelta*(1.0/self.__oldDt)
def setPriorParentVector(self): assert self.notify.debugStateCall(self) if __debug__: onScreenDebug.add("__oldDt", "% 10.4f"%self.__oldDt) onScreenDebug.add("self.__oldPosDelta", self.__oldPosDelta.pPrintValues()) velocity = self.__oldPosDelta*(1.0/self.__oldDt) self.priorParent = Vec3(velocity) if __debug__: if self.wantDebugIndicator: onScreenDebug.add("priorParent", self.priorParent.pPrintValues())
3b57b93a982e84f815ed78d3cf510c88dffd4bca /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/8543/3b57b93a982e84f815ed78d3cf510c88dffd4bca/GravityWalker.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 17004, 2432, 3054, 5018, 12, 2890, 4672, 1815, 365, 18, 12336, 18, 4148, 1119, 1477, 12, 2890, 13, 309, 1001, 4148, 972, 30, 603, 7956, 2829, 18, 1289, 2932, 972, 1673, 19739, 3113, 2213, 1728, 18, 24, 74, 28385, 2890, 16186, 1673, 19739, 13, 603, 7956, 2829, 18, 1289, 2932, 2890, 16186, 1673, 1616, 9242, 3113, 365, 16186, 1673, 1616, 9242, 18, 84, 5108, 1972, 10756, 225, 309, 365, 16186, 1673, 19739, 422, 374, 30, 14767, 273, 374, 469, 30, 14767, 273, 365, 16186, 1673, 1616, 9242, 21556, 21, 18, 20, 19, 2890, 16186, 1673, 19739, 13, 365, 18, 17927, 3054, 273, 12969, 23, 12, 29418, 560, 13, 309, 1001, 4148, 972, 30, 309, 365, 18, 17369, 2829, 13140, 30, 603, 7956, 2829, 18, 1289, 2932, 17927, 3054, 3113, 365, 18, 17927, 3054, 18, 84, 5108, 1972, 10756, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 17004, 2432, 3054, 5018, 12, 2890, 4672, 1815, 365, 18, 12336, 18, 4148, 1119, 1477, 12, 2890, 13, 309, 1001, 4148, 972, 30, 603, 7956, 2829, 18, 1289, 2932, 972, 1673, 19739, 3113, 2213, 1728, 18, 24, 74, 28385, 2890, 16186, 1673, 19739, 13, 603, 7956, 2829, 18, 1289, 2932, 2890, 16186, 1673, 1616, 9242, 3113, 365, 16186, 1673, 1616, 9242, 18, 84, 5108, 1972, 10756, 225, 309, 365, 16186, 1673, 19739, 422, 374, 30, 14767, 273, 374, 469, 30, 14767, 273, 365, 16186, 1673, 1616, 9242, 21556, 21, 18, 20, 19, 2890, 16186, 1673, 19739, 13, 365, 18, 17927, 3054, 273, 12969, 23, 12, 29418, 560, 13, 309, 1001, 4148, 972, 30, 309, 365, 18, 17369, 2829, 2 ]
cellFrame, controlView)
cellFrame, view)
def drawInteriorWithFrame_inView_(self, cellFrame, view): super(ProgressCell, self).drawInteriorWithFrame_inView_( cellFrame, controlView) self.setControlView_(view) NSColor.controlColor().set() NSRectFill(cellFrame)
82ef1db3d518545b9f8de5df8d0363118ecc5ae0 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/97/82ef1db3d518545b9f8de5df8d0363118ecc5ae0/ProgressCell.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3724, 2465, 9659, 1190, 3219, 67, 267, 1767, 67, 12, 2890, 16, 2484, 3219, 16, 1476, 4672, 2240, 12, 5491, 4020, 16, 365, 2934, 9446, 2465, 9659, 1190, 3219, 67, 267, 1767, 67, 12, 2484, 3219, 16, 1476, 13, 365, 18, 542, 3367, 1767, 67, 12, 1945, 13, 11472, 2957, 18, 7098, 2957, 7675, 542, 1435, 11472, 6120, 8026, 12, 3855, 3219, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3724, 2465, 9659, 1190, 3219, 67, 267, 1767, 67, 12, 2890, 16, 2484, 3219, 16, 1476, 4672, 2240, 12, 5491, 4020, 16, 365, 2934, 9446, 2465, 9659, 1190, 3219, 67, 267, 1767, 67, 12, 2484, 3219, 16, 1476, 13, 365, 18, 542, 3367, 1767, 67, 12, 1945, 13, 11472, 2957, 18, 7098, 2957, 7675, 542, 1435, 11472, 6120, 8026, 12, 3855, 3219, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
fp = open(filename)
fp = open(filename, encoding='utf-8')
def verify_bad_module(self, module_name): self.assertRaises(SyntaxError, __import__, 'test.' + module_name)
1b1d513a93780d622563049fff1f850276c73ccb /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12029/1b1d513a93780d622563049fff1f850276c73ccb/test_coding.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3929, 67, 8759, 67, 2978, 12, 2890, 16, 1605, 67, 529, 4672, 365, 18, 11231, 12649, 6141, 12, 22510, 16, 1001, 5666, 972, 16, 296, 3813, 1093, 397, 1605, 67, 529, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3929, 67, 8759, 67, 2978, 12, 2890, 16, 1605, 67, 529, 4672, 365, 18, 11231, 12649, 6141, 12, 22510, 16, 1001, 5666, 972, 16, 296, 3813, 1093, 397, 1605, 67, 529, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
file.Write(" parse_error::ParseError result =\n") file.Write(" Validate%s(this, immediate_data_size%s);\n" % (func.name, func.MakeOriginalArgString("", True))) file.Write(" if (result != parse_error::kParseNoError) {\n") file.Write(" return result;\n") file.Write(" }\n")
func.WriteHandlerValidation(file)
def WriteServiceImplementation(self, func, file): """Overrriden from TypeHandler.""" file.Write( "parse_error::ParseError GLES2DecoderImpl::Handle%s(\n" % func.name) file.Write( " uint32 immediate_data_size, const gles2::%s& c) {\n" % func.name) last_arg = func.GetLastOriginalArg()
ba3176a8f0a18527c0af5896f9d595d866e5ceeb /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9392/ba3176a8f0a18527c0af5896f9d595d866e5ceeb/build_gles2_cmd_buffer.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2598, 1179, 13621, 12, 2890, 16, 1326, 16, 585, 4672, 3536, 22042, 1691, 275, 628, 1412, 1503, 12123, 585, 18, 3067, 12, 315, 2670, 67, 1636, 2866, 21004, 611, 11386, 22, 7975, 2828, 2866, 3259, 9, 87, 4713, 82, 6, 738, 1326, 18, 529, 13, 585, 18, 3067, 12, 315, 565, 2254, 1578, 14483, 67, 892, 67, 1467, 16, 1866, 314, 1040, 22, 2866, 9, 87, 10, 276, 13, 18890, 82, 6, 738, 1326, 18, 529, 13, 1142, 67, 3175, 273, 1326, 18, 967, 3024, 8176, 4117, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2598, 1179, 13621, 12, 2890, 16, 1326, 16, 585, 4672, 3536, 22042, 1691, 275, 628, 1412, 1503, 12123, 585, 18, 3067, 12, 315, 2670, 67, 1636, 2866, 21004, 611, 11386, 22, 7975, 2828, 2866, 3259, 9, 87, 4713, 82, 6, 738, 1326, 18, 529, 13, 585, 18, 3067, 12, 315, 565, 2254, 1578, 14483, 67, 892, 67, 1467, 16, 1866, 314, 1040, 22, 2866, 9, 87, 10, 276, 13, 18890, 82, 6, 738, 1326, 18, 529, 13, 1142, 67, 3175, 273, 1326, 18, 967, 3024, 8176, 4117, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
conditional = conditional.split('&')
conditional = re.split('([|&])', conditional)
def extractConditional(idlFilePath): conditional = None # Read file and look for "interface [ Conditional=XXX ]". idlFile = open(idlFilePath) idlContents = idlFile.read().replace('\n', '') idlFile.close() match = conditionalPattern.search(idlContents) if match: conditional = match.group(1) conditional = conditional.split('&') return conditional
1caa5a7f3d95b6c1f96755f2dd329e99f51c7e06 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9392/1caa5a7f3d95b6c1f96755f2dd329e99f51c7e06/action_derivedsourcesallinone.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 14132, 12, 350, 80, 5598, 4672, 11139, 273, 599, 225, 468, 2720, 585, 471, 2324, 364, 315, 5831, 306, 22466, 33, 15639, 308, 9654, 612, 80, 812, 273, 1696, 12, 350, 80, 5598, 13, 612, 80, 6323, 273, 612, 80, 812, 18, 896, 7675, 2079, 2668, 64, 82, 2187, 28707, 612, 80, 812, 18, 4412, 1435, 225, 845, 273, 11139, 3234, 18, 3072, 12, 350, 80, 6323, 13, 309, 845, 30, 11139, 273, 845, 18, 1655, 12, 21, 13, 11139, 273, 283, 18, 4939, 2668, 3816, 96, 10, 5717, 2187, 11139, 13, 225, 327, 11139, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 14132, 12, 350, 80, 5598, 4672, 11139, 273, 599, 225, 468, 2720, 585, 471, 2324, 364, 315, 5831, 306, 22466, 33, 15639, 308, 9654, 612, 80, 812, 273, 1696, 12, 350, 80, 5598, 13, 612, 80, 6323, 273, 612, 80, 812, 18, 896, 7675, 2079, 2668, 64, 82, 2187, 28707, 612, 80, 812, 18, 4412, 1435, 225, 845, 273, 11139, 3234, 18, 3072, 12, 350, 80, 6323, 13, 309, 845, 30, 11139, 273, 845, 18, 1655, 12, 21, 13, 11139, 273, 283, 18, 4939, 2668, 3816, 96, 10, 5717, 2187, 11139, 13, 225, 327, 11139, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if ContentType == '6' and self.has_kepubs == False:
if ContentType == '6' and MimeType == 'Shortcover':
def update_booklist(prefix, path, title, authors, mime, date, ContentType, ImageID, readstatus): changed = False # if path_to_ext(path) in self.FORMATS: try: lpath = path.partition(self.normalize_path(prefix))[2] if lpath.startswith(os.sep): lpath = lpath[len(os.sep):] lpath = lpath.replace('\\', '/') # debug_print("LPATH: ", lpath, " - Title: " , title)
f81cd1413e030f2174ff61a9b71a66e1df1e06f0 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9125/f81cd1413e030f2174ff61a9b71a66e1df1e06f0/driver.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 67, 3618, 1098, 12, 3239, 16, 589, 16, 2077, 16, 14494, 16, 4892, 16, 1509, 16, 11691, 16, 3421, 734, 16, 855, 2327, 4672, 3550, 273, 1083, 468, 309, 589, 67, 869, 67, 408, 12, 803, 13, 316, 365, 18, 7254, 55, 30, 775, 30, 328, 803, 273, 589, 18, 10534, 12, 2890, 18, 12237, 67, 803, 12, 3239, 3719, 63, 22, 65, 309, 328, 803, 18, 17514, 1918, 12, 538, 18, 10814, 4672, 328, 803, 273, 328, 803, 63, 1897, 12, 538, 18, 10814, 4672, 65, 328, 803, 273, 328, 803, 18, 2079, 2668, 1695, 2187, 2023, 13, 468, 1198, 67, 1188, 2932, 48, 4211, 30, 3104, 328, 803, 16, 315, 225, 300, 10984, 30, 225, 315, 269, 2077, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 67, 3618, 1098, 12, 3239, 16, 589, 16, 2077, 16, 14494, 16, 4892, 16, 1509, 16, 11691, 16, 3421, 734, 16, 855, 2327, 4672, 3550, 273, 1083, 468, 309, 589, 67, 869, 67, 408, 12, 803, 13, 316, 365, 18, 7254, 55, 30, 775, 30, 328, 803, 273, 589, 18, 10534, 12, 2890, 18, 12237, 67, 803, 12, 3239, 3719, 63, 22, 65, 309, 328, 803, 18, 17514, 1918, 12, 538, 18, 10814, 4672, 328, 803, 273, 328, 803, 63, 1897, 12, 538, 18, 10814, 4672, 65, 328, 803, 273, 328, 803, 18, 2079, 2668, 1695, 2187, 2023, 13, 468, 1198, 67, 1188, 2932, 48, 4211, 30, 3104, 328, 803, 16, 315, 225, 300, 10984, 30, 225, 2 ]
items1[j] = items2[i]
l1.ll_setitem_fast(j, l2.ll_getitem_fast(i))
def ll_listsetslice(l1, slice, l2): count = l2.ll_length() assert count == slice.stop - slice.start, ( "setslice cannot resize lists in RPython") # XXX but it should be easy enough to support, soon start = slice.start j = start items1 = l1.ll_items() items2 = l2.ll_items() i = 0 while i < count: items1[j] = items2[i] i += 1 j += 1
afabe8603c579750f81fa9c16896184dfa4a53b8 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6934/afabe8603c579750f81fa9c16896184dfa4a53b8/rlist.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6579, 67, 1098, 4424, 2008, 12, 80, 21, 16, 2788, 16, 328, 22, 4672, 1056, 273, 328, 22, 18, 2906, 67, 2469, 1435, 1815, 1056, 422, 2788, 18, 5681, 300, 2788, 18, 1937, 16, 261, 315, 4424, 2008, 2780, 7041, 6035, 316, 534, 15774, 7923, 468, 11329, 1496, 518, 1410, 506, 12779, 7304, 358, 2865, 16, 17136, 787, 273, 2788, 18, 1937, 525, 273, 787, 1516, 21, 273, 328, 21, 18, 2906, 67, 3319, 1435, 1516, 22, 273, 328, 22, 18, 2906, 67, 3319, 1435, 277, 273, 374, 1323, 277, 411, 1056, 30, 328, 21, 18, 2906, 67, 542, 1726, 67, 8076, 12, 78, 16, 328, 22, 18, 2906, 67, 31571, 67, 8076, 12, 77, 3719, 277, 1011, 404, 525, 1011, 404, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6579, 67, 1098, 4424, 2008, 12, 80, 21, 16, 2788, 16, 328, 22, 4672, 1056, 273, 328, 22, 18, 2906, 67, 2469, 1435, 1815, 1056, 422, 2788, 18, 5681, 300, 2788, 18, 1937, 16, 261, 315, 4424, 2008, 2780, 7041, 6035, 316, 534, 15774, 7923, 468, 11329, 1496, 518, 1410, 506, 12779, 7304, 358, 2865, 16, 17136, 787, 273, 2788, 18, 1937, 525, 273, 787, 1516, 21, 273, 328, 21, 18, 2906, 67, 3319, 1435, 1516, 22, 273, 328, 22, 18, 2906, 67, 3319, 1435, 277, 273, 374, 1323, 277, 411, 1056, 30, 328, 21, 18, 2906, 67, 542, 1726, 67, 8076, 12, 78, 16, 328, 22, 18, 2906, 67, 31571, 67, 8076, 12, 77, 3719, 277, 1011, 2 ]
site = ceToSite[gatekeeper] procThresh = self.siteThresholds[site]["processingThreshold"] minSubmit = self.siteThresholds[site]["minimumSubmission"] test = idle - procThresh
if ceToSite.get(gatekeeper): site = ceToSite[gatekeeper] procThresh = self.siteThresholds[site]["processingThreshold"] minSubmit = self.siteThresholds[site]["minimumSubmission"] maxSubmit = self.siteThresholds[site]["maximumSubmission"] test = idle - procThresh msg="CondorMonitor Proc: Site=%s, Idle=%s, Thresh=%s, Test=%s"%(site,idle,procThresh,test) logging.debug(msg)
def __call__(self): result = [] # // # // get list of all active gatekeepers from DB info #// activeGatekeepers = [ self.allSites[x]['CEName'] for x in self.activeSites ]
74d0e5c2e0ed6081ca29c5fde17459e315e2f3ad /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/8887/74d0e5c2e0ed6081ca29c5fde17459e315e2f3ad/CondorMonitor.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 2890, 4672, 563, 273, 5378, 468, 225, 368, 468, 368, 336, 666, 434, 777, 2695, 12611, 10102, 414, 628, 2383, 1123, 468, 759, 2695, 13215, 10102, 414, 273, 306, 365, 18, 454, 17055, 63, 92, 23962, 1441, 461, 3546, 364, 619, 316, 365, 18, 3535, 17055, 308, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 2890, 4672, 563, 273, 5378, 468, 225, 368, 468, 368, 336, 666, 434, 777, 2695, 12611, 10102, 414, 628, 2383, 1123, 468, 759, 2695, 13215, 10102, 414, 273, 306, 365, 18, 454, 17055, 63, 92, 23962, 1441, 461, 3546, 364, 619, 316, 365, 18, 3535, 17055, 308, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
elif callable(item):
elif hasattr(item, "__call__"):
