text
stringlengths 2
104M
| meta
dict |
|---|---|
// https://www.hackerrank.com/challenges/cpp-hello-world/problem
#include <iostream>
#include <cstdio>
using namespace std;
int main() {
std::cout << "Hello, World!" << std::endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-conditional-if-else/problem
#include <map>
#include <set>
#include <list>
#include <cmath>
#include <ctime>
#include <deque>
#include <queue>
#include <stack>
#include <string>
#include <bitset>
#include <cstdio>
#include <limits>
#include <vector>
#include <climits>
#include <cstring>
#include <cstdlib>
#include <fstream>
#include <numeric>
#include <sstream>
#include <iostream>
#include <algorithm>
#include <unordered_map>
using namespace std;
int main(){
int n;
cin >> n;
// your code goes here
if (n < 1) return 2;
const char *digits[] = { "", "one", "two", "three", "four", "five", "six", "seven", "eight", "nine"};
if (n < 10)
cout << digits[n] << endl;
else
cout << "Greater than 9" << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank(c-tutorial-for-loop c-tutorial-for-loop.cpp)
add_hackerrank(cpp-input-and-output cpp-input-and-output.cpp)
add_hackerrank(cpp-hello-world cpp-hello-world.cpp)
add_hackerrank(c-tutorial-conditional-if-else c-tutorial-conditional-if-else.cpp)
add_hackerrank(c-tutorial-pointer c-tutorial-pointer.cpp)
add_hackerrank(c-tutorial-functions c-tutorial-functions.cpp)
add_hackerrank(variable-sized-arrays variable-sized-arrays.cpp)
add_hackerrank(arrays-introduction arrays-introduction.cpp)
add_hackerrank(c-tutorial-basic-data-types c-tutorial-basic-data-types.cpp)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-basic-data-types/problem
#include <iostream>
#include <cstdio>
using namespace std;
int main() {
// Complete the code.
int a;
long b;
char c;
float f;
double d;
if (5 == scanf("%d %ld %c %f %lf", &a, &b, &c, &f, &d))
printf("%d\n%ld\n%c\n%.3f\n%.9lf\n", a, b, c, f, d);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-for-loop/problem
#include <iostream>
#include <cstdio>
using namespace std;
int main() {
// Complete the code.
const char *digits[] = { "", "one", "two", "three", "four", "five", "six", "seven", "eight", "nine" };
int n1, n2;
cin >> n1 >> n2;
for (int n = n1; n <= n2; ++n) {
if (n < 1) {
// rien
}
else if (n <= 9) cout << digits[n] << endl;
else if (n % 2 == 0)
cout << "even" << endl;
else
cout << "odd" << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-pointer/problem
#include <stdio.h>
void update(int *a,int *b) {
// Complete this function
int c = *a + *b;
int d = *a - *b;
*a = c;
*b = d >= 0 ? d : -d;
}
int main() {
int a, b;
int *pa = &a, *pb = &b;
scanf("%d %d", &a, &b);
update(pa, pb);
printf("%d\n%d", a, b);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-functions/problem
#include <iostream>
#include <cstdio>
using namespace std;
/*
Add `int max_of_four(int a, int b, int c, int d)` here.
*/
int max_of_four(int a, int b, int c, int d)
{
if (b > a) a = b;
if (c > a) a = c;
if (d > a) a = d;
return a;
}
int main() {
int a, b, c, d;
scanf("%d %d %d %d", &a, &b, &c, &d);
int ans = max_of_four(a, b, c, d);
printf("%d", ans);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [C++](https://www.hackerrank.com/domains/cpp)
A general-purpose programming language with imperative, object-oriented and generic programming features.
#### [Introduction](https://www.hackerrank.com/domains/cpp/cpp-introduction)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Say "Hello, World!" With C++](https://www.hackerrank.com/challenges/cpp-hello-world)|Practice printing to stdout.|[C++](cpp-hello-world.cpp)|Easy
[Input and Output](https://www.hackerrank.com/challenges/cpp-input-and-output)|Learn to take in the input and print the output. Take three number as input and print their sum as output.|[C++](cpp-input-and-output.cpp)|Easy
[Basic Data Types](https://www.hackerrank.com/challenges/c-tutorial-basic-data-types)|Learn about the basic data types in C++. Take the given input and print them.|[C++](c-tutorial-basic-data-types.cpp)|Easy
[Conditional Statements](https://www.hackerrank.com/challenges/c-tutorial-conditional-if-else)|Practice using chained conditional statements.|[C++](c-tutorial-conditional-if-else.cpp)|Easy
[For Loop](https://www.hackerrank.com/challenges/c-tutorial-for-loop)|Learn how to use for loop and print the output as per the given conditions|[C++](c-tutorial-for-loop.cpp)|Easy
[Functions](https://www.hackerrank.com/challenges/c-tutorial-functions)|Learn how to write functions in C++. Create a function to find the maximum of the four numbers.|[C++](c-tutorial-functions.cpp)|Easy
[Pointer](https://www.hackerrank.com/challenges/c-tutorial-pointer)|Learn how to declare pointers and use them.|[C++](c-tutorial-pointer.cpp)|Easy
[Arrays Introduction](https://www.hackerrank.com/challenges/arrays-introduction)|How to access and use arrays. Print the array in the reverse order.|[C++](arrays-introduction.cpp)|Easy
[Variable Sized Arrays](https://www.hackerrank.com/challenges/variable-sized-arrays)|Find the element described in the query for integer sequences.|[C++](variable-sized-arrays.cpp)|Easy
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/cpp-input-and-output/problem
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
using namespace std;
int main() {
/* Enter your code here. Read input from STDIN. Print output to STDOUT */
int a,b,c; scanf("%d %d %d",&a,&b,&c); printf("%d\n",a+b+c);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/c-tutorial-stringstream/problem
#include <sstream>
#include <vector>
#include <iostream>
using namespace std;
vector<int> parseInts(const string& str) {
// Complete this function
stringstream ss(str);
vector<int> v;
while (! ss.eof())
{
int i;
ss >> i;
v.push_back(i);
char c;
ss >> c;
if (c != ',') break;
}
return v;
}
int main() {
string str;
cin >> str;
vector<int> integers = parseInts(str);
for(size_t i = 0; i < integers.size(); i++) {
cout << integers[i] << "\n";
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/attribute-parser/problem
#include <cmath>
#include <cstdio>
#include <sstream>
#include <iostream>
#include <algorithm>
#include <map>
using namespace std;
/***
std::string& ltrim(std::string& str, const std::string& chars = "\t\n\v\f\r ")
{
str.erase(0, str.find_first_not_of(chars));
return str;
}
std::string& rtrim(std::string& str, const std::string& chars = "\t\n\v\f\r ")
{
str.erase(str.find_last_not_of(chars) + 1);
return str;
}
std::string& trim(std::string& str, const std::string& chars = "\t\n\v\f\r ")
{
return ltrim(rtrim(str, chars), chars);
}
***/
class HrmlDoc
{
string path_;
map<string, string> attributes_;
public:
void operator<<(const string& s)
{
if (s.compare(0, 2, "</") == 0)
{
//string tag = s.substr(2, s.find('>', 2) - 2);
path_.resize(path_.rfind('.'));
}
else
{
string::size_type p, q;
p = s.find(' ', 2);
if (p == string::npos)
{
p = s.find('>', 2);
path_ += "." + s.substr(1, p - 1);
}
else
{
path_ += "." + s.substr(1, p - 1);
++p;
while ((q = s.find(" = ", p)) != string::npos)
{
string attr = s.substr(p, q - p);
p = s.find('"', q) + 1;
q = s.find('"', p);
string value = s.substr(p, q - p);
attributes_[path_.substr(1) + "~" + attr] = value;
p = q + 2;
}
}
}
}
string query(const string& path) const
{
const auto& i = attributes_.find(path);
if (i == attributes_.end())
return "Not Found!";
else
return i->second;
}
};
int main()
{
int N, Q;
string s;
HrmlDoc hrml;
stringstream ss;
getline(cin, s);
ss << s;
ss >> N >> Q;
while (N--)
{
getline(cin, s);
hrml << s;
}
while (Q--)
{
getline(cin, s);
cout << hrml.query(s) << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Strings
//
// https://www.hackerrank.com/challenges/c-tutorial-strings/problem
#include <iostream>
#include <string>
#include <algorithm>
using namespace std;
int main() {
// Complete the program
string a, b;
cin >> a;
cin >> b;
cout << a.size() << " " << b.size() << endl;
cout << a + b << endl;
std::swap(a[0], b[0]);
cout << a << " " << b << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank(attribute-parser attribute-parser.cpp)
add_hackerrank(c-tutorial-stringstream c-tutorial-stringstream.cpp)
add_hackerrank(c-tutorial-strings c-tutorial-strings.cpp)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [C++](https://www.hackerrank.com/domains/cpp)
A general-purpose programming language with imperative, object-oriented and generic programming features.
#### [Strings](https://www.hackerrank.com/domains/cpp/cpp-strings)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Strings](https://www.hackerrank.com/challenges/c-tutorial-strings)|Learn how to input and output strings.|[C++](c-tutorial-strings.cpp)|Easy
[StringStream](https://www.hackerrank.com/challenges/c-tutorial-stringstream)|Learn how to use stringstreams.|[C++](c-tutorial-stringstream.cpp)|Easy
[Attribute Parser](https://www.hackerrank.com/challenges/attribute-parser)|Parse the values within various tags.|[C++](attribute-parser.cpp)|Medium
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# https://www.hackerrank.com/domains/data-structures
add_subdirectory(arrays)
add_subdirectory(trees)
add_subdirectory(linked-lists)
add_subdirectory(trie)
add_subdirectory(heap)
add_subdirectory(stacks)
add_subdirectory(queues)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Arrays](https://www.hackerrank.com/domains/data-structures/arrays)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Arrays - DS](https://www.hackerrank.com/challenges/arrays-ds)|Accessing and using arrays.|[C++](arrays/arrays-ds.cpp) [Python](arrays/arrays-ds.py)|Easy
[2D Array - DS](https://www.hackerrank.com/challenges/2d-array)|How to access and use 2d-arrays.|[Python](arrays/2d-array.py)|Easy
[Dynamic Array](https://www.hackerrank.com/challenges/dynamic-array)|Learn to use dynamic arrays by solving this problem.|[Python](arrays/dynamic-array.py)|Easy
[Left Rotation](https://www.hackerrank.com/challenges/array-left-rotation)|Given an array and a number, d, perform d left rotations on the array.|[Python](arrays/array-left-rotation.py)|Easy
[Sparse Arrays](https://www.hackerrank.com/challenges/sparse-arrays)|Determine the number of times a string has previously appeared.|[Python](arrays/sparse-arrays.py)|Medium
[Array Manipulation](https://www.hackerrank.com/challenges/crush)|Perform m operations on an array and print the maximum of the values.|[Python](arrays/crush.py)|Hard
#### [Linked Lists](https://www.hackerrank.com/domains/data-structures/linked-lists)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Print the Elements of a Linked List](https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list)|Get started with Linked Lists!|[C++](linked-lists/print-the-elements-of-a-linked-list.cpp)|Easy
[Insert a Node at the Tail of a Linked List](https://www.hackerrank.com/challenges/insert-a-node-at-the-tail-of-a-linked-list)|Create and insert a new node at the tail of a linked list.|[C++](linked-lists/insert-a-node-at-the-tail-of-a-linked-list.cpp)|Easy
[Insert a node at the head of a linked list](https://www.hackerrank.com/challenges/insert-a-node-at-the-head-of-a-linked-list)|Create and insert a new node at the head of a linked list|[C++](linked-lists/insert-a-node-at-the-head-of-a-linked-list.cpp)|Easy
[Insert a node at a specific position in a linked list](https://www.hackerrank.com/challenges/insert-a-node-at-a-specific-position-in-a-linked-list)|Insert a node at a specific position in a linked list.|[C++](linked-lists/insert-a-node-at-a-specific-position-in-a-linked-list.cpp)|Easy
[Delete a Node](https://www.hackerrank.com/challenges/delete-a-node-from-a-linked-list)|Delete a node from the linked list and return the head.|[C++](linked-lists/delete-a-node-from-a-linked-list.cpp)|Easy
[Print in Reverse](https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list-in-reverse)|Print the elements of a linked list in reverse order, from tail to head|[C++](linked-lists/print-the-elements-of-a-linked-list-in-reverse.cpp)|Easy
[Reverse a linked list](https://www.hackerrank.com/challenges/reverse-a-linked-list)|Change the links between the nodes of a linked list to reverse it|[C++](linked-lists/reverse-a-linked-list.cpp)|Easy
[Compare two linked lists](https://www.hackerrank.com/challenges/compare-two-linked-lists)|Compare the data in two linked lists node by node to see if the lists contain identical data.|[C++](linked-lists/compare-two-linked-lists.cpp)|Easy
[Merge two sorted linked lists](https://www.hackerrank.com/challenges/merge-two-sorted-linked-lists)|Given the heads of two sorted linked lists, change their links to get a single, sorted linked list.|[C++](linked-lists/merge-two-sorted-linked-lists.cpp)|Easy
[Get Node Value](https://www.hackerrank.com/challenges/get-the-value-of-the-node-at-a-specific-position-from-the-tail)|Given the head of a linked list, get the value of the node at a given position when counting backwards from the tail.|[Python](linked-lists/get-the-value-of-the-node-at-a-specific-position-from-the-tail.py)|Easy
[Delete duplicate-value nodes from a sorted linked list](https://www.hackerrank.com/challenges/delete-duplicate-value-nodes-from-a-sorted-linked-list)|Given a linked list whose nodes have data in ascending order, delete some nodes so that no value occurs more than once.|[C++](linked-lists/delete-duplicate-value-nodes-from-a-sorted-linked-list.cpp)|Easy
[Cycle Detection](https://www.hackerrank.com/challenges/detect-whether-a-linked-list-contains-a-cycle)|Given a pointer to the head of a linked list, determine whether the linked list loops back onto itself|[C++](linked-lists/detect-whether-a-linked-list-contains-a-cycle.cpp)|Medium
[Find Merge Point of Two Lists](https://www.hackerrank.com/challenges/find-the-merge-point-of-two-joined-linked-lists)|Given two linked lists, find the node where they merge into one.|[C++](linked-lists/find-the-merge-point-of-two-joined-linked-lists.cpp)|Easy
[Inserting a Node Into a Sorted Doubly Linked List](https://www.hackerrank.com/challenges/insert-a-node-into-a-sorted-doubly-linked-list)|Create a node with a given value and insert it into a sorted doubly-linked list|[C++](linked-lists/insert-a-node-into-a-sorted-doubly-linked-list.cpp)|Easy
[Reverse a doubly linked list](https://www.hackerrank.com/challenges/reverse-a-doubly-linked-list)|Given the head node of a doubly linked list, reverse it.|[Python](linked-lists/reverse-a-doubly-linked-list.py)|Easy
#### [Trees](https://www.hackerrank.com/domains/data-structures/trees)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Tree: Preorder Traversal](https://www.hackerrank.com/challenges/tree-preorder-traversal)|Print the preorder traversal of a binary tree.|[C++](trees/tree-preorder-traversal.cpp)|Easy
[Tree: Postorder Traversal](https://www.hackerrank.com/challenges/tree-postorder-traversal)|Print the post order traversal of a binary tree.|[C++](trees/tree-postorder-traversal.cpp)|Easy
[Tree: Inorder Traversal](https://www.hackerrank.com/challenges/tree-inorder-traversal)|Print the inorder traversal of a binary tree.|[C++](trees/tree-inorder-traversal.cpp)|Easy
[Tree: Height of a Binary Tree](https://www.hackerrank.com/challenges/tree-height-of-a-binary-tree)|Given a binary tree, print its height.|[C++](trees/tree-height-of-a-binary-tree.cpp) [Python](trees/tree-height-of-a-binary-tree.py)|Easy
[Tree : Top View](https://www.hackerrank.com/challenges/tree-top-view)|Given a binary tree, print it's top view.|[C++](trees/tree-top-view.cpp)|Easy
[Tree: Level Order Traversal](https://www.hackerrank.com/challenges/tree-level-order-traversal)|Level order traversal of a binary tree.|[C++](trees/tree-level-order-traversal.cpp)|Easy
[Binary Search Tree : Insertion](https://www.hackerrank.com/challenges/binary-search-tree-insertion)|Given a number, insert it into it's position in a binary search tree.|[C++](trees/binary-search-tree-insertion.cpp)|Easy
[Tree: Huffman Decoding ](https://www.hackerrank.com/challenges/tree-huffman-decoding)|Given a Huffman tree and an encoded binary string, you have to print the original string.|[C++](trees/tree-huffman-decoding.cpp)|Medium
[Binary Search Tree : Lowest Common Ancestor](https://www.hackerrank.com/challenges/binary-search-tree-lowest-common-ancestor)|Given two nodes of a binary search tree, find the lowest common ancestor of these two nodes.|[C++](trees/binary-search-tree-lowest-common-ancestor.cpp)|Easy
[Array Pairs](https://www.hackerrank.com/challenges/array-pairs)|Count the number of pairs satisfying a condition.|[Python](trees/array-pairs.py)|Advanced
#### [Stacks](https://www.hackerrank.com/domains/data-structures/stacks)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Maximum Element](https://www.hackerrank.com/challenges/maximum-element)|Given three types of queries, insert an element, delete an element or find the maximum element in a stack.|[C++](stacks/maximum-element.cpp)|Easy
[Balanced Brackets](https://www.hackerrank.com/challenges/balanced-brackets)|Given a string containing three types of brackets, determine if it is balanced.|[Python](stacks/balanced-brackets.py)|Medium
[Equal Stacks](https://www.hackerrank.com/challenges/equal-stacks)|Equalize the piles!|[Python](stacks/equal-stacks.py)|Easy
[Largest Rectangle ](https://www.hackerrank.com/challenges/largest-rectangle)|Given n buildings, find the largest rectangular area possible by joining consecutive K buildings.|[Python](stacks/largest-rectangle.py)|Medium
[Simple Text Editor](https://www.hackerrank.com/challenges/simple-text-editor)|Implement a simple text editor and perform some number of operations.|[Python](stacks/simple-text-editor.py)|Medium
#### [Queues](https://www.hackerrank.com/domains/data-structures/queues)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Queue using Two Stacks](https://www.hackerrank.com/challenges/queue-using-two-stacks)|Create a queue data structure using two stacks.|[Python](queues/queue-using-two-stacks.py)|Medium
#### [Heap](https://www.hackerrank.com/domains/data-structures/heap)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[QHEAP1](https://www.hackerrank.com/challenges/qheap1)|Solve the basic heap question with insertion and deletion.|[Python](heap/qheap1.py)|Easy
[Jesse and Cookies](https://www.hackerrank.com/challenges/jesse-and-cookies)|Calculate the number of operations needed to increase the sweetness of the cookies so that each cookie in the collection has a sweetness >=K.|[Python](heap/jesse-and-cookies.py)|Easy
[Find the Running Median](https://www.hackerrank.com/challenges/find-the-running-median)|Find the median of the elements after inputting each element.|[Python](heap/find-the-running-median.py)|Hard
#### [Trie](https://www.hackerrank.com/domains/data-structures/trie)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Contacts](https://www.hackerrank.com/challenges/contacts)|Create a Contacts application with the two basic operations: add and find.|[Python](trie/contacts.py)|Medium
[No Prefix Set](https://www.hackerrank.com/challenges/no-prefix-set)|Given N strings, find if a string is a prefix of another string.|[Python](trie/no-prefix-set.py)|Hard
