messages listlengths 2 2 | images images listlengths 1 1 |
|---|---|
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1cc([16*])c(O)c([16*])c1', '[4*]C[8*]', '[5*]N(C)C', '[6*]C(=O)C=[7*]', '[7*]=Cc1ccc(O)cc1'"
},
{
"role": "assis... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc(O)cc1O', '[6*]C(=O)CCCCCCCCC#N'"
},
{
"role": "assistant",
"content": "[N][#C][C][C][C][C][C][C][C][C][C][=Bra... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C([4*])C(C)(C)S', '[1*]C(=O)C([4*])C=S', '[1*]C(=O)C([4*])CC=O', '[1*]C(=O)C([4*])CCCN=C(N)N', '[1*]C(=O)C[4*]... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CCCCCCCCCCCCCCC', '[5*]N1CCN([5*])C1'"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][C][C]... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[14*]c1cnc[nH]1', '[3*]O[3*]', '[4*]C(C)(C)C', '[4*]CC[8*]', '[5*]N[5*]'"
},
{
"role": "assistant",
"conte... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CC[8*]', '[13*]C1CC(=O)NC([13*])CC(=O)NC([13*])CC(=O)N1', '[16*]c1ccccc1', '[3*]O[3*]', '[4*]C[8*]'"
},
{
"role... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[11*]SN=Cc1ccc([16*])cc1', '[16*]c1cccc([N+](=O)[O-])c1', '[3*]O[3*]', '[5*]NC'"
},
{
"role": "assista... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[14*]c1cc2cccc([16*])c2c([14*])n1', '[14*]c1cccc([14*])n1', '[4*]CC', '[5*]N[5*]', '[8*]CN', '[8*]CO'"
},
{
"r... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[3*]O[Si](CC[Si](O[3*])(O[3*])O[3*])(O[3*])O[3*]', '[4*]CC'"
},
{
"role": "assistant",
"content": "[C][C][O][Si][Branch1][P... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][C][Branch2][Branch1][#Branch1][N][C][=Branch1][C][=O][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=Branch1][C... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'Cl', '[1*]C([6*])=O', '[16*]c1ccc2c(c1)OCCO2', '[16*]c1ccc2c(c1)OCO2', '[4*]C[8*]', '[5*]N1CCN([5*])CC1'"
},
{
"role": "assistant",
"conten... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'C=C', 'CC', 'CC12CCC3C(CCC4=NN=CC43C)C1CC(C1=CCOC1=O)O2', '[HH]'"
},
{
"role": "assistant",
"content": "[C][=C].[C... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation."
},
{
"role": "assistant",
"content": "[O][=P][Branch1][=Branch2][O][C][C][Branch1][C][Cl][C][Cl][Branch1][=Branch2][O][C][C][Branch1][C][Cl][C][Cl][O][C][C][Branch1][C][Cl][C][Cl]"
}
] | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[13*]C1CCCC(=O)N1', '[6*]C(=O)C(C)C', '[HH]'"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=Branch1][C][=... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C[4*]', '[1*]C([1*])=O', '[1*]C([6*])=O', '[16*]c1ccc([16*])cc1', '[3*]O[3*]', '[4*]CC', '[5*]N([5*])C(=NCC)c1ccc([16... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(C)=O', '[13*]C1(C)OC(=O)C23CCC4C(=CCC5C(C)(C)C([15*])CCC45C)C2(C)CCC13', '[13*]C1OC([13*])C(O)C([15*])C1O', '[13*]C1OCC([15*... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1cc([16*])c(O)c([16*])c1', '[16*]c1ccc([16*])c([16*])c1', '[3*]OC', '[3*]O[3*]', '[6*]C(=O)O'"
},
{
"role": "assistant",
... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C(N)C[8*]', '[1*]C([6*])=O', '[13*]C1CSSCC([15*])C(=O)NC([13*])C(=O)NC([13*])C(=O)NC([13*])C(=O)N1', '[16*]c1c[nH]c2ccccc12', '[16*]c1ccc(O)cc... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([6*])=O', '[15*]C1CCC(O)C1', '[16*]c1cccc([16*])c1', '[5*]N[5*]', '[8*]C(C)C', '[9*]n1ccc(C)c([16*])c1=O'"
},
{
"... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'O=C(O)CN(C=CCBr)N(C=CCBr)CC(=O)O'"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][N][Branch1][Branch1][C][=C]... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'[4*]CCC[4*]', '[5*]N(C)C', '[5*]N1c2ccccc2CCc2cccnc21'"
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'N#Cc1ccc(Cl)c2c1C(=O)c1ccccc1C2=O'"
},
{
"role": "assistant",
"content": "[N][#C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([6*])=O', '[13*]C1OC([13*])C(O)C(O)C1O', '[16*]c1ccccc1', '[3*]OC', '[3*]OC1=CC2(C)C(CC3OC(=O)C([15*])C4C5([15*])OCC34C2C(O)C5O)C... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1cc([16*])cc(O)c1', '[3*]ON', '[8*]CCCC'"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][=C][C][... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1c2c(nn1C)-c1ccccc1CCC2', '[16*]c1ccc(O)cc1'"
},
{
"role": "assistant",
"content": "[C][N][N][=C][C][=Branch1][#C][=C][R... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][N][C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][O-1].[C][N+1][Branch1][C][C][Branch1][C][C][C].[C][N+1][Branch1][C][C][Branch... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'CCC(C)[B]F'"
},
{
"role": "assistant",
"content": "[C][C][C][Branch1][C][C][BH0][F]"
}
] | |
[
{
"role": "user",
"content": "<image>\nDetermine the SELFIES notation for the molecule in this image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[16*]c1ccccc1', '[3*]O[3*]', '[4*]CCC(C)C', '[5*]N([5*])C'"
},
{
"role": "assistant",
"content": "[C][C][... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'O=C1Nc2cccc(Cl)c2C(C#CC2CC2)(C(F)(F)F)N1'"
},
{
"role": "assistant",
"content": "[O][=C][N][C][=C][C][=C][C][Branch... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[13*]C1NCC1[15*]', '[16*]c1ccccc1', '[3*]O[3*]', '[4*]C[8*]', '[8*]C(F)(F)F'"
},
{
"role": "assistant",
"content": "[F][C][Branch1][C][F][B... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc(N)c(I)c1', '[8*]CN=C(N)N'"
},
{
"role": "assistant",
"content": "[N][C][Branch1][C][N][=N][C][C][=C][C]... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1(C)CC2CCC1C2', '[8*]CO'"
},
{
"role": "assistant",
"content": "[C][C][Branch1][Ring1][C][O][C][C][C][C][C][Ring1][Bra... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C12CC3C(C)CCC3C3(C=O)CC1C=C(C(C)C)C23[15*]', '[16*]c1ccc(C#N)cc1', '[3*]OC', '[3*]O[3*]', '[4*]C[8*]', '[5*]N1CC([13*])OC(C)C([15*... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'[7*]=C1SC(=S)N([10*])C1=O', '[7*]=CC(=[7*])C', '[7*]=Cc1ccccc1', '[8*]CC(=O)O'"
},
{
"role": "assistant",
"content": "[C][C][=... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1sc(C)cc1C#N', '[16*]c1ccc(F)cc1[N+](=O)[O-]', '[5*]N[5*]'"
},
{
"role": "assistant",
"content": "[C][C][=C][C][Branch... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation."
