code
stringlengths
1
2.01M
repo_name
stringlengths
3
62
path
stringlengths
1
267
language
stringclasses
231 values
license
stringclasses
13 values
size
int64
1
2.01M
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import java.io.File; import java.io.IOException; import java.io.InputStream; /** * @author Joe LaPenna (joe@joelapenna.com) */ public interface DiskCache { public boolean exists(String key); public File getFile(String key); public InputStream getInputStream(String key) throws IOException; public void store(String key, InputStream is); public void invalidate(String key); public void cleanup(); public void clear(); }
07806919d-a
main/src/com/joelapenna/foursquared/util/DiskCache.java
Java
asf20
539
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.graphics.drawable.Drawable; import android.widget.TabHost.TabSpec; /** * Acts as an interface to the TabSpec class for setting the content view. * The level 3 SDK doesn't support setting a View for the content sections * of the tab, so we can only use the big native tab style. The level 4 * SDK and up support specifying a custom view for the tab. * * @date March 9, 2010 * @author Mark Wyszomierski (markww@gmail.com), foursquare. */ public class TabsUtil3 { private TabsUtil3() { } public static void setTabIndicator(TabSpec spec, String title, Drawable drawable) { // if (drawable != null) { // spec.setIndicator(title, drawable); // } else { spec.setIndicator(title); // } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/TabsUtil3.java
Java
asf20
860
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.graphics.Bitmap; import android.graphics.BitmapFactory; import android.graphics.Matrix; import android.os.Build; import java.io.FileOutputStream; import java.io.OutputStream; /** * @date July 24, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class ImageUtils { private ImageUtils() { } public static void resampleImageAndSaveToNewLocation(String pathInput, String pathOutput) throws Exception { Bitmap bmp = resampleImage(pathInput, 640); OutputStream out = new FileOutputStream(pathOutput); bmp.compress(Bitmap.CompressFormat.JPEG, 90, out); } public static Bitmap resampleImage(String path, int maxDim) throws Exception { BitmapFactory.Options bfo = new BitmapFactory.Options(); bfo.inJustDecodeBounds = true; BitmapFactory.decodeFile(path, bfo); BitmapFactory.Options optsDownSample = new BitmapFactory.Options(); optsDownSample.inSampleSize = getClosestResampleSize(bfo.outWidth, bfo.outHeight, maxDim); Bitmap bmpt = BitmapFactory.decodeFile(path, optsDownSample); Matrix m = new Matrix(); if (bmpt.getWidth() > maxDim || bmpt.getHeight() > maxDim) { BitmapFactory.Options optsScale = getResampling(bmpt.getWidth(), bmpt.getHeight(), maxDim); m.postScale((float)optsScale.outWidth / (float)bmpt.getWidth(), (float)optsScale.outHeight / (float)bmpt.getHeight()); } int sdk = new Integer(Build.VERSION.SDK).intValue(); if (sdk > 4) { int rotation = ExifUtils.getExifRotation(path); if (rotation != 0) { m.postRotate(rotation); } } return Bitmap.createBitmap(bmpt, 0, 0, bmpt.getWidth(), bmpt.getHeight(), m, true); } private static BitmapFactory.Options getResampling(int cx, int cy, int max) { float scaleVal = 1.0f; BitmapFactory.Options bfo = new BitmapFactory.Options(); if (cx > cy) { scaleVal = (float)max / (float)cx; } else if (cy > cx) { scaleVal = (float)max / (float)cy; } else { scaleVal = (float)max / (float)cx; } bfo.outWidth = (int)(cx * scaleVal + 0.5f); bfo.outHeight = (int)(cy * scaleVal + 0.5f); return bfo; } private static int getClosestResampleSize(int cx, int cy, int maxDim) { int max = Math.max(cx, cy); int resample = 1; for (resample = 1; resample < Integer.MAX_VALUE; resample++) { if (resample * maxDim > max) { resample--; break; } } if (resample > 0) { return resample; } return 1; } public static BitmapFactory.Options getBitmapDims(String path) throws Exception { BitmapFactory.Options bfo = new BitmapFactory.Options(); bfo.inJustDecodeBounds = true; BitmapFactory.decodeFile(path, bfo); return bfo; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/ImageUtils.java
Java
asf20
3,265
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.media.ExifInterface; import android.text.TextUtils; /** * @date July 24, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class ExifUtils { private ExifUtils() { } public static int getExifRotation(String imgPath) { try { ExifInterface exif = new ExifInterface(imgPath); String rotationAmount = exif.getAttribute(ExifInterface.TAG_ORIENTATION); if (!TextUtils.isEmpty(rotationAmount)) { int rotationParam = Integer.parseInt(rotationAmount); switch (rotationParam) { case ExifInterface.ORIENTATION_NORMAL: return 0; case ExifInterface.ORIENTATION_ROTATE_90: return 90; case ExifInterface.ORIENTATION_ROTATE_180: return 180; case ExifInterface.ORIENTATION_ROTATE_270: return 270; default: return 0; } } else { return 0; } } catch (Exception ex) { return 0; } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/ExifUtils.java
Java
asf20
1,279
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.app.Activity; import android.os.Build; /** * Acts as an interface to the contacts API which has changed between SDK 4 to * 5. * * @date February 14, 2010 * @author Mark Wyszomierski (markww@gmail.com), foursquare. */ public abstract class AddressBookUtils { public abstract String getAllContactsPhoneNumbers(Activity activity); public abstract String getAllContactsEmailAddresses(Activity activity); public abstract AddressBookEmailBuilder getAllContactsEmailAddressesInfo( Activity activity); public static AddressBookUtils addressBookUtils() { int sdk = new Integer(Build.VERSION.SDK).intValue(); if (sdk < 5) { return new AddressBookUtils3and4(); } else { return new AddressBookUtils5(); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/AddressBookUtils.java
Java
asf20
902
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import java.io.BufferedReader; import java.io.InputStream; import java.io.InputStreamReader; import java.text.DateFormat; import java.text.ParseException; import java.text.SimpleDateFormat; import java.util.Calendar; import java.util.Date; import android.content.res.Resources; import android.text.TextUtils; import android.text.format.DateUtils; import com.joelapenna.foursquare.types.Checkin; import com.joelapenna.foursquare.types.User; import com.joelapenna.foursquare.types.Venue; import com.joelapenna.foursquared.R; /** * @author Joe LaPenna (joe@joelapenna.com) * @author Mark Wyszomierski (markww@gmail.com) * -Added date formats for today/yesterday/older contexts. */ public class StringFormatters { public static final SimpleDateFormat DATE_FORMAT = new SimpleDateFormat( "EEE, dd MMM yy HH:mm:ss Z"); /** Should look like "9:09 AM". */ public static final SimpleDateFormat DATE_FORMAT_TODAY = new SimpleDateFormat( "h:mm a"); /** Should look like "Sun 1:56 PM". */ public static final SimpleDateFormat DATE_FORMAT_YESTERDAY = new SimpleDateFormat( "E h:mm a"); /** Should look like "Sat Mar 20". */ public static final SimpleDateFormat DATE_FORMAT_OLDER = new SimpleDateFormat( "E MMM d"); public static String getVenueLocationFull(Venue venue) { StringBuilder sb = new StringBuilder(); sb.append(venue.getAddress()); if (sb.length() > 0) { sb.append(" "); } if (!TextUtils.isEmpty(venue.getCrossstreet())) { sb.append("("); sb.append(venue.getCrossstreet()); sb.append(")"); } return sb.toString(); } public static String getVenueLocationCrossStreetOrCity(Venue venue) { if (!TextUtils.isEmpty(venue.getCrossstreet())) { return "(" + venue.getCrossstreet() + ")"; } else if (!TextUtils.isEmpty(venue.getCity()) && !TextUtils.isEmpty(venue.getState()) && !TextUtils.isEmpty(venue.getZip())) { return venue.getCity() + ", " + venue.getState() + " " + venue.getZip(); } else { return null; } } public static String getCheckinMessageLine1(Checkin checkin, boolean displayAtVenue) { if (checkin.getDisplay() != null) { return checkin.getDisplay(); } else { StringBuilder sb = new StringBuilder(); sb.append(getUserAbbreviatedName(checkin.getUser())); if (checkin.getVenue() != null && displayAtVenue) { sb.append(" @ " + checkin.getVenue().getName()); } return sb.toString(); } } public static String getCheckinMessageLine2(Checkin checkin) { if (TextUtils.isEmpty(checkin.getShout()) == false) { return checkin.getShout(); } else { // No shout, show address instead. if (checkin.getVenue() != null && checkin.getVenue().getAddress() != null) { String address = checkin.getVenue().getAddress(); if (checkin.getVenue().getCrossstreet() != null && checkin.getVenue().getCrossstreet().length() > 0) { address += " (" + checkin.getVenue().getCrossstreet() + ")"; } return address; } else { return ""; } } } public static String getCheckinMessageLine3(Checkin checkin) { if (!TextUtils.isEmpty(checkin.getCreated())) { try { return getTodayTimeString(checkin.getCreated()); } catch (Exception ex) { return checkin.getCreated(); } } else { return ""; } } public static String getUserFullName(User user) { StringBuffer sb = new StringBuffer(); sb.append(user.getFirstname()); String lastName = user.getLastname(); if (lastName != null && lastName.length() > 0) { sb.append(" "); sb.append(lastName); } return sb.toString(); } public static String getUserAbbreviatedName(User user) { StringBuffer sb = new StringBuffer(); sb.append(user.getFirstname()); String lastName = user.getLastname(); if (lastName != null && lastName.length() > 0) { sb.append(" "); sb.append(lastName.substring(0, 1) + "."); } return sb.toString(); } public static CharSequence getRelativeTimeSpanString(String created) { try { return DateUtils.getRelativeTimeSpanString(DATE_FORMAT.parse(created).getTime(), new Date().getTime(), DateUtils.MINUTE_IN_MILLIS, DateUtils.FORMAT_ABBREV_RELATIVE); } catch (ParseException e) { return created; } } /** * Returns a format that will look like: "9:09 AM". */ public static String getTodayTimeString(String created) { try { return DATE_FORMAT_TODAY.format(DATE_FORMAT.parse(created)); } catch (ParseException e) { return created; } } /** * Returns a format that will look like: "Sun 1:56 PM". */ public static String getYesterdayTimeString(String created) { try { return DATE_FORMAT_YESTERDAY.format(DATE_FORMAT.parse(created)); } catch (ParseException e) { return created; } } /** * Returns a format that will look like: "Sat Mar 20". */ public static String getOlderTimeString(String created) { try { return DATE_FORMAT_OLDER.format(DATE_FORMAT.parse(created)); } catch (ParseException e) { return created; } } /** * Reads an inputstream into a string. */ public static String inputStreamToString(InputStream is) throws Exception { BufferedReader reader = new BufferedReader(new InputStreamReader(is)); StringBuilder sb = new StringBuilder(); String line = null; while ((line = reader.readLine()) != null) { sb.append(line); } is.close(); return sb.toString(); } public static String getTipAge(Resources res, String created) { Calendar then = Calendar.getInstance(); then.setTime(new Date(created)); Calendar now = Calendar.getInstance(); now.setTime(new Date(System.currentTimeMillis())); if (now.get(Calendar.YEAR) == then.get(Calendar.YEAR)) { if (now.get(Calendar.MONTH) == then.get(Calendar.MONTH)) { int diffDays = now.get(Calendar.DAY_OF_MONTH)- then.get(Calendar.DAY_OF_MONTH); if (diffDays == 0) { return res.getString(R.string.tip_age_today); } else if (diffDays == 1) { return res.getString(R.string.tip_age_days, "1", ""); } else { return res.getString(R.string.tip_age_days, String.valueOf(diffDays), "s"); } } else { int diffMonths = now.get(Calendar.MONTH) - then.get(Calendar.MONTH); if (diffMonths == 1) { return res.getString(R.string.tip_age_months, "1", ""); } else { return res.getString(R.string.tip_age_months, String.valueOf(diffMonths), "s"); } } } else { int diffYears = now.get(Calendar.YEAR) - then.get(Calendar.YEAR); if (diffYears == 1) { return res.getString(R.string.tip_age_years, "1", ""); } else { return res.getString(R.string.tip_age_years, String.valueOf(diffYears), "s"); } } } public static String createServerDateFormatV1() { DateFormat df = new SimpleDateFormat("EEE, dd MMM yy HH:mm:ss Z"); return df.format(new Date()); } }
07806919d-a
main/src/com/joelapenna/foursquared/util/StringFormatters.java
Java
asf20
8,145
package com.joelapenna.foursquared.util; import com.joelapenna.foursquare.types.Group; import com.joelapenna.foursquare.types.User; import java.util.ArrayList; import java.util.HashMap; import java.util.HashSet; import java.util.LinkedHashMap; import java.util.List; import java.util.Map; import java.util.Set; /** * Handles building an internal list of all email addresses as both a comma * separated list, and as a linked hash map for use with email invites. The * internal map is kept for pruning when we get a list of contacts which are * already foursquare users back from the invite api method. Note that after * the prune method is called, the internal mEmailsCommaSeparated memeber may * be out of sync with the contents of the other maps. * * @date April 26, 2010 * @author Mark Wyszomierski (markww@gmail.com) * */ public class AddressBookEmailBuilder { /** * Keeps all emails as a flat comma separated list for use with the * API findFriends method. */ private StringBuilder mEmailsCommaSeparated; /** * Links a single email address to a single contact name. */ private LinkedHashMap<String, String> mEmailsToNames; /** * Links a single contact name to multiple email addresses. */ private HashMap<String, HashSet<String>> mNamesToEmails; public AddressBookEmailBuilder() { mEmailsCommaSeparated = new StringBuilder(); mEmailsToNames = new LinkedHashMap<String, String>(); mNamesToEmails = new HashMap<String, HashSet<String>>(); } public void addContact(String contactName, String contactEmail) { // Email addresses should be uniquely tied to a single contact name. mEmailsToNames.put(contactEmail, contactName); // Reverse link, a single contact can have multiple email addresses. HashSet<String> emailsForContact = mNamesToEmails.get(contactName); if (emailsForContact == null) { emailsForContact = new HashSet<String>(); mNamesToEmails.put(contactName, emailsForContact); } emailsForContact.add(contactEmail); // Keep building the comma separated flat list of email addresses. if (mEmailsCommaSeparated.length() > 0) { mEmailsCommaSeparated.append(","); } mEmailsCommaSeparated.append(contactEmail); } public String getEmailsCommaSeparated() { return mEmailsCommaSeparated.toString(); } public void pruneEmailsAndNames(Group<User> group) { if (group != null) { for (User it : group) { // Get the contact name this email address belongs to. String contactName = mEmailsToNames.get(it.getEmail()); if (contactName != null) { Set<String> allEmailsForContact = mNamesToEmails.get(contactName); if (allEmailsForContact != null) { for (String jt : allEmailsForContact) { // Get rid of these emails from the master list. mEmailsToNames.remove(jt); } } } } } } /** Returns the map as a list of [email, name] pairs. */ public List<ContactSimple> getEmailsAndNamesAsList() { List<ContactSimple> list = new ArrayList<ContactSimple>(); for (Map.Entry<String, String> it : mEmailsToNames.entrySet()) { ContactSimple contact = new ContactSimple(); contact.mName = it.getValue(); contact.mEmail = it.getKey(); list.add(contact); } return list; } public String getNameForEmail(String email) { return mEmailsToNames.get(email); } public String toStringCurrentEmails() { StringBuilder sb = new StringBuilder(1024); sb.append("Current email contents:\n"); for (Map.Entry<String, String> it : mEmailsToNames.entrySet()) { sb.append(it.getValue()); sb.append(" "); sb.append(it.getKey()); sb.append("\n"); } return sb.toString(); } public static void main(String[] args) { AddressBookEmailBuilder bld = new AddressBookEmailBuilder(); bld.addContact("john", "john@google.com"); bld.addContact("john", "john@hotmail.com"); bld.addContact("john", "john@yahoo.com"); bld.addContact("jane", "jane@blah.com"); bld.addContact("dave", "dave@amazon.com"); bld.addContact("dave", "dave@earthlink.net"); bld.addContact("sara", "sara@odwalla.org"); bld.addContact("sara", "sara@test.com"); System.out.println("Comma separated list of emails addresses:"); System.out.println(bld.getEmailsCommaSeparated()); Group<User> users = new Group<User>(); User userJohn = new User(); userJohn.setEmail("john@hotmail.com"); users.add(userJohn); User userSara = new User(); userSara.setEmail("sara@test.com"); users.add(userSara); bld.pruneEmailsAndNames(users); System.out.println(bld.toStringCurrentEmails()); } public static class ContactSimple { public String mName; public String mEmail; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/AddressBookEmailBuilder.java
Java
asf20
5,397
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import com.google.android.maps.GeoPoint; import android.content.Context; import android.location.Location; import android.location.LocationManager; import java.util.List; /** * @date June 30, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class GeoUtils { /** * To be used if you just want a one-shot best last location, iterates over * all providers and returns the most accurate result. */ public static Location getBestLastGeolocation(Context context) { LocationManager manager = (LocationManager)context.getSystemService( Context.LOCATION_SERVICE); List<String> providers = manager.getAllProviders(); Location bestLocation = null; for (String it : providers) { Location location = manager.getLastKnownLocation(it); if (location != null) { if (bestLocation == null || location.getAccuracy() < bestLocation.getAccuracy()) { bestLocation = location; } } } return bestLocation; } public static GeoPoint locationToGeoPoint(Location location) { if (location != null) { GeoPoint pt = new GeoPoint( (int)(location.getLatitude() * 1E6 + 0.5), (int)(location.getLongitude() * 1E6 + 0.5)); return pt; } else { return null; } } public static GeoPoint stringLocationToGeoPoint(String strlat, String strlon) { try { double lat = Double.parseDouble(strlat); double lon = Double.parseDouble(strlon); GeoPoint pt = new GeoPoint( (int)(lat * 1E6 + 0.5), (int)(lon * 1E6 + 0.5)); return pt; } catch (Exception ex) { return null; } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/GeoUtils.java
Java
asf20
1,993
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquared.FoursquaredSettings; import android.net.Uri; import android.util.Log; import java.io.File; import java.io.IOException; import java.io.InputStream; import java.util.Observable; import java.util.Observer; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class RemoteResourceManager extends Observable { private static final String TAG = "RemoteResourceManager"; private static final boolean DEBUG = FoursquaredSettings.DEBUG; private DiskCache mDiskCache; private RemoteResourceFetcher mRemoteResourceFetcher; private FetcherObserver mFetcherObserver = new FetcherObserver(); public RemoteResourceManager(String cacheName) { this(new BaseDiskCache("foursquare", cacheName)); } public RemoteResourceManager(DiskCache cache) { mDiskCache = cache; mRemoteResourceFetcher = new RemoteResourceFetcher(mDiskCache); mRemoteResourceFetcher.addObserver(mFetcherObserver); } public boolean exists(Uri uri) { return mDiskCache.exists(Uri.encode(uri.toString())); } /** * If IOException is thrown, we don't have the resource available. */ public File getFile(Uri uri) { if (DEBUG) Log.d(TAG, "getInputStream(): " + uri); return mDiskCache.getFile(Uri.encode(uri.toString())); } /** * If IOException is thrown, we don't have the resource available. */ public InputStream getInputStream(Uri uri) throws IOException { if (DEBUG) Log.d(TAG, "getInputStream(): " + uri); return mDiskCache.getInputStream(Uri.encode(uri.toString())); } /** * Request a resource be downloaded. Useful to call after a IOException from getInputStream. */ public void request(Uri uri) { if (DEBUG) Log.d(TAG, "request(): " + uri); mRemoteResourceFetcher.fetch(uri, Uri.encode(uri.toString())); } /** * Explicitly expire an individual item. */ public void invalidate(Uri uri) { mDiskCache.invalidate(Uri.encode(uri.toString())); } public void shutdown() { mRemoteResourceFetcher.shutdown(); mDiskCache.cleanup(); } public void clear() { mRemoteResourceFetcher.shutdown(); mDiskCache.clear(); } public static abstract class ResourceRequestObserver implements Observer { private Uri mRequestUri; abstract public void requestReceived(Observable observable, Uri uri); public ResourceRequestObserver(Uri requestUri) { mRequestUri = requestUri; } @Override public void update(Observable observable, Object data) { if (DEBUG) Log.d(TAG, "Recieved update: " + data); Uri dataUri = (Uri)data; if (dataUri == mRequestUri) { if (DEBUG) Log.d(TAG, "requestReceived: " + dataUri); requestReceived(observable, dataUri); } } } /** * Relay the observed download to this controlling class. */ private class FetcherObserver implements Observer { @Override public void update(Observable observable, Object data) { setChanged(); notifyObservers(data); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/RemoteResourceManager.java
Java
asf20
3,347
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquared.PreferenceActivity; import com.joelapenna.foursquared.R; import android.content.Context; import android.content.Intent; import android.view.Menu; /** * Collection of common functions which are called from the menu * * @author Alex Volovoy (avolovoy@gmail.com) */ public class MenuUtils { // Common menu items private static final int MENU_PREFERENCES = -1; private static final int MENU_GROUP_SYSTEM = 20; public static void addPreferencesToMenu(Context context, Menu menu) { Intent intent = new Intent(context, PreferenceActivity.class); menu.add(MENU_GROUP_SYSTEM, MENU_PREFERENCES, Menu.CATEGORY_SECONDARY, R.string.preferences_label).setIcon(R.drawable.ic_menu_preferences).setIntent( intent); } }
07806919d-a
main/src/com/joelapenna/foursquared/util/MenuUtils.java
Java
asf20
894
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.text.TextUtils; import com.joelapenna.foursquare.types.FoursquareType; import com.joelapenna.foursquare.types.Tip; import com.joelapenna.foursquare.types.Todo; /** * @date September 2, 2010. * @author Mark Wyszomierski (markww@gmail.com) */ public class TipUtils { public static final String TIP_STATUS_TODO = "todo"; public static final String TIP_STATUS_DONE = "done"; public static boolean isTodo(Tip tip) { if (tip != null) { if (!TextUtils.isEmpty(tip.getStatus())) { return tip.getStatus().equals(TIP_STATUS_TODO); } } return false; } public static boolean isDone(Tip tip) { if (tip != null) { if (!TextUtils.isEmpty(tip.getStatus())) { return tip.getStatus().equals(TIP_STATUS_DONE); } } return false; } public static boolean areEqual(FoursquareType tipOrTodo1, FoursquareType tipOrTodo2) { if (tipOrTodo1 instanceof Tip) { if (tipOrTodo2 instanceof Todo) { return false; } Tip tip1 = (Tip)tipOrTodo1; Tip tip2 = (Tip)tipOrTodo2; if (!tip1.getId().equals(tip2.getId())) { return false; } if (!TextUtils.isEmpty(tip1.getStatus()) && !TextUtils.isEmpty(tip2.getStatus())) { return tip1.getStatus().equals(tip2.getStatus()); } else if (TextUtils.isEmpty(tip1.getStatus()) && TextUtils.isEmpty(tip2.getStatus())) { return true; } else { return false; } } else if (tipOrTodo1 instanceof Todo) { if (tipOrTodo2 instanceof Tip) { return false; } Todo todo1 = (Todo)tipOrTodo1; Todo todo2 = (Todo)tipOrTodo2; if (!todo1.getId().equals(todo2.getId())) { return false; } if (todo1.getTip().getId().equals(todo2.getId())) { return true; } } return false; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/TipUtils.java
Java
asf20
2,077
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquared.R; import android.content.Context; import android.content.Intent; import android.graphics.drawable.Drawable; import android.os.Build; import android.view.LayoutInflater; import android.view.View; import android.widget.ImageView; import android.widget.TabHost; import android.widget.TextView; import android.widget.TabHost.TabSpec; /** * Acts as an interface to the TabSpec class for setting the content view. The * level 3 SDK doesn't support setting a View for the content sections of the * tab, so we can only use the big native tab style. The level 4 SDK and up * support specifying a custom view for the tab. * * @date March 9, 2010 * @author Mark Wyszomierski (markww@gmail.com), foursquare. */ public abstract class TabsUtil { private static void setTabIndicator(TabSpec spec, String title, Drawable drawable, View view) { int sdk = new Integer(Build.VERSION.SDK).intValue(); if (sdk < 4) { TabsUtil3.setTabIndicator(spec, title, drawable); } else { TabsUtil4.setTabIndicator(spec, view); } } public static void addTab(TabHost host, String title, int drawable, int index, int layout) { TabHost.TabSpec spec = host.newTabSpec("tab" + index); spec.setContent(layout); View view = prepareTabView(host.getContext(), title, drawable); TabsUtil.setTabIndicator(spec, title, host.getContext().getResources().getDrawable(drawable), view); host.addTab(spec); } public static void addTab(TabHost host, String title, int drawable, int index, Intent intent) { TabHost.TabSpec spec = host.newTabSpec("tab" + index); spec.setContent(intent); View view = prepareTabView(host.getContext(), title, drawable); TabsUtil.setTabIndicator(spec, title, host.getContext().getResources().getDrawable(drawable), view); host.addTab(spec); } private static View prepareTabView(Context context, String text, int drawable) { View view = LayoutInflater.from(context).inflate(R.layout.tab_main_nav, null); TextView tv = (TextView) view.findViewById(R.id.tvTitle); tv.setText(text); ImageView iv = (ImageView) view.findViewById(R.id.ivIcon); iv.setImageResource(drawable); return view; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/TabsUtil.java
Java
asf20
2,428
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquare.Foursquare; import com.joelapenna.foursquare.types.User; import com.joelapenna.foursquared.Foursquared; import com.joelapenna.foursquared.R; import android.app.Activity; import android.content.Context; import android.graphics.Bitmap; import android.graphics.BitmapFactory; import android.net.Uri; import android.text.TextUtils; import android.util.Log; import android.widget.ImageView; import java.io.IOException; import java.util.Observable; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class UserUtils { public static void ensureUserPhoto(final Context context, final User user, final boolean DEBUG, final String TAG) { Activity activity = ((Activity) context); final ImageView photo = (ImageView) activity.findViewById(R.id.photo); if (user.getPhoto() == null) { photo.setImageResource(R.drawable.blank_boy); return; } final Uri photoUri = Uri.parse(user.getPhoto()); if (photoUri != null) { RemoteResourceManager userPhotosManager = ((Foursquared) activity.getApplication()) .getRemoteResourceManager(); try { Bitmap bitmap = BitmapFactory.decodeStream(userPhotosManager .getInputStream(photoUri)); photo.setImageBitmap(bitmap); } catch (IOException e) { if (DEBUG) Log.d(TAG, "photo not already retrieved, requesting: " + photoUri); userPhotosManager.addObserver(new RemoteResourceManager.ResourceRequestObserver( photoUri) { @Override public void requestReceived(Observable observable, Uri uri) { observable.deleteObserver(this); updateUserPhoto(context, photo, uri, user, DEBUG, TAG); } }); userPhotosManager.request(photoUri); } } } private static void updateUserPhoto(Context context, final ImageView photo, final Uri uri, final User user, final boolean DEBUG, final String TAG) { final Activity activity = ((Activity) context); activity.runOnUiThread(new Runnable() { @Override public void run() { try { if (DEBUG) Log.d(TAG, "Loading user photo: " + uri); RemoteResourceManager userPhotosManager = ((Foursquared) activity .getApplication()).getRemoteResourceManager(); Bitmap bitmap = BitmapFactory.decodeStream(userPhotosManager .getInputStream(uri)); photo.setImageBitmap(bitmap); if (DEBUG) Log.d(TAG, "Loaded user photo: " + uri); } catch (IOException e) { if (DEBUG) Log.d(TAG, "Unable to load user photo: " + uri); if (Foursquare.MALE.equals(user.getGender())) { photo.setImageResource(R.drawable.blank_boy); } else { photo.setImageResource(R.drawable.blank_girl); } } catch (Exception e) { Log.d(TAG, "Ummm............", e); } } }); } public static boolean isFriend(User user) { if (user == null) { return false; } else if (TextUtils.isEmpty(user.getFriendstatus())) { return false; } else if (user.getFriendstatus().equals("friend")) { return true; } else { return false; } } public static boolean isFollower(User user) { if (user == null) { return false; } else if (TextUtils.isEmpty(user.getFriendstatus())) { return false; } else if (user.getFriendstatus().equals("pendingyou")) { return true; } else { return false; } } public static boolean isFriendStatusPendingYou(User user) { return user != null && user.getFriendstatus() != null && user.getFriendstatus().equals("pendingyou"); } public static boolean isFriendStatusPendingThem(User user) { return user != null && user.getFriendstatus() != null && user.getFriendstatus().equals("pendingthem"); } public static boolean isFriendStatusFollowingThem(User user) { return user != null && user.getFriendstatus() != null && user.getFriendstatus().equals("followingthem"); } public static int getDrawableForMeTabByGender(String gender) { if (gender != null && gender.equals("female")) { return R.drawable.tab_main_nav_me_girl_selector; } else { return R.drawable.tab_main_nav_me_boy_selector; } } public static int getDrawableForMeMenuItemByGender(String gender) { if (gender == null) { return R.drawable.ic_menu_myinfo_boy; } else if (gender.equals("female")) { return R.drawable.ic_menu_myinfo_girl; } else { return R.drawable.ic_menu_myinfo_boy; } } public static boolean getCanHaveFollowers(User user) { if (user.getTypes() != null && user.getTypes().size() > 0) { if (user.getTypes().contains("canHaveFollowers")) { return true; } } return false; } public static int getDrawableByGenderForUserThumbnail(User user) { String gender = user.getGender(); if (gender != null && gender.equals("female")) { return R.drawable.blank_girl; } else { return R.drawable.blank_boy; } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/UserUtils.java
Java
asf20
5,931
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.content.Context; import android.content.Intent; import android.net.Uri; import android.os.Build; import android.util.Log; import android.widget.Toast; /** * @date September 15, 2010. * @author Mark Wyszomierski (markww@gmail.com) */ public class UiUtil { private static final String TAG = "UiUtil"; public static int sdkVersion() { return new Integer(Build.VERSION.SDK).intValue(); } public static void startDialer(Context context, String phoneNumber) { try { Intent dial = new Intent(); dial.setAction(Intent.ACTION_DIAL); dial.setData(Uri.parse("tel:" + phoneNumber)); context.startActivity(dial); } catch (Exception ex) { Log.e(TAG, "Error starting phone dialer intent.", ex); Toast.makeText(context, "Sorry, we couldn't find any app to place a phone call!", Toast.LENGTH_SHORT).show(); } } public static void startSmsIntent(Context context, String phoneNumber) { try { Uri uri = Uri.parse("sms:" + phoneNumber); Intent intent = new Intent(Intent.ACTION_VIEW, uri); intent.putExtra("address", phoneNumber); intent.setType("vnd.android-dir/mms-sms"); context.startActivity(intent); } catch (Exception ex) { Log.e(TAG, "Error starting sms intent.", ex); Toast.makeText(context, "Sorry, we couldn't find any app to send an SMS!", Toast.LENGTH_SHORT).show(); } } public static void startEmailIntent(Context context, String emailAddress) { try { Intent intent = new Intent(android.content.Intent.ACTION_SEND); intent.setType("plain/text"); intent.putExtra(android.content.Intent.EXTRA_EMAIL, new String[] { emailAddress }); context.startActivity(intent); } catch (Exception ex) { Log.e(TAG, "Error starting email intent.", ex); Toast.makeText(context, "Sorry, we couldn't find any app for sending emails!", Toast.LENGTH_SHORT).show(); } } public static void startWebIntent(Context context, String url) { try { Intent intent = new Intent(Intent.ACTION_VIEW, Uri.parse(url)); context.startActivity(intent); } catch (Exception ex) { Log.e(TAG, "Error starting url intent.", ex); Toast.makeText(context, "Sorry, we couldn't find any app for viewing this url!", Toast.LENGTH_SHORT).show(); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/UiUtil.java
Java
asf20
2,738
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import android.util.Log; import java.util.HashMap; import java.util.Map; import java.util.logging.Handler; import java.util.logging.Level; import java.util.logging.LogRecord; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class JavaLoggingHandler extends Handler { private static Map<Level, Integer> sLoglevelMap = new HashMap<Level, Integer>(); static { sLoglevelMap.put(Level.FINEST, Log.VERBOSE); sLoglevelMap.put(Level.FINER, Log.DEBUG); sLoglevelMap.put(Level.FINE, Log.DEBUG); sLoglevelMap.put(Level.INFO, Log.INFO); sLoglevelMap.put(Level.WARNING, Log.WARN); sLoglevelMap.put(Level.SEVERE, Log.ERROR); } @Override public void publish(LogRecord record) { Integer level = sLoglevelMap.get(record.getLevel()); if (level == null) { level = Log.VERBOSE; } Log.println(level, record.getLoggerName(), record.getMessage()); } @Override public void close() { } @Override public void flush() { } }
07806919d-a
main/src/com/joelapenna/foursquared/util/JavaLoggingHandler.java
Java
asf20
1,135
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquared.FoursquaredSettings; import android.os.Environment; import android.util.Log; import java.io.BufferedInputStream; import java.io.BufferedOutputStream; import java.io.File; import java.io.FileInputStream; import java.io.FileOutputStream; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class BaseDiskCache implements DiskCache { private static final String TAG = "BaseDiskCache"; private static final boolean DEBUG = FoursquaredSettings.DEBUG; private static final String NOMEDIA = ".nomedia"; private static final int MIN_FILE_SIZE_IN_BYTES = 100; private File mStorageDirectory; BaseDiskCache(String dirPath, String name) { // Lets make sure we can actually cache things! File baseDirectory = new File(Environment.getExternalStorageDirectory(), dirPath); File storageDirectory = new File(baseDirectory, name); createDirectory(storageDirectory); mStorageDirectory = storageDirectory; // cleanup(); // Remove invalid files that may have shown up. cleanupSimple(); } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#exists(java.lang.String) */ @Override public boolean exists(String key) { return getFile(key).exists(); } /** * This is silly, but our content provider *has* to serve content: URIs as File/FileDescriptors * using ContentProvider.openAssetFile, this is a limitation of the StreamLoader that is used by * the WebView. So, we handle this by writing the file to disk, and returning a File pointer to * it. * * @param guid * @return */ public File getFile(String hash) { return new File(mStorageDirectory.toString() + File.separator + hash); } public InputStream getInputStream(String hash) throws IOException { return (InputStream)new FileInputStream(getFile(hash)); } /* * (non-Javadoc) * @see com.joelapenna.everdroid.evernote.NoteResourceDataBodyCache#storeResource (com * .evernote.edam.type.Resource) */ public void store(String key, InputStream is) { if (DEBUG) Log.d(TAG, "store: " + key); is = new BufferedInputStream(is); try { OutputStream os = new BufferedOutputStream(new FileOutputStream(getFile(key))); byte[] b = new byte[2048]; int count; int total = 0; while ((count = is.read(b)) > 0) { os.write(b, 0, count); total += count; } os.close(); if (DEBUG) Log.d(TAG, "store complete: " + key); } catch (IOException e) { if (DEBUG) Log.d(TAG, "store failed to store: " + key, e); return; } } public void invalidate(String key) { getFile(key).delete(); } public void cleanup() { // removes files that are too small to be valid. Cheap and cheater way to remove files that // were corrupted during download. String[] children = mStorageDirectory.list(); if (children != null) { // children will be null if hte directyr does not exist. for (int i = 0; i < children.length; i++) { File child = new File(mStorageDirectory, children[i]); if (!child.equals(new File(mStorageDirectory, NOMEDIA)) && child.length() <= MIN_FILE_SIZE_IN_BYTES) { if (DEBUG) Log.d(TAG, "Deleting: " + child); child.delete(); } } } } /** * Temporary fix until we rework this disk cache. We delete the first 50 youngest files * if we find the cache has more than 1000 images in it. */ public void cleanupSimple() { final int maxNumFiles = 1000; final int numFilesToDelete = 50; String[] children = mStorageDirectory.list(); if (children != null) { if (DEBUG) Log.d(TAG, "Found disk cache length to be: " + children.length); if (children.length > maxNumFiles) { if (DEBUG) Log.d(TAG, "Disk cache found to : " + children); for (int i = children.length - 1, m = i - numFilesToDelete; i > m; i--) { File child = new File(mStorageDirectory, children[i]); if (DEBUG) Log.d(TAG, " deleting: " + child.getName()); child.delete(); } } } } public void clear() { // Clear the whole cache. Coolness. String[] children = mStorageDirectory.list(); if (children != null) { // children will be null if hte directyr does not exist. for (int i = 0; i < children.length; i++) { File child = new File(mStorageDirectory, children[i]); if (!child.equals(new File(mStorageDirectory, NOMEDIA))) { if (DEBUG) Log.d(TAG, "Deleting: " + child); child.delete(); } } } mStorageDirectory.delete(); } private static final void createDirectory(File storageDirectory) { if (!storageDirectory.exists()) { Log.d(TAG, "Trying to create storageDirectory: " + String.valueOf(storageDirectory.mkdirs())); Log.d(TAG, "Exists: " + storageDirectory + " " + String.valueOf(storageDirectory.exists())); Log.d(TAG, "State: " + Environment.getExternalStorageState()); Log.d(TAG, "Isdir: " + storageDirectory + " " + String.valueOf(storageDirectory.isDirectory())); Log.d(TAG, "Readable: " + storageDirectory + " " + String.valueOf(storageDirectory.canRead())); Log.d(TAG, "Writable: " + storageDirectory + " " + String.valueOf(storageDirectory.canWrite())); File tmp = storageDirectory.getParentFile(); Log.d(TAG, "Exists: " + tmp + " " + String.valueOf(tmp.exists())); Log.d(TAG, "Isdir: " + tmp + " " + String.valueOf(tmp.isDirectory())); Log.d(TAG, "Readable: " + tmp + " " + String.valueOf(tmp.canRead())); Log.d(TAG, "Writable: " + tmp + " " + String.valueOf(tmp.canWrite())); tmp = tmp.getParentFile(); Log.d(TAG, "Exists: " + tmp + " " + String.valueOf(tmp.exists())); Log.d(TAG, "Isdir: " + tmp + " " + String.valueOf(tmp.isDirectory())); Log.d(TAG, "Readable: " + tmp + " " + String.valueOf(tmp.canRead())); Log.d(TAG, "Writable: " + tmp + " " + String.valueOf(tmp.canWrite())); } File nomediaFile = new File(storageDirectory, NOMEDIA); if (!nomediaFile.exists()) { try { Log.d(TAG, "Created file: " + nomediaFile + " " + String.valueOf(nomediaFile.createNewFile())); } catch (IOException e) { Log.d(TAG, "Unable to create .nomedia file for some reason.", e); throw new IllegalStateException("Unable to create nomedia file."); } } // After we best-effort try to create the file-structure we need, // lets make sure it worked. if (!(storageDirectory.isDirectory() && nomediaFile.exists())) { throw new RuntimeException("Unable to create storage directory and nomedia file."); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/BaseDiskCache.java
Java
asf20
7,683
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquared.Foursquared; import com.joelapenna.foursquared.R; import android.content.ActivityNotFoundException; import android.content.Context; import android.content.Intent; import android.content.res.Resources; import android.os.Build; import android.widget.Toast; /** * Collection of common functions for sending feedback. * * @author Alex Volovoy (avolovoy@gmail.com) */ public class FeedbackUtils { private static final String FEEDBACK_EMAIL_ADDRESS = "crashreport-android@foursquare.com"; public static void SendFeedBack(Context context, Foursquared foursquared) { Intent sendIntent = new Intent(Intent.ACTION_SEND); final String[] mailto = { FEEDBACK_EMAIL_ADDRESS }; final String new_line = "\n"; StringBuilder body = new StringBuilder(); Resources res = context.getResources(); body.append(new_line); body.append(new_line); body.append(res.getString(R.string.feedback_more)); body.append(new_line); body.append(res.getString(R.string.feedback_question_how_to_reproduce)); body.append(new_line); body.append(new_line); body.append(res.getString(R.string.feedback_question_expected_output)); body.append(new_line); body.append(new_line); body.append(res.getString(R.string.feedback_question_additional_information)); body.append(new_line); body.append(new_line); body.append("--------------------------------------"); body.append(new_line); body.append("ver: "); body.append(foursquared.getVersion()); body.append(new_line); body.append("user: "); body.append(foursquared.getUserId()); body.append(new_line); body.append("p: "); body.append(Build.MODEL); body.append(new_line); body.append("os: "); body.append(Build.VERSION.RELEASE); body.append(new_line); body.append("build#: "); body.append(Build.DISPLAY); body.append(new_line); body.append(new_line); sendIntent.putExtra(Intent.EXTRA_SUBJECT, context.getString(R.string.feedback_subject)); sendIntent.putExtra(Intent.EXTRA_EMAIL, mailto); sendIntent.putExtra(Intent.EXTRA_TEXT, body.toString()); sendIntent.setType("message/rfc822"); try { context.startActivity(Intent.createChooser(sendIntent, context .getText(R.string.feedback_subject))); } catch (ActivityNotFoundException ex) { Toast.makeText(context, context.getText(R.string.feedback_error), Toast.LENGTH_SHORT) .show(); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/FeedbackUtils.java
Java
asf20
2,801
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.os.Parcel; import android.text.TextUtils; import com.joelapenna.foursquare.types.Group; import com.joelapenna.foursquare.types.Tip; import com.joelapenna.foursquare.types.Todo; import com.joelapenna.foursquare.types.Venue; /** * @date September 16, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class VenueUtils { public static void handleTipChange(Venue venue, Tip tip, Todo todo) { // Update the tip in the tips group, if it exists. updateTip(venue, tip); // If it is a to-do, then make sure a to-do exists for it // in the to-do group. if (TipUtils.isTodo(tip)) { addTodo(venue, tip, todo); } else { // If it is not a to-do, make sure it does not exist in the // to-do group. removeTodo(venue, tip); } } private static void updateTip(Venue venue, Tip tip) { if (venue.getTips() != null) { for (Tip it : venue.getTips()) { if (it.getId().equals(tip.getId())) { it.setStatus(tip.getStatus()); break; } } } } public static void addTodo(Venue venue, Tip tip, Todo todo) { venue.setHasTodo(true); if (venue.getTodos() == null) { venue.setTodos(new Group<Todo>()); } // If found a to-do linked to the tip ID, then overwrite to-do attributes // with newer to-do object. for (Todo it : venue.getTodos()) { if (it.getTip().getId().equals(tip.getId())) { it.setId(todo.getId()); it.setCreated(todo.getCreated()); return; } } venue.getTodos().add(todo); } public static void addTip(Venue venue, Tip tip) { if (venue.getTips() == null) { venue.setTips(new Group<Tip>()); } for (Tip it : venue.getTips()) { if (it.getId().equals(tip.getId())) { return; } } venue.getTips().add(tip); } private static void removeTodo(Venue venue, Tip tip) { for (Todo it : venue.getTodos()) { if (it.getTip().getId().equals(tip.getId())) { venue.getTodos().remove(it); break; } } if (venue.getTodos().size() > 0) { venue.setHasTodo(true); } else { venue.setHasTodo(false); } } public static void replaceTipsAndTodos(Venue venueTarget, Venue venueSource) { if (venueTarget.getTips() == null) { venueTarget.setTips(new Group<Tip>()); } if (venueTarget.getTodos() == null) { venueTarget.setTodos(new Group<Todo>()); } if (venueSource.getTips() == null) { venueSource.setTips(new Group<Tip>()); } if (venueSource.getTodos() == null) { venueSource.setTodos(new Group<Todo>()); } venueTarget.getTips().clear(); venueTarget.getTips().addAll(venueSource.getTips()); venueTarget.getTodos().clear(); venueTarget.getTodos().addAll(venueSource.getTodos()); if (venueTarget.getTodos().size() > 0) { venueTarget.setHasTodo(true); } else { venueTarget.setHasTodo(false); } } public static boolean getSpecialHere(Venue venue) { if (venue != null && venue.getSpecials() != null && venue.getSpecials().size() > 0) { Venue specialVenue = venue.getSpecials().get(0).getVenue(); if (specialVenue == null || specialVenue.getId().equals(venue.getId())) { return true; } } return false; } /** * Creates a copy of the passed venue. This should really be implemented * as a copy constructor. */ public static Venue cloneVenue(Venue venue) { Parcel p1 = Parcel.obtain(); Parcel p2 = Parcel.obtain(); byte[] bytes = null; p1.writeValue(venue); bytes = p1.marshall(); p2.unmarshall(bytes, 0, bytes.length); p2.setDataPosition(0); Venue venueNew = (Venue)p2.readValue(Venue.class.getClassLoader()); p1.recycle(); p2.recycle(); return venueNew; } public static String toStringVenueShare(Venue venue) { StringBuilder sb = new StringBuilder(); sb.append(venue.getName()); sb.append("\n"); sb.append(StringFormatters.getVenueLocationFull(venue)); if (!TextUtils.isEmpty(venue.getPhone())) { sb.append("\n"); sb.append(venue.getPhone()); } return sb.toString(); } /** * Dumps some info about a venue. This can be moved into the Venue class. */ public static String toString(Venue venue) { StringBuilder sb = new StringBuilder(); sb.append(venue.toString()); sb.append(":\n"); sb.append(" id: "); sb.append(venue.getId()); sb.append("\n"); sb.append(" name: "); sb.append(venue.getName()); sb.append("\n"); sb.append(" address: "); sb.append(venue.getAddress()); sb.append("\n"); sb.append(" cross: "); sb.append(venue.getCrossstreet()); sb.append("\n"); sb.append(" hastodo: "); sb.append(venue.getHasTodo()); sb.append("\n"); sb.append(" tips: "); sb.append(venue.getTips() == null ? "(null)" : venue.getTips().size()); sb.append("\n"); sb.append(" todos: "); sb.append(venue.getTodos() == null ? "(null)" : venue.getTodos().size()); sb.append("\n"); sb.append(" specials: "); sb.append(venue.getSpecials() == null ? "(null)" : venue.getSpecials().size()); sb.append("\n"); return sb.toString(); } }
07806919d-a
main/src/com/joelapenna/foursquared/util/VenueUtils.java
Java
asf20
5,574
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.util.Log; import java.util.Calendar; import java.util.Date; /** * Initializes a few Date objects to act as boundaries for sorting checkin lists * by the following time categories: * * <ul> * <li>Within the last three hours.</li> * <li>Today</li> * <li>Yesterday</li> * </ul> * * Create an instance of this class, then call one of the three getBoundary() methods * and compare against a Date object to see if it falls before or after. * * @date March 22, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class CheckinTimestampSort { private static final String TAG = "CheckinTimestampSort"; private static final boolean DEBUG = false; private static final int IDX_RECENT = 0; private static final int IDX_TODAY = 1; private static final int IDX_YESTERDAY = 2; private Date[] mBoundaries; public CheckinTimestampSort() { mBoundaries = getDateObjects(); } public Date getBoundaryRecent() { return mBoundaries[IDX_RECENT]; } public Date getBoundaryToday() { return mBoundaries[IDX_TODAY]; } public Date getBoundaryYesterday() { return mBoundaries[IDX_YESTERDAY]; } private static Date[] getDateObjects() { Calendar cal = Calendar.getInstance(); cal.setTime(new Date()); if (DEBUG) Log.d(TAG, "Now: " + cal.getTime().toGMTString()); // Three hours ago or newer. cal.add(Calendar.HOUR, -3); Date dateRecent = cal.getTime(); if (DEBUG) Log.d(TAG, "Recent: " + cal.getTime().toGMTString()); // Today. cal.clear(Calendar.HOUR_OF_DAY); cal.clear(Calendar.HOUR); cal.clear(Calendar.MINUTE); cal.clear(Calendar.SECOND); Date dateToday = cal.getTime(); if (DEBUG) Log.d(TAG, "Today: " + cal.getTime().toGMTString()); // Yesterday. cal.add(Calendar.DAY_OF_MONTH, -1); Date dateYesterday = cal.getTime(); if (DEBUG) Log.d(TAG, "Yesterday: " + cal.getTime().toGMTString()); return new Date[] { dateRecent, dateToday, dateYesterday }; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/CheckinTimestampSort.java
Java
asf20
2,310
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared.util; import android.app.Activity; import android.database.Cursor; import android.provider.Contacts; import android.provider.Contacts.PhonesColumns; /** * Implementation of address book functions for sdk levels 3 and 4. * * @date February 14, 2010 * @author Mark Wyszomierski (markww@gmail.com), foursquare. */ public class AddressBookUtils3and4 extends AddressBookUtils { public AddressBookUtils3and4() { } @Override public String getAllContactsPhoneNumbers(Activity activity) { StringBuilder sb = new StringBuilder(1024); String[] PROJECTION = new String[] { PhonesColumns.NUMBER }; Cursor c = activity.managedQuery(Contacts.Phones.CONTENT_URI, PROJECTION, null, null, Contacts.Phones.DEFAULT_SORT_ORDER); if (c.moveToFirst()) { sb.append(c.getString(0)); while (c.moveToNext()) { sb.append(","); sb.append(c.getString(0)); } } c.close(); return sb.toString(); } @Override public String getAllContactsEmailAddresses(Activity activity) { StringBuilder sb = new StringBuilder(1024); String[] PROJECTION = new String[] { Contacts.ContactMethods.DATA }; Cursor c = activity.managedQuery( Contacts.ContactMethods.CONTENT_EMAIL_URI, PROJECTION, null, null, Contacts.ContactMethods.DEFAULT_SORT_ORDER); if (c.moveToFirst()) { sb.append(c.getString(0)); while (c.moveToNext()) { sb.append(","); sb.append(c.getString(0)); } } c.close(); return sb.toString(); } @Override public AddressBookEmailBuilder getAllContactsEmailAddressesInfo(Activity activity) { String[] PROJECTION = new String[] { Contacts.PeopleColumns.NAME, Contacts.ContactMethods.DATA }; Cursor c = activity.managedQuery( Contacts.ContactMethods.CONTENT_EMAIL_URI, PROJECTION, null, null, Contacts.ContactMethods.DEFAULT_SORT_ORDER); // We give a list of emails: markww@gmail.com,johndoe@gmail.com,janedoe@gmail.com // We get back only a list of emails of users that exist on the system (johndoe@gmail.com) // Iterate over all those returned users, on each iteration, remove from our hashmap. // Can now use the left over hashmap, which is still in correct order to display invites. AddressBookEmailBuilder bld = new AddressBookEmailBuilder(); if (c.moveToFirst()) { bld.addContact(c.getString(0), c.getString(1)); while (c.moveToNext()) { bld.addContact(c.getString(0), c.getString(1)); } } c.close(); return bld; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/AddressBookUtils3and4.java
Java
asf20
3,066
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquare.types.Checkin; import com.joelapenna.foursquare.types.Tip; import com.joelapenna.foursquare.types.User; import com.joelapenna.foursquare.types.Venue; import java.text.ParseException; import java.util.Comparator; /** * @author Joe LaPenna (joe@joelapenna.com) * @author Mark Wyszomierski (markww@gmail.com) * -Updated getVenueDistanceComparator() to do numeric comparison. (2010-03-23) */ public class Comparators { private static Comparator<Venue> sVenueDistanceComparator = null; private static Comparator<User> sUserRecencyComparator = null; private static Comparator<Checkin> sCheckinRecencyComparator = null; private static Comparator<Checkin> sCheckinDistanceComparator = null; private static Comparator<Tip> sTipRecencyComparator = null; public static Comparator<Venue> getVenueDistanceComparator() { if (sVenueDistanceComparator == null) { sVenueDistanceComparator = new Comparator<Venue>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(Venue object1, Venue object2) { // TODO: In practice we're pretty much guaranteed to get valid locations // from foursquare, but.. what if we don't, what's a good fail behavior // here? try { int d1 = Integer.parseInt(object1.getDistance()); int d2 = Integer.parseInt(object2.getDistance()); if (d1 < d2) { return -1; } else if (d1 > d2) { return 1; } else { return 0; } } catch (NumberFormatException ex) { return object1.getDistance().compareTo(object2.getDistance()); } } }; } return sVenueDistanceComparator; } public static Comparator<Venue> getVenueNameComparator() { if (sVenueDistanceComparator == null) { sVenueDistanceComparator = new Comparator<Venue>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(Venue object1, Venue object2) { return object1.getName().toLowerCase().compareTo( object2.getName().toLowerCase()); } }; } return sVenueDistanceComparator; } public static Comparator<User> getUserRecencyComparator() { if (sUserRecencyComparator == null) { sUserRecencyComparator = new Comparator<User>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(User object1, User object2) { try { return StringFormatters.DATE_FORMAT.parse(object2.getCreated()).compareTo( StringFormatters.DATE_FORMAT.parse(object1.getCreated())); } catch (ParseException e) { return 0; } } }; } return sUserRecencyComparator; } public static Comparator<Checkin> getCheckinRecencyComparator() { if (sCheckinRecencyComparator == null) { sCheckinRecencyComparator = new Comparator<Checkin>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(Checkin object1, Checkin object2) { try { return StringFormatters.DATE_FORMAT.parse(object2.getCreated()).compareTo( StringFormatters.DATE_FORMAT.parse(object1.getCreated())); } catch (ParseException e) { return 0; } } }; } return sCheckinRecencyComparator; } public static Comparator<Checkin> getCheckinDistanceComparator() { if (sCheckinDistanceComparator == null) { sCheckinDistanceComparator = new Comparator<Checkin>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(Checkin object1, Checkin object2) { try { int d1 = Integer.parseInt(object1.getDistance()); int d2 = Integer.parseInt(object2.getDistance()); if (d1 > d2) { return 1; } else if (d2 > d1) { return -1; } else { return 0; } } catch (NumberFormatException ex) { return 0; } } }; } return sCheckinDistanceComparator; } public static Comparator<Tip> getTipRecencyComparator() { if (sTipRecencyComparator == null) { sTipRecencyComparator = new Comparator<Tip>() { /* * (non-Javadoc) * @see java.util.Comparator#compare(java.lang.Object, java.lang.Object) */ @Override public int compare(Tip object1, Tip object2) { try { return StringFormatters.DATE_FORMAT.parse(object2.getCreated()).compareTo( StringFormatters.DATE_FORMAT.parse(object1.getCreated())); } catch (ParseException e) { return 0; } } }; } return sTipRecencyComparator; } }
07806919d-a
main/src/com/joelapenna/foursquared/util/Comparators.java
Java
asf20
6,515
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import java.io.File; import java.io.FileNotFoundException; import java.io.IOException; import java.io.InputStream; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class NullDiskCache implements DiskCache { /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#exists(java.lang.String) */ @Override public boolean exists(String key) { return false; } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#getFile(java.lang.String) */ @Override public File getFile(String key) { return null; } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#getInputStream(java.lang.String) */ @Override public InputStream getInputStream(String key) throws IOException { throw new FileNotFoundException(); } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#store(java.lang.String, java.io.InputStream) */ @Override public void store(String key, InputStream is) { } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#cleanup() */ @Override public void cleanup() { } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#invalidate(java.lang.String) */ @Override public void invalidate(String key) { } /* * (non-Javadoc) * @see com.joelapenna.foursquared.util.DiskCache#clear() */ @Override public void clear() { } }
07806919d-a
main/src/com/joelapenna/foursquared/util/NullDiskCache.java
Java
asf20
1,637
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared.util; import com.joelapenna.foursquare.error.FoursquareCredentialsException; import com.joelapenna.foursquare.error.FoursquareException; import com.joelapenna.foursquared.FoursquaredSettings; import com.joelapenna.foursquared.error.LocationException; import android.content.Context; import android.util.Log; import android.widget.Toast; import java.io.IOException; import java.net.SocketException; import java.net.SocketTimeoutException; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class NotificationsUtil { private static final String TAG = "NotificationsUtil"; private static final boolean DEBUG = FoursquaredSettings.DEBUG; public static void ToastReasonForFailure(Context context, Exception e) { if (DEBUG) Log.d(TAG, "Toasting for exception: ", e); if (e == null) { Toast.makeText(context, "A surprising new problem has occured. Try again!", Toast.LENGTH_SHORT).show(); } else if (e instanceof SocketTimeoutException) { Toast.makeText(context, "Foursquare over capacity, server request timed out!", Toast.LENGTH_SHORT).show(); } else if (e instanceof SocketException) { Toast.makeText(context, "Foursquare server not responding", Toast.LENGTH_SHORT).show(); } else if (e instanceof IOException) { Toast.makeText(context, "Network unavailable", Toast.LENGTH_SHORT).show(); } else if (e instanceof LocationException) { Toast.makeText(context, e.getMessage(), Toast.LENGTH_SHORT).show(); } else if (e instanceof FoursquareCredentialsException) { Toast.makeText(context, "Authorization failed.", Toast.LENGTH_SHORT).show(); } else if (e instanceof FoursquareException) { // FoursquareError is one of these String message; int toastLength = Toast.LENGTH_SHORT; if (e.getMessage() == null) { message = "Invalid Request"; } else { message = e.getMessage(); toastLength = Toast.LENGTH_LONG; } Toast.makeText(context, message, toastLength).show(); } else { Toast.makeText(context, "A surprising new problem has occured. Try again!", Toast.LENGTH_SHORT).show(); DumpcatcherHelper.sendException(e); } } }
07806919d-a
main/src/com/joelapenna/foursquared/util/NotificationsUtil.java
Java
asf20
2,476
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared; import android.app.Dialog; import android.content.Context; import android.os.Bundle; import android.view.Display; import android.view.WindowManager; import android.webkit.WebView; import android.widget.LinearLayout; /** * Renders the result of a checkin using a CheckinResult object. This is called * from CheckinExecuteActivity. It would be nicer to put this in another activity, * but right now the CheckinResult is quite large and would require a good amount * of work to add serializers for all its inner classes. This wouldn't be a huge * problem, but maintaining it as the classes evolve could more trouble than it's * worth. * * The only way the user can dismiss this dialog is by hitting the 'back' key. * CheckingExecuteActivity depends on this so it knows when to finish() itself. * * @date March 3, 2010. * @author Mark Wyszomierski (markww@gmail.com), foursquare. * */ public class WebViewDialog extends Dialog { private WebView mWebView; private String mTitle; private String mContent; public WebViewDialog(Context context, String title, String content) { super(context, R.style.ThemeCustomDlgBase_ThemeCustomDlg); mTitle = title; mContent = content; } @Override public void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); setContentView(R.layout.webview_dialog); setTitle(mTitle); mWebView = (WebView)findViewById(R.id.webView); mWebView.loadDataWithBaseURL("--", mContent, "text/html", "utf-8", ""); LinearLayout llMain = (LinearLayout)findViewById(R.id.llMain); inflateDialog(llMain); } /** * Force-inflates a dialog main linear-layout to take max available screen space even though * contents might not occupy full screen size. */ public static void inflateDialog(LinearLayout layout) { WindowManager wm = (WindowManager) layout.getContext().getSystemService(Context.WINDOW_SERVICE); Display display = wm.getDefaultDisplay(); layout.setMinimumWidth(display.getWidth() - 30); layout.setMinimumHeight(display.getHeight() - 40); } }
07806919d-a
main/src/com/joelapenna/foursquared/WebViewDialog.java
Java
asf20
2,290
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared; import android.app.Activity; import android.app.ProgressDialog; import android.content.DialogInterface; import android.content.DialogInterface.OnCancelListener; import android.content.Intent; import android.os.AsyncTask; import android.os.Bundle; import android.text.TextUtils; import android.util.Log; import android.view.View; import android.view.View.OnClickListener; import android.widget.Button; import android.widget.EditText; import android.widget.TextView; import android.widget.Toast; import com.joelapenna.foursquare.types.Tip; import com.joelapenna.foursquare.types.Venue; import com.joelapenna.foursquared.location.LocationUtils; import com.joelapenna.foursquared.util.NotificationsUtil; import com.joelapenna.foursquared.util.StringFormatters; /** * Lets the user add a tip to a venue. * * @date September 16, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class AddTipActivity extends Activity { private static final String TAG = "AddTipActivity"; public static final String INTENT_EXTRA_VENUE = Foursquared.PACKAGE_NAME + ".AddTipActivity.INTENT_EXTRA_VENUE"; public static final String EXTRA_TIP_RETURNED = Foursquared.PACKAGE_NAME + ".AddTipActivity.EXTRA_TIP_RETURNED"; private StateHolder mStateHolder; private ProgressDialog mDlgProgress; @Override public void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); setContentView(R.layout.add_tip_activity); StateHolder holder = (StateHolder) getLastNonConfigurationInstance(); if (holder != null) { mStateHolder = holder; mStateHolder.setActivityForTasks(this); } else { mStateHolder = new StateHolder(); if (getIntent().hasExtra(INTENT_EXTRA_VENUE)) { mStateHolder.setVenue((Venue)getIntent().getParcelableExtra(INTENT_EXTRA_VENUE)); } else { Log.e(TAG, "AddTipActivity must be given a venue parcel as intent extras."); finish(); return; } } ensureUi(); } @Override public Object onRetainNonConfigurationInstance() { mStateHolder.setActivityForTasks(null); return mStateHolder; } private void ensureUi() { TextView tvVenueName = (TextView)findViewById(R.id.addTipActivityVenueName); tvVenueName.setText(mStateHolder.getVenue().getName()); TextView tvVenueAddress = (TextView)findViewById(R.id.addTipActivityVenueAddress); tvVenueAddress.setText(StringFormatters.getVenueLocationCrossStreetOrCity( mStateHolder.getVenue())); Button btn = (Button) findViewById(R.id.addTipActivityButton); btn.setOnClickListener(new OnClickListener() { @Override public void onClick(View v) { EditText et = (EditText)findViewById(R.id.addTipActivityText); String text = et.getText().toString(); if (!TextUtils.isEmpty(text)) { mStateHolder.startTaskAddTip(AddTipActivity.this, mStateHolder.getVenue().getId(), text); } else { Toast.makeText(AddTipActivity.this, text, Toast.LENGTH_SHORT).show(); } } }); if (mStateHolder.getIsRunningTaskVenue()) { startProgressBar(); } } private void startProgressBar() { if (mDlgProgress == null) { mDlgProgress = ProgressDialog.show(this, "", getResources().getString(R.string.add_tip_todo_activity_progress_message)); mDlgProgress.setCancelable(true); mDlgProgress.setOnCancelListener(new OnCancelListener() { @Override public void onCancel(DialogInterface dialog) { Log.e(TAG, "User cancelled add tip."); mStateHolder.cancelTasks(); } }); } mDlgProgress.show(); setProgressBarIndeterminateVisibility(true); } private void stopProgressBar() { if (mDlgProgress != null) { mDlgProgress.dismiss(); mDlgProgress = null; } setProgressBarIndeterminateVisibility(false); } private static class TaskAddTip extends AsyncTask<Void, Void, Tip> { private AddTipActivity mActivity; private String mVenueId; private String mTipText; private Exception mReason; public TaskAddTip(AddTipActivity activity, String venueId, String tipText) { mActivity = activity; mVenueId = venueId; mTipText = tipText; } @Override protected void onPreExecute() { mActivity.startProgressBar(); } @Override protected Tip doInBackground(Void... params) { try { // The returned tip won't have the user object or venue attached to it // as part of the response. The venue is the parent venue and the user // is the logged-in user. Foursquared foursquared = (Foursquared)mActivity.getApplication(); Tip tip = foursquared.getFoursquare().addTip( mVenueId, mTipText, "tip", LocationUtils.createFoursquareLocation(foursquared.getLastKnownLocation())); // So fetch the full tip for convenience. Tip tipFull = foursquared.getFoursquare().tipDetail(tip.getId()); return tipFull; } catch (Exception e) { Log.e(TAG, "Error adding tip.", e); mReason = e; } return null; } @Override protected void onPostExecute(Tip tip) { mActivity.stopProgressBar(); mActivity.mStateHolder.setIsRunningTaskAddTip(false); if (tip != null) { Intent intent = new Intent(); intent.putExtra(EXTRA_TIP_RETURNED, tip); mActivity.setResult(Activity.RESULT_OK, intent); mActivity.finish(); } else { NotificationsUtil.ToastReasonForFailure(mActivity, mReason); mActivity.setResult(Activity.RESULT_CANCELED); mActivity.finish(); } } @Override protected void onCancelled() { mActivity.stopProgressBar(); mActivity.setResult(Activity.RESULT_CANCELED); mActivity.finish(); } public void setActivity(AddTipActivity activity) { mActivity = activity; } } private static final class StateHolder { private Venue mVenue; private TaskAddTip mTaskAddTip; private boolean mIsRunningTaskAddTip; public Venue getVenue() { return mVenue; } public void setVenue(Venue venue) { mVenue = venue; } public boolean getIsRunningTaskVenue() { return mIsRunningTaskAddTip; } public void setIsRunningTaskAddTip(boolean isRunningTaskAddTip) { mIsRunningTaskAddTip = isRunningTaskAddTip; } public void startTaskAddTip(AddTipActivity activity, String venueId, String text) { mIsRunningTaskAddTip = true; mTaskAddTip = new TaskAddTip(activity, venueId, text); mTaskAddTip.execute(); } public void setActivityForTasks(AddTipActivity activity) { if (mTaskAddTip != null) { mTaskAddTip.setActivity(activity); } } public void cancelTasks() { if (mTaskAddTip != null) { mTaskAddTip.cancel(true); } } } }
07806919d-a
main/src/com/joelapenna/foursquared/AddTipActivity.java
Java
asf20
7,839
/** * Copyright 2010 Mark Wyszomierski */ package com.joelapenna.foursquared; import com.joelapenna.foursquare.Foursquare; import com.joelapenna.foursquare.error.FoursquareException; import com.joelapenna.foursquare.types.CheckinResult; import com.joelapenna.foursquared.location.LocationUtils; import com.joelapenna.foursquared.util.NotificationsUtil; import com.joelapenna.foursquared.util.RemoteResourceManager; import android.app.Activity; import android.app.Dialog; import android.app.ProgressDialog; import android.content.BroadcastReceiver; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.IntentFilter; import android.content.DialogInterface.OnCancelListener; import android.location.Location; import android.net.Uri; import android.os.AsyncTask; import android.os.Bundle; import android.util.Log; import android.view.Window; /** * Can be called to execute a checkin. Should be presented with the transparent * dialog theme to appear only as a progress bar. When execution is complete, a * successful checkin will show an instance of CheckinResultDialog to handle * rendering the CheckinResult response object. A failed checkin will show a * toast with the error message. Ideally we could launch another activity for * rendering the result, but passing the CheckinResult between activities using * the extras data will have to be done when we have more time. * * For the location paramters of the checkin method, this activity will grab the * global last-known best location. * * The activity will setResult(RESULT_OK) if the checkin worked, and will * setResult(RESULT_CANCELED) if it did not work. * * @date March 2, 2010 * @author Mark Wyszomierski (markww@gmail.com). */ public class CheckinExecuteActivity extends Activity { public static final String TAG = "CheckinExecuteActivity"; public static final boolean DEBUG = FoursquaredSettings.DEBUG; public static final String INTENT_EXTRA_VENUE_ID = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_VENUE_ID"; public static final String INTENT_EXTRA_SHOUT = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_SHOUT"; public static final String INTENT_EXTRA_TELL_FRIENDS = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_TELL_FRIENDS"; public static final String INTENT_EXTRA_TELL_FOLLOWERS = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_TELL_FOLLOWERS"; public static final String INTENT_EXTRA_TELL_TWITTER = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_TELL_TWITTER"; public static final String INTENT_EXTRA_TELL_FACEBOOK = Foursquared.PACKAGE_NAME + ".CheckinExecuteActivity.INTENT_EXTRA_TELL_FACEBOOK"; private static final int DIALOG_CHECKIN_RESULT = 1; private StateHolder mStateHolder; private ProgressDialog mDlgProgress; private BroadcastReceiver mLoggedOutReceiver = new BroadcastReceiver() { @Override public void onReceive(Context context, Intent intent) { if (DEBUG) Log.d(TAG, "onReceive: " + intent); finish(); } }; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); if (DEBUG) Log.d(TAG, "onCreate()"); requestWindowFeature(Window.FEATURE_NO_TITLE); setContentView(R.layout.checkin_execute_activity); registerReceiver(mLoggedOutReceiver, new IntentFilter(Foursquared.INTENT_ACTION_LOGGED_OUT)); // We start the checkin immediately on creation. Object retained = getLastNonConfigurationInstance(); if (retained != null && retained instanceof StateHolder) { mStateHolder = (StateHolder) retained; mStateHolder.setActivity(this); } else { mStateHolder = new StateHolder(); String venueId = null; if (getIntent().getExtras().containsKey(INTENT_EXTRA_VENUE_ID)) { venueId = getIntent().getExtras().getString(INTENT_EXTRA_VENUE_ID); } else { Log.e(TAG, "CheckinExecuteActivity requires intent extra 'INTENT_EXTRA_VENUE_ID'."); finish(); return; } Foursquared foursquared = (Foursquared) getApplication(); Location location = foursquared.getLastKnownLocation(); mStateHolder.startTask( CheckinExecuteActivity.this, venueId, location, getIntent().getExtras().getString(INTENT_EXTRA_SHOUT), getIntent().getExtras().getBoolean(INTENT_EXTRA_TELL_FRIENDS, false), getIntent().getExtras().getBoolean(INTENT_EXTRA_TELL_FOLLOWERS, false), getIntent().getExtras().getBoolean(INTENT_EXTRA_TELL_TWITTER, false), getIntent().getExtras().getBoolean(INTENT_EXTRA_TELL_FACEBOOK, false) ); } } @Override public Object onRetainNonConfigurationInstance() { mStateHolder.setActivity(null); return mStateHolder; } @Override public void onResume() { super.onResume(); if (mStateHolder.getIsRunning()) { startProgressBar(getResources().getString(R.string.checkin_action_label), getResources().getString(R.string.checkin_execute_activity_progress_bar_message)); } } @Override public void onPause() { super.onPause(); stopProgressBar(); if (isFinishing()) { mStateHolder.cancelTasks(); } } @Override protected void onDestroy() { super.onDestroy(); unregisterReceiver(mLoggedOutReceiver); } private void startProgressBar(String title, String message) { if (mDlgProgress == null) { mDlgProgress = ProgressDialog.show(this, title, message); } mDlgProgress.show(); } private void stopProgressBar() { if (mDlgProgress != null) { mDlgProgress.dismiss(); mDlgProgress = null; } } @Override protected Dialog onCreateDialog(int id) { switch (id) { case DIALOG_CHECKIN_RESULT: // When the user cancels the dialog (by hitting the 'back' key), we // finish this activity. We don't listen to onDismiss() for this // action, because a device rotation will fire onDismiss(), and our // dialog would not be re-displayed after the rotation is complete. CheckinResultDialog dlg = new CheckinResultDialog( this, mStateHolder.getCheckinResult(), ((Foursquared)getApplication())); dlg.setOnCancelListener(new OnCancelListener() { @Override public void onCancel(DialogInterface dialog) { removeDialog(DIALOG_CHECKIN_RESULT); setResult(Activity.RESULT_OK); finish(); } }); return dlg; } return null; } private void onCheckinComplete(CheckinResult result, Exception ex) { mStateHolder.setIsRunning(false); stopProgressBar(); if (result != null) { mStateHolder.setCheckinResult(result); showDialog(DIALOG_CHECKIN_RESULT); } else { NotificationsUtil.ToastReasonForFailure(this, ex); setResult(Activity.RESULT_CANCELED); finish(); } } private static class CheckinTask extends AsyncTask<Void, Void, CheckinResult> { private CheckinExecuteActivity mActivity; private String mVenueId; private Location mLocation; private String mShout; private boolean mTellFriends; private boolean mTellFollowers; private boolean mTellTwitter; private boolean mTellFacebook; private Exception mReason; public CheckinTask(CheckinExecuteActivity activity, String venueId, Location location, String shout, boolean tellFriends, boolean tellFollowers, boolean tellTwitter, boolean tellFacebook) { mActivity = activity; mVenueId = venueId; mLocation = location; mShout = shout; mTellFriends = tellFriends; mTellFollowers = tellFollowers; mTellTwitter = tellTwitter; mTellFacebook = tellFacebook; } public void setActivity(CheckinExecuteActivity activity) { mActivity = activity; } @Override protected void onPreExecute() { mActivity.startProgressBar(mActivity.getResources().getString( R.string.checkin_action_label), mActivity.getResources().getString( R.string.checkin_execute_activity_progress_bar_message)); } @Override protected CheckinResult doInBackground(Void... params) { try { Foursquared foursquared = (Foursquared) mActivity.getApplication(); Foursquare foursquare = foursquared.getFoursquare(); CheckinResult result = foursquare.checkin( mVenueId, null, // passing in the real venue name causes a 400 response from the server. LocationUtils.createFoursquareLocation(mLocation), mShout, !mTellFriends, // (isPrivate) mTellFollowers, mTellTwitter, mTellFacebook); // Here we should really be downloading the mayor's photo serially, so that this // work is done in the background while the progress bar is already spinning. // When the checkin result dialog pops up, the photo would already be loaded. // We can at least start the request if necessary here in the background thread. if (result != null && result.getMayor() != null && result.getMayor().getUser() != null) { if (result.getMayor() != null && result.getMayor().getUser() != null) { Uri photoUri = Uri.parse(result.getMayor().getUser().getPhoto()); RemoteResourceManager rrm = foursquared.getRemoteResourceManager(); if (rrm.exists(photoUri) == false) { rrm.request(photoUri); } } } return result; } catch (Exception e) { if (DEBUG) Log.d(TAG, "CheckinTask: Exception checking in.", e); mReason = e; } return null; } @Override protected void onPostExecute(CheckinResult result) { if (DEBUG) Log.d(TAG, "CheckinTask: onPostExecute()"); if (mActivity != null) { mActivity.onCheckinComplete(result, mReason); } } @Override protected void onCancelled() { if (mActivity != null) { mActivity.onCheckinComplete(null, new FoursquareException( "Check-in cancelled.")); } } } private static class StateHolder { private CheckinTask mTask; private CheckinResult mCheckinResult; private boolean mIsRunning; public StateHolder() { mCheckinResult = null; mIsRunning = false; } public void startTask(CheckinExecuteActivity activity, String venueId, Location location, String shout, boolean tellFriends, boolean tellFollowers, boolean tellTwitter, boolean tellFacebook) { mIsRunning = true; mTask = new CheckinTask( activity, venueId, location, shout, tellFriends, tellFollowers, tellTwitter, tellFacebook); mTask.execute(); } public void setActivity(CheckinExecuteActivity activity) { if (mTask != null) { mTask.setActivity(activity); } } public boolean getIsRunning() { return mIsRunning; } public void setIsRunning(boolean isRunning) { mIsRunning = isRunning; } public CheckinResult getCheckinResult() { return mCheckinResult; } public void setCheckinResult(CheckinResult result) { mCheckinResult = result; } public void cancelTasks() { if (mTask != null && mIsRunning) { mTask.setActivity(null); mTask.cancel(true); } } } }
07806919d-a
main/src/com/joelapenna/foursquared/CheckinExecuteActivity.java
Java
asf20
13,494
