code
stringlengths
1
2.01M
repo_name
stringlengths
3
62
path
stringlengths
1
267
language
stringclasses
231 values
license
stringclasses
13 values
size
int64
1
2.01M
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * This class is from: * * Encryptor.java * Copyright 2008 Zach Scrivena * zachscrivena@gmail.com * http://zs.freeshell.org/ */ import java.security.MessageDigest; import java.security.SecureRandom; import java.util.Arrays; import javax.crypto.Cipher; import javax.crypto.spec.IvParameterSpec; import javax.crypto.spec.SecretKeySpec; /** * Perform AES-128 encryption. */ public final class Encryptor { /** name of the character set to use for converting between characters and bytes */ private static final String CHARSET_NAME = "UTF-8"; /** random number generator algorithm */ private static final String RNG_ALGORITHM = "SHA1PRNG"; /** message digest algorithm (must be sufficiently long to provide the key and initialization vector) */ private static final String DIGEST_ALGORITHM = "SHA-256"; /** key algorithm (must be compatible with CIPHER_ALGORITHM) */ private static final String KEY_ALGORITHM = "AES"; /** cipher algorithm (must be compatible with KEY_ALGORITHM) */ private static final String CIPHER_ALGORITHM = "AES/CBC/PKCS5Padding"; /** * Private constructor that should never be called. */ private Encryptor() {} /** * Encrypt the specified cleartext using the given password. * With the correct salt, number of iterations, and password, the decrypt() method reverses * the effect of this method. * This method generates and uses a random salt, and the user-specified number of iterations * and password to create a 16-byte secret key and 16-byte initialization vector. * The secret key and initialization vector are then used in the AES-128 cipher to encrypt * the given cleartext. * * @param salt * salt that was used in the encryption (to be populated) * @param iterations * number of iterations to use in salting * @param password * password to be used for encryption * @param cleartext * cleartext to be encrypted * @return * ciphertext * @throws Exception * on any error encountered in encryption */ public static byte[] encrypt( final byte[] salt, final int iterations, final String password, final byte[] cleartext) throws Exception { /* generate salt randomly */ SecureRandom.getInstance(RNG_ALGORITHM).nextBytes(salt); /* compute key and initialization vector */ final MessageDigest shaDigest = MessageDigest.getInstance(DIGEST_ALGORITHM); byte[] pw = password.getBytes(CHARSET_NAME); for (int i = 0; i < iterations; i++) { /* add salt */ final byte[] salted = new byte[pw.length + salt.length]; System.arraycopy(pw, 0, salted, 0, pw.length); System.arraycopy(salt, 0, salted, pw.length, salt.length); Arrays.fill(pw, (byte) 0x00); /* compute SHA-256 digest */ shaDigest.reset(); pw = shaDigest.digest(salted); Arrays.fill(salted, (byte) 0x00); } /* extract the 16-byte key and initialization vector from the SHA-256 digest */ final byte[] key = new byte[16]; final byte[] iv = new byte[16]; System.arraycopy(pw, 0, key, 0, 16); System.arraycopy(pw, 16, iv, 0, 16); Arrays.fill(pw, (byte) 0x00); /* perform AES-128 encryption */ final Cipher cipher = Cipher.getInstance(CIPHER_ALGORITHM); cipher.init( Cipher.ENCRYPT_MODE, new SecretKeySpec(key, KEY_ALGORITHM), new IvParameterSpec(iv)); Arrays.fill(key, (byte) 0x00); Arrays.fill(iv, (byte) 0x00); return cipher.doFinal(cleartext); } /** * Decrypt the specified ciphertext using the given password. * With the correct salt, number of iterations, and password, this method reverses the effect * of the encrypt() method. * This method uses the user-specified salt, number of iterations, and password * to recreate the 16-byte secret key and 16-byte initialization vector. * The secret key and initialization vector are then used in the AES-128 cipher to decrypt * the given ciphertext. * * @param salt * salt to be used in decryption * @param iterations * number of iterations to use in salting * @param password * password to be used for decryption * @param ciphertext * ciphertext to be decrypted * @return * cleartext * @throws Exception * on any error encountered in decryption */ public static byte[] decrypt( final byte[] salt, final int iterations, final String password, final byte[] ciphertext) throws Exception { /* compute key and initialization vector */ final MessageDigest shaDigest = MessageDigest.getInstance(DIGEST_ALGORITHM); byte[] pw = password.getBytes(CHARSET_NAME); for (int i = 0; i < iterations; i++) { /* add salt */ final byte[] salted = new byte[pw.length + salt.length]; System.arraycopy(pw, 0, salted, 0, pw.length); System.arraycopy(salt, 0, salted, pw.length, salt.length); Arrays.fill(pw, (byte) 0x00); /* compute SHA-256 digest */ shaDigest.reset(); pw = shaDigest.digest(salted); Arrays.fill(salted, (byte) 0x00); } /* extract the 16-byte key and initialization vector from the SHA-256 digest */ final byte[] key = new byte[16]; final byte[] iv = new byte[16]; System.arraycopy(pw, 0, key, 0, 16); System.arraycopy(pw, 16, iv, 0, 16); Arrays.fill(pw, (byte) 0x00); /* perform AES-128 decryption */ final Cipher cipher = Cipher.getInstance(CIPHER_ALGORITHM); cipher.init( Cipher.DECRYPT_MODE, new SecretKeySpec(key, KEY_ALGORITHM), new IvParameterSpec(iv)); Arrays.fill(key, (byte) 0x00); Arrays.fill(iv, (byte) 0x00); return cipher.doFinal(ciphertext); } }
zzsuper001-linuxshell
src/org/connectbot/util/Encryptor.java
Java
asf20
6,191
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.util.Vector; import org.connectbot.R; import android.content.Context; import android.graphics.Canvas; import android.graphics.Color; import android.graphics.Paint; import android.graphics.Typeface; import android.graphics.Paint.FontMetrics; import android.util.AttributeSet; import android.view.MotionEvent; import android.view.View; public class EntropyView extends View { private static final int SHA1_MAX_BYTES = 20; private static final int MILLIS_BETWEEN_INPUTS = 50; private Paint mPaint; private FontMetrics mFontMetrics; private boolean mFlipFlop; private long mLastTime; private Vector<OnEntropyGatheredListener> listeners; private byte[] mEntropy; private int mEntropyByteIndex; private int mEntropyBitIndex; private int splitText = 0; private float lastX = 0.0f, lastY = 0.0f; public EntropyView(Context context) { super(context); setUpEntropy(); } public EntropyView(Context context, AttributeSet attrs) { super(context, attrs); setUpEntropy(); } private void setUpEntropy() { mPaint = new Paint(); mPaint.setAntiAlias(true); mPaint.setTypeface(Typeface.DEFAULT); mPaint.setTextAlign(Paint.Align.CENTER); mPaint.setTextSize(16); mPaint.setColor(Color.WHITE); mFontMetrics = mPaint.getFontMetrics(); mEntropy = new byte[SHA1_MAX_BYTES]; mEntropyByteIndex = 0; mEntropyBitIndex = 0; listeners = new Vector<OnEntropyGatheredListener>(); } public void addOnEntropyGatheredListener(OnEntropyGatheredListener listener) { listeners.add(listener); } public void removeOnEntropyGatheredListener(OnEntropyGatheredListener listener) { listeners.remove(listener); } @Override public void onDraw(Canvas c) { String prompt = String.format(getResources().getString(R.string.pubkey_touch_prompt), (int)(100.0 * (mEntropyByteIndex / 20.0)) + (int)(5.0 * (mEntropyBitIndex / 8.0))); if (splitText > 0 || mPaint.measureText(prompt) > (getWidth() * 0.8)) { if (splitText == 0) splitText = prompt.indexOf(" ", prompt.length() / 2); c.drawText(prompt.substring(0, splitText), getWidth() / 2.0f, getHeight() / 2.0f + (mPaint.ascent() + mPaint.descent()), mPaint); c.drawText(prompt.substring(splitText), getWidth() / 2.0f, getHeight() / 2.0f - (mPaint.ascent() + mPaint.descent()), mPaint); } else { c.drawText(prompt, getWidth() / 2.0f, getHeight() / 2.0f - (mFontMetrics.ascent + mFontMetrics.descent) / 2, mPaint); } } @Override public boolean onTouchEvent(MotionEvent event) { if (mEntropyByteIndex >= SHA1_MAX_BYTES || lastX == event.getX() || lastY == event.getY()) return true; // Only get entropy every 200 milliseconds to ensure the user has moved around. long now = System.currentTimeMillis(); if ((now - mLastTime) < MILLIS_BETWEEN_INPUTS) return true; else mLastTime = now; byte input; lastX = event.getX(); lastY = event.getY(); // Get the lowest 4 bits of each X, Y input and concat to the entropy-gathering // string. if (mFlipFlop) input = (byte)((((int)lastX & 0x0F) << 4) | ((int)lastY & 0x0F)); else input = (byte)((((int)lastY & 0x0F) << 4) | ((int)lastX & 0x0F)); mFlipFlop = !mFlipFlop; for (int i = 0; i < 4 && mEntropyByteIndex < SHA1_MAX_BYTES; i++) { if ((input & 0x3) == 0x1) { mEntropy[mEntropyByteIndex] <<= 1; mEntropy[mEntropyByteIndex] |= 1; mEntropyBitIndex++; input >>= 2; } else if ((input & 0x3) == 0x2) { mEntropy[mEntropyByteIndex] <<= 1; mEntropyBitIndex++; input >>= 2; } if (mEntropyBitIndex >= 8) { mEntropyBitIndex = 0; mEntropyByteIndex++; } } // SHA1PRNG only keeps 160 bits of entropy. if (mEntropyByteIndex >= SHA1_MAX_BYTES) { for (OnEntropyGatheredListener listener: listeners) { listener.onEntropyGathered(mEntropy); } } invalidate(); return true; } }
zzsuper001-linuxshell
src/org/connectbot/util/EntropyView.java
Java
asf20
4,607
/* * Copyright (C) 2007 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ /* * 090408 * Keith Wiley * kwiley@keithwiley.com * http://keithwiley.com * * UberColorPickerDialog v1.1 * * This color picker was implemented as a (significant) extension of the * ColorPickerDialog class provided in the Android API Demos. You are free * to drop it unchanged into your own projects or to modify it as you see * fit. I would appreciate it if this comment block were let intact, * merely for credit's sake. * * Enjoy! */ package org.connectbot.util; import android.app.Dialog; import android.content.Context; import android.graphics.Bitmap; import android.graphics.Canvas; import android.graphics.Color; import android.graphics.ColorMatrix; import android.graphics.ComposeShader; import android.graphics.Paint; import android.graphics.PorterDuff; import android.graphics.PorterDuffXfermode; import android.graphics.RadialGradient; import android.graphics.Rect; import android.graphics.RectF; import android.graphics.Shader; import android.graphics.SweepGradient; import android.graphics.drawable.GradientDrawable; import android.graphics.drawable.GradientDrawable.Orientation; import android.os.Bundle; import android.util.DisplayMetrics; import android.view.MotionEvent; import android.view.View; /** * UberColorPickerDialog is a seriously enhanced version of the UberColorPickerDialog * class provided in the Android API Demos.<p> * * NOTE (from Kenny Root): This is a VERY slimmed down version custom for ConnectBot. * Visit Keith's site for the full version at the URL listed in the author line.<p> * * @author Keith Wiley, kwiley@keithwiley.com, http://keithwiley.com */ public class UberColorPickerDialog extends Dialog { private final OnColorChangedListener mListener; private final int mInitialColor; /** * Callback to the creator of the dialog, informing the creator of a new color and notifying that the dialog is about to dismiss. */ public interface OnColorChangedListener { void colorChanged(int color); } /** * Ctor * @param context * @param listener * @param initialColor * @param showTitle If true, a title is shown across the top of the dialog. If false a toast is shown instead. */ public UberColorPickerDialog(Context context, OnColorChangedListener listener, int initialColor) { super(context); mListener = listener; mInitialColor = initialColor; } /** * Activity entry point */ @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); OnColorChangedListener l = new OnColorChangedListener() { public void colorChanged(int color) { mListener.colorChanged(color); dismiss(); } }; DisplayMetrics dm = new DisplayMetrics(); getWindow().getWindowManager().getDefaultDisplay().getMetrics(dm); int screenWidth = dm.widthPixels; int screenHeight = dm.heightPixels; setTitle("Pick a color (try the trackball)"); try { setContentView(new ColorPickerView(getContext(), l, screenWidth, screenHeight, mInitialColor)); } catch (Exception e) { //There is currently only one kind of ctor exception, that where no methods are enabled. dismiss(); //This doesn't work! The dialog is still shown (its title at least, the layout is empty from the exception being thrown). <sigh> } } /** * ColorPickerView is the meat of this color picker (as opposed to the enclosing class). * All the heavy lifting is done directly by this View subclass. * <P> * You can enable/disable whichever color chooser methods you want by modifying the ENABLED_METHODS switches. They *should* * do all the work required to properly enable/disable methods without losing track of what goes with what and what maps to what. * <P> * If you add a new color chooser method, do a text search for "NEW_METHOD_WORK_NEEDED_HERE". That tag indicates all * the locations in the code that will have to be amended in order to properly add a new color chooser method. * I highly recommend adding new methods to the end of the list. If you want to try to reorder the list, you're on your own. */ private static class ColorPickerView extends View { private static int SWATCH_WIDTH = 95; private static final int SWATCH_HEIGHT = 60; private static int PALETTE_POS_X = 0; private static int PALETTE_POS_Y = SWATCH_HEIGHT; private static final int PALETTE_DIM = SWATCH_WIDTH * 2; private static final int PALETTE_RADIUS = PALETTE_DIM / 2; private static final int PALETTE_CENTER_X = PALETTE_RADIUS; private static final int PALETTE_CENTER_Y = PALETTE_RADIUS; private static final int SLIDER_THICKNESS = 40; private static int VIEW_DIM_X = PALETTE_DIM; private static int VIEW_DIM_Y = SWATCH_HEIGHT; //NEW_METHOD_WORK_NEEDED_HERE private static final int METHOD_HS_V_PALETTE = 0; //NEW_METHOD_WORK_NEEDED_HERE //Add a new entry to the list for each controller in the new method private static final int TRACKED_NONE = -1; //No object on screen is currently being tracked private static final int TRACK_SWATCH_OLD = 10; private static final int TRACK_SWATCH_NEW = 11; private static final int TRACK_HS_PALETTE = 30; private static final int TRACK_VER_VALUE_SLIDER = 31; private static final int TEXT_SIZE = 12; private static int[] TEXT_HSV_POS = new int[2]; private static int[] TEXT_RGB_POS = new int[2]; private static int[] TEXT_YUV_POS = new int[2]; private static int[] TEXT_HEX_POS = new int[2]; private static final float PI = 3.141592653589793f; private int mMethod = METHOD_HS_V_PALETTE; private int mTracking = TRACKED_NONE; //What object on screen is currently being tracked for movement //Zillions of persistant Paint objecs for drawing the View private Paint mSwatchOld, mSwatchNew; //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the palettes of the new method's UI controllers private Paint mOvalHueSat; private Bitmap mVerSliderBM; private Canvas mVerSliderCv; private Bitmap[] mHorSlidersBM = new Bitmap[3]; private Canvas[] mHorSlidersCv = new Canvas[3]; private Paint mValDimmer; //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the icon for the new method private Paint mOvalHueSatSmall; private Paint mPosMarker; private Paint mText; private Rect mOldSwatchRect = new Rect(); private Rect mNewSwatchRect = new Rect(); private Rect mPaletteRect = new Rect(); private Rect mVerSliderRect = new Rect(); private int[] mSpectrumColorsRev; private int mOriginalColor = 0; //The color passed in at the beginning, which can be reverted to at any time by tapping the old swatch. private float[] mHSV = new float[3]; private int[] mRGB = new int[3]; private float[] mYUV = new float[3]; private String mHexStr = ""; private boolean mHSVenabled = true; //Only true if an HSV method is enabled private boolean mRGBenabled = true; //Only true if an RGB method is enabled private boolean mYUVenabled = true; //Only true if a YUV method is enabled private boolean mHexenabled = true; //Only true if an RGB method is enabled private int[] mCoord = new int[3]; //For drawing slider/palette markers private int mFocusedControl = -1; //Which control receives trackball events. private OnColorChangedListener mListener; /** * Ctor. * @param c * @param l * @param width Used to determine orientation and adjust layout accordingly * @param height Used to determine orientation and adjust layout accordingly * @param color The initial color * @throws Exception */ ColorPickerView(Context c, OnColorChangedListener l, int width, int height, int color) throws Exception { super(c); //We need to make the dialog focusable to retrieve trackball events. setFocusable(true); mListener = l; mOriginalColor = color; Color.colorToHSV(color, mHSV); updateAllFromHSV(); //Setup the layout based on whether this is a portrait or landscape orientation. if (width <= height) { //Portrait layout SWATCH_WIDTH = (PALETTE_DIM + SLIDER_THICKNESS) / 2; PALETTE_POS_X = 0; PALETTE_POS_Y = TEXT_SIZE * 4 + SWATCH_HEIGHT; //Set more rects, lots of rects mOldSwatchRect.set(0, TEXT_SIZE * 4, SWATCH_WIDTH, TEXT_SIZE * 4 + SWATCH_HEIGHT); mNewSwatchRect.set(SWATCH_WIDTH, TEXT_SIZE * 4, SWATCH_WIDTH * 2, TEXT_SIZE * 4 + SWATCH_HEIGHT); mPaletteRect.set(0, PALETTE_POS_Y, PALETTE_DIM, PALETTE_POS_Y + PALETTE_DIM); mVerSliderRect.set(PALETTE_DIM, PALETTE_POS_Y, PALETTE_DIM + SLIDER_THICKNESS, PALETTE_POS_Y + PALETTE_DIM); TEXT_HSV_POS[0] = 3; TEXT_HSV_POS[1] = 0; TEXT_RGB_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_RGB_POS[1] = TEXT_HSV_POS[1]; TEXT_YUV_POS[0] = TEXT_HSV_POS[0] + 100; TEXT_YUV_POS[1] = TEXT_HSV_POS[1]; TEXT_HEX_POS[0] = TEXT_HSV_POS[0] + 150; TEXT_HEX_POS[1] = TEXT_HSV_POS[1]; VIEW_DIM_X = PALETTE_DIM + SLIDER_THICKNESS; VIEW_DIM_Y = SWATCH_HEIGHT + PALETTE_DIM + TEXT_SIZE * 4; } else { //Landscape layout SWATCH_WIDTH = 110; PALETTE_POS_X = SWATCH_WIDTH; PALETTE_POS_Y = 0; //Set more rects, lots of rects mOldSwatchRect.set(0, TEXT_SIZE * 7, SWATCH_WIDTH, TEXT_SIZE * 7 + SWATCH_HEIGHT); mNewSwatchRect.set(0, TEXT_SIZE * 7 + SWATCH_HEIGHT, SWATCH_WIDTH, TEXT_SIZE * 7 + SWATCH_HEIGHT * 2); mPaletteRect.set(SWATCH_WIDTH, PALETTE_POS_Y, SWATCH_WIDTH + PALETTE_DIM, PALETTE_POS_Y + PALETTE_DIM); mVerSliderRect.set(SWATCH_WIDTH + PALETTE_DIM, PALETTE_POS_Y, SWATCH_WIDTH + PALETTE_DIM + SLIDER_THICKNESS, PALETTE_POS_Y + PALETTE_DIM); TEXT_HSV_POS[0] = 3; TEXT_HSV_POS[1] = 0; TEXT_RGB_POS[0] = TEXT_HSV_POS[0]; TEXT_RGB_POS[1] = (int)(TEXT_HSV_POS[1] + TEXT_SIZE * 3.5); TEXT_YUV_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_YUV_POS[1] = (int)(TEXT_HSV_POS[1] + TEXT_SIZE * 3.5); TEXT_HEX_POS[0] = TEXT_HSV_POS[0] + 50; TEXT_HEX_POS[1] = TEXT_HSV_POS[1]; VIEW_DIM_X = PALETTE_POS_X + PALETTE_DIM + SLIDER_THICKNESS; VIEW_DIM_Y = Math.max(mNewSwatchRect.bottom, PALETTE_DIM); } //Rainbows make everybody happy! mSpectrumColorsRev = new int[] { 0xFFFF0000, 0xFFFF00FF, 0xFF0000FF, 0xFF00FFFF, 0xFF00FF00, 0xFFFFFF00, 0xFFFF0000, }; //Setup all the Paint and Shader objects. There are lots of them! //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the palettes of the new method's UI controllers mSwatchOld = new Paint(Paint.ANTI_ALIAS_FLAG); mSwatchOld.setStyle(Paint.Style.FILL); mSwatchOld.setColor(Color.HSVToColor(mHSV)); mSwatchNew = new Paint(Paint.ANTI_ALIAS_FLAG); mSwatchNew.setStyle(Paint.Style.FILL); mSwatchNew.setColor(Color.HSVToColor(mHSV)); Shader shaderA = new SweepGradient(0, 0, mSpectrumColorsRev, null); Shader shaderB = new RadialGradient(0, 0, PALETTE_CENTER_X, 0xFFFFFFFF, 0xFF000000, Shader.TileMode.CLAMP); Shader shader = new ComposeShader(shaderA, shaderB, PorterDuff.Mode.SCREEN); mOvalHueSat = new Paint(Paint.ANTI_ALIAS_FLAG); mOvalHueSat.setShader(shader); mOvalHueSat.setStyle(Paint.Style.FILL); mOvalHueSat.setDither(true); mVerSliderBM = Bitmap.createBitmap(SLIDER_THICKNESS, PALETTE_DIM, Bitmap.Config.RGB_565); mVerSliderCv = new Canvas(mVerSliderBM); for (int i = 0; i < 3; i++) { mHorSlidersBM[i] = Bitmap.createBitmap(PALETTE_DIM, SLIDER_THICKNESS, Bitmap.Config.RGB_565); mHorSlidersCv[i] = new Canvas(mHorSlidersBM[i]); } mValDimmer = new Paint(Paint.ANTI_ALIAS_FLAG); mValDimmer.setStyle(Paint.Style.FILL); mValDimmer.setDither(true); mValDimmer.setXfermode(new PorterDuffXfermode(PorterDuff.Mode.MULTIPLY)); //Whew, we're done making the big Paints and Shaders for the swatches, palettes, and sliders. //Now we need to make the Paints and Shaders that will draw the little method icons in the method selector list. //NEW_METHOD_WORK_NEEDED_HERE //Add Paints to represent the icon for the new method shaderA = new SweepGradient(0, 0, mSpectrumColorsRev, null); shaderB = new RadialGradient(0, 0, PALETTE_DIM / 2, 0xFFFFFFFF, 0xFF000000, Shader.TileMode.CLAMP); shader = new ComposeShader(shaderA, shaderB, PorterDuff.Mode.SCREEN); mOvalHueSatSmall = new Paint(Paint.ANTI_ALIAS_FLAG); mOvalHueSatSmall.setShader(shader); mOvalHueSatSmall.setStyle(Paint.Style.FILL); //Make a simple stroking Paint for drawing markers and borders and stuff like that. mPosMarker = new Paint(Paint.ANTI_ALIAS_FLAG); mPosMarker.setStyle(Paint.Style.STROKE); mPosMarker.setStrokeWidth(2); //Make a basic text Paint. mText = new Paint(Paint.ANTI_ALIAS_FLAG); mText.setTextSize(TEXT_SIZE); mText.setColor(Color.WHITE); //Kickstart initUI(); } /** * Draw the entire view (the entire dialog). */ @Override protected void onDraw(Canvas canvas) { //Draw the old and new swatches drawSwatches(canvas); //Write the text writeColorParams(canvas); //Draw the palette and sliders (the UI) if (mMethod == METHOD_HS_V_PALETTE) drawHSV1Palette(canvas); } /** * Draw the old and new swatches. * @param canvas */ private void drawSwatches(Canvas canvas) { float[] hsv = new float[3]; mText.setTextSize(16); //Draw the original swatch canvas.drawRect(mOldSwatchRect, mSwatchOld); Color.colorToHSV(mOriginalColor, hsv); //if (UberColorPickerDialog.isGray(mColor)) //Don't need this right here, but imp't to note // hsv[1] = 0; if (hsv[2] > .5) mText.setColor(Color.BLACK); canvas.drawText("Revert", mOldSwatchRect.left + SWATCH_WIDTH / 2 - mText.measureText("Revert") / 2, mOldSwatchRect.top + 16, mText); mText.setColor(Color.WHITE); //Draw the new swatch canvas.drawRect(mNewSwatchRect, mSwatchNew); if (mHSV[2] > .5) mText.setColor(Color.BLACK); canvas.drawText("Accept", mNewSwatchRect.left + SWATCH_WIDTH / 2 - mText.measureText("Accept") / 2, mNewSwatchRect.top + 16, mText); mText.setColor(Color.WHITE); mText.setTextSize(TEXT_SIZE); } /** * Write the color parametes (HSV, RGB, YUV, Hex, etc.). * @param canvas */ private void writeColorParams(Canvas canvas) { if (mHSVenabled) { canvas.drawText("H: " + Integer.toString((int)(mHSV[0] / 360.0f * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE, mText); canvas.drawText("S: " + Integer.toString((int)(mHSV[1] * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("V: " + Integer.toString((int)(mHSV[2] * 255)), TEXT_HSV_POS[0], TEXT_HSV_POS[1] + TEXT_SIZE * 3, mText); } if (mRGBenabled) { canvas.drawText("R: " + mRGB[0], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE, mText); canvas.drawText("G: " + mRGB[1], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("B: " + mRGB[2], TEXT_RGB_POS[0], TEXT_RGB_POS[1] + TEXT_SIZE * 3, mText); } if (mYUVenabled) { canvas.drawText("Y: " + Integer.toString((int)(mYUV[0] * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE, mText); canvas.drawText("U: " + Integer.toString((int)((mYUV[1] + .5f) * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE * 2, mText); canvas.drawText("V: " + Integer.toString((int)((mYUV[2] + .5f) * 255)), TEXT_YUV_POS[0], TEXT_YUV_POS[1] + TEXT_SIZE * 3, mText); } if (mHexenabled) canvas.drawText("#" + mHexStr, TEXT_HEX_POS[0], TEXT_HEX_POS[1] + TEXT_SIZE, mText); } /** * Place a small circle on the 2D palette to indicate the current values. * @param canvas * @param markerPosX * @param markerPosY */ private void mark2DPalette(Canvas canvas, int markerPosX, int markerPosY) { mPosMarker.setColor(Color.BLACK); canvas.drawOval(new RectF(markerPosX - 5, markerPosY - 5, markerPosX + 5, markerPosY + 5), mPosMarker); mPosMarker.setColor(Color.WHITE); canvas.drawOval(new RectF(markerPosX - 3, markerPosY - 3, markerPosX + 3, markerPosY + 3), mPosMarker); } /** * Draw a line across the slider to indicate its current value. * @param canvas * @param markerPos */ private void markVerSlider(Canvas canvas, int markerPos) { mPosMarker.setColor(Color.BLACK); canvas.drawRect(new Rect(0, markerPos - 2, SLIDER_THICKNESS, markerPos + 3), mPosMarker); mPosMarker.setColor(Color.WHITE); canvas.drawRect(new Rect(0, markerPos, SLIDER_THICKNESS, markerPos + 1), mPosMarker); } /** * Frame the slider to indicate that it has trackball focus. * @param canvas */ private void hilightFocusedVerSlider(Canvas canvas) { mPosMarker.setColor(Color.WHITE); canvas.drawRect(new Rect(0, 0, SLIDER_THICKNESS, PALETTE_DIM), mPosMarker); mPosMarker.setColor(Color.BLACK); canvas.drawRect(new Rect(2, 2, SLIDER_THICKNESS - 2, PALETTE_DIM - 2), mPosMarker); } /** * Frame the 2D palette to indicate that it has trackball focus. * @param canvas */ private void hilightFocusedOvalPalette(Canvas canvas) { mPosMarker.setColor(Color.WHITE); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mPosMarker); mPosMarker.setColor(Color.BLACK); canvas.drawOval(new RectF(-PALETTE_RADIUS + 2, -PALETTE_RADIUS + 2, PALETTE_RADIUS - 2, PALETTE_RADIUS - 2), mPosMarker); } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate the basic draw functions here. Use the 2D palette or 1D sliders as templates for the new method. /** * Draw the UI for HSV with angular H and radial S combined in 2D and a 1D V slider. * @param canvas */ private void drawHSV1Palette(Canvas canvas) { canvas.save(); canvas.translate(PALETTE_POS_X, PALETTE_POS_Y); //Draw the 2D palette canvas.translate(PALETTE_CENTER_X, PALETTE_CENTER_Y); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mOvalHueSat); canvas.drawOval(new RectF(-PALETTE_RADIUS, -PALETTE_RADIUS, PALETTE_RADIUS, PALETTE_RADIUS), mValDimmer); if (mFocusedControl == 0) hilightFocusedOvalPalette(canvas); mark2DPalette(canvas, mCoord[0], mCoord[1]); canvas.translate(-PALETTE_CENTER_X, -PALETTE_CENTER_Y); //Draw the 1D slider canvas.translate(PALETTE_DIM, 0); canvas.drawBitmap(mVerSliderBM, 0, 0, null); if (mFocusedControl == 1) hilightFocusedVerSlider(canvas); markVerSlider(canvas, mCoord[2]); canvas.restore(); } /** * Initialize the current color chooser's UI (set its color parameters and set its palette and slider values accordingly). */ private void initUI() { initHSV1Palette(); //Focus on the first controller (arbitrary). mFocusedControl = 0; } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last init function shown below /** * Initialize a color chooser. */ private void initHSV1Palette() { setOvalValDimmer(); setVerValSlider(); float angle = 2*PI - mHSV[0] / (180 / 3.1415927f); float radius = mHSV[1] * PALETTE_RADIUS; mCoord[0] = (int)(Math.cos(angle) * radius); mCoord[1] = (int)(Math.sin(angle) * radius); mCoord[2] = PALETTE_DIM - (int)(mHSV[2] * PALETTE_DIM); } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the set functions below, one per UI controller in the new method /** * Adjust a Paint which, when painted, dims its underlying object to show the effects of varying value (brightness). */ private void setOvalValDimmer() { float[] hsv = new float[3]; hsv[0] = mHSV[0]; hsv[1] = 0; hsv[2] = mHSV[2]; int gray = Color.HSVToColor(hsv); mValDimmer.setColor(gray); } /** * Create a linear gradient shader to show variations in value. */ private void setVerValSlider() { float[] hsv = new float[3]; hsv[0] = mHSV[0]; hsv[1] = mHSV[1]; hsv[2] = 1; int col = Color.HSVToColor(hsv); int colors[] = new int[2]; colors[0] = col; colors[1] = 0xFF000000; GradientDrawable gradDraw = new GradientDrawable(Orientation.TOP_BOTTOM, colors); gradDraw.setDither(true); gradDraw.setLevel(10000); gradDraw.setBounds(0, 0, SLIDER_THICKNESS, PALETTE_DIM); gradDraw.draw(mVerSliderCv); } /** * Report the correct tightly bounded dimensions of the view. */ @Override protected void onMeasure(int widthMeasureSpec, int heightMeasureSpec) { setMeasuredDimension(VIEW_DIM_X, VIEW_DIM_Y); } /** * Wrap Math.round(). I'm not a Java expert. Is this the only way to avoid writing "(int)Math.round" everywhere? * @param x * @return */ private int round(double x) { return (int)Math.round(x); } /** * Limit a value to the range [0,1]. * @param n * @return */ private float pinToUnit(float n) { if (n < 0) { n = 0; } else if (n > 1) { n = 1; } return n; } /** * Limit a value to the range [0,max]. * @param n * @param max * @return */ private float pin(float n, float max) { if (n < 0) { n = 0; } else if (n > max) { n = max; } return n; } /** * Limit a value to the range [min,max]. * @param n * @param min * @param max * @return */ private float pin(float n, float min, float max) { if (n < min) { n = min; } else if (n > max) { n = max; } return n; } /** * No clue what this does (some sort of average/mean I presume). It came with the original UberColorPickerDialog * in the API Demos and wasn't documented. I don't feel like spending any time figuring it out, I haven't looked at it at all. * @param s * @param d * @param p * @return */ private int ave(int s, int d, float p) { return s + round(p * (d - s)); } /** * Came with the original UberColorPickerDialog in the API Demos, wasn't documented. I believe it takes an array of * colors and a value in the range [0,1] and interpolates a resulting color in a seemingly predictable manner. * I haven't looked at it at all. * @param colors * @param unit * @return */ private int interpColor(int colors[], float unit) { if (unit <= 0) { return colors[0]; } if (unit >= 1) { return colors[colors.length - 1]; } float p = unit * (colors.length - 1); int i = (int)p; p -= i; // now p is just the fractional part [0...1) and i is the index int c0 = colors[i]; int c1 = colors[i+1]; int a = ave(Color.alpha(c0), Color.alpha(c1), p); int r = ave(Color.red(c0), Color.red(c1), p); int g = ave(Color.green(c0), Color.green(c1), p); int b = ave(Color.blue(c0), Color.blue(c1), p); return Color.argb(a, r, g, b); } /** * A standard point-in-rect routine. * @param x * @param y * @param r * @return true if point x,y is in rect r */ public boolean ptInRect(int x, int y, Rect r) { return x > r.left && x < r.right && y > r.top && y < r.bottom; } /** * Process trackball events. Used mainly for fine-tuned color adjustment, or alternatively to switch between slider controls. */ @Override public boolean dispatchTrackballEvent(MotionEvent event) { float x = event.getX(); float y = event.getY(); //A longer event history implies faster trackball movement. //Use it to infer a larger jump and therefore faster palette/slider adjustment. int jump = event.getHistorySize() + 1; switch (event.getAction()) { case MotionEvent.ACTION_DOWN: { } break; case MotionEvent.ACTION_MOVE: { //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the appropriate entry in this list, //depending on whether you use 1D or 2D controllers switch (mMethod) { case METHOD_HS_V_PALETTE: if (mFocusedControl == 0) { changeHSPalette(x, y, jump); } else if (mFocusedControl == 1) { if (y < 0) changeSlider(mFocusedControl, true, jump); else if (y > 0) changeSlider(mFocusedControl, false, jump); } break; } } break; case MotionEvent.ACTION_UP: { } break; } return true; } //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the appropriate functions below, //one per UI controller in the new method /** * Effect a trackball change to a 2D palette. * @param x -1: negative x change, 0: no x change, +1: positive x change. * @param y -1: negative y change, 0, no y change, +1: positive y change. * @param jump the amount by which to change. */ private void changeHSPalette(float x, float y, int jump) { int x2 = 0, y2 = 0; if (x < 0) x2 = -jump; else if (x > 0) x2 = jump; if (y < 0) y2 = -jump; else if (y > 0) y2 = jump; mCoord[0] += x2; mCoord[1] += y2; if (mCoord[0] < -PALETTE_RADIUS) mCoord[0] = -PALETTE_RADIUS; else if (mCoord[0] > PALETTE_RADIUS) mCoord[0] = PALETTE_RADIUS; if (mCoord[1] < -PALETTE_RADIUS) mCoord[1] = -PALETTE_RADIUS; else if (mCoord[1] > PALETTE_RADIUS) mCoord[1] = PALETTE_RADIUS; float radius = (float)java.lang.Math.sqrt(mCoord[0] * mCoord[0] + mCoord[1] * mCoord[1]); if (radius > PALETTE_RADIUS) radius = PALETTE_RADIUS; float angle = (float)java.lang.Math.atan2(mCoord[1], mCoord[0]); // need to turn angle [-PI ... PI] into unit [0....1] float unit = angle/(2*PI); if (unit < 0) { unit += 1; } mCoord[0] = round(Math.cos(angle) * radius); mCoord[1] = round(Math.sin(angle) * radius); int c = interpColor(mSpectrumColorsRev, unit); float[] hsv = new float[3]; Color.colorToHSV(c, hsv); mHSV[0] = hsv[0]; mHSV[1] = radius / PALETTE_RADIUS; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setVerValSlider(); invalidate(); } /** * Effect a trackball change to a 1D slider. * @param slider id of the slider to be effected * @param increase true if the change is an increase, false if a decrease * @param jump the amount by which to change in units of the range [0,255] */ private void changeSlider(int slider, boolean increase, int jump) { //NEW_METHOD_WORK_NEEDED_HERE //It is only necessary to add an entry here for a new method if the new method uses a 1D slider. //Note, some sliders are horizontal and others are vertical. //They differ a bit, especially in a sign flip on the vertical axis. if (mMethod == METHOD_HS_V_PALETTE) { //slider *must* equal 1 mHSV[2] += (increase ? jump : -jump) / 256.0f; mHSV[2] = pinToUnit(mHSV[2]); updateAllFromHSV(); mCoord[2] = PALETTE_DIM - (int)(mHSV[2] * PALETTE_DIM); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setOvalValDimmer(); invalidate(); } } /** * Keep all colorspace representations in sync. */ private void updateRGBfromHSV() { int color = Color.HSVToColor(mHSV); mRGB[0] = Color.red(color); mRGB[1] = Color.green(color); mRGB[2] = Color.blue(color); } /** * Keep all colorspace representations in sync. */ private void updateYUVfromRGB() { float r = mRGB[0] / 255.0f; float g = mRGB[1] / 255.0f; float b = mRGB[2] / 255.0f; ColorMatrix cm = new ColorMatrix(); cm.setRGB2YUV(); final float[] a = cm.getArray(); mYUV[0] = a[0] * r + a[1] * g + a[2] * b; mYUV[0] = pinToUnit(mYUV[0]); mYUV[1] = a[5] * r + a[6] * g + a[7] * b; mYUV[1] = pin(mYUV[1], -.5f, .5f); mYUV[2] = a[10] * r + a[11] * g + a[12] * b; mYUV[2] = pin(mYUV[2], -.5f, .5f); } /** * Keep all colorspace representations in sync. */ private void updateHexFromHSV() { //For now, assume 100% opacity mHexStr = Integer.toHexString(Color.HSVToColor(mHSV)).toUpperCase(); mHexStr = mHexStr.substring(2, mHexStr.length()); } /** * Keep all colorspace representations in sync. */ private void updateAllFromHSV() { //Update mRGB if (mRGBenabled || mYUVenabled) updateRGBfromHSV(); //Update mYUV if (mYUVenabled) updateYUVfromRGB(); //Update mHexStr if (mRGBenabled) updateHexFromHSV(); } /** * Process touch events: down, move, and up */ @Override public boolean onTouchEvent(MotionEvent event) { float x = event.getX(); float y = event.getY(); //Generate coordinates which are palette=local with the origin at the upper left of the main 2D palette int y2 = (int)(pin(round(y - PALETTE_POS_Y), PALETTE_DIM)); //Generate coordinates which are palette-local with the origin at the center of the main 2D palette float circlePinnedX = x - PALETTE_POS_X - PALETTE_CENTER_X; float circlePinnedY = y - PALETTE_POS_Y - PALETTE_CENTER_Y; //Is the event in a swatch? boolean inSwatchOld = ptInRect(round(x), round(y), mOldSwatchRect); boolean inSwatchNew = ptInRect(round(x), round(y), mNewSwatchRect); //Get the event's distance from the center of the main 2D palette float radius = (float)java.lang.Math.sqrt(circlePinnedX * circlePinnedX + circlePinnedY * circlePinnedY); //Is the event in a circle-pinned 2D palette? boolean inOvalPalette = radius <= PALETTE_RADIUS; //Pin the radius if (radius > PALETTE_RADIUS) radius = PALETTE_RADIUS; //Is the event in a vertical slider to the right of the main 2D palette boolean inVerSlider = ptInRect(round(x), round(y), mVerSliderRect); switch (event.getAction()) { case MotionEvent.ACTION_DOWN: mTracking = TRACKED_NONE; if (inSwatchOld) mTracking = TRACK_SWATCH_OLD; else if (inSwatchNew) mTracking = TRACK_SWATCH_NEW; //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last entry in this list else if (mMethod == METHOD_HS_V_PALETTE) { if (inOvalPalette) { mTracking = TRACK_HS_PALETTE; mFocusedControl = 0; } else if (inVerSlider) { mTracking = TRACK_VER_VALUE_SLIDER; mFocusedControl = 1; } } case MotionEvent.ACTION_MOVE: //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the entries in this list, //one per UI controller the new method requires. if (mTracking == TRACK_HS_PALETTE) { float angle = (float)java.lang.Math.atan2(circlePinnedY, circlePinnedX); // need to turn angle [-PI ... PI] into unit [0....1] float unit = angle/(2*PI); if (unit < 0) { unit += 1; } mCoord[0] = round(Math.cos(angle) * radius); mCoord[1] = round(Math.sin(angle) * radius); int c = interpColor(mSpectrumColorsRev, unit); float[] hsv = new float[3]; Color.colorToHSV(c, hsv); mHSV[0] = hsv[0]; mHSV[1] = radius / PALETTE_RADIUS; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setVerValSlider(); invalidate(); } else if (mTracking == TRACK_VER_VALUE_SLIDER) { if (mCoord[2] != y2) { mCoord[2] = y2; float value = 1.0f - (float)y2 / (float)PALETTE_DIM; mHSV[2] = value; updateAllFromHSV(); mSwatchNew.setColor(Color.HSVToColor(mHSV)); setOvalValDimmer(); invalidate(); } } break; case MotionEvent.ACTION_UP: //NEW_METHOD_WORK_NEEDED_HERE //To add a new method, replicate and extend the last entry in this list. if (mTracking == TRACK_SWATCH_OLD && inSwatchOld) { Color.colorToHSV(mOriginalColor, mHSV); mSwatchNew.setColor(mOriginalColor); initUI(); invalidate(); } else if (mTracking == TRACK_SWATCH_NEW && inSwatchNew) { mListener.colorChanged(mSwatchNew.getColor()); invalidate(); } mTracking= TRACKED_NONE; break; } return true; } } }
zzsuper001-linuxshell
src/org/connectbot/util/UberColorPickerDialog.java
Java
asf20
32,278
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.util.LinkedList; import java.util.List; import android.content.Context; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.database.sqlite.SQLiteException; import android.database.sqlite.SQLiteOpenHelper; import android.database.sqlite.SQLiteDatabase.CursorFactory; /** * @author Kenny Root * */ public abstract class RobustSQLiteOpenHelper extends SQLiteOpenHelper { private static List<String> mTableNames = new LinkedList<String>(); private static List<String> mIndexNames = new LinkedList<String>(); public RobustSQLiteOpenHelper(Context context, String name, CursorFactory factory, int version) { super(context, name, factory, version); } protected static void addTableName(String tableName) { mTableNames.add(tableName); } protected static void addIndexName(String indexName) { mIndexNames.add(indexName); } @Override public void onCreate(SQLiteDatabase db) { dropAllTables(db); } @Override public final void onUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) { try { onRobustUpgrade(db, oldVersion, newVersion); } catch (SQLiteException e) { // The database has entered an unknown state. Try to recover. try { regenerateTables(db); } catch (SQLiteException e2) { dropAndCreateTables(db); } } } public abstract void onRobustUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) throws SQLiteException; private void regenerateTables(SQLiteDatabase db) { dropAllTablesWithPrefix(db, "OLD_"); for (String tableName : mTableNames) db.execSQL("ALTER TABLE " + tableName + " RENAME TO OLD_" + tableName); onCreate(db); for (String tableName : mTableNames) repopulateTable(db, tableName); dropAllTablesWithPrefix(db, "OLD_"); } private void repopulateTable(SQLiteDatabase db, String tableName) { String columns = getTableColumnNames(db, tableName); StringBuilder sb = new StringBuilder(); sb.append("INSERT INTO ") .append(tableName) .append(" (") .append(columns) .append(") SELECT ") .append(columns) .append(" FROM OLD_") .append(tableName); String sql = sb.toString(); db.execSQL(sql); } private String getTableColumnNames(SQLiteDatabase db, String tableName) { StringBuilder sb = new StringBuilder(); Cursor fields = db.rawQuery("PRAGMA table_info(" + tableName + ")", null); while (fields.moveToNext()) { if (!fields.isFirst()) sb.append(", "); sb.append(fields.getString(1)); } fields.close(); return sb.toString(); } private void dropAndCreateTables(SQLiteDatabase db) { dropAllTables(db); onCreate(db); } private void dropAllTablesWithPrefix(SQLiteDatabase db, String prefix) { for (String indexName : mIndexNames) db.execSQL("DROP INDEX IF EXISTS " + prefix + indexName); for (String tableName : mTableNames) db.execSQL("DROP TABLE IF EXISTS " + prefix + tableName); } private void dropAllTables(SQLiteDatabase db) { dropAllTablesWithPrefix(db, ""); } }
zzsuper001-linuxshell
src/org/connectbot/util/RobustSQLiteOpenHelper.java
Java
asf20
3,732
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * @author Kenny Root * */ public class Colors { public final static Integer[] defaults = new Integer[] { 0xff000000, // black 0xffcc0000, // red 0xff00cc00, // green 0xffcccc00, // brown 0xff0000cc, // blue 0xffcc00cc, // purple 0xff00cccc, // cyan 0xffcccccc, // light grey 0xff444444, // dark grey 0xffff4444, // light red 0xff44ff44, // light green 0xffffff44, // yellow 0xff4444ff, // light blue 0xffff44ff, // light purple 0xff44ffff, // light cyan 0xffffffff, // white 0xff000000, 0xff00005f, 0xff000087, 0xff0000af, 0xff0000d7, 0xff0000ff, 0xff005f00, 0xff005f5f, 0xff005f87, 0xff005faf, 0xff005fd7, 0xff005fff, 0xff008700, 0xff00875f, 0xff008787, 0xff0087af, 0xff0087d7, 0xff0087ff, 0xff00af00, 0xff00af5f, 0xff00af87, 0xff00afaf, 0xff00afd7, 0xff00afff, 0xff00d700, 0xff00d75f, 0xff00d787, 0xff00d7af, 0xff00d7d7, 0xff00d7ff, 0xff00ff00, 0xff00ff5f, 0xff00ff87, 0xff00ffaf, 0xff00ffd7, 0xff00ffff, 0xff5f0000, 0xff5f005f, 0xff5f0087, 0xff5f00af, 0xff5f00d7, 0xff5f00ff, 0xff5f5f00, 0xff5f5f5f, 0xff5f5f87, 0xff5f5faf, 0xff5f5fd7, 0xff5f5fff, 0xff5f8700, 0xff5f875f, 0xff5f8787, 0xff5f87af, 0xff5f87d7, 0xff5f87ff, 0xff5faf00, 0xff5faf5f, 0xff5faf87, 0xff5fafaf, 0xff5fafd7, 0xff5fafff, 0xff5fd700, 0xff5fd75f, 0xff5fd787, 0xff5fd7af, 0xff5fd7d7, 0xff5fd7ff, 0xff5fff00, 0xff5fff5f, 0xff5fff87, 0xff5fffaf, 0xff5fffd7, 0xff5fffff, 0xff870000, 0xff87005f, 0xff870087, 0xff8700af, 0xff8700d7, 0xff8700ff, 0xff875f00, 0xff875f5f, 0xff875f87, 0xff875faf, 0xff875fd7, 0xff875fff, 0xff878700, 0xff87875f, 0xff878787, 0xff8787af, 0xff8787d7, 0xff8787ff, 0xff87af00, 0xff87af5f, 0xff87af87, 0xff87afaf, 0xff87afd7, 0xff87afff, 0xff87d700, 0xff87d75f, 0xff87d787, 0xff87d7af, 0xff87d7d7, 0xff87d7ff, 0xff87ff00, 0xff87ff5f, 0xff87ff87, 0xff87ffaf, 0xff87ffd7, 0xff87ffff, 0xffaf0000, 0xffaf005f, 0xffaf0087, 0xffaf00af, 0xffaf00d7, 0xffaf00ff, 0xffaf5f00, 0xffaf5f5f, 0xffaf5f87, 0xffaf5faf, 0xffaf5fd7, 0xffaf5fff, 0xffaf8700, 0xffaf875f, 0xffaf8787, 0xffaf87af, 0xffaf87d7, 0xffaf87ff, 0xffafaf00, 0xffafaf5f, 0xffafaf87, 0xffafafaf, 0xffafafd7, 0xffafafff, 0xffafd700, 0xffafd75f, 0xffafd787, 0xffafd7af, 0xffafd7d7, 0xffafd7ff, 0xffafff00, 0xffafff5f, 0xffafff87, 0xffafffaf, 0xffafffd7, 0xffafffff, 0xffd70000, 0xffd7005f, 0xffd70087, 0xffd700af, 0xffd700d7, 0xffd700ff, 0xffd75f00, 0xffd75f5f, 0xffd75f87, 0xffd75faf, 0xffd75fd7, 0xffd75fff, 0xffd78700, 0xffd7875f, 0xffd78787, 0xffd787af, 0xffd787d7, 0xffd787ff, 0xffd7af00, 0xffd7af5f, 0xffd7af87, 0xffd7afaf, 0xffd7afd7, 0xffd7afff, 0xffd7d700, 0xffd7d75f, 0xffd7d787, 0xffd7d7af, 0xffd7d7d7, 0xffd7d7ff, 0xffd7ff00, 0xffd7ff5f, 0xffd7ff87, 0xffd7ffaf, 0xffd7ffd7, 0xffd7ffff, 0xffff0000, 0xffff005f, 0xffff0087, 0xffff00af, 0xffff00d7, 0xffff00ff, 0xffff5f00, 0xffff5f5f, 0xffff5f87, 0xffff5faf, 0xffff5fd7, 0xffff5fff, 0xffff8700, 0xffff875f, 0xffff8787, 0xffff87af, 0xffff87d7, 0xffff87ff, 0xffffaf00, 0xffffaf5f, 0xffffaf87, 0xffffafaf, 0xffffafd7, 0xffffafff, 0xffffd700, 0xffffd75f, 0xffffd787, 0xffffd7af, 0xffffd7d7, 0xffffd7ff, 0xffffff00, 0xffffff5f, 0xffffff87, 0xffffffaf, 0xffffffd7, 0xffffffff, 0xff080808, 0xff121212, 0xff1c1c1c, 0xff262626, 0xff303030, 0xff3a3a3a, 0xff444444, 0xff4e4e4e, 0xff585858, 0xff626262, 0xff6c6c6c, 0xff767676, 0xff808080, 0xff8a8a8a, 0xff949494, 0xff9e9e9e, 0xffa8a8a8, 0xffb2b2b2, 0xffbcbcbc, 0xffc6c6c6, 0xffd0d0d0, 0xffdadada, 0xffe4e4e4, 0xffeeeeee, }; }
zzsuper001-linuxshell
src/org/connectbot/util/Colors.java
Java
asf20
4,271
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import android.os.Build; /** * @author Kenny Root * */ public class PreferenceConstants { public static final boolean PRE_ECLAIR = (Integer.parseInt(Build.VERSION.SDK) <= 4); public static final boolean PRE_FROYO = PRE_ECLAIR ? true : (Integer.parseInt(Build.VERSION.SDK) <= 7); public static final String MEMKEYS = "memkeys"; public static final String UPDATE = "update"; public static final String UPDATE_DAILY = "Daily"; public static final String UPDATE_WEEKLY = "Weekly"; public static final String UPDATE_NEVER = "Never"; public static final String LAST_CHECKED = "lastchecked"; public static final String SCROLLBACK = "scrollback"; public static final String EMULATION = "emulation"; public static final String ROTATION = "rotation"; public static final String ROTATION_DEFAULT = "Default"; public static final String ROTATION_LANDSCAPE = "Force landscape"; public static final String ROTATION_PORTRAIT = "Force portrait"; public static final String ROTATION_AUTOMATIC = "Automatic"; public static final String FULLSCREEN = "fullscreen"; public static final String KEYMODE = "keymode"; public static final String KEYMODE_RIGHT = "Use right-side keys"; public static final String KEYMODE_LEFT = "Use left-side keys"; public static final String CAMERA = "camera"; public static final String CAMERA_CTRLA_SPACE = "Ctrl+A then Space"; public static final String CAMERA_CTRLA = "Ctrl+A"; public static final String CAMERA_ESC = "Esc"; public static final String CAMERA_ESC_A = "Esc+A"; public static final String KEEP_ALIVE = "keepalive"; public static final String WIFI_LOCK = "wifilock"; public static final String BUMPY_ARROWS = "bumpyarrows"; public static final String EULA = "eula"; public static final String SORT_BY_COLOR = "sortByColor"; public static final String BELL = "bell"; public static final String BELL_VOLUME = "bellVolume"; public static final String BELL_VIBRATE = "bellVibrate"; public static final String BELL_NOTIFICATION = "bellNotification"; public static final float DEFAULT_BELL_VOLUME = 0.25f; public static final String CONNECTION_PERSIST = "connPersist"; /* Backup identifiers */ public static final String BACKUP_PREF_KEY = "prefs"; }
zzsuper001-linuxshell
src/org/connectbot/util/PreferenceConstants.java
Java
asf20
2,942
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import android.graphics.Paint; import android.text.AndroidCharacter; /** * @author Kenny Root * */ public abstract class EastAsianWidth { public static EastAsianWidth getInstance() { if (PreferenceConstants.PRE_FROYO) return PreFroyo.Holder.sInstance; else return FroyoAndBeyond.Holder.sInstance; } /** * @param charArray * @param i * @param position * @param wideAttribute */ public abstract void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth); private static class PreFroyo extends EastAsianWidth { private static final int BUFFER_SIZE = 4096; private float[] mWidths = new float[BUFFER_SIZE]; private static class Holder { private static final PreFroyo sInstance = new PreFroyo(); } @Override public void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth) { paint.getTextWidths(charArray, start, end, mWidths); final int N = end - start; for (int i = 0; i < N; i++) wideAttribute[i] = (byte) (((int)mWidths[i] != charWidth) ? AndroidCharacter.EAST_ASIAN_WIDTH_WIDE : AndroidCharacter.EAST_ASIAN_WIDTH_NARROW); } } private static class FroyoAndBeyond extends EastAsianWidth { private static class Holder { private static final FroyoAndBeyond sInstance = new FroyoAndBeyond(); } @Override public void measure(char[] charArray, int start, int end, byte[] wideAttribute, Paint paint, int charWidth) { AndroidCharacter.getEastAsianWidths(charArray, start, end - start, wideAttribute); } } }
zzsuper001-linuxshell
src/org/connectbot/util/EastAsianWidth.java
Java
asf20
2,300
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import org.connectbot.HelpActivity; import android.content.Context; import android.util.AttributeSet; import android.webkit.WebSettings; import android.webkit.WebView; /** * @author Kenny Root * */ public class HelpTopicView extends WebView { public HelpTopicView(Context context, AttributeSet attrs, int defStyle) { super(context, attrs, defStyle); initialize(); } public HelpTopicView(Context context, AttributeSet attrs) { super(context, attrs); initialize(); } public HelpTopicView(Context context) { super(context); initialize(); } private void initialize() { WebSettings wSet = getSettings(); wSet.setLayoutAlgorithm(WebSettings.LayoutAlgorithm.NARROW_COLUMNS); wSet.setUseWideViewPort(false); } public HelpTopicView setTopic(String topic) { String path = String.format("file:///android_asset/%s/%s%s", HelpActivity.HELPDIR, topic, HelpActivity.SUFFIX); loadUrl(path); computeScroll(); return this; } }
zzsuper001-linuxshell
src/org/connectbot/util/HelpTopicView.java
Java
asf20
1,670
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2010 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; /** * @author kroot * */ public interface OnDbWrittenListener { public void onDbWritten(); }
zzsuper001-linuxshell
src/org/connectbot/util/OnDbWrittenListener.java
Java
asf20
807
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import com.trilead.ssh2.crypto.Base64; /** * @author Kenny Root * */ public class XmlBuilder { private StringBuilder sb; public XmlBuilder() { sb = new StringBuilder(); } public XmlBuilder append(String data) { sb.append(data); return this; } public XmlBuilder append(String field, Object data) { if (data == null) { sb.append(String.format("<%s/>", field)); } else if (data instanceof String) { String input = (String) data; boolean binary = false; for (byte b : input.getBytes()) { if (b < 0x20 || b > 0x7e) { binary = true; break; } } sb.append(String.format("<%s>%s</%s>", field, binary ? new String(Base64.encode(input.getBytes())) : input, field)); } else if (data instanceof Integer) { sb.append(String.format("<%s>%d</%s>", field, (Integer) data, field)); } else if (data instanceof Long) { sb.append(String.format("<%s>%d</%s>", field, (Long) data, field)); } else if (data instanceof byte[]) { sb.append(String.format("<%s>%s</%s>", field, new String(Base64.encode((byte[]) data)), field)); } else if (data instanceof Boolean) { sb.append(String.format("<%s>%s</%s>", field, (Boolean) data, field)); } return this; } public String toString() { return sb.toString(); } }
zzsuper001-linuxshell
src/org/connectbot/util/XmlBuilder.java
Java
asf20
1,988
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.util.LinkedList; import java.util.List; import org.connectbot.bean.PubkeyBean; import android.content.ContentValues; import android.content.Context; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.database.sqlite.SQLiteException; /** * Public Key Encryption database. Contains private and public key pairs * for public key authentication. * * @author Kenny Root */ public class PubkeyDatabase extends RobustSQLiteOpenHelper { public final static String TAG = "ConnectBot.PubkeyDatabase"; public final static String DB_NAME = "pubkeys"; public final static int DB_VERSION = 2; public final static String TABLE_PUBKEYS = "pubkeys"; public final static String FIELD_PUBKEY_NICKNAME = "nickname"; public final static String FIELD_PUBKEY_TYPE = "type"; public final static String FIELD_PUBKEY_PRIVATE = "private"; public final static String FIELD_PUBKEY_PUBLIC = "public"; public final static String FIELD_PUBKEY_ENCRYPTED = "encrypted"; public final static String FIELD_PUBKEY_STARTUP = "startup"; public final static String FIELD_PUBKEY_CONFIRMUSE = "confirmuse"; public final static String FIELD_PUBKEY_LIFETIME = "lifetime"; public final static String KEY_TYPE_RSA = "RSA", KEY_TYPE_DSA = "DSA", KEY_TYPE_IMPORTED = "IMPORTED"; private Context context; static { addTableName(TABLE_PUBKEYS); } public PubkeyDatabase(Context context) { super(context, DB_NAME, null, DB_VERSION); this.context = context; } @Override public void onCreate(SQLiteDatabase db) { super.onCreate(db); db.execSQL("CREATE TABLE " + TABLE_PUBKEYS + " (_id INTEGER PRIMARY KEY, " + FIELD_PUBKEY_NICKNAME + " TEXT, " + FIELD_PUBKEY_TYPE + " TEXT, " + FIELD_PUBKEY_PRIVATE + " BLOB, " + FIELD_PUBKEY_PUBLIC + " BLOB, " + FIELD_PUBKEY_ENCRYPTED + " INTEGER, " + FIELD_PUBKEY_STARTUP + " INTEGER, " + FIELD_PUBKEY_CONFIRMUSE + " INTEGER DEFAULT 0, " + FIELD_PUBKEY_LIFETIME + " INTEGER DEFAULT 0)"); } @Override public void onRobustUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) throws SQLiteException { switch (oldVersion) { case 1: db.execSQL("ALTER TABLE " + TABLE_PUBKEYS + " ADD COLUMN " + FIELD_PUBKEY_CONFIRMUSE + " INTEGER DEFAULT 0"); db.execSQL("ALTER TABLE " + TABLE_PUBKEYS + " ADD COLUMN " + FIELD_PUBKEY_LIFETIME + " INTEGER DEFAULT 0"); } } /** * Delete a specific host by its <code>_id</code> value. */ public void deletePubkey(PubkeyBean pubkey) { HostDatabase hostdb = new HostDatabase(context); hostdb.stopUsingPubkey(pubkey.getId()); hostdb.close(); SQLiteDatabase db = getWritableDatabase(); db.delete(TABLE_PUBKEYS, "_id = ?", new String[] { Long.toString(pubkey.getId()) }); db.close(); } /** * Return a cursor that contains information about all known hosts. */ /* public Cursor allPubkeys() { SQLiteDatabase db = this.getReadableDatabase(); return db.query(TABLE_PUBKEYS, new String[] { "_id", FIELD_PUBKEY_NICKNAME, FIELD_PUBKEY_TYPE, FIELD_PUBKEY_PRIVATE, FIELD_PUBKEY_PUBLIC, FIELD_PUBKEY_ENCRYPTED, FIELD_PUBKEY_STARTUP }, null, null, null, null, null); }*/ public List<PubkeyBean> allPubkeys() { return getPubkeys(null, null); } public List<PubkeyBean> getAllStartPubkeys() { return getPubkeys(FIELD_PUBKEY_STARTUP + " = 1 AND " + FIELD_PUBKEY_ENCRYPTED + " = 0", null); } private List<PubkeyBean> getPubkeys(String selection, String[] selectionArgs) { SQLiteDatabase db = getReadableDatabase(); List<PubkeyBean> pubkeys = new LinkedList<PubkeyBean>(); Cursor c = db.query(TABLE_PUBKEYS, null, selection, selectionArgs, null, null, null); if (c != null) { final int COL_ID = c.getColumnIndexOrThrow("_id"), COL_NICKNAME = c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME), COL_TYPE = c.getColumnIndexOrThrow(FIELD_PUBKEY_TYPE), COL_PRIVATE = c.getColumnIndexOrThrow(FIELD_PUBKEY_PRIVATE), COL_PUBLIC = c.getColumnIndexOrThrow(FIELD_PUBKEY_PUBLIC), COL_ENCRYPTED = c.getColumnIndexOrThrow(FIELD_PUBKEY_ENCRYPTED), COL_STARTUP = c.getColumnIndexOrThrow(FIELD_PUBKEY_STARTUP), COL_CONFIRMUSE = c.getColumnIndexOrThrow(FIELD_PUBKEY_CONFIRMUSE), COL_LIFETIME = c.getColumnIndexOrThrow(FIELD_PUBKEY_LIFETIME); while (c.moveToNext()) { PubkeyBean pubkey = new PubkeyBean(); pubkey.setId(c.getLong(COL_ID)); pubkey.setNickname(c.getString(COL_NICKNAME)); pubkey.setType(c.getString(COL_TYPE)); pubkey.setPrivateKey(c.getBlob(COL_PRIVATE)); pubkey.setPublicKey(c.getBlob(COL_PUBLIC)); pubkey.setEncrypted(c.getInt(COL_ENCRYPTED) > 0); pubkey.setStartup(c.getInt(COL_STARTUP) > 0); pubkey.setConfirmUse(c.getInt(COL_CONFIRMUSE) > 0); pubkey.setLifetime(c.getInt(COL_LIFETIME)); pubkeys.add(pubkey); } c.close(); } db.close(); return pubkeys; } /** * @param hostId * @return */ public PubkeyBean findPubkeyById(long pubkeyId) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, null, "_id = ?", new String[] { String.valueOf(pubkeyId) }, null, null, null); PubkeyBean pubkey = null; if (c != null) { if (c.moveToFirst()) pubkey = createPubkeyBean(c); c.close(); } db.close(); return pubkey; } private PubkeyBean createPubkeyBean(Cursor c) { PubkeyBean pubkey = new PubkeyBean(); pubkey.setId(c.getLong(c.getColumnIndexOrThrow("_id"))); pubkey.setNickname(c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME))); pubkey.setType(c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_TYPE))); pubkey.setPrivateKey(c.getBlob(c.getColumnIndexOrThrow(FIELD_PUBKEY_PRIVATE))); pubkey.setPublicKey(c.getBlob(c.getColumnIndexOrThrow(FIELD_PUBKEY_PUBLIC))); pubkey.setEncrypted(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_ENCRYPTED)) > 0); pubkey.setStartup(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_STARTUP)) > 0); pubkey.setConfirmUse(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_CONFIRMUSE)) > 0); pubkey.setLifetime(c.getInt(c.getColumnIndexOrThrow(FIELD_PUBKEY_LIFETIME))); return pubkey; } /** * Pull all values for a given column as a list of Strings, probably for use * in a ListPreference. Sorted by <code>_id</code> ascending. */ public List<CharSequence> allValues(String column) { List<CharSequence> list = new LinkedList<CharSequence>(); SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { "_id", column }, null, null, null, null, "_id ASC"); if (c != null) { int COL = c.getColumnIndexOrThrow(column); while (c.moveToNext()) list.add(c.getString(COL)); c.close(); } db.close(); return list; } public String getNickname(long id) { String nickname = null; SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { "_id", FIELD_PUBKEY_NICKNAME }, "_id = ?", new String[] { Long.toString(id) }, null, null, null); if (c != null) { if (c.moveToFirst()) nickname = c.getString(c.getColumnIndexOrThrow(FIELD_PUBKEY_NICKNAME)); c.close(); } db.close(); return nickname; } /* public void setOnStart(long id, boolean onStart) { SQLiteDatabase db = this.getWritableDatabase(); ContentValues values = new ContentValues(); values.put(FIELD_PUBKEY_STARTUP, onStart ? 1 : 0); db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { Long.toString(id) }); } public boolean changePassword(long id, String oldPassword, String newPassword) throws NoSuchAlgorithmException, NoSuchPaddingException, IllegalBlockSizeException, InvalidKeyException, BadPaddingException { SQLiteDatabase db = this.getWritableDatabase(); Cursor c = db.query(TABLE_PUBKEYS, new String[] { FIELD_PUBKEY_TYPE, FIELD_PUBKEY_PRIVATE, FIELD_PUBKEY_ENCRYPTED }, "_id = ?", new String[] { String.valueOf(id) }, null, null, null); if (!c.moveToFirst()) return false; String keyType = c.getString(0); byte[] encPriv = c.getBlob(1); c.close(); PrivateKey priv; try { priv = PubkeyUtils.decodePrivate(encPriv, keyType, oldPassword); } catch (InvalidKeyException e) { return false; } catch (BadPaddingException e) { return false; } catch (InvalidKeySpecException e) { return false; } ContentValues values = new ContentValues(); values.put(FIELD_PUBKEY_PRIVATE, PubkeyUtils.getEncodedPrivate(priv, newPassword)); values.put(FIELD_PUBKEY_ENCRYPTED, newPassword.length() > 0 ? 1 : 0); db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { String.valueOf(id) }); return true; } */ /** * @param pubkey */ public PubkeyBean savePubkey(PubkeyBean pubkey) { SQLiteDatabase db = this.getWritableDatabase(); boolean success = false; ContentValues values = pubkey.getValues(); if (pubkey.getId() > 0) { values.remove("_id"); if (db.update(TABLE_PUBKEYS, values, "_id = ?", new String[] { String.valueOf(pubkey.getId()) }) > 0) success = true; } if (!success) { long id = db.insert(TABLE_PUBKEYS, null, pubkey.getValues()); pubkey.setId(id); } db.close(); return pubkey; } }
zzsuper001-linuxshell
src/org/connectbot/util/PubkeyDatabase.java
Java
asf20
9,887
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import org.connectbot.R; import android.app.Dialog; import android.content.Context; import android.view.View; public class EntropyDialog extends Dialog implements OnEntropyGatheredListener { public EntropyDialog(Context context) { super(context); this.setContentView(R.layout.dia_gatherentropy); this.setTitle(R.string.pubkey_gather_entropy); ((EntropyView) findViewById(R.id.entropy)).addOnEntropyGatheredListener(this); } public EntropyDialog(Context context, View view) { super(context); this.setContentView(view); this.setTitle(R.string.pubkey_gather_entropy); ((EntropyView) findViewById(R.id.entropy)).addOnEntropyGatheredListener(this); } public void onEntropyGathered(byte[] entropy) { this.dismiss(); } }
zzsuper001-linuxshell
src/org/connectbot/util/EntropyDialog.java
Java
asf20
1,458
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.io.IOException; import java.math.BigInteger; import java.security.AlgorithmParameters; import java.security.InvalidAlgorithmParameterException; import java.security.InvalidKeyException; import java.security.Key; import java.security.KeyFactory; import java.security.KeyPair; import java.security.MessageDigest; import java.security.NoSuchAlgorithmException; import java.security.PrivateKey; import java.security.PublicKey; import java.security.SecureRandom; import java.security.interfaces.DSAParams; import java.security.interfaces.DSAPrivateKey; import java.security.interfaces.DSAPublicKey; import java.security.interfaces.RSAPrivateCrtKey; import java.security.interfaces.RSAPrivateKey; import java.security.interfaces.RSAPublicKey; import java.security.spec.DSAPublicKeySpec; import java.security.spec.InvalidKeySpecException; import java.security.spec.InvalidParameterSpecException; import java.security.spec.KeySpec; import java.security.spec.PKCS8EncodedKeySpec; import java.security.spec.RSAPublicKeySpec; import java.security.spec.X509EncodedKeySpec; import java.util.Arrays; import javax.crypto.BadPaddingException; import javax.crypto.Cipher; import javax.crypto.EncryptedPrivateKeyInfo; import javax.crypto.IllegalBlockSizeException; import javax.crypto.NoSuchPaddingException; import javax.crypto.SecretKeyFactory; import javax.crypto.spec.PBEKeySpec; import javax.crypto.spec.PBEParameterSpec; import javax.crypto.spec.SecretKeySpec; import android.util.Log; import com.trilead.ssh2.crypto.Base64; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.RSASHA1Verify; public class PubkeyUtils { public static final String PKCS8_START = "-----BEGIN PRIVATE KEY-----"; public static final String PKCS8_END = "-----END PRIVATE KEY-----"; // Size in bytes of salt to use. private static final int SALT_SIZE = 8; // Number of iterations for password hashing. PKCS#5 recommends 1000 private static final int ITERATIONS = 1000; public static String formatKey(Key key){ String algo = key.getAlgorithm(); String fmt = key.getFormat(); byte[] encoded = key.getEncoded(); return "Key[algorithm=" + algo + ", format=" + fmt + ", bytes=" + encoded.length + "]"; } public static byte[] sha256(byte[] data) throws NoSuchAlgorithmException { return MessageDigest.getInstance("SHA-256").digest(data); } public static byte[] cipher(int mode, byte[] data, byte[] secret) throws NoSuchAlgorithmException, NoSuchPaddingException, InvalidKeyException, IllegalBlockSizeException, BadPaddingException { SecretKeySpec secretKeySpec = new SecretKeySpec(sha256(secret), "AES"); Cipher c = Cipher.getInstance("AES"); c.init(mode, secretKeySpec); return c.doFinal(data); } public static byte[] encrypt(byte[] cleartext, String secret) throws Exception { byte[] salt = new byte[SALT_SIZE]; byte[] ciphertext = Encryptor.encrypt(salt, ITERATIONS, secret, cleartext); byte[] complete = new byte[salt.length + ciphertext.length]; System.arraycopy(salt, 0, complete, 0, salt.length); System.arraycopy(ciphertext, 0, complete, salt.length, ciphertext.length); Arrays.fill(salt, (byte) 0x00); Arrays.fill(ciphertext, (byte) 0x00); return complete; } public static byte[] decrypt(byte[] complete, String secret) throws Exception { try { byte[] salt = new byte[SALT_SIZE]; byte[] ciphertext = new byte[complete.length - salt.length]; System.arraycopy(complete, 0, salt, 0, salt.length); System.arraycopy(complete, salt.length, ciphertext, 0, ciphertext.length); return Encryptor.decrypt(salt, ITERATIONS, secret, ciphertext); } catch (Exception e) { Log.d("decrypt", "Could not decrypt with new method", e); // We might be using the old encryption method. return cipher(Cipher.DECRYPT_MODE, complete, secret.getBytes()); } } public static byte[] getEncodedPublic(PublicKey pk) { return new X509EncodedKeySpec(pk.getEncoded()).getEncoded(); } public static byte[] getEncodedPrivate(PrivateKey pk) { return new PKCS8EncodedKeySpec(pk.getEncoded()).getEncoded(); } public static byte[] getEncodedPrivate(PrivateKey pk, String secret) throws Exception { if (secret.length() > 0) return encrypt(getEncodedPrivate(pk), secret); else return getEncodedPrivate(pk); } public static PrivateKey decodePrivate(byte[] encoded, String keyType) throws NoSuchAlgorithmException, InvalidKeySpecException { PKCS8EncodedKeySpec privKeySpec = new PKCS8EncodedKeySpec(encoded); KeyFactory kf = KeyFactory.getInstance(keyType); return kf.generatePrivate(privKeySpec); } public static PrivateKey decodePrivate(byte[] encoded, String keyType, String secret) throws Exception { if (secret != null && secret.length() > 0) return decodePrivate(decrypt(encoded, secret), keyType); else return decodePrivate(encoded, keyType); } public static PublicKey decodePublic(byte[] encoded, String keyType) throws NoSuchAlgorithmException, InvalidKeySpecException { X509EncodedKeySpec pubKeySpec = new X509EncodedKeySpec(encoded); KeyFactory kf = KeyFactory.getInstance(keyType); return kf.generatePublic(pubKeySpec); } public static KeyPair recoverKeyPair(byte[] encoded) throws NoSuchAlgorithmException, InvalidKeySpecException { KeySpec privKeySpec = new PKCS8EncodedKeySpec(encoded); KeySpec pubKeySpec; PrivateKey priv; PublicKey pub; KeyFactory kf; try { kf = KeyFactory.getInstance(PubkeyDatabase.KEY_TYPE_RSA); priv = kf.generatePrivate(privKeySpec); pubKeySpec = new RSAPublicKeySpec(((RSAPrivateCrtKey) priv) .getModulus(), ((RSAPrivateCrtKey) priv) .getPublicExponent()); pub = kf.generatePublic(pubKeySpec); } catch (ClassCastException e) { kf = KeyFactory.getInstance(PubkeyDatabase.KEY_TYPE_DSA); priv = kf.generatePrivate(privKeySpec); DSAParams params = ((DSAPrivateKey) priv).getParams(); // Calculate public key Y BigInteger y = params.getG().modPow(((DSAPrivateKey) priv).getX(), params.getP()); pubKeySpec = new DSAPublicKeySpec(y, params.getP(), params.getQ(), params.getG()); pub = kf.generatePublic(pubKeySpec); } return new KeyPair(pub, priv); } /* * Trilead compatibility methods */ public static Object convertToTrilead(PublicKey pk) { if (pk instanceof RSAPublicKey) { return new com.trilead.ssh2.signature.RSAPublicKey( ((RSAPublicKey) pk).getPublicExponent(), ((RSAPublicKey) pk).getModulus()); } else if (pk instanceof DSAPublicKey) { DSAParams dp = ((DSAPublicKey) pk).getParams(); return new com.trilead.ssh2.signature.DSAPublicKey( dp.getP(), dp.getQ(), dp.getG(), ((DSAPublicKey) pk).getY()); } throw new IllegalArgumentException("PublicKey is not RSA or DSA format"); } public static Object convertToTrilead(PrivateKey priv, PublicKey pub) { if (priv instanceof RSAPrivateKey) { return new com.trilead.ssh2.signature.RSAPrivateKey( ((RSAPrivateKey) priv).getPrivateExponent(), ((RSAPublicKey) pub).getPublicExponent(), ((RSAPrivateKey) priv).getModulus()); } else if (priv instanceof DSAPrivateKey) { DSAParams dp = ((DSAPrivateKey) priv).getParams(); return new com.trilead.ssh2.signature.DSAPrivateKey( dp.getP(), dp.getQ(), dp.getG(), ((DSAPublicKey) pub).getY(), ((DSAPrivateKey) priv).getX()); } throw new IllegalArgumentException("Key is not RSA or DSA format"); } /* * OpenSSH compatibility methods */ public static String convertToOpenSSHFormat(PublicKey pk, String origNickname) throws IOException, InvalidKeyException { String nickname = origNickname; if (nickname == null) nickname = "connectbot@android"; if (pk instanceof RSAPublicKey) { String data = "ssh-rsa "; data += String.valueOf(Base64.encode(RSASHA1Verify.encodeSSHRSAPublicKey( (com.trilead.ssh2.signature.RSAPublicKey)convertToTrilead(pk)))); return data + " " + nickname; } else if (pk instanceof DSAPublicKey) { String data = "ssh-dss "; data += String.valueOf(Base64.encode(DSASHA1Verify.encodeSSHDSAPublicKey( (com.trilead.ssh2.signature.DSAPublicKey)convertToTrilead(pk)))); return data + " " + nickname; } throw new InvalidKeyException("Unknown key type"); } /* * OpenSSH compatibility methods */ /** * @param trileadKey * @return OpenSSH-encoded pubkey */ public static byte[] extractOpenSSHPublic(Object trileadKey) { try { if (trileadKey instanceof com.trilead.ssh2.signature.RSAPrivateKey) return RSASHA1Verify.encodeSSHRSAPublicKey( ((com.trilead.ssh2.signature.RSAPrivateKey) trileadKey).getPublicKey()); else if (trileadKey instanceof com.trilead.ssh2.signature.DSAPrivateKey) return DSASHA1Verify.encodeSSHDSAPublicKey( ((com.trilead.ssh2.signature.DSAPrivateKey) trileadKey).getPublicKey()); else return null; } catch (IOException e) { return null; } } public static String exportPEM(PrivateKey key, String secret) throws NoSuchAlgorithmException, InvalidParameterSpecException, NoSuchPaddingException, InvalidKeyException, InvalidAlgorithmParameterException, InvalidKeySpecException, IllegalBlockSizeException, IOException { StringBuilder sb = new StringBuilder(); byte[] data = key.getEncoded(); sb.append(PKCS8_START); sb.append('\n'); if (secret != null) { byte[] salt = new byte[8]; SecureRandom random = new SecureRandom(); random.nextBytes(salt); PBEParameterSpec defParams = new PBEParameterSpec(salt, 1); AlgorithmParameters params = AlgorithmParameters.getInstance(key.getAlgorithm()); params.init(defParams); PBEKeySpec pbeSpec = new PBEKeySpec(secret.toCharArray()); SecretKeyFactory keyFact = SecretKeyFactory.getInstance(key.getAlgorithm()); Cipher cipher = Cipher.getInstance(key.getAlgorithm()); cipher.init(Cipher.WRAP_MODE, keyFact.generateSecret(pbeSpec), params); byte[] wrappedKey = cipher.wrap(key); EncryptedPrivateKeyInfo pinfo = new EncryptedPrivateKeyInfo(params, wrappedKey); data = pinfo.getEncoded(); sb.append("Proc-Type: 4,ENCRYPTED\n"); sb.append("DEK-Info: DES-EDE3-CBC,"); sb.append(encodeHex(salt)); sb.append("\n\n"); } int i = sb.length(); sb.append(Base64.encode(data)); for (i += 63; i < sb.length(); i += 64) { sb.insert(i, "\n"); } sb.append('\n'); sb.append(PKCS8_END); sb.append('\n'); return sb.toString(); } private static final char[] HEX_DIGITS = { '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', 'a', 'b', 'c', 'd', 'e', 'f' }; protected static String encodeHex(byte[] bytes) { final char[] hex = new char[bytes.length * 2]; int i = 0; for (byte b : bytes) { hex[i++] = HEX_DIGITS[(b >> 4) & 0x0f]; hex[i++] = HEX_DIGITS[b & 0x0f]; } return String.valueOf(hex); } }
zzsuper001-linuxshell
src/org/connectbot/util/PubkeyUtils.java
Java
asf20
11,493
