messages listlengths 2 2 | images images listlengths 1 1 |
|---|---|
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[5*]N(C)C', fragmnet2.'[4*]C[8*]', fragmnet3.'[16*]c1cc([16*])c(O)c... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[6*]C(=O)CCCCCCCCC#N', fragmnet2.'[16*]c1ccc(O)cc1O'\n<image>\nCan ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[1*]C(C)=O', fragmnet2.'[5*]N[5*]', fragmnet3.'[1*]C(=O)C([4*])C(C)... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[1*]C(=O)CCCCCCCCCCCCCCC', fragmnet2.'[5*]N1CCN([5*])C1', fragmnet3... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C(C)(C)C', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C([1*])=O', fr... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[13*]C1CC(=O)NC([13*])CC(=O)NC([13*])CC(=O)N1', fragmnet2.'[1*]C(=O... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[5*]NC', fragmnet2.'[1*]C([1*])=O', fragmnet3.'[3*]O[3*]', fragmnet... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[5*]N[5*]', fragmnet3.'[1*]C([1*])=O', fragmnet... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[3*]O[Si](CC[Si](O[3*])(O[3*])O[3*])(O[3*])O[3*... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C(CC(C)C)C(N)=O', fragmnet2.'[5*]N[5*]', fragmnet3.'[1*]C(=O)C(... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'Cl', fragmnet2.'[1*]C([6*])=O', fragmnet3.'[16*]c1ccc2c(c1)OCO2', f... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'C=C', fragmnet2.'CC', fragmnet3.'CC12CCC3C(CCC4=NN=CC43C)C1CC(C1=CC... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OP(=O)(O[3*])O[3*]', fragmnet2.'[4*]CC(Cl)CCl', fragmnet3.'[4*]... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[6*]C(=O)C(C)C', fragmnet2.'[13*]C1CCCC(=O)N1', fragmnet3.'[HH]'\n<... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[5*]N([5*])C(=NCC)c1ccc([16*])cc1', fragmnet2.'[5*]N[5*]', fragmnet... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[13*]C1OC([13*])C(O)C([15*])C1O', fragmnet3.'[8... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[16*]c1ccc([16*])c([16*])c1', fragmnet3.'[6*]C(... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C(C(N)=O)C(C)O', fragmnet2.'[5*]N[5*]', fragmnet3.'[1*]C([6*])=... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[9*]n1ccc(C)c([16*])c1=O', fragmnet2.'[16*]c1cccc([16*])c1', fragmn... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'O=C(O)CN(C=CCBr)N(C=CCBr)CC(=O)O'\n<image>\nWhat DeepSMILES string ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[5*]N(C)C', fragmnet2.'[4*]CCC[4*]', fragmnet3.'[5*]N1c2ccccc2CCc2c... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'N#Cc1ccc(Cl)c2c1C(=O)c1ccccc1C2=O'\n<image>\nTranslate this chemica... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C([6*])=O', fragmnet3.'[3*]OC1=CC2(C)C(CC3O... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CCCC', fragmnet2.'[16*]c1cc([16*])cc(O)c1', fragmnet3.'[3*]ON'\... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[14*]c1c2c(nn1C)-c1ccccc1CCC2', fragmnet2.'[16*]c1ccc(O)cc1'\n<imag... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C(C)C', fragmnet2.'[5*]N[5*]', fragmnet3.'[4*]CCCS(=O)(=O)[O-]'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CCC(C)[B]F'\n<image>\nPlease convert this molecular structure to it... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CCC(C)C', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C([1*])=O', fra... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'O=C1Nc2cccc(Cl)c2C(C#CC2CC2)(C(F)(F)F)N1'\n<image>\nDerive the Deep... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(F)(F)F', fragmnet2.'[13*]C1NCC1[15*]', fragmnet3.'[3*]O[3*]',... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CN=C(N)N', fragmnet2.'[16*]c1ccc(N)c(I)c1'\n<image>\nPlease con... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[15*]C1(C)CC2CCC1C2', fragmnet2.'[8*]CO'\n<image>\nTranslate this c... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[5*]N1CC([13*])OC(C)C([15*])C1', fragmnet3.'