/* * Copyright 2010 Mark Wyszomierski * Portions Copyright (c) 2008-2010 Facebook, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.facebook.android; import android.os.Bundle; import android.text.TextUtils; import java.io.IOException; import java.net.MalformedURLException; /** * Main Facebook object for storing session token and session expiration date * in memory, as well as generating urls to access different facebook endpoints. * * @author Steven Soneff (ssoneff@facebook.com): * -original author. * @author Mark Wyszomierski (markww@gmail.com): * -modified to remove network operation calls, and dialog creation, * focused on making this class only generate urls for external use * and storage of a session token and expiration date. */ public class Facebook { /** Strings used in the OAuth flow */ public static final String REDIRECT_URI = "fbconnect://success"; public static final String CANCEL_URI = "fbconnect:cancel"; public static final String TOKEN = "access_token"; public static final String EXPIRES = "expires_in"; /** Login action requires a few extra steps for setup and completion. */ public static final String LOGIN = "login"; /** Facebook server endpoints: may be modified in a subclass for testing */ protected static String OAUTH_ENDPOINT = "https://graph.facebook.com/oauth/authorize"; // https protected static String UI_SERVER = "http://www.facebook.com/connect/uiserver.php"; // http protected static String GRAPH_BASE_URL = "https://graph.facebook.com/"; protected static String RESTSERVER_URL = "https://api.facebook.com/restserver.php"; private String mAccessToken = null; private long mAccessExpires = 0; public Facebook() { } /** * Invalidates the current access token in memory, and generates a * prepared URL that can be used to log the user out. * * @throws MalformedURLException * @return PreparedUrl instance reflecting the full url of the service. */ public PreparedUrl logout() throws MalformedURLException, IOException { setAccessToken(null); setAccessExpires(0); Bundle b = new Bundle(); b.putString("method", "auth.expireSession"); return requestUrl(b); } /** * Build a url to Facebook's old (pre-graph) API with the given * parameters. One of the parameter keys must be "method" and its value * should be a valid REST server API method. * * See http://developers.facebook.com/docs/reference/rest/ * * Example: * <code> * Bundle parameters = new Bundle(); * parameters.putString("method", "auth.expireSession"); * PreparedUrl preparedUrl = requestUrl(parameters); * </code> * * @param parameters * Key-value pairs of parameters to the request. Refer to the * documentation: one of the parameters must be "method". * @throws MalformedURLException * if accessing an invalid endpoint * @throws IllegalArgumentException * if one of the parameters is not "method" * @return PreparedUrl instance reflecting the full url of the service. */ public PreparedUrl requestUrl(Bundle parameters) throws MalformedURLException { if (!parameters.containsKey("method")) { throw new IllegalArgumentException("API method must be specified. " + "(parameters must contain key \"method\" and value). See" + " http://developers.facebook.com/docs/reference/rest/"); } return requestUrl(null, parameters, "GET"); } /** * Build a url to the Facebook Graph API without any parameters. * * See http://developers.facebook.com/docs/api * * @param graphPath * Path to resource in the Facebook graph, e.g., to fetch data * about the currently logged authenticated user, provide "me", * which will fetch http://graph.facebook.com/me * @throws MalformedURLException * @return PreparedUrl instance reflecting the full url of the service. */ public PreparedUrl requestUrl(String graphPath) throws MalformedURLException { return requestUrl(graphPath, new Bundle(), "GET"); } /** * Build a url to the Facebook Graph API with the given string * parameters using an HTTP GET (default method). * * See http://developers.facebook.com/docs/api * * @param graphPath * Path to resource in the Facebook graph, e.g., to fetch data * about the currently logged authenticated user, provide "me", * which will fetch http://graph.facebook.com/me * @param parameters * key-value string parameters, e.g. the path "search" with * parameters "q" : "facebook" would produce a query for the * following graph resource: * https://graph.facebook.com/search?q=facebook * @throws MalformedURLException * @return PreparedUrl instance reflecting the full url of the service. */ public PreparedUrl requestUrl(String graphPath, Bundle parameters) throws MalformedURLException { return requestUrl(graphPath, parameters, "GET"); } /** * Build a PreparedUrl object which can be used with Util.openUrl(). * You can also use the returned PreparedUrl.getUrl() to run the * network operation yourself. * * Note that binary data parameters * (e.g. pictures) are not yet supported by this helper function. * * See http://developers.facebook.com/docs/api * * @param graphPath * Path to resource in the Facebook graph, e.g., to fetch data * about the currently logged authenticated user, provide "me", * which will fetch http://graph.facebook.com/me * @param parameters * key-value string parameters, e.g. the path "search" with * parameters {"q" : "facebook"} would produce a query for the * following graph resource: * https://graph.facebook.com/search?q=facebook * @param httpMethod * http verb, e.g. "GET", "POST", "DELETE" * @throws MalformedURLException * @return PreparedUrl instance reflecting the full url of the service. */ public PreparedUrl requestUrl(String graphPath, Bundle parameters, String httpMethod) throws MalformedURLException { parameters.putString("format", "json"); if (isSessionValid()) { parameters.putString(TOKEN, getAccessToken()); } String url = graphPath != null ? GRAPH_BASE_URL + graphPath : RESTSERVER_URL; return new PreparedUrl(url, parameters, httpMethod); } public boolean isSessionValid() { return (getAccessToken() != null) && ((getAccessExpires() == 0) || (System.currentTimeMillis() < getAccessExpires())); } public String getAccessToken() { return mAccessToken; } public long getAccessExpires() { return mAccessExpires; } public void setAccessToken(String token) { mAccessToken = token; } public void setAccessExpires(long time) { mAccessExpires = time; } public void setAccessExpiresIn(String expiresIn) { if (expiresIn != null) { setAccessExpires(System.currentTimeMillis() + Integer.parseInt(expiresIn) * 1000); } } public String generateUrl(String action, String appId, String[] permissions) { Bundle params = new Bundle(); String endpoint; if (action.equals(LOGIN)) { params.putString("client_id", appId); if (permissions != null && permissions.length > 0) { params.putString("scope", TextUtils.join(",", permissions)); } endpoint = OAUTH_ENDPOINT; params.putString("type", "user_agent"); params.putString("redirect_uri", REDIRECT_URI); } else { endpoint = UI_SERVER; params.putString("method", action); params.putString("next", REDIRECT_URI); } params.putString("display", "touch"); params.putString("sdk", "android"); if (isSessionValid()) { params.putString(TOKEN, getAccessToken()); } String url = endpoint + "?" + FacebookUtil.encodeUrl(params); return url; } /** * Stores a prepared url and parameters bundle from one of the <code>requestUrl</code> * methods. It can then be used with Util.openUrl() to run the network operation. * The Util.openUrl() requires the original params bundle and http method, so this * is just a convenience wrapper around it. * * @author Mark Wyszomierski (markww@gmail.com) */ public static class PreparedUrl { private String mUrl; private Bundle mParameters; private String mHttpMethod; public PreparedUrl(String url, Bundle parameters, String httpMethod) { mUrl = url; mParameters = parameters; mHttpMethod = httpMethod; } public String getUrl() { return mUrl; } public Bundle getParameters() { return mParameters; } public String getHttpMethod() { return mHttpMethod; } } }
07806919d-a
main/src/com/facebook/android/Facebook.java
Java
asf20
10,363
/* * Copyright 2010 Facebook, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.facebook.android; /** * Encapsulation of a Facebook Error: a Facebook request that could not be * fulfilled. * * @author ssoneff@facebook.com */ public class FacebookError extends Throwable { private static final long serialVersionUID = 1L; private int mErrorCode = 0; private String mErrorType; public FacebookError(String message) { super(message); } public FacebookError(String message, String type, int code) { super(message); mErrorType = type; mErrorCode = code; } public int getErrorCode() { return mErrorCode; } public String getErrorType() { return mErrorType; } }
07806919d-a
main/src/com/facebook/android/FacebookError.java
Java
asf20
1,304
/* * Copyright 2010 Mark Wyszomierski * Portions Copyright (c) 2008-2010 Facebook, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.facebook.android; import org.json.JSONException; import org.json.JSONObject; import android.os.Bundle; import java.io.BufferedReader; import java.io.FileNotFoundException; import java.io.IOException; import java.io.InputStream; import java.io.InputStreamReader; import java.net.HttpURLConnection; import java.net.MalformedURLException; import java.net.URL; import java.util.Set; /** * Utility class supporting the Facebook Object. * * @author ssoneff@facebook.com * -original author. * @author Mark Wyszomierski (markww@gmail.com): * -just removed alert dialog method which can be handled by managed * dialogs in third party apps. */ public final class FacebookUtil { public static String encodeUrl(Bundle parameters) { if (parameters == null) { return ""; } StringBuilder sb = new StringBuilder(); boolean first = true; for (String key : parameters.keySet()) { if (first) first = false; else sb.append("&"); sb.append(key + "=" + parameters.getString(key)); } return sb.toString(); } public static Bundle decodeUrl(String s) { Bundle params = new Bundle(); if (s != null) { String array[] = s.split("&"); for (String parameter : array) { String v[] = parameter.split("="); params.putString(v[0], v[1]); } } return params; } /** * Parse a URL query and fragment parameters into a key-value bundle. * * @param url the URL to parse * @return a dictionary bundle of keys and values */ public static Bundle parseUrl(String url) { // hack to prevent MalformedURLException url = url.replace("fbconnect", "http"); try { URL u = new URL(url); Bundle b = decodeUrl(u.getQuery()); b.putAll(decodeUrl(u.getRef())); return b; } catch (MalformedURLException e) { return new Bundle(); } } /** * Connect to an HTTP URL and return the response as a string. * * Note that the HTTP method override is used on non-GET requests. (i.e. * requests are made as "POST" with method specified in the body). * * @param url - the resource to open: must be a welformed URL * @param method - the HTTP method to use ("GET", "POST", etc.) * @param params - the query parameter for the URL (e.g. access_token=foo) * @return the URL contents as a String * @throws MalformedURLException - if the URL format is invalid * @throws IOException - if a network problem occurs */ public static String openUrl(String url, String method, Bundle params) throws MalformedURLException, IOException { if (method.equals("GET")) { url = url + "?" + encodeUrl(params); } HttpURLConnection conn = (HttpURLConnection) new URL(url).openConnection(); conn.setRequestProperty("User-Agent", System.getProperties(). getProperty("http.agent") + " FacebookAndroidSDK"); if (!method.equals("GET")) { // use method override params.putString("method", method); conn.setRequestMethod("POST"); conn.setDoOutput(true); conn.getOutputStream().write( encodeUrl(params).getBytes("UTF-8")); } String response = ""; try { response = read(conn.getInputStream()); } catch (FileNotFoundException e) { // Error Stream contains JSON that we can parse to a FB error response = read(conn.getErrorStream()); } return response; } private static String read(InputStream in) throws IOException { StringBuilder sb = new StringBuilder(); BufferedReader r = new BufferedReader(new InputStreamReader(in), 1000); for (String line = r.readLine(); line != null; line = r.readLine()) { sb.append(line); } in.close(); return sb.toString(); } /** * Parse a server response into a JSON Object. This is a basic * implementation using org.json.JSONObject representation. More * sophisticated applications may wish to do their own parsing. * * The parsed JSON is checked for a variety of error fields and * a FacebookException is thrown if an error condition is set, * populated with the error message and error type or code if * available. * * @param response - string representation of the response * @return the response as a JSON Object * @throws JSONException - if the response is not valid JSON * @throws FacebookError - if an error condition is set */ public static JSONObject parseJson(String response) throws JSONException, FacebookError { // Edge case: when sending a POST request to /[post_id]/likes // the return value is 'true' or 'false'. Unfortunately // these values cause the JSONObject constructor to throw // an exception. if (response.equals("false")) { throw new FacebookError("request failed"); } if (response.equals("true")) { response = "{value : true}"; } JSONObject json = new JSONObject(response); // errors set by the server are not consistent // they depend on the method and endpoint if (json.has("error")) { JSONObject error = json.getJSONObject("error"); throw new FacebookError( error.getString("message"), error.getString("type"), 0); } if (json.has("error_code") && json.has("error_msg")) { throw new FacebookError(json.getString("error_msg"), "", Integer.parseInt(json.getString("error_code"))); } if (json.has("error_code")) { throw new FacebookError("request failed", "", Integer.parseInt(json.getString("error_code"))); } if (json.has("error_msg")) { throw new FacebookError(json.getString("error_msg")); } if (json.has("error_reason")) { throw new FacebookError(json.getString("error_reason")); } return json; } public static String printBundle(Bundle bundle) { StringBuilder sb = new StringBuilder(); sb.append("Bundle: "); if (bundle != null) { sb.append(bundle.toString()); sb.append("\n"); Set<String> keys = bundle.keySet(); for (String it : keys) { sb.append(" "); sb.append(it); sb.append(": "); sb.append(bundle.get(it).toString()); sb.append("\n"); } } else { sb.append("(null)"); } return sb.toString(); } }
07806919d-a
main/src/com/facebook/android/FacebookUtil.java
Java
asf20
7,679
/** * Copyright 2010 Mark Wyszomierski * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.facebook.android; import com.joelapenna.foursquared.R; import android.app.Activity; import android.app.ProgressDialog; import android.content.Intent; import android.graphics.Bitmap; import android.graphics.Color; import android.graphics.Typeface; import android.net.Uri; import android.os.Bundle; import android.util.Log; import android.view.Window; import android.view.ViewGroup.LayoutParams; import android.webkit.CookieManager; import android.webkit.CookieSyncManager; import android.webkit.WebView; import android.webkit.WebViewClient; import android.widget.LinearLayout; import android.widget.TextView; /** * This activity can be used to run a facebook url request through a webview. * The user must supply these intent extras: * <ul> * <li>INTENT_EXTRA_ACTION - string, which facebook action to perform, like * "login", or "stream.publish".</li> * <li>INTENT_EXTRA_KEY_APP_ID - string, facebook developer key.</li> * <li>INTENT_EXTRA_KEY_PERMISSIONS - string array, set of facebook permissions * you want to use.</li> * </ul> * or you can supply only INTENT_EXTRA_KEY_CLEAR_COOKIES to just have the * activity clear its stored cookies (you can also supply it in combination with * the above flags to clear cookies before trying to run a request too). If * you've already authenticated the user, you can optionally pass in the token * and expiration time as intent extras using: * <ul> * <li>INTENT_EXTRA_AUTHENTICATED_TOKEN</li> * <li>INTENT_EXTRA_AUTHENTICATED_EXPIRES</li> * </ul> * they will then be used in web requests. You should use * <code>startActivityForResult</code> to start the activity. When the activity * finishes, it will return status code RESULT_OK. You can then check the * returned intent data object for: * <ul> * <li>INTENT_RESULT_KEY_RESULT_STATUS - boolean, whether the request succeeded * or not.</li> * <li>INTENT_RESULT_KEY_SUPPLIED_ACTION - string, the action you supplied as an * intent extra echoed back as a convenience.</li> * <li>INTENT_RESULT_KEY_RESULT_BUNDLE - bundle, present if request succeeded, * will have all the returned parameters as supplied by the WebView operation.</li> * <li>INTENT_RESULT_KEY_ERROR - string, present if request failed.</li> * </ul> * If the user canceled this activity, the activity result code will be * RESULT_CANCELED and there will be no intent data returned. You need the * <code>android.permission.INTERNET</code> permission added to your manifest. * You need to add this activity definition to your manifest. You can prevent * this activity from restarting on rotation so the network operations are * preserved within the WebView like so: * * <activity * android:name="com.facebook.android.FacebookWebViewActivity" * android:configChanges="orientation|keyboardHidden" /> * * This class and the rest of the facebook classes within this package are from * the facebook android library project: * * http://github.com/facebook/facebook-android-sdk * * The project implementation had several problems with it which made it unusable * in a production application. It has been rewritten here for use with the * Foursquare project. * * @date June 14, 2010 * @author Mark Wyszomierski (markww@gmail.com) */ public class FacebookWebViewActivity extends Activity { private static final String TAG = "FacebookWebViewActivity"; public static final String INTENT_EXTRA_ACTION = "com.facebook.android.FacebookWebViewActivity.action"; public static final String INTENT_EXTRA_KEY_APP_ID = "com.facebook.android.FacebookWebViewActivity.appid"; public static final String INTENT_EXTRA_KEY_PERMISSIONS = "com.facebook.android.FacebookWebViewActivity.permissions"; public static final String INTENT_EXTRA_AUTHENTICATED_TOKEN = "com.facebook.android.FacebookWebViewActivity.authenticated_token"; public static final String INTENT_EXTRA_AUTHENTICATED_EXPIRES = "com.facebook.android.FacebookWebViewActivity.authenticated_expires"; public static final String INTENT_EXTRA_KEY_CLEAR_COOKIES = "com.facebook.android.FacebookWebViewActivity.clear_cookies"; public static final String INTENT_EXTRA_KEY_DEBUG = "com.facebook.android.FacebookWebViewActivity.debug"; public static final String INTENT_RESULT_KEY_RESULT_STATUS = "result_status"; public static final String INTENT_RESULT_KEY_SUPPLIED_ACTION = "supplied_action"; public static final String INTENT_RESULT_KEY_RESULT_BUNDLE = "bundle"; public static final String INTENT_RESULT_KEY_ERROR = "error"; private static final String DISPLAY_STRING = "touch"; private static final int FB_BLUE = 0xFF6D84B4; private static final int MARGIN = 4; private static final int PADDING = 2; private TextView mTitle; private WebView mWebView; private ProgressDialog mSpinner; private String mAction; private String mAppId; private String[] mPermissions; private boolean mDebug; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); requestWindowFeature(Window.FEATURE_NO_TITLE); CookieSyncManager.createInstance(this); LinearLayout ll = new LinearLayout(this); ll.setOrientation(LinearLayout.VERTICAL); ll.setLayoutParams(new LayoutParams(LayoutParams.FILL_PARENT, LayoutParams.FILL_PARENT)); mTitle = new TextView(this); mTitle.setText("Facebook"); mTitle.setTextColor(Color.WHITE); mTitle.setTypeface(Typeface.DEFAULT_BOLD); mTitle.setBackgroundColor(FB_BLUE); mTitle.setPadding(MARGIN + PADDING, MARGIN, MARGIN, MARGIN); mTitle.setCompoundDrawablePadding(MARGIN + PADDING); mTitle.setCompoundDrawablesWithIntrinsicBounds(this.getResources().getDrawable( R.drawable.facebook_icon), null, null, null); ll.addView(mTitle); mWebView = new WebView(this); mWebView.setLayoutParams(new LayoutParams( LayoutParams.FILL_PARENT, LayoutParams.FILL_PARENT)); mWebView.setWebViewClient(new WebViewClientFacebook()); mWebView.setVerticalScrollBarEnabled(false); mWebView.setHorizontalScrollBarEnabled(false); mWebView.getSettings().setJavaScriptEnabled(true); ll.addView(mWebView); mSpinner = new ProgressDialog(this); mSpinner.requestWindowFeature(Window.FEATURE_NO_TITLE); mSpinner.setMessage("Loading..."); setContentView(ll, new LinearLayout.LayoutParams(LayoutParams.FILL_PARENT, LayoutParams.FILL_PARENT)); Bundle extras = getIntent().getExtras(); if (extras != null) { if (extras.containsKey(INTENT_EXTRA_KEY_DEBUG)) { mDebug = extras.getBoolean(INTENT_EXTRA_KEY_DEBUG); } if (extras.containsKey(INTENT_EXTRA_ACTION)) { if (extras.getBoolean(INTENT_EXTRA_KEY_CLEAR_COOKIES, false)) { clearCookies(); } if (extras.containsKey(INTENT_EXTRA_KEY_APP_ID)) { if (extras.containsKey(INTENT_EXTRA_KEY_PERMISSIONS)) { mAction = extras.getString(INTENT_EXTRA_ACTION); mAppId = extras.getString(INTENT_EXTRA_KEY_APP_ID); mPermissions = extras.getStringArray(INTENT_EXTRA_KEY_PERMISSIONS); // If the user supplied a pre-authenticated info, use it // here. Facebook facebook = new Facebook(); if (extras.containsKey(INTENT_EXTRA_AUTHENTICATED_TOKEN) && extras.containsKey(INTENT_EXTRA_AUTHENTICATED_EXPIRES)) { facebook.setAccessToken(extras .getString(INTENT_EXTRA_AUTHENTICATED_TOKEN)); facebook.setAccessExpires(extras .getLong(INTENT_EXTRA_AUTHENTICATED_EXPIRES)); if (mDebug) { Log.d(TAG, "onCreate(): authenticated token being used."); } } // Generate the url based on the action. String url = facebook.generateUrl(mAction, mAppId, mPermissions); if (mDebug) { String permissionsDump = "(null)"; if (mPermissions != null) { if (mPermissions.length > 0) { for (int i = 0; i < mPermissions.length; i++) { permissionsDump += mPermissions[i] + ", "; } } else { permissionsDump = "[empty]"; } } Log.d(TAG, "onCreate(): action: " + mAction + ", appid: " + mAppId + ", permissions: " + permissionsDump); Log.d(TAG, "onCreate(): Loading url: " + url); } // Start the request finally. mWebView.loadUrl(url); } else { Log.e(TAG, "Missing intent extra: INTENT_EXTRA_KEY_PERMISSIONS, finishing immediately."); finish(); } } else { Log.e(TAG, "Missing intent extra: INTENT_EXTRA_KEY_APP_ID, finishing immediately."); finish(); } } else if (extras.getBoolean(INTENT_EXTRA_KEY_CLEAR_COOKIES)) { clearCookies(); } else { Log.e(TAG, "Missing intent extra: INTENT_EXTRA_ACTION or INTENT_EXTRA_KEY_CLEAR_COOKIES, finishing immediately."); finish(); } } else { Log.e(TAG, "No intent extras supplied, finishing immediately."); finish(); } } private void clearCookies() { CookieManager cookieManager = CookieManager.getInstance(); cookieManager.removeAllCookie(); } @Override protected void onResume() { super.onResume(); CookieSyncManager.getInstance().startSync(); } @Override protected void onPause() { super.onPause(); CookieSyncManager.getInstance().stopSync(); } private class WebViewClientFacebook extends WebViewClient { @Override public boolean shouldOverrideUrlLoading(WebView view, String url) { if (mDebug) { Log.d(TAG, "WebViewClientFacebook:shouldOverrideUrlLoading(): " + url); } if (url.startsWith(Facebook.REDIRECT_URI)) { Bundle values = FacebookUtil.parseUrl(url); String error = values.getString("error_reason"); Intent result = new Intent(); result.putExtra(INTENT_RESULT_KEY_SUPPLIED_ACTION, mAction); if (error == null) { CookieSyncManager.getInstance().sync(); result.putExtra(INTENT_RESULT_KEY_RESULT_STATUS, true); result.putExtra(INTENT_RESULT_KEY_RESULT_BUNDLE, values); FacebookWebViewActivity.this.setResult(Activity.RESULT_OK, result); } else { result.putExtra(INTENT_RESULT_KEY_RESULT_STATUS, false); result.putExtra(INTENT_RESULT_KEY_SUPPLIED_ACTION, mAction); result.putExtra(INTENT_RESULT_KEY_ERROR, error); FacebookWebViewActivity.this.setResult(Activity.RESULT_OK, result); } FacebookWebViewActivity.this.finish(); return true; } else if (url.startsWith(Facebook.CANCEL_URI)) { FacebookWebViewActivity.this.setResult(Activity.RESULT_CANCELED); FacebookWebViewActivity.this.finish(); return true; } else if (url.contains(DISPLAY_STRING)) { return false; } // Launch non-dialog URLs in a full browser. startActivity(new Intent(Intent.ACTION_VIEW, Uri.parse(url))); return true; } @Override public void onReceivedError(WebView view, int errorCode, String description, String failingUrl) { super.onReceivedError(view, errorCode, description, failingUrl); if (mDebug) { Log.e(TAG, "WebViewClientFacebook:onReceivedError(): " + errorCode + ", " + description + ", " + failingUrl); } Intent result = new Intent(); result.putExtra(INTENT_RESULT_KEY_RESULT_STATUS, false); result.putExtra(INTENT_RESULT_KEY_SUPPLIED_ACTION, mAction); result.putExtra(INTENT_RESULT_KEY_ERROR, description + ", " + errorCode + ", " + failingUrl); FacebookWebViewActivity.this.setResult(Activity.RESULT_OK, result); FacebookWebViewActivity.this.finish(); } @Override public void onPageStarted(WebView view, String url, Bitmap favicon) { super.onPageStarted(view, url, favicon); if (mDebug) { Log.d(TAG, "WebViewClientFacebook:onPageStarted(): " + url); } mSpinner.show(); } @Override public void onPageFinished(WebView view, String url) { super.onPageFinished(view, url); if (mDebug) { Log.d(TAG, "WebViewClientFacebook:onPageFinished(): " + url); } String title = mWebView.getTitle(); if (title != null && title.length() > 0) { mTitle.setText(title); } mSpinner.dismiss(); } } }
07806919d-a
main/src/com/facebook/android/FacebookWebViewActivity.java
Java
asf20
14,675
<html> <head> <style type="text/css"> body { background:#fff; color:#000; font:normal 12px Tahoma, Arial, Helvetica, Serif; margin:0px; padding:0px; } h4 { float:left; height:15px; margin:0px 0 0; padding:20px 0 0 10px; font:bold 15px Arial, Helvetica, Serif; } h4 span { float:left; padding:0 5px; margin-top:-10px; } ul { clear:both;margin:0 0 15px; padding:0 0 0 20px; } ul li { margin:0;padding:0; list-style-type:square; margin-bottom:5px; margin-left:20px; font:13px Arial, Helvetica, Serif; } </style> </head> <body> <h4><span>What's new in v2010-10-05?</span></h4> <ul> <li>Badge description now being shown with badge-unlock in post-checkin dialog.</li> <li>Post-checkin scores were not being displayed. Scores were still being recorded for users on the foursquare servers, just not being shown in the results dialog.</li> <li>Venue shortcut-creation bug fixed.</li> <li>URLs now being linked in tip/to-do details screen.</li> </ul> <h4><span>What's new in v2010-09-30</span></h4> <ul> <li>Redesign for most activity screens.</li> <li>Tips and To-do screens added as top-level tabs.</li> <li>Friend information added to venue pages.</li> <li>Can access friend requests from Me tab.</li> <li>Can now refresh Me tab.</li> <li>Switched from xml to json for API calls.</li> </ul> <h4><span>What's new in v2010-08-31</span></h4> <ul> <li>Option for install to SD card (Android 2.2 and above required).</li> <li>Added profile settings information to Preferences page. This is a convenience to let users see what email address and name they're using with their Foursquare account.</li> <li>SSL support.</li> </ul> <h4><span>What's new in v2010-08-05</span></h4> <ul> <li>Click your user photo in the 'Me' tab to set a new photo for yourself.</li> <li>Added an option in preferences to use a Foursquare image viewer for viewing user photos. Un-check "Image Viewing" to use it instead of your phone's native image viewer (default).</li> </ul> <h4><span>What's new in v2010-07-13</span></h4> <ul> <li>Bug fix for new category icons (from 2010-07-12 version) which could cause a force-close on the Places tab.</li> </ul> <h4><span>What's new in v2010-07-12</span></h4> <ul> <li>Friend requests screen now has an input filter at top, should make it easier to locate specific friend requests by name.</li> <li>Places list items now have a 'special' icon when the venue is offering a special. Also now showing a person icon when the venue is trending.</li> <li>High res category icons being used now.</li> <li>Added last n system logs messages to feedback emails to help diagnose application errors.</li> </ul> <h4><span>What's new in v2010-06-28</span></h4> <ul> <li>Showing recent nearby friend checkins on a map. You can find this on the Friends tab, Menu -> More -> Map.</li> <li>Add Friends screen now has an option to find Facebook friends that are also using Foursquare. NOTE: There's a render bug in Android for the Facebook login page which makes the username and password fields misalign when the virtual keypad is displayed, this should be fixed in Android Froyo.</li> </ul> <h4><span>What's new in v2010-06-16</span></h4> <ul> <li>The venue activity has a new menu option called 'Edit Venue' which gives you the option to propose venue edits. These include marking a venue as closed, duplicate, or mislocated. The last option allows you to update all venue information such as address, name, etc.</li> <li>Menu for Friends tab updated to have a 'more' item, which gives the option to sort friend checkins by time or distance.</li> <li>Add friends and find friends items added to 'more' item on Friends tab menu. <li>Refresh menu item moved to first position in Places tab to be consistent with Friends tab.</li> <li>Fixed bug introduced in v2010-06-07 which was formatting the times of checkins incorrectly in the Friends tab.</li> </ul> <h4><span>What's new in v2010-06-07</span></h4> <ul> <li>Now showing the 'add friend' option on user details screens, if not already friends. Should make it easier to build your network. </li> <li>Checkin pings support. A service will wake every N minutes (user-configurable) to check for new checkins from friends. </li> <li>New item on user details pages named 'pings', allows you to turn pings on/off per user. Only applicable if you have enabled ping notifications for yourself. </li> <li>Fix a widget bug that would cause "Application Not Responding" errors.</li> <li>Fixed bug for new users on 1.5. The empty friends screen would crash on some android 1.5 devices.</li> </ul> <h4><span>What's new in v2010-05-11</span></h4> <ul> <li>Friend invites page now has an option to generate a list of contacts not on foursquare for sending email invites to join. This should make it easier to get friends playing along. </li> <li>For new users, the Friends tab will now show a sad face and two buttons 'add friends' & 'friend requests'. This should make it a little easier for new users to start adding friends. </li> <li>Updated default message for venue pages when there are no recent checkins. This was done to make it clear that the venue page is only showing recent checkins, not a total checkin history. </li> <li>Sorting nearby venues by popularity and distance instead of just distance, <a href="http://blog.foursquare.com/post/589698188/weve-just-made-the-places-screen-smarter">read here</a> for more info.</li> <li>Updated to SDK level 6. </li> </ul> <h4><span>v2010-04-23</span></h4> <ul> <li>Default zoom level for venue map is closer to street level.</li> <li>Added a new option through preferences which allows user to clear their current geo location before each venue search. This may help users having issues with geolocation.</li> <li>Updated application icon and menu icons for v6 and newer platforms.</li> <li>Showing reverse geolocation footer on Places tab.</li> </ul> <h4><span>v2010-04-09</span></h4> <ul> <li>New check-in button on venue page.</li> <li>Added a native sign up screen from the login page.</li> <li>Added a 'special' button to the venue page if the venue has a special available.</li> <li>Menu added for Me page, makes it easier to get to the Friend Requests page.</li> <li>Made quick-check-in off by default instead of on. Users can change this in preferences page.</li> <li>Fixed timestamp bug which would place some Droid users in the year 1910.</li> </ul> <h4><span>v2010-03-29</span></h4> <ul> <li>Update for timestamp formatting.</li> </ul> <h4><span>v2010-03-28</span></h4> <ul> <li>Updated checkin screen.</li> </ul> <h4><span>v2010-03-26</span></h4> <ul> <li>Added user photos to venue tips list.</li> <li>Clicking a tip from a venue page displays a new list of options (listing your to-do/completed tips will be added in a future version).</li> <li>Clicking on a nearby special shows venue details for that venue on post-checkin screen.</li> <li>Clicking on mayor photo in post-checkin screen shows user details.</li> <li>Updated distance sorting of venue searches.</li> </ul> <h4><span>v2010-03-23</span></h4> <ul> <li>This "What's New" page.</li> <li>View a user's mayorships through the user details page.</li> <li>History times are now formatted.</li> <li>Choose startup tab (Friends or Places) through the preferences page.</li> <li>Friends checkin tab is sorted by distance and checkin times.</li> <li>Added category icons for user history list.</li> </ul> <h4><span>v2010-03-12</span></h4> <ul> <li>New UI design.</li> <li>See user's mayorhip and badge count.</li> <li>See your own foursquare history.</li> <li>See friends of friends.</li> <li>See contact info of friends.</li> </ul> <h4><span>v2010-03-05</span></h4> <ul> <li>Global Search.</li> <li>Add Friends from Preferences page.</li> <li>Handle friend requests from Preferences page.</li> <li>Click on a user's photo in user details page to see full-size image.</li> </ul> </body> </html>
07806919d-a
main/assets/changelog-en.html
HTML
asf20
9,096
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquare; public class TestCredentials { public static final String oAuthConsumerKey = ""; public static final String oAuthConsumerSecret = ""; public static final String oAuthToken = ""; public static final String oAuthTokenSecret = ""; public static final String testFoursquarePhone = ""; public static final String testFoursquarePassword = ""; }
07806919d-a
examples/TestCredentials.java
Java
asf20
441
/** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquared; /** * @author Joe LaPenna (joe@joelapenna.com) */ public class FoursquaredSettings { public static final boolean USE_DEBUG_SERVER = false; public static final boolean DEBUG = false; public static final boolean LOCATION_DEBUG = false; public static final boolean USE_DUMPCATCHER = true; public static final boolean DUMPCATCHER_TEST = false; }
07806919d-a
examples/FoursquaredSettings.java
Java
asf20
444
#!/usr/bin/python import datetime import sys import textwrap import common from xml.dom import pulldom PARSER = """\ /** * Copyright 2009 Joe LaPenna */ package com.joelapenna.foursquare.parsers; import com.joelapenna.foursquare.Foursquare; import com.joelapenna.foursquare.error.FoursquareError; import com.joelapenna.foursquare.error.FoursquareParseException; import com.joelapenna.foursquare.types.%(type_name)s; import org.xmlpull.v1.XmlPullParser; import org.xmlpull.v1.XmlPullParserException; import java.io.IOException; import java.util.logging.Level; import java.util.logging.Logger; /** * Auto-generated: %(timestamp)s * * @author Joe LaPenna (joe@joelapenna.com) * @param <T> */ public class %(type_name)sParser extends AbstractParser<%(type_name)s> { private static final Logger LOG = Logger.getLogger(%(type_name)sParser.class.getCanonicalName()); private static final boolean DEBUG = Foursquare.PARSER_DEBUG; @Override public %(type_name)s parseInner(XmlPullParser parser) throws XmlPullParserException, IOException, FoursquareError, FoursquareParseException { parser.require(XmlPullParser.START_TAG, null, null); %(type_name)s %(top_node_name)s = new %(type_name)s(); while (parser.nextTag() == XmlPullParser.START_TAG) { String name = parser.getName(); %(stanzas)s } else { // Consume something we don't understand. if (DEBUG) LOG.log(Level.FINE, "Found tag that we don't recognize: " + name); skipSubTree(parser); } } return %(top_node_name)s; } }""" BOOLEAN_STANZA = """\ } else if ("%(name)s".equals(name)) { %(top_node_name)s.set%(camel_name)s(Boolean.valueOf(parser.nextText())); """ GROUP_STANZA = """\ } else if ("%(name)s".equals(name)) { %(top_node_name)s.set%(camel_name)s(new GroupParser(new %(sub_parser_camel_case)s()).parse(parser)); """ COMPLEX_STANZA = """\ } else if ("%(name)s".equals(name)) { %(top_node_name)s.set%(camel_name)s(new %(parser_name)s().parse(parser)); """ STANZA = """\ } else if ("%(name)s".equals(name)) { %(top_node_name)s.set%(camel_name)s(parser.nextText()); """ def main(): type_name, top_node_name, attributes = common.WalkNodesForAttributes( sys.argv[1]) GenerateClass(type_name, top_node_name, attributes) def GenerateClass(type_name, top_node_name, attributes): """generate it. type_name: the type of object the parser returns top_node_name: the name of the object the parser returns. per common.WalkNodsForAttributes """ stanzas = [] for name in sorted(attributes): typ, children = attributes[name] replacements = Replacements(top_node_name, name, typ, children) if typ == common.BOOLEAN: stanzas.append(BOOLEAN_STANZA % replacements) elif typ == common.GROUP: stanzas.append(GROUP_STANZA % replacements) elif typ in common.COMPLEX: stanzas.append(COMPLEX_STANZA % replacements) else: stanzas.append(STANZA % replacements) if stanzas: # pop off the extranious } else for the first conditional stanza. stanzas[0] = stanzas[0].replace('} else ', '', 1) replacements = Replacements(top_node_name, name, typ, [None]) replacements['stanzas'] = '\n'.join(stanzas).strip() print PARSER % replacements def Replacements(top_node_name, name, typ, children): # CameCaseClassName type_name = ''.join([word.capitalize() for word in top_node_name.split('_')]) # CamelCaseClassName camel_name = ''.join([word.capitalize() for word in name.split('_')]) # camelCaseLocalName attribute_name = camel_name.lower().capitalize() # mFieldName field_name = 'm' + camel_name if children[0]: sub_parser_camel_case = children[0] + 'Parser' else: sub_parser_camel_case = (camel_name[:-1] + 'Parser') return { 'type_name': type_name, 'name': name, 'top_node_name': top_node_name, 'camel_name': camel_name, 'parser_name': typ + 'Parser', 'attribute_name': attribute_name, 'field_name': field_name, 'typ': typ, 'timestamp': datetime.datetime.now(), 'sub_parser_camel_case': sub_parser_camel_case, 'sub_type': children[0] } if __name__ == '__main__': main()
07806919d-a
util/gen_parser.py
Python
asf20
4,392
#!/usr/bin/python """ Pull a oAuth protected page from foursquare. Expects ~/.oget to contain (one on each line): CONSUMER_KEY CONSUMER_KEY_SECRET USERNAME PASSWORD Don't forget to chmod 600 the file! """ import httplib import os import re import sys import urllib import urllib2 import urlparse import user from xml.dom import pulldom from xml.dom import minidom import oauth """From: http://groups.google.com/group/foursquare-api/web/oauth @consumer = OAuth::Consumer.new("consumer_token","consumer_secret", { :site => "http://foursquare.com", :scheme => :header, :http_method => :post, :request_token_path => "/oauth/request_token", :access_token_path => "/oauth/access_token", :authorize_path => "/oauth/authorize" }) """ SERVER = 'api.foursquare.com:80' CONTENT_TYPE_HEADER = {'Content-Type' :'application/x-www-form-urlencoded'} SIGNATURE_METHOD = oauth.OAuthSignatureMethod_HMAC_SHA1() AUTHEXCHANGE_URL = 'http://api.foursquare.com/v1/authexchange' def parse_auth_response(auth_response): return ( re.search('<oauth_token>(.*)</oauth_token>', auth_response).groups()[0], re.search('<oauth_token_secret>(.*)</oauth_token_secret>', auth_response).groups()[0] ) def create_signed_oauth_request(username, password, consumer): oauth_request = oauth.OAuthRequest.from_consumer_and_token( consumer, http_method='POST', http_url=AUTHEXCHANGE_URL, parameters=dict(fs_username=username, fs_password=password)) oauth_request.sign_request(SIGNATURE_METHOD, consumer, None) return oauth_request def main(): url = urlparse.urlparse(sys.argv[1]) # Nevermind that the query can have repeated keys. parameters = dict(urlparse.parse_qsl(url.query)) password_file = open(os.path.join(user.home, '.oget')) lines = [line.strip() for line in password_file.readlines()] if len(lines) == 4: cons_key, cons_key_secret, username, password = lines access_token = None else: cons_key, cons_key_secret, username, password, token, secret = lines access_token = oauth.OAuthToken(token, secret) consumer = oauth.OAuthConsumer(cons_key, cons_key_secret) if not access_token: oauth_request = create_signed_oauth_request(username, password, consumer) connection = httplib.HTTPConnection(SERVER) headers = {'Content-Type' :'application/x-www-form-urlencoded'} connection.request(oauth_request.http_method, AUTHEXCHANGE_URL, body=oauth_request.to_postdata(), headers=headers) auth_response = connection.getresponse().read() token = parse_auth_response(auth_response) access_token = oauth.OAuthToken(*token) open(os.path.join(user.home, '.oget'), 'w').write('\n'.join(( cons_key, cons_key_secret, username, password, token[0], token[1]))) oauth_request = oauth.OAuthRequest.from_consumer_and_token(consumer, access_token, http_method='POST', http_url=url.geturl(), parameters=parameters) oauth_request.sign_request(SIGNATURE_METHOD, consumer, access_token) connection = httplib.HTTPConnection(SERVER) connection.request(oauth_request.http_method, oauth_request.to_url(), body=oauth_request.to_postdata(), headers=CONTENT_TYPE_HEADER) print connection.getresponse().read() #print minidom.parse(connection.getresponse()).toprettyxml(indent=' ') if __name__ == '__main__': main()
07806919d-a
util/oget.py
Python
asf20
3,416
#!/usr/bin/python import os import subprocess import sys BASEDIR = '../main/src/com/joelapenna/foursquare' TYPESDIR = '../captures/types/v1' captures = sys.argv[1:] if not captures: captures = os.listdir(TYPESDIR) for f in captures: basename = f.split('.')[0] javaname = ''.join([c.capitalize() for c in basename.split('_')]) fullpath = os.path.join(TYPESDIR, f) typepath = os.path.join(BASEDIR, 'types', javaname + '.java') parserpath = os.path.join(BASEDIR, 'parsers', javaname + 'Parser.java') cmd = 'python gen_class.py %s > %s' % (fullpath, typepath) print cmd subprocess.call(cmd, stdout=sys.stdout, shell=True) cmd = 'python gen_parser.py %s > %s' % (fullpath, parserpath) print cmd subprocess.call(cmd, stdout=sys.stdout, shell=True)
07806919d-a
util/generate.py
Python
asf20
772
#!/usr/bin/python import logging from xml.dom import minidom from xml.dom import pulldom BOOLEAN = "boolean" STRING = "String" GROUP = "Group" # Interfaces that all FoursquareTypes implement. DEFAULT_INTERFACES = ['FoursquareType'] # Interfaces that specific FoursqureTypes implement. INTERFACES = { } DEFAULT_CLASS_IMPORTS = [ ] CLASS_IMPORTS = { # 'Checkin': DEFAULT_CLASS_IMPORTS + [ # 'import com.joelapenna.foursquare.filters.VenueFilterable' # ], # 'Venue': DEFAULT_CLASS_IMPORTS + [ # 'import com.joelapenna.foursquare.filters.VenueFilterable' # ], # 'Tip': DEFAULT_CLASS_IMPORTS + [ # 'import com.joelapenna.foursquare.filters.VenueFilterable' # ], } COMPLEX = [ 'Group', 'Badge', 'Beenhere', 'Checkin', 'CheckinResponse', 'City', 'Credentials', 'Data', 'Mayor', 'Rank', 'Score', 'Scoring', 'Settings', 'Stats', 'Tags', 'Tip', 'User', 'Venue', ] TYPES = COMPLEX + ['boolean'] def WalkNodesForAttributes(path): """Parse the xml file getting all attributes. <venue> <attribute>value</attribute> </venue> Returns: type_name - The java-style name the top node will have. "Venue" top_node_name - unadultured name of the xml stanza, probably the type of java class we're creating. "venue" attributes - {'attribute': 'value'} """ doc = pulldom.parse(path) type_name = None top_node_name = None attributes = {} level = 0 for event, node in doc: # For skipping parts of a tree. if level > 0: if event == pulldom.END_ELEMENT: level-=1 logging.warn('(%s) Skip end: %s' % (str(level), node)) continue elif event == pulldom.START_ELEMENT: logging.warn('(%s) Skipping: %s' % (str(level), node)) level+=1 continue if event == pulldom.START_ELEMENT: logging.warn('Parsing: ' + node.tagName) # Get the type name to use. if type_name is None: type_name = ''.join([word.capitalize() for word in node.tagName.split('_')]) top_node_name = node.tagName logging.warn('Found Top Node Name: ' + top_node_name) continue typ = node.getAttribute('type') child = node.getAttribute('child') # We don't want to walk complex types. if typ in COMPLEX: logging.warn('Found Complex: ' + node.tagName) level = 1 elif typ not in TYPES: logging.warn('Found String: ' + typ) typ = STRING else: logging.warn('Found Type: ' + typ) logging.warn('Adding: ' + str((node, typ))) attributes.setdefault(node.tagName, (typ, [child])) logging.warn('Attr: ' + str((type_name, top_node_name, attributes))) return type_name, top_node_name, attributes
07806919d-a
util/common.py
Python
asf20
2,820
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import android.test.ActivityInstrumentationTestCase2; /** * This is a simple framework for a test of an Application. See * {@link android.test.ApplicationTestCase ApplicationTestCase} for more * information on how to write and extend Application tests. * <p/> * To run this test, you can type: * adb shell am instrument -w \ * -e class org.connectbot.HostListActivityTest \ * org.connectbot.tests/android.test.InstrumentationTestRunner */ public class SettingsActivityTest extends ActivityInstrumentationTestCase2<SettingsActivity> { public SettingsActivityTest() { super("org.connectbot", SettingsActivity.class); } public void testOpenMenu() { SettingsActivity a = getActivity(); a.openOptionsMenu(); a.closeOptionsMenu(); } }
1031868817-aaaa
tests/src/org/connectbot/SettingsActivityTest.java
Java
asf20
1,463
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.bean.HostBean; import org.connectbot.mock.BeanTestCase; import android.test.AndroidTestCase; /** * @author Kenny Root * */ public class HostBeanTest extends AndroidTestCase { private static final String[] FIELDS = { "nickname", "username", "hostname", "port" }; HostBean host1; HostBean host2; @Override protected void setUp() throws Exception { super.setUp(); host1 = new HostBean(); host1.setNickname("Home"); host1.setUsername("bob"); host1.setHostname("server.example.com"); host1.setPort(22); host2 = new HostBean(); host2.setNickname("Home"); host2.setUsername("bob"); host2.setHostname("server.example.com"); host2.setPort(22); } @Override protected void tearDown() throws Exception { super.tearDown(); } public void testIdEquality() { host1.setId(1); host2.setId(1); assertTrue(host1.equals(host2)); assertTrue(host1.hashCode() == host2.hashCode()); } public void testIdInequality() { host1.setId(1); host2.setId(2); // HostBeans shouldn't be equal when their IDs are not the same assertFalse("HostBeans are equal when their ID is different", host1 .equals(host2)); assertFalse("HostBean hash codes are equal when their ID is different", host1.hashCode() == host2.hashCode()); } public void testIdEquality2() { host1.setId(1); host2.setId(1); host2.setNickname("Work"); host2.setUsername("alice"); host2.setHostname("client.example.com"); assertTrue( "HostBeans are not equal when their ID is the same but other fields are different!", host1.equals(host2)); assertTrue( "HostBeans hashCodes are not equal when their ID is the same but other fields are different!", host1.hashCode() == host2.hashCode()); } public void testBeanMeetsEqualsContract() { BeanTestCase.assertMeetsEqualsContract(HostBean.class, FIELDS); } public void testBeanMeetsHashCodeContract() { BeanTestCase.assertMeetsHashCodeContract(HostBean.class, FIELDS); } }
1031868817-aaaa
tests/src/org/connectbot/HostBeanTest.java
Java
asf20
2,689
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.bean.SelectionArea; import android.test.AndroidTestCase; /** * @author Kenny Root * */ public class SelectionAreaTest extends AndroidTestCase { private static final int WIDTH = 80; private static final int HEIGHT = 24; public void testCreate() { SelectionArea sa = new SelectionArea(); assertTrue(sa.getLeft() == 0); assertTrue(sa.getRight() == 0); assertTrue(sa.getTop() == 0); assertTrue(sa.getBottom() == 0); assertTrue(sa.isSelectingOrigin()); } public void testCheckMovement() { SelectionArea sa = new SelectionArea(); sa.setBounds(WIDTH, HEIGHT); sa.incrementColumn(); // Should be (1,0) to (1,0) assertTrue(sa.getLeft() == 1); assertTrue(sa.getTop() == 0); assertTrue(sa.getRight() == 1); assertTrue(sa.getBottom() == 0); sa.finishSelectingOrigin(); assertFalse(sa.isSelectingOrigin()); sa.incrementColumn(); sa.incrementColumn(); // Should be (1,0) to (3,0) assertTrue(sa.getLeft() == 1); assertTrue(sa.getTop() == 0); assertTrue(sa.getRight() == 3); assertTrue(sa.getBottom() == 0); } public void testBounds() { SelectionArea sa = new SelectionArea(); sa.setBounds(WIDTH, HEIGHT); for (int i = 0; i <= WIDTH; i++) sa.decrementColumn(); assertTrue("Left bound should be 0, but instead is " + sa.getLeft(), sa.getLeft() == 0); for (int i = 0; i <= HEIGHT; i++) sa.decrementRow(); assertTrue("Top bound should be 0, but instead is " + sa.getLeft(), sa.getTop() == 0); sa.finishSelectingOrigin(); for (int i = 0; i <= WIDTH * 2; i++) sa.incrementColumn(); assertTrue("Left bound should be 0, but instead is " + sa.getLeft(), sa.getLeft() == 0); assertTrue("Right bound should be " + (WIDTH - 1) + ", but instead is " + sa.getRight(), sa.getRight() == (WIDTH - 1)); for (int i = 0; i <= HEIGHT * 2; i++) sa.incrementRow(); assertTrue("Bottom bound should be " + (HEIGHT - 1) + ", but instead is " + sa.getBottom(), sa.getBottom() == (HEIGHT - 1)); assertTrue("Top bound should be 0, but instead is " + sa.getTop(), sa.getTop() == 0); } public void testSetThenMove() { SelectionArea sa = new SelectionArea(); sa.setBounds(WIDTH, HEIGHT); int targetColumn = WIDTH / 2; int targetRow = HEIGHT / 2; sa.setColumn(targetColumn); sa.setRow(targetRow); sa.incrementRow(); assertTrue("Row should be " + (targetRow + 1) + ", but instead is " + sa.getTop(), sa.getTop() == (targetRow + 1)); sa.decrementColumn(); assertTrue("Column shold be " + (targetColumn - 1) + ", but instead is " + sa.getLeft(), sa.getLeft() == (targetColumn - 1)); sa.finishSelectingOrigin(); sa.setRow(0); sa.setColumn(0); sa.incrementRow(); sa.decrementColumn(); assertTrue("Top row should be 1, but instead is " + sa.getTop(), sa.getTop() == 1); assertTrue("Left column shold be 0, but instead is " + sa.getLeft(), sa.getLeft() == 0); assertTrue("Bottom row should be " + (targetRow + 1) + ", but instead is " + sa.getBottom(), sa.getBottom() == (targetRow + 1)); assertTrue("Right column shold be " + (targetColumn - 1) + ", but instead is " + sa.getRight(), sa.getRight() == (targetColumn - 1)); } }
1031868817-aaaa
tests/src/org/connectbot/SelectionAreaTest.java
Java
asf20
3,919
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import android.test.ActivityInstrumentationTestCase2; /** * This is a simple framework for a test of an Application. See * {@link android.test.ApplicationTestCase ApplicationTestCase} for more * information on how to write and extend Application tests. * <p/> * To run this test, you can type: * adb shell am instrument -w \ * -e class org.connectbot.HostListActivityTest \ * org.connectbot.tests/android.test.InstrumentationTestRunner */ public class HostListActivityTest extends ActivityInstrumentationTestCase2<HostListActivity> { public HostListActivityTest() { super("org.connectbot", HostListActivity.class); } public void testOpenMenu() { HostListActivity a = getActivity(); a.openOptionsMenu(); a.closeOptionsMenu(); } }
1031868817-aaaa
tests/src/org/connectbot/HostListActivityTest.java
Java
asf20
1,463
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.lang.reflect.Field; import org.connectbot.mock.NullTransport; import org.connectbot.service.TerminalBridge; import org.connectbot.transport.AbsTransport; import org.connectbot.util.PreferenceConstants; import android.test.AndroidTestCase; import android.view.KeyEvent; /** * @author Kenny Root * */ public class TerminalBridgeTest extends AndroidTestCase { public void testShiftLock() throws SecurityException, NoSuchFieldException, IllegalArgumentException, IllegalAccessException { TerminalBridge bridge = new TerminalBridge(); AbsTransport nullTransport = new NullTransport(); // Make sure onKey will work when we call it Field disconnected = TerminalBridge.class .getDeclaredField("disconnected"); Field keymode = TerminalBridge.class.getDeclaredField("keymode"); Field transport = TerminalBridge.class.getDeclaredField("transport"); disconnected.setAccessible(true); keymode.setAccessible(true); transport.setAccessible(true); disconnected.setBoolean(bridge, false); keymode.set(bridge, PreferenceConstants.KEYMODE_RIGHT); transport.set(bridge, nullTransport); // Begin tests assertTrue("Meta state is " + bridge.getMetaState() + " when it should be 0", bridge.getMetaState() == 0); KeyEvent shiftDown = new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_SHIFT_LEFT); bridge.onKey(null, shiftDown.getKeyCode(), shiftDown); assertTrue("Shift test: after shift press, meta state is " + bridge.getMetaState() + " when it should be " + TerminalBridge.META_SHIFT_ON, bridge.getMetaState() == TerminalBridge.META_SHIFT_ON); KeyEvent shiftUp = KeyEvent.changeAction(shiftDown, KeyEvent.ACTION_UP); bridge.onKey(null, shiftUp.getKeyCode(), shiftUp); assertTrue("Shift test: after shift release, meta state is " + bridge.getMetaState() + " when it should be " + TerminalBridge.META_SHIFT_ON, bridge.getMetaState() == TerminalBridge.META_SHIFT_ON); KeyEvent letterAdown = new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_A); KeyEvent letterAup = KeyEvent.changeAction(letterAdown, KeyEvent.ACTION_UP); bridge.onKey(null, letterAdown.getKeyCode(), letterAdown); bridge.onKey(null, letterAup.getKeyCode(), letterAup); assertTrue("Shift test: after letter press and release, meta state is " + bridge.getMetaState() + " when it should be 0", bridge .getMetaState() == 0); bridge.onKey(null, shiftDown.getKeyCode(), shiftDown); bridge.onKey(null, shiftUp.getKeyCode(), shiftUp); bridge.onKey(null, shiftDown.getKeyCode(), shiftDown); bridge.onKey(null, shiftUp.getKeyCode(), shiftUp); assertTrue("Shift lock test: after two shift presses, meta state is " + bridge.getMetaState() + " when it should be " + TerminalBridge.META_SHIFT_LOCK, bridge.getMetaState() == TerminalBridge.META_SHIFT_LOCK); bridge.onKey(null, letterAdown.getKeyCode(), letterAdown); assertTrue( "Shift lock test: after letter press, meta state is " + bridge.getMetaState() + " when it should be " + TerminalBridge.META_SHIFT_LOCK, bridge.getMetaState() == TerminalBridge.META_SHIFT_LOCK); bridge.onKey(null, letterAup.getKeyCode(), letterAup); assertTrue( "Shift lock test: after letter press and release, meta state is " + bridge.getMetaState() + " when it should be " + TerminalBridge.META_SHIFT_LOCK, bridge.getMetaState() == TerminalBridge.META_SHIFT_LOCK); } }
1031868817-aaaa
tests/src/org/connectbot/TerminalBridgeTest.java
Java
asf20
4,140
/** * Originally from http://www.cornetdesign.com/files/BeanTestCase.java.txt */ package org.connectbot.mock; import junit.framework.TestCase; import java.lang.reflect.Field; public class BeanTestCase extends TestCase { private static final String TEST_STRING_VAL1 = "Some Value"; private static final String TEST_STRING_VAL2 = "Some Other Value"; public static void assertMeetsEqualsContract(Class<?> classUnderTest, String[] fieldNames) { Object o1; Object o2; try { // Get Instances o1 = classUnderTest.newInstance(); o2 = classUnderTest.newInstance(); assertTrue( "Instances with default constructor not equal (o1.equals(o2))", o1.equals(o2)); assertTrue( "Instances with default constructor not equal (o2.equals(o1))", o2.equals(o1)); Field[] fields = getFieldsByNameOrAll(classUnderTest, fieldNames); for (int i = 0; i < fields.length; i++) { // Reset the instances o1 = classUnderTest.newInstance(); o2 = classUnderTest.newInstance(); Field field = fields[i]; field.setAccessible(true); if (field.getType() == String.class) { field.set(o1, TEST_STRING_VAL1); } else if (field.getType() == boolean.class) { field.setBoolean(o1, true); } else if (field.getType() == short.class) { field.setShort(o1, (short) 1); } else if (field.getType() == long.class) { field.setLong(o1, (long) 1); } else if (field.getType() == float.class) { field.setFloat(o1, (float) 1); } else if (field.getType() == int.class) { field.setInt(o1, 1); } else if (field.getType() == byte.class) { field.setByte(o1, (byte) 1); } else if (field.getType() == char.class) { field.setChar(o1, (char) 1); } else if (field.getType() == double.class) { field.setDouble(o1, (double) 1); } else if (field.getType().isEnum()) { field.set(o1, field.getType().getEnumConstants()[0]); } else if (Object.class.isAssignableFrom(field.getType())) { field.set(o1, field.getType().newInstance()); } else { fail("Don't know how to set a " + field.getType().getName()); } assertFalse("Instances with o1 having " + field.getName() + " set and o2 having it not set are equal", o1 .equals(o2)); field.set(o2, field.get(o1)); assertTrue( "After setting o2 with the value of the object in o1, the two objects in the field are not equal", field.get(o1).equals(field.get(o2))); assertTrue( "Instances with o1 having " + field.getName() + " set and o2 having it set to the same object of type " + field.get(o2).getClass().getName() + " are not equal", o1.equals(o2)); if (field.getType() == String.class) { field.set(o2, TEST_STRING_VAL2); } else if (field.getType() == boolean.class) { field.setBoolean(o2, false); } else if (field.getType() == short.class) { field.setShort(o2, (short) 0); } else if (field.getType() == long.class) { field.setLong(o2, (long) 0); } else if (field.getType() == float.class) { field.setFloat(o2, (float) 0); } else if (field.getType() == int.class) { field.setInt(o2, 0); } else if (field.getType() == byte.class) { field.setByte(o2, (byte) 0); } else if (field.getType() == char.class) { field.setChar(o2, (char) 0); } else if (field.getType() == double.class) { field.setDouble(o2, (double) 1); } else if (field.getType().isEnum()) { field.set(o2, field.getType().getEnumConstants()[1]); } else if (Object.class.isAssignableFrom(field.getType())) { field.set(o2, field.getType().newInstance()); } else { fail("Don't know how to set a " + field.getType().getName()); } if (field.get(o1).equals(field.get(o2))) { // Even though we have different instances, they are equal. // Let's walk one of them // to see if we can find a field to set Field[] paramFields = field.get(o1).getClass() .getDeclaredFields(); for (int j = 0; j < paramFields.length; j++) { paramFields[j].setAccessible(true); if (paramFields[j].getType() == String.class) { paramFields[j].set(field.get(o1), TEST_STRING_VAL1); } } } assertFalse( "After setting o2 with a different object than what is in o1, the two objects in the field are equal. " + "This is after an attempt to walk the fields to make them different", field.get(o1).equals(field.get(o2))); assertFalse( "Instances with o1 having " + field.getName() + " set and o2 having it set to a different object are equal", o1.equals(o2)); } } catch (InstantiationException e) { e.printStackTrace(); throw new AssertionError( "Unable to construct an instance of the class under test"); } catch (IllegalAccessException e) { e.printStackTrace(); throw new AssertionError( "Unable to construct an instance of the class under test"); } catch (SecurityException e) { e.printStackTrace(); throw new AssertionError( "Unable to read the field from the class under test"); } catch (NoSuchFieldException e) { e.printStackTrace(); throw new AssertionError( "Unable to find field in the class under test"); } } /** * @param classUnderTest * @param fieldNames * @return * @throws NoSuchFieldException */ private static Field[] getFieldsByNameOrAll(Class<?> classUnderTest, String[] fieldNames) throws NoSuchFieldException { Field fields[]; if (fieldNames == null) { fields = classUnderTest.getDeclaredFields(); } else { fields = new Field[fieldNames.length]; for (int i = 0; i < fieldNames.length; i++) fields[i] = classUnderTest.getDeclaredField(fieldNames[i]); } return fields; } public static void assertMeetsHashCodeContract(Class<?> classUnderTest, String[] fieldNames) { try { Field[] fields = getFieldsByNameOrAll(classUnderTest, fieldNames); for (int i = 0; i < fields.length; i++) { Object o1 = classUnderTest.newInstance(); int initialHashCode = o1.hashCode(); Field field = fields[i]; field.setAccessible(true); if (field.getType() == String.class) { field.set(o1, TEST_STRING_VAL1); } else if (field.getType() == boolean.class) { field.setBoolean(o1, true); } else if (field.getType() == short.class) { field.setShort(o1, (short) 1); } else if (field.getType() == long.class) { field.setLong(o1, (long) 1); } else if (field.getType() == float.class) { field.setFloat(o1, (float) 1); } else if (field.getType() == int.class) { field.setInt(o1, 1); } else if (field.getType() == byte.class) { field.setByte(o1, (byte) 1); } else if (field.getType() == char.class) { field.setChar(o1, (char) 1); } else if (field.getType() == double.class) { field.setDouble(o1, (double) 1); } else if (field.getType().isEnum()) { field.set(o1, field.getType().getEnumConstants()[0]); } else if (Object.class.isAssignableFrom(field.getType())) { field.set(o1, field.getType().newInstance()); } else { fail("Don't know how to set a " + field.getType().getName()); } int updatedHashCode = o1.hashCode(); assertFalse( "The field " + field.getName() + " was not taken into account for the hashCode contract ", initialHashCode == updatedHashCode); } } catch (InstantiationException e) { e.printStackTrace(); throw new AssertionError( "Unable to construct an instance of the class under test"); } catch (IllegalAccessException e) { e.printStackTrace(); throw new AssertionError( "Unable to construct an instance of the class under test"); } catch (NoSuchFieldException e) { e.printStackTrace(); throw new AssertionError( "Unable to find field in the class under test"); } } }
1031868817-aaaa
tests/src/org/connectbot/mock/BeanTestCase.java
Java
asf20
7,895
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.mock; import java.io.IOException; import java.io.OutputStream; /** * @author Kenny Root * */ public class NullOutputStream extends OutputStream { @Override public void write(int arg0) throws IOException { // do nothing } }
1031868817-aaaa
tests/src/org/connectbot/mock/NullOutputStream.java
Java
asf20
937
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.mock; import java.io.IOException; import java.util.Map; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.transport.AbsTransport; import android.net.Uri; /** * @author kenny * */ public class NullTransport extends AbsTransport { /** * */ public NullTransport() { // TODO Auto-generated constructor stub } /** * @param host * @param bridge * @param manager */ public NullTransport(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); // TODO Auto-generated constructor stub } @Override public void close() { // TODO Auto-generated method stub } @Override public void connect() { // TODO Auto-generated method stub } @Override public HostBean createHost(Uri uri) { // TODO Auto-generated method stub return null; } @Override public void flush() throws IOException { // TODO Auto-generated method stub } @Override public String getDefaultNickname(String username, String hostname, int port) { // TODO Auto-generated method stub return null; } @Override public int getDefaultPort() { // TODO Auto-generated method stub return 0; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { // TODO Auto-generated method stub } @Override public boolean isConnected() { // TODO Auto-generated method stub return false; } @Override public boolean isSessionOpen() { // TODO Auto-generated method stub return false; } @Override public int read(byte[] buffer, int offset, int length) throws IOException { // TODO Auto-generated method stub return 0; } @Override public void setDimensions(int columns, int rows, int width, int height) { // TODO Auto-generated method stub } @Override public void write(byte[] buffer) throws IOException { // TODO Auto-generated method stub } @Override public void write(int c) throws IOException { // TODO Auto-generated method stub } @Override public boolean usesNetwork() { // TODO Auto-generated method stub return false; } }
1031868817-aaaa
tests/src/org/connectbot/mock/NullTransport.java
Java
asf20
2,862
/* * This file is part of "JTA - Telnet/SSH for the JAVA(tm) platform". * * (c) Matthias L. Jugel, Marcus Meißner 1996-2005. All Rights Reserved. * * Please visit http://javatelnet.org/ for updates and contact. * * --LICENSE NOTICE-- * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. * --LICENSE NOTICE-- * */ package de.mud.terminal; /** * Generic display */ public interface VDUDisplay { public void redraw(); public void updateScrollBar(); public void setVDUBuffer(VDUBuffer buffer); public VDUBuffer getVDUBuffer(); public void setColor(int index, int red, int green, int blue); public void resetColors(); }
1031868817-aaaa
src/de/mud/terminal/VDUDisplay.java
Java
asf20
1,290
/* * This file is part of "JTA - Telnet/SSH for the JAVA(tm) platform". * * (c) Matthias L. Jugel, Marcus Mei�ner 1996-2005. All Rights Reserved. * * Please visit http://javatelnet.org/ for updates and contact. * * --LICENSE NOTICE-- * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. * --LICENSE NOTICE-- * */ package de.mud.terminal; import java.util.Arrays; /** * Implementation of a Video Display Unit (VDU) buffer. This class contains * all methods to manipulate the buffer that stores characters and their * attributes as well as the regions displayed. * * @author Matthias L. Jugel, Marcus Meißner * @version $Id: VDUBuffer.java 503 2005-10-24 07:34:13Z marcus $ */ public class VDUBuffer { /** The current version id tag */ public final static String ID = "$Id: VDUBuffer.java 503 2005-10-24 07:34:13Z marcus $"; /** Enable debug messages. */ public final static int debug = 0; public int height, width; /* rows and columns */ public boolean[] update; /* contains the lines that need update */ public char[][] charArray; /* contains the characters */ public int[][] charAttributes; /* contains character attrs */ public int bufSize; public int maxBufSize; /* buffer sizes */ public int screenBase; /* the actual screen start */ public int windowBase; /* where the start displaying */ public int scrollMarker; /* marks the last line inserted */ private int topMargin; /* top scroll margin */ private int bottomMargin; /* bottom scroll margin */ // cursor variables protected boolean showcursor = true; protected int cursorX, cursorY; /** Scroll up when inserting a line. */ public final static boolean SCROLL_UP = false; /** Scroll down when inserting a line. */ public final static boolean SCROLL_DOWN = true; /* Attributes bit-field usage: * * 8421 8421 8421 8421 8421 8421 8421 8421 * |||| |||| |||| |||| |||| |||| |||| |||`- Bold * |||| |||| |||| |||| |||| |||| |||| ||`-- Underline * |||| |||| |||| |||| |||| |||| |||| |`--- Invert * |||| |||| |||| |||| |||| |||| |||| `---- Low * |||| |||| |||| |||| |||| |||| |||`------ Invisible * |||| |||| |||| |||| ||`+-++++-+++------- Foreground Color * |||| |||| |`++-++++-++------------------ Background Color * |||| |||| `----------------------------- Fullwidth character * `+++-++++------------------------------- Reserved for future use */ /** Make character normal. */ public final static int NORMAL = 0x00; /** Make character bold. */ public final static int BOLD = 0x01; /** Underline character. */ public final static int UNDERLINE = 0x02; /** Invert character. */ public final static int INVERT = 0x04; /** Lower intensity character. */ public final static int LOW = 0x08; /** Invisible character. */ public final static int INVISIBLE = 0x10; /** Unicode full-width character (CJK, et al.) */ public final static int FULLWIDTH = 0x8000000; /** how much to left shift the foreground color */ public final static int COLOR_FG_SHIFT = 5; /** how much to left shift the background color */ public final static int COLOR_BG_SHIFT = 14; /** color mask */ public final static int COLOR = 0x7fffe0; /* 0000 0000 0111 1111 1111 1111 1110 0000 */ /** foreground color mask */ public final static int COLOR_FG = 0x3fe0; /* 0000 0000 0000 0000 0011 1111 1110 0000 */ /** background color mask */ public final static int COLOR_BG = 0x7fc000; /* 0000 0000 0111 1111 1100 0000 0000 0000 */ /** * Create a new video display buffer with the passed width and height in * characters. * @param width the length of the character lines * @param height the amount of lines on the screen */ public VDUBuffer(int width, int height) { // set the display screen size setScreenSize(width, height, false); } /** * Create a standard video display buffer with 80 columns and 24 lines. */ public VDUBuffer() { this(80, 24); } /** * Put a character on the screen with normal font and outline. * The character previously on that position will be overwritten. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (line) * @param ch the character to show on the screen * @see #insertChar * @see #deleteChar * @see #redraw */ public void putChar(int c, int l, char ch) { putChar(c, l, ch, NORMAL); } /** * Put a character on the screen with specific font and outline. * The character previously on that position will be overwritten. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (line) * @param ch the character to show on the screen * @param attributes the character attributes * @see #BOLD * @see #UNDERLINE * @see #INVERT * @see #INVISIBLE * @see #NORMAL * @see #LOW * @see #insertChar * @see #deleteChar * @see #redraw */ public void putChar(int c, int l, char ch, int attributes) { charArray[screenBase + l][c] = ch; charAttributes[screenBase + l][c] = attributes; if (l < height) update[l + 1] = true; } /** * Get the character at the specified position. * @param c x-coordinate (column) * @param l y-coordinate (line) * @see #putChar */ public char getChar(int c, int l) { return charArray[screenBase + l][c]; } /** * Get the attributes for the specified position. * @param c x-coordinate (column) * @param l y-coordinate (line) * @see #putChar */ public int getAttributes(int c, int l) { return charAttributes[screenBase + l][c]; } /** * Insert a character at a specific position on the screen. * All character right to from this position will be moved one to the right. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (line) * @param ch the character to insert * @param attributes the character attributes * @see #BOLD * @see #UNDERLINE * @see #INVERT * @see #INVISIBLE * @see #NORMAL * @see #LOW * @see #putChar * @see #deleteChar * @see #redraw */ public void insertChar(int c, int l, char ch, int attributes) { System.arraycopy(charArray[screenBase + l], c, charArray[screenBase + l], c + 1, width - c - 1); System.arraycopy(charAttributes[screenBase + l], c, charAttributes[screenBase + l], c + 1, width - c - 1); putChar(c, l, ch, attributes); } /** * Delete a character at a given position on the screen. * All characters right to the position will be moved one to the left. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (line) * @see #putChar * @see #insertChar * @see #redraw */ public void deleteChar(int c, int l) { if (c < width - 1) { System.arraycopy(charArray[screenBase + l], c + 1, charArray[screenBase + l], c, width - c - 1); System.arraycopy(charAttributes[screenBase + l], c + 1, charAttributes[screenBase + l], c, width - c - 1); } putChar(width - 1, l, (char) 0); } /** * Put a String at a specific position. Any characters previously on that * position will be overwritten. You need to call redraw() for screen update. * @param c x-coordinate (column) * @param l y-coordinate (line) * @param s the string to be shown on the screen * @see #BOLD * @see #UNDERLINE * @see #INVERT * @see #INVISIBLE * @see #NORMAL * @see #LOW * @see #putChar * @see #insertLine * @see #deleteLine * @see #redraw */ public void putString(int c, int l, String s) { putString(c, l, s, NORMAL); } /** * Put a String at a specific position giving all characters the same * attributes. Any characters previously on that position will be * overwritten. You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (line) * @param s the string to be shown on the screen * @param attributes character attributes * @see #BOLD * @see #UNDERLINE * @see #INVERT * @see #INVISIBLE * @see #NORMAL * @see #LOW * @see #putChar * @see #insertLine * @see #deleteLine * @see #redraw */ public void putString(int c, int l, String s, int attributes) { for (int i = 0; i < s.length() && c + i < width; i++) putChar(c + i, l, s.charAt(i), attributes); } /** * Insert a blank line at a specific position. * The current line and all previous lines are scrolled one line up. The * top line is lost. You need to call redraw() to update the screen. * @param l the y-coordinate to insert the line * @see #deleteLine * @see #redraw */ public void insertLine(int l) { insertLine(l, 1, SCROLL_UP); } /** * Insert blank lines at a specific position. * You need to call redraw() to update the screen * @param l the y-coordinate to insert the line * @param n amount of lines to be inserted * @see #deleteLine * @see #redraw */ public void insertLine(int l, int n) { insertLine(l, n, SCROLL_UP); } /** * Insert a blank line at a specific position. Scroll text according to * the argument. * You need to call redraw() to update the screen * @param l the y-coordinate to insert the line * @param scrollDown scroll down * @see #deleteLine * @see #SCROLL_UP * @see #SCROLL_DOWN * @see #redraw */ public void insertLine(int l, boolean scrollDown) { insertLine(l, 1, scrollDown); } /** * Insert blank lines at a specific position. * The current line and all previous lines are scrolled one line up. The * top line is lost. You need to call redraw() to update the screen. * @param l the y-coordinate to insert the line * @param n number of lines to be inserted * @param scrollDown scroll down * @see #deleteLine * @see #SCROLL_UP * @see #SCROLL_DOWN * @see #redraw */ public synchronized void insertLine(int l, int n, boolean scrollDown) { char cbuf[][] = null; int abuf[][] = null; int offset = 0; int oldBase = screenBase; int newScreenBase = screenBase; int newWindowBase = windowBase; int newBufSize = bufSize; if (l > bottomMargin) /* We do not scroll below bottom margin (below the scrolling region). */ return; int top = (l < topMargin ? 0 : (l > bottomMargin ? (bottomMargin + 1 < height ? bottomMargin + 1 : height - 1) : topMargin)); int bottom = (l > bottomMargin ? height - 1 : (l < topMargin ? (topMargin > 0 ? topMargin - 1 : 0) : bottomMargin)); // System.out.println("l is "+l+", top is "+top+", bottom is "+bottom+", bottomargin is "+bottomMargin+", topMargin is "+topMargin); if (scrollDown) { if (n > (bottom - top)) n = (bottom - top); int size = bottom - l - (n - 1); if(size < 0) size = 0; cbuf = new char[size][]; abuf = new int[size][]; System.arraycopy(charArray, oldBase + l, cbuf, 0, bottom - l - (n - 1)); System.arraycopy(charAttributes, oldBase + l, abuf, 0, bottom - l - (n - 1)); System.arraycopy(cbuf, 0, charArray, oldBase + l + n, bottom - l - (n - 1)); System.arraycopy(abuf, 0, charAttributes, oldBase + l + n, bottom - l - (n - 1)); cbuf = charArray; abuf = charAttributes; } else { try { if (n > (bottom - top) + 1) n = (bottom - top) + 1; if (bufSize < maxBufSize) { if (bufSize + n > maxBufSize) { offset = n - (maxBufSize - bufSize); scrollMarker += offset; newBufSize = maxBufSize; newScreenBase = maxBufSize - height - 1; newWindowBase = screenBase; } else { scrollMarker += n; newScreenBase += n; newWindowBase += n; newBufSize += n; } cbuf = new char[newBufSize][]; abuf = new int[newBufSize][]; } else { offset = n; cbuf = charArray; abuf = charAttributes; } // copy anything from the top of the buffer (+offset) to the new top // up to the screenBase. if (oldBase > 0) { System.arraycopy(charArray, offset, cbuf, 0, oldBase - offset); System.arraycopy(charAttributes, offset, abuf, 0, oldBase - offset); } // copy anything from the top of the screen (screenBase) up to the // topMargin to the new screen if (top > 0) { System.arraycopy(charArray, oldBase, cbuf, newScreenBase, top); System.arraycopy(charAttributes, oldBase, abuf, newScreenBase, top); } // copy anything from the topMargin up to the amount of lines inserted // to the gap left over between scrollback buffer and screenBase if (oldBase >= 0) { System.arraycopy(charArray, oldBase + top, cbuf, oldBase - offset, n); System.arraycopy(charAttributes, oldBase + top, abuf, oldBase - offset, n); } // copy anything from topMargin + n up to the line linserted to the // topMargin System.arraycopy(charArray, oldBase + top + n, cbuf, newScreenBase + top, l - top - (n - 1)); System.arraycopy(charAttributes, oldBase + top + n, abuf, newScreenBase + top, l - top - (n - 1)); // // copy the all lines next to the inserted to the new buffer if (l < height - 1) { System.arraycopy(charArray, oldBase + l + 1, cbuf, newScreenBase + l + 1, (height - 1) - l); System.arraycopy(charAttributes, oldBase + l + 1, abuf, newScreenBase + l + 1, (height - 1) - l); } } catch (ArrayIndexOutOfBoundsException e) { // this should not happen anymore, but I will leave the code // here in case something happens anyway. That code above is // so complex I always have a hard time understanding what // I did, even though there are comments System.err.println("*** Error while scrolling up:"); System.err.println("--- BEGIN STACK TRACE ---"); e.printStackTrace(); System.err.println("--- END STACK TRACE ---"); System.err.println("bufSize=" + bufSize + ", maxBufSize=" + maxBufSize); System.err.println("top=" + top + ", bottom=" + bottom); System.err.println("n=" + n + ", l=" + l); System.err.println("screenBase=" + screenBase + ", windowBase=" + windowBase); System.err.println("newScreenBase=" + newScreenBase + ", newWindowBase=" + newWindowBase); System.err.println("oldBase=" + oldBase); System.err.println("size.width=" + width + ", size.height=" + height); System.err.println("abuf.length=" + abuf.length + ", cbuf.length=" + cbuf.length); System.err.println("*** done dumping debug information"); } } // this is a little helper to mark the scrolling scrollMarker -= n; for (int i = 0; i < n; i++) { cbuf[(newScreenBase + l) + (scrollDown ? i : -i)] = new char[width]; Arrays.fill(cbuf[(newScreenBase + l) + (scrollDown ? i : -i)], ' '); abuf[(newScreenBase + l) + (scrollDown ? i : -i)] = new int[width]; } charArray = cbuf; charAttributes = abuf; screenBase = newScreenBase; windowBase = newWindowBase; bufSize = newBufSize; if (scrollDown) markLine(l, bottom - l + 1); else markLine(top, l - top + 1); display.updateScrollBar(); } /** * Delete a line at a specific position. Subsequent lines will be scrolled * up to fill the space and a blank line is inserted at the end of the * screen. * @param l the y-coordinate to insert the line * @see #deleteLine */ public void deleteLine(int l) { int bottom = (l > bottomMargin ? height - 1: (l < topMargin?topMargin:bottomMargin + 1)); int numRows = bottom - l - 1; char[] discardedChars = charArray[screenBase + l]; int[] discardedAttributes = charAttributes[screenBase + l]; if (numRows > 0) { System.arraycopy(charArray, screenBase + l + 1, charArray, screenBase + l, numRows); System.arraycopy(charAttributes, screenBase + l + 1, charAttributes, screenBase + l, numRows); } int newBottomRow = screenBase + bottom - 1; charArray[newBottomRow] = discardedChars; charAttributes[newBottomRow] = discardedAttributes; Arrays.fill(charArray[newBottomRow], ' '); Arrays.fill(charAttributes[newBottomRow], 0); markLine(l, bottom - l); } /** * Delete a rectangular portion of the screen. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (row) * @param w with of the area in characters * @param h height of the area in characters * @param curAttr attribute to fill * @see #deleteChar * @see #deleteLine * @see #redraw */ public void deleteArea(int c, int l, int w, int h, int curAttr) { int endColumn = c + w; int targetRow = screenBase + l; for (int i = 0; i < h && l + i < height; i++) { Arrays.fill(charAttributes[targetRow], c, endColumn, curAttr); Arrays.fill(charArray[targetRow], c, endColumn, ' '); targetRow++; } markLine(l, h); } /** * Delete a rectangular portion of the screen. * You need to call redraw() to update the screen. * @param c x-coordinate (column) * @param l y-coordinate (row) * @param w with of the area in characters * @param h height of the area in characters * @see #deleteChar * @see #deleteLine * @see #redraw */ public void deleteArea(int c, int l, int w, int h) { deleteArea(c, l, w, h, 0); } /** * Sets whether the cursor is visible or not. * @param doshow */ public void showCursor(boolean doshow) { showcursor = doshow; } /** * Check whether the cursor is currently visible. * @return visibility */ public boolean isCursorVisible() { return showcursor; } /** * Puts the cursor at the specified position. * @param c column * @param l line */ public void setCursorPosition(int c, int l) { cursorX = c; cursorY = l; } /** * Get the current column of the cursor position. */ public int getCursorColumn() { return cursorX; } /** * Get the current line of the cursor position. */ public int getCursorRow() { return cursorY; } /** * Set the current window base. This allows to view the scrollback buffer. * @param line the line where the screen window starts * @see #setBufferSize * @see #getBufferSize */ public void setWindowBase(int line) { if (line > screenBase) line = screenBase; else if (line < 0) line = 0; windowBase = line; update[0] = true; redraw(); } /** * Get the current window base. * @see #setWindowBase */ public int getWindowBase() { return windowBase; } /** * Set the scroll margins simultaneously. If they're out of bounds, trim them. * @param l1 line that is the top * @param l2 line that is the bottom */ public void setMargins(int l1, int l2) { if (l1 > l2) return; if (l1 < 0) l1 = 0; if (l2 >= height) l2 = height - 1; topMargin = l1; bottomMargin = l2; } /** * Set the top scroll margin for the screen. If the current bottom margin * is smaller it will become the top margin and the line will become the * bottom margin. * @param l line that is the margin */ public void setTopMargin(int l) { if (l > bottomMargin) { topMargin = bottomMargin; bottomMargin = l; } else topMargin = l; if (topMargin < 0) topMargin = 0; if (bottomMargin >= height) bottomMargin = height - 1; } /** * Get the top scroll margin. */ public int getTopMargin() { return topMargin; } /** * Set the bottom scroll margin for the screen. If the current top margin * is bigger it will become the bottom margin and the line will become the * top margin. * @param l line that is the margin */ public void setBottomMargin(int l) { if (l < topMargin) { bottomMargin = topMargin; topMargin = l; } else bottomMargin = l; if (topMargin < 0) topMargin = 0; if (bottomMargin >= height) bottomMargin = height - 1; } /** * Get the bottom scroll margin. */ public int getBottomMargin() { return bottomMargin; } /** * Set scrollback buffer size. * @param amount new size of the buffer */ public void setBufferSize(int amount) { if (amount < height) amount = height; if (amount < maxBufSize) { char cbuf[][] = new char[amount][width]; int abuf[][] = new int[amount][width]; int copyStart = bufSize - amount < 0 ? 0 : bufSize - amount; int copyCount = bufSize - amount < 0 ? bufSize : amount; if (charArray != null) System.arraycopy(charArray, copyStart, cbuf, 0, copyCount); if (charAttributes != null) System.arraycopy(charAttributes, copyStart, abuf, 0, copyCount); charArray = cbuf; charAttributes = abuf; bufSize = copyCount; screenBase = bufSize - height; windowBase = screenBase; } maxBufSize = amount; update[0] = true; redraw(); } /** * Retrieve current scrollback buffer size. * @see #setBufferSize */ public int getBufferSize() { return bufSize; } /** * Retrieve maximum buffer Size. * @see #getBufferSize */ public int getMaxBufferSize() { return maxBufSize; } /** * Change the size of the screen. This will include adjustment of the * scrollback buffer. * @param w of the screen * @param h of the screen */ public void setScreenSize(int w, int h, boolean broadcast) { char cbuf[][]; int abuf[][]; int maxSize = bufSize; if (w < 1 || h < 1) return; if (debug > 0) System.err.println("VDU: screen size [" + w + "," + h + "]"); if (h > maxBufSize) maxBufSize = h; if (h > bufSize) { bufSize = h; screenBase = 0; windowBase = 0; } if (windowBase + h >= bufSize) windowBase = bufSize - h; if (screenBase + h >= bufSize) screenBase = bufSize - h; cbuf = new char[bufSize][w]; abuf = new int[bufSize][w]; for (int i = 0; i < bufSize; i++) { Arrays.fill(cbuf[i], ' '); } if (bufSize < maxSize) maxSize = bufSize; int rowLength; if (charArray != null && charAttributes != null) { for (int i = 0; i < maxSize && charArray[i] != null; i++) { rowLength = charArray[i].length; System.arraycopy(charArray[i], 0, cbuf[i], 0, w < rowLength ? w : rowLength); System.arraycopy(charAttributes[i], 0, abuf[i], 0, w < rowLength ? w : rowLength); } } int C = getCursorColumn(); if (C < 0) C = 0; else if (C >= width) C = width - 1; int R = getCursorRow(); if (R < 0) R = 0; else if (R >= height) R = height - 1; setCursorPosition(C, R); charArray = cbuf; charAttributes = abuf; width = w; height = h; topMargin = 0; bottomMargin = h - 1; update = new boolean[h + 1]; update[0] = true; /* FIXME: ??? if(resizeStrategy == RESIZE_FONT) setBounds(getBounds()); */ } /** * Get amount of rows on the screen. */ public int getRows() { return height; } /** * Get amount of columns on the screen. */ public int getColumns() { return width; } /** * Mark lines to be updated with redraw(). * @param l starting line * @param n amount of lines to be updated * @see #redraw */ public void markLine(int l, int n) { for (int i = 0; (i < n) && (l + i < height); i++) update[l + i + 1] = true; } // private static int checkBounds(int value, int lower, int upper) { // if (value < lower) // return lower; // else if (value > upper) // return upper; // else // return value; // } /** a generic display that should redraw on demand */ protected VDUDisplay display; public void setDisplay(VDUDisplay display) { this.display = display; } /** * Trigger a redraw on the display. */ protected void redraw() { if (display != null) display.redraw(); } }
