molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(CCCl)CCCl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule has Faint odor of herring.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(N(c2ccc(OC)cc2)c2cc3c(c4ccccc24)-c2c(ccc4ccccc24)C3(C(C)(C)C)C2(C(C)(C)C)c3ccc4ccccc4c3-c3c2cc(N(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccccc32)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a organic light-emitting device.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on colorectal cancer, and impacts alzheimer's disease, parkinson's disease, and breast cancer. It impacts diabetes mellitus, stomach cancer, cardiovascular disease, and seizure.",
"role": "assistant"
}
] |
{
"smiles": [
"OC1CCc2cc(Br)cc(F)c21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a lsd1 inhibitor and gpr40 agonist, belonging to the anti diabetic class of molecules, and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient and fat storage, and it impacts atherosclerosis. The molecule is a member of the thyroxine treatment class and affects metabolic syndrome, cardiovascular disease, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CC=CCC1C(O)CC(O)C1C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)n1c(N2CCC(N)CC2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, emulsifier, surfactant, food additive. The molecule is a membrane stabilizer, energy source, energy storage that impacts barth syndrome and aging. The molecule is a nutritional supplement and a stabilizing mitochondrial structure, it impacts tangier disease, and is smooth. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, thyroxine treatment, fat storage, inflammatory that impacts atherosclerosis and obesity. The molecule is a energy storage and energy source, and it impacts cardiovascular disease. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"N#Cc1cnc(-c2ccc(CN3CCC(n4ncc5c(N)ncnc54)CC3)cc2)c(-c2ccccc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a akt inhibitor that impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome. The molecule is a cholesterol translocation that impacts aging, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Nc1ccccc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "When heated to decomp, it emits toxic fumes of nitrogen oxides.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(F)c1cnccc1Nc1nc(-c2cccc(C(F)(F)F)n2)nn2cccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a nutrient that impacts metabolic syndrome, cardiovascular disease, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging. The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, inflammatory, fat storage that belongs to the thyroxine treatment class of molecules and impacts both metabolic syndrome and cardiovascular disease. The molecule is a energy source that impacts both obesity and atherosclerosis. The molecule is a energy storage and a nutrient, with effects on cancer and impacts on pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CC(O)CC=CC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting breast cancer, ulcerative colitis, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(C)CC(O)C(N)Cc1ccccc1.Cl.Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a dppiv inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCCCCCN=C=S"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage and nutrient, and it impacts atherosclerosis. The molecule is thyroxine treatment and impacts pancreatitis, metabolic syndrome, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=[N+]([O-])c1ccc(-c2ccccc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule has Sweetish odor.. When heated to decomp it emits toxic fumes of nitrogen oxides.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy source and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a nutritional supplement and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a membrane stabilizer, a surfactant, a stabilizing mitochondrial structure, and smooth. The molecule is a energy storage, emulsifier, cholesterol translocation, food additive, proton trap for oxidative phosphorylation.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc(-n2ncc3cc(NC(=O)NCCN4CC5CC4CN5c4ccccc4)ncc32)ccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a erk inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC(O)C(O)CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both breast cancer and cervical cancer, and also impacts atherosclerosis and ulcerative colitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a energy source and a membrane stabilizer, which impacts obesity, metabolic syndrome, and cancer, and is characterized as thyroxine treatment. It impacts atherosclerosis, cardiovascular disease, and pancreatitis. The molecule is a nutrient, energy storage, fat storage, inflammatory.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1c(F)cc(-c2cc(C(F)(F)F)c3c(N)ncnn23)cc1C(=O)NC1CN(C(=O)C(O)(CC)C(F)(F)F)CC1F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCc1cn(CC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to both the anti hypertensive and angiotensin ii antagonist classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, inflammatory, fat storage that impacts pancreatitis and atherosclerosis. The molecule is a thyroxine treatment that affects cancer by impacting cardiovascular disease. The molecule is a energy storage and a nutrient, impacting both metabolic syndrome and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a energy source, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, nutritional supplement, membrane stabilizer, surfactant that impacts tangier disease. The molecule is a cholesterol translocation, a energy storage, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a emulsifier and a food additive, which impacts both aging and diabetic heart disease, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(O)c(C(C)(C)C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "When heated to decomposition it emits acrid smoke and irritating fumes.