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import java.nio.charset.Charset; import java.util.Iterator; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Map.Entry; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import android.content.ContentValues; import android.content.Context; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.database.sqlite.SQLiteException; import android.util.Log; import com.trilead.ssh2.KnownHosts; /** * Contains information about various SSH hosts, include public hostkey if known * from previous sessions. * * @author jsharkey */ public class HostDatabase extends RobustSQLiteOpenHelper { public final static String TAG = "ConnectBot.HostDatabase"; public final static String DB_NAME = "hosts"; public final static int DB_VERSION = 22; public final static String TABLE_HOSTS = "hosts"; public final static String FIELD_HOST_NICKNAME = "nickname"; public final static String FIELD_HOST_PROTOCOL = "protocol"; public final static String FIELD_HOST_USERNAME = "username"; public final static String FIELD_HOST_HOSTNAME = "hostname"; public final static String FIELD_HOST_PORT = "port"; public final static String FIELD_HOST_HOSTKEYALGO = "hostkeyalgo"; public final static String FIELD_HOST_HOSTKEY = "hostkey"; public final static String FIELD_HOST_LASTCONNECT = "lastconnect"; public final static String FIELD_HOST_COLOR = "color"; public final static String FIELD_HOST_USEKEYS = "usekeys"; public final static String FIELD_HOST_USEAUTHAGENT = "useauthagent"; public final static String FIELD_HOST_POSTLOGIN = "postlogin"; public final static String FIELD_HOST_PUBKEYID = "pubkeyid"; public final static String FIELD_HOST_WANTSESSION = "wantsession"; public final static String FIELD_HOST_DELKEY = "delkey"; public final static String FIELD_HOST_FONTSIZE = "fontsize"; public final static String FIELD_HOST_COMPRESSION = "compression"; public final static String FIELD_HOST_ENCODING = "encoding"; public final static String FIELD_HOST_STAYCONNECTED = "stayconnected"; public final static String TABLE_PORTFORWARDS = "portforwards"; public final static String FIELD_PORTFORWARD_HOSTID = "hostid"; public final static String FIELD_PORTFORWARD_NICKNAME = "nickname"; public final static String FIELD_PORTFORWARD_TYPE = "type"; public final static String FIELD_PORTFORWARD_SOURCEPORT = "sourceport"; public final static String FIELD_PORTFORWARD_DESTADDR = "destaddr"; public final static String FIELD_PORTFORWARD_DESTPORT = "destport"; public final static String TABLE_COLORS = "colors"; public final static String FIELD_COLOR_SCHEME = "scheme"; public final static String FIELD_COLOR_NUMBER = "number"; public final static String FIELD_COLOR_VALUE = "value"; public final static String TABLE_COLOR_DEFAULTS = "colorDefaults"; public final static String FIELD_COLOR_FG = "fg"; public final static String FIELD_COLOR_BG = "bg"; public final static int DEFAULT_FG_COLOR = 7; public final static int DEFAULT_BG_COLOR = 0; public final static String COLOR_RED = "red"; public final static String COLOR_GREEN = "green"; public final static String COLOR_BLUE = "blue"; public final static String COLOR_GRAY = "gray"; public final static String PORTFORWARD_LOCAL = "local"; public final static String PORTFORWARD_REMOTE = "remote"; public final static String PORTFORWARD_DYNAMIC4 = "dynamic4"; public final static String PORTFORWARD_DYNAMIC5 = "dynamic5"; public final static String DELKEY_DEL = "del"; public final static String DELKEY_BACKSPACE = "backspace"; public final static String AUTHAGENT_NO = "no"; public final static String AUTHAGENT_CONFIRM = "confirm"; public final static String AUTHAGENT_YES = "yes"; public final static String ENCODING_DEFAULT = Charset.defaultCharset().name(); public final static long PUBKEYID_NEVER = -2; public final static long PUBKEYID_ANY = -1; public static final int DEFAULT_COLOR_SCHEME = 0; // Table creation strings public static final String CREATE_TABLE_COLOR_DEFAULTS = "CREATE TABLE " + TABLE_COLOR_DEFAULTS + " (" + FIELD_COLOR_SCHEME + " INTEGER NOT NULL, " + FIELD_COLOR_FG + " INTEGER NOT NULL DEFAULT " + DEFAULT_FG_COLOR + ", " + FIELD_COLOR_BG + " INTEGER NOT NULL DEFAULT " + DEFAULT_BG_COLOR + ")"; public static final String CREATE_TABLE_COLOR_DEFAULTS_INDEX = "CREATE INDEX " + TABLE_COLOR_DEFAULTS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLOR_DEFAULTS + " (" + FIELD_COLOR_SCHEME + ");"; private static final String WHERE_SCHEME_AND_COLOR = FIELD_COLOR_SCHEME + " = ? AND " + FIELD_COLOR_NUMBER + " = ?"; static { addTableName(TABLE_HOSTS); addTableName(TABLE_PORTFORWARDS); addIndexName(TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index"); addTableName(TABLE_COLORS); addIndexName(TABLE_COLORS + FIELD_COLOR_SCHEME + "index"); addTableName(TABLE_COLOR_DEFAULTS); addIndexName(TABLE_COLOR_DEFAULTS + FIELD_COLOR_SCHEME + "index"); } public static final Object[] dbLock = new Object[0]; public HostDatabase(Context context) { super(context, DB_NAME, null, DB_VERSION); getWritableDatabase().close(); } @Override public void onCreate(SQLiteDatabase db) { super.onCreate(db); db.execSQL("CREATE TABLE " + TABLE_HOSTS + " (_id INTEGER PRIMARY KEY, " + FIELD_HOST_NICKNAME + " TEXT, " + FIELD_HOST_PROTOCOL + " TEXT DEFAULT 'ssh', " + FIELD_HOST_USERNAME + " TEXT, " + FIELD_HOST_HOSTNAME + " TEXT, " + FIELD_HOST_PORT + " INTEGER, " + FIELD_HOST_HOSTKEYALGO + " TEXT, " + FIELD_HOST_HOSTKEY + " BLOB, " + FIELD_HOST_LASTCONNECT + " INTEGER, " + FIELD_HOST_COLOR + " TEXT, " + FIELD_HOST_USEKEYS + " TEXT, " + FIELD_HOST_USEAUTHAGENT + " TEXT, " + FIELD_HOST_POSTLOGIN + " TEXT, " + FIELD_HOST_PUBKEYID + " INTEGER DEFAULT " + PUBKEYID_ANY + ", " + FIELD_HOST_DELKEY + " TEXT DEFAULT '" + DELKEY_DEL + "', " + FIELD_HOST_FONTSIZE + " INTEGER, " + FIELD_HOST_WANTSESSION + " TEXT DEFAULT '" + Boolean.toString(true) + "', " + FIELD_HOST_COMPRESSION + " TEXT DEFAULT '" + Boolean.toString(false) + "', " + FIELD_HOST_ENCODING + " TEXT DEFAULT '" + ENCODING_DEFAULT + "', " + FIELD_HOST_STAYCONNECTED + " TEXT)"); db.execSQL("CREATE TABLE " + TABLE_PORTFORWARDS + " (_id INTEGER PRIMARY KEY, " + FIELD_PORTFORWARD_HOSTID + " INTEGER, " + FIELD_PORTFORWARD_NICKNAME + " TEXT, " + FIELD_PORTFORWARD_TYPE + " TEXT NOT NULL DEFAULT " + PORTFORWARD_LOCAL + ", " + FIELD_PORTFORWARD_SOURCEPORT + " INTEGER NOT NULL DEFAULT 8080, " + FIELD_PORTFORWARD_DESTADDR + " TEXT, " + FIELD_PORTFORWARD_DESTPORT + " TEXT)"); db.execSQL("CREATE INDEX " + TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index ON " + TABLE_PORTFORWARDS + " (" + FIELD_PORTFORWARD_HOSTID + ");"); db.execSQL("CREATE TABLE " + TABLE_COLORS + " (_id INTEGER PRIMARY KEY, " + FIELD_COLOR_NUMBER + " INTEGER, " + FIELD_COLOR_VALUE + " INTEGER, " + FIELD_COLOR_SCHEME + " INTEGER)"); db.execSQL("CREATE INDEX " + TABLE_COLORS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLORS + " (" + FIELD_COLOR_SCHEME + ");"); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS_INDEX); } @Override public void onRobustUpgrade(SQLiteDatabase db, int oldVersion, int newVersion) throws SQLiteException { // Versions of the database before the Android Market release will be // shot without warning. if (oldVersion <= 9) { db.execSQL("DROP TABLE IF EXISTS " + TABLE_HOSTS); onCreate(db); return; } switch (oldVersion) { case 10: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_PUBKEYID + " INTEGER DEFAULT " + PUBKEYID_ANY); case 11: db.execSQL("CREATE TABLE " + TABLE_PORTFORWARDS + " (_id INTEGER PRIMARY KEY, " + FIELD_PORTFORWARD_HOSTID + " INTEGER, " + FIELD_PORTFORWARD_NICKNAME + " TEXT, " + FIELD_PORTFORWARD_TYPE + " TEXT NOT NULL DEFAULT " + PORTFORWARD_LOCAL + ", " + FIELD_PORTFORWARD_SOURCEPORT + " INTEGER NOT NULL DEFAULT 8080, " + FIELD_PORTFORWARD_DESTADDR + " TEXT, " + FIELD_PORTFORWARD_DESTPORT + " INTEGER)"); case 12: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_WANTSESSION + " TEXT DEFAULT '" + Boolean.toString(true) + "'"); case 13: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_COMPRESSION + " TEXT DEFAULT '" + Boolean.toString(false) + "'"); case 14: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_ENCODING + " TEXT DEFAULT '" + ENCODING_DEFAULT + "'"); case 15: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_PROTOCOL + " TEXT DEFAULT 'ssh'"); case 16: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_DELKEY + " TEXT DEFAULT '" + DELKEY_DEL + "'"); case 17: db.execSQL("CREATE INDEX " + TABLE_PORTFORWARDS + FIELD_PORTFORWARD_HOSTID + "index ON " + TABLE_PORTFORWARDS + " (" + FIELD_PORTFORWARD_HOSTID + ");"); // Add colors db.execSQL("CREATE TABLE " + TABLE_COLORS + " (_id INTEGER PRIMARY KEY, " + FIELD_COLOR_NUMBER + " INTEGER, " + FIELD_COLOR_VALUE + " INTEGER, " + FIELD_COLOR_SCHEME + " INTEGER)"); db.execSQL("CREATE INDEX " + TABLE_COLORS + FIELD_COLOR_SCHEME + "index ON " + TABLE_COLORS + " (" + FIELD_COLOR_SCHEME + ");"); case 18: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_USEAUTHAGENT + " TEXT DEFAULT '" + AUTHAGENT_NO + "'"); case 19: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_STAYCONNECTED + " TEXT"); case 20: db.execSQL("ALTER TABLE " + TABLE_HOSTS + " ADD COLUMN " + FIELD_HOST_FONTSIZE + " INTEGER"); case 21: db.execSQL("DROP TABLE " + TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS); db.execSQL(CREATE_TABLE_COLOR_DEFAULTS_INDEX); } } /** * Touch a specific host to update its "last connected" field. * @param nickname Nickname field of host to update */ public void touchHost(HostBean host) { long now = System.currentTimeMillis() / 1000; ContentValues values = new ContentValues(); values.put(FIELD_HOST_LASTCONNECT, now); synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.update(TABLE_HOSTS, values, "_id = ?", new String[] { String.valueOf(host.getId()) }); } } /** * Create a new host using the given parameters. */ public HostBean saveHost(HostBean host) { long id; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); id = db.insert(TABLE_HOSTS, null, host.getValues()); } host.setId(id); return host; } /** * Update a field in a host record. */ public boolean updateFontSize(HostBean host) { long id = host.getId(); if (id < 0) return false; ContentValues updates = new ContentValues(); updates.put(FIELD_HOST_FONTSIZE, host.getFontSize()); synchronized (dbLock) { SQLiteDatabase db = getWritableDatabase(); db.update(TABLE_HOSTS, updates, "_id = ?", new String[] { String.valueOf(id) }); } return true; } /** * Delete a specific host by its <code>_id</code> value. */ public void deleteHost(HostBean host) { if (host.getId() < 0) return; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.delete(TABLE_HOSTS, "_id = ?", new String[] { String.valueOf(host.getId()) }); } } /** * Return a cursor that contains information about all known hosts. * @param sortColors If true, sort by color, otherwise sort by nickname. */ public List<HostBean> getHosts(boolean sortColors) { String sortField = sortColors ? FIELD_HOST_COLOR : FIELD_HOST_NICKNAME; List<HostBean> hosts; synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, null, null, null, null, sortField + " ASC"); hosts = createHostBeans(c); c.close(); } return hosts; } /** * @param hosts * @param c */ private List<HostBean> createHostBeans(Cursor c) { List<HostBean> hosts = new LinkedList<HostBean>(); final int COL_ID = c.getColumnIndexOrThrow("_id"), COL_NICKNAME = c.getColumnIndexOrThrow(FIELD_HOST_NICKNAME), COL_PROTOCOL = c.getColumnIndexOrThrow(FIELD_HOST_PROTOCOL), COL_USERNAME = c.getColumnIndexOrThrow(FIELD_HOST_USERNAME), COL_HOSTNAME = c.getColumnIndexOrThrow(FIELD_HOST_HOSTNAME), COL_PORT = c.getColumnIndexOrThrow(FIELD_HOST_PORT), COL_LASTCONNECT = c.getColumnIndexOrThrow(FIELD_HOST_LASTCONNECT), COL_COLOR = c.getColumnIndexOrThrow(FIELD_HOST_COLOR), COL_USEKEYS = c.getColumnIndexOrThrow(FIELD_HOST_USEKEYS), COL_USEAUTHAGENT = c.getColumnIndexOrThrow(FIELD_HOST_USEAUTHAGENT), COL_POSTLOGIN = c.getColumnIndexOrThrow(FIELD_HOST_POSTLOGIN), COL_PUBKEYID = c.getColumnIndexOrThrow(FIELD_HOST_PUBKEYID), COL_WANTSESSION = c.getColumnIndexOrThrow(FIELD_HOST_WANTSESSION), COL_DELKEY = c.getColumnIndexOrThrow(FIELD_HOST_DELKEY), COL_FONTSIZE = c.getColumnIndexOrThrow(FIELD_HOST_FONTSIZE), COL_COMPRESSION = c.getColumnIndexOrThrow(FIELD_HOST_COMPRESSION), COL_ENCODING = c.getColumnIndexOrThrow(FIELD_HOST_ENCODING), COL_STAYCONNECTED = c.getColumnIndexOrThrow(FIELD_HOST_STAYCONNECTED); while (c.moveToNext()) { HostBean host = new HostBean(); host.setId(c.getLong(COL_ID)); host.setNickname(c.getString(COL_NICKNAME)); host.setProtocol(c.getString(COL_PROTOCOL)); host.setUsername(c.getString(COL_USERNAME)); host.setHostname(c.getString(COL_HOSTNAME)); host.setPort(c.getInt(COL_PORT)); host.setLastConnect(c.getLong(COL_LASTCONNECT)); host.setColor(c.getString(COL_COLOR)); host.setUseKeys(Boolean.valueOf(c.getString(COL_USEKEYS))); host.setUseAuthAgent(c.getString(COL_USEAUTHAGENT)); host.setPostLogin(c.getString(COL_POSTLOGIN)); host.setPubkeyId(c.getLong(COL_PUBKEYID)); host.setWantSession(Boolean.valueOf(c.getString(COL_WANTSESSION))); host.setDelKey(c.getString(COL_DELKEY)); host.setFontSize(c.getInt(COL_FONTSIZE)); host.setCompression(Boolean.valueOf(c.getString(COL_COMPRESSION))); host.setEncoding(c.getString(COL_ENCODING)); host.setStayConnected(Boolean.valueOf(c.getString(COL_STAYCONNECTED))); hosts.add(host); } return hosts; } /** * @param c * @return */ private HostBean getFirstHostBean(Cursor c) { HostBean host = null; List<HostBean> hosts = createHostBeans(c); if (hosts.size() > 0) host = hosts.get(0); c.close(); return host; } /** * @param nickname * @param protocol * @param username * @param hostname * @param hostname2 * @param port * @return */ public HostBean findHost(Map<String, String> selection) { StringBuilder selectionBuilder = new StringBuilder(); Iterator<Entry<String, String>> i = selection.entrySet().iterator(); List<String> selectionValuesList = new LinkedList<String>(); int n = 0; while (i.hasNext()) { Entry<String, String> entry = i.next(); if (entry.getValue() == null) continue; if (n++ > 0) selectionBuilder.append(" AND "); selectionBuilder.append(entry.getKey()) .append(" = ?"); selectionValuesList.add(entry.getValue()); } String selectionValues[] = new String[selectionValuesList.size()]; selectionValuesList.toArray(selectionValues); selectionValuesList = null; HostBean host; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, selectionBuilder.toString(), selectionValues, null, null, null); host = getFirstHostBean(c); } return host; } /** * @param hostId * @return */ public HostBean findHostById(long hostId) { HostBean host; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, null, "_id = ?", new String[] { String.valueOf(hostId) }, null, null, null); host = getFirstHostBean(c); } return host; } /** * Record the given hostkey into database under this nickname. * @param hostname * @param port * @param hostkeyalgo * @param hostkey */ public void saveKnownHost(String hostname, int port, String hostkeyalgo, byte[] hostkey) { ContentValues values = new ContentValues(); values.put(FIELD_HOST_HOSTKEYALGO, hostkeyalgo); values.put(FIELD_HOST_HOSTKEY, hostkey); synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); db.update(TABLE_HOSTS, values, FIELD_HOST_HOSTNAME + " = ? AND " + FIELD_HOST_PORT + " = ?", new String[] { hostname, String.valueOf(port) }); Log.d(TAG, String.format("Finished saving hostkey information for '%s'", hostname)); } } /** * Build list of known hosts for Trilead library. * @return */ public KnownHosts getKnownHosts() { KnownHosts known = new KnownHosts(); synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_HOSTS, new String[] { FIELD_HOST_HOSTNAME, FIELD_HOST_PORT, FIELD_HOST_HOSTKEYALGO, FIELD_HOST_HOSTKEY }, null, null, null, null, null); if (c != null) { int COL_HOSTNAME = c.getColumnIndexOrThrow(FIELD_HOST_HOSTNAME), COL_PORT = c.getColumnIndexOrThrow(FIELD_HOST_PORT), COL_HOSTKEYALGO = c.getColumnIndexOrThrow(FIELD_HOST_HOSTKEYALGO), COL_HOSTKEY = c.getColumnIndexOrThrow(FIELD_HOST_HOSTKEY); while (c.moveToNext()) { String hostname = c.getString(COL_HOSTNAME), hostkeyalgo = c.getString(COL_HOSTKEYALGO); int port = c.getInt(COL_PORT); byte[] hostkey = c.getBlob(COL_HOSTKEY); if (hostkeyalgo == null || hostkeyalgo.length() == 0) continue; if (hostkey == null || hostkey.length == 0) continue; try { known.addHostkey(new String[] { String.format("%s:%d", hostname, port) }, hostkeyalgo, hostkey); } catch(Exception e) { Log.e(TAG, "Problem while adding a known host from database", e); } } c.close(); } } return known; } /** * Unset any hosts using a pubkey ID that has been deleted. * @param pubkeyId */ public void stopUsingPubkey(long pubkeyId) { if (pubkeyId < 0) return; ContentValues values = new ContentValues(); values.put(FIELD_HOST_PUBKEYID, PUBKEYID_ANY); synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.update(TABLE_HOSTS, values, FIELD_HOST_PUBKEYID + " = ?", new String[] { String.valueOf(pubkeyId) }); } Log.d(TAG, String.format("Set all hosts using pubkey id %d to -1", pubkeyId)); } /* * Methods for dealing with port forwards attached to hosts */ /** * Returns a list of all the port forwards associated with a particular host ID. * @param host the host for which we want the port forward list * @return port forwards associated with host ID */ public List<PortForwardBean> getPortForwardsForHost(HostBean host) { List<PortForwardBean> portForwards = new LinkedList<PortForwardBean>(); synchronized (dbLock) { SQLiteDatabase db = this.getReadableDatabase(); Cursor c = db.query(TABLE_PORTFORWARDS, new String[] { "_id", FIELD_PORTFORWARD_NICKNAME, FIELD_PORTFORWARD_TYPE, FIELD_PORTFORWARD_SOURCEPORT, FIELD_PORTFORWARD_DESTADDR, FIELD_PORTFORWARD_DESTPORT }, FIELD_PORTFORWARD_HOSTID + " = ?", new String[] { String.valueOf(host.getId()) }, null, null, null); while (c.moveToNext()) { PortForwardBean pfb = new PortForwardBean( c.getInt(0), host.getId(), c.getString(1), c.getString(2), c.getInt(3), c.getString(4), c.getInt(5)); portForwards.add(pfb); } c.close(); } return portForwards; } /** * Update the parameters of a port forward in the database. * @param pfb {@link PortForwardBean} to save * @return true on success */ public boolean savePortForward(PortForwardBean pfb) { boolean success = false; synchronized (dbLock) { SQLiteDatabase db = getWritableDatabase(); if (pfb.getId() < 0) { long id = db.insert(TABLE_PORTFORWARDS, null, pfb.getValues()); pfb.setId(id); success = true; } else { if (db.update(TABLE_PORTFORWARDS, pfb.getValues(), "_id = ?", new String[] { String.valueOf(pfb.getId()) }) > 0) success = true; } } return success; } /** * Deletes a port forward from the database. * @param pfb {@link PortForwardBean} to delete */ public void deletePortForward(PortForwardBean pfb) { if (pfb.getId() < 0) return; synchronized (dbLock) { SQLiteDatabase db = this.getWritableDatabase(); db.delete(TABLE_PORTFORWARDS, "_id = ?", new String[] { String.valueOf(pfb.getId()) }); } } public Integer[] getColorsForScheme(int scheme) { Integer[] colors = Colors.defaults.clone(); synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_COLORS, new String[] { FIELD_COLOR_NUMBER, FIELD_COLOR_VALUE }, FIELD_COLOR_SCHEME + " = ?", new String[] { String.valueOf(scheme) }, null, null, null); while (c.moveToNext()) { colors[c.getInt(0)] = new Integer(c.getInt(1)); } c.close(); } return colors; } public void setColorForScheme(int scheme, int number, int value) { final SQLiteDatabase db; final String[] whereArgs = new String[] { String.valueOf(scheme), String.valueOf(number) }; if (value == Colors.defaults[number]) { synchronized (dbLock) { db = getWritableDatabase(); db.delete(TABLE_COLORS, WHERE_SCHEME_AND_COLOR, whereArgs); } } else { final ContentValues values = new ContentValues(); values.put(FIELD_COLOR_VALUE, value); synchronized (dbLock) { db = getWritableDatabase(); final int rowsAffected = db.update(TABLE_COLORS, values, WHERE_SCHEME_AND_COLOR, whereArgs); if (rowsAffected == 0) { values.put(FIELD_COLOR_SCHEME, scheme); values.put(FIELD_COLOR_NUMBER, number); db.insert(TABLE_COLORS, null, values); } } } } public void setGlobalColor(int number, int value) { setColorForScheme(DEFAULT_COLOR_SCHEME, number, value); } public int[] getDefaultColorsForScheme(int scheme) { int[] colors = new int[] { DEFAULT_FG_COLOR, DEFAULT_BG_COLOR }; synchronized (dbLock) { SQLiteDatabase db = getReadableDatabase(); Cursor c = db.query(TABLE_COLOR_DEFAULTS, new String[] { FIELD_COLOR_FG, FIELD_COLOR_BG }, FIELD_COLOR_SCHEME + " = ?", new String[] { String.valueOf(scheme) }, null, null, null); if (c.moveToFirst()) { colors[0] = c.getInt(0); colors[1] = c.getInt(1); } c.close(); } return colors; } public int[] getGlobalDefaultColors() { return getDefaultColorsForScheme(DEFAULT_COLOR_SCHEME); } public void setDefaultColorsForScheme(int scheme, int fg, int bg) { SQLiteDatabase db; String schemeWhere = null; String[] whereArgs; schemeWhere = FIELD_COLOR_SCHEME + " = ?"; whereArgs = new String[] { String.valueOf(scheme) }; ContentValues values = new ContentValues(); values.put(FIELD_COLOR_FG, fg); values.put(FIELD_COLOR_BG, bg); synchronized (dbLock) { db = getWritableDatabase(); int rowsAffected = db.update(TABLE_COLOR_DEFAULTS, values, schemeWhere, whereArgs); if (rowsAffected == 0) { values.put(FIELD_COLOR_SCHEME, scheme); db.insert(TABLE_COLOR_DEFAULTS, null, values); } } } }
zzsuper001-linuxshell
src/org/connectbot/util/HostDatabase.java
Java
asf20
24,222
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; public interface OnEntropyGatheredListener { void onEntropyGathered(byte[] entropy); }
zzsuper001-linuxshell
src/org/connectbot/util/OnEntropyGatheredListener.java
Java
asf20
799
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.util; import android.content.Context; import android.preference.DialogPreference; import android.util.AttributeSet; import android.view.View; import android.widget.SeekBar; import android.widget.SeekBar.OnSeekBarChangeListener; /** * @author kenny * */ public class VolumePreference extends DialogPreference implements OnSeekBarChangeListener { /** * @param context * @param attrs */ public VolumePreference(Context context, AttributeSet attrs) { super(context, attrs); setupLayout(context, attrs); } public VolumePreference(Context context, AttributeSet attrs, int defStyle) { super(context, attrs, defStyle); setupLayout(context, attrs); } private void setupLayout(Context context, AttributeSet attrs) { setPersistent(true); } @Override protected View onCreateDialogView() { SeekBar sb = new SeekBar(getContext()); sb.setMax(100); sb.setProgress((int)(getPersistedFloat( PreferenceConstants.DEFAULT_BELL_VOLUME) * 100)); sb.setPadding(10, 10, 10, 10); sb.setOnSeekBarChangeListener(this); return sb; } public void onProgressChanged(SeekBar seekBar, int progress, boolean fromUser) { persistFloat(progress / 100f); } public void onStartTrackingTouch(SeekBar seekBar) { } public void onStopTrackingTouch(SeekBar seekBar) { } }
zzsuper001-linuxshell
src/org/connectbot/util/VolumePreference.java
Java
asf20
1,993
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.util.PreferenceConstants; import android.content.SharedPreferences; import android.os.Bundle; import android.preference.PreferenceActivity; import android.preference.PreferenceManager; import android.util.Log; public class SettingsActivity extends PreferenceActivity { private static final String TAG = "ConnectBot.Settings"; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); try { addPreferencesFromResource(R.xml.preferences); } catch (ClassCastException e) { Log.e(TAG, "Shared preferences are corrupt! Resetting to default values."); SharedPreferences preferences = PreferenceManager.getDefaultSharedPreferences(this); // Blow away all the preferences SharedPreferences.Editor editor = preferences.edit(); editor.clear(); editor.commit(); PreferenceManager.setDefaultValues(this, R.xml.preferences, true); // Since they were able to get to the Settings activity, they already agreed to the EULA editor = preferences.edit(); editor.putBoolean(PreferenceConstants.EULA, true); editor.commit(); addPreferencesFromResource(R.xml.preferences); } // TODO: add parse checking here to make sure we have integer value for scrollback } }
zzsuper001-linuxshell
src/org/connectbot/SettingsActivity.java
Java
asf20
1,972
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import org.connectbot.util.HostDatabase; import android.content.ContentValues; /** * @author Kenny Root * */ public class PortForwardBean extends AbstractBean { public static final String BEAN_NAME = "portforward"; /* Database fields */ private long id = -1; private long hostId = -1; private String nickname = null; private String type = null; private int sourcePort = -1; private String destAddr = null; private int destPort = -1; /* Transient values */ private boolean enabled = false; private Object identifier = null; /** * @param id database ID of port forward * @param nickname Nickname to use to identify port forward * @param type One of the port forward types from {@link HostDatabase} * @param sourcePort Source port number * @param destAddr Destination hostname or IP address * @param destPort Destination port number */ public PortForwardBean(long id, long hostId, String nickname, String type, int sourcePort, String destAddr, int destPort) { this.id = id; this.hostId = hostId; this.nickname = nickname; this.type = type; this.sourcePort = sourcePort; this.destAddr = destAddr; this.destPort = destPort; } /** * @param type One of the port forward types from {@link HostDatabase} * @param source Source port number * @param dest Destination is "host:port" format */ public PortForwardBean(long hostId, String nickname, String type, String source, String dest) { this.hostId = hostId; this.nickname = nickname; this.type = type; this.sourcePort = Integer.parseInt(source); setDest(dest); } public String getBeanName() { return BEAN_NAME; } /** * @param id the id to set */ public void setId(long id) { this.id = id; } /** * @return the id */ public long getId() { return id; } /** * @param nickname the nickname to set */ public void setNickname(String nickname) { this.nickname = nickname; } /** * @return the nickname */ public String getNickname() { return nickname; } /** * @param type the type to set */ public void setType(String type) { this.type = type; } /** * @return the type */ public String getType() { return type; } /** * @param sourcePort the sourcePort to set */ public void setSourcePort(int sourcePort) { this.sourcePort = sourcePort; } /** * @return the sourcePort */ public int getSourcePort() { return sourcePort; } /** * @param dest The destination in "host:port" format */ public final void setDest(String dest) { String[] destSplit = dest.split(":"); this.destAddr = destSplit[0]; if (destSplit.length > 1) this.destPort = Integer.parseInt(destSplit[1]); } /** * @param destAddr the destAddr to set */ public void setDestAddr(String destAddr) { this.destAddr = destAddr; } /** * @return the destAddr */ public String getDestAddr() { return destAddr; } /** * @param destPort the destPort to set */ public void setDestPort(int destPort) { this.destPort = destPort; } /** * @return the destPort */ public int getDestPort() { return destPort; } /** * @param enabled the enabled to set */ public void setEnabled(boolean enabled) { this.enabled = enabled; } /** * @return the enabled */ public boolean isEnabled() { return enabled; } /** * @param identifier the identifier of this particular type to set */ public void setIdentifier(Object identifier) { this.identifier = identifier; } /** * @return the identifier used by this particular type */ public Object getIdentifier() { return identifier; } /** * @return human readable description of the port forward */ public CharSequence getDescription() { String description = "Unknown type"; if (HostDatabase.PORTFORWARD_LOCAL.equals(type)) { description = String.format("Local port %d to %s:%d", sourcePort, destAddr, destPort); } else if (HostDatabase.PORTFORWARD_REMOTE.equals(type)) { description = String.format("Remote port %d to %s:%d", sourcePort, destAddr, destPort); /* I don't think we need the SOCKS4 type. } else if (HostDatabase.PORTFORWARD_DYNAMIC4.equals(type)) { description = String.format("Dynamic port %d (SOCKS4)", sourcePort); */ } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(type)) { description = String.format("Dynamic port %d (SOCKS)", sourcePort); } return description; } /** * @return */ public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(HostDatabase.FIELD_PORTFORWARD_HOSTID, hostId); values.put(HostDatabase.FIELD_PORTFORWARD_NICKNAME, nickname); values.put(HostDatabase.FIELD_PORTFORWARD_TYPE, type); values.put(HostDatabase.FIELD_PORTFORWARD_SOURCEPORT, sourcePort); values.put(HostDatabase.FIELD_PORTFORWARD_DESTADDR, destAddr); values.put(HostDatabase.FIELD_PORTFORWARD_DESTPORT, destPort); return values; } }
zzsuper001-linuxshell
src/org/connectbot/bean/PortForwardBean.java
Java
asf20
5,600
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import java.util.Map.Entry; import org.connectbot.util.XmlBuilder; import android.content.ContentValues; /** * @author Kenny Root * */ abstract class AbstractBean { public abstract ContentValues getValues(); public abstract String getBeanName(); public String toXML() { XmlBuilder xml = new XmlBuilder(); xml.append(String.format("<%s>", getBeanName())); ContentValues values = getValues(); for (Entry<String, Object> entry : values.valueSet()) { Object value = entry.getValue(); if (value != null) xml.append(entry.getKey(), value); } xml.append(String.format("</%s>", getBeanName())); return xml.toString(); } }
zzsuper001-linuxshell
src/org/connectbot/bean/AbstractBean.java
Java
asf20
1,362
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import org.connectbot.util.HostDatabase; import android.content.ContentValues; import android.net.Uri; /** * @author Kenny Root * */ public class HostBean extends AbstractBean { public static final String BEAN_NAME = "host"; /* Database fields */ private long id = -1; private String nickname = null; private String username = null; private String hostname = null; private int port = 22; private String protocol = "ssh"; private String hostKeyAlgo = null; private byte[] hostKey = null; private long lastConnect = -1; private String color; private boolean useKeys = true; private String useAuthAgent = HostDatabase.AUTHAGENT_NO; private String postLogin = null; private long pubkeyId = -1; private boolean wantSession = true; private String delKey = HostDatabase.DELKEY_DEL; private int fontSize = -1; private boolean compression = false; private String encoding = HostDatabase.ENCODING_DEFAULT; private boolean stayConnected = false; public HostBean() { } @Override public String getBeanName() { return BEAN_NAME; } public HostBean(String nickname, String protocol, String username, String hostname, int port) { this.nickname = nickname; this.protocol = protocol; this.username = username; this.hostname = hostname; this.port = port; } public void setId(long id) { this.id = id; } public long getId() { return id; } public void setNickname(String nickname) { this.nickname = nickname; } public String getNickname() { return nickname; } public void setUsername(String username) { this.username = username; } public String getUsername() { return username; } public void setHostname(String hostname) { this.hostname = hostname; } public String getHostname() { return hostname; } public void setPort(int port) { this.port = port; } public int getPort() { return port; } public void setProtocol(String protocol) { this.protocol = protocol; } public String getProtocol() { return protocol; } public void setHostKeyAlgo(String hostKeyAlgo) { this.hostKeyAlgo = hostKeyAlgo; } public String getHostKeyAlgo() { return hostKeyAlgo; } public void setHostKey(byte[] hostKey) { if (hostKey == null) this.hostKey = null; else this.hostKey = hostKey.clone(); } public byte[] getHostKey() { if (hostKey == null) return null; else return hostKey.clone(); } public void setLastConnect(long lastConnect) { this.lastConnect = lastConnect; } public long getLastConnect() { return lastConnect; } public void setColor(String color) { this.color = color; } public String getColor() { return color; } public void setUseKeys(boolean useKeys) { this.useKeys = useKeys; } public boolean getUseKeys() { return useKeys; } public void setUseAuthAgent(String useAuthAgent) { this.useAuthAgent = useAuthAgent; } public String getUseAuthAgent() { return useAuthAgent; } public void setPostLogin(String postLogin) { this.postLogin = postLogin; } public String getPostLogin() { return postLogin; } public void setPubkeyId(long pubkeyId) { this.pubkeyId = pubkeyId; } public long getPubkeyId() { return pubkeyId; } public void setWantSession(boolean wantSession) { this.wantSession = wantSession; } public boolean getWantSession() { return wantSession; } public void setDelKey(String delKey) { this.delKey = delKey; } public String getDelKey() { return delKey; } public void setFontSize(int fontSize) { this.fontSize = fontSize; } public int getFontSize() { return fontSize; } public void setCompression(boolean compression) { this.compression = compression; } public boolean getCompression() { return compression; } public void setEncoding(String encoding) { this.encoding = encoding; } public String getEncoding() { return this.encoding; } public void setStayConnected(boolean stayConnected) { this.stayConnected = stayConnected; } public boolean getStayConnected() { return stayConnected; } public String getDescription() { String description = String.format("%s@%s", username, hostname); if (port != 22) description += String.format(":%d", port); return description; } @Override public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(HostDatabase.FIELD_HOST_NICKNAME, nickname); values.put(HostDatabase.FIELD_HOST_PROTOCOL, protocol); values.put(HostDatabase.FIELD_HOST_USERNAME, username); values.put(HostDatabase.FIELD_HOST_HOSTNAME, hostname); values.put(HostDatabase.FIELD_HOST_PORT, port); values.put(HostDatabase.FIELD_HOST_HOSTKEYALGO, hostKeyAlgo); values.put(HostDatabase.FIELD_HOST_HOSTKEY, hostKey); values.put(HostDatabase.FIELD_HOST_LASTCONNECT, lastConnect); values.put(HostDatabase.FIELD_HOST_COLOR, color); values.put(HostDatabase.FIELD_HOST_USEKEYS, Boolean.toString(useKeys)); values.put(HostDatabase.FIELD_HOST_USEAUTHAGENT, useAuthAgent); values.put(HostDatabase.FIELD_HOST_POSTLOGIN, postLogin); values.put(HostDatabase.FIELD_HOST_PUBKEYID, pubkeyId); values.put(HostDatabase.FIELD_HOST_WANTSESSION, Boolean.toString(wantSession)); values.put(HostDatabase.FIELD_HOST_DELKEY, delKey); values.put(HostDatabase.FIELD_HOST_FONTSIZE, fontSize); values.put(HostDatabase.FIELD_HOST_COMPRESSION, Boolean.toString(compression)); values.put(HostDatabase.FIELD_HOST_ENCODING, encoding); values.put(HostDatabase.FIELD_HOST_STAYCONNECTED, stayConnected); return values; } @Override public boolean equals(Object o) { if (o == null || !(o instanceof HostBean)) return false; HostBean host = (HostBean)o; if (id != -1 && host.getId() != -1) return host.getId() == id; if (nickname == null) { if (host.getNickname() != null) return false; } else if (!nickname.equals(host.getNickname())) return false; if (protocol == null) { if (host.getProtocol() != null) return false; } else if (!protocol.equals(host.getProtocol())) return false; if (username == null) { if (host.getUsername() != null) return false; } else if (!username.equals(host.getUsername())) return false; if (hostname == null) { if (host.getHostname() != null) return false; } else if (!hostname.equals(host.getHostname())) return false; if (port != host.getPort()) return false; return true; } @Override public int hashCode() { int hash = 7; if (id != -1) return (int)id; hash = 31 * hash + (null == nickname ? 0 : nickname.hashCode()); hash = 31 * hash + (null == protocol ? 0 : protocol.hashCode()); hash = 31 * hash + (null == username ? 0 : username.hashCode()); hash = 31 * hash + (null == hostname ? 0 : hostname.hashCode()); hash = 31 * hash + port; return hash; } /** * @return URI identifying this HostBean */ public Uri getUri() { StringBuilder sb = new StringBuilder(); sb.append(protocol) .append("://"); if (username != null) sb.append(Uri.encode(username)) .append('@'); sb.append(Uri.encode(hostname)) .append(':') .append(port) .append("/#") .append(nickname); return Uri.parse(sb.toString()); } }
zzsuper001-linuxshell
src/org/connectbot/bean/HostBean.java
Java
asf20
7,849
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import java.security.KeyFactory; import java.security.NoSuchAlgorithmException; import java.security.PrivateKey; import java.security.PublicKey; import java.security.interfaces.DSAPublicKey; import java.security.interfaces.RSAPublicKey; import java.security.spec.EncodedKeySpec; import java.security.spec.InvalidKeySpecException; import java.security.spec.X509EncodedKeySpec; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.content.ContentValues; /** * @author Kenny Root * */ public class PubkeyBean extends AbstractBean { public static final String BEAN_NAME = "pubkey"; private static final String KEY_TYPE_RSA = "RSA"; private static final String KEY_TYPE_DSA = "DSA"; /* Database fields */ private long id; private String nickname; private String type; private byte[] privateKey; private PublicKey publicKey; private boolean encrypted = false; private boolean startup = false; private boolean confirmUse = false; private int lifetime = 0; /* Transient values */ private boolean unlocked = false; private Object unlockedPrivate = null; @Override public String getBeanName() { return BEAN_NAME; } public void setId(long id) { this.id = id; } public long getId() { return id; } public void setNickname(String nickname) { this.nickname = nickname; } public String getNickname() { return nickname; } public void setType(String type) { this.type = type; } public String getType() { return type; } public void setPrivateKey(byte[] privateKey) { if (privateKey == null) this.privateKey = null; else this.privateKey = privateKey.clone(); } public byte[] getPrivateKey() { if (privateKey == null) return null; else return privateKey.clone(); } private PublicKey decodePublicKeyAs(EncodedKeySpec keySpec, String keyType) { try { final KeyFactory kf = KeyFactory.getInstance(keyType); return kf.generatePublic(keySpec); } catch (NoSuchAlgorithmException e) { return null; } catch (InvalidKeySpecException e) { return null; } } public void setPublicKey(byte[] encoded) { final X509EncodedKeySpec pubKeySpec = new X509EncodedKeySpec(encoded); if (type != null) { publicKey = decodePublicKeyAs(pubKeySpec, type); } else { publicKey = decodePublicKeyAs(pubKeySpec, KEY_TYPE_RSA); if (publicKey != null) { type = KEY_TYPE_RSA; } else { publicKey = decodePublicKeyAs(pubKeySpec, KEY_TYPE_DSA); if (publicKey != null) { type = KEY_TYPE_DSA; } } } } public PublicKey getPublicKey() { return publicKey; } public void setEncrypted(boolean encrypted) { this.encrypted = encrypted; } public boolean isEncrypted() { return encrypted; } public void setStartup(boolean startup) { this.startup = startup; } public boolean isStartup() { return startup; } public void setConfirmUse(boolean confirmUse) { this.confirmUse = confirmUse; } public boolean isConfirmUse() { return confirmUse; } public void setLifetime(int lifetime) { this.lifetime = lifetime; } public int getLifetime() { return lifetime; } public void setUnlocked(boolean unlocked) { this.unlocked = unlocked; } public boolean isUnlocked() { return unlocked; } public void setUnlockedPrivate(Object unlockedPrivate) { this.unlockedPrivate = unlockedPrivate; } public Object getUnlockedPrivate() { return unlockedPrivate; } public String getDescription() { StringBuilder sb = new StringBuilder(); if (publicKey instanceof RSAPublicKey) { int bits = ((RSAPublicKey) publicKey).getModulus().bitLength(); sb.append("RSA "); sb.append(bits); sb.append("-bit"); } else if (publicKey instanceof DSAPublicKey) { sb.append("DSA 1024-bit"); } else { sb.append("Unknown Key Type"); } if (encrypted) sb.append(" (encrypted)"); return sb.toString(); } /* (non-Javadoc) * @see org.connectbot.bean.AbstractBean#getValues() */ @Override public ContentValues getValues() { ContentValues values = new ContentValues(); values.put(PubkeyDatabase.FIELD_PUBKEY_NICKNAME, nickname); values.put(PubkeyDatabase.FIELD_PUBKEY_TYPE, type); values.put(PubkeyDatabase.FIELD_PUBKEY_PRIVATE, privateKey); values.put(PubkeyDatabase.FIELD_PUBKEY_PUBLIC, publicKey.getEncoded()); values.put(PubkeyDatabase.FIELD_PUBKEY_ENCRYPTED, encrypted ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_STARTUP, startup ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_CONFIRMUSE, confirmUse ? 1 : 0); values.put(PubkeyDatabase.FIELD_PUBKEY_LIFETIME, lifetime); return values; } public boolean changePassword(String oldPassword, String newPassword) throws Exception { PrivateKey priv; try { priv = PubkeyUtils.decodePrivate(getPrivateKey(), getType(), oldPassword); } catch (Exception e) { return false; } setPrivateKey(PubkeyUtils.getEncodedPrivate(priv, newPassword)); setEncrypted(newPassword.length() > 0); return true; } }
zzsuper001-linuxshell
src/org/connectbot/bean/PubkeyBean.java
Java
asf20
5,697
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.bean; import de.mud.terminal.VDUBuffer; /** * @author Kenny Root * Keep track of a selection area for the terminal copying mechanism. * If the orientation is flipped one way, swap the bottom and top or * left and right to keep it in the correct orientation. */ public class SelectionArea { private int top; private int bottom; private int left; private int right; private int maxColumns; private int maxRows; private boolean selectingOrigin; public SelectionArea() { reset(); } public final void reset() { top = left = bottom = right = 0; selectingOrigin = true; } /** * @param columns * @param rows */ public void setBounds(int columns, int rows) { maxColumns = columns - 1; maxRows = rows - 1; } private int checkBounds(int value, int max) { if (value < 0) return 0; else if (value > max) return max; else return value; } public boolean isSelectingOrigin() { return selectingOrigin; } public void finishSelectingOrigin() { selectingOrigin = false; } public void decrementRow() { if (selectingOrigin) setTop(top - 1); else setBottom(bottom - 1); } public void incrementRow() { if (selectingOrigin) setTop(top + 1); else setBottom(bottom + 1); } public void setRow(int row) { if (selectingOrigin) setTop(row); else setBottom(row); } private void setTop(int top) { this.top = bottom = checkBounds(top, maxRows); } public int getTop() { return Math.min(top, bottom); } private void setBottom(int bottom) { this.bottom = checkBounds(bottom, maxRows); } public int getBottom() { return Math.max(top, bottom); } public void decrementColumn() { if (selectingOrigin) setLeft(left - 1); else setRight(right - 1); } public void incrementColumn() { if (selectingOrigin) setLeft(left + 1); else setRight(right + 1); } public void setColumn(int column) { if (selectingOrigin) setLeft(column); else setRight(column); } private void setLeft(int left) { this.left = right = checkBounds(left, maxColumns); } public int getLeft() { return Math.min(left, right); } private void setRight(int right) { this.right = checkBounds(right, maxColumns); } public int getRight() { return Math.max(left, right); } public String copyFrom(VDUBuffer vb) { int size = (getRight() - getLeft() + 1) * (getBottom() - getTop() + 1); StringBuffer buffer = new StringBuffer(size); for(int y = getTop(); y <= getBottom(); y++) { int lastNonSpace = buffer.length(); for (int x = getLeft(); x <= getRight(); x++) { // only copy printable chars char c = vb.getChar(x, y); if (!Character.isDefined(c) || (Character.isISOControl(c) && c != '\t')) c = ' '; if (c != ' ') lastNonSpace = buffer.length(); buffer.append(c); } // Don't leave a bunch of spaces in our copy buffer. if (buffer.length() > lastNonSpace) buffer.delete(lastNonSpace + 1, buffer.length()); if (y != bottom) buffer.append("\n"); } return buffer.toString(); } @Override public String toString() { StringBuilder buffer = new StringBuilder(); buffer.append("SelectionArea[top="); buffer.append(top); buffer.append(", bottom="); buffer.append(bottom); buffer.append(", left="); buffer.append(left); buffer.append(", right="); buffer.append(right); buffer.append(", maxColumns="); buffer.append(maxColumns); buffer.append(", maxRows="); buffer.append(maxRows); buffer.append(", isSelectingOrigin="); buffer.append(isSelectingOrigin()); buffer.append("]"); return buffer.toString(); } }
zzsuper001-linuxshell
src/org/connectbot/bean/SelectionArea.java
Java
asf20
4,319
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.security.KeyPair; import java.security.KeyPairGenerator; import java.security.PrivateKey; import java.security.PublicKey; import java.security.SecureRandom; import org.connectbot.bean.PubkeyBean; import org.connectbot.util.EntropyDialog; import org.connectbot.util.EntropyView; import org.connectbot.util.OnEntropyGatheredListener; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.app.Activity; import android.app.Dialog; import android.app.ProgressDialog; import android.content.Context; import android.os.Bundle; import android.os.Handler; import android.os.Message; import android.text.Editable; import android.text.TextWatcher; import android.util.Log; import android.view.LayoutInflater; import android.view.View; import android.view.View.OnClickListener; import android.view.View.OnFocusChangeListener; import android.widget.Button; import android.widget.CheckBox; import android.widget.EditText; import android.widget.RadioGroup; import android.widget.SeekBar; import android.widget.RadioGroup.OnCheckedChangeListener; import android.widget.SeekBar.OnSeekBarChangeListener; public class GeneratePubkeyActivity extends Activity implements OnEntropyGatheredListener { public final static String TAG = "ConnectBot.GeneratePubkeyActivity"; final static int DEFAULT_BITS = 1024; private LayoutInflater inflater = null; private EditText nickname; private RadioGroup keyTypeGroup; private SeekBar bitsSlider; private EditText bitsText; private CheckBox unlockAtStartup; private CheckBox confirmUse; private Button save; private Dialog entropyDialog; private ProgressDialog progress; private EditText password1, password2; private String keyType = PubkeyDatabase.KEY_TYPE_RSA; private int minBits = 768; private int bits = DEFAULT_BITS; private byte[] entropy; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_generatepubkey); nickname = (EditText) findViewById(R.id.nickname); keyTypeGroup = (RadioGroup) findViewById(R.id.key_type); bitsText = (EditText) findViewById(R.id.bits); bitsSlider = (SeekBar) findViewById(R.id.bits_slider); password1 = (EditText) findViewById(R.id.password1); password2 = (EditText) findViewById(R.id.password2); unlockAtStartup = (CheckBox) findViewById(R.id.unlock_at_startup); confirmUse = (CheckBox) findViewById(R.id.confirm_use); save = (Button) findViewById(R.id.save); inflater = LayoutInflater.from(this); nickname.addTextChangedListener(textChecker); password1.addTextChangedListener(textChecker); password2.addTextChangedListener(textChecker); keyTypeGroup.setOnCheckedChangeListener(new OnCheckedChangeListener() { public void onCheckedChanged(RadioGroup group, int checkedId) { if (checkedId == R.id.rsa) { minBits = 768; bitsSlider.setEnabled(true); bitsSlider.setProgress(DEFAULT_BITS - minBits); bitsText.setText(String.valueOf(DEFAULT_BITS)); bitsText.setEnabled(true); keyType = PubkeyDatabase.KEY_TYPE_RSA; } else if (checkedId == R.id.dsa) { // DSA keys can only be 1024 bits bitsSlider.setEnabled(false); bitsSlider.setProgress(DEFAULT_BITS - minBits); bitsText.setText(String.valueOf(DEFAULT_BITS)); bitsText.setEnabled(false); keyType = PubkeyDatabase.KEY_TYPE_DSA; } } }); bitsSlider.setOnSeekBarChangeListener(new OnSeekBarChangeListener() { public void onProgressChanged(SeekBar seekBar, int progress, boolean fromTouch) { // Stay evenly divisible by 8 because it looks nicer to have // 2048 than 2043 bits. int leftover = progress % 8; int ourProgress = progress; if (leftover > 0) ourProgress += 8 - leftover; bits = minBits + ourProgress; bitsText.setText(String.valueOf(bits)); } public void onStartTrackingTouch(SeekBar seekBar) { // We don't care about the start. } public void onStopTrackingTouch(SeekBar seekBar) { // We don't care about the stop. } }); bitsText.setOnFocusChangeListener(new OnFocusChangeListener() { public void onFocusChange(View v, boolean hasFocus) { if (!hasFocus) { try { bits = Integer.parseInt(bitsText.getText().toString()); if (bits < minBits) { bits = minBits; bitsText.setText(String.valueOf(bits)); } } catch (NumberFormatException nfe) { bits = DEFAULT_BITS; bitsText.setText(String.valueOf(bits)); } bitsSlider.setProgress(bits - minBits); } } }); save.setOnClickListener(new OnClickListener() { public void onClick(View view) { GeneratePubkeyActivity.this.save.setEnabled(false); GeneratePubkeyActivity.this.startEntropyGather(); } }); } private void checkEntries() { boolean allowSave = true; if (!password1.getText().toString().equals(password2.getText().toString())) allowSave = false; if (nickname.getText().length() == 0) allowSave = false; save.setEnabled(allowSave); } private void startEntropyGather() { final View entropyView = inflater.inflate(R.layout.dia_gatherentropy, null, false); ((EntropyView)entropyView.findViewById(R.id.entropy)).addOnEntropyGatheredListener(GeneratePubkeyActivity.this); entropyDialog = new EntropyDialog(GeneratePubkeyActivity.this, entropyView); entropyDialog.show(); } public void onEntropyGathered(byte[] entropy) { // For some reason the entropy dialog was aborted, exit activity if (entropy == null) { finish(); return; } this.entropy = entropy.clone(); int numSetBits = 0; for (int i = 0; i < 20; i++) numSetBits += measureNumberOfSetBits(this.entropy[i]); Log.d(TAG, "Entropy distribution=" + (int)(100.0 * numSetBits / 160.0) + "%"); Log.d(TAG, "entropy gathered; attemping to generate key..."); startKeyGen(); } private void startKeyGen() { progress = new ProgressDialog(GeneratePubkeyActivity.this); progress.setMessage(GeneratePubkeyActivity.this.getResources().getText(R.string.pubkey_generating)); progress.setIndeterminate(true); progress.setCancelable(false); progress.show(); Thread keyGenThread = new Thread(mKeyGen); keyGenThread.setName("KeyGen"); keyGenThread.start(); } private Handler handler = new Handler() { @Override public void handleMessage(Message msg) { progress.dismiss(); GeneratePubkeyActivity.this.finish(); } }; final private Runnable mKeyGen = new Runnable() { public void run() { try { boolean encrypted = false; SecureRandom random = SecureRandom.getInstance("SHA1PRNG"); random.setSeed(entropy); KeyPairGenerator keyPairGen = KeyPairGenerator.getInstance(keyType); keyPairGen.initialize(bits, random); KeyPair pair = keyPairGen.generateKeyPair(); PrivateKey priv = pair.getPrivate(); PublicKey pub = pair.getPublic(); String secret = password1.getText().toString(); if (secret.length() > 0) encrypted = true; Log.d(TAG, "private: " + PubkeyUtils.formatKey(priv)); Log.d(TAG, "public: " + PubkeyUtils.formatKey(pub)); PubkeyBean pubkey = new PubkeyBean(); pubkey.setNickname(nickname.getText().toString()); pubkey.setType(keyType); pubkey.setPrivateKey(PubkeyUtils.getEncodedPrivate(priv, secret)); pubkey.setPublicKey(PubkeyUtils.getEncodedPublic(pub)); pubkey.setEncrypted(encrypted); pubkey.setStartup(unlockAtStartup.isChecked()); pubkey.setConfirmUse(confirmUse.isChecked()); PubkeyDatabase pubkeydb = new PubkeyDatabase(GeneratePubkeyActivity.this); pubkeydb.savePubkey(pubkey); pubkeydb.close(); } catch (Exception e) { Log.e(TAG, "Could not generate key pair"); e.printStackTrace(); } handler.sendEmptyMessage(0); } }; final private TextWatcher textChecker = new TextWatcher() { public void afterTextChanged(Editable s) {} public void beforeTextChanged(CharSequence s, int start, int count, int after) {} public void onTextChanged(CharSequence s, int start, int before, int count) { checkEntries(); } }; private int measureNumberOfSetBits(byte b) { int numSetBits = 0; for (int i = 0; i < 8; i++) { if ((b & 1) == 1) numSetBits++; b >>= 1; } return numSetBits; } }
zzsuper001-linuxshell
src/org/connectbot/GeneratePubkeyActivity.java
Java
asf20
8,986
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.lang.ref.WeakReference; import java.util.List; import org.connectbot.bean.SelectionArea; import org.connectbot.service.PromptHelper; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalKeyListener; import org.connectbot.service.TerminalManager; import org.connectbot.util.PreferenceConstants; import android.app.Activity; import android.app.AlertDialog; import android.app.Dialog; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.Intent; import android.content.ServiceConnection; import android.content.SharedPreferences; import android.content.pm.ActivityInfo; import android.content.res.Configuration; import android.media.AudioManager; import android.net.Uri; import android.os.Bundle; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.preference.PreferenceManager; import android.text.ClipboardManager; import android.util.Log; import android.view.GestureDetector; import android.view.KeyEvent; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.MotionEvent; import android.view.View; import android.view.ViewConfiguration; import android.view.WindowManager; import android.view.MenuItem.OnMenuItemClickListener; import android.view.View.OnClickListener; import android.view.View.OnKeyListener; import android.view.View.OnTouchListener; import android.view.animation.Animation; import android.view.animation.AnimationUtils; import android.view.inputmethod.InputMethodManager; import android.widget.AdapterView; import android.widget.ArrayAdapter; import android.widget.Button; import android.widget.EditText; import android.widget.ImageView; import android.widget.ListView; import android.widget.RelativeLayout; import android.widget.TextView; import android.widget.Toast; import android.widget.ViewFlipper; import android.widget.AdapterView.OnItemClickListener; import de.mud.terminal.vt320; public class ConsoleActivity extends Activity { public final static String TAG = "ConnectBot.ConsoleActivity"; protected static final int REQUEST_EDIT = 1; private static final int CLICK_TIME = 400; private static final float MAX_CLICK_DISTANCE = 25f; private static final int KEYBOARD_DISPLAY_TIME = 1500; // Direction to shift the ViewFlipper private static final int SHIFT_LEFT = 0; private static final int SHIFT_RIGHT = 1; protected ViewFlipper flip = null; protected TerminalManager bound = null; protected LayoutInflater inflater = null; private SharedPreferences prefs = null; // determines whether or not menuitem accelerators are bound // otherwise they collide with an external keyboard's CTRL-char private boolean hardKeyboard = false; protected Uri requested; protected ClipboardManager clipboard; private RelativeLayout stringPromptGroup; protected EditText stringPrompt; private TextView stringPromptInstructions; private RelativeLayout booleanPromptGroup; private TextView booleanPrompt; private Button booleanYes, booleanNo; private TextView empty; private Animation slide_left_in, slide_left_out, slide_right_in, slide_right_out, fade_stay_hidden, fade_out_delayed; private Animation keyboard_fade_in, keyboard_fade_out; private float lastX, lastY; private InputMethodManager inputManager; private MenuItem disconnect, copy, paste, portForward, resize, urlscan; protected TerminalBridge copySource = null; private int lastTouchRow, lastTouchCol; private boolean forcedOrientation; private Handler handler = new Handler(); private ImageView mKeyboardButton; private ServiceConnection connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { bound = ((TerminalManager.TerminalBinder) service).getService(); // let manager know about our event handling services bound.disconnectHandler = disconnectHandler; Log.d(TAG, String.format("Connected to TerminalManager and found bridges.size=%d", bound.bridges.size())); bound.setResizeAllowed(true); // clear out any existing bridges and record requested index flip.removeAllViews(); final String requestedNickname = (requested != null) ? requested.getFragment() : null; int requestedIndex = 0; TerminalBridge requestedBridge = bound.getConnectedBridge(requestedNickname); // If we didn't find the requested connection, try opening it if (requestedNickname != null && requestedBridge == null) { try { Log.d(TAG, String.format("We couldnt find an existing bridge with URI=%s (nickname=%s), so creating one now", requested.toString(), requestedNickname)); requestedBridge = bound.openConnection(requested); } catch(Exception e) { Log.e(TAG, "Problem while trying to create new requested bridge from URI", e); } } // create views for all bridges on this service for (TerminalBridge bridge : bound.bridges) { final int currentIndex = addNewTerminalView(bridge); // check to see if this bridge was requested if (bridge == requestedBridge) requestedIndex = currentIndex; } setDisplayedTerminal(requestedIndex); } public void onServiceDisconnected(ComponentName className) { // tell each bridge to forget about our prompt handler synchronized (bound.bridges) { for(TerminalBridge bridge : bound.bridges) bridge.promptHelper.setHandler(null); } flip.removeAllViews(); updateEmptyVisible(); bound = null; } }; protected Handler promptHandler = new Handler() { @Override public void handleMessage(Message msg) { // someone below us requested to display a prompt updatePromptVisible(); } }; protected Handler disconnectHandler = new Handler() { @Override public void handleMessage(Message msg) { Log.d(TAG, "Someone sending HANDLE_DISCONNECT to parentHandler"); // someone below us requested to display a password dialog // they are sending nickname and requested TerminalBridge bridge = (TerminalBridge)msg.obj; if (bridge.isAwaitingClose()) closeBridge(bridge); } }; /** * @param bridge */ private void closeBridge(final TerminalBridge bridge) { synchronized (flip) { final int flipIndex = getFlipIndex(bridge); if (flipIndex >= 0) { if (flip.getDisplayedChild() == flipIndex) { shiftCurrentTerminal(SHIFT_LEFT); } flip.removeViewAt(flipIndex); /* TODO Remove this workaround when ViewFlipper is fixed to listen * to view removals. Android Issue 1784 */ final int numChildren = flip.getChildCount(); if (flip.getDisplayedChild() >= numChildren && numChildren > 0) { flip.setDisplayedChild(numChildren - 1); } updateEmptyVisible(); } // If we just closed the last bridge, go back to the previous activity. if (flip.getChildCount() == 0) { finish(); } } } protected View findCurrentView(int id) { View view = flip.getCurrentView(); if(view == null) return null; return view.findViewById(id); } protected PromptHelper getCurrentPromptHelper() { View view = findCurrentView(R.id.console_flip); if(!(view instanceof TerminalView)) return null; return ((TerminalView)view).bridge.promptHelper; } protected void hideAllPrompts() { stringPromptGroup.setVisibility(View.GONE); booleanPromptGroup.setVisibility(View.GONE); } // more like configureLaxMode -- enable network IO on UI thread private void configureStrictMode() { try { Class.forName("android.os.StrictMode"); StrictModeSetup.run(); } catch (ClassNotFoundException e) { } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); configureStrictMode(); hardKeyboard = getResources().getConfiguration().keyboard == Configuration.KEYBOARD_QWERTY; this.setContentView(R.layout.act_console); clipboard = (ClipboardManager)getSystemService(CLIPBOARD_SERVICE); prefs = PreferenceManager.getDefaultSharedPreferences(this); // hide status bar if requested by user if (prefs.getBoolean(PreferenceConstants.FULLSCREEN, false)) { getWindow().setFlags(WindowManager.LayoutParams.FLAG_FULLSCREEN, WindowManager.LayoutParams.FLAG_FULLSCREEN); } // TODO find proper way to disable volume key beep if it exists. setVolumeControlStream(AudioManager.STREAM_MUSIC); // handle requested console from incoming intent requested = getIntent().getData(); inflater = LayoutInflater.from(this); flip = (ViewFlipper)findViewById(R.id.console_flip); empty = (TextView)findViewById(android.R.id.empty); stringPromptGroup = (RelativeLayout) findViewById(R.id.console_password_group); stringPromptInstructions = (TextView) findViewById(R.id.console_password_instructions); stringPrompt = (EditText)findViewById(R.id.console_password); stringPrompt.setOnKeyListener(new OnKeyListener() { public boolean onKey(View v, int keyCode, KeyEvent event) { if(event.getAction() == KeyEvent.ACTION_UP) return false; if(keyCode != KeyEvent.KEYCODE_ENTER) return false; // pass collected password down to current terminal String value = stringPrompt.getText().toString(); PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return false; helper.setResponse(value); // finally clear password for next user stringPrompt.setText(""); updatePromptVisible(); return true; } }); booleanPromptGroup = (RelativeLayout) findViewById(R.id.console_boolean_group); booleanPrompt = (TextView)findViewById(R.id.console_prompt); booleanYes = (Button)findViewById(R.id.console_prompt_yes); booleanYes.setOnClickListener(new OnClickListener() { public void onClick(View v) { PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return; helper.setResponse(Boolean.TRUE); updatePromptVisible(); } }); booleanNo = (Button)findViewById(R.id.console_prompt_no); booleanNo.setOnClickListener(new OnClickListener() { public void onClick(View v) { PromptHelper helper = getCurrentPromptHelper(); if(helper == null) return; helper.setResponse(Boolean.FALSE); updatePromptVisible(); } }); // preload animations for terminal switching slide_left_in = AnimationUtils.loadAnimation(this, R.anim.slide_left_in); slide_left_out = AnimationUtils.loadAnimation(this, R.anim.slide_left_out); slide_right_in = AnimationUtils.loadAnimation(this, R.anim.slide_right_in); slide_right_out = AnimationUtils.loadAnimation(this, R.anim.slide_right_out); fade_out_delayed = AnimationUtils.loadAnimation(this, R.anim.fade_out_delayed); fade_stay_hidden = AnimationUtils.loadAnimation(this, R.anim.fade_stay_hidden); // Preload animation for keyboard button keyboard_fade_in = AnimationUtils.loadAnimation(this, R.anim.keyboard_fade_in); keyboard_fade_out = AnimationUtils.loadAnimation(this, R.anim.keyboard_fade_out); inputManager = (InputMethodManager) getSystemService(Context.INPUT_METHOD_SERVICE); final RelativeLayout keyboardGroup = (RelativeLayout) findViewById(R.id.keyboard_group); mKeyboardButton = (ImageView) findViewById(R.id.button_keyboard); mKeyboardButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; inputManager.showSoftInput(flip, InputMethodManager.SHOW_FORCED); keyboardGroup.setVisibility(View.GONE); } }); final ImageView ctrlButton = (ImageView) findViewById(R.id.button_ctrl); ctrlButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; TerminalView terminal = (TerminalView)flip; TerminalKeyListener handler = terminal.bridge.getKeyHandler(); handler.metaPress(TerminalKeyListener.META_CTRL_ON); keyboardGroup.setVisibility(View.GONE); } }); final ImageView escButton = (ImageView) findViewById(R.id.button_esc); escButton.setOnClickListener(new OnClickListener() { public void onClick(View view) { View flip = findCurrentView(R.id.console_flip); if (flip == null) return; TerminalView terminal = (TerminalView)flip; TerminalKeyListener handler = terminal.bridge.getKeyHandler(); handler.sendEscape(); keyboardGroup.setVisibility(View.GONE); } }); // detect fling gestures to switch between terminals final GestureDetector detect = new GestureDetector(new GestureDetector.SimpleOnGestureListener() { private float totalY = 0; @Override public boolean onFling(MotionEvent e1, MotionEvent e2, float velocityX, float velocityY) { final float distx = e2.getRawX() - e1.getRawX(); final float disty = e2.getRawY() - e1.getRawY(); final int goalwidth = flip.getWidth() / 2; // need to slide across half of display to trigger console change // make sure user kept a steady hand horizontally if (Math.abs(disty) < (flip.getHeight() / 4)) { if (distx > goalwidth) { shiftCurrentTerminal(SHIFT_RIGHT); return true; } if (distx < -goalwidth) { shiftCurrentTerminal(SHIFT_LEFT); return true; } } return false; } @Override public boolean onScroll(MotionEvent e1, MotionEvent e2, float distanceX, float distanceY) { // if copying, then ignore if (copySource != null && copySource.isSelectingForCopy()) return false; if (e1 == null || e2 == null) return false; // if releasing then reset total scroll if (e2.getAction() == MotionEvent.ACTION_UP) { totalY = 0; } // activate consider if within x tolerance if (Math.abs(e1.getX() - e2.getX()) < ViewConfiguration.getTouchSlop() * 4) { View flip = findCurrentView(R.id.console_flip); if(flip == null) return false; TerminalView terminal = (TerminalView)flip; // estimate how many rows we have scrolled through // accumulate distance that doesn't trigger immediate scroll totalY += distanceY; final int moved = (int)(totalY / terminal.bridge.charHeight); // consume as scrollback only if towards right half of screen if (e2.getX() > flip.getWidth() / 2) { if (moved != 0) { int base = terminal.bridge.buffer.getWindowBase(); terminal.bridge.buffer.setWindowBase(base + moved); totalY = 0; return true; } } else { // otherwise consume as pgup/pgdown for every 5 lines if (moved > 5) { ((vt320)terminal.bridge.buffer).keyPressed(vt320.KEY_PAGE_DOWN, ' ', 0); terminal.bridge.tryKeyVibrate(); totalY = 0; return true; } else if (moved < -5) { ((vt320)terminal.bridge.buffer).keyPressed(vt320.KEY_PAGE_UP, ' ', 0); terminal.bridge.tryKeyVibrate(); totalY = 0; return true; } } } return false; } }); flip.setLongClickable(true); flip.setOnTouchListener(new OnTouchListener() { public boolean onTouch(View v, MotionEvent event) { // when copying, highlight the area if (copySource != null && copySource.isSelectingForCopy()) { int row = (int)Math.floor(event.getY() / copySource.charHeight); int col = (int)Math.floor(event.getX() / copySource.charWidth); SelectionArea area = copySource.getSelectionArea(); switch(event.getAction()) { case MotionEvent.ACTION_DOWN: // recording starting area if (area.isSelectingOrigin()) { area.setRow(row); area.setColumn(col); lastTouchRow = row; lastTouchCol = col; copySource.redraw(); } return true; case MotionEvent.ACTION_MOVE: /* ignore when user hasn't moved since last time so * we can fine-tune with directional pad */ if (row == lastTouchRow && col == lastTouchCol) return true; // if the user moves, start the selection for other corner area.finishSelectingOrigin(); // update selected area area.setRow(row); area.setColumn(col); lastTouchRow = row; lastTouchCol = col; copySource.redraw(); return true; case MotionEvent.ACTION_UP: /* If they didn't move their finger, maybe they meant to * select the rest of the text with the directional pad. */ if (area.getLeft() == area.getRight() && area.getTop() == area.getBottom()) { return true; } // copy selected area to clipboard String copiedText = area.copyFrom(copySource.buffer); clipboard.setText(copiedText); Toast.makeText(ConsoleActivity.this, getString(R.string.console_copy_done, copiedText.length()), Toast.LENGTH_LONG).show(); // fall through to clear state case MotionEvent.ACTION_CANCEL: // make sure we clear any highlighted area area.reset(); copySource.setSelectingForCopy(false); copySource.redraw(); return true; } } Configuration config = getResources().getConfiguration(); if (event.getAction() == MotionEvent.ACTION_DOWN) { lastX = event.getX(); lastY = event.getY(); } else if (event.getAction() == MotionEvent.ACTION_UP && keyboardGroup.getVisibility() == View.GONE && event.getEventTime() - event.getDownTime() < CLICK_TIME && Math.abs(event.getX() - lastX) < MAX_CLICK_DISTANCE && Math.abs(event.getY() - lastY) < MAX_CLICK_DISTANCE) { keyboardGroup.startAnimation(keyboard_fade_in); keyboardGroup.setVisibility(View.VISIBLE); handler.postDelayed(new Runnable() { public void run() { if (keyboardGroup.getVisibility() == View.GONE) return; keyboardGroup.startAnimation(keyboard_fade_out); keyboardGroup.setVisibility(View.GONE); } }, KEYBOARD_DISPLAY_TIME); } // pass any touch events back to detector return detect.onTouchEvent(event); } }); } /** * */ private void configureOrientation() { String rotateDefault; if (getResources().getConfiguration().keyboard == Configuration.KEYBOARD_NOKEYS) rotateDefault = PreferenceConstants.ROTATION_PORTRAIT; else rotateDefault = PreferenceConstants.ROTATION_LANDSCAPE; String rotate = prefs.getString(PreferenceConstants.ROTATION, rotateDefault); if (PreferenceConstants.ROTATION_DEFAULT.equals(rotate)) rotate = rotateDefault; // request a forced orientation if requested by user if (PreferenceConstants.ROTATION_LANDSCAPE.equals(rotate)) { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_LANDSCAPE); forcedOrientation = true; } else if (PreferenceConstants.ROTATION_PORTRAIT.equals(rotate)) { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_PORTRAIT); forcedOrientation = true; } else { setRequestedOrientation(ActivityInfo.SCREEN_ORIENTATION_UNSPECIFIED); forcedOrientation = false; } } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); View view = findCurrentView(R.id.console_flip); final boolean activeTerminal = (view instanceof TerminalView); boolean sessionOpen = false; boolean disconnected = false; boolean canForwardPorts = false; if (activeTerminal) { TerminalBridge bridge = ((TerminalView) view).bridge; sessionOpen = bridge.isSessionOpen(); disconnected = bridge.isDisconnected(); canForwardPorts = bridge.canFowardPorts(); } menu.setQwertyMode(true); disconnect = menu.add(R.string.list_host_disconnect); if (hardKeyboard) disconnect.setAlphabeticShortcut('w'); if (!sessionOpen && disconnected) disconnect.setTitle(R.string.console_menu_close); disconnect.setEnabled(activeTerminal); disconnect.setIcon(android.R.drawable.ic_menu_close_clear_cancel); disconnect.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // disconnect or close the currently visible session TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; bridge.dispatchDisconnect(true); return true; } }); copy = menu.add(R.string.console_menu_copy); if (hardKeyboard) copy.setAlphabeticShortcut('c'); copy.setIcon(android.R.drawable.ic_menu_set_as); copy.setEnabled(activeTerminal); copy.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // mark as copying and reset any previous bounds TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); copySource = terminalView.bridge; SelectionArea area = copySource.getSelectionArea(); area.reset(); area.setBounds(copySource.buffer.getColumns(), copySource.buffer.getRows()); copySource.setSelectingForCopy(true); // Make sure we show the initial selection copySource.redraw(); Toast.makeText(ConsoleActivity.this, getString(R.string.console_copy_start), Toast.LENGTH_LONG).show(); return true; } }); paste = menu.add(R.string.console_menu_paste); if (hardKeyboard) paste.setAlphabeticShortcut('v'); paste.setIcon(android.R.drawable.ic_menu_edit); paste.setEnabled(clipboard.hasText() && sessionOpen); paste.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // force insert of clipboard text into current console TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; // pull string from clipboard and generate all events to force down String clip = clipboard.getText().toString(); bridge.injectString(clip); return true; } }); portForward = menu.add(R.string.console_menu_portforwards); if (hardKeyboard) portForward.setAlphabeticShortcut('f'); portForward.setIcon(android.R.drawable.ic_menu_manage); portForward.setEnabled(sessionOpen && canForwardPorts); portForward.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); TerminalBridge bridge = terminalView.bridge; Intent intent = new Intent(ConsoleActivity.this, PortForwardListActivity.class); intent.putExtra(Intent.EXTRA_TITLE, bridge.host.getId()); ConsoleActivity.this.startActivityForResult(intent, REQUEST_EDIT); return true; } }); urlscan = menu.add(R.string.console_menu_urlscan); if (hardKeyboard) urlscan.setAlphabeticShortcut('u'); urlscan.setIcon(android.R.drawable.ic_menu_search); urlscan.setEnabled(activeTerminal); urlscan.