1031868817-aaaa
src/de/mud/terminal/VDUBuffer.java
Java
asf20
26,114
/* * This file is part of "JTA - Telnet/SSH for the JAVA(tm) platform". * * (c) Matthias L. Jugel, Marcus Meiner 1996-2005. All Rights Reserved. * * Please visit http://javatelnet.org/ for updates and contact. * * --LICENSE NOTICE-- * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. * --LICENSE NOTICE-- * */ package de.mud.terminal; import android.text.AndroidCharacter; import java.util.Properties; /** * Implementation of a VT terminal emulation plus ANSI compatible. * <P> * <B>Maintainer:</B> Marcus Meißner * * @version $Id: vt320.java 507 2005-10-25 10:14:52Z marcus $ * @author Matthias L. Jugel, Marcus Meißner */ public abstract class vt320 extends VDUBuffer implements VDUInput { /** The current version id tag.<P> * $Id: vt320.java 507 2005-10-25 10:14:52Z marcus $ * */ public final static String ID = "$Id: vt320.java 507 2005-10-25 10:14:52Z marcus $"; /** the debug level */ private final static int debug = 0; private StringBuilder debugStr; public abstract void debug(String notice); /** * Write an answer back to the remote host. This is needed to be able to * send terminal answers requests like status and type information. * @param b the array of bytes to be sent */ public abstract void write(byte[] b); /** * Write an answer back to the remote host. This is needed to be able to * send terminal answers requests like status and type information. * @param b the array of bytes to be sent */ public abstract void write(int b); /** * Play the beep sound ... */ public void beep() { /* do nothing by default */ } /** * Convenience function for putString(char[], int, int) */ public void putString(String s) { int len = s.length(); char[] tmp = new char[len]; s.getChars(0, len, tmp, 0); putString(tmp, null, 0, len); } /** * Put string at current cursor position. Moves cursor * according to the String. Does NOT wrap. * @param s character array * @param start place to start in array * @param len number of characters to process */ public void putString(char[] s, byte[] fullwidths, int start, int len) { if (len > 0) { //markLine(R, 1); int lastChar = -1; char c; boolean isWide = false; for (int i = 0; i < len; i++) { c = s[start + i]; // Shortcut for my favorite ASCII if (c <= 0x7F) { if (lastChar != -1) putChar((char) lastChar, isWide, false); lastChar = c; isWide = false; } else if (!Character.isLowSurrogate(c) && !Character.isHighSurrogate(c)) { if (Character.getType(c) == Character.NON_SPACING_MARK) { if (lastChar != -1) { char nc = Precomposer.precompose((char) lastChar, c); putChar(nc, isWide, false); lastChar = -1; } } else { if (lastChar != -1) putChar((char) lastChar, isWide, false); lastChar = c; if (fullwidths != null) { final byte width = fullwidths[i]; isWide = (width == AndroidCharacter.EAST_ASIAN_WIDTH_WIDE) || (width == AndroidCharacter.EAST_ASIAN_WIDTH_FULL_WIDTH); } } } } if (lastChar != -1) putChar((char) lastChar, isWide, false); setCursorPosition(C, R); redraw(); } } protected void sendTelnetCommand(byte cmd) { } /** * Sent the changed window size from the terminal to all listeners. */ protected void setWindowSize(int c, int r) { /* To be overridden by Terminal.java */ } @Override public void setScreenSize(int c, int r, boolean broadcast) { int oldrows = height; if (debug>2) { if (debugStr == null) debugStr = new StringBuilder(); debugStr.append("setscreensize (") .append(c) .append(',') .append(r) .append(',') .append(broadcast) .append(')'); debug(debugStr.toString()); debugStr.setLength(0); } super.setScreenSize(c,r,false); boolean cursorChanged = false; // Don't let the cursor go off the screen. if (C >= c) { C = c - 1; cursorChanged = true; } if (R >= r) { R = r - 1; cursorChanged = true; } if (cursorChanged) { setCursorPosition(C, R); redraw(); } if (broadcast) { setWindowSize(c, r); /* broadcast up */ } } /** * Create a new vt320 terminal and intialize it with useful settings. */ public vt320(int width, int height) { super(width, height); debugStr = new StringBuilder(); setVMS(false); setIBMCharset(false); setTerminalID("vt320"); setBufferSize(100); //setBorder(2, false); gx = new char[4]; reset(); /* top row of numpad */ PF1 = "\u001bOP"; PF2 = "\u001bOQ"; PF3 = "\u001bOR"; PF4 = "\u001bOS"; /* the 3x2 keyblock on PC keyboards */ Insert = new String[4]; Remove = new String[4]; KeyHome = new String[4]; KeyEnd = new String[4]; NextScn = new String[4]; PrevScn = new String[4]; Escape = new String[4]; BackSpace = new String[4]; TabKey = new String[4]; Insert[0] = Insert[1] = Insert[2] = Insert[3] = "\u001b[2~"; Remove[0] = Remove[1] = Remove[2] = Remove[3] = "\u001b[3~"; PrevScn[0] = PrevScn[1] = PrevScn[2] = PrevScn[3] = "\u001b[5~"; NextScn[0] = NextScn[1] = NextScn[2] = NextScn[3] = "\u001b[6~"; KeyHome[0] = KeyHome[1] = KeyHome[2] = KeyHome[3] = "\u001b[H"; KeyEnd[0] = KeyEnd[1] = KeyEnd[2] = KeyEnd[3] = "\u001b[F"; Escape[0] = Escape[1] = Escape[2] = Escape[3] = "\u001b"; if (vms) { BackSpace[1] = "" + (char) 10; // VMS shift deletes word back BackSpace[2] = "\u0018"; // VMS control deletes line back BackSpace[0] = BackSpace[3] = "\u007f"; // VMS other is delete } else { //BackSpace[0] = BackSpace[1] = BackSpace[2] = BackSpace[3] = "\b"; // ConnectBot modifications. BackSpace[0] = "\b"; BackSpace[1] = "\u007f"; BackSpace[2] = "\u001b[3~"; BackSpace[3] = "\u001b[2~"; } /* some more VT100 keys */ Find = "\u001b[1~"; Select = "\u001b[4~"; Help = "\u001b[28~"; Do = "\u001b[29~"; FunctionKey = new String[21]; FunctionKey[0] = ""; FunctionKey[1] = PF1; FunctionKey[2] = PF2; FunctionKey[3] = PF3; FunctionKey[4] = PF4; /* following are defined differently for vt220 / vt132 ... */ FunctionKey[5] = "\u001b[15~"; FunctionKey[6] = "\u001b[17~"; FunctionKey[7] = "\u001b[18~"; FunctionKey[8] = "\u001b[19~"; FunctionKey[9] = "\u001b[20~"; FunctionKey[10] = "\u001b[21~"; FunctionKey[11] = "\u001b[23~"; FunctionKey[12] = "\u001b[24~"; FunctionKey[13] = "\u001b[25~"; FunctionKey[14] = "\u001b[26~"; FunctionKey[15] = Help; FunctionKey[16] = Do; FunctionKey[17] = "\u001b[31~"; FunctionKey[18] = "\u001b[32~"; FunctionKey[19] = "\u001b[33~"; FunctionKey[20] = "\u001b[34~"; FunctionKeyShift = new String[21]; FunctionKeyAlt = new String[21]; FunctionKeyCtrl = new String[21]; for (int i = 0; i < 20; i++) { FunctionKeyShift[i] = ""; FunctionKeyAlt[i] = ""; FunctionKeyCtrl[i] = ""; } FunctionKeyShift[15] = Find; FunctionKeyShift[16] = Select; TabKey[0] = "\u0009"; TabKey[1] = "\u001bOP\u0009"; TabKey[2] = TabKey[3] = ""; KeyUp = new String[4]; KeyUp[0] = "\u001b[A"; KeyDown = new String[4]; KeyDown[0] = "\u001b[B"; KeyRight = new String[4]; KeyRight[0] = "\u001b[C"; KeyLeft = new String[4]; KeyLeft[0] = "\u001b[D"; Numpad = new String[10]; Numpad[0] = "\u001bOp"; Numpad[1] = "\u001bOq"; Numpad[2] = "\u001bOr"; Numpad[3] = "\u001bOs"; Numpad[4] = "\u001bOt"; Numpad[5] = "\u001bOu"; Numpad[6] = "\u001bOv"; Numpad[7] = "\u001bOw"; Numpad[8] = "\u001bOx"; Numpad[9] = "\u001bOy"; KPMinus = PF4; KPComma = "\u001bOl"; KPPeriod = "\u001bOn"; KPEnter = "\u001bOM"; NUMPlus = new String[4]; NUMPlus[0] = "+"; NUMDot = new String[4]; NUMDot[0] = "."; } public void setBackspace(int type) { switch (type) { case DELETE_IS_DEL: BackSpace[0] = "\u007f"; BackSpace[1] = "\b"; break; case DELETE_IS_BACKSPACE: BackSpace[0] = "\b"; BackSpace[1] = "\u007f"; break; } } /** * Create a default vt320 terminal with 80 columns and 24 lines. */ public vt320() { this(80, 24); } /** * Terminal is mouse-aware and requires (x,y) coordinates of * on the terminal (character coordinates) and the button clicked. * @param x * @param y * @param modifiers */ public void mousePressed(int x, int y, int modifiers) { if (mouserpt == 0) return; int mods = modifiers; mousebut = 3; if ((mods & 16) == 16) mousebut = 0; if ((mods & 8) == 8) mousebut = 1; if ((mods & 4) == 4) mousebut = 2; int mousecode; if (mouserpt == 9) /* X10 Mouse */ mousecode = 0x20 | mousebut; else /* normal xterm mouse reporting */ mousecode = mousebut | 0x20 | ((mods & 7) << 2); byte b[] = new byte[6]; b[0] = 27; b[1] = (byte) '['; b[2] = (byte) 'M'; b[3] = (byte) mousecode; b[4] = (byte) (0x20 + x + 1); b[5] = (byte) (0x20 + y + 1); write(b); // FIXME: writeSpecial here } /** * Terminal is mouse-aware and requires the coordinates and button * of the release. * @param x * @param y * @param modifiers */ public void mouseReleased(int x, int y, int modifiers) { if (mouserpt == 0) return; /* problem is tht modifiers still have the released button set in them. int mods = modifiers; mousebut = 3; if ((mods & 16)==16) mousebut=0; if ((mods & 8)==8 ) mousebut=1; if ((mods & 4)==4 ) mousebut=2; */ int mousecode; if (mouserpt == 9) mousecode = 0x20 + mousebut; /* same as press? appears so. */ else mousecode = '#'; byte b[] = new byte[6]; b[0] = 27; b[1] = (byte) '['; b[2] = (byte) 'M'; b[3] = (byte) mousecode; b[4] = (byte) (0x20 + x + 1); b[5] = (byte) (0x20 + y + 1); write(b); // FIXME: writeSpecial here mousebut = 0; } /** we should do localecho (passed from other modules). false is default */ private boolean localecho = false; /** * Enable or disable the local echo property of the terminal. * @param echo true if the terminal should echo locally */ public void setLocalEcho(boolean echo) { localecho = echo; } /** * Enable the VMS mode of the terminal to handle some things differently * for VMS hosts. * @param vms true for vms mode, false for normal mode */ public void setVMS(boolean vms) { this.vms = vms; } /** * Enable the usage of the IBM character set used by some BBS's. Special * graphical character are available in this mode. * @param ibm true to use the ibm character set */ public void setIBMCharset(boolean ibm) { useibmcharset = ibm; } /** * Override the standard key codes used by the terminal emulation. * @param codes a properties object containing key code definitions */ public void setKeyCodes(Properties codes) { String res, prefixes[] = {"", "S", "C", "A"}; int i; for (i = 0; i < 10; i++) { res = codes.getProperty("NUMPAD" + i); if (res != null) Numpad[i] = unEscape(res); } for (i = 1; i < 20; i++) { res = codes.getProperty("F" + i); if (res != null) FunctionKey[i] = unEscape(res); res = codes.getProperty("SF" + i); if (res != null) FunctionKeyShift[i] = unEscape(res); res = codes.getProperty("CF" + i); if (res != null) FunctionKeyCtrl[i] = unEscape(res); res = codes.getProperty("AF" + i); if (res != null) FunctionKeyAlt[i] = unEscape(res); } for (i = 0; i < 4; i++) { res = codes.getProperty(prefixes[i] + "PGUP"); if (res != null) PrevScn[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "PGDOWN"); if (res != null) NextScn[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "END"); if (res != null) KeyEnd[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "HOME"); if (res != null) KeyHome[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "INSERT"); if (res != null) Insert[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "REMOVE"); if (res != null) Remove[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "UP"); if (res != null) KeyUp[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "DOWN"); if (res != null) KeyDown[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "LEFT"); if (res != null) KeyLeft[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "RIGHT"); if (res != null) KeyRight[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "ESCAPE"); if (res != null) Escape[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "BACKSPACE"); if (res != null) BackSpace[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "TAB"); if (res != null) TabKey[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "NUMPLUS"); if (res != null) NUMPlus[i] = unEscape(res); res = codes.getProperty(prefixes[i] + "NUMDECIMAL"); if (res != null) NUMDot[i] = unEscape(res); } } /** * Set the terminal id used to identify this terminal. * @param terminalID the id string */ public void setTerminalID(String terminalID) { this.terminalID = terminalID; if (terminalID.equals("scoansi")) { FunctionKey[1] = "\u001b[M"; FunctionKey[2] = "\u001b[N"; FunctionKey[3] = "\u001b[O"; FunctionKey[4] = "\u001b[P"; FunctionKey[5] = "\u001b[Q"; FunctionKey[6] = "\u001b[R"; FunctionKey[7] = "\u001b[S"; FunctionKey[8] = "\u001b[T"; FunctionKey[9] = "\u001b[U"; FunctionKey[10] = "\u001b[V"; FunctionKey[11] = "\u001b[W"; FunctionKey[12] = "\u001b[X"; FunctionKey[13] = "\u001b[Y"; FunctionKey[14] = "?"; FunctionKey[15] = "\u001b[a"; FunctionKey[16] = "\u001b[b"; FunctionKey[17] = "\u001b[c"; FunctionKey[18] = "\u001b[d"; FunctionKey[19] = "\u001b[e"; FunctionKey[20] = "\u001b[f"; PrevScn[0] = PrevScn[1] = PrevScn[2] = PrevScn[3] = "\u001b[I"; NextScn[0] = NextScn[1] = NextScn[2] = NextScn[3] = "\u001b[G"; // more theoretically. } } public void setAnswerBack(String ab) { this.answerBack = unEscape(ab); } /** * Get the terminal id used to identify this terminal. */ public String getTerminalID() { return terminalID; } /** * A small conveniance method thar converts the string to a byte array * for sending. * @param s the string to be sent */ private boolean write(String s, boolean doecho) { if (debug > 2) { debugStr.append("write(|") .append(s) .append("|,") .append(doecho); debug(debugStr.toString()); debugStr.setLength(0); } if (s == null) // aka the empty string. return true; /* NOTE: getBytes() honours some locale, it *CONVERTS* the string. * However, we output only 7bit stuff towards the target, and *some* * 8 bit control codes. We must not mess up the latter, so we do hand * by hand copy. */ byte arr[] = new byte[s.length()]; for (int i = 0; i < s.length(); i++) { arr[i] = (byte) s.charAt(i); } write(arr); if (doecho) putString(s); return true; } private boolean write(int s, boolean doecho) { if (debug > 2) { debugStr.append("write(|") .append(s) .append("|,") .append(doecho); debug(debugStr.toString()); debugStr.setLength(0); } write(s); // TODO check if character is wide if (doecho) putChar((char)s, false, false); return true; } private boolean write(String s) { return write(s, localecho); } // =================================================================== // the actual terminal emulation code comes here: // =================================================================== private String terminalID = "vt320"; private String answerBack = "Use Terminal.answerback to set ...\n"; // X - COLUMNS, Y - ROWS int R,C; int attributes = 0; int Sc,Sr,Sa,Stm,Sbm; char Sgr,Sgl; char Sgx[]; int insertmode = 0; int statusmode = 0; boolean vt52mode = false; boolean keypadmode = false; /* false - numeric, true - application */ boolean output8bit = false; int normalcursor = 0; boolean moveoutsidemargins = true; boolean wraparound = true; boolean sendcrlf = true; boolean capslock = false; boolean numlock = false; int mouserpt = 0; byte mousebut = 0; boolean useibmcharset = false; int lastwaslf = 0; boolean usedcharsets = false; private final static char ESC = 27; private final static char IND = 132; private final static char NEL = 133; private final static char RI = 141; private final static char SS2 = 142; private final static char SS3 = 143; private final static char DCS = 144; private final static char HTS = 136; private final static char CSI = 155; private final static char OSC = 157; private final static int TSTATE_DATA = 0; private final static int TSTATE_ESC = 1; /* ESC */ private final static int TSTATE_CSI = 2; /* ESC [ */ private final static int TSTATE_DCS = 3; /* ESC P */ private final static int TSTATE_DCEQ = 4; /* ESC [? */ private final static int TSTATE_ESCSQUARE = 5; /* ESC # */ private final static int TSTATE_OSC = 6; /* ESC ] */ private final static int TSTATE_SETG0 = 7; /* ESC (? */ private final static int TSTATE_SETG1 = 8; /* ESC )? */ private final static int TSTATE_SETG2 = 9; /* ESC *? */ private final static int TSTATE_SETG3 = 10; /* ESC +? */ private final static int TSTATE_CSI_DOLLAR = 11; /* ESC [ Pn $ */ private final static int TSTATE_CSI_EX = 12; /* ESC [ ! */ private final static int TSTATE_ESCSPACE = 13; /* ESC <space> */ private final static int TSTATE_VT52X = 14; private final static int TSTATE_VT52Y = 15; private final static int TSTATE_CSI_TICKS = 16; private final static int TSTATE_CSI_EQUAL = 17; /* ESC [ = */ private final static int TSTATE_TITLE = 18; /* xterm title */ /* Keys we support */ public final static int KEY_PAUSE = 1; public final static int KEY_F1 = 2; public final static int KEY_F2 = 3; public final static int KEY_F3 = 4; public final static int KEY_F4 = 5; public final static int KEY_F5 = 6; public final static int KEY_F6 = 7; public final static int KEY_F7 = 8; public final static int KEY_F8 = 9; public final static int KEY_F9 = 10; public final static int KEY_F10 = 11; public final static int KEY_F11 = 12; public final static int KEY_F12 = 13; public final static int KEY_UP = 14; public final static int KEY_DOWN =15 ; public final static int KEY_LEFT = 16; public final static int KEY_RIGHT = 17; public final static int KEY_PAGE_DOWN = 18; public final static int KEY_PAGE_UP = 19; public final static int KEY_INSERT = 20; public final static int KEY_DELETE = 21; public final static int KEY_BACK_SPACE = 22; public final static int KEY_HOME = 23; public final static int KEY_END = 24; public final static int KEY_NUM_LOCK = 25; public final static int KEY_CAPS_LOCK = 26; public final static int KEY_SHIFT = 27; public final static int KEY_CONTROL = 28; public final static int KEY_ALT = 29; public final static int KEY_ENTER = 30; public final static int KEY_NUMPAD0 = 31; public final static int KEY_NUMPAD1 = 32; public final static int KEY_NUMPAD2 = 33; public final static int KEY_NUMPAD3 = 34; public final static int KEY_NUMPAD4 = 35; public final static int KEY_NUMPAD5 = 36; public final static int KEY_NUMPAD6 = 37; public final static int KEY_NUMPAD7 = 38; public final static int KEY_NUMPAD8 = 39; public final static int KEY_NUMPAD9 = 40; public final static int KEY_DECIMAL = 41; public final static int KEY_ADD = 42; public final static int KEY_ESCAPE = 43; public final static int DELETE_IS_DEL = 0; public final static int DELETE_IS_BACKSPACE = 1; /* The graphics charsets * B - default ASCII * A - ISO Latin 1 * 0 - DEC SPECIAL * < - User defined * .... */ char gx[]; char gl; // GL (left charset) char gr; // GR (right charset) int onegl; // single shift override for GL. // Map from scoansi linedrawing to DEC _and_ unicode (for the stuff which // is not in linedrawing). Got from experimenting with scoadmin. private final static String scoansi_acs = "Tm7k3x4u?kZl@mYjEnB\u2566DqCtAvM\u2550:\u2551N\u2557I\u2554;\u2557H\u255a0a<\u255d"; // array to store DEC Special -> Unicode mapping // Unicode DEC Unicode name (DEC name) private static char DECSPECIAL[] = { '\u0040', //5f blank '\u2666', //60 black diamond '\u2592', //61 grey square '\u2409', //62 Horizontal tab (ht) pict. for control '\u240c', //63 Form Feed (ff) pict. for control '\u240d', //64 Carriage Return (cr) pict. for control '\u240a', //65 Line Feed (lf) pict. for control '\u00ba', //66 Masculine ordinal indicator '\u00b1', //67 Plus or minus sign '\u2424', //68 New Line (nl) pict. for control '\u240b', //69 Vertical Tab (vt) pict. for control '\u2518', //6a Forms light up and left '\u2510', //6b Forms light down and left '\u250c', //6c Forms light down and right '\u2514', //6d Forms light up and right '\u253c', //6e Forms light vertical and horizontal '\u2594', //6f Upper 1/8 block (Scan 1) '\u2580', //70 Upper 1/2 block (Scan 3) '\u2500', //71 Forms light horizontal or ?em dash? (Scan 5) '\u25ac', //72 \u25ac black rect. or \u2582 lower 1/4 (Scan 7) '\u005f', //73 \u005f underscore or \u2581 lower 1/8 (Scan 9) '\u251c', //74 Forms light vertical and right '\u2524', //75 Forms light vertical and left '\u2534', //76 Forms light up and horizontal '\u252c', //77 Forms light down and horizontal '\u2502', //78 vertical bar '\u2264', //79 less than or equal '\u2265', //7a greater than or equal '\u00b6', //7b paragraph '\u2260', //7c not equal '\u00a3', //7d Pound Sign (british) '\u00b7' //7e Middle Dot }; /** Strings to send on function key pressing */ private String Numpad[]; private String FunctionKey[]; private String FunctionKeyShift[]; private String FunctionKeyCtrl[]; private String FunctionKeyAlt[]; private String TabKey[]; private String KeyUp[],KeyDown[],KeyLeft[],KeyRight[]; private String KPMinus, KPComma, KPPeriod, KPEnter; private String PF1, PF2, PF3, PF4; private String Help, Do, Find, Select; private String KeyHome[], KeyEnd[], Insert[], Remove[], PrevScn[], NextScn[]; private String Escape[], BackSpace[], NUMDot[], NUMPlus[]; private String osc,dcs; /* to memorize OSC & DCS control sequence */ /** vt320 state variable (internal) */ private int term_state = TSTATE_DATA; /** in vms mode, set by Terminal.VMS property */ private boolean vms = false; /** Tabulators */ private byte[] Tabs; /** The list of integers as used by CSI */ private int[] DCEvars = new int[30]; private int DCEvar; /** * Replace escape code characters (backslash + identifier) with their * respective codes. * @param tmp the string to be parsed * @return a unescaped string */ static String unEscape(String tmp) { int idx = 0, oldidx = 0; String cmd; // f.println("unescape("+tmp+")"); cmd = ""; while ((idx = tmp.indexOf('\\', oldidx)) >= 0 && ++idx <= tmp.length()) { cmd += tmp.substring(oldidx, idx - 1); if (idx == tmp.length()) return cmd; switch (tmp.charAt(idx)) { case 'b': cmd += "\b"; break; case 'e': cmd += "\u001b"; break; case 'n': cmd += "\n"; break; case 'r': cmd += "\r"; break; case 't': cmd += "\t"; break; case 'v': cmd += "\u000b"; break; case 'a': cmd += "\u0012"; break; default : if ((tmp.charAt(idx) >= '0') && (tmp.charAt(idx) <= '9')) { int i; for (i = idx; i < tmp.length(); i++) if ((tmp.charAt(i) < '0') || (tmp.charAt(i) > '9')) break; cmd += (char) Integer.parseInt(tmp.substring(idx, i)); idx = i - 1; } else cmd += tmp.substring(idx, ++idx); break; } oldidx = ++idx; } if (oldidx <= tmp.length()) cmd += tmp.substring(oldidx); return cmd; } /** * A small conveniance method thar converts a 7bit string to the 8bit * version depending on VT52/Output8Bit mode. * * @param s the string to be sent */ private boolean writeSpecial(String s) { if (s == null) return true; if (((s.length() >= 3) && (s.charAt(0) == 27) && (s.charAt(1) == 'O'))) { if (vt52mode) { if ((s.charAt(2) >= 'P') && (s.charAt(2) <= 'S')) { s = "\u001b" + s.substring(2); /* ESC x */ } else { s = "\u001b?" + s.substring(2); /* ESC ? x */ } } else { if (output8bit) { s = "\u008f" + s.substring(2); /* SS3 x */ } /* else keep string as it is */ } } if (((s.length() >= 3) && (s.charAt(0) == 27) && (s.charAt(1) == '['))) { if (output8bit) { s = "\u009b" + s.substring(2); /* CSI ... */ } /* else keep */ } return write(s, false); } /** * main keytyping event handler... */ public void keyPressed(int keyCode, char keyChar, int modifiers) { boolean control = (modifiers & VDUInput.KEY_CONTROL) != 0; boolean shift = (modifiers & VDUInput.KEY_SHIFT) != 0; boolean alt = (modifiers & VDUInput.KEY_ALT) != 0; if (debug > 1) { debugStr.append("keyPressed(") .append(keyCode) .append(", ") .append((int)keyChar) .append(", ") .append(modifiers) .append(')'); debug(debugStr.toString()); debugStr.setLength(0); } int xind; String fmap[]; xind = 0; fmap = FunctionKey; if (shift) { fmap = FunctionKeyShift; xind = 1; } if (control) { fmap = FunctionKeyCtrl; xind = 2; } if (alt) { fmap = FunctionKeyAlt; xind = 3; } switch (keyCode) { case KEY_PAUSE: if (shift || control) sendTelnetCommand((byte) 243); // BREAK break; case KEY_F1: writeSpecial(fmap[1]); break; case KEY_F2: writeSpecial(fmap[2]); break; case KEY_F3: writeSpecial(fmap[3]); break; case KEY_F4: writeSpecial(fmap[4]); break; case KEY_F5: writeSpecial(fmap[5]); break; case KEY_F6: writeSpecial(fmap[6]); break; case KEY_F7: writeSpecial(fmap[7]); break; case KEY_F8: writeSpecial(fmap[8]); break; case KEY_F9: writeSpecial(fmap[9]); break; case KEY_F10: writeSpecial(fmap[10]); break; case KEY_F11: writeSpecial(fmap[11]); break; case KEY_F12: writeSpecial(fmap[12]); break; case KEY_UP: writeSpecial(KeyUp[xind]); break; case KEY_DOWN: writeSpecial(KeyDown[xind]); break; case KEY_LEFT: writeSpecial(KeyLeft[xind]); break; case KEY_RIGHT: writeSpecial(KeyRight[xind]); break; case KEY_PAGE_DOWN: writeSpecial(NextScn[xind]); break; case KEY_PAGE_UP: writeSpecial(PrevScn[xind]); break; case KEY_INSERT: writeSpecial(Insert[xind]); break; case KEY_DELETE: writeSpecial(Remove[xind]); break; case KEY_BACK_SPACE: writeSpecial(BackSpace[xind]); if (localecho) { if (BackSpace[xind] == "\b") { putString("\b \b"); // make the last char 'deleted' } else { putString(BackSpace[xind]); // echo it } } break; case KEY_HOME: writeSpecial(KeyHome[xind]); break; case KEY_END: writeSpecial(KeyEnd[xind]); break; case KEY_NUM_LOCK: if (vms && control) { writeSpecial(PF1); } if (!control) numlock = !numlock; break; case KEY_CAPS_LOCK: capslock = !capslock; return; case KEY_SHIFT: case KEY_CONTROL: case KEY_ALT: return; default: break; } } /* public void keyReleased(KeyEvent evt) { if (debug > 1) debug("keyReleased("+evt+")"); // ignore } */ /** * Handle key Typed events for the terminal, this will get * all normal key types, but no shift/alt/control/numlock. */ public void keyTyped(int keyCode, char keyChar, int modifiers) { boolean control = (modifiers & VDUInput.KEY_CONTROL) != 0; boolean shift = (modifiers & VDUInput.KEY_SHIFT) != 0; boolean alt = (modifiers & VDUInput.KEY_ALT) != 0; if (debug > 1) debug("keyTyped("+keyCode+", "+(int)keyChar+", "+modifiers+")"); if (keyChar == '\t') { if (shift) { write(TabKey[1], false); } else { if (control) { write(TabKey[2], false); } else { if (alt) { write(TabKey[3], false); } else { write(TabKey[0], false); } } } return; } if (alt) { write(((char) (keyChar | 0x80))); return; } if (((keyCode == KEY_ENTER) || (keyChar == 10)) && !control) { write('\r'); if (localecho) putString("\r\n"); // bad hack return; } if ((keyCode == 10) && !control) { debug("Sending \\r"); write('\r'); return; } // FIXME: on german PC keyboards you have to use Alt-Ctrl-q to get an @, // so we can't just use it here... will probably break some other VMS // codes. -Marcus // if(((!vms && keyChar == '2') || keyChar == '@' || keyChar == ' ') // && control) if (((!vms && keyChar == '2') || keyChar == ' ') && control) write(0); if (vms) { if (keyChar == 127 && !control) { if (shift) writeSpecial(Insert[0]); // VMS shift delete = insert else writeSpecial(Remove[0]); // VMS delete = remove return; } else if (control) switch (keyChar) { case '0': writeSpecial(Numpad[0]); return; case '1': writeSpecial(Numpad[1]); return; case '2': writeSpecial(Numpad[2]); return; case '3': writeSpecial(Numpad[3]); return; case '4': writeSpecial(Numpad[4]); return; case '5': writeSpecial(Numpad[5]); return; case '6': writeSpecial(Numpad[6]); return; case '7': writeSpecial(Numpad[7]); return; case '8': writeSpecial(Numpad[8]); return; case '9': writeSpecial(Numpad[9]); return; case '.': writeSpecial(KPPeriod); return; case '-': case 31: writeSpecial(KPMinus); return; case '+': writeSpecial(KPComma); return; case 10: writeSpecial(KPEnter); return; case '/': writeSpecial(PF2); return; case '*': writeSpecial(PF3); return; /* NUMLOCK handled in keyPressed */ default: break; } /* Now what does this do and how did it get here. -Marcus if (shift && keyChar < 32) { write(PF1+(char)(keyChar + 64)); return; } */ } // FIXME: not used? //String fmap[]; int xind; xind = 0; //fmap = FunctionKey; if (shift) { //fmap = FunctionKeyShift; xind = 1; } if (control) { //fmap = FunctionKeyCtrl; xind = 2; } if (alt) { //fmap = FunctionKeyAlt; xind = 3; } if (keyCode == KEY_ESCAPE) { writeSpecial(Escape[xind]); return; } if ((modifiers & VDUInput.KEY_ACTION) != 0) switch (keyCode) { case KEY_NUMPAD0: writeSpecial(Numpad[0]); return; case KEY_NUMPAD1: writeSpecial(Numpad[1]); return; case KEY_NUMPAD2: writeSpecial(Numpad[2]); return; case KEY_NUMPAD3: writeSpecial(Numpad[3]); return; case KEY_NUMPAD4: writeSpecial(Numpad[4]); return; case KEY_NUMPAD5: writeSpecial(Numpad[5]); return; case KEY_NUMPAD6: writeSpecial(Numpad[6]); return; case KEY_NUMPAD7: writeSpecial(Numpad[7]); return; case KEY_NUMPAD8: writeSpecial(Numpad[8]); return; case KEY_NUMPAD9: writeSpecial(Numpad[9]); return; case KEY_DECIMAL: writeSpecial(NUMDot[xind]); return; case KEY_ADD: writeSpecial(NUMPlus[xind]); return; } if (!((keyChar == 8) || (keyChar == 127) || (keyChar == '\r') || (keyChar == '\n'))) { write(keyChar); return; } } private void handle_dcs(String dcs) { debugStr.append("DCS: ") .append(dcs); debug(debugStr.toString()); debugStr.setLength(0); } private void handle_osc(String osc) { if (osc.length() > 2 && osc.substring(0, 2).equals("4;")) { // Define color palette String[] colorData = osc.split(";"); try { int colorIndex = Integer.parseInt(colorData[1]); if ("rgb:".equals(colorData[2].substring(0, 4))) { String[] rgb = colorData[2].substring(4).split("/"); int red = Integer.parseInt(rgb[0].substring(0, 2), 16) & 0xFF; int green = Integer.parseInt(rgb[1].substring(0, 2), 16) & 0xFF; int blue = Integer.parseInt(rgb[2].substring(0, 2), 16) & 0xFF; display.setColor(colorIndex, red, green, blue); } } catch (Exception e) { debugStr.append("OSC: invalid color sequence encountered: ") .append(osc); debug(debugStr.toString()); debugStr.setLength(0); } } else debug("OSC: " + osc); } private final static char unimap[] = { //# //# Name: cp437_DOSLatinUS to Unicode table //# Unicode version: 1.1 //# Table version: 1.1 //# Table format: Format A //# Date: 03/31/95 //# Authors: Michel Suignard <michelsu@microsoft.com> //# Lori Hoerth <lorih@microsoft.com> //# General notes: none //# //# Format: Three tab-separated columns //# Column #1 is the cp1255_WinHebrew code (in hex) //# Column #2 is the Unicode (in hex as 0xXXXX) //# Column #3 is the Unicode name (follows a comment sign, '#') //# //# The entries are in cp437_DOSLatinUS order //# 0x0000, // #NULL 0x0001, // #START OF HEADING 0x0002, // #START OF TEXT 0x0003, // #END OF TEXT 0x0004, // #END OF TRANSMISSION 0x0005, // #ENQUIRY 0x0006, // #ACKNOWLEDGE 0x0007, // #BELL 0x0008, // #BACKSPACE 0x0009, // #HORIZONTAL TABULATION 0x000a, // #LINE FEED 0x000b, // #VERTICAL TABULATION 0x000c, // #FORM FEED 0x000d, // #CARRIAGE RETURN 0x000e, // #SHIFT OUT 0x000f, // #SHIFT IN 0x0010, // #DATA LINK ESCAPE 0x0011, // #DEVICE CONTROL ONE 0x0012, // #DEVICE CONTROL TWO 0x0013, // #DEVICE CONTROL THREE 0x0014, // #DEVICE CONTROL FOUR 0x0015, // #NEGATIVE ACKNOWLEDGE 0x0016, // #SYNCHRONOUS IDLE 0x0017, // #END OF TRANSMISSION BLOCK 0x0018, // #CANCEL 0x0019, // #END OF MEDIUM 0x001a, // #SUBSTITUTE 0x001b, // #ESCAPE 0x001c, // #FILE SEPARATOR 0x001d, // #GROUP SEPARATOR 0x001e, // #RECORD SEPARATOR 0x001f, // #UNIT SEPARATOR 0x0020, // #SPACE 0x0021, // #EXCLAMATION MARK 0x0022, // #QUOTATION MARK 0x0023, // #NUMBER SIGN 0x0024, // #DOLLAR SIGN 0x0025, // #PERCENT SIGN 0x0026, // #AMPERSAND 0x0027, // #APOSTROPHE 0x0028, // #LEFT PARENTHESIS 0x0029, // #RIGHT PARENTHESIS 0x002a, // #ASTERISK 0x002b, // #PLUS SIGN 0x002c, // #COMMA 0x002d, // #HYPHEN-MINUS 0x002e, // #FULL STOP 0x002f, // #SOLIDUS 0x0030, // #DIGIT ZERO 0x0031, // #DIGIT ONE 0x0032, // #DIGIT TWO 0x0033, // #DIGIT THREE 0x0034, // #DIGIT FOUR 0x0035, // #DIGIT FIVE 0x0036, // #DIGIT SIX 0x0037, // #DIGIT SEVEN 0x0038, // #DIGIT EIGHT 0x0039, // #DIGIT NINE 0x003a, // #COLON 0x003b, // #SEMICOLON 0x003c, // #LESS-THAN SIGN 0x003d, // #EQUALS SIGN 0x003e, // #GREATER-THAN SIGN 0x003f, // #QUESTION MARK 0x0040, // #COMMERCIAL AT 0x0041, // #LATIN CAPITAL LETTER A 0x0042, // #LATIN CAPITAL LETTER B 0x0043, // #LATIN CAPITAL LETTER C 0x0044, // #LATIN CAPITAL LETTER D 0x0045, // #LATIN CAPITAL LETTER E 0x0046, // #LATIN CAPITAL LETTER F 0x0047, // #LATIN CAPITAL LETTER G 0x0048, // #LATIN CAPITAL LETTER H 0x0049, // #LATIN CAPITAL LETTER I 0x004a, // #LATIN CAPITAL LETTER J 0x004b, // #LATIN CAPITAL LETTER K 0x004c, // #LATIN CAPITAL LETTER L 0x004d, // #LATIN CAPITAL LETTER M 0x004e, // #LATIN CAPITAL LETTER N 0x004f, // #LATIN CAPITAL LETTER O 0x0050, // #LATIN CAPITAL LETTER P 0x0051, // #LATIN CAPITAL LETTER Q 0x0052, // #LATIN CAPITAL LETTER R 0x0053, // #LATIN CAPITAL LETTER S 0x0054, // #LATIN CAPITAL LETTER T 0x0055, // #LATIN CAPITAL LETTER U 0x0056, // #LATIN CAPITAL LETTER V 0x0057, // #LATIN CAPITAL LETTER W 0x0058, // #LATIN CAPITAL LETTER X 0x0059, // #LATIN CAPITAL LETTER Y 0x005a, // #LATIN CAPITAL LETTER Z 0x005b, // #LEFT SQUARE BRACKET 0x005c, // #REVERSE SOLIDUS 0x005d, // #RIGHT SQUARE BRACKET 0x005e, // #CIRCUMFLEX ACCENT 0x005f, // #LOW LINE 0x0060, // #GRAVE ACCENT 0x0061, // #LATIN SMALL LETTER A 0x0062, // #LATIN SMALL LETTER B 0x0063, // #LATIN SMALL LETTER C 0x0064, // #LATIN SMALL LETTER D 0x0065, // #LATIN SMALL LETTER E 0x0066, // #LATIN SMALL LETTER F 0x0067, // #LATIN SMALL LETTER G 0x0068, // #LATIN SMALL LETTER H 0x0069, // #LATIN SMALL LETTER I 0x006a, // #LATIN SMALL LETTER J 0x006b, // #LATIN SMALL LETTER K 0x006c, // #LATIN SMALL LETTER L 0x006d, // #LATIN SMALL LETTER M 0x006e, // #LATIN SMALL LETTER N 0x006f, // #LATIN SMALL LETTER O 0x0070, // #LATIN SMALL LETTER P 0x0071, // #LATIN SMALL LETTER Q 0x0072, // #LATIN SMALL LETTER R 0x0073, // #LATIN SMALL LETTER S 0x0074, // #LATIN SMALL LETTER T 0x0075, // #LATIN SMALL LETTER U 0x0076, // #LATIN SMALL LETTER V 0x0077, // #LATIN SMALL LETTER W 0x0078, // #LATIN SMALL LETTER X 0x0079, // #LATIN SMALL LETTER Y 0x007a, // #LATIN SMALL LETTER Z 0x007b, // #LEFT CURLY BRACKET 0x007c, // #VERTICAL LINE 0x007d, // #RIGHT CURLY BRACKET 0x007e, // #TILDE 0x007f, // #DELETE 0x00c7, // #LATIN CAPITAL LETTER C WITH CEDILLA 0x00fc, // #LATIN SMALL LETTER U WITH DIAERESIS 0x00e9, // #LATIN SMALL LETTER E WITH ACUTE 0x00e2, // #LATIN SMALL LETTER A WITH CIRCUMFLEX 0x00e4, // #LATIN SMALL LETTER A WITH DIAERESIS 0x00e0, // #LATIN SMALL LETTER A WITH GRAVE 0x00e5, // #LATIN SMALL LETTER A WITH RING ABOVE 0x00e7, // #LATIN SMALL LETTER C WITH CEDILLA 0x00ea, // #LATIN SMALL LETTER E WITH CIRCUMFLEX 0x00eb, // #LATIN SMALL LETTER E WITH DIAERESIS 0x00e8, // #LATIN SMALL LETTER E WITH GRAVE 0x00ef, // #LATIN SMALL LETTER I WITH DIAERESIS 0x00ee, // #LATIN SMALL LETTER I WITH CIRCUMFLEX 0x00ec, // #LATIN SMALL LETTER I WITH GRAVE 0x00c4, // #LATIN CAPITAL LETTER A WITH DIAERESIS 0x00c5, // #LATIN CAPITAL LETTER A WITH RING ABOVE 0x00c9, // #LATIN CAPITAL LETTER E WITH ACUTE 0x00e6, // #LATIN SMALL LIGATURE AE 0x00c6, // #LATIN CAPITAL LIGATURE AE 0x00f4, // #LATIN SMALL LETTER O WITH CIRCUMFLEX 0x00f6, // #LATIN SMALL LETTER O WITH DIAERESIS 0x00f2, // #LATIN SMALL LETTER O WITH GRAVE 0x00fb, // #LATIN SMALL LETTER U WITH CIRCUMFLEX 0x00f9, // #LATIN SMALL LETTER U WITH GRAVE 0x00ff, // #LATIN SMALL LETTER Y WITH DIAERESIS 0x00d6, // #LATIN CAPITAL LETTER O WITH DIAERESIS 0x00dc, // #LATIN CAPITAL LETTER U WITH DIAERESIS 0x00a2, // #CENT SIGN 0x00a3, // #POUND SIGN 0x00a5, // #YEN SIGN 0x20a7, // #PESETA SIGN 0x0192, // #LATIN SMALL LETTER F WITH HOOK 0x00e1, // #LATIN SMALL LETTER A WITH ACUTE 0x00ed, // #LATIN SMALL LETTER I WITH ACUTE 0x00f3, // #LATIN SMALL LETTER O WITH ACUTE 0x00fa, // #LATIN SMALL LETTER U WITH ACUTE 0x00f1, // #LATIN SMALL LETTER N WITH TILDE 0x00d1, // #LATIN CAPITAL LETTER N WITH TILDE 0x00aa, // #FEMININE ORDINAL INDICATOR 0x00ba, // #MASCULINE ORDINAL INDICATOR 0x00bf, // #INVERTED QUESTION MARK 0x2310, // #REVERSED NOT SIGN 0x00ac, // #NOT SIGN 0x00bd, // #VULGAR FRACTION ONE HALF 0x00bc, // #VULGAR FRACTION ONE QUARTER 0x00a1, // #INVERTED EXCLAMATION MARK 0x00ab, // #LEFT-POINTING DOUBLE ANGLE QUOTATION MARK 0x00bb, // #RIGHT-POINTING DOUBLE ANGLE QUOTATION MARK 0x2591, // #LIGHT SHADE 0x2592, // #MEDIUM SHADE 0x2593, // #DARK SHADE 0x2502, // #BOX DRAWINGS LIGHT VERTICAL 0x2524, // #BOX DRAWINGS LIGHT VERTICAL AND LEFT 0x2561, // #BOX DRAWINGS VERTICAL SINGLE AND LEFT DOUBLE 0x2562, // #BOX DRAWINGS VERTICAL DOUBLE AND LEFT SINGLE 0x2556, // #BOX DRAWINGS DOWN DOUBLE AND LEFT SINGLE 0x2555, // #BOX DRAWINGS DOWN SINGLE AND LEFT DOUBLE 0x2563, // #BOX DRAWINGS DOUBLE VERTICAL AND LEFT 0x2551, // #BOX DRAWINGS DOUBLE VERTICAL 0x2557, // #BOX DRAWINGS DOUBLE DOWN AND LEFT 0x255d, // #BOX DRAWINGS DOUBLE UP AND LEFT 0x255c, // #BOX DRAWINGS UP DOUBLE AND LEFT SINGLE 0x255b, // #BOX DRAWINGS UP SINGLE AND LEFT DOUBLE 0x2510, // #BOX DRAWINGS LIGHT DOWN AND LEFT 0x2514, // #BOX DRAWINGS LIGHT UP AND RIGHT 0x2534, // #BOX DRAWINGS LIGHT UP AND HORIZONTAL 0x252c, // #BOX DRAWINGS LIGHT DOWN AND HORIZONTAL 0x251c, // #BOX DRAWINGS LIGHT VERTICAL AND RIGHT 0x2500, // #BOX DRAWINGS LIGHT HORIZONTAL 0x253c, // #BOX DRAWINGS LIGHT VERTICAL AND HORIZONTAL 0x255e, // #BOX DRAWINGS VERTICAL SINGLE AND RIGHT DOUBLE 0x255f, // #BOX DRAWINGS VERTICAL DOUBLE AND RIGHT SINGLE 0x255a, // #BOX DRAWINGS DOUBLE UP AND RIGHT 0x2554, // #BOX DRAWINGS DOUBLE DOWN AND RIGHT 0x2569, // #BOX DRAWINGS DOUBLE UP AND HORIZONTAL 0x2566, // #BOX DRAWINGS DOUBLE DOWN AND HORIZONTAL 0x2560, // #BOX DRAWINGS DOUBLE VERTICAL AND RIGHT 0x2550, // #BOX DRAWINGS DOUBLE HORIZONTAL 0x256c, // #BOX DRAWINGS DOUBLE VERTICAL AND HORIZONTAL 0x2567, // #BOX DRAWINGS UP SINGLE AND HORIZONTAL DOUBLE 0x2568, // #BOX DRAWINGS UP DOUBLE AND HORIZONTAL SINGLE 0x2564, // #BOX DRAWINGS DOWN SINGLE AND HORIZONTAL DOUBLE 0x2565, // #BOX DRAWINGS DOWN DOUBLE AND HORIZONTAL SINGLE 0x2559, // #BOX DRAWINGS UP DOUBLE AND RIGHT SINGLE 0x2558, // #BOX DRAWINGS UP SINGLE AND RIGHT DOUBLE 0x2552, // #BOX DRAWINGS DOWN SINGLE AND RIGHT DOUBLE 0x2553, // #BOX DRAWINGS DOWN DOUBLE AND RIGHT SINGLE 0x256b, // #BOX DRAWINGS VERTICAL DOUBLE AND HORIZONTAL SINGLE 0x256a, // #BOX DRAWINGS VERTICAL SINGLE AND HORIZONTAL DOUBLE 0x2518, // #BOX DRAWINGS LIGHT UP AND LEFT 0x250c, // #BOX DRAWINGS LIGHT DOWN AND RIGHT 0x2588, // #FULL BLOCK 0x2584, // #LOWER HALF BLOCK 0x258c, // #LEFT HALF BLOCK 0x2590, // #RIGHT HALF BLOCK 0x2580, // #UPPER HALF BLOCK 0x03b1, // #GREEK SMALL LETTER ALPHA 0x00df, // #LATIN SMALL LETTER SHARP S 0x0393, // #GREEK CAPITAL LETTER GAMMA 0x03c0, // #GREEK SMALL LETTER PI 0x03a3, // #GREEK CAPITAL LETTER SIGMA 0x03c3, // #GREEK SMALL LETTER SIGMA 0x00b5, // #MICRO SIGN 0x03c4, // #GREEK SMALL LETTER TAU 0x03a6, // #GREEK CAPITAL LETTER PHI 0x0398, // #GREEK CAPITAL LETTER THETA 0x03a9, // #GREEK CAPITAL LETTER OMEGA 0x03b4, // #GREEK SMALL LETTER DELTA 0x221e, // #INFINITY 0x03c6, // #GREEK SMALL LETTER PHI 0x03b5, // #GREEK SMALL LETTER EPSILON 0x2229, // #INTERSECTION 0x2261, // #IDENTICAL TO 0x00b1, // #PLUS-MINUS SIGN 0x2265, // #GREATER-THAN OR EQUAL TO 0x2264, // #LESS-THAN OR EQUAL TO 0x2320, // #TOP HALF INTEGRAL 0x2321, // #BOTTOM HALF INTEGRAL 0x00f7, // #DIVISION SIGN 0x2248, // #ALMOST EQUAL TO 0x00b0, // #DEGREE SIGN 0x2219, // #BULLET OPERATOR 0x00b7, // #MIDDLE DOT 0x221a, // #SQUARE ROOT 0x207f, // #SUPERSCRIPT LATIN SMALL LETTER N 0x00b2, // #SUPERSCRIPT TWO 0x25a0, // #BLACK SQUARE 0x00a0, // #NO-BREAK SPACE }; public char map_cp850_unicode(char x) { if (x >= 0x100) return x; return unimap[x]; } private void _SetCursor(int row, int col) { int maxr = height - 1; int tm = getTopMargin(); R = (row < 0)?0: row; C = (col < 0)?0: (col >= width) ? width - 1 : col; if (!moveoutsidemargins) { R += tm; maxr = getBottomMargin(); } if (R > maxr) R = maxr; } private void putChar(char c, boolean isWide, boolean doshowcursor) { int rows = this.height; //statusline int columns = this.width; // byte msg[]; // if (debug > 4) { // debugStr.append("putChar(") // .append(c) // .append(" [") // .append((int) c) // .append("]) at R=") // .append(R) // .append(" , C=") // .append(C) // .append(", columns=") // .append(columns) // .append(", rows=") // .append(rows); // debug(debugStr.toString()); // debugStr.setLength(0); // } // markLine(R, 1); // if (c > 255) { // if (debug > 0) // debug("char > 255:" + (int) c); // //return; // } switch (term_state) { case TSTATE_DATA: /* FIXME: we shouldn't use chars with bit 8 set if ibmcharset. * probably... but some BBS do anyway... */ if (!useibmcharset) { boolean doneflag = true; switch (c) { case OSC: osc = ""; term_state = TSTATE_OSC; break; case RI: if (R > getTopMargin()) R--; else insertLine(R, 1, SCROLL_DOWN); if (debug > 1) debug("RI"); break; case IND: if (debug > 2) { debugStr.append("IND at ") .append(R) .append(", tm is ") .append(getTopMargin()) .append(", bm is ") .append(getBottomMargin()); debug(debugStr.toString()); debugStr.setLength(0); } if (R == getBottomMargin() || R == rows - 1) insertLine(R, 1, SCROLL_UP); else R++; if (debug > 1) debug("IND (at " + R + " )"); break; case NEL: if (R == getBottomMargin() || R == rows - 1) insertLine(R, 1, SCROLL_UP); else R++; C = 0; if (debug > 1) debug("NEL (at " + R + " )"); break; case HTS: Tabs[C] = 1; if (debug > 1) debug("HTS"); break; case DCS: dcs = ""; term_state = TSTATE_DCS; break; default: doneflag = false; break; } if (doneflag) break; } switch (c) { case SS3: onegl = 3; break; case SS2: onegl = 2; break; case CSI: // should be in the 8bit section, but some BBS use this DCEvar = 0; DCEvars[0] = 0; DCEvars[1] = 0; DCEvars[2] = 0; DCEvars[3] = 0; term_state = TSTATE_CSI; break; case ESC: term_state = TSTATE_ESC; lastwaslf = 0; break; case 5: /* ENQ */ write(answerBack, false); break; case 12: /* FormFeed, Home for the BBS world */ deleteArea(0, 0, columns, rows, attributes); C = R = 0; break; case '\b': /* 8 */ C--; if (C < 0) C = 0; lastwaslf = 0; break; case '\t': do { // Don't overwrite or insert! TABS are not destructive, but movement! C++; } while (C < columns && (Tabs[C] == 0)); lastwaslf = 0; break; case '\r': // 13 CR C = 0; break; case '\n': // 10 LF if (debug > 3) debug("R= " + R + ", bm " + getBottomMargin() + ", tm=" + getTopMargin() + ", rows=" + rows); if (!vms) { if (lastwaslf != 0 && lastwaslf != c) // Ray: I do not understand this logic. break; lastwaslf = c; /*C = 0;*/ } if (R == getBottomMargin() || R >= rows - 1) insertLine(R, 1, SCROLL_UP); else R++; break; case 7: beep(); break; case '\016': /* SMACS , as */ /* ^N, Shift out - Put G1 into GL */ gl = 1; usedcharsets = true; break; case '\017': /* RMACS , ae */ /* ^O, Shift in - Put G0 into GL */ gl = 0; usedcharsets = true; break; default: { int thisgl = gl; if (onegl >= 0) { thisgl = onegl; onegl = -1; } lastwaslf = 0; if (c < 32) { if (c != 0) if (debug > 0) debug("TSTATE_DATA char: " + ((int) c)); /*break; some BBS really want those characters, like hearst etc. */ if (c == 0) /* print 0 ... you bet */ break; } if (C >= columns) { if (wraparound) { int bot = rows; // If we're in the scroll region, check against the bottom margin if (R <= getBottomMargin() && R >= getTopMargin()) bot = getBottomMargin() + 1; if (R < bot - 1) R++; else { if (debug > 3) debug("scrolling due to wrap at " + R); insertLine(R, 1, SCROLL_UP); } C = 0; } else { // cursor stays on last character. C = columns - 1; } } boolean mapped = false; // Mapping if DEC Special is chosen charset if (usedcharsets) { if (c >= '\u0020' && c <= '\u007f') { switch (gx[thisgl]) { case '0': // Remap SCOANSI line drawing to VT100 line drawing chars // for our SCO using customers. if (terminalID.equals("scoansi") || terminalID.equals("ansi")) { for (int i = 0; i < scoansi_acs.length(); i += 2) { if (c == scoansi_acs.charAt(i)) { c = scoansi_acs.charAt(i + 1); break; } } } if (c >= '\u005f' && c <= '\u007e') { c = DECSPECIAL[(short) c - 0x5f]; mapped = true; } break; case '<': // 'user preferred' is currently 'ISO Latin-1 suppl c = (char) ((c & 0x7f) | 0x80); mapped = true; break; case 'A': case 'B': // Latin-1 , ASCII -> fall through mapped = true; break; default: debug("Unsupported GL mapping: " + gx[thisgl]); break; } } if (!mapped && (c >= '\u0080' && c <= '\u00ff')) { switch (gx[gr]) { case '0': if (c >= '\u00df' && c <= '\u00fe') { c = DECSPECIAL[c - '\u00df']; mapped = true; } break; case '<': case 'A': case 'B': mapped = true; break; default: debug("Unsupported GR mapping: " + gx[gr]); break; } } } if (!mapped && useibmcharset) c = map_cp850_unicode(c); /*if(true || (statusmode == 0)) { */ if (isWide) { if (C >= columns - 1) { if (wraparound) { int bot = rows; // If we're in the scroll region, check against the bottom margin if (R <= getBottomMargin() && R >= getTopMargin()) bot = getBottomMargin() + 1; if (R < bot - 1) R++; else { if (debug > 3) debug("scrolling due to wrap at " + R); insertLine(R, 1, SCROLL_UP); } C = 0; } else { // cursor stays on last wide character. C = columns - 2; } } } if (insertmode == 1) { if (isWide) { insertChar(C++, R, c, attributes | FULLWIDTH); insertChar(C, R, ' ', attributes | FULLWIDTH); } else insertChar(C, R, c, attributes); } else { if (isWide) { putChar(C++, R, c, attributes | FULLWIDTH); putChar(C, R, ' ', attributes | FULLWIDTH); } else putChar(C, R, c, attributes); } /* } else { if (insertmode==1) { insertChar(C, rows, c, attributes); } else { putChar(C, rows, c, attributes); } } */ C++; break; } } /* switch(c) */ break; case TSTATE_OSC: if ((c < 0x20) && (c != ESC)) {// NP - No printing character handle_osc(osc); term_state = TSTATE_DATA; break; } //but check for vt102 ESC \ if (c == '\\' && osc.charAt(osc.length() - 1) == ESC) { handle_osc(osc); term_state = TSTATE_DATA; break; } osc = osc + c; break; case TSTATE_ESCSPACE: term_state = TSTATE_DATA; switch (c) { case 'F': /* S7C1T, Disable output of 8-bit controls, use 7-bit */ output8bit = false; break; case 'G': /* S8C1T, Enable output of 8-bit control codes*/ output8bit = true; break; default: debug("ESC <space> " + c + " unhandled."); } break; case TSTATE_ESC: term_state = TSTATE_DATA; switch (c) { case ' ': term_state = TSTATE_ESCSPACE; break; case '#': term_state = TSTATE_ESCSQUARE; break; case 'c': /* Hard terminal reset */ reset(); break; case '[': DCEvar = 0; DCEvars[0] = 0; DCEvars[1] = 0; DCEvars[2] = 0; DCEvars[3] = 0; term_state = TSTATE_CSI; break; case ']': osc = ""; term_state = TSTATE_OSC; break; case 'P': dcs = ""; term_state = TSTATE_DCS; break; case 'A': /* CUU */ R--; if (R < 0) R = 0; break; case 'B': /* CUD */ R++; if (R >= rows) R = rows - 1; break; case 'C': C++; if (C >= columns) C = columns - 1; break; case 'I': // RI insertLine(R, 1, SCROLL_DOWN); break; case 'E': /* NEL */ if (R == getBottomMargin() || R == rows - 1) insertLine(R, 1, SCROLL_UP); else R++; C = 0; if (debug > 1) debug("ESC E (at " + R + ")"); break; case 'D': /* IND */ if (R == getBottomMargin() || R == rows - 1) insertLine(R, 1, SCROLL_UP); else R++; if (debug > 1) debug("ESC D (at " + R + " )"); break; case 'J': /* erase to end of screen */ if (R < rows - 1) deleteArea(0, R + 1, columns, rows - R - 1, attributes); if (C < columns - 1) deleteArea(C, R, columns - C, 1, attributes); break; case 'K': if (C < columns - 1) deleteArea(C, R, columns - C, 1, attributes); break; case 'M': // RI debug("ESC M : R is "+R+", tm is "+getTopMargin()+", bm is "+getBottomMargin()); if (R > getTopMargin()) { // just go up 1 line. R--; } else { // scroll down insertLine(R, 1, SCROLL_DOWN); } /* else do nothing ; */ if (debug > 2) debug("ESC M "); break; case 'H': if (debug > 1) debug("ESC H at " + C); /* right border probably ...*/ if (C >= columns) C = columns - 1; Tabs[C] = 1; break; case 'N': // SS2 onegl = 2; break; case 'O': // SS3 onegl = 3; break; case '=': /*application keypad*/ if (debug > 0) debug("ESC ="); keypadmode = true; break; case '<': /* vt52 mode off */ vt52mode = false; break; case '>': /*normal keypad*/ if (debug > 0) debug("ESC >"); keypadmode = false; break; case '7': /* DECSC: save cursor, attributes */ Sc = C; Sr = R; Sgl = gl; Sgr = gr; Sa = attributes; Sgx = new char[4]; for (int i = 0; i < 4; i++) Sgx[i] = gx[i]; if (debug > 1) debug("ESC 7"); break; case '8': /* DECRC: restore cursor, attributes */ C = Sc; R = Sr; gl = Sgl; gr = Sgr; if (Sgx != null) for (int i = 0; i < 4; i++) gx[i] = Sgx[i]; attributes = Sa; if (debug > 1) debug("ESC 8"); break; case '(': /* Designate G0 Character set (ISO 2022) */ term_state = TSTATE_SETG0; usedcharsets = true; break; case ')': /* Designate G1 character set (ISO 2022) */ term_state = TSTATE_SETG1; usedcharsets = true; break; case '*': /* Designate G2 Character set (ISO 2022) */ term_state = TSTATE_SETG2; usedcharsets = true; break; case '+': /* Designate G3 Character set (ISO 2022) */ term_state = TSTATE_SETG3; usedcharsets = true; break; case '~': /* Locking Shift 1, right */ gr = 1; usedcharsets = true; break; case 'n': /* Locking Shift 2 */ gl = 2; usedcharsets = true; break; case '}': /* Locking Shift 2, right */ gr = 2; usedcharsets = true; break; case 'o': /* Locking Shift 3 */ gl = 3; usedcharsets = true; break; case '|': /* Locking Shift 3, right */ gr = 3; usedcharsets = true; break; case 'Y': /* vt52 cursor address mode , next chars are x,y */ term_state = TSTATE_VT52Y; break; case '_': term_state = TSTATE_TITLE; break; case '\\': // TODO save title term_state = TSTATE_DATA; break; default: debug("ESC unknown letter: " + c + " (" + ((int) c) + ")"); break; } break; case TSTATE_VT52X: C = c - 37; if (C < 0) C = 0; else if (C >= width) C = width - 1; term_state = TSTATE_VT52Y; break; case TSTATE_VT52Y: R = c - 37; if (R < 0) R = 0; else if (R >= height) R = height - 1; term_state = TSTATE_DATA; break; case TSTATE_SETG0: if (c != '0' && c != 'A' && c != 'B' && c != '<') debug("ESC ( " + c + ": G0 char set? (" + ((int) c) + ")"); else { if (debug > 2) debug("ESC ( : G0 char set (" + c + " " + ((int) c) + ")"); gx[0] = c; } term_state = TSTATE_DATA; break; case TSTATE_SETG1: if (c != '0' && c != 'A' && c != 'B' && c != '<') { debug("ESC ) " + c + " (" + ((int) c) + ") :G1 char set?"); } else { if (debug > 2) debug("ESC ) :G1 char set (" + c + " " + ((int) c) + ")"); gx[1] = c; } term_state = TSTATE_DATA; break; case TSTATE_SETG2: if (c != '0' && c != 'A' && c != 'B' && c != '<') debug("ESC*:G2 char set? (" + ((int) c) + ")"); else { if (debug > 2) debug("ESC*:G2 char set (" + c + " " + ((int) c) + ")"); gx[2] = c; } term_state = TSTATE_DATA; break; case TSTATE_SETG3: if (c != '0' && c != 'A' && c != 'B' && c != '<') debug("ESC+:G3 char set? (" + ((int) c) + ")"); else { if (debug > 2) debug("ESC+:G3 char set (" + c + " " + ((int) c) + ")"); gx[3] = c; } term_state = TSTATE_DATA; break; case TSTATE_ESCSQUARE: switch (c) { case '8': for (int i = 0; i < columns; i++) for (int j = 0; j < rows; j++) putChar(i, j, 'E', 0); break; default: debug("ESC # " + c + " not supported."); break; } term_state = TSTATE_DATA; break; case TSTATE_DCS: if (c == '\\' && dcs.charAt(dcs.length() - 1) == ESC) { handle_dcs(dcs); term_state = TSTATE_DATA; break; } dcs = dcs + c; break; case TSTATE_DCEQ: term_state = TSTATE_DATA; switch (c) { case '0': case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': DCEvars[DCEvar] = DCEvars[DCEvar] * 10 + (c) - 48; term_state = TSTATE_DCEQ; break; case ';': DCEvar++; DCEvars[DCEvar] = 0; term_state = TSTATE_DCEQ; break; case 's': // XTERM_SAVE missing! if (true || debug > 1) debug("ESC [ ? " + DCEvars[0] + " s unimplemented!"); break; case 'r': // XTERM_RESTORE if (true || debug > 1) debug("ESC [ ? " + DCEvars[0] + " r"); /* DEC Mode reset */ for (int i = 0; i <= DCEvar; i++) { switch (DCEvars[i]) { case 3: /* 80 columns*/ setScreenSize(80, height, true); break; case 4: /* scrolling mode, smooth */ break; case 5: /* light background */ break; case 6: /* DECOM (Origin Mode) move inside margins. */ moveoutsidemargins = true; break; case 7: /* DECAWM: Autowrap Mode */ wraparound = false; break; case 12:/* local echo off */ break; case 9: /* X10 mouse */ case 1000: /* xterm style mouse report on */ case 1001: case 1002: case 1003: mouserpt = DCEvars[i]; break; default: debug("ESC [ ? " + DCEvars[0] + " r, unimplemented!"); } } break; case 'h': // DECSET if (debug > 0) debug("ESC [ ? " + DCEvars[0] + " h"); /* DEC Mode set */ for (int i = 0; i <= DCEvar; i++) { switch (DCEvars[i]) { case 1: /* Application cursor keys */ KeyUp[0] = "\u001bOA"; KeyDown[0] = "\u001bOB"; KeyRight[0] = "\u001bOC"; KeyLeft[0] = "\u001bOD"; break; case 2: /* DECANM */ vt52mode = false; break; case 3: /* 132 columns*/ setScreenSize(132, height, true); break; case 6: /* DECOM: move inside margins. */ moveoutsidemargins = false; break; case 7: /* DECAWM: Autowrap Mode */ wraparound = true; break; case 25: /* turn cursor on */ showCursor(true); break; case 9: /* X10 mouse */ case 1000: /* xterm style mouse report on */ case 1001: case 1002: case 1003: mouserpt = DCEvars[i]; break; /* unimplemented stuff, fall through */ /* 4 - scrolling mode, smooth */ /* 5 - light background */ /* 12 - local echo off */ /* 18 - DECPFF - Printer Form Feed Mode -> On */ /* 19 - DECPEX - Printer Extent Mode -> Screen */ default: debug("ESC [ ? " + DCEvars[0] + " h, unsupported."); break; } } break; case 'i': // DEC Printer Control, autoprint, echo screenchars to printer // This is different to CSI i! // Also: "Autoprint prints a final display line only when the // cursor is moved off the line by an autowrap or LF, FF, or // VT (otherwise do not print the line)." switch (DCEvars[0]) { case 1: if (debug > 1) debug("CSI ? 1 i : Print line containing cursor"); break; case 4: if (debug > 1) debug("CSI ? 4 i : Start passthrough printing"); break; case 5: if (debug > 1) debug("CSI ? 4 i : Stop passthrough printing"); break; } break; case 'l': //DECRST /* DEC Mode reset */ if (debug > 0) debug("ESC [ ? " + DCEvars[0] + " l"); for (int i = 0; i <= DCEvar; i++) { switch (DCEvars[i]) { case 1: /* Application cursor keys */ KeyUp[0] = "\u001b[A"; KeyDown[0] = "\u001b[B"; KeyRight[0] = "\u001b[C"; KeyLeft[0] = "\u001b[D"; break; case 2: /* DECANM */ vt52mode = true; break; case 3: /* 80 columns*/ setScreenSize(80, height, true); break; case 6: /* DECOM: move outside margins. */ moveoutsidemargins = true; break; case 7: /* DECAWM: Autowrap Mode OFF */ wraparound = false; break; case 25: /* turn cursor off */ showCursor(false); break; /* Unimplemented stuff: */ /* 4 - scrolling mode, jump */ /* 5 - dark background */ /* 7 - DECAWM - no wrap around mode */ /* 12 - local echo on */ /* 18 - DECPFF - Printer Form Feed Mode -> Off*/ /* 19 - DECPEX - Printer Extent Mode -> Scrolling Region */ case 9: /* X10 mouse */ case 1000: /* xterm style mouse report OFF */ case 1001: case 1002: case 1003: mouserpt = 0; break; default: debug("ESC [ ? " + DCEvars[0] + " l, unsupported."); break; } } break; case 'n': if (debug > 0) debug("ESC [ ? " + DCEvars[0] + " n"); switch (DCEvars[0]) { case 15: /* printer? no printer. */ write((ESC) + "[?13n", false); debug("ESC[5n"); break; default: debug("ESC [ ? " + DCEvars[0] + " n, unsupported."); break; } break; default: debug("ESC [ ? " + DCEvars[0] + " " + c + ", unsupported."); break; } break; case TSTATE_CSI_EX: term_state = TSTATE_DATA; switch (c) { case ESC: term_state = TSTATE_ESC; break; default: debug("Unknown character ESC[! character is " + (int) c); break; } break; case TSTATE_CSI_TICKS: term_state = TSTATE_DATA; switch (c) { case 'p': debug("Conformance level: " + DCEvars[0] + " (unsupported)," + DCEvars[1]); if (DCEvars[0] == 61) { output8bit = false; break; } if (DCEvars[1] == 1) { output8bit = false; } else { output8bit = true; /* 0 or 2 */ } break; default: debug("Unknown ESC [... \"" + c); break; } break; case TSTATE_CSI_EQUAL: term_state = TSTATE_DATA; switch (c) { case '0': case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': DCEvars[DCEvar] = DCEvars[DCEvar] * 10 + (c) - 48; term_state = TSTATE_CSI_EQUAL; break; case ';': DCEvar++; DCEvars[DCEvar] = 0; term_state = TSTATE_CSI_EQUAL; break; case 'F': /* SCO ANSI foreground */ { int newcolor; debug("ESC [ = "+DCEvars[0]+" F"); attributes &= ~COLOR_FG; newcolor = ((DCEvars[0] & 1) << 2) | (DCEvars[0] & 2) | ((DCEvars[0] & 4) >> 2) ; attributes |= (newcolor+1) << COLOR_FG_SHIFT; break; } case 'G': /* SCO ANSI background */ { int newcolor; debug("ESC [ = "+DCEvars[0]+" G"); attributes &= ~COLOR_BG; newcolor = ((DCEvars[0] & 1) << 2) | (DCEvars[0] & 2) | ((DCEvars[0] & 4) >> 2) ; attributes |= (newcolor+1) << COLOR_BG_SHIFT; break; } default: debugStr.append("Unknown ESC [ = "); for (int i=0;i<=DCEvar;i++) { debugStr.append(DCEvars[i]) .append(','); } debugStr.append(c); debug(debugStr.toString()); debugStr.setLength(0); break; } break; case TSTATE_CSI_DOLLAR: term_state = TSTATE_DATA; switch (c) { case '}': debug("Active Status Display now " + DCEvars[0]); statusmode = DCEvars[0]; break; /* bad documentation? case '-': debug("Set Status Display now "+DCEvars[0]); break; */ case '~': debug("Status Line mode now " + DCEvars[0]); break; default: debug("UNKNOWN Status Display code " + c + ", with Pn=" + DCEvars[0]); break; } break; case TSTATE_CSI: term_state = TSTATE_DATA; switch (c) { case '"': term_state = TSTATE_CSI_TICKS; break; case '$': term_state = TSTATE_CSI_DOLLAR; break; case '=': term_state = TSTATE_CSI_EQUAL; break; case '!': term_state = TSTATE_CSI_EX; break; case '?': DCEvar = 0; DCEvars[0] = 0; term_state = TSTATE_DCEQ; break; case '0': case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': DCEvars[DCEvar] = DCEvars[DCEvar] * 10 + (c) - 48; term_state = TSTATE_CSI; break; case ';': DCEvar++; DCEvars[DCEvar] = 0; term_state = TSTATE_CSI; break; case 'c':/* send primary device attributes */ /* send (ESC[?61c) */ String subcode = ""; if (terminalID.equals("vt320")) subcode = "63;"; if (terminalID.equals("vt220")) subcode = "62;"; if (terminalID.equals("vt100")) subcode = "61;"; write((ESC) + "[?" + subcode + "1;2c", false); if (debug > 1) debug("ESC [ " + DCEvars[0] + " c"); break; case 'q': if (debug > 1) debug("ESC [ " + DCEvars[0] + " q"); break; case 'g': /* used for tabsets */ switch (DCEvars[0]) { case 3:/* clear them */ Tabs = new byte[width]; break; case 0: Tabs[C] = 0; break; } if (debug > 1) debug("ESC [ " + DCEvars[0] + " g"); break; case 'h': switch (DCEvars[0]) { case 4: insertmode = 1; break; case 20: debug("Setting CRLF to TRUE"); sendcrlf = true; break; default: debug("unsupported: ESC [ " + DCEvars[0] + " h"); break; } if (debug > 1) debug("ESC [ " + DCEvars[0] + " h"); break; case 'i': // Printer Controller mode. // "Transparent printing sends all output, except the CSI 4 i // termination string, to the printer and not the screen, // uses an 8-bit channel if no parity so NUL and DEL will be // seen by the printer and by the termination recognizer code, // and all translation and character set selections are // bypassed." switch (DCEvars[0]) { case 0: if (debug > 1) debug("CSI 0 i: Print Screen, not implemented."); break; case 4: if (debug > 1) debug("CSI 4 i: Enable Transparent Printing, not implemented."); break; case 5: if (debug > 1) debug("CSI 4/5 i: Disable Transparent Printing, not implemented."); break; default: debug("ESC [ " + DCEvars[0] + " i, unimplemented!"); } break; case 'l': switch (DCEvars[0]) { case 4: insertmode = 0; break; case 20: debug("Setting CRLF to FALSE"); sendcrlf = false; break; default: debug("ESC [ " + DCEvars[0] + " l, unimplemented!"); break; } break; case 'A': // CUU { int limit; /* FIXME: xterm only cares about 0 and topmargin */ if (R >= getTopMargin()) { limit = getTopMargin(); } else limit = 0; if (DCEvars[0] == 0) R--; else R -= DCEvars[0]; if (R < limit) R = limit; if (debug > 1) debug("ESC [ " + DCEvars[0] + " A"); break; } case 'B': // CUD /* cursor down n (1) times */ { int limit; if (R <= getBottomMargin()) { limit = getBottomMargin(); } else limit = rows - 1; if (DCEvars[0] == 0) R++; else R += DCEvars[0]; if (R > limit) R = limit; else { if (debug > 2) debug("Not limited."); } if (debug > 2) debug("to: " + R); if (debug > 1) debug("ESC [ " + DCEvars[0] + " B (at C=" + C + ")"); break; } case 'C': if (DCEvars[0] == 0) DCEvars[0] = 1; while (DCEvars[0]-- > 0) { C++; } if (C >= columns) C = columns - 1; if (debug > 1) debug("ESC [ " + DCEvars[0] + " C"); break; case 'd': // CVA R = DCEvars[0]; if (R < 0) R = 0; else if (R >= height) R = height - 1; if (debug > 1) debug("ESC [ " + DCEvars[0] + " d"); break; case 'D': if (DCEvars[0] == 0) DCEvars[0] = 1; while (DCEvars[0]-- > 0) { C--; } if (C < 0) C = 0; if (debug > 1) debug("ESC [ " + DCEvars[0] + " D"); break; case 'r': // DECSTBM if (DCEvar > 0) // Ray: Any argument is optional { R = DCEvars[1] - 1; if (R < 0) R = rows - 1; else if (R >= rows) { R = rows - 1; } } else R = rows - 1; int bot = R; if (R >= DCEvars[0]) { R = DCEvars[0] - 1; if (R < 0) R = 0; } setMargins(R, bot); _SetCursor(0, 0); if (debug > 1) debug("ESC [" + DCEvars[0] + " ; " + DCEvars[1] + " r"); break; case 'G': /* CUP / cursor absolute column */ C = DCEvars[0]; if (C < 0) C = 0; else if (C >= width) C = width - 1; if (debug > 1) debug("ESC [ " + DCEvars[0] + " G"); break; case 'H': /* CUP / cursor position */ /* gets 2 arguments */ _SetCursor(DCEvars[0] - 1, DCEvars[1] - 1); if (debug > 2) { debug("ESC [ " + DCEvars[0] + ";" + DCEvars[1] + " H, moveoutsidemargins " + moveoutsidemargins); debug(" -> R now " + R + ", C now " + C); } break; case 'f': /* move cursor 2 */ /* gets 2 arguments */ R = DCEvars[0] - 1; C = DCEvars[1] - 1; if (C < 0) C = 0; else if (C >= width) C = width - 1; if (R < 0) R = 0; else if (R >= height) R = height - 1; if (debug > 2) debug("ESC [ " + DCEvars[0] + ";" + DCEvars[1] + " f"); break; case 'S': /* ind aka 'scroll forward' */ if (DCEvars[0] == 0) insertLine(rows - 1, SCROLL_UP); else insertLine(rows - 1, DCEvars[0], SCROLL_UP); break; case 'L': /* insert n lines */ if (DCEvars[0] == 0) insertLine(R, SCROLL_DOWN); else insertLine(R, DCEvars[0], SCROLL_DOWN); if (debug > 1) debug("ESC [ " + DCEvars[0] + "" + (c) + " (at R " + R + ")"); break; case 'T': /* 'ri' aka scroll backward */ if (DCEvars[0] == 0) insertLine(0, SCROLL_DOWN); else insertLine(0, DCEvars[0], SCROLL_DOWN); break; case 'M': if (debug > 1) debug("ESC [ " + DCEvars[0] + "" + (c) + " at R=" + R); if (DCEvars[0] == 0) deleteLine(R); else for (int i = 0; i < DCEvars[0]; i++) deleteLine(R); break; case 'K': if (debug > 1) debug("ESC [ " + DCEvars[0] + " K"); /* clear in line */ switch (DCEvars[0]) { case 6: /* 97801 uses ESC[6K for delete to end of line */ case 0:/*clear to right*/ if (C < columns - 1) deleteArea(C, R, columns - C, 1, attributes); break; case 1:/*clear to the left, including this */ if (C > 0) deleteArea(0, R, C + 1, 1, attributes); break; case 2:/*clear whole line */ deleteArea(0, R, columns, 1, attributes); break; } break; case 'J': /* clear below current line */ switch (DCEvars[0]) { case 0: if (R < rows - 1) deleteArea(0, R + 1, columns, rows - R - 1, attributes); if (C < columns - 1) deleteArea(C, R, columns - C, 1, attributes); break; case 1: if (R > 0) deleteArea(0, 0, columns, R, attributes); if (C > 0) deleteArea(0, R, C + 1, 1, attributes);// include up to and including current break; case 2: deleteArea(0, 0, columns, rows, attributes); break; } if (debug > 1) debug("ESC [ " + DCEvars[0] + " J"); break; case '@': if (debug > 1) debug("ESC [ " + DCEvars[0] + " @"); for (int i = 0; i < DCEvars[0]; i++) insertChar(C, R, ' ', attributes); break; case 'X': { int toerase = DCEvars[0]; if (debug > 1) debug("ESC [ " + DCEvars[0] + " X, C=" + C + ",R=" + R); if (toerase == 0) toerase = 1; if (toerase + C > columns) toerase = columns - C; deleteArea(C, R, toerase, 1, attributes); // does not change cursor position break; } case 'P': if (debug > 1) debug("ESC [ " + DCEvars[0] + " P, C=" + C + ",R=" + R); if (DCEvars[0] == 0) DCEvars[0] = 1; for (int i = 0; i < DCEvars[0]; i++) deleteChar(C, R); break; case 'n': switch (DCEvars[0]) { case 5: /* malfunction? No malfunction. */ writeSpecial((ESC) + "[0n"); if (debug > 1) debug("ESC[5n"); break; case 6: // DO NOT offset R and C by 1! (checked against /usr/X11R6/bin/resize // FIXME check again. // FIXME: but vttest thinks different??? writeSpecial((ESC) + "[" + R + ";" + C + "R"); if (debug > 1) debug("ESC[6n"); break; default: if (debug > 0) debug("ESC [ " + DCEvars[0] + " n??"); break; } break; case 's': /* DECSC - save cursor */ Sc = C; Sr = R; Sa = attributes; if (debug > 3) debug("ESC[s"); break; case 'u': /* DECRC - restore cursor */ C = Sc; R = Sr; attributes = Sa; if (debug > 3) debug("ESC[u"); break; case 'm': /* attributes as color, bold , blink,*/ if (debug > 3) debug("ESC [ "); if (DCEvar == 0 && DCEvars[0] == 0) attributes = 0; for (int i = 0; i <= DCEvar; i++) { switch (DCEvars[i]) { case 0: if (DCEvar > 0) { if (terminalID.equals("scoansi")) { attributes &= COLOR; /* Keeps color. Strange but true. */ } else { attributes = 0; } } break; case 1: attributes |= BOLD; attributes &= ~LOW; break; case 2: /* SCO color hack mode */ if (terminalID.equals("scoansi") && ((DCEvar - i) >= 2)) { int ncolor; attributes &= ~(COLOR | BOLD); ncolor = DCEvars[i + 1]; if ((ncolor & 8) == 8) attributes |= BOLD; ncolor = ((ncolor & 1) << 2) | (ncolor & 2) | ((ncolor & 4) >> 2); attributes |= ((ncolor) + 1) << COLOR_FG_SHIFT; ncolor = DCEvars[i + 2]; ncolor = ((ncolor & 1) << 2) | (ncolor & 2) | ((ncolor & 4) >> 2); attributes |= ((ncolor) + 1) << COLOR_BG_SHIFT; i += 2; } else { attributes |= LOW; } break; case 3: /* italics */ attributes |= INVERT; break; case 4: attributes |= UNDERLINE; break; case 7: attributes |= INVERT; break; case 8: attributes |= INVISIBLE; break; case 5: /* blink on */ break; /* 10 - ANSI X3.64-1979, select primary font, don't display control * chars, don't set bit 8 on output */ case 10: gl = 0; usedcharsets = true; break; /* 11 - ANSI X3.64-1979, select second alt. font, display control * chars, set bit 8 on output */ case 11: /* SMACS , as */ case 12: gl = 1; usedcharsets = true; break; case 21: /* normal intensity */ attributes &= ~(LOW | BOLD); break; case 23: /* italics off */ attributes &= ~INVERT; break; case 25: /* blinking off */ break; case 27: attributes &= ~INVERT; break; case 28: attributes &= ~INVISIBLE; break; case 24: attributes &= ~UNDERLINE; break; case 22: attributes &= ~BOLD; break; case 30: case 31: case 32: case 33: case 34: case 35: case 36: case 37: attributes &= ~COLOR_FG; attributes |= ((DCEvars[i] - 30) + 1)<< COLOR_FG_SHIFT; break; case 38: if (DCEvars[i+1] == 5) { attributes &= ~COLOR_FG; attributes |= ((DCEvars[i + 2]) + 1) << COLOR_FG_SHIFT; i += 2; } break; case 39: attributes &= ~COLOR_FG; break; case 40: case 41: case 42: case 43: case 44: case 45: case 46: case 47: attributes &= ~COLOR_BG; attributes |= ((DCEvars[i] - 40) + 1) << COLOR_BG_SHIFT; break; case 48: if (DCEvars[i+1] == 5) { attributes &= ~COLOR_BG; attributes |= (DCEvars[i + 2] + 1) << COLOR_BG_SHIFT; i += 2; } break; case 49: attributes &= ~COLOR_BG; break; case 90: case 91: case 92: case 93: case 94: case 95: case 96: case 97: attributes &= ~COLOR_FG; attributes |= ((DCEvars[i] - 82) + 1) << COLOR_FG_SHIFT; break; case 100: case 101: case 102: case 103: case 104: case 105: case 106: case 107: attributes &= ~COLOR_BG; attributes |= ((DCEvars[i] - 92) + 1) << COLOR_BG_SHIFT; break; default: debugStr.append("ESC [ ") .append(DCEvars[i]) .append(" m unknown..."); debug(debugStr.toString()); debugStr.setLength(0); break; } if (debug > 3) { debugStr.append(DCEvars[i]) .append(';'); debug(debugStr.toString()); debugStr.setLength(0); } } if (debug > 3) { debugStr.append(" (attributes = ") .append(attributes) .append(")m"); debug(debugStr.toString()); debugStr.setLength(0); } break; default: debugStr.append("ESC [ unknown letter: ") .append(c) .append(" (") .append((int)c) .append(')'); debug(debugStr.toString()); debugStr.setLength(0); break; } break; case TSTATE_TITLE: switch (c) { case ESC: term_state = TSTATE_ESC; break; default: // TODO save title break; } break; default: term_state = TSTATE_DATA; break; } setCursorPosition(C, R); } /* hard reset the terminal */ public void reset() { gx[0] = 'B'; gx[1] = 'B'; gx[2] = 'B'; gx[3] = 'B'; gl = 0; // default GL to G0 gr = 2; // default GR to G2 onegl = -1; // Single shift override /* reset tabs */ int nw = width; if (nw < 132) nw = 132; Tabs = new byte[nw]; for (int i = 0; i < nw; i += 8) { Tabs[i] = 1; } deleteArea(0, 0, width, height, attributes); setMargins(0, height); C = R = 0; _SetCursor(0, 0); if (display != null) display.resetColors(); showCursor(true); /*FIXME:*/ term_state = TSTATE_DATA; } }
1031868817-aaaa
src/de/mud/terminal/vt320.java
Java
asf20
95,581
