Dataset Viewer
Auto-converted to Parquet Duplicate
messages
listlengths
2
2
images
images listlengths
1
1
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=CC=C6OC))))CC[N+1]=O)[O-1])))C=CC=CC=C6))))))OCC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCSNC=CC=CCC=CNC=CC=CCCCNCC6))))))C=C6))))))N=C5C=CC=NC=C6)))))))))))=C6F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCN.NC=CC=CCN)=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C=CC=CNCCCCS4)))C4))))C=CN=CCl)C=C%106" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "N.O.O.O.O=C[O-1])CNCCNCC=O)O)))CC=O)O))))))CC=O)[O-1].[Na+1].[Na+1]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCOC=CCCC=N[NH1]C=5)))))=CC=NC=NCNC=CC=CF)CCl)=C6F))))))))=C%106)))))))))))C=NC=CC=N6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=NCNCCCCO)CNC=NC=CC=CC=C69)))))))))CC6C9)))))))))=NO5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCCCCCCCCCCCCCCCCCCCC)))))))))))OC=S)S" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=CCSC))=[N+1]CCOCC6)))))))COCCCNC)C))))))=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=CO)C=CC=CCCNN=CC=CC=NC6=N9))))))))))=C6F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNCC=CCNCCOC=CCC=NN=CN5CCCCC7))))))))))=CC=C6%10))))))))))=CC=C6C9=O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "NCN=CNCOCCO))CO)C5O))))))C=O)N=6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNCC))CC.CCNCC))CC.CCNCC))CC.OPO)O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C=CC=CC=CC=C6O%10)))C=O)NC5=O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COCC=NO))C=CF)C=COC))C=C6F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCC)CNC=O)CC)NC=O)CCCC=O)O))))NC=O)CNC=O)CCCCCN)))))NC=O)CN)CCCCN))))))))))))))))))))C=O)NCCC=CC=CO)C=C6)))))))C=O)NCC)C=O)NCC)C=O)NCCCC5C=O)NCCC=CC=CC=C6)))))))C=O)NCC)CN)=O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COCCCCNCC=NC=CC=CC=CN96))))))))))CC5CC9NCC)=O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNC)CCNC=O)C=CCOCCN)=O))=CC=5CBr)=C9N" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)OBC=CN=CC=NC=CO5)))))S5)))))OC5C)C" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCCCCCCC#CC#CCCCCCCCCC=O)CC[N+1]C)C)C)))OP=O)[O-1])OCCO)CO)))))))C=O)CCCCCCCCC#CC#CCCCCCCCCCC" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=COCCCl)Cl)Cl))))NC=CC=CCC=CC=CC=CC=C6%10))))))))=CC=C69" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCN)C=O)CCNC=O)CCCNCC=CC=CC=C6))))))))C=O)O)))))))C=O)O)))C=CC=CS=O)=O)CC=CC=CC=C6))))))))C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=NC=CC=O)O))C=N6.CC=NN=CC=CCl)C=CC=CC=C6N9C=CC=CCNC=O)CN)CC3))))))C=C6)))))))))))))))O5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=O)[O-1].CC=O)[O-1].O.O.O.O.[Eu+2]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNC=O)C=CC=CC=CF)C=C6))))))OC=CCNC=CCC=O)O))CC)N)CF)=C6))))))SC)=O)=O)))=CCCC3)))C=C96" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNC=O)C=CC=CNC=CCNCCO))C=CC=CC=C6))))))))=CC=NCC=CC=CC=C6F)))))))=NO5)))))C=N6)))))))C=C69" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=C[NH1]C=CBr)C=O)[NH1]6.C=CN=CN=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCOC=O)CCC=CC=CN)CI)=C6)))))))CC3" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=C[N+1]=O)[O-1]))CNC=CC=CCC=NOCC)=N5)))))=C6)))))))=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C)C=CC=CC=CCCC)C)C))=CCC=CCCC)C)C))=CCCC)C)C))=C6))))))=C6NC=CCC=CC=CC=C6))))))=CC=C6BC=CC=CC=CC=CC=C6))))))C=C6NC=CC=CC=CCC)C)C))C=C6))))))C=CCC)C)C))C=C6C=CCCC)C)C))=CCCC)C)C))=C6))))))))))))C=CCNC=CC=CC=C6C=CC=CC=C6%13)))))))))))))=CC%20=C6%14)))))))))))))))))))))))))))C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNC=O)OCC=CCBOCC)C)CC)C)O5)))))=CCCl)=C6%10" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C)OC=O)CCCNCCCC=O)OCC)C)C)))))))CC=CC=CC=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=CC=C6CNCC)=O)))C=O)NCCCCCN)=O))C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "NC=CC=CC=C6C=O)O.O=CCOP=O)O)O)))CO)CO)CO" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNCCCCC=O)O))))))CC=O)O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C)OC=O)C=NCC=NO))C=O)O)))=CN)S5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNC)CCCCCCNS=O)=O)C=CC=CCC)C)C))C=C6)))))))CC6)))))C=O)O5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "BrCBr)C=CC=CCBr)Br))S5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "NC=NC=NC=C6N=CN5CCCO)CCO))O5.NC=NC=NC=C6N=CN5COCCO))CC5O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C=CC=NC=C)NCCC)F)C4)))))))CC)C" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCF)F)CC#CCCC3)))))OC=O)NC=CCCCl))=CC=C6%10" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNCCCCO)C=CCC=CC#N))OC=5C=N9))))))))))CC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=CCCCC=O)NCCCCO)CNC=CN=CC=N6)))))))CC6C9)))))))))))))C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCN)C=NCC=CC=CC=C6C=O)NC=CC=CC=N6))))))))))))))=CCN)=NC=CN96" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "N#[N+1]C=CC=CCC=CC=CCC=O)O))=C6))))))=C6O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=S=O)NC=CC=CC=C6)))))))SCCl)Cl)CF)Cl)Cl" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "[SeH1]NC=CC=CC=CC=C69" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=P#COC=CC=CC=O)NC=NC=NC=C6N=CN5COCCO))CO)OC=CC=CC=C6Cl))))))))C5OCCCCO5))))))))))))))))))))))C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "[N-1]=[N+1]=[N-1].[NH3+1]CCCCCC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC.CC=CC=CN=CC=CCCC)C))=CN5C))))))[NH1]C5=C9.[HH1]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "ClC=CC=CC=C6CNCCNC=NC=CC=CC=C6N=C%10NCCC3))))))))))))))CC6.O=CO)CF)F)F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC=O)O))CCN4C=O)CC=CC=CCSC=CC9=5.CNCC=CC=CCl)C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNC=O)OCCC=CC=CC=C6C=CC=CC=C6%13))))))))))))))))CCNCCOCC6)))))))C=O)O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNCC=NON=C5N))))))=NC=CC#CCC)C)O))))N=COCCN))))C=C69.CCNCC=NON=C5N))))))=NC=CC#CCC)C)O))))N=COCCN))))C=C69.Cl.Cl" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "FC=CC=CCF)CC=C[NH1]C=5)))))[CH1-1]6.[Ti+2].CC=C[CH1-1]C=5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNCCCCNNC=CC=CC=C6CC)C9C)CN)=O)))))))))))C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC[NH1]CC=O)NC=CC=CC=NOC=O)[NH1]5)))))C=C6NCCNCC6))))))))))))))=CCl)C=5Cl.Cl" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CSCN=NC=O)C5SC))N=NC8=O" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=NNC)C=C5C=CC=CC=C6CN=CC=CC=O)NCCCC5C=O)N5))))))))C=CN6C=9Cl" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C=CC=CC=CC=CCF)F)F))CBr)=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)C)C=CC=NN5S=O)=O)CCCCC5))))))))CNC=O)O))C5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CSC=NC=O)SC5=CCC=CC=NNCC=CC=CC=C6CF)F)F)))))))))C=C5C=9" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNC=CCl)C=CCC=O)NCCCC=NCNCCN)CCCOC5))))C5)))))=CC=C6C%10))))))))))))=NN=C69" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCPCCCCC5)))))CCCCC5))))))C5" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C=CC=CC=NCC=CC=CC=CC=CC=C6SC=CC=CC=C69)))))))))))))C=C6))))))=NCC=CCC=CC=CC=C6))))))=CC=CC=CC=C6))))))CNC=CC=CC=C6C=CC=CC=C6%13)))))))))))))=C6))))))=N6))))))C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=NC=NC=C6CN)=NN5CC)C=CCCOCCl))))=CC=C6CCCN4CCCO4" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "OCCCCCC6O)NC=NCCl)=NC=C6F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "OBF)F.C=CC=NC=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=C[O-1])C=CC=CN=N6.