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); List<String> urls = terminalView.bridge.scanForURLs(); Dialog urlDialog = new Dialog(ConsoleActivity.this); urlDialog.setTitle(R.string.console_menu_urlscan); ListView urlListView = new ListView(ConsoleActivity.this); URLItemListener urlListener = new URLItemListener(ConsoleActivity.this); urlListView.setOnItemClickListener(urlListener); urlListView.setAdapter(new ArrayAdapter<String>(ConsoleActivity.this, android.R.layout.simple_list_item_1, urls)); urlDialog.setContentView(urlListView); urlDialog.show(); return true; } }); resize = menu.add(R.string.console_menu_resize); if (hardKeyboard) resize.setAlphabeticShortcut('s'); resize.setIcon(android.R.drawable.ic_menu_crop); resize.setEnabled(sessionOpen); resize.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final TerminalView terminalView = (TerminalView) findCurrentView(R.id.console_flip); final View resizeView = inflater.inflate(R.layout.dia_resize, null, false); new AlertDialog.Builder(ConsoleActivity.this) .setView(resizeView) .setPositiveButton(R.string.button_resize, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { int width, height; try { width = Integer.parseInt(((EditText) resizeView .findViewById(R.id.width)) .getText().toString()); height = Integer.parseInt(((EditText) resizeView .findViewById(R.id.height)) .getText().toString()); } catch (NumberFormatException nfe) { // TODO change this to a real dialog where we can // make the input boxes turn red to indicate an error. return; } terminalView.forceSize(width, height); } }).setNegativeButton(android.R.string.cancel, null).create().show(); return true; } }); return true; } @Override public boolean onPrepareOptionsMenu(Menu menu) { super.onPrepareOptionsMenu(menu); setVolumeControlStream(AudioManager.STREAM_NOTIFICATION); final View view = findCurrentView(R.id.console_flip); boolean activeTerminal = (view instanceof TerminalView); boolean sessionOpen = false; boolean disconnected = false; boolean canForwardPorts = false; if (activeTerminal) { TerminalBridge bridge = ((TerminalView) view).bridge; sessionOpen = bridge.isSessionOpen(); disconnected = bridge.isDisconnected(); canForwardPorts = bridge.canFowardPorts(); } disconnect.setEnabled(activeTerminal); if (sessionOpen || !disconnected) disconnect.setTitle(R.string.list_host_disconnect); else disconnect.setTitle(R.string.console_menu_close); copy.setEnabled(activeTerminal); paste.setEnabled(clipboard.hasText() && sessionOpen); portForward.setEnabled(sessionOpen && canForwardPorts); urlscan.setEnabled(activeTerminal); resize.setEnabled(sessionOpen); return true; } @Override public void onOptionsMenuClosed(Menu menu) { super.onOptionsMenuClosed(menu); setVolumeControlStream(AudioManager.STREAM_MUSIC); } @Override public void onStart() { super.onStart(); // connect with manager service to find all bridges // when connected it will insert all views bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); } @Override public void onPause() { super.onPause(); Log.d(TAG, "onPause called"); if (forcedOrientation && bound != null) bound.setResizeAllowed(false); } @Override public void onResume() { super.onResume(); Log.d(TAG, "onResume called"); // Make sure we don't let the screen fall asleep. // This also keeps the Wi-Fi chipset from disconnecting us. if (prefs.getBoolean(PreferenceConstants.KEEP_ALIVE, true)) { getWindow().addFlags(WindowManager.LayoutParams.FLAG_KEEP_SCREEN_ON); } else { getWindow().clearFlags(WindowManager.LayoutParams.FLAG_KEEP_SCREEN_ON); } configureOrientation(); if (forcedOrientation && bound != null) bound.setResizeAllowed(true); } /* (non-Javadoc) * @see android.app.Activity#onNewIntent(android.content.Intent) */ @Override protected void onNewIntent(Intent intent) { super.onNewIntent(intent); Log.d(TAG, "onNewIntent called"); requested = intent.getData(); if (requested == null) { Log.e(TAG, "Got null intent data in onNewIntent()"); return; } if (bound == null) { Log.e(TAG, "We're not bound in onNewIntent()"); return; } TerminalBridge requestedBridge = bound.getConnectedBridge(requested.getFragment()); int requestedIndex = 0; synchronized (flip) { if (requestedBridge == null) { // If we didn't find the requested connection, try opening it try { Log.d(TAG, String.format("We couldnt find an existing bridge with URI=%s (nickname=%s),"+ "so creating one now", requested.toString(), requested.getFragment())); requestedBridge = bound.openConnection(requested); } catch(Exception e) { Log.e(TAG, "Problem while trying to create new requested bridge from URI", e); // TODO: We should display an error dialog here. return; } requestedIndex = addNewTerminalView(requestedBridge); } else { final int flipIndex = getFlipIndex(requestedBridge); if (flipIndex > requestedIndex) { requestedIndex = flipIndex; } } setDisplayedTerminal(requestedIndex); } } @Override public void onStop() { super.onStop(); unbindService(connection); } protected void shiftCurrentTerminal(final int direction) { View overlay; synchronized (flip) { boolean shouldAnimate = flip.getChildCount() > 1; // Only show animation if there is something else to go to. if (shouldAnimate) { // keep current overlay from popping up again overlay = findCurrentView(R.id.terminal_overlay); if (overlay != null) overlay.startAnimation(fade_stay_hidden); if (direction == SHIFT_LEFT) { flip.setInAnimation(slide_left_in); flip.setOutAnimation(slide_left_out); flip.showNext(); } else if (direction == SHIFT_RIGHT) { flip.setInAnimation(slide_right_in); flip.setOutAnimation(slide_right_out); flip.showPrevious(); } } ConsoleActivity.this.updateDefault(); if (shouldAnimate) { // show overlay on new slide and start fade overlay = findCurrentView(R.id.terminal_overlay); if (overlay != null) overlay.startAnimation(fade_out_delayed); } updatePromptVisible(); } } /** * Save the currently shown {@link TerminalView} as the default. This is * saved back down into {@link TerminalManager} where we can read it again * later. */ private void updateDefault() { // update the current default terminal View view = findCurrentView(R.id.console_flip); if(!(view instanceof TerminalView)) return; TerminalView terminal = (TerminalView)view; if(bound == null) return; bound.defaultBridge = terminal.bridge; } protected void updateEmptyVisible() { // update visibility of empty status message empty.setVisibility((flip.getChildCount() == 0) ? View.VISIBLE : View.GONE); } /** * Show any prompts requested by the currently visible {@link TerminalView}. */ protected void updatePromptVisible() { // check if our currently-visible terminalbridge is requesting any prompt services View view = findCurrentView(R.id.console_flip); // Hide all the prompts in case a prompt request was canceled hideAllPrompts(); if(!(view instanceof TerminalView)) { // we dont have an active view, so hide any prompts return; } PromptHelper prompt = ((TerminalView)view).bridge.promptHelper; if(String.class.equals(prompt.promptRequested)) { stringPromptGroup.setVisibility(View.VISIBLE); String instructions = prompt.promptInstructions; if (instructions != null && instructions.length() > 0) { stringPromptInstructions.setVisibility(View.VISIBLE); stringPromptInstructions.setText(instructions); } else stringPromptInstructions.setVisibility(View.GONE); stringPrompt.setText(""); stringPrompt.setHint(prompt.promptHint); stringPrompt.requestFocus(); } else if(Boolean.class.equals(prompt.promptRequested)) { booleanPromptGroup.setVisibility(View.VISIBLE); booleanPrompt.setText(prompt.promptHint); booleanYes.requestFocus(); } else { hideAllPrompts(); view.requestFocus(); } } private class URLItemListener implements OnItemClickListener { private WeakReference<Context> contextRef; URLItemListener(Context context) { this.contextRef = new WeakReference<Context>(context); } public void onItemClick(AdapterView<?> arg0, View view, int position, long id) { Context context = contextRef.get(); if (context == null) return; try { TextView urlView = (TextView) view; String url = urlView.getText().toString(); if (url.indexOf("://") < 0) url = "http://" + url; Intent intent = new Intent(Intent.ACTION_VIEW, Uri.parse(url)); context.startActivity(intent); } catch (Exception e) { Log.e(TAG, "couldn't open URL", e); // We should probably tell the user that we couldn't find a handler... } } } @Override public void onConfigurationChanged(Configuration newConfig) { super.onConfigurationChanged(newConfig); Log.d(TAG, String.format("onConfigurationChanged; requestedOrientation=%d, newConfig.orientation=%d", getRequestedOrientation(), newConfig.orientation)); if (bound != null) { if (forcedOrientation && (newConfig.orientation != Configuration.ORIENTATION_LANDSCAPE && getRequestedOrientation() == ActivityInfo.SCREEN_ORIENTATION_LANDSCAPE) || (newConfig.orientation != Configuration.ORIENTATION_PORTRAIT && getRequestedOrientation() == ActivityInfo.SCREEN_ORIENTATION_PORTRAIT)) bound.setResizeAllowed(false); else bound.setResizeAllowed(true); bound.hardKeyboardHidden = (newConfig.hardKeyboardHidden == Configuration.HARDKEYBOARDHIDDEN_YES); mKeyboardButton.setVisibility(bound.hardKeyboardHidden ? View.VISIBLE : View.GONE); } } /** * Adds a new TerminalBridge to the current set of views in our ViewFlipper. * * @param bridge TerminalBridge to add to our ViewFlipper * @return the child index of the new view in the ViewFlipper */ private int addNewTerminalView(TerminalBridge bridge) { // let them know about our prompt handler services bridge.promptHelper.setHandler(promptHandler); // inflate each terminal view RelativeLayout view = (RelativeLayout)inflater.inflate(R.layout.item_terminal, flip, false); // set the terminal overlay text TextView overlay = (TextView)view.findViewById(R.id.terminal_overlay); overlay.setText(bridge.host.getNickname()); // and add our terminal view control, using index to place behind overlay TerminalView terminal = new TerminalView(ConsoleActivity.this, bridge); terminal.setId(R.id.console_flip); view.addView(terminal, 0); synchronized (flip) { // finally attach to the flipper flip.addView(view); return flip.getChildCount() - 1; } } private int getFlipIndex(TerminalBridge bridge) { synchronized (flip) { final int children = flip.getChildCount(); for (int i = 0; i < children; i++) { final View view = flip.getChildAt(i).findViewById(R.id.console_flip); if (view == null || !(view instanceof TerminalView)) { // How did that happen? continue; } final TerminalView tv = (TerminalView) view; if (tv.bridge == bridge) { return i; } } } return -1; } /** * Displays the child in the ViewFlipper at the requestedIndex and updates the prompts. * * @param requestedIndex the index of the terminal view to display */ private void setDisplayedTerminal(int requestedIndex) { synchronized (flip) { try { // show the requested bridge if found, also fade out overlay flip.setDisplayedChild(requestedIndex); flip.getCurrentView().findViewById(R.id.terminal_overlay) .startAnimation(fade_out_delayed); } catch (NullPointerException npe) { Log.d(TAG, "View went away when we were about to display it", npe); } updatePromptVisible(); updateEmptyVisible(); } } }
zzsuper001-linuxshell
src/org/connectbot/ConsoleActivity.java
Java
asf20
35,912
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.io.IOException; import android.app.Activity; import android.content.Intent; import android.content.res.AssetManager; import android.os.Bundle; import android.util.Log; import android.view.View; import android.view.View.OnClickListener; import android.widget.Button; import android.widget.LinearLayout; /** * @author Kenny Root * */ public class HelpActivity extends Activity { public final static String TAG = "ConnectBot.HelpActivity"; public final static String HELPDIR = "help"; public final static String SUFFIX = ".html"; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_help); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_help))); AssetManager am = this.getAssets(); LinearLayout content = (LinearLayout)this.findViewById(R.id.topics); try { for (String name : am.list(HELPDIR)) { if (name.endsWith(SUFFIX)) { Button button = new Button(this); final String topic = name.substring(0, name.length() - SUFFIX.length()); button.setText(topic); button.setOnClickListener(new OnClickListener() { public void onClick(View v) { Intent intent = new Intent(HelpActivity.this, HelpTopicActivity.class); intent.putExtra(Intent.EXTRA_TITLE, topic); HelpActivity.this.startActivity(intent); } }); content.addView(button); } } } catch (IOException e) { // TODO Auto-generated catch block Log.e(TAG, "couldn't get list of help assets", e); } } }
zzsuper001-linuxshell
src/org/connectbot/HelpActivity.java
Java
asf20
2,303
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.util.Arrays; import java.util.List; import org.connectbot.util.Colors; import org.connectbot.util.HostDatabase; import org.connectbot.util.UberColorPickerDialog; import org.connectbot.util.UberColorPickerDialog.OnColorChangedListener; import android.app.Activity; import android.content.Context; import android.graphics.Canvas; import android.graphics.Paint; import android.os.Bundle; import android.view.Menu; import android.view.MenuItem; import android.view.View; import android.view.ViewGroup; import android.view.MenuItem.OnMenuItemClickListener; import android.widget.AdapterView; import android.widget.BaseAdapter; import android.widget.GridView; import android.widget.Spinner; import android.widget.AdapterView.OnItemClickListener; import android.widget.AdapterView.OnItemSelectedListener; /** * @author Kenny Root * */ public class ColorsActivity extends Activity implements OnItemClickListener, OnColorChangedListener, OnItemSelectedListener { private GridView mColorGrid; private Spinner mFgSpinner; private Spinner mBgSpinner; private int mColorScheme; private List<Integer> mColorList; private HostDatabase hostdb; private int mCurrentColor = 0; private int[] mDefaultColors; @Override protected void onCreate(Bundle savedInstanceState) { super.onCreate(savedInstanceState); setContentView(R.layout.act_colors); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_colors))); mColorScheme = HostDatabase.DEFAULT_COLOR_SCHEME; hostdb = new HostDatabase(this); mColorList = Arrays.asList(hostdb.getColorsForScheme(mColorScheme)); mDefaultColors = hostdb.getDefaultColorsForScheme(mColorScheme); mColorGrid = (GridView) findViewById(R.id.color_grid); mColorGrid.setAdapter(new ColorsAdapter(true)); mColorGrid.setOnItemClickListener(this); mColorGrid.setSelection(0); mFgSpinner = (Spinner) findViewById(R.id.fg); mFgSpinner.setAdapter(new ColorsAdapter(false)); mFgSpinner.setSelection(mDefaultColors[0]); mFgSpinner.setOnItemSelectedListener(this); mBgSpinner = (Spinner) findViewById(R.id.bg); mBgSpinner.setAdapter(new ColorsAdapter(false)); mBgSpinner.setSelection(mDefaultColors[1]); mBgSpinner.setOnItemSelectedListener(this); } @Override protected void onDestroy() { super.onDestroy(); if (hostdb != null) { hostdb.close(); hostdb = null; } } @Override protected void onResume() { super.onResume(); if (hostdb == null) hostdb = new HostDatabase(this); } private class ColorsAdapter extends BaseAdapter { private boolean mSquareViews; public ColorsAdapter(boolean squareViews) { mSquareViews = squareViews; } public View getView(int position, View convertView, ViewGroup parent) { ColorView c; if (convertView == null) { c = new ColorView(ColorsActivity.this, mSquareViews); } else { c = (ColorView) convertView; } c.setColor(mColorList.get(position)); c.setNumber(position + 1); return c; } public int getCount() { return mColorList.size(); } public Object getItem(int position) { return mColorList.get(position); } public long getItemId(int position) { return position; } } private class ColorView extends View { private boolean mSquare; private Paint mTextPaint; private Paint mShadowPaint; // Things we paint private int mBackgroundColor; private String mText; private int mAscent; private int mWidthCenter; private int mHeightCenter; public ColorView(Context context, boolean square) { super(context); mSquare = square; mTextPaint = new Paint(); mTextPaint.setAntiAlias(true); mTextPaint.setTextSize(16); mTextPaint.setColor(0xFFFFFFFF); mTextPaint.setTextAlign(Paint.Align.CENTER); mShadowPaint = new Paint(mTextPaint); mShadowPaint.setStyle(Paint.Style.STROKE); mShadowPaint.setStrokeCap(Paint.Cap.ROUND); mShadowPaint.setStrokeJoin(Paint.Join.ROUND); mShadowPaint.setStrokeWidth(4f); mShadowPaint.setColor(0xFF000000); setPadding(10, 10, 10, 10); } public void setColor(int color) { mBackgroundColor = color; } public void setNumber(int number) { mText = Integer.toString(number); } @Override protected void onMeasure(int widthMeasureSpec, int heightMeasureSpec) { int width = measureWidth(widthMeasureSpec); int height; if (mSquare) height = width; else height = measureHeight(heightMeasureSpec); mAscent = (int) mTextPaint.ascent(); mWidthCenter = width / 2; mHeightCenter = height / 2 - mAscent / 2; setMeasuredDimension(width, height); } private int measureWidth(int measureSpec) { int result = 0; int specMode = MeasureSpec.getMode(measureSpec); int specSize = MeasureSpec.getSize(measureSpec); if (specMode == MeasureSpec.EXACTLY) { // We were told how big to be result = specSize; } else { // Measure the text result = (int) mTextPaint.measureText(mText) + getPaddingLeft() + getPaddingRight(); if (specMode == MeasureSpec.AT_MOST) { // Respect AT_MOST value if that was what is called for by // measureSpec result = Math.min(result, specSize); } } return result; } private int measureHeight(int measureSpec) { int result = 0; int specMode = MeasureSpec.getMode(measureSpec); int specSize = MeasureSpec.getSize(measureSpec); mAscent = (int) mTextPaint.ascent(); if (specMode == MeasureSpec.EXACTLY) { // We were told how big to be result = specSize; } else { // Measure the text (beware: ascent is a negative number) result = (int) (-mAscent + mTextPaint.descent()) + getPaddingTop() + getPaddingBottom(); if (specMode == MeasureSpec.AT_MOST) { // Respect AT_MOST value if that was what is called for by // measureSpec result = Math.min(result, specSize); } } return result; } @Override protected void onDraw(Canvas canvas) { super.onDraw(canvas); canvas.drawColor(mBackgroundColor); canvas.drawText(mText, mWidthCenter, mHeightCenter, mShadowPaint); canvas.drawText(mText, mWidthCenter, mHeightCenter, mTextPaint); } } private void editColor(int colorNumber) { mCurrentColor = colorNumber; new UberColorPickerDialog(this, this, mColorList.get(colorNumber)).show(); } public void onItemClick(AdapterView<?> parent, View view, int position, long id) { editColor(position); } public void onNothingSelected(AdapterView<?> arg0) { } public void colorChanged(int value) { hostdb.setGlobalColor(mCurrentColor, value); mColorList.set(mCurrentColor, value); mColorGrid.invalidateViews(); } public void onItemSelected(AdapterView<?> parent, View view, int position, long id) { boolean needUpdate = false; if (parent == mFgSpinner) { if (position != mDefaultColors[0]) { mDefaultColors[0] = position; needUpdate = true; } } else if (parent == mBgSpinner) { if (position != mDefaultColors[1]) { mDefaultColors[1] = position; needUpdate = true; } } if (needUpdate) hostdb.setDefaultColorsForScheme(mColorScheme, mDefaultColors[0], mDefaultColors[1]); } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); MenuItem reset = menu.add(R.string.menu_colors_reset); reset.setAlphabeticShortcut('r'); reset.setNumericShortcut('1'); reset.setIcon(android.R.drawable.ic_menu_revert); reset.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem arg0) { // Reset each individual color to defaults. for (int i = 0; i < Colors.defaults.length; i++) { if (mColorList.get(i) != Colors.defaults[i]) { hostdb.setGlobalColor(i, Colors.defaults[i]); mColorList.set(i, Colors.defaults[i]); } } mColorGrid.invalidateViews(); // Reset the default FG/BG colors as well. mFgSpinner.setSelection(HostDatabase.DEFAULT_FG_COLOR); mBgSpinner.setSelection(HostDatabase.DEFAULT_BG_COLOR); hostdb.setDefaultColorsForScheme(HostDatabase.DEFAULT_COLOR_SCHEME, HostDatabase.DEFAULT_FG_COLOR, HostDatabase.DEFAULT_BG_COLOR); return true; } }); return true; } }
zzsuper001-linuxshell
src/org/connectbot/ColorsActivity.java
Java
asf20
8,959
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.net.InetAddress; import java.net.InetSocketAddress; import java.security.NoSuchAlgorithmException; import java.security.PrivateKey; import java.security.PublicKey; import java.security.spec.InvalidKeySpecException; import java.util.Arrays; import java.util.HashMap; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Map.Entry; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.bean.PubkeyBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.service.TerminalManager.KeyHolder; import org.connectbot.util.HostDatabase; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import android.content.Context; import android.net.Uri; import android.util.Log; import com.trilead.ssh2.AuthAgentCallback; import com.trilead.ssh2.ChannelCondition; import com.trilead.ssh2.Connection; import com.trilead.ssh2.ConnectionInfo; import com.trilead.ssh2.ConnectionMonitor; import com.trilead.ssh2.DynamicPortForwarder; import com.trilead.ssh2.InteractiveCallback; import com.trilead.ssh2.KnownHosts; import com.trilead.ssh2.LocalPortForwarder; import com.trilead.ssh2.ServerHostKeyVerifier; import com.trilead.ssh2.Session; import com.trilead.ssh2.crypto.PEMDecoder; import com.trilead.ssh2.signature.DSAPrivateKey; import com.trilead.ssh2.signature.DSAPublicKey; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.RSAPrivateKey; import com.trilead.ssh2.signature.RSAPublicKey; import com.trilead.ssh2.signature.RSASHA1Verify; /** * @author Kenny Root * */ public class SSH extends AbsTransport implements ConnectionMonitor, InteractiveCallback, AuthAgentCallback { public SSH() { super(); } /** * @param bridge * @param db */ public SSH(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } private static final String PROTOCOL = "ssh"; private static final String TAG = "ConnectBot.SSH"; private static final int DEFAULT_PORT = 22; private static final String AUTH_PUBLICKEY = "publickey", AUTH_PASSWORD = "password", AUTH_KEYBOARDINTERACTIVE = "keyboard-interactive"; private final static int AUTH_TRIES = 20; static final Pattern hostmask; static { hostmask = Pattern.compile("^(.+)@([0-9a-z.-]+)(:(\\d+))?$", Pattern.CASE_INSENSITIVE); } private boolean compression = false; private volatile boolean authenticated = false; private volatile boolean connected = false; private volatile boolean sessionOpen = false; private boolean pubkeysExhausted = false; private boolean interactiveCanContinue = true; private Connection connection; private Session session; private ConnectionInfo connectionInfo; private OutputStream stdin; private InputStream stdout; private InputStream stderr; private static final int conditions = ChannelCondition.STDOUT_DATA | ChannelCondition.STDERR_DATA | ChannelCondition.CLOSED | ChannelCondition.EOF; private List<PortForwardBean> portForwards = new LinkedList<PortForwardBean>(); private int columns; private int rows; private int width; private int height; private String useAuthAgent = HostDatabase.AUTHAGENT_NO; private String agentLockPassphrase; public class HostKeyVerifier implements ServerHostKeyVerifier { public boolean verifyServerHostKey(String hostname, int port, String serverHostKeyAlgorithm, byte[] serverHostKey) throws IOException { // read in all known hosts from hostdb KnownHosts hosts = manager.hostdb.getKnownHosts(); Boolean result; String matchName = String.format("%s:%d", hostname, port); String fingerprint = KnownHosts.createHexFingerprint(serverHostKeyAlgorithm, serverHostKey); String algorithmName; if ("ssh-rsa".equals(serverHostKeyAlgorithm)) algorithmName = "RSA"; else if ("ssh-dss".equals(serverHostKeyAlgorithm)) algorithmName = "DSA"; else algorithmName = serverHostKeyAlgorithm; switch(hosts.verifyHostkey(matchName, serverHostKeyAlgorithm, serverHostKey)) { case KnownHosts.HOSTKEY_IS_OK: bridge.outputLine(manager.res.getString(R.string.terminal_sucess, algorithmName, fingerprint)); return true; case KnownHosts.HOSTKEY_IS_NEW: // prompt user bridge.outputLine(manager.res.getString(R.string.host_authenticity_warning, hostname)); bridge.outputLine(manager.res.getString(R.string.host_fingerprint, algorithmName, fingerprint)); result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_continue_connecting)); if(result == null) return false; if(result.booleanValue()) { // save this key in known database manager.hostdb.saveKnownHost(hostname, port, serverHostKeyAlgorithm, serverHostKey); } return result.booleanValue(); case KnownHosts.HOSTKEY_HAS_CHANGED: String header = String.format("@ %s @", manager.res.getString(R.string.host_verification_failure_warning_header)); char[] atsigns = new char[header.length()]; Arrays.fill(atsigns, '@'); String border = new String(atsigns); bridge.outputLine(border); bridge.outputLine(manager.res.getString(R.string.host_verification_failure_warning)); bridge.outputLine(border); bridge.outputLine(String.format(manager.res.getString(R.string.host_fingerprint), algorithmName, fingerprint)); // Users have no way to delete keys, so we'll prompt them for now. result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_continue_connecting)); if(result == null) return false; if(result.booleanValue()) { // save this key in known database manager.hostdb.saveKnownHost(hostname, port, serverHostKeyAlgorithm, serverHostKey); } return result.booleanValue(); default: return false; } } } private void authenticate() { try { if (connection.authenticateWithNone(host.getUsername())) { finishConnection(); return; } } catch(Exception e) { Log.d(TAG, "Host does not support 'none' authentication."); } bridge.outputLine(manager.res.getString(R.string.terminal_auth)); try { long pubkeyId = host.getPubkeyId(); if (!pubkeysExhausted && pubkeyId != HostDatabase.PUBKEYID_NEVER && connection.isAuthMethodAvailable(host.getUsername(), AUTH_PUBLICKEY)) { // if explicit pubkey defined for this host, then prompt for password as needed // otherwise just try all in-memory keys held in terminalmanager if (pubkeyId == HostDatabase.PUBKEYID_ANY) { // try each of the in-memory keys bridge.outputLine(manager.res .getString(R.string.terminal_auth_pubkey_any)); for (Entry<String, KeyHolder> entry : manager.loadedKeypairs.entrySet()) { if (entry.getValue().bean.isConfirmUse() && !promptForPubkeyUse(entry.getKey())) continue; if (this.tryPublicKey(host.getUsername(), entry.getKey(), entry.getValue().trileadKey)) { finishConnection(); break; } } } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_specific)); // use a specific key for this host, as requested PubkeyBean pubkey = manager.pubkeydb.findPubkeyById(pubkeyId); if (pubkey == null) bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_invalid)); else if (tryPublicKey(pubkey)) finishConnection(); } pubkeysExhausted = true; } else if (interactiveCanContinue && connection.isAuthMethodAvailable(host.getUsername(), AUTH_KEYBOARDINTERACTIVE)) { // this auth method will talk with us using InteractiveCallback interface // it blocks until authentication finishes bridge.outputLine(manager.res.getString(R.string.terminal_auth_ki)); interactiveCanContinue = false; if(connection.authenticateWithKeyboardInteractive(host.getUsername(), this)) { finishConnection(); } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_ki_fail)); } } else if (connection.isAuthMethodAvailable(host.getUsername(), AUTH_PASSWORD)) { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pass)); String password = bridge.getPromptHelper().requestStringPrompt(null, manager.res.getString(R.string.prompt_password)); if (password != null && connection.authenticateWithPassword(host.getUsername(), password)) { finishConnection(); } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_pass_fail)); } } else { bridge.outputLine(manager.res.getString(R.string.terminal_auth_fail)); } } catch (IllegalStateException e) { Log.e(TAG, "Connection went away while we were trying to authenticate", e); return; } catch(Exception e) { Log.e(TAG, "Problem during handleAuthentication()", e); } } /** * Attempt connection with database row pointed to by cursor. * @param cursor * @return true for successful authentication * @throws NoSuchAlgorithmException * @throws InvalidKeySpecException * @throws IOException */ private boolean tryPublicKey(PubkeyBean pubkey) throws NoSuchAlgorithmException, InvalidKeySpecException, IOException { Object trileadKey = null; if(manager.isKeyLoaded(pubkey.getNickname())) { // load this key from memory if its already there Log.d(TAG, String.format("Found unlocked key '%s' already in-memory", pubkey.getNickname())); if (pubkey.isConfirmUse()) { if (!promptForPubkeyUse(pubkey.getNickname())) return false; } trileadKey = manager.getKey(pubkey.getNickname()); } else { // otherwise load key from database and prompt for password as needed String password = null; if (pubkey.isEncrypted()) { password = bridge.getPromptHelper().requestStringPrompt(null, manager.res.getString(R.string.prompt_pubkey_password, pubkey.getNickname())); // Something must have interrupted the prompt. if (password == null) return false; } if(PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType())) { // load specific key using pem format trileadKey = PEMDecoder.decode(new String(pubkey.getPrivateKey()).toCharArray(), password); } else { // load using internal generated format PrivateKey privKey; try { privKey = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType(), password); } catch (Exception e) { String message = String.format("Bad password for key '%s'. Authentication failed.", pubkey.getNickname()); Log.e(TAG, message, e); bridge.outputLine(message); return false; } PublicKey pubKey = pubkey.getPublicKey(); // convert key to trilead format trileadKey = PubkeyUtils.convertToTrilead(privKey, pubKey); Log.d(TAG, "Unlocked key " + PubkeyUtils.formatKey(pubKey)); } Log.d(TAG, String.format("Unlocked key '%s'", pubkey.getNickname())); // save this key in memory manager.addKey(pubkey, trileadKey); } return tryPublicKey(host.getUsername(), pubkey.getNickname(), trileadKey); } private boolean tryPublicKey(String username, String keyNickname, Object trileadKey) throws IOException { //bridge.outputLine(String.format("Attempting 'publickey' with key '%s' [%s]...", keyNickname, trileadKey.toString())); boolean success = connection.authenticateWithPublicKey(username, trileadKey); if(!success) bridge.outputLine(manager.res.getString(R.string.terminal_auth_pubkey_fail, keyNickname)); return success; } /** * Internal method to request actual PTY terminal once we've finished * authentication. If called before authenticated, it will just fail. */ private void finishConnection() { authenticated = true; for (PortForwardBean portForward : portForwards) { try { enablePortForward(portForward); bridge.outputLine(manager.res.getString(R.string.terminal_enable_portfoward, portForward.getDescription())); } catch (Exception e) { Log.e(TAG, "Error setting up port forward during connect", e); } } if (!host.getWantSession()) { bridge.outputLine(manager.res.getString(R.string.terminal_no_session)); bridge.onConnected(); return; } try { session = connection.openSession(); if (!useAuthAgent.equals(HostDatabase.AUTHAGENT_NO)) session.requestAuthAgentForwarding(this); session.requestPTY(getEmulation(), columns, rows, width, height, null); session.startShell(); stdin = session.getStdin(); stdout = session.getStdout(); stderr = session.getStderr(); sessionOpen = true; bridge.onConnected(); } catch (IOException e1) { Log.e(TAG, "Problem while trying to create PTY in finishConnection()", e1); } } @Override public void connect() { connection = new Connection(host.getHostname(), host.getPort()); connection.addConnectionMonitor(this); try { connection.setCompression(compression); } catch (IOException e) { Log.e(TAG, "Could not enable compression!", e); } try { /* Uncomment when debugging SSH protocol: DebugLogger logger = new DebugLogger() { public void log(int level, String className, String message) { Log.d("SSH", message); } }; Logger.enabled = true; Logger.logger = logger; */ connectionInfo = connection.connect(new HostKeyVerifier()); connected = true; if (connectionInfo.clientToServerCryptoAlgorithm .equals(connectionInfo.serverToClientCryptoAlgorithm) && connectionInfo.clientToServerMACAlgorithm .equals(connectionInfo.serverToClientMACAlgorithm)) { bridge.outputLine(manager.res.getString(R.string.terminal_using_algorithm, connectionInfo.clientToServerCryptoAlgorithm, connectionInfo.clientToServerMACAlgorithm)); } else { bridge.outputLine(manager.res.getString( R.string.terminal_using_c2s_algorithm, connectionInfo.clientToServerCryptoAlgorithm, connectionInfo.clientToServerMACAlgorithm)); bridge.outputLine(manager.res.getString( R.string.terminal_using_s2c_algorithm, connectionInfo.serverToClientCryptoAlgorithm, connectionInfo.serverToClientMACAlgorithm)); } } catch (IOException e) { Log.e(TAG, "Problem in SSH connection thread during authentication", e); // Display the reason in the text. bridge.outputLine(e.getCause().getMessage()); onDisconnect(); return; } try { // enter a loop to keep trying until authentication int tries = 0; while (connected && !connection.isAuthenticationComplete() && tries++ < AUTH_TRIES) { authenticate(); // sleep to make sure we dont kill system Thread.sleep(1000); } } catch(Exception e) { Log.e(TAG, "Problem in SSH connection thread during authentication", e); } } @Override public void close() { connected = false; if (session != null) { session.close(); session = null; } if (connection != null) { connection.close(); connection = null; } } private void onDisconnect() { close(); bridge.dispatchDisconnect(false); } @Override public void flush() throws IOException { if (stdin != null) stdin.flush(); } @Override public int read(byte[] buffer, int start, int len) throws IOException { int bytesRead = 0; if (session == null) return 0; int newConditions = session.waitForCondition(conditions, 0); if ((newConditions & ChannelCondition.STDOUT_DATA) != 0) { bytesRead = stdout.read(buffer, start, len); } if ((newConditions & ChannelCondition.STDERR_DATA) != 0) { byte discard[] = new byte[256]; while (stderr.available() > 0) { stderr.read(discard); } } if ((newConditions & ChannelCondition.EOF) != 0) { onDisconnect(); throw new IOException("Remote end closed connection"); } return bytesRead; } @Override public void write(byte[] buffer) throws IOException { if (stdin != null) stdin.write(buffer); } @Override public void write(int c) throws IOException { if (stdin != null) stdin.write(c); } @Override public Map<String, String> getOptions() { Map<String, String> options = new HashMap<String, String>(); options.put("compression", Boolean.toString(compression)); return options; } @Override public void setOptions(Map<String, String> options) { if (options.containsKey("compression")) compression = Boolean.parseBoolean(options.get("compression")); } public static String getProtocolName() { return PROTOCOL; } @Override public boolean isSessionOpen() { return sessionOpen; } @Override public boolean isConnected() { return connected; } public void connectionLost(Throwable reason) { onDisconnect(); } @Override public boolean canForwardPorts() { return true; } @Override public List<PortForwardBean> getPortForwards() { return portForwards; } @Override public boolean addPortForward(PortForwardBean portForward) { return portForwards.add(portForward); } @Override public boolean removePortForward(PortForwardBean portForward) { // Make sure we don't have a phantom forwarder. disablePortForward(portForward); return portForwards.remove(portForward); } @Override public boolean enablePortForward(PortForwardBean portForward) { if (!portForwards.contains(portForward)) { Log.e(TAG, "Attempt to enable port forward not in list"); return false; } if (!authenticated) return false; if (HostDatabase.PORTFORWARD_LOCAL.equals(portForward.getType())) { LocalPortForwarder lpf = null; try { lpf = connection.createLocalPortForwarder( new InetSocketAddress(InetAddress.getLocalHost(), portForward.getSourcePort()), portForward.getDestAddr(), portForward.getDestPort()); } catch (Exception e) { Log.e(TAG, "Could not create local port forward", e); return false; } if (lpf == null) { Log.e(TAG, "returned LocalPortForwarder object is null"); return false; } portForward.setIdentifier(lpf); portForward.setEnabled(true); return true; } else if (HostDatabase.PORTFORWARD_REMOTE.equals(portForward.getType())) { try { connection.requestRemotePortForwarding("", portForward.getSourcePort(), portForward.getDestAddr(), portForward.getDestPort()); } catch (Exception e) { Log.e(TAG, "Could not create remote port forward", e); return false; } portForward.setEnabled(true); return true; } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(portForward.getType())) { DynamicPortForwarder dpf = null; try { dpf = connection.createDynamicPortForwarder( new InetSocketAddress(InetAddress.getLocalHost(), portForward.getSourcePort())); } catch (Exception e) { Log.e(TAG, "Could not create dynamic port forward", e); return false; } portForward.setIdentifier(dpf); portForward.setEnabled(true); return true; } else { // Unsupported type Log.e(TAG, String.format("attempt to forward unknown type %s", portForward.getType())); return false; } } @Override public boolean disablePortForward(PortForwardBean portForward) { if (!portForwards.contains(portForward)) { Log.e(TAG, "Attempt to disable port forward not in list"); return false; } if (!authenticated) return false; if (HostDatabase.PORTFORWARD_LOCAL.equals(portForward.getType())) { LocalPortForwarder lpf = null; lpf = (LocalPortForwarder)portForward.getIdentifier(); if (!portForward.isEnabled() || lpf == null) { Log.d(TAG, String.format("Could not disable %s; it appears to be not enabled or have no handler", portForward.getNickname())); return false; } portForward.setEnabled(false); try { lpf.close(); } catch (IOException e) { Log.e(TAG, "Could not stop local port forwarder, setting enabled to false", e); return false; } return true; } else if (HostDatabase.PORTFORWARD_REMOTE.equals(portForward.getType())) { portForward.setEnabled(false); try { connection.cancelRemotePortForwarding(portForward.getSourcePort()); } catch (IOException e) { Log.e(TAG, "Could not stop remote port forwarding, setting enabled to false", e); return false; } return true; } else if (HostDatabase.PORTFORWARD_DYNAMIC5.equals(portForward.getType())) { DynamicPortForwarder dpf = null; dpf = (DynamicPortForwarder)portForward.getIdentifier(); if (!portForward.isEnabled() || dpf == null) { Log.d(TAG, String.format("Could not disable %s; it appears to be not enabled or have no handler", portForward.getNickname())); return false; } portForward.setEnabled(false); try { dpf.close(); } catch (IOException e) { Log.e(TAG, "Could not stop dynamic port forwarder, setting enabled to false", e); return false; } return true; } else { // Unsupported type Log.e(TAG, String.format("attempt to forward unknown type %s", portForward.getType())); return false; } } @Override public void setDimensions(int columns, int rows, int width, int height) { this.columns = columns; this.rows = rows; if (sessionOpen) { try { session.resizePTY(columns, rows, width, height); } catch (IOException e) { Log.e(TAG, "Couldn't send resize PTY packet", e); } } } @Override public int getDefaultPort() { return DEFAULT_PORT; } @Override public String getDefaultNickname(String username, String hostname, int port) { if (port == DEFAULT_PORT) { return String.format("%s@%s", username, hostname); } else { return String.format("%s@%s:%d", username, hostname, port); } } public static Uri getUri(String input) { Matcher matcher = hostmask.matcher(input); if (!matcher.matches()) return null; StringBuilder sb = new StringBuilder(); sb.append(PROTOCOL) .append("://") .append(Uri.encode(matcher.group(1))) .append('@') .append(matcher.group(2)); String portString = matcher.group(4); int port = DEFAULT_PORT; if (portString != null) { try { port = Integer.parseInt(portString); if (port < 1 || port > 65535) { port = DEFAULT_PORT; } } catch (NumberFormatException nfe) { // Keep the default port } } if (port != DEFAULT_PORT) { sb.append(':') .append(port); } sb.append("/#") .append(Uri.encode(input)); Uri uri = Uri.parse(sb.toString()); return uri; } /** * Handle challenges from keyboard-interactive authentication mode. */ public String[] replyToChallenge(String name, String instruction, int numPrompts, String[] prompt, boolean[] echo) { interactiveCanContinue = true; String[] responses = new String[numPrompts]; for(int i = 0; i < numPrompts; i++) { // request response from user for each prompt responses[i] = bridge.promptHelper.requestStringPrompt(instruction, prompt[i]); } return responses; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); host.setHostname(uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; host.setPort(port); host.setUsername(uri.getUserInfo()); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); selection.put(HostDatabase.FIELD_HOST_HOSTNAME, uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; selection.put(HostDatabase.FIELD_HOST_PORT, Integer.toString(port)); selection.put(HostDatabase.FIELD_HOST_USERNAME, uri.getUserInfo()); } @Override public void setCompression(boolean compression) { this.compression = compression; } public static String getFormatHint(Context context) { return String.format("%s@%s:%s", context.getString(R.string.format_username), context.getString(R.string.format_hostname), context.getString(R.string.format_port)); } @Override public void setUseAuthAgent(String useAuthAgent) { this.useAuthAgent = useAuthAgent; } public Map<String,byte[]> retrieveIdentities() { Map<String,byte[]> pubKeys = new HashMap<String,byte[]>(manager.loadedKeypairs.size()); for (Entry<String,KeyHolder> entry : manager.loadedKeypairs.entrySet()) { Object trileadKey = entry.getValue().trileadKey; try { if (trileadKey instanceof RSAPrivateKey) { RSAPublicKey pubkey = ((RSAPrivateKey) trileadKey).getPublicKey(); pubKeys.put(entry.getKey(), RSASHA1Verify.encodeSSHRSAPublicKey(pubkey)); } else if (trileadKey instanceof DSAPrivateKey) { DSAPublicKey pubkey = ((DSAPrivateKey) trileadKey).getPublicKey(); pubKeys.put(entry.getKey(), DSASHA1Verify.encodeSSHDSAPublicKey(pubkey)); } else continue; } catch (IOException e) { continue; } } return pubKeys; } public Object getPrivateKey(byte[] publicKey) { String nickname = manager.getKeyNickname(publicKey); if (nickname == null) return null; if (useAuthAgent.equals(HostDatabase.AUTHAGENT_NO)) { Log.e(TAG, ""); return null; } else if (useAuthAgent.equals(HostDatabase.AUTHAGENT_CONFIRM) || manager.loadedKeypairs.get(nickname).bean.isConfirmUse()) { if (!promptForPubkeyUse(nickname)) return null; } return manager.getKey(nickname); } private boolean promptForPubkeyUse(String nickname) { Boolean result = bridge.promptHelper.requestBooleanPrompt(null, manager.res.getString(R.string.prompt_allow_agent_to_use_key, nickname)); return result; } public boolean addIdentity(Object key, String comment, boolean confirmUse, int lifetime) { PubkeyBean pubkey = new PubkeyBean(); // pubkey.setType(PubkeyDatabase.KEY_TYPE_IMPORTED); pubkey.setNickname(comment); pubkey.setConfirmUse(confirmUse); pubkey.setLifetime(lifetime); manager.addKey(pubkey, key); return true; } public boolean removeAllIdentities() { manager.loadedKeypairs.clear(); return true; } public boolean removeIdentity(byte[] publicKey) { return manager.removeKey(publicKey); } public boolean isAgentLocked() { return agentLockPassphrase != null; } public boolean requestAgentUnlock(String unlockPassphrase) { if (agentLockPassphrase == null) return false; if (agentLockPassphrase.equals(unlockPassphrase)) agentLockPassphrase = null; return agentLockPassphrase == null; } public boolean setAgentLock(String lockPassphrase) { if (agentLockPassphrase != null) return false; agentLockPassphrase = lockPassphrase; return true; } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return true; } }
zzsuper001-linuxshell
src/org/connectbot/transport/SSH.java
Java
asf20
27,883
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.FileDescriptor; import java.io.FileInputStream; import java.io.FileOutputStream; import java.io.IOException; import java.util.Map; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; import com.google.ase.Exec; /** * @author Kenny Root * */ public class Local extends AbsTransport { private static final String TAG = "ConnectBot.Local"; private static final String PROTOCOL = "local"; private static final String DEFAULT_URI = "local:#Local"; private FileDescriptor shellFd; private FileInputStream is; private FileOutputStream os; /** * */ public Local() { } /** * @param host * @param bridge * @param manager */ public Local(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } public static String getProtocolName() { return PROTOCOL; } @Override public void close() { try { if (os != null) { os.close(); os = null; } if (is != null) { is.close(); is = null; } } catch (IOException e) { Log.e(TAG, "Couldn't close shell", e); } } @Override public void connect() { int[] pids = new int[1]; try { shellFd = Exec.createSubprocess("/system/bin/sh", "-", null, pids); } catch (Exception e) { bridge.outputLine(manager.res.getString(R.string.local_shell_unavailable)); Log.e(TAG, "Cannot start local shell", e); return; } final int shellPid = pids[0]; Runnable exitWatcher = new Runnable() { public void run() { Exec.waitFor(shellPid); bridge.dispatchDisconnect(false); } }; Thread exitWatcherThread = new Thread(exitWatcher); exitWatcherThread.setName("LocalExitWatcher"); exitWatcherThread.setDaemon(true); exitWatcherThread.start(); is = new FileInputStream(shellFd); os = new FileOutputStream(shellFd); bridge.onConnected(); } @Override public void flush() throws IOException { os.flush(); } @Override public String getDefaultNickname(String username, String hostname, int port) { return DEFAULT_URI; } @Override public int getDefaultPort() { return 0; } @Override public boolean isConnected() { return is != null && os != null; } @Override public boolean isSessionOpen() { return is != null && os != null; } @Override public int read(byte[] buffer, int start, int len) throws IOException { if (is == null) { bridge.dispatchDisconnect(false); throw new IOException("session closed"); } return is.read(buffer, start, len); } @Override public void setDimensions(int columns, int rows, int width, int height) { try { Exec.setPtyWindowSize(shellFd, rows, columns, width, height); } catch (Exception e) { Log.e(TAG, "Couldn't resize pty", e); } } @Override public void write(byte[] buffer) throws IOException { if (os != null) os.write(buffer); } @Override public void write(int c) throws IOException { if (os != null) os.write(c); } public static Uri getUri(String input) { Uri uri = Uri.parse(DEFAULT_URI); if (input != null && input.length() > 0) { uri = uri.buildUpon().fragment(input).build(); } return uri; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); } public static String getFormatHint(Context context) { return context.getString(R.string.hostpref_nickname_title); } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return false; } }
zzsuper001-linuxshell
src/org/connectbot/transport/Local.java
Java
asf20
4,926
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.util.List; import java.util.Map; import org.connectbot.bean.HostBean; import org.connectbot.bean.PortForwardBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import android.content.Context; import android.net.Uri; /** * @author Kenny Root * */ public abstract class AbsTransport { HostBean host; TerminalBridge bridge; TerminalManager manager; String emulation; public AbsTransport() {} public AbsTransport(HostBean host, TerminalBridge bridge, TerminalManager manager) { this.host = host; this.bridge = bridge; this.manager = manager; } /** * @return protocol part of the URI */ public static String getProtocolName() { return "unknown"; } /** * Encode the current transport into a URI that can be passed via intent calls. * @return URI to host */ public static Uri getUri(String input) { return null; } /** * Causes transport to connect to the target host. After connecting but before a * session is started, must call back to {@link TerminalBridge#onConnected()}. * After that call a session may be opened. */ public abstract void connect(); /** * Reads from the transport. Transport must support reading into a the byte array * <code>buffer</code> at the start of <code>offset</code> and a maximum of * <code>length</code> bytes. If the remote host disconnects, throw an * {@link IOException}. * @param buffer byte buffer to store read bytes into * @param offset where to start writing in the buffer * @param length maximum number of bytes to read * @return number of bytes read * @throws IOException when remote host disconnects */ public abstract int read(byte[] buffer, int offset, int length) throws IOException; /** * Writes to the transport. If the host is not yet connected, simply return without * doing anything. An {@link IOException} should be thrown if there is an error after * connection. * @param buffer bytes to write to transport * @throws IOException when there is a problem writing after connection */ public abstract void write(byte[] buffer) throws IOException; /** * Writes to the transport. See {@link #write(byte[])} for behavior details. * @param c character to write to the transport * @throws IOException when there is a problem writing after connection */ public abstract void write(int c) throws IOException; /** * Flushes the write commands to the transport. * @throws IOException when there is a problem writing after connection */ public abstract void flush() throws IOException; /** * Closes the connection to the terminal. Note that the resulting failure to read * should call {@link TerminalBridge#dispatchDisconnect(boolean)}. */ public abstract void close(); /** * Tells the transport what dimensions the display is currently * @param columns columns of text * @param rows rows of text * @param width width in pixels * @param height height in pixels */ public abstract void setDimensions(int columns, int rows, int width, int height); public void setOptions(Map<String,String> options) { // do nothing } public Map<String,String> getOptions() { return null; } public void setCompression(boolean compression) { // do nothing } public void setUseAuthAgent(String useAuthAgent) { // do nothing } public void setEmulation(String emulation) { this.emulation = emulation; } public String getEmulation() { return emulation; } public void setHost(HostBean host) { this.host = host; } public void setBridge(TerminalBridge bridge) { this.bridge = bridge; } public void setManager(TerminalManager manager) { this.manager = manager; } /** * Whether or not this transport type can forward ports. * @return true on ability to forward ports */ public boolean canForwardPorts() { return false; } /** * Adds the {@link PortForwardBean} to the list. * @param portForward the port forward bean to add * @return true on successful addition */ public boolean addPortForward(PortForwardBean portForward) { return false; } /** * Enables a port forward member. After calling this method, the port forward should * be operational iff it could be enabled by the transport. * @param portForward member of our current port forwards list to enable * @return true on successful port forward setup */ public boolean enablePortForward(PortForwardBean portForward) { return false; } /** * Disables a port forward member. After calling this method, the port forward should * be non-functioning iff it could be disabled by the transport. * @param portForward member of our current port forwards list to enable * @return true on successful port forward tear-down */ public boolean disablePortForward(PortForwardBean portForward) { return false; } /** * Removes the {@link PortForwardBean} from the available port forwards. * @param portForward the port forward bean to remove * @return true on successful removal */ public boolean removePortForward(PortForwardBean portForward) { return false; } /** * Gets a list of the {@link PortForwardBean} currently used by this transport. * @return the list of port forwards */ public List<PortForwardBean> getPortForwards() { return null; } public abstract boolean isConnected(); public abstract boolean isSessionOpen(); /** * @return int default port for protocol */ public abstract int getDefaultPort(); /** * @param username * @param hostname * @param port * @return */ public abstract String getDefaultNickname(String username, String hostname, int port); /** * @param uri * @param selectionKeys * @param selectionValues */ public abstract void getSelectionArgs(Uri uri, Map<String, String> selection); /** * @param uri * @return */ public abstract HostBean createHost(Uri uri); /** * @param context context containing the correct resources * @return string that hints at the format for connection */ public static String getFormatHint(Context context) { return "???"; } /** * @return */ public abstract boolean usesNetwork(); }
zzsuper001-linuxshell
src/org/connectbot/transport/AbsTransport.java
Java
asf20
6,911
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.net.Socket; import java.net.SocketException; import java.net.UnknownHostException; import java.nio.charset.Charset; import java.util.Map; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.R; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; import de.mud.telnet.TelnetProtocolHandler; /** * Telnet transport implementation.<br/> * Original idea from the JTA telnet package (de.mud.telnet) * * @author Kenny Root * */ public class Telnet extends AbsTransport { private static final String TAG = "ConnectBot.Telnet"; private static final String PROTOCOL = "telnet"; private static final int DEFAULT_PORT = 23; private TelnetProtocolHandler handler; private Socket socket; private InputStream is; private OutputStream os; private int width; private int height; private boolean connected = false; static final Pattern hostmask; static { hostmask = Pattern.compile("^([0-9a-z.-]+)(:(\\d+))?$", Pattern.CASE_INSENSITIVE); } public Telnet() { handler = new TelnetProtocolHandler() { /** get the current terminal type */ @Override public String getTerminalType() { return getEmulation(); } /** get the current window size */ @Override public int[] getWindowSize() { return new int[] { width, height }; } /** notify about local echo */ @Override public void setLocalEcho(boolean echo) { /* EMPTY */ } /** write data to our back end */ @Override public void write(byte[] b) throws IOException { if (os != null) os.write(b); } /** sent on IAC EOR (prompt terminator for remote access systems). */ @Override public void notifyEndOfRecord() { } @Override protected String getCharsetName() { Charset charset = bridge.getCharset(); if (charset != null) return charset.name(); else return ""; } }; } /** * @param host * @param bridge * @param manager */ public Telnet(HostBean host, TerminalBridge bridge, TerminalManager manager) { super(host, bridge, manager); } public static String getProtocolName() { return PROTOCOL; } @Override public void connect() { try { socket = new Socket(host.getHostname(), host.getPort()); connected = true; is = socket.getInputStream(); os = socket.getOutputStream(); bridge.onConnected(); } catch (UnknownHostException e) { Log.d(TAG, "IO Exception connecting to host", e); } catch (IOException e) { Log.d(TAG, "IO Exception connecting to host", e); } } @Override public void close() { connected = false; if (socket != null) try { socket.close(); socket = null; } catch (IOException e) { Log.d(TAG, "Error closing telnet socket.", e); } } @Override public void flush() throws IOException { os.flush(); } @Override public int getDefaultPort() { return DEFAULT_PORT; } @Override public boolean isConnected() { return connected; } @Override public boolean isSessionOpen() { return connected; } @Override public int read(byte[] buffer, int start, int len) throws IOException { /* process all already read bytes */ int n = 0; do { n = handler.negotiate(buffer, start); if (n > 0) return n; } while (n == 0); while (n <= 0) { do { n = handler.negotiate(buffer, start); if (n > 0) return n; } while (n == 0); n = is.read(buffer, start, len); if (n < 0) { bridge.dispatchDisconnect(false); throw new IOException("Remote end closed connection."); } handler.inputfeed(buffer, start, n); n = handler.negotiate(buffer, start); } return n; } @Override public void write(byte[] buffer) throws IOException { try { if (os != null) os.write(buffer); } catch (SocketException e) { bridge.dispatchDisconnect(false); } } @Override public void write(int c) throws IOException { try { if (os != null) os.write(c); } catch (SocketException e) { bridge.dispatchDisconnect(false); } } @Override public void setDimensions(int columns, int rows, int width, int height) { try { handler.setWindowSize(columns, rows); } catch (IOException e) { Log.e(TAG, "Couldn't resize remote terminal", e); } } @Override public String getDefaultNickname(String username, String hostname, int port) { if (port == DEFAULT_PORT) { return String.format("%s", hostname); } else { return String.format("%s:%d", hostname, port); } } public static Uri getUri(String input) { Matcher matcher = hostmask.matcher(input); if (!matcher.matches()) return null; StringBuilder sb = new StringBuilder(); sb.append(PROTOCOL) .append("://") .append(matcher.group(1)); String portString = matcher.group(3); int port = DEFAULT_PORT; if (portString != null) { try { port = Integer.parseInt(portString); if (port < 1 || port > 65535) { port = DEFAULT_PORT; } } catch (NumberFormatException nfe) { // Keep the default port } } if (port != DEFAULT_PORT) { sb.append(':'); sb.append(port); } sb.append("/#") .append(Uri.encode(input)); Uri uri = Uri.parse(sb.toString()); return uri; } @Override public HostBean createHost(Uri uri) { HostBean host = new HostBean(); host.setProtocol(PROTOCOL); host.setHostname(uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; host.setPort(port); String nickname = uri.getFragment(); if (nickname == null || nickname.length() == 0) { host.setNickname(getDefaultNickname(host.getUsername(), host.getHostname(), host.getPort())); } else { host.setNickname(uri.getFragment()); } return host; } @Override public void getSelectionArgs(Uri uri, Map<String, String> selection) { selection.put(HostDatabase.FIELD_HOST_PROTOCOL, PROTOCOL); selection.put(HostDatabase.FIELD_HOST_NICKNAME, uri.getFragment()); selection.put(HostDatabase.FIELD_HOST_HOSTNAME, uri.getHost()); int port = uri.getPort(); if (port < 0) port = DEFAULT_PORT; selection.put(HostDatabase.FIELD_HOST_PORT, Integer.toString(port)); } public static String getFormatHint(Context context) { return String.format("%s:%s", context.getString(R.string.format_hostname), context.getString(R.string.format_port)); } /* (non-Javadoc) * @see org.connectbot.transport.AbsTransport#usesNetwork() */ @Override public boolean usesNetwork() { return true; } }
zzsuper001-linuxshell
src/org/connectbot/transport/Telnet.java
Java
asf20
7,445
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot.transport; import java.util.HashMap; import java.util.Map; import org.connectbot.bean.HostBean; import org.connectbot.util.HostDatabase; import android.content.Context; import android.net.Uri; import android.util.Log; /** * @author Kenny Root * */ public class TransportFactory { private static final String TAG = "ConnectBot.TransportFactory"; private static String[] transportNames = { SSH.getProtocolName(), Telnet.getProtocolName(), Local.getProtocolName(), }; /** * @param protocol * @return */ public static AbsTransport getTransport(String protocol) { if (SSH.getProtocolName().equals(protocol)) { return new SSH(); } else if (Telnet.getProtocolName().equals(protocol)) { return new Telnet(); } else if (Local.getProtocolName().equals(protocol)) { return new Local(); } else { return null; } } public static Uri getUri(String scheme, String input) { Log.d("TransportFactory", String.format( "Attempting to discover URI for scheme=%s on input=%s", scheme, input)); if (SSH.getProtocolName().equals(scheme)) return SSH.getUri(input); else if (Telnet.getProtocolName().equals(scheme)) return Telnet.getUri(input); else if (Local.getProtocolName().equals(scheme)) { Log.d("TransportFactory", "Got to the local parsing area"); return Local.getUri(input); } else return null; } public static String[] getTransportNames() { return transportNames; } public static boolean isSameTransportType(AbsTransport a, AbsTransport b) { if (a == null || b == null) return false; return a.getClass().equals(b.getClass()); } public static boolean canForwardPorts(String protocol) { // TODO uh, make this have less knowledge about its children if (SSH.getProtocolName().equals(protocol)) { return true; } else { return false; } } /** * @param protocol text name of protocol * @param context * @return expanded format hint */ public static String getFormatHint(String protocol, Context context) { if (SSH.getProtocolName().equals(protocol)) { return SSH.getFormatHint(context); } else if (Telnet.getProtocolName().equals(protocol)) { return Telnet.getFormatHint(context); } else if (Local.getProtocolName().equals(protocol)) { return Local.getFormatHint(context); } else { return AbsTransport.getFormatHint(context); } } /** * @param hostdb Handle to HostDatabase * @param uri URI to target server * @param host HostBean in which to put the results * @return true when host was found */ public static HostBean findHost(HostDatabase hostdb, Uri uri) { AbsTransport transport = getTransport(uri.getScheme()); Map<String, String> selection = new HashMap<String, String>(); transport.getSelectionArgs(uri, selection); if (selection.size() == 0) { Log.e(TAG, String.format("Transport %s failed to do something useful with URI=%s", uri.getScheme(), uri.toString())); throw new IllegalStateException("Failed to get needed selection arguments"); } return hostdb.findHost(selection); } }
zzsuper001-linuxshell
src/org/connectbot/transport/TransportFactory.java
Java
asf20
3,759
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.util.List; import java.util.regex.Matcher; import java.util.regex.Pattern; import org.connectbot.bean.SelectionArea; import org.connectbot.service.FontSizeChangedListener; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalKeyListener; import android.app.Activity; import android.content.ContentResolver; import android.content.Context; import android.content.Intent; import android.content.pm.ResolveInfo; import android.database.Cursor; import android.graphics.Canvas; import android.graphics.Matrix; import android.graphics.Paint; import android.graphics.Path; import android.graphics.PixelXorXfermode; import android.graphics.RectF; import android.net.Uri; import android.os.AsyncTask; import android.view.KeyEvent; import android.view.View; import android.view.ViewGroup.LayoutParams; import android.view.accessibility.AccessibilityEvent; import android.view.accessibility.AccessibilityManager; import android.view.inputmethod.BaseInputConnection; import android.view.inputmethod.EditorInfo; import android.view.inputmethod.InputConnection; import android.widget.Toast; import de.mud.terminal.VDUBuffer; /** * User interface {@link View} for showing a TerminalBridge in an * {@link Activity}. Handles drawing bitmap updates and passing keystrokes down * to terminal. * * @author jsharkey */ public class TerminalView extends View implements FontSizeChangedListener { private final Context context; public final TerminalBridge bridge; private final Paint paint; private final Paint cursorPaint; private final Paint cursorStrokePaint; // Cursor paints to distinguish modes private Path ctrlCursor, altCursor, shiftCursor; private RectF tempSrc, tempDst; private Matrix scaleMatrix; private static final Matrix.ScaleToFit scaleType = Matrix.ScaleToFit.FILL; private Toast notification = null; private String lastNotification = null; private volatile boolean notifications = true; // Related to Accessibility Features private boolean mAccessibilityInitialized = false; private boolean mAccessibilityActive = true; private Object[] mAccessibilityLock = new Object[0]; private StringBuffer mAccessibilityBuffer; private Pattern mControlCodes = null; private Matcher mCodeMatcher = null; private AccessibilityEventSender mEventSender = null; private static final String BACKSPACE_CODE = "\\x08\\x1b\\[K"; private static final String CONTROL_CODE_PATTERN = "\\x1b\\[K[^m]+[m|:]"; private static final int ACCESSIBILITY_EVENT_THRESHOLD = 1000; private static final String SCREENREADER_INTENT_ACTION = "android.accessibilityservice.AccessibilityService"; private static final String SCREENREADER_INTENT_CATEGORY = "android.accessibilityservice.category.FEEDBACK_SPOKEN"; public TerminalView(Context context, TerminalBridge bridge) { super(context); this.context = context; this.bridge = bridge; paint = new Paint(); setLayoutParams(new LayoutParams(LayoutParams.FILL_PARENT, LayoutParams.FILL_PARENT)); setFocusable(true); setFocusableInTouchMode(true); cursorPaint = new Paint(); cursorPaint.setColor(bridge.color[bridge.defaultFg]); cursorPaint.setXfermode(new PixelXorXfermode(bridge.color[bridge.defaultBg])); cursorPaint.setAntiAlias(true); cursorStrokePaint = new Paint(cursorPaint); cursorStrokePaint.setStrokeWidth(0.1f); cursorStrokePaint.setStyle(Paint.Style.STROKE); /* * Set up our cursor indicators on a 1x1 Path object which we can later * transform to our character width and height */ // TODO make this into a resource somehow shiftCursor = new Path(); shiftCursor.lineTo(0.5f, 0.33f); shiftCursor.lineTo(1.0f, 0.0f); altCursor = new Path(); altCursor.moveTo(0.0f, 1.0f); altCursor.lineTo(0.5f, 0.66f); altCursor.lineTo(1.0f, 1.0f); ctrlCursor = new Path(); ctrlCursor.moveTo(0.0f, 0.25f); ctrlCursor.lineTo(1.0f, 0.5f); ctrlCursor.lineTo(0.0f, 0.75f); // For creating the transform when the terminal resizes tempSrc = new RectF(); tempSrc.set(0.0f, 0.0f, 1.0f, 1.0f); tempDst = new RectF(); scaleMatrix = new Matrix(); bridge.addFontSizeChangedListener(this); // connect our view up to the bridge setOnKeyListener(bridge.getKeyHandler()); mAccessibilityBuffer = new StringBuffer(); // Enable accessibility features if a screen reader is active. new AccessibilityStateTester().execute((Void) null); } public void destroy() { // tell bridge to destroy its bitmap bridge.parentDestroyed(); } @Override protected void onSizeChanged(int w, int h, int oldw, int oldh) { super.onSizeChanged(w, h, oldw, oldh); bridge.parentChanged(this); scaleCursors(); } public void onFontSizeChanged(float size) { scaleCursors(); } private void scaleCursors() { // Create a scale matrix to scale our 1x1 representation of the cursor tempDst.set(0.0f, 0.0f, bridge.charWidth, bridge.charHeight); scaleMatrix.setRectToRect(tempSrc, tempDst, scaleType); } @Override public void onDraw(Canvas canvas) { if(bridge.bitmap != null) { // draw the bitmap bridge.onDraw(); // draw the bridge bitmap if it exists canvas.drawBitmap(bridge.bitmap, 0, 0, paint); // also draw cursor if visible if (bridge.buffer.isCursorVisible()) { int cursorColumn = bridge.buffer.getCursorColumn(); final int cursorRow = bridge.buffer.getCursorRow(); final int columns = bridge.buffer.getColumns(); if (cursorColumn == columns) cursorColumn = columns - 1; if (cursorColumn < 0 || cursorRow < 0) return; int currentAttribute = bridge.buffer.getAttributes( cursorColumn, cursorRow); boolean onWideCharacter = (currentAttribute & VDUBuffer.FULLWIDTH) != 0; int x = cursorColumn * bridge.charWidth; int y = (bridge.buffer.getCursorRow() + bridge.buffer.screenBase - bridge.buffer.windowBase) * bridge.charHeight; // Save the current clip and translation canvas.save(); canvas.translate(x, y); canvas.clipRect(0, 0, bridge.charWidth * (onWideCharacter ? 2 : 1), bridge.charHeight); canvas.drawPaint(cursorPaint); final int deadKey = bridge.getKeyHandler().getDeadKey(); if (deadKey != 0) { canvas.drawText(new char[] { (char)deadKey }, 0, 1, 0, 0, cursorStrokePaint); } // Make sure we scale our decorations to the correct size. canvas.concat(scaleMatrix); int metaState = bridge.getKeyHandler().getMetaState(); if ((metaState & TerminalKeyListener.META_SHIFT_ON) != 0) canvas.drawPath(shiftCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_SHIFT_LOCK) != 0) canvas.drawPath(shiftCursor, cursorPaint); if ((metaState & TerminalKeyListener.META_ALT_ON) != 0) canvas.drawPath(altCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_ALT_LOCK) != 0) canvas.drawPath(altCursor, cursorPaint); if ((metaState & TerminalKeyListener.META_CTRL_ON) != 0) canvas.drawPath(ctrlCursor, cursorStrokePaint); else if ((metaState & TerminalKeyListener.META_CTRL_LOCK) != 0) canvas.drawPath(ctrlCursor, cursorPaint); // Restore previous clip region canvas.restore(); } // draw any highlighted area if (bridge.isSelectingForCopy()) { SelectionArea area = bridge.getSelectionArea(); canvas.save(Canvas.CLIP_SAVE_FLAG); canvas.clipRect( area.getLeft() * bridge.charWidth, area.getTop() * bridge.charHeight, (area.getRight() + 1) * bridge.charWidth, (area.getBottom() + 1) * bridge.charHeight ); canvas.drawPaint(cursorPaint); canvas.restore(); } } } public void notifyUser(String message) { if (!notifications) return; if (notification != null) { // Don't keep telling the user the same thing. if (lastNotification != null && lastNotification.equals(message)) return; notification.setText(message); notification.show(); } else { notification = Toast.makeText(context, message, Toast.LENGTH_SHORT); notification.show(); } lastNotification = message; } /** * Ask the {@link TerminalBridge} we're connected to to resize to a specific size. * @param width * @param height */ public void forceSize(int width, int height) { bridge.resizeComputed(width, height, getWidth(), getHeight()); } /** * Sets the ability for the TerminalView to display Toast notifications to the user. * @param value whether to enable notifications or not */ public void setNotifications(boolean value) { notifications = value; } @Override public boolean onCheckIsTextEditor() { return true; } @Override public InputConnection onCreateInputConnection(EditorInfo outAttrs) { outAttrs.imeOptions |= EditorInfo.IME_FLAG_NO_EXTRACT_UI | EditorInfo.IME_FLAG_NO_ENTER_ACTION | EditorInfo.IME_ACTION_NONE; outAttrs.inputType = EditorInfo.TYPE_NULL; return new BaseInputConnection(this, false) { @Override public boolean deleteSurroundingText (int leftLength, int rightLength) { if (rightLength == 0 && leftLength == 0) { return this.sendKeyEvent(new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_DEL)); } for (int i = 0; i < leftLength; i++) { this.sendKeyEvent(new KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_DEL)); } // TODO: forward delete return true; } }; } public void propagateConsoleText(char[] rawText, int length) { if (mAccessibilityActive) { synchronized (mAccessibilityLock) { mAccessibilityBuffer.append(rawText, 0, length); } if (mAccessibilityInitialized) { if (mEventSender != null) { removeCallbacks(mEventSender); } else { mEventSender = new AccessibilityEventSender(); } postDelayed(mEventSender, ACCESSIBILITY_EVENT_THRESHOLD); } } } private class AccessibilityEventSender implements Runnable { public void run() { synchronized (mAccessibilityLock) { if (mCodeMatcher == null) { mCodeMatcher = mControlCodes.matcher(mAccessibilityBuffer); } else { mCodeMatcher.reset(mAccessibilityBuffer); } // Strip all control codes out. mAccessibilityBuffer = new StringBuffer(mCodeMatcher.replaceAll(" ")); // Apply Backspaces using backspace character sequence int i = mAccessibilityBuffer.indexOf(BACKSPACE_CODE); while (i != -1) { mAccessibilityBuffer = mAccessibilityBuffer.replace(i == 0 ? 0 : i - 1, i + BACKSPACE_CODE.length(), ""); i = mAccessibilityBuffer.indexOf(BACKSPACE_CODE); } if (mAccessibilityBuffer.length() > 0) { AccessibilityEvent event = AccessibilityEvent.obtain( AccessibilityEvent.TYPE_VIEW_TEXT_CHANGED); event.setFromIndex(0); event.setAddedCount(mAccessibilityBuffer.length()); event.getText().add(mAccessibilityBuffer); sendAccessibilityEventUnchecked(event); mAccessibilityBuffer.setLength(0); } } } } private class AccessibilityStateTester extends AsyncTask<Void, Void, Boolean> { @Override protected Boolean doInBackground(Void... params) { /* * Presumably if the accessibility manager is not enabled, we don't * need to send accessibility events. */ final AccessibilityManager accessibility = (AccessibilityManager) context .getSystemService(Context.ACCESSIBILITY_SERVICE); if (!accessibility.isEnabled()) { return false; } /* * Restrict the set of intents to only accessibility services that * have the category FEEDBACK_SPOKEN (aka, screen readers). */ final Intent screenReaderIntent = new Intent(SCREENREADER_INTENT_ACTION); screenReaderIntent.addCategory(SCREENREADER_INTENT_CATEGORY); final ContentResolver cr = context.getContentResolver(); final List<ResolveInfo> screenReaders = context.getPackageManager().queryIntentServices( screenReaderIntent, 0); boolean foundScreenReader = false; final int N = screenReaders.size(); for (int i = 0; i < N; i++) { final ResolveInfo screenReader = screenReaders.get(i); /* * All screen readers are expected to implement a content * provider that responds to: * content://<nameofpackage>.providers.StatusProvider */ final Cursor cursor = cr.query( Uri.parse("content://" + screenReader.serviceInfo.packageName + ".providers.StatusProvider"), null, null, null, null); if (cursor != null && cursor.moveToFirst()) { /* * These content providers use a special cursor that only has * one element, an integer that is 1 if the screen reader is * running. */ final int status = cursor.getInt(0); cursor.close(); if (status == 1) { foundScreenReader = true; break; } } } if (foundScreenReader) { mControlCodes = Pattern.compile(CONTROL_CODE_PATTERN); } return foundScreenReader; } @Override protected void onPostExecute(Boolean result) { mAccessibilityActive = result; mAccessibilityInitialized = true; if (result) { mEventSender = new AccessibilityEventSender(); postDelayed(mEventSender, ACCESSIBILITY_EVENT_THRESHOLD); } else { mAccessibilityBuffer = null; } } } }