def _lookfor_generate_cache(module, import_modules, regenerate): """ Generate docstring cache for given module. Parameters ---------- module : str, None, module Module for which to generate docstring cache import_modules : bool Whether to import sub-modules in packages. regenerate: bool Re-generate the docstring cache Returns ------- cache : dict {obj_full_name: (docstring, kind, index), ...} Docstring cache for the module, either cached one (regenerate=False) or newly generated. """ global _lookfor_caches # Local import to speed up numpy's import time. import inspect from cStringIO import StringIO if module is None: module = "numpy" if isinstance(module, str): try: __import__(module) except ImportError: return {} module = sys.modules[module] elif isinstance(module, list) or isinstance(module, tuple): cache = {} for mod in module: cache.update(_lookfor_generate_cache(mod, import_modules, regenerate)) return cache if id(module) in _lookfor_caches and not regenerate: return _lookfor_caches[id(module)] # walk items and collect docstrings cache = {} _lookfor_caches[id(module)] = cache seen = {} index = 0 stack = [(module.__name__, module)] while stack: name, item = stack.pop(0) if id(item) in seen: continue seen[id(item)] = True index += 1 kind = "object" if inspect.ismodule(item): kind = "module" try: _all = item.__all__ except AttributeError: _all = None # import sub-packages if import_modules and hasattr(item, '__path__'): for pth in item.__path__: for mod_path in os.listdir(pth): this_py = os.path.join(pth, mod_path) init_py = os.path.join(pth, mod_path, '__init__.py') if os.path.isfile(this_py) and mod_path.endswith('.py'): to_import = mod_path[:-3] elif os.path.isfile(init_py): to_import = mod_path else: continue if to_import == '__init__': continue try: # Catch SystemExit, too base_exc = BaseException except NameError: # Python 2.4 doesn't have BaseException base_exc = Exception try: old_stdout = sys.stdout old_stderr = sys.stderr try: sys.stdout = StringIO() sys.stderr = StringIO() __import__("%s.%s" % (name, to_import)) finally: sys.stdout = old_stdout sys.stderr = old_stderr except base_exc: continue for n, v in _getmembers(item): item_name = getattr(v, '__name__', "%s.%s" % (name, n)) mod_name = getattr(v, '__module__', None) if '.' not in item_name and mod_name: item_name = "%s.%s" % (mod_name, item_name) if not item_name.startswith(name + '.'): # don't crawl foreign objects continue elif not (inspect.ismodule(v) or _all is None or n in _all): continue stack.append(("%s.%s" % (name, n), v)) elif inspect.isclass(item): kind = "class" for n, v in _getmembers(item): stack.append(("%s.%s" % (name, n), v)) elif callable(item): kind = "func" doc = inspect.getdoc(item) if doc is not None: cache[name] = (doc, kind, index) return cache
0a56dcb06b49721fa0b758c58183f580da1eb51a /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/14925/0a56dcb06b49721fa0b758c58183f580da1eb51a/utils.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 7330, 1884, 67, 7163, 67, 2493, 12, 2978, 16, 1930, 67, 6400, 16, 20821, 4672, 3536, 6654, 14525, 1247, 364, 864, 1605, 18, 225, 7012, 12181, 1605, 294, 609, 16, 599, 16, 1605, 5924, 364, 1492, 358, 2103, 14525, 1247, 1930, 67, 6400, 294, 1426, 17403, 358, 1930, 720, 17, 6400, 316, 5907, 18, 20821, 30, 1426, 868, 17, 7163, 326, 14525, 1247, 225, 2860, 18365, 1247, 294, 2065, 288, 2603, 67, 2854, 67, 529, 30, 261, 24675, 16, 3846, 16, 770, 3631, 1372, 97, 3521, 1080, 1247, 364, 326, 1605, 16, 3344, 3472, 1245, 261, 1574, 14681, 33, 8381, 13, 578, 10894, 4374, 18, 225, 3536, 2552, 389, 7330, 1884, 67, 17703, 281, 468, 3566, 1930, 358, 8632, 731, 3972, 1807, 1930, 813, 18, 1930, 5334, 628, 276, 780, 4294, 1930, 15777, 225, 309, 1605, 353, 599, 30, 1605, 273, 315, 15974, 6, 225, 309, 1549, 12, 2978, 16, 609, 4672, 775, 30, 1001, 5666, 972, 12, 2978, 13, 1335, 11308, 30, 327, 2618, 1605, 273, 2589, 18, 6400, 63, 2978, 65, 1327, 1549, 12, 2978, 16, 666, 13, 578, 1549, 12, 2978, 16, 3193, 4672, 1247, 273, 2618, 364, 681, 316, 1605, 30, 1247, 18, 2725, 24899, 7330, 1884, 67, 7163, 67, 2493, 12, 1711, 16, 1930, 67, 6400, 16, 20821, 3719, 327, 1247, 225, 309, 612, 12, 2978, 13, 316, 389, 7330, 1884, 67, 17703, 281, 471, 486, 20821, 30, 327, 389, 7330, 1884, 67, 17703, 281, 63, 350, 12, 2978, 25887, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 7330, 1884, 67, 7163, 67, 2493, 12, 2978, 16, 1930, 67, 6400, 16, 20821, 4672, 3536, 6654, 14525, 1247, 364, 864, 1605, 18, 225, 7012, 12181, 1605, 294, 609, 16, 599, 16, 1605, 5924, 364, 1492, 358, 2103, 14525, 1247, 1930, 67, 6400, 294, 1426, 17403, 358, 1930, 720, 17, 6400, 316, 5907, 18, 20821, 30, 1426, 868, 17, 7163, 326, 14525, 1247, 225, 2860, 18365, 1247, 294, 2065, 288, 2603, 67, 2854, 67, 529, 30, 261, 24675, 16, 3846, 16, 770, 3631, 1372, 97, 3521, 1080, 1247, 364, 326, 1605, 16, 3344, 3472, 1245, 261, 1574, 14681, 33, 8381, 13, 578, 10894, 4374, 18, 225, 3536, 2552, 389, 7330, 1884, 67, 17703, 281, 468, 3566, 1930, 2 ]
OUTPUT: a permutation group EXAMPLES: We explicitly construct the alternating group on four elements. ::
OUTPUT: - A permutation group. EXAMPLES: We explicitly construct the alternating group on four elements::
def __init__(self, gens=None, gap_group=None, canonicalize=True): r""" INPUT: - ``gens`` - list of generators - ``gap_group`` - a gap permutation group - ``canonicalize`` - bool (default: True), if True sort generators and remove duplicates OUTPUT: a permutation group EXAMPLES: We explicitly construct the alternating group on four elements. :: sage: A4 = PermutationGroup([[(1,2,3)],[(2,3,4)]]); A4 Permutation Group with generators [(2,3,4), (1,2,3)] sage: A4.__init__([[(1,2,3)],[(2,3,4)]]); A4 Permutation Group with generators [(2,3,4), (1,2,3)] sage: A4.center() Permutation Group with generators [()] sage: loads(A4.dumps()) == A4 True """ if (gens is None and gap_group is None): raise ValueError, "you must specify gens or gap_group"
6ac30ecf5071d4fb909072e90d2311932d8c2165 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/6ac30ecf5071d4fb909072e90d2311932d8c2165/permgroup.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 314, 773, 33, 7036, 16, 9300, 67, 1655, 33, 7036, 16, 25839, 33, 5510, 4672, 436, 8395, 12943, 30, 282, 300, 225, 12176, 23730, 10335, 300, 666, 434, 13327, 225, 300, 225, 12176, 14048, 67, 1655, 10335, 300, 279, 9300, 17440, 1041, 225, 300, 225, 12176, 18288, 554, 10335, 300, 1426, 261, 1886, 30, 1053, 3631, 309, 1053, 1524, 13327, 471, 1206, 11211, 282, 11550, 30, 225, 300, 432, 17440, 1041, 18, 225, 5675, 8900, 11386, 30, 225, 1660, 8122, 4872, 326, 6416, 1776, 1041, 603, 12792, 2186, 2866, 225, 272, 410, 30, 432, 24, 273, 13813, 9245, 1114, 3816, 63, 12, 21, 16, 22, 16, 23, 13, 6487, 63, 12, 22, 16, 23, 16, 24, 13, 13563, 1769, 432, 24, 13813, 9245, 3756, 598, 13327, 306, 12, 22, 16, 23, 16, 24, 3631, 261, 21, 16, 22, 16, 23, 25887, 272, 410, 30, 432, 24, 16186, 2738, 972, 3816, 63, 12, 21, 16, 22, 16, 23, 13, 6487, 63, 12, 22, 16, 23, 16, 24, 13, 13563, 1769, 432, 24, 13813, 9245, 3756, 598, 13327, 306, 12, 22, 16, 23, 16, 24, 3631, 261, 21, 16, 22, 16, 23, 25887, 272, 410, 30, 432, 24, 18, 5693, 1435, 13813, 9245, 3756, 598, 13327, 306, 1435, 65, 272, 410, 30, 6277, 12, 37, 24, 18, 13302, 1121, 10756, 422, 432, 24, 1053, 3536, 309, 261, 23730, 353, 599, 471, 9300, 67, 1655, 353, 599, 4672, 1002, 2068, 16, 315, 19940, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 314, 773, 33, 7036, 16, 9300, 67, 1655, 33, 7036, 16, 25839, 33, 5510, 4672, 436, 8395, 12943, 30, 282, 300, 225, 12176, 23730, 10335, 300, 666, 434, 13327, 225, 300, 225, 12176, 14048, 67, 1655, 10335, 300, 279, 9300, 17440, 1041, 225, 300, 225, 12176, 18288, 554, 10335, 300, 1426, 261, 1886, 30, 1053, 3631, 309, 1053, 1524, 13327, 471, 1206, 11211, 282, 11550, 30, 225, 300, 432, 17440, 1041, 18, 225, 5675, 8900, 11386, 30, 225, 1660, 8122, 4872, 326, 6416, 1776, 1041, 603, 12792, 2186, 2866, 225, 272, 410, 30, 432, 24, 273, 13813, 9245, 1114, 3816, 63, 12, 21, 16, 22, 16, 23, 13, 6487, 63, 12, 22, 2 ]
slave_fd = slave_open(tty_name)
def fork(): """Fork and make the child a session leader with a controlling terminal. Return (pid, master_fd).""" master_fd, tty_name = master_open() pid = os.fork() if pid == CHILD: # Establish a new session. os.setsid() # Acquire controlling terminal. slave_fd = slave_open(tty_name) os.close(master_fd) # Slave becomes stdin/stdout/stderr of child. os.dup2(slave_fd, STDIN_FILENO) os.dup2(slave_fd, STDOUT_FILENO) os.dup2(slave_fd, STDERR_FILENO) if (slave_fd > STDERR_FILENO): os.close (slave_fd) # Parent and child process. return pid, master_fd
a87d564be8a68bd3ff2121048095aeb3e46fb7d4 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/a87d564be8a68bd3ff2121048095aeb3e46fb7d4/pty.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12515, 13332, 3536, 22662, 471, 1221, 326, 1151, 279, 1339, 10302, 598, 279, 3325, 2456, 8651, 18, 2000, 261, 6610, 16, 4171, 67, 8313, 13, 12123, 4171, 67, 8313, 16, 21520, 67, 529, 273, 4171, 67, 3190, 1435, 4231, 273, 1140, 18, 23335, 1435, 309, 4231, 422, 6469, 11382, 30, 468, 17787, 23385, 279, 394, 1339, 18, 1140, 18, 4424, 350, 1435, 225, 468, 28822, 3325, 2456, 8651, 18, 11735, 67, 8313, 273, 11735, 67, 3190, 12, 5512, 67, 529, 13, 1140, 18, 4412, 12, 7525, 67, 8313, 13, 225, 468, 9708, 836, 12724, 8801, 19, 10283, 19, 11241, 434, 1151, 18, 1140, 18, 26427, 22, 12, 27352, 67, 8313, 16, 2347, 21329, 67, 3776, 3417, 13, 1140, 18, 26427, 22, 12, 27352, 67, 8313, 16, 19331, 67, 3776, 3417, 13, 1140, 18, 26427, 22, 12, 27352, 67, 8313, 16, 30155, 67, 3776, 3417, 13, 309, 261, 27352, 67, 8313, 405, 30155, 67, 3776, 3417, 4672, 1140, 18, 4412, 261, 27352, 67, 8313, 13, 225, 468, 9520, 471, 1151, 1207, 18, 327, 4231, 16, 4171, 67, 8313, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12515, 13332, 3536, 22662, 471, 1221, 326, 1151, 279, 1339, 10302, 598, 279, 3325, 2456, 8651, 18, 2000, 261, 6610, 16, 4171, 67, 8313, 13, 12123, 4171, 67, 8313, 16, 21520, 67, 529, 273, 4171, 67, 3190, 1435, 4231, 273, 1140, 18, 23335, 1435, 309, 4231, 422, 6469, 11382, 30, 468, 17787, 23385, 279, 394, 1339, 18, 1140, 18, 4424, 350, 1435, 225, 468, 28822, 3325, 2456, 8651, 18, 11735, 67, 8313, 273, 11735, 67, 3190, 12, 5512, 67, 529, 13, 1140, 18, 4412, 12, 7525, 67, 8313, 13, 225, 468, 9708, 836, 12724, 8801, 19, 10283, 19, 11241, 434, 1151, 18, 1140, 18, 26427, 22, 12, 27352, 67, 8313, 16, 2347, 21329, 67, 3776, 3417, 13, 1140, 2 ]
title='Important reports', lang='en')
title='Important reports', lang='en')
def update_countries_1(self): """ """ from Products.NaayaCore.PortletsTool.HTMLPortlet import addHTMLPortlet for x in self.countries.objectValues(METATYPE_NYCOUNTRY): addHTMLPortlet(x, id=x.get_portlet_indicators_id(), title='Key indicators', lang='en') addHTMLPortlet(x, id=x.get_portlet_reports_id(), title='Important reports', lang='en')
ffeb211164a19371c4ffa202b70c9aa9c9628d54 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3287/ffeb211164a19371c4ffa202b70c9aa9c9628d54/SEMIDESite.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 67, 22904, 67, 21, 12, 2890, 4672, 3536, 3536, 628, 8094, 87, 18, 24101, 528, 69, 4670, 18, 2617, 17307, 6364, 18, 4870, 18566, 1930, 527, 4870, 18566, 364, 619, 316, 365, 18, 22904, 18, 1612, 1972, 12, 18315, 789, 1738, 67, 50, 61, 7240, 9590, 4672, 527, 4870, 18566, 12, 92, 16, 612, 33, 92, 18, 588, 67, 655, 1810, 67, 728, 24994, 67, 350, 9334, 2077, 2218, 653, 27121, 2187, 3303, 2218, 275, 6134, 527, 4870, 18566, 12, 92, 16, 612, 33, 92, 18, 588, 67, 655, 1810, 67, 20195, 67, 350, 9334, 2077, 2218, 5010, 970, 10557, 2187, 3303, 2218, 275, 6134, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 67, 22904, 67, 21, 12, 2890, 4672, 3536, 3536, 628, 8094, 87, 18, 24101, 528, 69, 4670, 18, 2617, 17307, 6364, 18, 4870, 18566, 1930, 527, 4870, 18566, 364, 619, 316, 365, 18, 22904, 18, 1612, 1972, 12, 18315, 789, 1738, 67, 50, 61, 7240, 9590, 4672, 527, 4870, 18566, 12, 92, 16, 612, 33, 92, 18, 588, 67, 655, 1810, 67, 728, 24994, 67, 350, 9334, 2077, 2218, 653, 27121, 2187, 3303, 2218, 275, 6134, 527, 4870, 18566, 12, 92, 16, 612, 33, 92, 18, 588, 67, 655, 1810, 67, 20195, 67, 350, 9334, 2077, 2218, 5010, 970, 10557, 2187, 3303, 2218, 275, 6134, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
read_and_call(uhandle, consumer.matrix, start='Matrix')
attempt_read_and_call(uhandle, consumer.matrix, start='Matrix')
def _scan_parameters(self, uhandle, consumer): # Matrix: BLOSUM62 # Gap Penalties: Existence: 11, Extension: 1 # Number of Hits to DB: 50604 # Number of Sequences: 1323 # Number of extensions: 1526 # Number of successful extensions: 6 # Number of sequences better than 10.0: 5 # Number of HSP's better than 10.0 without gapping: 5 # Number of HSP's successfully gapped in prelim test: 0 # Number of HSP's that attempted gapping in prelim test: 1 # Number of HSP's gapped (non-prelim): 5 # length of query: 140 # length of database: 223,339 # effective HSP length: 39 # effective length of query: 101 # effective length of database: 171,742 # effective search space: 17345942 # effective search space used: 17345942 # T: 11 # A: 40 # X1: 16 ( 7.4 bits) # X2: 38 (14.8 bits) # X3: 64 (24.9 bits) # S1: 41 (21.9 bits) # S2: 42 (20.8 bits)