[Li+1]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "OCCCCNC=NC=CC=C6CF)F)F))))))))CC5CC9NC=CN=CC=N6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C=CC=CC=CC=CC[Si]C=CC=CC=C6))))))C=CC=CC=C6))))))C=CC=CCNC=CC=CC=C6C=CC=CCC=CC[Si]C=CC=CC=C6))))))C=CC=CC=C6))))))C=CC=CCC=CC=CC=C6))))))=C6)))))))=CC=C6N9C=CC=CC=C6)))))))))))))=C6%13)))))))))))))=C6)))))))=C6))))))C=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCCCCCCCCCC=O)NCCO))COCOCCO))COP=O)O)O)))COC=O)CCCCCCCCCCCCC)))))))))))OC=O)CCCCCC))))))))))))C6NC=O)CCCCCCCCCCCCC)))))))))))OC=O)CCCCCC))))))))))))))))))))))))OC=O)CCCCCC.CCNCC))CC" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "O=CCC=CC=NC=CN5C=9)))))))))NCCCCO)COC=CC=CF)C=C6)))))))CC6C9" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCNCC))CC.OBO)OC=CF)CF)=CF)C=CF)CF)=CF)CF)=C%106" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COCC)CNC=O)CCC3C=CC=CC=C6))))))))))))C=CC=NCCl)=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CNCCCNC=O)NC=NC=COCC#N))=CC5=C9Br)))))))))))))CC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "[CH1-1]=CC=C)C.[CH1-1]=CC=C)C.[Mg+2]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=NCNCCCO)C5)))))=CC=C6C=O)NC=CN=CCF)=C6))))))C=O)N6C=CC=CF)CF)=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCCCCCCCF)CCNC=CC=C5C=O)OCCOCCOCC" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "ClC=CCCl)=CCCC=CCl)C=CCl)C=C6Cl)))))))N=CC=N5)))))N=CC=N5)))))CCl)=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=O)NCCCC=CC=C[NH1]CC=CNN=CN=C5CC)=C9C))))))))))=CCC)C))C5=C9)))))))))CC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C#CC=CF)C=CC=CCO)=CCC=NCOC))=CCNCCCOCCC38))))))))=NCOCCCNCCNCCCCNC=CC=CC=N)NCCC=O)NC6=O))))))))CNC))=C6))))))CC6)))))))CC6)))))))CC3)))))=NC6=C%10F)))))))))))=C%106" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COCCC)O)C=CC=CC=CCC=NC=NNC)C=C5C=9)))))))))N=C6S9" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=CN=CCNCCC4CF)F)F))))))=NCCC=NNCCNC4))))C=5)))))=CC)N96" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "ClC=CCC=CC=C[NH1]5)CCC3))CN=C6))))))))=CC=N6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=CC=C[P+1]CCCCCCCCCCC=O)O))))))))))))C=CC=CC)C=C6))))))C=CC=CC)C=C6)))))))C=C6.[Br-1]" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "C=CC=CCCCC5CNC9C=C%13" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCC=CNC=CN=C5C=9NCCCNCCCN)=O)))CCCNC=O)CCCCCC6O5))))))))CC6)))))))CC7" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=CC=COCCCCNC=O)C=CC=CC#N))C=N6)))))))CC5CC9O)))))))))))CC)=N6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCCCCC))CCCCCCCCC))CCCC))))))CC6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=O)CCCNC=CC=NCC=CC=NCCl)=C6))))))=C6))))))C4" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "N[Si]N)CCCCCF)F)CF)F)CF)F)CF)F)CF)F)CF)F)CF)F)CF)F)F)))))))))))))CCCCCF)F)CF)F)CF)F)CF)F)CF)F)CF)F)CF)F)CF)F)F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "[H]C#CC[H])[H])CC)C)C" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CC=CCC)=CCC=CC=C[NH1]C=CC5=N9))CCC3))CNCN)=O))C6C=CC=CCF)=C6)))))))))))))))))=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COCCOC=CC=CC#N))CC=CCCCNCC)C))))C=CC=CC=C6)))))))=CC=C6Cl)))))))=C6F" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC)=CNCCCSCCCCCNC=NC=CN)N=CN=C69)))))))))O5)))))))))))NC=CC=CC=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCC=O)C=CC=O)OC)))CC=O)OC)))=CC=CC=CC=CC=CC6=CC=C%10N%17%14" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "BrC=CC=CCC#CC=CC=CCC#CC=CC=CCC#CC=CC=CCC#CC=CC=CCBr)=C6))))))))=C6))))))))=C6))))))))=C6))))))))=C6" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "CCCC)CNC=O)CCCC)C)))NC=O)CC)N)))))))C=O)NCCC=CC=CO)C=C6)))))))C=O)NCCCCNC=N)N))))))C=O)NCCCCCN)))))C=O)NCCCC)C)))C=O)NCCCC)C)))C=O)NCCC=CC=CC=C6)))))))C=O)NCCCN)=O)))C=O)NCCCC5C=O)NCCO))C=O)NCC=O)NCCCC5C=O)NCCC=CC=CO)C=C6)))))))C=O)NCCCCN)=O))))C=O)NCCCCCN)))))C=O)NCCCCCN)))))C=O)NCCCC5C=O)NCC=O)NCCC=CN=C[NH1]5))))))C=O)NCCCC=O)O))))C=O)NCCCCCN)))))C=O)NCCCCCN)))))C=O)NCCCC=O)O))))C=O)NCC=O)NCCCC)C)))C=O)O)))))CC)C))))))))))))))))))))CC)C" } ]
[ { "role": "user", "content": "<image>\nConvert the molecular structure in the image to its DeepSMILES representation." }, { "role": "assistant", "content": "COC=CC=CCSC=CC=CC=C6)N=CCO[Si]C)C)CC)C)C)))))N5C)))))))))))C=C6" } ]
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
11