zzsuper001-linuxshell
src/org/connectbot/TerminalView.java
Java
asf20
13,881
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import org.connectbot.util.HelpTopicView; import android.app.Activity; import android.content.Intent; import android.os.Bundle; /** * @author Kenny Root * */ public class HelpTopicActivity extends Activity { public final static String TAG = "ConnectBot.HelpActivity"; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_help_topic); String topic = getIntent().getStringExtra(Intent.EXTRA_TITLE); this.setTitle(String.format("%s: %s - %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_help), topic)); HelpTopicView helpTopic = (HelpTopicView) findViewById(R.id.topic_text); helpTopic.setTopic(topic); } }
zzsuper001-linuxshell
src/org/connectbot/HelpTopicActivity.java
Java
asf20
1,431
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.io.ByteArrayOutputStream; import java.io.File; import java.io.FileInputStream; import java.io.IOException; import java.io.InputStream; import java.net.URI; import java.security.KeyPair; import java.security.PrivateKey; import java.security.PublicKey; import java.util.Collections; import java.util.EventListener; import java.util.LinkedList; import java.util.List; import org.connectbot.bean.PubkeyBean; import org.connectbot.service.TerminalManager; import org.connectbot.util.PubkeyDatabase; import org.connectbot.util.PubkeyUtils; import org.openintents.intents.FileManagerIntents; import android.app.AlertDialog; import android.app.ListActivity; import android.content.ActivityNotFoundException; import android.content.ComponentName; import android.content.Context; import android.content.DialogInterface; import android.content.DialogInterface.OnClickListener; import android.content.Intent; import android.content.ServiceConnection; import android.net.Uri; import android.os.Bundle; import android.os.Environment; import android.os.Handler; import android.os.IBinder; import android.os.Message; import android.text.ClipboardManager; import android.util.Log; import android.view.ContextMenu; import android.view.LayoutInflater; import android.view.Menu; import android.view.MenuItem; import android.view.MenuItem.OnMenuItemClickListener; import android.view.View; import android.view.ViewGroup; import android.widget.AdapterView; import android.widget.AdapterView.OnItemClickListener; import android.widget.ArrayAdapter; import android.widget.EditText; import android.widget.ImageView; import android.widget.TableRow; import android.widget.TextView; import android.widget.Toast; import com.trilead.ssh2.crypto.Base64; import com.trilead.ssh2.crypto.PEMDecoder; import com.trilead.ssh2.crypto.PEMStructure; /** * List public keys in database by nickname and describe their properties. Allow users to import, * generate, rename, and delete key pairs. * * @author Kenny Root */ public class PubkeyListActivity extends ListActivity implements EventListener { public final static String TAG = "ConnectBot.PubkeyListActivity"; private static final int MAX_KEYFILE_SIZE = 8192; private static final int REQUEST_CODE_PICK_FILE = 1; // Constants for AndExplorer's file picking intent private static final String ANDEXPLORER_TITLE = "explorer_title"; private static final String MIME_TYPE_ANDEXPLORER_FILE = "vnd.android.cursor.dir/lysesoft.andexplorer.file"; protected PubkeyDatabase pubkeydb; private List<PubkeyBean> pubkeys; protected ClipboardManager clipboard; protected LayoutInflater inflater = null; protected TerminalManager bound = null; private MenuItem onstartToggle = null; private MenuItem confirmUse = null; private ServiceConnection connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { bound = ((TerminalManager.TerminalBinder) service).getService(); // update our listview binder to find the service updateList(); } public void onServiceDisconnected(ComponentName className) { bound = null; updateList(); } }; @Override public void onStart() { super.onStart(); bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(pubkeydb == null) pubkeydb = new PubkeyDatabase(this); } @Override public void onStop() { super.onStop(); unbindService(connection); if(pubkeydb != null) { pubkeydb.close(); pubkeydb = null; } } @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); setContentView(R.layout.act_pubkeylist); this.setTitle(String.format("%s: %s", getResources().getText(R.string.app_name), getResources().getText(R.string.title_pubkey_list))); // connect with hosts database and populate list pubkeydb = new PubkeyDatabase(this); updateList(); registerForContextMenu(getListView()); getListView().setOnItemClickListener(new OnItemClickListener() { public void onItemClick(AdapterView<?> adapter, View view, int position, long id) { PubkeyBean pubkey = (PubkeyBean) getListView().getItemAtPosition(position); boolean loaded = bound.isKeyLoaded(pubkey.getNickname()); // handle toggling key in-memory on/off if(loaded) { bound.removeKey(pubkey.getNickname()); updateHandler.sendEmptyMessage(-1); } else { handleAddKey(pubkey); } } }); clipboard = (ClipboardManager)getSystemService(CLIPBOARD_SERVICE); inflater = LayoutInflater.from(this); } /** * Read given file into memory as <code>byte[]</code>. */ protected static byte[] readRaw(File file) throws Exception { InputStream is = new FileInputStream(file); ByteArrayOutputStream os = new ByteArrayOutputStream(); int bytesRead; byte[] buffer = new byte[1024]; while ((bytesRead = is.read(buffer)) != -1) { os.write(buffer, 0, bytesRead); } os.flush(); os.close(); is.close(); return os.toByteArray(); } @Override public boolean onCreateOptionsMenu(Menu menu) { super.onCreateOptionsMenu(menu); MenuItem generatekey = menu.add(R.string.pubkey_generate); generatekey.setIcon(android.R.drawable.ic_menu_manage); generatekey.setIntent(new Intent(PubkeyListActivity.this, GeneratePubkeyActivity.class)); MenuItem importkey = menu.add(R.string.pubkey_import); importkey.setIcon(android.R.drawable.ic_menu_upload); importkey.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { Uri sdcard = Uri.fromFile(Environment.getExternalStorageDirectory()); String pickerTitle = getString(R.string.pubkey_list_pick); // Try to use OpenIntent's file browser to pick a file Intent intent = new Intent(FileManagerIntents.ACTION_PICK_FILE); intent.setData(sdcard); intent.putExtra(FileManagerIntents.EXTRA_TITLE, pickerTitle); intent.putExtra(FileManagerIntents.EXTRA_BUTTON_TEXT, getString(android.R.string.ok)); try { startActivityForResult(intent, REQUEST_CODE_PICK_FILE); } catch (ActivityNotFoundException e) { // If OI didn't work, try AndExplorer intent = new Intent(Intent.ACTION_PICK); intent.setDataAndType(sdcard, MIME_TYPE_ANDEXPLORER_FILE); intent.putExtra(ANDEXPLORER_TITLE, pickerTitle); try { startActivityForResult(intent, REQUEST_CODE_PICK_FILE); } catch (ActivityNotFoundException e1) { pickFileSimple(); } } return true; } }); return true; } protected void handleAddKey(final PubkeyBean pubkey) { if (pubkey.isEncrypted()) { final View view = inflater.inflate(R.layout.dia_password, null); final EditText passwordField = (EditText)view.findViewById(android.R.id.text1); new AlertDialog.Builder(PubkeyListActivity.this) .setView(view) .setPositiveButton(R.string.pubkey_unlock, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { handleAddKey(pubkey, passwordField.getText().toString()); } }) .setNegativeButton(android.R.string.cancel, null).create().show(); } else { handleAddKey(pubkey, null); } } protected void handleAddKey(PubkeyBean pubkey, String password) { Object trileadKey = null; if(PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType())) { // load specific key using pem format try { trileadKey = PEMDecoder.decode(new String(pubkey.getPrivateKey()).toCharArray(), password); } catch(Exception e) { String message = getResources().getString(R.string.pubkey_failed_add, pubkey.getNickname()); Log.e(TAG, message, e); Toast.makeText(PubkeyListActivity.this, message, Toast.LENGTH_LONG); } } else { // load using internal generated format PrivateKey privKey = null; PublicKey pubKey = null; try { privKey = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType(), password); pubKey = pubkey.getPublicKey(); } catch (Exception e) { String message = getResources().getString(R.string.pubkey_failed_add, pubkey.getNickname()); Log.e(TAG, message, e); Toast.makeText(PubkeyListActivity.this, message, Toast.LENGTH_LONG); return; } // convert key to trilead format trileadKey = PubkeyUtils.convertToTrilead(privKey, pubKey); Log.d(TAG, "Unlocked key " + PubkeyUtils.formatKey(pubKey)); } if(trileadKey == null) return; Log.d(TAG, String.format("Unlocked key '%s'", pubkey.getNickname())); // save this key in memory bound.addKey(pubkey, trileadKey, true); updateHandler.sendEmptyMessage(-1); } @Override public void onCreateContextMenu(ContextMenu menu, View v, ContextMenu.ContextMenuInfo menuInfo) { // Create menu to handle deleting and editing pubkey AdapterView.AdapterContextMenuInfo info = (AdapterView.AdapterContextMenuInfo) menuInfo; final PubkeyBean pubkey = (PubkeyBean) getListView().getItemAtPosition(info.position); menu.setHeaderTitle(pubkey.getNickname()); // TODO: option load/unload key from in-memory list // prompt for password as needed for passworded keys // cant change password or clipboard imported keys final boolean imported = PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType()); final boolean loaded = bound.isKeyLoaded(pubkey.getNickname()); MenuItem load = menu.add(loaded ? R.string.pubkey_memory_unload : R.string.pubkey_memory_load); load.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { if(loaded) { bound.removeKey(pubkey.getNickname()); updateHandler.sendEmptyMessage(-1); } else { handleAddKey(pubkey); //bound.addKey(nickname, trileadKey); } return true; } }); onstartToggle = menu.add(R.string.pubkey_load_on_start); onstartToggle.setEnabled(!pubkey.isEncrypted()); onstartToggle.setCheckable(true); onstartToggle.setChecked(pubkey.isStartup()); onstartToggle.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // toggle onstart status pubkey.setStartup(!pubkey.isStartup()); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); return true; } }); MenuItem copyPublicToClipboard = menu.add(R.string.pubkey_copy_public); copyPublicToClipboard.setEnabled(!imported); copyPublicToClipboard.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { try { PublicKey pk = pubkey.getPublicKey(); String openSSHPubkey = PubkeyUtils.convertToOpenSSHFormat(pk, pubkey.getNickname()); clipboard.setText(openSSHPubkey); } catch (Exception e) { e.printStackTrace(); } return true; } }); MenuItem copyPrivateToClipboard = menu.add(R.string.pubkey_copy_private); copyPrivateToClipboard.setEnabled(!pubkey.isEncrypted() || imported); copyPrivateToClipboard.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { try { String data = null; if (imported) data = new String(pubkey.getPrivateKey()); else { PrivateKey pk = PubkeyUtils.decodePrivate(pubkey.getPrivateKey(), pubkey.getType()); data = PubkeyUtils.exportPEM(pk, null); } clipboard.setText(data); } catch (Exception e) { e.printStackTrace(); } return true; } }); MenuItem changePassword = menu.add(R.string.pubkey_change_password); changePassword.setEnabled(!imported); changePassword.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { final View changePasswordView = inflater.inflate(R.layout.dia_changepassword, null, false); ((TableRow)changePasswordView.findViewById(R.id.old_password_prompt)) .setVisibility(pubkey.isEncrypted() ? View.VISIBLE : View.GONE); new AlertDialog.Builder(PubkeyListActivity.this) .setView(changePasswordView) .setPositiveButton(R.string.button_change, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { String oldPassword = ((EditText)changePasswordView.findViewById(R.id.old_password)).getText().toString(); String password1 = ((EditText)changePasswordView.findViewById(R.id.password1)).getText().toString(); String password2 = ((EditText)changePasswordView.findViewById(R.id.password2)).getText().toString(); if (!password1.equals(password2)) { new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_passwords_do_not_match_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); return; } try { if (!pubkey.changePassword(oldPassword, password1)) new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_wrong_password_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); else { pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } } catch (Exception e) { Log.e(TAG, "Could not change private key password", e); new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_key_corrupted_msg) .setPositiveButton(android.R.string.ok, null) .create().show(); } } }) .setNegativeButton(android.R.string.cancel, null).create().show(); return true; } }); confirmUse = menu.add(R.string.pubkey_confirm_use); confirmUse.setCheckable(true); confirmUse.setChecked(pubkey.isConfirmUse()); confirmUse.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // toggle confirm use pubkey.setConfirmUse(!pubkey.isConfirmUse()); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); return true; } }); MenuItem delete = menu.add(R.string.pubkey_delete); delete.setOnMenuItemClickListener(new OnMenuItemClickListener() { public boolean onMenuItemClick(MenuItem item) { // prompt user to make sure they really want this new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(getString(R.string.delete_message, pubkey.getNickname())) .setPositiveButton(R.string.delete_pos, new DialogInterface.OnClickListener() { public void onClick(DialogInterface dialog, int which) { // dont forget to remove from in-memory if(loaded) bound.removeKey(pubkey.getNickname()); // delete from backend database and update gui pubkeydb.deletePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } }) .setNegativeButton(R.string.delete_neg, null).create().show(); return true; } }); } protected Handler updateHandler = new Handler() { @Override public void handleMessage(Message msg) { updateList(); } }; protected void updateList() { if (pubkeydb == null) return; pubkeys = pubkeydb.allPubkeys(); PubkeyAdapter adapter = new PubkeyAdapter(this, pubkeys); this.setListAdapter(adapter); } @Override protected void onActivityResult(int requestCode, int resultCode, Intent intent) { super.onActivityResult(requestCode, resultCode, intent); switch (requestCode) { case REQUEST_CODE_PICK_FILE: if (resultCode == RESULT_OK && intent != null) { Uri uri = intent.getData(); try { if (uri != null) { readKeyFromFile(new File(URI.create(uri.toString()))); } else { String filename = intent.getDataString(); if (filename != null) readKeyFromFile(new File(URI.create(filename))); } } catch (IllegalArgumentException e) { Log.e(TAG, "Couldn't read from picked file", e); } } break; } } /** * @param name */ private void readKeyFromFile(File file) { PubkeyBean pubkey = new PubkeyBean(); // find the exact file selected pubkey.setNickname(file.getName()); if (file.length() > MAX_KEYFILE_SIZE) { Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); return; } // parse the actual key once to check if its encrypted // then save original file contents into our database try { byte[] raw = readRaw(file); String data = new String(raw); if (data.startsWith(PubkeyUtils.PKCS8_START)) { int start = data.indexOf(PubkeyUtils.PKCS8_START) + PubkeyUtils.PKCS8_START.length(); int end = data.indexOf(PubkeyUtils.PKCS8_END); if (end > start) { char[] encoded = data.substring(start, end - 1).toCharArray(); Log.d(TAG, "encoded: " + new String(encoded)); byte[] decoded = Base64.decode(encoded); KeyPair kp = PubkeyUtils.recoverKeyPair(decoded); pubkey.setType(kp.getPrivate().getAlgorithm()); pubkey.setPrivateKey(kp.getPrivate().getEncoded()); pubkey.setPublicKey(kp.getPublic().getEncoded()); } else { Log.e(TAG, "Problem parsing PKCS#8 file; corrupt?"); Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); } } else { PEMStructure struct = PEMDecoder.parsePEM(new String(raw).toCharArray()); pubkey.setEncrypted(PEMDecoder.isPEMEncrypted(struct)); pubkey.setType(PubkeyDatabase.KEY_TYPE_IMPORTED); pubkey.setPrivateKey(raw); } // write new value into database if (pubkeydb == null) pubkeydb = new PubkeyDatabase(this); pubkeydb.savePubkey(pubkey); updateHandler.sendEmptyMessage(-1); } catch(Exception e) { Log.e(TAG, "Problem parsing imported private key", e); Toast.makeText(PubkeyListActivity.this, R.string.pubkey_import_parse_problem, Toast.LENGTH_LONG).show(); } } /** * */ private void pickFileSimple() { // build list of all files in sdcard root final File sdcard = Environment.getExternalStorageDirectory(); Log.d(TAG, sdcard.toString()); // Don't show a dialog if the SD card is completely absent. final String state = Environment.getExternalStorageState(); if (!Environment.MEDIA_MOUNTED_READ_ONLY.equals(state) && !Environment.MEDIA_MOUNTED.equals(state)) { new AlertDialog.Builder(PubkeyListActivity.this) .setMessage(R.string.alert_sdcard_absent) .setNegativeButton(android.R.string.cancel, null).create().show(); return; } List<String> names = new LinkedList<String>(); { File[] files = sdcard.listFiles(); if (files != null) { for(File file : sdcard.listFiles()) { if(file.isDirectory()) continue; names.add(file.getName()); } } } Collections.sort(names); final String[] namesList = names.toArray(new String[] {}); Log.d(TAG, names.toString()); // prompt user to select any file from the sdcard root new AlertDialog.Builder(PubkeyListActivity.this) .setTitle(R.string.pubkey_list_pick) .setItems(namesList, new OnClickListener() { public void onClick(DialogInterface arg0, int arg1) { String name = namesList[arg1]; readKeyFromFile(new File(sdcard, name)); } }) .setNegativeButton(android.R.string.cancel, null).create().show(); } class PubkeyAdapter extends ArrayAdapter<PubkeyBean> { private List<PubkeyBean> pubkeys; class ViewHolder { public TextView nickname; public TextView caption; public ImageView icon; } public PubkeyAdapter(Context context, List<PubkeyBean> pubkeys) { super(context, R.layout.item_pubkey, pubkeys); this.pubkeys = pubkeys; } @Override public View getView(int position, View convertView, ViewGroup parent) { ViewHolder holder; if (convertView == null) { convertView = inflater.inflate(R.layout.item_pubkey, null, false); holder = new ViewHolder(); holder.nickname = (TextView) convertView.findViewById(android.R.id.text1); holder.caption = (TextView) convertView.findViewById(android.R.id.text2); holder.icon = (ImageView) convertView.findViewById(android.R.id.icon1); convertView.setTag(holder); } else holder = (ViewHolder) convertView.getTag(); PubkeyBean pubkey = pubkeys.get(position); holder.nickname.setText(pubkey.getNickname()); boolean imported = PubkeyDatabase.KEY_TYPE_IMPORTED.equals(pubkey.getType()); if (imported) { try { PEMStructure struct = PEMDecoder.parsePEM(new String(pubkey.getPrivateKey()).toCharArray()); String type = (struct.pemType == PEMDecoder.PEM_RSA_PRIVATE_KEY) ? "RSA" : "DSA"; holder.caption.setText(String.format("%s unknown-bit", type)); } catch (IOException e) { Log.e(TAG, "Error decoding IMPORTED public key at " + pubkey.getId(), e); } } else { try { holder.caption.setText(pubkey.getDescription()); } catch (Exception e) { Log.e(TAG, "Error decoding public key at " + pubkey.getId(), e); holder.caption.setText(R.string.pubkey_unknown_format); } } if (bound == null) { holder.icon.setVisibility(View.GONE); } else { holder.icon.setVisibility(View.VISIBLE); if (bound.isKeyLoaded(pubkey.getNickname())) holder.icon.setImageState(new int[] { android.R.attr.state_checked }, true); else holder.icon.setImageState(new int[] { }, true); } return convertView; } } }
zzsuper001-linuxshell
src/org/connectbot/PubkeyListActivity.java
Java
asf20
22,017
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.connectbot; import java.nio.charset.Charset; import java.util.Arrays; import java.util.HashMap; import java.util.LinkedList; import java.util.List; import java.util.Map; import java.util.Set; import java.util.Map.Entry; import org.connectbot.bean.HostBean; import org.connectbot.service.TerminalBridge; import org.connectbot.service.TerminalManager; import org.connectbot.util.HostDatabase; import org.connectbot.util.PubkeyDatabase; import android.content.ComponentName; import android.content.ContentValues; import android.content.Context; import android.content.Intent; import android.content.ServiceConnection; import android.content.SharedPreferences; import android.content.SharedPreferences.OnSharedPreferenceChangeListener; import android.database.Cursor; import android.database.sqlite.SQLiteDatabase; import android.os.Bundle; import android.os.IBinder; import android.preference.CheckBoxPreference; import android.preference.ListPreference; import android.preference.Preference; import android.preference.PreferenceActivity; import android.util.Log; public class HostEditorActivity extends PreferenceActivity implements OnSharedPreferenceChangeListener { public class CursorPreferenceHack implements SharedPreferences { protected final String table; protected final long id; protected Map<String, String> values = new HashMap<String, String>(); // protected Map<String, String> pubkeys = new HashMap<String, String>(); public CursorPreferenceHack(String table, long id) { this.table = table; this.id = id; cacheValues(); } protected final void cacheValues() { // fill a cursor and cache the values locally // this makes sure we dont have any floating cursor to dispose later SQLiteDatabase db = hostdb.getReadableDatabase(); Cursor cursor = db.query(table, null, "_id = ?", new String[] { String.valueOf(id) }, null, null, null); if (cursor.moveToFirst()) { for(int i = 0; i < cursor.getColumnCount(); i++) { String key = cursor.getColumnName(i); if(key.equals(HostDatabase.FIELD_HOST_HOSTKEY)) continue; String value = cursor.getString(i); values.put(key, value); } } cursor.close(); db.close(); // db = pubkeydb.getReadableDatabase(); // cursor = db.query(PubkeyDatabase.TABLE_PUBKEYS, // new String[] { "_id", PubkeyDatabase.FIELD_PUBKEY_NICKNAME }, // null, null, null, null, null); // // if (cursor.moveToFirst()) { // do { // String pubkeyid = String.valueOf(cursor.getLong(0)); // String value = cursor.getString(1); // pubkeys.put(pubkeyid, value); // } while (cursor.moveToNext()); // } // // cursor.close(); // db.close(); } public boolean contains(String key) { return values.containsKey(key); } public class Editor implements SharedPreferences.Editor { private ContentValues update = new ContentValues(); public SharedPreferences.Editor clear() { Log.d(this.getClass().toString(), "clear()"); update = new ContentValues(); return this; } public boolean commit() { //Log.d(this.getClass().toString(), "commit() changes back to database"); SQLiteDatabase db = hostdb.getWritableDatabase(); db.update(table, update, "_id = ?", new String[] { String.valueOf(id) }); db.close(); // make sure we refresh the parent cached values cacheValues(); // and update any listeners for(OnSharedPreferenceChangeListener listener : listeners) { listener.onSharedPreferenceChanged(CursorPreferenceHack.this, null); } return true; } // Gingerbread compatibility public void apply() { commit(); } public android.content.SharedPreferences.Editor putBoolean(String key, boolean value) { return this.putString(key, Boolean.toString(value)); } public android.content.SharedPreferences.Editor putFloat(String key, float value) { return this.putString(key, Float.toString(value)); } public android.content.SharedPreferences.Editor putInt(String key, int value) { return this.putString(key, Integer.toString(value)); } public android.content.SharedPreferences.Editor putLong(String key, long value) { return this.putString(key, Long.toString(value)); } public android.content.SharedPreferences.Editor putString(String key, String value) { //Log.d(this.getClass().toString(), String.format("Editor.putString(key=%s, value=%s)", key, value)); update.put(key, value); return this; } public android.content.SharedPreferences.Editor remove(String key) { //Log.d(this.getClass().toString(), String.format("Editor.remove(key=%s)", key)); update.remove(key); return this; } public android.content.SharedPreferences.Editor putStringSet(String key, Set<String> value) { throw new UnsupportedOperationException("HostEditor Prefs do not support Set<String>"); } } public Editor edit() { //Log.d(this.getClass().toString(), "edit()"); return new Editor(); } public Map<String, ?> getAll() { return values; } public boolean getBoolean(String key, boolean defValue) { return Boolean.valueOf(this.getString(key, Boolean.toString(defValue))); } public float getFloat(String key, float defValue) { return Float.valueOf(this.getString(key, Float.toString(defValue))); } public int getInt(String key, int defValue) { return Integer.valueOf(this.getString(key, Integer.toString(defValue))); } public long getLong(String key, long defValue) { return Long.valueOf(this.getString(key, Long.toString(defValue))); } public String getString(String key, String defValue) { //Log.d(this.getClass().toString(), String.format("getString(key=%s, defValue=%s)", key, defValue)); if(!values.containsKey(key)) return defValue; return values.get(key); } public Set<String> getStringSet(String key, Set<String> defValue) { throw new ClassCastException("HostEditor Prefs do not support Set<String>"); } protected List<OnSharedPreferenceChangeListener> listeners = new LinkedList<OnSharedPreferenceChangeListener>(); public void registerOnSharedPreferenceChangeListener(OnSharedPreferenceChangeListener listener) { listeners.add(listener); } public void unregisterOnSharedPreferenceChangeListener(OnSharedPreferenceChangeListener listener) { listeners.remove(listener); } } @Override public SharedPreferences getSharedPreferences(String name, int mode) { //Log.d(this.getClass().toString(), String.format("getSharedPreferences(name=%s)", name)); return this.pref; } protected static final String TAG = "ConnectBot.HostEditorActivity"; protected HostDatabase hostdb = null; private PubkeyDatabase pubkeydb = null; private CursorPreferenceHack pref; private ServiceConnection connection; private HostBean host; protected TerminalBridge hostBridge; @Override public void onCreate(Bundle icicle) { super.onCreate(icicle); long hostId = this.getIntent().getLongExtra(Intent.EXTRA_TITLE, -1); // TODO: we could pass through a specific ContentProvider uri here //this.getPreferenceManager().setSharedPreferencesName(uri); this.hostdb = new HostDatabase(this); this.pubkeydb = new PubkeyDatabase(this); host = hostdb.findHostById(hostId); connection = new ServiceConnection() { public void onServiceConnected(ComponentName className, IBinder service) { TerminalManager bound = ((TerminalManager.TerminalBinder) service).getService(); hostBridge = bound.getConnectedBridge(host); } public void onServiceDisconnected(ComponentName name) { hostBridge = null; } }; this.pref = new CursorPreferenceHack(HostDatabase.TABLE_HOSTS, hostId); this.pref.registerOnSharedPreferenceChangeListener(this); this.addPreferencesFromResource(R.xml.host_prefs); // add all existing pubkeys to our listpreference for user to choose from // TODO: may be an issue here when this activity is recycled after adding a new pubkey // TODO: should consider moving into onStart, but we dont have a good way of resetting the listpref after filling once ListPreference pubkeyPref = (ListPreference)this.findPreference(HostDatabase.FIELD_HOST_PUBKEYID); List<CharSequence> pubkeyNicks = new LinkedList<CharSequence>(Arrays.asList(pubkeyPref.getEntries())); pubkeyNicks.addAll(pubkeydb.allValues(PubkeyDatabase.FIELD_PUBKEY_NICKNAME)); pubkeyPref.setEntries(pubkeyNicks.toArray(new CharSequence[pubkeyNicks.size()])); List<CharSequence> pubkeyIds = new LinkedList<CharSequence>(Arrays.asList(pubkeyPref.getEntryValues())); pubkeyIds.addAll(pubkeydb.allValues("_id")); pubkeyPref.setEntryValues(pubkeyIds.toArray(new CharSequence[pubkeyIds.size()])); // Populate the character set encoding list with all available final ListPreference charsetPref = (ListPreference) findPreference(HostDatabase.FIELD_HOST_ENCODING); if (CharsetHolder.isInitialized()) { initCharsetPref(charsetPref); } else { String[] currentCharsetPref = new String[1]; currentCharsetPref[0] = charsetPref.getValue(); charsetPref.setEntryValues(currentCharsetPref); charsetPref.setEntries(currentCharsetPref); new Thread(new Runnable() { public void run() { initCharsetPref(charsetPref); } }).start(); } this.updateSummaries(); } @Override public void onStart() { super.onStart(); bindService(new Intent(this, TerminalManager.class), connection, Context.BIND_AUTO_CREATE); if(this.hostdb == null) this.hostdb = new HostDatabase(this); if(this.pubkeydb == null) this.pubkeydb = new PubkeyDatabase(this); } @Override public void onStop() { super.onStop(); unbindService(connection); if(this.hostdb != null) { this.hostdb.close(); this.hostdb = null; } if(this.pubkeydb != null) { this.pubkeydb.close(); this.pubkeydb = null; } } private void updateSummaries() { // for all text preferences, set hint as current database value for (String key : this.pref.values.keySet()) { if(key.equals(HostDatabase.FIELD_HOST_POSTLOGIN)) continue; Preference pref = this.findPreference(key); if(pref == null) continue; if(pref instanceof CheckBoxPreference) continue; CharSequence value = this.pref.getString(key, ""); if (key.equals(HostDatabase.FIELD_HOST_PUBKEYID)) { try { int pubkeyId = Integer.parseInt((String) value); if (pubkeyId >= 0) pref.setSummary(pubkeydb.getNickname(pubkeyId)); else if(pubkeyId == HostDatabase.PUBKEYID_ANY) pref.setSummary(R.string.list_pubkeyids_any); else if(pubkeyId == HostDatabase.PUBKEYID_NEVER) pref.setSummary(R.string.list_pubkeyids_none); continue; } catch (NumberFormatException nfe) { // Fall through. } } else if (pref instanceof ListPreference) { ListPreference listPref = (ListPreference) pref; int entryIndex = listPref.findIndexOfValue((String) value); if (entryIndex >= 0) value = listPref.getEntries()[entryIndex]; } pref.setSummary(value); } } private void initCharsetPref(final ListPreference charsetPref) { charsetPref.setEntryValues(CharsetHolder.getCharsetIds()); charsetPref.setEntries(CharsetHolder.getCharsetNames()); } public void onSharedPreferenceChanged(SharedPreferences sharedPreferences, String key) { // update values on changed preference this.updateSummaries(); // Our CursorPreferenceHack always send null keys, so try to set charset anyway if (hostBridge != null) hostBridge.setCharset(sharedPreferences .getString(HostDatabase.FIELD_HOST_ENCODING, HostDatabase.ENCODING_DEFAULT)); } public static class CharsetHolder { private static boolean initialized = false; private static CharSequence[] charsetIds; private static CharSequence[] charsetNames; public static CharSequence[] getCharsetNames() { if (charsetNames == null) initialize(); return charsetNames; } public static CharSequence[] getCharsetIds() { if (charsetIds == null) initialize(); return charsetIds; } private synchronized static void initialize() { if (initialized) return; List<CharSequence> charsetIdsList = new LinkedList<CharSequence>(); List<CharSequence> charsetNamesList = new LinkedList<CharSequence>(); for (Entry<String, Charset> entry : Charset.availableCharsets().entrySet()) { Charset c = entry.getValue(); if (c.canEncode() && c.isRegistered()) { String key = entry.getKey(); if (key.startsWith("cp")) { // Custom CP437 charset changes charsetIdsList.add("CP437"); charsetNamesList.add("CP437"); } charsetIdsList.add(entry.getKey()); charsetNamesList.add(c.displayName()); } } charsetIds = charsetIdsList.toArray(new CharSequence[charsetIdsList.size()]); charsetNames = charsetNamesList.toArray(new CharSequence[charsetNamesList.size()]); initialized = true; } public static boolean isInitialized() { return initialized; } } }
zzsuper001-linuxshell
src/org/connectbot/HostEditorActivity.java
Java
asf20
13,651
/* * Copyright (C) 2008 OpenIntents.org * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.openintents.intents; // Version Dec 9, 2008 /** * Provides OpenIntents actions, extras, and categories used by providers. * <p>These specifiers extend the standard Android specifiers.</p> */ public final class FileManagerIntents { /** * Activity Action: Pick a file through the file manager, or let user * specify a custom file name. * Data is the current file name or file name suggestion. * Returns a new file name as file URI in data. * * <p>Constant Value: "org.openintents.action.PICK_FILE"</p> */ public static final String ACTION_PICK_FILE = "org.openintents.action.PICK_FILE"; /** * Activity Action: Pick a directory through the file manager, or let user * specify a custom file name. * Data is the current directory name or directory name suggestion. * Returns a new directory name as file URI in data. * * <p>Constant Value: "org.openintents.action.PICK_DIRECTORY"</p> */ public static final String ACTION_PICK_DIRECTORY = "org.openintents.action.PICK_DIRECTORY"; /** * The title to display. * * <p>This is shown in the title bar of the file manager.</p> * * <p>Constant Value: "org.openintents.extra.TITLE"</p> */ public static final String EXTRA_TITLE = "org.openintents.extra.TITLE"; /** * The text on the button to display. * * <p>Depending on the use, it makes sense to set this to "Open" or "Save".</p> * * <p>Constant Value: "org.openintents.extra.BUTTON_TEXT"</p> */ public static final String EXTRA_BUTTON_TEXT = "org.openintents.extra.BUTTON_TEXT"; }
zzsuper001-linuxshell
src/org/openintents/intents/FileManagerIntents.java
Java
asf20
2,159
/* * Licensed to the Apache Software Foundation (ASF) under one or more * contributor license agreements. See the NOTICE file distributed with * this work for additional information regarding copyright ownership. * The ASF licenses this file to You under the Apache License, Version 2.0 * (the "License"); you may not use this file except in compliance with * the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.apache.harmony.niochar.charset.additional; import java.nio.ByteBuffer; import java.nio.CharBuffer; import java.nio.charset.Charset; import java.nio.charset.CharsetDecoder; import java.nio.charset.CharsetEncoder; import java.nio.charset.CoderResult; /* TODO: support direct byte buffers import org.apache.harmony.nio.AddressUtil; import org.apache.harmony.niochar.CharsetProviderImpl; */ public class IBM437 extends Charset { public IBM437(String csName, String[] aliases) { super(csName, aliases); } public boolean contains(Charset cs) { return cs.name().equalsIgnoreCase("IBM367") || cs.name().equalsIgnoreCase("IBM437") || cs.name().equalsIgnoreCase("US-ASCII") ; } public CharsetDecoder newDecoder() { return new Decoder(this); } public CharsetEncoder newEncoder() { return new Encoder(this); } private static final class Decoder extends CharsetDecoder{ private Decoder(Charset cs){ super(cs, 1, 1); } private native int nDecode(char[] array, int arrPosition, int remaining, long outAddr, int absolutePos); protected CoderResult decodeLoop(ByteBuffer bb, CharBuffer cb){ int cbRemaining = cb.remaining(); /* TODO: support direct byte buffers if(CharsetProviderImpl.hasLoadedNatives() && bb.isDirect() && bb.hasRemaining() && cb.hasArray()){ int toProceed = bb.remaining(); int cbPos = cb.position(); int bbPos = bb.position(); boolean throwOverflow = false; if( cbRemaining < toProceed ) { toProceed = cbRemaining; throwOverflow = true; } int res = nDecode(cb.array(), cb.arrayOffset()+cbPos, toProceed, AddressUtil.getDirectBufferAddress(bb), bbPos); bb.position(bbPos+res); cb.position(cbPos+res); if(throwOverflow) return CoderResult.OVERFLOW; }else{ */ if(bb.hasArray() && cb.hasArray()) { int rem = bb.remaining(); rem = cbRemaining >= rem ? rem : cbRemaining; byte[] bArr = bb.array(); char[] cArr = cb.array(); int bStart = bb.position(); int cStart = cb.position(); int i; for(i=bStart; i<bStart+rem; i++) { char in = (char)(bArr[i] & 0xFF); if(in >= 26){ int index = (int)in - 26; cArr[cStart++] = (char)arr[index]; }else { cArr[cStart++] = (char)(in & 0xFF); } } bb.position(i); cb.position(cStart); if(rem == cbRemaining && bb.hasRemaining()) return CoderResult.OVERFLOW; } else { while(bb.hasRemaining()){ if( cbRemaining == 0 ) return CoderResult.OVERFLOW; char in = (char)(bb.get() & 0xFF); if(in >= 26){ int index = (int)in - 26; cb.put(arr[index]); }else { cb.put((char)(in & 0xFF)); } cbRemaining--; } /* } */ } return CoderResult.UNDERFLOW; } final static char[] arr = { 0x001C,0x001B,0x007F,0x001D,0x001E,0x001F, 0x0020,0x0021,0x0022,0x0023,0x0024,0x0025,0x0026,0x0027, 0x0028,0x0029,0x002A,0x002B,0x002C,0x002D,0x002E,0x002F, 0x0030,0x0031,0x0032,0x0033,0x0034,0x0035,0x0036,0x0037, 0x0038,0x0039,0x003A,0x003B,0x003C,0x003D,0x003E,0x003F, 0x0040,0x0041,0x0042,0x0043,0x0044,0x0045,0x0046,0x0047, 0x0048,0x0049,0x004A,0x004B,0x004C,0x004D,0x004E,0x004F, 0x0050,0x0051,0x0052,0x0053,0x0054,0x0055,0x0056,0x0057, 0x0058,0x0059,0x005A,0x005B,0x005C,0x005D,0x005E,0x005F, 0x0060,0x0061,0x0062,0x0063,0x0064,0x0065,0x0066,0x0067, 0x0068,0x0069,0x006A,0x006B,0x006C,0x006D,0x006E,0x006F, 0x0070,0x0071,0x0072,0x0073,0x0074,0x0075,0x0076,0x0077, 0x0078,0x0079,0x007A,0x007B,0x007C,0x007D,0x007E,0x001A, 0x00C7,0x00FC,0x00E9,0x00E2,0x00E4,0x00E0,0x00E5,0x00E7, 0x00EA,0x00EB,0x00E8,0x00EF,0x00EE,0x00EC,0x00C4,0x00C5, 0x00C9,0x00E6,0x00C6,0x00F4,0x00F6,0x00F2,0x00FB,0x00F9, 0x00FF,0x00D6,0x00DC,0x00A2,0x00A3,0x00A5,0x20A7,0x0192, 0x00E1,0x00ED,0x00F3,0x00FA,0x00F1,0x00D1,0x00AA,0x00BA, 0x00BF,0x2310,0x00AC,0x00BD,0x00BC,0x00A1,0x00AB,0x00BB, 0x2591,0x2592,0x2593,0x2502,0x2524,0x2561,0x2562,0x2556, 0x2555,0x2563,0x2551,0x2557,0x255D,0x255C,0x255B,0x2510, 0x2514,0x2534,0x252C,0x251C,0x2500,0x253C,0x255E,0x255F, 0x255A,0x2554,0x2569,0x2566,0x2560,0x2550,0x256C,0x2567, 0x2568,0x2564,0x2565,0x2559,0x2558,0x2552,0x2553,0x256B, 0x256A,0x2518,0x250C,0x2588,0x2584,0x258C,0x2590,0x2580, 0x03B1,0x00DF,0x0393,0x03C0,0x03A3,0x03C3,0x03BC,0x03C4, 0x03A6,0x0398,0x03A9,0x03B4,0x221E,0x03C6,0x03B5,0x2229, 0x2261,0x00B1,0x2265,0x2264,0x2320,0x2321,0x00F7,0x2248, 0x00B0,0x2219,0x00B7,0x221A,0x207F,0x00B2,0x25A0,0x00A0 }; } private static final class Encoder extends CharsetEncoder{ private Encoder(Charset cs){ super(cs, 1, 1); } private native void nEncode(long outAddr, int absolutePos, char[] array, int arrPosition, int[] res); protected CoderResult encodeLoop(CharBuffer cb, ByteBuffer bb){ int bbRemaining = bb.remaining(); /* TODO: support direct byte buffers if(CharsetProviderImpl.hasLoadedNatives() && bb.isDirect() && cb.hasRemaining() && cb.hasArray()){ int toProceed = cb.remaining(); int cbPos = cb.position(); int bbPos = bb.position(); boolean throwOverflow = false; if( bbRemaining < toProceed ) { toProceed = bbRemaining; throwOverflow = true; } int[] res = {toProceed, 0}; nEncode(AddressUtil.getDirectBufferAddress(bb), bbPos, cb.array(), cb.arrayOffset()+cbPos, res); if( res[0] <= 0 ) { bb.position(bbPos-res[0]); cb.position(cbPos-res[0]); if(res[1]!=0) { if(res[1] < 0) return CoderResult.malformedForLength(-res[1]); else return CoderResult.unmappableForLength(res[1]); } }else{ bb.position(bbPos+res[0]); cb.position(cbPos+res[0]); if(throwOverflow) return CoderResult.OVERFLOW; } }else{ */ if(bb.hasArray() && cb.hasArray()) { byte[] byteArr = bb.array(); char[] charArr = cb.array(); int rem = cb.remaining(); int byteArrStart = bb.position(); rem = bbRemaining <= rem ? bbRemaining : rem; int x; for(x = cb.position(); x < cb.position()+rem; x++) { char c = charArr[x]; if(c > (char)0x25A0){ if (c >= 0xD800 && c <= 0xDFFF) { if(x+1 < cb.limit()) { char c1 = charArr[x+1]; if(c1 >= 0xD800 && c1 <= 0xDFFF) { cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(2); } } else { cb.position(x); bb.position(byteArrStart); return CoderResult.UNDERFLOW; } cb.position(x); bb.position(byteArrStart); return CoderResult.malformedForLength(1); } cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); }else{ if(c < 0x1A) { byteArr[byteArrStart++] = (byte)c; } else { int index = (int)c >> 8; index = encodeIndex[index]; if(index < 0) { cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); } index <<= 8; index += (int)c & 0xFF; if((byte)arr[index] != 0){ byteArr[byteArrStart++] = (byte)arr[index]; }else{ cb.position(x); bb.position(byteArrStart); return CoderResult.unmappableForLength(1); } } } } cb.position(x); bb.position(byteArrStart); if(rem == bbRemaining && cb.hasRemaining()) { return CoderResult.OVERFLOW; } } else { while(cb.hasRemaining()){ if( bbRemaining == 0 ) return CoderResult.OVERFLOW; char c = cb.get(); if(c > (char)0x25A0){ if (c >= 0xD800 && c <= 0xDFFF) { if(cb.hasRemaining()) { char c1 = cb.get(); if(c1 >= 0xD800 && c1 <= 0xDFFF) { cb.position(cb.position()-2); return CoderResult.unmappableForLength(2); } else { cb.position(cb.position()-1); } } else { cb.position(cb.position()-1); return CoderResult.UNDERFLOW; } cb.position(cb.position()-1); return CoderResult.malformedForLength(1); } cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); }else{ if(c < 0x1A) { bb.put((byte)c); } else { int index = (int)c >> 8; index = encodeIndex[index]; if(index < 0) { cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); } index <<= 8; index += (int)c & 0xFF; if((byte)arr[index] != 0){ bb.put((byte)arr[index]); }else{ cb.position(cb.position()-1); return CoderResult.unmappableForLength(1); } } bbRemaining--; } } /* TODO: support direct byte buffers } */ } return CoderResult.UNDERFLOW; } final static char arr[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F, 0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x7F,0x1B,0x1A,0x1D,0x1E,0x1F, 0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27,0x28,0x29,0x2A,0x2B,0x2C,0x2D,0x2E,0x2F, 0x30,0x31,0x32,0x33,0x34,0x35,0x36,0x37,0x38,0x39,0x3A,0x3B,0x3C,0x3D,0x3E,0x3F, 0x40,0x41,0x42,0x43,0x44,0x45,0x46,0x47,0x48,0x49,0x4A,0x4B,0x4C,0x4D,0x4E,0x4F, 0x50,0x51,0x52,0x53,0x54,0x55,0x56,0x57,0x58,0x59,0x5A,0x5B,0x5C,0x5D,0x5E,0x5F, 0x60,0x61,0x62,0x63,0x64,0x65,0x66,0x67,0x68,0x69,0x6A,0x6B,0x6C,0x6D,0x6E,0x6F, 0x70,0x71,0x72,0x73,0x74,0x75,0x76,0x77,0x78,0x79,0x7A,0x7B,0x7C,0x7D,0x7E,0x1C, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xFF,0xAD,0x9B,0x9C,0x00,0x9D,0x00,0x00,0x00,0x00,0xA6,0xAE,0xAA,0x00,0x00,0x00, 0xF8,0xF1,0xFD,0x00,0x00,0x00,0x00,0xFA,0x00,0x00,0xA7,0xAF,0xAC,0xAB,0x00,0xA8, 0x00,0x00,0x00,0x00,0x8E,0x8F,0x92,0x80,0x00,0x90,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xA5,0x00,0x00,0x00,0x00,0x99,0x00,0x00,0x00,0x00,0x00,0x9A,0x00,0x00,0xE1, 0x85,0xA0,0x83,0x00,0x84,0x86,0x91,0x87,0x8A,0x82,0x88,0x89,0x8D,0xA1,0x8C,0x8B, 0x00,0xA4,0x95,0xA2,0x93,0x00,0x94,0xF6,0x00,0x97,0xA3,0x96,0x81,0x00,0x00,0x98, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x9F,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0xE2,0x00,0x00,0x00,0x00,0xE9,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0xE4,0x00,0x00,0xE8,0x00,0x00,0xEA,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xE0,0x00,0x00,0xEB,0xEE,0x00,0x00,0x00,0x00,0x00,0x00,0xE6,0x00,0x00,0x00, 0xE3,0x00,0x00,0xE5,0xE7,0x00,0xED,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xFC, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x9E,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xF9,0xFB,0x00,0x00,0x00,0xEC,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xEF,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xF7,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0xF0,0x00,0x00,0xF3,0xF2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xA9,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xF4,0xF5,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xC4,0x00,0xB3,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xDA,0x00,0x00,0x00, 0xBF,0x00,0x00,0x00,0xC0,0x00,0x00,0x00,0xD9,0x00,0x00,0x00,0xC3,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0xB4,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xC2,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0xC1,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xC5,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xCD,0xBA,0xD5,0xD6,0xC9,0xB8,0xB7,0xBB,0xD4,0xD3,0xC8,0xBE,0xBD,0xBC,0xC6,0xC7, 0xCC,0xB5,0xB6,0xB9,0xD1,0xD2,0xCB,0xCF,0xD0,0xCA,0xD8,0xD7,0xCE,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xDF,0x00,0x00,0x00,0xDC,0x00,0x00,0x00,0xDB,0x00,0x00,0x00,0xDD,0x00,0x00,0x00, 0xDE,0xB0,0xB1,0xB2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0xFE,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }; final static int[] encodeIndex = { 0,1,-1,2,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, 3,-1,4,5,-1,6,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1, -1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1 }; } }
zzsuper001-linuxshell
src/org/apache/harmony/niochar/charset/additional/IBM437.java
Java
asf20
27,504
/* * Copyright (C) 2007 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.google.ase; import java.io.FileDescriptor; /** * Tools for executing commands. */ public class Exec { /** * @param cmd * The command to execute * @param arg0 * The first argument to the command, may be null * @param arg1 * the second argument to the command, may be null * @return the file descriptor of the started process. * */ public static FileDescriptor createSubprocess(String cmd, String arg0, String arg1) { return createSubprocess(cmd, arg0, arg1, null); } /** * @param cmd * The command to execute * @param arg0 * The first argument to the command, may be null * @param arg1 * the second argument to the command, may be null * @param processId * A one-element array to which the process ID of the started process will be written. * @return the file descriptor of the started process. * */ public static native FileDescriptor createSubprocess(String cmd, String arg0, String arg1, int[] processId); public static native void setPtyWindowSize(FileDescriptor fd, int row, int col, int xpixel, int ypixel); /** * Causes the calling thread to wait for the process associated with the receiver to finish * executing. * * @return The exit value of the Process being waited on * */ public static native int waitFor(int processId); static { System.loadLibrary("com_google_ase_Exec"); } }
zzsuper001-linuxshell
src/com/google/ase/Exec.java
Java
asf20
2,111
package com.trilead.ssh2; import java.util.Map; /** * AuthAgentCallback. * * @author Kenny Root * @version $Id$ */ public interface AuthAgentCallback { /** * @return array of blobs containing the OpenSSH-format encoded public keys */ Map<String,byte[]> retrieveIdentities(); /** * @param key A <code>RSAPrivateKey</code> or <code>DSAPrivateKey</code> * containing a DSA or RSA private key of * the user in Trilead object format. * @param comment comment associated with this key * @param confirmUse whether to prompt before using this key * @param lifetime lifetime in seconds for key to be remembered * @return success or failure */ boolean addIdentity(Object key, String comment, boolean confirmUse, int lifetime); /** * @param publicKey byte blob containing the OpenSSH-format encoded public key * @return success or failure */ boolean removeIdentity(byte[] publicKey); /** * @return success or failure */ boolean removeAllIdentities(); /** * @param publicKey byte blob containing the OpenSSH-format encoded public key * @return A <code>RSAPrivateKey</code> or <code>DSAPrivateKey</code> * containing a DSA or RSA private key of * the user in Trilead object format. */ Object getPrivateKey(byte[] publicKey); /** * @return */ boolean isAgentLocked(); /** * @param lockPassphrase */ boolean setAgentLock(String lockPassphrase); /** * @param unlockPassphrase * @return */ boolean requestAgentUnlock(String unlockPassphrase); }
zzsuper001-linuxshell
src/com/trilead/ssh2/AuthAgentCallback.java
Java
asf20
1,551
package com.trilead.ssh2; /** * An abstract marker interface implemented by all proxy data implementations. * * @see HTTPProxyData * * @author Christian Plattner, plattner@trilead.com * @version $Id: ProxyData.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public abstract interface ProxyData { }
zzsuper001-linuxshell
src/com/trilead/ssh2/ProxyData.java
Java
asf20
326
package com.trilead.ssh2; import java.io.BufferedReader; import java.io.CharArrayReader; import java.io.CharArrayWriter; import java.io.File; import java.io.FileReader; import java.io.IOException; import java.io.RandomAccessFile; import java.io.UnsupportedEncodingException; import java.net.InetAddress; import java.net.UnknownHostException; import java.security.SecureRandom; import java.util.Iterator; import java.util.LinkedList; import java.util.Vector; import com.trilead.ssh2.crypto.Base64; import com.trilead.ssh2.crypto.digest.Digest; import com.trilead.ssh2.crypto.digest.HMAC; import com.trilead.ssh2.crypto.digest.MD5; import com.trilead.ssh2.crypto.digest.SHA1; import com.trilead.ssh2.signature.DSAPublicKey; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.RSAPublicKey; import com.trilead.ssh2.signature.RSASHA1Verify; /** * The <code>KnownHosts</code> class is a handy tool to verify received server hostkeys * based on the information in <code>known_hosts</code> files (the ones used by OpenSSH). * <p> * It offers basically an in-memory database for known_hosts entries, as well as some * helper functions. Entries from a <code>known_hosts</code> file can be loaded at construction time. * It is also possible to add more keys later (e.g., one can parse different * <code>known_hosts<code> files). * <p> * It is a thread safe implementation, therefore, you need only to instantiate one * <code>KnownHosts</code> for your whole application. * * @author Christian Plattner, plattner@trilead.com * @version $Id: KnownHosts.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class KnownHosts { public static final int HOSTKEY_IS_OK = 0; public static final int HOSTKEY_IS_NEW = 1; public static final int HOSTKEY_HAS_CHANGED = 2; private class KnownHostsEntry { String[] patterns; Object key; KnownHostsEntry(String[] patterns, Object key) { this.patterns = patterns; this.key = key; } } private LinkedList publicKeys = new LinkedList(); public KnownHosts() { } public KnownHosts(char[] knownHostsData) throws IOException { initialize(knownHostsData); } public KnownHosts(File knownHosts) throws IOException { initialize(knownHosts); } /** * Adds a single public key entry to the database. Note: this will NOT add the public key * to any physical file (e.g., "~/.ssh/known_hosts") - use <code>addHostkeyToFile()</code> for that purpose. * This method is designed to be used in a {@link ServerHostKeyVerifier}. * * @param hostnames a list of hostname patterns - at least one most be specified. Check out the * OpenSSH sshd man page for a description of the pattern matching algorithm. * @param serverHostKeyAlgorithm as passed to the {@link ServerHostKeyVerifier}. * @param serverHostKey as passed to the {@link ServerHostKeyVerifier}. * @throws IOException */ public void addHostkey(String hostnames[], String serverHostKeyAlgorithm, byte[] serverHostKey) throws IOException { if (hostnames == null) throw new IllegalArgumentException("hostnames may not be null"); if ("ssh-rsa".equals(serverHostKeyAlgorithm)) { RSAPublicKey rpk = RSASHA1Verify.decodeSSHRSAPublicKey(serverHostKey); synchronized (publicKeys) { publicKeys.add(new KnownHostsEntry(hostnames, rpk)); } } else if ("ssh-dss".equals(serverHostKeyAlgorithm)) { DSAPublicKey dpk = DSASHA1Verify.decodeSSHDSAPublicKey(serverHostKey); synchronized (publicKeys) { publicKeys.add(new KnownHostsEntry(hostnames, dpk)); } } else throw new IOException("Unknwon host key type (" + serverHostKeyAlgorithm + ")"); } /** * Parses the given known_hosts data and adds entries to the database. * * @param knownHostsData * @throws IOException */ public void addHostkeys(char[] knownHostsData) throws IOException { initialize(knownHostsData); } /** * Parses the given known_hosts file and adds entries to the database. * * @param knownHosts * @throws IOException */ public void addHostkeys(File knownHosts) throws IOException { initialize(knownHosts); } /** * Generate the hashed representation of the given hostname. Useful for adding entries * with hashed hostnames to a known_hosts file. (see -H option of OpenSSH key-gen). * * @param hostname * @return the hashed representation, e.g., "|1|cDhrv7zwEUV3k71CEPHnhHZezhA=|Xo+2y6rUXo2OIWRAYhBOIijbJMA=" */ public static final String createHashedHostname(String hostname) { SHA1 sha1 = new SHA1(); byte[] salt = new byte[sha1.getDigestLength()]; new SecureRandom().nextBytes(salt); byte[] hash = hmacSha1Hash(salt, hostname); String base64_salt = new String(Base64.encode(salt)); String base64_hash = new String(Base64.encode(hash)); return new String("|1|" + base64_salt + "|" + base64_hash); } private static final byte[] hmacSha1Hash(byte[] salt, String hostname) { SHA1 sha1 = new SHA1(); if (salt.length != sha1.getDigestLength()) throw new IllegalArgumentException("Salt has wrong length (" + salt.length + ")"); HMAC hmac = new HMAC(sha1, salt, salt.length); try { hmac.update(hostname.getBytes("ISO-8859-1")); }catch(UnsupportedEncodingException ignore) { /* Actually, ISO-8859-1 is supported by all correct * Java implementations. But... you never know. */ hmac.update(hostname.getBytes()); } byte[] dig = new byte[hmac.getDigestLength()]; hmac.digest(dig); return dig; } private final boolean checkHashed(String entry, String hostname) { if (entry.startsWith("|1|") == false) return false; int delim_idx = entry.indexOf('|', 3); if (delim_idx == -1) return false; String salt_base64 = entry.substring(3, delim_idx); String hash_base64 = entry.substring(delim_idx + 1); byte[] salt = null; byte[] hash = null; try { salt = Base64.decode(salt_base64.toCharArray()); hash = Base64.decode(hash_base64.toCharArray()); } catch (IOException e) { return false; } SHA1 sha1 = new SHA1(); if (salt.length != sha1.getDigestLength()) return false; byte[] dig = hmacSha1Hash(salt, hostname); for (int i = 0; i < dig.length; i++) if (dig[i] != hash[i]) return false; return true; } private int checkKey(String remoteHostname, Object remoteKey) { int result = HOSTKEY_IS_NEW; synchronized (publicKeys) { Iterator i = publicKeys.iterator(); while (i.hasNext()) { KnownHostsEntry ke = (KnownHostsEntry) i.next(); if (hostnameMatches(ke.patterns, remoteHostname) == false) continue; boolean res = matchKeys(ke.key, remoteKey); if (res == true) return HOSTKEY_IS_OK; result = HOSTKEY_HAS_CHANGED; } } return result; } private Vector getAllKeys(String hostname) { Vector keys = new Vector(); synchronized (publicKeys) { Iterator i = publicKeys.iterator(); while (i.hasNext()) { KnownHostsEntry ke = (KnownHostsEntry) i.next(); if (hostnameMatches(ke.patterns, hostname) == false) continue; keys.addElement(ke.key); } } return keys; } /** * Try to find the preferred order of hostkey algorithms for the given hostname. * Based on the type of hostkey that is present in the internal database * (i.e., either <code>ssh-rsa</code> or <code>ssh-dss</code>) * an ordered list of hostkey algorithms is returned which can be passed * to <code>Connection.setServerHostKeyAlgorithms</code>. * * @param hostname * @return <code>null</code> if no key for the given hostname is present or * there are keys of multiple types present for the given hostname. Otherwise, * an array with hostkey algorithms is returned (i.e., an array of length 2). */ public String[] getPreferredServerHostkeyAlgorithmOrder(String hostname) { String[] algos = recommendHostkeyAlgorithms(hostname); if (algos != null) return algos; InetAddress[] ipAdresses = null; try { ipAdresses = InetAddress.getAllByName(hostname); } catch (UnknownHostException e) { return null; } for (int i = 0; i < ipAdresses.length; i++) { algos = recommendHostkeyAlgorithms(ipAdresses[i].getHostAddress()); if (algos != null) return algos; } return null; } private final boolean hostnameMatches(String[] hostpatterns, String hostname) { boolean isMatch = false; boolean negate = false; hostname = hostname.toLowerCase(); for (int k = 0; k < hostpatterns.length; k++) { if (hostpatterns[k] == null) continue; String pattern = null; /* In contrast to OpenSSH we also allow negated hash entries (as well as hashed * entries in lines with multiple entries). */ if ((hostpatterns[k].length() > 0) && (hostpatterns[k].charAt(0) == '!')) { pattern = hostpatterns[k].substring(1); negate = true; } else { pattern = hostpatterns[k]; negate = false; } /* Optimize, no need to check this entry */ if ((isMatch) && (negate == false)) continue; /* Now compare */ if (pattern.charAt(0) == '|') { if (checkHashed(pattern, hostname)) { if (negate) return false; isMatch = true; } } else { pattern = pattern.toLowerCase(); if ((pattern.indexOf('?') != -1) || (pattern.indexOf('*') != -1)) { if (pseudoRegex(pattern.toCharArray(), 0, hostname.toCharArray(), 0)) { if (negate) return false; isMatch = true; } } else if (pattern.compareTo(hostname) == 0) { if (negate) return false; isMatch = true; } } } return isMatch; } private void initialize(char[] knownHostsData) throws IOException { BufferedReader br = new BufferedReader(new CharArrayReader(knownHostsData)); while (true) { String line = br.readLine(); if (line == null) break; line = line.trim(); if (line.startsWith("#")) continue; String[] arr = line.split(" "); if (arr.length >= 3) { if ((arr[1].compareTo("ssh-rsa") == 0) || (arr[1].compareTo("ssh-dss") == 0)) { String[] hostnames = arr[0].split(","); byte[] msg = Base64.decode(arr[2].toCharArray()); addHostkey(hostnames, arr[1], msg); } } } } private void initialize(File knownHosts) throws IOException { char[] buff = new char[512]; CharArrayWriter cw = new CharArrayWriter(); knownHosts.createNewFile(); FileReader fr = new FileReader(knownHosts); while (true) { int len = fr.read(buff); if (len < 0) break; cw.write(buff, 0, len); } fr.close(); initialize(cw.toCharArray()); } private final boolean matchKeys(Object key1, Object key2) { if ((key1 instanceof RSAPublicKey) && (key2 instanceof RSAPublicKey)) { RSAPublicKey savedRSAKey = (RSAPublicKey) key1; RSAPublicKey remoteRSAKey = (RSAPublicKey) key2; if (savedRSAKey.getE().equals(remoteRSAKey.getE()) == false) return false; if (savedRSAKey.getN().equals(remoteRSAKey.getN()) == false) return false; return true; } if ((key1 instanceof DSAPublicKey) && (key2 instanceof DSAPublicKey)) { DSAPublicKey savedDSAKey = (DSAPublicKey) key1; DSAPublicKey remoteDSAKey = (DSAPublicKey) key2; if (savedDSAKey.getG().equals(remoteDSAKey.getG()) == false) return false; if (savedDSAKey.getP().equals(remoteDSAKey.getP()) == false) return false; if (savedDSAKey.getQ().equals(remoteDSAKey.getQ()) == false) return false; if (savedDSAKey.getY().equals(remoteDSAKey.getY()) == false) return false; return true; } return false; } private final boolean pseudoRegex(char[] pattern, int i, char[] match, int j) { /* This matching logic is equivalent to the one present in OpenSSH 4.1 */ while (true) { /* Are we at the end of the pattern? */ if (pattern.length == i) return (match.length == j); if (pattern[i] == '*') { i++; if (pattern.length == i) return true; if ((pattern[i] != '*') && (pattern[i] != '?')) { while (true) { if ((pattern[i] == match[j]) && pseudoRegex(pattern, i + 1, match, j + 1)) return true; j++; if (match.length == j) return false; } } while (true) { if (pseudoRegex(pattern, i, match, j)) return true; j++; if (match.length == j) return false; } } if (match.length == j) return false; if ((pattern[i] != '?') && (pattern[i] != match[j])) return false; i++; j++; } } private String[] recommendHostkeyAlgorithms(String hostname) { String preferredAlgo = null; Vector keys = getAllKeys(hostname); for (int i = 0; i < keys.size(); i++) { String thisAlgo = null; if (keys.elementAt(i) instanceof RSAPublicKey) thisAlgo = "ssh-rsa"; else if (keys.elementAt(i) instanceof DSAPublicKey) thisAlgo = "ssh-dss"; else continue; if (preferredAlgo != null) { /* If we find different key types, then return null */ if (preferredAlgo.compareTo(thisAlgo) != 0) return null; /* OK, we found the same algo again, optimize */ continue; } } /* If we did not find anything that we know of, return null */ if (preferredAlgo == null) return null; /* Now put the preferred algo to the start of the array. * You may ask yourself why we do it that way - basically, we could just * return only the preferred algorithm: since we have a saved key of that * type (sent earlier from the remote host), then that should work out. * However, imagine that the server is (for whatever reasons) not offering * that type of hostkey anymore (e.g., "ssh-rsa" was disabled and * now "ssh-dss" is being used). If we then do not let the server send us * a fresh key of the new type, then we shoot ourself into the foot: * the connection cannot be established and hence the user cannot decide * if he/she wants to accept the new key. */ if (preferredAlgo.equals("ssh-rsa")) return new String[] { "ssh-rsa", "ssh-dss" }; return new String[] { "ssh-dss", "ssh-rsa" }; } /** * Checks the internal hostkey database for the given hostkey. * If no matching key can be found, then the hostname is resolved to an IP address * and the search is repeated using that IP address. * * @param hostname the server's hostname, will be matched with all hostname patterns * @param serverHostKeyAlgorithm type of hostkey, either <code>ssh-rsa</code> or <code>ssh-dss</code> * @param serverHostKey the key blob * @return <ul> * <li><code>HOSTKEY_IS_OK</code>: the given hostkey matches an entry for the given hostname</li> * <li><code>HOSTKEY_IS_NEW</code>: no entries found for this hostname and this type of hostkey</li> * <li><code>HOSTKEY_HAS_CHANGED</code>: hostname is known, but with another key of the same type * (man-in-the-middle attack?)</li> * </ul> * @throws IOException if the supplied key blob cannot be parsed or does not match the given hostkey type. */ public int verifyHostkey(String hostname, String serverHostKeyAlgorithm, byte[] serverHostKey) throws IOException { Object remoteKey = null; if ("ssh-rsa".equals(serverHostKeyAlgorithm)) { remoteKey = RSASHA1Verify.decodeSSHRSAPublicKey(serverHostKey); } else if ("ssh-dss".equals(serverHostKeyAlgorithm)) { remoteKey = DSASHA1Verify.decodeSSHDSAPublicKey(serverHostKey); } else throw new IllegalArgumentException("Unknown hostkey type " + serverHostKeyAlgorithm); int result = checkKey(hostname, remoteKey); if (result == HOSTKEY_IS_OK) return result; InetAddress[] ipAdresses = null; try { ipAdresses = InetAddress.getAllByName(hostname); } catch (UnknownHostException e) { return result; } for (int i = 0; i < ipAdresses.length; i++) { int newresult = checkKey(ipAdresses[i].getHostAddress(), remoteKey); if (newresult == HOSTKEY_IS_OK) return newresult; if (newresult == HOSTKEY_HAS_CHANGED) result = HOSTKEY_HAS_CHANGED; } return result; } /** * Adds a single public key entry to the a known_hosts file. * This method is designed to be used in a {@link ServerHostKeyVerifier}. * * @param knownHosts the file where the publickey entry will be appended. * @param hostnames a list of hostname patterns - at least one most be specified. Check out the * OpenSSH sshd man page for a description of the pattern matching algorithm. * @param serverHostKeyAlgorithm as passed to the {@link ServerHostKeyVerifier}. * @param serverHostKey as passed to the {@link ServerHostKeyVerifier}. * @throws IOException */ public final static void addHostkeyToFile(File knownHosts, String[] hostnames, String serverHostKeyAlgorithm, byte[] serverHostKey) throws IOException { if ((hostnames == null) || (hostnames.length == 0)) throw new IllegalArgumentException("Need at least one hostname specification"); if ((serverHostKeyAlgorithm == null) || (serverHostKey == null)) throw new IllegalArgumentException(); CharArrayWriter writer = new CharArrayWriter(); for (int i = 0; i < hostnames.length; i++) { if (i != 0) writer.write(','); writer.write(hostnames[i]); } writer.write(' '); writer.write(serverHostKeyAlgorithm); writer.write(' '); writer.write(Base64.encode(serverHostKey)); writer.write("\n"); char[] entry = writer.toCharArray(); RandomAccessFile raf = new RandomAccessFile(knownHosts, "rw"); long len = raf.length(); if (len > 0) { raf.seek(len - 1); int last = raf.read(); if (last != '\n') raf.write('\n'); } raf.write(new String(entry).getBytes("ISO-8859-1")); raf.close(); } /** * Generates a "raw" fingerprint of a hostkey. * * @param type either "md5" or "sha1" * @param keyType either "ssh-rsa" or "ssh-dss" * @param hostkey the hostkey * @return the raw fingerprint */ static final private byte[] rawFingerPrint(String type, String keyType, byte[] hostkey) { Digest dig = null; if ("md5".equals(type)) { dig = new MD5(); } else if ("sha1".equals(type)) { dig = new SHA1(); } else throw new IllegalArgumentException("Unknown hash type " + type); if ("ssh-rsa".equals(keyType)) { } else if ("ssh-dss".equals(keyType)) { } else throw new IllegalArgumentException("Unknown key type " + keyType); if (hostkey == null) throw new IllegalArgumentException("hostkey is null"); dig.update(hostkey); byte[] res = new byte[dig.getDigestLength()]; dig.digest(res); return res; } /** * Convert a raw fingerprint to hex representation (XX:YY:ZZ...). * @param fingerprint raw fingerprint * @return the hex representation */ static final private String rawToHexFingerprint(byte[] fingerprint) { final char[] alpha = "0123456789abcdef".toCharArray(); StringBuffer sb = new StringBuffer(); for (int i = 0; i < fingerprint.length; i++) { if (i != 0) sb.append(':'); int b = fingerprint[i] & 0xff; sb.append(alpha[b >> 4]); sb.append(alpha[b & 15]); } return sb.toString(); } /** * Convert a raw fingerprint to bubblebabble representation. * @param raw raw fingerprint * @return the bubblebabble representation */ static final private String rawToBubblebabbleFingerprint(byte[] raw) { final char[] v = "aeiouy".toCharArray(); final char[] c = "bcdfghklmnprstvzx".toCharArray(); StringBuffer sb = new StringBuffer(); int seed = 1; int rounds = (raw.length / 2) + 1; sb.append('x'); for (int i = 0; i < rounds; i++) { if (((i + 1) < rounds) || ((raw.length) % 2 != 0)) { sb.append(v[(((raw[2 * i] >> 6) & 3) + seed) % 6]); sb.append(c[(raw[2 * i] >> 2) & 15]); sb.append(v[((raw[2 * i] & 3) + (seed / 6)) % 6]); if ((i + 1) < rounds) { sb.append(c[(((raw[(2 * i) + 1])) >> 4) & 15]); sb.append('-'); sb.append(c[(((raw[(2 * i) + 1]))) & 15]); // As long as seed >= 0, seed will be >= 0 afterwards seed = ((seed * 5) + (((raw[2 * i] & 0xff) * 7) + (raw[(2 * i) + 1] & 0xff))) % 36; } } else { sb.append(v[seed % 6]); // seed >= 0, therefore index positive sb.append('x'); sb.append(v[seed / 6]); } } sb.append('x'); return sb.toString(); } /** * Convert a ssh2 key-blob into a human readable hex fingerprint. * Generated fingerprints are identical to those generated by OpenSSH. * <p> * Example fingerprint: d0:cb:76:19:99:5a:03:fc:73:10:70:93:f2:44:63:47. * @param keytype either "ssh-rsa" or "ssh-dss" * @param publickey key blob * @return Hex fingerprint */ public final static String createHexFingerprint(String keytype, byte[] publickey) { byte[] raw = rawFingerPrint("md5", keytype, publickey); return rawToHexFingerprint(raw); } /** * Convert a ssh2 key-blob into a human readable bubblebabble fingerprint. * The used bubblebabble algorithm (taken from OpenSSH) generates fingerprints * that are easier to remember for humans. * <p> * Example fingerprint: xofoc-bubuz-cazin-zufyl-pivuk-biduk-tacib-pybur-gonar-hotat-lyxux. * * @param keytype either "ssh-rsa" or "ssh-dss" * @param publickey key data * @return Bubblebabble fingerprint */ public final static String createBubblebabbleFingerprint(String keytype, byte[] publickey) { byte[] raw = rawFingerPrint("sha1", keytype, publickey); return rawToBubblebabbleFingerprint(raw); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/KnownHosts.java
Java
asf20
22,370