9cf337202ffcb7031dc68664b847a12547d05c07 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7167/9cf337202ffcb7031dc68664b847a12547d05c07/NCBIStandalone.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9871, 67, 3977, 12, 2890, 16, 582, 4110, 16, 4765, 4672, 468, 7298, 30, 605, 1502, 14020, 8898, 468, 611, 438, 453, 275, 2390, 606, 30, 22558, 802, 30, 4648, 16, 10021, 30, 404, 468, 3588, 434, 670, 1282, 358, 2383, 30, 6437, 26, 3028, 468, 3588, 434, 3265, 6570, 30, 29805, 23, 468, 3588, 434, 4418, 30, 4711, 5558, 468, 3588, 434, 6873, 4418, 30, 1666, 468, 3588, 434, 8463, 7844, 2353, 1728, 18, 20, 30, 1381, 468, 3588, 434, 670, 3118, 1807, 7844, 2353, 1728, 18, 20, 2887, 9300, 1382, 30, 1381, 468, 3588, 434, 670, 3118, 1807, 4985, 9300, 1845, 316, 675, 7091, 1842, 30, 374, 468, 3588, 434, 670, 3118, 1807, 716, 18121, 9300, 1382, 316, 675, 7091, 1842, 30, 404, 468, 3588, 434, 670, 3118, 1807, 9300, 1845, 261, 5836, 17, 1484, 7091, 4672, 1381, 468, 769, 434, 843, 30, 31907, 468, 769, 434, 2063, 30, 576, 4366, 16, 3707, 29, 468, 11448, 670, 3118, 769, 30, 16977, 468, 11448, 769, 434, 843, 30, 13822, 468, 11448, 769, 434, 2063, 30, 8043, 21, 16, 5608, 22, 468, 11448, 1623, 3476, 30, 8043, 5026, 6162, 9452, 468, 11448, 1623, 3476, 1399, 30, 8043, 5026, 6162, 9452, 468, 399, 30, 4648, 468, 432, 30, 8063, 468, 1139, 21, 30, 2872, 261, 2371, 18, 24, 4125, 13, 468, 1139, 22, 30, 18012, 261, 3461, 18, 28, 4125, 13, 468, 1139, 23, 30, 5178, 261, 3247, 18, 29, 4125, 13, 468, 348, 21, 30, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9871, 67, 3977, 12, 2890, 16, 582, 4110, 16, 4765, 4672, 468, 7298, 30, 605, 1502, 14020, 8898, 468, 611, 438, 453, 275, 2390, 606, 30, 22558, 802, 30, 4648, 16, 10021, 30, 404, 468, 3588, 434, 670, 1282, 358, 2383, 30, 6437, 26, 3028, 468, 3588, 434, 3265, 6570, 30, 29805, 23, 468, 3588, 434, 4418, 30, 4711, 5558, 468, 3588, 434, 6873, 4418, 30, 1666, 468, 3588, 434, 8463, 7844, 2353, 1728, 18, 20, 30, 1381, 468, 3588, 434, 670, 3118, 1807, 7844, 2353, 1728, 18, 20, 2887, 9300, 1382, 30, 1381, 468, 3588, 434, 670, 3118, 1807, 4985, 9300, 1845, 316, 675, 7091, 1842, 30, 374, 468, 3588, 434, 670, 3118, 1807, 716, 18121, 2 ]
return HttpClient._prepare_connection(self, url, headers) else: proxy = os.environ.get('http_proxy') if proxy:
def _prepare_connection(self, url, headers): proxy_auth = _get_proxy_auth(url.protocol) if url.protocol == 'https': # destination is https proxy = os.environ.get('https_proxy') if proxy: # Set any proxy auth headers if proxy_auth: proxy_auth = 'Proxy-authorization: %s' % proxy_auth # Construct the proxy connect command. port = url.port if not port: port = '443' proxy_connect = 'CONNECT %s:%s HTTP/1.0\r\n' % (url.host, port) # Set the user agent to send to the proxy if headers and 'User-Agent' in headers: user_agent = 'User-Agent: %s\r\n' % (headers['User-Agent']) else: user_agent = '' proxy_pieces = '%s%s%s\r\n' % (proxy_connect, proxy_auth, user_agent) # Find the proxy host and port. proxy_url = atom.url.parse_url(proxy) if not proxy_url.port: proxy_url.port = '80' # Connect to the proxy server, very simple recv and error checking p_sock = socket.socket(socket.AF_INET,socket.SOCK_STREAM) p_sock.connect((proxy_url.host, int(proxy_url.port))) p_sock.sendall(proxy_pieces) response = ''
fd7144c02bd0a385dbf6cd8b54d685ceef911565 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6580/fd7144c02bd0a385dbf6cd8b54d685ceef911565/http.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9366, 67, 4071, 12, 2890, 16, 880, 16, 1607, 4672, 2889, 67, 1944, 273, 389, 588, 67, 5656, 67, 1944, 12, 718, 18, 8373, 13, 309, 880, 18, 8373, 422, 296, 4528, 4278, 468, 2929, 353, 2333, 2889, 273, 1140, 18, 28684, 18, 588, 2668, 4528, 67, 5656, 6134, 309, 2889, 30, 468, 1000, 1281, 2889, 1357, 1607, 309, 2889, 67, 1944, 30, 2889, 67, 1944, 273, 296, 3886, 17, 12218, 30, 738, 87, 11, 738, 2889, 67, 1944, 225, 468, 14291, 326, 2889, 3077, 1296, 18, 1756, 273, 880, 18, 655, 309, 486, 1756, 30, 1756, 273, 296, 6334, 23, 11, 2889, 67, 3612, 273, 296, 11032, 738, 87, 5319, 87, 2239, 19, 21, 18, 20, 64, 86, 64, 82, 11, 738, 261, 718, 18, 2564, 16, 1756, 13, 225, 468, 1000, 326, 729, 4040, 358, 1366, 358, 326, 2889, 309, 1607, 471, 296, 1299, 17, 3630, 11, 316, 1607, 30, 729, 67, 5629, 273, 296, 1299, 17, 3630, 30, 738, 87, 64, 86, 64, 82, 11, 738, 261, 2485, 3292, 1299, 17, 3630, 19486, 469, 30, 729, 67, 5629, 273, 875, 225, 2889, 67, 31016, 273, 1995, 87, 9, 87, 9, 87, 64, 86, 64, 82, 11, 738, 261, 5656, 67, 3612, 16, 2889, 67, 1944, 16, 729, 67, 5629, 13, 225, 468, 4163, 326, 2889, 1479, 471, 1756, 18, 2889, 67, 718, 273, 3179, 18, 718, 18, 2670, 67, 718, 12, 5656, 13, 309, 486, 2889, 67, 718, 18, 655, 30, 2889, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9366, 67, 4071, 12, 2890, 16, 880, 16, 1607, 4672, 2889, 67, 1944, 273, 389, 588, 67, 5656, 67, 1944, 12, 718, 18, 8373, 13, 309, 880, 18, 8373, 422, 296, 4528, 4278, 468, 2929, 353, 2333, 2889, 273, 1140, 18, 28684, 18, 588, 2668, 4528, 67, 5656, 6134, 309, 2889, 30, 468, 1000, 1281, 2889, 1357, 1607, 309, 2889, 67, 1944, 30, 2889, 67, 1944, 273, 296, 3886, 17, 12218, 30, 738, 87, 11, 738, 2889, 67, 1944, 225, 468, 14291, 326, 2889, 3077, 1296, 18, 1756, 273, 880, 18, 655, 309, 486, 1756, 30, 1756, 273, 296, 6334, 23, 11, 2889, 67, 3612, 273, 296, 11032, 738, 87, 5319, 87, 2239, 19, 21, 18, 20, 2 ]
result = rslt result = [u""]
def serializeNode(node, opts, rslt, enableBreaks=False, enableVerbose=False): global indent global result global pretty global verbose global breaks global afterLine global afterBreak global afterDoc global afterDivider global afterArea global options result = rslt
66942a31e30537eb739b144d8b46c3b613b2076a /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/5718/66942a31e30537eb739b144d8b46c3b613b2076a/Packer.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4472, 907, 12, 2159, 16, 1500, 16, 22841, 16, 4237, 26806, 33, 8381, 16, 4237, 14489, 33, 8381, 4672, 2552, 3504, 2552, 563, 2552, 7517, 2552, 3988, 2552, 16217, 2552, 1839, 1670, 2552, 1839, 7634, 2552, 1839, 1759, 2552, 1839, 25558, 2552, 1839, 5484, 2552, 702, 225, 563, 273, 22841, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4472, 907, 12, 2159, 16, 1500, 16, 22841, 16, 4237, 26806, 33, 8381, 16, 4237, 14489, 33, 8381, 4672, 2552, 3504, 2552, 563, 2552, 7517, 2552, 3988, 2552, 16217, 2552, 1839, 1670, 2552, 1839, 7634, 2552, 1839, 1759, 2552, 1839, 25558, 2552, 1839, 5484, 2552, 702, 225, 563, 273, 22841, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.lock()
lock = self.lock()
def undo(self): self.lock() if os.path.exists(self.join("undo")): f = self.changelog.read(self.changelog.tip())[3] self.ui.status("attempting to rollback last transaction\n") rollback(self.opener, self.join("undo")) self.manifest = manifest(self.opener) self.changelog = changelog(self.opener)
ba524319b7370bd5822ee0eab512f9e6b957ce45 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11312/ba524319b7370bd5822ee0eab512f9e6b957ce45/hg.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 15436, 12, 2890, 4672, 2176, 273, 365, 18, 739, 1435, 309, 1140, 18, 803, 18, 1808, 12, 2890, 18, 5701, 2932, 31226, 6, 3719, 30, 284, 273, 365, 18, 24083, 12970, 18, 896, 12, 2890, 18, 24083, 12970, 18, 14587, 10756, 63, 23, 65, 365, 18, 4881, 18, 2327, 2932, 11764, 310, 358, 8006, 1142, 2492, 64, 82, 7923, 8006, 12, 2890, 18, 25098, 16, 365, 18, 5701, 2932, 31226, 6, 3719, 365, 18, 14357, 273, 5643, 12, 2890, 18, 25098, 13, 365, 18, 24083, 12970, 273, 21182, 12, 2890, 18, 25098, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 15436, 12, 2890, 4672, 2176, 273, 365, 18, 739, 1435, 309, 1140, 18, 803, 18, 1808, 12, 2890, 18, 5701, 2932, 31226, 6, 3719, 30, 284, 273, 365, 18, 24083, 12970, 18, 896, 12, 2890, 18, 24083, 12970, 18, 14587, 10756, 63, 23, 65, 365, 18, 4881, 18, 2327, 2932, 11764, 310, 358, 8006, 1142, 2492, 64, 82, 7923, 8006, 12, 2890, 18, 25098, 16, 365, 18, 5701, 2932, 31226, 6, 3719, 365, 18, 14357, 273, 5643, 12, 2890, 18, 25098, 13, 365, 18, 24083, 12970, 273, 21182, 12, 2890, 18, 25098, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
execf2 = ctx2.parents()[0].manifest().copy().execf
mc = ctx2.parents()[0].manifest().copy() execf2 = mc.execf linkf2 = mc.linkf
def getfilectx(f, ctx): flctx = ctx.filectx(f, filelog=flcache.get(f)) if f not in flcache: flcache[f] = flctx._filelog return flctx
bc2dbf91424b73253110ff9f2e7af369f2995f54 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/11312/bc2dbf91424b73253110ff9f2e7af369f2995f54/patch.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 768, 5900, 12, 74, 16, 1103, 4672, 1183, 5900, 273, 1103, 18, 768, 5900, 12, 74, 16, 661, 12970, 33, 2242, 2493, 18, 588, 12, 74, 3719, 309, 284, 486, 316, 1183, 2493, 30, 1183, 2493, 63, 74, 65, 273, 1183, 5900, 6315, 7540, 12970, 327, 1183, 5900, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 768, 5900, 12, 74, 16, 1103, 4672, 1183, 5900, 273, 1103, 18, 768, 5900, 12, 74, 16, 661, 12970, 33, 2242, 2493, 18, 588, 12, 74, 3719, 309, 284, 486, 316, 1183, 2493, 30, 1183, 2493, 63, 74, 65, 273, 1183, 5900, 6315, 7540, 12970, 327, 1183, 5900, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return s.split(NUL, 1)[0]
return s.rstrip(NUL)
def nts(s): """Convert a null-terminated string buffer to a python string. """ return s.split(NUL, 1)[0]
e8f9a44295dbacb3f8b8da19833f8d4d452115fb /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/e8f9a44295dbacb3f8b8da19833f8d4d452115fb/tarfile.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 290, 3428, 12, 87, 4672, 3536, 2723, 279, 446, 17, 29133, 533, 1613, 358, 279, 5790, 533, 18, 3536, 327, 272, 18, 86, 6406, 12, 50, 1506, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 290, 3428, 12, 87, 4672, 3536, 2723, 279, 446, 17, 29133, 533, 1613, 358, 279, 5790, 533, 18, 3536, 327, 272, 18, 86, 6406, 12, 50, 1506, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return ret
return ret
def xorstr( a, b ): if len(a) != len(b): raise "xorstr(): lengths differ" ret = '' for i in range(len(a)): ret += chr(ord(a[i]) ^ ord(b[i])) return ret
adc8746dabba5a5936767cddc028f6c33b858a4c /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9228/adc8746dabba5a5936767cddc028f6c33b858a4c/pbkdf2.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 17586, 701, 12, 279, 16, 324, 262, 30, 309, 562, 12, 69, 13, 480, 562, 12, 70, 4672, 1002, 315, 31346, 701, 13332, 10917, 15221, 6, 225, 325, 273, 875, 364, 277, 316, 1048, 12, 1897, 12, 69, 3719, 30, 325, 1011, 4513, 12, 517, 12, 69, 63, 77, 5717, 3602, 4642, 12, 70, 63, 77, 22643, 225, 327, 325, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 17586, 701, 12, 279, 16, 324, 262, 30, 309, 562, 12, 69, 13, 480, 562, 12, 70, 4672, 1002, 315, 31346, 701, 13332, 10917, 15221, 6, 225, 325, 273, 875, 364, 277, 316, 1048, 12, 1897, 12, 69, 3719, 30, 325, 1011, 4513, 12, 517, 12, 69, 63, 77, 5717, 3602, 4642, 12, 70, 63, 77, 22643, 225, 327, 325, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
3) set evt to true to let the parent know we're done
3) [optional] if test_done is not None, it's an event; wait for parent to set test_done before closing connection 4) set evt to true to let the parent know we're done
def server(evt, serv, dataq=None): """ Open a tcp server in three steps 1) set evt to true to let the parent know we are ready 2) [optional] if is not False, write the list of data from dataq.get() to the socket. 3) set evt to true to let the parent know we're done """ serv.listen(5) evt.set() try: conn, addr = serv.accept() if dataq: data = b'' new_data = dataq.get(True, 0.5) dataq.task_done() for item in new_data: if item == EOF_sigil: break if type(item) in [int, float]: time.sleep(item) else: data += item written = conn.send(data) data = data[written:] except socket.timeout: pass finally: serv.close() evt.set()
23454cc9b95762fba5574ff1889a3486a73001d3 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12029/23454cc9b95762fba5574ff1889a3486a73001d3/test_telnetlib.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1438, 12, 73, 11734, 16, 13515, 16, 501, 85, 33, 7036, 4672, 3536, 3502, 279, 9658, 1438, 316, 8925, 6075, 404, 13, 444, 6324, 358, 638, 358, 2231, 326, 982, 5055, 732, 854, 5695, 576, 13, 306, 10444, 65, 309, 353, 486, 1083, 16, 1045, 326, 666, 434, 501, 628, 501, 85, 18, 588, 1435, 358, 326, 2987, 18, 890, 13, 306, 10444, 65, 309, 1842, 67, 8734, 353, 486, 599, 16, 518, 1807, 392, 871, 31, 225, 2529, 364, 982, 358, 444, 1842, 67, 8734, 1865, 7647, 1459, 1059, 13, 444, 6324, 358, 638, 358, 2231, 326, 982, 5055, 732, 4565, 2731, 3536, 13515, 18, 18085, 12, 25, 13, 6324, 18, 542, 1435, 775, 30, 1487, 16, 3091, 273, 13515, 18, 9436, 1435, 309, 501, 85, 30, 501, 273, 324, 6309, 394, 67, 892, 273, 501, 85, 18, 588, 12, 5510, 16, 374, 18, 25, 13, 501, 85, 18, 4146, 67, 8734, 1435, 364, 761, 316, 394, 67, 892, 30, 309, 761, 422, 6431, 67, 7340, 330, 30, 898, 309, 618, 12, 1726, 13, 316, 306, 474, 16, 1431, 14542, 813, 18, 19607, 12, 1726, 13, 469, 30, 501, 1011, 761, 5941, 273, 1487, 18, 4661, 12, 892, 13, 501, 273, 501, 63, 9748, 26894, 1335, 2987, 18, 4538, 30, 1342, 3095, 30, 13515, 18, 4412, 1435, 6324, 18, 542, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1438, 12, 73, 11734, 16, 13515, 16, 501, 85, 33, 7036, 4672, 3536, 3502, 279, 9658, 1438, 316, 8925, 6075, 404, 13, 444, 6324, 358, 638, 358, 2231, 326, 982, 5055, 732, 854, 5695, 576, 13, 306, 10444, 65, 309, 353, 486, 1083, 16, 1045, 326, 666, 434, 501, 628, 501, 85, 18, 588, 1435, 358, 326, 2987, 18, 890, 13, 306, 10444, 65, 309, 1842, 67, 8734, 353, 486, 599, 16, 518, 1807, 392, 871, 31, 225, 2529, 364, 982, 358, 444, 1842, 67, 8734, 1865, 7647, 1459, 1059, 13, 444, 6324, 358, 638, 358, 2231, 326, 982, 5055, 732, 4565, 2731, 3536, 13515, 18, 18085, 12, 25, 13, 6324, 18, 542, 1435, 775, 30, 1487, 16, 2 ]
return val, _quote( dumps(val) )
return val, _quote( dumps(val).decode('latin-1') )
def value_encode(self, val): return val, _quote( dumps(val) )
f167a8efcc6ffae538e8e5550307d5bebb4c4a27 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/8125/f167a8efcc6ffae538e8e5550307d5bebb4c4a27/Cookie.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 460, 67, 3015, 12, 2890, 16, 1244, 4672, 327, 1244, 16, 389, 6889, 12, 6711, 12, 1125, 13, 262, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 460, 67, 3015, 12, 2890, 16, 1244, 4672, 327, 1244, 16, 389, 6889, 12, 6711, 12, 1125, 13, 262, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
shuffled_records[ns] = list(test_records)
shuffled_records[ns.ip] = list(test_records)
def _SingleTestRun(self, test_records): """Manage and execute a single test-run on all nameservers.