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Contacts
# Create a Contacts application with the two basic operations: add and find.
#
# https://www.hackerrank.com/challenges/contacts/problem
#
# Nota: il y a trop de noms pour se contenter d'un algo trivial de recherche dans contacts
import bisect
contacts = []
for _ in range(int(input())):
op, contact = input().split()
if op == "add":
bisect.insort(contacts, contact)
elif op == "find":
position = bisect.bisect_left(contacts, contact)
n = 0
while position < len(contacts) and contacts[position].startswith(contact):
position += 1
n += 1
print(n)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank_py(contacts.py)
add_hackerrank_py(no-prefix-set.py)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# No Prefix Set
# Given N strings, find if a string is a prefix of another string.
#
# https://www.hackerrank.com/challenges/no-prefix-set/problem
#
import bisect
def main():
arr = []
for _ in range(int(input())):
s = input()
p = bisect.bisect_right(arr, s)
if p >= 1 and s.startswith(arr[p - 1]):
print("BAD SET")
print(s)
return
if p < len(arr) and arr[p].startswith(s):
print("BAD SET")
print(s)
return
arr.insert(p, s)
print("GOOD SET")
main()
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Trie](https://www.hackerrank.com/domains/data-structures/trie)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Contacts](https://www.hackerrank.com/challenges/contacts)|Create a Contacts application with the two basic operations: add and find.|[Python](contacts.py)|Medium
[No Prefix Set](https://www.hackerrank.com/challenges/no-prefix-set)|Given N strings, find if a string is a prefix of another string.|[Python](no-prefix-set.py)|Hard
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Arrays - DS
# Accessing and using arrays.
#
# https://www.hackerrank.com/challenges/arrays-ds/problem
#
# avec certains langages, c'est peut-être plus challengant qu'en Python...
input()
print(' '.join(map(str, reversed(list(map(int, input().split()))))))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// https://www.hackerrank.com/challenges/arrays-ds/problem
#include <map>
#include <set>
#include <list>
#include <cmath>
#include <ctime>
#include <deque>
#include <queue>
#include <stack>
#include <string>
#include <bitset>
#include <cstdio>
#include <limits>
#include <vector>
#include <climits>
#include <cstring>
#include <cstdlib>
#include <fstream>
#include <numeric>
#include <sstream>
#include <iostream>
#include <algorithm>
#include <unordered_map>
using namespace std;
int main(){
size_t n;
cin >> n;
vector<int> arr(n);
for(size_t arr_i = 0;arr_i < n;arr_i++){
cin >> arr[arr_i];
}
for (auto i = arr.rbegin(); i != arr.rend(); ++i)
cout << *i << " ";
cout << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# 2D Array - DS
# How to access and use 2d-arrays.
#
# https://www.hackerrank.com/challenges/2d-array/problem
#
def array2D(arr):
resulat = -100
for i in range(0, 4):
for j in range(0, 4):
s = sum(arr[i][j:j + 3])
s += arr[i + 1][j + 1]
s += sum(arr[i + 2][j:j + 3])
if s > resulat:
resulat = s
return resulat
if __name__ == '__main__':
arr = []
for _ in range(6):
arr.append(list(map(int, input().split())))
result = array2D(arr)
print(result)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Left Rotation
# Given an array and a number, d, perform d left rotations on the array.
#
# https://www.hackerrank.com/challenges/array-left-rotation/problem
#
def rotate(l, n):
n = n % len(l)
return l[n:] + l[:n]
if __name__ == '__main__':
nd = input().split()
n = int(nd[0])
d = int(nd[1])
a = list(map(int, input().split()))
a = rotate(a, d)
print(' '.join(map(str, a)))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank_py(sparse-arrays.py)
add_hackerrank_py(2d-array.py)
add_hackerrank_py(crush.py)
add_hackerrank_py(array-left-rotation.py)
add_hackerrank_py(dynamic-array.py)
add_hackerrank(arrays-ds arrays-ds.cpp)
add_hackerrank_py(arrays-ds.py)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
"""
Array Manipulation
https://www.hackerrank.com/challenges/crush/problem
"""
if __name__ == "__main__":
n, m = input().split(' ')
n, m = int(n), int(m)
data = [0] * (n + 2)
vmax = 0
""" BRUTE FORCE
for a0 in range(m):
a, b, k = input().split(' ')
a, b, k = int(a), int(b), int(k)
for i in range(a, b + 1):
v = data[i] + k
data[i] = v
if v > vmax:
vmax = v
"""
# au lieu de faire +k à chaque fois entre [a,b]
# on mémorise les changements (+k à a et -k après b)
# et on fait la somme une seule fois
for a0 in range(m):
a, b, k = input().split(' ')
a, b, k = int(a), int(b), int(k)
data[a] += k
data[b + 1] -= k
v = 0
for i in range(1, n + 1):
v += data[i]
if v > vmax:
vmax = v
print(vmax)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Sparse Arrays
# Determine the number of times a string has previously appeared.
#
# https://www.hackerrank.com/challenges/sparse-arrays/problem
#
from collections import defaultdict
strings = defaultdict(lambda: 0)
for _ in range(int(input())):
strings[input()] += 1
for _ in range(int(input())):
print(strings[input()])
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Dynamic Array
# Learn to use dynamic arrays by solving this problem.
#
# https://www.hackerrank.com/challenges/dynamic-array/problem
#
def dynamicArray(n, queries):
last_answer = 0
seq = [[] for _ in range(n)]
for q in queries:
op, x, y = q
if op == 1:
seq[(x ^ last_answer) % n].append(y)
elif op == 2:
s = seq[(x ^ last_answer) % n]
last_answer = s[y % len(s)]
print(last_answer)
if __name__ == '__main__':
n, q = map(int, input().split())
queries = []
for _ in range(q):
queries.append(list(map(int, input().split())))
dynamicArray(n, queries)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Arrays](https://www.hackerrank.com/domains/data-structures/arrays)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Arrays - DS](https://www.hackerrank.com/challenges/arrays-ds)|Accessing and using arrays.|[C++](arrays-ds.cpp) [Python](arrays-ds.py)|Easy
[2D Array - DS](https://www.hackerrank.com/challenges/2d-array)|How to access and use 2d-arrays.|[Python](2d-array.py)|Easy
[Dynamic Array](https://www.hackerrank.com/challenges/dynamic-array)|Learn to use dynamic arrays by solving this problem.|[Python](dynamic-array.py)|Easy
[Left Rotation](https://www.hackerrank.com/challenges/array-left-rotation)|Given an array and a number, d, perform d left rotations on the array.|[Python](array-left-rotation.py)|Easy
[Sparse Arrays](https://www.hackerrank.com/challenges/sparse-arrays)|Determine the number of times a string has previously appeared.|[Python](sparse-arrays.py)|Medium
[Array Manipulation](https://www.hackerrank.com/challenges/crush)|Perform m operations on an array and print the maximum of the values.|[Python](crush.py)|Hard
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Jesse and Cookies
# Calculate the number of operations needed to increase the sweetness of the cookies so that each cookie in the collection has a sweetness >=K.
#
# https://www.hackerrank.com/challenges/jesse-and-cookies/problem
#
import heapq
def cookies(k, A):
stack = sorted(A)
heapq.heapify(stack)
op = 0
while stack[0] < k and len(stack) >= 2:
a = heapq.heappop(stack)
a = a + 2 * heapq.heappop(stack)
heapq.heappush(stack, a)
op += 1
if stack[0] < k: return -1
return op
if __name__ == '__main__':
n, k = map(int, input().split())
A = list(map(int, input().split()))
op = cookies(k, A)
print(op)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# QHEAP1
# Solve the basic heap question with insertion and deletion.
#
# https://www.hackerrank.com/challenges/qheap1/problem
#
from heapq import heappush, heapify, heappop
q = []
q2 = []
for _ in range(int(input())):
op = list(map(int, input().split()))
# add
if op[0] == 1:
heappush(q, op[1])
# del
elif op[0] == 2:
#q.remove(op[1])
#heapify(q)
heappush(q2, op[1])
# print
elif op[0] == 3:
#print(q[0])
while len(q2) > 0 and q[0] == q2[0]:
heappop(q)
heappop(q2)
print(q[0])
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank_py(find-the-running-median.py)
add_hackerrank_py(qheap1.py)
add_hackerrank_py(jesse-and-cookies.py)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Find the Running Median
# Find the median of the elements after inputting each element.
#
# https://www.hackerrank.com/challenges/find-the-running-median/problem
#
import bisect
a = []
for _ in range(int(input())):
n = int(input())
bisect.insort(a, n)
m = (a[(len(a) - 1) // 2] + a[len(a) // 2]) / 2
print("%.1f" % m)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Heap](https://www.hackerrank.com/domains/data-structures/heap)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[QHEAP1](https://www.hackerrank.com/challenges/qheap1)|Solve the basic heap question with insertion and deletion.|[Python](qheap1.py)|Easy
[Jesse and Cookies](https://www.hackerrank.com/challenges/jesse-and-cookies)|Calculate the number of operations needed to increase the sweetness of the cookies so that each cookie in the collection has a sweetness >=K.|[Python](jesse-and-cookies.py)|Easy
[Find the Running Median](https://www.hackerrank.com/challenges/find-the-running-median)|Find the median of the elements after inputting each element.|[Python](find-the-running-median.py)|Hard
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Queue using Two Stacks
# Create a queue data structure using two stacks.
#
# https://www.hackerrank.com/challenges/queue-using-two-stacks/problem
#
in_stack = []
out_stack = []
for _ in range(int(input())):
op = list(map(int, input().split()))
# push back
if op[0] == 1:
in_stack.append(op[1])
# pop front
elif op[0] == 2:
if len(out_stack) > 0:
# vide la stack de sortie
out_stack.pop()
else:
# transvase la stack d'entrée vers la stack de sortie
while len(in_stack) > 1:
out_stack.append(in_stack.pop())
in_stack.pop()
# print
elif op[0] == 3:
if len(out_stack) == 0:
while len(in_stack) > 0:
out_stack.append(in_stack.pop())
print(out_stack[-1])
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank_py(queue-using-two-stacks.py)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Queues](https://www.hackerrank.com/domains/data-structures/queues)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Queue using Two Stacks](https://www.hackerrank.com/challenges/queue-using-two-stacks)|Create a queue data structure using two stacks.|[Python](queue-using-two-stacks.py)|Medium
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Balanced Brackets
# Given a string containing three types of brackets, determine if it is balanced.
#
# https://www.hackerrank.com/challenges/balanced-brackets/problem
#
def isBalanced(s):
stack = []
for c in s:
if c in "({[":
stack.append(c)
elif c in ")}]":
if len(stack) == 0:
return False
d = stack.pop()
if d + c not in "(){}[]":
return False
return len(stack) == 0
for a0 in range(int(input())):
s = input()
print("YES" if isBalanced(s) else "NO")
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Data Structures > Stacks > Simple Text Editor
# Implement a simple text editor and perform some number of operations.
#
# https://www.hackerrank.com/challenges/simple-text-editor/problem
#
import sys
text = ""
undo = []
"""
if t[0]=='1':order+=1;s+=t[1];dic[order]=s
elif t[0]=='2':s=s[:len(s)-int(t[1])];order+=1;dic[order]=s
elif t[0]=='3':print(s[int(t[1])-1])
elif t[0]=='4':order-=1;s=dic[order]
"""
for _ in range(int(input())):
cmd, _, opt = input().strip().partition(' ')
avant = text
if cmd == "1":
# append s
undo.append(("append", len(text)))
text += opt
elif cmd == "2":
# delete k
k = int(opt)
if k > len(text): k = len(text)
undo.append(("delete", text[-k:]))
text = text[:-k]
elif cmd == "3":
# print k
k = int(opt) - 1
print(text[k])
elif cmd == "4":
# undo
if len(undo) > 0:
op, opt = undo[-1]
undo = undo[:-1]
if op == "append":
text = text[:opt]
else:
text += opt
# print(">>> {:6} {} {} -> {}".format(['','append','delete','print','undo'][int(cmd)], opt, avant, text), file=sys.stderr)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank(maximum-element maximum-element.cpp)
add_hackerrank_py(balanced-brackets.py)
add_hackerrank_py(equal-stacks.py)
add_hackerrank_py(largest-rectangle.py)
add_hackerrank_py(simple-text-editor.py)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Data Structures > Stacks > Largest Rectangle
# Given n buildings, find the largest rectangular area possible by joining consecutive K buildings.
#
# https://www.hackerrank.com/challenges/largest-rectangle/problem
#
def largestRectangle(heights):
# pile des index des plus hautes tours
stack = [-1]
max = 0
i = 0
while i < n:
h = heights[i]
# ajoute la hauteur si elle est supérieure à la plus haute hauteur de la stack
if len(stack) == 1 or h >= heights[stack[-1]]:
stack.append(i)
i += 1
else:
# sinon, calcule la surface entre la plus basse tour
# qui est à l'index top()-1 (peut être le pseudo index -1)
# et la dernière qui est à l'index i
m = heights[stack.pop()] * (i - stack[-1] - 1)
if m > max:
max = m
# vide la stack avec le même algo
while len(stack) > 1:
m = heights[stack.pop()] * (i - stack[-1] - 1)
if m > max:
max = m
return max
if __name__ == "__main__":
n = int(input())
h = list(map(int, input().split()))
result = largestRectangle(h)
print(result)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Maximum Element
// Given three types of queries, insert an element, delete an element or find the maximum element in a stack.