package com.trilead.ssh2; /** * An <code>InteractiveCallback</code> is used to respond to challenges sent * by the server if authentication mode "keyboard-interactive" is selected. * * @see Connection#authenticateWithKeyboardInteractive(String, * String[], InteractiveCallback) * * @author Christian Plattner, plattner@trilead.com * @version $Id: InteractiveCallback.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public interface InteractiveCallback { /** * This callback interface is used during a "keyboard-interactive" * authentication. Every time the server sends a set of challenges (however, * most often just one challenge at a time), this callback function will be * called to give your application a chance to talk to the user and to * determine the response(s). * <p> * Some copy-paste information from the standard: a command line interface * (CLI) client SHOULD print the name and instruction (if non-empty), adding * newlines. Then for each prompt in turn, the client SHOULD display the * prompt and read the user input. The name and instruction fields MAY be * empty strings, the client MUST be prepared to handle this correctly. The * prompt field(s) MUST NOT be empty strings. * <p> * Please refer to draft-ietf-secsh-auth-kbdinteract-XX.txt for the details. * <p> * Note: clients SHOULD use control character filtering as discussed in * RFC4251 to avoid attacks by including * terminal control characters in the fields to be displayed. * * @param name * the name String sent by the server. * @param instruction * the instruction String sent by the server. * @param numPrompts * number of prompts - may be zero (in this case, you should just * return a String array of length zero). * @param prompt * an array (length <code>numPrompts</code>) of Strings * @param echo * an array (length <code>numPrompts</code>) of booleans. For * each prompt, the corresponding echo field indicates whether or * not the user input should be echoed as characters are typed. * @return an array of reponses - the array size must match the parameter * <code>numPrompts</code>. */ public String[] replyToChallenge(String name, String instruction, int numPrompts, String[] prompt, boolean[] echo) throws Exception; }
zzsuper001-linuxshell
src/com/trilead/ssh2/InteractiveCallback.java
Java
asf20
2,460
package com.trilead.ssh2; import java.io.CharArrayWriter; import java.io.File; import java.io.FileReader; import java.io.IOException; import java.net.InetSocketAddress; import java.net.SocketTimeoutException; import java.security.SecureRandom; import java.util.Vector; import com.trilead.ssh2.auth.AuthenticationManager; import com.trilead.ssh2.channel.ChannelManager; import com.trilead.ssh2.crypto.CryptoWishList; import com.trilead.ssh2.crypto.cipher.BlockCipherFactory; import com.trilead.ssh2.crypto.digest.MAC; import com.trilead.ssh2.log.Logger; import com.trilead.ssh2.packets.PacketIgnore; import com.trilead.ssh2.transport.KexManager; import com.trilead.ssh2.transport.TransportManager; import com.trilead.ssh2.util.TimeoutService; import com.trilead.ssh2.util.TimeoutService.TimeoutToken; /** * A <code>Connection</code> is used to establish an encrypted TCP/IP * connection to a SSH-2 server. * <p> * Typically, one * <ol> * <li>creates a {@link #Connection(String) Connection} object.</li> * <li>calls the {@link #connect() connect()} method.</li> * <li>calls some of the authentication methods (e.g., * {@link #authenticateWithPublicKey(String, File, String) authenticateWithPublicKey()}).</li> * <li>calls one or several times the {@link #openSession() openSession()} * method.</li> * <li>finally, one must close the connection and release resources with the * {@link #close() close()} method.</li> * </ol> * * @author Christian Plattner, plattner@trilead.com * @version $Id: Connection.java,v 1.3 2008/04/01 12:38:09 cplattne Exp $ */ public class Connection { /** * The identifier presented to the SSH-2 server. */ public final static String identification = "TrileadSSH2Java_213"; /** * Will be used to generate all random data needed for the current * connection. Note: SecureRandom.nextBytes() is thread safe. */ private SecureRandom generator; /** * Unless you know what you are doing, you will never need this. * * @return The list of supported cipher algorithms by this implementation. */ public static synchronized String[] getAvailableCiphers() { return BlockCipherFactory.getDefaultCipherList(); } /** * Unless you know what you are doing, you will never need this. * * @return The list of supported MAC algorthims by this implementation. */ public static synchronized String[] getAvailableMACs() { return MAC.getMacList(); } /** * Unless you know what you are doing, you will never need this. * * @return The list of supported server host key algorthims by this * implementation. */ public static synchronized String[] getAvailableServerHostKeyAlgorithms() { return KexManager.getDefaultServerHostkeyAlgorithmList(); } private AuthenticationManager am; private boolean authenticated = false; private boolean compression = false; private ChannelManager cm; private CryptoWishList cryptoWishList = new CryptoWishList(); private DHGexParameters dhgexpara = new DHGexParameters(); private final String hostname; private final int port; private TransportManager tm; private boolean tcpNoDelay = false; private ProxyData proxyData = null; private Vector<ConnectionMonitor> connectionMonitors = new Vector<ConnectionMonitor>(); /** * Prepares a fresh <code>Connection</code> object which can then be used * to establish a connection to the specified SSH-2 server. * <p> * Same as {@link #Connection(String, int) Connection(hostname, 22)}. * * @param hostname * the hostname of the SSH-2 server. */ public Connection(String hostname) { this(hostname, 22); } /** * Prepares a fresh <code>Connection</code> object which can then be used * to establish a connection to the specified SSH-2 server. * * @param hostname * the host where we later want to connect to. * @param port * port on the server, normally 22. */ public Connection(String hostname, int port) { this.hostname = hostname; this.port = port; } /** * After a successful connect, one has to authenticate oneself. This method * is based on DSA (it uses DSA to sign a challenge sent by the server). * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If the server does not accept the request (or if further * authentication steps are needed), <code>false</code> is returned and * one can retry either by using this or any other authentication method * (use the <code>getRemainingAuthMethods</code> method to get a list of * the remaining possible methods). * * @param user * A <code>String</code> holding the username. * @param pem * A <code>String</code> containing the DSA private key of the * user in OpenSSH key format (PEM, you can't miss the * "-----BEGIN DSA PRIVATE KEY-----" tag). The string may contain * linefeeds. * @param password * If the PEM string is 3DES encrypted ("DES-EDE3-CBC"), then you * must specify the password. Otherwise, this argument will be * ignored and can be set to <code>null</code>. * * @return whether the connection is now authenticated. * @throws IOException * * @deprecated You should use one of the * {@link #authenticateWithPublicKey(String, File, String) authenticateWithPublicKey()} * methods, this method is just a wrapper for it and will * disappear in future builds. * */ public synchronized boolean authenticateWithDSA(String user, String pem, String password) throws IOException { if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); if (pem == null) throw new IllegalArgumentException("pem argument is null"); authenticated = am.authenticatePublicKey(user, pem.toCharArray(), password, getOrCreateSecureRND()); return authenticated; } /** * A wrapper that calls * {@link #authenticateWithKeyboardInteractive(String, String[], InteractiveCallback) * authenticateWithKeyboardInteractivewith} a <code>null</code> submethod * list. * * @param user * A <code>String</code> holding the username. * @param cb * An <code>InteractiveCallback</code> which will be used to * determine the responses to the questions asked by the server. * @return whether the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithKeyboardInteractive(String user, InteractiveCallback cb) throws IOException { return authenticateWithKeyboardInteractive(user, null, cb); } /** * After a successful connect, one has to authenticate oneself. This method * is based on "keyboard-interactive", specified in * draft-ietf-secsh-auth-kbdinteract-XX. Basically, you have to define a * callback object which will be feeded with challenges generated by the * server. Answers are then sent back to the server. It is possible that the * callback will be called several times during the invocation of this * method (e.g., if the server replies to the callback's answer(s) with * another challenge...) * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If the server does not accept the request (or if further * authentication steps are needed), <code>false</code> is returned and * one can retry either by using this or any other authentication method * (use the <code>getRemainingAuthMethods</code> method to get a list of * the remaining possible methods). * <p> * Note: some SSH servers advertise "keyboard-interactive", however, any * interactive request will be denied (without having sent any challenge to * the client). * * @param user * A <code>String</code> holding the username. * @param submethods * An array of submethod names, see * draft-ietf-secsh-auth-kbdinteract-XX. May be <code>null</code> * to indicate an empty list. * @param cb * An <code>InteractiveCallback</code> which will be used to * determine the responses to the questions asked by the server. * * @return whether the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithKeyboardInteractive(String user, String[] submethods, InteractiveCallback cb) throws IOException { if (cb == null) throw new IllegalArgumentException("Callback may not ne NULL!"); if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); authenticated = am.authenticateInteractive(user, submethods, cb); return authenticated; } /** * After a successful connect, one has to authenticate oneself. This method * sends username and password to the server. * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If the server does not accept the request (or if further * authentication steps are needed), <code>false</code> is returned and * one can retry either by using this or any other authentication method * (use the <code>getRemainingAuthMethods</code> method to get a list of * the remaining possible methods). * <p> * Note: if this method fails, then please double-check that it is actually * offered by the server (use * {@link #getRemainingAuthMethods(String) getRemainingAuthMethods()}. * <p> * Often, password authentication is disabled, but users are not aware of * it. Many servers only offer "publickey" and "keyboard-interactive". * However, even though "keyboard-interactive" *feels* like password * authentication (e.g., when using the putty or openssh clients) it is * *not* the same mechanism. * * @param user * @param password * @return if the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithPassword(String user, String password) throws IOException { if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); if (password == null) throw new IllegalArgumentException("password argument is null"); authenticated = am.authenticatePassword(user, password); return authenticated; } /** * After a successful connect, one has to authenticate oneself. This method * can be used to explicitly use the special "none" authentication method * (where only a username has to be specified). * <p> * Note 1: The "none" method may always be tried by clients, however as by * the specs, the server will not explicitly announce it. In other words, * the "none" token will never show up in the list returned by * {@link #getRemainingAuthMethods(String)}. * <p> * Note 2: no matter which one of the authenticateWithXXX() methods you * call, the library will always issue exactly one initial "none" * authentication request to retrieve the initially allowed list of * authentication methods by the server. Please read RFC 4252 for the * details. * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If further authentication steps are needed, <code>false</code> * is returned and one can retry by any other authentication method (use the * <code>getRemainingAuthMethods</code> method to get a list of the * remaining possible methods). * * @param user * @return if the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithNone(String user) throws IOException { if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); /* Trigger the sending of the PacketUserauthRequestNone packet */ /* (if not already done) */ authenticated = am.authenticateNone(user); return authenticated; } /** * After a successful connect, one has to authenticate oneself. The * authentication method "publickey" works by signing a challenge sent by * the server. The signature is either DSA or RSA based - it just depends on * the type of private key you specify, either a DSA or RSA private key in * PEM format. And yes, this is may seem to be a little confusing, the * method is called "publickey" in the SSH-2 protocol specification, however * since we need to generate a signature, you actually have to supply a * private key =). * <p> * The private key contained in the PEM file may also be encrypted * ("Proc-Type: 4,ENCRYPTED"). The library supports DES-CBC and DES-EDE3-CBC * encryption, as well as the more exotic PEM encrpytions AES-128-CBC, * AES-192-CBC and AES-256-CBC. * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If the server does not accept the request (or if further * authentication steps are needed), <code>false</code> is returned and * one can retry either by using this or any other authentication method * (use the <code>getRemainingAuthMethods</code> method to get a list of * the remaining possible methods). * <p> * NOTE PUTTY USERS: Event though your key file may start with * "-----BEGIN..." it is not in the expected format. You have to convert it * to the OpenSSH key format by using the "puttygen" tool (can be downloaded * from the Putty website). Simply load your key and then use the * "Conversions/Export OpenSSH key" functionality to get a proper PEM file. * * @param user * A <code>String</code> holding the username. * @param pemPrivateKey * A <code>char[]</code> containing a DSA or RSA private key of * the user in OpenSSH key format (PEM, you can't miss the * "-----BEGIN DSA PRIVATE KEY-----" or "-----BEGIN RSA PRIVATE * KEY-----" tag). The char array may contain * linebreaks/linefeeds. * @param password * If the PEM structure is encrypted ("Proc-Type: 4,ENCRYPTED") * then you must specify a password. Otherwise, this argument * will be ignored and can be set to <code>null</code>. * * @return whether the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithPublicKey(String user, char[] pemPrivateKey, String password) throws IOException { if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); if (pemPrivateKey == null) throw new IllegalArgumentException("pemPrivateKey argument is null"); authenticated = am.authenticatePublicKey(user, pemPrivateKey, password, getOrCreateSecureRND()); return authenticated; } /** * After a successful connect, one has to authenticate oneself. The * authentication method "publickey" works by signing a challenge sent by * the server. The signature is either DSA or RSA based - it just depends on * the type of private key you specify, either a DSA or RSA private key in * PEM format. And yes, this is may seem to be a little confusing, the * method is called "publickey" in the SSH-2 protocol specification, however * since we need to generate a signature, you actually have to supply a * private key =). * <p> * If the authentication phase is complete, <code>true</code> will be * returned. If the server does not accept the request (or if further * authentication steps are needed), <code>false</code> is returned and * one can retry either by using this or any other authentication method * (use the <code>getRemainingAuthMethods</code> method to get a list of * the remaining possible methods). * * @param user * A <code>String</code> holding the username. * @param key * A <code>RSAPrivateKey</code> or <code>DSAPrivateKey</code> * containing a DSA or RSA private key of * the user in Trilead object format. * * @return whether the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithPublicKey(String user, Object key) throws IOException { if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); if (user == null) throw new IllegalArgumentException("user argument is null"); if (key == null) throw new IllegalArgumentException("Key argument is null"); authenticated = am.authenticatePublicKey(user, key, getOrCreateSecureRND()); return authenticated; } /** * A convenience wrapper function which reads in a private key (PEM format, * either DSA or RSA) and then calls * <code>authenticateWithPublicKey(String, char[], String)</code>. * <p> * NOTE PUTTY USERS: Event though your key file may start with * "-----BEGIN..." it is not in the expected format. You have to convert it * to the OpenSSH key format by using the "puttygen" tool (can be downloaded * from the Putty website). Simply load your key and then use the * "Conversions/Export OpenSSH key" functionality to get a proper PEM file. * * @param user * A <code>String</code> holding the username. * @param pemFile * A <code>File</code> object pointing to a file containing a * DSA or RSA private key of the user in OpenSSH key format (PEM, * you can't miss the "-----BEGIN DSA PRIVATE KEY-----" or * "-----BEGIN RSA PRIVATE KEY-----" tag). * @param password * If the PEM file is encrypted then you must specify the * password. Otherwise, this argument will be ignored and can be * set to <code>null</code>. * * @return whether the connection is now authenticated. * @throws IOException */ public synchronized boolean authenticateWithPublicKey(String user, File pemFile, String password) throws IOException { if (pemFile == null) throw new IllegalArgumentException("pemFile argument is null"); char[] buff = new char[256]; CharArrayWriter cw = new CharArrayWriter(); FileReader fr = new FileReader(pemFile); while (true) { int len = fr.read(buff); if (len < 0) break; cw.write(buff, 0, len); } fr.close(); return authenticateWithPublicKey(user, cw.toCharArray(), password); } /** * Add a {@link ConnectionMonitor} to this connection. Can be invoked at any * time, but it is best to add connection monitors before invoking * <code>connect()</code> to avoid glitches (e.g., you add a connection * monitor after a successful connect(), but the connection has died in the * mean time. Then, your connection monitor won't be notified.) * <p> * You can add as many monitors as you like. * * @see ConnectionMonitor * * @param cmon * An object implementing the <code>ConnectionMonitor</code> * interface. */ public synchronized void addConnectionMonitor(ConnectionMonitor cmon) { if (cmon == null) throw new IllegalArgumentException("cmon argument is null"); connectionMonitors.addElement(cmon); if (tm != null) tm.setConnectionMonitors(connectionMonitors); } /** * Controls whether compression is used on the link or not. * <p> * Note: This can only be called before connect() * @param enabled whether to enable compression * @throws IOException */ public synchronized void setCompression(boolean enabled) throws IOException { if (tm != null) throw new IOException("Connection to " + hostname + " is already in connected state!"); compression = enabled; } /** * Close the connection to the SSH-2 server. All assigned sessions will be * closed, too. Can be called at any time. Don't forget to call this once * you don't need a connection anymore - otherwise the receiver thread may * run forever. */ public synchronized void close() { Throwable t = new Throwable("Closed due to user request."); close(t, false); } private void close(Throwable t, boolean hard) { if (cm != null) cm.closeAllChannels(); if (tm != null) { tm.close(t, hard == false); tm = null; } am = null; cm = null; authenticated = false; } /** * Same as * {@link #connect(ServerHostKeyVerifier, int, int) connect(null, 0, 0)}. * * @return see comments for the * {@link #connect(ServerHostKeyVerifier, int, int) connect(ServerHostKeyVerifier, int, int)} * method. * @throws IOException */ public synchronized ConnectionInfo connect() throws IOException { return connect(null, 0, 0); } /** * Same as * {@link #connect(ServerHostKeyVerifier, int, int) connect(verifier, 0, 0)}. * * @return see comments for the * {@link #connect(ServerHostKeyVerifier, int, int) connect(ServerHostKeyVerifier, int, int)} * method. * @throws IOException */ public synchronized ConnectionInfo connect(ServerHostKeyVerifier verifier) throws IOException { return connect(verifier, 0, 0); } /** * Connect to the SSH-2 server and, as soon as the server has presented its * host key, use the * {@link ServerHostKeyVerifier#verifyServerHostKey(String, int, String, * byte[]) ServerHostKeyVerifier.verifyServerHostKey()} method of the * <code>verifier</code> to ask for permission to proceed. If * <code>verifier</code> is <code>null</code>, then any host key will * be accepted - this is NOT recommended, since it makes man-in-the-middle * attackes VERY easy (somebody could put a proxy SSH server between you and * the real server). * <p> * Note: The verifier will be called before doing any crypto calculations * (i.e., diffie-hellman). Therefore, if you don't like the presented host * key then no CPU cycles are wasted (and the evil server has less * information about us). * <p> * However, it is still possible that the server presented a fake host key: * the server cheated (typically a sign for a man-in-the-middle attack) and * is not able to generate a signature that matches its host key. Don't * worry, the library will detect such a scenario later when checking the * signature (the signature cannot be checked before having completed the * diffie-hellman exchange). * <p> * Note 2: The {@link ServerHostKeyVerifier#verifyServerHostKey(String, int, * String, byte[]) ServerHostKeyVerifier.verifyServerHostKey()} method will * *NOT* be called from the current thread, the call is being made from a * background thread (there is a background dispatcher thread for every * established connection). * <p> * Note 3: This method will block as long as the key exchange of the * underlying connection has not been completed (and you have not specified * any timeouts). * <p> * Note 4: If you want to re-use a connection object that was successfully * connected, then you must call the {@link #close()} method before invoking * <code>connect()</code> again. * * @param verifier * An object that implements the {@link ServerHostKeyVerifier} * interface. Pass <code>null</code> to accept any server host * key - NOT recommended. * * @param connectTimeout * Connect the underlying TCP socket to the server with the given * timeout value (non-negative, in milliseconds). Zero means no * timeout. If a proxy is being used (see * {@link #setProxyData(ProxyData)}), then this timeout is used * for the connection establishment to the proxy. * * @param kexTimeout * Timeout for complete connection establishment (non-negative, * in milliseconds). Zero means no timeout. The timeout counts * from the moment you invoke the connect() method and is * cancelled as soon as the first key-exchange round has * finished. It is possible that the timeout event will be fired * during the invocation of the <code>verifier</code> callback, * but it will only have an effect after the * <code>verifier</code> returns. * * @return A {@link ConnectionInfo} object containing the details of the * established connection. * * @throws IOException * If any problem occurs, e.g., the server's host key is not * accepted by the <code>verifier</code> or there is problem * during the initial crypto setup (e.g., the signature sent by * the server is wrong). * <p> * In case of a timeout (either connectTimeout or kexTimeout) a * SocketTimeoutException is thrown. * <p> * An exception may also be thrown if the connection was already * successfully connected (no matter if the connection broke in * the mean time) and you invoke <code>connect()</code> again * without having called {@link #close()} first. * <p> * If a HTTP proxy is being used and the proxy refuses the * connection, then a {@link HTTPProxyException} may be thrown, * which contains the details returned by the proxy. If the * proxy is buggy and does not return a proper HTTP response, * then a normal IOException is thrown instead. */ public synchronized ConnectionInfo connect(ServerHostKeyVerifier verifier, int connectTimeout, int kexTimeout) throws IOException { final class TimeoutState { boolean isCancelled = false; boolean timeoutSocketClosed = false; } if (tm != null) throw new IOException("Connection to " + hostname + " is already in connected state!"); if (connectTimeout < 0) throw new IllegalArgumentException("connectTimeout must be non-negative!"); if (kexTimeout < 0) throw new IllegalArgumentException("kexTimeout must be non-negative!"); final TimeoutState state = new TimeoutState(); tm = new TransportManager(hostname, port); tm.setConnectionMonitors(connectionMonitors); // Don't offer compression if not requested if (!compression) { cryptoWishList.c2s_comp_algos = new String[] { "none" }; cryptoWishList.s2c_comp_algos = new String[] { "none" }; } /* * Make sure that the runnable below will observe the new value of "tm" * and "state" (the runnable will be executed in a different thread, * which may be already running, that is why we need a memory barrier * here). See also the comment in Channel.java if you are interested in * the details. * * OKOK, this is paranoid since adding the runnable to the todo list of * the TimeoutService will ensure that all writes have been flushed * before the Runnable reads anything (there is a synchronized block in * TimeoutService.addTimeoutHandler). */ synchronized (tm) { /* We could actually synchronize on anything. */ } try { TimeoutToken token = null; if (kexTimeout > 0) { final Runnable timeoutHandler = new Runnable() { public void run() { synchronized (state) { if (state.isCancelled) return; state.timeoutSocketClosed = true; tm.close(new SocketTimeoutException("The connect timeout expired"), false); } } }; long timeoutHorizont = System.currentTimeMillis() + kexTimeout; token = TimeoutService.addTimeoutHandler(timeoutHorizont, timeoutHandler); } try { tm.initialize(cryptoWishList, verifier, dhgexpara, connectTimeout, getOrCreateSecureRND(), proxyData); } catch (SocketTimeoutException se) { throw (SocketTimeoutException) new SocketTimeoutException( "The connect() operation on the socket timed out.").initCause(se); } tm.setTcpNoDelay(tcpNoDelay); /* Wait until first KEX has finished */ ConnectionInfo ci = tm.getConnectionInfo(1); /* Now try to cancel the timeout, if needed */ if (token != null) { TimeoutService.cancelTimeoutHandler(token); /* Were we too late? */ synchronized (state) { if (state.timeoutSocketClosed) throw new IOException("This exception will be replaced by the one below =)"); /* * Just in case the "cancelTimeoutHandler" invocation came * just a little bit too late but the handler did not enter * the semaphore yet - we can still stop it. */ state.isCancelled = true; } } return ci; } catch (SocketTimeoutException ste) { throw ste; } catch (IOException e1) { /* This will also invoke any registered connection monitors */ close(new Throwable("There was a problem during connect."), false); synchronized (state) { /* * Show a clean exception, not something like "the socket is * closed!?!" */ if (state.timeoutSocketClosed) throw new SocketTimeoutException("The kexTimeout (" + kexTimeout + " ms) expired."); } /* Do not wrap a HTTPProxyException */ if (e1 instanceof HTTPProxyException) throw e1; throw (IOException) new IOException("There was a problem while connecting to " + hostname + ":" + port) .initCause(e1); } } /** * Creates a new {@link LocalPortForwarder}. A * <code>LocalPortForwarder</code> forwards TCP/IP connections that arrive * at a local port via the secure tunnel to another host (which may or may * not be identical to the remote SSH-2 server). * <p> * This method must only be called after one has passed successfully the * authentication step. There is no limit on the number of concurrent * forwardings. * * @param local_port * the local port the LocalPortForwarder shall bind to. * @param host_to_connect * target address (IP or hostname) * @param port_to_connect * target port * @return A {@link LocalPortForwarder} object. * @throws IOException */ public synchronized LocalPortForwarder createLocalPortForwarder(int local_port, String host_to_connect, int port_to_connect) throws IOException { if (tm == null) throw new IllegalStateException("Cannot forward ports, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot forward ports, connection is not authenticated."); return new LocalPortForwarder(cm, local_port, host_to_connect, port_to_connect); } /** * Creates a new {@link LocalPortForwarder}. A * <code>LocalPortForwarder</code> forwards TCP/IP connections that arrive * at a local port via the secure tunnel to another host (which may or may * not be identical to the remote SSH-2 server). * <p> * This method must only be called after one has passed successfully the * authentication step. There is no limit on the number of concurrent * forwardings. * * @param addr * specifies the InetSocketAddress where the local socket shall * be bound to. * @param host_to_connect * target address (IP or hostname) * @param port_to_connect * target port * @return A {@link LocalPortForwarder} object. * @throws IOException */ public synchronized LocalPortForwarder createLocalPortForwarder(InetSocketAddress addr, String host_to_connect, int port_to_connect) throws IOException { if (tm == null) throw new IllegalStateException("Cannot forward ports, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot forward ports, connection is not authenticated."); return new LocalPortForwarder(cm, addr, host_to_connect, port_to_connect); } /** * Creates a new {@link LocalStreamForwarder}. A * <code>LocalStreamForwarder</code> manages an Input/Outputstream pair * that is being forwarded via the secure tunnel into a TCP/IP connection to * another host (which may or may not be identical to the remote SSH-2 * server). * * @param host_to_connect * @param port_to_connect * @return A {@link LocalStreamForwarder} object. * @throws IOException */ public synchronized LocalStreamForwarder createLocalStreamForwarder(String host_to_connect, int port_to_connect) throws IOException { if (tm == null) throw new IllegalStateException("Cannot forward, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot forward, connection is not authenticated."); return new LocalStreamForwarder(cm, host_to_connect, port_to_connect); } /** * Creates a new {@link DynamicPortForwarder}. A * <code>DynamicPortForwarder</code> forwards TCP/IP connections that arrive * at a local port via the secure tunnel to another host that is chosen via * the SOCKS protocol. * <p> * This method must only be called after one has passed successfully the * authentication step. There is no limit on the number of concurrent * forwardings. * * @param local_port * @return A {@link DynamicPortForwarder} object. * @throws IOException */ public synchronized DynamicPortForwarder createDynamicPortForwarder(int local_port) throws IOException { if (tm == null) throw new IllegalStateException("Cannot forward ports, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot forward ports, connection is not authenticated."); return new DynamicPortForwarder(cm, local_port); } /** * Creates a new {@link DynamicPortForwarder}. A * <code>DynamicPortForwarder</code> forwards TCP/IP connections that arrive * at a local port via the secure tunnel to another host that is chosen via * the SOCKS protocol. * <p> * This method must only be called after one has passed successfully the * authentication step. There is no limit on the number of concurrent * forwardings. * * @param addr * specifies the InetSocketAddress where the local socket shall * be bound to. * @return A {@link DynamicPortForwarder} object. * @throws IOException */ public synchronized DynamicPortForwarder createDynamicPortForwarder(InetSocketAddress addr) throws IOException { if (tm == null) throw new IllegalStateException("Cannot forward ports, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot forward ports, connection is not authenticated."); return new DynamicPortForwarder(cm, addr); } /** * Create a very basic {@link SCPClient} that can be used to copy files * from/to the SSH-2 server. * <p> * Works only after one has passed successfully the authentication step. * There is no limit on the number of concurrent SCP clients. * <p> * Note: This factory method will probably disappear in the future. * * @return A {@link SCPClient} object. * @throws IOException */ public synchronized SCPClient createSCPClient() throws IOException { if (tm == null) throw new IllegalStateException("Cannot create SCP client, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot create SCP client, connection is not authenticated."); return new SCPClient(this); } /** * Force an asynchronous key re-exchange (the call does not block). The * latest values set for MAC, Cipher and DH group exchange parameters will * be used. If a key exchange is currently in progress, then this method has * the only effect that the so far specified parameters will be used for the * next (server driven) key exchange. * <p> * Note: This implementation will never start a key exchange (other than the * initial one) unless you or the SSH-2 server ask for it. * * @throws IOException * In case of any failure behind the scenes. */ public synchronized void forceKeyExchange() throws IOException { if (tm == null) throw new IllegalStateException("You need to establish a connection first."); tm.forceKeyExchange(cryptoWishList, dhgexpara); } /** * Returns the hostname that was passed to the constructor. * * @return the hostname */ public synchronized String getHostname() { return hostname; } /** * Returns the port that was passed to the constructor. * * @return the TCP port */ public synchronized int getPort() { return port; } /** * Returns a {@link ConnectionInfo} object containing the details of the * connection. Can be called as soon as the connection has been established * (successfully connected). * * @return A {@link ConnectionInfo} object. * @throws IOException * In case of any failure behind the scenes. */ public synchronized ConnectionInfo getConnectionInfo() throws IOException { if (tm == null) throw new IllegalStateException( "Cannot get details of connection, you need to establish a connection first."); return tm.getConnectionInfo(1); } /** * After a successful connect, one has to authenticate oneself. This method * can be used to tell which authentication methods are supported by the * server at a certain stage of the authentication process (for the given * username). * <p> * Note 1: the username will only be used if no authentication step was done * so far (it will be used to ask the server for a list of possible * authentication methods by sending the initial "none" request). Otherwise, * this method ignores the user name and returns a cached method list (which * is based on the information contained in the last negative server * response). * <p> * Note 2: the server may return method names that are not supported by this * implementation. * <p> * After a successful authentication, this method must not be called * anymore. * * @param user * A <code>String</code> holding the username. * * @return a (possibly emtpy) array holding authentication method names. * @throws IOException */ public synchronized String[] getRemainingAuthMethods(String user) throws IOException { if (user == null) throw new IllegalArgumentException("user argument may not be NULL!"); if (tm == null) throw new IllegalStateException("Connection is not established!"); if (authenticated) throw new IllegalStateException("Connection is already authenticated!"); if (am == null) am = new AuthenticationManager(tm); if (cm == null) cm = new ChannelManager(tm); return am.getRemainingMethods(user); } /** * Determines if the authentication phase is complete. Can be called at any * time. * * @return <code>true</code> if no further authentication steps are * needed. */ public synchronized boolean isAuthenticationComplete() { return authenticated; } /** * Returns true if there was at least one failed authentication request and * the last failed authentication request was marked with "partial success" * by the server. This is only needed in the rare case of SSH-2 server * setups that cannot be satisfied with a single successful authentication * request (i.e., multiple authentication steps are needed.) * <p> * If you are interested in the details, then have a look at RFC4252. * * @return if the there was a failed authentication step and the last one * was marked as a "partial success". */ public synchronized boolean isAuthenticationPartialSuccess() { if (am == null) return false; return am.getPartialSuccess(); } /** * Checks if a specified authentication method is available. This method is * actually just a wrapper for {@link #getRemainingAuthMethods(String) * getRemainingAuthMethods()}. * * @param user * A <code>String</code> holding the username. * @param method * An authentication method name (e.g., "publickey", "password", * "keyboard-interactive") as specified by the SSH-2 standard. * @return if the specified authentication method is currently available. * @throws IOException */ public synchronized boolean isAuthMethodAvailable(String user, String method) throws IOException { if (method == null) throw new IllegalArgumentException("method argument may not be NULL!"); String methods[] = getRemainingAuthMethods(user); for (int i = 0; i < methods.length; i++) { if (methods[i].compareTo(method) == 0) return true; } return false; } private final SecureRandom getOrCreateSecureRND() { if (generator == null) generator = new SecureRandom(); return generator; } /** * Open a new {@link Session} on this connection. Works only after one has * passed successfully the authentication step. There is no limit on the * number of concurrent sessions. * * @return A {@link Session} object. * @throws IOException */ public synchronized Session openSession() throws IOException { if (tm == null) throw new IllegalStateException("Cannot open session, you need to establish a connection first."); if (!authenticated) throw new IllegalStateException("Cannot open session, connection is not authenticated."); return new Session(cm, getOrCreateSecureRND()); } /** * Send an SSH_MSG_IGNORE packet. This method will generate a random data * attribute (length between 0 (invlusive) and 16 (exclusive) bytes, * contents are random bytes). * <p> * This method must only be called once the connection is established. * * @throws IOException */ public synchronized void sendIgnorePacket() throws IOException { SecureRandom rnd = getOrCreateSecureRND(); byte[] data = new byte[rnd.nextInt(16)]; rnd.nextBytes(data); sendIgnorePacket(data); } /** * Send an SSH_MSG_IGNORE packet with the given data attribute. * <p> * This method must only be called once the connection is established. * * @throws IOException */ public synchronized void sendIgnorePacket(byte[] data) throws IOException { if (data == null) throw new IllegalArgumentException("data argument must not be null."); if (tm == null) throw new IllegalStateException( "Cannot send SSH_MSG_IGNORE packet, you need to establish a connection first."); PacketIgnore pi = new PacketIgnore(); pi.setData(data); tm.sendMessage(pi.getPayload()); } /** * Removes duplicates from a String array, keeps only first occurence of * each element. Does not destroy order of elements; can handle nulls. Uses * a very efficient O(N^2) algorithm =) * * @param list * a String array. * @return a cleaned String array. */ private String[] removeDuplicates(String[] list) { if ((list == null) || (list.length < 2)) return list; String[] list2 = new String[list.length]; int count = 0; for (int i = 0; i < list.length; i++) { boolean duplicate = false; String element = list[i]; for (int j = 0; j < count; j++) { if (((element == null) && (list2[j] == null)) || ((element != null) && (element.equals(list2[j])))) { duplicate = true; break; } } if (duplicate) continue; list2[count++] = list[i]; } if (count == list2.length) return list2; String[] tmp = new String[count]; System.arraycopy(list2, 0, tmp, 0, count); return tmp; } /** * Unless you know what you are doing, you will never need this. * * @param ciphers */ public synchronized void setClient2ServerCiphers(String[] ciphers) { if ((ciphers == null) || (ciphers.length == 0)) throw new IllegalArgumentException(); ciphers = removeDuplicates(ciphers); BlockCipherFactory.checkCipherList(ciphers); cryptoWishList.c2s_enc_algos = ciphers; } /** * Unless you know what you are doing, you will never need this. * * @param macs */ public synchronized void setClient2ServerMACs(String[] macs) { if ((macs == null) || (macs.length == 0)) throw new IllegalArgumentException(); macs = removeDuplicates(macs); MAC.checkMacList(macs); cryptoWishList.c2s_mac_algos = macs; } /** * Sets the parameters for the diffie-hellman group exchange. Unless you * know what you are doing, you will never need this. Default values are * defined in the {@link DHGexParameters} class. * * @param dgp * {@link DHGexParameters}, non null. * */ public synchronized void setDHGexParameters(DHGexParameters dgp) { if (dgp == null) throw new IllegalArgumentException(); dhgexpara = dgp; } /** * Unless you know what you are doing, you will never need this. * * @param ciphers */ public synchronized void setServer2ClientCiphers(String[] ciphers) { if ((ciphers == null) || (ciphers.length == 0)) throw new IllegalArgumentException(); ciphers = removeDuplicates(ciphers); BlockCipherFactory.checkCipherList(ciphers); cryptoWishList.s2c_enc_algos = ciphers; } /** * Unless you know what you are doing, you will never need this. * * @param macs */ public synchronized void setServer2ClientMACs(String[] macs) { if ((macs == null) || (macs.length == 0)) throw new IllegalArgumentException(); macs = removeDuplicates(macs); MAC.checkMacList(macs); cryptoWishList.s2c_mac_algos = macs; } /** * Define the set of allowed server host key algorithms to be used for the * following key exchange operations. * <p> * Unless you know what you are doing, you will never need this. * * @param algos * An array of allowed server host key algorithms. SSH-2 defines * <code>ssh-dss</code> and <code>ssh-rsa</code>. The * entries of the array must be ordered after preference, i.e., * the entry at index 0 is the most preferred one. You must * specify at least one entry. */ public synchronized void setServerHostKeyAlgorithms(String[] algos) { if ((algos == null) || (algos.length == 0)) throw new IllegalArgumentException(); algos = removeDuplicates(algos); KexManager.checkServerHostkeyAlgorithmsList(algos); cryptoWishList.serverHostKeyAlgorithms = algos; } /** * Enable/disable TCP_NODELAY (disable/enable Nagle's algorithm) on the * underlying socket. * <p> * Can be called at any time. If the connection has not yet been established * then the passed value will be stored and set after the socket has been * set up. The default value that will be used is <code>false</code>. * * @param enable * the argument passed to the <code>Socket.setTCPNoDelay()</code> * method. * @throws IOException */ public synchronized void setTCPNoDelay(boolean enable) throws IOException { tcpNoDelay = enable; if (tm != null) tm.setTcpNoDelay(enable); } /** * Used to tell the library that the connection shall be established through * a proxy server. It only makes sense to call this method before calling * the {@link #connect() connect()} method. * <p> * At the moment, only HTTP proxies are supported. * <p> * Note: This method can be called any number of times. The * {@link #connect() connect()} method will use the value set in the last * preceding invocation of this method. * * @see HTTPProxyData * * @param proxyData * Connection information about the proxy. If <code>null</code>, * then no proxy will be used (non surprisingly, this is also the * default). */ public synchronized void setProxyData(ProxyData proxyData) { this.proxyData = proxyData; } /** * Request a remote port forwarding. If successful, then forwarded * connections will be redirected to the given target address. You can * cancle a requested remote port forwarding by calling * {@link #cancelRemotePortForwarding(int) cancelRemotePortForwarding()}. * <p> * A call of this method will block until the peer either agreed or * disagreed to your request- * <p> * Note 1: this method typically fails if you * <ul> * <li>pass a port number for which the used remote user has not enough * permissions (i.e., port &lt; 1024)</li> * <li>or pass a port number that is already in use on the remote server</li> * <li>or if remote port forwarding is disabled on the server.</li> * </ul> * <p> * Note 2: (from the openssh man page): By default, the listening socket on * the server will be bound to the loopback interface only. This may be * overriden by specifying a bind address. Specifying a remote bind address * will only succeed if the server's <b>GatewayPorts</b> option is enabled * (see sshd_config(5)). * * @param bindAddress * address to bind to on the server: * <ul> * <li>"" means that connections are to be accepted on all * protocol families supported by the SSH implementation</li> * <li>"0.0.0.0" means to listen on all IPv4 addresses</li> * <li>"::" means to listen on all IPv6 addresses</li> * <li>"localhost" means to listen on all protocol families * supported by the SSH implementation on loopback addresses * only, [RFC3330] and RFC3513]</li> * <li>"127.0.0.1" and "::1" indicate listening on the loopback * interfaces for IPv4 and IPv6 respectively</li> * </ul> * @param bindPort * port number to bind on the server (must be &gt; 0) * @param targetAddress * the target address (IP or hostname) * @param targetPort * the target port * @throws IOException */ public synchronized void requestRemotePortForwarding(String bindAddress, int bindPort, String targetAddress, int targetPort) throws IOException { if (tm == null) throw new IllegalStateException("You need to establish a connection first."); if (!authenticated) throw new IllegalStateException("The connection is not authenticated."); if ((bindAddress == null) || (targetAddress == null) || (bindPort <= 0) || (targetPort <= 0)) throw new IllegalArgumentException(); cm.requestGlobalForward(bindAddress, bindPort, targetAddress, targetPort); } /** * Cancel an earlier requested remote port forwarding. Currently active * forwardings will not be affected (e.g., disrupted). Note that further * connection forwarding requests may be received until this method has * returned. * * @param bindPort * the allocated port number on the server * @throws IOException * if the remote side refuses the cancel request or another low * level error occurs (e.g., the underlying connection is * closed) */ public synchronized void cancelRemotePortForwarding(int bindPort) throws IOException { if (tm == null) throw new IllegalStateException("You need to establish a connection first."); if (!authenticated) throw new IllegalStateException("The connection is not authenticated."); cm.requestCancelGlobalForward(bindPort); } /** * Provide your own instance of SecureRandom. Can be used, e.g., if you want * to seed the used SecureRandom generator manually. * <p> * The SecureRandom instance is used during key exchanges, public key * authentication, x11 cookie generation and the like. * * @param rnd * a SecureRandom instance */ public synchronized void setSecureRandom(SecureRandom rnd) { if (rnd == null) throw new IllegalArgumentException(); this.generator = rnd; } /** * Enable/disable debug logging. <b>Only do this when requested by Trilead * support.</b> * <p> * For speed reasons, some static variables used to check whether debugging * is enabled are not protected with locks. In other words, if you * dynamicaly enable/disable debug logging, then some threads may still use * the old setting. To be on the safe side, enable debugging before doing * the <code>connect()</code> call. * * @param enable * on/off * @param logger * a {@link DebugLogger DebugLogger} instance, <code>null</code> * means logging using the simple logger which logs all messages * to to stderr. Ignored if enabled is <code>false</code> */ public synchronized void enableDebugging(boolean enable, DebugLogger logger) { Logger.enabled = enable; if (enable == false) { Logger.logger = null; } else { if (logger == null) { logger = new DebugLogger() { public void log(int level, String className, String message) { long now = System.currentTimeMillis(); System.err.println(now + " : " + className + ": " + message); } }; } Logger.logger = logger; } } /** * This method can be used to perform end-to-end connection testing. It * sends a 'ping' message to the server and waits for the 'pong' from the * server. * <p> * When this method throws an exception, then you can assume that the * connection should be abandoned. * <p> * Note: Works only after one has passed successfully the authentication * step. * <p> * Implementation details: this method sends a SSH_MSG_GLOBAL_REQUEST * request ('trilead-ping') to the server and waits for the * SSH_MSG_REQUEST_FAILURE reply packet from the server. * * @throws IOException * in case of any problem */ public synchronized void ping() throws IOException { if (tm == null) throw new IllegalStateException("You need to establish a connection first."); if (!authenticated) throw new IllegalStateException("The connection is not authenticated."); cm.requestGlobalTrileadPing(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/Connection.java
Java
asf20
56,638
package com.trilead.ssh2; import java.io.BufferedOutputStream; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.io.PrintStream; import java.nio.charset.Charset; import java.util.HashMap; import java.util.Vector; import com.trilead.ssh2.packets.TypesReader; import com.trilead.ssh2.packets.TypesWriter; import com.trilead.ssh2.sftp.AttribFlags; import com.trilead.ssh2.sftp.ErrorCodes; import com.trilead.ssh2.sftp.Packet; /** * A <code>SFTPv3Client</code> represents a SFTP (protocol version 3) * client connection tunnelled over a SSH-2 connection. This is a very simple * (synchronous) implementation. * <p> * Basically, most methods in this class map directly to one of * the packet types described in draft-ietf-secsh-filexfer-02.txt. * <p> * Note: this is experimental code. * <p> * Error handling: the methods of this class throw IOExceptions. However, unless * there is catastrophic failure, exceptions of the type {@link SFTPv3Client} will * be thrown (a subclass of IOException). Therefore, you can implement more verbose * behavior by checking if a thrown exception if of this type. If yes, then you * can cast the exception and access detailed information about the failure. * <p> * Notes about file names, directory names and paths, copy-pasted * from the specs: * <ul> * <li>SFTP v3 represents file names as strings. File names are * assumed to use the slash ('/') character as a directory separator.</li> * <li>File names starting with a slash are "absolute", and are relative to * the root of the file system. Names starting with any other character * are relative to the user's default directory (home directory).</li> * <li>Servers SHOULD interpret a path name component ".." as referring to * the parent directory, and "." as referring to the current directory. * If the server implementation limits access to certain parts of the * file system, it must be extra careful in parsing file names when * enforcing such restrictions. There have been numerous reported * security bugs where a ".." in a path name has allowed access outside * the intended area.</li> * <li>An empty path name is valid, and it refers to the user's default * directory (usually the user's home directory).</li> * </ul> * <p> * If you are still not tired then please go on and read the comment for * {@link #setCharset(String)}. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SFTPv3Client.java,v 1.3 2008/04/01 12:38:09 cplattne Exp $ */ public class SFTPv3Client { final Connection conn; final Session sess; final PrintStream debug; boolean flag_closed = false; InputStream is; OutputStream os; int protocol_version = 0; HashMap server_extensions = new HashMap(); int next_request_id = 1000; String charsetName = null; /** * Create a SFTP v3 client. * * @param conn The underlying SSH-2 connection to be used. * @param debug * @throws IOException * * @deprecated this constructor (debug version) will disappear in the future, * use {@link #SFTPv3Client(Connection)} instead. */ public SFTPv3Client(Connection conn, PrintStream debug) throws IOException { if (conn == null) throw new IllegalArgumentException("Cannot accept null argument!"); this.conn = conn; this.debug = debug; if (debug != null) debug.println("Opening session and starting SFTP subsystem."); sess = conn.openSession(); sess.startSubSystem("sftp"); is = sess.getStdout(); os = new BufferedOutputStream(sess.getStdin(), 2048); if ((is == null) || (os == null)) throw new IOException("There is a problem with the streams of the underlying channel."); init(); } /** * Create a SFTP v3 client. * * @param conn The underlying SSH-2 connection to be used. * @throws IOException */ public SFTPv3Client(Connection conn) throws IOException { this(conn, null); } /** * Set the charset used to convert between Java Unicode Strings and byte encodings * used by the server for paths and file names. Unfortunately, the SFTP v3 draft * says NOTHING about such conversions (well, with the exception of error messages * which have to be in UTF-8). Newer drafts specify to use UTF-8 for file names * (if I remember correctly). However, a quick test using OpenSSH serving a EXT-3 * filesystem has shown that UTF-8 seems to be a bad choice for SFTP v3 (tested with * filenames containing german umlauts). "windows-1252" seems to work better for Europe. * Luckily, "windows-1252" is the platform default in my case =). * <p> * If you don't set anything, then the platform default will be used (this is the default * behavior). * * @see #getCharset() * * @param charset the name of the charset to be used or <code>null</code> to use the platform's * default encoding. * @throws IOException */ public void setCharset(String charset) throws IOException { if (charset == null) { charsetName = charset; return; } try { Charset.forName(charset); } catch (Exception e) { throw (IOException) new IOException("This charset is not supported").initCause(e); } charsetName = charset; } /** * The currently used charset for filename encoding/decoding. * * @see #setCharset(String) * * @return The name of the charset (<code>null</code> if the platform's default charset is being used) */ public String getCharset() { return charsetName; } private final void checkHandleValidAndOpen(SFTPv3FileHandle handle) throws IOException { if (handle.client != this) throw new IOException("The file handle was created with another SFTPv3FileHandle instance."); if (handle.isClosed == true) throw new IOException("The file handle is closed."); } private final void sendMessage(int type, int requestId, byte[] msg, int off, int len) throws IOException { int msglen = len + 1; if (type != Packet.SSH_FXP_INIT) msglen += 4; os.write(msglen >> 24); os.write(msglen >> 16); os.write(msglen >> 8); os.write(msglen); os.write(type); if (type != Packet.SSH_FXP_INIT) { os.write(requestId >> 24); os.write(requestId >> 16); os.write(requestId >> 8); os.write(requestId); } os.write(msg, off, len); os.flush(); } private final void sendMessage(int type, int requestId, byte[] msg) throws IOException { sendMessage(type, requestId, msg, 0, msg.length); } private final void readBytes(byte[] buff, int pos, int len) throws IOException { while (len > 0) { int count = is.read(buff, pos, len); if (count < 0) throw new IOException("Unexpected end of sftp stream."); if ((count == 0) || (count > len)) throw new IOException("Underlying stream implementation is bogus!"); len -= count; pos += count; } } /** * Read a message and guarantee that the <b>contents</b> is not larger than * <code>maxlen</code> bytes. * <p> * Note: receiveMessage(34000) actually means that the message may be up to 34004 * bytes (the length attribute preceeding the contents is 4 bytes). * * @param maxlen * @return the message contents * @throws IOException */ private final byte[] receiveMessage(int maxlen) throws IOException { byte[] msglen = new byte[4]; readBytes(msglen, 0, 4); int len = (((msglen[0] & 0xff) << 24) | ((msglen[1] & 0xff) << 16) | ((msglen[2] & 0xff) << 8) | (msglen[3] & 0xff)); if ((len > maxlen) || (len <= 0)) throw new IOException("Illegal sftp packet len: " + len); byte[] msg = new byte[len]; readBytes(msg, 0, len); return msg; } private final int generateNextRequestID() { synchronized (this) { return next_request_id++; } } private final void closeHandle(byte[] handle) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle, 0, handle.length); sendMessage(Packet.SSH_FXP_CLOSE, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } private SFTPv3FileAttributes readAttrs(TypesReader tr) throws IOException { /* * uint32 flags * uint64 size present only if flag SSH_FILEXFER_ATTR_SIZE * uint32 uid present only if flag SSH_FILEXFER_ATTR_V3_UIDGID * uint32 gid present only if flag SSH_FILEXFER_ATTR_V3_UIDGID * uint32 permissions present only if flag SSH_FILEXFER_ATTR_PERMISSIONS * uint32 atime present only if flag SSH_FILEXFER_ATTR_V3_ACMODTIME * uint32 mtime present only if flag SSH_FILEXFER_ATTR_V3_ACMODTIME * uint32 extended_count present only if flag SSH_FILEXFER_ATTR_EXTENDED * string extended_type * string extended_data * ... more extended data (extended_type - extended_data pairs), * so that number of pairs equals extended_count */ SFTPv3FileAttributes fa = new SFTPv3FileAttributes(); int flags = tr.readUINT32(); if ((flags & AttribFlags.SSH_FILEXFER_ATTR_SIZE) != 0) { if (debug != null) debug.println("SSH_FILEXFER_ATTR_SIZE"); fa.size = new Long(tr.readUINT64()); } if ((flags & AttribFlags.SSH_FILEXFER_ATTR_V3_UIDGID) != 0) { if (debug != null) debug.println("SSH_FILEXFER_ATTR_V3_UIDGID"); fa.uid = new Integer(tr.readUINT32()); fa.gid = new Integer(tr.readUINT32()); } if ((flags & AttribFlags.SSH_FILEXFER_ATTR_PERMISSIONS) != 0) { if (debug != null) debug.println("SSH_FILEXFER_ATTR_PERMISSIONS"); fa.permissions = new Integer(tr.readUINT32()); } if ((flags & AttribFlags.SSH_FILEXFER_ATTR_V3_ACMODTIME) != 0) { if (debug != null) debug.println("SSH_FILEXFER_ATTR_V3_ACMODTIME"); fa.atime = new Long(((long)tr.readUINT32()) & 0xffffffffl); fa.mtime = new Long(((long)tr.readUINT32()) & 0xffffffffl); } if ((flags & AttribFlags.SSH_FILEXFER_ATTR_EXTENDED) != 0) { int count = tr.readUINT32(); if (debug != null) debug.println("SSH_FILEXFER_ATTR_EXTENDED (" + count + ")"); /* Read it anyway to detect corrupt packets */ while (count > 0) { tr.readByteString(); tr.readByteString(); count--; } } return fa; } /** * Retrieve the file attributes of an open file. * * @param handle a SFTPv3FileHandle handle. * @return a SFTPv3FileAttributes object. * @throws IOException */ public SFTPv3FileAttributes fstat(SFTPv3FileHandle handle) throws IOException { checkHandleValidAndOpen(handle); int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle.fileHandle, 0, handle.fileHandle.length); if (debug != null) { debug.println("Sending SSH_FXP_FSTAT..."); debug.flush(); } sendMessage(Packet.SSH_FXP_FSTAT, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_ATTRS) { return readAttrs(tr); } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); throw new SFTPException(tr.readString(), errorCode); } private SFTPv3FileAttributes statBoth(String path, int statMethod) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(path, charsetName); if (debug != null) { debug.println("Sending SSH_FXP_STAT/SSH_FXP_LSTAT..."); debug.flush(); } sendMessage(statMethod, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_ATTRS) { return readAttrs(tr); } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); throw new SFTPException(tr.readString(), errorCode); } /** * Retrieve the file attributes of a file. This method * follows symbolic links on the server. * * @see #lstat(String) * * @param path See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileAttributes object. * @throws IOException */ public SFTPv3FileAttributes stat(String path) throws IOException { return statBoth(path, Packet.SSH_FXP_STAT); } /** * Retrieve the file attributes of a file. This method * does NOT follow symbolic links on the server. * * @see #stat(String) * * @param path See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileAttributes object. * @throws IOException */ public SFTPv3FileAttributes lstat(String path) throws IOException { return statBoth(path, Packet.SSH_FXP_LSTAT); } /** * Read the target of a symbolic link. * * @param path See the {@link SFTPv3Client comment} for the class for more details. * @return The target of the link. * @throws IOException */ public String readLink(String path) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(path, charsetName); if (debug != null) { debug.println("Sending SSH_FXP_READLINK..."); debug.flush(); } sendMessage(Packet.SSH_FXP_READLINK, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_NAME) { int count = tr.readUINT32(); if (count != 1) throw new IOException("The server sent an invalid SSH_FXP_NAME packet."); return tr.readString(charsetName); } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); throw new SFTPException(tr.readString(), errorCode); } private void expectStatusOKMessage(int id) throws IOException { byte[] resp = receiveMessage(34000); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != id) throw new IOException("The server sent an invalid id field."); if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); if (errorCode == ErrorCodes.SSH_FX_OK) return; throw new SFTPException(tr.readString(), errorCode); } /** * Modify the attributes of a file. Used for operations such as changing * the ownership, permissions or access times, as well as for truncating a file. * * @param path See the {@link SFTPv3Client comment} for the class for more details. * @param attr A SFTPv3FileAttributes object. Specifies the modifications to be * made to the attributes of the file. Empty fields will be ignored. * @throws IOException */ public void setstat(String path, SFTPv3FileAttributes attr) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(path, charsetName); tw.writeBytes(createAttrs(attr)); if (debug != null) { debug.println("Sending SSH_FXP_SETSTAT..."); debug.flush(); } sendMessage(Packet.SSH_FXP_SETSTAT, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Modify the attributes of a file. Used for operations such as changing * the ownership, permissions or access times, as well as for truncating a file. * * @param handle a SFTPv3FileHandle handle * @param attr A SFTPv3FileAttributes object. Specifies the modifications to be * made to the attributes of the file. Empty fields will be ignored. * @throws IOException */ public void fsetstat(SFTPv3FileHandle handle, SFTPv3FileAttributes attr) throws IOException { checkHandleValidAndOpen(handle); int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle.fileHandle, 0, handle.fileHandle.length); tw.writeBytes(createAttrs(attr)); if (debug != null) { debug.println("Sending SSH_FXP_FSETSTAT..."); debug.flush(); } sendMessage(Packet.SSH_FXP_FSETSTAT, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Create a symbolic link on the server. Creates a link "src" that points * to "target". * * @param src See the {@link SFTPv3Client comment} for the class for more details. * @param target See the {@link SFTPv3Client comment} for the class for more details. * @throws IOException */ public void createSymlink(String src, String target) throws IOException { int req_id = generateNextRequestID(); /* Either I am too stupid to understand the SFTP draft * or the OpenSSH guys changed the semantics of src and target. */ TypesWriter tw = new TypesWriter(); tw.writeString(target, charsetName); tw.writeString(src, charsetName); if (debug != null) { debug.println("Sending SSH_FXP_SYMLINK..."); debug.flush(); } sendMessage(Packet.SSH_FXP_SYMLINK, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Have the server canonicalize any given path name to an absolute path. * This is useful for converting path names containing ".." components or * relative pathnames without a leading slash into absolute paths. * * @param path See the {@link SFTPv3Client comment} for the class for more details. * @return An absolute path. * @throws IOException */ public String canonicalPath(String path) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(path, charsetName); if (debug != null) { debug.println("Sending SSH_FXP_REALPATH..."); debug.flush(); } sendMessage(Packet.SSH_FXP_REALPATH, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_NAME) { int count = tr.readUINT32(); if (count != 1) throw new IOException("The server sent an invalid SSH_FXP_NAME packet."); return tr.readString(charsetName); } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); throw new SFTPException(tr.readString(), errorCode); } private final Vector scanDirectory(byte[] handle) throws IOException { Vector files = new Vector(); while (true) { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle, 0, handle.length); if (debug != null) { debug.println("Sending SSH_FXP_READDIR..."); debug.flush(); } sendMessage(Packet.SSH_FXP_READDIR, req_id, tw.getBytes()); /* Some servers send here a packet with size > 34000 */ /* To whom it may concern: please learn to read the specs. */ byte[] resp = receiveMessage(65536); if (debug != null) { debug.println("Got REPLY."); debug.flush(); } TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_NAME) { int count = tr.readUINT32(); if (debug != null) debug.println("Parsing " + count + " name entries..."); while (count > 0) { SFTPv3DirectoryEntry dirEnt = new SFTPv3DirectoryEntry(); dirEnt.filename = tr.readString(charsetName); dirEnt.longEntry = tr.readString(charsetName); dirEnt.attributes = readAttrs(tr); files.addElement(dirEnt); if (debug != null) debug.println("File: '" + dirEnt.filename + "'"); count--; } continue; } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); if (errorCode == ErrorCodes.SSH_FX_EOF) return files; throw new SFTPException(tr.readString(), errorCode); } } private final byte[] openDirectory(String path) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(path, charsetName); if (debug != null) { debug.println("Sending SSH_FXP_OPENDIR..."); debug.flush(); } sendMessage(Packet.SSH_FXP_OPENDIR, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_HANDLE) { if (debug != null) { debug.println("Got SSH_FXP_HANDLE."); debug.flush(); } byte[] handle = tr.readByteString(); return handle; } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); String errorMessage = tr.readString(); throw new SFTPException(errorMessage, errorCode); } private final String expandString(byte[] b, int off, int len) { StringBuffer sb = new StringBuffer(); for (int i = 0; i < len; i++) { int c = b[off + i] & 0xff; if ((c >= 32) && (c <= 126)) { sb.append((char) c); } else { sb.append("{0x" + Integer.toHexString(c) + "}"); } } return sb.toString(); } private void init() throws IOException { /* Send SSH_FXP_INIT (version 3) */ final int client_version = 3; if (debug != null) debug.println("Sending SSH_FXP_INIT (" + client_version + ")..."); TypesWriter tw = new TypesWriter(); tw.writeUINT32(client_version); sendMessage(Packet.SSH_FXP_INIT, 0, tw.getBytes()); /* Receive SSH_FXP_VERSION */ if (debug != null) debug.println("Waiting for SSH_FXP_VERSION..."); TypesReader tr = new TypesReader(receiveMessage(34000)); /* Should be enough for any reasonable server */ int type = tr.readByte(); if (type != Packet.SSH_FXP_VERSION) { throw new IOException("The server did not send a SSH_FXP_VERSION packet (got " + type + ")"); } protocol_version = tr.readUINT32(); if (debug != null) debug.println("SSH_FXP_VERSION: protocol_version = " + protocol_version); if (protocol_version != 3) throw new IOException("Server version " + protocol_version + " is currently not supported"); /* Read and save extensions (if any) for later use */ while (tr.remain() != 0) { String name = tr.readString(); byte[] value = tr.readByteString(); server_extensions.put(name, value); if (debug != null) debug.println("SSH_FXP_VERSION: extension: " + name + " = '" + expandString(value, 0, value.length) + "'"); } } /** * Returns the negotiated SFTP protocol version between the client and the server. * * @return SFTP protocol version, i.e., "3". * */ public int getProtocolVersion() { return protocol_version; } /** * Close this SFTP session. NEVER forget to call this method to free up * resources - even if you got an exception from one of the other methods. * Sometimes these other methods may throw an exception, saying that the * underlying channel is closed (this can happen, e.g., if the other server * sent a close message.) However, as long as you have not called the * <code>close()</code> method, you are likely wasting resources. * */ public void close() { sess.close(); } /** * List the contents of a directory. * * @param dirName See the {@link SFTPv3Client comment} for the class for more details. * @return A Vector containing {@link SFTPv3DirectoryEntry} objects. * @throws IOException */ public Vector ls(String dirName) throws IOException { byte[] handle = openDirectory(dirName); Vector result = scanDirectory(handle); closeHandle(handle); return result; } /** * Create a new directory. * * @param dirName See the {@link SFTPv3Client comment} for the class for more details. * @param posixPermissions the permissions for this directory, e.g., "0700" (remember that * this is octal noation). The server will likely apply a umask. * * @throws IOException */ public void mkdir(String dirName, int posixPermissions) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(dirName, charsetName); tw.writeUINT32(AttribFlags.SSH_FILEXFER_ATTR_PERMISSIONS); tw.writeUINT32(posixPermissions); sendMessage(Packet.SSH_FXP_MKDIR, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Remove a file. * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @throws IOException */ public void rm(String fileName) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(fileName, charsetName); sendMessage(Packet.SSH_FXP_REMOVE, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Remove an empty directory. * * @param dirName See the {@link SFTPv3Client comment} for the class for more details. * @throws IOException */ public void rmdir(String dirName) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(dirName, charsetName); sendMessage(Packet.SSH_FXP_RMDIR, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Move a file or directory. * * @param oldPath See the {@link SFTPv3Client comment} for the class for more details. * @param newPath See the {@link SFTPv3Client comment} for the class for more details. * @throws IOException */ public void mv(String oldPath, String newPath) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(oldPath, charsetName); tw.writeString(newPath, charsetName); sendMessage(Packet.SSH_FXP_RENAME, req_id, tw.getBytes()); expectStatusOKMessage(req_id); } /** * Open a file for reading. * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle openFileRO(String fileName) throws IOException { return openFile(fileName, 0x00000001, null); // SSH_FXF_READ } /** * Open a file for reading and writing. * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle openFileRW(String fileName) throws IOException { return openFile(fileName, 0x00000003, null); // SSH_FXF_READ | SSH_FXF_WRITE } // Append is broken (already in the specification, because there is no way to // send a write operation (what offset to use??)) // public SFTPv3FileHandle openFileRWAppend(String fileName) throws IOException // { // return openFile(fileName, 0x00000007, null); // SSH_FXF_READ | SSH_FXF_WRITE | SSH_FXF_APPEND // } /** * Create a file and open it for reading and writing. * Same as {@link #createFile(String, SFTPv3FileAttributes) createFile(fileName, null)}. * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle createFile(String fileName) throws IOException { return createFile(fileName, null); } /** * Create a file and open it for reading and writing. * You can specify the default attributes of the file (the server may or may * not respect your wishes). * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @param attr may be <code>null</code> to use server defaults. Probably only * the <code>uid</code>, <code>gid</code> and <code>permissions</code> * (remember the server may apply a umask) entries of the {@link SFTPv3FileHandle} * structure make sense. You need only to set those fields where you want * to override the server's defaults. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle createFile(String fileName, SFTPv3FileAttributes attr) throws IOException { return openFile(fileName, 0x00000008 | 0x00000003, attr); // SSH_FXF_CREAT | SSH_FXF_READ | SSH_FXF_WRITE } /** * Create a file (truncate it if it already exists) and open it for reading and writing. * Same as {@link #createFileTruncate(String, SFTPv3FileAttributes) createFileTruncate(fileName, null)}. * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle createFileTruncate(String fileName) throws IOException { return createFileTruncate(fileName, null); } /** * reate a file (truncate it if it already exists) and open it for reading and writing. * You can specify the default attributes of the file (the server may or may * not respect your wishes). * * @param fileName See the {@link SFTPv3Client comment} for the class for more details. * @param attr may be <code>null</code> to use server defaults. Probably only * the <code>uid</code>, <code>gid</code> and <code>permissions</code> * (remember the server may apply a umask) entries of the {@link SFTPv3FileHandle} * structure make sense. You need only to set those fields where you want * to override the server's defaults. * @return a SFTPv3FileHandle handle * @throws IOException */ public SFTPv3FileHandle createFileTruncate(String fileName, SFTPv3FileAttributes attr) throws IOException { return openFile(fileName, 0x00000018 | 0x00000003, attr); // SSH_FXF_CREAT | SSH_FXF_TRUNC | SSH_FXF_READ | SSH_FXF_WRITE } private byte[] createAttrs(SFTPv3FileAttributes attr) { TypesWriter tw = new TypesWriter(); int attrFlags = 0; if (attr == null) { tw.writeUINT32(0); } else { if (attr.size != null) attrFlags = attrFlags | AttribFlags.SSH_FILEXFER_ATTR_SIZE; if ((attr.uid != null) && (attr.gid != null)) attrFlags = attrFlags | AttribFlags.SSH_FILEXFER_ATTR_V3_UIDGID; if (attr.permissions != null) attrFlags = attrFlags | AttribFlags.SSH_FILEXFER_ATTR_PERMISSIONS; if ((attr.atime != null) && (attr.mtime != null)) attrFlags = attrFlags | AttribFlags.SSH_FILEXFER_ATTR_V3_ACMODTIME; tw.writeUINT32(attrFlags); if (attr.size != null) tw.writeUINT64(attr.size.longValue()); if ((attr.uid != null) && (attr.gid != null)) { tw.writeUINT32(attr.uid.intValue()); tw.writeUINT32(attr.gid.intValue()); } if (attr.permissions != null) tw.writeUINT32(attr.permissions.intValue()); if ((attr.atime != null) && (attr.mtime != null)) { tw.writeUINT32(attr.atime.intValue()); tw.writeUINT32(attr.mtime.intValue()); } } return tw.getBytes(); } private SFTPv3FileHandle openFile(String fileName, int flags, SFTPv3FileAttributes attr) throws IOException { int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(fileName, charsetName); tw.writeUINT32(flags); tw.writeBytes(createAttrs(attr)); if (debug != null) { debug.println("Sending SSH_FXP_OPEN..."); debug.flush(); } sendMessage(Packet.SSH_FXP_OPEN, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_HANDLE) { if (debug != null) { debug.println("Got SSH_FXP_HANDLE."); debug.flush(); } return new SFTPv3FileHandle(this, tr.readByteString()); } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); String errorMessage = tr.readString(); throw new SFTPException(errorMessage, errorCode); } /** * Read bytes from a file. No more than 32768 bytes may be read at once. * Be aware that the semantics of read() are different than for Java streams. * <p> * <ul> * <li>The server will read as many bytes as it can from the file (up to <code>len</code>), * and return them.</li> * <li>If EOF is encountered before reading any data, <code>-1</code> is returned. * <li>If an error occurs, an exception is thrown</li>. * <li>For normal disk files, it is guaranteed that the server will return the specified * number of bytes, or up to end of file. For, e.g., device files this may return * fewer bytes than requested.</li> * </ul> * * @param handle a SFTPv3FileHandle handle * @param fileOffset offset (in bytes) in the file * @param dst the destination byte array * @param dstoff offset in the destination byte array * @param len how many bytes to read, 0 &lt; len &lt;= 32768 bytes * @return the number of bytes that could be read, may be less than requested if * the end of the file is reached, -1 is returned in case of <code>EOF</code> * @throws IOException */ public int read(SFTPv3FileHandle handle, long fileOffset, byte[] dst, int dstoff, int len) throws IOException { checkHandleValidAndOpen(handle); if ((len > 32768) || (len <= 0)) throw new IllegalArgumentException("invalid len argument"); int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle.fileHandle, 0, handle.fileHandle.length); tw.writeUINT64(fileOffset); tw.writeUINT32(len); if (debug != null) { debug.println("Sending SSH_FXP_READ..."); debug.flush(); } sendMessage(Packet.SSH_FXP_READ, req_id, tw.getBytes()); byte[] resp = receiveMessage(34000); TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t == Packet.SSH_FXP_DATA) { if (debug != null) { debug.println("Got SSH_FXP_DATA..."); debug.flush(); } int readLen = tr.readUINT32(); if ((readLen < 0) || (readLen > len)) throw new IOException("The server sent an invalid length field."); tr.readBytes(dst, dstoff, readLen); return readLen; } if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); if (errorCode == ErrorCodes.SSH_FX_EOF) { if (debug != null) { debug.println("Got SSH_FX_EOF."); debug.flush(); } return -1; } String errorMessage = tr.readString(); throw new SFTPException(errorMessage, errorCode); } /** * Write bytes to a file. If <code>len</code> &gt; 32768, then the write operation will * be split into multiple writes. * * @param handle a SFTPv3FileHandle handle. * @param fileOffset offset (in bytes) in the file. * @param src the source byte array. * @param srcoff offset in the source byte array. * @param len how many bytes to write. * @throws IOException */ public void write(SFTPv3FileHandle handle, long fileOffset, byte[] src, int srcoff, int len) throws IOException { checkHandleValidAndOpen(handle); while (len > 0) { int writeRequestLen = len; if (writeRequestLen > 32768) writeRequestLen = 32768; int req_id = generateNextRequestID(); TypesWriter tw = new TypesWriter(); tw.writeString(handle.fileHandle, 0, handle.fileHandle.length); tw.writeUINT64(fileOffset); tw.writeString(src, srcoff, writeRequestLen); if (debug != null) { debug.println("Sending SSH_FXP_WRITE..."); debug.flush(); } sendMessage(Packet.SSH_FXP_WRITE, req_id, tw.getBytes()); fileOffset += writeRequestLen; srcoff += writeRequestLen; len -= writeRequestLen; byte[] resp = receiveMessage(34000); TypesReader tr = new TypesReader(resp); int t = tr.readByte(); int rep_id = tr.readUINT32(); if (rep_id != req_id) throw new IOException("The server sent an invalid id field."); if (t != Packet.SSH_FXP_STATUS) throw new IOException("The SFTP server sent an unexpected packet type (" + t + ")"); int errorCode = tr.readUINT32(); if (errorCode == ErrorCodes.SSH_FX_OK) continue; String errorMessage = tr.readString(); throw new SFTPException(errorMessage, errorCode); } } /** * Close a file. * * @param handle a SFTPv3FileHandle handle * @throws IOException */ public void closeFile(SFTPv3FileHandle handle) throws IOException { if (handle == null) throw new IllegalArgumentException("the handle argument may not be null"); try { if (handle.isClosed == false) { closeHandle(handle.fileHandle); } } finally { handle.isClosed = true; } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/SFTPv3Client.java
