molecules
dict
messages
listlengths
3
3
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, aging, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc(C#Cc2cnn(C)c2)c(OC)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a tubulin inhibitor and is both cancer treatment and belongs to the anti angiogenic and anti mitotic classes of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, nutrient, nutritional supplement, energy source that impacts atherosclerosis and cervical cancer. The molecule is a energy storage and smooth, and it impacts ulcerative colitis. The molecule is a emulsifier, a surfactant, and a food additive, and it impacts breast cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a fat storage that impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient that impacts atherosclerosis, thyroxine treatment, and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, aging, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "O=C(O)C(O)Cc1ccc(O)cc1.O=C(O)c1ccccc1SC(F)(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a anti depressant.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient and a inflammatory that impacts obesity, metabolic syndrome, cardiovascular disease, and pancreatitis. The molecule is a membrane stabilizer that affects cancer by impacting thyroxine treatment. The molecule is a fat storage, a energy storage, and a energy source, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutritional supplement, emulsifier, energy source, energy storage. The molecule is a surfactant and a cholesterol translocation, which impacts both barth syndrome and non-alcoholic fatty liver disease, and is characterized as smooth. The molecule is a membrane stabilizer, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, food additive that impacts aging and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "C=CC(=O)OCCOC(=O)c1ccc(N(CC(=O)O)CC(=O)O)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is photosensitive.", "role": "assistant" } ]
{ "smiles": [ "O=C(O)C(Cc1ccc(N2CCC(CNc3ccccn3)CC2)cc1)N1CCC2(CCCCC2)C1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a integrin inhibitor and is anti angiogenic.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient, membrane stabilizer, fat storage that impacts cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a energy storage and energy source, and it impacts metabolic syndrome. The molecule is a inflammatory and thyroxine treatment, impacting both obesity and cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, barth syndrome, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC(O)C=CC=CCC=CC=CC(O)C=CCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts atherosclerosis, cervical cancer, breast cancer, and ulcerative colitis.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutritional supplement, a stabilizing cytochrome oxidase, and a cholesterol translocation, and it impacts diabetic heart disease. The molecule is a membrane stabilizer, surfactant, apoptosis, emulsifier that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, a energy source, a proton trap for oxidative phosphorylation, and smooth. The molecule is a energy storage and a food additive that impacts aging, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CC(=CNc1ccccn1)CC(O)(P(O)O)P(=O)(O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "It impacts osteoporosis treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation that impacts barth syndrome, aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a surfactant, a apoptosis, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, energy source, cholesterol translocation that impacts tangier disease and barth syndrome. The molecule is a food additive, a energy storage, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a nutritional supplement, a emulsifier, and a stabilizing mitochondrial structure, it impacts diabetic heart disease and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a surfactant, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts aging. The molecule is a cholesterol translocation, emulsifier, energy storage, energy source, and smooth. The molecule is a food additive that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, membrane stabilizer, stabilizing cytochrome oxidase, nutritional supplement that impacts tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a fat storage, inflammatory, nutrient that impacts cardiovascular disease, metabolic syndrome, and atherosclerosis. The molecule is a energy storage and thyroxine treatment, and it impacts obesity. The molecule is a membrane stabilizer and a energy source, with effects on cancer and impacts on pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "C=C(N)C(NC(=O)c1ccc(-c2ccc(O)cc2)cc1)C(=O)NO" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti bacterial.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a surfactant and a membrane stabilizer, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a nutritional supplement, emulsifier, food additive, energy source, and smooth. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and aging. The molecule is a stabilizing mitochondrial structure, energy storage, apoptosis, cholesterol translocation that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC(Nc1ccc(C#N)cc1)C(F)(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is anti atherosclerotic.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage and a thyroxine treatment, impacting both pancreatitis and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC1OC1CCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It has an effect on stomach cancer, and impacts alzheimer's disease, cardiovascular disease, and breast cancer. It impacts parkinson's disease, colorectal cancer, seizure, and diabetes mellitus.", "role": "assistant" } ]
{ "smiles": [ "Cl.O=C(O)c1ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a ferroelectric member of the liquid crystal class.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCC=CCC=CCC(O)C=CC=CC=CC(O)CC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient that impacts both pancreatitis and metabolic syndrome. The molecule is a fat storage and thyroxine treatment, impacting both cardiovascular disease and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "COC1(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CC(OC5OC(C)C(O)C(OC6OCC(O)C(O)C6O)C5O)C5CC(=O)CCC5(C)C4CCC3(C)C2C1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC1OC1CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source and a inflammatory that impacts cardiovascular disease, obesity, metabolic syndrome, and thyroxine treatment. The molecule is a membrane stabilizer that impacts both cancer and pancreatitis. The molecule is a nutrient, a fat storage, and a energy storage, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts aging. The molecule is a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)COC(=O)CCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a fat storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a nutrient that impacts thyroxine treatment, metabolic syndrome, and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging. The molecule is a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a food additive, impacting both aging and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, membrane stabilizer, emulsifier that impacts diabetic heart disease. The molecule is a surfactant and a energy source, it impacts barth syndrome, and is smooth. The molecule is a apoptosis, energy storage, proton trap for oxidative phosphorylation, nutritional supplement that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC(=O)Nc1cccc(S(=O)(=O)O)c1OC(=O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is anti oxidant.", "role": "assistant" } ]