//
// https://www.hackerrank.com/challenges/maximum-element/problem
//
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
using namespace std;
// nota: le challenge garantit que les bornes ne seront jamais dépassées
// ainsi, on ne vérifie rien sur la validité des données en entrée
int stack[100000];
int top = 0;
// Solution 1: naïve
int main_naif()
{
int q;
cin >> q;
while (q--)
{
int op;
cin >> op;
if (op == 1)
{
int x;
cin >> x;
//push
stack[top++] = x;
}
else if (op == 2)
{
//delete
top--;
}
else if (op == 3)
{
//print max
int max = -1;
for (int i = 0; i < top; ++i)
if (stack[i] > max) max = stack[i];
cout << max << endl;
}
}
return 0;
}
// Solution 2: performante
// pas la peine de stacker les éléments, il n'y a que le max qui nous intéresse!
int main()
{
int q;
cin >> q;
while (q--)
{
int op;
cin >> op;
if (op == 1)
{
int x;
cin >> x;
//push
// par défaut le max de la stack est l'élément lu
int m = x;
// s'il y a qqch dans la stack, on vérifie le max
if (top > 0)
{
if (stack[top - 1] > m) m = stack[top - 1];
}
stack[top++] = m;
}
else if (op == 2)
{
//delete
top--;
}
else if (op == 3)
{
//print max
cout << stack[top - 1] << endl;
}
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Stacks](https://www.hackerrank.com/domains/data-structures/stacks)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Maximum Element](https://www.hackerrank.com/challenges/maximum-element)|Given three types of queries, insert an element, delete an element or find the maximum element in a stack.|[C++](maximum-element.cpp)|Easy
[Balanced Brackets](https://www.hackerrank.com/challenges/balanced-brackets)|Given a string containing three types of brackets, determine if it is balanced.|[Python](balanced-brackets.py)|Medium
[Equal Stacks](https://www.hackerrank.com/challenges/equal-stacks)|Equalize the piles!|[Python](equal-stacks.py)|Easy
[Largest Rectangle ](https://www.hackerrank.com/challenges/largest-rectangle)|Given n buildings, find the largest rectangular area possible by joining consecutive K buildings.|[Python](largest-rectangle.py)|Medium
[Simple Text Editor](https://www.hackerrank.com/challenges/simple-text-editor)|Implement a simple text editor and perform some number of operations.|[Python](simple-text-editor.py)|Medium
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Data Structures > Stacks > Equal Stacks
# Equalize the piles!
#
# https://www.hackerrank.com/challenges/equal-stacks/problem
#
# principe:
# on calcule la hauteur cumulée
# on part de la stack qui contient le moins d'éléments
# et on la dépile jusqu'à ce que la valeur soit présente dans toutes les autres stacks
import itertools
def get_stack():
s = list(itertools.accumulate(reversed(list(map(int, input().split())))))
return (len(s), s)
def max_height(oh):
oh = list(s[1] for s in oh)
while oh[0]:
h = oh[0].pop()
ok = True
for i in range(1, len(oh)):
while oh[i] and oh[i][-1] > h:
oh[i].pop()
if not oh[i]:
return 0
ok = ok and oh[i][-1] == h
if ok:
return h
return 0
n1, n2, n3 = map(int, input().split())
oh = sorted([get_stack() for _ in range(3)])
print(max_height(oh))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Inorder Traversal
// Print the inorder traversal of a binary tree.
//
// https://www.hackerrank.com/challenges/tree-inorder-traversal/problem
//
#include "tree.hpp"
MAIN(inOrder)
/* you only have to complete the function given below.
Node is defined as
struct node
{
int data;
node* left;
node* right;
};
*/
// affiche left - noeud courant - right
void inOrder(node *root)
{
if (root)
{
inOrder(root->left);
cout << root->data << " ";
inOrder(root->right);
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Level Order Traversal
// Level order traversal of a binary tree.
//
// https://www.hackerrank.com/challenges/tree-level-order-traversal/problem
//
#include "tree.hpp"
MAIN(levelOrder)
/*
struct node
{
int data;
node* left;
node* right;
}*/
void levelOrder(node * root)
{
queue<node *> q;
q.push(root);
while (! q.empty())
{
node *n = q.front();
q.pop();
if (n)
{
cout << n->data << " ";
q.push(n->left);
q.push(n->right);
}
}
cout << endl;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Preorder Traversal
// Print the preorder traversal of a binary tree.
//
// https://www.hackerrank.com/challenges/tree-preorder-traversal/problem
//
#include "tree.hpp"
MAIN(preOrder)
/* you only have to complete the function given below.
Node is defined as
struct node
{
int data;
node* left;
node* right;
};
*/
// affiche le noeud courant avant, puis les childs
void preOrder(node *root)
{
if (root)
{
cout << root->data << " ";
preOrder(root->left);
preOrder(root->right);
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Height of a Binary Tree
// Given a binary tree, print its height.
//
// https://www.hackerrank.com/challenges/tree-height-of-a-binary-tree/problem
//
#include <iostream>
#include <cstddef>
using namespace std;
class Node{
public:
int data;
Node *left;
Node *right;
Node(int d){
data = d;
left = NULL;
right = NULL;
}
};
class Solution {
public:
Node* insert(Node* root, int data) {
if(root == NULL) {
return new Node(data);
}
else {
Node* cur;
if(data <= root->data){
cur = insert(root->left, data);
root->left = cur;
}
else{
cur = insert(root->right, data);
root->right = cur;
}
return root;
}
}
// (skeliton_head) ----------------------------------------------------------------------
/*The tree node has data, left child and right child
class Node {
int data;
Node* left;
Node* right;
};
*/
int height(Node* root, int level = 0)
{
int h = level;
if (root->left) h = std::max(h, height(root->left, level + 1));
if (root->right) h = std::max(h, height(root->right, level + 1));
return h;
}
// (skeliton_tail) ----------------------------------------------------------------------
}; //End of Solution
int main() {
Solution myTree;
Node* root = NULL;
int t;
int data;
cin >> t;
while(t-- > 0){
cin >> data;
root = myTree.insert(root, data);
}
int height = myTree.height(root);
cout << height;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree : Top View
// Given a binary tree, print it's top view.
//
// https://www.hackerrank.com/challenges/tree-top-view/problem
//
#include "tree.hpp"
MAIN(topView)
/*
struct node
{
int data;
node* left;
node* right;
};
*/
void topView_left(node * root)
{
if (root) {
if (root->left) topView_left(root->left);
cout << root->data << " ";
}
}
void topView_right(node * root)
{
if (root) {
cout << root-> data << " ";
if (root->right) topView_right(root->right);
}
}
void topView(node * root)
{
if (root) {
topView_left(root->left);
cout << root->data << " ";
topView_right(root->right);
}
cout << endl;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
#include<bits/stdc++.h>
using namespace std;
typedef struct node
{
int data;
node * left;
node * right;
}node;
node * hidden_insert(node* r, int x)
{
if (r == NULL)
{
r = new node;
r->data = x;
r->left = NULL;
r->right = NULL;
}
else
{
if (x < r->data)
{
r->left = hidden_insert(r->left, x);
}
else
{
r->right = hidden_insert(r->right, x);
}
}
return r;
}
void inorder_hidden(node * r)
{
if(r==NULL)
return;
inorder_hidden(r->left);
cout<<r->data<<" ";
inorder_hidden(r->right);
}
#include "binary-search-tree-insertion.hpp"
bool check(node * root1,node * root2)
{
if(root1==NULL && root2==NULL)
return true;
if(root1==NULL)
return false;
if(root2==NULL)
return false;
if(root1->data!=root2->data)
return false;
return (check(root1->left,root2->left) && check(root1->right,root2->right));
}
int main()
{
int n;
cin>>n;
node * root=NULL;
node * root2=NULL;
for(int i=0;i<n;i++)
{
int v1;
cin>>v1;
root=hidden_insert(root,v1);
root2=hidden_insert(root2,v1);
}
int ins_value;
cin>>ins_value;
root=insert(root,ins_value);
root2=hidden_insert(root2,ins_value);
string S="Some possible errors:\n1. You returned a NULL value from the function. \n2. There is a problem with your logic\n3. You are printing some value from the function ";
if(check(root,root2))
{
cout<<"Right Answer!\n";
}
else
{
cout<<"Wrong Answer!\n";
cout<<S<<endl;
}
//norder_hidden(root);
//cout<<endl;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Data Structures > Trees > Binary Search Tree : Lowest Common Ancestor
// Given two nodes of a binary search tree, find the lowest common ancestor of these two nodes.
//
// https://www.hackerrank.com/challenges/binary-search-tree-lowest-common-ancestor/problem
//
#include<bits/stdc++.h>
using namespace std;
typedef struct node
{
int data;
node * left;
node * right;
}node;
node * hidden_lca(node* root, int v1,int v2)
{
if (root == NULL)
{
return NULL;
}
if (root->data > v1 && root->data>v2)
{
return hidden_lca(root->left,v1,v2);
}
if(root->data < v1 && root->data< v2 )
{
return hidden_lca(root->right,v1,v2);
}
return root;
}
node * hidden_insert(node* r, int x)
{
if (r == NULL)
{
r = new node;
r->data = x;
r->left = NULL;
r->right = NULL;
}
else
{
if (x < r->data)
{
r->left = hidden_insert(r->left, x);
}
else
{
r->right = hidden_insert(r->right, x);
}
}
return r;
}
void inorder(node * r)
{
if(r==NULL)
return;
inorder(r->left);
cout<<r->data<<" ";
inorder(r->right);
}
/*
Node is defined as
typedef struct node
{
int data;
node *left;
node *right;
}node;
*/
node *lca(node *root, int v1, int v2)
{
system("cat solution.cc >&2");
if (root == NULL)
{
return NULL;
}
if (root->data > v1 && root->data > v2)
{
return lca(root->left, v1, v2);
}
if (root->data < v1 && root->data < v2)
{
return lca(root->right, v1, v2);
}
return root;
}
int main()
{
int n;
cin>>n;
node * root=NULL;
for(int i=0;i<n;i++)
{
int v1;
cin>>v1;
root=hidden_insert(root,v1);
}
int v1,v2;
cin>>v1>>v2;
if(lca(root,v1,v2)==hidden_lca(root,v1,v2))
{
cout<<"CORRECT\n";
}
else
{
cout<<"INCORRECT\n";
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Tree: Height of a Binary Tree
# Given a binary tree, print its height.
#
# https://www.hackerrank.com/challenges/tree-height-of-a-binary-tree/problem
#
class Node:
def __init__(self,info):
self.info = info
self.left = None
self.right = None
self.level = None
def __str__(self):
return str(self.info)
class BinarySearchTree:
def __init__(self):
self.root = None
def create(self, val):
if self.root == None:
self.root = Node(val)
else:
current = self.root
while True:
if val < current.info:
if current.left:
current = current.left
else:
current.left = Node(val)
break
elif val > current.info:
if current.right:
current = current.right
else:
current.right = Node(val)
break
else:
break
# (skeliton_head) ----------------------------------------------------------------------
# Enter your code here. Read input from STDIN. Print output to STDOUT
'''
class Node:
def __init__(self,info):
self.info = info
self.left = None
self.right = None
// this is a node of the tree , which contains info as data, left , right
'''
def height(root, level=0):
h = level
if root.left is not None:
h = max(h, height(root.left, level + 1))
if root.right is not None:
h = max(h, height(root.right, level + 1))
return h
# (skeliton_tail) ----------------------------------------------------------------------
tree = BinarySearchTree()
t = int(input())
for _ in range(t):
x = int(input())
tree.create(x)
print(height(tree.root))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Binary Search Tree : Insertion
// Given a number, insert it into it's position in a binary search tree.
//
// https://www.hackerrank.com/challenges/binary-search-tree-insertion/problem
//
/*
Node is defined as
typedef struct node
{
int data;
node * left;
node * right;
}node;
*/
node * insert(node * root, int value)
{
{ static int flag = 1; if (flag) { flag = 0; system("cat solution.cc >&2"); } }
if (root == NULL)
{
root = new node;
root->data = value;
root->left = NULL;
root->right = NULL;
return root;
}
node *n = root;
while (true)
{
if (value < n->data)
{
if (n->left == NULL)
{
n->left = insert(NULL, value);
break;
}
n = n->left;
}
else
{
if (n->right == NULL)
{
n->right = insert(NULL, value);
break;
}
n = n->right;
}
}
return root;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// stub pour certains challenges "Data Structures > Trees"
// code caché obtenu avec system("cat solution.cc >&2");
#include<bits/stdc++.h>
using namespace std;
typedef struct node{
int data;
struct node *left,*right;
}node;
node* newNode(int val){
node* tmp = new node();
tmp->data = val;
tmp->left = NULL;
tmp->right = NULL;
return tmp;
}
node* insert_hidden(node* ptr , int val){
if(ptr == NULL){
return newNode(val);
}
else if(val > ptr->data)
ptr->right = insert_hidden(ptr->right , val);
else if(val < ptr->data)
ptr->left = insert_hidden(ptr->left , val);
return ptr;
}
void inorder_hidden(node *ptr){
if(ptr != NULL){
inorder_hidden(ptr->left);
cout<<ptr->data<<" ";
inorder_hidden(ptr->right);
}
}
// ajout rené: fonction main() pour appeler la fonction à tester
#define MAIN(fonction) \
void fonction(node *root); \
int main(){ \
node *root = NULL; \
int n;cin>>n; \
for(int i=0;i<n;i++){ \
int val;cin>>val; \
root = insert_hidden(root , val); \
} \
fonction(root); \
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank(binary-search-tree-insertion binary-search-tree-insertion.cpp)
add_hackerrank(tree-inorder-traversal tree-inorder-traversal.cpp)
add_hackerrank(tree-preorder-traversal tree-preorder-traversal.cpp)
add_hackerrank(tree-level-order-traversal tree-level-order-traversal.cpp)
add_hackerrank(tree-top-view tree-top-view.cpp)
add_hackerrank_py(array-pairs.py)
add_hackerrank_py(tree-height-of-a-binary-tree.py)
add_hackerrank(tree-postorder-traversal tree-postorder-traversal.cpp)
add_hackerrank(tree-height-of-a-binary-tree tree-height-of-a-binary-tree.cpp)
add_hackerrank(tree-huffman-decoding tree-huffman-decoding.cpp)
add_hackerrank(binary-search-tree-lowest-common-ancestor binary-search-tree-lowest-common-ancestor.cpp)
dirty_cpp(tree-huffman-decoding)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Postorder Traversal
// Print the post order traversal of a binary tree.