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package de.mud.terminal; /** * @author Kenny Root * This data was taken from xterm's precompose.c */ public class Precomposer { public final static char precompositions[][] = { { 0x226E, 0x003C, 0x0338}, { 0x2260, 0x003D, 0x0338}, { 0x226F, 0x003E, 0x0338}, { 0x00C0, 0x0041, 0x0300}, { 0x00C1, 0x0041, 0x0301}, { 0x00C2, 0x0041, 0x0302}, { 0x00C3, 0x0041, 0x0303}, { 0x0100, 0x0041, 0x0304}, { 0x0102, 0x0041, 0x0306}, { 0x0226, 0x0041, 0x0307}, { 0x00C4, 0x0041, 0x0308}, { 0x1EA2, 0x0041, 0x0309}, { 0x00C5, 0x0041, 0x030A}, { 0x01CD, 0x0041, 0x030C}, { 0x0200, 0x0041, 0x030F}, { 0x0202, 0x0041, 0x0311}, { 0x1EA0, 0x0041, 0x0323}, { 0x1E00, 0x0041, 0x0325}, { 0x0104, 0x0041, 0x0328}, { 0x1E02, 0x0042, 0x0307}, { 0x1E04, 0x0042, 0x0323}, { 0x1E06, 0x0042, 0x0331}, { 0x0106, 0x0043, 0x0301}, { 0x0108, 0x0043, 0x0302}, { 0x010A, 0x0043, 0x0307}, { 0x010C, 0x0043, 0x030C}, { 0x00C7, 0x0043, 0x0327}, { 0x1E0A, 0x0044, 0x0307}, { 0x010E, 0x0044, 0x030C}, { 0x1E0C, 0x0044, 0x0323}, { 0x1E10, 0x0044, 0x0327}, { 0x1E12, 0x0044, 0x032D}, { 0x1E0E, 0x0044, 0x0331}, { 0x00C8, 0x0045, 0x0300}, { 0x00C9, 0x0045, 0x0301}, { 0x00CA, 0x0045, 0x0302}, { 0x1EBC, 0x0045, 0x0303}, { 0x0112, 0x0045, 0x0304}, { 0x0114, 0x0045, 0x0306}, { 0x0116, 0x0045, 0x0307}, { 0x00CB, 0x0045, 0x0308}, { 0x1EBA, 0x0045, 0x0309}, { 0x011A, 0x0045, 0x030C}, { 0x0204, 0x0045, 0x030F}, { 0x0206, 0x0045, 0x0311}, { 0x1EB8, 0x0045, 0x0323}, { 0x0228, 0x0045, 0x0327}, { 0x0118, 0x0045, 0x0328}, { 0x1E18, 0x0045, 0x032D}, { 0x1E1A, 0x0045, 0x0330}, { 0x1E1E, 0x0046, 0x0307}, { 0x01F4, 0x0047, 0x0301}, { 0x011C, 0x0047, 0x0302}, { 0x1E20, 0x0047, 0x0304}, { 0x011E, 0x0047, 0x0306}, { 0x0120, 0x0047, 0x0307}, { 0x01E6, 0x0047, 0x030C}, { 0x0122, 0x0047, 0x0327}, { 0x0124, 0x0048, 0x0302}, { 0x1E22, 0x0048, 0x0307}, { 0x1E26, 0x0048, 0x0308}, { 0x021E, 0x0048, 0x030C}, { 0x1E24, 0x0048, 0x0323}, { 0x1E28, 0x0048, 0x0327}, { 0x1E2A, 0x0048, 0x032E}, { 0x00CC, 0x0049, 0x0300}, { 0x00CD, 0x0049, 0x0301}, { 0x00CE, 0x0049, 0x0302}, { 0x0128, 0x0049, 0x0303}, { 0x012A, 0x0049, 0x0304}, { 0x012C, 0x0049, 0x0306}, { 0x0130, 0x0049, 0x0307}, { 0x00CF, 0x0049, 0x0308}, { 0x1EC8, 0x0049, 0x0309}, { 0x01CF, 0x0049, 0x030C}, { 0x0208, 0x0049, 0x030F}, { 0x020A, 0x0049, 0x0311}, { 0x1ECA, 0x0049, 0x0323}, { 0x012E, 0x0049, 0x0328}, { 0x1E2C, 0x0049, 0x0330}, { 0x0134, 0x004A, 0x0302}, { 0x1E30, 0x004B, 0x0301}, { 0x01E8, 0x004B, 0x030C}, { 0x1E32, 0x004B, 0x0323}, { 0x0136, 0x004B, 0x0327}, { 0x1E34, 0x004B, 0x0331}, { 0x0139, 0x004C, 0x0301}, { 0x013D, 0x004C, 0x030C}, { 0x1E36, 0x004C, 0x0323}, { 0x013B, 0x004C, 0x0327}, { 0x1E3C, 0x004C, 0x032D}, { 0x1E3A, 0x004C, 0x0331}, { 0x1E3E, 0x004D, 0x0301}, { 0x1E40, 0x004D, 0x0307}, { 0x1E42, 0x004D, 0x0323}, { 0x01F8, 0x004E, 0x0300}, { 0x0143, 0x004E, 0x0301}, { 0x00D1, 0x004E, 0x0303}, { 0x1E44, 0x004E, 0x0307}, { 0x0147, 0x004E, 0x030C}, { 0x1E46, 0x004E, 0x0323}, { 0x0145, 0x004E, 0x0327}, { 0x1E4A, 0x004E, 0x032D}, { 0x1E48, 0x004E, 0x0331}, { 0x00D2, 0x004F, 0x0300}, { 0x00D3, 0x004F, 0x0301}, { 0x00D4, 0x004F, 0x0302}, { 0x00D5, 0x004F, 0x0303}, { 0x014C, 0x004F, 0x0304}, { 0x014E, 0x004F, 0x0306}, { 0x022E, 0x004F, 0x0307}, { 0x00D6, 0x004F, 0x0308}, { 0x1ECE, 0x004F, 0x0309}, { 0x0150, 0x004F, 0x030B}, { 0x01D1, 0x004F, 0x030C}, { 0x020C, 0x004F, 0x030F}, { 0x020E, 0x004F, 0x0311}, { 0x01A0, 0x004F, 0x031B}, { 0x1ECC, 0x004F, 0x0323}, { 0x01EA, 0x004F, 0x0328}, { 0x1E54, 0x0050, 0x0301}, { 0x1E56, 0x0050, 0x0307}, { 0x0154, 0x0052, 0x0301}, { 0x1E58, 0x0052, 0x0307}, { 0x0158, 0x0052, 0x030C}, { 0x0210, 0x0052, 0x030F}, { 0x0212, 0x0052, 0x0311}, { 0x1E5A, 0x0052, 0x0323}, { 0x0156, 0x0052, 0x0327}, { 0x1E5E, 0x0052, 0x0331}, { 0x015A, 0x0053, 0x0301}, { 0x015C, 0x0053, 0x0302}, { 0x1E60, 0x0053, 0x0307}, { 0x0160, 0x0053, 0x030C}, { 0x1E62, 0x0053, 0x0323}, { 0x0218, 0x0053, 0x0326}, { 0x015E, 0x0053, 0x0327}, { 0x1E6A, 0x0054, 0x0307}, { 0x0164, 0x0054, 0x030C}, { 0x1E6C, 0x0054, 0x0323}, { 0x021A, 0x0054, 0x0326}, { 0x0162, 0x0054, 0x0327}, { 0x1E70, 0x0054, 0x032D}, { 0x1E6E, 0x0054, 0x0331}, { 0x00D9, 0x0055, 0x0300}, { 0x00DA, 0x0055, 0x0301}, { 0x00DB, 0x0055, 0x0302}, { 0x0168, 0x0055, 0x0303}, { 0x016A, 0x0055, 0x0304}, { 0x016C, 0x0055, 0x0306}, { 0x00DC, 0x0055, 0x0308}, { 0x1EE6, 0x0055, 0x0309}, { 0x016E, 0x0055, 0x030A}, { 0x0170, 0x0055, 0x030B}, { 0x01D3, 0x0055, 0x030C}, { 0x0214, 0x0055, 0x030F}, { 0x0216, 0x0055, 0x0311}, { 0x01AF, 0x0055, 0x031B}, { 0x1EE4, 0x0055, 0x0323}, { 0x1E72, 0x0055, 0x0324}, { 0x0172, 0x0055, 0x0328}, { 0x1E76, 0x0055, 0x032D}, { 0x1E74, 0x0055, 0x0330}, { 0x1E7C, 0x0056, 0x0303}, { 0x1E7E, 0x0056, 0x0323}, { 0x1E80, 0x0057, 0x0300}, { 0x1E82, 0x0057, 0x0301}, { 0x0174, 0x0057, 0x0302}, { 0x1E86, 0x0057, 0x0307}, { 0x1E84, 0x0057, 0x0308}, { 0x1E88, 0x0057, 0x0323}, { 0x1E8A, 0x0058, 0x0307}, { 0x1E8C, 0x0058, 0x0308}, { 0x1EF2, 0x0059, 0x0300}, { 0x00DD, 0x0059, 0x0301}, { 0x0176, 0x0059, 0x0302}, { 0x1EF8, 0x0059, 0x0303}, { 0x0232, 0x0059, 0x0304}, { 0x1E8E, 0x0059, 0x0307}, { 0x0178, 0x0059, 0x0308}, { 0x1EF6, 0x0059, 0x0309}, { 0x1EF4, 0x0059, 0x0323}, { 0x0179, 0x005A, 0x0301}, { 0x1E90, 0x005A, 0x0302}, { 0x017B, 0x005A, 0x0307}, { 0x017D, 0x005A, 0x030C}, { 0x1E92, 0x005A, 0x0323}, { 0x1E94, 0x005A, 0x0331}, { 0x00E0, 0x0061, 0x0300}, { 0x00E1, 0x0061, 0x0301}, { 0x00E2, 0x0061, 0x0302}, { 0x00E3, 0x0061, 0x0303}, { 0x0101, 0x0061, 0x0304}, { 0x0103, 0x0061, 0x0306}, { 0x0227, 0x0061, 0x0307}, { 0x00E4, 0x0061, 0x0308}, { 0x1EA3, 0x0061, 0x0309}, { 0x00E5, 0x0061, 0x030A}, { 0x01CE, 0x0061, 0x030C}, { 0x0201, 0x0061, 0x030F}, { 0x0203, 0x0061, 0x0311}, { 0x1EA1, 0x0061, 0x0323}, { 0x1E01, 0x0061, 0x0325}, { 0x0105, 0x0061, 0x0328}, { 0x1E03, 0x0062, 0x0307}, { 0x1E05, 0x0062, 0x0323}, { 0x1E07, 0x0062, 0x0331}, { 0x0107, 0x0063, 0x0301}, { 0x0109, 0x0063, 0x0302}, { 0x010B, 0x0063, 0x0307}, { 0x010D, 0x0063, 0x030C}, { 0x00E7, 0x0063, 0x0327}, { 0x1E0B, 0x0064, 0x0307}, { 0x010F, 0x0064, 0x030C}, { 0x1E0D, 0x0064, 0x0323}, { 0x1E11, 0x0064, 0x0327}, { 0x1E13, 0x0064, 0x032D}, { 0x1E0F, 0x0064, 0x0331}, { 0x00E8, 0x0065, 0x0300}, { 0x00E9, 0x0065, 0x0301}, { 0x00EA, 0x0065, 0x0302}, { 0x1EBD, 0x0065, 0x0303}, { 0x0113, 0x0065, 0x0304}, { 0x0115, 0x0065, 0x0306}, { 0x0117, 0x0065, 0x0307}, { 0x00EB, 0x0065, 0x0308}, { 0x1EBB, 0x0065, 0x0309}, { 0x011B, 0x0065, 0x030C}, { 0x0205, 0x0065, 0x030F}, { 0x0207, 0x0065, 0x0311}, { 0x1EB9, 0x0065, 0x0323}, { 0x0229, 0x0065, 0x0327}, { 0x0119, 0x0065, 0x0328}, { 0x1E19, 0x0065, 0x032D}, { 0x1E1B, 0x0065, 0x0330}, { 0x1E1F, 0x0066, 0x0307}, { 0x01F5, 0x0067, 0x0301}, { 0x011D, 0x0067, 0x0302}, { 0x1E21, 0x0067, 0x0304}, { 0x011F, 0x0067, 0x0306}, { 0x0121, 0x0067, 0x0307}, { 0x01E7, 0x0067, 0x030C}, { 0x0123, 0x0067, 0x0327}, { 0x0125, 0x0068, 0x0302}, { 0x1E23, 0x0068, 0x0307}, { 0x1E27, 0x0068, 0x0308}, { 0x021F, 0x0068, 0x030C}, { 0x1E25, 0x0068, 0x0323}, { 0x1E29, 0x0068, 0x0327}, { 0x1E2B, 0x0068, 0x032E}, { 0x1E96, 0x0068, 0x0331}, { 0x00EC, 0x0069, 0x0300}, { 0x00ED, 0x0069, 0x0301}, { 0x00EE, 0x0069, 0x0302}, { 0x0129, 0x0069, 0x0303}, { 0x012B, 0x0069, 0x0304}, { 0x012D, 0x0069, 0x0306}, { 0x00EF, 0x0069, 0x0308}, { 0x1EC9, 0x0069, 0x0309}, { 0x01D0, 0x0069, 0x030C}, { 0x0209, 0x0069, 0x030F}, { 0x020B, 0x0069, 0x0311}, { 0x1ECB, 0x0069, 0x0323}, { 0x012F, 0x0069, 0x0328}, { 0x1E2D, 0x0069, 0x0330}, { 0x0135, 0x006A, 0x0302}, { 0x01F0, 0x006A, 0x030C}, { 0x1E31, 0x006B, 0x0301}, { 0x01E9, 0x006B, 0x030C}, { 0x1E33, 0x006B, 0x0323}, { 0x0137, 0x006B, 0x0327}, { 0x1E35, 0x006B, 0x0331}, { 0x013A, 0x006C, 0x0301}, { 0x013E, 0x006C, 0x030C}, { 0x1E37, 0x006C, 0x0323}, { 0x013C, 0x006C, 0x0327}, { 0x1E3D, 0x006C, 0x032D}, { 0x1E3B, 0x006C, 0x0331}, { 0x1E3F, 0x006D, 0x0301}, { 0x1E41, 0x006D, 0x0307}, { 0x1E43, 0x006D, 0x0323}, { 0x01F9, 0x006E, 0x0300}, { 0x0144, 0x006E, 0x0301}, { 0x00F1, 0x006E, 0x0303}, { 0x1E45, 0x006E, 0x0307}, { 0x0148, 0x006E, 0x030C}, { 0x1E47, 0x006E, 0x0323}, { 0x0146, 0x006E, 0x0327}, { 0x1E4B, 0x006E, 0x032D}, { 0x1E49, 0x006E, 0x0331}, { 0x00F2, 0x006F, 0x0300}, { 0x00F3, 0x006F, 0x0301}, { 0x00F4, 0x006F, 0x0302}, { 0x00F5, 0x006F, 0x0303}, { 0x014D, 0x006F, 0x0304}, { 0x014F, 0x006F, 0x0306}, { 0x022F, 0x006F, 0x0307}, { 0x00F6, 0x006F, 0x0308}, { 0x1ECF, 0x006F, 0x0309}, { 0x0151, 0x006F, 0x030B}, { 0x01D2, 0x006F, 0x030C}, { 0x020D, 0x006F, 0x030F}, { 0x020F, 0x006F, 0x0311}, { 0x01A1, 0x006F, 0x031B}, { 0x1ECD, 0x006F, 0x0323}, { 0x01EB, 0x006F, 0x0328}, { 0x1E55, 0x0070, 0x0301}, { 0x1E57, 0x0070, 0x0307}, { 0x0155, 0x0072, 0x0301}, { 0x1E59, 0x0072, 0x0307}, { 0x0159, 0x0072, 0x030C}, { 0x0211, 0x0072, 0x030F}, { 0x0213, 0x0072, 0x0311}, { 0x1E5B, 0x0072, 0x0323}, { 0x0157, 0x0072, 0x0327}, { 0x1E5F, 0x0072, 0x0331}, { 0x015B, 0x0073, 0x0301}, { 0x015D, 0x0073, 0x0302}, { 0x1E61, 0x0073, 0x0307}, { 0x0161, 0x0073, 0x030C}, { 0x1E63, 0x0073, 0x0323}, { 0x0219, 0x0073, 0x0326}, { 0x015F, 0x0073, 0x0327}, { 0x1E6B, 0x0074, 0x0307}, { 0x1E97, 0x0074, 0x0308}, { 0x0165, 0x0074, 0x030C}, { 0x1E6D, 0x0074, 0x0323}, { 0x021B, 0x0074, 0x0326}, { 0x0163, 0x0074, 0x0327}, { 0x1E71, 0x0074, 0x032D}, { 0x1E6F, 0x0074, 0x0331}, { 0x00F9, 0x0075, 0x0300}, { 0x00FA, 0x0075, 0x0301}, { 0x00FB, 0x0075, 0x0302}, { 0x0169, 0x0075, 0x0303}, { 0x016B, 0x0075, 0x0304}, { 0x016D, 0x0075, 0x0306}, { 0x00FC, 0x0075, 0x0308}, { 0x1EE7, 0x0075, 0x0309}, { 0x016F, 0x0075, 0x030A}, { 0x0171, 0x0075, 0x030B}, { 0x01D4, 0x0075, 0x030C}, { 0x0215, 0x0075, 0x030F}, { 0x0217, 0x0075, 0x0311}, { 0x01B0, 0x0075, 0x031B}, { 0x1EE5, 0x0075, 0x0323}, { 0x1E73, 0x0075, 0x0324}, { 0x0173, 0x0075, 0x0328}, { 0x1E77, 0x0075, 0x032D}, { 0x1E75, 0x0075, 0x0330}, { 0x1E7D, 0x0076, 0x0303}, { 0x1E7F, 0x0076, 0x0323}, { 0x1E81, 0x0077, 0x0300}, { 0x1E83, 0x0077, 0x0301}, { 0x0175, 0x0077, 0x0302}, { 0x1E87, 0x0077, 0x0307}, { 0x1E85, 0x0077, 0x0308}, { 0x1E98, 0x0077, 0x030A}, { 0x1E89, 0x0077, 0x0323}, { 0x1E8B, 0x0078, 0x0307}, { 0x1E8D, 0x0078, 0x0308}, { 0x1EF3, 0x0079, 0x0300}, { 0x00FD, 0x0079, 0x0301}, { 0x0177, 0x0079, 0x0302}, { 0x1EF9, 0x0079, 0x0303}, { 0x0233, 0x0079, 0x0304}, { 0x1E8F, 0x0079, 0x0307}, { 0x00FF, 0x0079, 0x0308}, { 0x1EF7, 0x0079, 0x0309}, { 0x1E99, 0x0079, 0x030A}, { 0x1EF5, 0x0079, 0x0323}, { 0x017A, 0x007A, 0x0301}, { 0x1E91, 0x007A, 0x0302}, { 0x017C, 0x007A, 0x0307}, { 0x017E, 0x007A, 0x030C}, { 0x1E93, 0x007A, 0x0323}, { 0x1E95, 0x007A, 0x0331}, { 0x1FED, 0x00A8, 0x0300}, { 0x0385, 0x00A8, 0x0301}, { 0x1FC1, 0x00A8, 0x0342}, { 0x1EA6, 0x00C2, 0x0300}, { 0x1EA4, 0x00C2, 0x0301}, { 0x1EAA, 0x00C2, 0x0303}, { 0x1EA8, 0x00C2, 0x0309}, { 0x01DE, 0x00C4, 0x0304}, { 0x01FA, 0x00C5, 0x0301}, { 0x01FC, 0x00C6, 0x0301}, { 0x01E2, 0x00C6, 0x0304}, { 0x1E08, 0x00C7, 0x0301}, { 0x1EC0, 0x00CA, 0x0300}, { 0x1EBE, 0x00CA, 0x0301}, { 0x1EC4, 0x00CA, 0x0303}, { 0x1EC2, 0x00CA, 0x0309}, { 0x1E2E, 0x00CF, 0x0301}, { 0x1ED2, 0x00D4, 0x0300}, { 0x1ED0, 0x00D4, 0x0301}, { 0x1ED6, 0x00D4, 0x0303}, { 0x1ED4, 0x00D4, 0x0309}, { 0x1E4C, 0x00D5, 0x0301}, { 0x022C, 0x00D5, 0x0304}, { 0x1E4E, 0x00D5, 0x0308}, { 0x022A, 0x00D6, 0x0304}, { 0x01FE, 0x00D8, 0x0301}, { 0x01DB, 0x00DC, 0x0300}, { 0x01D7, 0x00DC, 0x0301}, { 0x01D5, 0x00DC, 0x0304}, { 0x01D9, 0x00DC, 0x030C}, { 0x1EA7, 0x00E2, 0x0300}, { 0x1EA5, 0x00E2, 0x0301}, { 0x1EAB, 0x00E2, 0x0303}, { 0x1EA9, 0x00E2, 0x0309}, { 0x01DF, 0x00E4, 0x0304}, { 0x01FB, 0x00E5, 0x0301}, { 0x01FD, 0x00E6, 0x0301}, { 0x01E3, 0x00E6, 0x0304}, { 0x1E09, 0x00E7, 0x0301}, { 0x1EC1, 0x00EA, 0x0300}, { 0x1EBF, 0x00EA, 0x0301}, { 0x1EC5, 0x00EA, 0x0303}, { 0x1EC3, 0x00EA, 0x0309}, { 0x1E2F, 0x00EF, 0x0301}, { 0x1ED3, 0x00F4, 0x0300}, { 0x1ED1, 0x00F4, 0x0301}, { 0x1ED7, 0x00F4, 0x0303}, { 0x1ED5, 0x00F4, 0x0309}, { 0x1E4D, 0x00F5, 0x0301}, { 0x022D, 0x00F5, 0x0304}, { 0x1E4F, 0x00F5, 0x0308}, { 0x022B, 0x00F6, 0x0304}, { 0x01FF, 0x00F8, 0x0301}, { 0x01DC, 0x00FC, 0x0300}, { 0x01D8, 0x00FC, 0x0301}, { 0x01D6, 0x00FC, 0x0304}, { 0x01DA, 0x00FC, 0x030C}, { 0x1EB0, 0x0102, 0x0300}, { 0x1EAE, 0x0102, 0x0301}, { 0x1EB4, 0x0102, 0x0303}, { 0x1EB2, 0x0102, 0x0309}, { 0x1EB1, 0x0103, 0x0300}, { 0x1EAF, 0x0103, 0x0301}, { 0x1EB5, 0x0103, 0x0303}, { 0x1EB3, 0x0103, 0x0309}, { 0x1E14, 0x0112, 0x0300}, { 0x1E16, 0x0112, 0x0301}, { 0x1E15, 0x0113, 0x0300}, { 0x1E17, 0x0113, 0x0301}, { 0x1E50, 0x014C, 0x0300}, { 0x1E52, 0x014C, 0x0301}, { 0x1E51, 0x014D, 0x0300}, { 0x1E53, 0x014D, 0x0301}, { 0x1E64, 0x015A, 0x0307}, { 0x1E65, 0x015B, 0x0307}, { 0x1E66, 0x0160, 0x0307}, { 0x1E67, 0x0161, 0x0307}, { 0x1E78, 0x0168, 0x0301}, { 0x1E79, 0x0169, 0x0301}, { 0x1E7A, 0x016A, 0x0308}, { 0x1E7B, 0x016B, 0x0308}, { 0x1E9B, 0x017F, 0x0307}, { 0x1EDC, 0x01A0, 0x0300}, { 0x1EDA, 0x01A0, 0x0301}, { 0x1EE0, 0x01A0, 0x0303}, { 0x1EDE, 0x01A0, 0x0309}, { 0x1EE2, 0x01A0, 0x0323}, { 0x1EDD, 0x01A1, 0x0300}, { 0x1EDB, 0x01A1, 0x0301}, { 0x1EE1, 0x01A1, 0x0303}, { 0x1EDF, 0x01A1, 0x0309}, { 0x1EE3, 0x01A1, 0x0323}, { 0x1EEA, 0x01AF, 0x0300}, { 0x1EE8, 0x01AF, 0x0301}, { 0x1EEE, 0x01AF, 0x0303}, { 0x1EEC, 0x01AF, 0x0309}, { 0x1EF0, 0x01AF, 0x0323}, { 0x1EEB, 0x01B0, 0x0300}, { 0x1EE9, 0x01B0, 0x0301}, { 0x1EEF, 0x01B0, 0x0303}, { 0x1EED, 0x01B0, 0x0309}, { 0x1EF1, 0x01B0, 0x0323}, { 0x01EE, 0x01B7, 0x030C}, { 0x01EC, 0x01EA, 0x0304}, { 0x01ED, 0x01EB, 0x0304}, { 0x01E0, 0x0226, 0x0304}, { 0x01E1, 0x0227, 0x0304}, { 0x1E1C, 0x0228, 0x0306}, { 0x1E1D, 0x0229, 0x0306}, { 0x0230, 0x022E, 0x0304}, { 0x0231, 0x022F, 0x0304}, { 0x01EF, 0x0292, 0x030C}, { 0x0344, 0x0308, 0x0301}, { 0x1FBA, 0x0391, 0x0300}, { 0x0386, 0x0391, 0x0301}, { 0x1FB9, 0x0391, 0x0304}, { 0x1FB8, 0x0391, 0x0306}, { 0x1F08, 0x0391, 0x0313}, { 0x1F09, 0x0391, 0x0314}, { 0x1FBC, 0x0391, 0x0345}, { 0x1FC8, 0x0395, 0x0300}, { 0x0388, 0x0395, 0x0301}, { 0x1F18, 0x0395, 0x0313}, { 0x1F19, 0x0395, 0x0314}, { 0x1FCA, 0x0397, 0x0300}, { 0x0389, 0x0397, 0x0301}, { 0x1F28, 0x0397, 0x0313}, { 0x1F29, 0x0397, 0x0314}, { 0x1FCC, 0x0397, 0x0345}, { 0x1FDA, 0x0399, 0x0300}, { 0x038A, 0x0399, 0x0301}, { 0x1FD9, 0x0399, 0x0304}, { 0x1FD8, 0x0399, 0x0306}, { 0x03AA, 0x0399, 0x0308}, { 0x1F38, 0x0399, 0x0313}, { 0x1F39, 0x0399, 0x0314}, { 0x1FF8, 0x039F, 0x0300}, { 0x038C, 0x039F, 0x0301}, { 0x1F48, 0x039F, 0x0313}, { 0x1F49, 0x039F, 0x0314}, { 0x1FEC, 0x03A1, 0x0314}, { 0x1FEA, 0x03A5, 0x0300}, { 0x038E, 0x03A5, 0x0301}, { 0x1FE9, 0x03A5, 0x0304}, { 0x1FE8, 0x03A5, 0x0306}, { 0x03AB, 0x03A5, 0x0308}, { 0x1F59, 0x03A5, 0x0314}, { 0x1FFA, 0x03A9, 0x0300}, { 0x038F, 0x03A9, 0x0301}, { 0x1F68, 0x03A9, 0x0313}, { 0x1F69, 0x03A9, 0x0314}, { 0x1FFC, 0x03A9, 0x0345}, { 0x1FB4, 0x03AC, 0x0345}, { 0x1FC4, 0x03AE, 0x0345}, { 0x1F70, 0x03B1, 0x0300}, { 0x03AC, 0x03B1, 0x0301}, { 0x1FB1, 0x03B1, 0x0304}, { 0x1FB0, 0x03B1, 0x0306}, { 0x1F00, 0x03B1, 0x0313}, { 0x1F01, 0x03B1, 0x0314}, { 0x1FB6, 0x03B1, 0x0342}, { 0x1FB3, 0x03B1, 0x0345}, { 0x1F72, 0x03B5, 0x0300}, { 0x03AD, 0x03B5, 0x0301}, { 0x1F10, 0x03B5, 0x0313}, { 0x1F11, 0x03B5, 0x0314}, { 0x1F74, 0x03B7, 0x0300}, { 0x03AE, 0x03B7, 0x0301}, { 0x1F20, 0x03B7, 0x0313}, { 0x1F21, 0x03B7, 0x0314}, { 0x1FC6, 0x03B7, 0x0342}, { 0x1FC3, 0x03B7, 0x0345}, { 0x1F76, 0x03B9, 0x0300}, { 0x03AF, 0x03B9, 0x0301}, { 0x1FD1, 0x03B9, 0x0304}, { 0x1FD0, 0x03B9, 0x0306}, { 0x03CA, 0x03B9, 0x0308}, { 0x1F30, 0x03B9, 0x0313}, { 0x1F31, 0x03B9, 0x0314}, { 0x1FD6, 0x03B9, 0x0342}, { 0x1F78, 0x03BF, 0x0300}, { 0x03CC, 0x03BF, 0x0301}, { 0x1F40, 0x03BF, 0x0313}, { 0x1F41, 0x03BF, 0x0314}, { 0x1FE4, 0x03C1, 0x0313}, { 0x1FE5, 0x03C1, 0x0314}, { 0x1F7A, 0x03C5, 0x0300}, { 0x03CD, 0x03C5, 0x0301}, { 0x1FE1, 0x03C5, 0x0304}, { 0x1FE0, 0x03C5, 0x0306}, { 0x03CB, 0x03C5, 0x0308}, { 0x1F50, 0x03C5, 0x0313}, { 0x1F51, 0x03C5, 0x0314}, { 0x1FE6, 0x03C5, 0x0342}, { 0x1F7C, 0x03C9, 0x0300}, { 0x03CE, 0x03C9, 0x0301}, { 0x1F60, 0x03C9, 0x0313}, { 0x1F61, 0x03C9, 0x0314}, { 0x1FF6, 0x03C9, 0x0342}, { 0x1FF3, 0x03C9, 0x0345}, { 0x1FD2, 0x03CA, 0x0300}, { 0x0390, 0x03CA, 0x0301}, { 0x1FD7, 0x03CA, 0x0342}, { 0x1FE2, 0x03CB, 0x0300}, { 0x03B0, 0x03CB, 0x0301}, { 0x1FE7, 0x03CB, 0x0342}, { 0x1FF4, 0x03CE, 0x0345}, { 0x03D3, 0x03D2, 0x0301}, { 0x03D4, 0x03D2, 0x0308}, { 0x0407, 0x0406, 0x0308}, { 0x04D0, 0x0410, 0x0306}, { 0x04D2, 0x0410, 0x0308}, { 0x0403, 0x0413, 0x0301}, { 0x0400, 0x0415, 0x0300}, { 0x04D6, 0x0415, 0x0306}, { 0x0401, 0x0415, 0x0308}, { 0x04C1, 0x0416, 0x0306}, { 0x04DC, 0x0416, 0x0308}, { 0x04DE, 0x0417, 0x0308}, { 0x040D, 0x0418, 0x0300}, { 0x04E2, 0x0418, 0x0304}, { 0x0419, 0x0418, 0x0306}, { 0x04E4, 0x0418, 0x0308}, { 0x040C, 0x041A, 0x0301}, { 0x04E6, 0x041E, 0x0308}, { 0x04EE, 0x0423, 0x0304}, { 0x040E, 0x0423, 0x0306}, { 0x04F0, 0x0423, 0x0308}, { 0x04F2, 0x0423, 0x030B}, { 0x04F4, 0x0427, 0x0308}, { 0x04F8, 0x042B, 0x0308}, { 0x04EC, 0x042D, 0x0308}, { 0x04D1, 0x0430, 0x0306}, { 0x04D3, 0x0430, 0x0308}, { 0x0453, 0x0433, 0x0301}, { 0x0450, 0x0435, 0x0300}, { 0x04D7, 0x0435, 0x0306}, { 0x0451, 0x0435, 0x0308}, { 0x04C2, 0x0436, 0x0306}, { 0x04DD, 0x0436, 0x0308}, { 0x04DF, 0x0437, 0x0308}, { 0x045D, 0x0438, 0x0300}, { 0x04E3, 0x0438, 0x0304}, { 0x0439, 0x0438, 0x0306}, { 0x04E5, 0x0438, 0x0308}, { 0x045C, 0x043A, 0x0301}, { 0x04E7, 0x043E, 0x0308}, { 0x04EF, 0x0443, 0x0304}, { 0x045E, 0x0443, 0x0306}, { 0x04F1, 0x0443, 0x0308}, { 0x04F3, 0x0443, 0x030B}, { 0x04F5, 0x0447, 0x0308}, { 0x04F9, 0x044B, 0x0308}, { 0x04ED, 0x044D, 0x0308}, { 0x0457, 0x0456, 0x0308}, { 0x0476, 0x0474, 0x030F}, { 0x0477, 0x0475, 0x030F}, { 0x04DA, 0x04D8, 0x0308}, { 0x04DB, 0x04D9, 0x0308}, { 0x04EA, 0x04E8, 0x0308}, { 0x04EB, 0x04E9, 0x0308}, { 0xFB2E, 0x05D0, 0x05B7}, { 0xFB2F, 0x05D0, 0x05B8}, { 0xFB30, 0x05D0, 0x05BC}, { 0xFB31, 0x05D1, 0x05BC}, { 0xFB4C, 0x05D1, 0x05BF}, { 0xFB32, 0x05D2, 0x05BC}, { 0xFB33, 0x05D3, 0x05BC}, { 0xFB34, 0x05D4, 0x05BC}, { 0xFB4B, 0x05D5, 0x05B9}, { 0xFB35, 0x05D5, 0x05BC}, { 0xFB36, 0x05D6, 0x05BC}, { 0xFB38, 0x05D8, 0x05BC}, { 0xFB1D, 0x05D9, 0x05B4}, { 0xFB39, 0x05D9, 0x05BC}, { 0xFB3A, 0x05DA, 0x05BC}, { 0xFB3B, 0x05DB, 0x05BC}, { 0xFB4D, 0x05DB, 0x05BF}, { 0xFB3C, 0x05DC, 0x05BC}, { 0xFB3E, 0x05DE, 0x05BC}, { 0xFB40, 0x05E0, 0x05BC}, { 0xFB41, 0x05E1, 0x05BC}, { 0xFB43, 0x05E3, 0x05BC}, { 0xFB44, 0x05E4, 0x05BC}, { 0xFB4E, 0x05E4, 0x05BF}, { 0xFB46, 0x05E6, 0x05BC}, { 0xFB47, 0x05E7, 0x05BC}, { 0xFB48, 0x05E8, 0x05BC}, { 0xFB49, 0x05E9, 0x05BC}, { 0xFB2A, 0x05E9, 0x05C1}, { 0xFB2B, 0x05E9, 0x05C2}, { 0xFB4A, 0x05EA, 0x05BC}, { 0xFB1F, 0x05F2, 0x05B7}, { 0x0622, 0x0627, 0x0653}, { 0x0623, 0x0627, 0x0654}, { 0x0625, 0x0627, 0x0655}, { 0x0624, 0x0648, 0x0654}, { 0x0626, 0x064A, 0x0654}, { 0x06C2, 0x06C1, 0x0654}, { 0x06D3, 0x06D2, 0x0654}, { 0x06C0, 0x06D5, 0x0654}, { 0x0958, 0x0915, 0x093C}, { 0x0959, 0x0916, 0x093C}, { 0x095A, 0x0917, 0x093C}, { 0x095B, 0x091C, 0x093C}, { 0x095C, 0x0921, 0x093C}, { 0x095D, 0x0922, 0x093C}, { 0x0929, 0x0928, 0x093C}, { 0x095E, 0x092B, 0x093C}, { 0x095F, 0x092F, 0x093C}, { 0x0931, 0x0930, 0x093C}, { 0x0934, 0x0933, 0x093C}, { 0x09DC, 0x09A1, 0x09BC}, { 0x09DD, 0x09A2, 0x09BC}, { 0x09DF, 0x09AF, 0x09BC}, { 0x09CB, 0x09C7, 0x09BE}, { 0x09CC, 0x09C7, 0x09D7}, { 0x0A59, 0x0A16, 0x0A3C}, { 0x0A5A, 0x0A17, 0x0A3C}, { 0x0A5B, 0x0A1C, 0x0A3C}, { 0x0A5E, 0x0A2B, 0x0A3C}, { 0x0A33, 0x0A32, 0x0A3C}, { 0x0A36, 0x0A38, 0x0A3C}, { 0x0B5C, 0x0B21, 0x0B3C}, { 0x0B5D, 0x0B22, 0x0B3C}, { 0x0B4B, 0x0B47, 0x0B3E}, { 0x0B48, 0x0B47, 0x0B56}, { 0x0B4C, 0x0B47, 0x0B57}, { 0x0B94, 0x0B92, 0x0BD7}, { 0x0BCA, 0x0BC6, 0x0BBE}, { 0x0BCC, 0x0BC6, 0x0BD7}, { 0x0BCB, 0x0BC7, 0x0BBE}, { 0x0C48, 0x0C46, 0x0C56}, { 0x0CC0, 0x0CBF, 0x0CD5}, { 0x0CCA, 0x0CC6, 0x0CC2}, { 0x0CC7, 0x0CC6, 0x0CD5}, { 0x0CC8, 0x0CC6, 0x0CD6}, { 0x0CCB, 0x0CCA, 0x0CD5}, { 0x0D4A, 0x0D46, 0x0D3E}, { 0x0D4C, 0x0D46, 0x0D57}, { 0x0D4B, 0x0D47, 0x0D3E}, { 0x0DDA, 0x0DD9, 0x0DCA}, { 0x0DDC, 0x0DD9, 0x0DCF}, { 0x0DDE, 0x0DD9, 0x0DDF}, { 0x0DDD, 0x0DDC, 0x0DCA}, { 0x0F69, 0x0F40, 0x0FB5}, { 0x0F43, 0x0F42, 0x0FB7}, { 0x0F4D, 0x0F4C, 0x0FB7}, { 0x0F52, 0x0F51, 0x0FB7}, { 0x0F57, 0x0F56, 0x0FB7}, { 0x0F5C, 0x0F5B, 0x0FB7}, { 0x0F73, 0x0F71, 0x0F72}, { 0x0F75, 0x0F71, 0x0F74}, { 0x0F81, 0x0F71, 0x0F80}, { 0x0FB9, 0x0F90, 0x0FB5}, { 0x0F93, 0x0F92, 0x0FB7}, { 0x0F9D, 0x0F9C, 0x0FB7}, { 0x0FA2, 0x0FA1, 0x0FB7}, { 0x0FA7, 0x0FA6, 0x0FB7}, { 0x0FAC, 0x0FAB, 0x0FB7}, { 0x0F76, 0x0FB2, 0x0F80}, { 0x0F78, 0x0FB3, 0x0F80}, { 0x1026, 0x1025, 0x102E}, { 0x1B06, 0x1B05, 0x1B35}, { 0x1B08, 0x1B07, 0x1B35}, { 0x1B0A, 0x1B09, 0x1B35}, { 0x1B0C, 0x1B0B, 0x1B35}, { 0x1B0E, 0x1B0D, 0x1B35}, { 0x1B12, 0x1B11, 0x1B35}, { 0x1B3B, 0x1B3A, 0x1B35}, { 0x1B3D, 0x1B3C, 0x1B35}, { 0x1B40, 0x1B3E, 0x1B35}, { 0x1B41, 0x1B3F, 0x1B35}, { 0x1B43, 0x1B42, 0x1B35}, { 0x1E38, 0x1E36, 0x0304}, { 0x1E39, 0x1E37, 0x0304}, { 0x1E5C, 0x1E5A, 0x0304}, { 0x1E5D, 0x1E5B, 0x0304}, { 0x1E68, 0x1E62, 0x0307}, { 0x1E69, 0x1E63, 0x0307}, { 0x1EAC, 0x1EA0, 0x0302}, { 0x1EB6, 0x1EA0, 0x0306}, { 0x1EAD, 0x1EA1, 0x0302}, { 0x1EB7, 0x1EA1, 0x0306}, { 0x1EC6, 0x1EB8, 0x0302}, { 0x1EC7, 0x1EB9, 0x0302}, { 0x1ED8, 0x1ECC, 0x0302}, { 0x1ED9, 0x1ECD, 0x0302}, { 0x1F02, 0x1F00, 0x0300}, { 0x1F04, 0x1F00, 0x0301}, { 0x1F06, 0x1F00, 0x0342}, { 0x1F80, 0x1F00, 0x0345}, { 0x1F03, 0x1F01, 0x0300}, { 0x1F05, 0x1F01, 0x0301}, { 0x1F07, 0x1F01, 0x0342}, { 0x1F81, 0x1F01, 0x0345}, { 0x1F82, 0x1F02, 0x0345}, { 0x1F83, 0x1F03, 0x0345}, { 0x1F84, 0x1F04, 0x0345}, { 0x1F85, 0x1F05, 0x0345}, { 0x1F86, 0x1F06, 0x0345}, { 0x1F87, 0x1F07, 0x0345}, { 0x1F0A, 0x1F08, 0x0300}, { 0x1F0C, 0x1F08, 0x0301}, { 0x1F0E, 0x1F08, 0x0342}, { 0x1F88, 0x1F08, 0x0345}, { 0x1F0B, 0x1F09, 0x0300}, { 0x1F0D, 0x1F09, 0x0301}, { 0x1F0F, 0x1F09, 0x0342}, { 0x1F89, 0x1F09, 0x0345}, { 0x1F8A, 0x1F0A, 0x0345}, { 0x1F8B, 0x1F0B, 0x0345}, { 0x1F8C, 0x1F0C, 0x0345}, { 0x1F8D, 0x1F0D, 0x0345}, { 0x1F8E, 0x1F0E, 0x0345}, { 0x1F8F, 0x1F0F, 0x0345}, { 0x1F12, 0x1F10, 0x0300}, { 0x1F14, 0x1F10, 0x0301}, { 0x1F13, 0x1F11, 0x0300}, { 0x1F15, 0x1F11, 0x0301}, { 0x1F1A, 0x1F18, 0x0300}, { 0x1F1C, 0x1F18, 0x0301}, { 0x1F1B, 0x1F19, 0x0300}, { 0x1F1D, 0x1F19, 0x0301}, { 0x1F22, 0x1F20, 0x0300}, { 0x1F24, 0x1F20, 0x0301}, { 0x1F26, 0x1F20, 0x0342}, { 0x1F90, 0x1F20, 0x0345}, { 0x1F23, 0x1F21, 0x0300}, { 0x1F25, 0x1F21, 0x0301}, { 0x1F27, 0x1F21, 0x0342}, { 0x1F91, 0x1F21, 0x0345}, { 0x1F92, 0x1F22, 0x0345}, { 0x1F93, 0x1F23, 0x0345}, { 0x1F94, 0x1F24, 0x0345}, { 0x1F95, 0x1F25, 0x0345}, { 0x1F96, 0x1F26, 0x0345}, { 0x1F97, 0x1F27, 0x0345}, { 0x1F2A, 0x1F28, 0x0300}, { 0x1F2C, 0x1F28, 0x0301}, { 0x1F2E, 0x1F28, 0x0342}, { 0x1F98, 0x1F28, 0x0345}, { 0x1F2B, 0x1F29, 0x0300}, { 0x1F2D, 0x1F29, 0x0301}, { 0x1F2F, 0x1F29, 0x0342}, { 0x1F99, 0x1F29, 0x0345}, { 0x1F9A, 0x1F2A, 0x0345}, { 0x1F9B, 0x1F2B, 0x0345}, { 0x1F9C, 0x1F2C, 0x0345}, { 0x1F9D, 0x1F2D, 0x0345}, { 0x1F9E, 0x1F2E, 0x0345}, { 0x1F9F, 0x1F2F, 0x0345}, { 0x1F32, 0x1F30, 0x0300}, { 0x1F34, 0x1F30, 0x0301}, { 0x1F36, 0x1F30, 0x0342}, { 0x1F33, 0x1F31, 0x0300}, { 0x1F35, 0x1F31, 0x0301}, { 0x1F37, 0x1F31, 0x0342}, { 0x1F3A, 0x1F38, 0x0300}, { 0x1F3C, 0x1F38, 0x0301}, { 0x1F3E, 0x1F38, 0x0342}, { 0x1F3B, 0x1F39, 0x0300}, { 0x1F3D, 0x1F39, 0x0301}, { 0x1F3F, 0x1F39, 0x0342}, { 0x1F42, 0x1F40, 0x0300}, { 0x1F44, 0x1F40, 0x0301}, { 0x1F43, 0x1F41, 0x0300}, { 0x1F45, 0x1F41, 0x0301}, { 0x1F4A, 0x1F48, 0x0300}, { 0x1F4C, 0x1F48, 0x0301}, { 0x1F4B, 0x1F49, 0x0300}, { 0x1F4D, 0x1F49, 0x0301}, { 0x1F52, 0x1F50, 0x0300}, { 0x1F54, 0x1F50, 0x0301}, { 0x1F56, 0x1F50, 0x0342}, { 0x1F53, 0x1F51, 0x0300}, { 0x1F55, 0x1F51, 0x0301}, { 0x1F57, 0x1F51, 0x0342}, { 0x1F5B, 0x1F59, 0x0300}, { 0x1F5D, 0x1F59, 0x0301}, { 0x1F5F, 0x1F59, 0x0342}, { 0x1F62, 0x1F60, 0x0300}, { 0x1F64, 0x1F60, 0x0301}, { 0x1F66, 0x1F60, 0x0342}, { 0x1FA0, 0x1F60, 0x0345}, { 0x1F63, 0x1F61, 0x0300}, { 0x1F65, 0x1F61, 0x0301}, { 0x1F67, 0x1F61, 0x0342}, { 0x1FA1, 0x1F61, 0x0345}, { 0x1FA2, 0x1F62, 0x0345}, { 0x1FA3, 0x1F63, 0x0345}, { 0x1FA4, 0x1F64, 0x0345}, { 0x1FA5, 0x1F65, 0x0345}, { 0x1FA6, 0x1F66, 0x0345}, { 0x1FA7, 0x1F67, 0x0345}, { 0x1F6A, 0x1F68, 0x0300}, { 0x1F6C, 0x1F68, 0x0301}, { 0x1F6E, 0x1F68, 0x0342}, { 0x1FA8, 0x1F68, 0x0345}, { 0x1F6B, 0x1F69, 0x0300}, { 0x1F6D, 0x1F69, 0x0301}, { 0x1F6F, 0x1F69, 0x0342}, { 0x1FA9, 0x1F69, 0x0345}, { 0x1FAA, 0x1F6A, 0x0345}, { 0x1FAB, 0x1F6B, 0x0345}, { 0x1FAC, 0x1F6C, 0x0345}, { 0x1FAD, 0x1F6D, 0x0345}, { 0x1FAE, 0x1F6E, 0x0345}, { 0x1FAF, 0x1F6F, 0x0345}, { 0x1FB2, 0x1F70, 0x0345}, { 0x1FC2, 0x1F74, 0x0345}, { 0x1FF2, 0x1F7C, 0x0345}, { 0x1FB7, 0x1FB6, 0x0345}, { 0x1FCD, 0x1FBF, 0x0300}, { 0x1FCE, 0x1FBF, 0x0301}, { 0x1FCF, 0x1FBF, 0x0342}, { 0x1FC7, 0x1FC6, 0x0345}, { 0x1FF7, 0x1FF6, 0x0345}, { 0x1FDD, 0x1FFE, 0x0300}, { 0x1FDE, 0x1FFE, 0x0301}, { 0x1FDF, 0x1FFE, 0x0342}, { 0x219A, 0x2190, 0x0338}, { 0x219B, 0x2192, 0x0338}, { 0x21AE, 0x2194, 0x0338}, { 0x21CD, 0x21D0, 0x0338}, { 0x21CF, 0x21D2, 0x0338}, { 0x21CE, 0x21D4, 0x0338}, { 0x2204, 0x2203, 0x0338}, { 0x2209, 0x2208, 0x0338}, { 0x220C, 0x220B, 0x0338}, { 0x2224, 0x2223, 0x0338}, { 0x2226, 0x2225, 0x0338}, { 0x2241, 0x223C, 0x0338}, { 0x2244, 0x2243, 0x0338}, { 0x2247, 0x2245, 0x0338}, { 0x2249, 0x2248, 0x0338}, { 0x226D, 0x224D, 0x0338}, { 0x2262, 0x2261, 0x0338}, { 0x2270, 0x2264, 0x0338}, { 0x2271, 0x2265, 0x0338}, { 0x2274, 0x2272, 0x0338}, { 0x2275, 0x2273, 0x0338}, { 0x2278, 0x2276, 0x0338}, { 0x2279, 0x2277, 0x0338}, { 0x2280, 0x227A, 0x0338}, { 0x2281, 0x227B, 0x0338}, { 0x22E0, 0x227C, 0x0338}, { 0x22E1, 0x227D, 0x0338}, { 0x2284, 0x2282, 0x0338}, { 0x2285, 0x2283, 0x0338}, { 0x2288, 0x2286, 0x0338}, { 0x2289, 0x2287, 0x0338}, { 0x22E2, 0x2291, 0x0338}, { 0x22E3, 0x2292, 0x0338}, { 0x22AC, 0x22A2, 0x0338}, { 0x22AD, 0x22A8, 0x0338}, { 0x22AE, 0x22A9, 0x0338}, { 0x22AF, 0x22AB, 0x0338}, { 0x22EA, 0x22B2, 0x0338}, { 0x22EB, 0x22B3, 0x0338}, { 0x22EC, 0x22B4, 0x0338}, { 0x22ED, 0x22B5, 0x0338}, { 0x2ADC, 0x2ADD, 0x0338}, { 0x3094, 0x3046, 0x3099}, { 0x304C, 0x304B, 0x3099}, { 0x304E, 0x304D, 0x3099}, { 0x3050, 0x304F, 0x3099}, { 0x3052, 0x3051, 0x3099}, { 0x3054, 0x3053, 0x3099}, { 0x3056, 0x3055, 0x3099}, { 0x3058, 0x3057, 0x3099}, { 0x305A, 0x3059, 0x3099}, { 0x305C, 0x305B, 0x3099}, { 0x305E, 0x305D, 0x3099}, { 0x3060, 0x305F, 0x3099}, { 0x3062, 0x3061, 0x3099}, { 0x3065, 0x3064, 0x3099}, { 0x3067, 0x3066, 0x3099}, { 0x3069, 0x3068, 0x3099}, { 0x3070, 0x306F, 0x3099}, { 0x3071, 0x306F, 0x309A}, { 0x3073, 0x3072, 0x3099}, { 0x3074, 0x3072, 0x309A}, { 0x3076, 0x3075, 0x3099}, { 0x3077, 0x3075, 0x309A}, { 0x3079, 0x3078, 0x3099}, { 0x307A, 0x3078, 0x309A}, { 0x307C, 0x307B, 0x3099}, { 0x307D, 0x307B, 0x309A}, { 0x309E, 0x309D, 0x3099}, { 0x30F4, 0x30A6, 0x3099}, { 0x30AC, 0x30AB, 0x3099}, { 0x30AE, 0x30AD, 0x3099}, { 0x30B0, 0x30AF, 0x3099}, { 0x30B2, 0x30B1, 0x3099}, { 0x30B4, 0x30B3, 0x3099}, { 0x30B6, 0x30B5, 0x3099}, { 0x30B8, 0x30B7, 0x3099}, { 0x30BA, 0x30B9, 0x3099}, { 0x30BC, 0x30BB, 0x3099}, { 0x30BE, 0x30BD, 0x3099}, { 0x30C0, 0x30BF, 0x3099}, { 0x30C2, 0x30C1, 0x3099}, { 0x30C5, 0x30C4, 0x3099}, { 0x30C7, 0x30C6, 0x3099}, { 0x30C9, 0x30C8, 0x3099}, { 0x30D0, 0x30CF, 0x3099}, { 0x30D1, 0x30CF, 0x309A}, { 0x30D3, 0x30D2, 0x3099}, { 0x30D4, 0x30D2, 0x309A}, { 0x30D6, 0x30D5, 0x3099}, { 0x30D7, 0x30D5, 0x309A}, { 0x30D9, 0x30D8, 0x3099}, { 0x30DA, 0x30D8, 0x309A}, { 0x30DC, 0x30DB, 0x3099}, { 0x30DD, 0x30DB, 0x309A}, { 0x30F7, 0x30EF, 0x3099}, { 0x30F8, 0x30F0, 0x3099}, { 0x30F9, 0x30F1, 0x3099}, { 0x30FA, 0x30F2, 0x3099}, { 0x30FE, 0x30FD, 0x3099}, { 0xFB2C, 0xFB49, 0x05C1}, { 0xFB2D, 0xFB49, 0x05C2}, }; private static final int UNICODE_SHIFT = 21; public static char precompose(char base, char comb) { int min = 0; int max = precompositions.length - 1; int mid; long sought = base << UNICODE_SHIFT | comb; long that; while (max >= min) { mid = (min + max) / 2; that = precompositions[mid][1] << UNICODE_SHIFT | precompositions[mid][2]; if (that < sought) min = mid + 1; else if (that > sought) max = mid - 1; else return precompositions[mid][0]; } // No match; return character without combiner return base; } }
1031868817-aaaa
src/de/mud/terminal/Precomposer.java
Java
asf20
30,428
/* * This file is part of "JTA - Telnet/SSH for the JAVA(tm) platform". * * (c) Matthias L. Jugel, Marcus Meißner 1996-2005. All Rights Reserved. * * Please visit http://javatelnet.org/ for updates and contact. * * --LICENSE NOTICE-- * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. * --LICENSE NOTICE-- * */ package de.mud.terminal; import java.util.Properties; /** * An interface for a terminal that accepts input from keyboard and mouse. * * @author Matthias L. Jugel, Marcus Meißner * @version $Id: VDUInput.java 499 2005-09-29 08:24:54Z leo $ */ public interface VDUInput { public final static int KEY_CONTROL = 0x01; public final static int KEY_SHIFT = 0x02; public final static int KEY_ALT = 0x04; public final static int KEY_ACTION = 0x08; /** * Direct access to writing data ... * @param b */ void write(byte b[]); /** * Terminal is mouse-aware and requires (x,y) coordinates of * on the terminal (character coordinates) and the button clicked. * @param x * @param y * @param modifiers */ void mousePressed(int x, int y, int modifiers); /** * Terminal is mouse-aware and requires the coordinates and button * of the release. * @param x * @param y * @param modifiers */ void mouseReleased(int x, int y, int modifiers); /** * Override the standard key codes used by the terminal emulation. * @param codes a properties object containing key code definitions */ void setKeyCodes(Properties codes); /** * main keytyping event handler... * @param keyCode the key code * @param keyChar the character represented by the key * @param modifiers shift/alt/control modifiers */ void keyPressed(int keyCode, char keyChar, int modifiers); /** * Handle key Typed events for the terminal, this will get * all normal key types, but no shift/alt/control/numlock. * @param keyCode the key code * @param keyChar the character represented by the key * @param modifiers shift/alt/control modifiers */ void keyTyped(int keyCode, char keyChar, int modifiers); }
1031868817-aaaa
src/de/mud/terminal/VDUInput.java
Java
asf20
2,742
/* * This file is part of "JTA - Telnet/SSH for the JAVA(tm) platform". * * (c) Matthias L. Jugel, Marcus Meißner 1996-2005. All Rights Reserved. * * Please visit http://javatelnet.org/ for updates and contact. * * --LICENSE NOTICE-- * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. * --LICENSE NOTICE-- * */ package de.mud.telnet; import java.io.IOException; /** * This is a telnet protocol handler. The handler needs implementations * for several methods to handle the telnet options and to be able to * read and write the buffer. * <P> * <B>Maintainer:</B> Marcus Meissner * * @version $Id: TelnetProtocolHandler.java 503 2005-10-24 07:34:13Z marcus $ * @author Matthias L. Jugel, Marcus Meissner */ public abstract class TelnetProtocolHandler { /** contains the current revision id */ public final static String ID = "$Id: TelnetProtocolHandler.java 503 2005-10-24 07:34:13Z marcus $"; /** debug level */ private final static int debug = 0; /** temporary buffer for data-telnetstuff-data transformation */ private byte[] tempbuf = new byte[0]; /** the data sent on pressing <RETURN> \n */ private byte[] crlf = new byte[2]; /** the data sent on pressing <LineFeed> \r */ private byte[] cr = new byte[2]; /** * Create a new telnet protocol handler. */ public TelnetProtocolHandler() { reset(); crlf[0] = 13; crlf[1] = 10; cr[0] = 13; cr[1] = 0; } /** * Get the current terminal type for TTYPE telnet option. * @return the string id of the terminal */ protected abstract String getTerminalType(); /** * Get the current window size of the terminal for the * NAWS telnet option. * @return the size of the terminal as Dimension */ protected abstract int[] getWindowSize(); /** * Set the local echo option of telnet. * @param echo true for local echo, false for no local echo */ protected abstract void setLocalEcho(boolean echo); /** * Generate an EOR (end of record) request. For use by prompt displaying. */ protected abstract void notifyEndOfRecord(); /** * Send data to the remote host. * @param b array of bytes to send */ protected abstract void write(byte[] b) throws IOException; /** * Read the charset name from terminal. */ protected abstract String getCharsetName(); /** * Send one byte to the remote host. * @param b the byte to be sent * @see #write(byte[] b) */ private static byte[] one = new byte[1]; private void write(byte b) throws IOException { one[0] = b; write(one); } /** * Reset the protocol handler. This may be necessary after the * connection was closed or some other problem occured. */ public void reset() { neg_state = 0; receivedDX = new byte[256]; sentDX = new byte[256]; receivedWX = new byte[256]; sentWX = new byte[256]; } // =================================================================== // the actual negotiation handling for the telnet protocol follows: // =================================================================== /** state variable for telnet negotiation reader */ private byte neg_state = 0; /** constants for the negotiation state */ private final static byte STATE_DATA = 0; private final static byte STATE_IAC = 1; private final static byte STATE_IACSB = 2; private final static byte STATE_IACWILL = 3; private final static byte STATE_IACDO = 4; private final static byte STATE_IACWONT = 5; private final static byte STATE_IACDONT = 6; private final static byte STATE_IACSBIAC = 7; private final static byte STATE_IACSBDATA = 8; private final static byte STATE_IACSBDATAIAC = 9; /** What IAC SB <xx> we are handling right now */ private byte current_sb; /** current SB negotiation buffer */ private byte[] sbbuf; /** IAC - init sequence for telnet negotiation. */ private final static byte IAC = (byte)255; /** [IAC] End Of Record */ private final static byte EOR = (byte)239; /** [IAC] WILL */ private final static byte WILL = (byte)251; /** [IAC] WONT */ private final static byte WONT = (byte)252; /** [IAC] DO */ private final static byte DO = (byte)253; /** [IAC] DONT */ private final static byte DONT = (byte)254; /** [IAC] Sub Begin */ private final static byte SB = (byte)250; /** [IAC] Sub End */ private final static byte SE = (byte)240; /** Telnet option: binary mode */ private final static byte TELOPT_BINARY= (byte)0; /* binary mode */ /** Telnet option: echo text */ private final static byte TELOPT_ECHO = (byte)1; /* echo on/off */ /** Telnet option: sga */ private final static byte TELOPT_SGA = (byte)3; /* supress go ahead */ /** Telnet option: End Of Record */ private final static byte TELOPT_EOR = (byte)25; /* end of record */ /** Telnet option: Negotiate About Window Size */ private final static byte TELOPT_NAWS = (byte)31; /* NA-WindowSize*/ /** Telnet option: Terminal Type */ private final static byte TELOPT_TTYPE = (byte)24; /* terminal type */ /** Telnet option: CHARSET */ private final static byte TELOPT_CHARSET= (byte)42; /* charset */ private final static byte[] IACWILL = { IAC, WILL }; private final static byte[] IACWONT = { IAC, WONT }; private final static byte[] IACDO = { IAC, DO }; private final static byte[] IACDONT = { IAC, DONT }; private final static byte[] IACSB = { IAC, SB }; private final static byte[] IACSE = { IAC, SE }; private final static byte CHARSET_ACCEPTED = (byte)2; private final static byte CHARSET_REJECTED = (byte)3; /** Telnet option qualifier 'IS' */ private final static byte TELQUAL_IS = (byte)0; /** Telnet option qualifier 'SEND' */ private final static byte TELQUAL_SEND = (byte)1; /** What IAC DO(NT) request do we have received already ? */ private byte[] receivedDX; /** What IAC WILL/WONT request do we have received already ? */ private byte[] receivedWX; /** What IAC DO/DONT request do we have sent already ? */ private byte[] sentDX; /** What IAC WILL/WONT request do we have sent already ? */ private byte[] sentWX; /** * Send a Telnet Escape character (IAC <code>) */ public void sendTelnetControl(byte code) throws IOException { byte[] b = new byte[2]; b[0] = IAC; b[1] = code; write(b); } /** * Send the new Window Size (via NAWS) */ public void setWindowSize(int columns,int rows) throws IOException { if(debug > 2) System.err.println("sending NAWS"); if (receivedDX[TELOPT_NAWS] != DO) { System.err.println("not allowed to send NAWS? (DONT NAWS)"); return; } write(IAC);write(SB);write(TELOPT_NAWS); write((byte) (columns >> 8)); write((byte) (columns & 0xff)); write((byte) (rows >> 8)); write((byte) (rows & 0xff)); write(IAC);write(SE); } /** * Handle an incoming IAC SB &lt;type&gt; &lt;bytes&gt; IAC SE * @param type type of SB * @param sbata byte array as &lt;bytes&gt; */ private void handle_sb(byte type, byte[] sbdata) throws IOException { if(debug > 1) System.err.println("TelnetIO.handle_sb("+type+")"); switch (type) { case TELOPT_TTYPE: if (sbdata.length>0 && sbdata[0]==TELQUAL_SEND) { write(IACSB);write(TELOPT_TTYPE);write(TELQUAL_IS); /* FIXME: need more logic here if we use * more than one terminal type */ String ttype = getTerminalType(); if(ttype == null) ttype = "dumb"; write(ttype.getBytes()); write(IACSE); } break; case TELOPT_CHARSET: System.out.println("Got SB CHARSET"); String charsetStr = new String(sbdata, "US-ASCII"); if (charsetStr.startsWith("TTABLE ")) { charsetStr = charsetStr.substring(7); } String[] charsets = charsetStr.split(charsetStr.substring(0,0)); String myCharset = getCharsetName(); for (String charset : charsets) { if (charset.equals(myCharset)) { write(IACSB);write(TELOPT_CHARSET);write(CHARSET_ACCEPTED); write(charset.getBytes()); write(IACSE); System.out.println("Sent our charset!"); return; } } write(IACSB);write(TELOPT_CHARSET);write(CHARSET_REJECTED); write(IACSE); break; } } /** * Do not send any notifications at startup. We do not know, * whether the remote client understands telnet protocol handling, * so we are silent. * (This used to send IAC WILL SGA, but this is false for a compliant * client.) */ public void startup() throws IOException { } /** * Transpose special telnet codes like 0xff or newlines to values * that are compliant to the protocol. This method will also send * the buffer immediately after transposing the data. * @param buf the data buffer to be sent */ public void transpose(byte[] buf) throws IOException { int i; byte[] nbuf,xbuf; int nbufptr=0; nbuf = new byte[buf.length*2]; // FIXME: buffer overflows possible for (i = 0; i < buf.length ; i++) { switch (buf[i]) { // Escape IAC twice in stream ... to be telnet protocol compliant // this is there in binary and non-binary mode. case IAC: nbuf[nbufptr++]=IAC; nbuf[nbufptr++]=IAC; break; // We need to heed RFC 854. LF (\n) is 10, CR (\r) is 13 // we assume that the Terminal sends \n for lf+cr and \r for just cr // linefeed+carriage return is CR LF */ case 10: // \n if (receivedDX[TELOPT_BINARY + 128 ] != DO) { while (nbuf.length - nbufptr < crlf.length) { xbuf = new byte[nbuf.length*2]; System.arraycopy(nbuf,0,xbuf,0,nbufptr); nbuf = xbuf; } for (int j=0;j<crlf.length;j++) nbuf[nbufptr++]=crlf[j]; break; } else { // copy verbatim in binary mode. nbuf[nbufptr++]=buf[i]; } break; // carriage return is CR NUL */ case 13: // \r if (receivedDX[TELOPT_BINARY + 128 ] != DO) { while (nbuf.length - nbufptr < cr.length) { xbuf = new byte[nbuf.length*2]; System.arraycopy(nbuf,0,xbuf,0,nbufptr); nbuf = xbuf; } for (int j=0;j<cr.length;j++) nbuf[nbufptr++]=cr[j]; } else { // copy verbatim in binary mode. nbuf[nbufptr++]=buf[i]; } break; // all other characters are just copied default: nbuf[nbufptr++]=buf[i]; break; } } xbuf = new byte[nbufptr]; System.arraycopy(nbuf,0,xbuf,0,nbufptr); write(xbuf); } public void setCRLF(String xcrlf) { crlf = xcrlf.getBytes(); } public void setCR(String xcr) { cr = xcr.getBytes(); } /** * Handle telnet protocol negotiation. The buffer will be parsed * and necessary actions are taken according to the telnet protocol. * See <A HREF="RFC-Telnet-URL">RFC-Telnet</A> * @param nbuf the byte buffer put out after negotiation * @return number of bytes processed, 0 for none, and -1 for end of buffer. */ public int negotiate(byte nbuf[], int offset) throws IOException { int count = tempbuf.length; byte[] buf = tempbuf; byte sendbuf[] = new byte[3]; byte b,reply; int boffset = 0, noffset = offset; boolean dobreak = false; if (count == 0) // buffer is empty. return -1; while(!dobreak && (boffset < count) && (noffset < nbuf.length)) { b=buf[boffset++]; // of course, byte is a signed entity (-128 -> 127) // but apparently the SGI Netscape 3.0 doesn't seem // to care and provides happily values up to 255 if (b>=128) b=(byte)(b-256); if(debug > 2) { Byte B = new Byte(b); System.err.print("byte: " + B.intValue()+ " "); } switch (neg_state) { case STATE_DATA: if (b==IAC) { neg_state = STATE_IAC; dobreak = true; // leave the loop so we can sync. } else nbuf[noffset++]=b; break; case STATE_IAC: switch (b) { case IAC: if(debug > 2) System.err.print("IAC "); neg_state = STATE_DATA; nbuf[noffset++]=IAC; break; case WILL: if(debug > 2) System.err.print("WILL "); neg_state = STATE_IACWILL; break; case WONT: if(debug > 2) System.err.print("WONT "); neg_state = STATE_IACWONT; break; case DONT: if(debug > 2) System.err.print("DONT "); neg_state = STATE_IACDONT; break; case DO: if(debug > 2) System.err.print("DO "); neg_state = STATE_IACDO; break; case EOR: if(debug > 1) System.err.print("EOR "); notifyEndOfRecord(); dobreak = true; // leave the loop so we can sync. neg_state = STATE_DATA; break; case SB: if(debug > 2) System.err.print("SB "); neg_state = STATE_IACSB; break; default: if(debug > 2) System.err.print("<UNKNOWN "+b+" > "); neg_state = STATE_DATA; break; } break; case STATE_IACWILL: switch(b) { case TELOPT_ECHO: if(debug > 2) System.err.println("ECHO"); reply = DO; setLocalEcho(false); break; case TELOPT_SGA: if(debug > 2) System.err.println("SGA"); reply = DO; break; case TELOPT_EOR: if(debug > 2) System.err.println("EOR"); reply = DO; break; case TELOPT_BINARY: if(debug > 2) System.err.println("BINARY"); reply = DO; break; default: if(debug > 2) System.err.println("<UNKNOWN,"+b+">"); reply = DONT; break; } if(debug > 1) System.err.println("<"+b+", WILL ="+WILL+">"); if (reply != sentDX[b+128] || WILL != receivedWX[b+128]) { sendbuf[0]=IAC; sendbuf[1]=reply; sendbuf[2]=b; write(sendbuf); sentDX[b+128] = reply; receivedWX[b+128] = WILL; } neg_state = STATE_DATA; break; case STATE_IACWONT: switch(b) { case TELOPT_ECHO: if(debug > 2) System.err.println("ECHO"); setLocalEcho(true); reply = DONT; break; case TELOPT_SGA: if(debug > 2) System.err.println("SGA"); reply = DONT; break; case TELOPT_EOR: if(debug > 2) System.err.println("EOR"); reply = DONT; break; case TELOPT_BINARY: if(debug > 2) System.err.println("BINARY"); reply = DONT; break; default: if(debug > 2) System.err.println("<UNKNOWN,"+b+">"); reply = DONT; break; } if(reply != sentDX[b+128] || WONT != receivedWX[b+128]) { sendbuf[0]=IAC; sendbuf[1]=reply; sendbuf[2]=b; write(sendbuf); sentDX[b+128] = reply; receivedWX[b+128] = WILL; } neg_state = STATE_DATA; break; case STATE_IACDO: switch (b) { case TELOPT_ECHO: if(debug > 2) System.err.println("ECHO"); reply = WILL; setLocalEcho(true); break; case TELOPT_SGA: if(debug > 2) System.err.println("SGA"); reply = WILL; break; case TELOPT_TTYPE: if(debug > 2) System.err.println("TTYPE"); reply = WILL; break; case TELOPT_BINARY: if(debug > 2) System.err.println("BINARY"); reply = WILL; break; case TELOPT_NAWS: if(debug > 2) System.err.println("NAWS"); int[] size = getWindowSize(); receivedDX[b] = DO; if(size == null) { // this shouldn't happen write(IAC); write(WONT); write(TELOPT_NAWS); reply = WONT; sentWX[b] = WONT; break; } reply = WILL; sentWX[b] = WILL; sendbuf[0]=IAC; sendbuf[1]=WILL; sendbuf[2]=TELOPT_NAWS; write(sendbuf); write(IAC);write(SB);write(TELOPT_NAWS); write((byte) (size[0] >> 8)); write((byte) (size[0] & 0xff)); write((byte) (size[1] >> 8)); write((byte) (size[1] & 0xff)); write(IAC);write(SE); break; default: if(debug > 2) System.err.println("<UNKNOWN,"+b+">"); reply = WONT; break; } if(reply != sentWX[128+b] || DO != receivedDX[128+b]) { sendbuf[0]=IAC; sendbuf[1]=reply; sendbuf[2]=b; write(sendbuf); sentWX[b+128] = reply; receivedDX[b+128] = DO; } neg_state = STATE_DATA; break; case STATE_IACDONT: switch (b) { case TELOPT_ECHO: if(debug > 2) System.err.println("ECHO"); reply = WONT; setLocalEcho(false); break; case TELOPT_SGA: if(debug > 2) System.err.println("SGA"); reply = WONT; break; case TELOPT_NAWS: if(debug > 2) System.err.println("NAWS"); reply = WONT; break; case TELOPT_BINARY: if(debug > 2) System.err.println("BINARY"); reply = WONT; break; default: if(debug > 2) System.err.println("<UNKNOWN,"+b+">"); reply = WONT; break; } if(reply != sentWX[b+128] || DONT != receivedDX[b+128]) { write(IAC);write(reply);write(b); sentWX[b+128] = reply; receivedDX[b+128] = DONT; } neg_state = STATE_DATA; break; case STATE_IACSBIAC: if(debug > 2) System.err.println(""+b+" "); if (b == IAC) { sbbuf = new byte[0]; current_sb = b; neg_state = STATE_IACSBDATA; } else { System.err.println("(bad) "+b+" "); neg_state = STATE_DATA; } break; case STATE_IACSB: if(debug > 2) System.err.println(""+b+" "); switch (b) { case IAC: neg_state = STATE_IACSBIAC; break; default: current_sb = b; sbbuf = new byte[0]; neg_state = STATE_IACSBDATA; break; } break; case STATE_IACSBDATA: if (debug > 2) System.err.println(""+b+" "); switch (b) { case IAC: neg_state = STATE_IACSBDATAIAC; break; default: byte[] xsb = new byte[sbbuf.length+1]; System.arraycopy(sbbuf,0,xsb,0,sbbuf.length); sbbuf = xsb; sbbuf[sbbuf.length-1] = b; break; } break; case STATE_IACSBDATAIAC: if (debug > 2) System.err.println(""+b+" "); switch (b) { case IAC: neg_state = STATE_IACSBDATA; byte[] xsb = new byte[sbbuf.length+1]; System.arraycopy(sbbuf,0,xsb,0,sbbuf.length); sbbuf = xsb; sbbuf[sbbuf.length-1] = IAC; break; case SE: handle_sb(current_sb,sbbuf); current_sb = 0; neg_state = STATE_DATA; break; case SB: handle_sb(current_sb,sbbuf); neg_state = STATE_IACSB; break; default: neg_state = STATE_DATA; break; } break; default: if (debug > 1) System.err.println("This should not happen: "+neg_state+" "); neg_state = STATE_DATA; break; } } // shrink tempbuf to new processed size. byte[] xb = new byte[count-boffset]; System.arraycopy(tempbuf,boffset,xb,0,count-boffset); tempbuf = xb; return noffset - offset; } public void inputfeed(byte[] b, int offset, int len) { byte[] xb = new byte[tempbuf.length+len]; System.arraycopy(tempbuf,0,xb,0,tempbuf.length); System.arraycopy(b,offset,xb,tempbuf.length,len); tempbuf = xb; } }
1031868817-aaaa
src/de/mud/telnet/TelnetProtocolHandler.java
Java
asf20
20,838
/* * Copyright (C) 2008 OpenIntents.org * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.openintents.intents; // Version Dec 9, 2008 /** * Provides OpenIntents actions, extras, and categories used by providers. * <p>These specifiers extend the standard Android specifiers.</p> */ public final class FileManagerIntents { /** * Activity Action: Pick a file through the file manager, or let user * specify a custom file name. * Data is the current file name or file name suggestion. * Returns a new file name as file URI in data. * * <p>Constant Value: "org.openintents.action.PICK_FILE"</p> */ public static final String ACTION_PICK_FILE = "org.openintents.action.PICK_FILE"; /** * Activity Action: Pick a directory through the file manager, or let user * specify a custom file name. * Data is the current directory name or directory name suggestion. * Returns a new directory name as file URI in data. * * <p>Constant Value: "org.openintents.action.PICK_DIRECTORY"</p> */ public static final String ACTION_PICK_DIRECTORY = "org.openintents.action.PICK_DIRECTORY"; /** * The title to display. * * <p>This is shown in the title bar of the file manager.</p> * * <p>Constant Value: "org.openintents.extra.TITLE"</p> */ public static final String EXTRA_TITLE = "org.openintents.extra.TITLE"; /** * The text on the button to display. * * <p>Depending on the use, it makes sense to set this to "Open" or "Save".</p> * * <p>Constant Value: "org.openintents.extra.BUTTON_TEXT"</p> */ public static final String EXTRA_BUTTON_TEXT = "org.openintents.extra.BUTTON_TEXT"; }
1031868817-aaaa
src/org/openintents/intents/FileManagerIntents.java
Java
asf20
2,159
/* * Licensed to the Apache Software Foundation (ASF) under one or more * contributor license agreements. See the NOTICE file distributed with * this work for additional information regarding copyright ownership. * The ASF licenses this file to You under the Apache License, Version 2.0 * (the "License"); you may not use this file except in compliance with * the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.apache.harmony.niochar.charset.additional; import java.nio.ByteBuffer; import java.nio.CharBuffer; import java.nio.charset.Charset; import java.nio.charset.CharsetDecoder; import java.nio.charset.CharsetEncoder; import java.nio.charset.CoderResult; /* TODO: support direct byte buffers import org.apache.harmony.nio.AddressUtil; import org.apache.harmony.niochar.CharsetProviderImpl; */ public class IBM437 extends Charset { public IBM437(String csName, String[] aliases) { super(csName, aliases); } public boolean contains(Charset cs) { return cs.name().equalsIgnoreCase("IBM367") || cs.name().equalsIgnoreCase("IBM437") || cs.name().equalsIgnoreCase("US-ASCII") ; } public CharsetDecoder newDecoder() { return new Decoder(this); } public CharsetEncoder newEncoder() { return new Encoder(this); } private static final class Decoder extends CharsetDecoder{ private Decoder(Charset cs){ super(cs, 1, 1); } private native int nDecode(char[] array, int arrPosition, int remaining, long outAddr, int absolutePos); protected CoderResult decodeLoop(ByteBuffer bb, CharBuffer cb){ int cbRemaining = cb.remaining(); /* TODO: support direct byte buffers if(CharsetProviderImpl.hasLoadedNatives() && bb.isDirect() && bb.hasRemaining() && cb.hasArray()){ int toProceed = bb.remaining(); int cbPos = cb.position(); int bbPos = bb.position(); boolean throwOverflow = false; if( cbRemaining < toProceed ) { toProceed = cbRemaining; throwOverflow = true; } int res = nDecode(cb.array(), cb.arrayOffset()+cbPos, toProceed, AddressUtil.getDirectBufferAddress(bb), bbPos); bb.position(bbPos+res); cb.position(cbPos+res); if(throwOverflow) return CoderResult.OVERFLOW; }else{ */ if(bb.hasArray() && cb.hasArray()) { int rem = bb.remaining(); rem = cbRemaining >= rem ? rem : cbRemaining; byte[] bArr = bb.array(); char[] cArr = cb.array(); int bStart = bb.position(); int cStart = cb.position(); int i; for(i=bStart; i<bStart+rem; i++) { char in = (char)(bArr[i] & 0xFF); if(in >= 26){ int index = (int)in - 26; cArr[cStart++] = (char)arr[index]; }else { cArr[cStart++] = (char)(in & 0xFF); } } bb.position(i); cb.position(cStart); if(rem == cbRemaining && bb.hasRemaining()) return CoderResult.OVERFLOW; } else { while(bb.hasRemaining()){ if( cbRemaining == 0 ) return CoderResult.OVERFLOW; char in = (char)(bb.get() & 0xFF); if(in >= 26){ int index = (int)in - 26; cb.put(arr[index]); }else { cb.put((char)(in & 0xFF)); } cbRemaining--; } /* } */ } return CoderResult.UNDERFLOW; } final static char[] arr = { 0x001C,0x001B,0x007F,0x001D,0x001E,0x001F, 0x0020,0x0021,0x0022,0x0023,0x0024,0x0025,0x0026,0x0027, 0x0028,0x0029,0x002A,0x002B,0x002C,0x002D,0x002E,0x002F, 0x0030,0x0031,0x0032,0x0033,0x0034,0x0035,0x0036,0x0037, 0x0038,0x0039,0x003A,0x003B,0x003C,0x003D,0x003E,0x003F, 0x0040,0x0041,0x0042,0x0043,0x0044,0x0045,0x0046,0x0047, 0x0048,0x0049,0x004A,0x004B,0x004C,0x004D,0x004E,0x004F, 0x0050,0x0051,0x0052,0x0053,0x0054,0x0055,0x0056,0x0057, 0x0058,0x0059,0x005A,0x005B,0x005C,0x005D,0x005E,0x005F, 0x0060,0x0061,0x0062,0x0063,0x0064,0x0065,0x0066,0x0067, 0x0068,0x0069,0x006A,0x006B,0x006C,0x006D,0x006E,0x006F, 0x0070,0x0071,0x0072,0x0073,0x0074,0x0075,0x0076,0x0077, 0x0078,0x0079,0x007A,0x007B,0x007C,0x007D,0x007E,0x001A, 0x00C7,0x00FC,0x00E9,0x00E2,0x00E4,0x00E0,0x00E5,0x00E7, 0x00EA,0x00EB,0x00E8,0x00EF,0x00EE,0x00EC,0x00C4,0x00C5, 0x00C9,0x00E6,0x00C6,0x00F4,0x00F6,0x00F2,0x00FB,0x00F9, 0x00FF,0x00D6,0x00DC,0x00A2,0x00A3,0x00A5,0x20A7,0x0192, 0x00E1,0x00ED,0x00F3,0x00FA,0x00F1,0x00D1,0x00AA,0x00BA, 0x00BF,0x2310,0x00AC,0x00BD,0x00BC,0x00A1,0x00AB,0x00BB, 0x2591,0x2592,0x2593,0x2502,0x2524,0x2561,0x2562,0x2556, 0x2555,0x2563,0x2551,0x2557,0x255D,0x255C,0x255B,0x2510, 0x2514,0x2534,0x252C,0x251C,0x2500,0x253C,0x255E,0x255F, 0x255A,0x2554,0x2569,0x2566,0x2560,0x2550,0x256C,0x2567, 0x2568,0x2564,0x2565,0x2559,0x2558,0x2552,0x2553,0x256B, 0x256A,0x2518,0x250C,0x2588,0x2584,0x258C,0x2590,0x2580, 0x03B1,0x00DF,0x0393,0x03C0,0x03A3,0x03C3,0x03BC,0x03C4, 0x03A6,0x0398,0x03A9,0x03B4,0x221E,0x03C6,0x03B5,0x2229, 0x2261,0x00B1,0x2265,0x2264,0x2320,0x2321,0x00F7,0x2248, 0x00B0,0x2219,0x00B7,0x221A,0x207F,0x00B2,0x25A0,0x00A0 }; } private static final class Encoder extends CharsetEncoder{ private Encoder(Charset cs){ super(cs, 1, 1); } private native void nEncode(long outAddr, int absolutePos, char[] array, int arrPosition, int[] res); protected CoderResult encodeLoop(CharBuffer cb, ByteBuffer bb){ int bbRemaining = bb.remaining(); /* TODO: support direct byte buffers if(CharsetProviderImpl.hasLoadedNatives() && bb.isDirect() && cb.hasRemaining() && cb.hasArray()){ int toProceed = cb.remaining(); int cbPos = cb.position(); int bbPos = bb.position(); boolean throwOverflow = false; if( bbRemaining < toProceed ) { toProceed = bbRemaining; throwOverflow = true; } int[] res = {toProceed, 0}; nEncode(AddressUtil.getDirectBufferAddress(bb), bbPos, cb.array(), cb.arrayOffset()+cbPos, res); if( res[0] <= 0 ) { bb.position(bbPos-res[0]); cb.position(cbPos-res[0]); if(res[1]!=0) { if(res[1] < 0) return CoderResult.malformedForLength(-res[1]); else return CoderResult.unmappableForLength(res[1]); } }else{ bb.position(bbPos+res[0]); cb.position(cbPos+res[0]); if(throwOverflow) return CoderResult.OVERFLOW; } }else{ */ if(bb.hasArray() && cb.hasArray()) { byte[] byteArr = bb.array(); char[] charArr = cb.array(); int rem = cb.remaining(); int byteArrStart = bb.position(); rem = bbRemaining <= rem ? bbRemaining : rem; int x; for(x = cb.position(); x < cb.position()+rem; x++) { char c = charArr[x]; if(c > (char)0x25A0){ if (c >= 0xD800 && c <= 0xDFFF) { if(x+1 < cb.limit()) { char c1 = charArr[x+1]; if(c1 >= 0xD800 && c1 <= 0xDFFF) { cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(2); } } else { cb.position(x); bb.position(byteArrStart); return CoderResult.UNDERFLOW; } cb.position(x); bb.position(byteArrStart); return CoderResult.malformedForLength(1); } cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); }else{ if(c < 0x1A) { byteArr[byteArrStart++] = (byte)c; } else { int index = (int)c >> 8; index = encodeIndex[index]; if(index < 0) { cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); } index <<= 8; index += (int)c & 0xFF; if((byte)arr[index] != 0){ byteArr[byteArrStart++] = (byte)arr[index]; }else{ cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); } } } } cb.position(x); bb.position(byteArrStart); if(rem == bbRemaining && cb.hasRemaining()) { return CoderResult.OVERFLOW; } } else { while(cb.hasRemaining()){ if( bbRemaining == 0 ) return CoderResult.OVERFLOW; char c = cb.get(); if(c > (char)0x25A0){ if (c >= 0xD800 && c <= 0xDFFF) { if(cb.hasRemaining()) { char c1 = cb.get(); if(c1 >= 0xD800 && c1 <= 0xDFFF) { cb.position(cb.position()-2); return CoderResult.unmappableForLength(2); } else { cb.position(cb.position()-1); } } else { cb.position(cb.position()-1); return CoderResult.UNDERFLOW; } cb.position(cb.position()-1); return CoderResult.malformedForLength(1); } cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); }else{ if(c < 0x1A) { bb.put((byte)c); } else { int index = (int)c >> 8; index = encodeIndex[index]; if(index < 0) { cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); } index <<= 8; index += (int)c & 0xFF; if((byte)arr[index] != 0){ bb.put((byte)arr[index]); }else{ cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); } } bbRemaining--; } } /* TODO: support direct byte buffers } */ } return CoderResult.UNDERFLOW; } final static char arr[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F, 0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x7F,0x1B,0x1A,0x1D,0x1E,0x1F, 0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27,0x28,0x29,0x2A,0x2B,0x2C,0x2D,0x2E,0x2F, 0x30,0x31,0x32,0x33,0x34,0x35,0x36,0x37,0x38,0x39,0x3A,0x3B,0x3C,0x3D,0x3E,0x3F, 0x40,0x41,0x42,0x43,0x44,0x45,0x46,0x47,0x48,0x49,0x4A,0x4B,0x4C,0x4D,0x4E,0x4F, 0x50,0x51,0x52,0x53,0x54,0x55,0x56,0x57,0x58,0x59,0x5A,0x5B,0x5C,0x5D,0x5E,0x5F, 0x60,0x61,0x62,0x63,0x64,0x65,0x66,0x67,0x68,0x69,0x6A,0x6B,0x6C,0x6D,0x6E,0x6F, 0x70,0x71,0x72,0x73,0x74,0x75,0x76,0x77,0x78,0x79,0x7A,0x7B,0x7C,0x7D,0x7E,0x1C, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xFF,0xAD,0x9B,0x9C,0x00,0x9D,0x00,0x00,0x00,0x00,0xA6,0xAE,0xAA,0x00,0x00,0x00, 0xF8,0xF1,0xFD,0x00,0x00,0x00,0x00,0xFA,0x00,0x00,0xA7,0xAF,0xAC,0xAB,0x00,0xA8, 0x00,0x00,0x00,0x00,0x8E,0x8F,0x92,0x80,0x00,0x90,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xA5,0x00,0x00,0x00,0x00,0x99,0x00,0x00,0x00,0x00,0x00,0x9A,0x00,0x00,0xE1, 0x85,0xA0,0x83,0x00,0x84,0x86,0x91,0x87,0x8A,0x82,0x88,0x89,0x8D,0xA1,0x8C,0x8B, 0x00,0xA4,0x95,0xA2,0x93,0x00,0x94,0xF6,0x00,0x97,0xA3,0x96,0x81,0x00,0x00,0x98, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x9F,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0xE2,0x00,0x00,0x00,0x00,0xE9,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0xE4,0x00,0x00,0xE8,0x00,0x00,0xEA,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xE0,0x00,0x00,0xEB,0xEE,0x00,0x00,0x00,0x00,0x00,0x00,0xE6,0x00,0x00,0x00, 0xE3,0x00,0x00,0xE5,0xE7,0x00,0xED,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xFC, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x9E,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xF9,0xFB,0x00,0x00,0x00,0xEC,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xEF,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xF7,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xF0,0x00,0x00,0xF3,0xF2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xA9,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xF4,0xF5,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xC4,0x00,0xB3,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xDA,0x00,0x00,0x00, 0xBF,0x00,0x00,0x00,0xC0,0x00,0x00,0x00,0xD9,0x00,0x00,0x00,0xC3,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0xB4,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xC2,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0xC1,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xC5,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xCD,0xBA,0xD5,0xD6,0xC9,0xB8,0xB7,0xBB,0xD4,0xD3,0xC8,0xBE,0xBD,0xBC,0xC6,0xC7, 0xCC,0xB5,0xB6,0xB9,0xD1,0xD2,0xCB,0xCF,0xD0,0xCA,0xD8,0xD7,0xCE,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xDF,0x00,0x00,0x00,0xDC,0x00,0x00,0x00,0xDB,0x00,0x00,0x00,0xDD,0x00,0x00,0x00, 0xDE,0xB0,0xB1,0xB2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xFE,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }; final static int[] encodeIndex = { 0,1,-1,2,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, 3,-1,4,5,-1,6,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1 }; } }
1031868817-aaaa
src/org/apache/harmony/niochar/charset/additional/IBM437.java
Java
asf20
27,504
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.util.Arrays; import java.util.List; import org.connectbot.util.Colors; import org.connectbot.util.HostDatabase; import org.connectbot.util.UberColorPickerDialog; import org.connectbot.util.UberColorPickerDialog.OnColorChangedListener; import android.app.Activity; import android.content.Context; import android.graphics.Canvas; import android.graphics.Paint; import android.os.Bundle; import android.view.Menu; import android.view.MenuItem; import android.view.View; import android.view.ViewGroup; import android.view.MenuItem.OnMenuItemClickListener; import android.widget.AdapterView; import android.widget.BaseAdapter; import android.widget.GridView; import android.widget.Spinner; import android.widget.AdapterView.OnItemClickListener; import android.widget.AdapterView.OnItemSelectedListener; /** * @author Kenny Root * */ public class ColorsActivity extends Activity implements OnItemClickListener, OnColorChangedListener, OnItemSelectedListener { private GridView mColorGrid; private Spinner mFgSpinner; private Spinner mBgSpinner; private int mColorScheme; private List<Integer> mColorList; private HostDatabase hostdb; private int mCurrentColor = 0; private int[] mDefaultColors; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); setContentView(R.layout.act_colors); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_colors))); mColorScheme = HostDatabase.DEFAULT_COLOR_SCHEME; hostdb = new HostDatabase(this); mColorList = Arrays.asList(hostdb.getColorsForScheme(mColorScheme)); mDefaultColors = hostdb.getDefaultColorsForScheme(mColorScheme); mColorGrid = (GridView) findViewById(R.id.color_grid); mColorGrid.setAdapter(new ColorsAdapter(true)); mColorGrid.setOnItemClickListener(this); mColorGrid.setSelection(0); mFgSpinner = (Spinner) findViewById(R.id.fg); mFgSpinner.setAdapter(new ColorsAdapter(false)); mFgSpinner.setSelection(mDefaultColors[0]); mFgSpinner.setOnItemSelectedListener(this); mBgSpinner = (Spinner) findViewById(R.id.bg); mBgSpinner.setAdapter(new ColorsAdapter(false)); mBgSpinner.setSelection(mDefaultColors[1]); mBgSpinner.setOnItemSelectedListener(this); } @Override protected void onDestroy() { super.onDestroy(); if (hostdb != null) { hostdb.close(); hostdb = null; } } @Override protected void onResume() { super.onResume(); if (hostdb == null) hostdb = new HostDatabase(this); } private class ColorsAdapter extends BaseAdapter { private boolean mSquareViews; public ColorsAdapter(boolean squareViews) { mSquareViews = squareViews; } public View getView(int position, View convertView, ViewGroup parent) { ColorView c; if (convertView == null) { c = new ColorView(ColorsActivity.this, mSquareViews); } else { c = (ColorView) convertView; } c.setColor(mColorList.get(position)); c.setNumber(position + 1); return c; } public int getCount() { return mColorList.size(); } public Object getItem(int position) { return mColorList.get(position); } public long getItemId(int position) { return position; } } private class ColorView extends View { private boolean mSquare; private Paint mTextPaint; private Paint mShadowPaint; // Things we paint private int mBackgroundColor; private String mText; private int mAscent; private int mWidthCenter; private int mHeightCenter; public ColorView(Context context, boolean square) { super(context); mSquare = square; mTextPaint = new Paint(); mTextPaint.setAntiAlias(true); mTextPaint.setTextSize(16); mTextPaint.setColor(0xFFFFFFFF); mTextPaint.setTextAlign(Paint.Align.CENTER); mShadowPaint = new Paint(mTextPaint); mShadowPaint.setStyle(Paint.Style.STROKE); mShadowPaint.setStrokeCap(Paint.Cap.ROUND); mShadowPaint.setStrokeJoin(Paint.Join.ROUND); mShadowPaint.setStrokeWidth(4f); mShadowPaint.setColor(0xFF000000); setPadding(10, 10, 10, 10); } public void setColor(int color) { mBackgroundColor = color; } public void setNumber(int number) { mText = Integer.toString(number); } @Override protected void onMeasure(int widthMeasureSpec, int heightMeasureSpec) { int width = measureWidth(widthMeasureSpec); int height; if (mSquare) height = width; else height = measureHeight(heightMeasureSpec); mAscent = (int) mTextPaint.ascent(); mWidthCenter = width / 2; mHeightCenter = height / 2 - mAscent / 2; setMeasuredDimension(width, height); } private int measureWidth(int measureSpec) { int result = 0; int specMode = MeasureSpec.getMode(measureSpec); int specSize = MeasureSpec.getSize(measureSpec); if (specMode == MeasureSpec.EXACTLY) { // We were told how big to be result = specSize; } else { // Measure the text result = (int) mTextPaint.measureText(mText) + getPaddingLeft() + getPaddingRight(); if (specMode == MeasureSpec.AT_MOST) { // Respect AT_MOST value if that was what is called for by // measureSpec result = Math.min(result, specSize); } } return result; } private int measureHeight(int measureSpec) { int result = 0; int specMode = MeasureSpec.getMode(measureSpec); int specSize = MeasureSpec.getSize(measureSpec); mAscent = (int) mTextPaint.ascent(); if (specMode == MeasureSpec.EXACTLY) { // We were told how big to be result = specSize; } else { // Measure the text (beware: ascent is a negative number) result = (int) (-mAscent + mTextPaint.descent()) + getPaddingTop() + getPaddingBottom(); if (specMode == MeasureSpec.AT_MOST) { // Respect AT_MOST value if that was what is called for by // measureSpec result = Math.min(result, specSize); } } return result; } @Override protected void onDraw(Canvas canvas) { super.onDraw(canvas); canvas.drawColor(mBackgroundColor); canvas.drawText(mText, mWidthCenter, mHeightCenter, mShadowPaint); canvas.drawText(mText, mWidthCenter, mHeightCenter, mTextPaint); } } private void editColor(int colorNumber) { mCurrentColor = colorNumber; new UberColorPickerDialog(this, this, mColorList.get(colorNumber)).show(); } public void onItemClick(AdapterView<?> parent, View view, int position, long id) { editColor(position); } public void onNothingSelected(AdapterView<?> arg0) { } public void colorChanged(int value) { hostdb.setGlobalColor(mCurrentColor, value); mColorList.set(mCurrentColor, value); mColorGrid.invalidateViews(); } public void onItemSelected(AdapterView<?> parent, View view, int position, long id) { boolean needUpdate = false; if (parent == mFgSpinner) { if (position != mDefaultColors[0]) { mDefaultColors[0] = position; needUpdate = true; } } else if (parent == mBgSpinner) { if (position != mDefaultColors[1]) { mDefaultColors[1] = position; needUpdate = true; } } if (needUpdate) hostdb.setDefaultColorsForScheme(mColorScheme, mDefaultColors[0], mDefaultColors[1]); } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); MenuItem reset = menu.add(R.string.menu_colors_reset); reset.setAlphabeticShortcut('r'); reset.setNumericShortcut('1'); reset.setIcon(android.R.drawable.ic_menu_revert); reset.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem arg0) { // Reset each individual color to defaults. for (int i = 0; i < Colors.defaults.length; i++) { if (mColorList.get(i) != Colors.defaults[i]) { hostdb.setGlobalColor(i, Colors.defaults[i]); mColorList.set(i, Colors.defaults[i]); } } mColorGrid.invalidateViews(); // Reset the default FG/BG colors as well. mFgSpinner.setSelection(HostDatabase.DEFAULT_FG_COLOR); mBgSpinner.setSelection(HostDatabase.DEFAULT_BG_COLOR); hostdb.setDefaultColorsForScheme(HostDatabase.DEFAULT_COLOR_SCHEME, HostDatabase.DEFAULT_FG_COLOR, HostDatabase.DEFAULT_BG_COLOR); return true; } }); return true; } }
1031868817-aaaa
src/org/connectbot/ColorsActivity.java
Java
asf20
8,959
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; public interface BridgeDisconnectedListener { public void onDisconnected(TerminalBridge bridge); }
1031868817-aaaa
src/org/connectbot/service/BridgeDisconnectedListener.java
Java
asf20
813
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import org.connectbot.util.PreferenceConstants; import android.app.backup.BackupManager; import android.content.Context; /** * @author kroot * */ public abstract class BackupWrapper { public static BackupWrapper getInstance() { if (PreferenceConstants.PRE_FROYO) return PreFroyo.Holder.sInstance; else return FroyoAndBeyond.Holder.sInstance; } public abstract void onDataChanged(Context context); private static class PreFroyo extends BackupWrapper { private static class Holder { private static final PreFroyo sInstance = new PreFroyo(); } @Override public void onDataChanged(Context context) { // do nothing for now } } private static class FroyoAndBeyond extends BackupWrapper { private static class Holder { private static final FroyoAndBeyond sInstance = new FroyoAndBeyond(); } private static BackupManager mBackupManager; @Override public void onDataChanged(Context context) { checkBackupManager(context); if (mBackupManager != null) { mBackupManager.dataChanged(); } } private void checkBackupManager(Context context) { if (mBackupManager == null) { mBackupManager = new BackupManager(context); } } } }
1031868817-aaaa
src/org/connectbot/service/BackupWrapper.java
Java
asf20
1,911
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.io.IOException; import java.nio.ByteBuffer; import java.nio.CharBuffer; import java.nio.charset.Charset; import java.nio.charset.CharsetDecoder; import java.nio.charset.CoderResult; import java.nio.charset.CodingErrorAction; import org.apache.harmony.niochar.charset.additional.IBM437; import org.connectbot.transport.AbsTransport; import org.connectbot.util.EastAsianWidth; import android.util.Log; import de.mud.terminal.vt320; /** * @author Kenny Root */ public class Relay implements Runnable { private static final String TAG = "ConnectBot.Relay"; private static final int BUFFER_SIZE = 4096; private TerminalBridge bridge; private Charset currentCharset; private CharsetDecoder decoder; private AbsTransport transport; private vt320 buffer; private ByteBuffer byteBuffer; private CharBuffer charBuffer; private byte[] byteArray; private char[] charArray; public Relay(TerminalBridge bridge, AbsTransport transport, vt320 buffer, String encoding) { setCharset(encoding); this.bridge = bridge; this.transport = transport; this.buffer = buffer; } public void setCharset(String encoding) { Log.d("ConnectBot.Relay", "changing charset to " + encoding); Charset charset; if (encoding.equals("CP437")) charset = new IBM437("IBM437", new String[] { "IBM437", "CP437" }); else charset = Charset.forName(encoding); if (charset == currentCharset || charset == null) return; CharsetDecoder newCd = charset.newDecoder(); newCd.onUnmappableCharacter(CodingErrorAction.REPLACE); newCd.onMalformedInput(CodingErrorAction.REPLACE); currentCharset = charset; synchronized (this) { decoder = newCd; } } public Charset getCharset() { return currentCharset; } public void run() { byteBuffer = ByteBuffer.allocate(BUFFER_SIZE); charBuffer = CharBuffer.allocate(BUFFER_SIZE); /* for East Asian character widths */ byte[] wideAttribute = new byte[BUFFER_SIZE]; byteArray = byteBuffer.array(); charArray = charBuffer.array(); CoderResult result; int bytesRead = 0; byteBuffer.limit(0); int bytesToRead; int offset; int charWidth; EastAsianWidth measurer = EastAsianWidth.getInstance(); try { while (true) { charWidth = bridge.charWidth; bytesToRead = byteBuffer.capacity() - byteBuffer.limit(); offset = byteBuffer.arrayOffset() + byteBuffer.limit(); bytesRead = transport.read(byteArray, offset, bytesToRead); if (bytesRead > 0) { byteBuffer.limit(byteBuffer.limit() + bytesRead); synchronized (this) { result = decoder.decode(byteBuffer, charBuffer, false); } if (result.isUnderflow() && byteBuffer.limit() == byteBuffer.capacity()) { byteBuffer.compact(); byteBuffer.limit(byteBuffer.position()); byteBuffer.position(0); } offset = charBuffer.position(); measurer.measure(charArray, 0, offset, wideAttribute, bridge.defaultPaint, charWidth); buffer.putString(charArray, wideAttribute, 0, charBuffer.position()); charBuffer.clear(); bridge.redraw(); } } } catch (IOException e) { Log.e(TAG, "Problem while handling incoming data in relay thread", e); } } }
1031868817-aaaa
src/org/connectbot/service/Relay.java
Java
asf20
3,909
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.io.IOException; import org.connectbot.util.HostDatabase; import org.connectbot.util.PreferenceConstants; import org.connectbot.util.PubkeyDatabase; import android.app.backup.BackupAgentHelper; import android.app.backup.BackupDataInput; import android.app.backup.BackupDataOutput; import android.app.backup.FileBackupHelper; import android.app.backup.SharedPreferencesBackupHelper; import android.os.ParcelFileDescriptor; import android.util.Log; /** * @author kroot * */ public class BackupAgent extends BackupAgentHelper { @Override public void onCreate() { Log.d("ConnectBot.BackupAgent", "onCreate called"); SharedPreferencesBackupHelper prefs = new SharedPreferencesBackupHelper(this, getPackageName() + "_preferences"); addHelper(PreferenceConstants.BACKUP_PREF_KEY, prefs); FileBackupHelper hosts = new FileBackupHelper(this, "../databases/" + HostDatabase.DB_NAME); addHelper(HostDatabase.DB_NAME, hosts); FileBackupHelper pubkeys = new FileBackupHelper(this, "../databases/" + PubkeyDatabase.DB_NAME); addHelper(PubkeyDatabase.DB_NAME, pubkeys); } @Override public void onBackup(ParcelFileDescriptor oldState, BackupDataOutput data, ParcelFileDescriptor newState) throws IOException { synchronized (HostDatabase.dbLock) { super.onBackup(oldState, data, newState); } } @Override public void onRestore(BackupDataInput data, int appVersionCode, ParcelFileDescriptor newState) throws IOException { Log.d("ConnectBot.BackupAgent", "onRestore called"); synchronized (HostDatabase.dbLock) { Log.d("ConnectBot.BackupAgent", "onRestore in-lock"); super.onRestore(data, appVersionCode, newState); } } }
1031868817-aaaa
src/org/connectbot/service/BackupAgent.java
Java
asf20
2,398
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; /** * @author Kenny Root * */ public interface FontSizeChangedListener { /** * @param size * new font size */ void onFontSizeChanged(float size); }
1031868817-aaaa
src/org/connectbot/service/FontSizeChangedListener.java
Java
asf20
884
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.util.concurrent.Semaphore; import android.os.Handler; import android.os.Message; /** * Helps provide a relay for prompts and responses between a possible user * interface and some underlying service. * * @author jsharkey */ public class PromptHelper { private final Object tag; private Handler handler = null; private Semaphore promptToken; private Semaphore promptResponse; public String promptInstructions = null; public String promptHint = null; public Object promptRequested = null; private Object response = null; public PromptHelper(Object tag) { this.tag = tag; // Threads must acquire this before they can send a prompt. promptToken = new Semaphore(1); // Responses will release this semaphore. promptResponse = new Semaphore(0); } /** * Register a user interface handler, if available. */ public void setHandler(Handler handler) { this.handler = handler; } /** * Set an incoming value from an above user interface. Will automatically * notify any waiting requests. */ public void setResponse(Object value) { response = value; promptRequested = null; promptInstructions = null; promptHint = null; promptResponse.release(); } /** * Return the internal response value just before erasing and returning it. */ protected Object popResponse() { Object value = response; response = null; return value; } /** * Request a prompt response from parent. This is a blocking call until user * interface returns a value. * Only one thread can call this at a time. cancelPrompt() will force this to * immediately return. */ private Object requestPrompt(String instructions, String hint, Object type) throws InterruptedException { Object response = null; promptToken.acquire(); try { promptInstructions = instructions; promptHint = hint; promptRequested = type; // notify any parent watching for live events if (handler != null) Message.obtain(handler, -1, tag).sendToTarget(); // acquire lock until user passes back value promptResponse.acquire(); response = popResponse(); } finally { promptToken.release(); } return response; } /** * Request a string response from parent. This is a blocking call until user * interface returns a value. * @param hint prompt hint for user to answer * @return string user has entered */ public String requestStringPrompt(String instructions, String hint) { String value = null; try { value = (String)this.requestPrompt(instructions, hint, String.class); } catch(Exception e) { } return value; } /** * Request a boolean response from parent. This is a blocking call until user * interface returns a value. * @param hint prompt hint for user to answer * @return choice user has made (yes/no) */ public Boolean requestBooleanPrompt(String instructions, String hint) { Boolean value = null; try { value = (Boolean)this.requestPrompt(instructions, hint, Boolean.class); } catch(Exception e) { } return value; } /** * Cancel an in-progress prompt. */ public void cancelPrompt() { if (!promptToken.tryAcquire()) { // A thread has the token, so try to interrupt it response = null; promptResponse.release(); } else { // No threads have acquired the token promptToken.release(); } } }
1031868817-aaaa
src/org/connectbot/service/PromptHelper.java
Java
asf20
4,054
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.io.IOException; import org.connectbot.TerminalView; import org.connectbot.bean.SelectionArea; import org.connectbot.util.PreferenceConstants; import android.content.SharedPreferences; import android.content.SharedPreferences.OnSharedPreferenceChangeListener; import android.content.res.Configuration; import android.preference.PreferenceManager; import android.text.ClipboardManager; import android.util.Log; import android.view.KeyCharacterMap; import android.view.KeyEvent; import android.view.View; import android.view.View.OnKeyListener; import de.mud.terminal.VDUBuffer; import de.mud.terminal.vt320; /** * @author kenny * */ @SuppressWarnings("deprecation") // for ClipboardManager public class TerminalKeyListener implements OnKeyListener, OnSharedPreferenceChangeListener { private static final String TAG = "ConnectBot.OnKeyListener"; public final static int META_CTRL_ON = 0x01; public final static int META_CTRL_LOCK = 0x02; public final static int META_ALT_ON = 0x04; public final static int META_ALT_LOCK = 0x08; public final static int META_SHIFT_ON = 0x10; public final static int META_SHIFT_LOCK = 0x20; public final static int META_SLASH = 0x40; public final static int META_TAB = 0x80; // The bit mask of momentary and lock states for each public final static int META_CTRL_MASK = META_CTRL_ON | META_CTRL_LOCK; public final static int META_ALT_MASK = META_ALT_ON | META_ALT_LOCK; public final static int META_SHIFT_MASK = META_SHIFT_ON | META_SHIFT_LOCK; // backport constants from api level 11 public final static int KEYCODE_ESCAPE = 111; public final static int HC_META_CTRL_ON = 4096; // All the transient key codes public final static int META_TRANSIENT = META_CTRL_ON | META_ALT_ON | META_SHIFT_ON; private final TerminalManager manager; private final TerminalBridge bridge; private final VDUBuffer buffer; private String keymode = null; private boolean hardKeyboard = false; private int metaState = 0; private int mDeadKey = 0; // TODO add support for the new API. private ClipboardManager clipboard = null; private boolean selectingForCopy = false; private final SelectionArea selectionArea; private String encoding; private final SharedPreferences prefs; public TerminalKeyListener(TerminalManager manager, TerminalBridge bridge, VDUBuffer buffer, String encoding) { this.manager = manager; this.bridge = bridge; this.buffer = buffer; this.encoding = encoding; selectionArea = new SelectionArea(); prefs = PreferenceManager.getDefaultSharedPreferences(manager); prefs.registerOnSharedPreferenceChangeListener(this); hardKeyboard = (manager.res.getConfiguration().keyboard == Configuration.KEYBOARD_QWERTY); updateKeymode(); } /** * Handle onKey() events coming down from a {@link TerminalView} above us. * Modify the keys to make more sense to a host then pass it to the transport. */ public boolean onKey(View v, int keyCode, KeyEvent event) { try { final boolean hardKeyboardHidden = manager.hardKeyboardHidden; // Ignore all key-up events except for the special keys if (event.getAction() == KeyEvent.ACTION_UP) { // There's nothing here for virtual keyboard users. if (!hardKeyboard || (hardKeyboard && hardKeyboardHidden)) return false; // skip keys if we aren't connected yet or have been disconnected if (bridge.isDisconnected() || bridge.transport == null) return false; if (PreferenceConstants.KEYMODE_RIGHT.equals(keymode)) { if (keyCode == KeyEvent.KEYCODE_ALT_RIGHT && (metaState & META_SLASH) != 0) { metaState &= ~(META_SLASH | META_TRANSIENT); bridge.transport.write('/'); return true; } else if (keyCode == KeyEvent.KEYCODE_SHIFT_RIGHT && (metaState & META_TAB) != 0) { metaState &= ~(META_TAB | META_TRANSIENT); bridge.transport.write(0x09); return true; } } else if (PreferenceConstants.KEYMODE_LEFT.equals(keymode)) { if (keyCode == KeyEvent.KEYCODE_ALT_LEFT && (metaState & META_SLASH) != 0) { metaState &= ~(META_SLASH | META_TRANSIENT); bridge.transport.write('/'); return true; } else if (keyCode == KeyEvent.KEYCODE_SHIFT_LEFT && (metaState & META_TAB) != 0) { metaState &= ~(META_TAB | META_TRANSIENT); bridge.transport.write(0x09); return true; } } return false; } // check for terminal resizing keys if (keyCode == KeyEvent.KEYCODE_VOLUME_UP) { bridge.increaseFontSize(); return true; } else if(keyCode == KeyEvent.KEYCODE_VOLUME_DOWN) { bridge.decreaseFontSize(); return true; } // skip keys if we aren't connected yet or have been disconnected if (bridge.isDisconnected() || bridge.transport == null) return false; bridge.resetScrollPosition(); if (keyCode == KeyEvent.KEYCODE_UNKNOWN && event.getAction() == KeyEvent.ACTION_MULTIPLE) { byte[] input = event.getCharacters().getBytes(encoding); bridge.transport.write(input); return true; } int curMetaState = event.getMetaState(); final int orgMetaState = curMetaState; if ((metaState & META_SHIFT_MASK) != 0) { curMetaState |= KeyEvent.META_SHIFT_ON; } if ((metaState & META_ALT_MASK) != 0) { curMetaState |= KeyEvent.META_ALT_ON; } int key = event.getUnicodeChar(curMetaState); // no hard keyboard? ALT-k should pass through to below if ((orgMetaState & KeyEvent.META_ALT_ON) != 0 && (!hardKeyboard || hardKeyboardHidden)) { key = 0; } if ((key & KeyCharacterMap.COMBINING_ACCENT) != 0) { mDeadKey = key & KeyCharacterMap.COMBINING_ACCENT_MASK; return true; } if (mDeadKey != 0) { key = KeyCharacterMap.getDeadChar(mDeadKey, keyCode); mDeadKey = 0; } final boolean printing = (key != 0); // otherwise pass through to existing session // print normal keys if (printing) { metaState &= ~(META_SLASH | META_TAB); // Remove shift and alt modifiers final int lastMetaState = metaState; metaState &= ~(META_SHIFT_ON | META_ALT_ON); if (metaState != lastMetaState) { bridge.redraw(); } if ((metaState & META_CTRL_MASK) != 0) { metaState &= ~META_CTRL_ON; bridge.redraw(); // If there is no hard keyboard or there is a hard keyboard currently hidden, // CTRL-1 through CTRL-9 will send F1 through F9 if ((!hardKeyboard || (hardKeyboard && hardKeyboardHidden)) && sendFunctionKey(keyCode)) return true; key = keyAsControl(key); } // handle pressing f-keys if ((hardKeyboard && !hardKeyboardHidden) && (curMetaState & KeyEvent.META_SHIFT_ON) != 0 && sendFunctionKey(keyCode)) return true; if (key < 0x80) bridge.transport.write(key); else // TODO write encoding routine that doesn't allocate each time bridge.transport.write(new String(Character.toChars(key)) .getBytes(encoding)); return true; } // send ctrl and meta-keys as appropriate if (!hardKeyboard || hardKeyboardHidden) { int k = event.getUnicodeChar(0); int k0 = k; boolean sendCtrl = false; boolean sendMeta = false; if (k != 0) { if ((orgMetaState & HC_META_CTRL_ON) != 0) { k = keyAsControl(k); if (k != k0) sendCtrl = true; // send F1-F10 via CTRL-1 through CTRL-0 if (!sendCtrl && sendFunctionKey(keyCode)) return true; } else if ((orgMetaState & KeyEvent.META_ALT_ON) != 0) { sendMeta = true; sendEscape(); } if (sendMeta || sendCtrl) { bridge.transport.write(k); return true; } } } // try handling keymode shortcuts if (hardKeyboard && !hardKeyboardHidden && event.getRepeatCount() == 0) { if (PreferenceConstants.KEYMODE_RIGHT.equals(keymode)) { switch (keyCode) { case KeyEvent.KEYCODE_ALT_RIGHT: metaState |= META_SLASH; return true; case KeyEvent.KEYCODE_SHIFT_RIGHT: metaState |= META_TAB; return true; case KeyEvent.KEYCODE_SHIFT_LEFT: metaPress(META_SHIFT_ON); return true; case KeyEvent.KEYCODE_ALT_LEFT: metaPress(META_ALT_ON); return true; } } else if (PreferenceConstants.KEYMODE_LEFT.equals(keymode)) { switch (keyCode) { case KeyEvent.KEYCODE_ALT_LEFT: metaState |= META_SLASH; return true; case KeyEvent.KEYCODE_SHIFT_LEFT: metaState |= META_TAB; return true; case KeyEvent.KEYCODE_SHIFT_RIGHT: metaPress(META_SHIFT_ON); return true; case KeyEvent.KEYCODE_ALT_RIGHT: metaPress(META_ALT_ON); return true; } } else { switch (keyCode) { case KeyEvent.KEYCODE_ALT_LEFT: case KeyEvent.KEYCODE_ALT_RIGHT: metaPress(META_ALT_ON); return true; case KeyEvent.KEYCODE_SHIFT_LEFT: case KeyEvent.KEYCODE_SHIFT_RIGHT: metaPress(META_SHIFT_ON); return true; } } } // look for special chars switch(keyCode) { case KEYCODE_ESCAPE: sendEscape(); return true; case KeyEvent.KEYCODE_TAB: bridge.transport.write(0x09); return true; case KeyEvent.KEYCODE_CAMERA: // check to see which shortcut the camera button triggers String camera = manager.prefs.getString( PreferenceConstants.CAMERA, PreferenceConstants.CAMERA_CTRLA_SPACE); if(PreferenceConstants.CAMERA_CTRLA_SPACE.equals(camera)) { bridge.transport.write(0x01); bridge.transport.write(' '); } else if(PreferenceConstants.CAMERA_CTRLA.equals(camera)) { bridge.transport.write(0x01); } else if(PreferenceConstants.CAMERA_ESC.equals(camera)) { ((vt320)buffer).keyTyped(vt320.KEY_ESCAPE, ' ', 0); } else if(PreferenceConstants.CAMERA_ESC_A.equals(camera)) { ((vt320)buffer).keyTyped(vt320.KEY_ESCAPE, ' ', 0); bridge.transport.write('a'); } break; case KeyEvent.KEYCODE_DEL: ((vt320) buffer).keyPressed(vt320.KEY_BACK_SPACE, ' ', getStateForBuffer()); metaState &= ~META_TRANSIENT; return true; case KeyEvent.KEYCODE_ENTER: ((vt320)buffer).keyTyped(vt320.KEY_ENTER, ' ', 0); metaState &= ~META_TRANSIENT; return true; case KeyEvent.KEYCODE_DPAD_LEFT: if (selectingForCopy) { selectionArea.decrementColumn(); bridge.redraw(); } else { ((vt320) buffer).keyPressed(vt320.KEY_LEFT, ' ', getStateForBuffer()); metaState &= ~META_TRANSIENT; bridge.tryKeyVibrate(); } return true; case KeyEvent.KEYCODE_DPAD_UP: if (selectingForCopy) { selectionArea.decrementRow(); bridge.redraw(); } else { ((vt320) buffer).keyPressed(vt320.KEY_UP, ' ', getStateForBuffer()); metaState &= ~META_TRANSIENT; bridge.tryKeyVibrate(); } return true; case KeyEvent.KEYCODE_DPAD_DOWN: if (selectingForCopy) { selectionArea.incrementRow(); bridge.redraw(); } else { ((vt320) buffer).keyPressed(vt320.KEY_DOWN, ' ', getStateForBuffer()); metaState &= ~META_TRANSIENT; bridge.tryKeyVibrate(); } return true; case KeyEvent.KEYCODE_DPAD_RIGHT: if (selectingForCopy) { selectionArea.incrementColumn(); bridge.redraw(); } else { ((vt320) buffer).keyPressed(vt320.KEY_RIGHT, ' ', getStateForBuffer()); metaState &= ~META_TRANSIENT; bridge.tryKeyVibrate(); } return true; case KeyEvent.KEYCODE_DPAD_CENTER: if (selectingForCopy) { if (selectionArea.isSelectingOrigin()) selectionArea.finishSelectingOrigin(); else { if (clipboard != null) { // copy selected area to clipboard String copiedText = selectionArea.copyFrom(buffer); clipboard.setText(copiedText); // XXX STOPSHIP // manager.notifyUser(manager.getString( // R.string.console_copy_done, // copiedText.length())); selectingForCopy = false; selectionArea.reset(); } } } else { if ((metaState & META_CTRL_ON) != 0) { sendEscape(); metaState &= ~META_CTRL_ON; } else metaPress(META_CTRL_ON); } bridge.redraw(); return true; } } catch (IOException e) { Log.e(TAG, "Problem while trying to handle an onKey() event", e); try { bridge.transport.flush(); } catch (IOException ioe) { Log.d(TAG, "Our transport was closed, dispatching disconnect event"); bridge.dispatchDisconnect(false); } } catch (NullPointerException npe) { Log.d(TAG, "Input before connection established ignored."); return true; } return false; } public int keyAsControl(int key) { // Support CTRL-a through CTRL-z if (key >= 0x61 && key <= 0x7A) key -= 0x60; // Support CTRL-A through CTRL-_ else if (key >= 0x41 && key <= 0x5F) key -= 0x40; // CTRL-space sends NULL else if (key == 0x20) key = 0x00; // CTRL-? sends DEL else if (key == 0x3F) key = 0x7F; return key; } public void sendEscape() { ((vt320)buffer).keyTyped(vt320.KEY_ESCAPE, ' ', 0); } /** * @param key * @return successful */ private boolean sendFunctionKey(int keyCode) { switch (keyCode) { case KeyEvent.KEYCODE_1: ((vt320) buffer).keyPressed(vt320.KEY_F1, ' ', 0); return true; case KeyEvent.KEYCODE_2: ((vt320) buffer).keyPressed(vt320.KEY_F2, ' ', 0); return true; case KeyEvent.KEYCODE_3: ((vt320) buffer).keyPressed(vt320.KEY_F3, ' ', 0); return true; case KeyEvent.KEYCODE_4: ((vt320) buffer).keyPressed(vt320.KEY_F4, ' ', 0); return true; case KeyEvent.KEYCODE_5: ((vt320) buffer).keyPressed(vt320.KEY_F5, ' ', 0); return true; case KeyEvent.KEYCODE_6: ((vt320) buffer).keyPressed(vt320.KEY_F6, ' ', 0); return true; case KeyEvent.KEYCODE_7: ((vt320) buffer).keyPressed(vt320.KEY_F7, ' ', 0); return true; case KeyEvent.KEYCODE_8: ((vt320) buffer).keyPressed(vt320.KEY_F8, ' ', 0); return true; case KeyEvent.KEYCODE_9: ((vt320) buffer).keyPressed(vt320.KEY_F9, ' ', 0); return true; case KeyEvent.KEYCODE_0: ((vt320) buffer).keyPressed(vt320.KEY_F10, ' ', 0); return true; default: return false; } } /** * Handle meta key presses where the key can be locked on. * <p> * 1st press: next key to have meta state<br /> * 2nd press: meta state is locked on<br /> * 3rd press: disable meta state * * @param code */ public void metaPress(int code) { if ((metaState & (code << 1)) != 0) { metaState &= ~(code << 1); } else if ((metaState & code) != 0) { metaState &= ~code; metaState |= code << 1; } else metaState |= code; bridge.redraw(); } public void setTerminalKeyMode(String keymode) { this.keymode = keymode; } private int getStateForBuffer() { int bufferState = 0; if ((metaState & META_CTRL_MASK) != 0) bufferState |= vt320.KEY_CONTROL; if ((metaState & META_SHIFT_MASK) != 0) bufferState |= vt320.KEY_SHIFT; if ((metaState & META_ALT_MASK) != 0) bufferState |= vt320.KEY_ALT; return bufferState; } public int getMetaState() { return metaState; } public int getDeadKey() { return mDeadKey; } public void setClipboardManager(ClipboardManager clipboard) { this.clipboard = clipboard; } public void onSharedPreferenceChanged(SharedPreferences sharedPreferences, String key) { if (PreferenceConstants.KEYMODE.equals(key)) { updateKeymode(); } } private void updateKeymode() { keymode = prefs.getString(PreferenceConstants.KEYMODE, PreferenceConstants.KEYMODE_RIGHT); } public void setCharset(String encoding) { this.encoding = encoding; } }
