Datasets:
OpenMol
/
LPM-24_caption-MMChat

Dataset card Data Studio Files
xet
Community
1
molecules
dict
messages
listlengths
3
3
{ "smiles": [ "Cc1cc2c(nc1N1CCC(Oc3ccc4c(c3)CS(=O)(=O)C4)CC1)CNC2=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a neurological treatment and is psychiatric treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "COc1cccc(-c2cc(-c3cccnc3)cc(NCCc3c[nH]c4ccccc34)n2)n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to both the anti inflammatory and anti cancer classes of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC1CN(c2nc(N)c(C(=O)NCCO)nc2Cl)CCN1C1CCN(C(=O)c2cc(F)c(Cl)nc2Cl)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "It impacts inflammatory disease treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy storage, membrane stabilizer, emulsifier, surfactant. The molecule is a energy source and a apoptosis that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a food additive, a nutritional supplement, a cholesterol translocation, and smooth. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis, nutritional supplement. The molecule is a energy storage and a food additive that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a emulsifier, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, a energy source, and a surfactant, it impacts tangier disease and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a energy source and a energy storage that impacts metabolic syndrome, cardiovascular disease, cancer, and obesity. The molecule is a inflammatory and nutrient, and it impacts atherosclerosis. The molecule is a membrane stabilizer, a fat storage, and a thyroxine treatment, and it impacts pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CC1OC(O)C(OC2OC(C(=O)O)C(O)C(OC3OC(C(=O)O)C(O)C(O)C3O)C2O)C(O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy source, membrane stabilizer, emulsifier, nutrient, energy storage, surfactant.", "role": "assistant" } ]
{ "smiles": [ "Cc1ccc(-n2c(C)ccc2C)cc1C1COCCC2CCn3c(cccc3=O)N21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a kinase inhibitor that impacts cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC1C=CC(=O)C1C=CC(O)CCCCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CC(C)n1nc(-c2ccc(CC(=O)Nc3onc(C45CC(C)(C4)C5)c3F)cc2)c(C(N)=O)c1N" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a kinase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "ClCC1(c2ccccc2)C=CC=CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It belongs to the luminescent class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC(O)C=CC=CCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a membrane stabilizer and a cholesterol translocation, impacting both barth syndrome and aging. The molecule is a energy storage, apoptosis, surfactant, stabilizing mitochondrial structure, emulsifier. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a food additive, nutritional supplement, energy source that impacts diabetic heart disease and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "COc1cccc(Oc2cccc3c(CN(C)C(=O)C=Cc4cnc5c(c4)NCCC(=O)N5COP(=O)(OCCSC)OCCS(C)(C)C)c(C)oc23)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti biotic.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CC(C)=CCOC=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is alliaceous and roasted.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage that impacts pancreatitis, cardiovascular disease, and thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage, inflammatory, energy source, nutrient that impacts metabolic syndrome and thyroxine treatment. The molecule is a membrane stabilizer and fat storage, and it impacts pancreatitis. It impacts obesity, cardiovascular disease, cancer, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc(-c2nc3c(C(=O)N4CCN(C(CO)c5ccc(OC)nc5OC)CC4C)cnn3c(C(F)(F)F)c2C)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It belongs to the anti retroviral class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts tangier disease, aging, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a inflammatory that impacts cancer, cardiovascular disease, atherosclerosis, obesity, and metabolic syndrome. The molecule is a energy source, a nutrient, and a fat storage. The molecule is a thyroxine treatment, a membrane stabilizer, and a energy storage, and it impacts pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CC(C)c1nc(COCCOC(N)=O)n(C)c1Sc1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti hiv member of the anti viral class.", "role": "assistant" } ]
{ "smiles": [ "O=C1OC2C(O)C(O)C(COC3OC(CO)C(O)C(O)C3O)OC2N1c1ccccc1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a emulsifier, surfactant, membrane stabilizer, nutrient, energy storage, energy source.", "role": "assistant" } ]
{ "smiles": [ "C=CC=Cc1c(C(C)c2ccccc2)sc2c1=CC=CC(C)(c1ccccc1)C=2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a organic electroluminescent device and is electroluminescent.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, barth syndrome, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy source and membrane stabilizer, belonging to the thyroxine treatment class of molecules, with effects on cancer and impacts on both cardiovascular disease and obesity. The molecule is a energy storage that impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage, a inflammatory, and a nutrient, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a surfactant and a apoptosis, impacting both aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, energy source, nutritional supplement that impacts diabetic heart disease and barth syndrome. The molecule is a membrane stabilizer, a emulsifier, a stabilizing mitochondrial structure, and smooth. The molecule is a stabilizing cytochrome oxidase, food additive, proton trap for oxidative phosphorylation, energy storage that impacts tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCc1nc2ccccc2[nH]1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient and is analgesic.", "role": "assistant" } ]
{ "smiles": [ "Cc1ccc(CCN2CCC(C)C(N)CC2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti bacterial.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "Cc1c(C(=O)O)c(Cl)n(C)c1C(=O)C(O)NC(C)C(F)(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the hepatitis b treatment class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CC(C)(C)OC(=O)NC1OC1C(CC1CCCCC(=O)N1)C1COCO1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nitric oxide synthase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source, membrane stabilizer, fat storage, energy storage that belongs to the thyroxine treatment class of molecules and impacts obesity. The molecule is a nutrient that impacts both cancer and metabolic syndrome. The molecule is a inflammatory that impacts cardiovascular disease, atherosclerosis, and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a energy source, fat storage, and membrane stabilizer that has an effect on cancer and impacts both metabolic syndrome and obesity. The molecule is a nutrient and thyroxine treatment, and it impacts pancreatitis. The molecule is a inflammatory and a energy storage, impacting both atherosclerosis and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "FC(F)(F)c1ccc(Cl)c(Cl)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule has Aromatic.