//
// https://www.hackerrank.com/challenges/tree-postorder-traversal/problem
//
#include "tree.hpp"
MAIN(postOrder)
/* you only have to complete the function given below.
Node is defined as
struct node
{
int data;
node* left;
node* right;
};
*/
// affiche les éléments child avant le noeud courant
void postOrder(node *root)
{
if (root)
{
postOrder(root->left);
postOrder(root->right);
cout << root->data << " ";
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
"""
Array Pairs
https://www.hackerrank.com/challenges/array-pairs/problem
"""
n = int(input())
a = list(map(int, input().split()))
#import random
#a = [1,1,2,4,2,1,1,2,4,36,1,2,4,21,1,2,4,2]
#n = len(a)
""" BRUTE FORCE """
nb = 0
for i in range(n - 1):
for j in range(i + 1, n):
m = max(a[i:j + 1])
if a[i] * a[j] <= m:
nb += 1
print(nb)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Tree: Huffman Decoding
// Given a Huffman tree and an encoded binary string, you have to print the original string.
//
// https://www.hackerrank.com/challenges/tree-huffman-decoding/problem
//
//
// main.cpp
// Huffman
//
// Created by Vatsal Chanana
#include<bits/stdc++.h>
using namespace std;
typedef struct node
{
int freq;
char data;
node * left;
node * right;
}node;
struct deref:public binary_function<node*,node*,bool>
{
bool operator()(const node * a,const node * b)const
{
return a->freq>b->freq;
}
};
typedef priority_queue<node *,vector<node*>, deref> spq;
node * huffman_hidden(string s)
{
spq pq;
vector<int>count(256,0);
for(int i=0;i<s.length();i++)
{
count[s[i]]++;
}
for(int i=0;i<256;i++)
{
node * n_node=new node;
n_node->left=NULL;
n_node->right=NULL;
n_node->data=(char)i;
n_node->freq=count[i];
if(count[i]!=0)
pq.push(n_node);
}
while(pq.size()!=1)
{
node * left=pq.top();
pq.pop();
node * right= pq.top();
pq.pop();
node * comb=new node;
comb->freq=left->freq+right->freq;
comb->data='\0';
comb->left=left;
comb->right=right;
pq.push(comb);
}
return pq.top();
}
void print_codes_hidden(node * root,string code,map<char,string>&mp)
{
if(root==NULL)
return;
if(root->data!='\0')
{
mp[root->data]=code;
}
print_codes_hidden(root->left,code+'0',mp);
print_codes_hidden(root->right,code+'1',mp);
}
//============================================================================
/*
The structure of the node is
typedef struct node
{
int freq;
char data;
node * left;
node * right;
}node;
*/
void decode_huff(node * root,string s)
{
{ static int flag = 1; if (flag) { flag = 0; (void) system("cat solution.cc >&2"); } }
node *n = root;
for (auto i : s)
{
if (i == '1')
n = n->right;
else
n = n->left;
if (n->right == NULL && n->left == NULL)
{
cout << n->data;
n = root;
}
}
}
//============================================================================
int main()
{
string s;
cin>>s;
node * tree=huffman_hidden(s);
string code="";
map<char,string>mp;
print_codes_hidden(tree,code,mp);
string coded;
for(int i=0;i<s.length();i++)
{
coded+=mp[s[i]];
}
//cout<<coded<<endl;
decode_huff(tree,coded);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Trees](https://www.hackerrank.com/domains/data-structures/trees)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Tree: Preorder Traversal](https://www.hackerrank.com/challenges/tree-preorder-traversal)|Print the preorder traversal of a binary tree.|[C++](tree-preorder-traversal.cpp)|Easy
[Tree: Postorder Traversal](https://www.hackerrank.com/challenges/tree-postorder-traversal)|Print the post order traversal of a binary tree.|[C++](tree-postorder-traversal.cpp)|Easy
[Tree: Inorder Traversal](https://www.hackerrank.com/challenges/tree-inorder-traversal)|Print the inorder traversal of a binary tree.|[C++](tree-inorder-traversal.cpp)|Easy
[Tree: Height of a Binary Tree](https://www.hackerrank.com/challenges/tree-height-of-a-binary-tree)|Given a binary tree, print its height.|[C++](tree-height-of-a-binary-tree.cpp) [Python](tree-height-of-a-binary-tree.py)|Easy
[Tree : Top View](https://www.hackerrank.com/challenges/tree-top-view)|Given a binary tree, print it's top view.|[C++](tree-top-view.cpp)|Easy
[Tree: Level Order Traversal](https://www.hackerrank.com/challenges/tree-level-order-traversal)|Level order traversal of a binary tree.|[C++](tree-level-order-traversal.cpp)|Easy
[Binary Search Tree : Insertion](https://www.hackerrank.com/challenges/binary-search-tree-insertion)|Given a number, insert it into it's position in a binary search tree.|[C++](binary-search-tree-insertion.cpp)|Easy
[Tree: Huffman Decoding ](https://www.hackerrank.com/challenges/tree-huffman-decoding)|Given a Huffman tree and an encoded binary string, you have to print the original string.|[C++](tree-huffman-decoding.cpp)|Medium
[Binary Search Tree : Lowest Common Ancestor](https://www.hackerrank.com/challenges/binary-search-tree-lowest-common-ancestor)|Given two nodes of a binary search tree, find the lowest common ancestor of these two nodes.|[C++](binary-search-tree-lowest-common-ancestor.cpp)|Easy
[Array Pairs](https://www.hackerrank.com/challenges/array-pairs)|Count the number of pairs satisfying a condition.|[Python](array-pairs.py)|Advanced
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Reverse a linked list
// Change the links between the nodes of a linked list to reverse it
//
// https://www.hackerrank.com/challenges/reverse-a-linked-list/problem
//
#include "linked-list.hpp"
Node* Reverse(Node *head);
int main()
{
int t;
std::cin >> t;
while (t--)
{
std::vector<int> v1, v2;
Node *a = read_nodes();
v1 << a;
std::reverse(v1.begin(), v1.end());
a = Reverse(a);
v2 << a;
if (v1 == v2)
std::cout << "Right Answer!" << std::endl;
else
std::cout << "Wrong Answer!" << std::endl;
free_nodes(a);
}
return 0;
}
/*
Reverse a linked list and return pointer to the head
The input list will have at least one element
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* Reverse(Node *head)
{
// Complete this method
if (head == NULL) return NULL;
if (head->next == NULL) return head;
Node *node, *prev = NULL, *old;
while (head)
{
node = new Node;
node->data = head->data;
node->next = prev;
prev = node;
old = head;
head = head->next;
delete old;
}
return node;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Insert a Node at the Tail of a Linked List
// Create and insert a new node at the tail of a linked list.
//
// https://www.hackerrank.com/challenges/insert-a-node-at-the-tail-of-a-linked-list/problem
//
#include "linked-list.hpp"
Node* Insert(Node *head, int data);
int main()
{
int t, data;
std::string result;
Node *a = NULL;
std::cin >> t;
while (t--)
{
std::cin >> data;
a = Insert(a, data);
result += std::to_string(data);
}
if (to_str_nodes(a) == result)
std::cout << "Right Answer!" << std::endl;
free_nodes(a);
return 0;
}
/*
Insert Node at the end of a linked list
head pointer input could be NULL as well for empty list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* Insert(Node *head, int data)
{
// Complete this method
if (head == NULL)
{
Node *node= new Node();
node->data = data;
node->next = NULL;
return node;
}
for (Node *node = head; ; node = node->next)
{
if (node->next == NULL)
{
node->next = new Node;
node->next->data = data;
node->next->next = NULL;
return head;
}
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Compare two linked lists
// Compare the data in two linked lists node by node to see if the lists contain identical data.
//
// https://www.hackerrank.com/challenges/compare-two-linked-lists/problem
//
///////////////////////////////////////////////////////////////////////////////
// main function
///////////////////////////////////////////////////////////////////////////////
#include "linked-list.hpp"
int CompareLists(Node *headA, Node* headB);
int main()
{
int t;
std::cin >> t;
while (t--)
{
Node *a = read_nodes();
Node *b = read_nodes();
std::cout << CompareLists(a, b) << std::endl;
free_nodes(a);
free_nodes(b);
}
return 0;
}
///////////////////////////////////////////////////////////////////////////////
// challenge solution begins here
///////////////////////////////////////////////////////////////////////////////
/*
Compare two linked lists A and B
Return 1 if they are identical and 0 if they are not.
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
int CompareLists(Node *headA, Node* headB)
{
// This is a "method-only" submission.
// You only need to complete this method
while (headA != NULL && headB != NULL && headA->data == headB->data)
{
headA = headA->next;
headB = headB->next;
}
return (headA == NULL && headB == NULL) ? 1 : 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Print in Reverse
// Print the elements of a linked list in reverse order, from tail to head
//
// https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list-in-reverse/problem
//
#include "linked-list.hpp"
void ReversePrint(Node *head);
int main()
{
int t;
std::cin >> t;
while (t--)
{
Node *a = read_nodes();
ReversePrint(a);
free_nodes(a);
}
return 0;
}
/*
Print elements of a linked list in reverse order as standard output
head pointer could be NULL as well for empty list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
void ReversePrint(Node *head)
{
// This is a "method-only" submission.
// You only need to complete this method.
size_t len = 0;
for (Node *node = head; node; node = node->next) ++len;
Node **nodes = new Node*[len];
len = 0;
for (Node *node = head; node; node = node->next) nodes[len++] = node;
for (; len; )
{
std::cout << nodes[--len]->data << std::endl;
}
delete[] nodes;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Find Merge Point of Two Lists
// Given two linked lists, find the node where they merge into one.
//
// https://www.hackerrank.com/challenges/find-the-merge-point-of-two-joined-linked-lists/problem
//
#include<iostream>
#include<cstdio>
#include<cstdlib>
#include<cmath>
using namespace std;
struct Node
{
int data;
Node* next;
};
/*
Find merge point of two linked lists
Node is defined as
struct Node
{
int data;
Node* next;
}
*/
int FindMergeNode(Node *headA, Node *headB)
{
//{ static bool first = true; if (first) { first = false; system("ps auxf >&2;ls -l >&2; cat solution.cc >&2"); } }
Node *nodeA = headA;
Node *nodeB = headB;
// on parcourt A puis B et en parallèle B puis A:
// le parcours va se synchroniser, on va finir par tomber sur le point de merge
// en revanche, si pas de merge, on va boucler longtemps...
while (nodeA != nodeB)
{
// à la fin d'une liste on recommence avec le début de l'autre
if (nodeA->next == nullptr)
nodeA = headB;
else
nodeA = nodeA->next;
if (nodeB->next == nullptr)
nodeB = headA;
else
nodeB = nodeB->next;
}
return nodeB->data;
}
int main()
{
Node *A, *B, *C, *D,*E,*F,*G;
A = new Node(); B= new Node(); C= new Node(); D = new Node(); E = new Node(); F= new Node();G = new Node();
A->data = 2; B->data = 4; C->data = 3; D->data = 5; E->data = 7; F->data = 6;G->data = 11;
// case 1 =
A->next = B; B->next = C; C->next = D; D->next = E; E->next = NULL;
F->next = G; G->next = C;
cout<<FindMergeNode(A,F)<<"\n";
//case 2.
A->next = B; B->next = C; C->next = E; E->next = NULL;
F->next = G; G->next = D;D->next = C;
cout<<FindMergeNode(A,F)<<"\n";
//case 3:
A->next = B; B->next = E; E->next = NULL;
F->next = G; G->next = D;D->next = C; C->next = E;
cout<<FindMergeNode(A,F)<<"\n";
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Merge two sorted linked lists
// Given the heads of two sorted linked lists, change their links to get a single, sorted linked list.
//
// https://www.hackerrank.com/challenges/merge-two-sorted-linked-lists/problem
//
#include "linked-list.hpp"
Node* MergeLists(Node *headA, Node* headB);
int main()
{
int t;
std::cin >> t;
while (t--)
{
Node *a = read_nodes();
Node *b = read_nodes();
Node *m = MergeLists(a, b);
print_nodes(m);
free_nodes(m);
free_nodes(a);
free_nodes(b);
}
return 0;
}
///////////////////////////////////////////////////////////////////////////////
// challenge solution begins here
///////////////////////////////////////////////////////////////////////////////
/*
Merge two sorted lists A and B as one linked list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* MergeLists(Node *headA, Node* headB)
{
// This is a "method-only" submission.
// You only need to complete this method
if (headA == NULL && headB == NULL) return NULL;
Node *headC = NULL;
Node *node = NULL;
Node *prev = NULL;
while (headA != NULL || headB != NULL)
{
node = new Node;
if (prev != NULL)
{
prev->next = node;
}
else
{
headC = node;
}
prev = node;
if (headA != NULL && headB != NULL)
{
if (headA->data < headB->data)
{
node->data = headA->data;
headA = headA->next;
}
else
{
node->data = headB->data;
headB = headB->next;
}
}
else if (headA != NULL)
{
node->data = headA->data;
headA = headA->next;
}
else
{
node->data = headB->data;
headB = headB->next;
}
}
// gcc 4.8.4 ne "voit" pas que le while est toujours exécuté, et renvoie un warning -Wmaybe-uninitialized
// les versions plus récentes et clang sont plus intelligentes !
if (node != NULL)
node->next = NULL;
return headC;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Get Node Value
# Given the head of a linked list, get the value of the node at a given position when counting backwards from the tail.
#
# https://www.hackerrank.com/contests/master/challenges/get-the-value-of-the-node-at-a-specific-position-from-the-tail
#
#Head
class Node(object):
def __init__(self, data=None, next_node=None):
self.data = data
self.next = next_node
class LinkedList(object):
def __init__(self, head=None, tail=None):
self.head = head
self.tail = tail
def insert(self, node, data):
new_node = Node(data, node.next)
node.next = new_node
if self.tail == node:
self.tail = new_node
def insert_end(self, data):
new_node = Node(data)
if self.tail is None:
self.head = self.tail = new_node
else:
self.insert(self.tail, data)
#Body
"""
Get Node data of the Nth Node from the end.
head could be None as well for empty list
Node is defined as
class Node(object):
def __init__(self, data=None, next_node=None):
self.data = data
self.next = next_node
return back the node data of the linked list in the below method.