1031868817-aaaa
src/org/connectbot/service/TerminalKeyListener.java
Java
asf20
16,393
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.io.IOException; import java.lang.ref.WeakReference; import java.security.PrivateKey; import java.security.PublicKey; import java.util.Arrays; import java.util.HashMap; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Timer; import java.util.TimerTask; import java.util.Map.Entry; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.bean.PubkeyBean; import org.connectbot.transport.TransportFactory; import org.connectbot.util.HostDatabase; import org.connectbot.util.PreferenceConstants; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.app.Service; import android.content.Context; import android.content.Intent; import android.content.SharedPreferences; import android.content.SharedPreferences.OnSharedPreferenceChangeListener; import android.content.res.AssetFileDescriptor; import android.content.res.Configuration; import android.content.res.Resources; import android.media.AudioManager; import android.media.MediaPlayer; import android.media.MediaPlayer.OnCompletionListener; import android.net.Uri; import android.os.Binder; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.os.Vibrator; import android.preference.PreferenceManager; import android.util.Log; import com.nullwire.trace.ExceptionHandler; /** * Manager for SSH connections that runs as a background service. This service * holds a list of currently connected SSH bridges that are ready for connection * up to a GUI if needed. * * @author jsharkey */ public class TerminalManager extends Service implements BridgeDisconnectedListener, OnSharedPreferenceChangeListener { public final static String TAG = "ConnectBot.TerminalManager"; public List<TerminalBridge> bridges = new LinkedList<TerminalBridge>(); public Map<HostBean, WeakReference<TerminalBridge>> mHostBridgeMap = new HashMap<HostBean, WeakReference<TerminalBridge>>(); public Map<String, WeakReference<TerminalBridge>> mNicknameBridgeMap = new HashMap<String, WeakReference<TerminalBridge>>(); public TerminalBridge defaultBridge = null; public List<HostBean> disconnected = new LinkedList<HostBean>(); public Handler disconnectHandler = null; public Map<String, KeyHolder> loadedKeypairs = new HashMap<String, KeyHolder>(); public Resources res; public HostDatabase hostdb; public PubkeyDatabase pubkeydb; protected SharedPreferences prefs; final private IBinder binder = new TerminalBinder(); private ConnectivityReceiver connectivityManager; private MediaPlayer mediaPlayer; private Timer pubkeyTimer; private Timer idleTimer; private final long IDLE_TIMEOUT = 300000; // 5 minutes private Vibrator vibrator; private volatile boolean wantKeyVibration; public static final long VIBRATE_DURATION = 30; private boolean wantBellVibration; private boolean resizeAllowed = true; private boolean savingKeys; protected List<WeakReference<TerminalBridge>> mPendingReconnect = new LinkedList<WeakReference<TerminalBridge>>(); public boolean hardKeyboardHidden; @Override public void onCreate() { Log.i(TAG, "Starting background service"); ExceptionHandler.register(this); prefs = PreferenceManager.getDefaultSharedPreferences(this); prefs.registerOnSharedPreferenceChangeListener(this); res = getResources(); pubkeyTimer = new Timer("pubkeyTimer", true); hostdb = new HostDatabase(this); pubkeydb = new PubkeyDatabase(this); // load all marked pubkeys into memory updateSavingKeys(); List<PubkeyBean> pubkeys = pubkeydb.getAllStartPubkeys(); for (PubkeyBean pubkey : pubkeys) { try { PrivateKey privKey = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType()); PublicKey pubKey = PubkeyUtils.decodePublic(pubkey.getPublicKey(), pubkey.getType()); Object trileadKey = PubkeyUtils.convertToTrilead(privKey, pubKey); addKey(pubkey, trileadKey); } catch (Exception e) { Log.d(TAG, String.format("Problem adding key '%s' to in-memory cache", pubkey.getNickname()), e); } } vibrator = (Vibrator) getSystemService(Context.VIBRATOR_SERVICE); wantKeyVibration = prefs.getBoolean(PreferenceConstants.BUMPY_ARROWS, true); wantBellVibration = prefs.getBoolean(PreferenceConstants.BELL_VIBRATE, true); enableMediaPlayer(); hardKeyboardHidden = (res.getConfiguration().hardKeyboardHidden == Configuration.HARDKEYBOARDHIDDEN_YES); final boolean lockingWifi = prefs.getBoolean(PreferenceConstants.WIFI_LOCK, true); connectivityManager = new ConnectivityReceiver(this, lockingWifi); } private void updateSavingKeys() { savingKeys = prefs.getBoolean(PreferenceConstants.MEMKEYS, true); } @Override public void onDestroy() { Log.i(TAG, "Destroying background service"); disconnectAll(true); if(hostdb != null) { hostdb.close(); hostdb = null; } if(pubkeydb != null) { pubkeydb.close(); pubkeydb = null; } synchronized (this) { if (idleTimer != null) idleTimer.cancel(); if (pubkeyTimer != null) pubkeyTimer.cancel(); } connectivityManager.cleanup(); ConnectionNotifier.getInstance().hideRunningNotification(this); disableMediaPlayer(); } /** * Disconnect all currently connected bridges. */ private void disconnectAll(final boolean immediate) { TerminalBridge[] tmpBridges = null; synchronized (bridges) { if (bridges.size() > 0) { tmpBridges = bridges.toArray(new TerminalBridge[bridges.size()]); } } if (tmpBridges != null) { // disconnect and dispose of any existing bridges for (int i = 0; i < tmpBridges.length; i++) tmpBridges[i].dispatchDisconnect(immediate); } } /** * Open a new SSH session using the given parameters. */ private TerminalBridge openConnection(HostBean host) throws IllegalArgumentException, IOException { // throw exception if terminal already open if (getConnectedBridge(host) != null) { throw new IllegalArgumentException("Connection already open for that nickname"); } TerminalBridge bridge = new TerminalBridge(this, host); bridge.setOnDisconnectedListener(this); bridge.startConnection(); synchronized (bridges) { bridges.add(bridge); WeakReference<TerminalBridge> wr = new WeakReference<TerminalBridge>(bridge); mHostBridgeMap.put(bridge.host, wr); mNicknameBridgeMap.put(bridge.host.getNickname(), wr); } synchronized (disconnected) { disconnected.remove(bridge.host); } if (bridge.isUsingNetwork()) { connectivityManager.incRef(); } if (prefs.getBoolean(PreferenceConstants.CONNECTION_PERSIST, true)) { ConnectionNotifier.getInstance().showRunningNotification(this); } // also update database with new connected time touchHost(host); return bridge; } public String getEmulation() { return prefs.getString(PreferenceConstants.EMULATION, "screen"); } public int getScrollback() { int scrollback = 140; try { scrollback = Integer.parseInt(prefs.getString(PreferenceConstants.SCROLLBACK, "140")); } catch(Exception e) { } return scrollback; } /** * Open a new connection by reading parameters from the given URI. Follows * format specified by an individual transport. */ public TerminalBridge openConnection(Uri uri) throws Exception { HostBean host = TransportFactory.findHost(hostdb, uri); if (host == null) host = TransportFactory.getTransport(uri.getScheme()).createHost(uri); return openConnection(host); } /** * Update the last-connected value for the given nickname by passing through * to {@link HostDatabase}. */ private void touchHost(HostBean host) { hostdb.touchHost(host); } /** * Find a connected {@link TerminalBridge} with the given HostBean. * * @param host the HostBean to search for * @return TerminalBridge that uses the HostBean */ public TerminalBridge getConnectedBridge(HostBean host) { WeakReference<TerminalBridge> wr = mHostBridgeMap.get(host); if (wr != null) { return wr.get(); } else { return null; } } /** * Find a connected {@link TerminalBridge} using its nickname. * * @param nickname * @return TerminalBridge that matches nickname */ public TerminalBridge getConnectedBridge(final String nickname) { if (nickname == null) { return null; } WeakReference<TerminalBridge> wr = mNicknameBridgeMap.get(nickname); if (wr != null) { return wr.get(); } else { return null; } } /** * Called by child bridge when somehow it's been disconnected. */ public void onDisconnected(TerminalBridge bridge) { boolean shouldHideRunningNotification = false; synchronized (bridges) { // remove this bridge from our list bridges.remove(bridge); mHostBridgeMap.remove(bridge.host); mNicknameBridgeMap.remove(bridge.host.getNickname()); if (bridge.isUsingNetwork()) { connectivityManager.decRef(); } if (bridges.size() == 0 && mPendingReconnect.size() == 0) { shouldHideRunningNotification = true; } } synchronized (disconnected) { disconnected.add(bridge.host); } if (shouldHideRunningNotification) { ConnectionNotifier.getInstance().hideRunningNotification(this); } // pass notification back up to gui if (disconnectHandler != null) Message.obtain(disconnectHandler, -1, bridge).sendToTarget(); } public boolean isKeyLoaded(String nickname) { return loadedKeypairs.containsKey(nickname); } public void addKey(PubkeyBean pubkey, Object trileadKey) { addKey(pubkey, trileadKey, false); } public void addKey(PubkeyBean pubkey, Object trileadKey, boolean force) { if (!savingKeys && !force) return; removeKey(pubkey.getNickname()); byte[] sshPubKey = PubkeyUtils.extractOpenSSHPublic(trileadKey); KeyHolder keyHolder = new KeyHolder(); keyHolder.bean = pubkey; keyHolder.trileadKey = trileadKey; keyHolder.openSSHPubkey = sshPubKey; loadedKeypairs.put(pubkey.getNickname(), keyHolder); if (pubkey.getLifetime() > 0) { final String nickname = pubkey.getNickname(); pubkeyTimer.schedule(new TimerTask() { @Override public void run() { Log.d(TAG, "Unloading from memory key: " + nickname); removeKey(nickname); } }, pubkey.getLifetime() * 1000); } Log.d(TAG, String.format("Added key '%s' to in-memory cache", pubkey.getNickname())); } public boolean removeKey(String nickname) { Log.d(TAG, String.format("Removed key '%s' to in-memory cache", nickname)); return loadedKeypairs.remove(nickname) != null; } public boolean removeKey(byte[] publicKey) { String nickname = null; for (Entry<String,KeyHolder> entry : loadedKeypairs.entrySet()) { if (Arrays.equals(entry.getValue().openSSHPubkey, publicKey)) { nickname = entry.getKey(); break; } } if (nickname != null) { Log.d(TAG, String.format("Removed key '%s' to in-memory cache", nickname)); return removeKey(nickname); } else return false; } public Object getKey(String nickname) { if (loadedKeypairs.containsKey(nickname)) { KeyHolder keyHolder = loadedKeypairs.get(nickname); return keyHolder.trileadKey; } else return null; } public Object getKey(byte[] publicKey) { for (KeyHolder keyHolder : loadedKeypairs.values()) { if (Arrays.equals(keyHolder.openSSHPubkey, publicKey)) return keyHolder.trileadKey; } return null; } public String getKeyNickname(byte[] publicKey) { for (Entry<String,KeyHolder> entry : loadedKeypairs.entrySet()) { if (Arrays.equals(entry.getValue().openSSHPubkey, publicKey)) return entry.getKey(); } return null; } private void stopWithDelay() { // TODO add in a way to check whether keys loaded are encrypted and only // set timer when we have an encrypted key loaded if (loadedKeypairs.size() > 0) { synchronized (this) { if (idleTimer == null) idleTimer = new Timer("idleTimer", true); idleTimer.schedule(new IdleTask(), IDLE_TIMEOUT); } } else { Log.d(TAG, "Stopping background service immediately"); stopSelf(); } } protected void stopNow() { if (bridges.size() == 0) { stopSelf(); } } private synchronized void stopIdleTimer() { if (idleTimer != null) { idleTimer.cancel(); idleTimer = null; } } public class TerminalBinder extends Binder { public TerminalManager getService() { return TerminalManager.this; } } @Override public IBinder onBind(Intent intent) { Log.i(TAG, "Someone bound to TerminalManager"); setResizeAllowed(true); stopIdleTimer(); // Make sure we stay running to maintain the bridges startService(new Intent(this, TerminalManager.class)); return binder; } @Override public int onStartCommand(Intent intent, int flags, int startId) { /* * We want this service to continue running until it is explicitly * stopped, so return sticky. */ return START_STICKY; } @Override public void onRebind(Intent intent) { super.onRebind(intent); setResizeAllowed(true); Log.i(TAG, "Someone rebound to TerminalManager"); stopIdleTimer(); } @Override public boolean onUnbind(Intent intent) { Log.i(TAG, "Someone unbound from TerminalManager"); setResizeAllowed(true); if (bridges.size() == 0) { stopWithDelay(); } return true; } private class IdleTask extends TimerTask { /* (non-Javadoc) * @see java.util.TimerTask#run() */ @Override public void run() { Log.d(TAG, String.format("Stopping service after timeout of ~%d seconds", IDLE_TIMEOUT / 1000)); TerminalManager.this.stopNow(); } } public void tryKeyVibrate() { if (wantKeyVibration) vibrate(); } private void vibrate() { if (vibrator != null) vibrator.vibrate(VIBRATE_DURATION); } private void enableMediaPlayer() { mediaPlayer = new MediaPlayer(); float volume = prefs.getFloat(PreferenceConstants.BELL_VOLUME, PreferenceConstants.DEFAULT_BELL_VOLUME); mediaPlayer.setAudioStreamType(AudioManager.STREAM_NOTIFICATION); mediaPlayer.setOnCompletionListener(new BeepListener()); AssetFileDescriptor file = res.openRawResourceFd(R.raw.bell); try { mediaPlayer.setDataSource(file.getFileDescriptor(), file .getStartOffset(), file.getLength()); file.close(); mediaPlayer.setVolume(volume, volume); mediaPlayer.prepare(); } catch (IOException e) { Log.e(TAG, "Error setting up bell media player", e); } } private void disableMediaPlayer() { if (mediaPlayer != null) { mediaPlayer.release(); mediaPlayer = null; } } public void playBeep() { if (mediaPlayer != null) mediaPlayer.start(); if (wantBellVibration) vibrate(); } private static class BeepListener implements OnCompletionListener { public void onCompletion(MediaPlayer mp) { mp.seekTo(0); } } /** * Send system notification to user for a certain host. When user selects * the notification, it will bring them directly to the ConsoleActivity * displaying the host. * * @param host */ public void sendActivityNotification(HostBean host) { if (!prefs.getBoolean(PreferenceConstants.BELL_NOTIFICATION, false)) return; ConnectionNotifier.getInstance().showActivityNotification(this, host); } /* (non-Javadoc) * @see android.content.SharedPreferences.OnSharedPreferenceChangeListener#onSharedPreferenceChanged(android.content.SharedPreferences, java.lang.String) */ public void onSharedPreferenceChanged(SharedPreferences sharedPreferences, String key) { if (PreferenceConstants.BELL.equals(key)) { boolean wantAudible = sharedPreferences.getBoolean( PreferenceConstants.BELL, true); if (wantAudible && mediaPlayer == null) enableMediaPlayer(); else if (!wantAudible && mediaPlayer != null) disableMediaPlayer(); } else if (PreferenceConstants.BELL_VOLUME.equals(key)) { if (mediaPlayer != null) { float volume = sharedPreferences.getFloat( PreferenceConstants.BELL_VOLUME, PreferenceConstants.DEFAULT_BELL_VOLUME); mediaPlayer.setVolume(volume, volume); } } else if (PreferenceConstants.BELL_VIBRATE.equals(key)) { wantBellVibration = sharedPreferences.getBoolean( PreferenceConstants.BELL_VIBRATE, true); } else if (PreferenceConstants.BUMPY_ARROWS.equals(key)) { wantKeyVibration = sharedPreferences.getBoolean( PreferenceConstants.BUMPY_ARROWS, true); } else if (PreferenceConstants.WIFI_LOCK.equals(key)) { final boolean lockingWifi = prefs.getBoolean(PreferenceConstants.WIFI_LOCK, true); connectivityManager.setWantWifiLock(lockingWifi); } else if (PreferenceConstants.MEMKEYS.equals(key)) { updateSavingKeys(); } } /** * Allow {@link TerminalBridge} to resize when the parent has changed. * @param resizeAllowed */ public void setResizeAllowed(boolean resizeAllowed) { this.resizeAllowed = resizeAllowed; } public boolean isResizeAllowed() { return resizeAllowed; } public static class KeyHolder { public PubkeyBean bean; public Object trileadKey; public byte[] openSSHPubkey; } /** * Called when connectivity to the network is lost and it doesn't appear * we'll be getting a different connection any time soon. */ public void onConnectivityLost() { final Thread t = new Thread() { @Override public void run() { disconnectAll(false); } }; t.setName("Disconnector"); t.start(); } /** * Called when connectivity to the network is restored. */ public void onConnectivityRestored() { final Thread t = new Thread() { @Override public void run() { reconnectPending(); } }; t.setName("Reconnector"); t.start(); } /** * Insert request into reconnect queue to be executed either immediately * or later when connectivity is restored depending on whether we're * currently connected. * * @param bridge the TerminalBridge to reconnect when possible */ public void requestReconnect(TerminalBridge bridge) { synchronized (mPendingReconnect) { mPendingReconnect.add(new WeakReference<TerminalBridge>(bridge)); if (!bridge.isUsingNetwork() || connectivityManager.isConnected()) { reconnectPending(); } } } /** * Reconnect all bridges that were pending a reconnect when connectivity * was lost. */ private void reconnectPending() { synchronized (mPendingReconnect) { for (WeakReference<TerminalBridge> ref : mPendingReconnect) { TerminalBridge bridge = ref.get(); if (bridge == null) { continue; } bridge.startConnection(); } mPendingReconnect.clear(); } } }
1031868817-aaaa
src/org/connectbot/service/TerminalManager.java
Java
asf20
19,234
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.lang.reflect.InvocationTargetException; import java.lang.reflect.Method; import org.connectbot.ConsoleActivity; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.util.HostDatabase; import org.connectbot.util.PreferenceConstants; import android.app.Notification; import android.app.NotificationManager; import android.app.PendingIntent; import android.app.Service; import android.content.Context; import android.content.Intent; import android.content.res.Resources; import android.graphics.Color; /** * @author Kenny Root * * Based on the concept from jasta's blog post. */ public abstract class ConnectionNotifier { private static final int ONLINE_NOTIFICATION = 1; private static final int ACTIVITY_NOTIFICATION = 2; public static ConnectionNotifier getInstance() { if (PreferenceConstants.PRE_ECLAIR) return PreEclair.Holder.sInstance; else return EclairAndBeyond.Holder.sInstance; } protected NotificationManager getNotificationManager(Context context) { return (NotificationManager)context.getSystemService(Context.NOTIFICATION_SERVICE); } protected Notification newNotification(Context context) { Notification notification = new Notification(); notification.icon = R.drawable.notification_icon; notification.when = System.currentTimeMillis(); return notification; } protected Notification newActivityNotification(Context context, HostBean host) { Notification notification = newNotification(context); Resources res = context.getResources(); String contentText = res.getString( R.string.notification_text, host.getNickname()); Intent notificationIntent = new Intent(context, ConsoleActivity.class); notificationIntent.setAction("android.intent.action.VIEW"); notificationIntent.setData(host.getUri()); PendingIntent contentIntent = PendingIntent.getActivity(context, 0, notificationIntent, 0); notification.setLatestEventInfo(context, res.getString(R.string.app_name), contentText, contentIntent); notification.flags = Notification.FLAG_AUTO_CANCEL; notification.flags |= Notification.DEFAULT_LIGHTS; if (HostDatabase.COLOR_RED.equals(host.getColor())) notification.ledARGB = Color.RED; else if (HostDatabase.COLOR_GREEN.equals(host.getColor())) notification.ledARGB = Color.GREEN; else if (HostDatabase.COLOR_BLUE.equals(host.getColor())) notification.ledARGB = Color.BLUE; else notification.ledARGB = Color.WHITE; notification.ledOnMS = 300; notification.ledOffMS = 1000; notification.flags |= Notification.FLAG_SHOW_LIGHTS; return notification; } protected Notification newRunningNotification(Context context) { Notification notification = newNotification(context); notification.flags = Notification.FLAG_ONGOING_EVENT | Notification.FLAG_NO_CLEAR; notification.when = 0; notification.contentIntent = PendingIntent.getActivity(context, ONLINE_NOTIFICATION, new Intent(context, ConsoleActivity.class), 0); Resources res = context.getResources(); notification.setLatestEventInfo(context, res.getString(R.string.app_name), res.getString(R.string.app_is_running), notification.contentIntent); return notification; } public void showActivityNotification(Service context, HostBean host) { getNotificationManager(context).notify(ACTIVITY_NOTIFICATION, newActivityNotification(context, host)); } public void hideActivityNotification(Service context) { getNotificationManager(context).cancel(ACTIVITY_NOTIFICATION); } public abstract void showRunningNotification(Service context); public abstract void hideRunningNotification(Service context); private static class PreEclair extends ConnectionNotifier { private static final Class<?>[] setForegroundSignature = new Class[] {boolean.class}; private Method setForeground = null; private static class Holder { private static final PreEclair sInstance = new PreEclair(); } public PreEclair() { try { setForeground = Service.class.getMethod("setForeground", setForegroundSignature); } catch (Exception e) { } } @Override public void showRunningNotification(Service context) { if (setForeground != null) { Object[] setForegroundArgs = new Object[1]; setForegroundArgs[0] = Boolean.TRUE; try { setForeground.invoke(context, setForegroundArgs); } catch (InvocationTargetException e) { } catch (IllegalAccessException e) { } getNotificationManager(context).notify(ONLINE_NOTIFICATION, newRunningNotification(context)); } } @Override public void hideRunningNotification(Service context) { if (setForeground != null) { Object[] setForegroundArgs = new Object[1]; setForegroundArgs[0] = Boolean.FALSE; try { setForeground.invoke(context, setForegroundArgs); } catch (InvocationTargetException e) { } catch (IllegalAccessException e) { } getNotificationManager(context).cancel(ONLINE_NOTIFICATION); } } } private static class EclairAndBeyond extends ConnectionNotifier { private static class Holder { private static final EclairAndBeyond sInstance = new EclairAndBeyond(); } @Override public void showRunningNotification(Service context) { context.startForeground(ONLINE_NOTIFICATION, newRunningNotification(context)); } @Override public void hideRunningNotification(Service context) { context.stopForeground(true); } } }
1031868817-aaaa
src/org/connectbot/service/ConnectionNotifier.java
Java
asf20
6,136
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.service; import java.io.IOException; import java.nio.charset.Charset; import java.util.LinkedList; import java.util.List; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.R; import org.connectbot.TerminalView; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.bean.SelectionArea; import org.connectbot.transport.AbsTransport; import org.connectbot.transport.TransportFactory; import org.connectbot.util.HostDatabase; import android.content.Context; import android.graphics.Bitmap; import android.graphics.Bitmap.Config; import android.graphics.Canvas; import android.graphics.Color; import android.graphics.Paint; import android.graphics.Paint.FontMetrics; import android.graphics.Typeface; import android.text.ClipboardManager; import android.util.Log; import de.mud.terminal.VDUBuffer; import de.mud.terminal.VDUDisplay; import de.mud.terminal.vt320; /** * Provides a bridge between a MUD terminal buffer and a possible TerminalView. * This separation allows us to keep the TerminalBridge running in a background * service. A TerminalView shares down a bitmap that we can use for rendering * when available. * * This class also provides SSH hostkey verification prompting, and password * prompting. */ @SuppressWarnings("deprecation") // for ClipboardManager public class TerminalBridge implements VDUDisplay { public final static String TAG = "ConnectBot.TerminalBridge"; public final static int DEFAULT_FONT_SIZE = 10; private final static int FONT_SIZE_STEP = 2; public Integer[] color; public int defaultFg = HostDatabase.DEFAULT_FG_COLOR; public int defaultBg = HostDatabase.DEFAULT_BG_COLOR; protected final TerminalManager manager; public HostBean host; /* package */ AbsTransport transport; final Paint defaultPaint; private Relay relay; private final String emulation; private final int scrollback; public Bitmap bitmap = null; public VDUBuffer buffer = null; private TerminalView parent = null; private final Canvas canvas = new Canvas(); private boolean disconnected = false; private boolean awaitingClose = false; private boolean forcedSize = false; private int columns; private int rows; /* package */ final TerminalKeyListener keyListener; private boolean selectingForCopy = false; private final SelectionArea selectionArea; // TODO add support for the new clipboard API private ClipboardManager clipboard; public int charWidth = -1; public int charHeight = -1; private int charTop = -1; private float fontSize = -1; private final List<FontSizeChangedListener> fontSizeChangedListeners; private final List<String> localOutput; /** * Flag indicating if we should perform a full-screen redraw during our next * rendering pass. */ private boolean fullRedraw = false; public PromptHelper promptHelper; protected BridgeDisconnectedListener disconnectListener = null; /** * Create a new terminal bridge suitable for unit testing. */ public TerminalBridge() { buffer = new vt320() { @Override public void write(byte[] b) {} @Override public void write(int b) {} @Override public void sendTelnetCommand(byte cmd) {} @Override public void setWindowSize(int c, int r) {} @Override public void debug(String s) {} }; emulation = null; manager = null; defaultPaint = new Paint(); selectionArea = new SelectionArea(); scrollback = 1; localOutput = new LinkedList<String>(); fontSizeChangedListeners = new LinkedList<FontSizeChangedListener>(); transport = null; keyListener = new TerminalKeyListener(manager, this, buffer, null); } /** * Create new terminal bridge with following parameters. We will immediately * launch thread to start SSH connection and handle any hostkey verification * and password authentication. */ public TerminalBridge(final TerminalManager manager, final HostBean host) throws IOException { this.manager = manager; this.host = host; emulation = manager.getEmulation(); scrollback = manager.getScrollback(); // create prompt helper to relay password and hostkey requests up to gui promptHelper = new PromptHelper(this); // create our default paint defaultPaint = new Paint(); defaultPaint.setAntiAlias(true); defaultPaint.setTypeface(Typeface.MONOSPACE); defaultPaint.setFakeBoldText(true); // more readable? localOutput = new LinkedList<String>(); fontSizeChangedListeners = new LinkedList<FontSizeChangedListener>(); int hostFontSize = host.getFontSize(); if (hostFontSize <= 0) hostFontSize = DEFAULT_FONT_SIZE; setFontSize(hostFontSize); // create terminal buffer and handle outgoing data // this is probably status reply information buffer = new vt320() { @Override public void debug(String s) { Log.d(TAG, s); } @Override public void write(byte[] b) { try { if (b != null && transport != null) transport.write(b); } catch (IOException e) { Log.e(TAG, "Problem writing outgoing data in vt320() thread", e); } } @Override public void write(int b) { try { if (transport != null) transport.write(b); } catch (IOException e) { Log.e(TAG, "Problem writing outgoing data in vt320() thread", e); } } // We don't use telnet sequences. @Override public void sendTelnetCommand(byte cmd) { } // We don't want remote to resize our window. @Override public void setWindowSize(int c, int r) { } @Override public void beep() { if (parent.isShown()) manager.playBeep(); else manager.sendActivityNotification(host); } }; // Don't keep any scrollback if a session is not being opened. if (host.getWantSession()) buffer.setBufferSize(scrollback); else buffer.setBufferSize(0); resetColors(); buffer.setDisplay(this); selectionArea = new SelectionArea(); keyListener = new TerminalKeyListener(manager, this, buffer, host.getEncoding()); } public PromptHelper getPromptHelper() { return promptHelper; } /** * Spawn thread to open connection and start login process. */ protected void startConnection() { transport = TransportFactory.getTransport(host.getProtocol()); transport.setBridge(this); transport.setManager(manager); transport.setHost(host); // TODO make this more abstract so we don't litter on AbsTransport transport.setCompression(host.getCompression()); transport.setUseAuthAgent(host.getUseAuthAgent()); transport.setEmulation(emulation); if (transport.canForwardPorts()) { for (PortForwardBean portForward : manager.hostdb.getPortForwardsForHost(host)) transport.addPortForward(portForward); } outputLine(manager.res.getString(R.string.terminal_connecting, host.getHostname(), host.getPort(), host.getProtocol())); Thread connectionThread = new Thread(new Runnable() { public void run() { transport.connect(); } }); connectionThread.setName("Connection"); connectionThread.setDaemon(true); connectionThread.start(); } /** * Handle challenges from keyboard-interactive authentication mode. */ public String[] replyToChallenge(String name, String instruction, int numPrompts, String[] prompt, boolean[] echo) { String[] responses = new String[numPrompts]; for(int i = 0; i < numPrompts; i++) { // request response from user for each prompt responses[i] = promptHelper.requestStringPrompt(instruction, prompt[i]); } return responses; } /** * @return charset in use by bridge */ public Charset getCharset() { return relay.getCharset(); } /** * Sets the encoding used by the terminal. If the connection is live, * then the character set is changed for the next read. * @param encoding the canonical name of the character encoding */ public void setCharset(String encoding) { if (relay != null) relay.setCharset(encoding); keyListener.setCharset(encoding); } /** * Convenience method for writing a line into the underlying MUD buffer. * Should never be called once the session is established. */ public final void outputLine(String line) { if (transport != null && transport.isSessionOpen()) Log.e(TAG, "Session established, cannot use outputLine!", new IOException("outputLine call traceback")); synchronized (localOutput) { final String s = line + "\r\n"; localOutput.add(s); ((vt320) buffer).putString(s); } } /** * Inject a specific string into this terminal. Used for post-login strings * and pasting clipboard. */ public void injectString(final String string) { if (string == null || string.length() == 0) return; Thread injectStringThread = new Thread(new Runnable() { public void run() { try { transport.write(string.getBytes(host.getEncoding())); } catch (Exception e) { Log.e(TAG, "Couldn't inject string to remote host: ", e); } } }); injectStringThread.setName("InjectString"); injectStringThread.start(); } /** * Internal method to request actual PTY terminal once we've finished * authentication. If called before authenticated, it will just fail. */ public void onConnected() { disconnected = false; ((vt320) buffer).reset(); // We no longer need our local output. localOutput.clear(); // previously tried vt100 and xterm for emulation modes // "screen" works the best for color and escape codes ((vt320) buffer).setAnswerBack(emulation); if (HostDatabase.DELKEY_BACKSPACE.equals(host.getDelKey())) ((vt320) buffer).setBackspace(vt320.DELETE_IS_BACKSPACE); else ((vt320) buffer).setBackspace(vt320.DELETE_IS_DEL); // create thread to relay incoming connection data to buffer relay = new Relay(this, transport, (vt320) buffer, host.getEncoding()); Thread relayThread = new Thread(relay); relayThread.setDaemon(true); relayThread.setName("Relay"); relayThread.start(); // force font-size to make sure we resizePTY as needed setFontSize(fontSize); // finally send any post-login string, if requested injectString(host.getPostLogin()); } /** * @return whether a session is open or not */ public boolean isSessionOpen() { if (transport != null) return transport.isSessionOpen(); return false; } public void setOnDisconnectedListener(BridgeDisconnectedListener disconnectListener) { this.disconnectListener = disconnectListener; } /** * Force disconnection of this terminal bridge. */ public void dispatchDisconnect(boolean immediate) { // We don't need to do this multiple times. synchronized (this) { if (disconnected && !immediate) return; disconnected = true; } // Cancel any pending prompts. promptHelper.cancelPrompt(); // disconnection request hangs if we havent really connected to a host yet // temporary fix is to just spawn disconnection into a thread Thread disconnectThread = new Thread(new Runnable() { public void run() { if (transport != null && transport.isConnected()) transport.close(); } }); disconnectThread.setName("Disconnect"); disconnectThread.start(); if (immediate) { awaitingClose = true; if (disconnectListener != null) disconnectListener.onDisconnected(TerminalBridge.this); } else { { final String line = manager.res.getString(R.string.alert_disconnect_msg); ((vt320) buffer).putString("\r\n" + line + "\r\n"); } if (host.getStayConnected()) { manager.requestReconnect(this); return; } Thread disconnectPromptThread = new Thread(new Runnable() { public void run() { Boolean result = promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_host_disconnected)); if (result == null || result.booleanValue()) { awaitingClose = true; // Tell the TerminalManager that we can be destroyed now. if (disconnectListener != null) disconnectListener.onDisconnected(TerminalBridge.this); } } }); disconnectPromptThread.setName("DisconnectPrompt"); disconnectPromptThread.setDaemon(true); disconnectPromptThread.start(); } } public void setSelectingForCopy(boolean selectingForCopy) { this.selectingForCopy = selectingForCopy; } public boolean isSelectingForCopy() { return selectingForCopy; } public SelectionArea getSelectionArea() { return selectionArea; } public synchronized void tryKeyVibrate() { manager.tryKeyVibrate(); } /** * Request a different font size. Will make call to parentChanged() to make * sure we resize PTY if needed. */ /* package */ final void setFontSize(float size) { if (size <= 0.0) return; defaultPaint.setTextSize(size); fontSize = size; // read new metrics to get exact pixel dimensions FontMetrics fm = defaultPaint.getFontMetrics(); charTop = (int)Math.ceil(fm.top); float[] widths = new float[1]; defaultPaint.getTextWidths("X", widths); charWidth = (int)Math.ceil(widths[0]); charHeight = (int)Math.ceil(fm.descent - fm.top); // refresh any bitmap with new font size if(parent != null) parentChanged(parent); for (FontSizeChangedListener ofscl : fontSizeChangedListeners) ofscl.onFontSizeChanged(size); host.setFontSize((int) fontSize); manager.hostdb.updateFontSize(host); forcedSize = false; } /** * Add an {@link FontSizeChangedListener} to the list of listeners for this * bridge. * * @param listener * listener to add */ public void addFontSizeChangedListener(FontSizeChangedListener listener) { fontSizeChangedListeners.add(listener); } /** * Remove an {@link FontSizeChangedListener} from the list of listeners for * this bridge. * * @param listener */ public void removeFontSizeChangedListener(FontSizeChangedListener listener) { fontSizeChangedListeners.remove(listener); } /** * Something changed in our parent {@link TerminalView}, maybe it's a new * parent, or maybe it's an updated font size. We should recalculate * terminal size information and request a PTY resize. */ public final synchronized void parentChanged(TerminalView parent) { if (manager != null && !manager.isResizeAllowed()) { Log.d(TAG, "Resize is not allowed now"); return; } this.parent = parent; final int width = parent.getWidth(); final int height = parent.getHeight(); // Something has gone wrong with our layout; we're 0 width or height! if (width <= 0 || height <= 0) return; clipboard = (ClipboardManager) parent.getContext().getSystemService(Context.CLIPBOARD_SERVICE); keyListener.setClipboardManager(clipboard); if (!forcedSize) { // recalculate buffer size int newColumns, newRows; newColumns = width / charWidth; newRows = height / charHeight; // If nothing has changed in the terminal dimensions and not an intial // draw then don't blow away scroll regions and such. if (newColumns == columns && newRows == rows) return; columns = newColumns; rows = newRows; } // reallocate new bitmap if needed boolean newBitmap = (bitmap == null); if(bitmap != null) newBitmap = (bitmap.getWidth() != width || bitmap.getHeight() != height); if (newBitmap) { discardBitmap(); bitmap = Bitmap.createBitmap(width, height, Config.ARGB_8888); canvas.setBitmap(bitmap); } // clear out any old buffer information defaultPaint.setColor(Color.BLACK); canvas.drawPaint(defaultPaint); // Stroke the border of the terminal if the size is being forced; if (forcedSize) { int borderX = (columns * charWidth) + 1; int borderY = (rows * charHeight) + 1; defaultPaint.setColor(Color.GRAY); defaultPaint.setStrokeWidth(0.0f); if (width >= borderX) canvas.drawLine(borderX, 0, borderX, borderY + 1, defaultPaint); if (height >= borderY) canvas.drawLine(0, borderY, borderX + 1, borderY, defaultPaint); } try { // request a terminal pty resize synchronized (buffer) { buffer.setScreenSize(columns, rows, true); } if(transport != null) transport.setDimensions(columns, rows, width, height); } catch(Exception e) { Log.e(TAG, "Problem while trying to resize screen or PTY", e); } // redraw local output if we don't have a sesson to receive our resize request if (transport == null) { synchronized (localOutput) { ((vt320) buffer).reset(); for (String line : localOutput) ((vt320) buffer).putString(line); } } // force full redraw with new buffer size fullRedraw = true; redraw(); parent.notifyUser(String.format("%d x %d", columns, rows)); Log.i(TAG, String.format("parentChanged() now width=%d, height=%d", columns, rows)); } /** * Somehow our parent {@link TerminalView} was destroyed. Now we don't need * to redraw anywhere, and we can recycle our internal bitmap. */ public synchronized void parentDestroyed() { parent = null; discardBitmap(); } private void discardBitmap() { if (bitmap != null) bitmap.recycle(); bitmap = null; } public void setVDUBuffer(VDUBuffer buffer) { this.buffer = buffer; } public VDUBuffer getVDUBuffer() { return buffer; } public void onDraw() { int fg, bg; synchronized (buffer) { boolean entireDirty = buffer.update[0] || fullRedraw; boolean isWideCharacter = false; // walk through all lines in the buffer for(int l = 0; l < buffer.height; l++) { // check if this line is dirty and needs to be repainted // also check for entire-buffer dirty flags if (!entireDirty && !buffer.update[l + 1]) continue; // reset dirty flag for this line buffer.update[l + 1] = false; // walk through all characters in this line for (int c = 0; c < buffer.width; c++) { int addr = 0; int currAttr = buffer.charAttributes[buffer.windowBase + l][c]; { int fgcolor = defaultFg; // check if foreground color attribute is set if ((currAttr & VDUBuffer.COLOR_FG) != 0) fgcolor = ((currAttr & VDUBuffer.COLOR_FG) >> VDUBuffer.COLOR_FG_SHIFT) - 1; if (fgcolor < 8 && (currAttr & VDUBuffer.BOLD) != 0) fg = color[fgcolor + 8]; else fg = color[fgcolor]; } // check if background color attribute is set if ((currAttr & VDUBuffer.COLOR_BG) != 0) bg = color[((currAttr & VDUBuffer.COLOR_BG) >> VDUBuffer.COLOR_BG_SHIFT) - 1]; else bg = color[defaultBg]; // support character inversion by swapping background and foreground color if ((currAttr & VDUBuffer.INVERT) != 0) { int swapc = bg; bg = fg; fg = swapc; } // set underlined attributes if requested defaultPaint.setUnderlineText((currAttr & VDUBuffer.UNDERLINE) != 0); isWideCharacter = (currAttr & VDUBuffer.FULLWIDTH) != 0; if (isWideCharacter) addr++; else { // determine the amount of continuous characters with the same settings and print them all at once while(c + addr < buffer.width && buffer.charAttributes[buffer.windowBase + l][c + addr] == currAttr) { addr++; } } // Save the current clip region canvas.save(Canvas.CLIP_SAVE_FLAG); // clear this dirty area with background color defaultPaint.setColor(bg); if (isWideCharacter) { canvas.clipRect(c * charWidth, l * charHeight, (c + 2) * charWidth, (l + 1) * charHeight); } else { canvas.clipRect(c * charWidth, l * charHeight, (c + addr) * charWidth, (l + 1) * charHeight); } canvas.drawPaint(defaultPaint); // write the text string starting at 'c' for 'addr' number of characters defaultPaint.setColor(fg); if((currAttr & VDUBuffer.INVISIBLE) == 0) canvas.drawText(buffer.charArray[buffer.windowBase + l], c, addr, c * charWidth, (l * charHeight) - charTop, defaultPaint); // Restore the previous clip region canvas.restore(); // advance to the next text block with different characteristics c += addr - 1; if (isWideCharacter) c++; } } // reset entire-buffer flags buffer.update[0] = false; } fullRedraw = false; } public void redraw() { if (parent != null) parent.postInvalidate(); } // We don't have a scroll bar. public void updateScrollBar() { } /** * Resize terminal to fit [rows]x[cols] in screen of size [width]x[height] * @param rows * @param cols * @param width * @param height */ public synchronized void resizeComputed(int cols, int rows, int width, int height) { float size = 8.0f; float step = 8.0f; float limit = 0.125f; int direction; while ((direction = fontSizeCompare(size, cols, rows, width, height)) < 0) size += step; if (direction == 0) { Log.d("fontsize", String.format("Found match at %f", size)); return; } step /= 2.0f; size -= step; while ((direction = fontSizeCompare(size, cols, rows, width, height)) != 0 && step >= limit) { step /= 2.0f; if (direction > 0) { size -= step; } else { size += step; } } if (direction > 0) size -= step; this.columns = cols; this.rows = rows; setFontSize(size); forcedSize = true; } private int fontSizeCompare(float size, int cols, int rows, int width, int height) { // read new metrics to get exact pixel dimensions defaultPaint.setTextSize(size); FontMetrics fm = defaultPaint.getFontMetrics(); float[] widths = new float[1]; defaultPaint.getTextWidths("X", widths); int termWidth = (int)widths[0] * cols; int termHeight = (int)Math.ceil(fm.descent - fm.top) * rows; Log.d("fontsize", String.format("font size %f resulted in %d x %d", size, termWidth, termHeight)); // Check to see if it fits in resolution specified. if (termWidth > width || termHeight > height) return 1; if (termWidth == width || termHeight == height) return 0; return -1; } /** * @return whether underlying transport can forward ports */ public boolean canFowardPorts() { return transport.canForwardPorts(); } /** * Adds the {@link PortForwardBean} to the list. * @param portForward the port forward bean to add * @return true on successful addition */ public boolean addPortForward(PortForwardBean portForward) { return transport.addPortForward(portForward); } /** * Removes the {@link PortForwardBean} from the list. * @param portForward the port forward bean to remove * @return true on successful removal */ public boolean removePortForward(PortForwardBean portForward) { return transport.removePortForward(portForward); } /** * @return the list of port forwards */ public List<PortForwardBean> getPortForwards() { return transport.getPortForwards(); } /** * Enables a port forward member. After calling this method, the port forward should * be operational. * @param portForward member of our current port forwards list to enable * @return true on successful port forward setup */ public boolean enablePortForward(PortForwardBean portForward) { if (!transport.isConnected()) { Log.i(TAG, "Attempt to enable port forward while not connected"); return false; } return transport.enablePortForward(portForward); } /** * Disables a port forward member. After calling this method, the port forward should * be non-functioning. * @param portForward member of our current port forwards list to enable * @return true on successful port forward tear-down */ public boolean disablePortForward(PortForwardBean portForward) { if (!transport.isConnected()) { Log.i(TAG, "Attempt to disable port forward while not connected"); return false; } return transport.disablePortForward(portForward); } /** * @return whether the TerminalBridge should close */ public boolean isAwaitingClose() { return awaitingClose; } /** * @return whether this connection had started and subsequently disconnected */ public boolean isDisconnected() { return disconnected; } /* (non-Javadoc) * @see de.mud.terminal.VDUDisplay#setColor(byte, byte, byte, byte) */ public void setColor(int index, int red, int green, int blue) { // Don't allow the system colors to be overwritten for now. May violate specs. if (index < color.length && index >= 16) color[index] = 0xff000000 | red << 16 | green << 8 | blue; } public final void resetColors() { int[] defaults = manager.hostdb.getDefaultColorsForScheme(HostDatabase.DEFAULT_COLOR_SCHEME); defaultFg = defaults[0]; defaultBg = defaults[1]; color = manager.hostdb.getColorsForScheme(HostDatabase.DEFAULT_COLOR_SCHEME); } private static Pattern urlPattern = null; /** * @return */ public List<String> scanForURLs() { List<String> urls = new LinkedList<String>(); if (urlPattern == null) { // based on http://www.ietf.org/rfc/rfc2396.txt String scheme = "[A-Za-z][-+.0-9A-Za-z]*"; String unreserved = "[-._~0-9A-Za-z]"; String pctEncoded = "%[0-9A-Fa-f]{2}"; String subDelims = "[!$&'()*+,;:=]"; String userinfo = "(?:" + unreserved + "|" + pctEncoded + "|" + subDelims + "|:)*"; String h16 = "[0-9A-Fa-f]{1,4}"; String decOctet = "(?:[0-9]|[1-9][0-9]|1[0-9]{2}|2[0-4][0-9]|25[0-5])"; String ipv4address = decOctet + "\\." + decOctet + "\\." + decOctet + "\\." + decOctet; String ls32 = "(?:" + h16 + ":" + h16 + "|" + ipv4address + ")"; String ipv6address = "(?:(?:" + h16 + "){6}" + ls32 + ")"; String ipvfuture = "v[0-9A-Fa-f]+.(?:" + unreserved + "|" + subDelims + "|:)+"; String ipLiteral = "\\[(?:" + ipv6address + "|" + ipvfuture + ")\\]"; String regName = "(?:" + unreserved + "|" + pctEncoded + "|" + subDelims + ")*"; String host = "(?:" + ipLiteral + "|" + ipv4address + "|" + regName + ")"; String port = "[0-9]*"; String authority = "(?:" + userinfo + "@)?" + host + "(?::" + port + ")?"; String pchar = "(?:" + unreserved + "|" + pctEncoded + "|" + subDelims + "|@)"; String segment = pchar + "*"; String pathAbempty = "(?:/" + segment + ")*"; String segmentNz = pchar + "+"; String pathAbsolute = "/(?:" + segmentNz + "(?:/" + segment + ")*)?"; String pathRootless = segmentNz + "(?:/" + segment + ")*"; String hierPart = "(?://" + authority + pathAbempty + "|" + pathAbsolute + "|" + pathRootless + ")"; String query = "(?:" + pchar + "|/|\\?)*"; String fragment = "(?:" + pchar + "|/|\\?)*"; String uriRegex = scheme + ":" + hierPart + "(?:" + query + ")?(?:#" + fragment + ")?"; urlPattern = Pattern.compile(uriRegex); } char[] visibleBuffer = new char[buffer.height * buffer.width]; for (int l = 0; l < buffer.height; l++) System.arraycopy(buffer.charArray[buffer.windowBase + l], 0, visibleBuffer, l * buffer.width, buffer.width); Matcher urlMatcher = urlPattern.matcher(new String(visibleBuffer)); while (urlMatcher.find()) urls.add(urlMatcher.group()); return urls; } /** * @return */ public boolean isUsingNetwork() { return transport.usesNetwork(); } /** * @return */ public TerminalKeyListener getKeyHandler() { return keyListener; } /** * */ public void resetScrollPosition() { // if we're in scrollback, scroll to bottom of window on input if (buffer.windowBase != buffer.screenBase) buffer.setWindowBase(buffer.screenBase); } /** * */ public void increaseFontSize() { setFontSize(fontSize + FONT_SIZE_STEP); } /** * */ public void decreaseFontSize() { setFontSize(fontSize - FONT_SIZE_STEP); } }
1031868817-aaaa
src/org/connectbot/service/TerminalBridge.java
Java
asf20
28,163
/** * */ package org.connectbot.service; import android.content.BroadcastReceiver; import android.content.Context; import android.content.Intent; import android.content.IntentFilter; import android.net.ConnectivityManager; import android.net.NetworkInfo; import android.net.NetworkInfo.State; import android.net.wifi.WifiManager; import android.net.wifi.WifiManager.WifiLock; import android.util.Log; /** * @author kroot * */ public class ConnectivityReceiver extends BroadcastReceiver { private static final String TAG = "ConnectBot.ConnectivityManager"; private boolean mIsConnected = false; final private TerminalManager mTerminalManager; final private WifiLock mWifiLock; private int mNetworkRef = 0; private boolean mLockingWifi; private Object[] mLock = new Object[0]; public ConnectivityReceiver(TerminalManager manager, boolean lockingWifi) { mTerminalManager = manager; final ConnectivityManager cm = (ConnectivityManager) manager.getSystemService(Context.CONNECTIVITY_SERVICE); final WifiManager wm = (WifiManager) manager.getSystemService(Context.WIFI_SERVICE); mWifiLock = wm.createWifiLock(TAG); final NetworkInfo info = cm.getActiveNetworkInfo(); if (info != null) { mIsConnected = (info.getState() == State.CONNECTED); } mLockingWifi = lockingWifi; final IntentFilter filter = new IntentFilter(); filter.addAction(ConnectivityManager.CONNECTIVITY_ACTION); manager.registerReceiver(this, filter); } /* (non-Javadoc) * @see android.content.BroadcastReceiver#onReceive(android.content.Context, android.content.Intent) */ @Override public void onReceive(Context context, Intent intent) { final String action = intent.getAction(); if (!action.equals(ConnectivityManager.CONNECTIVITY_ACTION)) { Log.w(TAG, "onReceived() called: " + intent); return; } boolean noConnectivity = intent.getBooleanExtra(ConnectivityManager.EXTRA_NO_CONNECTIVITY, false); boolean isFailover = intent.getBooleanExtra(ConnectivityManager.EXTRA_IS_FAILOVER, false); Log.d(TAG, "onReceived() called; noConnectivity? " + noConnectivity + "; isFailover? " + isFailover); if (noConnectivity && !isFailover && mIsConnected) { mIsConnected = false; mTerminalManager.onConnectivityLost(); } else if (!mIsConnected) { NetworkInfo info = (NetworkInfo) intent.getExtras() .get(ConnectivityManager.EXTRA_NETWORK_INFO); if (mIsConnected = (info.getState() == State.CONNECTED)) { mTerminalManager.onConnectivityRestored(); } } } /** * */ public void cleanup() { if (mWifiLock.isHeld()) mWifiLock.release(); mTerminalManager.unregisterReceiver(this); } /** * Increase the number of things using the network. Acquire a Wi-Fi lock * if necessary. */ public void incRef() { synchronized (mLock) { mNetworkRef += 1; acquireWifiLockIfNecessaryLocked(); } } /** * Decrease the number of things using the network. Release the Wi-Fi lock * if necessary. */ public void decRef() { synchronized (mLock) { mNetworkRef -= 1; releaseWifiLockIfNecessaryLocked(); } } /** * @param mLockingWifi */ public void setWantWifiLock(boolean lockingWifi) { synchronized (mLock) { mLockingWifi = lockingWifi; if (mLockingWifi) { acquireWifiLockIfNecessaryLocked(); } else { releaseWifiLockIfNecessaryLocked(); } } } private void acquireWifiLockIfNecessaryLocked() { if (mLockingWifi && mNetworkRef > 0 && !mWifiLock.isHeld()) { mWifiLock.acquire(); } } private void releaseWifiLockIfNecessaryLocked() { if (mNetworkRef == 0 && mWifiLock.isHeld()) { mWifiLock.release(); } } /** * @return whether we're connected to a network */ public boolean isConnected() { return mIsConnected; } }
1031868817-aaaa
src/org/connectbot/service/ConnectivityReceiver.java
Java
asf20
3,788
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.util.List; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import android.app.AlertDialog; import android.app.ListActivity; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.ServiceConnection; import android.content.res.Resources; import android.database.SQLException; import android.graphics.Paint; import android.os.Bundle; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.util.Log; import android.view.ContextMenu; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.View; import android.view.ViewGroup; import android.view.MenuItem.OnMenuItemClickListener; import android.widget.AdapterView; import android.widget.ArrayAdapter; import android.widget.EditText; import android.widget.ListView; import android.widget.Spinner; import android.widget.TextView; import android.widget.Toast; import android.widget.AdapterView.OnItemClickListener; import android.widget.AdapterView.OnItemSelectedListener; /** * List all portForwards for a particular host and provide a way for users to add more portForwards, * edit existing portForwards, and delete portForwards. * * @author Kenny Root */ public class PortForwardListActivity extends ListActivity { public final static String TAG = "ConnectBot.PortForwardListActivity"; private static final int LISTENER_CYCLE_TIME = 500; protected HostDatabase hostdb; private List<PortForwardBean> portForwards; private ServiceConnection connection = null; protected TerminalBridge hostBridge = null; protected LayoutInflater inflater = null; private HostBean host; @Override public void onStart() { super.onStart(); this.bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(this.hostdb == null) this.hostdb = new HostDatabase(this); } @Override public void onStop() { super.onStop(); this.unbindService(connection); if(this.hostdb != null) { this.hostdb.close(); this.hostdb = null; } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); long hostId = this.getIntent().getLongExtra(Intent.EXTRA_TITLE, -1); setContentView(R.layout.act_portforwardlist); // connect with hosts database and populate list this.hostdb = new HostDatabase(this); host = hostdb.findHostById(hostId); { final String nickname = host != null ? host.getNickname() : null; final Resources resources = getResources(); if (nickname != null) { this.setTitle(String.format("%s: %s (%s)", resources.getText(R.string.app_name), resources.getText(R.string.title_port_forwards_list), nickname)); } else { this.setTitle(String.format("%s: %s", resources.getText(R.string.app_name), resources.getText(R.string.title_port_forwards_list))); } } connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { TerminalManager bound = ((TerminalManager.TerminalBinder) service).getService(); hostBridge = bound.getConnectedBridge(host); updateHandler.sendEmptyMessage(-1); } public void onServiceDisconnected(ComponentName name) { hostBridge = null; } }; this.updateList(); this.registerForContextMenu(this.getListView()); this.getListView().setOnItemClickListener(new OnItemClickListener() { public void onItemClick(AdapterView<?> adapter, View view, int position, long id) { ListView lv = PortForwardListActivity.this.getListView(); PortForwardBean pfb = (PortForwardBean) lv.getItemAtPosition(position); if (hostBridge != null) { if (pfb.isEnabled()) hostBridge.disablePortForward(pfb); else { if (!hostBridge.enablePortForward(pfb)) Toast.makeText(PortForwardListActivity.this, getString(R.string.portforward_problem), Toast.LENGTH_LONG).show(); } updateHandler.sendEmptyMessage(-1); } } }); this.inflater = LayoutInflater.from(this); } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); MenuItem add = menu.add(R.string.portforward_menu_add); add.setIcon(android.R.drawable.ic_menu_add); add.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // build dialog to prompt user about updating final View portForwardView = inflater.inflate(R.layout.dia_portforward, null, false); final EditText destEdit = (EditText) portForwardView.findViewById(R.id.portforward_destination); final Spinner typeSpinner = (Spinner)portForwardView.findViewById(R.id.portforward_type); typeSpinner.setOnItemSelectedListener(new OnItemSelectedListener() { public void onItemSelected(AdapterView<?> value, View view, int position, long id) { destEdit.setEnabled(position != 2); } public void onNothingSelected(AdapterView<?> arg0) { } }); new AlertDialog.Builder(PortForwardListActivity.this) .setView(portForwardView) .setPositiveButton(R.string.portforward_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { try { final EditText nicknameEdit = (EditText) portForwardView.findViewById(R.id.nickname); final EditText sourcePortEdit = (EditText) portForwardView.findViewById(R.id.portforward_source); String type = HostDatabase.PORTFORWARD_LOCAL; switch (typeSpinner.getSelectedItemPosition()) { case 0: type = HostDatabase.PORTFORWARD_LOCAL; break; case 1: type = HostDatabase.PORTFORWARD_REMOTE; break; case 2: type = HostDatabase.PORTFORWARD_DYNAMIC5; break; } PortForwardBean pfb = new PortForwardBean( host != null ? host.getId() : -1, nicknameEdit.getText().toString(), type, sourcePortEdit.getText().toString(), destEdit.getText().toString()); if (hostBridge != null) { hostBridge.addPortForward(pfb); hostBridge.enablePortForward(pfb); } if (host != null && !hostdb.savePortForward(pfb)) throw new SQLException("Could not save port forward"); updateHandler.sendEmptyMessage(-1); } catch (Exception e) { Log.e(TAG, "Could not update port forward", e); // TODO Show failure dialog. } } }) .setNegativeButton(R.string.delete_neg, null).create().show(); return true; } }); return true; } @Override public void onCreateContextMenu(ContextMenu menu, View v, ContextMenu.ContextMenuInfo menuInfo) { // Create menu to handle deleting and editing port forward AdapterView.AdapterContextMenuInfo info = (AdapterView.AdapterContextMenuInfo) menuInfo; final PortForwardBean pfb = (PortForwardBean) this.getListView().getItemAtPosition(info.position); menu.setHeaderTitle(pfb.getNickname()); MenuItem edit = menu.add(R.string.portforward_edit); edit.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final View editTunnelView = inflater.inflate(R.layout.dia_portforward, null, false); final Spinner typeSpinner = (Spinner) editTunnelView.findViewById(R.id.portforward_type); if (HostDatabase.PORTFORWARD_LOCAL.equals(pfb.getType())) typeSpinner.setSelection(0); else if (HostDatabase.PORTFORWARD_REMOTE.equals(pfb.getType())) typeSpinner.setSelection(1); else typeSpinner.setSelection(2); final EditText nicknameEdit = (EditText) editTunnelView.findViewById(R.id.nickname); nicknameEdit.setText(pfb.getNickname()); final EditText sourcePortEdit = (EditText) editTunnelView.findViewById(R.id.portforward_source); sourcePortEdit.setText(String.valueOf(pfb.getSourcePort())); final EditText destEdit = (EditText) editTunnelView.findViewById(R.id.portforward_destination); if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(pfb.getType())) { destEdit.setEnabled(false); } else { destEdit.setText(String.format("%s:%d", pfb.getDestAddr(), pfb.getDestPort())); } typeSpinner.setOnItemSelectedListener(new OnItemSelectedListener() { public void onItemSelected(AdapterView<?> value, View view, int position, long id) { destEdit.setEnabled(position != 2); } public void onNothingSelected(AdapterView<?> arg0) { } }); new AlertDialog.Builder(PortForwardListActivity.this) .setView(editTunnelView) .setPositiveButton(R.string.button_change, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { try { if (hostBridge != null) hostBridge.disablePortForward(pfb); pfb.setNickname(nicknameEdit.getText().toString()); switch (typeSpinner.getSelectedItemPosition()) { case 0: pfb.setType(HostDatabase.PORTFORWARD_LOCAL); break; case 1: pfb.setType(HostDatabase.PORTFORWARD_REMOTE); break; case 2: pfb.setType(HostDatabase.PORTFORWARD_DYNAMIC5); break; } pfb.setSourcePort(Integer.parseInt(sourcePortEdit.getText().toString())); pfb.setDest(destEdit.getText().toString()); // Use the new settings for the existing connection. if (hostBridge != null) updateHandler.postDelayed(new Runnable() { public void run() { hostBridge.enablePortForward(pfb); updateHandler.sendEmptyMessage(-1); } }, LISTENER_CYCLE_TIME); if (!hostdb.savePortForward(pfb)) throw new SQLException("Could not save port forward"); updateHandler.sendEmptyMessage(-1); } catch (Exception e) { Log.e(TAG, "Could not update port forward", e); // TODO Show failure dialog. } } }) .setNegativeButton(android.R.string.cancel, null).create().show(); return true; } }); MenuItem delete = menu.add(R.string.portforward_delete); delete.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // prompt user to make sure they really want this new AlertDialog.Builder(PortForwardListActivity.this) .setMessage(getString(R.string.delete_message, pfb.getNickname())) .setPositiveButton(R.string.delete_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { try { // Delete the port forward from the host if needed. if (hostBridge != null) hostBridge.removePortForward(pfb); hostdb.deletePortForward(pfb); } catch (Exception e) { Log.e(TAG, "Could not delete port forward", e); } updateHandler.sendEmptyMessage(-1); } }) .setNegativeButton(R.string.delete_neg, null).create().show(); return true; } }); } protected Handler updateHandler = new Handler() { @Override public void handleMessage(Message msg) { PortForwardListActivity.this.updateList(); } }; protected void updateList() { if (hostBridge != null) { this.portForwards = hostBridge.getPortForwards(); } else { if (this.hostdb == null) return; this.portForwards = this.hostdb.getPortForwardsForHost(host); } PortForwardAdapter adapter = new PortForwardAdapter(this, portForwards); this.setListAdapter(adapter); } class PortForwardAdapter extends ArrayAdapter<PortForwardBean> { class ViewHolder { public TextView nickname; public TextView caption; } private List<PortForwardBean> portForwards; public PortForwardAdapter(Context context, List<PortForwardBean> portForwards) { super(context, R.layout.item_portforward, portForwards); this.portForwards = portForwards; } @Override public View getView(int position, View convertView, ViewGroup parent) { ViewHolder holder; if (convertView == null) { convertView = inflater.inflate(R.layout.item_portforward, null, false); holder = new ViewHolder(); holder.nickname = (TextView)convertView.findViewById(android.R.id.text1); holder.caption = (TextView)convertView.findViewById(android.R.id.text2); convertView.setTag(holder); } else holder = (ViewHolder) convertView.getTag(); PortForwardBean pfb = portForwards.get(position); holder.nickname.setText(pfb.getNickname()); holder.caption.setText(pfb.getDescription()); if (hostBridge != null && !pfb.isEnabled()) { holder.nickname.setPaintFlags(holder.nickname.getPaintFlags() | Paint.STRIKE_THRU_TEXT_FLAG); holder.caption.setPaintFlags(holder.caption.getPaintFlags() | Paint.STRIKE_THRU_TEXT_FLAG); } return convertView; } } }
1031868817-aaaa
src/org/connectbot/PortForwardListActivity.java
Java
asf20
13,807
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.util.PreferenceConstants; import android.content.SharedPreferences; import android.os.Bundle; import android.preference.PreferenceActivity; import android.preference.PreferenceManager; import android.util.Log; public class SettingsActivity extends PreferenceActivity { private static final String TAG = "ConnectBot.Settings"; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); try { addPreferencesFromResource(R.xml.preferences); } catch (ClassCastException e) { Log.e(TAG, "Shared preferences are corrupt! Resetting to default values."); SharedPreferences preferences = PreferenceManager.getDefaultSharedPreferences(this); // Blow away all the preferences SharedPreferences.Editor editor = preferences.edit(); editor.clear(); editor.commit(); PreferenceManager.setDefaultValues(this, R.xml.preferences, true); // Since they were able to get to the Settings activity, they already agreed to the EULA editor = preferences.edit(); editor.putBoolean(PreferenceConstants.EULA, true); editor.commit(); addPreferencesFromResource(R.xml.preferences); } // TODO: add parse checking here to make sure we have integer value for scrollback } }
1031868817-aaaa
src/org/connectbot/SettingsActivity.java
Java
asf20
1,972
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.security.KeyPair; import java.security.KeyPairGenerator; import java.security.PrivateKey; import java.security.PublicKey; import java.security.SecureRandom; import org.connectbot.bean.PubkeyBean; import org.connectbot.util.EntropyDialog; import org.connectbot.util.EntropyView; import org.connectbot.util.OnEntropyGatheredListener; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.app.Activity; import android.app.Dialog; import android.app.ProgressDialog; import android.content.Context; import android.os.Bundle; import android.os.Handler; import android.os.Message; import android.text.Editable; import android.text.TextWatcher; import android.util.Log; import android.view.LayoutInflater; import android.view.View; import android.view.View.OnClickListener; import android.view.View.OnFocusChangeListener; import android.widget.Button; import android.widget.CheckBox; import android.widget.EditText; import android.widget.RadioGroup; import android.widget.SeekBar; import android.widget.RadioGroup.OnCheckedChangeListener; import android.widget.SeekBar.OnSeekBarChangeListener; public class GeneratePubkeyActivity extends Activity implements OnEntropyGatheredListener { public final static String TAG = "ConnectBot.GeneratePubkeyActivity"; final static int DEFAULT_BITS = 1024; private LayoutInflater inflater = null; private EditText nickname; private RadioGroup keyTypeGroup; private SeekBar bitsSlider; private EditText bitsText; private CheckBox unlockAtStartup; private CheckBox confirmUse; private Button save; private Dialog entropyDialog; private ProgressDialog progress; private EditText password1, password2; private String keyType = PubkeyDatabase.KEY_TYPE_RSA; private int minBits = 768; private int bits = DEFAULT_BITS; private byte[] entropy; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_generatepubkey); nickname = (EditText) findViewById(R.id.nickname); keyTypeGroup = (RadioGroup) findViewById(R.id.key_type); bitsText = (EditText) findViewById(R.id.bits); bitsSlider = (SeekBar) findViewById(R.id.bits_slider); password1 = (EditText) findViewById(R.id.password1); password2 = (EditText) findViewById(R.id.password2); unlockAtStartup = (CheckBox) findViewById(R.id.unlock_at_startup); confirmUse = (CheckBox) findViewById(R.id.confirm_use); save = (Button) findViewById(R.id.save); inflater = LayoutInflater.from(this); nickname.addTextChangedListener(textChecker); password1.addTextChangedListener(textChecker); password2.addTextChangedListener(textChecker); keyTypeGroup.setOnCheckedChangeListener(new OnCheckedChangeListener() { public void onCheckedChanged(RadioGroup group, int checkedId) { if (checkedId == R.id.rsa) { minBits = 768; bitsSlider.setEnabled(true); bitsSlider.setProgress(DEFAULT_BITS - minBits); bitsText.setText(String.valueOf(DEFAULT_BITS)); bitsText.setEnabled(true); keyType = PubkeyDatabase.KEY_TYPE_RSA; } else if (checkedId == R.id.dsa) { // DSA keys can only be 1024 bits bitsSlider.setEnabled(false); bitsSlider.setProgress(DEFAULT_BITS - minBits); bitsText.setText(String.valueOf(DEFAULT_BITS)); bitsText.setEnabled(false); keyType = PubkeyDatabase.KEY_TYPE_DSA; } } }); bitsSlider.setOnSeekBarChangeListener(new OnSeekBarChangeListener() { public void onProgressChanged(SeekBar seekBar, int progress, boolean fromTouch) { // Stay evenly divisible by 8 because it looks nicer to have // 2048 than 2043 bits. int leftover = progress % 8; int ourProgress = progress; if (leftover > 0) ourProgress += 8 - leftover; bits = minBits + ourProgress; bitsText.setText(String.valueOf(bits)); } public void onStartTrackingTouch(SeekBar seekBar) { // We don't care about the start. } public void onStopTrackingTouch(SeekBar seekBar) { // We don't care about the stop. } }); bitsText.setOnFocusChangeListener(new OnFocusChangeListener() { public void onFocusChange(View v, boolean hasFocus) { if (!hasFocus) { try { bits = Integer.parseInt(bitsText.getText().toString()); if (bits < minBits) { bits = minBits; bitsText.setText(String.valueOf(bits)); } } catch (NumberFormatException nfe) { bits = DEFAULT_BITS; bitsText.setText(String.valueOf(bits)); } bitsSlider.setProgress(bits - minBits); } } }); save.setOnClickListener(new OnClickListener() { public void onClick(View view) { GeneratePubkeyActivity.this.save.setEnabled(false); GeneratePubkeyActivity.this.startEntropyGather(); } }); } private void checkEntries() { boolean allowSave = true; if (!password1.getText().toString().equals(password2.getText().toString())) allowSave = false; if (nickname.getText().length() == 0) allowSave = false; save.setEnabled(allowSave); } private void startEntropyGather() { final View entropyView = inflater.inflate(R.layout.dia_gatherentropy, null, false); ((EntropyView)entropyView.findViewById(R.id.entropy)).addOnEntropyGatheredListener(GeneratePubkeyActivity.this); entropyDialog = new EntropyDialog(GeneratePubkeyActivity.this, entropyView); entropyDialog.show(); } public void onEntropyGathered(byte[] entropy) { // For some reason the entropy dialog was aborted, exit activity if (entropy == null) { finish(); return; } this.entropy = entropy.clone(); int numSetBits = 0; for (int i = 0; i < 20; i++) numSetBits += measureNumberOfSetBits(this.entropy[i]); Log.d(TAG, "Entropy distribution=" + (int)(100.0 * numSetBits / 160.0) + "%"); Log.d(TAG, "entropy gathered; attemping to generate key..."); startKeyGen(); } private void startKeyGen() { progress = new ProgressDialog(GeneratePubkeyActivity.this); progress.setMessage(GeneratePubkeyActivity.this.getResources().getText(R.string.pubkey_generating)); progress.setIndeterminate(true); progress.setCancelable(false); progress.show(); Thread keyGenThread = new Thread(mKeyGen); keyGenThread.setName("KeyGen"); keyGenThread.start(); } private Handler handler = new Handler() { @Override public void handleMessage(Message msg) { progress.dismiss(); GeneratePubkeyActivity.this.finish(); } }; final private Runnable mKeyGen = new Runnable() { public void run() { try { boolean encrypted = false; SecureRandom random = SecureRandom.getInstance("SHA1PRNG"); random.setSeed(entropy); KeyPairGenerator keyPairGen = KeyPairGenerator.getInstance(keyType); keyPairGen.initialize(bits, random); KeyPair pair = keyPairGen.generateKeyPair(); PrivateKey priv = pair.getPrivate(); PublicKey pub = pair.getPublic(); String secret = password1.getText().toString(); if (secret.length() > 0) encrypted = true; Log.d(TAG, "private: " + PubkeyUtils.formatKey(priv)); Log.d(TAG, "public: " + PubkeyUtils.formatKey(pub)); PubkeyBean pubkey = new PubkeyBean(); pubkey.setNickname(nickname.getText().toString()); pubkey.setType(keyType); pubkey.setPrivateKey(PubkeyUtils.getEncodedPrivate(priv, secret)); pubkey.setPublicKey(PubkeyUtils.getEncodedPublic(pub)); pubkey.setEncrypted(encrypted); pubkey.setStartup(unlockAtStartup.isChecked()); pubkey.setConfirmUse(confirmUse.isChecked()); PubkeyDatabase pubkeydb = new PubkeyDatabase(GeneratePubkeyActivity.this); pubkeydb.savePubkey(pubkey); pubkeydb.close(); } catch (Exception e) { Log.e(TAG, "Could not generate key pair"); e.printStackTrace(); } handler.sendEmptyMessage(0); } }; final private TextWatcher textChecker = new TextWatcher() { public void afterTextChanged(Editable s) {} public void beforeTextChanged(CharSequence s, int start, int count, int after) {} public void onTextChanged(CharSequence s, int start, int before, int count) { checkEntries(); } }; private int measureNumberOfSetBits(byte b) { int numSetBits = 0; for (int i = 0; i < 8; i++) { if ((b & 1) == 1) numSetBits++; b >>= 1; } return numSetBits; } }
1031868817-aaaa
src/org/connectbot/GeneratePubkeyActivity.java
Java
asf20
8,986
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import org.connectbot.util.HostDatabase; import android.content.ContentValues; /** * @author Kenny Root * */ public class PortForwardBean extends AbstractBean { public static final String BEAN_NAME = "portforward"; /* Database fields */ private long id = -1; private long hostId = -1; private String nickname = null; private String type = null; private int sourcePort = -1; private String destAddr = null; private int destPort = -1; /* Transient values */ private boolean enabled = false; private Object identifier = null; /** * @param id database ID of port forward * @param nickname Nickname to use to identify port forward * @param type One of the port forward types from {@link HostDatabase} * @param sourcePort Source port number * @param destAddr Destination hostname or IP address * @param destPort Destination port number */ public PortForwardBean(long id, long hostId, String nickname, String type, int sourcePort, String destAddr, int destPort) { this.id = id; this.hostId = hostId; this.nickname = nickname; this.type = type; this.sourcePort = sourcePort; this.destAddr = destAddr; this.destPort = destPort; } /** * @param type One of the port forward types from {@link HostDatabase} * @param source Source port number * @param dest Destination is "host:port" format */ public PortForwardBean(long hostId, String nickname, String type, String source, String dest) { this.hostId = hostId; this.nickname = nickname; this.type = type; this.sourcePort = Integer.parseInt(source); setDest(dest); } public String getBeanName() { return BEAN_NAME; } /** * @param id the id to set */ public void setId(long id) { this.id = id; } /** * @return the id */ public long getId() { return id; } /** * @param nickname the nickname to set */ public void setNickname(String nickname) { this.nickname = nickname; } /** * @return the nickname */ public String getNickname() { return nickname; } /** * @param type the type to set */ public void setType(String type) { this.type = type; } /** * @return the type */ public String getType() { return type; } /** * @param sourcePort the sourcePort to set */ public void setSourcePort(int sourcePort) { this.sourcePort = sourcePort; } /** * @return the sourcePort */ public int getSourcePort() { return sourcePort; } /** * @param dest The destination in "host:port" format */ public final void setDest(String dest) { String[] destSplit = dest.split(":"); this.destAddr = destSplit[0]; if (destSplit.length > 1) this.destPort = Integer.parseInt(destSplit[1]); } /** * @param destAddr the destAddr to set */ public void setDestAddr(String destAddr) { this.destAddr = destAddr; } /** * @return the destAddr */ public String getDestAddr() { return destAddr; } /** * @param destPort the destPort to set */ public void setDestPort(int destPort) { this.destPort = destPort; } /** * @return the destPort */ public int getDestPort() { return destPort; } /** * @param enabled the enabled to set */ public void setEnabled(boolean enabled) { this.enabled = enabled; } /** * @return the enabled */ public boolean isEnabled() { return enabled; } /** * @param identifier the identifier of this particular type to set */ public void setIdentifier(Object identifier) { this.identifier = identifier; } /** * @return the identifier used by this particular type */ public Object getIdentifier() { return identifier; } /** * @return human readable description of the port forward */ public CharSequence getDescription() { String description = "Unknown type"; if (HostDatabase.PORTFORWARD_LOCAL.equals(type)) { description = String.format("Local port %d to %s:%d", sourcePort, destAddr, destPort); } else if (HostDatabase.PORTFORWARD_REMOTE.equals(type)) { description = String.format("Remote port %d to %s:%d", sourcePort, destAddr, destPort); /* I don't think we need the SOCKS4 type. } else if (HostDatabase.PORTFORWARD_DYNAMIC4.equals(type)) { description = String.format("Dynamic port %d (SOCKS4)", sourcePort); */ } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(type)) { description = String.format("Dynamic port %d (SOCKS)", sourcePort); } return description; } /** * @return */ public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(HostDatabase.FIELD_PORTFORWARD_HOSTID, hostId); values.put(HostDatabase.FIELD_PORTFORWARD_NICKNAME, nickname); values.put(HostDatabase.FIELD_PORTFORWARD_TYPE, type); values.put(HostDatabase.FIELD_PORTFORWARD_SOURCEPORT, sourcePort); values.put(HostDatabase.FIELD_PORTFORWARD_DESTADDR, destAddr); values.put(HostDatabase.FIELD_PORTFORWARD_DESTPORT, destPort); return values; } }