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, aging, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C)CNc1cc(Cl)nc2c(F)cccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts pain treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting pancreatitis. The molecule is a nutrient that impacts atherosclerosis, cardiovascular disease, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CCCC(CNC(=O)C2CCCN2C(=O)CNc2cnccc2C(=N)C(N)=O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a complement pathway modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is fruity, spicy, wine, and rose.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and aging. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCc1sc(-c2ccc(C(F)(F)F)cc2F)nc1CSc1nc(N)cc(N)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis. The molecule is a energy storage, stabilizing mitochondrial structure, food additive, energy source that impacts diabetic heart disease. The molecule is a nutritional supplement, a emulsifier, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a surfactant and smooth, impacting aging, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OC(COC(=O)CCCCCCCC=CCCCC)COP(=O)(O)OCCN"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts diabetes mellitus type 2, alzheimer's disease, non-alcoholic fatty liver disease, and parkinson's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and tangier disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cccc(C)c1-c1nc2c(c(N3CCCC(O)C3)n1)CN(c1cc(C(C)C)nn1C)CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a c5a receptor modulator member of the inflammatory treatment class.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome. The molecule is a apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(C(=O)C=Cc2ccc([N+](=O)[O-])cc2O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "This molecule is a member of the thyroxine treatment class, known to influence cancer, and has an impact on metabolic syndrome, pancreatitis, atherosclerosis, and obesity. The molecule is a membrane stabilizer, a fat storage, and a energy source. The molecule is a energy storage, a inflammatory, and a nutrient, and it impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC1C(O)CC(=O)C1C=CC(O)CCCCC)COP(=O)(O)OCC(N)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1C(NS(=O)(=O)c2ccc(-c3ccc(Cl)s3)s2)CCCN1CC(=O)N1CCCC1CNCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a factor xa inhibitor and belongs to the anti coagulant class of molecules, impacting cardiovascular treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CC(=O)OC1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)COC(=O)CCCCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment and fat storage, and it impacts cardiovascular disease. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Fc1ccc(OCCN2CCCNCC2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC1OC1CCCCC)COP(=O)(O)OCC(N)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)c1nc2n(c(=O)c1OCc1ccccc1)CC1CCCC2(NC(=O)OCc2ccccc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a hiv integrase inhibitor and anti viral, and it impacts aids treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a surfactant and a emulsifier, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a cholesterol translocation, food additive, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a nutritional supplement, apoptosis, proton trap for oxidative phosphorylation, energy storage. The molecule is a stabilizing mitochondrial structure, energy source, membrane stabilizer that impacts tangier disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a member of the thyroxine treatment class and affects both atherosclerosis and metabolic syndrome. The molecule is a nutrient and a fat storage, impacting both pancreatitis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(=O)OCCC(Br)(Br)[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti bacterial and anti microbial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a nutrient that impacts cardiovascular disease, pancreatitis, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1c2cc(N3CCCCC3)c3ccccc3c2C(=O)N1Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is fluorescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a surfactant, proton trap for oxidative phosphorylation, membrane stabilizer, energy source that impacts aging. The molecule is a food additive, a cholesterol translocation, and a nutritional supplement, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, emulsifier, energy storage that impacts barth syndrome and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(-c2c3cc(F)ccc3c(-c3ccc(F)cc3F)c3c(F)ccc(F)c23)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fluorescent and is chemiluminescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCCC(O)CC(O)CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a surfactant, energy source, membrane stabilizer, nutrient, emulsifier, energy storage.",
"role": "assistant"
}
] |
{
"smiles": [
"C[N+](C)(Cc1ccccc1)C1CO1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a angiogenesis inhibitor and belongs to both the anti tumor and anti tumor activity classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(=O)N1CCCC(CC(NC(=O)C=Cc2cc(Cl)ccc2-n2cnnn2)c2cc(-c3ccc(NC(=O)OC)cc3)c(Cl)nn2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a factor xia inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C2OC2C(=O)O)cc(O)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, nutrient, energy source, energy storage.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.