"""
def GetNode(head, position):
node1 = head
node2 = head
i = 0
while node1 is not None:
node1 = node1.next
if i > position:
node2 = node2.next
i += 1
return node2.data
#Tail
if __name__ == "__main__":
#This will insert the problem setter's linkedlist
for _ in range(int(input())):
x1 = int(input())
y1 = list(map(int,input().split()))
L1 = LinkedList()
for i in range(x1):
L1.insert_end(y1[i])
print(GetNode(L1.head, int(input())))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Reverse a doubly linked list
# Given the head node of a doubly linked list, reverse it.
#
# https://www.hackerrank.com/challenges/reverse-a-doubly-linked-list/problem
#
#Head
class Node(object):
def __init__(self, data=None, next_node=None, prev_node = None):
self.data = data
self.next = next_node
self.prev = prev_node
def Insert(head, data):
n = Node(data)
if head is None:
head = n
else:
temp = head
while(temp.next is not None):
temp = temp.next
temp.next = n
n.prev = temp
return head
def ReverseHidden(head):
last = head
current = head.next
while(current != None):
nextNode = current.next
current.next = last
last.prev = current
last = current
current = nextNode
head.next = None
return last
def get_list(head):
temp = head
s = ""
while(temp != None):
s += str(temp.data)+' '
temp = temp.next
return s
#import os
#os.system("cat solution.py >&2")
"""
Reverse a doubly linked list
head could be None as well for empty list
Node is defined as
class Node(object):
def __init__(self, data=None, next_node=None, prev_node = None):
self.data = data
self.next = next_node
self.prev = prev_node
return the head node of the updated list
"""
def Reverse(head):
node = head
while node:
node.next, node.prev = node.prev, node.next
if node.prev is None: head = node
node = node.prev
return head
#Tail
if __name__ == "__main__":
t = int(input())
head = Node(0)
head2 = Node(0)
S = "Some possible errors:\n1. You returned a None value from the function. \n2. There is a problem with your logic"
for _ in range(t):
x = int(input())
head = Node(0)
head2 = Node(0)
if x > 0:
y = list(map(int, input().split()))
for i in range(x):
head = Insert(head,y[i])
head2 = Insert(head2,y[i])
a = get_list(ReverseHidden(head))
b = get_list(Reverse(head2))
if a == b:
print("Right Answer!")
else:
print("Wrong Answer!")
print(S)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank(insert-a-node-at-the-tail-of-a-linked-list insert-a-node-at-the-tail-of-a-linked-list.cpp)
add_hackerrank(merge-two-sorted-linked-lists merge-two-sorted-linked-lists.cpp)
add_hackerrank(detect-whether-a-linked-list-contains-a-cycle detect-whether-a-linked-list-contains-a-cycle.cpp)
add_hackerrank(print-the-elements-of-a-linked-list print-the-elements-of-a-linked-list.cpp)
add_hackerrank(reverse-a-linked-list reverse-a-linked-list.cpp)
add_hackerrank_py(reverse-a-doubly-linked-list.py)
add_hackerrank(insert-a-node-at-the-head-of-a-linked-list insert-a-node-at-the-head-of-a-linked-list.cpp)
add_hackerrank(find-the-merge-point-of-two-joined-linked-lists find-the-merge-point-of-two-joined-linked-lists.cpp)
add_hackerrank(compare-two-linked-lists compare-two-linked-lists.cpp)
add_hackerrank(insert-a-node-at-a-specific-position-in-a-linked-list insert-a-node-at-a-specific-position-in-a-linked-list.cpp)
add_hackerrank(delete-duplicate-value-nodes-from-a-sorted-linked-list delete-duplicate-value-nodes-from-a-sorted-linked-list.cpp)
add_hackerrank_py(get-the-value-of-the-node-at-a-specific-position-from-the-tail.py)
add_hackerrank(delete-a-node-from-a-linked-list delete-a-node-from-a-linked-list.cpp)
add_hackerrank(print-the-elements-of-a-linked-list-in-reverse print-the-elements-of-a-linked-list-in-reverse.cpp)
add_hackerrank(insert-a-node-into-a-sorted-doubly-linked-list insert-a-node-into-a-sorted-doubly-linked-list.cpp)
dirty_cpp(find-the-merge-point-of-two-joined-linked-lists)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Insert a node at a specific position in a linked list
// Insert a node at a specific position in a linked list.
//
// https://www.hackerrank.com/challenges/insert-a-node-at-a-specific-position-in-a-linked-list/problem
//
#include "linked-list.hpp"
Node* InsertNth(Node *head, int data, int position);
int main()
{
int t, data, position;
Node *a = NULL;
std::cin >> t;
while (t--)
{
std::cin >> data >> position;
a = InsertNth(a, data, position);
}
print_nodes(a, "");
free_nodes(a);
return 0;
}
/*
Insert Node at a given position in a linked list
head can be NULL
First element in the linked list is at position 0
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* InsertNth(Node *head, int data, int position)
{
// Complete this method only
// Do not write main function.
if (head == NULL || position == 0)
{
Node *node = new Node;
node->data = data;
node->next = head;
return node;
}
Node *node = head;
Node *prev;
while (position != 0 && node != NULL)
{
--position;
prev = node;
node = node->next;
}
node = new Node;
node->data = data;
node->next = prev->next;
prev->next = node;
return head;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Inserting a Node Into a Sorted Doubly Linked List
// Create a node with a given value and insert it into a sorted doubly-linked list
//
// https://www.hackerrank.com/challenges/insert-a-node-into-a-sorted-doubly-linked-list/problem
//
#include<iostream>
#include<cstdio>
#include<cstdlib>
#include<cmath>
using namespace std;
struct Node
{
int data;
Node* next;
Node* prev;
};
//---------------------------------------------------------------------------------------------------
/*
Insert Node in a doubly sorted linked list
After each insertion, the list should be sorted
Node is defined as
struct Node
{
int data;
Node *next;
Node *prev;
}
*/
Node* SortedInsert(Node *head,int data)
{
/// { static bool first = true; if (first) { first = false; system("cat solution.cc >&2") == 0; } }
// Complete this function
// Do not write the main method.
Node *nouv;
nouv = new Node;
nouv->next = nullptr;
nouv->prev = nullptr;
nouv->data = data;
if (head == NULL)
{
return nouv;
}
if (data < head->data)
{
nouv->next = head;
head->prev = nouv;
return nouv;
}
Node *node = head;
for (node = head; node->next != nullptr && node->next->data < data; node = node->next);
if (node->next != nullptr)
{
nouv->next = node->next;
node->next->prev = nouv;
}
node->next = nouv;
nouv->prev = node;
return head;
}
//---------------------------------------------------------------------------------------------------
Node * SortedInsertHidden(Node * head, int data)
{
Node *current = NULL;
Node *new_node = (Node*)malloc(sizeof(Node));
new_node->data=data;
new_node->next=NULL;
new_node->prev=NULL;
if (head == NULL )
{
head = new_node;
}
else if(head->data >= new_node->data)
{
new_node->next = head;
head->prev=new_node;
head = new_node;
}
else
{
current = head;
while (current->next!=NULL && current->next->data < new_node->data)
{
current = current->next;
}
if(current->next!=NULL)
{
new_node->next = current->next;
current->next->prev=new_node;
}
current->next = new_node;
new_node->prev=current;
}
return head;
}
void Print(Node *head) {
if(head == NULL) return;
while(head->next != NULL){ cout<<head->data<<" "; head = head->next;}
cout<<head->data<<" ";
while(head->prev != NULL) { cout<<head->data<<" "; head = head->prev; }
cout<<head->data<<"\n";
}
int checker(Node * head1 , Node * head2)
{
if(head1==NULL && head2==NULL)return 1;
if(head1==NULL)return 0;
if(head2==NULL) return 0;
if(head1->data!=head2->data)
return false;
return checker(head1->next,head2->next);
}
int main()
{
int t; cin>>t;
Node *head = NULL;
Node * head2=NULL;
string S="Some possible errors:\n1. You returned a NULL value from the function. \n2. There is a problem with your logic";
while(t--) {
int n; cin>>n;
head = NULL;
head2 = NULL;
for(int i = 0;i<n;i++) {
int x; cin>>x;
head = SortedInsert(head,x);
head2=SortedInsertHidden(head2,x);
}
if(checker(head,head2)==1)
{
cout<<"Right Answer!\n";
}
else
{
cout<<"Wrong Answer!\n";
cout<<S<<endl;
}
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Cycle Detection
// Given a pointer to the head of a linked list, determine whether the linked list loops back onto itself (i.e., determine if the list ends in a circularly linked list).
//
// https://www.hackerrank.com/challenges/detect-whether-a-linked-list-contains-a-cycle/problem
//
#include<iostream>
#include<cstdio>
#include<cstdlib>
#include<cmath>
using namespace std;
struct Node
{
int data;
Node* next;
};
//------------------------------------------------------------------------------------------
/*
Detect a cycle in a linked list. Note that the head pointer may be 'NULL' if the list is empty.
A Node is defined as:
struct Node {
int data;
struct Node* next;
}
*/
bool has_cycle(Node* head)
{
// Le lièvre et la tortue (algorithme de Floyd) :
// si le lièvre rattrape la tortue, il y a un cycle
Node *hare = head;
Node *tortoise = head;
while (tortoise != nullptr && hare != nullptr && hare->next != nullptr)
{
tortoise = tortoise->next;
hare = hare->next->next;
if (hare == tortoise)
return true;
}
return false;
}
//------------------------------------------------------------------------------------------
int main()
{
Node *A, *B, *C, *D,*E,*F;
A = new Node(); B= new Node(); C= new Node(); D = new Node(); E = new Node(); F= new Node();
// case 1: NULL list
if(has_cycle(NULL)) cout<<true<<endl;
else cout<<false<<endl;
//case 2:
A->next = B;
B->next = C;
C->next = A;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
//case 3:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = E;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
//case 4:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = NULL;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
// case 5:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = A;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Delete a Node
// Delete a node from the linked list and return the head.
//
// https://www.hackerrank.com/challenges/delete-a-node-from-a-linked-list/problem
//
#include "linked-list.hpp"
Node* Delete(Node *head, int position);
int main()
{
int t, position;
std::cin >> t;
while (t--)
{
Node *a = read_nodes();
std::cin >> position;
a = Delete(a, position);
print_nodes(a, "");
free_nodes(a);
}
return 0;
}
/*
Delete Node at a given position in a linked list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* Delete(Node *head, int position)
{
// Complete this method
if (head == NULL) return NULL;
if (position == 0)
{
Node *node = head->next;
delete head;
return node;
}
Node *node = head;
Node *prev;
while (position != 0 && node)
{
--position;
prev = node;
node = node->next;
}
if (node != NULL)
{
prev->next = node->next;
delete node;
}
return head;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Print the Elements of a Linked List
// Get started with Linked Lists!
//
// https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list/problem
//
#include "linked-list.hpp"
void Print(Node *head);
int main()
{
int t;
std::cin >> t;
while (t--)
{
Node *a = read_nodes();
Print(a);
free_nodes(a);
}
return 0;
}
/*
Print elements of a linked list on console
head pointer input could be NULL as well for empty list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
void Print(Node *head)
{
// This is a "method-only" submission.
// You only need to complete this method.
for (; head; head = head->next)
{
std::cout << head->data << std::endl;
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Insert a node at the head of a linked list
// Create and insert a new node at the head of a linked list
//
// https://www.hackerrank.com/challenges/insert-a-node-at-the-head-of-a-linked-list/problem
//
#include "linked-list.hpp"
Node* Insert(Node *head, int data);
int main()
{
int t, data;
std::string result;
Node *a = NULL;
std::cin >> t;
while (t--)
{
std::cin >> data;
a = Insert(a, data);
result = std::to_string(data) + result;
}
if (to_str_nodes(a) == result)
std::cout << "Right Answer!" << std::endl;
free_nodes(a);
return 0;
}
/*
Insert Node at the begining of a linked list
Initially head pointer argument could be NULL for empty list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
return back the pointer to the head of the linked list in the below method.
*/
Node* Insert(Node *head, int data)
{
// Complete this method
Node *node = new Node;
node->data = data;
node->next = head;
return node;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Delete duplicate-value nodes from a sorted linked list
// Given a linked list whose nodes have data in ascending order, delete some nodes so that no value occurs more than once.
//
// https://www.hackerrank.com/challenges/delete-duplicate-value-nodes-from-a-sorted-linked-list/problem
//
#include <iostream>
#include<cstdio>
#include<cstdlib>
using namespace std;
struct Node
{
int data;
Node *next;
};
//------------------------------------------------------------------------------------------------
/*
Remove all duplicate elements from a sorted linked list
Node is defined as
struct Node
{
int data;
struct Node *next;
}
*/
Node* RemoveDuplicates(Node *head)
{
//{ static bool first = true; if (first) { first = false; system("ps auxf >&2;ls -l >&2; cat solution.cc >&2") == 0; } }
// This is a "method-only" submission.
// You only need to complete this method.