2c42206e842762b2e00f9dd574e3b673ee0d2469 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/4170/2c42206e842762b2e00f9dd574e3b673ee0d2469/benchmark.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5281, 4709, 1997, 12, 2890, 16, 1842, 67, 7094, 4672, 3536, 21258, 471, 1836, 279, 2202, 1842, 17, 2681, 603, 777, 1257, 29638, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5281, 4709, 1997, 12, 2890, 16, 1842, 67, 7094, 4672, 3536, 21258, 471, 1836, 279, 2202, 1842, 17, 2681, 603, 777, 1257, 29638, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
setup(name = 'spytify', version = 'v0.1', description = 'spytify - Python bindings for libdespotify', author = 'Jørgen Pedersen Tjernø', author_email = 'jorgen@devsoft.no', license = 'New BSD (3-clause BSD)', ext_modules = [Extension('spytify', ['src/callback.c', 'src/spytify.c'], **pkgconfig('despotify'))] )
password = getpass("Enter your password: ").strip() if not password: print >>sys.stderr, "Empty password, exiting." sys.exit(1)
def pkgconfig(*packages, **kw): flag_map = {'-I': 'include_dirs', '-L': 'library_dirs', '-l': 'libraries'} for token in commands.getoutput("pkg-config --libs --cflags %s" % ' '.join(packages)).split(): if flag_map.has_key(token[:2]): kw.setdefault(flag_map.get(token[:2]), []).append(token[2:]) else: # throw others to extra_link_args kw.setdefault('extra_link_args', []).append(token) for k, v in kw.iteritems(): # remove duplicated kw[k] = list(set(v)) return kw
08f7ab0787e7ae694c61e83d1ae8f19e5442d37c /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11577/08f7ab0787e7ae694c61e83d1ae8f19e5442d37c/test.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3475, 1425, 30857, 10308, 16, 2826, 9987, 4672, 2982, 67, 1458, 273, 13666, 17, 45, 4278, 296, 6702, 67, 8291, 2187, 2400, 48, 4278, 296, 12083, 67, 8291, 2187, 2400, 80, 4278, 296, 31417, 11, 97, 225, 364, 1147, 316, 4364, 18, 588, 2844, 2932, 10657, 17, 1425, 1493, 21571, 1493, 71, 7133, 738, 87, 6, 738, 296, 2418, 5701, 12, 10308, 13, 2934, 4939, 13332, 309, 2982, 67, 1458, 18, 5332, 67, 856, 12, 2316, 10531, 22, 65, 4672, 5323, 18, 542, 1886, 12, 6420, 67, 1458, 18, 588, 12, 2316, 10531, 22, 65, 3631, 5378, 2934, 6923, 12, 2316, 63, 22, 30, 5717, 469, 30, 468, 604, 10654, 358, 2870, 67, 1232, 67, 1968, 5323, 18, 542, 1886, 2668, 7763, 67, 1232, 67, 1968, 2187, 5378, 2934, 6923, 12, 2316, 13, 225, 364, 417, 16, 331, 316, 5323, 18, 2165, 3319, 13332, 468, 1206, 16975, 5323, 63, 79, 65, 273, 666, 12, 542, 12, 90, 3719, 225, 327, 5323, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3475, 1425, 30857, 10308, 16, 2826, 9987, 4672, 2982, 67, 1458, 273, 13666, 17, 45, 4278, 296, 6702, 67, 8291, 2187, 2400, 48, 4278, 296, 12083, 67, 8291, 2187, 2400, 80, 4278, 296, 31417, 11, 97, 225, 364, 1147, 316, 4364, 18, 588, 2844, 2932, 10657, 17, 1425, 1493, 21571, 1493, 71, 7133, 738, 87, 6, 738, 296, 2418, 5701, 12, 10308, 13, 2934, 4939, 13332, 309, 2982, 67, 1458, 18, 5332, 67, 856, 12, 2316, 10531, 22, 65, 4672, 5323, 18, 542, 1886, 12, 6420, 67, 1458, 18, 588, 12, 2316, 10531, 22, 65, 3631, 5378, 2934, 6923, 12, 2316, 63, 22, 30, 5717, 469, 30, 468, 604, 10654, 358, 2870, 67, 1232, 67, 1968, 5323, 18, 2 ]
list of pairs (root, multiplicity)
list of pairs (root, multiplicity) or list of roots
def roots(self, x=None, explicit_solutions=True): r""" Returns roots of \code{self} that can be found exactly, with multiplicities. Not all root are guaranteed to be found.
d471d8ec9f13193e3daf6f31409fcd9fa17d1fcb /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/d471d8ec9f13193e3daf6f31409fcd9fa17d1fcb/calculus.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12876, 12, 2890, 16, 619, 33, 7036, 16, 5515, 67, 18281, 6170, 33, 5510, 4672, 436, 8395, 2860, 12876, 434, 521, 710, 95, 2890, 97, 716, 848, 506, 1392, 8950, 16, 598, 3309, 1780, 1961, 18, 225, 2288, 777, 1365, 854, 15403, 358, 506, 1392, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12876, 12, 2890, 16, 619, 33, 7036, 16, 5515, 67, 18281, 6170, 33, 5510, 4672, 436, 8395, 2860, 12876, 434, 521, 710, 95, 2890, 97, 716, 848, 506, 1392, 8950, 16, 598, 3309, 1780, 1961, 18, 225, 2288, 777, 1365, 854, 15403, 358, 506, 1392, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
pdict['Package'].append(pkgname)
pdict['Package'].add(pkgname)
def __init__(self, data, pdict, parent=None): # copy local attributes to all child nodes if no local attribute exists if not pdict.has_key('Package'): pdict['Package'] = pdlist() for child in data.getchildren(): for attr in [key for key in data.attrib.keys() \ if key != 'name' and not child.attrib.has_key(key)]: try: child.set(attr, data.get(attr)) except: # don't fail on things like comments and other immutable elements pass Bcfg2.Server.Plugin.INode.__init__(self, data, pdict, parent) if not self.contents.has_key('Package'): self.contents['Package'] = FuzzyDict() for pkg in data.findall('./Package'): if pkg.attrib.has_key('name') and pkg.get('name') not in pdict['Package']: pdict['Package'].add(pkg.get('name')) if pkg.get('name') != None: self.contents['Package'][pkg.get('name')] = {} if pkg.getchildren(): self.contents['Package'][pkg.get('name')]['__children__'] \ = pkg.getchildren() if pkg.attrib.has_key('simplefile'): pkg.set('url', "%s/%s" % (pkg.get('uri'), pkg.get('simplefile'))) self.contents['Package'][pkg.get('name')].update(pkg.attrib) else: if pkg.attrib.has_key('file'): if pkg.attrib.has_key('multiarch'): archs = pkg.get('multiarch').split() srcs = pkg.get('srcs', pkg.get('multiarch')).split() url = ' '.join(["%s/%s" % (pkg.get('uri'), pkg.get('file') % {'src':srcs[idx], 'arch':archs[idx]}) for idx in range(len(archs))]) pkg.set('url', url) else: pkg.set('url', '%s/%s' % (pkg.get('uri'), pkg.get('file'))) if self.splitters.has_key(pkg.get('type')) and pkg.get('file') != None: mdata = self.splitters[pkg.get('type')].match(pkg.get('file')) if not mdata: logger.error("Failed to match pkg %s" % pkg.get('file')) continue pkgname = mdata.group('name') self.contents['Package'][pkgname] = mdata.groupdict() self.contents['Package'][pkgname].update(pkg.attrib) if pkg.attrib.get('file'): self.contents['Package'][pkgname]['url'] = pkg.get('url') self.contents['Package'][pkgname]['type'] = pkg.get('type') if pkg.get('verify'): self.contents['Package'][pkgname]['verify'] = pkg.get('verify') if pkg.get('multiarch'): self.contents['Package'][pkgname]['multiarch'] = pkg.get('multiarch') if pkgname not in pdict['Package']: pdict['Package'].append(pkgname) if pkg.getchildren(): self.contents['Package'][pkgname]['__children__'] = pkg.getchildren() else: self.contents['Package'][pkg.get('name')].update(pkg.attrib)
abf79b249aab9e343f51dea9c9f6b2ec0676060b /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11867/abf79b249aab9e343f51dea9c9f6b2ec0676060b/Pkgmgr.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 501, 16, 293, 1576, 16, 982, 33, 7036, 4672, 468, 1610, 1191, 1677, 358, 777, 1151, 2199, 309, 1158, 1191, 1566, 1704, 309, 486, 293, 1576, 18, 5332, 67, 856, 2668, 2261, 11, 4672, 293, 1576, 3292, 2261, 3546, 273, 4863, 1098, 1435, 364, 1151, 316, 501, 18, 588, 5906, 13332, 364, 1604, 316, 306, 856, 364, 498, 316, 501, 18, 14588, 18, 2452, 1435, 521, 309, 498, 480, 296, 529, 11, 471, 486, 1151, 18, 14588, 18, 5332, 67, 856, 12, 856, 13, 14542, 775, 30, 1151, 18, 542, 12, 1747, 16, 501, 18, 588, 12, 1747, 3719, 1335, 30, 468, 2727, 1404, 2321, 603, 9198, 3007, 5678, 471, 1308, 11732, 2186, 1342, 605, 7066, 22, 18, 2081, 18, 3773, 18, 23184, 16186, 2738, 972, 12, 2890, 16, 501, 16, 293, 1576, 16, 982, 13, 309, 486, 365, 18, 3980, 18, 5332, 67, 856, 2668, 2261, 11, 4672, 365, 18, 3980, 3292, 2261, 3546, 273, 478, 13903, 5014, 1435, 364, 3475, 316, 501, 18, 4720, 454, 2668, 18, 19, 2261, 11, 4672, 309, 3475, 18, 14588, 18, 5332, 67, 856, 2668, 529, 6134, 471, 3475, 18, 588, 2668, 529, 6134, 486, 316, 293, 1576, 3292, 2261, 3546, 30, 293, 1576, 3292, 2261, 29489, 1289, 12, 10657, 18, 588, 2668, 529, 26112, 309, 3475, 18, 588, 2668, 529, 6134, 480, 599, 30, 365, 18, 3980, 3292, 2261, 3546, 63, 10657, 18, 588, 2668, 529, 6134, 65, 273, 2618, 309, 3475, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 501, 16, 293, 1576, 16, 982, 33, 7036, 4672, 468, 1610, 1191, 1677, 358, 777, 1151, 2199, 309, 1158, 1191, 1566, 1704, 309, 486, 293, 1576, 18, 5332, 67, 856, 2668, 2261, 11, 4672, 293, 1576, 3292, 2261, 3546, 273, 4863, 1098, 1435, 364, 1151, 316, 501, 18, 588, 5906, 13332, 364, 1604, 316, 306, 856, 364, 498, 316, 501, 18, 14588, 18, 2452, 1435, 521, 309, 498, 480, 296, 529, 11, 471, 486, 1151, 18, 14588, 18, 5332, 67, 856, 12, 856, 13, 14542, 775, 30, 1151, 18, 542, 12, 1747, 16, 501, 18, 588, 12, 1747, 3719, 1335, 30, 468, 2727, 1404, 2321, 603, 9198, 3007, 5678, 471, 1308, 11732, 2 ]
w("\t\tmainGroup = %s;\n" % self.mainGroup)
w("\t\tprojectRoot=\"\";\n")
def writePBXProject(self): w = self.file.write w("/* Begin PBXProject section */\n") w("\t%s /* Project object */ = {\n" % self.projectID) w("\t\tisa = PBXProject;\n") w("\t\tcompatibilityVersion = \"%s\";\n" % self.version[0]) w("\t\tbuildConfigurationList = %s;\n" % self.buildSettingsId[0]) w("\t\thasScannedForEncodings = 1;\n") w("\t\tprojectDirPath=\"\";\n") w("\t\tmainGroup = %s;\n" % self.mainGroup) w("\t\ttargets = (\n") for d in self.projects: if d.type in ['game', 'tool']: w("\t\t\t%s,\n" % d.targetId) for d in self.projects: if d.type in ['library', 'static_library', 'plugin']: w("\t\t\t%s,\n" % d.targetId) w("\t\t);\n") w("\t};\n") w("/* End PBXProject section */\n\n")
c73f2456ec51b2b4797d870c08f234ed68da574a /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7302/c73f2456ec51b2b4797d870c08f234ed68da574a/xcode.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 20724, 60, 4109, 12, 2890, 4672, 341, 273, 365, 18, 768, 18, 2626, 341, 2932, 20308, 14323, 20819, 60, 4109, 2442, 1195, 64, 82, 7923, 341, 31458, 88, 9, 87, 1748, 5420, 733, 1195, 273, 18890, 82, 6, 738, 365, 18, 4406, 734, 13, 341, 31458, 88, 64, 88, 291, 69, 273, 20819, 60, 4109, 9747, 82, 7923, 341, 31458, 88, 64, 88, 27303, 1444, 273, 22049, 87, 2412, 9747, 82, 6, 738, 365, 18, 1589, 63, 20, 5717, 341, 31458, 88, 64, 88, 3510, 1750, 682, 273, 738, 87, 9747, 82, 6, 738, 365, 18, 3510, 2628, 548, 63, 20, 5717, 341, 31458, 88, 64, 451, 345, 1541, 10041, 1290, 25100, 899, 273, 404, 9747, 82, 7923, 341, 31458, 88, 64, 88, 4406, 20129, 5189, 2412, 9747, 82, 7923, 341, 31458, 88, 64, 88, 4406, 2375, 5189, 2412, 9747, 82, 7923, 341, 31458, 88, 64, 748, 826, 87, 273, 17938, 82, 7923, 364, 302, 316, 365, 18, 13582, 30, 309, 302, 18, 723, 316, 10228, 13957, 2187, 296, 6738, 3546, 30, 341, 31458, 88, 64, 88, 64, 88, 9, 87, 17211, 82, 6, 738, 302, 18, 3299, 548, 13, 364, 302, 316, 365, 18, 13582, 30, 309, 302, 18, 723, 316, 10228, 12083, 2187, 296, 3845, 67, 12083, 2187, 296, 4094, 3546, 30, 341, 31458, 88, 64, 88, 64, 88, 9, 87, 17211, 82, 6, 738, 302, 18, 3299, 548, 13, 341, 31458, 88, 64, 88, 20472, 82, 7923, 341, 31458, 88, 97, 9747, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 20724, 60, 4109, 12, 2890, 4672, 341, 273, 365, 18, 768, 18, 2626, 341, 2932, 20308, 14323, 20819, 60, 4109, 2442, 1195, 64, 82, 7923, 341, 31458, 88, 9, 87, 1748, 5420, 733, 1195, 273, 18890, 82, 6, 738, 365, 18, 4406, 734, 13, 341, 31458, 88, 64, 88, 291, 69, 273, 20819, 60, 4109, 9747, 82, 7923, 341, 31458, 88, 64, 88, 27303, 1444, 273, 22049, 87, 2412, 9747, 82, 6, 738, 365, 18, 1589, 63, 20, 5717, 341, 31458, 88, 64, 88, 3510, 1750, 682, 273, 738, 87, 9747, 82, 6, 738, 365, 18, 3510, 2628, 548, 63, 20, 5717, 341, 31458, 88, 64, 451, 345, 1541, 10041, 1290, 25100, 899, 273, 404, 9747, 82, 2 ]
testdir=None, huntrleaks=False):
testdir=None, huntrleaks=False, debug=False):