1031868817-aaaa
src/org/connectbot/bean/PortForwardBean.java
Java
asf20
5,600
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import de.mud.terminal.VDUBuffer; /** * @author Kenny Root * Keep track of a selection area for the terminal copying mechanism. * If the orientation is flipped one way, swap the bottom and top or * left and right to keep it in the correct orientation. */ public class SelectionArea { private int top; private int bottom; private int left; private int right; private int maxColumns; private int maxRows; private boolean selectingOrigin; public SelectionArea() { reset(); } public final void reset() { top = left = bottom = right = 0; selectingOrigin = true; } /** * @param columns * @param rows */ public void setBounds(int columns, int rows) { maxColumns = columns - 1; maxRows = rows - 1; } private int checkBounds(int value, int max) { if (value < 0) return 0; else if (value > max) return max; else return value; } public boolean isSelectingOrigin() { return selectingOrigin; } public void finishSelectingOrigin() { selectingOrigin = false; } public void decrementRow() { if (selectingOrigin) setTop(top - 1); else setBottom(bottom - 1); } public void incrementRow() { if (selectingOrigin) setTop(top + 1); else setBottom(bottom + 1); } public void setRow(int row) { if (selectingOrigin) setTop(row); else setBottom(row); } private void setTop(int top) { this.top = bottom = checkBounds(top, maxRows); } public int getTop() { return Math.min(top, bottom); } private void setBottom(int bottom) { this.bottom = checkBounds(bottom, maxRows); } public int getBottom() { return Math.max(top, bottom); } public void decrementColumn() { if (selectingOrigin) setLeft(left - 1); else setRight(right - 1); } public void incrementColumn() { if (selectingOrigin) setLeft(left + 1); else setRight(right + 1); } public void setColumn(int column) { if (selectingOrigin) setLeft(column); else setRight(column); } private void setLeft(int left) { this.left = right = checkBounds(left, maxColumns); } public int getLeft() { return Math.min(left, right); } private void setRight(int right) { this.right = checkBounds(right, maxColumns); } public int getRight() { return Math.max(left, right); } public String copyFrom(VDUBuffer vb) { int size = (getRight() - getLeft() + 1) * (getBottom() - getTop() + 1); StringBuffer buffer = new StringBuffer(size); for(int y = getTop(); y <= getBottom(); y++) { int lastNonSpace = buffer.length(); for (int x = getLeft(); x <= getRight(); x++) { // only copy printable chars char c = vb.getChar(x, y); if (!Character.isDefined(c) || (Character.isISOControl(c) && c != '\t')) c = ' '; if (c != ' ') lastNonSpace = buffer.length(); buffer.append(c); } // Don't leave a bunch of spaces in our copy buffer. if (buffer.length() > lastNonSpace) buffer.delete(lastNonSpace + 1, buffer.length()); if (y != bottom) buffer.append("\n"); } return buffer.toString(); } @Override public String toString() { StringBuilder buffer = new StringBuilder(); buffer.append("SelectionArea[top="); buffer.append(top); buffer.append(", bottom="); buffer.append(bottom); buffer.append(", left="); buffer.append(left); buffer.append(", right="); buffer.append(right); buffer.append(", maxColumns="); buffer.append(maxColumns); buffer.append(", maxRows="); buffer.append(maxRows); buffer.append(", isSelectingOrigin="); buffer.append(isSelectingOrigin()); buffer.append("]"); return buffer.toString(); } }
1031868817-aaaa
src/org/connectbot/bean/SelectionArea.java
Java
asf20
4,319
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import java.util.Map.Entry; import org.connectbot.util.XmlBuilder; import android.content.ContentValues; /** * @author Kenny Root * */ abstract class AbstractBean { public abstract ContentValues getValues(); public abstract String getBeanName(); public String toXML() { XmlBuilder xml = new XmlBuilder(); xml.append(String.format("<%s>", getBeanName())); ContentValues values = getValues(); for (Entry<String, Object> entry : values.valueSet()) { Object value = entry.getValue(); if (value != null) xml.append(entry.getKey(), value); } xml.append(String.format("</%s>", getBeanName())); return xml.toString(); } }
1031868817-aaaa
src/org/connectbot/bean/AbstractBean.java
Java
asf20
1,362
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import org.connectbot.util.HostDatabase; import android.content.ContentValues; import android.net.Uri; /** * @author Kenny Root * */ public class HostBean extends AbstractBean { public static final String BEAN_NAME = "host"; /* Database fields */ private long id = -1; private String nickname = null; private String username = null; private String hostname = null; private int port = 22; private String protocol = "ssh"; private String hostKeyAlgo = null; private byte[] hostKey = null; private long lastConnect = -1; private String color; private boolean useKeys = true; private String useAuthAgent = HostDatabase.AUTHAGENT_NO; private String postLogin = null; private long pubkeyId = -1; private boolean wantSession = true; private String delKey = HostDatabase.DELKEY_DEL; private int fontSize = -1; private boolean compression = false; private String encoding = HostDatabase.ENCODING_DEFAULT; private boolean stayConnected = false; public HostBean() { } @Override public String getBeanName() { return BEAN_NAME; } public HostBean(String nickname, String protocol, String username, String hostname, int port) { this.nickname = nickname; this.protocol = protocol; this.username = username; this.hostname = hostname; this.port = port; } public void setId(long id) { this.id = id; } public long getId() { return id; } public void setNickname(String nickname) { this.nickname = nickname; } public String getNickname() { return nickname; } public void setUsername(String username) { this.username = username; } public String getUsername() { return username; } public void setHostname(String hostname) { this.hostname = hostname; } public String getHostname() { return hostname; } public void setPort(int port) { this.port = port; } public int getPort() { return port; } public void setProtocol(String protocol) { this.protocol = protocol; } public String getProtocol() { return protocol; } public void setHostKeyAlgo(String hostKeyAlgo) { this.hostKeyAlgo = hostKeyAlgo; } public String getHostKeyAlgo() { return hostKeyAlgo; } public void setHostKey(byte[] hostKey) { if (hostKey == null) this.hostKey = null; else this.hostKey = hostKey.clone(); } public byte[] getHostKey() { if (hostKey == null) return null; else return hostKey.clone(); } public void setLastConnect(long lastConnect) { this.lastConnect = lastConnect; } public long getLastConnect() { return lastConnect; } public void setColor(String color) { this.color = color; } public String getColor() { return color; } public void setUseKeys(boolean useKeys) { this.useKeys = useKeys; } public boolean getUseKeys() { return useKeys; } public void setUseAuthAgent(String useAuthAgent) { this.useAuthAgent = useAuthAgent; } public String getUseAuthAgent() { return useAuthAgent; } public void setPostLogin(String postLogin) { this.postLogin = postLogin; } public String getPostLogin() { return postLogin; } public void setPubkeyId(long pubkeyId) { this.pubkeyId = pubkeyId; } public long getPubkeyId() { return pubkeyId; } public void setWantSession(boolean wantSession) { this.wantSession = wantSession; } public boolean getWantSession() { return wantSession; } public void setDelKey(String delKey) { this.delKey = delKey; } public String getDelKey() { return delKey; } public void setFontSize(int fontSize) { this.fontSize = fontSize; } public int getFontSize() { return fontSize; } public void setCompression(boolean compression) { this.compression = compression; } public boolean getCompression() { return compression; } public void setEncoding(String encoding) { this.encoding = encoding; } public String getEncoding() { return this.encoding; } public void setStayConnected(boolean stayConnected) { this.stayConnected = stayConnected; } public boolean getStayConnected() { return stayConnected; } public String getDescription() { String description = String.format("%s@%s", username, hostname); if (port != 22) description += String.format(":%d", port); return description; } @Override public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(HostDatabase.FIELD_HOST_NICKNAME, nickname); values.put(HostDatabase.FIELD_HOST_PROTOCOL, protocol); values.put(HostDatabase.FIELD_HOST_USERNAME, username); values.put(HostDatabase.FIELD_HOST_HOSTNAME, hostname); values.put(HostDatabase.FIELD_HOST_PORT, port); values.put(HostDatabase.FIELD_HOST_HOSTKEYALGO, hostKeyAlgo); values.put(HostDatabase.FIELD_HOST_HOSTKEY, hostKey); values.put(HostDatabase.FIELD_HOST_LASTCONNECT, lastConnect); values.put(HostDatabase.FIELD_HOST_COLOR, color); values.put(HostDatabase.FIELD_HOST_USEKEYS, Boolean.toString(useKeys)); values.put(HostDatabase.FIELD_HOST_USEAUTHAGENT, useAuthAgent); values.put(HostDatabase.FIELD_HOST_POSTLOGIN, postLogin); values.put(HostDatabase.FIELD_HOST_PUBKEYID, pubkeyId); values.put(HostDatabase.FIELD_HOST_WANTSESSION, Boolean.toString(wantSession)); values.put(HostDatabase.FIELD_HOST_DELKEY, delKey); values.put(HostDatabase.FIELD_HOST_FONTSIZE, fontSize); values.put(HostDatabase.FIELD_HOST_COMPRESSION, Boolean.toString(compression)); values.put(HostDatabase.FIELD_HOST_ENCODING, encoding); values.put(HostDatabase.FIELD_HOST_STAYCONNECTED, stayConnected); return values; } @Override public boolean equals(Object o) { if (o == null || !(o instanceof HostBean)) return false; HostBean host = (HostBean)o; if (id != -1 && host.getId() != -1) return host.getId() == id; if (nickname == null) { if (host.getNickname() != null) return false; } else if (!nickname.equals(host.getNickname())) return false; if (protocol == null) { if (host.getProtocol() != null) return false; } else if (!protocol.equals(host.getProtocol())) return false; if (username == null) { if (host.getUsername() != null) return false; } else if (!username.equals(host.getUsername())) return false; if (hostname == null) { if (host.getHostname() != null) return false; } else if (!hostname.equals(host.getHostname())) return false; if (port != host.getPort()) return false; return true; } @Override public int hashCode() { int hash = 7; if (id != -1) return (int)id; hash = 31 * hash + (null == nickname ? 0 : nickname.hashCode()); hash = 31 * hash + (null == protocol ? 0 : protocol.hashCode()); hash = 31 * hash + (null == username ? 0 : username.hashCode()); hash = 31 * hash + (null == hostname ? 0 : hostname.hashCode()); hash = 31 * hash + port; return hash; } /** * @return URI identifying this HostBean */ public Uri getUri() { StringBuilder sb = new StringBuilder(); sb.append(protocol) .append("://"); if (username != null) sb.append(Uri.encode(username)) .append('@'); sb.append(Uri.encode(hostname)) .append(':') .append(port) .append("/#") .append(nickname); return Uri.parse(sb.toString()); } }
1031868817-aaaa
src/org/connectbot/bean/HostBean.java
Java
asf20
7,849
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import java.security.PrivateKey; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.content.ContentValues; /** * @author Kenny Root * */ public class PubkeyBean extends AbstractBean { public static final String BEAN_NAME = "pubkey"; /* Database fields */ private long id; private String nickname; private String type; private byte[] privateKey; private byte[] publicKey; private boolean encrypted = false; private boolean startup = false; private boolean confirmUse = false; private int lifetime = 0; /* Transient values */ private boolean unlocked = false; private Object unlockedPrivate = null; @Override public String getBeanName() { return BEAN_NAME; } public void setId(long id) { this.id = id; } public long getId() { return id; } public void setNickname(String nickname) { this.nickname = nickname; } public String getNickname() { return nickname; } public void setType(String type) { this.type = type; } public String getType() { return type; } public void setPrivateKey(byte[] privateKey) { if (privateKey == null) this.privateKey = null; else this.privateKey = privateKey.clone(); } public byte[] getPrivateKey() { if (privateKey == null) return null; else return privateKey.clone(); } public void setPublicKey(byte[] publicKey) { if (publicKey == null) this.publicKey = null; else this.publicKey = publicKey.clone(); } public byte[] getPublicKey() { if (publicKey == null) return null; else return publicKey.clone(); } public void setEncrypted(boolean encrypted) { this.encrypted = encrypted; } public boolean isEncrypted() { return encrypted; } public void setStartup(boolean startup) { this.startup = startup; } public boolean isStartup() { return startup; } public void setConfirmUse(boolean confirmUse) { this.confirmUse = confirmUse; } public boolean isConfirmUse() { return confirmUse; } public void setLifetime(int lifetime) { this.lifetime = lifetime; } public int getLifetime() { return lifetime; } public void setUnlocked(boolean unlocked) { this.unlocked = unlocked; } public boolean isUnlocked() { return unlocked; } public void setUnlockedPrivate(Object unlockedPrivate) { this.unlockedPrivate = unlockedPrivate; } public Object getUnlockedPrivate() { return unlockedPrivate; } /* (non-Javadoc) * @see org.connectbot.bean.AbstractBean#getValues() */ @Override public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(PubkeyDatabase.FIELD_PUBKEY_NICKNAME, nickname); values.put(PubkeyDatabase.FIELD_PUBKEY_TYPE, type); values.put(PubkeyDatabase.FIELD_PUBKEY_PRIVATE, privateKey); values.put(PubkeyDatabase.FIELD_PUBKEY_PUBLIC, publicKey); values.put(PubkeyDatabase.FIELD_PUBKEY_ENCRYPTED, encrypted ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_STARTUP, startup ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_CONFIRMUSE, confirmUse ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_LIFETIME, lifetime); return values; } public boolean changePassword(String oldPassword, String newPassword) throws Exception { PrivateKey priv; try { priv = PubkeyUtils.decodePrivate(getPrivateKey(), getType(), oldPassword); } catch (Exception e) { return false; } setPrivateKey(PubkeyUtils.getEncodedPrivate(priv, newPassword)); setEncrypted(newPassword.length() > 0); return true; } }
1031868817-aaaa
src/org/connectbot/bean/PubkeyBean.java
Java
asf20
4,213
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.lang.ref.WeakReference; import java.util.List; import org.connectbot.bean.SelectionArea; import org.connectbot.service.PromptHelper; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalKeyListener; import org.connectbot.service.TerminalManager; import org.connectbot.util.PreferenceConstants; import android.app.Activity; import android.app.AlertDialog; import android.app.Dialog; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.ServiceConnection; import android.content.SharedPreferences; import android.content.pm.ActivityInfo; import android.content.res.Configuration; import android.media.AudioManager; import android.net.Uri; import android.os.Bundle; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.preference.PreferenceManager; import android.text.ClipboardManager; import android.util.Log; import android.view.GestureDetector; import android.view.KeyEvent; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.MotionEvent; import android.view.View; import android.view.ViewConfiguration; import android.view.WindowManager; import android.view.MenuItem.OnMenuItemClickListener; import android.view.View.OnClickListener; import android.view.View.OnKeyListener; import android.view.View.OnTouchListener; import android.view.animation.Animation; import android.view.animation.AnimationUtils; import android.view.inputmethod.InputMethodManager; import android.widget.AdapterView; import android.widget.ArrayAdapter; import android.widget.Button; import android.widget.EditText; import android.widget.ImageView; import android.widget.ListView; import android.widget.RelativeLayout; import android.widget.TextView; import android.widget.Toast; import android.widget.ViewFlipper; import android.widget.AdapterView.OnItemClickListener; import com.nullwire.trace.ExceptionHandler; import de.mud.terminal.vt320; public class ConsoleActivity extends Activity { public final static String TAG = "ConnectBot.ConsoleActivity"; protected static final int REQUEST_EDIT = 1; private static final int CLICK_TIME = 400; private static final float MAX_CLICK_DISTANCE = 25f; private static final int KEYBOARD_DISPLAY_TIME = 1500; // Direction to shift the ViewFlipper private static final int SHIFT_LEFT = 0; private static final int SHIFT_RIGHT = 1; protected ViewFlipper flip = null; protected TerminalManager bound = null; protected LayoutInflater inflater = null; private SharedPreferences prefs = null; // determines whether or not menuitem accelerators are bound // otherwise they collide with an external keyboard's CTRL-char private boolean hardKeyboard = false; protected Uri requested; protected ClipboardManager clipboard; private RelativeLayout stringPromptGroup; protected EditText stringPrompt; private TextView stringPromptInstructions; private RelativeLayout booleanPromptGroup; private TextView booleanPrompt; private Button booleanYes, booleanNo; private TextView empty; private Animation slide_left_in, slide_left_out, slide_right_in, slide_right_out, fade_stay_hidden, fade_out_delayed; private Animation keyboard_fade_in, keyboard_fade_out; private float lastX, lastY; private InputMethodManager inputManager; private MenuItem disconnect, copy, paste, portForward, resize, urlscan; protected TerminalBridge copySource = null; private int lastTouchRow, lastTouchCol; private boolean forcedOrientation; private Handler handler = new Handler(); private ImageView mKeyboardButton; private ServiceConnection connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { bound = ((TerminalManager.TerminalBinder) service).getService(); // let manager know about our event handling services bound.disconnectHandler = disconnectHandler; Log.d(TAG, String.format("Connected to TerminalManager and found bridges.size=%d", bound.bridges.size())); bound.setResizeAllowed(true); // clear out any existing bridges and record requested index flip.removeAllViews(); final String requestedNickname = (requested != null) ? requested.getFragment() : null; int requestedIndex = 0; TerminalBridge requestedBridge = bound.getConnectedBridge(requestedNickname); // If we didn't find the requested connection, try opening it if (requestedNickname != null && requestedBridge == null) { try { Log.d(TAG, String.format("We couldnt find an existing bridge with URI=%s (nickname=%s), so creating one now", requested.toString(), requestedNickname)); requestedBridge = bound.openConnection(requested); } catch(Exception e) { Log.e(TAG, "Problem while trying to create new requested bridge from URI", e); } } // create views for all bridges on this service for (TerminalBridge bridge : bound.bridges) { final int currentIndex = addNewTerminalView(bridge); // check to see if this bridge was requested if (bridge == requestedBridge) requestedIndex = currentIndex; } setDisplayedTerminal(requestedIndex); } public void onServiceDisconnected(ComponentName className) { // tell each bridge to forget about our prompt handler synchronized (bound.bridges) { for(TerminalBridge bridge : bound.bridges) bridge.promptHelper.setHandler(null); } flip.removeAllViews(); updateEmptyVisible(); bound = null; } }; protected Handler promptHandler = new Handler() { @Override public void handleMessage(Message msg) { // someone below us requested to display a prompt updatePromptVisible(); } }; protected Handler disconnectHandler = new Handler() { @Override public void handleMessage(Message msg) { Log.d(TAG, "Someone sending HANDLE_DISCONNECT to parentHandler"); // someone below us requested to display a password dialog // they are sending nickname and requested TerminalBridge bridge = (TerminalBridge)msg.obj; if (bridge.isAwaitingClose()) closeBridge(bridge); } }; /** * @param bridge */ private void closeBridge(final TerminalBridge bridge) { synchronized (flip) { final int flipIndex = getFlipIndex(bridge); if (flipIndex >= 0) { if (flip.getDisplayedChild() == flipIndex) { shiftCurrentTerminal(SHIFT_LEFT); } flip.removeViewAt(flipIndex); /* TODO Remove this workaround when ViewFlipper is fixed to listen * to view removals. Android Issue 1784 */ final int numChildren = flip.getChildCount(); if (flip.getDisplayedChild() >= numChildren && numChildren > 0) { flip.setDisplayedChild(numChildren - 1); } updateEmptyVisible(); } // If we just closed the last bridge, go back to the previous activity. if (flip.getChildCount() == 0) { finish(); } } } protected View findCurrentView(int id) { View view = flip.getCurrentView(); if(view == null) return null; return view.findViewById(id); } protected PromptHelper getCurrentPromptHelper() { View view = findCurrentView(R.id.console_flip); if(!(view instanceof TerminalView)) return null; return ((TerminalView)view).bridge.promptHelper; } protected void hideAllPrompts() { stringPromptGroup.setVisibility(View.GONE); booleanPromptGroup.setVisibility(View.GONE); } // more like configureLaxMode -- enable network IO on UI thread private void configureStrictMode() { try { Class.forName("android.os.StrictMode"); StrictModeSetup.run(); } catch (ClassNotFoundException e) { } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); configureStrictMode(); hardKeyboard = getResources().getConfiguration().keyboard == Configuration.KEYBOARD_QWERTY; this.setContentView(R.layout.act_console); ExceptionHandler.register(this); clipboard = (ClipboardManager)getSystemService(CLIPBOARD_SERVICE); prefs = PreferenceManager.getDefaultSharedPreferences(this); // hide status bar if requested by user if (prefs.getBoolean(PreferenceConstants.FULLSCREEN, false)) { getWindow().setFlags(WindowManager.LayoutParams.FLAG_FULLSCREEN, WindowManager.LayoutParams.FLAG_FULLSCREEN); } // TODO find proper way to disable volume key beep if it exists. setVolumeControlStream(AudioManager.STREAM_MUSIC); // handle requested console from incoming intent requested = getIntent().getData(); inflater = LayoutInflater.from(this); flip = (ViewFlipper)findViewById(R.id.console_flip); empty = (TextView)findViewById(android.R.id.empty); stringPromptGroup = (RelativeLayout) findViewById(R.id.console_password_group); stringPromptInstructions = (TextView) findViewById(R.id.console_password_instructions); stringPrompt = (EditText)findViewById(R.id.console_password); stringPrompt.setOnKeyListener(new OnKeyListener() { public boolean onKey(View v, int keyCode, KeyEvent event) { if(event.getAction() == KeyEvent.ACTION_UP) return false; if(keyCode != KeyEvent.KEYCODE_ENTER) return false; // pass collected password down to current terminal String value = stringPrompt.getText().toString(); PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return false; helper.setResponse(value); // finally clear password for next user stringPrompt.setText(""); updatePromptVisible(); return true; } }); booleanPromptGroup = (RelativeLayout) findViewById(R.id.console_boolean_group); booleanPrompt = (TextView)findViewById(R.id.console_prompt); booleanYes = (Button)findViewById(R.id.console_prompt_yes); booleanYes.setOnClickListener(new OnClickListener() { public void onClick(View v) { PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return; helper.setResponse(Boolean.TRUE); updatePromptVisible(); } }); booleanNo = (Button)findViewById(R.id.console_prompt_no); booleanNo.setOnClickListener(new OnClickListener() { public void onClick(View v) { PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return; helper.setResponse(Boolean.FALSE); updatePromptVisible(); } }); // preload animations for terminal switching slide_left_in = AnimationUtils.loadAnimation(this, R.anim.slide_left_in); slide_left_out = AnimationUtils.loadAnimation(this, R.anim.slide_left_out); slide_right_in = AnimationUtils.loadAnimation(this, R.anim.slide_right_in); slide_right_out = AnimationUtils.loadAnimation(this, R.anim.slide_right_out); fade_out_delayed = AnimationUtils.loadAnimation(this, R.anim.fade_out_delayed); fade_stay_hidden = AnimationUtils.loadAnimation(this, R.anim.fade_stay_hidden); // Preload animation for keyboard button keyboard_fade_in = AnimationUtils.loadAnimation(this, R.anim.keyboard_fade_in); keyboard_fade_out = AnimationUtils.loadAnimation(this, R.anim.keyboard_fade_out); inputManager = (InputMethodManager) getSystemService(Context.INPUT_METHOD_SERVICE); final RelativeLayout keyboardGroup = (RelativeLayout) findViewById(R.id.keyboard_group); mKeyboardButton = (ImageView) findViewById(R.id.button_keyboard); mKeyboardButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; inputManager.showSoftInput(flip, InputMethodManager.SHOW_FORCED); keyboardGroup.setVisibility(View.GONE); } }); final ImageView ctrlButton = (ImageView) findViewById(R.id.button_ctrl); ctrlButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; TerminalView terminal = (TerminalView)flip; TerminalKeyListener handler = terminal.bridge.getKeyHandler(); handler.metaPress(TerminalKeyListener.META_CTRL_ON); keyboardGroup.setVisibility(View.GONE); } }); final ImageView escButton = (ImageView) findViewById(R.id.button_esc); escButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; TerminalView terminal = (TerminalView)flip; TerminalKeyListener handler = terminal.bridge.getKeyHandler(); handler.sendEscape(); keyboardGroup.setVisibility(View.GONE); } }); // detect fling gestures to switch between terminals final GestureDetector detect = new GestureDetector(new GestureDetector.SimpleOnGestureListener() { private float totalY = 0; @Override public boolean onFling(MotionEvent e1, MotionEvent e2, float velocityX, float velocityY) { final float distx = e2.getRawX() - e1.getRawX(); final float disty = e2.getRawY() - e1.getRawY(); final int goalwidth = flip.getWidth() / 2; // need to slide across half of display to trigger console change // make sure user kept a steady hand horizontally if (Math.abs(disty) < (flip.getHeight() / 4)) { if (distx > goalwidth) { shiftCurrentTerminal(SHIFT_RIGHT); return true; } if (distx < -goalwidth) { shiftCurrentTerminal(SHIFT_LEFT); return true; } } return false; } @Override public boolean onScroll(MotionEvent e1, MotionEvent e2, float distanceX, float distanceY) { // if copying, then ignore if (copySource != null && copySource.isSelectingForCopy()) return false; if (e1 == null || e2 == null) return false; // if releasing then reset total scroll if (e2.getAction() == MotionEvent.ACTION_UP) { totalY = 0; } // activate consider if within x tolerance if (Math.abs(e1.getX() - e2.getX()) < ViewConfiguration.getTouchSlop() * 4) { View flip = findCurrentView(R.id.console_flip); if(flip == null) return false; TerminalView terminal = (TerminalView)flip; // estimate how many rows we have scrolled through // accumulate distance that doesn't trigger immediate scroll totalY += distanceY; final int moved = (int)(totalY / terminal.bridge.charHeight); // consume as scrollback only if towards right half of screen if (e2.getX() > flip.getWidth() / 2) { if (moved != 0) { int base = terminal.bridge.buffer.getWindowBase(); terminal.bridge.buffer.setWindowBase(base + moved); totalY = 0; return true; } } else { // otherwise consume as pgup/pgdown for every 5 lines if (moved > 5) { ((vt320)terminal.bridge.buffer).keyPressed(vt320.KEY_PAGE_DOWN, ' ', 0); terminal.bridge.tryKeyVibrate(); totalY = 0; return true; } else if (moved < -5) { ((vt320)terminal.bridge.buffer).keyPressed(vt320.KEY_PAGE_UP, ' ', 0); terminal.bridge.tryKeyVibrate(); totalY = 0; return true; } } } return false; } }); flip.setLongClickable(true); flip.setOnTouchListener(new OnTouchListener() { public boolean onTouch(View v, MotionEvent event) { // when copying, highlight the area if (copySource != null && copySource.isSelectingForCopy()) { int row = (int)Math.floor(event.getY() / copySource.charHeight); int col = (int)Math.floor(event.getX() / copySource.charWidth); SelectionArea area = copySource.getSelectionArea(); switch(event.getAction()) { case MotionEvent.ACTION_DOWN: // recording starting area if (area.isSelectingOrigin()) { area.setRow(row); area.setColumn(col); lastTouchRow = row; lastTouchCol = col; copySource.redraw(); } return true; case MotionEvent.ACTION_MOVE: /* ignore when user hasn't moved since last time so * we can fine-tune with directional pad */ if (row == lastTouchRow && col == lastTouchCol) return true; // if the user moves, start the selection for other corner area.finishSelectingOrigin(); // update selected area area.setRow(row); area.setColumn(col); lastTouchRow = row; lastTouchCol = col; copySource.redraw(); return true; case MotionEvent.ACTION_UP: /* If they didn't move their finger, maybe they meant to * select the rest of the text with the directional pad. */ if (area.getLeft() == area.getRight() && area.getTop() == area.getBottom()) { return true; } // copy selected area to clipboard String copiedText = area.copyFrom(copySource.buffer); clipboard.setText(copiedText); Toast.makeText(ConsoleActivity.this, getString(R.string.console_copy_done, copiedText.length()), Toast.LENGTH_LONG).show(); // fall through to clear state case MotionEvent.ACTION_CANCEL: // make sure we clear any highlighted area area.reset(); copySource.setSelectingForCopy(false); copySource.redraw(); return true; } } Configuration config = getResources().getConfiguration(); if (event.getAction() == MotionEvent.ACTION_DOWN) { lastX = event.getX(); lastY = event.getY(); } else if (event.getAction() == MotionEvent.ACTION_UP && keyboardGroup.getVisibility() == View.GONE && event.getEventTime() - event.getDownTime() < CLICK_TIME && Math.abs(event.getX() - lastX) < MAX_CLICK_DISTANCE && Math.abs(event.getY() - lastY) < MAX_CLICK_DISTANCE) { keyboardGroup.startAnimation(keyboard_fade_in); keyboardGroup.setVisibility(View.VISIBLE); handler.postDelayed(new Runnable() { public void run() { if (keyboardGroup.getVisibility() == View.GONE) return; keyboardGroup.startAnimation(keyboard_fade_out); keyboardGroup.setVisibility(View.GONE); } }, KEYBOARD_DISPLAY_TIME); } // pass any touch events back to detector return detect.onTouchEvent(event); } }); } /** * */ private void configureOrientation() { String rotateDefault; if (getResources().getConfiguration().keyboard == Configuration.KEYBOARD_NOKEYS) rotateDefault = PreferenceConstants.ROTATION_PORTRAIT; else rotateDefault = PreferenceConstants.ROTATION_LANDSCAPE; String rotate = prefs.getString(PreferenceConstants.ROTATION, rotateDefault); if (PreferenceConstants.ROTATION_DEFAULT.equals(rotate)) rotate = rotateDefault; // request a forced orientation if requested by user if (PreferenceConstants.ROTATION_LANDSCAPE.equals(rotate)) { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_LANDSCAPE); forcedOrientation = true; } else if (PreferenceConstants.ROTATION_PORTRAIT.equals(rotate)) { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_PORTRAIT); forcedOrientation = true; } else { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_UNSPECIFIED); forcedOrientation = false; } } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); View view = findCurrentView(R.id.console_flip); final boolean activeTerminal = (view instanceof TerminalView); boolean sessionOpen = false; boolean disconnected = false; boolean canForwardPorts = false; if (activeTerminal) { TerminalBridge bridge = ((TerminalView) view).bridge; sessionOpen = bridge.isSessionOpen(); disconnected = bridge.isDisconnected(); canForwardPorts = bridge.canFowardPorts(); } menu.setQwertyMode(true); disconnect = menu.add(R.string.list_host_disconnect); if (hardKeyboard) disconnect.setAlphabeticShortcut('w'); if (!sessionOpen && disconnected) disconnect.setTitle(R.string.console_menu_close); disconnect.setEnabled(activeTerminal); disconnect.setIcon(android.R.drawable.ic_menu_close_clear_cancel); disconnect.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // disconnect or close the currently visible session TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; bridge.dispatchDisconnect(true); return true; } }); copy = menu.add(R.string.console_menu_copy); if (hardKeyboard) copy.setAlphabeticShortcut('c'); copy.setIcon(android.R.drawable.ic_menu_set_as); copy.setEnabled(activeTerminal); copy.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // mark as copying and reset any previous bounds TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); copySource = terminalView.bridge; SelectionArea area = copySource.getSelectionArea(); area.reset(); area.setBounds(copySource.buffer.getColumns(), copySource.buffer.getRows()); copySource.setSelectingForCopy(true); // Make sure we show the initial selection copySource.redraw(); Toast.makeText(ConsoleActivity.this, getString(R.string.console_copy_start), Toast.LENGTH_LONG).show(); return true; } }); paste = menu.add(R.string.console_menu_paste); if (hardKeyboard) paste.setAlphabeticShortcut('v'); paste.setIcon(android.R.drawable.ic_menu_edit); paste.setEnabled(clipboard.hasText() && sessionOpen); paste.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // force insert of clipboard text into current console TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; // pull string from clipboard and generate all events to force down String clip = clipboard.getText().toString(); bridge.injectString(clip); return true; } }); portForward = menu.add(R.string.console_menu_portforwards); if (hardKeyboard) portForward.setAlphabeticShortcut('f'); portForward.setIcon(android.R.drawable.ic_menu_manage); portForward.setEnabled(sessionOpen && canForwardPorts); portForward.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; Intent intent = new Intent(ConsoleActivity.this, PortForwardListActivity.class); intent.putExtra(Intent.EXTRA_TITLE, bridge.host.getId()); ConsoleActivity.this.startActivityForResult(intent, REQUEST_EDIT); return true; } }); urlscan = menu.add(R.string.console_menu_urlscan); if (hardKeyboard) urlscan.setAlphabeticShortcut('u'); urlscan.setIcon(android.R.drawable.ic_menu_search); urlscan.setEnabled(activeTerminal); urlscan.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); List<String> urls = terminalView.bridge.scanForURLs(); Dialog urlDialog = new Dialog(ConsoleActivity.this); urlDialog.setTitle(R.string.console_menu_urlscan); ListView urlListView = new ListView(ConsoleActivity.this); URLItemListener urlListener = new URLItemListener(ConsoleActivity.this); urlListView.setOnItemClickListener(urlListener); urlListView.setAdapter(new ArrayAdapter<String>(ConsoleActivity.this, android.R.layout.simple_list_item_1, urls)); urlDialog.setContentView(urlListView); urlDialog.show(); return true; } }); resize = menu.add(R.string.console_menu_resize); if (hardKeyboard) resize.setAlphabeticShortcut('s'); resize.setIcon(android.R.drawable.ic_menu_crop); resize.setEnabled(sessionOpen); resize.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); final View resizeView = inflater.inflate(R.layout.dia_resize, null, false); new AlertDialog.Builder(ConsoleActivity.this) .setView(resizeView) .setPositiveButton(R.string.button_resize, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { int width, height; try { width = Integer.parseInt(((EditText) resizeView .findViewById(R.id.width)) .getText().toString()); height = Integer.parseInt(((EditText) resizeView .findViewById(R.id.height)) .getText().toString()); } catch (NumberFormatException nfe) { // TODO change this to a real dialog where we can // make the input boxes turn red to indicate an error. return; } terminalView.forceSize(width, height); } }).setNegativeButton(android.R.string.cancel, null).create().show(); return true; } }); return true; } @Override public boolean onPrepareOptionsMenu(Menu menu) { super.onPrepareOptionsMenu(menu); setVolumeControlStream(AudioManager.STREAM_NOTIFICATION); final View view = findCurrentView(R.id.console_flip); boolean activeTerminal = (view instanceof TerminalView); boolean sessionOpen = false; boolean disconnected = false; boolean canForwardPorts = false; if (activeTerminal) { TerminalBridge bridge = ((TerminalView) view).bridge; sessionOpen = bridge.isSessionOpen(); disconnected = bridge.isDisconnected(); canForwardPorts = bridge.canFowardPorts(); } disconnect.setEnabled(activeTerminal); if (sessionOpen || !disconnected) disconnect.setTitle(R.string.list_host_disconnect); else disconnect.setTitle(R.string.console_menu_close); copy.setEnabled(activeTerminal); paste.setEnabled(clipboard.hasText() && sessionOpen); portForward.setEnabled(sessionOpen && canForwardPorts); urlscan.setEnabled(activeTerminal); resize.setEnabled(sessionOpen); return true; } @Override public void onOptionsMenuClosed(Menu menu) { super.onOptionsMenuClosed(menu); setVolumeControlStream(AudioManager.STREAM_MUSIC); } @Override public void onStart() { super.onStart(); // connect with manager service to find all bridges // when connected it will insert all views bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); } @Override public void onPause() { super.onPause(); Log.d(TAG, "onPause called"); if (forcedOrientation && bound != null) bound.setResizeAllowed(false); } @Override public void onResume() { super.onResume(); Log.d(TAG, "onResume called"); // Make sure we don't let the screen fall asleep. // This also keeps the Wi-Fi chipset from disconnecting us. if (prefs.getBoolean(PreferenceConstants.KEEP_ALIVE, true)) { getWindow().addFlags(WindowManager.LayoutParams.FLAG_KEEP_SCREEN_ON); } else { getWindow().clearFlags(WindowManager.LayoutParams.FLAG_KEEP_SCREEN_ON); } configureOrientation(); if (forcedOrientation && bound != null) bound.setResizeAllowed(true); } /* (non-Javadoc) * @see android.app.Activity#onNewIntent(android.content.Intent) */ @Override protected void onNewIntent(Intent intent) { super.onNewIntent(intent); Log.d(TAG, "onNewIntent called"); requested = intent.getData(); if (requested == null) { Log.e(TAG, "Got null intent data in onNewIntent()"); return; } if (bound == null) { Log.e(TAG, "We're not bound in onNewIntent()"); return; } TerminalBridge requestedBridge = bound.getConnectedBridge(requested.getFragment()); int requestedIndex = 0; synchronized (flip) { if (requestedBridge == null) { // If we didn't find the requested connection, try opening it try { Log.d(TAG, String.format("We couldnt find an existing bridge with URI=%s (nickname=%s),"+ "so creating one now", requested.toString(), requested.getFragment())); requestedBridge = bound.openConnection(requested); } catch(Exception e) { Log.e(TAG, "Problem while trying to create new requested bridge from URI", e); // TODO: We should display an error dialog here. return; } requestedIndex = addNewTerminalView(requestedBridge); } else { final int flipIndex = getFlipIndex(requestedBridge); if (flipIndex > requestedIndex) { requestedIndex = flipIndex; } } setDisplayedTerminal(requestedIndex); } } @Override public void onStop() { super.onStop(); unbindService(connection); } protected void shiftCurrentTerminal(final int direction) { View overlay; synchronized (flip) { boolean shouldAnimate = flip.getChildCount() > 1; // Only show animation if there is something else to go to. if (shouldAnimate) { // keep current overlay from popping up again overlay = findCurrentView(R.id.terminal_overlay); if (overlay != null) overlay.startAnimation(fade_stay_hidden); if (direction == SHIFT_LEFT) { flip.setInAnimation(slide_left_in); flip.setOutAnimation(slide_left_out); flip.showNext(); } else if (direction == SHIFT_RIGHT) { flip.setInAnimation(slide_right_in); flip.setOutAnimation(slide_right_out); flip.showPrevious(); } } ConsoleActivity.this.updateDefault(); if (shouldAnimate) { // show overlay on new slide and start fade overlay = findCurrentView(R.id.terminal_overlay); if (overlay != null) overlay.startAnimation(fade_out_delayed); } updatePromptVisible(); } } /** * Save the currently shown {@link TerminalView} as the default. This is * saved back down into {@link TerminalManager} where we can read it again * later. */ private void updateDefault() { // update the current default terminal View view = findCurrentView(R.id.console_flip); if(!(view instanceof TerminalView)) return; TerminalView terminal = (TerminalView)view; if(bound == null) return; bound.defaultBridge = terminal.bridge; } protected void updateEmptyVisible() { // update visibility of empty status message empty.setVisibility((flip.getChildCount() == 0) ? View.VISIBLE : View.GONE); } /** * Show any prompts requested by the currently visible {@link TerminalView}. */ protected void updatePromptVisible() { // check if our currently-visible terminalbridge is requesting any prompt services View view = findCurrentView(R.id.console_flip); // Hide all the prompts in case a prompt request was canceled hideAllPrompts(); if(!(view instanceof TerminalView)) { // we dont have an active view, so hide any prompts return; } PromptHelper prompt = ((TerminalView)view).bridge.promptHelper; if(String.class.equals(prompt.promptRequested)) { stringPromptGroup.setVisibility(View.VISIBLE); String instructions = prompt.promptInstructions; if (instructions != null && instructions.length() > 0) { stringPromptInstructions.setVisibility(View.VISIBLE); stringPromptInstructions.setText(instructions); } else stringPromptInstructions.setVisibility(View.GONE); stringPrompt.setText(""); stringPrompt.setHint(prompt.promptHint); stringPrompt.requestFocus(); } else if(Boolean.class.equals(prompt.promptRequested)) { booleanPromptGroup.setVisibility(View.VISIBLE); booleanPrompt.setText(prompt.promptHint); booleanYes.requestFocus(); } else { hideAllPrompts(); view.requestFocus(); } } private class URLItemListener implements OnItemClickListener { private WeakReference<Context> contextRef; URLItemListener(Context context) { this.contextRef = new WeakReference<Context>(context); } public void onItemClick(AdapterView<?> arg0, View view, int position, long id) { Context context = contextRef.get(); if (context == null) return; try { TextView urlView = (TextView) view; String url = urlView.getText().toString(); if (url.indexOf("://") < 0) url = "http://" + url; Intent intent = new Intent(Intent.ACTION_VIEW, Uri.parse(url)); context.startActivity(intent); } catch (Exception e) { Log.e(TAG, "couldn't open URL", e); // We should probably tell the user that we couldn't find a handler... } } } @Override public void onConfigurationChanged(Configuration newConfig) { super.onConfigurationChanged(newConfig); Log.d(TAG, String.format("onConfigurationChanged; requestedOrientation=%d, newConfig.orientation=%d", getRequestedOrientation(), newConfig.orientation)); if (bound != null) { if (forcedOrientation && (newConfig.orientation != Configuration.ORIENTATION_LANDSCAPE && getRequestedOrientation() == ActivityInfo.SCREEN_ORIENTATION_LANDSCAPE) || (newConfig.orientation != Configuration.ORIENTATION_PORTRAIT && getRequestedOrientation() == ActivityInfo.SCREEN_ORIENTATION_PORTRAIT)) bound.setResizeAllowed(false); else bound.setResizeAllowed(true); bound.hardKeyboardHidden = (newConfig.hardKeyboardHidden == Configuration.HARDKEYBOARDHIDDEN_YES); mKeyboardButton.setVisibility(bound.hardKeyboardHidden ? View.VISIBLE : View.GONE); } } /** * Adds a new TerminalBridge to the current set of views in our ViewFlipper. * * @param bridge TerminalBridge to add to our ViewFlipper * @return the child index of the new view in the ViewFlipper */ private int addNewTerminalView(TerminalBridge bridge) { // let them know about our prompt handler services bridge.promptHelper.setHandler(promptHandler); // inflate each terminal view RelativeLayout view = (RelativeLayout)inflater.inflate(R.layout.item_terminal, flip, false); // set the terminal overlay text TextView overlay = (TextView)view.findViewById(R.id.terminal_overlay); overlay.setText(bridge.host.getNickname()); // and add our terminal view control, using index to place behind overlay TerminalView terminal = new TerminalView(ConsoleActivity.this, bridge); terminal.setId(R.id.console_flip); view.addView(terminal, 0); synchronized (flip) { // finally attach to the flipper flip.addView(view); return flip.getChildCount() - 1; } } private int getFlipIndex(TerminalBridge bridge) { synchronized (flip) { final int children = flip.getChildCount(); for (int i = 0; i < children; i++) { final View view = flip.getChildAt(i).findViewById(R.id.console_flip); if (view == null || !(view instanceof TerminalView)) { // How did that happen? continue; } final TerminalView tv = (TerminalView) view; if (tv.bridge == bridge) { return i; } } } return -1; } /** * Displays the child in the ViewFlipper at the requestedIndex and updates the prompts. * * @param requestedIndex the index of the terminal view to display */ private void setDisplayedTerminal(int requestedIndex) { synchronized (flip) { try { // show the requested bridge if found, also fade out overlay flip.setDisplayedChild(requestedIndex); flip.getCurrentView().findViewById(R.id.terminal_overlay) .startAnimation(fade_out_delayed); } catch (NullPointerException npe) { Log.d(TAG, "View went away when we were about to display it", npe); } updatePromptVisible(); updateEmptyVisible(); } } }
1031868817-aaaa
src/org/connectbot/ConsoleActivity.java
Java
asf20
35,993
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.io.IOException; import android.app.Activity; import android.content.Intent; import android.content.res.AssetManager; import android.os.Bundle; import android.util.Log; import android.view.View; import android.view.View.OnClickListener; import android.widget.Button; import android.widget.LinearLayout; /** * @author Kenny Root * */ public class HelpActivity extends Activity { public final static String TAG = "ConnectBot.HelpActivity"; public final static String HELPDIR = "help"; public final static String SUFFIX = ".html"; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_help); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_help))); AssetManager am = this.getAssets(); LinearLayout content = (LinearLayout)this.findViewById(R.id.topics); try { for (String name : am.list(HELPDIR)) { if (name.endsWith(SUFFIX)) { Button button = new Button(this); final String topic = name.substring(0, name.length() - SUFFIX.length()); button.setText(topic); button.setOnClickListener(new OnClickListener() { public void onClick(View v) { Intent intent = new Intent(HelpActivity.this, HelpTopicActivity.class); intent.putExtra(Intent.EXTRA_TITLE, topic); HelpActivity.this.startActivity(intent); } }); content.addView(button); } } } catch (IOException e) { // TODO Auto-generated catch block Log.e(TAG, "couldn't get list of help assets", e); } } }
1031868817-aaaa
src/org/connectbot/HelpActivity.java
Java
asf20
2,303
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.bean.SelectionArea; import org.connectbot.service.FontSizeChangedListener; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalKeyListener; import android.app.Activity; import android.content.Context; import android.graphics.Canvas; import android.graphics.Matrix; import android.graphics.Paint; import android.graphics.Path; import android.graphics.PixelXorXfermode; import android.graphics.RectF; import android.view.KeyEvent; import android.view.View; import android.view.ViewGroup.LayoutParams; import android.view.inputmethod.BaseInputConnection; import android.view.inputmethod.EditorInfo; import android.view.inputmethod.InputConnection; import android.widget.Toast; import de.mud.terminal.VDUBuffer; /** * User interface {@link View} for showing a TerminalBridge in an * {@link Activity}. Handles drawing bitmap updates and passing keystrokes down * to terminal. * * @author jsharkey */ public class TerminalView extends View implements FontSizeChangedListener { private final Context context; public final TerminalBridge bridge; private final Paint paint; private final Paint cursorPaint; private final Paint cursorStrokePaint; // Cursor paints to distinguish modes private Path ctrlCursor, altCursor, shiftCursor; private RectF tempSrc, tempDst; private Matrix scaleMatrix; private static final Matrix.ScaleToFit scaleType = Matrix.ScaleToFit.FILL; private Toast notification = null; private String lastNotification = null; private volatile boolean notifications = true; public TerminalView(Context context, TerminalBridge bridge) { super(context); this.context = context; this.bridge = bridge; paint = new Paint(); setLayoutParams(new LayoutParams(LayoutParams.FILL_PARENT, LayoutParams.FILL_PARENT)); setFocusable(true); setFocusableInTouchMode(true); cursorPaint = new Paint(); cursorPaint.setColor(bridge.color[bridge.defaultFg]); cursorPaint.setXfermode(new PixelXorXfermode(bridge.color[bridge.defaultBg])); cursorPaint.setAntiAlias(true); cursorStrokePaint = new Paint(cursorPaint); cursorStrokePaint.setStrokeWidth(0.1f); cursorStrokePaint.setStyle(Paint.Style.STROKE); /* * Set up our cursor indicators on a 1x1 Path object which we can later * transform to our character width and height */ // TODO make this into a resource somehow shiftCursor = new Path(); shiftCursor.lineTo(0.5f, 0.33f); shiftCursor.lineTo(1.0f, 0.0f); altCursor = new Path(); altCursor.moveTo(0.0f, 1.0f); altCursor.lineTo(0.5f, 0.66f); altCursor.lineTo(1.0f, 1.0f); ctrlCursor = new Path(); ctrlCursor.moveTo(0.0f, 0.25f); ctrlCursor.lineTo(1.0f, 0.5f); ctrlCursor.lineTo(0.0f, 0.75f); // For creating the transform when the terminal resizes tempSrc = new RectF(); tempSrc.set(0.0f, 0.0f, 1.0f, 1.0f); tempDst = new RectF(); scaleMatrix = new Matrix(); bridge.addFontSizeChangedListener(this); // connect our view up to the bridge setOnKeyListener(bridge.getKeyHandler()); } public void destroy() { // tell bridge to destroy its bitmap bridge.parentDestroyed(); } @Override protected void onSizeChanged(int w, int h, int oldw, int oldh) { super.onSizeChanged(w, h, oldw, oldh); bridge.parentChanged(this); scaleCursors(); } public void onFontSizeChanged(float size) { scaleCursors(); } private void scaleCursors() { // Create a scale matrix to scale our 1x1 representation of the cursor tempDst.set(0.0f, 0.0f, bridge.charWidth, bridge.charHeight); scaleMatrix.setRectToRect(tempSrc, tempDst, scaleType); } @Override public void onDraw(Canvas canvas) { if(bridge.bitmap != null) { // draw the bitmap bridge.onDraw(); // draw the bridge bitmap if it exists canvas.drawBitmap(bridge.bitmap, 0, 0, paint); // also draw cursor if visible if (bridge.buffer.isCursorVisible()) { int cursorColumn = bridge.buffer.getCursorColumn(); final int cursorRow = bridge.buffer.getCursorRow(); final int columns = bridge.buffer.getColumns(); if (cursorColumn == columns) cursorColumn = columns - 1; if (cursorColumn < 0 || cursorRow < 0) return; int currentAttribute = bridge.buffer.getAttributes( cursorColumn, cursorRow); boolean onWideCharacter = (currentAttribute & VDUBuffer.FULLWIDTH) != 0; int x = cursorColumn * bridge.charWidth; int y = (bridge.buffer.getCursorRow() + bridge.buffer.screenBase - bridge.buffer.windowBase) * bridge.charHeight; // Save the current clip and translation canvas.save(); canvas.translate(x, y); canvas.clipRect(0, 0, bridge.charWidth * (onWideCharacter ? 2 : 1), bridge.charHeight); canvas.drawPaint(cursorPaint); final int deadKey = bridge.getKeyHandler().getDeadKey(); if (deadKey != 0) { canvas.drawText(new char[] { (char)deadKey }, 0, 1, 0, 0, cursorStrokePaint); } // Make sure we scale our decorations to the correct size. canvas.concat(scaleMatrix); int metaState = bridge.getKeyHandler().getMetaState(); if ((metaState & TerminalKeyListener.META_SHIFT_ON) != 0) canvas.drawPath(shiftCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_SHIFT_LOCK) != 0) canvas.drawPath(shiftCursor, cursorPaint); if ((metaState & TerminalKeyListener.META_ALT_ON) != 0) canvas.drawPath(altCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_ALT_LOCK) != 0) canvas.drawPath(altCursor, cursorPaint); if ((metaState & TerminalKeyListener.META_CTRL_ON) != 0) canvas.drawPath(ctrlCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_CTRL_LOCK) != 0) canvas.drawPath(ctrlCursor, cursorPaint); // Restore previous clip region canvas.restore(); } // draw any highlighted area if (bridge.isSelectingForCopy()) { SelectionArea area = bridge.getSelectionArea(); canvas.save(Canvas.CLIP_SAVE_FLAG); canvas.clipRect( area.getLeft() * bridge.charWidth, area.getTop() * bridge.charHeight, (area.getRight() + 1) * bridge.charWidth, (area.getBottom() + 1) * bridge.charHeight ); canvas.drawPaint(cursorPaint); canvas.restore(); } } } public void notifyUser(String message) { if (!notifications) return; if (notification != null) { // Don't keep telling the user the same thing. if (lastNotification != null && lastNotification.equals(message)) return; notification.setText(message); notification.show(); } else { notification = Toast.makeText(context, message, Toast.LENGTH_SHORT); notification.show(); } lastNotification = message; } /** * Ask the {@link TerminalBridge} we're connected to to resize to a specific size. * @param width * @param height */ public void forceSize(int width, int height) { bridge.resizeComputed(width, height, getWidth(), getHeight()); } /** * Sets the ability for the TerminalView to display Toast notifications to the user. * @param value whether to enable notifications or not */ public void setNotifications(boolean value) { notifications = value; } @Override public boolean onCheckIsTextEditor() { return true; } @Override public InputConnection onCreateInputConnection(EditorInfo outAttrs) { outAttrs.imeOptions |= EditorInfo.IME_FLAG_NO_EXTRACT_UI | EditorInfo.IME_FLAG_NO_ENTER_ACTION | EditorInfo.IME_ACTION_NONE; outAttrs.inputType = EditorInfo.TYPE_NULL; return new BaseInputConnection(this, false) { @Override public boolean deleteSurroundingText (int leftLength, int rightLength) { if (rightLength == 0 && leftLength == 0) { return this.sendKeyEvent(new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_DEL)); } for (int i = 0; i < leftLength; i++) { this.sendKeyEvent(new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_DEL)); } // TODO: forward delete return true; } }; } }
1031868817-aaaa
src/org/connectbot/TerminalView.java
Java
asf20
8,703
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.util.HelpTopicView; import android.app.Activity; import android.content.Intent; import android.os.Bundle; /** * @author Kenny Root * */ public class HelpTopicActivity extends Activity { public final static String TAG = "ConnectBot.HelpActivity"; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_help_topic); String topic = getIntent().getStringExtra(Intent.EXTRA_TITLE); this.setTitle(String.format("%s: %s - %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_help), topic)); HelpTopicView helpTopic = (HelpTopicView) findViewById(R.id.topic_text); helpTopic.setTopic(topic); } }
1031868817-aaaa
src/org/connectbot/HelpTopicActivity.java
Java
asf20
1,431
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.nio.charset.Charset; import java.util.Arrays; import java.util.HashMap; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Set; import java.util.Map.Entry; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import org.connectbot.util.PubkeyDatabase; import android.content.ComponentName; import android.content.ContentValues; import android.content.Context; import android.content.Intent; import android.content.ServiceConnection; import android.content.SharedPreferences; import android.content.SharedPreferences.OnSharedPreferenceChangeListener; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.os.Bundle; import android.os.IBinder; import android.preference.CheckBoxPreference; import android.preference.ListPreference; import android.preference.Preference; import android.preference.PreferenceActivity; import android.util.Log; public class HostEditorActivity extends PreferenceActivity implements OnSharedPreferenceChangeListener { public class CursorPreferenceHack implements SharedPreferences { protected final String table; protected final long id; protected Map<String, String> values = new HashMap<String, String>(); // protected Map<String, String> pubkeys = new HashMap<String, String>(); public CursorPreferenceHack(String table, long id) { this.table = table; this.id = id; cacheValues(); } protected final void cacheValues() { // fill a cursor and cache the values locally // this makes sure we dont have any floating cursor to dispose later SQLiteDatabase db = hostdb.getReadableDatabase(); Cursor cursor = db.query(table, null, "_id = ?", new String[] { String.valueOf(id) }, null, null, null); if (cursor.moveToFirst()) { for(int i = 0; i < cursor.getColumnCount(); i++) { String key = cursor.getColumnName(i); if(key.equals(HostDatabase.FIELD_HOST_HOSTKEY)) continue; String value = cursor.getString(i); values.put(key, value); } } cursor.close(); db.close(); // db = pubkeydb.getReadableDatabase(); // cursor = db.query(PubkeyDatabase.TABLE_PUBKEYS, // new String[] { "_id", PubkeyDatabase.FIELD_PUBKEY_NICKNAME }, // null, null, null, null, null); // // if (cursor.moveToFirst()) { // do { // String pubkeyid = String.valueOf(cursor.getLong(0)); // String value = cursor.getString(1); // pubkeys.put(pubkeyid, value); // } while (cursor.moveToNext()); // } // // cursor.close(); // db.close(); } public boolean contains(String key) { return values.containsKey(key); } public class Editor implements SharedPreferences.Editor { private ContentValues update = new ContentValues(); public SharedPreferences.Editor clear() { Log.d(this.getClass().toString(), "clear()"); update = new ContentValues(); return this; } public boolean commit() { //Log.d(this.getClass().toString(), "commit() changes back to database"); SQLiteDatabase db = hostdb.getWritableDatabase(); db.update(table, update, "_id = ?", new String[] { String.valueOf(id) }); db.close(); // make sure we refresh the parent cached values cacheValues(); // and update any listeners for(OnSharedPreferenceChangeListener listener : listeners) { listener.onSharedPreferenceChanged(CursorPreferenceHack.this, null); } return true; } // Gingerbread compatibility public void apply() { commit(); } public android.content.SharedPreferences.Editor putBoolean(String key, boolean value) { return this.putString(key, Boolean.toString(value)); } public android.content.SharedPreferences.Editor putFloat(String key, float value) { return this.putString(key, Float.toString(value)); } public android.content.SharedPreferences.Editor putInt(String key, int value) { return this.putString(key, Integer.toString(value)); } public android.content.SharedPreferences.Editor putLong(String key, long value) { return this.putString(key, Long.toString(value)); } public android.content.SharedPreferences.Editor putString(String key, String value) { //Log.d(this.getClass().toString(), String.format("Editor.putString(key=%s, value=%s)", key, value)); update.put(key, value); return this; } public android.content.SharedPreferences.Editor remove(String key) { //Log.d(this.getClass().toString(), String.format("Editor.remove(key=%s)", key)); update.remove(key); return this; } public android.content.SharedPreferences.Editor putStringSet(String key, Set<String> value) { throw new UnsupportedOperationException("HostEditor Prefs do not support Set<String>"); } } public Editor edit() { //Log.d(this.getClass().toString(), "edit()"); return new Editor(); } public Map<String, ?> getAll() { return values; } public boolean getBoolean(String key, boolean defValue) { return Boolean.valueOf(this.getString(key, Boolean.toString(defValue))); } public float getFloat(String key, float defValue) { return Float.valueOf(this.getString(key, Float.toString(defValue))); } public int getInt(String key, int defValue) { return Integer.valueOf(this.getString(key, Integer.toString(defValue))); } public long getLong(String key, long defValue) { return Long.valueOf(this.getString(key, Long.toString(defValue))); } public String getString(String key, String defValue) { //Log.d(this.getClass().toString(), String.format("getString(key=%s, defValue=%s)", key, defValue)); if(!values.containsKey(key)) return defValue; return values.get(key); } public Set<String> getStringSet(String key, Set<String> defValue) { throw new ClassCastException("HostEditor Prefs do not support Set<String>"); } protected List<OnSharedPreferenceChangeListener> listeners = new LinkedList<OnSharedPreferenceChangeListener>(); public void registerOnSharedPreferenceChangeListener(OnSharedPreferenceChangeListener listener) { listeners.add(listener); } public void unregisterOnSharedPreferenceChangeListener(OnSharedPreferenceChangeListener listener) { listeners.remove(listener); } } @Override public SharedPreferences getSharedPreferences(String name, int mode) { //Log.d(this.getClass().toString(), String.format("getSharedPreferences(name=%s)", name)); return this.pref; } protected static final String TAG = "ConnectBot.HostEditorActivity"; protected HostDatabase hostdb = null; private PubkeyDatabase pubkeydb = null; private CursorPreferenceHack pref; private ServiceConnection connection; private HostBean host; protected TerminalBridge hostBridge; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); long hostId = this.getIntent().getLongExtra(Intent.EXTRA_TITLE, -1); // TODO: we could pass through a specific ContentProvider uri here //this.getPreferenceManager().setSharedPreferencesName(uri); this.hostdb = new HostDatabase(this); this.pubkeydb = new PubkeyDatabase(this); host = hostdb.findHostById(hostId); connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { TerminalManager bound = ((TerminalManager.TerminalBinder) service).getService(); hostBridge = bound.getConnectedBridge(host); } public void onServiceDisconnected(ComponentName name) { hostBridge = null; } }; this.pref = new CursorPreferenceHack(HostDatabase.TABLE_HOSTS, hostId); this.pref.registerOnSharedPreferenceChangeListener(this); this.addPreferencesFromResource(R.xml.host_prefs); // add all existing pubkeys to our listpreference for user to choose from // TODO: may be an issue here when this activity is recycled after adding a new pubkey // TODO: should consider moving into onStart, but we dont have a good way of resetting the listpref after filling once ListPreference pubkeyPref = (ListPreference)this.findPreference(HostDatabase.FIELD_HOST_PUBKEYID); List<CharSequence> pubkeyNicks = new LinkedList<CharSequence>(Arrays.asList(pubkeyPref.getEntries())); pubkeyNicks.addAll(pubkeydb.allValues(PubkeyDatabase.FIELD_PUBKEY_NICKNAME)); pubkeyPref.setEntries(pubkeyNicks.toArray(new CharSequence[pubkeyNicks.size()])); List<CharSequence> pubkeyIds = new LinkedList<CharSequence>(Arrays.asList(pubkeyPref.getEntryValues())); pubkeyIds.addAll(pubkeydb.allValues("_id")); pubkeyPref.setEntryValues(pubkeyIds.toArray(new CharSequence[pubkeyIds.size()])); // Populate the character set encoding list with all available final ListPreference charsetPref = (ListPreference) findPreference(HostDatabase.FIELD_HOST_ENCODING); if (CharsetHolder.isInitialized()) { initCharsetPref(charsetPref); } else { String[] currentCharsetPref = new String[1]; currentCharsetPref[0] = charsetPref.getValue(); charsetPref.setEntryValues(currentCharsetPref); charsetPref.setEntries(currentCharsetPref); new Thread(new Runnable() { public void run() { initCharsetPref(charsetPref); } }).start(); } this.updateSummaries(); } @Override public void onStart() { super.onStart(); bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(this.hostdb == null) this.hostdb = new HostDatabase(this); if(this.pubkeydb == null) this.pubkeydb = new PubkeyDatabase(this); } @Override public void onStop() { super.onStop(); unbindService(connection); if(this.hostdb != null) { this.hostdb.close(); this.hostdb = null; } if(this.pubkeydb != null) { this.pubkeydb.close(); this.pubkeydb = null; } } private void updateSummaries() { // for all text preferences, set hint as current database value for (String key : this.pref.values.keySet()) { if(key.equals(HostDatabase.FIELD_HOST_POSTLOGIN)) continue; Preference pref = this.findPreference(key); if(pref == null) continue; if(pref instanceof CheckBoxPreference) continue; CharSequence value = this.pref.getString(key, ""); if (key.equals(HostDatabase.FIELD_HOST_PUBKEYID)) { try { int pubkeyId = Integer.parseInt((String) value); if (pubkeyId >= 0) pref.setSummary(pubkeydb.getNickname(pubkeyId)); else if(pubkeyId == HostDatabase.PUBKEYID_ANY) pref.setSummary(R.string.list_pubkeyids_any); else if(pubkeyId == HostDatabase.PUBKEYID_NEVER) pref.setSummary(R.string.list_pubkeyids_none); continue; } catch (NumberFormatException nfe) { // Fall through. } } else if (pref instanceof ListPreference) { ListPreference listPref = (ListPreference) pref; int entryIndex = listPref.findIndexOfValue((String) value); if (entryIndex >= 0) value = listPref.getEntries()[entryIndex]; } pref.setSummary(value); } } private void initCharsetPref(final ListPreference charsetPref) { charsetPref.setEntryValues(CharsetHolder.getCharsetIds()); charsetPref.setEntries(CharsetHolder.getCharsetNames()); } public void onSharedPreferenceChanged(SharedPreferences sharedPreferences, String key) { // update values on changed preference this.updateSummaries(); // Our CursorPreferenceHack always send null keys, so try to set charset anyway if (hostBridge != null) hostBridge.setCharset(sharedPreferences .getString(HostDatabase.FIELD_HOST_ENCODING, HostDatabase.ENCODING_DEFAULT)); } public static class CharsetHolder { private static boolean initialized = false; private static CharSequence[] charsetIds; private static CharSequence[] charsetNames; public static CharSequence[] getCharsetNames() { if (charsetNames == null) initialize(); return charsetNames; } public static CharSequence[] getCharsetIds() { if (charsetIds == null) initialize(); return charsetIds; } private synchronized static void initialize() { if (initialized) return; List<CharSequence> charsetIdsList = new LinkedList<CharSequence>(); List<CharSequence> charsetNamesList = new LinkedList<CharSequence>(); for (Entry<String, Charset> entry : Charset.availableCharsets().entrySet()) { Charset c = entry.getValue(); if (c.canEncode() && c.isRegistered()) { String key = entry.getKey(); if (key.startsWith("cp")) { // Custom CP437 charset changes charsetIdsList.add("CP437"); charsetNamesList.add("CP437"); } charsetIdsList.add(entry.getKey()); charsetNamesList.add(c.displayName()); } } charsetIds = charsetIdsList.toArray(new CharSequence[charsetIdsList.size()]); charsetNames = charsetNamesList.toArray(new CharSequence[charsetNamesList.size()]); initialized = true; } public static boolean isInitialized() { return initialized; } } }
1031868817-aaaa
src/org/connectbot/HostEditorActivity.java
Java
asf20
13,651