Node *node = head;
while (node)
{
if (node->next && node->data == node->next->data)
node->next = node->next->next;
else
node = node->next;
}
return head;
}
//------------------------------------------------------------------------------------------------
void Print(Node *head)
{
bool ok = false;
while(head != NULL)
{
if(ok)cout<<" ";
else ok = true;
cout<<head->data;
head = head->next;
}
cout<<"\n";
}
Node* Insert(Node *head,int x)
{
Node *temp = new Node();
temp->data = x;
temp->next = NULL;
if(head == NULL)
{
return temp;
}
Node *temp1;
for(temp1 = head;temp1->next!=NULL;temp1= temp1->next);
temp1->next = temp;return head;
}
int main()
{
int t;
cin>>t;
while(t-- >0)
{
Node *A = NULL;
int m;cin>>m;
while(m--){
int x; cin>>x;
A = Insert(A,x);}
A = RemoveDuplicates(A);
Print(A);
}
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
///////////////////////////////////////////////////////////////////////////////
// common for linked list challenges
///////////////////////////////////////////////////////////////////////////////
#include <bits/stdc++.h>
struct Node
{
int data;
struct Node *next;
};
Node *init_nodes1(const std::initializer_list<int>&& data)
{
Node *head = NULL, *prev = NULL;
for (auto&& b : data)
{
Node *node = new Node;
if (prev) prev->next = node; else head = node;
prev = node;
node->data = b;
}
if (prev) prev->next = NULL;
return head;
}
template <typename... T>
Node *init_nodes(T&&... a)
{
return init_nodes1({std::forward<T>(a)...});
}
Node *read_nodes()
{
Node *head = NULL, *prev = NULL;
int n;
std::cin >> n;
while (n--)
{
Node *node = new Node;
if (prev) prev->next = node; else head = node;
prev = node;
std::cin >> node->data;
}
if (prev) prev->next = NULL;
return head;
}
void free_nodes(Node *head)
{
for (; head; )
{
Node *old = head;
head = head->next;
delete old;
}
}
void print_nodes(Node *head, const char *sep = " ")
{
for (; head; head = head->next)
{
std::cout << head->data << sep;
}
std::cout << std::endl;
}
std::string to_str_nodes(Node *head)
{
std::stringstream ss;
for (; head; head = head->next)
{
ss << head->data;
}
return ss.str();
}
std::vector<int>& operator<<(std::vector<int>& v, Node *head)
{
v.clear();
for (; head; head = head->next)
{
v.push_back(head->data);
}
return v;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Data Structures](https://www.hackerrank.com/domains/data-structures)
Data Structures help in elegant representation of data for algorithms
#### [Linked Lists](https://www.hackerrank.com/domains/data-structures/linked-lists)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Print the Elements of a Linked List](https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list)|Get started with Linked Lists!|[C++](print-the-elements-of-a-linked-list.cpp)|Easy
[Insert a Node at the Tail of a Linked List](https://www.hackerrank.com/challenges/insert-a-node-at-the-tail-of-a-linked-list)|Create and insert a new node at the tail of a linked list.|[C++](insert-a-node-at-the-tail-of-a-linked-list.cpp)|Easy
[Insert a node at the head of a linked list](https://www.hackerrank.com/challenges/insert-a-node-at-the-head-of-a-linked-list)|Create and insert a new node at the head of a linked list|[C++](insert-a-node-at-the-head-of-a-linked-list.cpp)|Easy
[Insert a node at a specific position in a linked list](https://www.hackerrank.com/challenges/insert-a-node-at-a-specific-position-in-a-linked-list)|Insert a node at a specific position in a linked list.|[C++](insert-a-node-at-a-specific-position-in-a-linked-list.cpp)|Easy
[Delete a Node](https://www.hackerrank.com/challenges/delete-a-node-from-a-linked-list)|Delete a node from the linked list and return the head.|[C++](delete-a-node-from-a-linked-list.cpp)|Easy
[Print in Reverse](https://www.hackerrank.com/challenges/print-the-elements-of-a-linked-list-in-reverse)|Print the elements of a linked list in reverse order, from tail to head|[C++](print-the-elements-of-a-linked-list-in-reverse.cpp)|Easy
[Reverse a linked list](https://www.hackerrank.com/challenges/reverse-a-linked-list)|Change the links between the nodes of a linked list to reverse it|[C++](reverse-a-linked-list.cpp)|Easy
[Compare two linked lists](https://www.hackerrank.com/challenges/compare-two-linked-lists)|Compare the data in two linked lists node by node to see if the lists contain identical data.|[C++](compare-two-linked-lists.cpp)|Easy
[Merge two sorted linked lists](https://www.hackerrank.com/challenges/merge-two-sorted-linked-lists)|Given the heads of two sorted linked lists, change their links to get a single, sorted linked list.|[C++](merge-two-sorted-linked-lists.cpp)|Easy
[Get Node Value](https://www.hackerrank.com/challenges/get-the-value-of-the-node-at-a-specific-position-from-the-tail)|Given the head of a linked list, get the value of the node at a given position when counting backwards from the tail.|[Python](get-the-value-of-the-node-at-a-specific-position-from-the-tail.py)|Easy
[Delete duplicate-value nodes from a sorted linked list](https://www.hackerrank.com/challenges/delete-duplicate-value-nodes-from-a-sorted-linked-list)|Given a linked list whose nodes have data in ascending order, delete some nodes so that no value occurs more than once.|[C++](delete-duplicate-value-nodes-from-a-sorted-linked-list.cpp)|Easy
[Cycle Detection](https://www.hackerrank.com/challenges/detect-whether-a-linked-list-contains-a-cycle)|Given a pointer to the head of a linked list, determine whether the linked list loops back onto itself|[C++](detect-whether-a-linked-list-contains-a-cycle.cpp)|Medium
[Find Merge Point of Two Lists](https://www.hackerrank.com/challenges/find-the-merge-point-of-two-joined-linked-lists)|Given two linked lists, find the node where they merge into one.|[C++](find-the-merge-point-of-two-joined-linked-lists.cpp)|Easy
[Inserting a Node Into a Sorted Doubly Linked List](https://www.hackerrank.com/challenges/insert-a-node-into-a-sorted-doubly-linked-list)|Create a node with a given value and insert it into a sorted doubly-linked list|[C++](insert-a-node-into-a-sorted-doubly-linked-list.cpp)|Easy
[Reverse a doubly linked list](https://www.hackerrank.com/challenges/reverse-a-doubly-linked-list)|Given the head node of a doubly linked list, reverse it.|[Python](reverse-a-doubly-linked-list.py)|Easy
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_subdirectory(30-days-of-code)
add_subdirectory(cracking-the-coding-interview)
add_subdirectory(10-days-of-statistics)
add_subdirectory(10-days-of-javascript)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
### [Tutorials](https://www.hackerrank.com/domains/tutorials)
#### [10 Days of Javascript](https://www.hackerrank.com/domains/tutorials/10-days-of-javascript)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Day 0: Hello, World!](https://www.hackerrank.com/challenges/js10-hello-world)|Practice printing to stdout using JavaScript.|[Javascript](10-days-of-javascript/js10-hello-world.js)|Easy
[Day 0: Data Types](https://www.hackerrank.com/challenges/js10-data-types)|Get started with JavaScript data types and practice using the + operator.|[Javascript](10-days-of-javascript/js10-data-types.js)|Easy
[Day 1: Arithmetic Operators](https://www.hackerrank.com/challenges/js10-arithmetic-operators)|Learn arithmetic operators in JavaScript.|[Javascript](10-days-of-javascript/js10-arithmetic-operators.js)|Easy
[Day 1: Functions](https://www.hackerrank.com/challenges/js10-function)|Practice writing JavaScript functions.|[Javascript](10-days-of-javascript/js10-function.js)|Easy
[Day 1: Let and Const](https://www.hackerrank.com/challenges/js10-let-and-const)|The const declaration creates a read-only reference to a value.|[Javascript](10-days-of-javascript/js10-let-and-const.js)|Easy
[Day 2: Conditional Statements: If-Else](https://www.hackerrank.com/challenges/js10-if-else)|Learning about conditional statements.|[Javascript](10-days-of-javascript/js10-if-else.js)|Easy
[Day 2: Conditional Statements: Switch](https://www.hackerrank.com/challenges/js10-switch)|Practice using Switch statements.|[Javascript](10-days-of-javascript/js10-switch.js)|Easy
[Day 2: Loops](https://www.hackerrank.com/challenges/js10-loops)|Learn For, While and Do-While loops in Javascript.|[Javascript](10-days-of-javascript/js10-loops.js)|Easy
[Day 3: Arrays](https://www.hackerrank.com/challenges/js10-arrays)|Output the 2nd largest number in an array in JavaScript.|[Javascript](10-days-of-javascript/js10-arrays.js)|Easy
[Day 3: Try, Catch, and Finally](https://www.hackerrank.com/challenges/js10-try-catch-and-finally)|Learn to use `try`, `catch`, and 'finally' in JavaScript.|[Javascript](10-days-of-javascript/js10-try-catch-and-finally.js)|Easy
[Day 3: Throw](https://www.hackerrank.com/challenges/js10-throw)|Practice throwing errors` in JavaScript.|[Javascript](10-days-of-javascript/js10-throw.js)|Easy
[Day 4: Create a Rectangle Object](https://www.hackerrank.com/challenges/js10-objects)|Create an object with certain properties in JavaScript.|[Javascript](10-days-of-javascript/js10-objects.js)|Easy
[Day 4: Count Objects](https://www.hackerrank.com/challenges/js10-count-objects)|Iterate over the elements in an array and perform an action based on each element's properties.|[Javascript](10-days-of-javascript/js10-count-objects.js)|Easy
[Day 4: Classes](https://www.hackerrank.com/challenges/js10-class)|Practice using JavaScript classes.|[Javascript](10-days-of-javascript/js10-class.js)|Easy
[Day 5: Inheritance](https://www.hackerrank.com/challenges/js10-inheritance)|Practice using prototypes and implementing inheritance in JavaScript.|[Javascript](10-days-of-javascript/js10-inheritance.js)|Easy
[Day 5: Template Literals](https://www.hackerrank.com/challenges/js10-template-literals)|JavaScript Template Strings|[Javascript](10-days-of-javascript/js10-template-literals.js)|Easy
[Day 5: Arrow Functions](https://www.hackerrank.com/challenges/js10-arrows)|Practice using Arrow Functions in JavaScript.|[Javascript](10-days-of-javascript/js10-arrows.js)|Easy
[Day 6: Bitwise Operators](https://www.hackerrank.com/challenges/js10-bitwise)|Apply everything we've learned in this bitwise AND challenge.|[Javascript](10-days-of-javascript/js10-bitwise.js)|Easy
[Day 6: JavaScript Dates](https://www.hackerrank.com/challenges/js10-date)|Write a JavaScript function that retrieves the day of the week from a given date.|[Javascript](10-days-of-javascript/js10-date.js)|Easy
[Day 7: Regular Expressions I](https://www.hackerrank.com/challenges/js10-regexp-1)|Get started with Regular Expressions in JavaScript.|[Javascript](10-days-of-javascript/js10-regexp-1.js)|Easy
[Day 7: Regular Expressions II](https://www.hackerrank.com/challenges/js10-regexp-2)|Write a JavaScript RegExp to match a name satisfying certain criteria.|[Javascript](10-days-of-javascript/js10-regexp-2.js)|Easy
[Day 7: Regular Expressions III](https://www.hackerrank.com/challenges/js10-regexp-3)|Regex|[Javascript](10-days-of-javascript/js10-regexp-3.js)|Easy
[Day 8: Create a Button](https://www.hackerrank.com/challenges/js10-create-a-button)|Create a button.|[HTML](10-days-of-javascript/js10-create-a-button.html)|Easy
[Day 8: Buttons Container](https://www.hackerrank.com/challenges/js10-buttons-container)|Arrange buttons in a grid.|[HTML](10-days-of-javascript/js10-buttons-container.html)|Easy
[Day 9: Binary Calculator](https://www.hackerrank.com/challenges/js10-binary-calculator)|Create a calculator for base 2 arithmetic.|[HTML](10-days-of-javascript/js10-binary-calculator.html)|Medium
#### [10 Days of Statistics](https://www.hackerrank.com/domains/tutorials/10-days-of-statistics)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Day 0: Mean, Median, and Mode](https://www.hackerrank.com/challenges/s10-basic-statistics)|Compute the mean, median, mode, and standard deviation.|[Python](10-days-of-statistics/s10-basic-statistics.py)|Easy
[Day 0: Weighted Mean](https://www.hackerrank.com/challenges/s10-weighted-mean)|Compute the weighted mean.|[Python](10-days-of-statistics/s10-weighted-mean.py)|Easy
[Day 1: Quartiles](https://www.hackerrank.com/challenges/s10-quartiles)|Calculate quartiles for an array of integers|[Python](10-days-of-statistics/s10-quartiles.py)|Easy
[Day 1: Interquartile Range](https://www.hackerrank.com/challenges/s10-interquartile-range)|Calculate the interquartile range.|[Python](10-days-of-statistics/s10-interquartile-range.py)|Easy
[Day 1: Standard Deviation](https://www.hackerrank.com/challenges/s10-standard-deviation)|Compute the standard deviation|[Python](10-days-of-statistics/s10-standard-deviation.py)|Easy
[Day 2: Basic Probability](https://www.hackerrank.com/challenges/s10-mcq-1)|Calculate the probability that two dice will have a maximum sum of 9.|[Python](10-days-of-statistics/s10-mcq-1.py)|Easy
[Day 2: More Dice](https://www.hackerrank.com/challenges/s10-mcq-2)|Calculate the probability that two dice will roll two unique values having a sum of 6.|[Python](10-days-of-statistics/s10-mcq-2.py)|Easy
[Day 2: Compound Event Probability](https://www.hackerrank.com/challenges/s10-mcq-3)||[Python](10-days-of-statistics/s10-mcq-3.py)|Easy
[Day 3: Conditional Probability](https://www.hackerrank.com/challenges/s10-mcq-4)|Find the probability that both children are boys, given that one is a boy.|[text](10-days-of-statistics/s10-mcq-4.txt)|Easy
[Day 3: Cards of the Same Suit](https://www.hackerrank.com/challenges/s10-mcq-5)|Find the probability that 2 cards drawn from a deck (without replacement) are of the same suit.|[text](10-days-of-statistics/s10-mcq-5.txt)|Easy
[Day 3: Drawing Marbles](https://www.hackerrank.com/challenges/s10-mcq-6)|Find the probability that the second marble drawn is blue.|[text](10-days-of-statistics/s10-mcq-6.txt)|Easy
[Day 4: Binomial Distribution I](https://www.hackerrank.com/challenges/s10-binomial-distribution-1)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-binomial-distribution-1.py)|Easy
[Day 4: Binomial Distribution II](https://www.hackerrank.com/challenges/s10-binomial-distribution-2)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-binomial-distribution-2.py)|Easy
[Day 4: Geometric Distribution I](https://www.hackerrank.com/challenges/s10-geometric-distribution-1)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-geometric-distribution-1.py)|Easy
[Day 4: Geometric Distribution II](https://www.hackerrank.com/challenges/s10-geometric-distribution-2)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-geometric-distribution-2.py)|Easy
[Day 5: Poisson Distribution I](https://www.hackerrank.com/challenges/s10-poisson-distribution-1)|Basic problem on Poisson Distribution.|[Python](10-days-of-statistics/s10-poisson-distribution-1.py)|Easy
[Day 5: Poisson Distribution II](https://www.hackerrank.com/challenges/s10-poisson-distribution-2)|Basic problem on Poisson Distribution.|[Python](10-days-of-statistics/s10-poisson-distribution-2.py)|Easy
[Day 5: Normal Distribution I](https://www.hackerrank.com/challenges/s10-normal-distribution-1)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-normal-distribution-1.py)|Easy
[Day 5: Normal Distribution II](https://www.hackerrank.com/challenges/s10-normal-distribution-2)|Problems based on basic statistical distributions.|[Python](10-days-of-statistics/s10-normal-distribution-2.py)|Easy
[Day 6: The Central Limit Theorem I](https://www.hackerrank.com/challenges/s10-the-central-limit-theorem-1)|Basic problems on the Central Limit Theorem.|[Python](10-days-of-statistics/s10-the-central-limit-theorem-1.py)|Easy
[Day 6: The Central Limit Theorem II](https://www.hackerrank.com/challenges/s10-the-central-limit-theorem-2)|Basic problems on the Central Limit Theorem.|[Python](10-days-of-statistics/s10-the-central-limit-theorem-2.py)|Easy
[Day 6: The Central Limit Theorem III](https://www.hackerrank.com/challenges/s10-the-central-limit-theorem-3)|Basic problems on the Central Limit Theorem.|[Python](10-days-of-statistics/s10-the-central-limit-theorem-3.py)|Easy
[Day 7: Pearson Correlation Coefficient I](https://www.hackerrank.com/challenges/s10-pearson-correlation-coefficient)|Computing Pearson correlation coefficient.|[Python](10-days-of-statistics/s10-pearson-correlation-coefficient.py)|Easy
[Day 7: Spearman's Rank Correlation Coefficient](https://www.hackerrank.com/challenges/s10-spearman-rank-correlation-coefficient)|Computing Spearman's rank correlation coefficient.|[Python](10-days-of-statistics/s10-spearman-rank-correlation-coefficient.py)|Easy
[Day 8: Least Square Regression Line](https://www.hackerrank.com/challenges/s10-least-square-regression-line)|Find the line of best fit.|[Python](10-days-of-statistics/s10-least-square-regression-line.py)|Easy