},
{
"role": "assistant",
"content": "[C][C][N][C][C][S][C][Ring1][Branch1][=C][C][=C][C][=N+1][Branch1][Ring1][C][C][C][C][S][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C([4*])C[4*]', '[1*]C(C)=O', '[11*]S[11*]', '[15*]C1CCCCC1[15*]', '[3*]OC', '[3*]O[3*]', '[5*]N[5*]'"
},
{... | |
[
{
"role": "user",
"content": "<image>\nGenerate the SELFIES string for the molecule shown in this image.\nHint: Below are potential or similar substructures of this molecule.\n'CCCC=[N+](C)[O-]'"
},
{
"role": "assistant",
"content": "[C][C][C][C][=N+1][Branch1][C][C][O-1]"
}
] | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?\nHint: Below are potential or similar substructures of this molecule.\n'Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12'"
},
{
"role": "assistant",
"content": "[N][C][=C][C][=C]... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1cccc([16*])c1[16*]', '[3*]OC', '[4*]C[8*]', '[5*]N(C)C', '[8*]C(C)(C)O'"
},
{
"role": "assistant",
"content": "[C][O][C... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[12*]S(C)(=O)=O', '[16*]c1c2ccc(F)cc2nc2c([16*])cccc12', '[16*]c1ccc([16*])c([16*])c1', '[3*]OC', '[5*]N(C)C', '[5*]N[5*]'"
},
{
... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C([4*])C[8*]', '[14*]c1cc([16*])cc([14*])n1', '[14*]c1cnc([14*])[nH]1', '[16*]c1ccccc1', '[3*]OC', '[4*]C[8*]', ... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'O=C1c2ccccc2C(=O)c2[nH]ncc21'"
},
{
"role": "assistant",
"content": "[O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1cc([14*])on1', '[16*]c1cc2cc(Br)ccc2nc1Cl', '[16*]c1ccc([16*])cc1', '[3*]OC'"
},
{
"role": "assistant",
"content":... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[3*]O[3*]', '[4*]C(C)(C)C', '[5*]N1CCC(C(C)=NS(=O)C(C)(C)C)CC1'"
},
{
"role": "assistant",
"content... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([1*])=O', '[11*]SC#N', '[16*]c1ccc([16*])cc1', '[3*]O[3*]', '[4*]CC#CC', '[5*]N[5*]'"
},
{
"role": "assistant",
... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation.\nHint: Below are potential or similar substructures of this molecule.\n'Cl', '[1*]C([6*])=O', '[16*]c1ccc2c(c1)OCO2', '[4*]C([8*])C', '[5*]N1CCN([5*])CC1'"
},
{
"role": "assistant",
"con... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1cc([16*])ccn1', '[14*]c1nc([14*])c2nc([14*])n(C)c(=O)c2n1', '[16*]c1ccc(Cl)cc1F', '[3*]OC', '[5*]N1CCOC([13*])C1', '[8*]C(F)(F)F'... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc(O)c(O)c1', '[8*]CC(N)C(=O)O'"
},
{
"role": "assistant",
"content": "[N][C][Branch1][S][C][C][=C][C... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[11*]S[11*]', '[14*]c1nc2ccccc2c(C)[n+]1[O-]', '[4*]CCC(C)C', '[4*]C[8*]'"
},
{
"role": "assistant",
"content": "[C][C][=... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(N)=O', '[11*]S[11*]', '[16*]c1cc(Cl)cc(Cl)c1', '[16*]c1ccncc1', '[3*]O[3*]', '[4*]CCC[8*]', '[8*]C(C)C', '[8*]C[8*]', '[9*]n1c(... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1ccc(C)s1', '[16*]c1ccc(C#C)c(Cl)c1'"
},
{
"role": "assistant",
"content": "[C][#C][C][=C][C][=C][Branch1][O][C][=C][C][=C][Branch1][... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[14*]c1cnc2c([16*])cc3c(nc(N)n3C)c2n1', '[3*]OS(=O)(=O)O', '[8*]CO'"
},
{
"role": "assistant",
"content": "[C][N][C][Branch1... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[13*]C1CCCC=N1', '[6*]C(=O)O'"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][C][C][C][C][=N][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc([N+](=O)[O-])c(C)c1', '[8*]C(F)(F)F'"
},
{
"role": "assistant",
"content": "[C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][B... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'Cl', '[1*]C(=O)C(C)N', '[1*]C(=O)C([4*])CC(C)C', '[13*]C1CC([15*])C(O)C(C)O1', '[3*]OC', '[3*]OC1CC([15*])(O)Cc2c(O)c3c(c(O)c21)C(=O)c1c([... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?\nHint: Below are potential or similar substructures of this molecule.\n'[10*]N1CC2C3CC4(CC5=CCC3C4C5)C2C1=O', '[8*]CC'"
},
{
"role": "assistant",
"content": "[C][C][N][C][C][C][C][C][Branc... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?"