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.net.InetAddress; import java.net.InetSocketAddress; import java.security.NoSuchAlgorithmException; import java.security.PrivateKey; import java.security.PublicKey; import java.security.spec.InvalidKeySpecException; import java.util.Arrays; import java.util.HashMap; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Map.Entry; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.bean.PubkeyBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.service.TerminalManager.KeyHolder; import org.connectbot.util.HostDatabase; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.content.Context; import android.net.Uri; import android.util.Log; import com.trilead.ssh2.AuthAgentCallback; import com.trilead.ssh2.ChannelCondition; import com.trilead.ssh2.Connection; import com.trilead.ssh2.ConnectionInfo; import com.trilead.ssh2.ConnectionMonitor; import com.trilead.ssh2.DynamicPortForwarder; import com.trilead.ssh2.InteractiveCallback; import com.trilead.ssh2.KnownHosts; import com.trilead.ssh2.LocalPortForwarder; import com.trilead.ssh2.ServerHostKeyVerifier; import com.trilead.ssh2.Session; import com.trilead.ssh2.crypto.PEMDecoder; import com.trilead.ssh2.signature.DSAPrivateKey; import com.trilead.ssh2.signature.DSAPublicKey; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.RSAPrivateKey; import com.trilead.ssh2.signature.RSAPublicKey; import com.trilead.ssh2.signature.RSASHA1Verify; /** * @author Kenny Root * */ public class SSH extends AbsTransport implements ConnectionMonitor, InteractiveCallback, AuthAgentCallback { public SSH() { super(); } /** * @param bridge * @param db */ public SSH(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } private static final String PROTOCOL = "ssh"; private static final String TAG = "ConnectBot.SSH"; private static final int DEFAULT_PORT = 22; private static final String AUTH_PUBLICKEY = "publickey", AUTH_PASSWORD = "password", AUTH_KEYBOARDINTERACTIVE = "keyboard-interactive"; private final static int AUTH_TRIES = 20; static final Pattern hostmask; static { hostmask = Pattern.compile("^(.+)@([0-9a-z.-]+)(:(\\d+))?$", Pattern.CASE_INSENSITIVE); } private boolean compression = false; private volatile boolean authenticated = false; private volatile boolean connected = false; private volatile boolean sessionOpen = false; private boolean pubkeysExhausted = false; private boolean interactiveCanContinue = true; private Connection connection; private Session session; private ConnectionInfo connectionInfo; private OutputStream stdin; private InputStream stdout; private InputStream stderr; private static final int conditions = ChannelCondition.STDOUT_DATA | ChannelCondition.STDERR_DATA | ChannelCondition.CLOSED | ChannelCondition.EOF; private List<PortForwardBean> portForwards = new LinkedList<PortForwardBean>(); private int columns; private int rows; private int width; private int height; private String useAuthAgent = HostDatabase.AUTHAGENT_NO; private String agentLockPassphrase; public class HostKeyVerifier implements ServerHostKeyVerifier { public boolean verifyServerHostKey(String hostname, int port, String serverHostKeyAlgorithm, byte[] serverHostKey) throws IOException { // read in all known hosts from hostdb KnownHosts hosts = manager.hostdb.getKnownHosts(); Boolean result; String matchName = String.format("%s:%d", hostname, port); String fingerprint = KnownHosts.createHexFingerprint(serverHostKeyAlgorithm, serverHostKey); String algorithmName; if ("ssh-rsa".equals(serverHostKeyAlgorithm)) algorithmName = "RSA"; else if ("ssh-dss".equals(serverHostKeyAlgorithm)) algorithmName = "DSA"; else algorithmName = serverHostKeyAlgorithm; switch(hosts.verifyHostkey(matchName, serverHostKeyAlgorithm, serverHostKey)) { case KnownHosts.HOSTKEY_IS_OK: bridge.outputLine(manager.res.getString(R.string.terminal_sucess, algorithmName, fingerprint)); return true; case KnownHosts.HOSTKEY_IS_NEW: // prompt user bridge.outputLine(manager.res.getString(R.string.host_authenticity_warning, hostname)); bridge.outputLine(manager.res.getString(R.string.host_fingerprint, algorithmName, fingerprint)); result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_continue_connecting)); if(result == null) return false; if(result.booleanValue()) { // save this key in known database manager.hostdb.saveKnownHost(hostname, port, serverHostKeyAlgorithm, serverHostKey); } return result.booleanValue(); case KnownHosts.HOSTKEY_HAS_CHANGED: String header = String.format("@ %s @", manager.res.getString(R.string.host_verification_failure_warning_header)); char[] atsigns = new char[header.length()]; Arrays.fill(atsigns, '@'); String border = new String(atsigns); bridge.outputLine(border); bridge.outputLine(manager.res.getString(R.string.host_verification_failure_warning)); bridge.outputLine(border); bridge.outputLine(String.format(manager.res.getString(R.string.host_fingerprint), algorithmName, fingerprint)); // Users have no way to delete keys, so we'll prompt them for now. result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_continue_connecting)); if(result == null) return false; if(result.booleanValue()) { // save this key in known database manager.hostdb.saveKnownHost(hostname, port, serverHostKeyAlgorithm, serverHostKey); } return result.booleanValue(); default: return false; } } } private void authenticate() { try { if (connection.authenticateWithNone(host.getUsername())) { finishConnection(); return; } } catch(Exception e) { Log.d(TAG, "Host does not support 'none' authentication."); } bridge.outputLine(manager.res.getString(R.string.terminal_auth)); try { long pubkeyId = host.getPubkeyId(); if (!pubkeysExhausted && pubkeyId != HostDatabase.PUBKEYID_NEVER && connection.isAuthMethodAvailable(host.getUsername(), AUTH_PUBLICKEY)) { // if explicit pubkey defined for this host, then prompt for password as needed // otherwise just try all in-memory keys held in terminalmanager if (pubkeyId == HostDatabase.PUBKEYID_ANY) { // try each of the in-memory keys bridge.outputLine(manager.res .getString(R.string.terminal_auth_pubkey_any)); for (Entry<String, KeyHolder> entry : manager.loadedKeypairs.entrySet()) { if (entry.getValue().bean.isConfirmUse() && !promptForPubkeyUse(entry.getKey())) continue; if (this.tryPublicKey(host.getUsername(), entry.getKey(), entry.getValue().trileadKey)) { finishConnection(); break; } } } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_specific)); // use a specific key for this host, as requested PubkeyBean pubkey = manager.pubkeydb.findPubkeyById(pubkeyId); if (pubkey == null) bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_invalid)); else if (tryPublicKey(pubkey)) finishConnection(); } pubkeysExhausted = true; } else if (interactiveCanContinue && connection.isAuthMethodAvailable(host.getUsername(), AUTH_KEYBOARDINTERACTIVE)) { // this auth method will talk with us using InteractiveCallback interface // it blocks until authentication finishes bridge.outputLine(manager.res.getString(R.string.terminal_auth_ki)); interactiveCanContinue = false; if(connection.authenticateWithKeyboardInteractive(host.getUsername(), this)) { finishConnection(); } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_ki_fail)); } } else if (connection.isAuthMethodAvailable(host.getUsername(), AUTH_PASSWORD)) { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pass)); String password = bridge.getPromptHelper().requestStringPrompt(null, manager.res.getString(R.string.prompt_password)); if (password != null && connection.authenticateWithPassword(host.getUsername(), password)) { finishConnection(); } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pass_fail)); } } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_fail)); } } catch (IllegalStateException e) { Log.e(TAG, "Connection went away while we were trying to authenticate", e); return; } catch(Exception e) { Log.e(TAG, "Problem during handleAuthentication()", e); } } /** * Attempt connection with database row pointed to by cursor. * @param cursor * @return true for successful authentication * @throws NoSuchAlgorithmException * @throws InvalidKeySpecException * @throws IOException */ private boolean tryPublicKey(PubkeyBean pubkey) throws NoSuchAlgorithmException, InvalidKeySpecException, IOException { Object trileadKey = null; if(manager.isKeyLoaded(pubkey.getNickname())) { // load this key from memory if its already there Log.d(TAG, String.format("Found unlocked key '%s' already in-memory", pubkey.getNickname())); if (pubkey.isConfirmUse()) { if (!promptForPubkeyUse(pubkey.getNickname())) return false; } trileadKey = manager.getKey(pubkey.getNickname()); } else { // otherwise load key from database and prompt for password as needed String password = null; if (pubkey.isEncrypted()) { password = bridge.getPromptHelper().requestStringPrompt(null, manager.res.getString(R.string.prompt_pubkey_password, pubkey.getNickname())); // Something must have interrupted the prompt. if (password == null) return false; } if(PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType())) { // load specific key using pem format trileadKey = PEMDecoder.decode(new String(pubkey.getPrivateKey()).toCharArray(), password); } else { // load using internal generated format PrivateKey privKey; try { privKey = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType(), password); } catch (Exception e) { String message = String.format("Bad password for key '%s'. Authentication failed.", pubkey.getNickname()); Log.e(TAG, message, e); bridge.outputLine(message); return false; } PublicKey pubKey = PubkeyUtils.decodePublic(pubkey.getPublicKey(), pubkey.getType()); // convert key to trilead format trileadKey = PubkeyUtils.convertToTrilead(privKey, pubKey); Log.d(TAG, "Unlocked key " + PubkeyUtils.formatKey(pubKey)); } Log.d(TAG, String.format("Unlocked key '%s'", pubkey.getNickname())); // save this key in memory manager.addKey(pubkey, trileadKey); } return tryPublicKey(host.getUsername(), pubkey.getNickname(), trileadKey); } private boolean tryPublicKey(String username, String keyNickname, Object trileadKey) throws IOException { //bridge.outputLine(String.format("Attempting 'publickey' with key '%s' [%s]...", keyNickname, trileadKey.toString())); boolean success = connection.authenticateWithPublicKey(username, trileadKey); if(!success) bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_fail, keyNickname)); return success; } /** * Internal method to request actual PTY terminal once we've finished * authentication. If called before authenticated, it will just fail. */ private void finishConnection() { authenticated = true; for (PortForwardBean portForward : portForwards) { try { enablePortForward(portForward); bridge.outputLine(manager.res.getString(R.string.terminal_enable_portfoward, portForward.getDescription())); } catch (Exception e) { Log.e(TAG, "Error setting up port forward during connect", e); } } if (!host.getWantSession()) { bridge.outputLine(manager.res.getString(R.string.terminal_no_session)); bridge.onConnected(); return; } try { session = connection.openSession(); if (!useAuthAgent.equals(HostDatabase.AUTHAGENT_NO)) session.requestAuthAgentForwarding(this); session.requestPTY(getEmulation(), columns, rows, width, height, null); session.startShell(); stdin = session.getStdin(); stdout = session.getStdout(); stderr = session.getStderr(); sessionOpen = true; bridge.onConnected(); } catch (IOException e1) { Log.e(TAG, "Problem while trying to create PTY in finishConnection()", e1); } } @Override public void connect() { connection = new Connection(host.getHostname(), host.getPort()); connection.addConnectionMonitor(this); try { connection.setCompression(compression); } catch (IOException e) { Log.e(TAG, "Could not enable compression!", e); } try { /* Uncomment when debugging SSH protocol: DebugLogger logger = new DebugLogger() { public void log(int level, String className, String message) { Log.d("SSH", message); } }; Logger.enabled = true; Logger.logger = logger; */ connectionInfo = connection.connect(new HostKeyVerifier()); connected = true; if (connectionInfo.clientToServerCryptoAlgorithm .equals(connectionInfo.serverToClientCryptoAlgorithm) && connectionInfo.clientToServerMACAlgorithm .equals(connectionInfo.serverToClientMACAlgorithm)) { bridge.outputLine(manager.res.getString(R.string.terminal_using_algorithm, connectionInfo.clientToServerCryptoAlgorithm, connectionInfo.clientToServerMACAlgorithm)); } else { bridge.outputLine(manager.res.getString( R.string.terminal_using_c2s_algorithm, connectionInfo.clientToServerCryptoAlgorithm, connectionInfo.clientToServerMACAlgorithm)); bridge.outputLine(manager.res.getString( R.string.terminal_using_s2c_algorithm, connectionInfo.serverToClientCryptoAlgorithm, connectionInfo.serverToClientMACAlgorithm)); } } catch (IOException e) { Log.e(TAG, "Problem in SSH connection thread during authentication", e); // Display the reason in the text. bridge.outputLine(e.getCause().getMessage()); onDisconnect(); return; } try { // enter a loop to keep trying until authentication int tries = 0; while (connected && !connection.isAuthenticationComplete() && tries++ < AUTH_TRIES) { authenticate(); // sleep to make sure we dont kill system Thread.sleep(1000); } } catch(Exception e) { Log.e(TAG, "Problem in SSH connection thread during authentication", e); } } @Override public void close() { connected = false; if (session != null) { session.close(); session = null; } if (connection != null) { connection.close(); connection = null; } } private void onDisconnect() { close(); bridge.dispatchDisconnect(false); } @Override public void flush() throws IOException { if (stdin != null) stdin.flush(); } @Override public int read(byte[] buffer, int start, int len) throws IOException { int bytesRead = 0; if (session == null) return 0; int newConditions = session.waitForCondition(conditions, 0); if ((newConditions & ChannelCondition.STDOUT_DATA) != 0) { bytesRead = stdout.read(buffer, start, len); } if ((newConditions & ChannelCondition.STDERR_DATA) != 0) { byte discard[] = new byte[256]; while (stderr.available() > 0) { stderr.read(discard); } } if ((newConditions & ChannelCondition.EOF) != 0) { onDisconnect(); throw new IOException("Remote end closed connection"); } return bytesRead; } @Override public void write(byte[] buffer) throws IOException { if (stdin != null) stdin.write(buffer); } @Override public void write(int c) throws IOException { if (stdin != null) stdin.write(c); } @Override public Map<String, String> getOptions() { Map<String, String> options = new HashMap<String, String>(); options.put("compression", Boolean.toString(compression)); return options; } @Override public void setOptions(Map<String, String> options) { if (options.containsKey("compression")) compression = Boolean.parseBoolean(options.get("compression")); } public static String getProtocolName() { return PROTOCOL; } @Override public boolean isSessionOpen() { return sessionOpen; } @Override public boolean isConnected() { return connected; } public void connectionLost(Throwable reason) { onDisconnect(); } @Override public boolean canForwardPorts() { return true; } @Override public List<PortForwardBean> getPortForwards() { return portForwards; } @Override public boolean addPortForward(PortForwardBean portForward) { return portForwards.add(portForward); } @Override public boolean removePortForward(PortForwardBean portForward) { // Make sure we don't have a phantom forwarder. disablePortForward(portForward); return portForwards.remove(portForward); } @Override public boolean enablePortForward(PortForwardBean portForward) { if (!portForwards.contains(portForward)) { Log.e(TAG, "Attempt to enable port forward not in list"); return false; } if (!authenticated) return false; if (HostDatabase.PORTFORWARD_LOCAL.equals(portForward.getType())) { LocalPortForwarder lpf = null; try { lpf = connection.createLocalPortForwarder( new InetSocketAddress(InetAddress.getLocalHost(), portForward.getSourcePort()), portForward.getDestAddr(), portForward.getDestPort()); } catch (Exception e) { Log.e(TAG, "Could not create local port forward", e); return false; } if (lpf == null) { Log.e(TAG, "returned LocalPortForwarder object is null"); return false; } portForward.setIdentifier(lpf); portForward.setEnabled(true); return true; } else if (HostDatabase.PORTFORWARD_REMOTE.equals(portForward.getType())) { try { connection.requestRemotePortForwarding("", portForward.getSourcePort(), portForward.getDestAddr(), portForward.getDestPort()); } catch (Exception e) { Log.e(TAG, "Could not create remote port forward", e); return false; } portForward.setEnabled(true); return true; } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(portForward.getType())) { DynamicPortForwarder dpf = null; try { dpf = connection.createDynamicPortForwarder( new InetSocketAddress(InetAddress.getLocalHost(), portForward.getSourcePort())); } catch (Exception e) { Log.e(TAG, "Could not create dynamic port forward", e); return false; } portForward.setIdentifier(dpf); portForward.setEnabled(true); return true; } else { // Unsupported type Log.e(TAG, String.format("attempt to forward unknown type %s", portForward.getType())); return false; } } @Override public boolean disablePortForward(PortForwardBean portForward) { if (!portForwards.contains(portForward)) { Log.e(TAG, "Attempt to disable port forward not in list"); return false; } if (!authenticated) return false; if (HostDatabase.PORTFORWARD_LOCAL.equals(portForward.getType())) { LocalPortForwarder lpf = null; lpf = (LocalPortForwarder)portForward.getIdentifier(); if (!portForward.isEnabled() || lpf == null) { Log.d(TAG, String.format("Could not disable %s; it appears to be not enabled or have no handler", portForward.getNickname())); return false; } portForward.setEnabled(false); try { lpf.close(); } catch (IOException e) { Log.e(TAG, "Could not stop local port forwarder, setting enabled to false", e); return false; } return true; } else if (HostDatabase.PORTFORWARD_REMOTE.equals(portForward.getType())) { portForward.setEnabled(false); try { connection.cancelRemotePortForwarding(portForward.getSourcePort()); } catch (IOException e) { Log.e(TAG, "Could not stop remote port forwarding, setting enabled to false", e); return false; } return true; } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(portForward.getType())) { DynamicPortForwarder dpf = null; dpf = (DynamicPortForwarder)portForward.getIdentifier(); if (!portForward.isEnabled() || dpf == null) { Log.d(TAG, String.format("Could not disable %s; it appears to be not enabled or have no handler", portForward.getNickname())); return false; } portForward.setEnabled(false); try { dpf.close(); } catch (IOException e) { Log.e(TAG, "Could not stop dynamic port forwarder, setting enabled to false", e); return false; } return true; } else { // Unsupported type Log.e(TAG, String.format("attempt to forward unknown type %s", portForward.getType())); return false; } } @Override public void setDimensions(int columns, int rows, int width, int height) { this.columns = columns; this.rows = rows; if (sessionOpen) { try { session.resizePTY(columns, rows, width, height); } catch (IOException e) { Log.e(TAG, "Couldn't send resize PTY packet", e); } } } @Override public int getDefaultPort() { return DEFAULT_PORT; } @Override public String getDefaultNickname(String username, String hostname, int port) { if (port == DEFAULT_PORT) { return String.format("%s@%s", username, hostname); } else { return String.format("%s@%s:%d", username, hostname, port); } } public static Uri getUri(String input) { Matcher matcher = hostmask.matcher(input); if (!matcher.matches()) return null; StringBuilder sb = new StringBuilder(); sb.append(PROTOCOL) .append("://") .append(Uri.encode(matcher.group(1))) .append('@') .append(matcher.group(2)); String portString = matcher.group(4); int port = DEFAULT_PORT; if (portString != null) { try { port = Integer.parseInt(portString); if (port < 1 || port > 65535) { port = DEFAULT_PORT; } } catch (NumberFormatException nfe) { // Keep the default port } } if (port != DEFAULT_PORT) { sb.append(':') .append(port); } sb.append("/#") .append(Uri.encode(input)); Uri uri = Uri.parse(sb.toString()); return uri; } /** * Handle challenges from keyboard-interactive authentication mode. */ public String[] replyToChallenge(String name, String instruction, int numPrompts, String[] prompt, boolean[] echo) { interactiveCanContinue = true; String[] responses = new String[numPrompts]; for(int i = 0; i < numPrompts; i++) { // request response from user for each prompt responses[i] = bridge.promptHelper.requestStringPrompt(instruction, prompt[i]); } return responses; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); host.setHostname(uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; host.setPort(port); host.setUsername(uri.getUserInfo()); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); selection.put(HostDatabase.FIELD_HOST_HOSTNAME, uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; selection.put(HostDatabase.FIELD_HOST_PORT, Integer.toString(port)); selection.put(HostDatabase.FIELD_HOST_USERNAME, uri.getUserInfo()); } @Override public void setCompression(boolean compression) { this.compression = compression; } public static String getFormatHint(Context context) { return String.format("%s@%s:%s", context.getString(R.string.format_username), context.getString(R.string.format_hostname), context.getString(R.string.format_port)); } @Override public void setUseAuthAgent(String useAuthAgent) { this.useAuthAgent = useAuthAgent; } public Map<String,byte[]> retrieveIdentities() { Map<String,byte[]> pubKeys = new HashMap<String,byte[]>(manager.loadedKeypairs.size()); for (Entry<String,KeyHolder> entry : manager.loadedKeypairs.entrySet()) { Object trileadKey = entry.getValue().trileadKey; try { if (trileadKey instanceof RSAPrivateKey) { RSAPublicKey pubkey = ((RSAPrivateKey) trileadKey).getPublicKey(); pubKeys.put(entry.getKey(), RSASHA1Verify.encodeSSHRSAPublicKey(pubkey)); } else if (trileadKey instanceof DSAPrivateKey) { DSAPublicKey pubkey = ((DSAPrivateKey) trileadKey).getPublicKey(); pubKeys.put(entry.getKey(), DSASHA1Verify.encodeSSHDSAPublicKey(pubkey)); } else continue; } catch (IOException e) { continue; } } return pubKeys; } public Object getPrivateKey(byte[] publicKey) { String nickname = manager.getKeyNickname(publicKey); if (nickname == null) return null; if (useAuthAgent.equals(HostDatabase.AUTHAGENT_NO)) { Log.e(TAG, ""); return null; } else if (useAuthAgent.equals(HostDatabase.AUTHAGENT_CONFIRM) || manager.loadedKeypairs.get(nickname).bean.isConfirmUse()) { if (!promptForPubkeyUse(nickname)) return null; } return manager.getKey(nickname); } private boolean promptForPubkeyUse(String nickname) { Boolean result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_allow_agent_to_use_key, nickname)); return result; } public boolean addIdentity(Object key, String comment, boolean confirmUse, int lifetime) { PubkeyBean pubkey = new PubkeyBean(); // pubkey.setType(PubkeyDatabase.KEY_TYPE_IMPORTED); pubkey.setNickname(comment); pubkey.setConfirmUse(confirmUse); pubkey.setLifetime(lifetime); manager.addKey(pubkey, key); return true; } public boolean removeAllIdentities() { manager.loadedKeypairs.clear(); return true; } public boolean removeIdentity(byte[] publicKey) { return manager.removeKey(publicKey); } public boolean isAgentLocked() { return agentLockPassphrase != null; } public boolean requestAgentUnlock(String unlockPassphrase) { if (agentLockPassphrase == null) return false; if (agentLockPassphrase.equals(unlockPassphrase)) agentLockPassphrase = null; return agentLockPassphrase == null; } public boolean setAgentLock(String lockPassphrase) { if (agentLockPassphrase != null) return false; agentLockPassphrase = lockPassphrase; return true; } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return true; } }
1031868817-aaaa
src/org/connectbot/transport/SSH.java
Java
asf20
27,933
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.util.List; import java.util.Map; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import android.content.Context; import android.net.Uri; /** * @author Kenny Root * */ public abstract class AbsTransport { HostBean host; TerminalBridge bridge; TerminalManager manager; String emulation; public AbsTransport() {} public AbsTransport(HostBean host, TerminalBridge bridge, TerminalManager manager) { this.host = host; this.bridge = bridge; this.manager = manager; } /** * @return protocol part of the URI */ public static String getProtocolName() { return "unknown"; } /** * Encode the current transport into a URI that can be passed via intent calls. * @return URI to host */ public static Uri getUri(String input) { return null; } /** * Causes transport to connect to the target host. After connecting but before a * session is started, must call back to {@link TerminalBridge#onConnected()}. * After that call a session may be opened. */ public abstract void connect(); /** * Reads from the transport. Transport must support reading into a the byte array * <code>buffer</code> at the start of <code>offset</code> and a maximum of * <code>length</code> bytes. If the remote host disconnects, throw an * {@link IOException}. * @param buffer byte buffer to store read bytes into * @param offset where to start writing in the buffer * @param length maximum number of bytes to read * @return number of bytes read * @throws IOException when remote host disconnects */ public abstract int read(byte[] buffer, int offset, int length) throws IOException; /** * Writes to the transport. If the host is not yet connected, simply return without * doing anything. An {@link IOException} should be thrown if there is an error after * connection. * @param buffer bytes to write to transport * @throws IOException when there is a problem writing after connection */ public abstract void write(byte[] buffer) throws IOException; /** * Writes to the transport. See {@link #write(byte[])} for behavior details. * @param c character to write to the transport * @throws IOException when there is a problem writing after connection */ public abstract void write(int c) throws IOException; /** * Flushes the write commands to the transport. * @throws IOException when there is a problem writing after connection */ public abstract void flush() throws IOException; /** * Closes the connection to the terminal. Note that the resulting failure to read * should call {@link TerminalBridge#dispatchDisconnect(boolean)}. */ public abstract void close(); /** * Tells the transport what dimensions the display is currently * @param columns columns of text * @param rows rows of text * @param width width in pixels * @param height height in pixels */ public abstract void setDimensions(int columns, int rows, int width, int height); public void setOptions(Map<String,String> options) { // do nothing } public Map<String,String> getOptions() { return null; } public void setCompression(boolean compression) { // do nothing } public void setUseAuthAgent(String useAuthAgent) { // do nothing } public void setEmulation(String emulation) { this.emulation = emulation; } public String getEmulation() { return emulation; } public void setHost(HostBean host) { this.host = host; } public void setBridge(TerminalBridge bridge) { this.bridge = bridge; } public void setManager(TerminalManager manager) { this.manager = manager; } /** * Whether or not this transport type can forward ports. * @return true on ability to forward ports */ public boolean canForwardPorts() { return false; } /** * Adds the {@link PortForwardBean} to the list. * @param portForward the port forward bean to add * @return true on successful addition */ public boolean addPortForward(PortForwardBean portForward) { return false; } /** * Enables a port forward member. After calling this method, the port forward should * be operational iff it could be enabled by the transport. * @param portForward member of our current port forwards list to enable * @return true on successful port forward setup */ public boolean enablePortForward(PortForwardBean portForward) { return false; } /** * Disables a port forward member. After calling this method, the port forward should * be non-functioning iff it could be disabled by the transport. * @param portForward member of our current port forwards list to enable * @return true on successful port forward tear-down */ public boolean disablePortForward(PortForwardBean portForward) { return false; } /** * Removes the {@link PortForwardBean} from the available port forwards. * @param portForward the port forward bean to remove * @return true on successful removal */ public boolean removePortForward(PortForwardBean portForward) { return false; } /** * Gets a list of the {@link PortForwardBean} currently used by this transport. * @return the list of port forwards */ public List<PortForwardBean> getPortForwards() { return null; } public abstract boolean isConnected(); public abstract boolean isSessionOpen(); /** * @return int default port for protocol */ public abstract int getDefaultPort(); /** * @param username * @param hostname * @param port * @return */ public abstract String getDefaultNickname(String username, String hostname, int port); /** * @param uri * @param selectionKeys * @param selectionValues */ public abstract void getSelectionArgs(Uri uri, Map<String, String> selection); /** * @param uri * @return */ public abstract HostBean createHost(Uri uri); /** * @param context context containing the correct resources * @return string that hints at the format for connection */ public static String getFormatHint(Context context) { return "???"; } /** * @return */ public abstract boolean usesNetwork(); }
1031868817-aaaa
src/org/connectbot/transport/AbsTransport.java
Java
asf20
6,911
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.util.HashMap; import java.util.Map; import org.connectbot.bean.HostBean; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; /** * @author Kenny Root * */ public class TransportFactory { private static final String TAG = "ConnectBot.TransportFactory"; private static String[] transportNames = { SSH.getProtocolName(), Telnet.getProtocolName(), Local.getProtocolName(), }; /** * @param protocol * @return */ public static AbsTransport getTransport(String protocol) { if (SSH.getProtocolName().equals(protocol)) { return new SSH(); } else if (Telnet.getProtocolName().equals(protocol)) { return new Telnet(); } else if (Local.getProtocolName().equals(protocol)) { return new Local(); } else { return null; } } public static Uri getUri(String scheme, String input) { Log.d("TransportFactory", String.format( "Attempting to discover URI for scheme=%s on input=%s", scheme, input)); if (SSH.getProtocolName().equals(scheme)) return SSH.getUri(input); else if (Telnet.getProtocolName().equals(scheme)) return Telnet.getUri(input); else if (Local.getProtocolName().equals(scheme)) { Log.d("TransportFactory", "Got to the local parsing area"); return Local.getUri(input); } else return null; } public static String[] getTransportNames() { return transportNames; } public static boolean isSameTransportType(AbsTransport a, AbsTransport b) { if (a == null || b == null) return false; return a.getClass().equals(b.getClass()); } public static boolean canForwardPorts(String protocol) { // TODO uh, make this have less knowledge about its children if (SSH.getProtocolName().equals(protocol)) { return true; } else { return false; } } /** * @param protocol text name of protocol * @param context * @return expanded format hint */ public static String getFormatHint(String protocol, Context context) { if (SSH.getProtocolName().equals(protocol)) { return SSH.getFormatHint(context); } else if (Telnet.getProtocolName().equals(protocol)) { return Telnet.getFormatHint(context); } else if (Local.getProtocolName().equals(protocol)) { return Local.getFormatHint(context); } else { return AbsTransport.getFormatHint(context); } } /** * @param hostdb Handle to HostDatabase * @param uri URI to target server * @param host HostBean in which to put the results * @return true when host was found */ public static HostBean findHost(HostDatabase hostdb, Uri uri) { AbsTransport transport = getTransport(uri.getScheme()); Map<String, String> selection = new HashMap<String, String>(); transport.getSelectionArgs(uri, selection); if (selection.size() == 0) { Log.e(TAG, String.format("Transport %s failed to do something useful with URI=%s", uri.getScheme(), uri.toString())); throw new IllegalStateException("Failed to get needed selection arguments"); } return hostdb.findHost(selection); } }
1031868817-aaaa
src/org/connectbot/transport/TransportFactory.java
Java
asf20
3,759
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.net.Socket; import java.net.SocketException; import java.net.UnknownHostException; import java.nio.charset.Charset; import java.util.Map; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; import de.mud.telnet.TelnetProtocolHandler; /** * Telnet transport implementation.<br/> * Original idea from the JTA telnet package (de.mud.telnet) * * @author Kenny Root * */ public class Telnet extends AbsTransport { private static final String TAG = "ConnectBot.Telnet"; private static final String PROTOCOL = "telnet"; private static final int DEFAULT_PORT = 23; private TelnetProtocolHandler handler; private Socket socket; private InputStream is; private OutputStream os; private int width; private int height; private boolean connected = false; static final Pattern hostmask; static { hostmask = Pattern.compile("^([0-9a-z.-]+)(:(\\d+))?$", Pattern.CASE_INSENSITIVE); } public Telnet() { handler = new TelnetProtocolHandler() { /** get the current terminal type */ @Override public String getTerminalType() { return getEmulation(); } /** get the current window size */ @Override public int[] getWindowSize() { return new int[] { width, height }; } /** notify about local echo */ @Override public void setLocalEcho(boolean echo) { /* EMPTY */ } /** write data to our back end */ @Override public void write(byte[] b) throws IOException { if (os != null) os.write(b); } /** sent on IAC EOR (prompt terminator for remote access systems). */ @Override public void notifyEndOfRecord() { } @Override protected String getCharsetName() { Charset charset = bridge.getCharset(); if (charset != null) return charset.name(); else return ""; } }; } /** * @param host * @param bridge * @param manager */ public Telnet(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } public static String getProtocolName() { return PROTOCOL; } @Override public void connect() { try { socket = new Socket(host.getHostname(), host.getPort()); connected = true; is = socket.getInputStream(); os = socket.getOutputStream(); bridge.onConnected(); } catch (UnknownHostException e) { Log.d(TAG, "IO Exception connecting to host", e); } catch (IOException e) { Log.d(TAG, "IO Exception connecting to host", e); } } @Override public void close() { connected = false; if (socket != null) try { socket.close(); socket = null; } catch (IOException e) { Log.d(TAG, "Error closing telnet socket.", e); } } @Override public void flush() throws IOException { os.flush(); } @Override public int getDefaultPort() { return DEFAULT_PORT; } @Override public boolean isConnected() { return connected; } @Override public boolean isSessionOpen() { return connected; } @Override public int read(byte[] buffer, int start, int len) throws IOException { /* process all already read bytes */ int n = 0; do { n = handler.negotiate(buffer, start); if (n > 0) return n; } while (n == 0); while (n <= 0) { do { n = handler.negotiate(buffer, start); if (n > 0) return n; } while (n == 0); n = is.read(buffer, start, len); if (n < 0) { bridge.dispatchDisconnect(false); throw new IOException("Remote end closed connection."); } handler.inputfeed(buffer, start, n); n = handler.negotiate(buffer, start); } return n; } @Override public void write(byte[] buffer) throws IOException { try { if (os != null) os.write(buffer); } catch (SocketException e) { bridge.dispatchDisconnect(false); } } @Override public void write(int c) throws IOException { try { if (os != null) os.write(c); } catch (SocketException e) { bridge.dispatchDisconnect(false); } } @Override public void setDimensions(int columns, int rows, int width, int height) { try { handler.setWindowSize(columns, rows); } catch (IOException e) { Log.e(TAG, "Couldn't resize remote terminal", e); } } @Override public String getDefaultNickname(String username, String hostname, int port) { if (port == DEFAULT_PORT) { return String.format("%s", hostname); } else { return String.format("%s:%d", hostname, port); } } public static Uri getUri(String input) { Matcher matcher = hostmask.matcher(input); if (!matcher.matches()) return null; StringBuilder sb = new StringBuilder(); sb.append(PROTOCOL) .append("://") .append(matcher.group(1)); String portString = matcher.group(3); int port = DEFAULT_PORT; if (portString != null) { try { port = Integer.parseInt(portString); if (port < 1 || port > 65535) { port = DEFAULT_PORT; } } catch (NumberFormatException nfe) { // Keep the default port } } if (port != DEFAULT_PORT) { sb.append(':'); sb.append(port); } sb.append("/#") .append(Uri.encode(input)); Uri uri = Uri.parse(sb.toString()); return uri; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); host.setHostname(uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; host.setPort(port); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); selection.put(HostDatabase.FIELD_HOST_HOSTNAME, uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; selection.put(HostDatabase.FIELD_HOST_PORT, Integer.toString(port)); } public static String getFormatHint(Context context) { return String.format("%s:%s", context.getString(R.string.format_hostname), context.getString(R.string.format_port)); } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return true; } }
1031868817-aaaa
src/org/connectbot/transport/Telnet.java
Java
asf20
7,445
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.FileDescriptor; import java.io.FileInputStream; import java.io.FileOutputStream; import java.io.IOException; import java.util.Map; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; import com.google.ase.Exec; /** * @author Kenny Root * */ public class Local extends AbsTransport { private static final String TAG = "ConnectBot.Local"; private static final String PROTOCOL = "local"; private static final String DEFAULT_URI = "local:#Local"; private FileDescriptor shellFd; private FileInputStream is; private FileOutputStream os; /** * */ public Local() { } /** * @param host * @param bridge * @param manager */ public Local(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } public static String getProtocolName() { return PROTOCOL; } @Override public void close() { try { if (os != null) { os.close(); os = null; } if (is != null) { is.close(); is = null; } } catch (IOException e) { Log.e(TAG, "Couldn't close shell", e); } } @Override public void connect() { int[] pids = new int[1]; try { shellFd = Exec.createSubprocess("/system/bin/sh", "-", null, pids); } catch (Exception e) { bridge.outputLine(manager.res.getString(R.string.local_shell_unavailable)); Log.e(TAG, "Cannot start local shell", e); return; } final int shellPid = pids[0]; Runnable exitWatcher = new Runnable() { public void run() { Exec.waitFor(shellPid); bridge.dispatchDisconnect(false); } }; Thread exitWatcherThread = new Thread(exitWatcher); exitWatcherThread.setName("LocalExitWatcher"); exitWatcherThread.setDaemon(true); exitWatcherThread.start(); is = new FileInputStream(shellFd); os = new FileOutputStream(shellFd); bridge.onConnected(); } @Override public void flush() throws IOException { os.flush(); } @Override public String getDefaultNickname(String username, String hostname, int port) { return DEFAULT_URI; } @Override public int getDefaultPort() { return 0; } @Override public boolean isConnected() { return is != null && os != null; } @Override public boolean isSessionOpen() { return is != null && os != null; } @Override public int read(byte[] buffer, int start, int len) throws IOException { if (is == null) { bridge.dispatchDisconnect(false); throw new IOException("session closed"); } return is.read(buffer, start, len); } @Override public void setDimensions(int columns, int rows, int width, int height) { try { Exec.setPtyWindowSize(shellFd, rows, columns, width, height); } catch (Exception e) { Log.e(TAG, "Couldn't resize pty", e); } } @Override public void write(byte[] buffer) throws IOException { if (os != null) os.write(buffer); } @Override public void write(int c) throws IOException { if (os != null) os.write(c); } public static Uri getUri(String input) { Uri uri = Uri.parse(DEFAULT_URI); if (input != null && input.length() > 0) { uri = uri.buildUpon().fragment(input).build(); } return uri; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); } public static String getFormatHint(Context context) { return context.getString(R.string.hostpref_nickname_title); } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return false; } }
1031868817-aaaa
src/org/connectbot/transport/Local.java
Java
asf20
4,926
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import android.os.StrictMode; public class StrictModeSetup { public static void run() { StrictMode.setThreadPolicy(StrictMode.ThreadPolicy.LAX); } }
1031868817-aaaa
src/org/connectbot/StrictModeSetup.java
Java
asf20
856
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.util.List; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.transport.TransportFactory; import org.connectbot.util.HostDatabase; import org.connectbot.util.PreferenceConstants; import org.connectbot.util.UpdateHelper; import android.app.Activity; import android.app.AlertDialog; import android.app.ListActivity; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.ServiceConnection; import android.content.SharedPreferences; import android.content.Intent.ShortcutIconResource; import android.content.SharedPreferences.Editor; import android.content.res.ColorStateList; import android.net.Uri; import android.os.Bundle; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.preference.PreferenceManager; import android.util.Log; import android.view.ContextMenu; import android.view.KeyEvent; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.View; import android.view.ViewGroup; import android.view.MenuItem.OnMenuItemClickListener; import android.view.View.OnKeyListener; import android.widget.AdapterView; import android.widget.ArrayAdapter; import android.widget.ImageView; import android.widget.ListView; import android.widget.Spinner; import android.widget.TextView; import android.widget.AdapterView.OnItemClickListener; import com.nullwire.trace.ExceptionHandler; public class HostListActivity extends ListActivity { public final static int REQUEST_EDIT = 1; public final static int REQUEST_EULA = 2; protected TerminalManager bound = null; protected HostDatabase hostdb; private List<HostBean> hosts; protected LayoutInflater inflater = null; protected boolean sortedByColor = false; private MenuItem sortcolor; private MenuItem sortlast; private Spinner transportSpinner; private TextView quickconnect; private SharedPreferences prefs = null; protected boolean makingShortcut = false; protected Handler updateHandler = new Handler() { @Override public void handleMessage(Message msg) { HostListActivity.this.updateList(); } }; private ServiceConnection connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { bound = ((TerminalManager.TerminalBinder) service).getService(); // update our listview binder to find the service HostListActivity.this.updateList(); } public void onServiceDisconnected(ComponentName className) { bound = null; HostListActivity.this.updateList(); } }; @Override public void onStart() { super.onStart(); // start the terminal manager service this.bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(this.hostdb == null) this.hostdb = new HostDatabase(this); } @Override public void onStop() { super.onStop(); this.unbindService(connection); if(this.hostdb != null) { this.hostdb.close(); this.hostdb = null; } } @Override public void onResume() { super.onResume(); ExceptionHandler.checkForTraces(this); } @Override protected void onActivityResult(int requestCode, int resultCode, Intent data) { if (requestCode == REQUEST_EULA) { if(resultCode == Activity.RESULT_OK) { // yay they agreed, so store that info Editor edit = prefs.edit(); edit.putBoolean(PreferenceConstants.EULA, true); edit.commit(); } else { // user didnt agree, so close this.finish(); } } else if (requestCode == REQUEST_EDIT) { this.updateList(); } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_hostlist); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_hosts_list))); ExceptionHandler.register(this); // check for eula agreement this.prefs = PreferenceManager.getDefaultSharedPreferences(this); boolean agreed = prefs.getBoolean(PreferenceConstants.EULA, false); if(!agreed) { this.startActivityForResult(new Intent(this, WizardActivity.class), REQUEST_EULA); } // start thread to check for new version new UpdateHelper(this); this.makingShortcut = Intent.ACTION_CREATE_SHORTCUT.equals(getIntent().getAction()) || Intent.ACTION_PICK.equals(getIntent().getAction()); // connect with hosts database and populate list this.hostdb = new HostDatabase(this); ListView list = this.getListView(); this.sortedByColor = prefs.getBoolean(PreferenceConstants.SORT_BY_COLOR, false); //this.list.setSelector(R.drawable.highlight_disabled_pressed); list.setOnItemClickListener(new OnItemClickListener() { public synchronized void onItemClick(AdapterView<?> parent, View view, int position, long id) { // launch off to console details HostBean host = (HostBean) parent.getAdapter().getItem(position); Uri uri = host.getUri(); Intent contents = new Intent(Intent.ACTION_VIEW, uri); contents.setFlags(Intent.FLAG_ACTIVITY_CLEAR_TOP); if (makingShortcut) { // create shortcut if requested ShortcutIconResource icon = Intent.ShortcutIconResource.fromContext(HostListActivity.this, R.drawable.icon); Intent intent = new Intent(); intent.putExtra(Intent.EXTRA_SHORTCUT_INTENT, contents); intent.putExtra(Intent.EXTRA_SHORTCUT_NAME, host.getNickname()); intent.putExtra(Intent.EXTRA_SHORTCUT_ICON_RESOURCE, icon); setResult(RESULT_OK, intent); finish(); } else { // otherwise just launch activity to show this host HostListActivity.this.startActivity(contents); } } }); this.registerForContextMenu(list); quickconnect = (TextView) this.findViewById(R.id.front_quickconnect); quickconnect.setVisibility(makingShortcut ? View.GONE : View.VISIBLE); quickconnect.setOnKeyListener(new OnKeyListener() { public boolean onKey(View v, int keyCode, KeyEvent event) { if(event.getAction() == KeyEvent.ACTION_UP) return false; if(keyCode != KeyEvent.KEYCODE_ENTER) return false; return startConsoleActivity(); } }); transportSpinner = (Spinner)findViewById(R.id.transport_selection); transportSpinner.setVisibility(makingShortcut ? View.GONE : View.VISIBLE); ArrayAdapter<String> transportSelection = new ArrayAdapter<String>(this, android.R.layout.simple_spinner_item, TransportFactory.getTransportNames()); transportSelection.setDropDownViewResource(android.R.layout.simple_spinner_dropdown_item); transportSpinner.setOnItemSelectedListener(new AdapterView.OnItemSelectedListener() { public void onItemSelected(AdapterView<?> arg0, View view, int position, long id) { String formatHint = TransportFactory.getFormatHint( (String) transportSpinner.getSelectedItem(), HostListActivity.this); quickconnect.setHint(formatHint); quickconnect.setError(null); quickconnect.requestFocus(); } public void onNothingSelected(AdapterView<?> arg0) { } }); transportSpinner.setAdapter(transportSelection); this.inflater = LayoutInflater.from(this); } @Override public boolean onPrepareOptionsMenu(Menu menu) { super.onPrepareOptionsMenu(menu); // don't offer menus when creating shortcut if (makingShortcut) return true; sortcolor.setVisible(!sortedByColor); sortlast.setVisible(sortedByColor); return true; } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); // don't offer menus when creating shortcut if(makingShortcut) return true; // add host, ssh keys, about sortcolor = menu.add(R.string.list_menu_sortcolor); sortcolor.setIcon(android.R.drawable.ic_menu_share); sortcolor.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { sortedByColor = true; updateList(); return true; } }); sortlast = menu.add(R.string.list_menu_sortname); sortlast.setIcon(android.R.drawable.ic_menu_share); sortlast.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { sortedByColor = false; updateList(); return true; } }); MenuItem keys = menu.add(R.string.list_menu_pubkeys); keys.setIcon(android.R.drawable.ic_lock_lock); keys.setIntent(new Intent(HostListActivity.this, PubkeyListActivity.class)); MenuItem colors = menu.add("Colors"); colors.setIcon(android.R.drawable.ic_menu_slideshow); colors.setIntent(new Intent(HostListActivity.this, ColorsActivity.class)); MenuItem settings = menu.add(R.string.list_menu_settings); settings.setIcon(android.R.drawable.ic_menu_preferences); settings.setIntent(new Intent(HostListActivity.this, SettingsActivity.class)); MenuItem help = menu.add(R.string.title_help); help.setIcon(android.R.drawable.ic_menu_help); help.setIntent(new Intent(HostListActivity.this, HelpActivity.class)); return true; } @Override public void onCreateContextMenu(ContextMenu menu, View v, ContextMenu.ContextMenuInfo menuInfo) { // create menu to handle hosts // create menu to handle deleting and sharing lists AdapterView.AdapterContextMenuInfo info = (AdapterView.AdapterContextMenuInfo) menuInfo; final HostBean host = (HostBean) this.getListView().getItemAtPosition(info.position); menu.setHeaderTitle(host.getNickname()); // edit, disconnect, delete MenuItem connect = menu.add(R.string.list_host_disconnect); final TerminalBridge bridge = bound.getConnectedBridge(host); connect.setEnabled((bridge != null)); connect.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { bridge.dispatchDisconnect(true); updateHandler.sendEmptyMessage(-1); return true; } }); MenuItem edit = menu.add(R.string.list_host_edit); edit.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { Intent intent = new Intent(HostListActivity.this, HostEditorActivity.class); intent.putExtra(Intent.EXTRA_TITLE, host.getId()); HostListActivity.this.startActivityForResult(intent, REQUEST_EDIT); return true; } }); MenuItem portForwards = menu.add(R.string.list_host_portforwards); portForwards.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { Intent intent = new Intent(HostListActivity.this, PortForwardListActivity.class); intent.putExtra(Intent.EXTRA_TITLE, host.getId()); HostListActivity.this.startActivityForResult(intent, REQUEST_EDIT); return true; } }); if (!TransportFactory.canForwardPorts(host.getProtocol())) portForwards.setEnabled(false); MenuItem delete = menu.add(R.string.list_host_delete); delete.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // prompt user to make sure they really want this new AlertDialog.Builder(HostListActivity.this) .setMessage(getString(R.string.delete_message, host.getNickname())) .setPositiveButton(R.string.delete_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { // make sure we disconnect if(bridge != null) bridge.dispatchDisconnect(true); hostdb.deleteHost(host); updateHandler.sendEmptyMessage(-1); } }) .setNegativeButton(R.string.delete_neg, null).create().show(); return true; } }); } /** * @param text * @return */ private boolean startConsoleActivity() { Uri uri = TransportFactory.getUri((String) transportSpinner .getSelectedItem(), quickconnect.getText().toString()); if (uri == null) { quickconnect.setError(getString(R.string.list_format_error, TransportFactory.getFormatHint( (String) transportSpinner.getSelectedItem(), HostListActivity.this))); return false; } HostBean host = TransportFactory.findHost(hostdb, uri); if (host == null) { host = TransportFactory.getTransport(uri.getScheme()).createHost(uri); host.setColor(HostDatabase.COLOR_GRAY); host.setPubkeyId(HostDatabase.PUBKEYID_ANY); hostdb.saveHost(host); } Intent intent = new Intent(HostListActivity.this, ConsoleActivity.class); intent.setData(uri); startActivity(intent); return true; } protected void updateList() { if (prefs.getBoolean(PreferenceConstants.SORT_BY_COLOR, false) != sortedByColor) { Editor edit = prefs.edit(); edit.putBoolean(PreferenceConstants.SORT_BY_COLOR, sortedByColor); edit.commit(); } if (hostdb == null) hostdb = new HostDatabase(this); hosts = hostdb.getHosts(sortedByColor); // Don't lose hosts that are connected via shortcuts but not in the database. if (bound != null) { for (TerminalBridge bridge : bound.bridges) { if (!hosts.contains(bridge.host)) hosts.add(0, bridge.host); } } HostAdapter adapter = new HostAdapter(this, hosts, bound); this.setListAdapter(adapter); } class HostAdapter extends ArrayAdapter<HostBean> { private List<HostBean> hosts; private final TerminalManager manager; private final ColorStateList red, green, blue; public final static int STATE_UNKNOWN = 1, STATE_CONNECTED = 2, STATE_DISCONNECTED = 3; class ViewHolder { public TextView nickname; public TextView caption; public ImageView icon; } public HostAdapter(Context context, List<HostBean> hosts, TerminalManager manager) { super(context, R.layout.item_host, hosts); this.hosts = hosts; this.manager = manager; red = context.getResources().getColorStateList(R.color.red); green = context.getResources().getColorStateList(R.color.green); blue = context.getResources().getColorStateList(R.color.blue); } /** * Check if we're connected to a terminal with the given host. */ private int getConnectedState(HostBean host) { // always disconnected if we dont have backend service if (this.manager == null) return STATE_UNKNOWN; if (manager.getConnectedBridge(host) != null) return STATE_CONNECTED; if (manager.disconnected.contains(host)) return STATE_DISCONNECTED; return STATE_UNKNOWN; } @Override public View getView(int position, View convertView, ViewGroup parent) { ViewHolder holder; if (convertView == null) { convertView = inflater.inflate(R.layout.item_host, null, false); holder = new ViewHolder(); holder.nickname = (TextView)convertView.findViewById(android.R.id.text1); holder.caption = (TextView)convertView.findViewById(android.R.id.text2); holder.icon = (ImageView)convertView.findViewById(android.R.id.icon); convertView.setTag(holder); } else holder = (ViewHolder) convertView.getTag(); HostBean host = hosts.get(position); if (host == null) { // Well, something bad happened. We can't continue. Log.e("HostAdapter", "Host bean is null!"); holder.nickname.setText("Error during lookup"); holder.caption.setText("see 'adb logcat' for more"); return convertView; } holder.nickname.setText(host.getNickname()); switch (this.getConnectedState(host)) { case STATE_UNKNOWN: holder.icon.setImageState(new int[] { }, true); break; case STATE_CONNECTED: holder.icon.setImageState(new int[] { android.R.attr.state_checked }, true); break; case STATE_DISCONNECTED: holder.icon.setImageState(new int[] { android.R.attr.state_expanded }, true); break; } ColorStateList chosen = null; if (HostDatabase.COLOR_RED.equals(host.getColor())) chosen = this.red; else if (HostDatabase.COLOR_GREEN.equals(host.getColor())) chosen = this.green; else if (HostDatabase.COLOR_BLUE.equals(host.getColor())) chosen = this.blue; Context context = convertView.getContext(); if (chosen != null) { // set color normally if not selected holder.nickname.setTextColor(chosen); holder.caption.setTextColor(chosen); } else { // selected, so revert back to default black text holder.nickname.setTextAppearance(context, android.R.attr.textAppearanceLarge); holder.caption.setTextAppearance(context, android.R.attr.textAppearanceSmall); } long now = System.currentTimeMillis() / 1000; String nice = context.getString(R.string.bind_never); if (host.getLastConnect() > 0) { int minutes = (int)((now - host.getLastConnect()) / 60); if (minutes >= 60) { int hours = (minutes / 60); if (hours >= 24) { int days = (hours / 24); nice = context.getString(R.string.bind_days, days); } else nice = context.getString(R.string.bind_hours, hours); } else nice = context.getString(R.string.bind_minutes, minutes); } holder.caption.setText(nice); return convertView; } } }
1031868817-aaaa
src/org/connectbot/HostListActivity.java
Java
asf20
17,731
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.io.ByteArrayOutputStream; import java.io.File; import java.io.FileInputStream; import java.io.IOException; import java.io.InputStream; import java.net.URI; import java.security.KeyPair; import java.security.PrivateKey; import java.security.PublicKey; import java.util.Collections; import java.util.EventListener; import java.util.LinkedList; import java.util.List; import org.connectbot.bean.PubkeyBean; import org.connectbot.service.TerminalManager; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import org.openintents.intents.FileManagerIntents; import android.app.AlertDialog; import android.app.ListActivity; import android.content.ActivityNotFoundException; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.ServiceConnection; import android.content.DialogInterface.OnClickListener; import android.net.Uri; import android.os.Bundle; import android.os.Environment; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.text.ClipboardManager; import android.util.Log; import android.view.ContextMenu; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.View; import android.view.ViewGroup; import android.view.MenuItem.OnMenuItemClickListener; import android.widget.AdapterView; import android.widget.ArrayAdapter; import android.widget.EditText; import android.widget.ImageView; import android.widget.TableRow; import android.widget.TextView; import android.widget.Toast; import android.widget.AdapterView.OnItemClickListener; import com.trilead.ssh2.crypto.Base64; import com.trilead.ssh2.crypto.PEMDecoder; import com.trilead.ssh2.crypto.PEMStructure; /** * List public keys in database by nickname and describe their properties. Allow users to import, * generate, rename, and delete key pairs. * * @author Kenny Root */ public class PubkeyListActivity extends ListActivity implements EventListener { public final static String TAG = "ConnectBot.PubkeyListActivity"; private static final int MAX_KEYFILE_SIZE = 8192; private static final int REQUEST_CODE_PICK_FILE = 1; // Constants for AndExplorer's file picking intent private static final String ANDEXPLORER_TITLE = "explorer_title"; private static final String MIME_TYPE_ANDEXPLORER_FILE = "vnd.android.cursor.dir/lysesoft.andexplorer.file"; protected PubkeyDatabase pubkeydb; private List<PubkeyBean> pubkeys; protected ClipboardManager clipboard; protected LayoutInflater inflater = null; protected TerminalManager bound = null; private MenuItem onstartToggle = null; private MenuItem confirmUse = null; private ServiceConnection connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { bound = ((TerminalManager.TerminalBinder) service).getService(); // update our listview binder to find the service updateList(); } public void onServiceDisconnected(ComponentName className) { bound = null; updateList(); } }; @Override public void onStart() { super.onStart(); bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(pubkeydb == null) pubkeydb = new PubkeyDatabase(this); } @Override public void onStop() { super.onStop(); unbindService(connection); if(pubkeydb != null) { pubkeydb.close(); pubkeydb = null; } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_pubkeylist); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_pubkey_list))); // connect with hosts database and populate list pubkeydb = new PubkeyDatabase(this); updateList(); registerForContextMenu(getListView()); getListView().setOnItemClickListener(new OnItemClickListener() { public void onItemClick(AdapterView<?> adapter, View view, int position, long id) { PubkeyBean pubkey = (PubkeyBean) getListView().getItemAtPosition(position); boolean loaded = bound.isKeyLoaded(pubkey.getNickname()); // handle toggling key in-memory on/off if(loaded) { bound.removeKey(pubkey.getNickname()); updateHandler.sendEmptyMessage(-1); } else { handleAddKey(pubkey); } } }); clipboard = (ClipboardManager)getSystemService(CLIPBOARD_SERVICE); inflater = LayoutInflater.from(this); } /** * Read given file into memory as <code>byte[]</code>. */ protected static byte[] readRaw(File file) throws Exception { InputStream is = new FileInputStream(file); ByteArrayOutputStream os = new ByteArrayOutputStream(); int bytesRead; byte[] buffer = new byte[1024]; while ((bytesRead = is.read(buffer)) != -1) { os.write(buffer, 0, bytesRead); } os.flush(); os.close(); is.close(); return os.toByteArray(); } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); MenuItem generatekey = menu.add(R.string.pubkey_generate); generatekey.setIcon(android.R.drawable.ic_menu_manage); generatekey.setIntent(new Intent(PubkeyListActivity.this, GeneratePubkeyActivity.class)); MenuItem importkey = menu.add(R.string.pubkey_import); importkey.setIcon(android.R.drawable.ic_menu_upload); importkey.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { Uri sdcard = Uri.fromFile(Environment.getExternalStorageDirectory()); String pickerTitle = getString(R.string.pubkey_list_pick); // Try to use OpenIntent's file browser to pick a file Intent intent = new Intent(FileManagerIntents.ACTION_PICK_FILE); intent.setData(sdcard); intent.putExtra(FileManagerIntents.EXTRA_TITLE, pickerTitle); intent.putExtra(FileManagerIntents.EXTRA_BUTTON_TEXT, getString(android.R.string.ok)); try { startActivityForResult(intent, REQUEST_CODE_PICK_FILE); } catch (ActivityNotFoundException e) { // If OI didn't work, try AndExplorer intent = new Intent(Intent.ACTION_PICK); intent.setDataAndType(sdcard, MIME_TYPE_ANDEXPLORER_FILE); intent.putExtra(ANDEXPLORER_TITLE, pickerTitle); try { startActivityForResult(intent, REQUEST_CODE_PICK_FILE); } catch (ActivityNotFoundException e1) { pickFileSimple(); } } return true; } }); return true; } protected void handleAddKey(final PubkeyBean pubkey) { if (pubkey.isEncrypted()) { final View view = inflater.inflate(R.layout.dia_password, null); final EditText passwordField = (EditText)view.findViewById(android.R.id.text1); new AlertDialog.Builder(PubkeyListActivity.this) .setView(view) .setPositiveButton(R.string.pubkey_unlock, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { handleAddKey(pubkey, passwordField.getText().toString()); } }) .setNegativeButton(android.R.string.cancel, null).create().show(); } else { handleAddKey(pubkey, null); } } protected void handleAddKey(PubkeyBean pubkey, String password) { Object trileadKey = null; if(PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType())) { // load specific key using pem format try { trileadKey = PEMDecoder.decode(new String(pubkey.getPrivateKey()).toCharArray(), password); } catch(Exception e) { String message = getResources().getString(R.string.pubkey_failed_add, pubkey.getNickname()); Log.e(TAG, message, e); Toast.makeText(PubkeyListActivity.this, message, Toast.LENGTH_LONG); } } else { // load using internal generated format PrivateKey privKey = null; PublicKey pubKey = null; try { privKey = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType(), password); pubKey = PubkeyUtils.decodePublic(pubkey.getPublicKey(), pubkey.getType()); } catch (Exception e) { String message = getResources().getString(R.string.pubkey_failed_add, pubkey.getNickname()); Log.e(TAG, message, e); Toast.makeText(PubkeyListActivity.this, message, Toast.LENGTH_LONG); return; } // convert key to trilead format trileadKey = PubkeyUtils.convertToTrilead(privKey, pubKey); Log.d(TAG, "Unlocked key " + PubkeyUtils.formatKey(pubKey)); } if(trileadKey == null) return; Log.d(TAG, String.format("Unlocked key '%s'", pubkey.getNickname())); // save this key in memory bound.addKey(pubkey, trileadKey, true); updateHandler.sendEmptyMessage(-1); } @Override public void onCreateContextMenu(ContextMenu menu, View v, ContextMenu.ContextMenuInfo menuInfo) { // Create menu to handle deleting and editing pubkey AdapterView.AdapterContextMenuInfo info = (AdapterView.AdapterContextMenuInfo) menuInfo; final PubkeyBean pubkey = (PubkeyBean) getListView().getItemAtPosition(info.position); menu.setHeaderTitle(pubkey.getNickname()); // TODO: option load/unload key from in-memory list // prompt for password as needed for passworded keys // cant change password or clipboard imported keys final boolean imported = PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType()); final boolean loaded = bound.isKeyLoaded(pubkey.getNickname()); MenuItem load = menu.add(loaded ? R.string.pubkey_memory_unload : R.string.pubkey_memory_load); load.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { if(loaded) { bound.removeKey(pubkey.getNickname()); updateHandler.sendEmptyMessage(-1); } else { handleAddKey(pubkey); //bound.addKey(nickname, trileadKey); } return true; } }); onstartToggle = menu.add(R.string.pubkey_load_on_start); onstartToggle.setEnabled(!pubkey.isEncrypted()); onstartToggle.setCheckable(true); onstartToggle.setChecked(pubkey.isStartup()); onstartToggle.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // toggle onstart status pubkey.setStartup(!pubkey.isStartup()); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); return true; } }); MenuItem copyPublicToClipboard = menu.add(R.string.pubkey_copy_public); copyPublicToClipboard.setEnabled(!imported); copyPublicToClipboard.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { try { PublicKey pk = PubkeyUtils.decodePublic(pubkey.getPublicKey(), pubkey.getType()); String openSSHPubkey = PubkeyUtils.convertToOpenSSHFormat(pk, pubkey.getNickname()); clipboard.setText(openSSHPubkey); } catch (Exception e) { e.printStackTrace(); } return true; } }); MenuItem copyPrivateToClipboard = menu.add(R.string.pubkey_copy_private); copyPrivateToClipboard.setEnabled(!pubkey.isEncrypted() || imported); copyPrivateToClipboard.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { try { String data = null; if (imported) data = new String(pubkey.getPrivateKey()); else { PrivateKey pk = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType()); data = PubkeyUtils.exportPEM(pk, null); } clipboard.setText(data); } catch (Exception e) { e.printStackTrace(); } return true; } }); MenuItem changePassword = menu.add(R.string.pubkey_change_password); changePassword.setEnabled(!imported); changePassword.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final View changePasswordView = inflater.inflate(R.layout.dia_changepassword, null, false); ((TableRow)changePasswordView.findViewById(R.id.old_password_prompt)) .setVisibility(pubkey.isEncrypted() ? View.VISIBLE : View.GONE); new AlertDialog.Builder(PubkeyListActivity.this) .setView(changePasswordView) .setPositiveButton(R.string.button_change, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { String oldPassword = ((EditText)changePasswordView.findViewById(R.id.old_password)).getText().toString(); String password1 = ((EditText)changePasswordView.findViewById(R.id.password1)).getText().toString(); String password2 = ((EditText)changePasswordView.findViewById(R.id.password2)).getText().toString(); if (!password1.equals(password2)) { new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_passwords_do_not_match_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); return; } try { if (!pubkey.changePassword(oldPassword, password1)) new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_wrong_password_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); else { pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } } catch (Exception e) { Log.e(TAG, "Could not change private key password", e); new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_key_corrupted_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); } } }) .setNegativeButton(android.R.string.cancel, null).create().show(); return true; } }); confirmUse = menu.add(R.string.pubkey_confirm_use); confirmUse.setCheckable(true); confirmUse.setChecked(pubkey.isConfirmUse()); confirmUse.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // toggle confirm use pubkey.setConfirmUse(!pubkey.isConfirmUse()); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); return true; } }); MenuItem delete = menu.add(R.string.pubkey_delete); delete.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // prompt user to make sure they really want this new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(getString(R.string.delete_message, pubkey.getNickname())) .setPositiveButton(R.string.delete_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { // dont forget to remove from in-memory if(loaded) bound.removeKey(pubkey.getNickname()); // delete from backend database and update gui pubkeydb.deletePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } }) .setNegativeButton(R.string.delete_neg, null).create().show(); return true; } }); } protected Handler updateHandler = new Handler() { @Override public void handleMessage(Message msg) { updateList(); } }; protected void updateList() { if (pubkeydb == null) return; pubkeys = pubkeydb.allPubkeys(); PubkeyAdapter adapter = new PubkeyAdapter(this, pubkeys); this.setListAdapter(adapter); } @Override protected void onActivityResult(int requestCode, int resultCode, Intent intent) { super.onActivityResult(requestCode, resultCode, intent); switch (requestCode) { case REQUEST_CODE_PICK_FILE: if (resultCode == RESULT_OK && intent != null) { Uri uri = intent.getData(); try { if (uri != null) { readKeyFromFile(new File(URI.create(uri.toString()))); } else { String filename = intent.getDataString(); if (filename != null) readKeyFromFile(new File(URI.create(filename))); } } catch (IllegalArgumentException e) { Log.e(TAG, "Couldn't read from picked file", e); } } break; } } /** * @param name */ private void readKeyFromFile(File file) { PubkeyBean pubkey = new PubkeyBean(); // find the exact file selected pubkey.setNickname(file.getName()); if (file.length() > MAX_KEYFILE_SIZE) { Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); return; } // parse the actual key once to check if its encrypted // then save original file contents into our database try { byte[] raw = readRaw(file); String data = new String(raw); if (data.startsWith(PubkeyUtils.PKCS8_START)) { int start = data.indexOf(PubkeyUtils.PKCS8_START) + PubkeyUtils.PKCS8_START.length(); int end = data.indexOf(PubkeyUtils.PKCS8_END); if (end > start) { char[] encoded = data.substring(start, end - 1).toCharArray(); Log.d(TAG, "encoded: " + new String(encoded)); byte[] decoded = Base64.decode(encoded); KeyPair kp = PubkeyUtils.recoverKeyPair(decoded); pubkey.setType(kp.getPrivate().getAlgorithm()); pubkey.setPrivateKey(kp.getPrivate().getEncoded()); pubkey.setPublicKey(kp.getPublic().getEncoded()); } else { Log.e(TAG, "Problem parsing PKCS#8 file; corrupt?"); Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); } } else { PEMStructure struct = PEMDecoder.parsePEM(new String(raw).toCharArray()); pubkey.setEncrypted(PEMDecoder.isPEMEncrypted(struct)); pubkey.setType(PubkeyDatabase.KEY_TYPE_IMPORTED); pubkey.setPrivateKey(raw); } // write new value into database if (pubkeydb == null) pubkeydb = new PubkeyDatabase(this); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } catch(Exception e) { Log.e(TAG, "Problem parsing imported private key", e); Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); } } /** * */ private void pickFileSimple() { // build list of all files in sdcard root final File sdcard = Environment.getExternalStorageDirectory(); Log.d(TAG, sdcard.toString()); // Don't show a dialog if the SD card is completely absent. final String state = Environment.getExternalStorageState(); if (!Environment.MEDIA_MOUNTED_READ_ONLY.equals(state) && !Environment.MEDIA_MOUNTED.equals(state)) { new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_sdcard_absent) .setNegativeButton(android.R.string.cancel, null).create().show(); return; } List<String> names = new LinkedList<String>(); { File[] files = sdcard.listFiles(); if (files != null) { for(File file : sdcard.listFiles()) { if(file.isDirectory()) continue; names.add(file.getName()); } } } Collections.sort(names); final String[] namesList = names.toArray(new String[] {}); Log.d(TAG, names.toString()); // prompt user to select any file from the sdcard root new AlertDialog.Builder(PubkeyListActivity.this) .setTitle(R.string.pubkey_list_pick) .setItems(namesList, new OnClickListener() { public void onClick(DialogInterface arg0, int arg1) { String name = namesList[arg1]; readKeyFromFile(new File(sdcard, name)); } }) .setNegativeButton(android.R.string.cancel, null).create().show(); } class PubkeyAdapter extends ArrayAdapter<PubkeyBean> { private List<PubkeyBean> pubkeys; class ViewHolder { public TextView nickname; public TextView caption; public ImageView icon; } public PubkeyAdapter(Context context, List<PubkeyBean> pubkeys) { super(context, R.layout.item_pubkey, pubkeys); this.pubkeys = pubkeys; } @Override public View getView(int position, View convertView, ViewGroup parent) { ViewHolder holder; if (convertView == null) { convertView = inflater.inflate(R.layout.item_pubkey, null, false); holder = new ViewHolder(); holder.nickname = (TextView) convertView.findViewById(android.R.id.text1); holder.caption = (TextView) convertView.findViewById(android.R.id.text2); holder.icon = (ImageView) convertView.findViewById(android.R.id.icon1); convertView.setTag(holder); } else holder = (ViewHolder) convertView.getTag(); PubkeyBean pubkey = pubkeys.get(position); holder.nickname.setText(pubkey.getNickname()); boolean imported = PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType()); if (imported) { try { PEMStructure struct = PEMDecoder.parsePEM(new String(pubkey.getPrivateKey()).toCharArray()); String type = (struct.pemType == PEMDecoder.PEM_RSA_PRIVATE_KEY) ? "RSA" : "DSA"; holder.caption.setText(String.format("%s unknown-bit", type)); } catch (IOException e) { Log.e(TAG, "Error decoding IMPORTED public key at " + pubkey.getId(), e); } } else { try { PublicKey pub = PubkeyUtils.decodePublic(pubkey.getPublicKey(), pubkey.getType()); holder.caption.setText(PubkeyUtils.describeKey(pub, pubkey.isEncrypted())); } catch (Exception e) { Log.e(TAG, "Error decoding public key at " + pubkey.getId(), e); holder.caption.setText(R.string.pubkey_unknown_format); } } if (bound == null) { holder.icon.setVisibility(View.GONE); } else { holder.icon.setVisibility(View.VISIBLE); if (bound.isKeyLoaded(pubkey.getNickname())) holder.icon.setImageState(new int[] { android.R.attr.state_checked }, true); else holder.icon.setImageState(new int[] { }, true); } return convertView; } } }
1031868817-aaaa
src/org/connectbot/PubkeyListActivity.java
Java
asf20
22,220
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * @author Kenny Root * */ public class Colors { public final static Integer[] defaults = new Integer[] { 0xff000000, // black 0xffcc0000, // red 0xff00cc00, // green 0xffcccc00, // brown 0xff0000cc, // blue 0xffcc00cc, // purple 0xff00cccc, // cyan 0xffcccccc, // light grey 0xff444444, // dark grey 0xffff4444, // light red 0xff44ff44, // light green 0xffffff44, // yellow 0xff4444ff, // light blue 0xffff44ff, // light purple 0xff44ffff, // light cyan 0xffffffff, // white 0xff000000, 0xff00005f, 0xff000087, 0xff0000af, 0xff0000d7, 0xff0000ff, 0xff005f00, 0xff005f5f, 0xff005f87, 0xff005faf, 0xff005fd7, 0xff005fff, 0xff008700, 0xff00875f, 0xff008787, 0xff0087af, 0xff0087d7, 0xff0087ff, 0xff00af00, 0xff00af5f, 0xff00af87, 0xff00afaf, 0xff00afd7, 0xff00afff, 0xff00d700, 0xff00d75f, 0xff00d787, 0xff00d7af, 0xff00d7d7, 0xff00d7ff, 0xff00ff00, 0xff00ff5f, 0xff00ff87, 0xff00ffaf, 0xff00ffd7, 0xff00ffff, 0xff5f0000, 0xff5f005f, 0xff5f0087, 0xff5f00af, 0xff5f00d7, 0xff5f00ff, 0xff5f5f00, 0xff5f5f5f, 0xff5f5f87, 0xff5f5faf, 0xff5f5fd7, 0xff5f5fff, 0xff5f8700, 0xff5f875f, 0xff5f8787, 0xff5f87af, 0xff5f87d7, 0xff5f87ff, 0xff5faf00, 0xff5faf5f, 0xff5faf87, 0xff5fafaf, 0xff5fafd7, 0xff5fafff, 0xff5fd700, 0xff5fd75f, 0xff5fd787, 0xff5fd7af, 0xff5fd7d7, 0xff5fd7ff, 0xff5fff00, 0xff5fff5f, 0xff5fff87, 0xff5fffaf, 0xff5fffd7, 0xff5fffff, 0xff870000, 0xff87005f, 0xff870087, 0xff8700af, 0xff8700d7, 0xff8700ff, 0xff875f00, 0xff875f5f, 0xff875f87, 0xff875faf, 0xff875fd7, 0xff875fff, 0xff878700, 0xff87875f, 0xff878787, 0xff8787af, 0xff8787d7, 0xff8787ff, 0xff87af00, 0xff87af5f, 0xff87af87, 0xff87afaf, 0xff87afd7, 0xff87afff, 0xff87d700, 0xff87d75f, 0xff87d787, 0xff87d7af, 0xff87d7d7, 0xff87d7ff, 0xff87ff00, 0xff87ff5f, 0xff87ff87, 0xff87ffaf, 0xff87ffd7, 0xff87ffff, 0xffaf0000, 0xffaf005f, 0xffaf0087, 0xffaf00af, 0xffaf00d7, 0xffaf00ff, 0xffaf5f00, 0xffaf5f5f, 0xffaf5f87, 0xffaf5faf, 0xffaf5fd7, 0xffaf5fff, 0xffaf8700, 0xffaf875f, 0xffaf8787, 0xffaf87af, 0xffaf87d7, 0xffaf87ff, 0xffafaf00, 0xffafaf5f, 0xffafaf87, 0xffafafaf, 0xffafafd7, 0xffafafff, 0xffafd700, 0xffafd75f, 0xffafd787, 0xffafd7af, 0xffafd7d7, 0xffafd7ff, 0xffafff00, 0xffafff5f, 0xffafff87, 0xffafffaf, 0xffafffd7, 0xffafffff, 0xffd70000, 0xffd7005f, 0xffd70087, 0xffd700af, 0xffd700d7, 0xffd700ff, 0xffd75f00, 0xffd75f5f, 0xffd75f87, 0xffd75faf, 0xffd75fd7, 0xffd75fff, 0xffd78700, 0xffd7875f, 0xffd78787, 0xffd787af, 0xffd787d7, 0xffd787ff, 0xffd7af00, 0xffd7af5f, 0xffd7af87, 0xffd7afaf, 0xffd7afd7, 0xffd7afff, 0xffd7d700, 0xffd7d75f, 0xffd7d787, 0xffd7d7af, 0xffd7d7d7, 0xffd7d7ff, 0xffd7ff00, 0xffd7ff5f, 0xffd7ff87, 0xffd7ffaf, 0xffd7ffd7, 0xffd7ffff, 0xffff0000, 0xffff005f, 0xffff0087, 0xffff00af, 0xffff00d7, 0xffff00ff, 0xffff5f00, 0xffff5f5f, 0xffff5f87, 0xffff5faf, 0xffff5fd7, 0xffff5fff, 0xffff8700, 0xffff875f, 0xffff8787, 0xffff87af, 0xffff87d7, 0xffff87ff, 0xffffaf00, 0xffffaf5f, 0xffffaf87, 0xffffafaf, 0xffffafd7, 0xffffafff, 0xffffd700, 0xffffd75f, 0xffffd787, 0xffffd7af, 0xffffd7d7, 0xffffd7ff, 0xffffff00, 0xffffff5f, 0xffffff87, 0xffffffaf, 0xffffffd7, 0xffffffff, 0xff080808, 0xff121212, 0xff1c1c1c, 0xff262626, 0xff303030, 0xff3a3a3a, 0xff444444, 0xff4e4e4e, 0xff585858, 0xff626262, 0xff6c6c6c, 0xff767676, 0xff808080, 0xff8a8a8a, 0xff949494, 0xff9e9e9e, 0xffa8a8a8, 0xffb2b2b2, 0xffbcbcbc, 0xffc6c6c6, 0xffd0d0d0, 0xffdadada, 0xffe4e4e4, 0xffeeeeee, }; }
1031868817-aaaa
src/org/connectbot/util/Colors.java
Java
asf20
4,271
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.io.IOException; import java.math.BigInteger; import java.security.AlgorithmParameters; import java.security.InvalidAlgorithmParameterException; import java.security.InvalidKeyException; import java.security.Key; import java.security.KeyFactory; import java.security.KeyPair; import java.security.MessageDigest; import java.security.NoSuchAlgorithmException; import java.security.PrivateKey; import java.security.PublicKey; import java.security.SecureRandom; import java.security.interfaces.DSAParams; import java.security.interfaces.DSAPrivateKey; import java.security.interfaces.DSAPublicKey; import java.security.interfaces.RSAPrivateCrtKey; import java.security.interfaces.RSAPrivateKey; import java.security.interfaces.RSAPublicKey; import java.security.spec.DSAPublicKeySpec; import java.security.spec.InvalidKeySpecException; import java.security.spec.InvalidParameterSpecException; import java.security.spec.KeySpec; import java.security.spec.PKCS8EncodedKeySpec; import java.security.spec.RSAPublicKeySpec; import java.security.spec.X509EncodedKeySpec; import java.util.Arrays; import javax.crypto.BadPaddingException; import javax.crypto.Cipher; import javax.crypto.EncryptedPrivateKeyInfo; import javax.crypto.IllegalBlockSizeException; import javax.crypto.NoSuchPaddingException; import javax.crypto.SecretKeyFactory; import javax.crypto.spec.PBEKeySpec; import javax.crypto.spec.PBEParameterSpec; import javax.crypto.spec.SecretKeySpec; import android.util.Log; import com.trilead.ssh2.crypto.Base64; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.RSASHA1Verify; public class PubkeyUtils { public static final String PKCS8_START = "-----BEGIN PRIVATE KEY-----"; public static final String PKCS8_END = "-----END PRIVATE KEY-----"; // Size in bytes of salt to use. private static final int SALT_SIZE = 8; // Number of iterations for password hashing. PKCS#5 recommends 1000 private static final int ITERATIONS = 1000; public static String formatKey(Key key){ String algo = key.getAlgorithm(); String fmt = key.getFormat(); byte[] encoded = key.getEncoded(); return "Key[algorithm=" + algo + ", format=" + fmt + ", bytes=" + encoded.length + "]"; } public static String describeKey(Key key, boolean encrypted) { String desc = null; if (key instanceof RSAPublicKey) { int bits = ((RSAPublicKey)key).getModulus().bitLength(); desc = "RSA " + String.valueOf(bits) + "-bit"; } else if (key instanceof DSAPublicKey) { desc = "DSA 1024-bit"; } else { desc = "Unknown Key Type"; } if (encrypted) desc += " (encrypted)"; return desc; } public static byte[] sha256(byte[] data) throws NoSuchAlgorithmException { return MessageDigest.getInstance("SHA-256").digest(data); } public static byte[] cipher(int mode, byte[] data, byte[] secret) throws NoSuchAlgorithmException, NoSuchPaddingException, InvalidKeyException, IllegalBlockSizeException, BadPaddingException { SecretKeySpec secretKeySpec = new SecretKeySpec(sha256(secret), "AES"); Cipher c = Cipher.getInstance("AES"); c.init(mode, secretKeySpec); return c.doFinal(data); } public static byte[] encrypt(byte[] cleartext, String secret) throws Exception { byte[] salt = new byte[SALT_SIZE]; byte[] ciphertext = Encryptor.encrypt(salt, ITERATIONS, secret, cleartext); byte[] complete = new byte[salt.length + ciphertext.length]; System.arraycopy(salt, 0, complete, 0, salt.length); System.arraycopy(ciphertext, 0, complete, salt.length, ciphertext.length); Arrays.fill(salt, (byte) 0x00); Arrays.fill(ciphertext, (byte) 0x00); return complete; } public static byte[] decrypt(byte[] complete, String secret) throws Exception { try { byte[] salt = new byte[SALT_SIZE]; byte[] ciphertext = new byte[complete.length - salt.length]; System.arraycopy(complete, 0, salt, 0, salt.length); System.arraycopy(complete, salt.length, ciphertext, 0, ciphertext.length); return Encryptor.decrypt(salt, ITERATIONS, secret, ciphertext); } catch (Exception e) { Log.d("decrypt", "Could not decrypt with new method", e); // We might be using the old encryption method. return cipher(Cipher.DECRYPT_MODE, complete, secret.getBytes()); } } public static byte[] getEncodedPublic(PublicKey pk) { return new X509EncodedKeySpec(pk.getEncoded()).getEncoded(); } public static byte[] getEncodedPrivate(PrivateKey pk) { return new PKCS8EncodedKeySpec(pk.getEncoded()).getEncoded(); } public static byte[] getEncodedPrivate(PrivateKey pk, String secret) throws Exception { if (secret.length() > 0) return encrypt(getEncodedPrivate(pk), secret); else return getEncodedPrivate(pk); } public static PrivateKey decodePrivate(byte[] encoded, String keyType) throws NoSuchAlgorithmException, InvalidKeySpecException { PKCS8EncodedKeySpec privKeySpec = new PKCS8EncodedKeySpec(encoded); KeyFactory kf = KeyFactory.getInstance(keyType); return kf.generatePrivate(privKeySpec); } public static PrivateKey decodePrivate(byte[] encoded, String keyType, String secret) throws Exception { if (secret != null && secret.length() > 0) return decodePrivate(decrypt(encoded, secret), keyType); else return decodePrivate(encoded, keyType); } public static PublicKey decodePublic(byte[] encoded, String keyType) throws NoSuchAlgorithmException, InvalidKeySpecException { X509EncodedKeySpec pubKeySpec = new X509EncodedKeySpec(encoded); KeyFactory kf = KeyFactory.getInstance(keyType); return kf.generatePublic(pubKeySpec); } public static KeyPair recoverKeyPair(byte[] encoded) throws NoSuchAlgorithmException, InvalidKeySpecException { KeySpec privKeySpec = new PKCS8EncodedKeySpec(encoded); KeySpec pubKeySpec; PrivateKey priv; PublicKey pub; KeyFactory kf; try { kf = KeyFactory.getInstance(PubkeyDatabase.KEY_TYPE_RSA); priv = kf.generatePrivate(privKeySpec); pubKeySpec = new RSAPublicKeySpec(((RSAPrivateCrtKey) priv) .getModulus(), ((RSAPrivateCrtKey) priv) .getPublicExponent()); pub = kf.generatePublic(pubKeySpec); } catch (ClassCastException e) { kf = KeyFactory.getInstance(PubkeyDatabase.KEY_TYPE_DSA); priv = kf.generatePrivate(privKeySpec); DSAParams params = ((DSAPrivateKey) priv).getParams(); // Calculate public key Y BigInteger y = params.getG().modPow(((DSAPrivateKey) priv).getX(), params.getP()); pubKeySpec = new DSAPublicKeySpec(y, params.getP(), params.getQ(), params.getG()); pub = kf.generatePublic(pubKeySpec); } return new KeyPair(pub, priv); } /* * Trilead compatibility methods */ public static Object convertToTrilead(PublicKey pk) { if (pk instanceof RSAPublicKey) { return new com.trilead.ssh2.signature.RSAPublicKey( ((RSAPublicKey) pk).getPublicExponent(), ((RSAPublicKey) pk).getModulus()); } else if (pk instanceof DSAPublicKey) { DSAParams dp = ((DSAPublicKey) pk).getParams(); return new com.trilead.ssh2.signature.DSAPublicKey( dp.getP(), dp.getQ(), dp.getG(), ((DSAPublicKey) pk).getY()); } throw new IllegalArgumentException("PublicKey is not RSA or DSA format"); } public static Object convertToTrilead(PrivateKey priv, PublicKey pub) { if (priv instanceof RSAPrivateKey) { return new com.trilead.ssh2.signature.RSAPrivateKey( ((RSAPrivateKey) priv).getPrivateExponent(), ((RSAPublicKey) pub).getPublicExponent(), ((RSAPrivateKey) priv).getModulus()); } else if (priv instanceof DSAPrivateKey) { DSAParams dp = ((DSAPrivateKey) priv).getParams(); return new com.trilead.ssh2.signature.DSAPrivateKey( dp.getP(), dp.getQ(), dp.getG(), ((DSAPublicKey) pub).getY(), ((DSAPrivateKey) priv).getX()); } throw new IllegalArgumentException("Key is not RSA or DSA format"); } /* * OpenSSH compatibility methods */ public static String convertToOpenSSHFormat(PublicKey pk, String origNickname) throws IOException, InvalidKeyException { String nickname = origNickname; if (nickname == null) nickname = "connectbot@android"; if (pk instanceof RSAPublicKey) { String data = "ssh-rsa "; data += String.valueOf(Base64.encode(RSASHA1Verify.encodeSSHRSAPublicKey( (com.trilead.ssh2.signature.RSAPublicKey)convertToTrilead(pk)))); return data + " " + nickname; } else if (pk instanceof DSAPublicKey) { String data = "ssh-dss "; data += String.valueOf(Base64.encode(DSASHA1Verify.encodeSSHDSAPublicKey( (com.trilead.ssh2.signature.DSAPublicKey)convertToTrilead(pk)))); return data + " " + nickname; } throw new InvalidKeyException("Unknown key type"); } /* * OpenSSH compatibility methods */ /** * @param trileadKey * @return OpenSSH-encoded pubkey */ public static byte[] extractOpenSSHPublic(Object trileadKey) { try { if (trileadKey instanceof com.trilead.ssh2.signature.RSAPrivateKey) return RSASHA1Verify.encodeSSHRSAPublicKey( ((com.trilead.ssh2.signature.RSAPrivateKey) trileadKey).getPublicKey()); else if (trileadKey instanceof com.trilead.ssh2.signature.DSAPrivateKey) return DSASHA1Verify.encodeSSHDSAPublicKey( ((com.trilead.ssh2.signature.DSAPrivateKey) trileadKey).getPublicKey()); else return null; } catch (IOException e) { return null; } } public static String exportPEM(PrivateKey key, String secret) throws NoSuchAlgorithmException, InvalidParameterSpecException, NoSuchPaddingException, InvalidKeyException, InvalidAlgorithmParameterException, InvalidKeySpecException, IllegalBlockSizeException, IOException { StringBuilder sb = new StringBuilder(); byte[] data = key.getEncoded(); sb.append(PKCS8_START); sb.append('\n'); if (secret != null) { byte[] salt = new byte[8]; SecureRandom random = new SecureRandom(); random.nextBytes(salt); PBEParameterSpec defParams = new PBEParameterSpec(salt, 1); AlgorithmParameters params = AlgorithmParameters.getInstance(key.getAlgorithm()); params.init(defParams); PBEKeySpec pbeSpec = new PBEKeySpec(secret.toCharArray()); SecretKeyFactory keyFact = SecretKeyFactory.getInstance(key.getAlgorithm()); Cipher cipher = Cipher.getInstance(key.getAlgorithm()); cipher.init(Cipher.WRAP_MODE, keyFact.generateSecret(pbeSpec), params); byte[] wrappedKey = cipher.wrap(key); EncryptedPrivateKeyInfo pinfo = new EncryptedPrivateKeyInfo(params, wrappedKey); data = pinfo.getEncoded(); sb.append("Proc-Type: 4,ENCRYPTED\n"); sb.append("DEK-Info: DES-EDE3-CBC,"); sb.append(encodeHex(salt)); sb.append("\n\n"); } int i = sb.length(); sb.append(Base64.encode(data)); for (i += 63; i < sb.length(); i += 64) { sb.insert(i, "\n"); } sb.append('\n'); sb.append(PKCS8_END); sb.append('\n'); return sb.toString(); } final static private char hexDigit[] = { '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', 'a', 'b', 'c', 'd', 'e', 'f' }; private static String encodeHex(byte[] bytes) { char[] hex = new char[bytes.length * 2]; int i = 0; for (byte b : bytes) { hex[i++] = hexDigit[(b >> 4) & 0x0f]; hex[i++] = hexDigit[b & 0x0f]; } return new String(hex); } }
1031868817-aaaa
src/org/connectbot/util/PubkeyUtils.java
Java
asf20
11,888
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import org.connectbot.R; import android.app.Dialog; import android.content.Context; import android.view.View; public class EntropyDialog extends Dialog implements OnEntropyGatheredListener { public EntropyDialog(Context context) { super(context); this.setContentView(R.layout.dia_gatherentropy); this.setTitle(R.string.pubkey_gather_entropy); ((EntropyView) findViewById(R.id.entropy)).addOnEntropyGatheredListener(this); } public EntropyDialog(Context context, View view) { super(context); this.setContentView(view); this.setTitle(R.string.pubkey_gather_entropy); ((EntropyView) findViewById(R.id.entropy)).addOnEntropyGatheredListener(this); } public void onEntropyGathered(byte[] entropy) { this.dismiss(); } }
1031868817-aaaa
src/org/connectbot/util/EntropyDialog.java
Java
asf20
1,458