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient that impacts both pancreatitis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both atherosclerosis and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "C#CCCCCCC(C)OCC(=O)NCC(=O)NCCNC(=O)C(F)(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti body.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, non-alcoholic fatty liver disease, and parkinson's disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient that impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage that impacts thyroxine treatment, cardiovascular disease, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "OC(c1ccccc1)c1ncc2c(n1)CCNCC2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It impacts treatment of disorder.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC1OC1CC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "O=c1c(-c2ccc(F)cc2)c(O)[n+](CCc2ccccn2)c2ccccn12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a anti parasitic.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts both pancreatitis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CC(C)C(=O)C(C)(C)n1ncnn1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a anti viral, hcv inhibitor, ns5a inhibitor, anti viral compound and belongs to the hcv treatment class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CC=CC(=O)CCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a emulsifier, food additive, surfactant, stabilizing cytochrome oxidase. The molecule is a membrane stabilizer, energy source, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, it impacts diabetic heart disease, and is smooth. The molecule is a nutritional supplement, energy storage, proton trap for oxidative phosphorylation that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, barth syndrome, and aging. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "Cc1csc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c1NCc1ccnc2ccccc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to both the anti cancer and cancer treatment classes of molecules.", "role": "assistant" } ]
{ "smiles": [ "Cc1noc(-c2cc3ccccc3nc2N2CCC(NC3CCCCC3)C(O)C2)n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is modulate.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, a surfactant, and a food additive, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, energy source, nutritional supplement, cholesterol translocation, and smooth. The molecule is a membrane stabilizer, a apoptosis, and a energy storage, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a emulsifier that impacts barth syndrome, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a apoptosis, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a emulsifier and a surfactant that impacts aging, barth syndrome, and diabetic heart disease. The molecule is a energy source, a energy storage, and a nutritional supplement, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, stabilizing cytochrome oxidase, food additive, proton trap for oxidative phosphorylation, and smooth.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCOC(=O)C1OC(OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(C(=O)OC5OC(CO)C(O)C(O)C5O)CCC34C)C2(C)C)C(O)C(OC2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CN(C)CCOc1cccc(C(C(N)=O)N2c3c(C(=O)O)ccnc3NC2c2ccc(F)cc2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a protein kinase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both diabetic heart disease and tangier disease. The molecule is a energy source, food additive, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. The molecule is a emulsifier, proton trap for oxidative phosphorylation, nutritional supplement, energy storage. The molecule is a apoptosis, a membrane stabilizer, and a surfactant, it impacts barth syndrome and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CC1(C)c2cc(N(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)c3ccc4ccccc4c3)ccc2-c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is luminescent and electroluminescent.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and barth syndrome. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC(O)C=CC1C(=O)C=CC1CC=CCCCC(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a greenhouse gas, a fossil fuel, and a bacterial metabolite.", "role": "assistant" } ]
{ "smiles": [ "CN(C(=O)CNC(=O)OC(C)(C)C)C1CCNC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a ddr1 inhibitor and fibrosis treatment, and it impacts cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage, inflammatory, nutrient that impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a fat storage, a thyroxine treatment, and a membrane stabilizer. The molecule is a energy source that impacts atherosclerosis, cancer, and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage, fat storage, energy source that impacts metabolic syndrome, obesity, and cardiovascular disease. The molecule is a nutrient and membrane stabilizer with an effect on cancer. The molecule is a inflammatory and thyroxine treatment, impacting both pancreatitis and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "FCN1CCC=C(c2nsnc2OCCCCCC(F)F)C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a muscarinic agonist.", "role": "assistant" } ]
{ "smiles": [ "Oc1ccc(C2Oc3cc(O)c4c(c3C2c2cc(O)cc(O)c2)C2C(c3ccc(O)cc3)c3c(O)cc(O)cc3C3c5c(cc(O)cc5C2C4c2ccc(O)cc2)OC3c2ccc(O)cc2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase that impacts aging, barth syndrome, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(C=CC(=O)C(C=CC(O)CCCCC)C(O)C2OP(=O)(O)O)CC=CCCCC(=O)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It has an effect on colorectal cancer, and impacts cardiovascular disease, breast cancer, and diabetes mellitus. It impacts parkinson's disease, stomach cancer, seizure, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a energy storage, fat storage, energy source, nutrient that impacts cardiovascular disease and thyroxine treatment. It impacts cancer, metabolic syndrome, and pancreatitis. The molecule is a membrane stabilizer and a inflammatory, impacting both obesity and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a inflammatory, energy storage, energy source, membrane stabilizer that impacts obesity and atherosclerosis. The molecule is a fat storage that impacts both pancreatitis and metabolic syndrome. The nutrient molecule affects cancer, impacts cardiovascular disease, and is thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "Cc1cc(F)ccc1C(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2scnc2c1)C1CCC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a estrogen receptor modulator.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CC1COCc2c1c(=O)c(O)c1n2CCN(Cc2ccc(F)c(Cl)c2)C1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a hiv integrase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "O=C(Cc1ccnc(F)c1)c1ccc(Br)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a jak inhibitor.", "role": "assistant" } ]