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][=C][Branch1][C][O][C][=C][Branch1][N][C][Branch1][C][O][=C][Ring1][Branch2... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1CCC2C3C(CCC12C)C1(C)CCC(=O)C=C1Cc1nnnn13', '[8*]C(C)CCCC(C)C'"
},
{
"role": "assistant",
"content": "[C][C][Branch1][... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?"
},
{
"role": "assistant",
"content": "[C][C][O][C][=Branch1][C][=O][C][=Branch1][=Branch2][=C][C][C][=C][O][C][=Ring1][Branch1][P][=Branch1][C][=O][Branch1][Ring2][O][C][C][O][C][C]"
}
... | |
[
{
"role": "user",
"content": "<image>\nDetermine the SELFIES notation for the molecule in this image.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1(C)C=CC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C=C1', '[8*]C(C)(Cl)Cl'"
},
{
"role": "assistant",
"content": "[C][C]... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure."
},
{
"role": "assistant",
"content": "[C][C][O][C][Branch2][Branch1][Branch2][O][C][C][C][C][Branch1][C][C][C][Branch2][Ring2][Branch2][C][C][C][C][Ring1][#Branch1][C][C][C][Bran... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc([16*])c([16*])c1', '[16*]c1ccc([16*])cc1', '[16*]c1ccccc1', '[3*]OC', '[3*]O[3*]', '[4*]C[8*]', '[8*]C([8*])C(Cl)(Cl)Cl'"
}... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C([4*])C[8*]', '[1*]C(=O)CN', '[16*]c1ccccc1', '[3*]OC', '[5*]N[5*]'"
},
{
"role": "assistant",
"content":... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CC1N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21', '[13*]C1NC(=O)C(C)NC(=O)C([13*])N(C)C(=O)C([13*])NC(=O)C([13*])NC(=O)C([13*])N(C)C(=O)C([13*])... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc(C)cc1[16*]', '[3*]O[3*]', '[4*]CC[4*]', '[5*]NC1=NCCN1', '[8*]C(C)C'"
},
{
"role": "assistant",
... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C12CC3CC(CC(C3)C1)C2', '[6*]C(=O)NNC([6*])=O'"
},
{
"role": "assistant",
"content": "[O][=C][Branch2][Ring1][O]... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1CCCCC1', '[8*]C(C)(C)CC(O)CC'"
},
{
"role": "assistant",
"content": "[C][C][C][Branch1][C][O][C][C][Branch1][C]... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1CCC2C3CCC4CC(N)CCC4(C)C3CCC12C', '[8*]C(C)O'"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][O][C][C][C]... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation."
},
{
"role": "assistant",
"content": "[C][=C][C][=C][Branch2][#Branch1][O][C][=C][C][=C][C][Branch2][=Branch1][#C][C][=C][C][Branch2][Branch1][=Branch1][N][C][=C][C][=C][C][=C][Ring1][=... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CCCC[4*]', '[10*]N1C(=O)c2cccc([16*])c2C1=O', '[14*]c1ncc([16*])cn1', '[15*]C1CCC(=O)NC1=O', '[16*]c1cccc(C#N)c1', '[16*]... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation."