[4*... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[7*]=CC(=[7*])C', fragmnet2.'[7*]=Cc1ccccc1', fragmnet3.'[7*]=C1SC(... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[14*]c1sc(C)cc1C#N', fragmnet2.'[5*]N[5*]', fragmnet3.'[16*]c1ccc(F... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[5*]N1CCSC1=CC=[7*]', fragmnet3.'[7*]=CC1=[N+](... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C(=O)C([4*])C[4*]', fragmnet3.'[11*]S[11*]'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CCCC=[N+](C)[O-]'\n<image>\nGenerate the DeepSMILES string for the ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12'\n<image>\nWhat... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[16*]c1cccc([16*])c1[16*]', fragmnet3.'[4*]C[8*... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[16*]c1c2ccc(F)cc2nc2c([16*])cccc12', fragmnet3... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C(=O)C([4*])C[8*]', fragmnet3.'[14*]c1cnc([... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'O=C1c2ccccc2C(=O)c2[nH]ncc21'\n<image>\nWhat DeepSMILES string corr... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[16*]c1ccc([16*])cc1', fragmnet3.'[14*]c1cc([14... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[5*]N1CCC(C(C)=NS(=O)C(C)(C)C)CC1', fragmnet2.'[1*]C([1*])=O', frag... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC#CC', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C([1*])=O', fragm... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C([8*])C', fragmnet2.'[16*]c1ccc2c(c1)OCO2', fragmnet3.'[5*]N1C... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[14*]c1cc([16*])ccn1', fragmnet3.'[5*]N1CCOC([1... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CC(N)C(=O)O', fragmnet2.'[16*]c1ccc(O)c(O)c1'\n<image>\nWhat wo... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[14*]c1nc2ccccc2c(C)[n+]1[O-]', fragmnet2.'[4*]C[8*]', fragmnet3.'[... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(C)C', fragmnet2.'[9*]n1c([14*])nc([14*])c1[14*]', fragmnet3.'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1ccc(C#C)c(Cl)c1', fragmnet2.'[14*]c1ccc(C)s1'\n<image>\nWhat... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[14*]c1cnc2c([16*])cc3c(nc(N)n3C)c2n1', fragmnet2.'[8*]CO', fragmne... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[6*]C(=O)O', fragmnet2.'[13*]C1CCCC=N1'\n<image>\nWhat is the DeepS... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1ccc([N+](=O)[O-])c(C)c1', fragmnet2.'[8*]C(F)(F)F'\n<image>\... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[3*]OC1CC([15*])(O)Cc2c(O)c3c(c(O)c21)C(=O)c1c(... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CC', fragmnet2.'[10*]N1CC2C3CC4(CC5=CCC3C4C5)C2C1=O'\n<image>\n... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[3*]OC1CC(O)(C(C)=NNC(=O)CCCCC(=O)NN=C(C)C2(O)C... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(C)CCCC(C)C', fragmnet2.'[15*]C1CCC2C3C(CCC12C)C1(C)CCC(=O)C=C... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C(=O)C(=[7*])P(=O)(O... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(C)(Cl)Cl', fragmnet2.'[15*]C1(C)C=CC(=NNc2ccc([N+](=O)[O-])cc... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[13*]C1CC2OC(C)(C)OC2C(C)O1', fragmnet2.'[3*]O[3*]', fragmnet3.'[15... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[16*]c1ccc([16*])cc1', fragmnet3.'[8*]C([8*])C(... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C(=O)C([4*])C[8*]', fragmnet3.'[16*]c1ccccc... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[4*]C([8*])[8*]', fragmnet3.'[16*]c1ccccc1', fr... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1ccc(C)cc1[16*]', fragmnet2.'[8*]C(C)C', fragmnet3.'[3*]O[3*]... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[6*]C(=O)NNC([6*])=O', fragmnet2.'[15*]C12CC3CC(CC(C3)C1)C2', fragm... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(C)(C)CC(O)CC', fragmnet2.'[15*]C1CCCCC1'\n<image>\nConvert th... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]C(C)O', fragmnet2.'