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.io.ByteArrayOutputStream; import java.io.InputStream; import java.net.URL; import java.net.URLConnection; import java.util.Locale; import org.connectbot.R; import org.json.JSONObject; import android.app.AlertDialog; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.SharedPreferences; import android.content.SharedPreferences.Editor; import android.content.pm.PackageInfo; import android.content.pm.PackageManager; import android.net.Uri; import android.os.Handler; import android.os.Message; import android.preference.PreferenceManager; import android.util.Log; /** * Helper class that checks for updates to this application. On construction, it * spawns a background thread that checks for any app updates. If available, * shows a dialog to the user, prompting them to visit Market for the upgrade. * * <b>Be sure to change the UPDATE_URL field before using this class.</b> Then * place a text file at that URL containing JSON data in the format: * * <code>{"versionCode": 110, "features": "Brand new interface with over * 9,000 improvements.", "target": "search?q=searchterms"}</code> * * Which should contain information about your newest version. The * <code>target</code> field is used to build an Intent that launches Market on * the device, simply be prefixing it with <code>market://</code>. If you know * your exact Market ID, you could use the value * <code>details?id=yourexactmarketid</code> * * If you're looking for an advanced version-checking system that offers more * customization, check out Veecheck: http://www.tomgibara.com/android/veecheck/ * * @author jsharkey */ public final class UpdateHelper implements Runnable { public final static String TAG = "ConnectBot.UpdateHelper"; public final static String UPDATE_URL = "http://connectbot.org/version"; protected Context context; private String packageName, versionName; protected int versionCode; private String userAgent; /** * Constructor will automatically spawn thread to check for updates. * Recommended usage is <code>new UpdateHelper(this);</code> in the first * onCreate() of your app. */ public UpdateHelper(Context context) { this.context = context; try { // read current version information about this package PackageManager manager = context.getPackageManager(); PackageInfo info = manager.getPackageInfo(context.getPackageName(), 0); this.packageName = info.packageName; this.versionCode = info.versionCode; this.versionName = info.versionName; } catch(Exception e) { Log.e(TAG, "Couldn't find package information in PackageManager", e); return; } // decide if we really need to check for update SharedPreferences prefs = PreferenceManager.getDefaultSharedPreferences(context); String frequency; try { frequency = prefs.getString(PreferenceConstants.UPDATE, PreferenceConstants.UPDATE_DAILY); } catch (ClassCastException cce) { // Hm, somehow we got a long in there in the previous upgrades. frequency = PreferenceConstants.UPDATE_DAILY; Editor editor = prefs.edit(); editor.putString(PreferenceConstants.UPDATE, frequency); editor.commit(); } long lastChecked = prefs.getLong(PreferenceConstants.LAST_CHECKED, 0); long now = (System.currentTimeMillis() / 1000); long passed = now - lastChecked; boolean shouldCheck = false; if (PreferenceConstants.UPDATE_DAILY.equals(frequency)) { shouldCheck = (passed > 60 * 60 * 24); } else if (PreferenceConstants.UPDATE_WEEKLY.equals(frequency)) { shouldCheck = (passed > 60 * 60 * 24 * 7); } // place version information in user-agent string to be used later userAgent = String.format("%s/%s (%d, freq=%s, lang=%s)", packageName, versionName, versionCode, frequency, Locale.getDefault().getLanguage()); if(shouldCheck) { // spawn thread to check for update // Note that this class should be marked final because a thread is started in the constructor. Thread updateThread = new Thread(this); updateThread.setName("UpdateHelper"); updateThread.start(); // update our last-checked time Editor editor = prefs.edit(); editor.putLong(PreferenceConstants.LAST_CHECKED, now); editor.commit(); } } public void run() { try { // fetch and parse the version update information as json // pass information off to handler to create JSONObject json = new JSONObject(UpdateHelper.getUrl(UPDATE_URL, userAgent)); Message.obtain(versionHandler, -1, json).sendToTarget(); } catch(Exception e) { Log.e(TAG, "Problem while fetching/parsing update response", e); } } /** * Handler that will parse the JSON response and show dialog to user if an * update is available. */ private Handler versionHandler = new Handler() { @Override public void handleMessage(Message msg) { // make sure we are being passed a real json object if(!(msg.obj instanceof JSONObject)) return; JSONObject json = (JSONObject)msg.obj; // pull out version and target information from response final int versionCode = json.optInt("versionCode"); final String features = json.optString("features"); final String target = "market://" + json.optString("target"); // skip if we're already good enough if(versionCode <= UpdateHelper.this.versionCode) return; // build dialog to prompt user about updating new AlertDialog.Builder(context) .setTitle(R.string.upgrade) .setMessage(features) .setPositiveButton(R.string.upgrade_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { Intent intent = new Intent(Intent.ACTION_VIEW, Uri.parse(target)); context.startActivity(intent); } }) .setNegativeButton(R.string.upgrade_neg, null).create().show(); } }; /** * Read contents of a URL and return as a String. Handles any server * downtime with a 6-second timeout. */ private static String getUrl(String tryUrl, String userAgent) throws Exception { URL url = new URL(tryUrl); URLConnection connection = url.openConnection(); connection.setConnectTimeout(6000); connection.setReadTimeout(6000); connection.setRequestProperty("User-Agent", userAgent); connection.connect(); InputStream is = connection.getInputStream(); ByteArrayOutputStream os = new ByteArrayOutputStream(); int bytesRead; byte[] buffer = new byte[1024]; while ((bytesRead = is.read(buffer)) != -1) { os.write(buffer, 0, bytesRead); } os.flush(); os.close(); is.close(); return new String(os.toByteArray()); } }
1031868817-aaaa
src/org/connectbot/util/UpdateHelper.java
Java
asf20
7,347
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.util.LinkedList; import java.util.List; import org.connectbot.bean.PubkeyBean; import android.content.ContentValues; import android.content.Context; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.database.sqlite.SQLiteException; /** * Public Key Encryption database. Contains private and public key pairs * for public key authentication. * * @author Kenny Root */ public class PubkeyDatabase extends RobustSQLiteOpenHelper { public final static String TAG = "ConnectBot.PubkeyDatabase"; public final static String DB_NAME = "pubkeys"; public final static int DB_VERSION = 2; public final static String TABLE_PUBKEYS = "pubkeys"; public final static String FIELD_PUBKEY_NICKNAME = "nickname"; public final static String FIELD_PUBKEY_TYPE = "type"; public final static String FIELD_PUBKEY_PRIVATE = "private"; public final static String FIELD_PUBKEY_PUBLIC = "public"; public final static String FIELD_PUBKEY_ENCRYPTED = "encrypted"; public final static String FIELD_PUBKEY_STARTUP = "startup"; public final static String FIELD_PUBKEY_CONFIRMUSE = "confirmuse"; public final static String FIELD_PUBKEY_LIFETIME = "lifetime"; public final static String KEY_TYPE_RSA = "RSA", KEY_TYPE_DSA = "DSA", KEY_TYPE_IMPORTED = "IMPORTED"; private Context context; static { addTableName(TABLE_PUBKEYS); } public PubkeyDatabase(Context context) { super(context, DB_NAME, null, DB_VERSION); this.context = context; } @Override public void onCreate(SQLiteDatabase db) { super.onCreate(db); db.execSQL("CREATE TABLE " + TABLE_PUBKEYS + " (_id INTEGER PRIMARY KEY, " + FIELD_PUBKEY_NICKNAME + " TEXT, " + FIELD_PUBKEY_TYPE + " TEXT, " + FIELD_PUBKEY_PRIVATE + " BLOB, " + FIELD_PUBKEY_PUBLIC + " BLOB, " + FIELD_PUBKEY_ENCRYPTED + " INTEGER, " + FIELD_PUBKEY_STARTUP + " INTEGER, " + FIELD_PUBKEY_CONFIRMUSE + " INTEGER DEFAULT 0, " + FIELD_PUBKEY_LIFETIME + " INTEGER DEFAULT 0)"); } @Override public void onRobustUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) throws SQLiteException { switch (oldVersion) { case 1: db.execSQL("ALTER TABLE " + TABLE_PUBKEYS + " ADD COLUMN " + FIELD_PUBKEY_CONFIRMUSE + " INTEGER DEFAULT 0"); db.execSQL("ALTER TABLE " + TABLE_PUBKEYS + " ADD COLUMN " + FIELD_PUBKEY_LIFETIME + " INTEGER DEFAULT 0"); } } /** * Delete a specific host by its <code>_id</code> value. */ public void deletePubkey(PubkeyBean pubkey) { HostDatabase hostdb = new HostDatabase(context); hostdb.stopUsingPubkey(pubkey.getId()); hostdb.close(); SQLiteDatabase db = getWritableDatabase(); db.delete(TABLE_PUBKEYS, "_id = ?", new String[] { Long.toString(pubkey.getId()) }); db.close(); } /** * Return a cursor that contains information about all known hosts. */ /* public Cursor allPubkeys() { SQLiteDatabase db = this.getReadableDatabase(); return db.query(TABLE_PUBKEYS, new String[] { "_id", FIELD_PUBKEY_NICKNAME, FIELD_PUBKEY_TYPE, FIELD_PUBKEY_PRIVATE, FIELD_PUBKEY_PUBLIC, FIELD_PUBKEY_ENCRYPTED, FIELD_PUBKEY_STARTUP }, null, null, null, null, null); }*/ public List<PubkeyBean> allPubkeys() { return getPubkeys(null, null); } public List<PubkeyBean> getAllStartPubkeys() { return getPubkeys(FIELD_PUBKEY_STARTUP + " = 1 AND " + FIELD_PUBKEY_ENCRYPTED + " = 0", null); } private List<PubkeyBean> getPubkeys(String selection, String[] selectionArgs) { SQLiteDatabase db = getReadableDatabase(); List<PubkeyBean> pubkeys = new LinkedList<PubkeyBean>(); Cursor c = db.query(TABLE_PUBKEYS, null, selection, selectionArgs, null, null, null); if (c != null) { final int COL_ID = c.getColumnIndexOrThrow("_id"), COL_NICKNAME = c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME), COL_TYPE = c.getColumnIndexOrThrow(FIELD_PUBKEY_TYPE), COL_PRIVATE = c.getColumnIndexOrThrow(FIELD_PUBKEY_PRIVATE), COL_PUBLIC = c.getColumnIndexOrThrow(FIELD_PUBKEY_PUBLIC), COL_ENCRYPTED = c.getColumnIndexOrThrow(FIELD_PUBKEY_ENCRYPTED), COL_STARTUP = c.getColumnIndexOrThrow(FIELD_PUBKEY_STARTUP), COL_CONFIRMUSE = c.getColumnIndexOrThrow(FIELD_PUBKEY_CONFIRMUSE), COL_LIFETIME = c.getColumnIndexOrThrow(FIELD_PUBKEY_LIFETIME); while (c.moveToNext()) { PubkeyBean pubkey = new PubkeyBean(); pubkey.setId(c.getLong(COL_ID)); pubkey.setNickname(c.getString(COL_NICKNAME)); pubkey.setType(c.getString(COL_TYPE)); pubkey.setPrivateKey(c.getBlob(COL_PRIVATE)); pubkey.setPublicKey(c.getBlob(COL_PUBLIC)); pubkey.setEncrypted(c.getInt(COL_ENCRYPTED) > 0); pubkey.setStartup(c.getInt(COL_STARTUP) > 0); pubkey.setConfirmUse(c.getInt(COL_CONFIRMUSE) > 0); pubkey.setLifetime(c.getInt(COL_LIFETIME)); pubkeys.add(pubkey); } c.close(); } db.close(); return pubkeys; } /** * @param hostId * @return */ public PubkeyBean findPubkeyById(long pubkeyId) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, null, "_id = ?", new String[] { String.valueOf(pubkeyId) }, null, null, null); PubkeyBean pubkey = null; if (c != null) { if (c.moveToFirst()) pubkey = createPubkeyBean(c); c.close(); } db.close(); return pubkey; } private PubkeyBean createPubkeyBean(Cursor c) { PubkeyBean pubkey = new PubkeyBean(); pubkey.setId(c.getLong(c.getColumnIndexOrThrow("_id"))); pubkey.setNickname(c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME))); pubkey.setType(c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_TYPE))); pubkey.setPrivateKey(c.getBlob(c.getColumnIndexOrThrow(FIELD_PUBKEY_PRIVATE))); pubkey.setPublicKey(c.getBlob(c.getColumnIndexOrThrow(FIELD_PUBKEY_PUBLIC))); pubkey.setEncrypted(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_ENCRYPTED)) > 0); pubkey.setStartup(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_STARTUP)) > 0); pubkey.setConfirmUse(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_CONFIRMUSE)) > 0); pubkey.setLifetime(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_LIFETIME))); return pubkey; } /** * Pull all values for a given column as a list of Strings, probably for use * in a ListPreference. Sorted by <code>_id</code> ascending. */ public List<CharSequence> allValues(String column) { List<CharSequence> list = new LinkedList<CharSequence>(); SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { "_id", column }, null, null, null, null, "_id ASC"); if (c != null) { int COL = c.getColumnIndexOrThrow(column); while (c.moveToNext()) list.add(c.getString(COL)); c.close(); } db.close(); return list; } public String getNickname(long id) { String nickname = null; SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { "_id", FIELD_PUBKEY_NICKNAME }, "_id = ?", new String[] { Long.toString(id) }, null, null, null); if (c != null) { if (c.moveToFirst()) nickname = c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME)); c.close(); } db.close(); return nickname; } /* public void setOnStart(long id, boolean onStart) { SQLiteDatabase db = this.getWritableDatabase(); ContentValues values = new ContentValues(); values.put(FIELD_PUBKEY_STARTUP, onStart ? 1 : 0); db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { Long.toString(id) }); } public boolean changePassword(long id, String oldPassword, String newPassword) throws NoSuchAlgorithmException, NoSuchPaddingException, IllegalBlockSizeException, InvalidKeyException, BadPaddingException { SQLiteDatabase db = this.getWritableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { FIELD_PUBKEY_TYPE, FIELD_PUBKEY_PRIVATE, FIELD_PUBKEY_ENCRYPTED }, "_id = ?", new String[] { String.valueOf(id) }, null, null, null); if (!c.moveToFirst()) return false; String keyType = c.getString(0); byte[] encPriv = c.getBlob(1); c.close(); PrivateKey priv; try { priv = PubkeyUtils.decodePrivate(encPriv, keyType, oldPassword); } catch (InvalidKeyException e) { return false; } catch (BadPaddingException e) { return false; } catch (InvalidKeySpecException e) { return false; } ContentValues values = new ContentValues(); values.put(FIELD_PUBKEY_PRIVATE, PubkeyUtils.getEncodedPrivate(priv, newPassword)); values.put(FIELD_PUBKEY_ENCRYPTED, newPassword.length() > 0 ? 1 : 0); db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { String.valueOf(id) }); return true; } */ /** * @param pubkey */ public PubkeyBean savePubkey(PubkeyBean pubkey) { SQLiteDatabase db = this.getWritableDatabase(); boolean success = false; ContentValues values = pubkey.getValues(); if (pubkey.getId() > 0) { values.remove("_id"); if (db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { String.valueOf(pubkey.getId()) }) > 0) success = true; } if (!success) { long id = db.insert(TABLE_PUBKEYS, null, pubkey.getValues()); pubkey.setId(id); } db.close(); return pubkey; } }
1031868817-aaaa
src/org/connectbot/util/PubkeyDatabase.java
Java
asf20
9,887
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import android.graphics.Paint; import android.text.AndroidCharacter; /** * @author Kenny Root * */ public abstract class EastAsianWidth { public static EastAsianWidth getInstance() { if (PreferenceConstants.PRE_FROYO) return PreFroyo.Holder.sInstance; else return FroyoAndBeyond.Holder.sInstance; } /** * @param charArray * @param i * @param position * @param wideAttribute */ public abstract void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth); private static class PreFroyo extends EastAsianWidth { private static final int BUFFER_SIZE = 4096; private float[] mWidths = new float[BUFFER_SIZE]; private static class Holder { private static final PreFroyo sInstance = new PreFroyo(); } @Override public void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth) { paint.getTextWidths(charArray, start, end, mWidths); final int N = end - start; for (int i = 0; i < N; i++) wideAttribute[i] = (byte) (((int)mWidths[i] != charWidth) ? AndroidCharacter.EAST_ASIAN_WIDTH_WIDE : AndroidCharacter.EAST_ASIAN_WIDTH_NARROW); } } private static class FroyoAndBeyond extends EastAsianWidth { private static class Holder { private static final FroyoAndBeyond sInstance = new FroyoAndBeyond(); } @Override public void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth) { AndroidCharacter.getEastAsianWidths(charArray, start, end - start, wideAttribute); } } }
1031868817-aaaa
src/org/connectbot/util/EastAsianWidth.java
Java
asf20
2,300
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import org.connectbot.HelpActivity; import android.content.Context; import android.util.AttributeSet; import android.webkit.WebSettings; import android.webkit.WebView; /** * @author Kenny Root * */ public class HelpTopicView extends WebView { public HelpTopicView(Context context, AttributeSet attrs, int defStyle) { super(context, attrs, defStyle); initialize(); } public HelpTopicView(Context context, AttributeSet attrs) { super(context, attrs); initialize(); } public HelpTopicView(Context context) { super(context); initialize(); } private void initialize() { WebSettings wSet = getSettings(); wSet.setLayoutAlgorithm(WebSettings.LayoutAlgorithm.NARROW_COLUMNS); wSet.setUseWideViewPort(false); } public HelpTopicView setTopic(String topic) { String path = String.format("file:///android_asset/%s/%s%s", HelpActivity.HELPDIR, topic, HelpActivity.SUFFIX); loadUrl(path); computeScroll(); return this; } }
1031868817-aaaa
src/org/connectbot/util/HelpTopicView.java
Java
asf20
1,670
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * @author kroot * */ public interface OnDbWrittenListener { public void onDbWritten(); }
1031868817-aaaa
src/org/connectbot/util/OnDbWrittenListener.java
Java
asf20
807
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.util.Vector; import org.connectbot.R; import android.content.Context; import android.graphics.Canvas; import android.graphics.Color; import android.graphics.Paint; import android.graphics.Typeface; import android.graphics.Paint.FontMetrics; import android.util.AttributeSet; import android.view.MotionEvent; import android.view.View; public class EntropyView extends View { private static final int SHA1_MAX_BYTES = 20; private static final int MILLIS_BETWEEN_INPUTS = 50; private Paint mPaint; private FontMetrics mFontMetrics; private boolean mFlipFlop; private long mLastTime; private Vector<OnEntropyGatheredListener> listeners; private byte[] mEntropy; private int mEntropyByteIndex; private int mEntropyBitIndex; private int splitText = 0; private float lastX = 0.0f, lastY = 0.0f; public EntropyView(Context context) { super(context); setUpEntropy(); } public EntropyView(Context context, AttributeSet attrs) { super(context, attrs); setUpEntropy(); } private void setUpEntropy() { mPaint = new Paint(); mPaint.setAntiAlias(true); mPaint.setTypeface(Typeface.DEFAULT); mPaint.setTextAlign(Paint.Align.CENTER); mPaint.setTextSize(16); mPaint.setColor(Color.WHITE); mFontMetrics = mPaint.getFontMetrics(); mEntropy = new byte[SHA1_MAX_BYTES]; mEntropyByteIndex = 0; mEntropyBitIndex = 0; listeners = new Vector<OnEntropyGatheredListener>(); } public void addOnEntropyGatheredListener(OnEntropyGatheredListener listener) { listeners.add(listener); } public void removeOnEntropyGatheredListener(OnEntropyGatheredListener listener) { listeners.remove(listener); } @Override public void onDraw(Canvas c) { String prompt = String.format(getResources().getString(R.string.pubkey_touch_prompt), (int)(100.0 * (mEntropyByteIndex / 20.0)) + (int)(5.0 * (mEntropyBitIndex / 8.0))); if (splitText > 0 || mPaint.measureText(prompt) > (getWidth() * 0.8)) { if (splitText == 0) splitText = prompt.indexOf(" ", prompt.length() / 2); c.drawText(prompt.substring(0, splitText), getWidth() / 2.0f, getHeight() / 2.0f + (mPaint.ascent() + mPaint.descent()), mPaint); c.drawText(prompt.substring(splitText), getWidth() / 2.0f, getHeight() / 2.0f - (mPaint.ascent() + mPaint.descent()), mPaint); } else { c.drawText(prompt, getWidth() / 2.0f, getHeight() / 2.0f - (mFontMetrics.ascent + mFontMetrics.descent) / 2, mPaint); } } @Override public boolean onTouchEvent(MotionEvent event) { if (mEntropyByteIndex >= SHA1_MAX_BYTES || lastX == event.getX() || lastY == event.getY()) return true; // Only get entropy every 200 milliseconds to ensure the user has moved around. long now = System.currentTimeMillis(); if ((now - mLastTime) < MILLIS_BETWEEN_INPUTS) return true; else mLastTime = now; byte input; lastX = event.getX(); lastY = event.getY(); // Get the lowest 4 bits of each X, Y input and concat to the entropy-gathering // string. if (mFlipFlop) input = (byte)((((int)lastX & 0x0F) << 4) | ((int)lastY & 0x0F)); else input = (byte)((((int)lastY & 0x0F) << 4) | ((int)lastX & 0x0F)); mFlipFlop = !mFlipFlop; for (int i = 0; i < 4 && mEntropyByteIndex < SHA1_MAX_BYTES; i++) { if ((input & 0x3) == 0x1) { mEntropy[mEntropyByteIndex] <<= 1; mEntropy[mEntropyByteIndex] |= 1; mEntropyBitIndex++; input >>= 2; } else if ((input & 0x3) == 0x2) { mEntropy[mEntropyByteIndex] <<= 1; mEntropyBitIndex++; input >>= 2; } if (mEntropyBitIndex >= 8) { mEntropyBitIndex = 0; mEntropyByteIndex++; } } // SHA1PRNG only keeps 160 bits of entropy. if (mEntropyByteIndex >= SHA1_MAX_BYTES) { for (OnEntropyGatheredListener listener: listeners) { listener.onEntropyGathered(mEntropy); } } invalidate(); return true; } }
1031868817-aaaa
src/org/connectbot/util/EntropyView.java
Java
asf20
4,607
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * This class is from: * * Encryptor.java * Copyright 2008 Zach Scrivena * zachscrivena@gmail.com * http://zs.freeshell.org/ */ import java.security.MessageDigest; import java.security.SecureRandom; import java.util.Arrays; import javax.crypto.Cipher; import javax.crypto.spec.IvParameterSpec; import javax.crypto.spec.SecretKeySpec; /** * Perform AES-128 encryption. */ public final class Encryptor { /** name of the character set to use for converting between characters and bytes */ private static final String CHARSET_NAME = "UTF-8"; /** random number generator algorithm */ private static final String RNG_ALGORITHM = "SHA1PRNG"; /** message digest algorithm (must be sufficiently long to provide the key and initialization vector) */ private static final String DIGEST_ALGORITHM = "SHA-256"; /** key algorithm (must be compatible with CIPHER_ALGORITHM) */ private static final String KEY_ALGORITHM = "AES"; /** cipher algorithm (must be compatible with KEY_ALGORITHM) */ private static final String CIPHER_ALGORITHM = "AES/CBC/PKCS5Padding"; /** * Private constructor that should never be called. */ private Encryptor() {} /** * Encrypt the specified cleartext using the given password. * With the correct salt, number of iterations, and password, the decrypt() method reverses * the effect of this method. * This method generates and uses a random salt, and the user-specified number of iterations * and password to create a 16-byte secret key and 16-byte initialization vector. * The secret key and initialization vector are then used in the AES-128 cipher to encrypt * the given cleartext. * * @param salt * salt that was used in the encryption (to be populated) * @param iterations * number of iterations to use in salting * @param password * password to be used for encryption * @param cleartext * cleartext to be encrypted * @return * ciphertext * @throws Exception * on any error encountered in encryption */ public static byte[] encrypt( final byte[] salt, final int iterations, final String password, final byte[] cleartext) throws Exception { /* generate salt randomly */ SecureRandom.getInstance(RNG_ALGORITHM).nextBytes(salt); /* compute key and initialization vector */ final MessageDigest shaDigest = MessageDigest.getInstance(DIGEST_ALGORITHM); byte[] pw = password.getBytes(CHARSET_NAME); for (int i = 0; i < iterations; i++) { /* add salt */ final byte[] salted = new byte[pw.length + salt.length]; System.arraycopy(pw, 0, salted, 0, pw.length); System.arraycopy(salt, 0, salted, pw.length, salt.length); Arrays.fill(pw, (byte) 0x00); /* compute SHA-256 digest */ shaDigest.reset(); pw = shaDigest.digest(salted); Arrays.fill(salted, (byte) 0x00); } /* extract the 16-byte key and initialization vector from the SHA-256 digest */ final byte[] key = new byte[16]; final byte[] iv = new byte[16]; System.arraycopy(pw, 0, key, 0, 16); System.arraycopy(pw, 16, iv, 0, 16); Arrays.fill(pw, (byte) 0x00); /* perform AES-128 encryption */ final Cipher cipher = Cipher.getInstance(CIPHER_ALGORITHM); cipher.init( Cipher.ENCRYPT_MODE, new SecretKeySpec(key, KEY_ALGORITHM), new IvParameterSpec(iv)); Arrays.fill(key, (byte) 0x00); Arrays.fill(iv, (byte) 0x00); return cipher.doFinal(cleartext); } /** * Decrypt the specified ciphertext using the given password. * With the correct salt, number of iterations, and password, this method reverses the effect * of the encrypt() method. * This method uses the user-specified salt, number of iterations, and password * to recreate the 16-byte secret key and 16-byte initialization vector. * The secret key and initialization vector are then used in the AES-128 cipher to decrypt * the given ciphertext. * * @param salt * salt to be used in decryption * @param iterations * number of iterations to use in salting * @param password * password to be used for decryption * @param ciphertext * ciphertext to be decrypted * @return * cleartext * @throws Exception * on any error encountered in decryption */ public static byte[] decrypt( final byte[] salt, final int iterations, final String password, final byte[] ciphertext) throws Exception { /* compute key and initialization vector */ final MessageDigest shaDigest = MessageDigest.getInstance(DIGEST_ALGORITHM); byte[] pw = password.getBytes(CHARSET_NAME); for (int i = 0; i < iterations; i++) { /* add salt */ final byte[] salted = new byte[pw.length + salt.length]; System.arraycopy(pw, 0, salted, 0, pw.length); System.arraycopy(salt, 0, salted, pw.length, salt.length); Arrays.fill(pw, (byte) 0x00); /* compute SHA-256 digest */ shaDigest.reset(); pw = shaDigest.digest(salted); Arrays.fill(salted, (byte) 0x00); } /* extract the 16-byte key and initialization vector from the SHA-256 digest */ final byte[] key = new byte[16]; final byte[] iv = new byte[16]; System.arraycopy(pw, 0, key, 0, 16); System.arraycopy(pw, 16, iv, 0, 16); Arrays.fill(pw, (byte) 0x00); /* perform AES-128 decryption */ final Cipher cipher = Cipher.getInstance(CIPHER_ALGORITHM); cipher.init( Cipher.DECRYPT_MODE, new SecretKeySpec(key, KEY_ALGORITHM), new IvParameterSpec(iv)); Arrays.fill(key, (byte) 0x00); Arrays.fill(iv, (byte) 0x00); return cipher.doFinal(ciphertext); } }
1031868817-aaaa
src/org/connectbot/util/Encryptor.java
Java
asf20
6,191
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.nio.charset.Charset; import java.util.Iterator; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Map.Entry; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import android.content.ContentValues; import android.content.Context; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.database.sqlite.SQLiteException; import android.util.Log; import com.trilead.ssh2.KnownHosts; /** * Contains information about various SSH hosts, include public hostkey if known * from previous sessions. * * @author jsharkey */ public class HostDatabase extends RobustSQLiteOpenHelper { public final static String TAG = "ConnectBot.HostDatabase"; public final static String DB_NAME = "hosts"; public final static int DB_VERSION = 22; public final static String TABLE_HOSTS = "hosts"; public final static String FIELD_HOST_NICKNAME = "nickname"; public final static String FIELD_HOST_PROTOCOL = "protocol"; public final static String FIELD_HOST_USERNAME = "username"; public final static String FIELD_HOST_HOSTNAME = "hostname"; public final static String FIELD_HOST_PORT = "port"; public final static String FIELD_HOST_HOSTKEYALGO = "hostkeyalgo"; public final static String FIELD_HOST_HOSTKEY = "hostkey"; public final static String FIELD_HOST_LASTCONNECT = "lastconnect"; public final static String FIELD_HOST_COLOR = "color"; public final static String FIELD_HOST_USEKEYS = "usekeys"; public final static String FIELD_HOST_USEAUTHAGENT = "useauthagent"; public final static String FIELD_HOST_POSTLOGIN = "postlogin"; public final static String FIELD_HOST_PUBKEYID = "pubkeyid"; public final static String FIELD_HOST_WANTSESSION = "wantsession"; public final static String FIELD_HOST_DELKEY = "delkey"; public final static String FIELD_HOST_FONTSIZE = "fontsize"; public final static String FIELD_HOST_COMPRESSION = "compression"; public final static String FIELD_HOST_ENCODING = "encoding"; public final static String FIELD_HOST_STAYCONNECTED = "stayconnected"; public final static String TABLE_PORTFORWARDS = "portforwards"; public final static String FIELD_PORTFORWARD_HOSTID = "hostid"; public final static String FIELD_PORTFORWARD_NICKNAME = "nickname"; public final static String FIELD_PORTFORWARD_TYPE = "type"; public final static String FIELD_PORTFORWARD_SOURCEPORT = "sourceport"; public final static String FIELD_PORTFORWARD_DESTADDR = "destaddr"; public final static String FIELD_PORTFORWARD_DESTPORT = "destport"; public final static String TABLE_COLORS = "colors"; public final static String FIELD_COLOR_SCHEME = "scheme"; public final static String FIELD_COLOR_NUMBER = "number"; public final static String FIELD_COLOR_VALUE = "value"; public final static String TABLE_COLOR_DEFAULTS = "colorDefaults"; public final static String FIELD_COLOR_FG = "fg"; public final static String FIELD_COLOR_BG = "bg"; public final static int DEFAULT_FG_COLOR = 7; public final static int DEFAULT_BG_COLOR = 0; public final static String COLOR_RED = "red"; public final static String COLOR_GREEN = "green"; public final static String COLOR_BLUE = "blue"; public final static String COLOR_GRAY = "gray"; public final static String PORTFORWARD_LOCAL = "local"; public final static String PORTFORWARD_REMOTE = "remote"; public final static String PORTFORWARD_DYNAMIC4 = "dynamic4"; public final static String PORTFORWARD_DYNAMIC5 = "dynamic5"; public final static String DELKEY_DEL = "del"; public final static String DELKEY_BACKSPACE = "backspace"; public final static String AUTHAGENT_NO = "no"; public final static String AUTHAGENT_CONFIRM = "confirm"; public final static String AUTHAGENT_YES = "yes"; public final static String ENCODING_DEFAULT = Charset.defaultCharset().name(); public final static long PUBKEYID_NEVER = -2; public final static long PUBKEYID_ANY = -1; public static final int DEFAULT_COLOR_SCHEME = 0; // Table creation strings public static final String CREATE_TABLE_COLOR_DEFAULTS = "CREATE TABLE " + TABLE_COLOR_DEFAULTS + " (" + FIELD_COLOR_SCHEME + " INTEGER NOT NULL, " + FIELD_COLOR_FG + " INTEGER NOT NULL DEFAULT " + DEFAULT_FG_COLOR + ", " + FIELD_COLOR_BG + " INTEGER NOT NULL DEFAULT " + DEFAULT_BG_COLOR + ")"; public static final String CREATE_TABLE_COLOR_DEFAULTS_INDEX = "CREATE INDEX " + TABLE_COLOR_DEFAULTS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLOR_DEFAULTS + " (" + FIELD_COLOR_SCHEME + ");"; static { addTableName(TABLE_HOSTS); addTableName(TABLE_PORTFORWARDS); addIndexName(TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index"); addTableName(TABLE_COLORS); addIndexName(TABLE_COLORS + FIELD_COLOR_SCHEME + "index"); addTableName(TABLE_COLOR_DEFAULTS); addIndexName(TABLE_COLOR_DEFAULTS + FIELD_COLOR_SCHEME + "index"); } public static final Object[] dbLock = new Object[0]; public HostDatabase(Context context) { super(context, DB_NAME, null, DB_VERSION); getWritableDatabase().close(); } @Override public void onCreate(SQLiteDatabase db) { super.onCreate(db); db.execSQL("CREATE TABLE " + TABLE_HOSTS + " (_id INTEGER PRIMARY KEY, " + FIELD_HOST_NICKNAME + " TEXT, " + FIELD_HOST_PROTOCOL + " TEXT DEFAULT 'ssh', " + FIELD_HOST_USERNAME + " TEXT, " + FIELD_HOST_HOSTNAME + " TEXT, " + FIELD_HOST_PORT + " INTEGER, " + FIELD_HOST_HOSTKEYALGO + " TEXT, " + FIELD_HOST_HOSTKEY + " BLOB, " + FIELD_HOST_LASTCONNECT + " INTEGER, " + FIELD_HOST_COLOR + " TEXT, " + FIELD_HOST_USEKEYS + " TEXT, " + FIELD_HOST_USEAUTHAGENT + " TEXT, " + FIELD_HOST_POSTLOGIN + " TEXT, " + FIELD_HOST_PUBKEYID + " INTEGER DEFAULT " + PUBKEYID_ANY + ", " + FIELD_HOST_DELKEY + " TEXT DEFAULT '" + DELKEY_DEL + "', " + FIELD_HOST_FONTSIZE + " INTEGER, " + FIELD_HOST_WANTSESSION + " TEXT DEFAULT '" + Boolean.toString(true) + "', " + FIELD_HOST_COMPRESSION + " TEXT DEFAULT '" + Boolean.toString(false) + "', " + FIELD_HOST_ENCODING + " TEXT DEFAULT '" + ENCODING_DEFAULT + "', " + FIELD_HOST_STAYCONNECTED + " TEXT)"); db.execSQL("CREATE TABLE " + TABLE_PORTFORWARDS + " (_id INTEGER PRIMARY KEY, " + FIELD_PORTFORWARD_HOSTID + " INTEGER, " + FIELD_PORTFORWARD_NICKNAME + " TEXT, " + FIELD_PORTFORWARD_TYPE + " TEXT NOT NULL DEFAULT " + PORTFORWARD_LOCAL + ", " + FIELD_PORTFORWARD_SOURCEPORT + " INTEGER NOT NULL DEFAULT 8080, " + FIELD_PORTFORWARD_DESTADDR + " TEXT, " + FIELD_PORTFORWARD_DESTPORT + " TEXT)"); db.execSQL("CREATE INDEX " + TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index ON " + TABLE_PORTFORWARDS + " (" + FIELD_PORTFORWARD_HOSTID + ");"); db.execSQL("CREATE TABLE " + TABLE_COLORS + " (_id INTEGER PRIMARY KEY, " + FIELD_COLOR_NUMBER + " INTEGER, " + FIELD_COLOR_VALUE + " INTEGER, " + FIELD_COLOR_SCHEME + " INTEGER)"); db.execSQL("CREATE INDEX " + TABLE_COLORS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLORS + " (" + FIELD_COLOR_SCHEME + ");"); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS_INDEX); } @Override public void onRobustUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) throws SQLiteException { // Versions of the database before the Android Market release will be // shot without warning. if (oldVersion <= 9) { db.execSQL("DROP TABLE IF EXISTS " + TABLE_HOSTS); onCreate(db); return; } switch (oldVersion) { case 10: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_PUBKEYID + " INTEGER DEFAULT " + PUBKEYID_ANY); case 11: db.execSQL("CREATE TABLE " + TABLE_PORTFORWARDS + " (_id INTEGER PRIMARY KEY, " + FIELD_PORTFORWARD_HOSTID + " INTEGER, " + FIELD_PORTFORWARD_NICKNAME + " TEXT, " + FIELD_PORTFORWARD_TYPE + " TEXT NOT NULL DEFAULT " + PORTFORWARD_LOCAL + ", " + FIELD_PORTFORWARD_SOURCEPORT + " INTEGER NOT NULL DEFAULT 8080, " + FIELD_PORTFORWARD_DESTADDR + " TEXT, " + FIELD_PORTFORWARD_DESTPORT + " INTEGER)"); case 12: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_WANTSESSION + " TEXT DEFAULT '" + Boolean.toString(true) + "'"); case 13: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_COMPRESSION + " TEXT DEFAULT '" + Boolean.toString(false) + "'"); case 14: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_ENCODING + " TEXT DEFAULT '" + ENCODING_DEFAULT + "'"); case 15: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_PROTOCOL + " TEXT DEFAULT 'ssh'"); case 16: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_DELKEY + " TEXT DEFAULT '" + DELKEY_DEL + "'"); case 17: db.execSQL("CREATE INDEX " + TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index ON " + TABLE_PORTFORWARDS + " (" + FIELD_PORTFORWARD_HOSTID + ");"); // Add colors db.execSQL("CREATE TABLE " + TABLE_COLORS + " (_id INTEGER PRIMARY KEY, " + FIELD_COLOR_NUMBER + " INTEGER, " + FIELD_COLOR_VALUE + " INTEGER, " + FIELD_COLOR_SCHEME + " INTEGER)"); db.execSQL("CREATE INDEX " + TABLE_COLORS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLORS + " (" + FIELD_COLOR_SCHEME + ");"); case 18: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_USEAUTHAGENT + " TEXT DEFAULT '" + AUTHAGENT_NO + "'"); case 19: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_STAYCONNECTED + " TEXT"); case 20: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_FONTSIZE + " INTEGER"); case 21: db.execSQL("DROP TABLE " + TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS_INDEX); } } /** * Touch a specific host to update its "last connected" field. * @param nickname Nickname field of host to update */ public void touchHost(HostBean host) { long now = System.currentTimeMillis() / 1000; ContentValues values = new ContentValues(); values.put(FIELD_HOST_LASTCONNECT, now); synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.update(TABLE_HOSTS, values, "_id = ?", new String[] { String.valueOf(host.getId()) }); } } /** * Create a new host using the given parameters. */ public HostBean saveHost(HostBean host) { long id; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); id = db.insert(TABLE_HOSTS, null, host.getValues()); } host.setId(id); return host; } /** * Update a field in a host record. */ public boolean updateFontSize(HostBean host) { long id = host.getId(); if (id < 0) return false; ContentValues updates = new ContentValues(); updates.put(FIELD_HOST_FONTSIZE, host.getFontSize()); synchronized (dbLock) { SQLiteDatabase db = getWritableDatabase(); db.update(TABLE_HOSTS, updates, "_id = ?", new String[] { String.valueOf(id) }); } return true; } /** * Delete a specific host by its <code>_id</code> value. */ public void deleteHost(HostBean host) { if (host.getId() < 0) return; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.delete(TABLE_HOSTS, "_id = ?", new String[] { String.valueOf(host.getId()) }); } } /** * Return a cursor that contains information about all known hosts. * @param sortColors If true, sort by color, otherwise sort by nickname. */ public List<HostBean> getHosts(boolean sortColors) { String sortField = sortColors ? FIELD_HOST_COLOR : FIELD_HOST_NICKNAME; List<HostBean> hosts; synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, null, null, null, null, sortField + " ASC"); hosts = createHostBeans(c); c.close(); } return hosts; } /** * @param hosts * @param c */ private List<HostBean> createHostBeans(Cursor c) { List<HostBean> hosts = new LinkedList<HostBean>(); final int COL_ID = c.getColumnIndexOrThrow("_id"), COL_NICKNAME = c.getColumnIndexOrThrow(FIELD_HOST_NICKNAME), COL_PROTOCOL = c.getColumnIndexOrThrow(FIELD_HOST_PROTOCOL), COL_USERNAME = c.getColumnIndexOrThrow(FIELD_HOST_USERNAME), COL_HOSTNAME = c.getColumnIndexOrThrow(FIELD_HOST_HOSTNAME), COL_PORT = c.getColumnIndexOrThrow(FIELD_HOST_PORT), COL_LASTCONNECT = c.getColumnIndexOrThrow(FIELD_HOST_LASTCONNECT), COL_COLOR = c.getColumnIndexOrThrow(FIELD_HOST_COLOR), COL_USEKEYS = c.getColumnIndexOrThrow(FIELD_HOST_USEKEYS), COL_USEAUTHAGENT = c.getColumnIndexOrThrow(FIELD_HOST_USEAUTHAGENT), COL_POSTLOGIN = c.getColumnIndexOrThrow(FIELD_HOST_POSTLOGIN), COL_PUBKEYID = c.getColumnIndexOrThrow(FIELD_HOST_PUBKEYID), COL_WANTSESSION = c.getColumnIndexOrThrow(FIELD_HOST_WANTSESSION), COL_DELKEY = c.getColumnIndexOrThrow(FIELD_HOST_DELKEY), COL_FONTSIZE = c.getColumnIndexOrThrow(FIELD_HOST_FONTSIZE), COL_COMPRESSION = c.getColumnIndexOrThrow(FIELD_HOST_COMPRESSION), COL_ENCODING = c.getColumnIndexOrThrow(FIELD_HOST_ENCODING), COL_STAYCONNECTED = c.getColumnIndexOrThrow(FIELD_HOST_STAYCONNECTED); while (c.moveToNext()) { HostBean host = new HostBean(); host.setId(c.getLong(COL_ID)); host.setNickname(c.getString(COL_NICKNAME)); host.setProtocol(c.getString(COL_PROTOCOL)); host.setUsername(c.getString(COL_USERNAME)); host.setHostname(c.getString(COL_HOSTNAME)); host.setPort(c.getInt(COL_PORT)); host.setLastConnect(c.getLong(COL_LASTCONNECT)); host.setColor(c.getString(COL_COLOR)); host.setUseKeys(Boolean.valueOf(c.getString(COL_USEKEYS))); host.setUseAuthAgent(c.getString(COL_USEAUTHAGENT)); host.setPostLogin(c.getString(COL_POSTLOGIN)); host.setPubkeyId(c.getLong(COL_PUBKEYID)); host.setWantSession(Boolean.valueOf(c.getString(COL_WANTSESSION))); host.setDelKey(c.getString(COL_DELKEY)); host.setFontSize(c.getInt(COL_FONTSIZE)); host.setCompression(Boolean.valueOf(c.getString(COL_COMPRESSION))); host.setEncoding(c.getString(COL_ENCODING)); host.setStayConnected(Boolean.valueOf(c.getString(COL_STAYCONNECTED))); hosts.add(host); } return hosts; } /** * @param c * @return */ private HostBean getFirstHostBean(Cursor c) { HostBean host = null; List<HostBean> hosts = createHostBeans(c); if (hosts.size() > 0) host = hosts.get(0); c.close(); return host; } /** * @param nickname * @param protocol * @param username * @param hostname * @param hostname2 * @param port * @return */ public HostBean findHost(Map<String, String> selection) { StringBuilder selectionBuilder = new StringBuilder(); Iterator<Entry<String, String>> i = selection.entrySet().iterator(); List<String> selectionValuesList = new LinkedList<String>(); int n = 0; while (i.hasNext()) { Entry<String, String> entry = i.next(); if (entry.getValue() == null) continue; if (n++ > 0) selectionBuilder.append(" AND "); selectionBuilder.append(entry.getKey()) .append(" = ?"); selectionValuesList.add(entry.getValue()); } String selectionValues[] = new String[selectionValuesList.size()]; selectionValuesList.toArray(selectionValues); selectionValuesList = null; HostBean host; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, selectionBuilder.toString(), selectionValues, null, null, null); host = getFirstHostBean(c); } return host; } /** * @param hostId * @return */ public HostBean findHostById(long hostId) { HostBean host; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, "_id = ?", new String[] { String.valueOf(hostId) }, null, null, null); host = getFirstHostBean(c); } return host; } /** * Record the given hostkey into database under this nickname. * @param hostname * @param port * @param hostkeyalgo * @param hostkey */ public void saveKnownHost(String hostname, int port, String hostkeyalgo, byte[] hostkey) { ContentValues values = new ContentValues(); values.put(FIELD_HOST_HOSTKEYALGO, hostkeyalgo); values.put(FIELD_HOST_HOSTKEY, hostkey); synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); db.update(TABLE_HOSTS, values, FIELD_HOST_HOSTNAME + " = ? AND " + FIELD_HOST_PORT + " = ?", new String[] { hostname, String.valueOf(port) }); Log.d(TAG, String.format("Finished saving hostkey information for '%s'", hostname)); } } /** * Build list of known hosts for Trilead library. * @return */ public KnownHosts getKnownHosts() { KnownHosts known = new KnownHosts(); synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, new String[] { FIELD_HOST_HOSTNAME, FIELD_HOST_PORT, FIELD_HOST_HOSTKEYALGO, FIELD_HOST_HOSTKEY }, null, null, null, null, null); if (c != null) { int COL_HOSTNAME = c.getColumnIndexOrThrow(FIELD_HOST_HOSTNAME), COL_PORT = c.getColumnIndexOrThrow(FIELD_HOST_PORT), COL_HOSTKEYALGO = c.getColumnIndexOrThrow(FIELD_HOST_HOSTKEYALGO), COL_HOSTKEY = c.getColumnIndexOrThrow(FIELD_HOST_HOSTKEY); while (c.moveToNext()) { String hostname = c.getString(COL_HOSTNAME), hostkeyalgo = c.getString(COL_HOSTKEYALGO); int port = c.getInt(COL_PORT); byte[] hostkey = c.getBlob(COL_HOSTKEY); if (hostkeyalgo == null || hostkeyalgo.length() == 0) continue; if (hostkey == null || hostkey.length == 0) continue; try { known.addHostkey(new String[] { String.format("%s:%d", hostname, port) }, hostkeyalgo, hostkey); } catch(Exception e) { Log.e(TAG, "Problem while adding a known host from database", e); } } c.close(); } } return known; } /** * Unset any hosts using a pubkey ID that has been deleted. * @param pubkeyId */ public void stopUsingPubkey(long pubkeyId) { if (pubkeyId < 0) return; ContentValues values = new ContentValues(); values.put(FIELD_HOST_PUBKEYID, PUBKEYID_ANY); synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.update(TABLE_HOSTS, values, FIELD_HOST_PUBKEYID + " = ?", new String[] { String.valueOf(pubkeyId) }); } Log.d(TAG, String.format("Set all hosts using pubkey id %d to -1", pubkeyId)); } /* * Methods for dealing with port forwards attached to hosts */ /** * Returns a list of all the port forwards associated with a particular host ID. * @param host the host for which we want the port forward list * @return port forwards associated with host ID */ public List<PortForwardBean> getPortForwardsForHost(HostBean host) { List<PortForwardBean> portForwards = new LinkedList<PortForwardBean>(); synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PORTFORWARDS, new String[] { "_id", FIELD_PORTFORWARD_NICKNAME, FIELD_PORTFORWARD_TYPE, FIELD_PORTFORWARD_SOURCEPORT, FIELD_PORTFORWARD_DESTADDR, FIELD_PORTFORWARD_DESTPORT }, FIELD_PORTFORWARD_HOSTID + " = ?", new String[] { String.valueOf(host.getId()) }, null, null, null); while (c.moveToNext()) { PortForwardBean pfb = new PortForwardBean( c.getInt(0), host.getId(), c.getString(1), c.getString(2), c.getInt(3), c.getString(4), c.getInt(5)); portForwards.add(pfb); } c.close(); } return portForwards; } /** * Update the parameters of a port forward in the database. * @param pfb {@link PortForwardBean} to save * @return true on success */ public boolean savePortForward(PortForwardBean pfb) { boolean success = false; synchronized (dbLock) { SQLiteDatabase db = getWritableDatabase(); if (pfb.getId() < 0) { long id = db.insert(TABLE_PORTFORWARDS, null, pfb.getValues()); pfb.setId(id); success = true; } else { if (db.update(TABLE_PORTFORWARDS, pfb.getValues(), "_id = ?", new String[] { String.valueOf(pfb.getId()) }) > 0) success = true; } } return success; } /** * Deletes a port forward from the database. * @param pfb {@link PortForwardBean} to delete */ public void deletePortForward(PortForwardBean pfb) { if (pfb.getId() < 0) return; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.delete(TABLE_PORTFORWARDS, "_id = ?", new String[] { String.valueOf(pfb.getId()) }); } } public Integer[] getColorsForScheme(int scheme) { Integer[] colors = Colors.defaults.clone(); synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_COLORS, new String[] { FIELD_COLOR_NUMBER, FIELD_COLOR_VALUE }, FIELD_COLOR_SCHEME + " = ?", new String[] { String.valueOf(scheme) }, null, null, null); while (c.moveToNext()) { colors[c.getInt(0)] = new Integer(c.getInt(1)); } c.close(); } return colors; } public void setColorForScheme(int scheme, int number, int value) { SQLiteDatabase db; String schemeWhere; schemeWhere = FIELD_COLOR_SCHEME + " = ?"; if (value == Colors.defaults[number]) { String[] whereArgs = new String[1]; whereArgs[0] = String.valueOf(number); synchronized (dbLock) { db = getWritableDatabase(); db.delete(TABLE_COLORS, FIELD_COLOR_NUMBER + " = ? AND " + schemeWhere, new String[] { String.valueOf(number) }); } } else { ContentValues values = new ContentValues(); values.put(FIELD_COLOR_NUMBER, number); values.put(FIELD_COLOR_VALUE, value); String[] whereArgs = null; whereArgs = new String[] { String.valueOf(scheme) }; synchronized (dbLock) { db = getWritableDatabase(); int rowsAffected = db.update(TABLE_COLORS, values, schemeWhere, whereArgs); if (rowsAffected == 0) { db.insert(TABLE_COLORS, null, values); } } } } public void setGlobalColor(int number, int value) { setColorForScheme(DEFAULT_COLOR_SCHEME, number, value); } public int[] getDefaultColorsForScheme(int scheme) { int[] colors = new int[] { DEFAULT_FG_COLOR, DEFAULT_BG_COLOR }; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_COLOR_DEFAULTS, new String[] { FIELD_COLOR_FG, FIELD_COLOR_BG }, FIELD_COLOR_SCHEME + " = ?", new String[] { String.valueOf(scheme) }, null, null, null); if (c.moveToFirst()) { colors[0] = c.getInt(0); colors[1] = c.getInt(1); } c.close(); } return colors; } public int[] getGlobalDefaultColors() { return getDefaultColorsForScheme(DEFAULT_COLOR_SCHEME); } public void setDefaultColorsForScheme(int scheme, int fg, int bg) { SQLiteDatabase db; String schemeWhere = null; String[] whereArgs; schemeWhere = FIELD_COLOR_SCHEME + " = ?"; whereArgs = new String[] { String.valueOf(scheme) }; ContentValues values = new ContentValues(); values.put(FIELD_COLOR_FG, fg); values.put(FIELD_COLOR_BG, bg); synchronized (dbLock) { db = getWritableDatabase(); int rowsAffected = db.update(TABLE_COLOR_DEFAULTS, values, schemeWhere, whereArgs); if (rowsAffected == 0) { values.put(FIELD_COLOR_SCHEME, scheme); db.insert(TABLE_COLOR_DEFAULTS, null, values); } } } }
1031868817-aaaa
src/org/connectbot/util/HostDatabase.java
Java
asf20
24,233
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import android.os.Build; /** * @author Kenny Root * */ public class PreferenceConstants { public static final boolean PRE_ECLAIR = (Integer.parseInt(Build.VERSION.SDK) <= 4); public static final boolean PRE_FROYO = PRE_ECLAIR ? true : (Integer.parseInt(Build.VERSION.SDK) <= 7); public static final String MEMKEYS = "memkeys"; public static final String UPDATE = "update"; public static final String UPDATE_DAILY = "Daily"; public static final String UPDATE_WEEKLY = "Weekly"; public static final String UPDATE_NEVER = "Never"; public static final String LAST_CHECKED = "lastchecked"; public static final String SCROLLBACK = "scrollback"; public static final String EMULATION = "emulation"; public static final String ROTATION = "rotation"; public static final String ROTATION_DEFAULT = "Default"; public static final String ROTATION_LANDSCAPE = "Force landscape"; public static final String ROTATION_PORTRAIT = "Force portrait"; public static final String ROTATION_AUTOMATIC = "Automatic"; public static final String FULLSCREEN = "fullscreen"; public static final String KEYMODE = "keymode"; public static final String KEYMODE_RIGHT = "Use right-side keys"; public static final String KEYMODE_LEFT = "Use left-side keys"; public static final String CAMERA = "camera"; public static final String CAMERA_CTRLA_SPACE = "Ctrl+A then Space"; public static final String CAMERA_CTRLA = "Ctrl+A"; public static final String CAMERA_ESC = "Esc"; public static final String CAMERA_ESC_A = "Esc+A"; public static final String KEEP_ALIVE = "keepalive"; public static final String WIFI_LOCK = "wifilock"; public static final String BUMPY_ARROWS = "bumpyarrows"; public static final String EULA = "eula"; public static final String SORT_BY_COLOR = "sortByColor"; public static final String BELL = "bell"; public static final String BELL_VOLUME = "bellVolume"; public static final String BELL_VIBRATE = "bellVibrate"; public static final String BELL_NOTIFICATION = "bellNotification"; public static final float DEFAULT_BELL_VOLUME = 0.25f; public static final String CONNECTION_PERSIST = "connPersist"; /* Backup identifiers */ public static final String BACKUP_PREF_KEY = "prefs"; }
1031868817-aaaa
src/org/connectbot/util/PreferenceConstants.java
Java
asf20
2,942
/* * Copyright (C) 2007 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ /* * 090408 * Keith Wiley * kwiley@keithwiley.com * http://keithwiley.com * * UberColorPickerDialog v1.1 * * This color picker was implemented as a (significant) extension of the * ColorPickerDialog class provided in the Android API Demos. You are free * to drop it unchanged into your own projects or to modify it as you see * fit. I would appreciate it if this comment block were let intact, * merely for credit's sake. * * Enjoy! */ package org.connectbot.util; import android.app.Dialog; import android.content.Context; import android.graphics.Bitmap; import android.graphics.Canvas; import android.graphics.Color; import android.graphics.ColorMatrix; import android.graphics.ComposeShader; import android.graphics.Paint; import android.graphics.PorterDuff; import android.graphics.PorterDuffXfermode; import android.graphics.RadialGradient; import android.graphics.Rect; import android.graphics.RectF; import android.graphics.Shader; import android.graphics.SweepGradient; import android.graphics.drawable.GradientDrawable; import android.graphics.drawable.GradientDrawable.Orientation; import android.os.Bundle; import android.util.DisplayMetrics; import android.view.MotionEvent; import android.view.View; /** * UberColorPickerDialog is a seriously enhanced version of the UberColorPickerDialog * class provided in the Android API Demos.<p> * * NOTE (from Kenny Root): This is a VERY slimmed down version custom for ConnectBot. * Visit Keith's site for the full version at the URL listed in the author line.<p> * * @author Keith Wiley, kwiley@keithwiley.com, http://keithwiley.com */ public class UberColorPickerDialog extends Dialog { private OnColorChangedListener mListener; private int mInitialColor; /** * Callback to the creator of the dialog, informing the creator of a new color and notifying that the dialog is about to dismiss. */ public interface OnColorChangedListener { void colorChanged(int color); } /** * Ctor * @param context * @param listener * @param initialColor * @param showTitle If true, a title is shown across the top of the dialog. If false a toast is shown instead. */ public UberColorPickerDialog(Context context, OnColorChangedListener listener, int initialColor) { super(context); mListener = listener; mInitialColor = initialColor; } /** * Activity entry point */ @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); OnColorChangedListener l = new OnColorChangedListener() { public void colorChanged(int color) { mListener.colorChanged(color); dismiss(); } }; DisplayMetrics dm = new DisplayMetrics(); getWindow().getWindowManager().getDefaultDisplay().getMetrics(dm); int screenWidth = dm.widthPixels; int screenHeight = dm.heightPixels; setTitle("Pick a color (try the trackball)"); try { setContentView(new ColorPickerView(getContext(), l, screenWidth, screenHeight, mInitialColor)); } catch (Exception e) { //There is currently only one kind of ctor exception, that where no methods are enabled. dismiss(); //This doesn't work! The dialog is still shown (its title at least, the layout is empty from the exception being thrown). <sigh> } } /** * ColorPickerView is the meat of this color picker (as opposed to the enclosing class). * All the heavy lifting is done directly by this View subclass. * <P> * You can enable/disable whichever color chooser methods you want by modifying the ENABLED_METHODS switches. They *should* * do all the work required to properly enable/disable methods without losing track of what goes with what and what maps to what. * <P> * If you add a new color chooser method, do a text search for "NEW_METHOD_WORK_NEEDED_HERE". That tag indicates all * the locations in the code that will have to be amended in order to properly add a new color chooser method. * I highly recommend adding new methods to the end of the list. If you want to try to reorder the list, you're on your own. */ private static class ColorPickerView extends View { private static int SWATCH_WIDTH = 95; private static final int SWATCH_HEIGHT = 60; private static int PALETTE_POS_X = 0; private static int PALETTE_POS_Y = SWATCH_HEIGHT; private static final int PALETTE_DIM = SWATCH_WIDTH * 2; private static final int PALETTE_RADIUS = PALETTE_DIM / 2; private static final int PALETTE_CENTER_X = PALETTE_RADIUS; private static final int PALETTE_CENTER_Y = PALETTE_RADIUS; private static final int SLIDER_THICKNESS = 40; private static int VIEW_DIM_X = PALETTE_DIM; private static int VIEW_DIM_Y = SWATCH_HEIGHT; //NEW_METHOD_WORK_NEEDED_HERE private static final int METHOD_HS_V_PALETTE = 0; //NEW_METHOD_WORK_NEEDED_HERE //Add a new entry to the list for each controller in the new method private static final int TRACKED_NONE = -1; //No object on screen is currently being tracked private static final int TRACK_SWATCH_OLD = 10; private static final int TRACK_SWATCH_NEW = 11; private static final int TRACK_HS_PALETTE = 30; private static final int TRACK_VER_VALUE_SLIDER = 31; private static final int TEXT_SIZE = 12; private static int[] TEXT_HSV_POS = new int[2]; private static int[] TEXT_RGB_POS = new int[2]; private static int[] TEXT_YUV_POS = new int[2]; private static int[] TEXT_HEX_POS = new int[2]; private static final float PI = 3.141592653589793f; private int mMethod = METHOD_HS_V_PALETTE; private int mTracking = TRACKED_NONE; //What object on screen is currently being tracked for movement //Zillions of persistant Paint objecs for drawing the View private Paint mSwatchOld, mSwatchNew; //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the palettes of the new method's UI controllers private Paint mOvalHueSat; private Bitmap mVerSliderBM; private Canvas mVerSliderCv; private Bitmap[] mHorSlidersBM = new Bitmap[3]; private Canvas[] mHorSlidersCv = new Canvas[3]; private Paint mValDimmer; //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the icon for the new method private Paint mOvalHueSatSmall; private Paint mPosMarker; private Paint mText; private Rect mOldSwatchRect = new Rect(); private Rect mNewSwatchRect = new Rect(); private Rect mPaletteRect = new Rect(); private Rect mVerSliderRect = new Rect(); private int[] mSpectrumColorsRev; private int mOriginalColor = 0; //The color passed in at the beginning, which can be reverted to at any time by tapping the old swatch. private float[] mHSV = new float[3]; private int[] mRGB = new int[3]; private float[] mYUV = new float[3]; private String mHexStr = ""; private boolean mHSVenabled = true; //Only true if an HSV method is enabled private boolean mRGBenabled = true; //Only true if an RGB method is enabled private boolean mYUVenabled = true; //Only true if a YUV method is enabled private boolean mHexenabled = true; //Only true if an RGB method is enabled private int[] mCoord = new int[3]; //For drawing slider/palette markers private int mFocusedControl = -1; //Which control receives trackball events. private OnColorChangedListener mListener; /** * Ctor. * @param c * @param l * @param width Used to determine orientation and adjust layout accordingly * @param height Used to determine orientation and adjust layout accordingly * @param color The initial color * @throws Exception */ ColorPickerView(Context c, OnColorChangedListener l, int width, int height, int color) throws Exception { super(c); //We need to make the dialog focusable to retrieve trackball events. setFocusable(true); mListener = l; mOriginalColor = color; Color.colorToHSV(color, mHSV); updateAllFromHSV(); //Setup the layout based on whether this is a portrait or landscape orientation. if (width <= height) { //Portrait layout SWATCH_WIDTH = (PALETTE_DIM + SLIDER_THICKNESS) / 2; PALETTE_POS_X = 0; PALETTE_POS_Y = TEXT_SIZE * 4 + SWATCH_HEIGHT; //Set more rects, lots of rects mOldSwatchRect.set(0, TEXT_SIZE * 4, SWATCH_WIDTH, TEXT_SIZE * 4 + SWATCH_HEIGHT); mNewSwatchRect.set(SWATCH_WIDTH, TEXT_SIZE * 4, SWATCH_WIDTH * 2, TEXT_SIZE * 4 + SWATCH_HEIGHT); mPaletteRect.set(0, PALETTE_POS_Y, PALETTE_DIM, PALETTE_POS_Y + PALETTE_DIM); mVerSliderRect.set(PALETTE_DIM, PALETTE_POS_Y, PALETTE_DIM + SLIDER_THICKNESS, PALETTE_POS_Y + PALETTE_DIM); TEXT_HSV_POS[0] = 3; TEXT_HSV_POS[1] = 0; TEXT_RGB_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_RGB_POS[1] = TEXT_HSV_POS[1]; TEXT_YUV_POS[0] = TEXT_HSV_POS[0] + 100; TEXT_YUV_POS[1] = TEXT_HSV_POS[1]; TEXT_HEX_POS[0] = TEXT_HSV_POS[0] + 150; TEXT_HEX_POS[1] = TEXT_HSV_POS[1]; VIEW_DIM_X = PALETTE_DIM + SLIDER_THICKNESS; VIEW_DIM_Y = SWATCH_HEIGHT + PALETTE_DIM + TEXT_SIZE * 4; } else { //Landscape layout SWATCH_WIDTH = 110; PALETTE_POS_X = SWATCH_WIDTH; PALETTE_POS_Y = 0; //Set more rects, lots of rects mOldSwatchRect.set(0, TEXT_SIZE * 7, SWATCH_WIDTH, TEXT_SIZE * 7 + SWATCH_HEIGHT); mNewSwatchRect.set(0, TEXT_SIZE * 7 + SWATCH_HEIGHT, SWATCH_WIDTH, TEXT_SIZE * 7 + SWATCH_HEIGHT * 2); mPaletteRect.set(SWATCH_WIDTH, PALETTE_POS_Y, SWATCH_WIDTH + PALETTE_DIM, PALETTE_POS_Y + PALETTE_DIM); mVerSliderRect.set(SWATCH_WIDTH + PALETTE_DIM, PALETTE_POS_Y, SWATCH_WIDTH + PALETTE_DIM + SLIDER_THICKNESS, PALETTE_POS_Y + PALETTE_DIM); TEXT_HSV_POS[0] = 3; TEXT_HSV_POS[1] = 0; TEXT_RGB_POS[0] = TEXT_HSV_POS[0]; TEXT_RGB_POS[1] = (int)(TEXT_HSV_POS[1] + TEXT_SIZE * 3.5); TEXT_YUV_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_YUV_POS[1] = (int)(TEXT_HSV_POS[1] + TEXT_SIZE * 3.5); TEXT_HEX_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_HEX_POS[1] = TEXT_HSV_POS[1]; VIEW_DIM_X = PALETTE_POS_X + PALETTE_DIM + SLIDER_THICKNESS; VIEW_DIM_Y = Math.max(mNewSwatchRect.bottom, PALETTE_DIM); } //Rainbows make everybody happy! mSpectrumColorsRev = new int[] { 0xFFFF0000, 0xFFFF00FF, 0xFF0000FF, 0xFF00FFFF, 0xFF00FF00, 0xFFFFFF00, 0xFFFF0000, }; //Setup all the Paint and Shader objects. There are lots of them! //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the palettes of the new method's UI controllers mSwatchOld = new Paint(Paint.ANTI_ALIAS_FLAG); mSwatchOld.setStyle(Paint.Style.FILL); mSwatchOld.setColor(Color.HSVToColor(mHSV)); mSwatchNew = new Paint(Paint.ANTI_ALIAS_FLAG); mSwatchNew.setStyle(Paint.Style.FILL); mSwatchNew.setColor(Color.HSVToColor(mHSV)); Shader shaderA = new SweepGradient(0, 0, mSpectrumColorsRev, null); Shader shaderB = new RadialGradient(0, 0, PALETTE_CENTER_X, 0xFFFFFFFF, 0xFF000000, Shader.TileMode.CLAMP); Shader shader = new ComposeShader(shaderA, shaderB, PorterDuff.Mode.SCREEN); mOvalHueSat = new Paint(Paint.ANTI_ALIAS_FLAG); mOvalHueSat.setShader(shader); mOvalHueSat.setStyle(Paint.Style.FILL); mOvalHueSat.setDither(true); mVerSliderBM = Bitmap.createBitmap(SLIDER_THICKNESS, PALETTE_DIM, Bitmap.Config.RGB_565); mVerSliderCv = new Canvas(mVerSliderBM); for (int i = 0; i < 3; i++) { mHorSlidersBM[i] = Bitmap.createBitmap(PALETTE_DIM, SLIDER_THICKNESS, Bitmap.Config.RGB_565); mHorSlidersCv[i] = new Canvas(mHorSlidersBM[i]); } mValDimmer = new Paint(Paint.ANTI_ALIAS_FLAG); mValDimmer.setStyle(Paint.Style.FILL); mValDimmer.setDither(true); mValDimmer.setXfermode(new PorterDuffXfermode(PorterDuff.Mode.MULTIPLY)); //Whew, we're done making the big Paints and Shaders for the swatches, palettes, and sliders. //Now we need to make the Paints and Shaders that will draw the little method icons in the method selector list. //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the icon for the new method shaderA = new SweepGradient(0, 0, mSpectrumColorsRev, null); shaderB = new RadialGradient(0, 0, PALETTE_DIM / 2, 0xFFFFFFFF, 0xFF000000, Shader.TileMode.CLAMP); shader = new ComposeShader(shaderA, shaderB, PorterDuff.Mode.SCREEN); mOvalHueSatSmall = new Paint(Paint.ANTI_ALIAS_FLAG); mOvalHueSatSmall.setShader(shader); mOvalHueSatSmall.setStyle(Paint.Style.FILL); //Make a simple stroking Paint for drawing markers and borders and stuff like that. mPosMarker = new Paint(Paint.ANTI_ALIAS_FLAG); mPosMarker.setStyle(Paint.Style.STROKE); mPosMarker.setStrokeWidth(2); //Make a basic text Paint. mText = new Paint(Paint.ANTI_ALIAS_FLAG); mText.setTextSize(TEXT_SIZE); mText.setColor(Color.WHITE); //Kickstart initUI(); } /** * Draw the entire view (the entire dialog). */ @Override protected void onDraw(Canvas canvas) { //Draw the old and new swatches drawSwatches(canvas); //Write the text writeColorParams(canvas); //Draw the palette and sliders (the UI) if (mMethod == METHOD_HS_V_PALETTE) drawHSV1Palette(canvas); } /** * Draw the old and new swatches. * @param canvas */ private void drawSwatches(Canvas canvas) { float[] hsv = new float[3]; mText.setTextSize(16); //Draw the original swatch canvas.drawRect(mOldSwatchRect, mSwatchOld); Color.colorToHSV(mOriginalColor, hsv); //if (UberColorPickerDialog.isGray(mColor)) //Don't need this right here, but imp't to note // hsv[1] = 0; if (hsv[2] > .5) mText.setColor(Color.BLACK); canvas.drawText("Revert", mOldSwatchRect.left + SWATCH_WIDTH / 2 - mText.measureText("Revert") / 2, mOldSwatchRect.top + 16, mText); mText.setColor(Color.WHITE); //Draw the new swatch canvas.drawRect(mNewSwatchRect, mSwatchNew); if (mHSV[2] > .5) mText.setColor(Color.BLACK); canvas.drawText("Accept", mNewSwatchRect.left + SWATCH_WIDTH / 2 - mText.measureText("Accept") / 2, mNewSwatchRect.top + 16, mText); mText.setColor(Color.WHITE); mText.setTextSize(TEXT_SIZE); } /** * Write the color parametes (HSV, RGB, YUV, Hex, etc.). * @param canvas */ private void writeColorParams(Canvas canvas) { if (mHSVenabled) { canvas.drawText("H: " + Integer.toString((int)(mHSV[0] / 360.0f * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE, mText); canvas.drawText("S: " + Integer.toString((int)(mHSV[1] * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("V: " + Integer.toString((int)(mHSV[2] * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE * 3, mText); } if (mRGBenabled) { canvas.drawText("R: " + mRGB[0], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE, mText); canvas.drawText("G: " + mRGB[1], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("B: " + mRGB[2], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE * 3, mText); } if (mYUVenabled) { canvas.drawText("Y: " + Integer.toString((int)(mYUV[0] * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE, mText); canvas.drawText("U: " + Integer.toString((int)((mYUV[1] + .5f) * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("V: " + Integer.toString((int)((mYUV[2] + .5f) * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE * 3, mText); } if (mHexenabled) canvas.drawText("#" + mHexStr, TEXT_HEX_POS[0], TEXT_HEX_POS[1] + TEXT_SIZE, mText); } /** * Place a small circle on the 2D palette to indicate the current values. * @param canvas * @param markerPosX * @param markerPosY */ private void mark2DPalette(Canvas canvas, int markerPosX, int markerPosY) { mPosMarker.setColor(Color.BLACK); canvas.drawOval(new RectF(markerPosX - 5, markerPosY - 5, markerPosX + 5, markerPosY + 5), mPosMarker); mPosMarker.setColor(Color.WHITE); canvas.drawOval(new RectF(markerPosX - 3, markerPosY - 3, markerPosX + 3, markerPosY + 3), mPosMarker); } /** * Draw a line across the slider to indicate its current value. * @param canvas * @param markerPos */ private void markVerSlider(Canvas canvas, int markerPos) { mPosMarker.setColor(Color.BLACK); canvas.drawRect(new Rect(0, markerPos - 2, SLIDER_THICKNESS, markerPos + 3), mPosMarker); mPosMarker.setColor(Color.WHITE); canvas.drawRect(new Rect(0, markerPos, SLIDER_THICKNESS, markerPos + 1), mPosMarker); } /** * Frame the slider to indicate that it has trackball focus. * @param canvas */ private void hilightFocusedVerSlider(Canvas canvas) { mPosMarker.setColor(Color.WHITE); canvas.drawRect(new Rect(0, 0, SLIDER_THICKNESS, PALETTE_DIM), mPosMarker); mPosMarker.setColor(Color.BLACK); canvas.drawRect(new Rect(2, 2, SLIDER_THICKNESS - 2, PALETTE_DIM - 2), mPosMarker); } /** * Frame the 2D palette to indicate that it has trackball focus. * @param canvas */ private void hilightFocusedOvalPalette(Canvas canvas) { mPosMarker.setColor(Color.WHITE); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mPosMarker); mPosMarker.setColor(Color.BLACK); canvas.drawOval(new RectF(-PALETTE_RADIUS + 2, -PALETTE_RADIUS + 2, PALETTE_RADIUS - 2, PALETTE_RADIUS - 2), mPosMarker); } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate the basic draw functions here. Use the 2D palette or 1D sliders as templates for the new method. /** * Draw the UI for HSV with angular H and radial S combined in 2D and a 1D V slider. * @param canvas */ private void drawHSV1Palette(Canvas canvas) { canvas.save(); canvas.translate(PALETTE_POS_X, PALETTE_POS_Y); //Draw the 2D palette canvas.translate(PALETTE_CENTER_X, PALETTE_CENTER_Y); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mOvalHueSat); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mValDimmer); if (mFocusedControl == 0) hilightFocusedOvalPalette(canvas); mark2DPalette(canvas, mCoord[0], mCoord[1]); canvas.translate(-PALETTE_CENTER_X, -PALETTE_CENTER_Y); //Draw the 1D slider canvas.translate(PALETTE_DIM, 0); canvas.drawBitmap(mVerSliderBM, 0, 0, null); if (mFocusedControl == 1) hilightFocusedVerSlider(canvas); markVerSlider(canvas, mCoord[2]); canvas.restore(); } /** * Initialize the current color chooser's UI (set its color parameters and set its palette and slider values accordingly). */ private void initUI() { initHSV1Palette(); //Focus on the first controller (arbitrary). mFocusedControl = 0; } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last init function shown below /** * Initialize a color chooser. */ private void initHSV1Palette() { setOvalValDimmer(); setVerValSlider(); float angle = 2*PI - mHSV[0] / (180 / 3.1415927f); float radius = mHSV[1] * PALETTE_RADIUS; mCoord[0] = (int)(Math.cos(angle) * radius); mCoord[1] = (int)(Math.sin(angle) * radius); mCoord[2] = PALETTE_DIM - (int)(mHSV[2] * PALETTE_DIM); } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the set functions below, one per UI controller in the new method /** * Adjust a Paint which, when painted, dims its underlying object to show the effects of varying value (brightness). */ private void setOvalValDimmer() { float[] hsv = new float[3]; hsv[0] = mHSV[0]; hsv[1] = 0; hsv[2] = mHSV[2]; int gray = Color.HSVToColor(hsv); mValDimmer.setColor(gray); } /** * Create a linear gradient shader to show variations in value. */ private void setVerValSlider() { float[] hsv = new float[3]; hsv[0] = mHSV[0]; hsv[1] = mHSV[1]; hsv[2] = 1; int col = Color.HSVToColor(hsv); int colors[] = new int[2]; colors[0] = col; colors[1] = 0xFF000000; GradientDrawable gradDraw = new GradientDrawable(Orientation.TOP_BOTTOM, colors); gradDraw.setDither(true); gradDraw.setLevel(10000); gradDraw.setBounds(0, 0, SLIDER_THICKNESS, PALETTE_DIM); gradDraw.draw(mVerSliderCv); } /** * Report the correct tightly bounded dimensions of the view. */ @Override protected void onMeasure(int widthMeasureSpec, int heightMeasureSpec) { setMeasuredDimension(VIEW_DIM_X, VIEW_DIM_Y); } /** * Wrap Math.round(). I'm not a Java expert. Is this the only way to avoid writing "(int)Math.round" everywhere? * @param x * @return */ private int round(double x) { return (int)Math.round(x); } /** * Limit a value to the range [0,1]. * @param n * @return */ private float pinToUnit(float n) { if (n < 0) { n = 0; } else if (n > 1) { n = 1; } return n; } /** * Limit a value to the range [0,max]. * @param n * @param max * @return */ private float pin(float n, float max) { if (n < 0) { n = 0; } else if (n > max) { n = max; } return n; } /** * Limit a value to the range [min,max]. * @param n * @param min * @param max * @return */ private float pin(float n, float min, float max) { if (n < min) { n = min; } else if (n > max) { n = max; } return n; } /** * No clue what this does (some sort of average/mean I presume). It came with the original UberColorPickerDialog * in the API Demos and wasn't documented. I don't feel like spending any time figuring it out, I haven't looked at it at all. * @param s * @param d * @param p * @return */ private int ave(int s, int d, float p) { return s + round(p * (d - s)); } /** * Came with the original UberColorPickerDialog in the API Demos, wasn't documented. I believe it takes an array of * colors and a value in the range [0,1] and interpolates a resulting color in a seemingly predictable manner. * I haven't looked at it at all. * @param colors * @param unit * @return */ private int interpColor(int colors[], float unit) { if (unit <= 0) { return colors[0]; } if (unit >= 1) { return colors[colors.length - 1]; } float p = unit * (colors.length - 1); int i = (int)p; p -= i; // now p is just the fractional part [0...1) and i is the index int c0 = colors[i]; int c1 = colors[i+1]; int a = ave(Color.alpha(c0), Color.alpha(c1), p); int r = ave(Color.red(c0), Color.red(c1), p); int g = ave(Color.green(c0), Color.green(c1), p); int b = ave(Color.blue(c0), Color.blue(c1), p); return Color.argb(a, r, g, b); } /** * A standard point-in-rect routine. * @param x * @param y * @param r * @return true if point x,y is in rect r */ public boolean ptInRect(int x, int y, Rect r) { return x > r.left && x < r.right && y > r.top && y < r.bottom; } /** * Process trackball events. Used mainly for fine-tuned color adjustment, or alternatively to switch between slider controls. */ @Override public boolean dispatchTrackballEvent(MotionEvent event) { float x = event.getX(); float y = event.getY(); //A longer event history implies faster trackball movement. //Use it to infer a larger jump and therefore faster palette/slider adjustment. int jump = event.getHistorySize() + 1; switch (event.getAction()) { case MotionEvent.ACTION_DOWN: { } break; case MotionEvent.ACTION_MOVE: { //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the appropriate entry in this list, //depending on whether you use 1D or 2D controllers switch (mMethod) { case METHOD_HS_V_PALETTE: if (mFocusedControl == 0) { changeHSPalette(x, y, jump); } else if (mFocusedControl == 1) { if (y < 0) changeSlider(mFocusedControl, true, jump); else if (y > 0) changeSlider(mFocusedControl, false, jump); } break; } } break; case MotionEvent.ACTION_UP: { } break; } return true; } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the appropriate functions below, //one per UI controller in the new method /** * Effect a trackball change to a 2D palette. * @param x -1: negative x change, 0: no x change, +1: positive x change. * @param y -1: negative y change, 0, no y change, +1: positive y change. * @param jump the amount by which to change. */ private void changeHSPalette(float x, float y, int jump) { int x2 = 0, y2 = 0; if (x < 0) x2 = -jump; else if (x > 0) x2 = jump; if (y < 0) y2 = -jump; else if (y > 0) y2 = jump; mCoord[0] += x2; mCoord[1] += y2; if (mCoord[0] < -PALETTE_RADIUS) mCoord[0] = -PALETTE_RADIUS; else if (mCoord[0] > PALETTE_RADIUS) mCoord[0] = PALETTE_RADIUS; if (mCoord[1] < -PALETTE_RADIUS) mCoord[1] = -PALETTE_RADIUS; else if (mCoord[1] > PALETTE_RADIUS) mCoord[1] = PALETTE_RADIUS; float radius = (float)java.lang.Math.sqrt(mCoord[0] * mCoord[0] + mCoord[1] * mCoord[1]); if (radius > PALETTE_RADIUS) radius = PALETTE_RADIUS; float angle = (float)java.lang.Math.atan2(mCoord[1], mCoord[0]); // need to turn angle [-PI ... PI] into unit [0....1] float unit = angle/(2*PI); if (unit < 0) { unit += 1; } mCoord[0] = round(Math.cos(angle) * radius); mCoord[1] = round(Math.sin(angle) * radius); int c = interpColor(mSpectrumColorsRev, unit); float[] hsv = new float[3]; Color.colorToHSV(c, hsv); mHSV[0] = hsv[0]; mHSV[1] = radius / PALETTE_RADIUS; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setVerValSlider(); invalidate(); } /** * Effect a trackball change to a 1D slider. * @param slider id of the slider to be effected * @param increase true if the change is an increase, false if a decrease * @param jump the amount by which to change in units of the range [0,255] */ private void changeSlider(int slider, boolean increase, int jump) { //NEW_METHOD_WORK_NEEDED_HERE //It is only necessary to add an entry here for a new method if the new method uses a 1D slider. //Note, some sliders are horizontal and others are vertical. //They differ a bit, especially in a sign flip on the vertical axis. if (mMethod == METHOD_HS_V_PALETTE) { //slider *must* equal 1 mHSV[2] += (increase ? jump : -jump) / 256.0f; mHSV[2] = pinToUnit(mHSV[2]); updateAllFromHSV(); mCoord[2] = PALETTE_DIM - (int)(mHSV[2] * PALETTE_DIM); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setOvalValDimmer(); invalidate(); } } /** * Keep all colorspace representations in sync. */ private void updateRGBfromHSV() { int color = Color.HSVToColor(mHSV); mRGB[0] = Color.red(color); mRGB[1] = Color.green(color); mRGB[2] = Color.blue(color); } /** * Keep all colorspace representations in sync. */ private void updateYUVfromRGB() { float r = mRGB[0] / 255.0f; float g = mRGB[1] / 255.0f; float b = mRGB[2] / 255.0f; ColorMatrix cm = new ColorMatrix(); cm.setRGB2YUV(); final float[] a = cm.getArray(); mYUV[0] = a[0] * r + a[1] * g + a[2] * b; mYUV[0] = pinToUnit(mYUV[0]); mYUV[1] = a[5] * r + a[6] * g + a[7] * b; mYUV[1] = pin(mYUV[1], -.5f, .5f); mYUV[2] = a[10] * r + a[11] * g + a[12] * b; mYUV[2] = pin(mYUV[2], -.5f, .5f); } /** * Keep all colorspace representations in sync. */ private void updateHexFromHSV() { //For now, assume 100% opacity mHexStr = Integer.toHexString(Color.HSVToColor(mHSV)).toUpperCase(); mHexStr = mHexStr.substring(2, mHexStr.length()); } /** * Keep all colorspace representations in sync. */ private void updateAllFromHSV() { //Update mRGB if (mRGBenabled || mYUVenabled) updateRGBfromHSV(); //Update mYUV if (mYUVenabled) updateYUVfromRGB(); //Update mHexStr if (mRGBenabled) updateHexFromHSV(); } /** * Process touch events: down, move, and up */ @Override public boolean onTouchEvent(MotionEvent event) { float x = event.getX(); float y = event.getY(); //Generate coordinates which are palette=local with the origin at the upper left of the main 2D palette int y2 = (int)(pin(round(y - PALETTE_POS_Y), PALETTE_DIM)); //Generate coordinates which are palette-local with the origin at the center of the main 2D palette float circlePinnedX = x - PALETTE_POS_X - PALETTE_CENTER_X; float circlePinnedY = y - PALETTE_POS_Y - PALETTE_CENTER_Y; //Is the event in a swatch? boolean inSwatchOld = ptInRect(round(x), round(y), mOldSwatchRect); boolean inSwatchNew = ptInRect(round(x), round(y), mNewSwatchRect); //Get the event's distance from the center of the main 2D palette float radius = (float)java.lang.Math.sqrt(circlePinnedX * circlePinnedX + circlePinnedY * circlePinnedY); //Is the event in a circle-pinned 2D palette? boolean inOvalPalette = radius <= PALETTE_RADIUS; //Pin the radius if (radius > PALETTE_RADIUS) radius = PALETTE_RADIUS; //Is the event in a vertical slider to the right of the main 2D palette boolean inVerSlider = ptInRect(round(x), round(y), mVerSliderRect); switch (event.getAction()) { case MotionEvent.ACTION_DOWN: mTracking = TRACKED_NONE; if (inSwatchOld) mTracking = TRACK_SWATCH_OLD; else if (inSwatchNew) mTracking = TRACK_SWATCH_NEW; //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last entry in this list else if (mMethod == METHOD_HS_V_PALETTE) { if (inOvalPalette) { mTracking = TRACK_HS_PALETTE; mFocusedControl = 0; } else if (inVerSlider) { mTracking = TRACK_VER_VALUE_SLIDER; mFocusedControl = 1; } } case MotionEvent.ACTION_MOVE: //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the entries in this list, //one per UI controller the new method requires. if (mTracking == TRACK_HS_PALETTE) { float angle = (float)java.lang.Math.atan2(circlePinnedY, circlePinnedX); // need to turn angle [-PI ... PI] into unit [0....1] float unit = angle/(2*PI); if (unit < 0) { unit += 1; } mCoord[0] = round(Math.cos(angle) * radius); mCoord[1] = round(Math.sin(angle) * radius); int c = interpColor(mSpectrumColorsRev, unit); float[] hsv = new float[3]; Color.colorToHSV(c, hsv); mHSV[0] = hsv[0]; mHSV[1] = radius / PALETTE_RADIUS; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setVerValSlider(); invalidate(); } else if (mTracking == TRACK_VER_VALUE_SLIDER) { if (mCoord[2] != y2) { mCoord[2] = y2; float value = 1.0f - (float)y2 / (float)PALETTE_DIM; mHSV[2] = value; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setOvalValDimmer(); invalidate(); } } break; case MotionEvent.ACTION_UP: //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last entry in this list. if (mTracking == TRACK_SWATCH_OLD && inSwatchOld) { Color.colorToHSV(mOriginalColor, mHSV); mSwatchNew.setColor(mOriginalColor); initUI(); invalidate(); } else if (mTracking == TRACK_SWATCH_NEW && inSwatchNew) { mListener.colorChanged(mSwatchNew.getColor()); invalidate(); } mTracking= TRACKED_NONE; break; } return true; } } }
1031868817-aaaa
src/org/connectbot/util/UberColorPickerDialog.java
Java
asf20
32,266
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import com.trilead.ssh2.crypto.Base64; /** * @author Kenny Root * */ public class XmlBuilder { private StringBuilder sb; public XmlBuilder() { sb = new StringBuilder(); } public XmlBuilder append(String data) { sb.append(data); return this; } public XmlBuilder append(String field, Object data) { if (data == null) { sb.append(String.format("<%s/>", field)); } else if (data instanceof String) { String input = (String) data; boolean binary = false; for (byte b : input.getBytes()) { if (b < 0x20 || b > 0x7e) { binary = true; break; } } sb.append(String.format("<%s>%s</%s>", field, binary ? new String(Base64.encode(input.getBytes())) : input, field)); } else if (data instanceof Integer) { sb.append(String.format("<%s>%d</%s>", field, (Integer) data, field)); } else if (data instanceof Long) { sb.append(String.format("<%s>%d</%s>", field, (Long) data, field)); } else if (data instanceof byte[]) { sb.append(String.format("<%s>%s</%s>", field, new String(Base64.encode((byte[]) data)), field)); } else if (data instanceof Boolean) { sb.append(String.format("<%s>%s</%s>", field, (Boolean) data, field)); } return this; } public String toString() { return sb.toString(); } }
1031868817-aaaa
src/org/connectbot/util/XmlBuilder.java
Java
asf20
1,988