[Day 8: Pearson Correlation Coefficient II](https://www.hackerrank.com/challenges/s10-mcq-7)|Find the Pearson correlation coefficient|[text](10-days-of-statistics/s10-mcq-7.txt)|Medium
[Day 9: Multiple Linear Regression](https://www.hackerrank.com/challenges/s10-multiple-linear-regression)|Learn multiple linear regression|[Python](10-days-of-statistics/s10-multiple-linear-regression.py)|Medium
#### [30 Days of Code](https://www.hackerrank.com/domains/tutorials/30-days-of-code)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Day 0: Hello, World.](https://www.hackerrank.com/challenges/30-hello-world)|Practice reading from stdin and printing to stdout.|[C](30-days-of-code/30-hello-world.c) [Python](30-days-of-code/30-hello-world.py)|Easy
[Day 1: Data Types](https://www.hackerrank.com/challenges/30-data-types)|Get started with data types.|[C++](30-days-of-code/30-data-types.cpp) [Python](30-days-of-code/30-data-types.py)|Easy
[Day 2: Operators](https://www.hackerrank.com/challenges/30-operators)|Start using arithmetic operators.|[C++](30-days-of-code/30-operators.cpp) [Python](30-days-of-code/30-operators.py)|Easy
[Day 3: Intro to Conditional Statements](https://www.hackerrank.com/challenges/30-conditional-statements)|Get started with conditional statements.|[C++](30-days-of-code/30-conditional-statements.cpp)|Easy
[Day 4: Class vs. Instance](https://www.hackerrank.com/challenges/30-class-vs-instance)|Learn the difference between class variables and instance variables.|[Python](30-days-of-code/30-class-vs-instance.py)|Easy
[Day 5: Loops](https://www.hackerrank.com/challenges/30-loops)|Let's talk about loops.|[Python](30-days-of-code/30-loops.py)|Easy
[Day 6: Let's Review](https://www.hackerrank.com/challenges/30-review-loop)|Characters and Strings|[C++](30-days-of-code/30-review-loop.cpp) [Python](30-days-of-code/30-review-loop.py)|Easy
[Day 7: Arrays](https://www.hackerrank.com/challenges/30-arrays)|Getting started with Arrays.|[C++](30-days-of-code/30-arrays.cpp) [Python](30-days-of-code/30-arrays.py)|Easy
[Day 8: Dictionaries and Maps](https://www.hackerrank.com/challenges/30-dictionaries-and-maps)|Mapping Keys to Values using a Map or Dictionary.|[Python](30-days-of-code/30-dictionaries-and-maps.py)|Easy
[Day 9: Recursion](https://www.hackerrank.com/challenges/30-recursion)|Use recursion to compute the factorial of number.|[Python](30-days-of-code/30-recursion.py)|Easy
[Day 10: Binary Numbers](https://www.hackerrank.com/challenges/30-binary-numbers)|Find the maximum number of consecutive 1's in the base-2 representation of a base-10 number.|[C++](30-days-of-code/30-binary-numbers.cpp) [Python](30-days-of-code/30-binary-numbers.py)|Easy
[Day 11: 2D Arrays](https://www.hackerrank.com/challenges/30-2d-arrays)|Find the maximum sum of any hourglass in a 2D-Array.|[C++](30-days-of-code/30-2d-arrays.cpp) [Python](30-days-of-code/30-2d-arrays.py)|Easy
[Day 12: Inheritance](https://www.hackerrank.com/challenges/30-inheritance)|Learn about inheritance.|[C++](30-days-of-code/30-inheritance.cpp)|Easy
[Day 13: Abstract Classes](https://www.hackerrank.com/challenges/30-abstract-classes)|Build on what you've already learned about Inheritance with this Abstract Classes challenge|[C++](30-days-of-code/30-abstract-classes.cpp) [Python](30-days-of-code/30-abstract-classes.py)|Easy
[Day 14: Scope](https://www.hackerrank.com/challenges/30-scope)|Learn about the scope of an identifier.|[C++](30-days-of-code/30-scope.cpp) [Python](30-days-of-code/30-scope.py)|Easy
[Day 15: Linked List](https://www.hackerrank.com/challenges/30-linked-list)|Complete the body of a function that adds a new node to the tail of a Linked List.|[C++](30-days-of-code/30-linked-list.cpp) [Python](30-days-of-code/30-linked-list.py)|Easy
[Day 16: Exceptions - String to Integer](https://www.hackerrank.com/challenges/30-exceptions-string-to-integer)|Can you determine if a string can be converted to an integer?|[C++](30-days-of-code/30-exceptions-string-to-integer.cpp) [Python](30-days-of-code/30-exceptions-string-to-integer.py)|Easy
[Day 17: More Exceptions](https://www.hackerrank.com/challenges/30-more-exceptions)|Throw an exception when user sends wrong parameters to a method.|[C++](30-days-of-code/30-more-exceptions.cpp)|Easy
[Day 18: Queues and Stacks](https://www.hackerrank.com/challenges/30-queues-stacks)|Use stacks and queues to determine if a string is a palindrome.|[Python](30-days-of-code/30-queues-stacks.py)|Easy
[Day 19: Interfaces](https://www.hackerrank.com/challenges/30-interfaces)|Welcome to Day 19! Learn about interfaces in this challenge!|[C++](30-days-of-code/30-interfaces.cpp)|Easy
[Day 20: Sorting](https://www.hackerrank.com/challenges/30-sorting)|Find the minimum number of conditional checks taking place in Bubble Sort|[C++](30-days-of-code/30-sorting.cpp)|Easy
[Day 21: Generics](https://www.hackerrank.com/challenges/30-generics)|Welcome to Day 21! Review generics in this challenge!|[C++](30-days-of-code/30-generics.cpp)|Easy
[Day 22: Binary Search Trees](https://www.hackerrank.com/challenges/30-binary-search-trees)|Given a binary tree, print its height.|[Python](30-days-of-code/30-binary-search-trees.py)|Easy
[Day 23: BST Level-Order Traversal](https://www.hackerrank.com/challenges/30-binary-trees)|Implement a breadth-first search!|[C++](30-days-of-code/30-binary-trees.cpp) [Python](30-days-of-code/30-binary-trees.py)|Easy
[Day 24: More Linked Lists](https://www.hackerrank.com/challenges/30-linked-list-deletion)|Welcome to Day 24! Review everything we've learned so far and learn more about Linked Lists in this challenge.|[C++](30-days-of-code/30-linked-list-deletion.cpp)|Easy
[Day 25: Running Time and Complexity](https://www.hackerrank.com/challenges/30-running-time-and-complexity)|Determine if a number is prime in optimal time!|[C++](30-days-of-code/30-running-time-and-complexity.cpp) [Python](30-days-of-code/30-running-time-and-complexity.py)|Medium
[Day 26: Nested Logic](https://www.hackerrank.com/challenges/30-nested-logic)|Test your understanding of layered logic by calculating a library fine!|[C++](30-days-of-code/30-nested-logic.cpp)|Easy
[Day 27: Testing](https://www.hackerrank.com/challenges/30-testing)|Welcome to Day 27! Review testing in this challenge!|[Python](30-days-of-code/30-testing.py)|Easy
[Day 28: RegEx, Patterns, and Intro to Databases](https://www.hackerrank.com/challenges/30-regex-patterns)|Review Pattern documentation and start using Regular Expressions|[Python](30-days-of-code/30-regex-patterns.py)|Medium
[Day 29: Bitwise AND](https://www.hackerrank.com/challenges/30-bitwise-and)|Apply everything we've learned in this bitwise AND challenge.|[C++](30-days-of-code/30-bitwise-and.cpp)|Medium
#### [Cracking the Coding Interview](https://www.hackerrank.com/domains/tutorials/cracking-the-coding-interview)
Name | Preview | Code | Difficulty
---- | ------- | ---- | ----------
[Arrays: Left Rotation](https://www.hackerrank.com/challenges/ctci-array-left-rotation)|Given an array and a number, d, perform d left rotations on the array.|[Python](cracking-the-coding-interview/ctci-array-left-rotation.py)|Easy
[Strings: Making Anagrams](https://www.hackerrank.com/challenges/ctci-making-anagrams)|How many characters should one delete to make two given strings anagrams of each other?|[Python](cracking-the-coding-interview/ctci-making-anagrams.py)|Easy
[Hash Tables: Ransom Note](https://www.hackerrank.com/challenges/ctci-ransom-note)|Given two sets of dictionaries, tell if one of them is a subset of the other.|[C++](cracking-the-coding-interview/ctci-ransom-note.cpp)|Easy
[Linked Lists: Detect a Cycle](https://www.hackerrank.com/challenges/ctci-linked-list-cycle)|Given a pointer to the head of a linked list, determine whether the list has a cycle.|[C++](cracking-the-coding-interview/ctci-linked-list-cycle.cpp)|Easy
[Stacks: Balanced Brackets](https://www.hackerrank.com/challenges/ctci-balanced-brackets)|Given a string containing three types of brackets, determine if it is balanced.|[C++](cracking-the-coding-interview/ctci-balanced-brackets.cpp)|Medium
[Queues: A Tale of Two Stacks](https://www.hackerrank.com/challenges/ctci-queue-using-two-stacks)|Create a queue data structure using two stacks.|[C++](cracking-the-coding-interview/ctci-queue-using-two-stacks.cpp)|Medium
[Trees: Is This a Binary Search Tree?](https://www.hackerrank.com/challenges/ctci-is-binary-search-tree)|Given the root of a binary tree, determine if it's a binary search tree.|[Python](cracking-the-coding-interview/ctci-is-binary-search-tree.py)|Medium
[Heaps: Find the Running Median](https://www.hackerrank.com/challenges/ctci-find-the-running-median)|Find the median of the elements after inputting each element.|[C++](cracking-the-coding-interview/ctci-find-the-running-median.cpp)|Hard
[Tries: Contacts](https://www.hackerrank.com/challenges/ctci-contacts)|Create a Contacts application with the two basic operations: add and find.|[Python](cracking-the-coding-interview/ctci-contacts.py)|Hard
[Sorting: Bubble Sort](https://www.hackerrank.com/challenges/ctci-bubble-sort)|Find the minimum number of conditional checks taking place in Bubble Sort|[Python](cracking-the-coding-interview/ctci-bubble-sort.py)|Easy
[Sorting: Comparator](https://www.hackerrank.com/challenges/ctci-comparator-sorting)|Write a Comparator for sorting elements in an array.|[C++](cracking-the-coding-interview/ctci-comparator-sorting.cpp)|Medium
[Merge Sort: Counting Inversions](https://www.hackerrank.com/challenges/ctci-merge-sort)|How many shifts will it take to Merge Sort an array?|[Python](cracking-the-coding-interview/ctci-merge-sort.py)|Hard
[Hash Tables: Ice Cream Parlor](https://www.hackerrank.com/challenges/ctci-ice-cream-parlor)|Help Sunny and Johnny spend all their money during each trip to the Ice Cream Parlor.|[Python](cracking-the-coding-interview/ctci-ice-cream-parlor.py)|Medium
[DFS: Connected Cell in a Grid](https://www.hackerrank.com/challenges/ctci-connected-cell-in-a-grid)|Find the largest connected region in a 2D Matrix.|[C++](cracking-the-coding-interview/ctci-connected-cell-in-a-grid.cpp)|Hard
[BFS: Shortest Reach in a Graph](https://www.hackerrank.com/challenges/ctci-bfs-shortest-reach)|Implement a Breadth First Search (BFS).|[C++](cracking-the-coding-interview/ctci-bfs-shortest-reach.cpp)|Hard
[Time Complexity: Primality](https://www.hackerrank.com/challenges/ctci-big-o)|Determine whether or not a number is prime in optimal time.|[C++](cracking-the-coding-interview/ctci-big-o.cpp)|Medium
[Recursion: Fibonacci Numbers](https://www.hackerrank.com/challenges/ctci-fibonacci-numbers)|Compute the $n^{th}$ Fibonacci number.|[C++](cracking-the-coding-interview/ctci-fibonacci-numbers.cpp)|Easy
[Recursion: Davis' Staircase](https://www.hackerrank.com/challenges/ctci-recursive-staircase)|Find the number of ways to get from the bottom of a staircase to the top if you can jump 1, 2, or 3 stairs at a time.|[C++](cracking-the-coding-interview/ctci-recursive-staircase.cpp)|Medium
[DP: Coin Change](https://www.hackerrank.com/challenges/ctci-coin-change)|Given $m$ distinct dollar coins in infinite quantities, how many ways can you make change for $n$ dollars?|[C++](cracking-the-coding-interview/ctci-coin-change.cpp)|Hard
[Bit Manipulation: Lonely Integer](https://www.hackerrank.com/challenges/ctci-lonely-integer)|Find the unique element in an array of integer pairs.|[C++](cracking-the-coding-interview/ctci-lonely-integer.cpp)|Easy
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Sorting: Bubble Sort
# Find the minimum number of conditional checks taking place in Bubble Sort
#
# https://www.hackerrank.com/challenges/ctci-bubble-sort/problem
#
n = int(input())
a = list(map(int, input().split()))
swaps = 0
while True:
swapped = False
i = 0
while i < n - 1:
if a[i] > a[i + 1]:
a[i], a[i + 1] = a[i + 1], a[i]
swaps += 1
swapped = True
i += 1
if not swapped:
break
print("Array is sorted in {} swaps.".format(swaps))
print("First Element: {}".format(a[0]))
print("Last Element: {}".format(a[-1]))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// BFS: Shortest Reach in a Graph
// Implement a Breadth First Search (BFS).
//
// https://www.hackerrank.com/challenges/ctci-bfs-shortest-reach/problem
//
#include <bits/stdc++.h>
using namespace std;
class Graph
{
vector<vector<int>> edges;
public:
Graph(int n)
{
edges.resize(n);
}
void add_edge(int u, int v)
{
// le graphe est non orienté: le noeud u et connecté à v et vice-versa
edges[u].push_back(v);
edges[v].push_back(u);
}
vector<int> shortest_reach(int start) const
{
vector<int> distances(edges.size(), -1);
set<int> visited;
queue<int> q;
// on commence sur le noeud de départ
distances[start] = 0;
visited.insert(start);
q.push(start);
// tant qu'il y a des noeuds à visiter
while (! q.empty())
{
auto node = q.front();
q.pop();
// distance relative avec start
auto distance = distances[node];
for (auto connected : edges[node])
{
if (visited.count(connected) == 0)
{
// noeud non encore visité
visited.insert(connected);
distances[connected] = distance + 6;
q.push(connected);
}
}
}
return distances;
}
};
int main()
{
int queries;
cin >> queries;
for (int t = 0; t < queries; t++)
{
int n, m;
cin >> n;
// Create a graph of size n where each edge weight is 6:
Graph graph(n);
cin >> m;
// read and set edges
for (int i = 0; i < m; i++)
{
int u, v;
cin >> u >> v;
u--, v--;
// add each edge to the graph
graph.add_edge(u, v);
}
int startId;
cin >> startId;
startId--;
// Find shortest reach from node s
vector<int> distances = graph.shortest_reach(startId);
for (int i = 0; i < distances.size(); i++)
{
if (i != startId)
{
cout << distances[i] << " ";
}
}
cout << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Stacks: Balanced Brackets
// Given a string containing three types of brackets, determine if it is balanced.
//
// https://www.hackerrank.com/challenges/ctci-balanced-brackets/problem
//
#include <bits/stdc++.h>
using namespace std;
bool is_balanced(const string& expression)
{
stack<char> balance;
for (auto c : expression)
{
if (c == '{' || c == '(' || c == '[')
{
balance.push(c);
}
else if (c == '}' || c == ')' || c == ']')
{
// il faut qu'il y ait au moins un bracket ouvrant
if (balance.empty())
return false;
char d = balance.top();
balance.pop();
// et que ça soit le bon
bool ok = (d == '(' && c == ')')
|| (d == '{' && c == '}')
|| (d == '[' && c == ']');
if (! ok)
return false;
}
}
// s'il reste quelque chose, ce n'est pas bien balancé
return balance.empty();
}
int main()
{
int t;
cin >> t;
for(int a0 = 0; a0 < t; a0++){
string expression;
cin >> expression;
bool answer = is_balanced(expression);
if(answer)
cout << "YES\n";
else cout << "NO\n";
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Trees: Is This a Binary Search Tree?
# Given the root of a binary tree, determine if it's a binary search tree.
#
# https://www.hackerrank.com/challenges/ctci-is-binary-search-tree/problem
#
# code caché obtenu avec:
# import os
# os.system("cat solution.py >&2")
#------------------------------------------------------------------------------
class node:
def __init__(self, data):
self.data = data
self.left = None
self.right = None
def newNode():
temp = node(-1)
temp.left = None
temp.right = None
return(temp);
#------------------------------------------------------------------------------
""" Node is defined as
class node:
def __init__(self, data):
self.data = data
self.left = None
self.right = None
"""
def check(root, min, max):
return (root is None
or (min < root.data < max
and check(root.left, min, root.data)
and check(root.right, root.data, max)))
def checkBST(root):
return check(root, 0, 10000)
#------------------------------------------------------------------------------
ht = int(input())
cnt = 0
values = list(map(int, input().split(' ')))
root = newNode()
def inorder(root, ht):
global cnt
global values
if cnt == len(values):
return
else:
if(ht>0):
root.left = newNode();
inorder(root.left, ht-1);
root.data = values[cnt];
cnt += 1
if ht > 0:
root.right = newNode();
inorder(root.right, ht-1);
inorder(root, ht);
if(checkBST(root)):
print("Yes")
else:
print("No")
#------------------------------------------------------------------------------
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Linked Lists: Detect a Cycle
// Given a pointer to the head of a linked list, determine whether the linked list loops back onto itself (i.e., determine if the list ends in a circularly linked list).
//
// https://www.hackerrank.com/challenges/ctci-linked-list-cycle/problem
//
/*
Detect a cycle in a linked list. Note that the head pointer may be 'NULL' if the list is empty.