},
{
"role": "assistant",
"content": "[C][=C][Branch1][C][C][C][C][C][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch2][Ring2][C][C][C][Branch1][C][O][C][N][C][C][C][C][C... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image."
},
{
"role": "assistant",
"content": "[C][Sn][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][Ring1][#Branch2][C][Branch1][=... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?"
},
{
"role": "assistant",
"content": "[O][=N+1][Branch1][C][O-1][C][=C][N][C][=Branch1][Ring2][=N][Ring1][Branch1][O][C][C][Branch2][Ring1][#Branch1][O][C][C][=C][C][=C][Branch1][O... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CC([4*])C([1*])=O', '[1*]C([1*])=O', '[1*]C([6*])=O', '[15*]C1CCCCC1[15*]', '[16*]c1ccccc1', '[3*]O[3*]', '[4*]C(C)(C)... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1', '[1*]C(=O)C([4*])C', '[1*]C([1*])=O', '[5*]N(C)C', '[5*]NC1CCc2ccccc21', '[5*]N[5... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(C)=O', '[14*]c1nc2c([16*])cc(NN=C(C)c3cccc(C)c3)nc2n1C', '[4*]C([8*])C(C)C', '[5*]N1CCOCC1', '[5*]N[5*]'"
},
{
"role": "a... | |
[
{
"role": "user",
"content": "<image>\nPlease analyze this structure and output its SELFIES formula.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)C(CC[4*])CC(=O)C([4*])C[8*]', '[1*]C(=O)C(N)C[8*]', '[11*]SC', '[16*]c1ccc(F)cc1', '[16*]c1cccc([16*])c1', '[3*]O[3*]', '[4*]C... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'c1ccc2c(c1)Cc1c-2[nH]c2ccccc12'"
},
{
"role": "assistant",
"content": "[C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[15*]C1COc2cc(O)c(O)cc2C1=O', '[16*]c1ccc(O)cc1'"
},
{
"role": "assistant",
"content": "[O][=C][C][=C][C][Branch1][C][O][=C]... | |
[
{
"role": "user",
"content": "<image>\nTranslate this chemical structure into its SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc([16*])cc1', '[3*]OP(O[3*])O[3*]', '[4*]CC(CC)CCCC', '[8*]C(C)(C)CC(C)(C)C'"
},
{
"role": "assistant",
"content": ... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation."
},
{
"role": "assistant",
"content": "[C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure."
},
{
"role": "assistant",
"content": "[C][C][C][=C][Branch2][#Branch1][=Branch1][C][=C][C][=C][Branch2][=Branch1][#Branch2][C][=Branch1][C][=O][N][C][C][C][=Branch1][C][=O][N][C]... | |
[
{
"role": "user",
"content": "<image>\nBased on the molecular structure shown, what is its SELFIES formula?\nHint: Below are potential or similar substructures of this molecule.\n'[4*]CC', '[5*]N1CCCC1[13*]', '[8*]CN'"
},
{
"role": "assistant",
"content": "[C][C][N][C][C][C][C][Ring1][Branch1][C... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[13*]C1([13*])CCCS1(=O)=O', '[3*]O[3*]', '[3*]O[Si](C)(C)C', '[4*]C([4*])[8*]', '[4*]CCC[SiH3]'"
},
{
"role": "assistan... | |
[
{
"role": "user",
"content": "<image>\nWhat SELFIES string corresponds to this molecular diagram?\nHint: Below are potential or similar substructures of this molecule.\n'CCCCC(C)N'"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][Branch1][C][C][N]"
}
] | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?\nHint: Below are potential or similar substructures of this molecule.\n'S', '[16*]c1cccc2ccccc12', '[16*]c1ccccc1', '[16*]c1ccccc1[16*]'"
},
{
"role": "assistant",
"content": "[S].[... | |
[
{
"role": "user",
"content": "<image>\nWhat is the SELFIES formula of this molecule?\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CCS', '[3*]O[3*]', '[4*]CCCCCCCCC'"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][C][C][C][C][O][C][=Branch1][C][=O][C][C]... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'Cc1ccc([Si](C)c2ccc3ccc4cccc5ccc2c3c45)cc1'"
},
{
"role": "assistant",
"content": "[C][C][=C][C][=C][Branch2][Ring1][=... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C(=O)CCC([8*])C', '[1*]C(C)=O', '[15*]C1CCC2(C)C3=CC(=O)C4(C)C([15*])CCC4C3C([15*])CC2C1', '[3*]OC', '[3*]O[3*]'"
},
{
... | |
[
{
"role": "user",
"content": "<image>\nWhat would be the correct SELFIES representation of this chemical compound?"