Java
asf20
39,259
package com.trilead.ssh2; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import com.trilead.ssh2.channel.Channel; import com.trilead.ssh2.channel.ChannelManager; import com.trilead.ssh2.channel.LocalAcceptThread; /** * A <code>LocalStreamForwarder</code> forwards an Input- and Outputstream * pair via the secure tunnel to another host (which may or may not be identical * to the remote SSH-2 server). * * @author Christian Plattner, plattner@trilead.com * @version $Id: LocalStreamForwarder.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class LocalStreamForwarder { ChannelManager cm; String host_to_connect; int port_to_connect; LocalAcceptThread lat; Channel cn; LocalStreamForwarder(ChannelManager cm, String host_to_connect, int port_to_connect) throws IOException { this.cm = cm; this.host_to_connect = host_to_connect; this.port_to_connect = port_to_connect; cn = cm.openDirectTCPIPChannel(host_to_connect, port_to_connect, "127.0.0.1", 0); } /** * @return An <code>InputStream</code> object. * @throws IOException */ public InputStream getInputStream() throws IOException { return cn.getStdoutStream(); } /** * Get the OutputStream. Please be aware that the implementation MAY use an * internal buffer. To make sure that the buffered data is sent over the * tunnel, you have to call the <code>flush</code> method of the * <code>OutputStream</code>. To signal EOF, please use the * <code>close</code> method of the <code>OutputStream</code>. * * @return An <code>OutputStream</code> object. * @throws IOException */ public OutputStream getOutputStream() throws IOException { return cn.getStdinStream(); } /** * Close the underlying SSH forwarding channel and free up resources. * You can also use this method to force the shutdown of the underlying * forwarding channel. Pending output (OutputStream not flushed) will NOT * be sent. Pending input (InputStream) can still be read. If the shutdown * operation is already in progress (initiated from either side), then this * call is a no-op. * * @throws IOException */ public void close() throws IOException { cm.closeChannel(cn, "Closed due to user request.", true); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/LocalStreamForwarder.java
Java
asf20
2,351
package com.trilead.ssh2; /** * A <code>HTTPProxyData</code> object is used to specify the needed connection data * to connect through a HTTP proxy. * * @see Connection#setProxyData(ProxyData) * * @author Christian Plattner, plattner@trilead.com * @version $Id: HTTPProxyData.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class HTTPProxyData implements ProxyData { public final String proxyHost; public final int proxyPort; public final String proxyUser; public final String proxyPass; public final String[] requestHeaderLines; /** * Same as calling {@link #HTTPProxyData(String, int, String, String) HTTPProxyData(proxyHost, proxyPort, <code>null</code>, <code>null</code>)} * * @param proxyHost Proxy hostname. * @param proxyPort Proxy port. */ public HTTPProxyData(String proxyHost, int proxyPort) { this(proxyHost, proxyPort, null, null); } /** * Same as calling {@link #HTTPProxyData(String, int, String, String, String[]) HTTPProxyData(proxyHost, proxyPort, <code>null</code>, <code>null</code>, <code>null</code>)} * * @param proxyHost Proxy hostname. * @param proxyPort Proxy port. * @param proxyUser Username for basic authentication (<code>null</code> if no authentication is needed). * @param proxyPass Password for basic authentication (<code>null</code> if no authentication is needed). */ public HTTPProxyData(String proxyHost, int proxyPort, String proxyUser, String proxyPass) { this(proxyHost, proxyPort, proxyUser, proxyPass, null); } /** * Connection data for a HTTP proxy. It is possible to specify a username and password * if the proxy requires basic authentication. Also, additional request header lines can * be specified (e.g., "User-Agent: CERN-LineMode/2.15 libwww/2.17b3"). * <p> * Please note: if you want to use basic authentication, then both <code>proxyUser</code> * and <code>proxyPass</code> must be non-null. * <p> * Here is an example: * <p> * <code> * new HTTPProxyData("192.168.1.1", "3128", "proxyuser", "secret", new String[] {"User-Agent: TrileadBasedClient/1.0", "X-My-Proxy-Option: something"}); * </code> * * @param proxyHost Proxy hostname. * @param proxyPort Proxy port. * @param proxyUser Username for basic authentication (<code>null</code> if no authentication is needed). * @param proxyPass Password for basic authentication (<code>null</code> if no authentication is needed). * @param requestHeaderLines An array with additional request header lines (without end-of-line markers) * that have to be sent to the server. May be <code>null</code>. */ public HTTPProxyData(String proxyHost, int proxyPort, String proxyUser, String proxyPass, String[] requestHeaderLines) { if (proxyHost == null) throw new IllegalArgumentException("proxyHost must be non-null"); if (proxyPort < 0) throw new IllegalArgumentException("proxyPort must be non-negative"); this.proxyHost = proxyHost; this.proxyPort = proxyPort; this.proxyUser = proxyUser; this.proxyPass = proxyPass; this.requestHeaderLines = requestHeaderLines; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/HTTPProxyData.java
Java
asf20
3,189
package com.trilead.ssh2; /** * A callback interface used to implement a client specific method of checking * server host keys. * * @author Christian Plattner, plattner@trilead.com * @version $Id: ServerHostKeyVerifier.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public interface ServerHostKeyVerifier { /** * The actual verifier method, it will be called by the key exchange code * on EVERY key exchange - this can happen several times during the lifetime * of a connection. * <p> * Note: SSH-2 servers are allowed to change their hostkey at ANY time. * * @param hostname the hostname used to create the {@link Connection} object * @param port the remote TCP port * @param serverHostKeyAlgorithm the public key algorithm (<code>ssh-rsa</code> or <code>ssh-dss</code>) * @param serverHostKey the server's public key blob * @return if the client wants to accept the server's host key - if not, the * connection will be closed. * @throws Exception Will be wrapped with an IOException, extended version of returning false =) */ public boolean verifyServerHostKey(String hostname, int port, String serverHostKeyAlgorithm, byte[] serverHostKey) throws Exception; }
zzsuper001-linuxshell
src/com/trilead/ssh2/ServerHostKeyVerifier.java
Java
asf20
1,248
package com.trilead.ssh2; /** * A <code>SFTPv3DirectoryEntry</code> as returned by {@link SFTPv3Client#ls(String)}. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SFTPv3DirectoryEntry.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class SFTPv3DirectoryEntry { /** * A relative name within the directory, without any path components. */ public String filename; /** * An expanded format for the file name, similar to what is returned by * "ls -l" on Un*x systems. * <p> * The format of this field is unspecified by the SFTP v3 protocol. * It MUST be suitable for use in the output of a directory listing * command (in fact, the recommended operation for a directory listing * command is to simply display this data). However, clients SHOULD NOT * attempt to parse the longname field for file attributes; they SHOULD * use the attrs field instead. * <p> * The recommended format for the longname field is as follows:<br> * <code>-rwxr-xr-x 1 mjos staff 348911 Mar 25 14:29 t-filexfer</code> */ public String longEntry; /** * The attributes of this entry. */ public SFTPv3FileAttributes attributes; }
zzsuper001-linuxshell
src/com/trilead/ssh2/SFTPv3DirectoryEntry.java
Java
asf20
1,230
package com.trilead.ssh2; import java.io.IOException; import com.trilead.ssh2.sftp.ErrorCodes; /** * Used in combination with the SFTPv3Client. This exception wraps * error messages sent by the SFTP server. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SFTPException.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class SFTPException extends IOException { private static final long serialVersionUID = 578654644222421811L; private final String sftpErrorMessage; private final int sftpErrorCode; private static String constructMessage(String s, int errorCode) { String[] detail = ErrorCodes.getDescription(errorCode); if (detail == null) return s + " (UNKNOW SFTP ERROR CODE)"; return s + " (" + detail[0] + ": " + detail[1] + ")"; } SFTPException(String msg, int errorCode) { super(constructMessage(msg, errorCode)); sftpErrorMessage = msg; sftpErrorCode = errorCode; } /** * Get the error message sent by the server. Often, this * message does not help a lot (e.g., "failure"). * * @return the plain string as sent by the server. */ public String getServerErrorMessage() { return sftpErrorMessage; } /** * Get the error code sent by the server. * * @return an error code as defined in the SFTP specs. */ public int getServerErrorCode() { return sftpErrorCode; } /** * Get the symbolic name of the error code as given in the SFTP specs. * * @return e.g., "SSH_FX_INVALID_FILENAME". */ public String getServerErrorCodeSymbol() { String[] detail = ErrorCodes.getDescription(sftpErrorCode); if (detail == null) return "UNKNOW SFTP ERROR CODE " + sftpErrorCode; return detail[0]; } /** * Get the description of the error code as given in the SFTP specs. * * @return e.g., "The filename is not valid." */ public String getServerErrorCodeVerbose() { String[] detail = ErrorCodes.getDescription(sftpErrorCode); if (detail == null) return "The error code " + sftpErrorCode + " is unknown."; return detail[1]; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/SFTPException.java
Java
asf20
2,153
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.trilead.ssh2; import java.io.IOException; import java.net.InetSocketAddress; import com.trilead.ssh2.channel.ChannelManager; import com.trilead.ssh2.channel.DynamicAcceptThread; /** * A <code>DynamicPortForwarder</code> forwards TCP/IP connections to a local * port via the secure tunnel to another host which is selected via the * SOCKS protocol. Checkout {@link Connection#createDynamicPortForwarder(int)} * on how to create one. * * @author Kenny Root * @version $Id: $ */ public class DynamicPortForwarder { ChannelManager cm; DynamicAcceptThread dat; DynamicPortForwarder(ChannelManager cm, int local_port) throws IOException { this.cm = cm; dat = new DynamicAcceptThread(cm, local_port); dat.setDaemon(true); dat.start(); } DynamicPortForwarder(ChannelManager cm, InetSocketAddress addr) throws IOException { this.cm = cm; dat = new DynamicAcceptThread(cm, addr); dat.setDaemon(true); dat.start(); } /** * Stop TCP/IP forwarding of newly arriving connections. * * @throws IOException */ public void close() throws IOException { dat.stopWorking(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/DynamicPortForwarder.java
Java
asf20
1,806
package com.trilead.ssh2; /** * An interface which needs to be implemented if you * want to capture debugging messages. * * @see Connection#enableDebugging(boolean, DebugLogger) * * @author Christian Plattner, plattner@trilead.com * @version $Id: DebugLogger.java,v 1.1 2008/03/03 07:01:36 cplattne Exp $ */ public interface DebugLogger { /** * Log a debug message. * * @param level 0-99, 99 is a the most verbose level * @param className the class that generated the message * @param message the debug message */ public void log(int level, String className, String message); }
zzsuper001-linuxshell
src/com/trilead/ssh2/DebugLogger.java
Java
asf20
622
package com.trilead.ssh2.crypto; import java.io.BufferedReader; import java.io.CharArrayReader; import java.io.IOException; import java.math.BigInteger; import com.trilead.ssh2.crypto.cipher.AES; import com.trilead.ssh2.crypto.cipher.BlockCipher; import com.trilead.ssh2.crypto.cipher.CBCMode; import com.trilead.ssh2.crypto.cipher.DES; import com.trilead.ssh2.crypto.cipher.DESede; import com.trilead.ssh2.crypto.digest.MD5; import com.trilead.ssh2.signature.DSAPrivateKey; import com.trilead.ssh2.signature.RSAPrivateKey; /** * PEM Support. * * @author Christian Plattner, plattner@trilead.com * @version $Id: PEMDecoder.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class PEMDecoder { public static final int PEM_RSA_PRIVATE_KEY = 1; public static final int PEM_DSA_PRIVATE_KEY = 2; private static final int hexToInt(char c) { if ((c >= 'a') && (c <= 'f')) { return (c - 'a') + 10; } if ((c >= 'A') && (c <= 'F')) { return (c - 'A') + 10; } if ((c >= '0') && (c <= '9')) { return (c - '0'); } throw new IllegalArgumentException("Need hex char"); } private static byte[] hexToByteArray(String hex) { if (hex == null) throw new IllegalArgumentException("null argument"); if ((hex.length() % 2) != 0) throw new IllegalArgumentException("Uneven string length in hex encoding."); byte decoded[] = new byte[hex.length() / 2]; for (int i = 0; i < decoded.length; i++) { int hi = hexToInt(hex.charAt(i * 2)); int lo = hexToInt(hex.charAt((i * 2) + 1)); decoded[i] = (byte) (hi * 16 + lo); } return decoded; } private static byte[] generateKeyFromPasswordSaltWithMD5(byte[] password, byte[] salt, int keyLen) throws IOException { if (salt.length < 8) throw new IllegalArgumentException("Salt needs to be at least 8 bytes for key generation."); MD5 md5 = new MD5(); byte[] key = new byte[keyLen]; byte[] tmp = new byte[md5.getDigestLength()]; while (true) { md5.update(password, 0, password.length); md5.update(salt, 0, 8); // ARGH we only use the first 8 bytes of the // salt in this step. // This took me two hours until I got AES-xxx running. int copy = (keyLen < tmp.length) ? keyLen : tmp.length; md5.digest(tmp, 0); System.arraycopy(tmp, 0, key, key.length - keyLen, copy); keyLen -= copy; if (keyLen == 0) return key; md5.update(tmp, 0, tmp.length); } } private static byte[] removePadding(byte[] buff, int blockSize) throws IOException { /* Removes RFC 1423/PKCS #7 padding */ int rfc_1423_padding = buff[buff.length - 1] & 0xff; if ((rfc_1423_padding < 1) || (rfc_1423_padding > blockSize)) throw new IOException("Decrypted PEM has wrong padding, did you specify the correct password?"); for (int i = 2; i <= rfc_1423_padding; i++) { if (buff[buff.length - i] != rfc_1423_padding) throw new IOException("Decrypted PEM has wrong padding, did you specify the correct password?"); } byte[] tmp = new byte[buff.length - rfc_1423_padding]; System.arraycopy(buff, 0, tmp, 0, buff.length - rfc_1423_padding); return tmp; } public static final PEMStructure parsePEM(char[] pem) throws IOException { PEMStructure ps = new PEMStructure(); String line = null; BufferedReader br = new BufferedReader(new CharArrayReader(pem)); String endLine = null; while (true) { line = br.readLine(); if (line == null) throw new IOException("Invalid PEM structure, '-----BEGIN...' missing"); line = line.trim(); if (line.startsWith("-----BEGIN DSA PRIVATE KEY-----")) { endLine = "-----END DSA PRIVATE KEY-----"; ps.pemType = PEM_DSA_PRIVATE_KEY; break; } if (line.startsWith("-----BEGIN RSA PRIVATE KEY-----")) { endLine = "-----END RSA PRIVATE KEY-----"; ps.pemType = PEM_RSA_PRIVATE_KEY; break; } } while (true) { line = br.readLine(); if (line == null) throw new IOException("Invalid PEM structure, " + endLine + " missing"); line = line.trim(); int sem_idx = line.indexOf(':'); if (sem_idx == -1) break; String name = line.substring(0, sem_idx + 1); String value = line.substring(sem_idx + 1); String values[] = value.split(","); for (int i = 0; i < values.length; i++) values[i] = values[i].trim(); // Proc-Type: 4,ENCRYPTED // DEK-Info: DES-EDE3-CBC,579B6BE3E5C60483 if ("Proc-Type:".equals(name)) { ps.procType = values; continue; } if ("DEK-Info:".equals(name)) { ps.dekInfo = values; continue; } /* Ignore line */ } StringBuffer keyData = new StringBuffer(); while (true) { if (line == null) throw new IOException("Invalid PEM structure, " + endLine + " missing"); line = line.trim(); if (line.startsWith(endLine)) break; keyData.append(line); line = br.readLine(); } char[] pem_chars = new char[keyData.length()]; keyData.getChars(0, pem_chars.length, pem_chars, 0); ps.data = Base64.decode(pem_chars); if (ps.data.length == 0) throw new IOException("Invalid PEM structure, no data available"); return ps; } private static final void decryptPEM(PEMStructure ps, byte[] pw) throws IOException { if (ps.dekInfo == null) throw new IOException("Broken PEM, no mode and salt given, but encryption enabled"); if (ps.dekInfo.length != 2) throw new IOException("Broken PEM, DEK-Info is incomplete!"); String algo = ps.dekInfo[0]; byte[] salt = hexToByteArray(ps.dekInfo[1]); BlockCipher bc = null; if (algo.equals("DES-EDE3-CBC")) { DESede des3 = new DESede(); des3.init(false, generateKeyFromPasswordSaltWithMD5(pw, salt, 24)); bc = new CBCMode(des3, salt, false); } else if (algo.equals("DES-CBC")) { DES des = new DES(); des.init(false, generateKeyFromPasswordSaltWithMD5(pw, salt, 8)); bc = new CBCMode(des, salt, false); } else if (algo.equals("AES-128-CBC")) { AES aes = new AES(); aes.init(false, generateKeyFromPasswordSaltWithMD5(pw, salt, 16)); bc = new CBCMode(aes, salt, false); } else if (algo.equals("AES-192-CBC")) { AES aes = new AES(); aes.init(false, generateKeyFromPasswordSaltWithMD5(pw, salt, 24)); bc = new CBCMode(aes, salt, false); } else if (algo.equals("AES-256-CBC")) { AES aes = new AES(); aes.init(false, generateKeyFromPasswordSaltWithMD5(pw, salt, 32)); bc = new CBCMode(aes, salt, false); } else { throw new IOException("Cannot decrypt PEM structure, unknown cipher " + algo); } if ((ps.data.length % bc.getBlockSize()) != 0) throw new IOException("Invalid PEM structure, size of encrypted block is not a multiple of " + bc.getBlockSize()); /* Now decrypt the content */ byte[] dz = new byte[ps.data.length]; for (int i = 0; i < ps.data.length / bc.getBlockSize(); i++) { bc.transformBlock(ps.data, i * bc.getBlockSize(), dz, i * bc.getBlockSize()); } /* Now check and remove RFC 1423/PKCS #7 padding */ dz = removePadding(dz, bc.getBlockSize()); ps.data = dz; ps.dekInfo = null; ps.procType = null; } public static final boolean isPEMEncrypted(PEMStructure ps) throws IOException { if (ps.procType == null) return false; if (ps.procType.length != 2) throw new IOException("Unknown Proc-Type field."); if ("4".equals(ps.procType[0]) == false) throw new IOException("Unknown Proc-Type field (" + ps.procType[0] + ")"); if ("ENCRYPTED".equals(ps.procType[1])) return true; return false; } public static Object decode(char[] pem, String password) throws IOException { PEMStructure ps = parsePEM(pem); if (isPEMEncrypted(ps)) { if (password == null) throw new IOException("PEM is encrypted, but no password was specified"); decryptPEM(ps, password.getBytes("ISO-8859-1")); } if (ps.pemType == PEM_DSA_PRIVATE_KEY) { SimpleDERReader dr = new SimpleDERReader(ps.data); byte[] seq = dr.readSequenceAsByteArray(); if (dr.available() != 0) throw new IOException("Padding in DSA PRIVATE KEY DER stream."); dr.resetInput(seq); BigInteger version = dr.readInt(); if (version.compareTo(BigInteger.ZERO) != 0) throw new IOException("Wrong version (" + version + ") in DSA PRIVATE KEY DER stream."); BigInteger p = dr.readInt(); BigInteger q = dr.readInt(); BigInteger g = dr.readInt(); BigInteger y = dr.readInt(); BigInteger x = dr.readInt(); if (dr.available() != 0) throw new IOException("Padding in DSA PRIVATE KEY DER stream."); return new DSAPrivateKey(p, q, g, y, x); } if (ps.pemType == PEM_RSA_PRIVATE_KEY) { SimpleDERReader dr = new SimpleDERReader(ps.data); byte[] seq = dr.readSequenceAsByteArray(); if (dr.available() != 0) throw new IOException("Padding in RSA PRIVATE KEY DER stream."); dr.resetInput(seq); BigInteger version = dr.readInt(); if ((version.compareTo(BigInteger.ZERO) != 0) && (version.compareTo(BigInteger.ONE) != 0)) throw new IOException("Wrong version (" + version + ") in RSA PRIVATE KEY DER stream."); BigInteger n = dr.readInt(); BigInteger e = dr.readInt(); BigInteger d = dr.readInt(); return new RSAPrivateKey(d, e, n); } throw new IOException("PEM problem: it is of unknown type"); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/PEMDecoder.java
Java
asf20
9,657
package com.trilead.ssh2.crypto.digest; import java.math.BigInteger; /** * HashForSSH2Types. * * @author Christian Plattner, plattner@trilead.com * @version $Id: HashForSSH2Types.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class HashForSSH2Types { Digest md; public HashForSSH2Types(Digest md) { this.md = md; } public HashForSSH2Types(String type) { if (type.equals("SHA1")) { md = new SHA1(); } else if (type.equals("MD5")) { md = new MD5(); } else throw new IllegalArgumentException("Unknown algorithm " + type); } public void updateByte(byte b) { /* HACK - to test it with J2ME */ byte[] tmp = new byte[1]; tmp[0] = b; md.update(tmp); } public void updateBytes(byte[] b) { md.update(b); } public void updateUINT32(int v) { md.update((byte) (v >> 24)); md.update((byte) (v >> 16)); md.update((byte) (v >> 8)); md.update((byte) (v)); } public void updateByteString(byte[] b) { updateUINT32(b.length); updateBytes(b); } public void updateBigInt(BigInteger b) { updateByteString(b.toByteArray()); } public void reset() { md.reset(); } public int getDigestLength() { return md.getDigestLength(); } public byte[] getDigest() { byte[] tmp = new byte[md.getDigestLength()]; getDigest(tmp); return tmp; } public void getDigest(byte[] out) { getDigest(out, 0); } public void getDigest(byte[] out, int off) { md.digest(out, off); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/HashForSSH2Types.java
Java
asf20
1,553
package com.trilead.ssh2.crypto.digest; /** * MAC. * * @author Christian Plattner, plattner@trilead.com * @version $Id: MAC.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public final class MAC { Digest mac; int size; public final static String[] getMacList() { /* Higher Priority First */ return new String[] { "hmac-sha1-96", "hmac-sha1", "hmac-md5-96", "hmac-md5" }; } public final static void checkMacList(String[] macs) { for (int i = 0; i < macs.length; i++) getKeyLen(macs[i]); } public final static int getKeyLen(String type) { if (type.equals("hmac-sha1")) return 20; if (type.equals("hmac-sha1-96")) return 20; if (type.equals("hmac-md5")) return 16; if (type.equals("hmac-md5-96")) return 16; throw new IllegalArgumentException("Unkown algorithm " + type); } public MAC(String type, byte[] key) { if (type.equals("hmac-sha1")) { mac = new HMAC(new SHA1(), key, 20); } else if (type.equals("hmac-sha1-96")) { mac = new HMAC(new SHA1(), key, 12); } else if (type.equals("hmac-md5")) { mac = new HMAC(new MD5(), key, 16); } else if (type.equals("hmac-md5-96")) { mac = new HMAC(new MD5(), key, 12); } else throw new IllegalArgumentException("Unkown algorithm " + type); size = mac.getDigestLength(); } public final void initMac(int seq) { mac.reset(); mac.update((byte) (seq >> 24)); mac.update((byte) (seq >> 16)); mac.update((byte) (seq >> 8)); mac.update((byte) (seq)); } public final void update(byte[] packetdata, int off, int len) { mac.update(packetdata, off, len); } public final void getMac(byte[] out, int off) { mac.digest(out, off); } public final int size() { return size; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/MAC.java
Java
asf20
1,822
package com.trilead.ssh2.crypto.digest; /** * MD5. Based on the example code in RFC 1321. Optimized (...a little). * * @author Christian Plattner, plattner@trilead.com * @version $Id: MD5.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ /* * The following disclaimer has been copied from RFC 1321: * * Copyright (C) 1991-2, RSA Data Security, Inc. Created 1991. All rights * reserved. * * License to copy and use this software is granted provided that it is * identified as the "RSA Data Security, Inc. MD5 Message-Digest Algorithm" in * all material mentioning or referencing this software or this function. * * License is also granted to make and use derivative works provided that such * works are identified as "derived from the RSA Data Security, Inc. MD5 * Message-Digest Algorithm" in all material mentioning or referencing the * derived work. * * RSA Data Security, Inc. makes no representations concerning either the * merchantability of this software or the suitability of this software for any * particular purpose. It is provided "as is" without express or implied * warranty of any kind. * * These notices must be retained in any copies of any part of this * documentation and/or software. * */ public final class MD5 implements Digest { private int state0, state1, state2, state3; private long count; private final byte[] block = new byte[64]; private final int x[] = new int[16]; private static final byte[] padding = new byte[] { (byte) 128, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 }; public MD5() { reset(); } private static final int FF(int a, int b, int c, int d, int x, int s, int ac) { a += ((b & c) | ((~b) & d)) + x + ac; return ((a << s) | (a >>> (32 - s))) + b; } private static final int GG(int a, int b, int c, int d, int x, int s, int ac) { a += ((b & d) | (c & (~d))) + x + ac; return ((a << s) | (a >>> (32 - s))) + b; } private static final int HH(int a, int b, int c, int d, int x, int s, int ac) { a += (b ^ c ^ d) + x + ac; return ((a << s) | (a >>> (32 - s))) + b; } private static final int II(int a, int b, int c, int d, int x, int s, int ac) { a += (c ^ (b | (~d))) + x + ac; return ((a << s) | (a >>> (32 - s))) + b; } private static final void encode(byte[] dst, int dstoff, int word) { dst[dstoff] = (byte) (word); dst[dstoff + 1] = (byte) (word >> 8); dst[dstoff + 2] = (byte) (word >> 16); dst[dstoff + 3] = (byte) (word >> 24); } private final void transform(byte[] src, int pos) { int a = state0; int b = state1; int c = state2; int d = state3; for (int i = 0; i < 16; i++, pos += 4) { x[i] = (src[pos] & 0xff) | ((src[pos + 1] & 0xff) << 8) | ((src[pos + 2] & 0xff) << 16) | ((src[pos + 3] & 0xff) << 24); } /* Round 1 */ a = FF(a, b, c, d, x[0], 7, 0xd76aa478); /* 1 */ d = FF(d, a, b, c, x[1], 12, 0xe8c7b756); /* 2 */ c = FF(c, d, a, b, x[2], 17, 0x242070db); /* 3 */ b = FF(b, c, d, a, x[3], 22, 0xc1bdceee); /* 4 */ a = FF(a, b, c, d, x[4], 7, 0xf57c0faf); /* 5 */ d = FF(d, a, b, c, x[5], 12, 0x4787c62a); /* 6 */ c = FF(c, d, a, b, x[6], 17, 0xa8304613); /* 7 */ b = FF(b, c, d, a, x[7], 22, 0xfd469501); /* 8 */ a = FF(a, b, c, d, x[8], 7, 0x698098d8); /* 9 */ d = FF(d, a, b, c, x[9], 12, 0x8b44f7af); /* 10 */ c = FF(c, d, a, b, x[10], 17, 0xffff5bb1); /* 11 */ b = FF(b, c, d, a, x[11], 22, 0x895cd7be); /* 12 */ a = FF(a, b, c, d, x[12], 7, 0x6b901122); /* 13 */ d = FF(d, a, b, c, x[13], 12, 0xfd987193); /* 14 */ c = FF(c, d, a, b, x[14], 17, 0xa679438e); /* 15 */ b = FF(b, c, d, a, x[15], 22, 0x49b40821); /* 16 */ /* Round 2 */ a = GG(a, b, c, d, x[1], 5, 0xf61e2562); /* 17 */ d = GG(d, a, b, c, x[6], 9, 0xc040b340); /* 18 */ c = GG(c, d, a, b, x[11], 14, 0x265e5a51); /* 19 */ b = GG(b, c, d, a, x[0], 20, 0xe9b6c7aa); /* 20 */ a = GG(a, b, c, d, x[5], 5, 0xd62f105d); /* 21 */ d = GG(d, a, b, c, x[10], 9, 0x2441453); /* 22 */ c = GG(c, d, a, b, x[15], 14, 0xd8a1e681); /* 23 */ b = GG(b, c, d, a, x[4], 20, 0xe7d3fbc8); /* 24 */ a = GG(a, b, c, d, x[9], 5, 0x21e1cde6); /* 25 */ d = GG(d, a, b, c, x[14], 9, 0xc33707d6); /* 26 */ c = GG(c, d, a, b, x[3], 14, 0xf4d50d87); /* 27 */ b = GG(b, c, d, a, x[8], 20, 0x455a14ed); /* 28 */ a = GG(a, b, c, d, x[13], 5, 0xa9e3e905); /* 29 */ d = GG(d, a, b, c, x[2], 9, 0xfcefa3f8); /* 30 */ c = GG(c, d, a, b, x[7], 14, 0x676f02d9); /* 31 */ b = GG(b, c, d, a, x[12], 20, 0x8d2a4c8a); /* 32 */ /* Round 3 */ a = HH(a, b, c, d, x[5], 4, 0xfffa3942); /* 33 */ d = HH(d, a, b, c, x[8], 11, 0x8771f681); /* 34 */ c = HH(c, d, a, b, x[11], 16, 0x6d9d6122); /* 35 */ b = HH(b, c, d, a, x[14], 23, 0xfde5380c); /* 36 */ a = HH(a, b, c, d, x[1], 4, 0xa4beea44); /* 37 */ d = HH(d, a, b, c, x[4], 11, 0x4bdecfa9); /* 38 */ c = HH(c, d, a, b, x[7], 16, 0xf6bb4b60); /* 39 */ b = HH(b, c, d, a, x[10], 23, 0xbebfbc70); /* 40 */ a = HH(a, b, c, d, x[13], 4, 0x289b7ec6); /* 41 */ d = HH(d, a, b, c, x[0], 11, 0xeaa127fa); /* 42 */ c = HH(c, d, a, b, x[3], 16, 0xd4ef3085); /* 43 */ b = HH(b, c, d, a, x[6], 23, 0x4881d05); /* 44 */ a = HH(a, b, c, d, x[9], 4, 0xd9d4d039); /* 45 */ d = HH(d, a, b, c, x[12], 11, 0xe6db99e5); /* 46 */ c = HH(c, d, a, b, x[15], 16, 0x1fa27cf8); /* 47 */ b = HH(b, c, d, a, x[2], 23, 0xc4ac5665); /* 48 */ /* Round 4 */ a = II(a, b, c, d, x[0], 6, 0xf4292244); /* 49 */ d = II(d, a, b, c, x[7], 10, 0x432aff97); /* 50 */ c = II(c, d, a, b, x[14], 15, 0xab9423a7); /* 51 */ b = II(b, c, d, a, x[5], 21, 0xfc93a039); /* 52 */ a = II(a, b, c, d, x[12], 6, 0x655b59c3); /* 53 */ d = II(d, a, b, c, x[3], 10, 0x8f0ccc92); /* 54 */ c = II(c, d, a, b, x[10], 15, 0xffeff47d); /* 55 */ b = II(b, c, d, a, x[1], 21, 0x85845dd1); /* 56 */ a = II(a, b, c, d, x[8], 6, 0x6fa87e4f); /* 57 */ d = II(d, a, b, c, x[15], 10, 0xfe2ce6e0); /* 58 */ c = II(c, d, a, b, x[6], 15, 0xa3014314); /* 59 */ b = II(b, c, d, a, x[13], 21, 0x4e0811a1); /* 60 */ a = II(a, b, c, d, x[4], 6, 0xf7537e82); /* 61 */ d = II(d, a, b, c, x[11], 10, 0xbd3af235); /* 62 */ c = II(c, d, a, b, x[2], 15, 0x2ad7d2bb); /* 63 */ b = II(b, c, d, a, x[9], 21, 0xeb86d391); /* 64 */ state0 += a; state1 += b; state2 += c; state3 += d; } public final void reset() { count = 0; state0 = 0x67452301; state1 = 0xefcdab89; state2 = 0x98badcfe; state3 = 0x10325476; /* Clear traces in memory... */ for (int i = 0; i < 16; i++) x[i] = 0; } public final void update(byte b) { final int space = 64 - ((int) (count & 0x3f)); count++; block[64 - space] = b; if (space == 1) transform(block, 0); } public final void update(byte[] buff, int pos, int len) { int space = 64 - ((int) (count & 0x3f)); count += len; while (len > 0) { if (len < space) { System.arraycopy(buff, pos, block, 64 - space, len); break; } if (space == 64) { transform(buff, pos); } else { System.arraycopy(buff, pos, block, 64 - space, space); transform(block, 0); } pos += space; len -= space; space = 64; } } public final void update(byte[] b) { update(b, 0, b.length); } public final void digest(byte[] dst, int pos) { byte[] bits = new byte[8]; encode(bits, 0, (int) (count << 3)); encode(bits, 4, (int) (count >> 29)); int idx = (int) count & 0x3f; int padLen = (idx < 56) ? (56 - idx) : (120 - idx); update(padding, 0, padLen); update(bits, 0, 8); encode(dst, pos, state0); encode(dst, pos + 4, state1); encode(dst, pos + 8, state2); encode(dst, pos + 12, state3); reset(); } public final void digest(byte[] dst) { digest(dst, 0); } public final int getDigestLength() { return 16; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/MD5.java
Java
asf20
8,195
package com.trilead.ssh2.crypto.digest; /** * Digest. * * @author Christian Plattner, plattner@trilead.com * @version $Id: Digest.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public interface Digest { public int getDigestLength(); public void update(byte b); public void update(byte[] b); public void update(byte b[], int off, int len); public void reset(); public void digest(byte[] out); public void digest(byte[] out, int off); }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/Digest.java
Java
asf20
483
package com.trilead.ssh2.crypto.digest; /** * HMAC. * * @author Christian Plattner, plattner@trilead.com * @version $Id: HMAC.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public final class HMAC implements Digest { Digest md; byte[] k_xor_ipad; byte[] k_xor_opad; byte[] tmp; int size; public HMAC(Digest md, byte[] key, int size) { this.md = md; this.size = size; tmp = new byte[md.getDigestLength()]; final int BLOCKSIZE = 64; k_xor_ipad = new byte[BLOCKSIZE]; k_xor_opad = new byte[BLOCKSIZE]; if (key.length > BLOCKSIZE) { md.reset(); md.update(key); md.digest(tmp); key = tmp; } System.arraycopy(key, 0, k_xor_ipad, 0, key.length); System.arraycopy(key, 0, k_xor_opad, 0, key.length); for (int i = 0; i < BLOCKSIZE; i++) { k_xor_ipad[i] ^= 0x36; k_xor_opad[i] ^= 0x5C; } md.update(k_xor_ipad); } public final int getDigestLength() { return size; } public final void update(byte b) { md.update(b); } public final void update(byte[] b) { md.update(b); } public final void update(byte[] b, int off, int len) { md.update(b, off, len); } public final void reset() { md.reset(); md.update(k_xor_ipad); } public final void digest(byte[] out) { digest(out, 0); } public final void digest(byte[] out, int off) { md.digest(tmp); md.update(k_xor_opad); md.update(tmp); md.digest(tmp); System.arraycopy(tmp, 0, out, off, size); md.update(k_xor_ipad); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/HMAC.java
Java
asf20
1,578
package com.trilead.ssh2.crypto.digest; /** * SHA-1 implementation based on FIPS PUB 180-1. * Highly optimized. * <p> * (http://www.itl.nist.gov/fipspubs/fip180-1.htm) * * @author Christian Plattner, plattner@trilead.com * @version $Id: SHA1.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public final class SHA1 implements Digest { private int H0, H1, H2, H3, H4; private final int[] w = new int[80]; private int currentPos; private long currentLen; public SHA1() { reset(); } public final int getDigestLength() { return 20; } public final void reset() { H0 = 0x67452301; H1 = 0xEFCDAB89; H2 = 0x98BADCFE; H3 = 0x10325476; H4 = 0xC3D2E1F0; currentPos = 0; currentLen = 0; /* In case of complete paranoia, we should also wipe out the * information contained in the w[] array */ } public final void update(byte b[]) { update(b, 0, b.length); } public final void update(byte b[], int off, int len) { if (len >= 4) { int idx = currentPos >> 2; switch (currentPos & 3) { case 0: w[idx] = (((b[off++] & 0xff) << 24) | ((b[off++] & 0xff) << 16) | ((b[off++] & 0xff) << 8) | (b[off++] & 0xff)); len -= 4; currentPos += 4; currentLen += 32; if (currentPos == 64) { perform(); currentPos = 0; } break; case 1: w[idx] = (w[idx] << 24) | (((b[off++] & 0xff) << 16) | ((b[off++] & 0xff) << 8) | (b[off++] & 0xff)); len -= 3; currentPos += 3; currentLen += 24; if (currentPos == 64) { perform(); currentPos = 0; } break; case 2: w[idx] = (w[idx] << 16) | (((b[off++] & 0xff) << 8) | (b[off++] & 0xff)); len -= 2; currentPos += 2; currentLen += 16; if (currentPos == 64) { perform(); currentPos = 0; } break; case 3: w[idx] = (w[idx] << 8) | (b[off++] & 0xff); len--; currentPos++; currentLen += 8; if (currentPos == 64) { perform(); currentPos = 0; } break; } /* Now currentPos is a multiple of 4 - this is the place to be...*/ while (len >= 8) { w[currentPos >> 2] = ((b[off++] & 0xff) << 24) | ((b[off++] & 0xff) << 16) | ((b[off++] & 0xff) << 8) | (b[off++] & 0xff); currentPos += 4; if (currentPos == 64) { perform(); currentPos = 0; } w[currentPos >> 2] = ((b[off++] & 0xff) << 24) | ((b[off++] & 0xff) << 16) | ((b[off++] & 0xff) << 8) | (b[off++] & 0xff); currentPos += 4; if (currentPos == 64) { perform(); currentPos = 0; } currentLen += 64; len -= 8; } while (len < 0) //(len >= 4) { w[currentPos >> 2] = ((b[off++] & 0xff) << 24) | ((b[off++] & 0xff) << 16) | ((b[off++] & 0xff) << 8) | (b[off++] & 0xff); len -= 4; currentPos += 4; currentLen += 32; if (currentPos == 64) { perform(); currentPos = 0; } } } /* Remaining bytes (1-3) */ while (len > 0) { /* Here is room for further improvements */ int idx = currentPos >> 2; w[idx] = (w[idx] << 8) | (b[off++] & 0xff); currentLen += 8; currentPos++; if (currentPos == 64) { perform(); currentPos = 0; } len--; } } public final void update(byte b) { int idx = currentPos >> 2; w[idx] = (w[idx] << 8) | (b & 0xff); currentLen += 8; currentPos++; if (currentPos == 64) { perform(); currentPos = 0; } } private final void putInt(byte[] b, int pos, int val) { b[pos] = (byte) (val >> 24); b[pos + 1] = (byte) (val >> 16); b[pos + 2] = (byte) (val >> 8); b[pos + 3] = (byte) val; } public final void digest(byte[] out) { digest(out, 0); } public final void digest(byte[] out, int off) { /* Pad with a '1' and 7-31 zero bits... */ int idx = currentPos >> 2; w[idx] = ((w[idx] << 8) | (0x80)) << ((3 - (currentPos & 3)) << 3); currentPos = (currentPos & ~3) + 4; if (currentPos == 64) { currentPos = 0; perform(); } else if (currentPos == 60) { currentPos = 0; w[15] = 0; perform(); } /* Now currentPos is a multiple of 4 and we can do the remaining * padding much more efficiently, furthermore we are sure * that currentPos <= 56. */ for (int i = currentPos >> 2; i < 14; i++) w[i] = 0; w[14] = (int) (currentLen >> 32); w[15] = (int) currentLen; perform(); putInt(out, off, H0); putInt(out, off + 4, H1); putInt(out, off + 8, H2); putInt(out, off + 12, H3); putInt(out, off + 16, H4); reset(); } private final void perform() { for (int t = 16; t < 80; t++) { int x = w[t - 3] ^ w[t - 8] ^ w[t - 14] ^ w[t - 16]; w[t] = ((x << 1) | (x >>> 31)); } int A = H0; int B = H1; int C = H2; int D = H3; int E = H4; /* Here we use variable substitution and loop unrolling * * === Original step: * * T = s5(A) + f(B,C,D) + E + w[0] + K; * E = D; D = C; C = s30(B); B = A; A = T; * * === Rewritten step: * * T = s5(A + f(B,C,D) + E + w[0] + K; * B = s30(B); * E = D; D = C; C = B; B = A; A = T; * * === Let's rewrite things, introducing new variables: * * E0 = E; D0 = D; C0 = C; B0 = B; A0 = A; * * T = s5(A0) + f(B0,C0,D0) + E0 + w[0] + K; * B0 = s30(B0); * E1 = D0; D1 = C0; C1 = B0; B1 = A0; A1 = T; * * T = s5(A1) + f(B1,C1,D1) + E1 + w[1] + K; * B1 = s30(B1); * E2 = D1; D2 = C1; C2 = B1; B2 = A1; A2 = T; * * E = E2; D = E2; C = C2; B = B2; A = A2; * * === No need for 'T', we can write into 'Ex' instead since * after the calculation of 'T' nobody is interested * in 'Ex' anymore. * * E0 = E; D0 = D; C0 = C; B0 = B; A0 = A; * * E0 = E0 + s5(A0) + f(B0,C0,D0) + w[0] + K; * B0 = s30(B0); * E1 = D0; D1 = C0; C1 = B0; B1 = A0; A1 = E0; * * E1 = E1 + s5(A1) + f(B1,C1,D1) + w[1] + K; * B1 = s30(B1); * E2 = D1; D2 = C1; C2 = B1; B2 = A1; A2 = E1; * * E = Ex; D = Ex; C = Cx; B = Bx; A = Ax; * * === Further optimization: get rid of the swap operations * Idea: instead of swapping the variables, swap the names of * the used variables in the next step: * * E0 = E; D0 = d; C0 = C; B0 = B; A0 = A; * * E0 = E0 + s5(A0) + f(B0,C0,D0) + w[0] + K; * B0 = s30(B0); * // E1 = D0; D1 = C0; C1 = B0; B1 = A0; A1 = E0; * * D0 = D0 + s5(E0) + f(A0,B0,C0) + w[1] + K; * A0 = s30(A0); * E2 = C0; D2 = B0; C2 = A0; B2 = E0; A2 = D0; * * E = E2; D = D2; C = C2; B = B2; A = A2; * * === OK, let's do this several times, also, directly * use A (instead of A0) and B,C,D,E. * * E = E + s5(A) + f(B,C,D) + w[0] + K; * B = s30(B); * // E1 = D; D1 = C; C1 = B; B1 = A; A1 = E; * * D = D + s5(E) + f(A,B,C) + w[1] + K; * A = s30(A); * // E2 = C; D2 = B; C2 = A; B2 = E; A2 = D; * * C = C + s5(D) + f(E,A,B) + w[2] + K; * E = s30(E); * // E3 = B; D3 = A; C3 = E; B3 = D; A3 = C; * * B = B + s5(C) + f(D,E,A) + w[3] + K; * D = s30(D); * // E4 = A; D4 = E; C4 = D; B4 = C; A4 = B; * * A = A + s5(B) + f(C,D,E) + w[4] + K; * C = s30(C); * // E5 = E; D5 = D; C5 = C; B5 = B; A5 = A; * * //E = E5; D = D5; C = C5; B = B5; A = A5; * * === Very nice, after 5 steps each variable * has the same contents as after 5 steps with * the original algorithm! * * We therefore can easily unroll each interval, * as the number of steps in each interval is a * multiple of 5 (20 steps per interval). */ E += ((A << 5) | (A >>> 27)) + ((B & C) | ((~B) & D)) + w[0] + 0x5A827999; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | ((~A) & C)) + w[1] + 0x5A827999; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | ((~E) & B)) + w[2] + 0x5A827999; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | ((~D) & A)) + w[3] + 0x5A827999; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | ((~C) & E)) + w[4] + 0x5A827999; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | ((~B) & D)) + w[5] + 0x5A827999; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | ((~A) & C)) + w[6] + 0x5A827999; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | ((~E) & B)) + w[7] + 0x5A827999; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | ((~D) & A)) + w[8] + 0x5A827999; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | ((~C) & E)) + w[9] + 0x5A827999; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | ((~B) & D)) + w[10] + 0x5A827999; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | ((~A) & C)) + w[11] + 0x5A827999; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | ((~E) & B)) + w[12] + 0x5A827999; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | ((~D) & A)) + w[13] + 0x5A827999; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | ((~C) & E)) + w[14] + 0x5A827999; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | ((~B) & D)) + w[15] + 0x5A827999; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | ((~A) & C)) + w[16] + 0x5A827999; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | ((~E) & B)) + w[17] + 0x5A827999; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | ((~D) & A)) + w[18] + 0x5A827999; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | ((~C) & E)) + w[19] + 0x5A827999; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[20] + 0x6ED9EBA1; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[21] + 0x6ED9EBA1; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[22] + 0x6ED9EBA1; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[23] + 0x6ED9EBA1; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[24] + 0x6ED9EBA1; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[25] + 0x6ED9EBA1; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[26] + 0x6ED9EBA1; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[27] + 0x6ED9EBA1; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[28] + 0x6ED9EBA1; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[29] + 0x6ED9EBA1; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[30] + 0x6ED9EBA1; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[31] + 0x6ED9EBA1; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[32] + 0x6ED9EBA1; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[33] + 0x6ED9EBA1; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[34] + 0x6ED9EBA1; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[35] + 0x6ED9EBA1; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[36] + 0x6ED9EBA1; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[37] + 0x6ED9EBA1; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[38] + 0x6ED9EBA1; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[39] + 0x6ED9EBA1; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | (B & D) | (C & D)) + w[40] + 0x8F1BBCDC; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | (A & C) | (B & C)) + w[41] + 0x8F1BBCDC; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | (E & B) | (A & B)) + w[42] + 0x8F1BBCDC; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | (D & A) | (E & A)) + w[43] + 0x8F1BBCDC; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | (C & E) | (D & E)) + w[44] + 0x8F1BBCDC; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | (B & D) | (C & D)) + w[45] + 0x8F1BBCDC; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | (A & C) | (B & C)) + w[46] + 0x8F1BBCDC; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | (E & B) | (A & B)) + w[47] + 0x8F1BBCDC; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | (D & A) | (E & A)) + w[48] + 0x8F1BBCDC; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | (C & E) | (D & E)) + w[49] + 0x8F1BBCDC; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + ((B & C) | (B & D) | (C & D)) + w[50] + 0x8F1BBCDC; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | (A & C) | (B & C)) + w[51] + 0x8F1BBCDC; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | (E & B) | (A & B)) + w[52] + 0x8F1BBCDC; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | (D & A) | (E & A)) + w[53] + 0x8F1BBCDC; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | (C & E) | (D & E)) + w[54] + 0x8F1BBCDC; C = ((C << 30) | (C >>> 2)); E = E + ((A << 5) | (A >>> 27)) + ((B & C) | (B & D) | (C & D)) + w[55] + 0x8F1BBCDC; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + ((A & B) | (A & C) | (B & C)) + w[56] + 0x8F1BBCDC; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + ((E & A) | (E & B) | (A & B)) + w[57] + 0x8F1BBCDC; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + ((D & E) | (D & A) | (E & A)) + w[58] + 0x8F1BBCDC; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + ((C & D) | (C & E) | (D & E)) + w[59] + 0x8F1BBCDC; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[60] + 0xCA62C1D6; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[61] + 0xCA62C1D6; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[62] + 0xCA62C1D6; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[63] + 0xCA62C1D6; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[64] + 0xCA62C1D6; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[65] + 0xCA62C1D6; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[66] + 0xCA62C1D6; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[67] + 0xCA62C1D6; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[68] + 0xCA62C1D6; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[69] + 0xCA62C1D6; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[70] + 0xCA62C1D6; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[71] + 0xCA62C1D6; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[72] + 0xCA62C1D6; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[73] + 0xCA62C1D6; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[74] + 0xCA62C1D6; C = ((C << 30) | (C >>> 2)); E += ((A << 5) | (A >>> 27)) + (B ^ C ^ D) + w[75] + 0xCA62C1D6; B = ((B << 30) | (B >>> 2)); D += ((E << 5) | (E >>> 27)) + (A ^ B ^ C) + w[76] + 0xCA62C1D6; A = ((A << 30) | (A >>> 2)); C += ((D << 5) | (D >>> 27)) + (E ^ A ^ B) + w[77] + 0xCA62C1D6; E = ((E << 30) | (E >>> 2)); B += ((C << 5) | (C >>> 27)) + (D ^ E ^ A) + w[78] + 0xCA62C1D6; D = ((D << 30) | (D >>> 2)); A += ((B << 5) | (B >>> 27)) + (C ^ D ^ E) + w[79] + 0xCA62C1D6; C = ((C << 30) | (C >>> 2)); H0 += A; H1 += B; H2 += C; H3 += D; H4 += E; // debug(80, H0, H1, H2, H3, H4); } private static final String toHexString(byte[] b) { final String hexChar = "0123456789ABCDEF"; StringBuffer sb = new StringBuffer(); for (int i = 0; i < b.length; i++) { sb.append(hexChar.charAt((b[i] >> 4) & 0x0f)); sb.append(hexChar.charAt(b[i] & 0x0f)); } return sb.toString(); } public static void main(String[] args) { SHA1 sha = new SHA1(); byte[] dig1 = new byte[20]; byte[] dig2 = new byte[20]; byte[] dig3 = new byte[20]; /* * We do not specify a charset name for getBytes(), since we assume that * the JVM's default encoder maps the _used_ ASCII characters exactly as * getBytes("US-ASCII") would do. (Ah, yes, too lazy to catch the * exception that can be thrown by getBytes("US-ASCII")). Note: This has * no effect on the SHA-1 implementation, this is just for the following * test code. */ sha.update("abc".getBytes()); sha.digest(dig1); sha.update("abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq".getBytes()); sha.digest(dig2); for (int i = 0; i < 1000000; i++) sha.update((byte) 'a'); sha.digest(dig3); String dig1_res = toHexString(dig1); String dig2_res = toHexString(dig2); String dig3_res = toHexString(dig3); String dig1_ref = "A9993E364706816ABA3E25717850C26C9CD0D89D"; String dig2_ref = "84983E441C3BD26EBAAE4AA1F95129E5E54670F1"; String dig3_ref = "34AA973CD4C4DAA4F61EEB2BDBAD27316534016F"; if (dig1_res.equals(dig1_ref)) System.out.println("SHA-1 Test 1 OK."); else System.out.println("SHA-1 Test 1 FAILED."); if (dig2_res.equals(dig2_ref)) System.out.println("SHA-1 Test 2 OK."); else System.out.println("SHA-1 Test 2 FAILED."); if (dig3_res.equals(dig3_ref)) System.out.println("SHA-1 Test 3 OK."); else System.out.println("SHA-1 Test 3 FAILED."); if (dig3_res.equals(dig3_ref)) System.out.println("SHA-1 Test 3 OK."); else System.out.println("SHA-1 Test 3 FAILED."); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/digest/SHA1.java
Java
asf20
18,717
package com.trilead.ssh2.crypto; import java.math.BigInteger; import com.trilead.ssh2.crypto.digest.HashForSSH2Types; /** * Establishes key material for iv/key/mac (both directions). * * @author Christian Plattner, plattner@trilead.com * @version $Id: KeyMaterial.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class KeyMaterial { public byte[] initial_iv_client_to_server; public byte[] initial_iv_server_to_client; public byte[] enc_key_client_to_server; public byte[] enc_key_server_to_client; public byte[] integrity_key_client_to_server; public byte[] integrity_key_server_to_client; private static byte[] calculateKey(HashForSSH2Types sh, BigInteger K, byte[] H, byte type, byte[] SessionID, int keyLength) { byte[] res = new byte[keyLength]; int dglen = sh.getDigestLength(); int numRounds = (keyLength + dglen - 1) / dglen; byte[][] tmp = new byte[numRounds][]; sh.reset(); sh.updateBigInt(K); sh.updateBytes(H); sh.updateByte(type); sh.updateBytes(SessionID); tmp[0] = sh.getDigest(); int off = 0; int produced = Math.min(dglen, keyLength); System.arraycopy(tmp[0], 0, res, off, produced); keyLength -= produced; off += produced; for (int i = 1; i < numRounds; i++) { sh.updateBigInt(K); sh.updateBytes(H); for (int j = 0; j < i; j++) sh.updateBytes(tmp[j]); tmp[i] = sh.getDigest(); produced = Math.min(dglen, keyLength); System.arraycopy(tmp[i], 0, res, off, produced); keyLength -= produced; off += produced; } return res; } public static KeyMaterial create(String hashType, byte[] H, BigInteger K, byte[] SessionID, int keyLengthCS, int blockSizeCS, int macLengthCS, int keyLengthSC, int blockSizeSC, int macLengthSC) throws IllegalArgumentException { KeyMaterial km = new KeyMaterial(); HashForSSH2Types sh = new HashForSSH2Types(hashType); km.initial_iv_client_to_server = calculateKey(sh, K, H, (byte) 'A', SessionID, blockSizeCS); km.initial_iv_server_to_client = calculateKey(sh, K, H, (byte) 'B', SessionID, blockSizeSC); km.enc_key_client_to_server = calculateKey(sh, K, H, (byte) 'C', SessionID, keyLengthCS); km.enc_key_server_to_client = calculateKey(sh, K, H, (byte) 'D', SessionID, keyLengthSC); km.integrity_key_client_to_server = calculateKey(sh, K, H, (byte) 'E', SessionID, macLengthCS); km.integrity_key_server_to_client = calculateKey(sh, K, H, (byte) 'F', SessionID, macLengthSC); return km; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/KeyMaterial.java
Java
asf20
2,566
package com.trilead.ssh2.crypto; import com.trilead.ssh2.compression.CompressionFactory; import com.trilead.ssh2.crypto.cipher.BlockCipherFactory; import com.trilead.ssh2.crypto.digest.MAC; import com.trilead.ssh2.transport.KexManager; /** * CryptoWishList. * * @author Christian Plattner, plattner@trilead.com * @version $Id: CryptoWishList.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class CryptoWishList { public String[] kexAlgorithms = KexManager.getDefaultKexAlgorithmList(); public String[] serverHostKeyAlgorithms = KexManager.getDefaultServerHostkeyAlgorithmList(); public String[] c2s_enc_algos = BlockCipherFactory.getDefaultCipherList(); public String[] s2c_enc_algos = BlockCipherFactory.getDefaultCipherList(); public String[] c2s_mac_algos = MAC.getMacList(); public String[] s2c_mac_algos = MAC.getMacList(); public String[] c2s_comp_algos = CompressionFactory.getDefaultCompressorList(); public String[] s2c_comp_algos = CompressionFactory.getDefaultCompressorList(); }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/CryptoWishList.java
Java
asf20
1,043
package com.trilead.ssh2.crypto; import java.io.IOException; import java.math.BigInteger; /** * SimpleDERReader. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SimpleDERReader.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class SimpleDERReader { byte[] buffer; int pos; int count; public SimpleDERReader(byte[] b) { resetInput(b); } public SimpleDERReader(byte[] b, int off, int len) { resetInput(b, off, len); } public void resetInput(byte[] b) { resetInput(b, 0, b.length); } public void resetInput(byte[] b, int off, int len) { buffer = b; pos = off; count = len; } private byte readByte() throws IOException { if (count <= 0) throw new IOException("DER byte array: out of data"); count--; return buffer[pos++]; } private byte[] readBytes(int len) throws IOException { if (len > count) throw new IOException("DER byte array: out of data"); byte[] b = new byte[len]; System.arraycopy(buffer, pos, b, 0, len); pos += len; count -= len; return b; } public int available() { return count; } private int readLength() throws IOException { int len = readByte() & 0xff; if ((len & 0x80) == 0) return len; int remain = len & 0x7F; if (remain == 0) return -1; len = 0; while (remain > 0) { len = len << 8; len = len | (readByte() & 0xff); remain--; } return len; } public int ignoreNextObject() throws IOException { int type = readByte() & 0xff; int len = readLength(); if ((len < 0) || len > available()) throw new IOException("Illegal len in DER object (" + len + ")"); readBytes(len); return type; } public BigInteger readInt() throws IOException { int type = readByte() & 0xff; if (type != 0x02) throw new IOException("Expected DER Integer, but found type " + type); int len = readLength(); if ((len < 0) || len > available()) throw new IOException("Illegal len in DER object (" + len + ")"); byte[] b = readBytes(len); BigInteger bi = new BigInteger(b); return bi; } public byte[] readSequenceAsByteArray() throws IOException { int type = readByte() & 0xff; if (type != 0x30) throw new IOException("Expected DER Sequence, but found type " + type); int len = readLength(); if ((len < 0) || len > available()) throw new IOException("Illegal len in DER object (" + len + ")"); byte[] b = readBytes(len); return b; } public byte[] readOctetString() throws IOException { int type = readByte() & 0xff; if (type != 0x04) throw new IOException("Expected DER Octetstring, but found type " + type); int len = readLength(); if ((len < 0) || len > available()) throw new IOException("Illegal len in DER object (" + len + ")"); byte[] b = readBytes(len); return b; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/SimpleDERReader.java
Java
asf20
3,005
package com.trilead.ssh2.crypto; import java.io.CharArrayWriter; import java.io.IOException; /** * Basic Base64 Support. * * @author Christian Plattner, plattner@trilead.com * @version $Id: Base64.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class Base64 { static final char[] alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".toCharArray(); public static char[] encode(byte[] content) { CharArrayWriter cw = new CharArrayWriter((4 * content.length) / 3); int idx = 0; int x = 0; for (int i = 0; i < content.length; i++) { if (idx == 0) x = (content[i] & 0xff) << 16; else if (idx == 1) x = x | ((content[i] & 0xff) << 8); else x = x | (content[i] & 0xff); idx++; if (idx == 3) { cw.write(alphabet[x >> 18]); cw.write(alphabet[(x >> 12) & 0x3f]); cw.write(alphabet[(x >> 6) & 0x3f]); cw.write(alphabet[x & 0x3f]); idx = 0; } } if (idx == 1) { cw.write(alphabet[x >> 18]); cw.write(alphabet[(x >> 12) & 0x3f]); cw.write('='); cw.write('='); } if (idx == 2) { cw.write(alphabet[x >> 18]); cw.write(alphabet[(x >> 12) & 0x3f]); cw.write(alphabet[(x >> 6) & 0x3f]); cw.write('='); } return cw.toCharArray(); } public static byte[] decode(char[] message) throws IOException { byte buff[] = new byte[4]; byte dest[] = new byte[message.length]; int bpos = 0; int destpos = 0; for (int i = 0; i < message.length; i++) { int c = message[i]; if ((c == '\n') || (c == '\r') || (c == ' ') || (c == '\t')) continue; if ((c >= 'A') && (c <= 'Z')) { buff[bpos++] = (byte) (c - 'A'); } else if ((c >= 'a') && (c <= 'z')) { buff[bpos++] = (byte) ((c - 'a') + 26); } else if ((c >= '0') && (c <= '9')) { buff[bpos++] = (byte) ((c - '0') + 52); } else if (c == '+') { buff[bpos++] = 62; } else if (c == '/') { buff[bpos++] = 63; } else if (c == '=') { buff[bpos++] = 64; } else { throw new IOException("Illegal char in base64 code."); } if (bpos == 4) { bpos = 0; if (buff[0] == 64) break; if (buff[1] == 64) throw new IOException("Unexpected '=' in base64 code."); if (buff[2] == 64) { int v = (((buff[0] & 0x3f) << 6) | ((buff[1] & 0x3f))); dest[destpos++] = (byte) (v >> 4); break; } else if (buff[3] == 64) { int v = (((buff[0] & 0x3f) << 12) | ((buff[1] & 0x3f) << 6) | ((buff[2] & 0x3f))); dest[destpos++] = (byte) (v >> 10); dest[destpos++] = (byte) (v >> 2); break; } else { int v = (((buff[0] & 0x3f) << 18) | ((buff[1] & 0x3f) << 12) | ((buff[2] & 0x3f) << 6) | ((buff[3] & 0x3f))); dest[destpos++] = (byte) (v >> 16); dest[destpos++] = (byte) (v >> 8); dest[destpos++] = (byte) (v); } } } byte[] res = new byte[destpos]; System.arraycopy(dest, 0, res, 0, destpos); return res; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/Base64.java
Java
asf20
3,149
package com.trilead.ssh2.crypto.cipher; /** * BlockCipher. * * @author Christian Plattner, plattner@trilead.com * @version $Id: BlockCipher.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public interface BlockCipher { public void init(boolean forEncryption, byte[] key); public int getBlockSize(); public void transformBlock(byte[] src, int srcoff, byte[] dst, int dstoff); }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/BlockCipher.java
Java
asf20
406
package com.trilead.ssh2.crypto.cipher; /* This file was shamelessly taken (and modified) from the Bouncy Castle Crypto package. Their licence file states the following: Copyright (c) 2000 - 2004 The Legion Of The Bouncy Castle (http://www.bouncycastle.org) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /** * DESede. * * @author See comments in the source file * @version $Id: DESede.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ * */ public class DESede extends DES { private int[] key1 = null; private int[] key2 = null; private int[] key3 = null; private boolean encrypt; /** * standard constructor. */ public DESede() { } /** * initialise a DES cipher. * * @param encrypting * whether or not we are for encryption. * @param key * the parameters required to set up the cipher. * @exception IllegalArgumentException * if the params argument is inappropriate. */ public void init(boolean encrypting, byte[] key) { key1 = generateWorkingKey(encrypting, key, 0); key2 = generateWorkingKey(!encrypting, key, 8); key3 = generateWorkingKey(encrypting, key, 16); encrypt = encrypting; } public String getAlgorithmName() { return "DESede"; } public int getBlockSize() { return 8; } public void transformBlock(byte[] in, int inOff, byte[] out, int outOff) { if (key1 == null) { throw new IllegalStateException("DESede engine not initialised!"); } if (encrypt) { desFunc(key1, in, inOff, out, outOff); desFunc(key2, out, outOff, out, outOff); desFunc(key3, out, outOff, out, outOff); } else { desFunc(key3, in, inOff, out, outOff); desFunc(key2, out, outOff, out, outOff); desFunc(key1, out, outOff, out, outOff); } } public void reset() { } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/DESede.java
Java
asf20
2,900
package com.trilead.ssh2.crypto.cipher; import java.util.Vector; /** * BlockCipherFactory. * * @author Christian Plattner, plattner@trilead.com * @version $Id: BlockCipherFactory.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class BlockCipherFactory { static class CipherEntry { String type; int blocksize; int keysize; String cipherClass; public CipherEntry(String type, int blockSize, int keySize, String cipherClass) { this.type = type; this.blocksize = blockSize; this.keysize = keySize; this.cipherClass = cipherClass; } } static Vector<CipherEntry> ciphers = new Vector<CipherEntry>(); static { /* Higher Priority First */ ciphers.addElement(new CipherEntry("aes256-ctr", 16, 32, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("aes192-ctr", 16, 24, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("aes128-ctr", 16, 16, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("blowfish-ctr", 8, 16, "com.trilead.ssh2.crypto.cipher.BlowFish")); ciphers.addElement(new CipherEntry("aes256-cbc", 16, 32, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("aes192-cbc", 16, 24, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("aes128-cbc", 16, 16, "com.trilead.ssh2.crypto.cipher.AES")); ciphers.addElement(new CipherEntry("blowfish-cbc", 8, 16, "com.trilead.ssh2.crypto.cipher.BlowFish")); ciphers.addElement(new CipherEntry("3des-ctr", 8, 24, "com.trilead.ssh2.crypto.cipher.DESede")); ciphers.addElement(new CipherEntry("3des-cbc", 8, 24, "com.trilead.ssh2.crypto.cipher.DESede")); } public static String[] getDefaultCipherList() { String list[] = new String[ciphers.size()]; for (int i = 0; i < ciphers.size(); i++) { CipherEntry ce = ciphers.elementAt(i); list[i] = new String(ce.type); } return list; } public static void checkCipherList(String[] cipherCandidates) { for (int i = 0; i < cipherCandidates.length; i++) getEntry(cipherCandidates[i]); } public static BlockCipher createCipher(String type, boolean encrypt, byte[] key, byte[] iv) { try { CipherEntry ce = getEntry(type); Class cc = Class.forName(ce.cipherClass); BlockCipher bc = (BlockCipher) cc.newInstance(); if (type.endsWith("-cbc")) { bc.init(encrypt, key); return new CBCMode(bc, iv, encrypt); } else if (type.endsWith("-ctr")) { bc.init(true, key); return new CTRMode(bc, iv, encrypt); } throw new IllegalArgumentException("Cannot instantiate " + type); } catch (Exception e) { throw new IllegalArgumentException("Cannot instantiate " + type); } } private static CipherEntry getEntry(String type) { for (int i = 0; i < ciphers.size(); i++) { CipherEntry ce = ciphers.elementAt(i); if (ce.type.equals(type)) return ce; } throw new IllegalArgumentException("Unkown algorithm " + type); } public static int getBlockSize(String type) { CipherEntry ce = getEntry(type); return ce.blocksize; } public static int getKeySize(String type) { CipherEntry ce = getEntry(type); return ce.keysize; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/BlockCipherFactory.java
Java
asf20
3,320