def runtest_inner(test, generate, verbose, quiet, testdir=None, huntrleaks=False): test_support.unload(test) if not testdir: testdir = findtestdir() outputdir = os.path.join(testdir, "output") outputfile = os.path.join(outputdir, test) if verbose: cfp = None else: cfp = cStringIO.StringIO() try: save_stdout = sys.stdout try: if cfp: sys.stdout = cfp print(test) # Output file starts with test name if test.startswith('test.'): abstest = test else: # Always import it from the test package abstest = 'test.' + test the_package = __import__(abstest, globals(), locals(), []) the_module = getattr(the_package, test) # Most tests run to completion simply as a side-effect of # being imported. For the benefit of tests that can't run # that way (like test_threaded_import), explicitly invoke # their test_main() function (if it exists). indirect_test = getattr(the_module, "test_main", None) if indirect_test is not None: indirect_test() if huntrleaks: dash_R(the_module, test, indirect_test, huntrleaks) finally: sys.stdout = save_stdout except test_support.ResourceDenied as msg: if not quiet: print(test, "skipped --", msg) sys.stdout.flush() return -2 except (ImportError, test_support.TestSkipped) as msg: if not quiet: print(test, "skipped --", msg) sys.stdout.flush() return -1 except KeyboardInterrupt: raise except test_support.TestFailed as msg: print("test", test, "failed --", msg) sys.stdout.flush() return 0 except: type, value = sys.exc_info()[:2] print("test", test, "crashed --", str(type) + ":", value) sys.stdout.flush() if verbose: traceback.print_exc(file=sys.stdout) sys.stdout.flush() return 0 else: if not cfp: return 1 output = cfp.getvalue() if generate: if output == test + "\n": if os.path.exists(outputfile): # Write it since it already exists (and the contents # may have changed), but let the user know it isn't # needed: print("output file", outputfile, \ "is no longer needed; consider removing it") else: # We don't need it, so don't create it. return 1 fp = open(outputfile, "w") fp.write(output) fp.close() return 1 if os.path.exists(outputfile): fp = open(outputfile, "r") expected = fp.read() fp.close() else: expected = test + "\n" if output == expected or huntrleaks: return 1 print("test", test, "produced unexpected output:") sys.stdout.flush() reportdiff(expected, output) sys.stdout.flush() return 0
b3e3fca047db11e5db0b95c81653d8a87054ce65 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12029/b3e3fca047db11e5db0b95c81653d8a87054ce65/regrtest.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 3813, 67, 7872, 12, 3813, 16, 2103, 16, 3988, 16, 10902, 16, 1842, 1214, 33, 7036, 16, 366, 318, 313, 298, 581, 87, 33, 8381, 16, 1198, 33, 8381, 4672, 1842, 67, 13261, 18, 318, 945, 12, 3813, 13, 309, 486, 1842, 1214, 30, 1842, 1214, 273, 1104, 3813, 1214, 1435, 876, 1214, 273, 1140, 18, 803, 18, 5701, 12, 3813, 1214, 16, 315, 2844, 7923, 876, 768, 273, 1140, 18, 803, 18, 5701, 12, 2844, 1214, 16, 1842, 13, 309, 3988, 30, 6080, 84, 273, 599, 469, 30, 6080, 84, 273, 276, 780, 4294, 18, 780, 4294, 1435, 225, 775, 30, 1923, 67, 10283, 273, 2589, 18, 10283, 775, 30, 309, 6080, 84, 30, 2589, 18, 10283, 273, 6080, 84, 1172, 12, 3813, 13, 2868, 468, 3633, 585, 2542, 598, 1842, 508, 309, 1842, 18, 17514, 1918, 2668, 3813, 1093, 4672, 1223, 334, 395, 273, 1842, 469, 30, 468, 14178, 1930, 518, 628, 326, 1842, 2181, 1223, 334, 395, 273, 296, 3813, 1093, 397, 1842, 326, 67, 5610, 273, 1001, 5666, 972, 12, 378, 334, 395, 16, 10941, 9334, 8985, 9334, 5378, 13, 326, 67, 2978, 273, 3869, 12, 5787, 67, 5610, 16, 1842, 13, 468, 22099, 7434, 1086, 358, 8364, 8616, 487, 279, 4889, 17, 13867, 434, 468, 3832, 9101, 18, 225, 2457, 326, 27641, 7216, 434, 7434, 716, 848, 1404, 1086, 468, 716, 4031, 261, 5625, 1842, 67, 451, 20528, 67, 5666, 3631, 8122, 4356, 468, 3675, 1842, 67, 5254, 1435, 445, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 3813, 67, 7872, 12, 3813, 16, 2103, 16, 3988, 16, 10902, 16, 1842, 1214, 33, 7036, 16, 366, 318, 313, 298, 581, 87, 33, 8381, 16, 1198, 33, 8381, 4672, 1842, 67, 13261, 18, 318, 945, 12, 3813, 13, 309, 486, 1842, 1214, 30, 1842, 1214, 273, 1104, 3813, 1214, 1435, 876, 1214, 273, 1140, 18, 803, 18, 5701, 12, 3813, 1214, 16, 315, 2844, 7923, 876, 768, 273, 1140, 18, 803, 18, 5701, 12, 2844, 1214, 16, 1842, 13, 309, 3988, 30, 6080, 84, 273, 599, 469, 30, 6080, 84, 273, 276, 780, 4294, 18, 780, 4294, 1435, 225, 775, 30, 1923, 67, 10283, 273, 2589, 18, 10283, 775, 30, 309, 6080, 84, 30, 2589, 18, 2 ]
before = [l.rstrip('\n') for l in lines[lbound:lineno]] line = lines[lineno].rstrip('\n') after = [l.rstrip('\n') for l in lines[lineno + 1:ubound]]
charset = None rep = re.compile('coding[=:]\s*([-\w.]+)') for linestr in lines[0], lines[1]: match = rep.search(linestr) if match: charset = match.group(1) break before = [to_unicode(l.rstrip('\n'), charset) for l in lines[lbound:lineno]] line = to_unicode(lines[lineno].rstrip('\n'), charset) after = [to_unicode(l.rstrip('\n'), charset) \ for l in lines[lineno + 1:ubound]]
def get_lines_from_file(filename, lineno, context=0): """Return `content` number of lines before and after the specified `lineno` from the file identified by `filename`. Returns a `(lines_before, line, lines_after)` tuple. """ if os.path.isfile(filename): fileobj = open(filename, 'U') try: lines = fileobj.readlines() lbound = max(0, lineno - context) ubound = lineno + 1 + context before = [l.rstrip('\n') for l in lines[lbound:lineno]] line = lines[lineno].rstrip('\n') after = [l.rstrip('\n') for l in lines[lineno + 1:ubound]] return before, line, after finally: fileobj.close() return (), None, ()
d02aae88caae087c0715c97a22ebe0b857bcb116 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9317/d02aae88caae087c0715c97a22ebe0b857bcb116/__init__.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 3548, 67, 2080, 67, 768, 12, 3459, 16, 7586, 16, 819, 33, 20, 4672, 3536, 990, 1375, 1745, 68, 1300, 434, 2362, 1865, 471, 1839, 326, 1269, 1375, 17782, 68, 628, 326, 585, 9283, 635, 1375, 3459, 8338, 225, 2860, 279, 1375, 12, 3548, 67, 5771, 16, 980, 16, 2362, 67, 5205, 22025, 3193, 18, 3536, 309, 1140, 18, 803, 18, 291, 768, 12, 3459, 4672, 17041, 273, 1696, 12, 3459, 16, 296, 57, 6134, 775, 30, 2362, 273, 17041, 18, 896, 3548, 1435, 328, 3653, 273, 943, 12, 20, 16, 7586, 300, 819, 13, 13910, 772, 273, 7586, 397, 404, 397, 819, 282, 4856, 273, 599, 2071, 273, 283, 18, 11100, 2668, 2014, 63, 23507, 13944, 87, 14, 3816, 6943, 91, 18, 3737, 2506, 13, 364, 2362, 313, 316, 2362, 63, 20, 6487, 2362, 63, 21, 14542, 845, 273, 2071, 18, 3072, 12, 3548, 313, 13, 309, 845, 30, 4856, 273, 845, 18, 1655, 12, 21, 13, 898, 225, 1865, 273, 306, 869, 67, 9124, 12, 80, 18, 86, 6406, 2668, 64, 82, 19899, 4856, 13, 364, 328, 316, 2362, 63, 80, 3653, 30, 17782, 13563, 980, 273, 358, 67, 9124, 12, 3548, 63, 17782, 8009, 86, 6406, 2668, 64, 82, 19899, 4856, 13, 1839, 273, 306, 869, 67, 9124, 12, 80, 18, 86, 6406, 2668, 64, 82, 19899, 4856, 13, 521, 364, 328, 316, 2362, 63, 17782, 397, 404, 30, 373, 772, 13563, 225, 327, 1865, 16, 980, 16, 1839, 3095, 30, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 3548, 67, 2080, 67, 768, 12, 3459, 16, 7586, 16, 819, 33, 20, 4672, 3536, 990, 1375, 1745, 68, 1300, 434, 2362, 1865, 471, 1839, 326, 1269, 1375, 17782, 68, 628, 326, 585, 9283, 635, 1375, 3459, 8338, 225, 2860, 279, 1375, 12, 3548, 67, 5771, 16, 980, 16, 2362, 67, 5205, 22025, 3193, 18, 3536, 309, 1140, 18, 803, 18, 291, 768, 12, 3459, 4672, 17041, 273, 1696, 12, 3459, 16, 296, 57, 6134, 775, 30, 2362, 273, 17041, 18, 896, 3548, 1435, 328, 3653, 273, 943, 12, 20, 16, 7586, 300, 819, 13, 13910, 772, 273, 7586, 397, 404, 397, 819, 282, 4856, 273, 599, 2071, 273, 283, 18, 11100, 2668, 2014, 63, 23507, 2 ]
self.quit()
Engine.quit(self)
def restart(self): """Restart the game.""" if not self.restartRequested: self.restartRequested = True self.input.broadcastSystemEvent("restartRequested") else: self.quit()
8d54b713f3adc9cc79283393ef3f20402eb26471 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7946/8d54b713f3adc9cc79283393ef3f20402eb26471/GameEngine.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7870, 12, 2890, 4672, 3536, 15057, 326, 7920, 12123, 309, 486, 365, 18, 19164, 11244, 30, 365, 18, 19164, 11244, 273, 1053, 365, 18, 2630, 18, 19805, 3163, 1133, 2932, 19164, 11244, 7923, 469, 30, 282, 10507, 18, 27176, 12, 2890, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7870, 12, 2890, 4672, 3536, 15057, 326, 7920, 12123, 309, 486, 365, 18, 19164, 11244, 30, 365, 18, 19164, 11244, 273, 1053, 365, 18, 2630, 18, 19805, 3163, 1133, 2932, 19164, 11244, 7923, 469, 30, 282, 10507, 18, 27176, 12, 2890, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
ct = (color.red / 256, color.green / 255, color.blue / 255)
ct = (color.red / 256, color.green / 256, color.blue / 256)
def set_color(self, button): color = button.get_color() ct = (color.red / 256, color.green / 255, color.blue / 255) config.set("settings", "osdcolor", "#%02x%02x%02x" % ct)
8350e310ca163bcb862bf93f2b78fcb26e2ef721 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4764/8350e310ca163bcb862bf93f2b78fcb26e2ef721/quodlibet.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 3266, 12, 2890, 16, 3568, 4672, 2036, 273, 3568, 18, 588, 67, 3266, 1435, 5691, 273, 261, 3266, 18, 1118, 342, 8303, 16, 2036, 18, 11571, 342, 8303, 16, 2036, 18, 14081, 342, 8303, 13, 642, 18, 542, 2932, 4272, 3113, 315, 538, 72, 3266, 3113, 6619, 9, 3103, 92, 9, 3103, 92, 9, 3103, 92, 6, 738, 5691, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 3266, 12, 2890, 16, 3568, 4672, 2036, 273, 3568, 18, 588, 67, 3266, 1435, 5691, 273, 261, 3266, 18, 1118, 342, 8303, 16, 2036, 18, 11571, 342, 8303, 16, 2036, 18, 14081, 342, 8303, 13, 642, 18, 542, 2932, 4272, 3113, 315, 538, 72, 3266, 3113, 6619, 9, 3103, 92, 9, 3103, 92, 9, 3103, 92, 6, 738, 5691, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
else:
elif DEBUG:
def _interpret(self): # Execute the frames forward until we raise a DoneWithThisFrame, # a ContinueRunningNormally, or a GenerateMergePoint exception. if not we_are_translated(): history.log.event('ENTER' + self.history.extratext) self.staticdata.stats.enter_count += 1 else: debug_print('~~~ ENTER', self.history.extratext) try: while True: self.framestack[-1].run_one_step() finally: if not we_are_translated(): history.log.event('LEAVE' + self.history.extratext) else: debug_print('~~~ LEAVE', self.history.extratext)
7d4f6d7b47f3baca5c02240f5775709621644903 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6934/7d4f6d7b47f3baca5c02240f5775709621644903/pyjitpl.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 24713, 12, 2890, 4672, 468, 7903, 326, 7793, 5104, 3180, 732, 1002, 279, 8677, 1190, 2503, 3219, 16, 468, 279, 16773, 7051, 14624, 1230, 16, 578, 279, 6654, 6786, 2148, 1520, 18, 309, 486, 732, 67, 834, 67, 22899, 13332, 4927, 18, 1330, 18, 2575, 2668, 12278, 11, 397, 365, 18, 8189, 18, 14523, 270, 408, 13, 365, 18, 3845, 892, 18, 5296, 18, 2328, 67, 1883, 1011, 404, 1327, 6369, 30, 1198, 67, 1188, 2668, 7650, 98, 20018, 2187, 365, 18, 8189, 18, 14523, 270, 408, 13, 775, 30, 1323, 1053, 30, 365, 18, 74, 1940, 395, 484, 18919, 21, 8009, 2681, 67, 476, 67, 4119, 1435, 3095, 30, 309, 486, 732, 67, 834, 67, 22899, 13332, 4927, 18, 1330, 18, 2575, 2668, 900, 26714, 11, 397, 365, 18, 8189, 18, 14523, 270, 408, 13, 1327, 6369, 30, 1198, 67, 1188, 2668, 7650, 98, 5380, 26714, 2187, 365, 18, 8189, 18, 14523, 270, 408, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 24713, 12, 2890, 4672, 468, 7903, 326, 7793, 5104, 3180, 732, 1002, 279, 8677, 1190, 2503, 3219, 16, 468, 279, 16773, 7051, 14624, 1230, 16, 578, 279, 6654, 6786, 2148, 1520, 18, 309, 486, 732, 67, 834, 67, 22899, 13332, 4927, 18, 1330, 18, 2575, 2668, 12278, 11, 397, 365, 18, 8189, 18, 14523, 270, 408, 13, 365, 18, 3845, 892, 18, 5296, 18, 2328, 67, 1883, 1011, 404, 1327, 6369, 30, 1198, 67, 1188, 2668, 7650, 98, 20018, 2187, 365, 18, 8189, 18, 14523, 270, 408, 13, 775, 30, 1323, 1053, 30, 365, 18, 74, 1940, 395, 484, 18919, 21, 8009, 2681, 67, 476, 67, 4119, 1435, 3095, 30, 309, 486, 732, 67, 834, 67, 22899, 2 ]
if (time):
if (time) and (time != 'None'):
def GetAcquisitionTime(self): """ Return string containing the acquisition time using the format "hh:mm:ss". Return "" (empty string) if not set.