[15*]C1CCC2C3CCC4CC(N)CCC4(C)C3CCC12C'\n<ima... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1ccccc1', fragmnet2.'[16*]c1cccc([16*])c1', fragmnet3.'[16*]c... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1cccc(C#N)c1', fragmnet2.'[9*]n1nc([14*])ccc1=O', fragmnet3.'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CC(=C)C', fragmnet2.'[10*]N1C(=O)C([15*])CC1[13*]', fragmnet3.'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'C[Sn](C)(C)c1ccc(S(=O)(=O)O)c2c1C([Sn](C)(C)C)c1ccc(S(=O)(=O)O)cc1O... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[15*]C1COc2nc([N+](=O)[O-])cn2C1', fragmnet2.'[3*]O[3*]', fragmnet3... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]C(C)(C)C', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C(=O)CC([4*])C... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[1*]C(=O)C([4*])C', fragmnet2.'[5*]N[5*]', fragmnet3.'[1*]C([1*])=O... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[1*]C(C)=O', fragmnet2.'[5*]N[5*]', fragmnet3.'[4*]C([8*])C(C)C', f... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C(=O)C(CC[4*])CC(=O)... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'c1ccc2c(c1)Cc1c-2[nH]c2ccccc12'\n<image>\nDerive the DeepSMILES rep... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[15*]C1COc2cc(O)c(O)cc2C1=O', fragmnet2.'[16*]c1ccc(O)cc1'\n<image>... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC(CC)CCCC', fragmnet2.'[3*]OP(O[3*])O[3*]', fragmnet3.'[16*]c1... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1'\n<image>\nPlease convert this molecu... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CC', fragmnet2.'[16*]c1cnc(N)c([16*])c1[16*]', fragmnet3.'[14*]... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CC', fragmnet2.'[5*]N1CCCC1[13*]', fragmnet3.'[8*]CN'\n<image>\... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]O[Si](C)(C)C', fragmnet2.'[4*]C([4*])[8*]', fragmnet3.'[3*]O[Si... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CCCCC(C)N'\n<image>\nWhat DeepSMILES string corresponds to this mol... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'S', fragmnet2.'[16*]c1ccccc1', fragmnet3.'[16*]c1ccccc1[16*]', frag... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CCCCCCCCC', fragmnet2.'[3*]O[3*]', fragmnet3.'[1*]C(=O)CCS'\n<i... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'Cc1ccc([Si](C)c2ccc3ccc4cccc5ccc2c3c45)cc1'\n<image>\nConvert this ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C(=O)CCC([8*])C', fragmnet3.'[15*]C1CCC2(C)... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[1*]C([6*])=O', fragmnet3.'[15*]C12C(=O)C=C(OC)... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[9*]n1cc(C)c(=O)[nH]c1=O', fragmnet2.'[13*]C1CC([15*])C([13*])O1', ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[8*]CCCCCCCCCCC', fragmnet2.'[16*]c1ccccc1S(=O)(=O)O', fragmnet3.'[... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CC1(C)c2ccccc2C2C1C1(Cl)C(=O)C2(Cl)C(Cl)=C1Cl'\n<image>\nGenerate t... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'O=S(=O)(O)c1cc(S(=O)(=O)O)c2ccc(O)c(N=Nc3ccc(S(=O)(=O)O)c4ccccc34)c... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CN=C(C)NC', fragmnet2.'CN=C(C)NC', fragmnet3.'[Li]'\n<image>\nCan y... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[4*]CCCCC(CCC)CCCCC(CCC)CCCC', fragmnet2.'[3*]O[3*]', fragmnet3.'[4... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'CC1(C)CC(O)CC(C)(C)N1'\n<image>\nConvert this molecular diagram to ... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[16*]c1ccccc1C(=N)c1c(C)cccc1C', fragmnet2.'[8*]C[8*]', fragmnet3.'... | |
[
{
"role": "user",
"content": "As an expert in converting molecular images to DeepSMILES for OCSR tasks, analyze the provided image. Use the following BRICS-derived substructures as a hint to generate the final DeepSMILES string.\nfragmnet1.'[3*]OC', fragmnet2.'[4*]CC([4*])CC[8*]', fragmnet3.'[9*]n1ccc(=O)[n... |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 15