package com.trilead.ssh2.crypto.cipher; /** * CBCMode. * * @author Christian Plattner, plattner@trilead.com * @version $Id: CBCMode.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class CBCMode implements BlockCipher { BlockCipher tc; int blockSize; boolean doEncrypt; byte[] cbc_vector; byte[] tmp_vector; public void init(boolean forEncryption, byte[] key) { } public CBCMode(BlockCipher tc, byte[] iv, boolean doEncrypt) throws IllegalArgumentException { this.tc = tc; this.blockSize = tc.getBlockSize(); this.doEncrypt = doEncrypt; if (this.blockSize != iv.length) throw new IllegalArgumentException("IV must be " + blockSize + " bytes long! (currently " + iv.length + ")"); this.cbc_vector = new byte[blockSize]; this.tmp_vector = new byte[blockSize]; System.arraycopy(iv, 0, cbc_vector, 0, blockSize); } public int getBlockSize() { return blockSize; } private void encryptBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { for (int i = 0; i < blockSize; i++) cbc_vector[i] ^= src[srcoff + i]; tc.transformBlock(cbc_vector, 0, dst, dstoff); System.arraycopy(dst, dstoff, cbc_vector, 0, blockSize); } private void decryptBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { /* Assume the worst, src and dst are overlapping... */ System.arraycopy(src, srcoff, tmp_vector, 0, blockSize); tc.transformBlock(src, srcoff, dst, dstoff); for (int i = 0; i < blockSize; i++) dst[dstoff + i] ^= cbc_vector[i]; /* ...that is why we need a tmp buffer. */ byte[] swap = cbc_vector; cbc_vector = tmp_vector; tmp_vector = swap; } public void transformBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { if (doEncrypt) encryptBlock(src, srcoff, dst, dstoff); else decryptBlock(src, srcoff, dst, dstoff); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/CBCMode.java
Java
asf20
1,915
package com.trilead.ssh2.crypto.cipher; /** * NullCipher. * * @author Christian Plattner, plattner@trilead.com * @version $Id: NullCipher.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class NullCipher implements BlockCipher { private int blockSize = 8; public NullCipher() { } public NullCipher(int blockSize) { this.blockSize = blockSize; } public void init(boolean forEncryption, byte[] key) { } public int getBlockSize() { return blockSize; } public void transformBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { System.arraycopy(src, srcoff, dst, dstoff, blockSize); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/NullCipher.java
Java
asf20
663
package com.trilead.ssh2.crypto.cipher; /** * This is CTR mode as described in draft-ietf-secsh-newmodes-XY.txt * * @author Christian Plattner, plattner@trilead.com * @version $Id: CTRMode.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class CTRMode implements BlockCipher { byte[] X; byte[] Xenc; BlockCipher bc; int blockSize; boolean doEncrypt; int count = 0; public void init(boolean forEncryption, byte[] key) { } public CTRMode(BlockCipher tc, byte[] iv, boolean doEnc) throws IllegalArgumentException { bc = tc; blockSize = bc.getBlockSize(); doEncrypt = doEnc; if (blockSize != iv.length) throw new IllegalArgumentException("IV must be " + blockSize + " bytes long! (currently " + iv.length + ")"); X = new byte[blockSize]; Xenc = new byte[blockSize]; System.arraycopy(iv, 0, X, 0, blockSize); } public final int getBlockSize() { return blockSize; } public final void transformBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { bc.transformBlock(X, 0, Xenc, 0); for (int i = 0; i < blockSize; i++) { dst[dstoff + i] = (byte) (src[srcoff + i] ^ Xenc[i]); } for (int i = (blockSize - 1); i >= 0; i--) { X[i]++; if (X[i] != 0) break; } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/CTRMode.java
Java
asf20
1,305
package com.trilead.ssh2.crypto.cipher; import java.io.IOException; import java.io.InputStream; /** * CipherInputStream. * * @author Christian Plattner, plattner@trilead.com * @version $Id: CipherInputStream.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class CipherInputStream { BlockCipher currentCipher; InputStream bi; byte[] buffer; byte[] enc; int blockSize; int pos; /* * We cannot use java.io.BufferedInputStream, since that is not available in * J2ME. Everything could be improved alot here. */ final int BUFF_SIZE = 2048; byte[] input_buffer = new byte[BUFF_SIZE]; int input_buffer_pos = 0; int input_buffer_size = 0; public CipherInputStream(BlockCipher tc, InputStream bi) { this.bi = bi; changeCipher(tc); } private int fill_buffer() throws IOException { input_buffer_pos = 0; input_buffer_size = bi.read(input_buffer, 0, BUFF_SIZE); return input_buffer_size; } private int internal_read(byte[] b, int off, int len) throws IOException { if (input_buffer_size < 0) return -1; if (input_buffer_pos >= input_buffer_size) { if (fill_buffer() <= 0) return -1; } int avail = input_buffer_size - input_buffer_pos; int thiscopy = (len > avail) ? avail : len; System.arraycopy(input_buffer, input_buffer_pos, b, off, thiscopy); input_buffer_pos += thiscopy; return thiscopy; } public void changeCipher(BlockCipher bc) { this.currentCipher = bc; blockSize = bc.getBlockSize(); buffer = new byte[blockSize]; enc = new byte[blockSize]; pos = blockSize; } private void getBlock() throws IOException { int n = 0; while (n < blockSize) { int len = internal_read(enc, n, blockSize - n); if (len < 0) throw new IOException("Cannot read full block, EOF reached."); n += len; } try { currentCipher.transformBlock(enc, 0, buffer, 0); } catch (Exception e) { throw new IOException("Error while decrypting block."); } pos = 0; } public int read(byte[] dst) throws IOException { return read(dst, 0, dst.length); } public int read(byte[] dst, int off, int len) throws IOException { int count = 0; while (len > 0) { if (pos >= blockSize) getBlock(); int avail = blockSize - pos; int copy = Math.min(avail, len); System.arraycopy(buffer, pos, dst, off, copy); pos += copy; off += copy; len -= copy; count += copy; } return count; } public int read() throws IOException { if (pos >= blockSize) { getBlock(); } return buffer[pos++] & 0xff; } public int readPlain(byte[] b, int off, int len) throws IOException { if (pos != blockSize) throw new IOException("Cannot read plain since crypto buffer is not aligned."); int n = 0; while (n < len) { int cnt = internal_read(b, off + n, len - n); if (cnt < 0) throw new IOException("Cannot fill buffer, EOF reached."); n += cnt; } return n; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/CipherInputStream.java
Java
asf20
3,067
package com.trilead.ssh2.crypto.cipher; /* This file is based on the 3DES implementation from the Bouncy Castle Crypto package. Their licence file states the following: Copyright (c) 2000 - 2004 The Legion Of The Bouncy Castle (http://www.bouncycastle.org) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /** * DES. * * @author See comments in the source file * @version $Id: DES.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ * */ public class DES implements BlockCipher { private int[] workingKey = null; /** * standard constructor. */ public DES() { } /** * initialise a DES cipher. * * @param encrypting * whether or not we are for encryption. * @param key * the parameters required to set up the cipher. * @exception IllegalArgumentException * if the params argument is inappropriate. */ public void init(boolean encrypting, byte[] key) { this.workingKey = generateWorkingKey(encrypting, key, 0); } public String getAlgorithmName() { return "DES"; } public int getBlockSize() { return 8; } public void transformBlock(byte[] in, int inOff, byte[] out, int outOff) { if (workingKey == null) { throw new IllegalStateException("DES engine not initialised!"); } desFunc(workingKey, in, inOff, out, outOff); } public void reset() { } /** * what follows is mainly taken from "Applied Cryptography", by Bruce * Schneier, however it also bears great resemblance to Richard * Outerbridge's D3DES... */ static short[] Df_Key = { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10, 0x89, 0xab, 0xcd, 0xef, 0x01, 0x23, 0x45, 0x67 }; static short[] bytebit = { 0200, 0100, 040, 020, 010, 04, 02, 01 }; static int[] bigbyte = { 0x800000, 0x400000, 0x200000, 0x100000, 0x80000, 0x40000, 0x20000, 0x10000, 0x8000, 0x4000, 0x2000, 0x1000, 0x800, 0x400, 0x200, 0x100, 0x80, 0x40, 0x20, 0x10, 0x8, 0x4, 0x2, 0x1 }; /* * Use the key schedule specified in the Standard (ANSI X3.92-1981). */ static byte[] pc1 = { 56, 48, 40, 32, 24, 16, 8, 0, 57, 49, 41, 33, 25, 17, 9, 1, 58, 50, 42, 34, 26, 18, 10, 2, 59, 51, 43, 35, 62, 54, 46, 38, 30, 22, 14, 6, 61, 53, 45, 37, 29, 21, 13, 5, 60, 52, 44, 36, 28, 20, 12, 4, 27, 19, 11, 3 }; static byte[] totrot = { 1, 2, 4, 6, 8, 10, 12, 14, 15, 17, 19, 21, 23, 25, 27, 28 }; static byte[] pc2 = { 13, 16, 10, 23, 0, 4, 2, 27, 14, 5, 20, 9, 22, 18, 11, 3, 25, 7, 15, 6, 26, 19, 12, 1, 40, 51, 30, 36, 46, 54, 29, 39, 50, 44, 32, 47, 43, 48, 38, 55, 33, 52, 45, 41, 49, 35, 28, 31 }; static int[] SP1 = { 0x01010400, 0x00000000, 0x00010000, 0x01010404, 0x01010004, 0x00010404, 0x00000004, 0x00010000, 0x00000400, 0x01010400, 0x01010404, 0x00000400, 0x01000404, 0x01010004, 0x01000000, 0x00000004, 0x00000404, 0x01000400, 0x01000400, 0x00010400, 0x00010400, 0x01010000, 0x01010000, 0x01000404, 0x00010004, 0x01000004, 0x01000004, 0x00010004, 0x00000000, 0x00000404, 0x00010404, 0x01000000, 0x00010000, 0x01010404, 0x00000004, 0x01010000, 0x01010400, 0x01000000, 0x01000000, 0x00000400, 0x01010004, 0x00010000, 0x00010400, 0x01000004, 0x00000400, 0x00000004, 0x01000404, 0x00010404, 0x01010404, 0x00010004, 0x01010000, 0x01000404, 0x01000004, 0x00000404, 0x00010404, 0x01010400, 0x00000404, 0x01000400, 0x01000400, 0x00000000, 0x00010004, 0x00010400, 0x00000000, 0x01010004 }; static int[] SP2 = { 0x80108020, 0x80008000, 0x00008000, 0x00108020, 0x00100000, 0x00000020, 0x80100020, 0x80008020, 0x80000020, 0x80108020, 0x80108000, 0x80000000, 0x80008000, 0x00100000, 0x00000020, 0x80100020, 0x00108000, 0x00100020, 0x80008020, 0x00000000, 0x80000000, 0x00008000, 0x00108020, 0x80100000, 0x00100020, 0x80000020, 0x00000000, 0x00108000, 0x00008020, 0x80108000, 0x80100000, 0x00008020, 0x00000000, 0x00108020, 0x80100020, 0x00100000, 0x80008020, 0x80100000, 0x80108000, 0x00008000, 0x80100000, 0x80008000, 0x00000020, 0x80108020, 0x00108020, 0x00000020, 0x00008000, 0x80000000, 0x00008020, 0x80108000, 0x00100000, 0x80000020, 0x00100020, 0x80008020, 0x80000020, 0x00100020, 0x00108000, 0x00000000, 0x80008000, 0x00008020, 0x80000000, 0x80100020, 0x80108020, 0x00108000 }; static int[] SP3 = { 0x00000208, 0x08020200, 0x00000000, 0x08020008, 0x08000200, 0x00000000, 0x00020208, 0x08000200, 0x00020008, 0x08000008, 0x08000008, 0x00020000, 0x08020208, 0x00020008, 0x08020000, 0x00000208, 0x08000000, 0x00000008, 0x08020200, 0x00000200, 0x00020200, 0x08020000, 0x08020008, 0x00020208, 0x08000208, 0x00020200, 0x00020000, 0x08000208, 0x00000008, 0x08020208, 0x00000200, 0x08000000, 0x08020200, 0x08000000, 0x00020008, 0x00000208, 0x00020000, 0x08020200, 0x08000200, 0x00000000, 0x00000200, 0x00020008, 0x08020208, 0x08000200, 0x08000008, 0x00000200, 0x00000000, 0x08020008, 0x08000208, 0x00020000, 0x08000000, 0x08020208, 0x00000008, 0x00020208, 0x00020200, 0x08000008, 0x08020000, 0x08000208, 0x00000208, 0x08020000, 0x00020208, 0x00000008, 0x08020008, 0x00020200 }; static int[] SP4 = { 0x00802001, 0x00002081, 0x00002081, 0x00000080, 0x00802080, 0x00800081, 0x00800001, 0x00002001, 0x00000000, 0x00802000, 0x00802000, 0x00802081, 0x00000081, 0x00000000, 0x00800080, 0x00800001, 0x00000001, 0x00002000, 0x00800000, 0x00802001, 0x00000080, 0x00800000, 0x00002001, 0x00002080, 0x00800081, 0x00000001, 0x00002080, 0x00800080, 0x00002000, 0x00802080, 0x00802081, 0x00000081, 0x00800080, 0x00800001, 0x00802000, 0x00802081, 0x00000081, 0x00000000, 0x00000000, 0x00802000, 0x00002080, 0x00800080, 0x00800081, 0x00000001, 0x00802001, 0x00002081, 0x00002081, 0x00000080, 0x00802081, 0x00000081, 0x00000001, 0x00002000, 0x00800001, 0x00002001, 0x00802080, 0x00800081, 0x00002001, 0x00002080, 0x00800000, 0x00802001, 0x00000080, 0x00800000, 0x00002000, 0x00802080 }; static int[] SP5 = { 0x00000100, 0x02080100, 0x02080000, 0x42000100, 0x00080000, 0x00000100, 0x40000000, 0x02080000, 0x40080100, 0x00080000, 0x02000100, 0x40080100, 0x42000100, 0x42080000, 0x00080100, 0x40000000, 0x02000000, 0x40080000, 0x40080000, 0x00000000, 0x40000100, 0x42080100, 0x42080100, 0x02000100, 0x42080000, 0x40000100, 0x00000000, 0x42000000, 0x02080100, 0x02000000, 0x42000000, 0x00080100, 0x00080000, 0x42000100, 0x00000100, 0x02000000, 0x40000000, 0x02080000, 0x42000100, 0x40080100, 0x02000100, 0x40000000, 0x42080000, 0x02080100, 0x40080100, 0x00000100, 0x02000000, 0x42080000, 0x42080100, 0x00080100, 0x42000000, 0x42080100, 0x02080000, 0x00000000, 0x40080000, 0x42000000, 0x00080100, 0x02000100, 0x40000100, 0x00080000, 0x00000000, 0x40080000, 0x02080100, 0x40000100 }; static int[] SP6 = { 0x20000010, 0x20400000, 0x00004000, 0x20404010, 0x20400000, 0x00000010, 0x20404010, 0x00400000, 0x20004000, 0x00404010, 0x00400000, 0x20000010, 0x00400010, 0x20004000, 0x20000000, 0x00004010, 0x00000000, 0x00400010, 0x20004010, 0x00004000, 0x00404000, 0x20004010, 0x00000010, 0x20400010, 0x20400010, 0x00000000, 0x00404010, 0x20404000, 0x00004010, 0x00404000, 0x20404000, 0x20000000, 0x20004000, 0x00000010, 0x20400010, 0x00404000, 0x20404010, 0x00400000, 0x00004010, 0x20000010, 0x00400000, 0x20004000, 0x20000000, 0x00004010, 0x20000010, 0x20404010, 0x00404000, 0x20400000, 0x00404010, 0x20404000, 0x00000000, 0x20400010, 0x00000010, 0x00004000, 0x20400000, 0x00404010, 0x00004000, 0x00400010, 0x20004010, 0x00000000, 0x20404000, 0x20000000, 0x00400010, 0x20004010 }; static int[] SP7 = { 0x00200000, 0x04200002, 0x04000802, 0x00000000, 0x00000800, 0x04000802, 0x00200802, 0x04200800, 0x04200802, 0x00200000, 0x00000000, 0x04000002, 0x00000002, 0x04000000, 0x04200002, 0x00000802, 0x04000800, 0x00200802, 0x00200002, 0x04000800, 0x04000002, 0x04200000, 0x04200800, 0x00200002, 0x04200000, 0x00000800, 0x00000802, 0x04200802, 0x00200800, 0x00000002, 0x04000000, 0x00200800, 0x04000000, 0x00200800, 0x00200000, 0x04000802, 0x04000802, 0x04200002, 0x04200002, 0x00000002, 0x00200002, 0x04000000, 0x04000800, 0x00200000, 0x04200800, 0x00000802, 0x00200802, 0x04200800, 0x00000802, 0x04000002, 0x04200802, 0x04200000, 0x00200800, 0x00000000, 0x00000002, 0x04200802, 0x00000000, 0x00200802, 0x04200000, 0x00000800, 0x04000002, 0x04000800, 0x00000800, 0x00200002 }; static int[] SP8 = { 0x10001040, 0x00001000, 0x00040000, 0x10041040, 0x10000000, 0x10001040, 0x00000040, 0x10000000, 0x00040040, 0x10040000, 0x10041040, 0x00041000, 0x10041000, 0x00041040, 0x00001000, 0x00000040, 0x10040000, 0x10000040, 0x10001000, 0x00001040, 0x00041000, 0x00040040, 0x10040040, 0x10041000, 0x00001040, 0x00000000, 0x00000000, 0x10040040, 0x10000040, 0x10001000, 0x00041040, 0x00040000, 0x00041040, 0x00040000, 0x10041000, 0x00001000, 0x00000040, 0x10040040, 0x00001000, 0x00041040, 0x10001000, 0x00000040, 0x10000040, 0x10040000, 0x10040040, 0x10000000, 0x00040000, 0x10001040, 0x00000000, 0x10041040, 0x00040040, 0x10000040, 0x10040000, 0x10001000, 0x10001040, 0x00000000, 0x10041040, 0x00041000, 0x00041000, 0x00001040, 0x00001040, 0x00040040, 0x10000000, 0x10041000 }; /** * generate an integer based working key based on our secret key and what we * processing we are planning to do. * * Acknowledgements for this routine go to James Gillogly & Phil Karn. * (whoever, and wherever they are!). */ protected int[] generateWorkingKey(boolean encrypting, byte[] key, int off) { int[] newKey = new int[32]; boolean[] pc1m = new boolean[56], pcr = new boolean[56]; for (int j = 0; j < 56; j++) { int l = pc1[j]; pc1m[j] = ((key[off + (l >>> 3)] & bytebit[l & 07]) != 0); } for (int i = 0; i < 16; i++) { int l, m, n; if (encrypting) { m = i << 1; } else { m = (15 - i) << 1; } n = m + 1; newKey[m] = newKey[n] = 0; for (int j = 0; j < 28; j++) { l = j + totrot[i]; if (l < 28) { pcr[j] = pc1m[l]; } else { pcr[j] = pc1m[l - 28]; } } for (int j = 28; j < 56; j++) { l = j + totrot[i]; if (l < 56) { pcr[j] = pc1m[l]; } else { pcr[j] = pc1m[l - 28]; } } for (int j = 0; j < 24; j++) { if (pcr[pc2[j]]) { newKey[m] |= bigbyte[j]; } if (pcr[pc2[j + 24]]) { newKey[n] |= bigbyte[j]; } } } // // store the processed key // for (int i = 0; i != 32; i += 2) { int i1, i2; i1 = newKey[i]; i2 = newKey[i + 1]; newKey[i] = ((i1 & 0x00fc0000) << 6) | ((i1 & 0x00000fc0) << 10) | ((i2 & 0x00fc0000) >>> 10) | ((i2 & 0x00000fc0) >>> 6); newKey[i + 1] = ((i1 & 0x0003f000) << 12) | ((i1 & 0x0000003f) << 16) | ((i2 & 0x0003f000) >>> 4) | (i2 & 0x0000003f); } return newKey; } /** * the DES engine. */ protected void desFunc(int[] wKey, byte[] in, int inOff, byte[] out, int outOff) { int work, right, left; left = (in[inOff + 0] & 0xff) << 24; left |= (in[inOff + 1] & 0xff) << 16; left |= (in[inOff + 2] & 0xff) << 8; left |= (in[inOff + 3] & 0xff); right = (in[inOff + 4] & 0xff) << 24; right |= (in[inOff + 5] & 0xff) << 16; right |= (in[inOff + 6] & 0xff) << 8; right |= (in[inOff + 7] & 0xff); work = ((left >>> 4) ^ right) & 0x0f0f0f0f; right ^= work; left ^= (work << 4); work = ((left >>> 16) ^ right) & 0x0000ffff; right ^= work; left ^= (work << 16); work = ((right >>> 2) ^ left) & 0x33333333; left ^= work; right ^= (work << 2); work = ((right >>> 8) ^ left) & 0x00ff00ff; left ^= work; right ^= (work << 8); right = ((right << 1) | ((right >>> 31) & 1)) & 0xffffffff; work = (left ^ right) & 0xaaaaaaaa; left ^= work; right ^= work; left = ((left << 1) | ((left >>> 31) & 1)) & 0xffffffff; for (int round = 0; round < 8; round++) { int fval; work = (right << 28) | (right >>> 4); work ^= wKey[round * 4 + 0]; fval = SP7[work & 0x3f]; fval |= SP5[(work >>> 8) & 0x3f]; fval |= SP3[(work >>> 16) & 0x3f]; fval |= SP1[(work >>> 24) & 0x3f]; work = right ^ wKey[round * 4 + 1]; fval |= SP8[work & 0x3f]; fval |= SP6[(work >>> 8) & 0x3f]; fval |= SP4[(work >>> 16) & 0x3f]; fval |= SP2[(work >>> 24) & 0x3f]; left ^= fval; work = (left << 28) | (left >>> 4); work ^= wKey[round * 4 + 2]; fval = SP7[work & 0x3f]; fval |= SP5[(work >>> 8) & 0x3f]; fval |= SP3[(work >>> 16) & 0x3f]; fval |= SP1[(work >>> 24) & 0x3f]; work = left ^ wKey[round * 4 + 3]; fval |= SP8[work & 0x3f]; fval |= SP6[(work >>> 8) & 0x3f]; fval |= SP4[(work >>> 16) & 0x3f]; fval |= SP2[(work >>> 24) & 0x3f]; right ^= fval; } right = (right << 31) | (right >>> 1); work = (left ^ right) & 0xaaaaaaaa; left ^= work; right ^= work; left = (left << 31) | (left >>> 1); work = ((left >>> 8) ^ right) & 0x00ff00ff; right ^= work; left ^= (work << 8); work = ((left >>> 2) ^ right) & 0x33333333; right ^= work; left ^= (work << 2); work = ((right >>> 16) ^ left) & 0x0000ffff; left ^= work; right ^= (work << 16); work = ((right >>> 4) ^ left) & 0x0f0f0f0f; left ^= work; right ^= (work << 4); out[outOff + 0] = (byte) ((right >>> 24) & 0xff); out[outOff + 1] = (byte) ((right >>> 16) & 0xff); out[outOff + 2] = (byte) ((right >>> 8) & 0xff); out[outOff + 3] = (byte) (right & 0xff); out[outOff + 4] = (byte) ((left >>> 24) & 0xff); out[outOff + 5] = (byte) ((left >>> 16) & 0xff); out[outOff + 6] = (byte) ((left >>> 8) & 0xff); out[outOff + 7] = (byte) (left & 0xff); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/DES.java
Java
asf20
14,918
package com.trilead.ssh2.crypto.cipher; /* This file was shamelessly taken from the Bouncy Castle Crypto package. Their licence file states the following: Copyright (c) 2000 - 2004 The Legion Of The Bouncy Castle (http://www.bouncycastle.org) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /** * A class that provides Blowfish key encryption operations, such as encoding * data and generating keys. All the algorithms herein are from Applied * Cryptography and implement a simplified cryptography interface. * * @author See comments in the source file * @version $Id: BlowFish.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class BlowFish implements BlockCipher { private final static int[] KP = { 0x243F6A88, 0x85A308D3, 0x13198A2E, 0x03707344, 0xA4093822, 0x299F31D0, 0x082EFA98, 0xEC4E6C89, 0x452821E6, 0x38D01377, 0xBE5466CF, 0x34E90C6C, 0xC0AC29B7, 0xC97C50DD, 0x3F84D5B5, 0xB5470917, 0x9216D5D9, 0x8979FB1B }, KS0 = { 0xD1310BA6, 0x98DFB5AC, 0x2FFD72DB, 0xD01ADFB7, 0xB8E1AFED, 0x6A267E96, 0xBA7C9045, 0xF12C7F99, 0x24A19947, 0xB3916CF7, 0x0801F2E2, 0x858EFC16, 0x636920D8, 0x71574E69, 0xA458FEA3, 0xF4933D7E, 0x0D95748F, 0x728EB658, 0x718BCD58, 0x82154AEE, 0x7B54A41D, 0xC25A59B5, 0x9C30D539, 0x2AF26013, 0xC5D1B023, 0x286085F0, 0xCA417918, 0xB8DB38EF, 0x8E79DCB0, 0x603A180E, 0x6C9E0E8B, 0xB01E8A3E, 0xD71577C1, 0xBD314B27, 0x78AF2FDA, 0x55605C60, 0xE65525F3, 0xAA55AB94, 0x57489862, 0x63E81440, 0x55CA396A, 0x2AAB10B6, 0xB4CC5C34, 0x1141E8CE, 0xA15486AF, 0x7C72E993, 0xB3EE1411, 0x636FBC2A, 0x2BA9C55D, 0x741831F6, 0xCE5C3E16, 0x9B87931E, 0xAFD6BA33, 0x6C24CF5C, 0x7A325381, 0x28958677, 0x3B8F4898, 0x6B4BB9AF, 0xC4BFE81B, 0x66282193, 0x61D809CC, 0xFB21A991, 0x487CAC60, 0x5DEC8032, 0xEF845D5D, 0xE98575B1, 0xDC262302, 0xEB651B88, 0x23893E81, 0xD396ACC5, 0x0F6D6FF3, 0x83F44239, 0x2E0B4482, 0xA4842004, 0x69C8F04A, 0x9E1F9B5E, 0x21C66842, 0xF6E96C9A, 0x670C9C61, 0xABD388F0, 0x6A51A0D2, 0xD8542F68, 0x960FA728, 0xAB5133A3, 0x6EEF0B6C, 0x137A3BE4, 0xBA3BF050, 0x7EFB2A98, 0xA1F1651D, 0x39AF0176, 0x66CA593E, 0x82430E88, 0x8CEE8619, 0x456F9FB4, 0x7D84A5C3, 0x3B8B5EBE, 0xE06F75D8, 0x85C12073, 0x401A449F, 0x56C16AA6, 0x4ED3AA62, 0x363F7706, 0x1BFEDF72, 0x429B023D, 0x37D0D724, 0xD00A1248, 0xDB0FEAD3, 0x49F1C09B, 0x075372C9, 0x80991B7B, 0x25D479D8, 0xF6E8DEF7, 0xE3FE501A, 0xB6794C3B, 0x976CE0BD, 0x04C006BA, 0xC1A94FB6, 0x409F60C4, 0x5E5C9EC2, 0x196A2463, 0x68FB6FAF, 0x3E6C53B5, 0x1339B2EB, 0x3B52EC6F, 0x6DFC511F, 0x9B30952C, 0xCC814544, 0xAF5EBD09, 0xBEE3D004, 0xDE334AFD, 0x660F2807, 0x192E4BB3, 0xC0CBA857, 0x45C8740F, 0xD20B5F39, 0xB9D3FBDB, 0x5579C0BD, 0x1A60320A, 0xD6A100C6, 0x402C7279, 0x679F25FE, 0xFB1FA3CC, 0x8EA5E9F8, 0xDB3222F8, 0x3C7516DF, 0xFD616B15, 0x2F501EC8, 0xAD0552AB, 0x323DB5FA, 0xFD238760, 0x53317B48, 0x3E00DF82, 0x9E5C57BB, 0xCA6F8CA0, 0x1A87562E, 0xDF1769DB, 0xD542A8F6, 0x287EFFC3, 0xAC6732C6, 0x8C4F5573, 0x695B27B0, 0xBBCA58C8, 0xE1FFA35D, 0xB8F011A0, 0x10FA3D98, 0xFD2183B8, 0x4AFCB56C, 0x2DD1D35B, 0x9A53E479, 0xB6F84565, 0xD28E49BC, 0x4BFB9790, 0xE1DDF2DA, 0xA4CB7E33, 0x62FB1341, 0xCEE4C6E8, 0xEF20CADA, 0x36774C01, 0xD07E9EFE, 0x2BF11FB4, 0x95DBDA4D, 0xAE909198, 0xEAAD8E71, 0x6B93D5A0, 0xD08ED1D0, 0xAFC725E0, 0x8E3C5B2F, 0x8E7594B7, 0x8FF6E2FB, 0xF2122B64, 0x8888B812, 0x900DF01C, 0x4FAD5EA0, 0x688FC31C, 0xD1CFF191, 0xB3A8C1AD, 0x2F2F2218, 0xBE0E1777, 0xEA752DFE, 0x8B021FA1, 0xE5A0CC0F, 0xB56F74E8, 0x18ACF3D6, 0xCE89E299, 0xB4A84FE0, 0xFD13E0B7, 0x7CC43B81, 0xD2ADA8D9, 0x165FA266, 0x80957705, 0x93CC7314, 0x211A1477, 0xE6AD2065, 0x77B5FA86, 0xC75442F5, 0xFB9D35CF, 0xEBCDAF0C, 0x7B3E89A0, 0xD6411BD3, 0xAE1E7E49, 0x00250E2D, 0x2071B35E, 0x226800BB, 0x57B8E0AF, 0x2464369B, 0xF009B91E, 0x5563911D, 0x59DFA6AA, 0x78C14389, 0xD95A537F, 0x207D5BA2, 0x02E5B9C5, 0x83260376, 0x6295CFA9, 0x11C81968, 0x4E734A41, 0xB3472DCA, 0x7B14A94A, 0x1B510052, 0x9A532915, 0xD60F573F, 0xBC9BC6E4, 0x2B60A476, 0x81E67400, 0x08BA6FB5, 0x571BE91F, 0xF296EC6B, 0x2A0DD915, 0xB6636521, 0xE7B9F9B6, 0xFF34052E, 0xC5855664, 0x53B02D5D, 0xA99F8FA1, 0x08BA4799, 0x6E85076A }, KS1 = { 0x4B7A70E9, 0xB5B32944, 0xDB75092E, 0xC4192623, 0xAD6EA6B0, 0x49A7DF7D, 0x9CEE60B8, 0x8FEDB266, 0xECAA8C71, 0x699A17FF, 0x5664526C, 0xC2B19EE1, 0x193602A5, 0x75094C29, 0xA0591340, 0xE4183A3E, 0x3F54989A, 0x5B429D65, 0x6B8FE4D6, 0x99F73FD6, 0xA1D29C07, 0xEFE830F5, 0x4D2D38E6, 0xF0255DC1, 0x4CDD2086, 0x8470EB26, 0x6382E9C6, 0x021ECC5E, 0x09686B3F, 0x3EBAEFC9, 0x3C971814, 0x6B6A70A1, 0x687F3584, 0x52A0E286, 0xB79C5305, 0xAA500737, 0x3E07841C, 0x7FDEAE5C, 0x8E7D44EC, 0x5716F2B8, 0xB03ADA37, 0xF0500C0D, 0xF01C1F04, 0x0200B3FF, 0xAE0CF51A, 0x3CB574B2, 0x25837A58, 0xDC0921BD, 0xD19113F9, 0x7CA92FF6, 0x94324773, 0x22F54701, 0x3AE5E581, 0x37C2DADC, 0xC8B57634, 0x9AF3DDA7, 0xA9446146, 0x0FD0030E, 0xECC8C73E, 0xA4751E41, 0xE238CD99, 0x3BEA0E2F, 0x3280BBA1, 0x183EB331, 0x4E548B38, 0x4F6DB908, 0x6F420D03, 0xF60A04BF, 0x2CB81290, 0x24977C79, 0x5679B072, 0xBCAF89AF, 0xDE9A771F, 0xD9930810, 0xB38BAE12, 0xDCCF3F2E, 0x5512721F, 0x2E6B7124, 0x501ADDE6, 0x9F84CD87, 0x7A584718, 0x7408DA17, 0xBC9F9ABC, 0xE94B7D8C, 0xEC7AEC3A, 0xDB851DFA, 0x63094366, 0xC464C3D2, 0xEF1C1847, 0x3215D908, 0xDD433B37, 0x24C2BA16, 0x12A14D43, 0x2A65C451, 0x50940002, 0x133AE4DD, 0x71DFF89E, 0x10314E55, 0x81AC77D6, 0x5F11199B, 0x043556F1, 0xD7A3C76B, 0x3C11183B, 0x5924A509, 0xF28FE6ED, 0x97F1FBFA, 0x9EBABF2C, 0x1E153C6E, 0x86E34570, 0xEAE96FB1, 0x860E5E0A, 0x5A3E2AB3, 0x771FE71C, 0x4E3D06FA, 0x2965DCB9, 0x99E71D0F, 0x803E89D6, 0x5266C825, 0x2E4CC978, 0x9C10B36A, 0xC6150EBA, 0x94E2EA78, 0xA5FC3C53, 0x1E0A2DF4, 0xF2F74EA7, 0x361D2B3D, 0x1939260F, 0x19C27960, 0x5223A708, 0xF71312B6, 0xEBADFE6E, 0xEAC31F66, 0xE3BC4595, 0xA67BC883, 0xB17F37D1, 0x018CFF28, 0xC332DDEF, 0xBE6C5AA5, 0x65582185, 0x68AB9802, 0xEECEA50F, 0xDB2F953B, 0x2AEF7DAD, 0x5B6E2F84, 0x1521B628, 0x29076170, 0xECDD4775, 0x619F1510, 0x13CCA830, 0xEB61BD96, 0x0334FE1E, 0xAA0363CF, 0xB5735C90, 0x4C70A239, 0xD59E9E0B, 0xCBAADE14, 0xEECC86BC, 0x60622CA7, 0x9CAB5CAB, 0xB2F3846E, 0x648B1EAF, 0x19BDF0CA, 0xA02369B9, 0x655ABB50, 0x40685A32, 0x3C2AB4B3, 0x319EE9D5, 0xC021B8F7, 0x9B540B19, 0x875FA099, 0x95F7997E, 0x623D7DA8, 0xF837889A, 0x97E32D77, 0x11ED935F, 0x16681281, 0x0E358829, 0xC7E61FD6, 0x96DEDFA1, 0x7858BA99, 0x57F584A5, 0x1B227263, 0x9B83C3FF, 0x1AC24696, 0xCDB30AEB, 0x532E3054, 0x8FD948E4, 0x6DBC3128, 0x58EBF2EF, 0x34C6FFEA, 0xFE28ED61, 0xEE7C3C73, 0x5D4A14D9, 0xE864B7E3, 0x42105D14, 0x203E13E0, 0x45EEE2B6, 0xA3AAABEA, 0xDB6C4F15, 0xFACB4FD0, 0xC742F442, 0xEF6ABBB5, 0x654F3B1D, 0x41CD2105, 0xD81E799E, 0x86854DC7, 0xE44B476A, 0x3D816250, 0xCF62A1F2, 0x5B8D2646, 0xFC8883A0, 0xC1C7B6A3, 0x7F1524C3, 0x69CB7492, 0x47848A0B, 0x5692B285, 0x095BBF00, 0xAD19489D, 0x1462B174, 0x23820E00, 0x58428D2A, 0x0C55F5EA, 0x1DADF43E, 0x233F7061, 0x3372F092, 0x8D937E41, 0xD65FECF1, 0x6C223BDB, 0x7CDE3759, 0xCBEE7460, 0x4085F2A7, 0xCE77326E, 0xA6078084, 0x19F8509E, 0xE8EFD855, 0x61D99735, 0xA969A7AA, 0xC50C06C2, 0x5A04ABFC, 0x800BCADC, 0x9E447A2E, 0xC3453484, 0xFDD56705, 0x0E1E9EC9, 0xDB73DBD3, 0x105588CD, 0x675FDA79, 0xE3674340, 0xC5C43465, 0x713E38D8, 0x3D28F89E, 0xF16DFF20, 0x153E21E7, 0x8FB03D4A, 0xE6E39F2B, 0xDB83ADF7 }, KS2 = { 0xE93D5A68, 0x948140F7, 0xF64C261C, 0x94692934, 0x411520F7, 0x7602D4F7, 0xBCF46B2E, 0xD4A20068, 0xD4082471, 0x3320F46A, 0x43B7D4B7, 0x500061AF, 0x1E39F62E, 0x97244546, 0x14214F74, 0xBF8B8840, 0x4D95FC1D, 0x96B591AF, 0x70F4DDD3, 0x66A02F45, 0xBFBC09EC, 0x03BD9785, 0x7FAC6DD0, 0x31CB8504, 0x96EB27B3, 0x55FD3941, 0xDA2547E6, 0xABCA0A9A, 0x28507825, 0x530429F4, 0x0A2C86DA, 0xE9B66DFB, 0x68DC1462, 0xD7486900, 0x680EC0A4, 0x27A18DEE, 0x4F3FFEA2, 0xE887AD8C, 0xB58CE006, 0x7AF4D6B6, 0xAACE1E7C, 0xD3375FEC, 0xCE78A399, 0x406B2A42, 0x20FE9E35, 0xD9F385B9, 0xEE39D7AB, 0x3B124E8B, 0x1DC9FAF7, 0x4B6D1856, 0x26A36631, 0xEAE397B2, 0x3A6EFA74, 0xDD5B4332, 0x6841E7F7, 0xCA7820FB, 0xFB0AF54E, 0xD8FEB397, 0x454056AC, 0xBA489527, 0x55533A3A, 0x20838D87, 0xFE6BA9B7, 0xD096954B, 0x55A867BC, 0xA1159A58, 0xCCA92963, 0x99E1DB33, 0xA62A4A56, 0x3F3125F9, 0x5EF47E1C, 0x9029317C, 0xFDF8E802, 0x04272F70, 0x80BB155C, 0x05282CE3, 0x95C11548, 0xE4C66D22, 0x48C1133F, 0xC70F86DC, 0x07F9C9EE, 0x41041F0F, 0x404779A4, 0x5D886E17, 0x325F51EB, 0xD59BC0D1, 0xF2BCC18F, 0x41113564, 0x257B7834, 0x602A9C60, 0xDFF8E8A3, 0x1F636C1B, 0x0E12B4C2, 0x02E1329E, 0xAF664FD1, 0xCAD18115, 0x6B2395E0, 0x333E92E1, 0x3B240B62, 0xEEBEB922, 0x85B2A20E, 0xE6BA0D99, 0xDE720C8C, 0x2DA2F728, 0xD0127845, 0x95B794FD, 0x647D0862, 0xE7CCF5F0, 0x5449A36F, 0x877D48FA, 0xC39DFD27, 0xF33E8D1E, 0x0A476341, 0x992EFF74, 0x3A6F6EAB, 0xF4F8FD37, 0xA812DC60, 0xA1EBDDF8, 0x991BE14C, 0xDB6E6B0D, 0xC67B5510, 0x6D672C37, 0x2765D43B, 0xDCD0E804, 0xF1290DC7, 0xCC00FFA3, 0xB5390F92, 0x690FED0B, 0x667B9FFB, 0xCEDB7D9C, 0xA091CF0B, 0xD9155EA3, 0xBB132F88, 0x515BAD24, 0x7B9479BF, 0x763BD6EB, 0x37392EB3, 0xCC115979, 0x8026E297, 0xF42E312D, 0x6842ADA7, 0xC66A2B3B, 0x12754CCC, 0x782EF11C, 0x6A124237, 0xB79251E7, 0x06A1BBE6, 0x4BFB6350, 0x1A6B1018, 0x11CAEDFA, 0x3D25BDD8, 0xE2E1C3C9, 0x44421659, 0x0A121386, 0xD90CEC6E, 0xD5ABEA2A, 0x64AF674E, 0xDA86A85F, 0xBEBFE988, 0x64E4C3FE, 0x9DBC8057, 0xF0F7C086, 0x60787BF8, 0x6003604D, 0xD1FD8346, 0xF6381FB0, 0x7745AE04, 0xD736FCCC, 0x83426B33, 0xF01EAB71, 0xB0804187, 0x3C005E5F, 0x77A057BE, 0xBDE8AE24, 0x55464299, 0xBF582E61, 0x4E58F48F, 0xF2DDFDA2, 0xF474EF38, 0x8789BDC2, 0x5366F9C3, 0xC8B38E74, 0xB475F255, 0x46FCD9B9, 0x7AEB2661, 0x8B1DDF84, 0x846A0E79, 0x915F95E2, 0x466E598E, 0x20B45770, 0x8CD55591, 0xC902DE4C, 0xB90BACE1, 0xBB8205D0, 0x11A86248, 0x7574A99E, 0xB77F19B6, 0xE0A9DC09, 0x662D09A1, 0xC4324633, 0xE85A1F02, 0x09F0BE8C, 0x4A99A025, 0x1D6EFE10, 0x1AB93D1D, 0x0BA5A4DF, 0xA186F20F, 0x2868F169, 0xDCB7DA83, 0x573906FE, 0xA1E2CE9B, 0x4FCD7F52, 0x50115E01, 0xA70683FA, 0xA002B5C4, 0x0DE6D027, 0x9AF88C27, 0x773F8641, 0xC3604C06, 0x61A806B5, 0xF0177A28, 0xC0F586E0, 0x006058AA, 0x30DC7D62, 0x11E69ED7, 0x2338EA63, 0x53C2DD94, 0xC2C21634, 0xBBCBEE56, 0x90BCB6DE, 0xEBFC7DA1, 0xCE591D76, 0x6F05E409, 0x4B7C0188, 0x39720A3D, 0x7C927C24, 0x86E3725F, 0x724D9DB9, 0x1AC15BB4, 0xD39EB8FC, 0xED545578, 0x08FCA5B5, 0xD83D7CD3, 0x4DAD0FC4, 0x1E50EF5E, 0xB161E6F8, 0xA28514D9, 0x6C51133C, 0x6FD5C7E7, 0x56E14EC4, 0x362ABFCE, 0xDDC6C837, 0xD79A3234, 0x92638212, 0x670EFA8E, 0x406000E0 }, KS3 = { 0x3A39CE37, 0xD3FAF5CF, 0xABC27737, 0x5AC52D1B, 0x5CB0679E, 0x4FA33742, 0xD3822740, 0x99BC9BBE, 0xD5118E9D, 0xBF0F7315, 0xD62D1C7E, 0xC700C47B, 0xB78C1B6B, 0x21A19045, 0xB26EB1BE, 0x6A366EB4, 0x5748AB2F, 0xBC946E79, 0xC6A376D2, 0x6549C2C8, 0x530FF8EE, 0x468DDE7D, 0xD5730A1D, 0x4CD04DC6, 0x2939BBDB, 0xA9BA4650, 0xAC9526E8, 0xBE5EE304, 0xA1FAD5F0, 0x6A2D519A, 0x63EF8CE2, 0x9A86EE22, 0xC089C2B8, 0x43242EF6, 0xA51E03AA, 0x9CF2D0A4, 0x83C061BA, 0x9BE96A4D, 0x8FE51550, 0xBA645BD6, 0x2826A2F9, 0xA73A3AE1, 0x4BA99586, 0xEF5562E9, 0xC72FEFD3, 0xF752F7DA, 0x3F046F69, 0x77FA0A59, 0x80E4A915, 0x87B08601, 0x9B09E6AD, 0x3B3EE593, 0xE990FD5A, 0x9E34D797, 0x2CF0B7D9, 0x022B8B51, 0x96D5AC3A, 0x017DA67D, 0xD1CF3ED6, 0x7C7D2D28, 0x1F9F25CF, 0xADF2B89B, 0x5AD6B472, 0x5A88F54C, 0xE029AC71, 0xE019A5E6, 0x47B0ACFD, 0xED93FA9B, 0xE8D3C48D, 0x283B57CC, 0xF8D56629, 0x79132E28, 0x785F0191, 0xED756055, 0xF7960E44, 0xE3D35E8C, 0x15056DD4, 0x88F46DBA, 0x03A16125, 0x0564F0BD, 0xC3EB9E15, 0x3C9057A2, 0x97271AEC, 0xA93A072A, 0x1B3F6D9B, 0x1E6321F5, 0xF59C66FB, 0x26DCF319, 0x7533D928, 0xB155FDF5, 0x03563482, 0x8ABA3CBB, 0x28517711, 0xC20AD9F8, 0xABCC5167, 0xCCAD925F, 0x4DE81751, 0x3830DC8E, 0x379D5862, 0x9320F991, 0xEA7A90C2, 0xFB3E7BCE, 0x5121CE64, 0x774FBE32, 0xA8B6E37E, 0xC3293D46, 0x48DE5369, 0x6413E680, 0xA2AE0810, 0xDD6DB224, 0x69852DFD, 0x09072166, 0xB39A460A, 0x6445C0DD, 0x586CDECF, 0x1C20C8AE, 0x5BBEF7DD, 0x1B588D40, 0xCCD2017F, 0x6BB4E3BB, 0xDDA26A7E, 0x3A59FF45, 0x3E350A44, 0xBCB4CDD5, 0x72EACEA8, 0xFA6484BB, 0x8D6612AE, 0xBF3C6F47, 0xD29BE463, 0x542F5D9E, 0xAEC2771B, 0xF64E6370, 0x740E0D8D, 0xE75B1357, 0xF8721671, 0xAF537D5D, 0x4040CB08, 0x4EB4E2CC, 0x34D2466A, 0x0115AF84, 0xE1B00428, 0x95983A1D, 0x06B89FB4, 0xCE6EA048, 0x6F3F3B82, 0x3520AB82, 0x011A1D4B, 0x277227F8, 0x611560B1, 0xE7933FDC, 0xBB3A792B, 0x344525BD, 0xA08839E1, 0x51CE794B, 0x2F32C9B7, 0xA01FBAC9, 0xE01CC87E, 0xBCC7D1F6, 0xCF0111C3, 0xA1E8AAC7, 0x1A908749, 0xD44FBD9A, 0xD0DADECB, 0xD50ADA38, 0x0339C32A, 0xC6913667, 0x8DF9317C, 0xE0B12B4F, 0xF79E59B7, 0x43F5BB3A, 0xF2D519FF, 0x27D9459C, 0xBF97222C, 0x15E6FC2A, 0x0F91FC71, 0x9B941525, 0xFAE59361, 0xCEB69CEB, 0xC2A86459, 0x12BAA8D1, 0xB6C1075E, 0xE3056A0C, 0x10D25065, 0xCB03A442, 0xE0EC6E0E, 0x1698DB3B, 0x4C98A0BE, 0x3278E964, 0x9F1F9532, 0xE0D392DF, 0xD3A0342B, 0x8971F21E, 0x1B0A7441, 0x4BA3348C, 0xC5BE7120, 0xC37632D8, 0xDF359F8D, 0x9B992F2E, 0xE60B6F47, 0x0FE3F11D, 0xE54CDA54, 0x1EDAD891, 0xCE6279CF, 0xCD3E7E6F, 0x1618B166, 0xFD2C1D05, 0x848FD2C5, 0xF6FB2299, 0xF523F357, 0xA6327623, 0x93A83531, 0x56CCCD02, 0xACF08162, 0x5A75EBB5, 0x6E163697, 0x88D273CC, 0xDE966292, 0x81B949D0, 0x4C50901B, 0x71C65614, 0xE6C6C7BD, 0x327A140A, 0x45E1D006, 0xC3F27B9A, 0xC9AA53FD, 0x62A80F00, 0xBB25BFE2, 0x35BDD2F6, 0x71126905, 0xB2040222, 0xB6CBCF7C, 0xCD769C2B, 0x53113EC0, 0x1640E3D3, 0x38ABBD60, 0x2547ADF0, 0xBA38209C, 0xF746CE76, 0x77AFA1C5, 0x20756060, 0x85CBFE4E, 0x8AE88DD8, 0x7AAAF9B0, 0x4CF9AA7E, 0x1948C25C, 0x02FB8A8C, 0x01C36AE4, 0xD6EBE1F9, 0x90D4F869, 0xA65CDEA0, 0x3F09252D, 0xC208E69F, 0xB74E6132, 0xCE77E25B, 0x578FDFE3, 0x3AC372E6 }; // ==================================== // Useful constants // ==================================== private static final int ROUNDS = 16; private static final int BLOCK_SIZE = 8; // bytes = 64 bits private static final int SBOX_SK = 256; private static final int P_SZ = ROUNDS + 2; private final int[] S0, S1, S2, S3; // the s-boxes private final int[] P; // the p-array private boolean doEncrypt = false; private byte[] workingKey = null; public BlowFish() { S0 = new int[SBOX_SK]; S1 = new int[SBOX_SK]; S2 = new int[SBOX_SK]; S3 = new int[SBOX_SK]; P = new int[P_SZ]; } /** * initialise a Blowfish cipher. * * @param encrypting * whether or not we are for encryption. * @param key * the key required to set up the cipher. * @exception IllegalArgumentException * if the params argument is inappropriate. */ public void init(boolean encrypting, byte[] key) { this.doEncrypt = encrypting; this.workingKey = key; setKey(this.workingKey); } public String getAlgorithmName() { return "Blowfish"; } public final void transformBlock(byte[] in, int inOff, byte[] out, int outOff) { if (workingKey == null) { throw new IllegalStateException("Blowfish not initialised"); } if (doEncrypt) { encryptBlock(in, inOff, out, outOff); } else { decryptBlock(in, inOff, out, outOff); } } public void reset() { } public int getBlockSize() { return BLOCK_SIZE; } // ================================== // Private Implementation // ================================== private int F(int x) { return (((S0[(x >>> 24)] + S1[(x >>> 16) & 0xff]) ^ S2[(x >>> 8) & 0xff]) + S3[x & 0xff]); } /** * apply the encryption cycle to each value pair in the table. */ private void processTable(int xl, int xr, int[] table) { int size = table.length; for (int s = 0; s < size; s += 2) { xl ^= P[0]; for (int i = 1; i < ROUNDS; i += 2) { xr ^= F(xl) ^ P[i]; xl ^= F(xr) ^ P[i + 1]; } xr ^= P[ROUNDS + 1]; table[s] = xr; table[s + 1] = xl; xr = xl; // end of cycle swap xl = table[s]; } } private void setKey(byte[] key) { /* * - comments are from _Applied Crypto_, Schneier, p338 please be * careful comparing the two, AC numbers the arrays from 1, the enclosed * code from 0. * * (1) Initialise the S-boxes and the P-array, with a fixed string This * string contains the hexadecimal digits of pi (3.141...) */ System.arraycopy(KS0, 0, S0, 0, SBOX_SK); System.arraycopy(KS1, 0, S1, 0, SBOX_SK); System.arraycopy(KS2, 0, S2, 0, SBOX_SK); System.arraycopy(KS3, 0, S3, 0, SBOX_SK); System.arraycopy(KP, 0, P, 0, P_SZ); /* * (2) Now, XOR P[0] with the first 32 bits of the key, XOR P[1] with * the second 32-bits of the key, and so on for all bits of the key (up * to P[17]). Repeatedly cycle through the key bits until the entire * P-array has been XOR-ed with the key bits */ int keyLength = key.length; int keyIndex = 0; for (int i = 0; i < P_SZ; i++) { // get the 32 bits of the key, in 4 * 8 bit chunks int data = 0x0000000; for (int j = 0; j < 4; j++) { // create a 32 bit block data = (data << 8) | (key[keyIndex++] & 0xff); // wrap when we get to the end of the key if (keyIndex >= keyLength) { keyIndex = 0; } } // XOR the newly created 32 bit chunk onto the P-array P[i] ^= data; } /* * (3) Encrypt the all-zero string with the Blowfish algorithm, using * the subkeys described in (1) and (2) * * (4) Replace P1 and P2 with the output of step (3) * * (5) Encrypt the output of step(3) using the Blowfish algorithm, with * the modified subkeys. * * (6) Replace P3 and P4 with the output of step (5) * * (7) Continue the process, replacing all elements of the P-array and * then all four S-boxes in order, with the output of the continuously * changing Blowfish algorithm */ processTable(0, 0, P); processTable(P[P_SZ - 2], P[P_SZ - 1], S0); processTable(S0[SBOX_SK - 2], S0[SBOX_SK - 1], S1); processTable(S1[SBOX_SK - 2], S1[SBOX_SK - 1], S2); processTable(S2[SBOX_SK - 2], S2[SBOX_SK - 1], S3); } /** * Encrypt the given input starting at the given offset and place the result * in the provided buffer starting at the given offset. The input will be an * exact multiple of our blocksize. */ private void encryptBlock(byte[] src, int srcIndex, byte[] dst, int dstIndex) { int xl = BytesTo32bits(src, srcIndex); int xr = BytesTo32bits(src, srcIndex + 4); xl ^= P[0]; for (int i = 1; i < ROUNDS; i += 2) { xr ^= F(xl) ^ P[i]; xl ^= F(xr) ^ P[i + 1]; } xr ^= P[ROUNDS + 1]; Bits32ToBytes(xr, dst, dstIndex); Bits32ToBytes(xl, dst, dstIndex + 4); } /** * Decrypt the given input starting at the given offset and place the result * in the provided buffer starting at the given offset. The input will be an * exact multiple of our blocksize. */ private void decryptBlock(byte[] src, int srcIndex, byte[] dst, int dstIndex) { int xl = BytesTo32bits(src, srcIndex); int xr = BytesTo32bits(src, srcIndex + 4); xl ^= P[ROUNDS + 1]; for (int i = ROUNDS; i > 0; i -= 2) { xr ^= F(xl) ^ P[i]; xl ^= F(xr) ^ P[i - 1]; } xr ^= P[0]; Bits32ToBytes(xr, dst, dstIndex); Bits32ToBytes(xl, dst, dstIndex + 4); } private int BytesTo32bits(byte[] b, int i) { return ((b[i] & 0xff) << 24) | ((b[i + 1] & 0xff) << 16) | ((b[i + 2] & 0xff) << 8) | ((b[i + 3] & 0xff)); } private void Bits32ToBytes(int in, byte[] b, int offset) { b[offset + 3] = (byte) in; b[offset + 2] = (byte) (in >> 8); b[offset + 1] = (byte) (in >> 16); b[offset] = (byte) (in >> 24); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/BlowFish.java
Java
asf20
20,816
package com.trilead.ssh2.crypto.cipher; /* This file was shamelessly taken from the Bouncy Castle Crypto package. Their licence file states the following: Copyright (c) 2000 - 2004 The Legion Of The Bouncy Castle (http://www.bouncycastle.org) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /** * An implementation of the AES (Rijndael), from FIPS-197. * <p> * For further details see: <a * href="http://csrc.nist.gov/encryption/aes/">http://csrc.nist.gov/encryption/aes/ * </a>. * * This implementation is based on optimizations from Dr. Brian Gladman's paper * and C code at <a * href="http://fp.gladman.plus.com/cryptography_technology/rijndael/">http://fp.gladman.plus.com/cryptography_technology/rijndael/ * </a> * * There are three levels of tradeoff of speed vs memory Because java has no * preprocessor, they are written as three separate classes from which to choose * * The fastest uses 8Kbytes of static tables to precompute round calculations, 4 * 256 word tables for encryption and 4 for decryption. * * The middle performance version uses only one 256 word table for each, for a * total of 2Kbytes, adding 12 rotate operations per round to compute the values * contained in the other tables from the contents of the first * * The slowest version uses no static tables at all and computes the values in * each round * <p> * This file contains the fast version with 8Kbytes of static tables for round * precomputation * * @author See comments in the source file * @version $Id: AES.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class AES implements BlockCipher { // The S box private static final byte[] S = { (byte) 99, (byte) 124, (byte) 119, (byte) 123, (byte) 242, (byte) 107, (byte) 111, (byte) 197, (byte) 48, (byte) 1, (byte) 103, (byte) 43, (byte) 254, (byte) 215, (byte) 171, (byte) 118, (byte) 202, (byte) 130, (byte) 201, (byte) 125, (byte) 250, (byte) 89, (byte) 71, (byte) 240, (byte) 173, (byte) 212, (byte) 162, (byte) 175, (byte) 156, (byte) 164, (byte) 114, (byte) 192, (byte) 183, (byte) 253, (byte) 147, (byte) 38, (byte) 54, (byte) 63, (byte) 247, (byte) 204, (byte) 52, (byte) 165, (byte) 229, (byte) 241, (byte) 113, (byte) 216, (byte) 49, (byte) 21, (byte) 4, (byte) 199, (byte) 35, (byte) 195, (byte) 24, (byte) 150, (byte) 5, (byte) 154, (byte) 7, (byte) 18, (byte) 128, (byte) 226, (byte) 235, (byte) 39, (byte) 178, (byte) 117, (byte) 9, (byte) 131, (byte) 44, (byte) 26, (byte) 27, (byte) 110, (byte) 90, (byte) 160, (byte) 82, (byte) 59, (byte) 214, (byte) 179, (byte) 41, (byte) 227, (byte) 47, (byte) 132, (byte) 83, (byte) 209, (byte) 0, (byte) 237, (byte) 32, (byte) 252, (byte) 177, (byte) 91, (byte) 106, (byte) 203, (byte) 190, (byte) 57, (byte) 74, (byte) 76, (byte) 88, (byte) 207, (byte) 208, (byte) 239, (byte) 170, (byte) 251, (byte) 67, (byte) 77, (byte) 51, (byte) 133, (byte) 69, (byte) 249, (byte) 2, (byte) 127, (byte) 80, (byte) 60, (byte) 159, (byte) 168, (byte) 81, (byte) 163, (byte) 64, (byte) 143, (byte) 146, (byte) 157, (byte) 56, (byte) 245, (byte) 188, (byte) 182, (byte) 218, (byte) 33, (byte) 16, (byte) 255, (byte) 243, (byte) 210, (byte) 205, (byte) 12, (byte) 19, (byte) 236, (byte) 95, (byte) 151, (byte) 68, (byte) 23, (byte) 196, (byte) 167, (byte) 126, (byte) 61, (byte) 100, (byte) 93, (byte) 25, (byte) 115, (byte) 96, (byte) 129, (byte) 79, (byte) 220, (byte) 34, (byte) 42, (byte) 144, (byte) 136, (byte) 70, (byte) 238, (byte) 184, (byte) 20, (byte) 222, (byte) 94, (byte) 11, (byte) 219, (byte) 224, (byte) 50, (byte) 58, (byte) 10, (byte) 73, (byte) 6, (byte) 36, (byte) 92, (byte) 194, (byte) 211, (byte) 172, (byte) 98, (byte) 145, (byte) 149, (byte) 228, (byte) 121, (byte) 231, (byte) 200, (byte) 55, (byte) 109, (byte) 141, (byte) 213, (byte) 78, (byte) 169, (byte) 108, (byte) 86, (byte) 244, (byte) 234, (byte) 101, (byte) 122, (byte) 174, (byte) 8, (byte) 186, (byte) 120, (byte) 37, (byte) 46, (byte) 28, (byte) 166, (byte) 180, (byte) 198, (byte) 232, (byte) 221, (byte) 116, (byte) 31, (byte) 75, (byte) 189, (byte) 139, (byte) 138, (byte) 112, (byte) 62, (byte) 181, (byte) 102, (byte) 72, (byte) 3, (byte) 246, (byte) 14, (byte) 97, (byte) 53, (byte) 87, (byte) 185, (byte) 134, (byte) 193, (byte) 29, (byte) 158, (byte) 225, (byte) 248, (byte) 152, (byte) 17, (byte) 105, (byte) 217, (byte) 142, (byte) 148, (byte) 155, (byte) 30, (byte) 135, (byte) 233, (byte) 206, (byte) 85, (byte) 40, (byte) 223, (byte) 140, (byte) 161, (byte) 137, (byte) 13, (byte) 191, (byte) 230, (byte) 66, (byte) 104, (byte) 65, (byte) 153, (byte) 45, (byte) 15, (byte) 176, (byte) 84, (byte) 187, (byte) 22, }; // The inverse S-box private static final byte[] Si = { (byte) 82, (byte) 9, (byte) 106, (byte) 213, (byte) 48, (byte) 54, (byte) 165, (byte) 56, (byte) 191, (byte) 64, (byte) 163, (byte) 158, (byte) 129, (byte) 243, (byte) 215, (byte) 251, (byte) 124, (byte) 227, (byte) 57, (byte) 130, (byte) 155, (byte) 47, (byte) 255, (byte) 135, (byte) 52, (byte) 142, (byte) 67, (byte) 68, (byte) 196, (byte) 222, (byte) 233, (byte) 203, (byte) 84, (byte) 123, (byte) 148, (byte) 50, (byte) 166, (byte) 194, (byte) 35, (byte) 61, (byte) 238, (byte) 76, (byte) 149, (byte) 11, (byte) 66, (byte) 250, (byte) 195, (byte) 78, (byte) 8, (byte) 46, (byte) 161, (byte) 102, (byte) 40, (byte) 217, (byte) 36, (byte) 178, (byte) 118, (byte) 91, (byte) 162, (byte) 73, (byte) 109, (byte) 139, (byte) 209, (byte) 37, (byte) 114, (byte) 248, (byte) 246, (byte) 100, (byte) 134, (byte) 104, (byte) 152, (byte) 22, (byte) 212, (byte) 164, (byte) 92, (byte) 204, (byte) 93, (byte) 101, (byte) 182, (byte) 146, (byte) 108, (byte) 112, (byte) 72, (byte) 80, (byte) 253, (byte) 237, (byte) 185, (byte) 218, (byte) 94, (byte) 21, (byte) 70, (byte) 87, (byte) 167, (byte) 141, (byte) 157, (byte) 132, (byte) 144, (byte) 216, (byte) 171, (byte) 0, (byte) 140, (byte) 188, (byte) 211, (byte) 10, (byte) 247, (byte) 228, (byte) 88, (byte) 5, (byte) 184, (byte) 179, (byte) 69, (byte) 6, (byte) 208, (byte) 44, (byte) 30, (byte) 143, (byte) 202, (byte) 63, (byte) 15, (byte) 2, (byte) 193, (byte) 175, (byte) 189, (byte) 3, (byte) 1, (byte) 19, (byte) 138, (byte) 107, (byte) 58, (byte) 145, (byte) 17, (byte) 65, (byte) 79, (byte) 103, (byte) 220, (byte) 234, (byte) 151, (byte) 242, (byte) 207, (byte) 206, (byte) 240, (byte) 180, (byte) 230, (byte) 115, (byte) 150, (byte) 172, (byte) 116, (byte) 34, (byte) 231, (byte) 173, (byte) 53, (byte) 133, (byte) 226, (byte) 249, (byte) 55, (byte) 232, (byte) 28, (byte) 117, (byte) 223, (byte) 110, (byte) 71, (byte) 241, (byte) 26, (byte) 113, (byte) 29, (byte) 41, (byte) 197, (byte) 137, (byte) 111, (byte) 183, (byte) 98, (byte) 14, (byte) 170, (byte) 24, (byte) 190, (byte) 27, (byte) 252, (byte) 86, (byte) 62, (byte) 75, (byte) 198, (byte) 210, (byte) 121, (byte) 32, (byte) 154, (byte) 219, (byte) 192, (byte) 254, (byte) 120, (byte) 205, (byte) 90, (byte) 244, (byte) 31, (byte) 221, (byte) 168, (byte) 51, (byte) 136, (byte) 7, (byte) 199, (byte) 49, (byte) 177, (byte) 18, (byte) 16, (byte) 89, (byte) 39, (byte) 128, (byte) 236, (byte) 95, (byte) 96, (byte) 81, (byte) 127, (byte) 169, (byte) 25, (byte) 181, (byte) 74, (byte) 13, (byte) 45, (byte) 229, (byte) 122, (byte) 159, (byte) 147, (byte) 201, (byte) 156, (byte) 239, (byte) 160, (byte) 224, (byte) 59, (byte) 77, (byte) 174, (byte) 42, (byte) 245, (byte) 176, (byte) 200, (byte) 235, (byte) 187, (byte) 60, (byte) 131, (byte) 83, (byte) 153, (byte) 97, (byte) 23, (byte) 43, (byte) 4, (byte) 126, (byte) 186, (byte) 119, (byte) 214, (byte) 38, (byte) 225, (byte) 105, (byte) 20, (byte) 99, (byte) 85, (byte) 33, (byte) 12, (byte) 125, }; // vector used in calculating key schedule (powers of x in GF(256)) private static final int[] rcon = { 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91 }; // precomputation tables of calculations for rounds private static final int[] T0 = { 0xa56363c6, 0x847c7cf8, 0x997777ee, 0x8d7b7bf6, 0x0df2f2ff, 0xbd6b6bd6, 0xb16f6fde, 0x54c5c591, 0x50303060, 0x03010102, 0xa96767ce, 0x7d2b2b56, 0x19fefee7, 0x62d7d7b5, 0xe6abab4d, 0x9a7676ec, 0x45caca8f, 0x9d82821f, 0x40c9c989, 0x877d7dfa, 0x15fafaef, 0xeb5959b2, 0xc947478e, 0x0bf0f0fb, 0xecadad41, 0x67d4d4b3, 0xfda2a25f, 0xeaafaf45, 0xbf9c9c23, 0xf7a4a453, 0x967272e4, 0x5bc0c09b, 0xc2b7b775, 0x1cfdfde1, 0xae93933d, 0x6a26264c, 0x5a36366c, 0x413f3f7e, 0x02f7f7f5, 0x4fcccc83, 0x5c343468, 0xf4a5a551, 0x34e5e5d1, 0x08f1f1f9, 0x937171e2, 0x73d8d8ab, 0x53313162, 0x3f15152a, 0x0c040408, 0x52c7c795, 0x65232346, 0x5ec3c39d, 0x28181830, 0xa1969637, 0x0f05050a, 0xb59a9a2f, 0x0907070e, 0x36121224, 0x9b80801b, 0x3de2e2df, 0x26ebebcd, 0x6927274e, 0xcdb2b27f, 0x9f7575ea, 0x1b090912, 0x9e83831d, 0x742c2c58, 0x2e1a1a34, 0x2d1b1b36, 0xb26e6edc, 0xee5a5ab4, 0xfba0a05b, 0xf65252a4, 0x4d3b3b76, 0x61d6d6b7, 0xceb3b37d, 0x7b292952, 0x3ee3e3dd, 0x712f2f5e, 0x97848413, 0xf55353a6, 0x68d1d1b9, 0x00000000, 0x2cededc1, 0x60202040, 0x1ffcfce3, 0xc8b1b179, 0xed5b5bb6, 0xbe6a6ad4, 0x46cbcb8d, 0xd9bebe67, 0x4b393972, 0xde4a4a94, 0xd44c4c98, 0xe85858b0, 0x4acfcf85, 0x6bd0d0bb, 0x2aefefc5, 0xe5aaaa4f, 0x16fbfbed, 0xc5434386, 0xd74d4d9a, 0x55333366, 0x94858511, 0xcf45458a, 0x10f9f9e9, 0x06020204, 0x817f7ffe, 0xf05050a0, 0x443c3c78, 0xba9f9f25, 0xe3a8a84b, 0xf35151a2, 0xfea3a35d, 0xc0404080, 0x8a8f8f05, 0xad92923f, 0xbc9d9d21, 0x48383870, 0x04f5f5f1, 0xdfbcbc63, 0xc1b6b677, 0x75dadaaf, 0x63212142, 0x30101020, 0x1affffe5, 0x0ef3f3fd, 0x6dd2d2bf, 0x4ccdcd81, 0x140c0c18, 0x35131326, 0x2fececc3, 0xe15f5fbe, 0xa2979735, 0xcc444488, 0x3917172e, 0x57c4c493, 0xf2a7a755, 0x827e7efc, 0x473d3d7a, 0xac6464c8, 0xe75d5dba, 0x2b191932, 0x957373e6, 0xa06060c0, 0x98818119, 0xd14f4f9e, 0x7fdcdca3, 0x66222244, 0x7e2a2a54, 0xab90903b, 0x8388880b, 0xca46468c, 0x29eeeec7, 0xd3b8b86b, 0x3c141428, 0x79dedea7, 0xe25e5ebc, 0x1d0b0b16, 0x76dbdbad, 0x3be0e0db, 0x56323264, 0x4e3a3a74, 0x1e0a0a14, 0xdb494992, 0x0a06060c, 0x6c242448, 0xe45c5cb8, 0x5dc2c29f, 0x6ed3d3bd, 0xefacac43, 0xa66262c4, 0xa8919139, 0xa4959531, 0x37e4e4d3, 0x8b7979f2, 0x32e7e7d5, 0x43c8c88b, 0x5937376e, 0xb76d6dda, 0x8c8d8d01, 0x64d5d5b1, 0xd24e4e9c, 0xe0a9a949, 0xb46c6cd8, 0xfa5656ac, 0x07f4f4f3, 0x25eaeacf, 0xaf6565ca, 0x8e7a7af4, 0xe9aeae47, 0x18080810, 0xd5baba6f, 0x887878f0, 0x6f25254a, 0x722e2e5c, 0x241c1c38, 0xf1a6a657, 0xc7b4b473, 0x51c6c697, 0x23e8e8cb, 0x7cdddda1, 0x9c7474e8, 0x211f1f3e, 0xdd4b4b96, 0xdcbdbd61, 0x868b8b0d, 0x858a8a0f, 0x907070e0, 0x423e3e7c, 0xc4b5b571, 0xaa6666cc, 0xd8484890, 0x05030306, 0x01f6f6f7, 0x120e0e1c, 0xa36161c2, 0x5f35356a, 0xf95757ae, 0xd0b9b969, 0x91868617, 0x58c1c199, 0x271d1d3a, 0xb99e9e27, 0x38e1e1d9, 0x13f8f8eb, 0xb398982b, 0x33111122, 0xbb6969d2, 0x70d9d9a9, 0x898e8e07, 0xa7949433, 0xb69b9b2d, 0x221e1e3c, 0x92878715, 0x20e9e9c9, 0x49cece87, 0xff5555aa, 0x78282850, 0x7adfdfa5, 0x8f8c8c03, 0xf8a1a159, 0x80898909, 0x170d0d1a, 0xdabfbf65, 0x31e6e6d7, 0xc6424284, 0xb86868d0, 0xc3414182, 0xb0999929, 0x772d2d5a, 0x110f0f1e, 0xcbb0b07b, 0xfc5454a8, 0xd6bbbb6d, 0x3a16162c }; private static final int[] T1 = { 0x6363c6a5, 0x7c7cf884, 0x7777ee99, 0x7b7bf68d, 0xf2f2ff0d, 0x6b6bd6bd, 0x6f6fdeb1, 0xc5c59154, 0x30306050, 0x01010203, 0x6767cea9, 0x2b2b567d, 0xfefee719, 0xd7d7b562, 0xabab4de6, 0x7676ec9a, 0xcaca8f45, 0x82821f9d, 0xc9c98940, 0x7d7dfa87, 0xfafaef15, 0x5959b2eb, 0x47478ec9, 0xf0f0fb0b, 0xadad41ec, 0xd4d4b367, 0xa2a25ffd, 0xafaf45ea, 0x9c9c23bf, 0xa4a453f7, 0x7272e496, 0xc0c09b5b, 0xb7b775c2, 0xfdfde11c, 0x93933dae, 0x26264c6a, 0x36366c5a, 0x3f3f7e41, 0xf7f7f502, 0xcccc834f, 0x3434685c, 0xa5a551f4, 0xe5e5d134, 0xf1f1f908, 0x7171e293, 0xd8d8ab73, 0x31316253, 0x15152a3f, 0x0404080c, 0xc7c79552, 0x23234665, 0xc3c39d5e, 0x18183028, 0x969637a1, 0x05050a0f, 0x9a9a2fb5, 0x07070e09, 0x12122436, 0x80801b9b, 0xe2e2df3d, 0xebebcd26, 0x27274e69, 0xb2b27fcd, 0x7575ea9f, 0x0909121b, 0x83831d9e, 0x2c2c5874, 0x1a1a342e, 0x1b1b362d, 0x6e6edcb2, 0x5a5ab4ee, 0xa0a05bfb, 0x5252a4f6, 0x3b3b764d, 0xd6d6b761, 0xb3b37dce, 0x2929527b, 0xe3e3dd3e, 0x2f2f5e71, 0x84841397, 0x5353a6f5, 0xd1d1b968, 0x00000000, 0xededc12c, 0x20204060, 0xfcfce31f, 0xb1b179c8, 0x5b5bb6ed, 0x6a6ad4be, 0xcbcb8d46, 0xbebe67d9, 0x3939724b, 0x4a4a94de, 0x4c4c98d4, 0x5858b0e8, 0xcfcf854a, 0xd0d0bb6b, 0xefefc52a, 0xaaaa4fe5, 0xfbfbed16, 0x434386c5, 0x4d4d9ad7, 0x33336655, 0x85851194, 0x45458acf, 0xf9f9e910, 0x02020406, 0x7f7ffe81, 0x5050a0f0, 0x3c3c7844, 0x9f9f25ba, 0xa8a84be3, 0x5151a2f3, 0xa3a35dfe, 0x404080c0, 0x8f8f058a, 0x92923fad, 0x9d9d21bc, 0x38387048, 0xf5f5f104, 0xbcbc63df, 0xb6b677c1, 0xdadaaf75, 0x21214263, 0x10102030, 0xffffe51a, 0xf3f3fd0e, 0xd2d2bf6d, 0xcdcd814c, 0x0c0c1814, 0x13132635, 0xececc32f, 0x5f5fbee1, 0x979735a2, 0x444488cc, 0x17172e39, 0xc4c49357, 0xa7a755f2, 0x7e7efc82, 0x3d3d7a47, 0x6464c8ac, 0x5d5dbae7, 0x1919322b, 0x7373e695, 0x6060c0a0, 0x81811998, 0x4f4f9ed1, 0xdcdca37f, 0x22224466, 0x2a2a547e, 0x90903bab, 0x88880b83, 0x46468cca, 0xeeeec729, 0xb8b86bd3, 0x1414283c, 0xdedea779, 0x5e5ebce2, 0x0b0b161d, 0xdbdbad76, 0xe0e0db3b, 0x32326456, 0x3a3a744e, 0x0a0a141e, 0x494992db, 0x06060c0a, 0x2424486c, 0x5c5cb8e4, 0xc2c29f5d, 0xd3d3bd6e, 0xacac43ef, 0x6262c4a6, 0x919139a8, 0x959531a4, 0xe4e4d337, 0x7979f28b, 0xe7e7d532, 0xc8c88b43, 0x37376e59, 0x6d6ddab7, 0x8d8d018c, 0xd5d5b164, 0x4e4e9cd2, 0xa9a949e0, 0x6c6cd8b4, 0x5656acfa, 0xf4f4f307, 0xeaeacf25, 0x6565caaf, 0x7a7af48e, 0xaeae47e9, 0x08081018, 0xbaba6fd5, 0x7878f088, 0x25254a6f, 0x2e2e5c72, 0x1c1c3824, 0xa6a657f1, 0xb4b473c7, 0xc6c69751, 0xe8e8cb23, 0xdddda17c, 0x7474e89c, 0x1f1f3e21, 0x4b4b96dd, 0xbdbd61dc, 0x8b8b0d86, 0x8a8a0f85, 0x7070e090, 0x3e3e7c42, 0xb5b571c4, 0x6666ccaa, 0x484890d8, 0x03030605, 0xf6f6f701, 0x0e0e1c12, 0x6161c2a3, 0x35356a5f, 0x5757aef9, 0xb9b969d0, 0x86861791, 0xc1c19958, 0x1d1d3a27, 0x9e9e27b9, 0xe1e1d938, 0xf8f8eb13, 0x98982bb3, 0x11112233, 0x6969d2bb, 0xd9d9a970, 0x8e8e0789, 0x949433a7, 0x9b9b2db6, 0x1e1e3c22, 0x87871592, 0xe9e9c920, 0xcece8749, 0x5555aaff, 0x28285078, 0xdfdfa57a, 0x8c8c038f, 0xa1a159f8, 0x89890980, 0x0d0d1a17, 0xbfbf65da, 0xe6e6d731, 0x424284c6, 0x6868d0b8, 0x414182c3, 0x999929b0, 0x2d2d5a77, 0x0f0f1e11, 0xb0b07bcb, 0x5454a8fc, 0xbbbb6dd6, 0x16162c3a }; private static final int[] T2 = { 0x63c6a563, 0x7cf8847c, 0x77ee9977, 0x7bf68d7b, 0xf2ff0df2, 0x6bd6bd6b, 0x6fdeb16f, 0xc59154c5, 0x30605030, 0x01020301, 0x67cea967, 0x2b567d2b, 0xfee719fe, 0xd7b562d7, 0xab4de6ab, 0x76ec9a76, 0xca8f45ca, 0x821f9d82, 0xc98940c9, 0x7dfa877d, 0xfaef15fa, 0x59b2eb59, 0x478ec947, 0xf0fb0bf0, 0xad41ecad, 0xd4b367d4, 0xa25ffda2, 0xaf45eaaf, 0x9c23bf9c, 0xa453f7a4, 0x72e49672, 0xc09b5bc0, 0xb775c2b7, 0xfde11cfd, 0x933dae93, 0x264c6a26, 0x366c5a36, 0x3f7e413f, 0xf7f502f7, 0xcc834fcc, 0x34685c34, 0xa551f4a5, 0xe5d134e5, 0xf1f908f1, 0x71e29371, 0xd8ab73d8, 0x31625331, 0x152a3f15, 0x04080c04, 0xc79552c7, 0x23466523, 0xc39d5ec3, 0x18302818, 0x9637a196, 0x050a0f05, 0x9a2fb59a, 0x070e0907, 0x12243612, 0x801b9b80, 0xe2df3de2, 0xebcd26eb, 0x274e6927, 0xb27fcdb2, 0x75ea9f75, 0x09121b09, 0x831d9e83, 0x2c58742c, 0x1a342e1a, 0x1b362d1b, 0x6edcb26e, 0x5ab4ee5a, 0xa05bfba0, 0x52a4f652, 0x3b764d3b, 0xd6b761d6, 0xb37dceb3, 0x29527b29, 0xe3dd3ee3, 0x2f5e712f, 0x84139784, 0x53a6f553, 0xd1b968d1, 0x00000000, 0xedc12ced, 0x20406020, 0xfce31ffc, 0xb179c8b1, 0x5bb6ed5b, 0x6ad4be6a, 0xcb8d46cb, 0xbe67d9be, 0x39724b39, 0x4a94de4a, 0x4c98d44c, 0x58b0e858, 0xcf854acf, 0xd0bb6bd0, 0xefc52aef, 0xaa4fe5aa, 0xfbed16fb, 0x4386c543, 0x4d9ad74d, 0x33665533, 0x85119485, 0x458acf45, 0xf9e910f9, 0x02040602, 0x7ffe817f, 0x50a0f050, 0x3c78443c, 0x9f25ba9f, 0xa84be3a8, 0x51a2f351, 0xa35dfea3, 0x4080c040, 0x8f058a8f, 0x923fad92, 0x9d21bc9d, 0x38704838, 0xf5f104f5, 0xbc63dfbc, 0xb677c1b6, 0xdaaf75da, 0x21426321, 0x10203010, 0xffe51aff, 0xf3fd0ef3, 0xd2bf6dd2, 0xcd814ccd, 0x0c18140c, 0x13263513, 0xecc32fec, 0x5fbee15f, 0x9735a297, 0x4488cc44, 0x172e3917, 0xc49357c4, 0xa755f2a7, 0x7efc827e, 0x3d7a473d, 0x64c8ac64, 0x5dbae75d, 0x19322b19, 0x73e69573, 0x60c0a060, 0x81199881, 0x4f9ed14f, 0xdca37fdc, 0x22446622, 0x2a547e2a, 0x903bab90, 0x880b8388, 0x468cca46, 0xeec729ee, 0xb86bd3b8, 0x14283c14, 0xdea779de, 0x5ebce25e, 0x0b161d0b, 0xdbad76db, 0xe0db3be0, 0x32645632, 0x3a744e3a, 0x0a141e0a, 0x4992db49, 0x060c0a06, 0x24486c24, 0x5cb8e45c, 0xc29f5dc2, 0xd3bd6ed3, 0xac43efac, 0x62c4a662, 0x9139a891, 0x9531a495, 0xe4d337e4, 0x79f28b79, 0xe7d532e7, 0xc88b43c8, 0x376e5937, 0x6ddab76d, 0x8d018c8d, 0xd5b164d5, 0x4e9cd24e, 0xa949e0a9, 0x6cd8b46c, 0x56acfa56, 0xf4f307f4, 0xeacf25ea, 0x65caaf65, 0x7af48e7a, 0xae47e9ae, 0x08101808, 0xba6fd5ba, 0x78f08878, 0x254a6f25, 0x2e5c722e, 0x1c38241c, 0xa657f1a6, 0xb473c7b4, 0xc69751c6, 0xe8cb23e8, 0xdda17cdd, 0x74e89c74, 0x1f3e211f, 0x4b96dd4b, 0xbd61dcbd, 0x8b0d868b, 0x8a0f858a, 0x70e09070, 0x3e7c423e, 0xb571c4b5, 0x66ccaa66, 0x4890d848, 0x03060503, 0xf6f701f6, 0x0e1c120e, 0x61c2a361, 0x356a5f35, 0x57aef957, 0xb969d0b9, 0x86179186, 0xc19958c1, 0x1d3a271d, 0x9e27b99e, 0xe1d938e1, 0xf8eb13f8, 0x982bb398, 0x11223311, 0x69d2bb69, 0xd9a970d9, 0x8e07898e, 0x9433a794, 0x9b2db69b, 0x1e3c221e, 0x87159287, 0xe9c920e9, 0xce8749ce, 0x55aaff55, 0x28507828, 0xdfa57adf, 0x8c038f8c, 0xa159f8a1, 0x89098089, 0x0d1a170d, 0xbf65dabf, 0xe6d731e6, 0x4284c642, 0x68d0b868, 0x4182c341, 0x9929b099, 0x2d5a772d, 0x0f1e110f, 0xb07bcbb0, 0x54a8fc54, 0xbb6dd6bb, 0x162c3a16 }; private static final int[] T3 = { 0xc6a56363, 0xf8847c7c, 0xee997777, 0xf68d7b7b, 0xff0df2f2, 0xd6bd6b6b, 0xdeb16f6f, 0x9154c5c5, 0x60503030, 0x02030101, 0xcea96767, 0x567d2b2b, 0xe719fefe, 0xb562d7d7, 0x4de6abab, 0xec9a7676, 0x8f45caca, 0x1f9d8282, 0x8940c9c9, 0xfa877d7d, 0xef15fafa, 0xb2eb5959, 0x8ec94747, 0xfb0bf0f0, 0x41ecadad, 0xb367d4d4, 0x5ffda2a2, 0x45eaafaf, 0x23bf9c9c, 0x53f7a4a4, 0xe4967272, 0x9b5bc0c0, 0x75c2b7b7, 0xe11cfdfd, 0x3dae9393, 0x4c6a2626, 0x6c5a3636, 0x7e413f3f, 0xf502f7f7, 0x834fcccc, 0x685c3434, 0x51f4a5a5, 0xd134e5e5, 0xf908f1f1, 0xe2937171, 0xab73d8d8, 0x62533131, 0x2a3f1515, 0x080c0404, 0x9552c7c7, 0x46652323, 0x9d5ec3c3, 0x30281818, 0x37a19696, 0x0a0f0505, 0x2fb59a9a, 0x0e090707, 0x24361212, 0x1b9b8080, 0xdf3de2e2, 0xcd26ebeb, 0x4e692727, 0x7fcdb2b2, 0xea9f7575, 0x121b0909, 0x1d9e8383, 0x58742c2c, 0x342e1a1a, 0x362d1b1b, 0xdcb26e6e, 0xb4ee5a5a, 0x5bfba0a0, 0xa4f65252, 0x764d3b3b, 0xb761d6d6, 0x7dceb3b3, 0x527b2929, 0xdd3ee3e3, 0x5e712f2f, 0x13978484, 0xa6f55353, 0xb968d1d1, 0x00000000, 0xc12ceded, 0x40602020, 0xe31ffcfc, 0x79c8b1b1, 0xb6ed5b5b, 0xd4be6a6a, 0x8d46cbcb, 0x67d9bebe, 0x724b3939, 0x94de4a4a, 0x98d44c4c, 0xb0e85858, 0x854acfcf, 0xbb6bd0d0, 0xc52aefef, 0x4fe5aaaa, 0xed16fbfb, 0x86c54343, 0x9ad74d4d, 0x66553333, 0x11948585, 0x8acf4545, 0xe910f9f9, 0x04060202, 0xfe817f7f, 0xa0f05050, 0x78443c3c, 0x25ba9f9f, 0x4be3a8a8, 0xa2f35151, 0x5dfea3a3, 0x80c04040, 0x058a8f8f, 0x3fad9292, 0x21bc9d9d, 0x70483838, 0xf104f5f5, 0x63dfbcbc, 0x77c1b6b6, 0xaf75dada, 0x42632121, 0x20301010, 0xe51affff, 0xfd0ef3f3, 0xbf6dd2d2, 0x814ccdcd, 0x18140c0c, 0x26351313, 0xc32fecec, 0xbee15f5f, 0x35a29797, 0x88cc4444, 0x2e391717, 0x9357c4c4, 0x55f2a7a7, 0xfc827e7e, 0x7a473d3d, 0xc8ac6464, 0xbae75d5d, 0x322b1919, 0xe6957373, 0xc0a06060, 0x19988181, 0x9ed14f4f, 0xa37fdcdc, 0x44662222, 0x547e2a2a, 0x3bab9090, 0x0b838888, 0x8cca4646, 0xc729eeee, 0x6bd3b8b8, 0x283c1414, 0xa779dede, 0xbce25e5e, 0x161d0b0b, 0xad76dbdb, 0xdb3be0e0, 0x64563232, 0x744e3a3a, 0x141e0a0a, 0x92db4949, 0x0c0a0606, 0x486c2424, 0xb8e45c5c, 0x9f5dc2c2, 0xbd6ed3d3, 0x43efacac, 0xc4a66262, 0x39a89191, 0x31a49595, 0xd337e4e4, 0xf28b7979, 0xd532e7e7, 0x8b43c8c8, 0x6e593737, 0xdab76d6d, 0x018c8d8d, 0xb164d5d5, 0x9cd24e4e, 0x49e0a9a9, 0xd8b46c6c, 0xacfa5656, 0xf307f4f4, 0xcf25eaea, 0xcaaf6565, 0xf48e7a7a, 0x47e9aeae, 0x10180808, 0x6fd5baba, 0xf0887878, 0x4a6f2525, 0x5c722e2e, 0x38241c1c, 0x57f1a6a6, 0x73c7b4b4, 0x9751c6c6, 0xcb23e8e8, 0xa17cdddd, 0xe89c7474, 0x3e211f1f, 0x96dd4b4b, 0x61dcbdbd, 0x0d868b8b, 0x0f858a8a, 0xe0907070, 0x7c423e3e, 0x71c4b5b5, 0xccaa6666, 0x90d84848, 0x06050303, 0xf701f6f6, 0x1c120e0e, 0xc2a36161, 0x6a5f3535, 0xaef95757, 0x69d0b9b9, 0x17918686, 0x9958c1c1, 0x3a271d1d, 0x27b99e9e, 0xd938e1e1, 0xeb13f8f8, 0x2bb39898, 0x22331111, 0xd2bb6969, 0xa970d9d9, 0x07898e8e, 0x33a79494, 0x2db69b9b, 0x3c221e1e, 0x15928787, 0xc920e9e9, 0x8749cece, 0xaaff5555, 0x50782828, 0xa57adfdf, 0x038f8c8c, 0x59f8a1a1, 0x09808989, 0x1a170d0d, 0x65dabfbf, 0xd731e6e6, 0x84c64242, 0xd0b86868, 0x82c34141, 0x29b09999, 0x5a772d2d, 0x1e110f0f, 0x7bcbb0b0, 0xa8fc5454, 0x6dd6bbbb, 0x2c3a1616 }; private static final int[] Tinv0 = { 0x50a7f451, 0x5365417e, 0xc3a4171a, 0x965e273a, 0xcb6bab3b, 0xf1459d1f, 0xab58faac, 0x9303e34b, 0x55fa3020, 0xf66d76ad, 0x9176cc88, 0x254c02f5, 0xfcd7e54f, 0xd7cb2ac5, 0x80443526, 0x8fa362b5, 0x495ab1de, 0x671bba25, 0x980eea45, 0xe1c0fe5d, 0x02752fc3, 0x12f04c81, 0xa397468d, 0xc6f9d36b, 0xe75f8f03, 0x959c9215, 0xeb7a6dbf, 0xda595295, 0x2d83bed4, 0xd3217458, 0x2969e049, 0x44c8c98e, 0x6a89c275, 0x78798ef4, 0x6b3e5899, 0xdd71b927, 0xb64fe1be, 0x17ad88f0, 0x66ac20c9, 0xb43ace7d, 0x184adf63, 0x82311ae5, 0x60335197, 0x457f5362, 0xe07764b1, 0x84ae6bbb, 0x1ca081fe, 0x942b08f9, 0x58684870, 0x19fd458f, 0x876cde94, 0xb7f87b52, 0x23d373ab, 0xe2024b72, 0x578f1fe3, 0x2aab5566, 0x0728ebb2, 0x03c2b52f, 0x9a7bc586, 0xa50837d3, 0xf2872830, 0xb2a5bf23, 0xba6a0302, 0x5c8216ed, 0x2b1ccf8a, 0x92b479a7, 0xf0f207f3, 0xa1e2694e, 0xcdf4da65, 0xd5be0506, 0x1f6234d1, 0x8afea6c4, 0x9d532e34, 0xa055f3a2, 0x32e18a05, 0x75ebf6a4, 0x39ec830b, 0xaaef6040, 0x069f715e, 0x51106ebd, 0xf98a213e, 0x3d06dd96, 0xae053edd, 0x46bde64d, 0xb58d5491, 0x055dc471, 0x6fd40604, 0xff155060, 0x24fb9819, 0x97e9bdd6, 0xcc434089, 0x779ed967, 0xbd42e8b0, 0x888b8907, 0x385b19e7, 0xdbeec879, 0x470a7ca1, 0xe90f427c, 0xc91e84f8, 0x00000000, 0x83868009, 0x48ed2b32, 0xac70111e, 0x4e725a6c, 0xfbff0efd, 0x5638850f, 0x1ed5ae3d, 0x27392d36, 0x64d90f0a, 0x21a65c68, 0xd1545b9b, 0x3a2e3624, 0xb1670a0c, 0x0fe75793, 0xd296eeb4, 0x9e919b1b, 0x4fc5c080, 0xa220dc61, 0x694b775a, 0x161a121c, 0x0aba93e2, 0xe52aa0c0, 0x43e0223c, 0x1d171b12, 0x0b0d090e, 0xadc78bf2, 0xb9a8b62d, 0xc8a91e14, 0x8519f157, 0x4c0775af, 0xbbdd99ee, 0xfd607fa3, 0x9f2601f7, 0xbcf5725c, 0xc53b6644, 0x347efb5b, 0x7629438b, 0xdcc623cb, 0x68fcedb6, 0x63f1e4b8, 0xcadc31d7, 0x10856342, 0x40229713, 0x2011c684, 0x7d244a85, 0xf83dbbd2, 0x1132f9ae, 0x6da129c7, 0x4b2f9e1d, 0xf330b2dc, 0xec52860d, 0xd0e3c177, 0x6c16b32b, 0x99b970a9, 0xfa489411, 0x2264e947, 0xc48cfca8, 0x1a3ff0a0, 0xd82c7d56, 0xef903322, 0xc74e4987, 0xc1d138d9, 0xfea2ca8c, 0x360bd498, 0xcf81f5a6, 0x28de7aa5, 0x268eb7da, 0xa4bfad3f, 0xe49d3a2c, 0x0d927850, 0x9bcc5f6a, 0x62467e54, 0xc2138df6, 0xe8b8d890, 0x5ef7392e, 0xf5afc382, 0xbe805d9f, 0x7c93d069, 0xa92dd56f, 0xb31225cf, 0x3b99acc8, 0xa77d1810, 0x6e639ce8, 0x7bbb3bdb, 0x097826cd, 0xf418596e, 0x01b79aec, 0xa89a4f83, 0x656e95e6, 0x7ee6ffaa, 0x08cfbc21, 0xe6e815ef, 0xd99be7ba, 0xce366f4a, 0xd4099fea, 0xd67cb029, 0xafb2a431, 0x31233f2a, 0x3094a5c6, 0xc066a235, 0x37bc4e74, 0xa6ca82fc, 0xb0d090e0, 0x15d8a733, 0x4a9804f1, 0xf7daec41, 0x0e50cd7f, 0x2ff69117, 0x8dd64d76, 0x4db0ef43, 0x544daacc, 0xdf0496e4, 0xe3b5d19e, 0x1b886a4c, 0xb81f2cc1, 0x7f516546, 0x04ea5e9d, 0x5d358c01, 0x737487fa, 0x2e410bfb, 0x5a1d67b3, 0x52d2db92, 0x335610e9, 0x1347d66d, 0x8c61d79a, 0x7a0ca137, 0x8e14f859, 0x893c13eb, 0xee27a9ce, 0x35c961b7, 0xede51ce1, 0x3cb1477a, 0x59dfd29c, 0x3f73f255, 0x79ce1418, 0xbf37c773, 0xeacdf753, 0x5baafd5f, 0x146f3ddf, 0x86db4478, 0x81f3afca, 0x3ec468b9, 0x2c342438, 0x5f40a3c2, 0x72c31d16, 0x0c25e2bc, 0x8b493c28, 0x41950dff, 0x7101a839, 0xdeb30c08, 0x9ce4b4d8, 0x90c15664, 0x6184cb7b, 0x70b632d5, 0x745c6c48, 0x4257b8d0 }; private static final int[] Tinv1 = { 0xa7f45150, 0x65417e53, 0xa4171ac3, 0x5e273a96, 0x6bab3bcb, 0x459d1ff1, 0x58faacab, 0x03e34b93, 0xfa302055, 0x6d76adf6, 0x76cc8891, 0x4c02f525, 0xd7e54ffc, 0xcb2ac5d7, 0x44352680, 0xa362b58f, 0x5ab1de49, 0x1bba2567, 0x0eea4598, 0xc0fe5de1, 0x752fc302, 0xf04c8112, 0x97468da3, 0xf9d36bc6, 0x5f8f03e7, 0x9c921595, 0x7a6dbfeb, 0x595295da, 0x83bed42d, 0x217458d3, 0x69e04929, 0xc8c98e44, 0x89c2756a, 0x798ef478, 0x3e58996b, 0x71b927dd, 0x4fe1beb6, 0xad88f017, 0xac20c966, 0x3ace7db4, 0x4adf6318, 0x311ae582, 0x33519760, 0x7f536245, 0x7764b1e0, 0xae6bbb84, 0xa081fe1c, 0x2b08f994, 0x68487058, 0xfd458f19, 0x6cde9487, 0xf87b52b7, 0xd373ab23, 0x024b72e2, 0x8f1fe357, 0xab55662a, 0x28ebb207, 0xc2b52f03, 0x7bc5869a, 0x0837d3a5, 0x872830f2, 0xa5bf23b2, 0x6a0302ba, 0x8216ed5c, 0x1ccf8a2b, 0xb479a792, 0xf207f3f0, 0xe2694ea1, 0xf4da65cd, 0xbe0506d5, 0x6234d11f, 0xfea6c48a, 0x532e349d, 0x55f3a2a0, 0xe18a0532, 0xebf6a475, 0xec830b39, 0xef6040aa, 0x9f715e06, 0x106ebd51, 0x8a213ef9, 0x06dd963d, 0x053eddae, 0xbde64d46, 0x8d5491b5, 0x5dc47105, 0xd406046f, 0x155060ff, 0xfb981924, 0xe9bdd697, 0x434089cc, 0x9ed96777, 0x42e8b0bd, 0x8b890788, 0x5b19e738, 0xeec879db, 0x0a7ca147, 0x0f427ce9, 0x1e84f8c9, 0x00000000, 0x86800983, 0xed2b3248, 0x70111eac, 0x725a6c4e, 0xff0efdfb, 0x38850f56, 0xd5ae3d1e, 0x392d3627, 0xd90f0a64, 0xa65c6821, 0x545b9bd1, 0x2e36243a, 0x670a0cb1, 0xe757930f, 0x96eeb4d2, 0x919b1b9e, 0xc5c0804f, 0x20dc61a2, 0x4b775a69, 0x1a121c16, 0xba93e20a, 0x2aa0c0e5, 0xe0223c43, 0x171b121d, 0x0d090e0b, 0xc78bf2ad, 0xa8b62db9, 0xa91e14c8, 0x19f15785, 0x0775af4c, 0xdd99eebb, 0x607fa3fd, 0x2601f79f, 0xf5725cbc, 0x3b6644c5, 0x7efb5b34, 0x29438b76, 0xc623cbdc, 0xfcedb668, 0xf1e4b863, 0xdc31d7ca, 0x85634210, 0x22971340, 0x11c68420, 0x244a857d, 0x3dbbd2f8, 0x32f9ae11, 0xa129c76d, 0x2f9e1d4b, 0x30b2dcf3, 0x52860dec, 0xe3c177d0, 0x16b32b6c, 0xb970a999, 0x489411fa, 0x64e94722, 0x8cfca8c4, 0x3ff0a01a, 0x2c7d56d8, 0x903322ef, 0x4e4987c7, 0xd138d9c1, 0xa2ca8cfe, 0x0bd49836, 0x81f5a6cf, 0xde7aa528, 0x8eb7da26, 0xbfad3fa4, 0x9d3a2ce4, 0x9278500d, 0xcc5f6a9b, 0x467e5462, 0x138df6c2, 0xb8d890e8, 0xf7392e5e, 0xafc382f5, 0x805d9fbe, 0x93d0697c, 0x2dd56fa9, 0x1225cfb3, 0x99acc83b, 0x7d1810a7, 0x639ce86e, 0xbb3bdb7b, 0x7826cd09, 0x18596ef4, 0xb79aec01, 0x9a4f83a8, 0x6e95e665, 0xe6ffaa7e, 0xcfbc2108, 0xe815efe6, 0x9be7bad9, 0x366f4ace, 0x099fead4, 0x7cb029d6, 0xb2a431af, 0x233f2a31, 0x94a5c630, 0x66a235c0, 0xbc4e7437, 0xca82fca6, 0xd090e0b0, 0xd8a73315, 0x9804f14a, 0xdaec41f7, 0x50cd7f0e, 0xf691172f, 0xd64d768d, 0xb0ef434d, 0x4daacc54, 0x0496e4df, 0xb5d19ee3, 0x886a4c1b, 0x1f2cc1b8, 0x5165467f, 0xea5e9d04, 0x358c015d, 0x7487fa73, 0x410bfb2e, 0x1d67b35a, 0xd2db9252, 0x5610e933, 0x47d66d13, 0x61d79a8c, 0x0ca1377a, 0x14f8598e, 0x3c13eb89, 0x27a9ceee, 0xc961b735, 0xe51ce1ed, 0xb1477a3c, 0xdfd29c59, 0x73f2553f, 0xce141879, 0x37c773bf, 0xcdf753ea, 0xaafd5f5b, 0x6f3ddf14, 0xdb447886, 0xf3afca81, 0xc468b93e, 0x3424382c, 0x40a3c25f, 0xc31d1672, 0x25e2bc0c, 0x493c288b, 0x950dff41, 0x01a83971, 0xb30c08de, 0xe4b4d89c, 0xc1566490, 0x84cb7b61, 0xb632d570, 0x5c6c4874, 0x57b8d042 }; private static final int[] Tinv2 = { 0xf45150a7, 0x417e5365, 0x171ac3a4, 0x273a965e, 0xab3bcb6b, 0x9d1ff145, 0xfaacab58, 0xe34b9303, 0x302055fa, 0x76adf66d, 0xcc889176, 0x02f5254c, 0xe54ffcd7, 0x2ac5d7cb, 0x35268044, 0x62b58fa3, 0xb1de495a, 0xba25671b, 0xea45980e, 0xfe5de1c0, 0x2fc30275, 0x4c8112f0, 0x468da397, 0xd36bc6f9, 0x8f03e75f, 0x9215959c, 0x6dbfeb7a, 0x5295da59, 0xbed42d83, 0x7458d321, 0xe0492969, 0xc98e44c8, 0xc2756a89, 0x8ef47879, 0x58996b3e, 0xb927dd71, 0xe1beb64f, 0x88f017ad, 0x20c966ac, 0xce7db43a, 0xdf63184a, 0x1ae58231, 0x51976033, 0x5362457f, 0x64b1e077, 0x6bbb84ae, 0x81fe1ca0, 0x08f9942b, 0x48705868, 0x458f19fd, 0xde94876c, 0x7b52b7f8, 0x73ab23d3, 0x4b72e202, 0x1fe3578f, 0x55662aab, 0xebb20728, 0xb52f03c2, 0xc5869a7b, 0x37d3a508, 0x2830f287, 0xbf23b2a5, 0x0302ba6a, 0x16ed5c82, 0xcf8a2b1c, 0x79a792b4, 0x07f3f0f2, 0x694ea1e2, 0xda65cdf4, 0x0506d5be, 0x34d11f62, 0xa6c48afe, 0x2e349d53, 0xf3a2a055, 0x8a0532e1, 0xf6a475eb, 0x830b39ec, 0x6040aaef, 0x715e069f, 0x6ebd5110, 0x213ef98a, 0xdd963d06, 0x3eddae05, 0xe64d46bd, 0x5491b58d, 0xc471055d, 0x06046fd4, 0x5060ff15, 0x981924fb, 0xbdd697e9, 0x4089cc43, 0xd967779e, 0xe8b0bd42, 0x8907888b, 0x19e7385b, 0xc879dbee, 0x7ca1470a, 0x427ce90f, 0x84f8c91e, 0x00000000, 0x80098386, 0x2b3248ed, 0x111eac70, 0x5a6c4e72, 0x0efdfbff, 0x850f5638, 0xae3d1ed5, 0x2d362739, 0x0f0a64d9, 0x5c6821a6, 0x5b9bd154, 0x36243a2e, 0x0a0cb167, 0x57930fe7, 0xeeb4d296, 0x9b1b9e91, 0xc0804fc5, 0xdc61a220, 0x775a694b, 0x121c161a, 0x93e20aba, 0xa0c0e52a, 0x223c43e0, 0x1b121d17, 0x090e0b0d, 0x8bf2adc7, 0xb62db9a8, 0x1e14c8a9, 0xf1578519, 0x75af4c07, 0x99eebbdd, 0x7fa3fd60, 0x01f79f26, 0x725cbcf5, 0x6644c53b, 0xfb5b347e, 0x438b7629, 0x23cbdcc6, 0xedb668fc, 0xe4b863f1, 0x31d7cadc, 0x63421085, 0x97134022, 0xc6842011, 0x4a857d24, 0xbbd2f83d, 0xf9ae1132, 0x29c76da1, 0x9e1d4b2f, 0xb2dcf330, 0x860dec52, 0xc177d0e3, 0xb32b6c16, 0x70a999b9, 0x9411fa48, 0xe9472264, 0xfca8c48c, 0xf0a01a3f, 0x7d56d82c, 0x3322ef90, 0x4987c74e, 0x38d9c1d1, 0xca8cfea2, 0xd498360b, 0xf5a6cf81, 0x7aa528de, 0xb7da268e, 0xad3fa4bf, 0x3a2ce49d, 0x78500d92, 0x5f6a9bcc, 0x7e546246, 0x8df6c213, 0xd890e8b8, 0x392e5ef7, 0xc382f5af, 0x5d9fbe80, 0xd0697c93, 0xd56fa92d, 0x25cfb312, 0xacc83b99, 0x1810a77d, 0x9ce86e63, 0x3bdb7bbb, 0x26cd0978, 0x596ef418, 0x9aec01b7, 0x4f83a89a, 0x95e6656e, 0xffaa7ee6, 0xbc2108cf, 0x15efe6e8, 0xe7bad99b, 0x6f4ace36, 0x9fead409, 0xb029d67c, 0xa431afb2, 0x3f2a3123, 0xa5c63094, 0xa235c066, 0x4e7437bc, 0x82fca6ca, 0x90e0b0d0, 0xa73315d8, 0x04f14a98, 0xec41f7da, 0xcd7f0e50, 0x91172ff6, 0x4d768dd6, 0xef434db0, 0xaacc544d, 0x96e4df04, 0xd19ee3b5, 0x6a4c1b88, 0x2cc1b81f, 0x65467f51, 0x5e9d04ea, 0x8c015d35, 0x87fa7374, 0x0bfb2e41, 0x67b35a1d, 0xdb9252d2, 0x10e93356, 0xd66d1347, 0xd79a8c61, 0xa1377a0c, 0xf8598e14, 0x13eb893c, 0xa9ceee27, 0x61b735c9, 0x1ce1ede5, 0x477a3cb1, 0xd29c59df, 0xf2553f73, 0x141879ce, 0xc773bf37, 0xf753eacd, 0xfd5f5baa, 0x3ddf146f, 0x447886db, 0xafca81f3, 0x68b93ec4, 0x24382c34, 0xa3c25f40, 0x1d1672c3, 0xe2bc0c25, 0x3c288b49, 0x0dff4195, 0xa8397101, 0x0c08deb3, 0xb4d89ce4, 0x566490c1, 0xcb7b6184, 0x32d570b6, 0x6c48745c, 0xb8d04257 }; private static final int[] Tinv3 = { 0x5150a7f4, 0x7e536541, 0x1ac3a417, 0x3a965e27, 0x3bcb6bab, 0x1ff1459d, 0xacab58fa, 0x4b9303e3, 0x2055fa30, 0xadf66d76, 0x889176cc, 0xf5254c02, 0x4ffcd7e5, 0xc5d7cb2a, 0x26804435, 0xb58fa362, 0xde495ab1, 0x25671bba, 0x45980eea, 0x5de1c0fe, 0xc302752f, 0x8112f04c, 0x8da39746, 0x6bc6f9d3, 0x03e75f8f, 0x15959c92, 0xbfeb7a6d, 0x95da5952, 0xd42d83be, 0x58d32174, 0x492969e0, 0x8e44c8c9, 0x756a89c2, 0xf478798e, 0x996b3e58, 0x27dd71b9, 0xbeb64fe1, 0xf017ad88, 0xc966ac20, 0x7db43ace, 0x63184adf, 0xe582311a, 0x97603351, 0x62457f53, 0xb1e07764, 0xbb84ae6b, 0xfe1ca081, 0xf9942b08, 0x70586848, 0x8f19fd45, 0x94876cde, 0x52b7f87b, 0xab23d373, 0x72e2024b, 0xe3578f1f, 0x662aab55, 0xb20728eb, 0x2f03c2b5, 0x869a7bc5, 0xd3a50837, 0x30f28728, 0x23b2a5bf, 0x02ba6a03, 0xed5c8216, 0x8a2b1ccf, 0xa792b479, 0xf3f0f207, 0x4ea1e269, 0x65cdf4da, 0x06d5be05, 0xd11f6234, 0xc48afea6, 0x349d532e, 0xa2a055f3, 0x0532e18a, 0xa475ebf6, 0x0b39ec83, 0x40aaef60, 0x5e069f71, 0xbd51106e, 0x3ef98a21, 0x963d06dd, 0xddae053e, 0x4d46bde6, 0x91b58d54, 0x71055dc4, 0x046fd406, 0x60ff1550, 0x1924fb98, 0xd697e9bd, 0x89cc4340, 0x67779ed9, 0xb0bd42e8, 0x07888b89, 0xe7385b19, 0x79dbeec8, 0xa1470a7c, 0x7ce90f42, 0xf8c91e84, 0x00000000, 0x09838680, 0x3248ed2b, 0x1eac7011, 0x6c4e725a, 0xfdfbff0e, 0x0f563885, 0x3d1ed5ae, 0x3627392d, 0x0a64d90f, 0x6821a65c, 0x9bd1545b, 0x243a2e36, 0x0cb1670a, 0x930fe757, 0xb4d296ee, 0x1b9e919b, 0x804fc5c0, 0x61a220dc, 0x5a694b77, 0x1c161a12, 0xe20aba93, 0xc0e52aa0, 0x3c43e022, 0x121d171b, 0x0e0b0d09, 0xf2adc78b, 0x2db9a8b6, 0x14c8a91e, 0x578519f1, 0xaf4c0775, 0xeebbdd99, 0xa3fd607f, 0xf79f2601, 0x5cbcf572, 0x44c53b66, 0x5b347efb, 0x8b762943, 0xcbdcc623, 0xb668fced, 0xb863f1e4, 0xd7cadc31, 0x42108563, 0x13402297, 0x842011c6, 0x857d244a, 0xd2f83dbb, 0xae1132f9, 0xc76da129, 0x1d4b2f9e, 0xdcf330b2, 0x0dec5286, 0x77d0e3c1, 0x2b6c16b3, 0xa999b970, 0x11fa4894, 0x472264e9, 0xa8c48cfc, 0xa01a3ff0, 0x56d82c7d, 0x22ef9033, 0x87c74e49, 0xd9c1d138, 0x8cfea2ca, 0x98360bd4, 0xa6cf81f5, 0xa528de7a, 0xda268eb7, 0x3fa4bfad, 0x2ce49d3a, 0x500d9278, 0x6a9bcc5f, 0x5462467e, 0xf6c2138d, 0x90e8b8d8, 0x2e5ef739, 0x82f5afc3, 0x9fbe805d, 0x697c93d0, 0x6fa92dd5, 0xcfb31225, 0xc83b99ac, 0x10a77d18, 0xe86e639c, 0xdb7bbb3b, 0xcd097826, 0x6ef41859, 0xec01b79a, 0x83a89a4f, 0xe6656e95, 0xaa7ee6ff, 0x2108cfbc, 0xefe6e815, 0xbad99be7, 0x4ace366f, 0xead4099f, 0x29d67cb0, 0x31afb2a4, 0x2a31233f, 0xc63094a5, 0x35c066a2, 0x7437bc4e, 0xfca6ca82, 0xe0b0d090, 0x3315d8a7, 0xf14a9804, 0x41f7daec, 0x7f0e50cd, 0x172ff691, 0x768dd64d, 0x434db0ef, 0xcc544daa, 0xe4df0496, 0x9ee3b5d1, 0x4c1b886a, 0xc1b81f2c, 0x467f5165, 0x9d04ea5e, 0x015d358c, 0xfa737487, 0xfb2e410b, 0xb35a1d67, 0x9252d2db, 0xe9335610, 0x6d1347d6, 0x9a8c61d7, 0x377a0ca1, 0x598e14f8, 0xeb893c13, 0xceee27a9, 0xb735c961, 0xe1ede51c, 0x7a3cb147, 0x9c59dfd2, 0x553f73f2, 0x1879ce14, 0x73bf37c7, 0x53eacdf7, 0x5f5baafd, 0xdf146f3d, 0x7886db44, 0xca81f3af, 0xb93ec468, 0x382c3424, 0xc25f40a3, 0x1672c31d, 0xbc0c25e2, 0x288b493c, 0xff41950d, 0x397101a8, 0x08deb30c, 0xd89ce4b4, 0x6490c156, 0x7b6184cb, 0xd570b632, 0x48745c6c, 0xd04257b8 }; private final int shift(int r, int shift) { return (((r >>> shift) | (r << (32 - shift)))); } /* multiply four bytes in GF(2^8) by 'x' {02} in parallel */ private static final int m1 = 0x80808080; private static final int m2 = 0x7f7f7f7f; private static final int m3 = 0x0000001b; private final int FFmulX(int x) { return (((x & m2) << 1) ^ (((x & m1) >>> 7) * m3)); } /* * The following defines provide alternative definitions of FFmulX that * might give improved performance if a fast 32-bit multiply is not * available. * * private int FFmulX(int x) { int u = x & m1; u |= (u >> 1); return ((x & * m2) < < 1) ^ ((u >>> 3) | (u >>> 6)); } private static final int m4 = * 0x1b1b1b1b; private int FFmulX(int x) { int u = x & m1; return ((x & m2) < < * 1) ^ ((u - (u >>> 7)) & m4); } * */ private final int inv_mcol(int x) { int f2 = FFmulX(x); int f4 = FFmulX(f2); int f8 = FFmulX(f4); int f9 = x ^ f8; return f2 ^ f4 ^ f8 ^ shift(f2 ^ f9, 8) ^ shift(f4 ^ f9, 16) ^ shift(f9, 24); } private final int subWord(int x) { return (S[x & 255] & 255 | ((S[(x >> 8) & 255] & 255) << 8) | ((S[(x >> 16) & 255] & 255) << 16) | S[(x >> 24) & 255] << 24); } /** * Calculate the necessary round keys The number of calculations depends on * key size and block size AES specified a fixed block size of 128 bits and * key sizes 128/192/256 bits This code is written assuming those are the * only possible values */ private final int[][] generateWorkingKey(byte[] key, boolean forEncryption) { int KC = key.length / 4; // key length in words int t; if (((KC != 4) && (KC != 6) && (KC != 8)) || ((KC * 4) != key.length)) { throw new IllegalArgumentException("Key length not 128/192/256 bits."); } ROUNDS = KC + 6; // This is not always true for the generalized // Rijndael that allows larger block sizes int[][] W = new int[ROUNDS + 1][4]; // 4 words in a block // // copy the key into the round key array // t = 0; for (int i = 0; i < key.length; t++) { W[t >> 2][t & 3] = (key[i] & 0xff) | ((key[i + 1] & 0xff) << 8) | ((key[i + 2] & 0xff) << 16) | (key[i + 3] << 24); i += 4; } // // while not enough round key material calculated // calculate new values // int k = (ROUNDS + 1) << 2; for (int i = KC; (i < k); i++) { int temp = W[(i - 1) >> 2][(i - 1) & 3]; if ((i % KC) == 0) { temp = subWord(shift(temp, 8)) ^ rcon[(i / KC) - 1]; } else if ((KC > 6) && ((i % KC) == 4)) { temp = subWord(temp); } W[i >> 2][i & 3] = W[(i - KC) >> 2][(i - KC) & 3] ^ temp; } if (!forEncryption) { for (int j = 1; j < ROUNDS; j++) { for (int i = 0; i < 4; i++) { W[j][i] = inv_mcol(W[j][i]); } } } return W; } private int ROUNDS; private int[][] WorkingKey = null; private int C0, C1, C2, C3; private boolean doEncrypt; private static final int BLOCK_SIZE = 16; /** * default constructor - 128 bit block size. */ public AES() { } /** * initialise an AES cipher. * * @param forEncryption * whether or not we are for encryption. * @param key * the key required to set up the cipher. * @exception IllegalArgumentException * if the params argument is inappropriate. */ public final void init(boolean forEncryption, byte[] key) { WorkingKey = generateWorkingKey(key, forEncryption); this.doEncrypt = forEncryption; } public final String getAlgorithmName() { return "AES"; } public final int getBlockSize() { return BLOCK_SIZE; } public final int processBlock(byte[] in, int inOff, byte[] out, int outOff) { if (WorkingKey == null) { throw new IllegalStateException("AES engine not initialised"); } if ((inOff + (32 / 2)) > in.length) { throw new IllegalArgumentException("input buffer too short"); } if ((outOff + (32 / 2)) > out.length) { throw new IllegalArgumentException("output buffer too short"); } if (doEncrypt) { unpackBlock(in, inOff); encryptBlock(WorkingKey); packBlock(out, outOff); } else { unpackBlock(in, inOff); decryptBlock(WorkingKey); packBlock(out, outOff); } return BLOCK_SIZE; } public final void reset() { } private final void unpackBlock(byte[] bytes, int off) { int index = off; C0 = (bytes[index++] & 0xff); C0 |= (bytes[index++] & 0xff) << 8; C0 |= (bytes[index++] & 0xff) << 16; C0 |= bytes[index++] << 24; C1 = (bytes[index++] & 0xff); C1 |= (bytes[index++] & 0xff) << 8; C1 |= (bytes[index++] & 0xff) << 16; C1 |= bytes[index++] << 24; C2 = (bytes[index++] & 0xff); C2 |= (bytes[index++] & 0xff) << 8; C2 |= (bytes[index++] & 0xff) << 16; C2 |= bytes[index++] << 24; C3 = (bytes[index++] & 0xff); C3 |= (bytes[index++] & 0xff) << 8; C3 |= (bytes[index++] & 0xff) << 16; C3 |= bytes[index++] << 24; } private final void packBlock(byte[] bytes, int off) { int index = off; bytes[index++] = (byte) C0; bytes[index++] = (byte) (C0 >> 8); bytes[index++] = (byte) (C0 >> 16); bytes[index++] = (byte) (C0 >> 24); bytes[index++] = (byte) C1; bytes[index++] = (byte) (C1 >> 8); bytes[index++] = (byte) (C1 >> 16); bytes[index++] = (byte) (C1 >> 24); bytes[index++] = (byte) C2; bytes[index++] = (byte) (C2 >> 8); bytes[index++] = (byte) (C2 >> 16); bytes[index++] = (byte) (C2 >> 24); bytes[index++] = (byte) C3; bytes[index++] = (byte) (C3 >> 8); bytes[index++] = (byte) (C3 >> 16); bytes[index++] = (byte) (C3 >> 24); } private final void encryptBlock(int[][] KW) { int r, r0, r1, r2, r3; C0 ^= KW[0][0]; C1 ^= KW[0][1]; C2 ^= KW[0][2]; C3 ^= KW[0][3]; for (r = 1; r < ROUNDS - 1;) { r0 = T0[C0 & 255] ^ T1[(C1 >> 8) & 255] ^ T2[(C2 >> 16) & 255] ^ T3[(C3 >> 24) & 255] ^ KW[r][0]; r1 = T0[C1 & 255] ^ T1[(C2 >> 8) & 255] ^ T2[(C3 >> 16) & 255] ^ T3[(C0 >> 24) & 255] ^ KW[r][1]; r2 = T0[C2 & 255] ^ T1[(C3 >> 8) & 255] ^ T2[(C0 >> 16) & 255] ^ T3[(C1 >> 24) & 255] ^ KW[r][2]; r3 = T0[C3 & 255] ^ T1[(C0 >> 8) & 255] ^ T2[(C1 >> 16) & 255] ^ T3[(C2 >> 24) & 255] ^ KW[r++][3]; C0 = T0[r0 & 255] ^ T1[(r1 >> 8) & 255] ^ T2[(r2 >> 16) & 255] ^ T3[(r3 >> 24) & 255] ^ KW[r][0]; C1 = T0[r1 & 255] ^ T1[(r2 >> 8) & 255] ^ T2[(r3 >> 16) & 255] ^ T3[(r0 >> 24) & 255] ^ KW[r][1]; C2 = T0[r2 & 255] ^ T1[(r3 >> 8) & 255] ^ T2[(r0 >> 16) & 255] ^ T3[(r1 >> 24) & 255] ^ KW[r][2]; C3 = T0[r3 & 255] ^ T1[(r0 >> 8) & 255] ^ T2[(r1 >> 16) & 255] ^ T3[(r2 >> 24) & 255] ^ KW[r++][3]; } r0 = T0[C0 & 255] ^ T1[(C1 >> 8) & 255] ^ T2[(C2 >> 16) & 255] ^ T3[(C3 >> 24) & 255] ^ KW[r][0]; r1 = T0[C1 & 255] ^ T1[(C2 >> 8) & 255] ^ T2[(C3 >> 16) & 255] ^ T3[(C0 >> 24) & 255] ^ KW[r][1]; r2 = T0[C2 & 255] ^ T1[(C3 >> 8) & 255] ^ T2[(C0 >> 16) & 255] ^ T3[(C1 >> 24) & 255] ^ KW[r][2]; r3 = T0[C3 & 255] ^ T1[(C0 >> 8) & 255] ^ T2[(C1 >> 16) & 255] ^ T3[(C2 >> 24) & 255] ^ KW[r++][3]; // the final round's table is a simple function of S so we don't use a // whole other four tables for it C0 = (S[r0 & 255] & 255) ^ ((S[(r1 >> 8) & 255] & 255) << 8) ^ ((S[(r2 >> 16) & 255] & 255) << 16) ^ (S[(r3 >> 24) & 255] << 24) ^ KW[r][0]; C1 = (S[r1 & 255] & 255) ^ ((S[(r2 >> 8) & 255] & 255) << 8) ^ ((S[(r3 >> 16) & 255] & 255) << 16) ^ (S[(r0 >> 24) & 255] << 24) ^ KW[r][1]; C2 = (S[r2 & 255] & 255) ^ ((S[(r3 >> 8) & 255] & 255) << 8) ^ ((S[(r0 >> 16) & 255] & 255) << 16) ^ (S[(r1 >> 24) & 255] << 24) ^ KW[r][2]; C3 = (S[r3 & 255] & 255) ^ ((S[(r0 >> 8) & 255] & 255) << 8) ^ ((S[(r1 >> 16) & 255] & 255) << 16) ^ (S[(r2 >> 24) & 255] << 24) ^ KW[r][3]; } private final void decryptBlock(int[][] KW) { int r, r0, r1, r2, r3; C0 ^= KW[ROUNDS][0]; C1 ^= KW[ROUNDS][1]; C2 ^= KW[ROUNDS][2]; C3 ^= KW[ROUNDS][3]; for (r = ROUNDS - 1; r > 1;) { r0 = Tinv0[C0 & 255] ^ Tinv1[(C3 >> 8) & 255] ^ Tinv2[(C2 >> 16) & 255] ^ Tinv3[(C1 >> 24) & 255] ^ KW[r][0]; r1 = Tinv0[C1 & 255] ^ Tinv1[(C0 >> 8) & 255] ^ Tinv2[(C3 >> 16) & 255] ^ Tinv3[(C2 >> 24) & 255] ^ KW[r][1]; r2 = Tinv0[C2 & 255] ^ Tinv1[(C1 >> 8) & 255] ^ Tinv2[(C0 >> 16) & 255] ^ Tinv3[(C3 >> 24) & 255] ^ KW[r][2]; r3 = Tinv0[C3 & 255] ^ Tinv1[(C2 >> 8) & 255] ^ Tinv2[(C1 >> 16) & 255] ^ Tinv3[(C0 >> 24) & 255] ^ KW[r--][3]; C0 = Tinv0[r0 & 255] ^ Tinv1[(r3 >> 8) & 255] ^ Tinv2[(r2 >> 16) & 255] ^ Tinv3[(r1 >> 24) & 255] ^ KW[r][0]; C1 = Tinv0[r1 & 255] ^ Tinv1[(r0 >> 8) & 255] ^ Tinv2[(r3 >> 16) & 255] ^ Tinv3[(r2 >> 24) & 255] ^ KW[r][1]; C2 = Tinv0[r2 & 255] ^ Tinv1[(r1 >> 8) & 255] ^ Tinv2[(r0 >> 16) & 255] ^ Tinv3[(r3 >> 24) & 255] ^ KW[r][2]; C3 = Tinv0[r3 & 255] ^ Tinv1[(r2 >> 8) & 255] ^ Tinv2[(r1 >> 16) & 255] ^ Tinv3[(r0 >> 24) & 255] ^ KW[r--][3]; } r0 = Tinv0[C0 & 255] ^ Tinv1[(C3 >> 8) & 255] ^ Tinv2[(C2 >> 16) & 255] ^ Tinv3[(C1 >> 24) & 255] ^ KW[r][0]; r1 = Tinv0[C1 & 255] ^ Tinv1[(C0 >> 8) & 255] ^ Tinv2[(C3 >> 16) & 255] ^ Tinv3[(C2 >> 24) & 255] ^ KW[r][1]; r2 = Tinv0[C2 & 255] ^ Tinv1[(C1 >> 8) & 255] ^ Tinv2[(C0 >> 16) & 255] ^ Tinv3[(C3 >> 24) & 255] ^ KW[r][2]; r3 = Tinv0[C3 & 255] ^ Tinv1[(C2 >> 8) & 255] ^ Tinv2[(C1 >> 16) & 255] ^ Tinv3[(C0 >> 24) & 255] ^ KW[r--][3]; // the final round's table is a simple function of Si so we don't use a // whole other four tables for it C0 = (Si[r0 & 255] & 255) ^ ((Si[(r3 >> 8) & 255] & 255) << 8) ^ ((Si[(r2 >> 16) & 255] & 255) << 16) ^ (Si[(r1 >> 24) & 255] << 24) ^ KW[0][0]; C1 = (Si[r1 & 255] & 255) ^ ((Si[(r0 >> 8) & 255] & 255) << 8) ^ ((Si[(r3 >> 16) & 255] & 255) << 16) ^ (Si[(r2 >> 24) & 255] << 24) ^ KW[0][1]; C2 = (Si[r2 & 255] & 255) ^ ((Si[(r1 >> 8) & 255] & 255) << 8) ^ ((Si[(r0 >> 16) & 255] & 255) << 16) ^ (Si[(r3 >> 24) & 255] << 24) ^ KW[0][2]; C3 = (Si[r3 & 255] & 255) ^ ((Si[(r2 >> 8) & 255] & 255) << 8) ^ ((Si[(r1 >> 16) & 255] & 255) << 16) ^ (Si[(r0 >> 24) & 255] << 24) ^ KW[0][3]; } public void transformBlock(byte[] src, int srcoff, byte[] dst, int dstoff) { processBlock(src, srcoff, dst, dstoff); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/AES.java