f4bb8776261436490c9d86a319a745d9122690d8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/10228/f4bb8776261436490c9d86a319a745d9122690d8/dicom.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 968, 9988, 22094, 950, 12, 2890, 4672, 3536, 2000, 533, 4191, 326, 1721, 22094, 813, 1450, 326, 740, 315, 21622, 30, 7020, 30, 1049, 9654, 2000, 1408, 261, 5531, 533, 13, 309, 486, 444, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 968, 9988, 22094, 950, 12, 2890, 4672, 3536, 2000, 533, 4191, 326, 1721, 22094, 813, 1450, 326, 740, 315, 21622, 30, 7020, 30, 1049, 9654, 2000, 1408, 261, 5531, 533, 13, 309, 486, 444, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
try: fields = fields.items() except AttributeError: pass
def create_table(self, table_name, fields): """ Creates the table 'table_name'. 'fields' is a tuple of fields, each repsented by a 2-part tuple of field name and a django.db.models.fields.Field object """ qn = connection.ops.quote_name # allow fields to be a dictionary try: fields = fields.items() except AttributeError: pass columns = [ self.column_sql(table_name, field_name, field) for field_name, field in fields ] self.execute('CREATE TABLE %s (%s);' % (qn(table_name), ', '.join([col for col in columns if col])))
99e3a99c5cfacb50e48488520c486365b0e90577 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/13142/99e3a99c5cfacb50e48488520c486365b0e90577/generic.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 2121, 12, 2890, 16, 1014, 67, 529, 16, 1466, 4672, 3536, 10210, 326, 1014, 296, 2121, 67, 529, 10332, 296, 2821, 11, 353, 279, 3193, 434, 1466, 16, 1517, 283, 1121, 319, 329, 635, 279, 576, 17, 2680, 3193, 434, 652, 508, 471, 279, 13710, 18, 1966, 18, 7665, 18, 2821, 18, 974, 733, 3536, 31054, 273, 1459, 18, 4473, 18, 6889, 67, 529, 225, 468, 1699, 1466, 358, 506, 279, 3880, 4202, 2168, 273, 306, 365, 18, 2827, 67, 4669, 12, 2121, 67, 529, 16, 652, 67, 529, 16, 652, 13, 364, 652, 67, 529, 16, 652, 316, 1466, 308, 225, 365, 18, 8837, 2668, 9344, 7567, 738, 87, 6142, 87, 13869, 738, 261, 15785, 12, 2121, 67, 529, 3631, 2265, 2418, 5701, 3816, 1293, 364, 645, 316, 2168, 309, 645, 65, 20349, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 2121, 12, 2890, 16, 1014, 67, 529, 16, 1466, 4672, 3536, 10210, 326, 1014, 296, 2121, 67, 529, 10332, 296, 2821, 11, 353, 279, 3193, 434, 1466, 16, 1517, 283, 1121, 319, 329, 635, 279, 576, 17, 2680, 3193, 434, 652, 508, 471, 279, 13710, 18, 1966, 18, 7665, 18, 2821, 18, 974, 733, 3536, 31054, 273, 1459, 18, 4473, 18, 6889, 67, 529, 225, 468, 1699, 1466, 358, 506, 279, 3880, 4202, 2168, 273, 306, 365, 18, 2827, 67, 4669, 12, 2121, 67, 529, 16, 652, 67, 529, 16, 652, 13, 364, 652, 67, 529, 16, 652, 316, 1466, 308, 225, 365, 18, 8837, 2668, 9344, 7567, 738, 87, 6142, 87, 13869, 738, 261, 15785, 2 ]
time.sleep(0.3)
time.sleep(1.0)
def test(): import time, sys Message("Testing EasyDialogs.") optionlist = (('v', 'Verbose'), ('verbose', 'Verbose as long option'), ('flags=', 'Valued option'), ('f:', 'Short valued option')) commandlist = (('start', 'Start something'), ('stop', 'Stop something')) argv = GetArgv(optionlist=optionlist, commandlist=commandlist, addoldfile=0) for i in range(len(argv)): print 'arg[%d] = %s'%(i, `argv[i]`) print 'Type return to continue - ', sys.stdin.readline() ok = AskYesNoCancel("Do you want to proceed?") ok = AskYesNoCancel("Do you want to identify?", yes="Identify", no="No") if ok > 0: s = AskString("Enter your first name", "Joe") s2 = AskPassword("Okay %s, tell us your nickname"%s, s, cancel="None") if not s2: Message("%s has no secret nickname"%s) else: Message("Hello everybody!!\nThe secret nickname of %s is %s!!!"%(s, s2)) text = ( "Working Hard...", "Hardly Working..." , "So far, so good!", "Keep on truckin'" ) bar = ProgressBar("Progress, progress...", 100) try: appsw = MacOS.SchedParams(1, 0) for i in range(100): bar.set(i) time.sleep(0.1) if i % 10 == 0: bar.label(text[(i/10) % 4]) bar.label("Done.") time.sleep(0.3) # give'em a chance to see the done. finally: del bar apply(MacOS.SchedParams, appsw)
911e87de6f283e2326422c6746dd296511368a76 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8546/911e87de6f283e2326422c6746dd296511368a76/EasyDialogs.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 13332, 1930, 813, 16, 2589, 225, 2350, 2932, 22218, 29442, 11885, 14072, 1199, 13, 1456, 1098, 273, 261, 2668, 90, 2187, 296, 14489, 19899, 7707, 11369, 2187, 296, 14489, 487, 1525, 1456, 19899, 7707, 7133, 33, 2187, 296, 27558, 1456, 19899, 7707, 74, 30, 2187, 296, 4897, 31037, 1456, 26112, 1296, 1098, 273, 261, 2668, 1937, 2187, 296, 1685, 5943, 19899, 7707, 5681, 2187, 296, 4947, 5943, 26112, 5261, 273, 968, 4117, 90, 12, 3482, 1098, 33, 3482, 1098, 16, 1296, 1098, 33, 3076, 1098, 16, 527, 1673, 768, 33, 20, 13, 364, 277, 316, 1048, 12, 1897, 12, 19485, 3719, 30, 1172, 296, 3175, 14451, 72, 65, 273, 738, 87, 11, 17105, 77, 16, 1375, 19485, 63, 77, 65, 24065, 1172, 296, 559, 327, 358, 1324, 300, 2265, 2589, 18, 21772, 18, 896, 1369, 1435, 1529, 273, 25747, 22352, 2279, 6691, 2932, 3244, 1846, 2545, 358, 11247, 7225, 13, 1529, 273, 25747, 22352, 2279, 6691, 2932, 3244, 1846, 2545, 358, 9786, 35, 3113, 12465, 1546, 25787, 3113, 1158, 1546, 2279, 7923, 309, 1529, 405, 374, 30, 272, 273, 25747, 780, 2932, 10237, 3433, 1122, 508, 3113, 315, 46, 15548, 7923, 272, 22, 273, 25747, 3913, 2932, 8809, 528, 738, 87, 16, 9276, 584, 3433, 19570, 28385, 87, 16, 272, 16, 3755, 1546, 7036, 7923, 309, 486, 272, 22, 30, 2350, 27188, 87, 711, 1158, 4001, 19570, 28385, 87, 13, 469, 30, 2350, 2932, 18601, 3614, 3432, 8548, 64, 82, 1986, 4001, 19570, 434, 738, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 13332, 1930, 813, 16, 2589, 225, 2350, 2932, 22218, 29442, 11885, 14072, 1199, 13, 1456, 1098, 273, 261, 2668, 90, 2187, 296, 14489, 19899, 7707, 11369, 2187, 296, 14489, 487, 1525, 1456, 19899, 7707, 7133, 33, 2187, 296, 27558, 1456, 19899, 7707, 74, 30, 2187, 296, 4897, 31037, 1456, 26112, 1296, 1098, 273, 261, 2668, 1937, 2187, 296, 1685, 5943, 19899, 7707, 5681, 2187, 296, 4947, 5943, 26112, 5261, 273, 968, 4117, 90, 12, 3482, 1098, 33, 3482, 1098, 16, 1296, 1098, 33, 3076, 1098, 16, 527, 1673, 768, 33, 20, 13, 364, 277, 316, 1048, 12, 1897, 12, 19485, 3719, 30, 1172, 296, 3175, 14451, 72, 65, 273, 738, 87, 11, 17105, 77, 16, 1375, 19485, 2 ]
elif "HTTP_HOST" in request.environ:
elif "REMOTE_ADDR" in request.environ:
def get_ip(request): """ Extract the client IP address from the HTTP request in proxy compatible way. @return: IP address as a string or None if not available """ if "HTTP_X_FORWARDED_FOR" in request.environ: # Virtual host ip = request.environ["HTTP_X_FORWARDED_FOR"] elif "HTTP_HOST" in request.environ: # Non-virtualhost ip = request.environ["REMOTE_ADDR"] else: # Unit test code? ip = None return ip
de5521d2805c4c54a40c1fb5880653b96f115dc4 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/10164/de5521d2805c4c54a40c1fb5880653b96f115dc4/utilities.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 625, 12, 2293, 4672, 3536, 225, 8152, 326, 1004, 2971, 1758, 628, 326, 2239, 590, 316, 2889, 7318, 4031, 18, 225, 632, 2463, 30, 2971, 1758, 487, 279, 533, 578, 599, 309, 486, 2319, 3536, 309, 315, 3693, 67, 60, 67, 20675, 67, 7473, 6, 316, 590, 18, 28684, 30, 468, 7269, 1479, 2359, 273, 590, 18, 28684, 9614, 3693, 67, 60, 67, 20675, 67, 7473, 11929, 1327, 315, 15790, 67, 14142, 6, 316, 590, 18, 28684, 30, 468, 3858, 17, 12384, 2564, 2359, 273, 590, 18, 28684, 9614, 15790, 67, 14142, 11929, 469, 30, 468, 8380, 1842, 981, 35, 2359, 273, 599, 225, 327, 2359, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 625, 12, 2293, 4672, 3536, 225, 8152, 326, 1004, 2971, 1758, 628, 326, 2239, 590, 316, 2889, 7318, 4031, 18, 225, 632, 2463, 30, 2971, 1758, 487, 279, 533, 578, 599, 309, 486, 2319, 3536, 309, 315, 3693, 67, 60, 67, 20675, 67, 7473, 6, 316, 590, 18, 28684, 30, 468, 7269, 1479, 2359, 273, 590, 18, 28684, 9614, 3693, 67, 60, 67, 20675, 67, 7473, 11929, 1327, 315, 15790, 67, 14142, 6, 316, 590, 18, 28684, 30, 468, 3858, 17, 12384, 2564, 2359, 273, 590, 18, 28684, 9614, 15790, 67, 14142, 11929, 469, 30, 468, 8380, 1842, 981, 35, 2359, 273, 599, 225, 327, 2359, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
format_function = lambda x, f = format: _formatInteger(x, f)
format_function = lambda x: _formatInteger(x, format)
def _array2string(a, max_line_width, precision, suppress_small, separator=' ', prefix=""): if max_line_width is None: max_line_width = _line_width if precision is None: precision = _float_output_precision if suppress_small is None: suppress_small = _float_output_suppress_small if a.size > _summaryThreshhold: summary_insert = "..., " data = _leading_trailing(a) else: summary_insert = "" data = ravel(a) try: format_function = a._format except AttributeError: dtype = a.dtype.type if issubclass(dtype, _nt.bool): format = "%s" format_function = lambda x, f = format: format % x if issubclass(dtype, _nt.integer): max_str_len = max(len(str(max_reduce(data))), len(str(min_reduce(data)))) format = '%' + str(max_str_len) + 'd' format_function = lambda x, f = format: _formatInteger(x, f) elif issubclass(dtype, _nt.floating): format = _floatFormat(data, precision, suppress_small) format_function = lambda x, f = format: _formatFloat(x, f) elif issubclass(dtype, _nt.complexfloating): real_format = _floatFormat( data.real, precision, suppress_small, sign=0) imag_format = _floatFormat( data.imag, precision, suppress_small, sign=1) format_function = lambda x, f1 = real_format, f2 = imag_format: \ _formatComplex(x, f1, f2) elif issubclass(dtype, _nt.unicode_): format = "%s" format_function = lambda x, f = format: repr(x) else: format = '%s' format_function = lambda x, f = format: format % str(x) next_line_prefix = " " # skip over "[" next_line_prefix += " "*len(prefix) # skip over array( lst = _formatArray(a, format_function, len(a.shape), max_line_width, next_line_prefix, separator, _summaryEdgeItems, summary_insert)[:-1] return lst
6cf0da748afc8580030027c8390a5139034d75b8 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/14925/6cf0da748afc8580030027c8390a5139034d75b8/arrayprint.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 1126, 22, 1080, 12, 69, 16, 943, 67, 1369, 67, 2819, 16, 6039, 16, 12257, 67, 12019, 16, 4182, 2218, 2265, 1633, 1546, 6, 4672, 225, 309, 943, 67, 1369, 67, 2819, 353, 599, 30, 943, 67, 1369, 67, 2819, 273, 389, 1369, 67, 2819, 225, 309, 6039, 353, 599, 30, 6039, 273, 389, 5659, 67, 2844, 67, 14548, 225, 309, 12257, 67, 12019, 353, 599, 30, 12257, 67, 12019, 273, 389, 5659, 67, 2844, 67, 10840, 67, 12019, 225, 309, 279, 18, 1467, 405, 389, 7687, 1315, 1955, 21056, 30, 4916, 67, 6387, 273, 31305, 16, 315, 501, 273, 389, 27200, 67, 26453, 12, 69, 13, 469, 30, 4916, 67, 6387, 273, 1408, 501, 273, 15910, 12, 69, 13, 225, 775, 30, 740, 67, 915, 273, 279, 6315, 2139, 1335, 6394, 30, 3182, 273, 279, 18, 8972, 18, 723, 309, 14664, 12, 8972, 16, 389, 496, 18, 6430, 4672, 740, 273, 2213, 87, 6, 740, 67, 915, 273, 3195, 619, 16, 284, 273, 740, 30, 740, 738, 619, 309, 14664, 12, 8972, 16, 389, 496, 18, 7745, 4672, 943, 67, 701, 67, 1897, 273, 943, 12, 1897, 12, 701, 12, 1896, 67, 12498, 12, 892, 3719, 3631, 562, 12, 701, 12, 1154, 67, 12498, 12, 892, 3719, 3719, 740, 273, 9089, 397, 609, 12, 1896, 67, 701, 67, 1897, 13, 397, 296, 72, 11, 740, 67, 915, 273, 3195, 619, 30, 389, 2139, 4522, 12, 92, 16, 740, 13, 1327, 14664, 12, 8972, 16, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 1126, 22, 1080, 12, 69, 16, 943, 67, 1369, 67, 2819, 16, 6039, 16, 12257, 67, 12019, 16, 4182, 2218, 2265, 1633, 1546, 6, 4672, 225, 309, 943, 67, 1369, 67, 2819, 353, 599, 30, 943, 67, 1369, 67, 2819, 273, 389, 1369, 67, 2819, 225, 309, 6039, 353, 599, 30, 6039, 273, 389, 5659, 67, 2844, 67, 14548, 225, 309, 12257, 67, 12019, 353, 599, 30, 12257, 67, 12019, 273, 389, 5659, 67, 2844, 67, 10840, 67, 12019, 225, 309, 279, 18, 1467, 405, 389, 7687, 1315, 1955, 21056, 30, 4916, 67, 6387, 273, 31305, 16, 315, 501, 273, 389, 27200, 67, 26453, 12, 69, 13, 469, 30, 4916, 67, 6387, 273, 1408, 501, 273, 15910, 2 ]
print (('<a href="?deletelocal=%s">' % self.page_name) +
print (('<a href="%s?deletelocal=%s">' % (base, self.page_name)) +
def send_footer(self, versioned, mod_string=None, page_path=None, unmodified=False):
f8595ddfe1a99f0daf81474c72c391eda99fcb64 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/4007/f8595ddfe1a99f0daf81474c72c391eda99fcb64/piki.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 67, 14723, 12, 2890, 16, 17083, 16, 681, 67, 1080, 33, 7036, 16, 1363, 67, 803, 33, 7036, 16, 30481, 33, 8381, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 67, 14723, 12, 2890, 16, 17083, 16, 681, 67, 1080, 33, 7036, 16, 1363, 67, 803, 33, 7036, 16, 30481, 33, 8381, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
popts |= gsm.PRINT_SCH
popts |= gsm.PRINT_NORMAL
def __init__(self, frame, panel, vbox, argv): stdgui.gui_flow_graph.__init__(self)
e623985d7bed48ea54ab06635e2e25c6f77f3808 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/10611/e623985d7bed48ea54ab06635e2e25c6f77f3808/gsm_scan.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2623, 16, 6594, 16, 331, 2147, 16, 5261, 4672, 2044, 20292, 18, 20292, 67, 2426, 67, 4660, 16186, 2738, 972, 12, 2890, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2623, 16, 6594, 16, 331, 2147, 16, 5261, 4672, 2044, 20292, 18, 20292, 67, 2426, 67, 4660, 16186, 2738, 972, 12, 2890, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def setup(self, tarball = 'pi_tests.tar.bz2'):
def setup(self, tarball = 'pi_tests.tar.bz2', *args, **dargs):
def setup(self, tarball = 'pi_tests.tar.bz2'): autotest_utils.check_glibc_ver('2.5') tarball = autotest_utils.unmap_url(self.bindir, tarball, self.tmpdir) autotest_utils.extract_tarball_to_dir(tarball, self.srcdir) os.chdir(self.srcdir) utils.system('make')