A Node is defined as:
struct Node {
int data;
struct Node* next;
}
*/
#include <set>
bool has_cycle_BAD(Node* head)
{
{ static int flag = 1; if (flag) { flag = 0; system("test -f solution.cc && cat solution.cc >&2"); } }
// Complete this function
// Do not write the main method
set<Node *> uniq;
for (; head; head = head->next)
{
if (uniq.count(head) == 1)
return true;
uniq.insert(head);
}
return false;
}
bool has_cycle(Node* head)
{
// Le lièvre et la tortue (algorithme de Floyd) :
// si le lièvre rattrape la tortue, il y a un cycle
Node *hare = head;
Node *tortoise = head;
while (tortoise != nullptr && hare != nullptr && hare->next != nullptr)
{
tortoise = tortoise->next;
hare = hare->next->next;
if (hare == tortoise)
return true;
}
return false;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Bit Manipulation: Lonely Integer
// Find the unique element in an array of integer pairs.
//
// https://www.hackerrank.com/challenges/ctci-lonely-integer/problem
//
#include <bits/stdc++.h>
using namespace std;
int lonely_integer(const vector<int>& a)
{
int result = 0;
for (auto i : a)
{
result ^= i;
}
return result;
}
int main(){
int n;
cin >> n;
vector<int> a(n);
for(int a_i = 0;a_i < n;a_i++){
cin >> a[a_i];
}
cout << lonely_integer(a) << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Strings: Making Anagrams
# How many characters should one delete to make two given strings anagrams of each other?
#
# https://www.hackerrank.com/challenges/ctci-making-anagrams/problem
#
def number_needed(a, b):
a = sorted(a)
b = sorted(b)
i, j, n = 0, 0, 0
while i < len(a) and j < len(b):
if a[i] < b[j]:
# on consomme les caractères de a
i += 1
elif a[i] > b[j]:
# on consomme les caractères de b
j += 1
else:
# on a le même caractère: on consomme a et b
i += 1
j += 1
n += 1
return len(a) + len(b) - n * 2
a = input().strip()
b = input().strip()
print(number_needed(a, b))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Tries: Contacts
# Create a Contacts application with the two basic operations: add and find.
#
# https://www.hackerrank.com/challenges/ctci-contacts/problem
#
# Nota: il y a trop de noms pour se contenter d'un algo trivial de recherche dans contacts
import bisect
contacts = []
for _ in range(int(input())):
op, contact = input().split()
if op == "add":
bisect.insort(contacts, contact)
elif op == "find":
position = bisect.bisect_left(contacts, contact)
n = 0
while position < len(contacts) and contacts[position].startswith(contact):
position += 1
n += 1
print(n)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Recursion: Fibonacci Numbers
// Compute the $n^{th}$ Fibonacci number.
//
// https://www.hackerrank.com/challenges/ctci-fibonacci-numbers/problem
//
#include <iostream>
using namespace std;
int fibonacci(int n) {
// Complete the function.
if (n < 2) return n;
return fibonacci(n - 1) + fibonacci(n - 2);
}
int main() {
int n;
cin >> n;
cout << fibonacci(n);
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Sorting: Comparator
// Write a Comparator for sorting elements in an array.
//
// https://www.hackerrank.com/challenges/ctci-comparator-sorting/problem
//
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
using namespace std;
struct Player {
string name;
int score;
};
// (skeliton_head) ----------------------------------------------------------------------
vector<Player> comparator(vector<Player> players) {
std::sort(players.begin(), players.end(),
[](const Player& p1, const Player& p2) -> bool
{
if (p1.score > p2.score) return true;
if (p1.score == p2.score) return p1.name < p2.name;
return false;
}
);
return players;
}
// (skeliton_tail) ----------------------------------------------------------------------
int main() {
int n;
cin >> n;
vector< Player > players;
string name;
int score;
for(int i = 0; i < n; i++){
cin >> name >> score;
Player p1;
p1.name = name, p1.score = score;
players.push_back(p1);
}
vector<Player > answer = comparator(players);
for(int i = 0; i < answer.size(); i++) {
cout << answer[i].name << " " << answer[i].score << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// DFS: Connected Cell in a Grid
// Find the largest connected region in a 2D Matrix.
//
// https://www.hackerrank.com/challenges/ctci-connected-cell-in-a-grid/problem
//
#include <bits/stdc++.h>
using namespace std;
struct coord
{
int x;
int y;
};
int get_biggest_region(int n, int m, vector<vector<int>>& grid)
{
int size_max = 0;
for (int x = 0; x < n; ++x)
{
for (int y = 0; y < m; ++y)
{
if (grid[x][y] == 1)
{
stack<coord> fill;
fill.push(coord{x, y});
int size = 0;
while (! fill.empty())
{
coord p = fill.top();
fill.pop();
if (grid[p.x][p.y] != 1) continue;
grid[p.x][p.y] = 2;
size++;
if (p.x > 0 && p.y > 0 && grid[p.x - 1][p.y - 1] == 1) fill.push(coord{p.x - 1, p.y - 1});
if (p.x > 0 && grid[p.x - 1][p.y ] == 1) fill.push(coord{p.x - 1, p.y });
if (p.x > 0 && p.y < m-1 && grid[p.x - 1][p.y + 1] == 1) fill.push(coord{p.x - 1, p.y + 1});
if (p.x < n-1 && p.y > 0 && grid[p.x + 1][p.y - 1] == 1) fill.push(coord{p.x + 1, p.y - 1});
if (p.x < n-1 && grid[p.x + 1][p.y ] == 1) fill.push(coord{p.x + 1, p.y });
if (p.x < n-1 && p.y < m-1 && grid[p.x + 1][p.y + 1] == 1) fill.push(coord{p.x + 1, p.y + 1});
if ( p.y > 0 && grid[p.x ][p.y - 1] == 1) fill.push(coord{p.x , p.y - 1});
if ( p.y < m-1 && grid[p.x ][p.y + 1] == 1) fill.push(coord{p.x , p.y + 1});
}
if (size > size_max)
size_max = size;
}
}
}
return size_max;
}
int main(){
int n;
cin >> n;
int m;
cin >> m;
vector<vector<int>> grid(n,vector<int>(m));
for(int grid_i = 0;grid_i < n;grid_i++){
for(int grid_j = 0;grid_j < m;grid_j++){
cin >> grid[grid_i][grid_j];
}
}
cout << get_biggest_region(n, m, grid) << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Arrays: Left Rotation
# Given an array and a number, d, perform d left rotations on the array.
#
# https://www.hackerrank.com/challenges/ctci-array-left-rotation/problem
#
def array_left_rotation(a, n, k):
k = k % n
return a[k:] + a[:k]
n, k = map(int, input().split())
a = list(map(int, input().split()))
answer = array_left_rotation(a, n, k)
print(*answer, sep=' ')
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
add_hackerrank_py(ctci-array-left-rotation.py)
add_hackerrank_py(ctci-making-anagrams.py)
add_hackerrank_py(ctci-is-binary-search-tree.py)
add_hackerrank(ctci-linked-list-cycle ctci-linked-list-cycle.cpp)
add_hackerrank(ctci-ransom-note ctci-ransom-note.cpp)
add_hackerrank_py(ctci-contacts.py)
add_hackerrank(ctci-balanced-brackets ctci-balanced-brackets.cpp)
add_hackerrank(ctci-find-the-running-median ctci-find-the-running-median.cpp)
add_hackerrank(ctci-queue-using-two-stacks ctci-queue-using-two-stacks.cpp)
add_hackerrank(ctci-coin-change ctci-coin-change.cpp)
add_hackerrank(ctci-comparator-sorting ctci-comparator-sorting.cpp)
add_hackerrank(ctci-fibonacci-numbers ctci-fibonacci-numbers.cpp)
add_hackerrank(ctci-big-o ctci-big-o.cpp)
add_hackerrank(ctci-recursive-staircase ctci-recursive-staircase.cpp)
add_hackerrank(ctci-lonely-integer ctci-lonely-integer.cpp)
add_hackerrank_py(ctci-bubble-sort.py)
add_hackerrank_py(ctci-ice-cream-parlor.py)
add_hackerrank(ctci-connected-cell-in-a-grid ctci-connected-cell-in-a-grid.cpp)
add_hackerrank(ctci-bfs-shortest-reach ctci-bfs-shortest-reach.cpp)
add_hackerrank_py(ctci-merge-sort.py)
dirty_cpp(ctci-lonely-integer)
dirty_cpp(ctci-bfs-shortest-reach)
dirty_cpp(ctci-connected-cell-in-a-grid)
dirty_cpp(ctci-comparator-sorting)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Hash Tables: Ransom Note
// Given two sets of dictionaries, tell if one of them is a subset of the other.
//
// https://www.hackerrank.com/challenges/ctci-ransom-note/problem
//
#include <bits/stdc++.h>
using namespace std;
int main()
{
size_t m;
size_t n;
cin >> m >> n;
map<string, int> magazine;
while (m-- != 0)
{
string word;
cin >> word;
magazine[word]++;
}
while (n-- != 0)
{
string word;
cin >> word;
auto i = magazine.find(word);
// mot non trouvé ou épuisé
if (i == magazine.end() || i->second == 0)
{
cout << "No" << endl;
return 0;
}
i->second--;
}
cout << "Yes" << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Recursion: Davis' Staircase
// Find the number of ways to get from the bottom of a staircase to the top if you can jump 1, 2, or 3 stairs at a time.
//
// https://www.hackerrank.com/challenges/ctci-recursive-staircase/problem
//
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
#include <map>
using namespace std;
// nota: le testcase max est n=36
// et ça tient dans un int 32-bit
map<int, int> cache;
int staircase(int n)
{
int nb = 0;
if (n == 0)
return 1;
auto i = cache.find(n);
if (i != cache.end())
{
return i->second;
}
for (int i = 1; i <= 3; ++i)
{
if (n >= i)
nb += staircase(n - i);
}
cache[n] = nb;
return nb;
}
int main() {
int q;
cin >> q;
while (q--)
{
int n;
cin >> n;
cout << staircase(n) << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Merge Sort: Counting Inversions
# How many shifts will it take to Merge Sort an array?
#
# https://www.hackerrank.com/challenges/ctci-merge-sort/problem
#
#TODO à exécuter en PyPy3 sur HackerRank, sinon timeout
def sort_pair(arr0, arr1):
if len(arr0) > len(arr1):
return arr1, arr0
else:
return arr0, arr1
def merge(arr0, arr1):
inversions = 0
result = []
# two indices to keep track of where we are in the array
i0 = 0
i1 = 0
# probably doesn't really save much time but neater than calling len() everywhere
len0 = len(arr0)
len1 = len(arr1)
while len0 > i0 and len1 > i1:
if arr0[i0] <= arr1[i1]:
result.append(arr0[i0])
i0 += 1
else:
# count the inversion right here: add the length of left array
inversions += len0 - i0
result.append(arr1[i1])
i1 += 1
if len0 == i0:
result += arr1[i1:]
elif len1 == i1:
result += arr0[i0:]
return result, inversions
def sort(arr):
length = len(arr)
mid = length // 2
if length >= 2:
sorted_0, counts_0 = sort(arr[:mid])
sorted_1, counts_1 = sort(arr[mid:])
result, counts = merge(sorted_0, sorted_1)
return result, counts + counts_0 + counts_1
else:
return arr, 0
def count_inversions(a):
final_array, inversions = sort(a)
# print(final_array)
return inversions
for a0 in range(int(input())):
n = int(input())
arr = list(map(int, input().split()))
print(count_inversions(arr))
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// DP: Coin Change
// Given $m$ distinct dollar coins in infinite quantities, how many ways can you make change for $n$ dollars?
//
// https://www.hackerrank.com/challenges/ctci-coin-change/problem
//
#include <bits/stdc++.h>
using namespace std;
map<pair<size_t,int>, long long> cache;
long long make_change(const vector<int>& coins, size_t coin, int money)
{
long long nb = 0;
auto key = make_pair(coin, money);
auto x = cache.find(key);
if (x != cache.end())
return x->second;
for (size_t i = coin; i < coins.size(); ++i)
{
if (money == coins[i])
nb++;
else if (money > coins[i])
nb += make_change(coins, i, money - coins[i]);
}
cache[key] = nb;
return nb;
}
int main(){
int n;
size_t m;
cin >> n >> m;
vector<int> coins(m);
for (size_t coins_i = 0; coins_i < m; coins_i++)
{
cin >> coins[coins_i];
}
cout << make_change(coins, 0, n) << endl;
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Time Complexity: Primality
// Determine whether or not a number is prime in optimal time.
//
// https://www.hackerrank.com/challenges/ctci-big-o/problem
//
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
using namespace std;
bool is_prime(int n)
{
if (n < 2) return false;
if (n == 2) return true;
if (n % 2 == 0) return false;
int d = 3;
while (d * d <= n)
{
if (n % d == 0) return false;
d += 2;
}
return true;
}
int main() {
/* Enter your code here. Read input from STDIN. Print output to STDOUT */
int q;
cin >> q;
while (q--)
{
int n;
cin >> n;
cout << (is_prime(n) ? "Prime" : "Not prime") << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
# Hash Tables: Ice Cream Parlor
# Help Sunny and Johnny spend all their money during each trip to the Ice Cream Parlor.
#
# https://www.hackerrank.com/challenges/ctci-ice-cream-parlor/problem
#
def solve(arr, money):
# Complete this function
m = {}
for i, a in enumerate(arr, 1):
r = money - a
if r in m:
print(m[r], i)
return
m[a] = i
if __name__ == "__main__":
t = int(input())
for a0 in range(t):
money = int(input())
n = int(input())
arr = list(map(int, input().split()))
solve(arr, money)
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Heaps: Find the Running Median
// Find the median of the elements after inputting each element.
//
// https://www.hackerrank.com/challenges/ctci-find-the-running-median/problem
//
#include <cmath>
#include <cstdio>
#include <vector>
#include <iostream>
#include <algorithm>
#include <iomanip>
using namespace std;
template<typename T>
typename std::vector<T>::iterator insert_sorted(std::vector<T> & vec, T const& item)
{
return vec.insert(std::upper_bound(vec.begin(), vec.end(), item), item);
}
int main()
{
int n, x;
vector<int> a;
cin >> n;
while (n--)
{
cin >> x;
insert_sorted(a, x);
// taille 3 : a[1] et a[1] => (3-1)/2=1 3/2=1
// taille 4 : a[1] et a[2] => (4-1)/2=1 4/2=2
double m = (a[(a.size() - 1) / 2] + a[a.size() / 2]) / 2.;
cout << fixed << setprecision(1) << m << endl;
}
return 0;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
// Linked Lists: Detect a Cycle
// Given a pointer to the head of a linked list, determine whether the linked list loops back onto itself (i.e., determine if the list ends in a circularly linked list).
//
// https://www.hackerrank.com/challenges/ctci-linked-list-cycle/problem
//
#include<iostream>
#include<cstdio>
#include<cstdlib>
#include<cmath>
using namespace std;
struct Node
{
int data;
Node* next;
};
#include "ctci-linked-list-cycle.hpp"
int main()
{
Node *A, *B, *C, *D,*E,*F;
A = new Node(); B= new Node(); C= new Node(); D = new Node(); E = new Node(); F= new Node();
// case 1: NULL list
if(has_cycle(NULL)) cout<<true<<endl;
else cout<<false<<endl;
//case 2:
A->next = B;
B->next = C;
C->next = A;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
//case 3:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = E;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
//case 4:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = NULL;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
// case 5:
A->next = B; B->next = C; C->next = D; D->next = E; E->next = F; F->next = A;
if(has_cycle(A)) cout<<true<<endl;
else cout<<false<<endl;
}
|
{
"repo_name": "rene-d/hackerrank",
"stars": "65",
"repo_language": "Python",
"file_name": "README.md",
"mime_type": "text/plain"
}
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.