{ "smiles": [ "CCN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)Cc1nc2ccccc2c(=O)[nH]1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti viral class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a surfactant that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a nutritional supplement, stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging. The molecule is a food additive, emulsifier, membrane stabilizer, energy storage. The molecule is a energy source, a cholesterol translocation, and a proton trap for oxidative phosphorylation, it impacts tangier disease and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CC=CC(O)CC=CCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient that impacts both metabolic syndrome and thyroxine treatment. The molecule is a fat storage that impacts pancreatitis, cardiovascular disease, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCC(O)C=CC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It has an effect on breast cancer, and impacts parkinson's disease, stomach cancer, and cardiovascular disease. It impacts alzheimer's disease, diabetes mellitus, seizure, and colorectal cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutrient that impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "O=C(OC1C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OCC2OC(OC(=O)c2ccc(O)c(O)c2O)C1OC(=O)c1cc(O)c(O)c(O)c1Oc1cc2c(c(O)c1O)-c1c(cc(O)c(O)c1O)C(=O)OC1C(COC2=O)OC(O)C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC21)c1cc(O)c(O)c(O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, aging, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCC(=O)CC1C(O)CC(O)C1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that impacts alzheimer's disease, parkinson's disease, diabetes mellitus type 2, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC(O)C=CC=CC=CC=CC(O)C(O)CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "It has an effect on colorectal cancer, and impacts alzheimer's disease, diabetes mellitus, and parkinson's disease. It impacts cardiovascular disease, stomach cancer, breast cancer, and seizure.", "role": "assistant" } ]
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both pancreatitis and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "C=CCCc1cc(OCc2cc[n+]([O-])cc2)n2nccc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti ulcer that is anti inflammatory and anti inflammatory agent.", "role": "assistant" } ]
{ "smiles": [ "N#Cc1ccc(-n2c3ccccc3c3cc(-c4cc(-n5c6ccccc6c6ccccc65)cc(C(F)(F)F)c4)ccc32)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belongs to the optoelectronic class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a inflammatory, fat storage, thyroxine treatment that impacts obesity, pancreatitis, and atherosclerosis. The molecule is a membrane stabilizer and nutrient, and it impacts metabolic syndrome. The molecule is a energy source and a energy storage, impacting both cardiovascular disease and cancer.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a inflammatory, fat storage, energy source that belongs to the thyroxine treatment class of molecules and impacts both atherosclerosis and metabolic syndrome. The molecule is a nutrient that impacts both cancer and pancreatitis. The molecule is a energy storage and a membrane stabilizer, impacting both cardiovascular disease and obesity.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a food additive, it impacts aging, and is smooth. The molecule is a apoptosis, energy source, energy storage, stabilizing mitochondrial structure, surfactant. The molecule is a nutritional supplement and a emulsifier, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation, membrane stabilizer, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCC(CNN)c1ccc(Cl)c(Cl)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is anti hypertensive and anti thrombotic.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, a energy storage, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a energy source, it impacts barth syndrome and is smooth. The molecule is a stabilizing cytochrome oxidase and a surfactant, impacting both aging and diabetic heart disease. The molecule is a nutritional supplement, cholesterol translocation, emulsifier, food additive that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a fat storage that impacts both atherosclerosis and cardiovascular disease. The molecule is a thyroxine treatment and a nutrient, impacting both pancreatitis and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "Cc1c(OC2OC(COC(=O)C=Cc3ccccc3)C(O)C(O)C2O)occc1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCC1OC1CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient, inflammatory, and energy storage that has an effect on cancer and impacts both obesity and pancreatitis. The molecule is a membrane stabilizer that impacts both metabolic syndrome and cardiovascular disease. The molecule is a energy source and a fat storage, it impacts atherosclerosis, and is thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient and fat storage, and it impacts pancreatitis. It impacts thyroxine treatment, cardiovascular disease, atherosclerosis, and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a thyroxine treatment and nutrient, and it impacts pancreatitis. The molecule is a fat storage that impacts cardiovascular disease, metabolic syndrome, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a fat storage and nutrient, and it impacts pancreatitis. The molecule is a thyroxine treatment that impacts metabolic syndrome, cardiovascular disease, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a energy storage that affects breast cancer by impacting inflammatory bowel disease, cardiovascular disease, celiac disease, and diabetes mellitus type 2. The molecule is a surfactant and energy source, and it impacts heart failure. The molecule is a membrane stabilizer, a emulsifier, and a nutrient, and it impacts renal cell carcinoma.", "role": "assistant" } ]
{ "smiles": [ "CC1CCC(C2CCC(C3CCCC(F)CC3F)CC2F)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belongs to the optoelectronic class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a membrane stabilizer and a nutrient that impacts cardiovascular disease, obesity, metabolic syndrome, and pancreatitis. The molecule is a fat storage, a thyroxine treatment, and a inflammatory. The molecule is a energy storage and a energy source, impacting both cancer and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, energy storage, energy source, nutrient, inflammatory that impacts obesity. The molecule is a thyroxine treatment that affects cancer by impacting cardiovascular disease. The molecule is a fat storage that impacts pancreatitis, atherosclerosis, and metabolic syndrome.", "role": "assistant" } ]