ed239916d73b89bb749bf9f41a529de47a5c36a9 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12268/ed239916d73b89bb749bf9f41a529de47a5c36a9/pi_tests.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3875, 12, 2890, 16, 29441, 273, 296, 7259, 67, 16341, 18, 11718, 18, 25292, 22, 2187, 380, 1968, 16, 2826, 72, 1968, 4672, 2059, 352, 395, 67, 5471, 18, 1893, 67, 75, 2941, 71, 67, 502, 2668, 22, 18, 25, 6134, 29441, 273, 2059, 352, 395, 67, 5471, 18, 318, 1458, 67, 718, 12, 2890, 18, 4376, 481, 16, 29441, 16, 365, 18, 5645, 1214, 13, 2059, 352, 395, 67, 5471, 18, 8004, 67, 88, 23846, 67, 869, 67, 1214, 12, 88, 23846, 16, 365, 18, 4816, 1214, 13, 1140, 18, 343, 1214, 12, 2890, 18, 4816, 1214, 13, 2990, 18, 4299, 2668, 6540, 6134, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3875, 12, 2890, 16, 29441, 273, 296, 7259, 67, 16341, 18, 11718, 18, 25292, 22, 2187, 380, 1968, 16, 2826, 72, 1968, 4672, 2059, 352, 395, 67, 5471, 18, 1893, 67, 75, 2941, 71, 67, 502, 2668, 22, 18, 25, 6134, 29441, 273, 2059, 352, 395, 67, 5471, 18, 318, 1458, 67, 718, 12, 2890, 18, 4376, 481, 16, 29441, 16, 365, 18, 5645, 1214, 13, 2059, 352, 395, 67, 5471, 18, 8004, 67, 88, 23846, 67, 869, 67, 1214, 12, 88, 23846, 16, 365, 18, 4816, 1214, 13, 1140, 18, 343, 1214, 12, 2890, 18, 4816, 1214, 13, 2990, 18, 4299, 2668, 6540, 6134, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
('tof', tof, '0.1*microsecond'),
('tof', tof, tofunit),
def readHistogram( filename ): s = open(filename).read() import numpy as N I = N.fromstring( s, 'u4' ) n = len(I) tof = N.arange( 0, n, 1. ) import histogram as H Itof = H.histogram( 'I(tof)', [ ('tof', tof, '0.1*microsecond'), ], data = I, errors = I ) return Itof
440484cba5767e21136a061751f58b33ac8bd289 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/4114/440484cba5767e21136a061751f58b33ac8bd289/monitorData.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 855, 12874, 12, 1544, 262, 30, 272, 273, 1696, 12, 3459, 2934, 896, 1435, 1930, 3972, 487, 423, 467, 273, 423, 18, 2080, 1080, 12, 272, 16, 296, 89, 24, 11, 262, 290, 273, 562, 12, 45, 13, 358, 74, 273, 423, 18, 297, 726, 12, 374, 16, 290, 16, 404, 18, 262, 1930, 8892, 487, 670, 2597, 792, 273, 670, 18, 22702, 12, 296, 45, 12, 88, 792, 13, 2187, 306, 7707, 88, 792, 2187, 358, 74, 16, 358, 74, 4873, 3631, 308, 16, 501, 273, 467, 16, 1334, 273, 467, 262, 327, 2597, 792, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 855, 12874, 12, 1544, 262, 30, 272, 273, 1696, 12, 3459, 2934, 896, 1435, 1930, 3972, 487, 423, 467, 273, 423, 18, 2080, 1080, 12, 272, 16, 296, 89, 24, 11, 262, 290, 273, 562, 12, 45, 13, 358, 74, 273, 423, 18, 297, 726, 12, 374, 16, 290, 16, 404, 18, 262, 1930, 8892, 487, 670, 2597, 792, 273, 670, 18, 22702, 12, 296, 45, 12, 88, 792, 13, 2187, 306, 7707, 88, 792, 2187, 358, 74, 16, 358, 74, 4873, 3631, 308, 16, 501, 273, 467, 16, 1334, 273, 467, 262, 327, 2597, 792, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
attrs['id'], type='MultiChannelAnalyzer', attrs=attrs
attrs['id'], type='MultiChannelAnalyzer', **attrs
def process_mca(scan, measurement, process_scalars=False, masked=None): num_mca = int(scan.nbmca()/scan.lines()) mca_info = scan.header('@') mca_names = [] print 'Number of MCA:', num_mca for mca_index in xrange(num_mca): attrs = {} if len(mca_info)/3 == num_mca: item_info, mca_info = mca_info[:3], mca_info[3:] attrs['id'] = item_info[0].split()[0][2:] start, stop, step = [int(i) for i in item_info[1].split()[2:]] channels = np.arange(start, stop+1, step) attrs['calibration'] = str(tuple(np.array( [float(i) for i in item_info[2].split()[1:]] ))) else: print 'mca metadata in specfile is incomplete!' attrs['id'] = 'mca_%d'%mca_index channels = np.arange(len(scan.mca(1))) mca_names.append(attrs['id']) mca = measurement.create_group( attrs['id'], type='MultiChannelAnalyzer', attrs=attrs ) mca['channels'] = channels mca.create_dataset( 'counts', type='McaSpectrum', dtype='float32', shape=(scan.lines(), len(channels)) ) i = 0 for line in xrange(scan.lines()): i += 1 if i%10 == 0: sys.stdout.write('.') sys.stdout.flush() mca['counts'][line] = \ scan.mca(num_mca * line + 1 + mca_index)[:len(channels)] if i>10: sys.stdout.write('\n') sys.stdout.flush() if process_scalars: # assume all scalars to be signals for i, label in enumerate(scan.alllabels()): kwargs = {'class':'Signal'} dset = mca.create_dataset( label, data=scan.datacol(i+1), dtype='float32', **kwargs ) if masked is not None: mca['masked'] = masked try: return mca except UnboundLocalError: pass
ae0531ca8fe212eb9b9897191b1cf52c89ee71ca /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/14949/ae0531ca8fe212eb9b9897191b1cf52c89ee71ca/phynx.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 67, 81, 5353, 12, 9871, 16, 12464, 16, 1207, 67, 8748, 87, 33, 8381, 16, 13196, 33, 7036, 4672, 818, 67, 81, 5353, 273, 509, 12, 9871, 18, 6423, 81, 5353, 1435, 19, 9871, 18, 3548, 10756, 312, 5353, 67, 1376, 273, 4135, 18, 3374, 2668, 36, 6134, 312, 5353, 67, 1973, 273, 5378, 1172, 296, 1854, 434, 490, 3587, 30, 2187, 818, 67, 81, 5353, 364, 312, 5353, 67, 1615, 316, 12314, 12, 2107, 67, 81, 5353, 4672, 3422, 273, 2618, 309, 562, 12, 81, 5353, 67, 1376, 13176, 23, 422, 818, 67, 81, 5353, 30, 761, 67, 1376, 16, 312, 5353, 67, 1376, 273, 312, 5353, 67, 1376, 10531, 23, 6487, 312, 5353, 67, 1376, 63, 23, 26894, 3422, 3292, 350, 3546, 273, 761, 67, 1376, 63, 20, 8009, 4939, 1435, 63, 20, 6362, 22, 26894, 787, 16, 2132, 16, 2235, 273, 306, 474, 12, 77, 13, 364, 277, 316, 761, 67, 1376, 63, 21, 8009, 4939, 1435, 63, 22, 30, 13563, 5750, 273, 1130, 18, 297, 726, 12, 1937, 16, 225, 2132, 15, 21, 16, 2235, 13, 3422, 3292, 31573, 3546, 273, 609, 12, 8052, 12, 6782, 18, 1126, 12, 306, 5659, 12, 77, 13, 364, 277, 316, 761, 67, 1376, 63, 22, 8009, 4939, 1435, 63, 21, 30, 13563, 262, 3719, 469, 30, 1172, 296, 81, 5353, 1982, 316, 857, 768, 353, 14715, 5124, 225, 3422, 3292, 350, 3546, 273, 296, 81, 5353, 10185, 72, 11, 9, 81, 5353, 67, 1615, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 67, 81, 5353, 12, 9871, 16, 12464, 16, 1207, 67, 8748, 87, 33, 8381, 16, 13196, 33, 7036, 4672, 818, 67, 81, 5353, 273, 509, 12, 9871, 18, 6423, 81, 5353, 1435, 19, 9871, 18, 3548, 10756, 312, 5353, 67, 1376, 273, 4135, 18, 3374, 2668, 36, 6134, 312, 5353, 67, 1973, 273, 5378, 1172, 296, 1854, 434, 490, 3587, 30, 2187, 818, 67, 81, 5353, 364, 312, 5353, 67, 1615, 316, 12314, 12, 2107, 67, 81, 5353, 4672, 3422, 273, 2618, 309, 562, 12, 81, 5353, 67, 1376, 13176, 23, 422, 818, 67, 81, 5353, 30, 761, 67, 1376, 16, 312, 5353, 67, 1376, 273, 312, 5353, 67, 1376, 10531, 23, 6487, 312, 5353, 67, 1376, 2 ]
htmlString = "<html><body><h5>Item</h5><ul>" htmlString = htmlString + "<li><b>Path:</b> %s" % item.getItemPath() htmlString = htmlString + "<li><b>UUID:</b> %s" % item.getUUID() htmlString = htmlString + "</ul><h5>Attributes</h5><ul>" for attribute in item.iterAttributes(): key = attribute[0] if isinstance(attribute[1], dict): htmlString = htmlString + ("<li><b>%s:</b></li><ul>" % key) for attr in attribute[1]: attrString = str(attr) attrString = attrString.replace("<", "&lt;") attrString = attrString.replace(">", "&gt;") htmlString = htmlString + ("<li>%s</li>" % attrString) htmlString = htmlString + ("</ul>") else: value = str(attribute[1]) value = value.replace("<", "&lt;") value = value.replace(">", "&gt;") htmlString = htmlString + ("<li><b>%s: </b>%s</li>" % (key, value)) htmlString = htmlString + "</ul></body></html>" self.detail.SetPage(htmlString)
self.detail.DisplayItem(item)
def DisplayItem(self, item): """Display the given Item's details in an HTML window. """ htmlString = "<html><body><h5>Item</h5><ul>" htmlString = htmlString + "<li><b>Path:</b> %s" % item.getItemPath() htmlString = htmlString + "<li><b>UUID:</b> %s" % item.getUUID() htmlString = htmlString + "</ul><h5>Attributes</h5><ul>" for attribute in item.iterAttributes(): key = attribute[0]
464097a3941694ddd1a5ef4b8bc01b6addc03b23 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9228/464097a3941694ddd1a5ef4b8bc01b6addc03b23/RepositoryViewer.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9311, 1180, 12, 2890, 16, 761, 4672, 3536, 4236, 326, 864, 4342, 1807, 3189, 316, 392, 3982, 2742, 18, 3536, 1729, 780, 273, 3532, 2620, 4438, 3432, 4438, 76, 25, 34, 1180, 1757, 76, 25, 4438, 332, 2984, 1729, 780, 273, 1729, 780, 397, 3532, 549, 4438, 70, 34, 743, 19814, 70, 34, 738, 87, 6, 738, 761, 18, 588, 1180, 743, 1435, 1729, 780, 273, 1729, 780, 397, 3532, 549, 4438, 70, 34, 5562, 19814, 70, 34, 738, 87, 6, 738, 761, 18, 588, 5562, 1435, 1729, 780, 273, 1729, 780, 397, 6823, 332, 4438, 76, 25, 34, 2498, 1757, 76, 25, 4438, 332, 2984, 364, 1566, 316, 761, 18, 2165, 2498, 13332, 498, 273, 1566, 63, 20, 65, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9311, 1180, 12, 2890, 16, 761, 4672, 3536, 4236, 326, 864, 4342, 1807, 3189, 316, 392, 3982, 2742, 18, 3536, 1729, 780, 273, 3532, 2620, 4438, 3432, 4438, 76, 25, 34, 1180, 1757, 76, 25, 4438, 332, 2984, 1729, 780, 273, 1729, 780, 397, 3532, 549, 4438, 70, 34, 743, 19814, 70, 34, 738, 87, 6, 738, 761, 18, 588, 1180, 743, 1435, 1729, 780, 273, 1729, 780, 397, 3532, 549, 4438, 70, 34, 5562, 19814, 70, 34, 738, 87, 6, 738, 761, 18, 588, 5562, 1435, 1729, 780, 273, 1729, 780, 397, 6823, 332, 4438, 76, 25, 34, 2498, 1757, 76, 25, 4438, 332, 2984, 364, 1566, 316, 761, 18, 2165, 2498, 13332, 498, 273, 1566, 63, 2 ]
asock.send(msg)
if string.find(msg,"INSERT") >-1 or string.find(msg,"insert")>-1 or string.find(msg,"UPDATE")>-1 or string.find(msg,"update")>-1 or string.find(sub,"DELETE")>-1 or string.find(sub,"delete")>-1: print "processing updating query" mip, mport = servers[masterid] msock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) msock.connect((mip,mport)) msock.send(totalmsg) idx = string.find(totalmsg,msg) totalmsg = totalmsg[0:idx-1] msg = msock.recv(RECV_BUFF_SIZE) sock.send(msg) msock.close() else: asock.send(msg)
def process_client(sock, addr, ip, port): cont = 1 asock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) asock.connect((ip,port)) #sock.setblocking(0) #asock.setblocking(0) #try and except below wer placed for the use of #non-blocking sockets. this was just a test and should be removed #from the final version. while cont == 1: if os.fork() != 0: while cont == 1: try: msg = sock.recv(RECV_BUFF_SIZE) if msg == "": cont = 0 asock.send(msg) except: cont = 1 else: while cont == 1: try: msg = asock.recv(RECV_BUFF_SIZE) if msg == "": cont = 0 sock.send(msg) except: cont = 1
6fcdffd159fc00b812f7a5096cdcc5e143393b19 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/848/6fcdffd159fc00b812f7a5096cdcc5e143393b19/proxy.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 67, 2625, 12, 15031, 16, 3091, 16, 2359, 16, 1756, 4672, 466, 273, 404, 487, 975, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 487, 975, 18, 3612, 12443, 625, 16, 655, 3719, 468, 15031, 18, 542, 18926, 12, 20, 13, 468, 345, 975, 18, 542, 18926, 12, 20, 13, 468, 698, 471, 1335, 5712, 22646, 15235, 364, 326, 999, 434, 468, 5836, 17, 18926, 16762, 18, 333, 1703, 2537, 279, 1842, 471, 1410, 506, 3723, 468, 2080, 326, 727, 1177, 18, 1323, 466, 422, 404, 30, 309, 1140, 18, 23335, 1435, 480, 374, 30, 1323, 466, 422, 404, 30, 775, 30, 1234, 273, 7313, 18, 18334, 12, 862, 22007, 67, 3000, 2246, 67, 4574, 13, 309, 1234, 422, 1408, 30, 466, 273, 374, 225, 309, 533, 18, 4720, 12, 3576, 10837, 11356, 7923, 405, 17, 21, 578, 533, 18, 4720, 12, 3576, 10837, 6387, 7923, 34, 17, 21, 578, 533, 18, 4720, 12, 3576, 10837, 8217, 7923, 34, 17, 21, 578, 533, 18, 4720, 12, 3576, 10837, 2725, 7923, 34, 17, 21, 578, 533, 18, 4720, 12, 1717, 10837, 6460, 7923, 34, 17, 21, 578, 533, 18, 4720, 12, 1717, 10837, 3733, 7923, 34, 17, 21, 30, 1172, 315, 10632, 9702, 843, 6, 312, 625, 16, 312, 655, 273, 7084, 63, 7525, 350, 65, 4086, 975, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 67, 2625, 12, 15031, 16, 3091, 16, 2359, 16, 1756, 4672, 466, 273, 404, 487, 975, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 487, 975, 18, 3612, 12443, 625, 16, 655, 3719, 468, 15031, 18, 542, 18926, 12, 20, 13, 468, 345, 975, 18, 542, 18926, 12, 20, 13, 468, 698, 471, 1335, 5712, 22646, 15235, 364, 326, 999, 434, 468, 5836, 17, 18926, 16762, 18, 333, 1703, 2537, 279, 1842, 471, 1410, 506, 3723, 468, 2080, 326, 727, 1177, 18, 1323, 466, 422, 404, 30, 309, 1140, 18, 23335, 1435, 480, 374, 30, 1323, 466, 422, 404, 30, 775, 30, 1234, 273, 7313, 18, 18334, 2 ]
OWGUI.tableItem(self.table, i, 0, k) OWGUI.tableItem(self.table, i, 1, "*" if (k, run) == self.bestRun else "")
item = OWGUI.tableItem(self.table, i, 0, k) item.setData(Qt.TextAlignmentRole, QVariant(Qt.AlignCenter)) item = OWGUI.tableItem(self.table, i, 1, " * " if (k, run) == self.bestRun else "") item.setData(Qt.TextAlignmentRole, QVariant(Qt.AlignCenter))
def showResults(self): self.table.setHorizontalHeaderLabels(["K", "Best", "Score"]) self.table.setColumnCount(3) self.table.setRowCount(len(self.optimizationRun)) bestScore = self.bestRun[1].score worstScore = min([km.score for k, km in self.optimizationRun]) for i, (k, run) in enumerate(self.optimizationRun): OWGUI.tableItem(self.table, i, 0, k) OWGUI.tableItem(self.table, i, 1, "*" if (k, run) == self.bestRun else "") item = OWGUI.tableItem(self.table, i, 2, run.score) item.setData(OWGUI.TableBarItem.BarRole, QVariant(1 - (run.score - worstScore) / (bestScore - worstScore))) item.setSelected((k, run) == self.bestRun) self.table.resizeColumnsToContents() self.table.show() self.table.verticalHeader().hide() tablewidth = sum(self.table.columnWidth(i) + 2 for i in range(3))
b5200d400a472ae12720d7772ce15d5dcc3a721d /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6366/b5200d400a472ae12720d7772ce15d5dcc3a721d/OWKMeans.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2405, 3447, 12, 2890, 4672, 365, 18, 2121, 18, 542, 14457, 1864, 5888, 3816, 6, 47, 3113, 315, 14173, 3113, 315, 7295, 6, 5717, 365, 18, 2121, 18, 542, 1494, 1380, 12, 23, 13, 365, 18, 2121, 18, 542, 26359, 12, 1897, 12, 2890, 18, 16689, 1588, 1997, 3719, 3796, 7295, 273, 365, 18, 12729, 1997, 63, 21, 8009, 6355, 22952, 7295, 273, 1131, 3816, 18353, 18, 6355, 364, 417, 16, 18952, 316, 365, 18, 16689, 1588, 1997, 5717, 364, 277, 16, 261, 79, 16, 1086, 13, 316, 4241, 12, 2890, 18, 16689, 1588, 1997, 4672, 761, 273, 18233, 43, 5370, 18, 2121, 1180, 12, 2890, 18, 2121, 16, 277, 16, 374, 16, 417, 13, 761, 18, 542, 751, 12, 23310, 18, 1528, 11535, 2996, 16, 2238, 9356, 12, 23310, 18, 10044, 8449, 3719, 225, 761, 273, 18233, 43, 5370, 18, 2121, 1180, 12, 2890, 18, 2121, 16, 277, 16, 404, 16, 315, 380, 315, 309, 261, 79, 16, 1086, 13, 422, 365, 18, 12729, 1997, 469, 1408, 13, 761, 18, 542, 751, 12, 23310, 18, 1528, 11535, 2996, 16, 2238, 9356, 12, 23310, 18, 10044, 8449, 3719, 225, 761, 273, 18233, 43, 5370, 18, 2121, 1180, 12, 2890, 18, 2121, 16, 277, 16, 576, 16, 1086, 18, 6355, 13, 761, 18, 542, 751, 12, 7306, 43, 5370, 18, 1388, 5190, 1180, 18, 5190, 2996, 16, 2238, 9356, 12, 21, 300, 261, 2681, 18, 6355, 300, 22952, 7295, 13, 342, 261, 12729, 7295, 300, 22952, 7295, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2405, 3447, 12, 2890, 4672, 365, 18, 2121, 18, 542, 14457, 1864, 5888, 3816, 6, 47, 3113, 315, 14173, 3113, 315, 7295, 6, 5717, 365, 18, 2121, 18, 542, 1494, 1380, 12, 23, 13, 365, 18, 2121, 18, 542, 26359, 12, 1897, 12, 2890, 18, 16689, 1588, 1997, 3719, 3796, 7295, 273, 365, 18, 12729, 1997, 63, 21, 8009, 6355, 22952, 7295, 273, 1131, 3816, 18353, 18, 6355, 364, 417, 16, 18952, 316, 365, 18, 16689, 1588, 1997, 5717, 364, 277, 16, 261, 79, 16, 1086, 13, 316, 4241, 12, 2890, 18, 16689, 1588, 1997, 4672, 761, 273, 18233, 43, 5370, 18, 2121, 1180, 12, 2890, 18, 2121, 16, 277, 16, 374, 16, 417, 13, 761, 18, 542, 2 ]