Java
asf20
45,563
package com.trilead.ssh2.crypto.cipher; import java.io.IOException; import java.io.OutputStream; /** * CipherOutputStream. * * @author Christian Plattner, plattner@trilead.com * @version $Id: CipherOutputStream.java,v 1.1 2007/10/15 12:49:55 cplattne Exp $ */ public class CipherOutputStream { BlockCipher currentCipher; OutputStream bo; byte[] buffer; byte[] enc; int blockSize; int pos; /* * We cannot use java.io.BufferedOutputStream, since that is not available * in J2ME. Everything could be improved here alot. */ final int BUFF_SIZE = 2048; byte[] out_buffer = new byte[BUFF_SIZE]; int out_buffer_pos = 0; public CipherOutputStream(BlockCipher tc, OutputStream bo) { this.bo = bo; changeCipher(tc); } private void internal_write(byte[] src, int off, int len) throws IOException { while (len > 0) { int space = BUFF_SIZE - out_buffer_pos; int copy = (len > space) ? space : len; System.arraycopy(src, off, out_buffer, out_buffer_pos, copy); off += copy; out_buffer_pos += copy; len -= copy; if (out_buffer_pos >= BUFF_SIZE) { bo.write(out_buffer, 0, BUFF_SIZE); out_buffer_pos = 0; } } } private void internal_write(int b) throws IOException { out_buffer[out_buffer_pos++] = (byte) b; if (out_buffer_pos >= BUFF_SIZE) { bo.write(out_buffer, 0, BUFF_SIZE); out_buffer_pos = 0; } } public void flush() throws IOException { if (pos != 0) throw new IOException("FATAL: cannot flush since crypto buffer is not aligned."); if (out_buffer_pos > 0) { bo.write(out_buffer, 0, out_buffer_pos); out_buffer_pos = 0; } bo.flush(); } public void changeCipher(BlockCipher bc) { this.currentCipher = bc; blockSize = bc.getBlockSize(); buffer = new byte[blockSize]; enc = new byte[blockSize]; pos = 0; } private void writeBlock() throws IOException { try { currentCipher.transformBlock(buffer, 0, enc, 0); } catch (Exception e) { throw (IOException) new IOException("Error while decrypting block.").initCause(e); } internal_write(enc, 0, blockSize); pos = 0; } public void write(byte[] src, int off, int len) throws IOException { while (len > 0) { int avail = blockSize - pos; int copy = Math.min(avail, len); System.arraycopy(src, off, buffer, pos, copy); pos += copy; off += copy; len -= copy; if (pos >= blockSize) writeBlock(); } } public void write(int b) throws IOException { buffer[pos++] = (byte) b; if (pos >= blockSize) writeBlock(); } public void writePlain(int b) throws IOException { if (pos != 0) throw new IOException("Cannot write plain since crypto buffer is not aligned."); internal_write(b); } public void writePlain(byte[] b, int off, int len) throws IOException { if (pos != 0) throw new IOException("Cannot write plain since crypto buffer is not aligned."); internal_write(b, off, len); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/cipher/CipherOutputStream.java
Java
asf20
3,080
package com.trilead.ssh2.crypto.dh; import java.io.UnsupportedEncodingException; import java.math.BigInteger; import java.security.SecureRandom; import com.trilead.ssh2.crypto.digest.HashForSSH2Types; import com.trilead.ssh2.log.Logger; /** * DhExchange. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DhExchange.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class DhExchange { private static final Logger log = Logger.getLogger(DhExchange.class); /* Given by the standard */ static final BigInteger p1, p14; static final BigInteger g; BigInteger p; /* Client public and private */ BigInteger e; BigInteger x; /* Server public */ BigInteger f; /* Shared secret */ BigInteger k; static { final String p1_string = "17976931348623159077083915679378745319786029604875" + "60117064444236841971802161585193689478337958649255415021805654859805036464" + "40548199239100050792877003355816639229553136239076508735759914822574862575" + "00742530207744771258955095793777842444242661733472762929938766870920560605" + "0270810842907692932019128194467627007"; final String p14_string = "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129" + "024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0" + "A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB" + "6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3DC2007CB8A" + "163BF0598DA48361C55D39A69163FA8FD24CF5F83655D23DCA3AD961C62F356208" + "552BB9ED529077096966D670C354E4ABC9804F1746C08CA18217C32905E462E36C" + "E3BE39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9DE2BCBF69558171" + "83995497CEA956AE515D2261898FA051015728E5A8AACAA68FFFFFFFFFFFFFFFF"; p1 = new BigInteger(p1_string); p14 = new BigInteger(p14_string, 16); g = new BigInteger("2"); } public DhExchange() { } public void init(int group, SecureRandom rnd) { k = null; if (group == 1) p = p1; else if (group == 14) p = p14; else throw new IllegalArgumentException("Unknown DH group " + group); x = new BigInteger(p.bitLength() - 1, rnd); e = g.modPow(x, p); } /** * @return Returns the e. * @throws IllegalStateException */ public BigInteger getE() { if (e == null) throw new IllegalStateException("DhDsaExchange not initialized!"); return e; } /** * @return Returns the shared secret k. * @throws IllegalStateException */ public BigInteger getK() { if (k == null) throw new IllegalStateException("Shared secret not yet known, need f first!"); return k; } /** * @param f */ public void setF(BigInteger f) { if (e == null) throw new IllegalStateException("DhDsaExchange not initialized!"); BigInteger zero = BigInteger.valueOf(0); if (zero.compareTo(f) >= 0 || p.compareTo(f) <= 0) throw new IllegalArgumentException("Invalid f specified!"); this.f = f; this.k = f.modPow(x, p); } public byte[] calculateH(byte[] clientversion, byte[] serverversion, byte[] clientKexPayload, byte[] serverKexPayload, byte[] hostKey) throws UnsupportedEncodingException { HashForSSH2Types hash = new HashForSSH2Types("SHA1"); if (log.isEnabled()) { log.log(90, "Client: '" + new String(clientversion, "ISO-8859-1") + "'"); log.log(90, "Server: '" + new String(serverversion, "ISO-8859-1") + "'"); } hash.updateByteString(clientversion); hash.updateByteString(serverversion); hash.updateByteString(clientKexPayload); hash.updateByteString(serverKexPayload); hash.updateByteString(hostKey); hash.updateBigInt(e); hash.updateBigInt(f); hash.updateBigInt(k); return hash.getDigest(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/dh/DhExchange.java
Java
asf20
3,808
package com.trilead.ssh2.crypto.dh; import java.math.BigInteger; import java.security.SecureRandom; import com.trilead.ssh2.DHGexParameters; import com.trilead.ssh2.crypto.digest.HashForSSH2Types; /** * DhGroupExchange. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DhGroupExchange.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class DhGroupExchange { /* Given by the standard */ private BigInteger p; private BigInteger g; /* Client public and private */ private BigInteger e; private BigInteger x; /* Server public */ private BigInteger f; /* Shared secret */ private BigInteger k; public DhGroupExchange(BigInteger p, BigInteger g) { this.p = p; this.g = g; } public void init(SecureRandom rnd) { k = null; x = new BigInteger(p.bitLength() - 1, rnd); e = g.modPow(x, p); } /** * @return Returns the e. */ public BigInteger getE() { if (e == null) throw new IllegalStateException("Not initialized!"); return e; } /** * @return Returns the shared secret k. */ public BigInteger getK() { if (k == null) throw new IllegalStateException("Shared secret not yet known, need f first!"); return k; } /** * Sets f and calculates the shared secret. */ public void setF(BigInteger f) { if (e == null) throw new IllegalStateException("Not initialized!"); BigInteger zero = BigInteger.valueOf(0); if (zero.compareTo(f) >= 0 || p.compareTo(f) <= 0) throw new IllegalArgumentException("Invalid f specified!"); this.f = f; this.k = f.modPow(x, p); } public byte[] calculateH(byte[] clientversion, byte[] serverversion, byte[] clientKexPayload, byte[] serverKexPayload, byte[] hostKey, DHGexParameters para) { HashForSSH2Types hash = new HashForSSH2Types("SHA1"); hash.updateByteString(clientversion); hash.updateByteString(serverversion); hash.updateByteString(clientKexPayload); hash.updateByteString(serverKexPayload); hash.updateByteString(hostKey); if (para.getMin_group_len() > 0) hash.updateUINT32(para.getMin_group_len()); hash.updateUINT32(para.getPref_group_len()); if (para.getMax_group_len() > 0) hash.updateUINT32(para.getMax_group_len()); hash.updateBigInt(p); hash.updateBigInt(g); hash.updateBigInt(e); hash.updateBigInt(f); hash.updateBigInt(k); return hash.getDigest(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/dh/DhGroupExchange.java
Java
asf20
2,477
package com.trilead.ssh2.crypto; /** * Parsed PEM structure. * * @author Christian Plattner, plattner@trilead.com * @version $Id: PEMStructure.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class PEMStructure { public int pemType; String dekInfo[]; String procType[]; public byte[] data; }
zzsuper001-linuxshell
src/com/trilead/ssh2/crypto/PEMStructure.java
Java
asf20
327
package com.trilead.ssh2.auth; import java.io.IOException; import java.security.SecureRandom; import java.util.Vector; import com.trilead.ssh2.InteractiveCallback; import com.trilead.ssh2.crypto.PEMDecoder; import com.trilead.ssh2.packets.PacketServiceAccept; import com.trilead.ssh2.packets.PacketServiceRequest; import com.trilead.ssh2.packets.PacketUserauthBanner; import com.trilead.ssh2.packets.PacketUserauthFailure; import com.trilead.ssh2.packets.PacketUserauthInfoRequest; import com.trilead.ssh2.packets.PacketUserauthInfoResponse; import com.trilead.ssh2.packets.PacketUserauthRequestInteractive; import com.trilead.ssh2.packets.PacketUserauthRequestNone; import com.trilead.ssh2.packets.PacketUserauthRequestPassword; import com.trilead.ssh2.packets.PacketUserauthRequestPublicKey; import com.trilead.ssh2.packets.Packets; import com.trilead.ssh2.packets.TypesWriter; import com.trilead.ssh2.signature.DSAPrivateKey; import com.trilead.ssh2.signature.DSASHA1Verify; import com.trilead.ssh2.signature.DSASignature; import com.trilead.ssh2.signature.RSAPrivateKey; import com.trilead.ssh2.signature.RSASHA1Verify; import com.trilead.ssh2.signature.RSASignature; import com.trilead.ssh2.transport.MessageHandler; import com.trilead.ssh2.transport.TransportManager; /** * AuthenticationManager. * * @author Christian Plattner, plattner@trilead.com * @version $Id: AuthenticationManager.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class AuthenticationManager implements MessageHandler { TransportManager tm; Vector packets = new Vector(); boolean connectionClosed = false; String banner; String[] remainingMethods = new String[0]; boolean isPartialSuccess = false; boolean authenticated = false; boolean initDone = false; public AuthenticationManager(TransportManager tm) { this.tm = tm; } boolean methodPossible(String methName) { if (remainingMethods == null) return false; for (int i = 0; i < remainingMethods.length; i++) { if (remainingMethods[i].compareTo(methName) == 0) return true; } return false; } byte[] deQueue() throws IOException { synchronized (packets) { while (packets.size() == 0) { if (connectionClosed) throw (IOException) new IOException("The connection is closed.").initCause(tm .getReasonClosedCause()); try { packets.wait(); } catch (InterruptedException ign) { } } /* This sequence works with J2ME */ byte[] res = (byte[]) packets.firstElement(); packets.removeElementAt(0); return res; } } byte[] getNextMessage() throws IOException { while (true) { byte[] msg = deQueue(); if (msg[0] != Packets.SSH_MSG_USERAUTH_BANNER) return msg; PacketUserauthBanner sb = new PacketUserauthBanner(msg, 0, msg.length); banner = sb.getBanner(); } } public String[] getRemainingMethods(String user) throws IOException { initialize(user); return remainingMethods; } public boolean getPartialSuccess() { return isPartialSuccess; } private boolean initialize(String user) throws IOException { if (initDone == false) { tm.registerMessageHandler(this, 0, 255); PacketServiceRequest sr = new PacketServiceRequest("ssh-userauth"); tm.sendMessage(sr.getPayload()); PacketUserauthRequestNone urn = new PacketUserauthRequestNone("ssh-connection", user); tm.sendMessage(urn.getPayload()); byte[] msg = getNextMessage(); new PacketServiceAccept(msg, 0, msg.length); msg = getNextMessage(); initDone = true; if (msg[0] == Packets.SSH_MSG_USERAUTH_SUCCESS) { authenticated = true; tm.removeMessageHandler(this, 0, 255); return true; } if (msg[0] == Packets.SSH_MSG_USERAUTH_FAILURE) { PacketUserauthFailure puf = new PacketUserauthFailure(msg, 0, msg.length); remainingMethods = puf.getAuthThatCanContinue(); isPartialSuccess = puf.isPartialSuccess(); return false; } throw new IOException("Unexpected SSH message (type " + msg[0] + ")"); } return authenticated; } public boolean authenticatePublicKey(String user, char[] PEMPrivateKey, String password, SecureRandom rnd) throws IOException { Object key = PEMDecoder.decode(PEMPrivateKey, password); return authenticatePublicKey(user, key, rnd); } public boolean authenticatePublicKey(String user, Object key, SecureRandom rnd) throws IOException { try { initialize(user); if (methodPossible("publickey") == false) throw new IOException("Authentication method publickey not supported by the server at this stage."); if (key instanceof DSAPrivateKey) { DSAPrivateKey pk = (DSAPrivateKey) key; byte[] pk_enc = DSASHA1Verify.encodeSSHDSAPublicKey(pk.getPublicKey()); TypesWriter tw = new TypesWriter(); byte[] H = tm.getSessionIdentifier(); tw.writeString(H, 0, H.length); tw.writeByte(Packets.SSH_MSG_USERAUTH_REQUEST); tw.writeString(user); tw.writeString("ssh-connection"); tw.writeString("publickey"); tw.writeBoolean(true); tw.writeString("ssh-dss"); tw.writeString(pk_enc, 0, pk_enc.length); byte[] msg = tw.getBytes(); DSASignature ds = DSASHA1Verify.generateSignature(msg, pk, rnd); byte[] ds_enc = DSASHA1Verify.encodeSSHDSASignature(ds); PacketUserauthRequestPublicKey ua = new PacketUserauthRequestPublicKey("ssh-connection", user, "ssh-dss", pk_enc, ds_enc); tm.sendMessage(ua.getPayload()); } else if (key instanceof RSAPrivateKey) { RSAPrivateKey pk = (RSAPrivateKey) key; byte[] pk_enc = RSASHA1Verify.encodeSSHRSAPublicKey(pk.getPublicKey()); TypesWriter tw = new TypesWriter(); { byte[] H = tm.getSessionIdentifier(); tw.writeString(H, 0, H.length); tw.writeByte(Packets.SSH_MSG_USERAUTH_REQUEST); tw.writeString(user); tw.writeString("ssh-connection"); tw.writeString("publickey"); tw.writeBoolean(true); tw.writeString("ssh-rsa"); tw.writeString(pk_enc, 0, pk_enc.length); } byte[] msg = tw.getBytes(); RSASignature ds = RSASHA1Verify.generateSignature(msg, pk); byte[] rsa_sig_enc = RSASHA1Verify.encodeSSHRSASignature(ds); PacketUserauthRequestPublicKey ua = new PacketUserauthRequestPublicKey("ssh-connection", user, "ssh-rsa", pk_enc, rsa_sig_enc); tm.sendMessage(ua.getPayload()); } else { throw new IOException("Unknown private key type returned by the PEM decoder."); } byte[] ar = getNextMessage(); if (ar[0] == Packets.SSH_MSG_USERAUTH_SUCCESS) { authenticated = true; tm.removeMessageHandler(this, 0, 255); return true; } if (ar[0] == Packets.SSH_MSG_USERAUTH_FAILURE) { PacketUserauthFailure puf = new PacketUserauthFailure(ar, 0, ar.length); remainingMethods = puf.getAuthThatCanContinue(); isPartialSuccess = puf.isPartialSuccess(); return false; } throw new IOException("Unexpected SSH message (type " + ar[0] + ")"); } catch (IOException e) { e.printStackTrace(); tm.close(e, false); throw (IOException) new IOException("Publickey authentication failed.").initCause(e); } } public boolean authenticateNone(String user) throws IOException { try { initialize(user); return authenticated; } catch (IOException e) { tm.close(e, false); throw (IOException) new IOException("None authentication failed.").initCause(e); } } public boolean authenticatePassword(String user, String pass) throws IOException { try { initialize(user); if (methodPossible("password") == false) throw new IOException("Authentication method password not supported by the server at this stage."); PacketUserauthRequestPassword ua = new PacketUserauthRequestPassword("ssh-connection", user, pass); tm.sendMessage(ua.getPayload()); byte[] ar = getNextMessage(); if (ar[0] == Packets.SSH_MSG_USERAUTH_SUCCESS) { authenticated = true; tm.removeMessageHandler(this, 0, 255); return true; } if (ar[0] == Packets.SSH_MSG_USERAUTH_FAILURE) { PacketUserauthFailure puf = new PacketUserauthFailure(ar, 0, ar.length); remainingMethods = puf.getAuthThatCanContinue(); isPartialSuccess = puf.isPartialSuccess(); return false; } throw new IOException("Unexpected SSH message (type " + ar[0] + ")"); } catch (IOException e) { tm.close(e, false); throw (IOException) new IOException("Password authentication failed.").initCause(e); } } public boolean authenticateInteractive(String user, String[] submethods, InteractiveCallback cb) throws IOException { try { initialize(user); if (methodPossible("keyboard-interactive") == false) throw new IOException( "Authentication method keyboard-interactive not supported by the server at this stage."); if (submethods == null) submethods = new String[0]; PacketUserauthRequestInteractive ua = new PacketUserauthRequestInteractive("ssh-connection", user, submethods); tm.sendMessage(ua.getPayload()); while (true) { byte[] ar = getNextMessage(); if (ar[0] == Packets.SSH_MSG_USERAUTH_SUCCESS) { authenticated = true; tm.removeMessageHandler(this, 0, 255); return true; } if (ar[0] == Packets.SSH_MSG_USERAUTH_FAILURE) { PacketUserauthFailure puf = new PacketUserauthFailure(ar, 0, ar.length); remainingMethods = puf.getAuthThatCanContinue(); isPartialSuccess = puf.isPartialSuccess(); return false; } if (ar[0] == Packets.SSH_MSG_USERAUTH_INFO_REQUEST) { PacketUserauthInfoRequest pui = new PacketUserauthInfoRequest(ar, 0, ar.length); String[] responses; try { responses = cb.replyToChallenge(pui.getName(), pui.getInstruction(), pui.getNumPrompts(), pui .getPrompt(), pui.getEcho()); } catch (Exception e) { throw (IOException) new IOException("Exception in callback.").initCause(e); } if (responses == null) throw new IOException("Your callback may not return NULL!"); PacketUserauthInfoResponse puir = new PacketUserauthInfoResponse(responses); tm.sendMessage(puir.getPayload()); continue; } throw new IOException("Unexpected SSH message (type " + ar[0] + ")"); } } catch (IOException e) { tm.close(e, false); throw (IOException) new IOException("Keyboard-interactive authentication failed.").initCause(e); } } public void handleMessage(byte[] msg, int msglen) throws IOException { synchronized (packets) { if (msg == null) { connectionClosed = true; } else { byte[] tmp = new byte[msglen]; System.arraycopy(msg, 0, tmp, 0, msglen); packets.addElement(tmp); } packets.notifyAll(); if (packets.size() > 5) { connectionClosed = true; throw new IOException("Error, peer is flooding us with authentication packets."); } } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/auth/AuthenticationManager.java
Java
asf20
11,374
package com.trilead.ssh2; import java.io.IOException; import java.io.InputStream; /** * A <code>StreamGobbler</code> is an InputStream that uses an internal worker * thread to constantly consume input from another InputStream. It uses a buffer * to store the consumed data. The buffer size is automatically adjusted, if needed. * <p> * This class is sometimes very convenient - if you wrap a session's STDOUT and STDERR * InputStreams with instances of this class, then you don't have to bother about * the shared window of STDOUT and STDERR in the low level SSH-2 protocol, * since all arriving data will be immediatelly consumed by the worker threads. * Also, as a side effect, the streams will be buffered (e.g., single byte * read() operations are faster). * <p> * Other SSH for Java libraries include this functionality by default in * their STDOUT and STDERR InputStream implementations, however, please be aware * that this approach has also a downside: * <p> * If you do not call the StreamGobbler's <code>read()</code> method often enough * and the peer is constantly sending huge amounts of data, then you will sooner or later * encounter a low memory situation due to the aggregated data (well, it also depends on the Java heap size). * Joe Average will like this class anyway - a paranoid programmer would never use such an approach. * <p> * The term "StreamGobbler" was taken from an article called "When Runtime.exec() won't", * see http://www.javaworld.com/javaworld/jw-12-2000/jw-1229-traps.html. * * @author Christian Plattner, plattner@trilead.com * @version $Id: StreamGobbler.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class StreamGobbler extends InputStream { class GobblerThread extends Thread { public void run() { byte[] buff = new byte[8192]; while (true) { try { int avail = is.read(buff); synchronized (synchronizer) { if (avail <= 0) { isEOF = true; synchronizer.notifyAll(); break; } int space_available = buffer.length - write_pos; if (space_available < avail) { /* compact/resize buffer */ int unread_size = write_pos - read_pos; int need_space = unread_size + avail; byte[] new_buffer = buffer; if (need_space > buffer.length) { int inc = need_space / 3; inc = (inc < 256) ? 256 : inc; inc = (inc > 8192) ? 8192 : inc; new_buffer = new byte[need_space + inc]; } if (unread_size > 0) System.arraycopy(buffer, read_pos, new_buffer, 0, unread_size); buffer = new_buffer; read_pos = 0; write_pos = unread_size; } System.arraycopy(buff, 0, buffer, write_pos, avail); write_pos += avail; synchronizer.notifyAll(); } } catch (IOException e) { synchronized (synchronizer) { exception = e; synchronizer.notifyAll(); break; } } } } } private InputStream is; private GobblerThread t; private Object synchronizer = new Object(); private boolean isEOF = false; private boolean isClosed = false; private IOException exception = null; private byte[] buffer = new byte[2048]; private int read_pos = 0; private int write_pos = 0; public StreamGobbler(InputStream is) { this.is = is; t = new GobblerThread(); t.setDaemon(true); t.start(); } public int read() throws IOException { synchronized (synchronizer) { if (isClosed) throw new IOException("This StreamGobbler is closed."); while (read_pos == write_pos) { if (exception != null) throw exception; if (isEOF) return -1; try { synchronizer.wait(); } catch (InterruptedException e) { } } int b = buffer[read_pos++] & 0xff; return b; } } public int available() throws IOException { synchronized (synchronizer) { if (isClosed) throw new IOException("This StreamGobbler is closed."); return write_pos - read_pos; } } public int read(byte[] b) throws IOException { return read(b, 0, b.length); } public void close() throws IOException { synchronized (synchronizer) { if (isClosed) return; isClosed = true; isEOF = true; synchronizer.notifyAll(); is.close(); } } public int read(byte[] b, int off, int len) throws IOException { if (b == null) throw new NullPointerException(); if ((off < 0) || (len < 0) || ((off + len) > b.length) || ((off + len) < 0) || (off > b.length)) throw new IndexOutOfBoundsException(); if (len == 0) return 0; synchronized (synchronizer) { if (isClosed) throw new IOException("This StreamGobbler is closed."); while (read_pos == write_pos) { if (exception != null) throw exception; if (isEOF) return -1; try { synchronizer.wait(); } catch (InterruptedException e) { } } int avail = write_pos - read_pos; avail = (avail > len) ? len : avail; System.arraycopy(buffer, read_pos, b, off, avail); read_pos += avail; return avail; } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/StreamGobbler.java
Java
asf20
5,412
package com.trilead.ssh2; import java.io.IOException; /** * May be thrown upon connect() if a HTTP proxy is being used. * * @see Connection#connect() * @see Connection#setProxyData(ProxyData) * * @author Christian Plattner, plattner@trilead.com * @version $Id: HTTPProxyException.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class HTTPProxyException extends IOException { private static final long serialVersionUID = 2241537397104426186L; public final String httpResponse; public final int httpErrorCode; public HTTPProxyException(String httpResponse, int httpErrorCode) { super("HTTP Proxy Error (" + httpErrorCode + " " + httpResponse + ")"); this.httpResponse = httpResponse; this.httpErrorCode = httpErrorCode; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/HTTPProxyException.java
Java
asf20
787
package com.trilead.ssh2; /** * In most cases you probably do not need the information contained in here. * * @author Christian Plattner, plattner@trilead.com * @version $Id: ConnectionInfo.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class ConnectionInfo { /** * The used key exchange (KEX) algorithm in the latest key exchange. */ public String keyExchangeAlgorithm; /** * The currently used crypto algorithm for packets from to the client to the * server. */ public String clientToServerCryptoAlgorithm; /** * The currently used crypto algorithm for packets from to the server to the * client. */ public String serverToClientCryptoAlgorithm; /** * The currently used MAC algorithm for packets from to the client to the * server. */ public String clientToServerMACAlgorithm; /** * The currently used MAC algorithm for packets from to the server to the * client. */ public String serverToClientMACAlgorithm; /** * The type of the server host key (currently either "ssh-dss" or * "ssh-rsa"). */ public String serverHostKeyAlgorithm; /** * The server host key that was sent during the latest key exchange. */ public byte[] serverHostKey; /** * Number of kex exchanges performed on this connection so far. */ public int keyExchangeCounter = 0; }
zzsuper001-linuxshell
src/com/trilead/ssh2/ConnectionInfo.java
Java
asf20
1,378
package com.trilead.ssh2; /** * A <code>ConnectionMonitor</code> is used to get notified when the * underlying socket of a connection is closed. * * @author Christian Plattner, plattner@trilead.com * @version $Id: ConnectionMonitor.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public interface ConnectionMonitor { /** * This method is called after the connection's underlying * socket has been closed. E.g., due to the {@link Connection#close()} request of the * user, if the peer closed the connection, due to a fatal error during connect() * (also if the socket cannot be established) or if a fatal error occured on * an established connection. * <p> * This is an experimental feature. * <p> * You MUST NOT make any assumption about the thread that invokes this method. * <p> * <b>Please note: if the connection is not connected (e.g., there was no successful * connect() call), then the invocation of {@link Connection#close()} will NOT trigger * this method.</b> * * @see Connection#addConnectionMonitor(ConnectionMonitor) * * @param reason Includes an indication why the socket was closed. */ public void connectionLost(Throwable reason); }
zzsuper001-linuxshell
src/com/trilead/ssh2/ConnectionMonitor.java
Java
asf20
1,233
package com.trilead.ssh2; /** * A <code>DHGexParameters</code> object can be used to specify parameters for * the diffie-hellman group exchange. * <p> * Depending on which constructor is used, either the use of a * <code>SSH_MSG_KEX_DH_GEX_REQUEST</code> or <code>SSH_MSG_KEX_DH_GEX_REQUEST_OLD</code> * can be forced. * * @see Connection#setDHGexParameters(DHGexParameters) * @author Christian Plattner, plattner@trilead.com * @version $Id: DHGexParameters.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class DHGexParameters { private final int min_group_len; private final int pref_group_len; private final int max_group_len; private static final int MIN_ALLOWED = 1024; private static final int MAX_ALLOWED = 8192; /** * Same as calling {@link #DHGexParameters(int, int, int) DHGexParameters(1024, 1024, 4096)}. * This is also the default used by the Connection class. * */ public DHGexParameters() { this(1024, 1024, 4096); } /** * This constructor can be used to force the sending of a * <code>SSH_MSG_KEX_DH_GEX_REQUEST_OLD</code> request. * Internally, the minimum and maximum group lengths will * be set to zero. * * @param pref_group_len has to be &gt= 1024 and &lt;= 8192 */ public DHGexParameters(int pref_group_len) { if ((pref_group_len < MIN_ALLOWED) || (pref_group_len > MAX_ALLOWED)) throw new IllegalArgumentException("pref_group_len out of range!"); this.pref_group_len = pref_group_len; this.min_group_len = 0; this.max_group_len = 0; } /** * This constructor can be used to force the sending of a * <code>SSH_MSG_KEX_DH_GEX_REQUEST</code> request. * <p> * Note: older OpenSSH servers don't understand this request, in which * case you should use the {@link #DHGexParameters(int)} constructor. * <p> * All values have to be &gt= 1024 and &lt;= 8192. Furthermore, * min_group_len &lt;= pref_group_len &lt;= max_group_len. * * @param min_group_len * @param pref_group_len * @param max_group_len */ public DHGexParameters(int min_group_len, int pref_group_len, int max_group_len) { if ((min_group_len < MIN_ALLOWED) || (min_group_len > MAX_ALLOWED)) throw new IllegalArgumentException("min_group_len out of range!"); if ((pref_group_len < MIN_ALLOWED) || (pref_group_len > MAX_ALLOWED)) throw new IllegalArgumentException("pref_group_len out of range!"); if ((max_group_len < MIN_ALLOWED) || (max_group_len > MAX_ALLOWED)) throw new IllegalArgumentException("max_group_len out of range!"); if ((pref_group_len < min_group_len) || (pref_group_len > max_group_len)) throw new IllegalArgumentException("pref_group_len is incompatible with min and max!"); if (max_group_len < min_group_len) throw new IllegalArgumentException("max_group_len must not be smaller than min_group_len!"); this.min_group_len = min_group_len; this.pref_group_len = pref_group_len; this.max_group_len = max_group_len; } /** * Get the maximum group length. * * @return the maximum group length, may be <code>zero</code> if * SSH_MSG_KEX_DH_GEX_REQUEST_OLD should be requested */ public int getMax_group_len() { return max_group_len; } /** * Get the minimum group length. * * @return minimum group length, may be <code>zero</code> if * SSH_MSG_KEX_DH_GEX_REQUEST_OLD should be requested */ public int getMin_group_len() { return min_group_len; } /** * Get the preferred group length. * * @return the preferred group length */ public int getPref_group_len() { return pref_group_len; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/DHGexParameters.java
Java
asf20
3,708
package com.trilead.ssh2; /** * Contains constants that can be used to specify what conditions to wait for on * a SSH-2 channel (e.g., represented by a {@link Session}). * * @see Session#waitForCondition(int, long) * * @author Christian Plattner, plattner@trilead.com * @version $Id: ChannelCondition.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public abstract interface ChannelCondition { /** * A timeout has occurred, none of your requested conditions is fulfilled. * However, other conditions may be true - therefore, NEVER use the "==" * operator to test for this (or any other) condition. Always use * something like <code>((cond & ChannelCondition.CLOSED) != 0)</code>. */ public static final int TIMEOUT = 1; /** * The underlying SSH-2 channel, however not necessarily the whole connection, * has been closed. This implies <code>EOF</code>. Note that there may still * be unread stdout or stderr data in the local window, i.e, <code>STDOUT_DATA</code> * or/and <code>STDERR_DATA</code> may be set at the same time. */ public static final int CLOSED = 2; /** * There is stdout data available that is ready to be consumed. */ public static final int STDOUT_DATA = 4; /** * There is stderr data available that is ready to be consumed. */ public static final int STDERR_DATA = 8; /** * EOF on has been reached, no more _new_ stdout or stderr data will arrive * from the remote server. However, there may be unread stdout or stderr * data, i.e, <code>STDOUT_DATA</code> or/and <code>STDERR_DATA</code> * may be set at the same time. */ public static final int EOF = 16; /** * The exit status of the remote process is available. * Some servers never send the exist status, or occasionally "forget" to do so. */ public static final int EXIT_STATUS = 32; /** * The exit signal of the remote process is available. */ public static final int EXIT_SIGNAL = 64; }
zzsuper001-linuxshell
src/com/trilead/ssh2/ChannelCondition.java
Java
asf20
2,005
package com.trilead.ssh2.util; import java.io.PrintWriter; import java.io.StringWriter; import java.util.Collections; import java.util.LinkedList; import com.trilead.ssh2.log.Logger; /** * TimeoutService (beta). Here you can register a timeout. * <p> * Implemented having large scale programs in mind: if you open many concurrent SSH connections * that rely on timeouts, then there will be only one timeout thread. Once all timeouts * have expired/are cancelled, the thread will (sooner or later) exit. * Only after new timeouts arrive a new thread (singleton) will be instantiated. * * @author Christian Plattner, plattner@trilead.com * @version $Id: TimeoutService.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class TimeoutService { private static final Logger log = Logger.getLogger(TimeoutService.class); public static class TimeoutToken implements Comparable { private long runTime; private Runnable handler; private TimeoutToken(long runTime, Runnable handler) { this.runTime = runTime; this.handler = handler; } public int compareTo(Object o) { TimeoutToken t = (TimeoutToken) o; if (runTime > t.runTime) return 1; if (runTime == t.runTime) return 0; return -1; } } private static class TimeoutThread extends Thread { public void run() { synchronized (todolist) { while (true) { if (todolist.size() == 0) { timeoutThread = null; return; } long now = System.currentTimeMillis(); TimeoutToken tt = (TimeoutToken) todolist.getFirst(); if (tt.runTime > now) { /* Not ready yet, sleep a little bit */ try { todolist.wait(tt.runTime - now); } catch (InterruptedException e) { } /* We cannot simply go on, since it could be that the token * was removed (cancelled) or another one has been inserted in * the meantime. */ continue; } todolist.removeFirst(); try { tt.handler.run(); } catch (Exception e) { StringWriter sw = new StringWriter(); e.printStackTrace(new PrintWriter(sw)); log.log(20, "Exeception in Timeout handler:" + e.getMessage() + "(" + sw.toString() + ")"); } } } } } /* The list object is also used for locking purposes */ private static final LinkedList todolist = new LinkedList(); private static Thread timeoutThread = null; /** * It is assumed that the passed handler will not execute for a long time. * * @param runTime * @param handler * @return a TimeoutToken that can be used to cancel the timeout. */ public static final TimeoutToken addTimeoutHandler(long runTime, Runnable handler) { TimeoutToken token = new TimeoutToken(runTime, handler); synchronized (todolist) { todolist.add(token); Collections.sort(todolist); if (timeoutThread != null) timeoutThread.interrupt(); else { timeoutThread = new TimeoutThread(); timeoutThread.setDaemon(true); timeoutThread.start(); } } return token; } public static final void cancelTimeoutHandler(TimeoutToken token) { synchronized (todolist) { todolist.remove(token); if (timeoutThread != null) timeoutThread.interrupt(); } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/util/TimeoutService.java
Java
asf20
3,443
package com.trilead.ssh2.util; /** * Tokenizer. Why? Because StringTokenizer is not available in J2ME. * * @author Christian Plattner, plattner@trilead.com * @version $Id: Tokenizer.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class Tokenizer { /** * Exists because StringTokenizer is not available in J2ME. * Returns an array with at least 1 entry. * * @param source must be non-null * @param delimiter * @return an array of Strings */ public static String[] parseTokens(String source, char delimiter) { int numtoken = 1; for (int i = 0; i < source.length(); i++) { if (source.charAt(i) == delimiter) numtoken++; } String list[] = new String[numtoken]; int nextfield = 0; for (int i = 0; i < numtoken; i++) { if (nextfield >= source.length()) { list[i] = ""; } else { int idx = source.indexOf(delimiter, nextfield); if (idx == -1) idx = source.length(); list[i] = source.substring(nextfield, idx); nextfield = idx + 1; } } return list; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/util/Tokenizer.java
Java
asf20
1,104
package com.trilead.ssh2; /** * A <code>SFTPv3FileHandle</code>. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SFTPv3FileHandle.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class SFTPv3FileHandle { final SFTPv3Client client; final byte[] fileHandle; boolean isClosed = false; /* The constructor is NOT public */ SFTPv3FileHandle(SFTPv3Client client, byte[] h) { this.client = client; this.fileHandle = h; } /** * Get the SFTPv3Client instance which created this handle. * * @return A SFTPv3Client instance. */ public SFTPv3Client getClient() { return client; } /** * Check if this handle was closed with the {@link SFTPv3Client#closeFile(SFTPv3FileHandle)} method * of the <code>SFTPv3Client</code> instance which created the handle. * * @return if the handle is closed. */ public boolean isClosed() { return isClosed; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/SFTPv3FileHandle.java
Java
asf20
959
package com.trilead.ssh2; /** * A <code>SFTPv3FileAttributes</code> object represents detail information * about a file on the server. Not all fields may/must be present. * * @author Christian Plattner, plattner@trilead.com * @version $Id: SFTPv3FileAttributes.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class SFTPv3FileAttributes { /** * The SIZE attribute. <code>NULL</code> if not present. */ public Long size = null; /** * The UID attribute. <code>NULL</code> if not present. */ public Integer uid = null; /** * The GID attribute. <code>NULL</code> if not present. */ public Integer gid = null; /** * The POSIX permissions. <code>NULL</code> if not present. * <p> * Here is a list: * <p> * <pre>Note: these numbers are all OCTAL. * * S_IFMT 0170000 bitmask for the file type bitfields * S_IFSOCK 0140000 socket * S_IFLNK 0120000 symbolic link * S_IFREG 0100000 regular file * S_IFBLK 0060000 block device * S_IFDIR 0040000 directory * S_IFCHR 0020000 character device * S_IFIFO 0010000 fifo * S_ISUID 0004000 set UID bit * S_ISGID 0002000 set GID bit * S_ISVTX 0001000 sticky bit * * S_IRWXU 00700 mask for file owner permissions * S_IRUSR 00400 owner has read permission * S_IWUSR 00200 owner has write permission * S_IXUSR 00100 owner has execute permission * S_IRWXG 00070 mask for group permissions * S_IRGRP 00040 group has read permission * S_IWGRP 00020 group has write permission * S_IXGRP 00010 group has execute permission * S_IRWXO 00007 mask for permissions for others (not in group) * S_IROTH 00004 others have read permission * S_IWOTH 00002 others have write permisson * S_IXOTH 00001 others have execute permission * </pre> */ public Integer permissions = null; /** * The ATIME attribute. Represented as seconds from Jan 1, 1970 in UTC. * <code>NULL</code> if not present. */ public Long atime = null; /** * The MTIME attribute. Represented as seconds from Jan 1, 1970 in UTC. * <code>NULL</code> if not present. */ public Long mtime = null; /** * Checks if this entry is a directory. * * @return Returns true if permissions are available and they indicate * that this entry represents a directory. */ public boolean isDirectory() { if (permissions == null) return false; return ((permissions.intValue() & 0040000) != 0); } /** * Checks if this entry is a regular file. * * @return Returns true if permissions are available and they indicate * that this entry represents a regular file. */ public boolean isRegularFile() { if (permissions == null) return false; return ((permissions.intValue() & 0100000) != 0); } /** * Checks if this entry is a a symlink. * * @return Returns true if permissions are available and they indicate * that this entry represents a symlink. */ public boolean isSymlink() { if (permissions == null) return false; return ((permissions.intValue() & 0120000) != 0); } /** * Turn the POSIX permissions into a 7 digit octal representation. * Note: the returned value is first masked with <code>0177777</code>. * * @return <code>NULL</code> if permissions are not available. */ public String getOctalPermissions() { if (permissions == null) return null; String res = Integer.toString(permissions.intValue() & 0177777, 8); StringBuffer sb = new StringBuffer(); int leadingZeros = 7 - res.length(); while (leadingZeros > 0) { sb.append('0'); leadingZeros--; } sb.append(res); return sb.toString(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/SFTPv3FileAttributes.java
Java
asf20
3,936
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.trilead.ssh2.compression; import com.jcraft.jzlib.JZlib; import com.jcraft.jzlib.ZStream; /** * @author Kenny Root * */ public class Zlib implements ICompressor { static private final int DEFAULT_BUF_SIZE = 4096; static private final int LEVEL = 5; private ZStream deflate; private byte[] deflate_tmpbuf; private ZStream inflate; private byte[] inflate_tmpbuf; private byte[] inflated_buf; public Zlib() { deflate = new ZStream(); inflate = new ZStream(); deflate.deflateInit(LEVEL); inflate.inflateInit(); deflate_tmpbuf = new byte[DEFAULT_BUF_SIZE]; inflate_tmpbuf = new byte[DEFAULT_BUF_SIZE]; inflated_buf = new byte[DEFAULT_BUF_SIZE]; } public boolean canCompressPreauth() { return true; } public int getBufferSize() { return DEFAULT_BUF_SIZE; } public int compress(byte[] buf, int start, int len, byte[] output) { deflate.next_in = buf; deflate.next_in_index = start; deflate.avail_in = len - start; if ((buf.length + 1024) > deflate_tmpbuf.length) { deflate_tmpbuf = new byte[buf.length + 1024]; } deflate.next_out = deflate_tmpbuf; deflate.next_out_index = 0; deflate.avail_out = output.length; if (deflate.deflate(JZlib.Z_PARTIAL_FLUSH) != JZlib.Z_OK) { System.err.println("compress: compression failure"); } if (deflate.avail_in > 0) { System.err.println("compress: deflated data too large"); } int outputlen = output.length - deflate.avail_out; System.arraycopy(deflate_tmpbuf, 0, output, 0, outputlen); return outputlen; } public byte[] uncompress(byte[] buffer, int start, int[] length) { int inflated_end = 0; inflate.next_in = buffer; inflate.next_in_index = start; inflate.avail_in = length[0]; while (true) { inflate.next_out = inflate_tmpbuf; inflate.next_out_index = 0; inflate.avail_out = DEFAULT_BUF_SIZE; int status = inflate.inflate(JZlib.Z_PARTIAL_FLUSH); switch (status) { case JZlib.Z_OK: if (inflated_buf.length < inflated_end + DEFAULT_BUF_SIZE - inflate.avail_out) { byte[] foo = new byte[inflated_end + DEFAULT_BUF_SIZE - inflate.avail_out]; System.arraycopy(inflated_buf, 0, foo, 0, inflated_end); inflated_buf = foo; } System.arraycopy(inflate_tmpbuf, 0, inflated_buf, inflated_end, DEFAULT_BUF_SIZE - inflate.avail_out); inflated_end += (DEFAULT_BUF_SIZE - inflate.avail_out); length[0] = inflated_end; break; case JZlib.Z_BUF_ERROR: if (inflated_end > buffer.length - start) { byte[] foo = new byte[inflated_end + start]; System.arraycopy(buffer, 0, foo, 0, start); System.arraycopy(inflated_buf, 0, foo, start, inflated_end); buffer = foo; } else { System.arraycopy(inflated_buf, 0, buffer, start, inflated_end); } length[0] = inflated_end; return buffer; default: System.err.println("uncompress: inflate returnd " + status); return null; } } } }
zzsuper001-linuxshell
src/com/trilead/ssh2/compression/Zlib.java
Java
asf20
3,628
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.trilead.ssh2.compression; /** * Defines how zlib@openssh.org compression works. * See * http://www.openssh.org/txt/draft-miller-secsh-compression-delayed-00.txt * compression is disabled until userauth has occurred. * * @author Matt Johnston * */ public class ZlibOpenSSH extends Zlib { public boolean canCompressPreauth() { return false; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/compression/ZlibOpenSSH.java
Java
asf20
1,051
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.trilead.ssh2.compression; import java.util.Vector; /** * @author Kenny Root * */ public class CompressionFactory { static class CompressorEntry { String type; String compressorClass; public CompressorEntry(String type, String compressorClass) { this.type = type; this.compressorClass = compressorClass; } } static Vector<CompressorEntry> compressors = new Vector<CompressorEntry>(); static { /* Higher Priority First */ compressors.addElement(new CompressorEntry("zlib", "com.trilead.ssh2.compression.Zlib")); compressors.addElement(new CompressorEntry("zlib@openssh.com", "com.trilead.ssh2.compression.ZlibOpenSSH")); compressors.addElement(new CompressorEntry("none", "")); } public static String[] getDefaultCompressorList() { String list[] = new String[compressors.size()]; for (int i = 0; i < compressors.size(); i++) { CompressorEntry ce = compressors.elementAt(i); list[i] = new String(ce.type); } return list; } public static void checkCompressorList(String[] compressorCandidates) { for (int i = 0; i < compressorCandidates.length; i++) getEntry(compressorCandidates[i]); } public static ICompressor createCompressor(String type) { try { CompressorEntry ce = getEntry(type); if ("".equals(ce.compressorClass)) return null; Class<?> cc = Class.forName(ce.compressorClass); ICompressor cmp = (ICompressor) cc.newInstance(); return cmp; } catch (Exception e) { throw new IllegalArgumentException("Cannot instantiate " + type); } } private static CompressorEntry getEntry(String type) { for (int i = 0; i < compressors.size(); i++) { CompressorEntry ce = compressors.elementAt(i); if (ce.type.equals(type)) return ce; } throw new IllegalArgumentException("Unkown algorithm " + type); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/compression/CompressionFactory.java
Java
asf20
2,516
/* * ConnectBot: simple, powerful, open-source SSH client for Android * Copyright 2007 Kenny Root, Jeffrey Sharkey * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.trilead.ssh2.compression; /** * @author Kenny Root * */ public interface ICompressor { int getBufferSize(); int compress(byte[] buf, int start, int len, byte[] output); byte[] uncompress(byte[] buf, int start, int[] len); boolean canCompressPreauth(); }
zzsuper001-linuxshell
src/com/trilead/ssh2/compression/ICompressor.java
Java
asf20
957
package com.trilead.ssh2.signature; import java.io.IOException; import java.math.BigInteger; import java.security.SecureRandom; import com.trilead.ssh2.crypto.digest.SHA1; import com.trilead.ssh2.log.Logger; import com.trilead.ssh2.packets.TypesReader; import com.trilead.ssh2.packets.TypesWriter; /** * DSASHA1Verify. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DSASHA1Verify.java,v 1.2 2008/04/01 12:38:09 cplattne Exp $ */ public class DSASHA1Verify { private static final Logger log = Logger.getLogger(DSASHA1Verify.class); public static DSAPublicKey decodeSSHDSAPublicKey(byte[] key) throws IOException { TypesReader tr = new TypesReader(key); String key_format = tr.readString(); if (key_format.equals("ssh-dss") == false) throw new IllegalArgumentException("This is not a ssh-dss public key!"); BigInteger p = tr.readMPINT(); BigInteger q = tr.readMPINT(); BigInteger g = tr.readMPINT(); BigInteger y = tr.readMPINT(); if (tr.remain() != 0) throw new IOException("Padding in DSA public key!"); return new DSAPublicKey(p, q, g, y); } public static byte[] encodeSSHDSAPublicKey(DSAPublicKey pk) throws IOException { TypesWriter tw = new TypesWriter(); tw.writeString("ssh-dss"); tw.writeMPInt(pk.getP()); tw.writeMPInt(pk.getQ()); tw.writeMPInt(pk.getG()); tw.writeMPInt(pk.getY()); return tw.getBytes(); } public static byte[] encodeSSHDSASignature(DSASignature ds) { TypesWriter tw = new TypesWriter(); tw.writeString("ssh-dss"); byte[] r = ds.getR().toByteArray(); byte[] s = ds.getS().toByteArray(); byte[] a40 = new byte[40]; /* Patch (unsigned) r and s into the target array. */ int r_copylen = (r.length < 20) ? r.length : 20; int s_copylen = (s.length < 20) ? s.length : 20; System.arraycopy(r, r.length - r_copylen, a40, 20 - r_copylen, r_copylen); System.arraycopy(s, s.length - s_copylen, a40, 40 - s_copylen, s_copylen); tw.writeString(a40, 0, 40); return tw.getBytes(); } public static DSASignature decodeSSHDSASignature(byte[] sig) throws IOException { byte[] rsArray = null; if (sig.length == 40) { /* OK, another broken SSH server. */ rsArray = sig; } else { /* Hopefully a server obeing the standard... */ TypesReader tr = new TypesReader(sig); String sig_format = tr.readString(); if (sig_format.equals("ssh-dss") == false) throw new IOException("Peer sent wrong signature format"); rsArray = tr.readByteString(); if (rsArray.length != 40) throw new IOException("Peer sent corrupt signature"); if (tr.remain() != 0) throw new IOException("Padding in DSA signature!"); } /* Remember, s and r are unsigned ints. */ byte[] tmp = new byte[20]; System.arraycopy(rsArray, 0, tmp, 0, 20); BigInteger r = new BigInteger(1, tmp); System.arraycopy(rsArray, 20, tmp, 0, 20); BigInteger s = new BigInteger(1, tmp); if (log.isEnabled()) { log.log(30, "decoded ssh-dss signature: first bytes r(" + ((rsArray[0]) & 0xff) + "), s(" + ((rsArray[20]) & 0xff) + ")"); } return new DSASignature(r, s); } public static boolean verifySignature(byte[] message, DSASignature ds, DSAPublicKey dpk) throws IOException { /* Inspired by Bouncycastle's DSASigner class */ SHA1 md = new SHA1(); md.update(message); byte[] sha_message = new byte[md.getDigestLength()]; md.digest(sha_message); BigInteger m = new BigInteger(1, sha_message); BigInteger r = ds.getR(); BigInteger s = ds.getS(); BigInteger g = dpk.getG(); BigInteger p = dpk.getP(); BigInteger q = dpk.getQ(); BigInteger y = dpk.getY(); BigInteger zero = BigInteger.ZERO; if (log.isEnabled()) { log.log(60, "ssh-dss signature: m: " + m.toString(16)); log.log(60, "ssh-dss signature: r: " + r.toString(16)); log.log(60, "ssh-dss signature: s: " + s.toString(16)); log.log(60, "ssh-dss signature: g: " + g.toString(16)); log.log(60, "ssh-dss signature: p: " + p.toString(16)); log.log(60, "ssh-dss signature: q: " + q.toString(16)); log.log(60, "ssh-dss signature: y: " + y.toString(16)); } if (zero.compareTo(r) >= 0 || q.compareTo(r) <= 0) { log.log(20, "ssh-dss signature: zero.compareTo(r) >= 0 || q.compareTo(r) <= 0"); return false; } if (zero.compareTo(s) >= 0 || q.compareTo(s) <= 0) { log.log(20, "ssh-dss signature: zero.compareTo(s) >= 0 || q.compareTo(s) <= 0"); return false; } BigInteger w = s.modInverse(q); BigInteger u1 = m.multiply(w).mod(q); BigInteger u2 = r.multiply(w).mod(q); u1 = g.modPow(u1, p); u2 = y.modPow(u2, p); BigInteger v = u1.multiply(u2).mod(p).mod(q); return v.equals(r); } public static DSASignature generateSignature(byte[] message, DSAPrivateKey pk, SecureRandom rnd) { SHA1 md = new SHA1(); md.update(message); byte[] sha_message = new byte[md.getDigestLength()]; md.digest(sha_message); BigInteger m = new BigInteger(1, sha_message); BigInteger k; int qBitLength = pk.getQ().bitLength(); do { k = new BigInteger(qBitLength, rnd); } while (k.compareTo(pk.getQ()) >= 0); BigInteger r = pk.getG().modPow(k, pk.getP()).mod(pk.getQ()); k = k.modInverse(pk.getQ()).multiply(m.add((pk).getX().multiply(r))); BigInteger s = k.mod(pk.getQ()); return new DSASignature(r, s); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/DSASHA1Verify.java
Java
asf20
5,551
package com.trilead.ssh2.signature; import java.io.IOException; import java.math.BigInteger; import com.trilead.ssh2.crypto.SimpleDERReader; import com.trilead.ssh2.crypto.digest.SHA1; import com.trilead.ssh2.log.Logger; import com.trilead.ssh2.packets.TypesReader; import com.trilead.ssh2.packets.TypesWriter; /** * RSASHA1Verify. * * @author Christian Plattner, plattner@trilead.com * @version $Id: RSASHA1Verify.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class RSASHA1Verify { private static final Logger log = Logger.getLogger(RSASHA1Verify.class); public static RSAPublicKey decodeSSHRSAPublicKey(byte[] key) throws IOException { TypesReader tr = new TypesReader(key); String key_format = tr.readString(); if (key_format.equals("ssh-rsa") == false) throw new IllegalArgumentException("This is not a ssh-rsa public key"); BigInteger e = tr.readMPINT(); BigInteger n = tr.readMPINT(); if (tr.remain() != 0) throw new IOException("Padding in RSA public key!"); return new RSAPublicKey(e, n); } public static byte[] encodeSSHRSAPublicKey(RSAPublicKey pk) throws IOException { TypesWriter tw = new TypesWriter(); tw.writeString("ssh-rsa"); tw.writeMPInt(pk.getE()); tw.writeMPInt(pk.getN()); return tw.getBytes(); } public static RSASignature decodeSSHRSASignature(byte[] sig) throws IOException { TypesReader tr = new TypesReader(sig); String sig_format = tr.readString(); if (sig_format.equals("ssh-rsa") == false) throw new IOException("Peer sent wrong signature format"); /* S is NOT an MPINT. "The value for 'rsa_signature_blob' is encoded as a string * containing s (which is an integer, without lengths or padding, unsigned and in * network byte order)." See also below. */ byte[] s = tr.readByteString(); if (s.length == 0) throw new IOException("Error in RSA signature, S is empty."); if (log.isEnabled()) { log.log(80, "Decoding ssh-rsa signature string (length: " + s.length + ")"); } if (tr.remain() != 0) throw new IOException("Padding in RSA signature!"); return new RSASignature(new BigInteger(1, s)); } public static byte[] encodeSSHRSASignature(RSASignature sig) throws IOException { TypesWriter tw = new TypesWriter(); tw.writeString("ssh-rsa"); /* S is NOT an MPINT. "The value for 'rsa_signature_blob' is encoded as a string * containing s (which is an integer, without lengths or padding, unsigned and in * network byte order)." */ byte[] s = sig.getS().toByteArray(); /* Remove first zero sign byte, if present */ if ((s.length > 1) && (s[0] == 0x00)) tw.writeString(s, 1, s.length - 1); else tw.writeString(s, 0, s.length); return tw.getBytes(); } public static RSASignature generateSignature(byte[] message, RSAPrivateKey pk) throws IOException { SHA1 md = new SHA1(); md.update(message); byte[] sha_message = new byte[md.getDigestLength()]; md.digest(sha_message); byte[] der_header = new byte[] { 0x30, 0x21, 0x30, 0x09, 0x06, 0x05, 0x2b, 0x0e, 0x03, 0x02, 0x1a, 0x05, 0x00, 0x04, 0x14 }; int rsa_block_len = (pk.getN().bitLength() + 7) / 8; int num_pad = rsa_block_len - (2 + der_header.length + sha_message.length) - 1; if (num_pad < 8) throw new IOException("Cannot sign with RSA, message too long"); byte[] sig = new byte[der_header.length + sha_message.length + 2 + num_pad]; sig[0] = 0x01; for (int i = 0; i < num_pad; i++) { sig[i + 1] = (byte) 0xff; } sig[num_pad + 1] = 0x00; System.arraycopy(der_header, 0, sig, 2 + num_pad, der_header.length); System.arraycopy(sha_message, 0, sig, 2 + num_pad + der_header.length, sha_message.length); BigInteger m = new BigInteger(1, sig); BigInteger s = m.modPow(pk.getD(), pk.getN()); return new RSASignature(s); } public static boolean verifySignature(byte[] message, RSASignature ds, RSAPublicKey dpk) throws IOException { SHA1 md = new SHA1(); md.update(message); byte[] sha_message = new byte[md.getDigestLength()]; md.digest(sha_message); BigInteger n = dpk.getN(); BigInteger e = dpk.getE(); BigInteger s = ds.getS(); if (n.compareTo(s) <= 0) { log.log(20, "ssh-rsa signature: n.compareTo(s) <= 0"); return false; } int rsa_block_len = (n.bitLength() + 7) / 8; /* And now the show begins */ if (rsa_block_len < 1) { log.log(20, "ssh-rsa signature: rsa_block_len < 1"); return false; } byte[] v = s.modPow(e, n).toByteArray(); int startpos = 0; if ((v.length > 0) && (v[0] == 0x00)) startpos++; if ((v.length - startpos) != (rsa_block_len - 1)) { log.log(20, "ssh-rsa signature: (v.length - startpos) != (rsa_block_len - 1)"); return false; } if (v[startpos] != 0x01) { log.log(20, "ssh-rsa signature: v[startpos] != 0x01"); return false; } int pos = startpos + 1; while (true) { if (pos >= v.length) { log.log(20, "ssh-rsa signature: pos >= v.length"); return false; } if (v[pos] == 0x00) break; if (v[pos] != (byte) 0xff) { log.log(20, "ssh-rsa signature: v[pos] != (byte) 0xff"); return false; } pos++; } int num_pad = pos - (startpos + 1); if (num_pad < 8) { log.log(20, "ssh-rsa signature: num_pad < 8"); return false; } pos++; if (pos >= v.length) { log.log(20, "ssh-rsa signature: pos >= v.length"); return false; } SimpleDERReader dr = new SimpleDERReader(v, pos, v.length - pos); byte[] seq = dr.readSequenceAsByteArray(); if (dr.available() != 0) { log.log(20, "ssh-rsa signature: dr.available() != 0"); return false; } dr.resetInput(seq); /* Read digestAlgorithm */ byte digestAlgorithm[] = dr.readSequenceAsByteArray(); /* Inspired by RFC 3347, however, ignoring the comment regarding old BER based implementations */ if ((digestAlgorithm.length < 8) || (digestAlgorithm.length > 9)) { log.log(20, "ssh-rsa signature: (digestAlgorithm.length < 8) || (digestAlgorithm.length > 9)"); return false; } byte[] digestAlgorithm_sha1 = new byte[] { 0x06, 0x05, 0x2b, 0x0e, 0x03, 0x02, 0x1a, 0x05, 0x00 }; for (int i = 0; i < digestAlgorithm.length; i++) { if (digestAlgorithm[i] != digestAlgorithm_sha1[i]) { log.log(20, "ssh-rsa signature: digestAlgorithm[i] != digestAlgorithm_sha1[i]"); return false; } } byte[] digest = dr.readOctetString(); if (dr.available() != 0) { log.log(20, "ssh-rsa signature: dr.available() != 0 (II)"); return false; } if (digest.length != sha_message.length) { log.log(20, "ssh-rsa signature: digest.length != sha_message.length"); return false; } for (int i = 0; i < sha_message.length; i++) { if (sha_message[i] != digest[i]) { log.log(20, "ssh-rsa signature: sha_message[i] != digest[i]"); return false; } } return true; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/RSASHA1Verify.java
Java
asf20
7,162
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * RSAPrivateKey. * * @author Christian Plattner, plattner@trilead.com * @version $Id: RSAPrivateKey.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class RSAPrivateKey { private BigInteger d; private BigInteger e; private BigInteger n; public RSAPrivateKey(BigInteger d, BigInteger e, BigInteger n) { this.d = d; this.e = e; this.n = n; } public BigInteger getD() { return d; } public BigInteger getE() { return e; } public BigInteger getN() { return n; } public RSAPublicKey getPublicKey() { return new RSAPublicKey(e, n); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/RSAPrivateKey.java
Java
asf20
693
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * RSASignature. * * @author Christian Plattner, plattner@trilead.com * @version $Id: RSASignature.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class RSASignature { BigInteger s; public BigInteger getS() { return s; } public RSASignature(BigInteger s) { this.s = s; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/RSASignature.java
Java
asf20
398
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * DSAPublicKey. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DSAPublicKey.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class DSAPublicKey { private BigInteger p; private BigInteger q; private BigInteger g; private BigInteger y; public DSAPublicKey(BigInteger p, BigInteger q, BigInteger g, BigInteger y) { this.p = p; this.q = q; this.g = g; this.y = y; } public BigInteger getP() { return p; } public BigInteger getQ() { return q; } public BigInteger getG() { return g; } public BigInteger getY() { return y; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/DSAPublicKey.java
Java
asf20
709
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * RSAPublicKey. * * @author Christian Plattner, plattner@trilead.com * @version $Id: RSAPublicKey.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class RSAPublicKey { BigInteger e; BigInteger n; public RSAPublicKey(BigInteger e, BigInteger n) { this.e = e; this.n = n; } public BigInteger getE() { return e; } public BigInteger getN() { return n; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/RSAPublicKey.java
Java
asf20
487
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * DSAPrivateKey. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DSAPrivateKey.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class DSAPrivateKey { private BigInteger p; private BigInteger q; private BigInteger g; private BigInteger x; private BigInteger y; public DSAPrivateKey(BigInteger p, BigInteger q, BigInteger g, BigInteger y, BigInteger x) { this.p = p; this.q = q; this.g = g; this.y = y; this.x = x; } public BigInteger getP() { return p; } public BigInteger getQ() { return q; } public BigInteger getG() { return g; } public BigInteger getY() { return y; } public BigInteger getX() { return x; } public DSAPublicKey getPublicKey() { return new DSAPublicKey(p, q, g, y); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/DSAPrivateKey.java
Java
asf20
910
package com.trilead.ssh2.signature; import java.math.BigInteger; /** * DSASignature. * * @author Christian Plattner, plattner@trilead.com * @version $Id: DSASignature.java,v 1.1 2007/10/15 12:49:57 cplattne Exp $ */ public class DSASignature { private BigInteger r; private BigInteger s; public DSASignature(BigInteger r, BigInteger s) { this.r = r; this.s = s; } public BigInteger getR() { return r; } public BigInteger getS() { return s; } }
zzsuper001-linuxshell
src/com/trilead/ssh2/signature/DSASignature.java
Java
asf20
505
package com.trilead.ssh2; import java.io.IOException; import java.net.InetSocketAddress; import com.trilead.ssh2.channel.ChannelManager; import com.trilead.ssh2.channel.LocalAcceptThread; /** * A <code>LocalPortForwarder</code> forwards TCP/IP connections to a local * port via the secure tunnel to another host (which may or may not be identical * to the remote SSH-2 server). Checkout {@link Connection#createLocalPortForwarder(int, String, int)} * on how to create one. * * @author Christian Plattner, plattner@trilead.com * @version $Id: LocalPortForwarder.java,v 1.1 2007/10/15 12:49:56 cplattne Exp $ */ public class LocalPortForwarder { ChannelManager cm; String host_to_connect; int port_to_connect; LocalAcceptThread lat; LocalPortForwarder(ChannelManager cm, int local_port, String host_to_connect, int port_to_connect) throws IOException { this.cm = cm; this.host_to_connect = host_to_connect; this.port_to_connect = port_to_connect; lat = new LocalAcceptThread(cm, local_port, host_to_connect, port_to_connect); lat.setDaemon(true); lat.start(); } LocalPortForwarder(ChannelManager cm, InetSocketAddress addr, String host_to_connect, int port_to_connect) throws IOException { this.cm = cm; this.host_to_connect = host_to_connect; this.port_to_connect = port_to_connect; lat = new LocalAcceptThread(cm, addr, host_to_connect, port_to_connect); lat.setDaemon(true); lat.start(); } /** * Stop TCP/IP forwarding of newly arriving connections. * * @throws IOException */ public void close() throws IOException { lat.stopWorking(); } }
zzsuper001-linuxshell
src/com/trilead/ssh2/LocalPortForwarder.java
Java
asf20
1,682