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][C][=C][Branch1][Ring1][O][C][C][=C][C][=C][C][=Branch1][N][=C][Branch1][C][O][C][Ring1][#Branch1][=C][Ring1][=N][C]... | |
[
{
"role": "user",
"content": "<image>\nPlease convert this molecular structure to its SELFIES representation."
},
{
"role": "assistant",
"content": "[C][C][=C][N][Branch2][Ring2][Ring2][C][C][C][Branch2][Ring1][Branch1][N][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccccc1S(=O)(=O)O', '[4*]CCO', '[5*]N[5*]', '[8*]CCCCCCCCCCC'"
},
{
"role": "assistant",
"content": "... | |
[
{
"role": "user",
"content": "<image>\nGenerate the SELFIES string for the molecule shown in this image.\nHint: Below are potential or similar substructures of this molecule.\n'CC1(C)c2ccccc2C2C1C1(Cl)C(=O)C2(Cl)C(Cl)=C1Cl'"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=C][C][=... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'O=S(=O)(O)c1cc(S(=O)(=O)O)c2ccc(O)c(N=Nc3ccc(S(=O)(=O)O)c4ccccc34)c2c1'"
},
{
"role": "assistant",
"content": "[O][=S][=B... | |
[
{
"role": "user",
"content": "<image>\nCan you provide the SELFIES formula for the displayed molecule?\nHint: Below are potential or similar substructures of this molecule.\n'CN=C(C)NC', '[Li]'"
},
{
"role": "assistant",
"content": "[C][N][=C][Branch1][C][C][N][C].[C][N][=C][Branch1][C][C][N][C]... | |
[
{
"role": "user",
"content": "<image>\nDerive the SELFIES representation from this chemical structure image.\nHint: Below are potential or similar substructures of this molecule.\n'[3*]O[3*]', '[4*]CC', '[4*]CCCCC(CCC)CCCCC(CCC)CCCC'"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][Branch1... | |
[
{
"role": "user",
"content": "<image>\nConvert this molecular diagram to its equivalent SELFIES notation.\nHint: Below are potential or similar substructures of this molecule.\n'CC1(C)CC(O)CC(C)(C)N1'"
},
{
"role": "assistant",
"content": "[H][C][Branch1][C][H][Branch1][C][H][C][Branch1][=Branch... | |
[
{
"role": "user",
"content": "<image>\nPlease identify and provide the SELFIES formula for this molecular structure.\nHint: Below are potential or similar substructures of this molecule.\n'[16*]c1ccc2ccccc2c1', '[16*]c1ccccc1C(=N)c1c(C)cccc1C', '[8*]C[8*]'"
},
{
"role": "assistant",
"content": "... | |
[
{
"role": "user",
"content": "<image>\nDetermine the SELFIES notation for the molecule in this image.\nHint: Below are potential or similar substructures of this molecule.\n'[1*]C([6*])=O', '[15*]C1(C)CCCC1', '[3*]OC', '[3*]O[3*]', '[4*]CC([4*])CC[8*]', '[9*]n1ccc(=O)[nH]c1=O'"
},
{
"role": "assista... |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 7