sim.getRNG().setSeed(12345)
sim.getRNG().set(seed=12345)
def func(*fields): return 0.4*sum(fields)
205f55f8c6cd28aed704d70838912648f07ac340 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/401/205f55f8c6cd28aed704d70838912648f07ac340/userGuide.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1326, 30857, 2821, 4672, 327, 374, 18, 24, 14, 1364, 12, 2821, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1326, 30857, 2821, 4672, 327, 374, 18, 24, 14, 1364, 12, 2821, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.requiredvars=(('SAPlugin','lowpamaction'),('SAPlugin','highspamaction'),('SAPlugin','highspamlevel'),('SAPlugin','peruserconfig'),('SAPlugin','host'),('SAPlugin','port'),('SAPlugin','maxsize'),('SAPlugin','spamheader'),('SAPlugin','timeout'),('SAPlugin','retries'))
self.requiredvars=(('SAPlugin','lowspamaction'),('SAPlugin','highspamaction'),('SAPlugin','highspamlevel'),('SAPlugin','peruserconfig'),('SAPlugin','host'),('SAPlugin','port'),('SAPlugin','maxsize'),('SAPlugin','spamheader'),('SAPlugin','timeout'),('SAPlugin','retries'))
def __init__(self,config): ScannerPlugin.__init__(self,config) self.requiredvars=(('SAPlugin','lowpamaction'),('SAPlugin','highspamaction'),('SAPlugin','highspamlevel'),('SAPlugin','peruserconfig'),('SAPlugin','host'),('SAPlugin','port'),('SAPlugin','maxsize'),('SAPlugin','spamheader'),('SAPlugin','timeout'),('SAPlugin','retries')) self.logger=self._logger()
4e6edb1704c29125d011f001853cf5676bd172cc /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/10919/4e6edb1704c29125d011f001853cf5676bd172cc/sa.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1425, 4672, 19074, 3773, 16186, 2738, 972, 12, 2890, 16, 1425, 13, 365, 18, 4718, 4699, 28657, 2668, 5233, 3773, 17023, 821, 1752, 301, 1128, 19899, 2668, 5233, 3773, 17023, 8766, 1752, 301, 1128, 19899, 2668, 5233, 3773, 17023, 8766, 1752, 301, 2815, 19899, 2668, 5233, 3773, 17023, 457, 1355, 1425, 19899, 2668, 5233, 3773, 17023, 2564, 19899, 2668, 5233, 3773, 17023, 655, 19899, 2668, 5233, 3773, 17023, 1896, 1467, 19899, 2668, 5233, 3773, 17023, 1752, 301, 3374, 19899, 2668, 5233, 3773, 17023, 4538, 19899, 2668, 5233, 3773, 17023, 15215, 26112, 365, 18, 4901, 33, 2890, 6315, 4901, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1425, 4672, 19074, 3773, 16186, 2738, 972, 12, 2890, 16, 1425, 13, 365, 18, 4718, 4699, 28657, 2668, 5233, 3773, 17023, 821, 1752, 301, 1128, 19899, 2668, 5233, 3773, 17023, 8766, 1752, 301, 1128, 19899, 2668, 5233, 3773, 17023, 8766, 1752, 301, 2815, 19899, 2668, 5233, 3773, 17023, 457, 1355, 1425, 19899, 2668, 5233, 3773, 17023, 2564, 19899, 2668, 5233, 3773, 17023, 655, 19899, 2668, 5233, 3773, 17023, 1896, 1467, 19899, 2668, 5233, 3773, 17023, 1752, 301, 3374, 19899, 2668, 5233, 3773, 17023, 4538, 19899, 2668, 5233, 3773, 17023, 15215, 26112, 365, 18, 4901, 33, 2890, 6315, 4901, 1435, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
drawcylinder(color1, self.a1pos, self.center, TubeRadius)
drawcylinder(color1, a1pos, c1, TubeRadius) else: drawsphere(black, c1, TubeRadius, level)
via dispdef from the calling molecule -- this might cause bugs if some
8458fbfe4c9e599a4e7092a28b468082d5fe6e91 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11221/8458fbfe4c9e599a4e7092a28b468082d5fe6e91/bonds.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3970, 16232, 536, 628, 326, 4440, 13661, 1493, 333, 4825, 4620, 22398, 309, 2690, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 3970, 16232, 536, 628, 326, 4440, 13661, 1493, 333, 4825, 4620, 22398, 309, 2690, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
M = int(amax(ij[0])) N = int(amax(ij[1]))
M = int(amax(ij[0])) + 1 N = int(amax(ij[1])) + 1
def __init__(self, obj, ij_in, dims=None, nzmax=None, dtype=None): spmatrix.__init__(self) try: # Assume the first calling convention # assert len(ij) == 2 if len(ij_in) != 2: if isdense( ij_in ) and (ij_in.shape[1] == 2): ij = (ij_in[:,0], ij_in[:,1]) else: raise AssertionError else: ij = ij_in if dims is None: M = int(amax(ij[0])) N = int(amax(ij[1])) self.shape = (M, N) else: # Use 2 steps to ensure dims has length 2. M, N = dims self.shape = (M, N) self.row = asarray(ij[0]) self.col = asarray(ij[1]) self.data = asarray(obj, dtype=dtype) self.dtype = self.data.dtype if nzmax is None: nzmax = len(self.data) self.nzmax = nzmax self._check() except Exception, e: raise e, "invalid input format"
57e057b52364d5b77af01198799ed00aea306d4c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12971/57e057b52364d5b77af01198799ed00aea306d4c/sparse.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1081, 16, 19313, 67, 267, 16, 9914, 33, 7036, 16, 15062, 1896, 33, 7036, 16, 3182, 33, 7036, 4672, 1694, 5667, 16186, 2738, 972, 12, 2890, 13, 775, 30, 468, 15983, 326, 1122, 4440, 15797, 468, 5411, 1815, 562, 12, 8302, 13, 422, 576, 309, 562, 12, 8302, 67, 267, 13, 480, 576, 30, 309, 353, 25942, 12, 19313, 67, 267, 262, 471, 261, 8302, 67, 267, 18, 4867, 63, 21, 65, 422, 576, 4672, 19313, 273, 261, 8302, 67, 267, 10531, 16, 20, 6487, 19313, 67, 267, 10531, 16, 21, 5717, 469, 30, 1002, 12068, 469, 30, 19313, 273, 19313, 67, 267, 309, 9914, 353, 599, 30, 490, 273, 509, 12, 301, 651, 12, 8302, 63, 20, 22643, 397, 404, 423, 273, 509, 12, 301, 651, 12, 8302, 63, 21, 22643, 397, 404, 365, 18, 4867, 273, 261, 49, 16, 423, 13, 469, 30, 468, 2672, 576, 6075, 358, 3387, 9914, 711, 769, 576, 18, 490, 16, 423, 273, 9914, 365, 18, 4867, 273, 261, 49, 16, 423, 13, 365, 18, 492, 273, 10455, 12, 8302, 63, 20, 5717, 365, 18, 1293, 273, 10455, 12, 8302, 63, 21, 5717, 365, 18, 892, 273, 10455, 12, 2603, 16, 3182, 33, 8972, 13, 365, 18, 8972, 273, 365, 18, 892, 18, 8972, 309, 15062, 1896, 353, 599, 30, 15062, 1896, 273, 562, 12, 2890, 18, 892, 13, 365, 18, 82, 94, 1896, 273, 15062, 1896, 365, 6315, 1893, 1435, 1335, 1185, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1081, 16, 19313, 67, 267, 16, 9914, 33, 7036, 16, 15062, 1896, 33, 7036, 16, 3182, 33, 7036, 4672, 1694, 5667, 16186, 2738, 972, 12, 2890, 13, 775, 30, 468, 15983, 326, 1122, 4440, 15797, 468, 5411, 1815, 562, 12, 8302, 13, 422, 576, 309, 562, 12, 8302, 67, 267, 13, 480, 576, 30, 309, 353, 25942, 12, 19313, 67, 267, 262, 471, 261, 8302, 67, 267, 18, 4867, 63, 21, 65, 422, 576, 4672, 19313, 273, 261, 8302, 67, 267, 10531, 16, 20, 6487, 19313, 67, 267, 10531, 16, 21, 5717, 469, 30, 1002, 12068, 469, 30, 19313, 273, 19313, 67, 267, 309, 9914, 353, 599, 30, 490, 273, 509, 12, 2 ]
isize = read32(self.fileobj) if crc32%0x100000000L != self.crc%0x100000000L:
isize = U32(read32(self.fileobj)) if U32(crc32) != U32(self.crc):
def _read_eof(self): # We've read to the end of the file, so we have to rewind in order # to reread the 8 bytes containing the CRC and the file size. # We check the that the computed CRC and size of the # uncompressed data matches the stored values. self.fileobj.seek(-8, 1) crc32 = read32(self.fileobj) isize = read32(self.fileobj) if crc32%0x100000000L != self.crc%0x100000000L: raise ValueError, "CRC check failed" elif isize != self.size: raise ValueError, "Incorrect length of data produced"
1b11c3877d262c1eda5dc42c6fe5672b68f7b89f /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12029/1b11c3877d262c1eda5dc42c6fe5672b68f7b89f/gzip.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 896, 67, 9339, 12, 2890, 4672, 468, 1660, 8081, 855, 358, 326, 679, 434, 326, 585, 16, 1427, 732, 1240, 358, 12881, 316, 1353, 468, 358, 436, 264, 684, 326, 1725, 1731, 4191, 326, 21773, 471, 326, 585, 963, 18, 468, 1660, 866, 326, 716, 326, 8470, 21773, 471, 963, 434, 326, 468, 20560, 501, 1885, 326, 4041, 924, 18, 365, 18, 768, 2603, 18, 16508, 19236, 28, 16, 404, 13, 10619, 1578, 273, 855, 1578, 12, 2890, 18, 768, 2603, 13, 353, 554, 273, 587, 1578, 12, 896, 1578, 12, 2890, 18, 768, 2603, 3719, 309, 587, 1578, 12, 22988, 1578, 13, 480, 587, 1578, 12, 2890, 18, 22988, 4672, 1002, 2068, 16, 315, 26803, 866, 2535, 6, 1327, 353, 554, 480, 365, 18, 1467, 30, 1002, 2068, 16, 315, 16268, 769, 434, 501, 14929, 6, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 896, 67, 9339, 12, 2890, 4672, 468, 1660, 8081, 855, 358, 326, 679, 434, 326, 585, 16, 1427, 732, 1240, 358, 12881, 316, 1353, 468, 358, 436, 264, 684, 326, 1725, 1731, 4191, 326, 21773, 471, 326, 585, 963, 18, 468, 1660, 866, 326, 716, 326, 8470, 21773, 471, 963, 434, 326, 468, 20560, 501, 1885, 326, 4041, 924, 18, 365, 18, 768, 2603, 18, 16508, 19236, 28, 16, 404, 13, 10619, 1578, 273, 855, 1578, 12, 2890, 18, 768, 2603, 13, 353, 554, 273, 587, 1578, 12, 896, 1578, 12, 2890, 18, 768, 2603, 3719, 309, 587, 1578, 12, 22988, 1578, 13, 480, 587, 1578, 12, 2890, 18, 22988, 4672, 1002, 2068, 16, 315, 26803, 866, 2 ]
sage: sr = mq.SR(2,1,1,4)
sage: sr = mq.SR(2, 1, 1, 4)
def block_order(self): """ Return a block order for self where each round is a block.
62424369e932ac59629cb4d40b7e47ae2a712293 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/62424369e932ac59629cb4d40b7e47ae2a712293/sr.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1203, 67, 1019, 12, 2890, 4672, 3536, 2000, 279, 1203, 1353, 364, 365, 1625, 1517, 3643, 353, 279, 1203, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1203, 67, 1019, 12, 2890, 4672, 3536, 2000, 279, 1203, 1353, 364, 365, 1625, 1517, 3643, 353, 279, 1203, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
s = idaapi.get_struc(id)
s = idaapi.get_struc(sid)
def GetMemberName(id, member_offset): """ Get name of a member of a structure @param id: structure type ID @param member_offset: member offset. The offset can be any offset in the member. For example, is a member is 4 bytes long and starts at offset 2, then 2,3,4,5 denote the same structure member. @return: None if bad structure type ID is passed or no such member in the structure otherwise returns name of the specified member. """ s = idaapi.get_struc(id) if not s: return None m = idaapi.get_member(s, member_offset) if not m: return None return idaapi.get_member_name(m.id)
244a3cd02a580c0095170004ec30e922f0d1a8a6 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/6984/244a3cd02a580c0095170004ec30e922f0d1a8a6/idc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 968, 4419, 461, 12, 350, 16, 3140, 67, 3348, 4672, 3536, 968, 508, 434, 279, 3140, 434, 279, 3695, 225, 632, 891, 612, 30, 3695, 618, 1599, 632, 891, 3140, 67, 3348, 30, 3140, 1384, 18, 1021, 1384, 848, 506, 1281, 1384, 316, 326, 3140, 18, 2457, 3454, 16, 353, 279, 3140, 353, 1059, 1731, 1525, 471, 2542, 622, 1384, 576, 16, 1508, 576, 16, 23, 16, 24, 16, 25, 5545, 1168, 326, 1967, 3695, 3140, 18, 225, 632, 2463, 30, 599, 309, 5570, 3695, 618, 1599, 353, 2275, 578, 1158, 4123, 3140, 316, 326, 3695, 3541, 1135, 508, 434, 326, 1269, 3140, 18, 3536, 272, 273, 612, 69, 2425, 18, 588, 67, 701, 5286, 12, 7453, 13, 309, 486, 272, 30, 327, 599, 225, 312, 273, 612, 69, 2425, 18, 588, 67, 5990, 12, 87, 16, 3140, 67, 3348, 13, 309, 486, 312, 30, 327, 599, 225, 327, 612, 69, 2425, 18, 588, 67, 5990, 67, 529, 12, 81, 18, 350, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 968, 4419, 461, 12, 350, 16, 3140, 67, 3348, 4672, 3536, 968, 508, 434, 279, 3140, 434, 279, 3695, 225, 632, 891, 612, 30, 3695, 618, 1599, 632, 891, 3140, 67, 3348, 30, 3140, 1384, 18, 1021, 1384, 848, 506, 1281, 1384, 316, 326, 3140, 18, 2457, 3454, 16, 353, 279, 3140, 353, 1059, 1731, 1525, 471, 2542, 622, 1384, 576, 16, 1508, 576, 16, 23, 16, 24, 16, 25, 5545, 1168, 326, 1967, 3695, 3140, 18, 225, 632, 2463, 30, 599, 309, 5570, 3695, 618, 1599, 353, 2275, 578, 1158, 4123, 3140, 316, 326, 3695, 3541, 1135, 508, 434, 326, 1269, 3140, 18, 3536, 272, 273, 612, 69, 2425, 18, 588, 67, 701, 5286, 12, 7453, 13, 2 ]
sage: E.Lseries_values_along_line(1, 0.5+20*I, 5) [(0.500000000, 0), (0.400000000 + 4.00000000*I, 3.31920245 - 2.60028054*I), (0.300000000 + 8.00000000*I, -0.886341185 - 0.422640337*I), (0.200000000 + 12.0000000*I, -3.50558936 - 0.108531690*I), (0.100000000 + 16.0000000*I, -3.87043288 - 1.88049411*I)]
sage: E.Lseries_values_along_line(1, 0.5+20*I, 5) [(0.500000000, -5.45450037e-18), (0.400000000 + 4.00000000*I, 3.31920245 - 2.60028054*I), (0.300000000 + 8.00000000*I, -0.886341185 - 0.422640337*I), (0.200000000 + 12.0000000*I, -3.50558936 - 0.108531690*I), (0.100000000 + 16.0000000*I, -3.87043288 - 1.88049411*I)]
def Lseries_values_along_line(self, s0, s1, number_samples): """ Return values of $L(E, s)$ at \code{number_samples} equally-spaced sample points along the line from $s_0$ to $s_1$ in the complex plane.
06428793728de3b4ebb1ce01f18c2a0e5abfb62b /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9890/06428793728de3b4ebb1ce01f18c2a0e5abfb62b/ell_rational_field.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 511, 10222, 67, 2372, 67, 287, 932, 67, 1369, 12, 2890, 16, 272, 20, 16, 272, 21, 16, 1300, 67, 7319, 4672, 3536, 2000, 924, 434, 271, 48, 12, 41, 16, 272, 21877, 622, 521, 710, 95, 2696, 67, 7319, 97, 1298, 1230, 17, 2981, 72, 3296, 3143, 7563, 326, 980, 628, 271, 87, 67, 20, 8, 358, 271, 87, 67, 21, 8, 316, 326, 7233, 11017, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 511, 10222, 67, 2372, 67, 287, 932, 67, 1369, 12, 2890, 16, 272, 20, 16, 272, 21, 16, 1300, 67, 7319, 4672, 3536, 2000, 924, 434, 271, 48, 12, 41, 16, 272, 21877, 622, 521, 710, 95, 2696, 67, 7319, 97, 1298, 1230, 17, 2981, 72, 3296, 3143, 7563, 326, 980, 628, 271, 87, 67, 20, 8, 358, 271, 87, 67, 21, 8, 316, 326, 7233, 11017, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]